Mana_Filters - Version 13.10.17.19

Version Notes

Adds multiple selection features for attribute and price filters in Magento layered navigation.

Release Info

Developer	Mana Team
Extension	Mana_Filters
Version	13.10.17.19
Comparing to
See all releases

Code changes from version 12.12.21.19 to 13.10.17.19

Files changed (154) hide show

app/code/local/Mana/Core/Block/Js.php +18 -2
app/code/local/Mana/Core/Block/Require.php +21 -0
app/code/local/Mana/Core/Helper/Data.php +293 -1
app/code/local/Mana/Core/Helper/Debug.php +37 -0
app/code/local/Mana/Core/Helper/Files.php +36 -6
app/code/local/Mana/Core/Helper/Js.php +469 -1
app/code/local/Mana/Core/Helper/Json.php +22 -0
app/code/local/Mana/Core/Helper/Layer.php +89 -0
app/code/local/Mana/Core/Helper/Layout.php +14 -0
app/code/local/Mana/Core/Helper/Logger.php +110 -0
app/code/local/Mana/Core/Helper/Mbstring.php +69 -0
app/code/local/Mana/Core/Helper/PageType.php +24 -0
app/code/local/Mana/Core/Helper/PageType/Category.php +24 -0
app/code/local/Mana/Core/Helper/PageType/CmsPage.php +20 -0
app/code/local/Mana/Core/Helper/PageType/HomePage.php +20 -0
app/code/local/Mana/Core/Helper/PageType/Search.php +20 -0
app/code/local/Mana/Core/Helper/Router.php +91 -0
app/code/local/Mana/Core/Helper/Seo.php +72 -0
app/code/local/Mana/Core/Helper/UrlTemplate.php +21 -0
app/code/local/Mana/Core/Helper/Utils.php +118 -0
app/code/local/Mana/Core/Model/Callback.php +6 -6
app/code/local/Mana/Core/Model/Closure.php +18 -0
app/code/local/Mana/Core/Model/Indexer.php +62 -0
app/code/local/Mana/Core/Model/Observer.php +122 -1
app/code/local/Mana/Core/Model/Source/Js.php +27 -0
app/code/local/Mana/Core/Model/Source/YesNoDefault.php +22 -0
app/code/local/Mana/Core/Resource/Indexer.php +19 -0
app/code/local/Mana/Core/Rewrite/PageCache/Processor.php +27 -0
app/code/local/Mana/Core/etc/adminhtml.xml +64 -0
app/code/local/Mana/Core/etc/config.xml +109 -9
app/code/local/Mana/Core/etc/system.xml +57 -0
app/code/local/Mana/Db/Exception/Formula.php +16 -0
app/code/local/Mana/Db/Exception/Validation.php +15 -2
app/code/local/Mana/Db/Helper/Config.php +414 -0
app/code/local/Mana/Db/Helper/Data.php +304 -86
app/code/local/Mana/Db/Helper/Formula.php +471 -0
app/code/local/Mana/Db/Helper/Formula/Abstract.php +73 -0
app/code/local/Mana/Db/Helper/Formula/DependencyFinder.php +100 -0
app/code/local/Mana/Db/Helper/Formula/Entity.php +45 -0
app/code/local/Mana/Db/Helper/Formula/Entity/Aggregate.php +87 -0
app/code/local/Mana/Db/Helper/Formula/Entity/Aggregate/Field.php +60 -0
app/code/local/Mana/Db/Helper/Formula/Entity/Foreign.php +50 -0
app/code/local/Mana/Db/Helper/Formula/Entity/Frontend.php +43 -0
app/code/local/Mana/Db/Helper/Formula/Entity/Normal.php +36 -0
app/code/local/Mana/Db/Helper/Formula/Evaluator.php +20 -0
app/code/local/Mana/Db/Helper/Formula/Function.php +28 -0
app/code/local/Mana/Db/Helper/Formula/Function/Count.php +47 -0
app/code/local/Mana/Db/Helper/Formula/Function/Glue.php +83 -0
app/code/local/Mana/Db/Helper/Formula/Function/If.php +51 -0
app/code/local/Mana/Db/Helper/Formula/Function/Lower.php +30 -0
app/code/local/Mana/Db/Helper/Formula/Function/Seo.php +33 -0
app/code/local/Mana/Db/Helper/Formula/Function/SkinUrl.php +32 -0
app/code/local/Mana/Db/Helper/Formula/Parser.php +379 -0
app/code/local/Mana/Db/Helper/Formula/Processor.php +63 -0
app/code/local/Mana/Db/Helper/Formula/Processor/Eav.php +41 -0
app/code/local/Mana/Db/Helper/Formula/Processor/Entity.php +178 -0
app/code/local/Mana/Db/Helper/Formula/Processor/System.php +16 -0
app/code/local/Mana/Db/Helper/Formula/Processor/Table.php +86 -0
app/code/local/Mana/Db/Helper/Formula/Selector.php +450 -0
app/code/local/Mana/Db/Model/Entity.php +296 -0
app/code/local/Mana/Db/Model/Entity/Indexer.php +349 -0
app/code/local/Mana/Db/Model/Formula/Alias.php +58 -0
app/code/local/Mana/Db/Model/Formula/Alias/Array.php +104 -0
app/code/local/Mana/Db/Model/Formula/Alias/Empty.php +68 -0
app/code/local/Mana/Db/Model/Formula/Alias/Single.php +86 -0
app/code/local/Mana/Db/Model/Formula/Closure.php +16 -0
app/code/local/Mana/Db/Model/Formula/Closure/AggregateFieldJoin.php +50 -0
app/code/local/Mana/Db/Model/Formula/Closure/ForeignJoin.php +28 -0
app/code/local/Mana/Db/Model/Formula/Closure/ForeignJoinEnd.php +38 -0
app/code/local/Mana/Db/Model/Formula/Closure/Join.php +44 -0
app/code/local/Mana/Db/Model/Formula/Context.php +217 -0
app/code/local/Mana/Db/Model/Formula/Entity.php +53 -0
app/code/local/Mana/Db/Model/Formula/Expr.php +26 -0
app/code/local/Mana/Db/Model/Formula/Field.php +37 -0
app/code/local/Mana/Db/Model/Formula/Node.php +17 -0
app/code/local/Mana/Db/Model/Formula/Node/Add.php +28 -0
app/code/local/Mana/Db/Model/Formula/Node/Field.php +21 -0
app/code/local/Mana/Db/Model/Formula/Node/FormulaExpr.php +17 -0
app/code/local/Mana/Db/Model/Formula/Node/FunctionCall.php +21 -0
app/code/local/Mana/Db/Model/Formula/Node/Identifier.php +17 -0
app/code/local/Mana/Db/Model/Formula/Node/Multiply.php +28 -0
app/code/local/Mana/Db/Model/Formula/Node/NullValue.php +13 -0
app/code/local/Mana/Db/Model/Formula/Node/NumberConstant.php +17 -0
app/code/local/Mana/Db/Model/Formula/Node/StringConstant.php +17 -0
app/code/local/Mana/Db/Model/Indexer.php +1 -1
app/code/local/Mana/Db/Model/Observer.php +33 -6
app/code/local/Mana/Db/Model/Setup.php +84 -0
app/code/local/Mana/Db/Model/Setup/Abstract.php +33 -0
app/code/local/Mana/Db/Model/Setup/V13012122.php +478 -0
app/code/local/Mana/Db/Resource/Edit/Session.php +11 -0
app/code/local/Mana/Db/Resource/Entity.php +86 -0
app/code/local/Mana/Db/Resource/Entity/Collection.php +124 -0
app/code/local/Mana/Db/Resource/Entity/Indexer.php +89 -0
app/code/local/Mana/Db/Resource/Entity/JsonCollection.php +186 -0
app/code/local/Mana/Db/Resource/Formula.php +50 -0
app/code/local/Mana/Db/etc/config.xml +8 -2
app/code/local/Mana/Db/etc/m_db.xml +44 -0
app/code/local/Mana/Filters/Block/Filter.php +50 -2
app/code/local/Mana/Filters/Block/View.php +31 -7
app/code/local/Mana/Filters/Helper/Data.php +44 -60
app/code/local/Mana/Filters/Model/Filter/Attribute.php +8 -5
app/code/local/Mana/Filters/Model/Filter/Category.php +28 -1
app/code/local/Mana/Filters/Model/Filter/Decimal.php +24 -18
app/code/local/Mana/Filters/Model/Filter/Price.php +77 -63
app/code/local/Mana/Filters/Model/Filter2.php +25 -0
app/code/local/Mana/Filters/Model/Filter2/Store.php +4 -1
app/code/local/Mana/Filters/Model/Filter2/Value.php +11 -0
app/code/local/Mana/Filters/Model/Item.php +38 -8
app/code/local/Mana/Filters/Model/Observer.php +45 -1
app/code/local/Mana/Filters/Model/Query.php +1 -0
app/code/local/Mana/Filters/Model/Solr/Attribute.php +42 -8
app/code/local/Mana/Filters/Model/Solr/Category.php +18 -3
app/code/local/Mana/Filters/Model/Solr/Decimal.php +8 -6
app/code/local/Mana/Filters/Model/Solr/Price.php +22 -13
app/code/local/Mana/Filters/Model/Solr/Reverse/Attribute.php +1 -2
app/code/local/Mana/Filters/Model/Solr/Reverse/Decimal.php +7 -5
app/code/local/Mana/Filters/Model/Solr/Reverse/Price.php +11 -9
app/code/local/Mana/Filters/Resource/Filter/Decimal.php +19 -17
app/code/local/Mana/Filters/Resource/Filter/Price.php +70 -23
app/code/local/Mana/Filters/Resource/Filter/Reverse/Decimal.php +18 -16
app/code/local/Mana/Filters/Resource/Filter/Reverse/Price.php +13 -8
app/code/local/Mana/Filters/Resource/Filter2.php +13 -0
app/code/local/Mana/Filters/Resource/Filter2/Store.php +6 -0
app/code/local/Mana/Filters/Resource/Filter2/Value.php +24 -0
app/code/local/Mana/Filters/Resource/Filter2/Value/Store.php +5 -1
app/code/local/Mana/Filters/Resource/Indexer/Source.php +3 -0
app/code/local/Mana/Filters/Resource/Solr/And/Attribute.php +1 -3
app/code/local/Mana/Filters/Resource/Solr/Attribute.php +3 -7
app/code/local/Mana/Filters/Resource/Solr/Collection.php +62 -0
app/code/local/Mana/Filters/Resource/Solr/Engine.php +24 -0
app/code/local/Mana/Filters/Resource/Solr/Reverse/Attribute.php +1 -3
app/code/local/Mana/Filters/etc/config.xml +31 -8
app/code/local/Mana/Filters/sql/mana_filters_setup/mysql4-upgrade-13.09.11.14-13.09.23.17.php +29 -0
app/design/adminhtml/default/default/layout/mana_core.xml +5 -2
app/design/adminhtml/default/default/template/mana/core/js.phtml +9 -0
app/design/adminhtml/default/default/template/mana/core/require.phtml +14 -0
app/design/frontend/base/default/layout/mana_core.xml +5 -2
app/design/frontend/base/default/template/mana/core/js.phtml +9 -0
app/design/frontend/base/default/template/mana/core/require.phtml +14 -0
app/design/frontend/base/default/template/mana/filters/cms.phtml +21 -1
app/design/frontend/base/default/template/mana/filters/items/list.phtml +4 -4
app/design/frontend/base/default/template/mana/filters/items/list_popup.phtml +10 -8
app/design/frontend/base/default/template/mana/filters/items/standard.phtml +4 -4
app/design/frontend/base/default/template/mana/filters/items/standard_popup.phtml +10 -5
app/design/frontend/base/default/template/mana/filters/state.phtml +1 -0
app/etc/modules/Mana_Core.xml +6 -0
app/locale/en_US/Mana_Core.csv +16 -0
app/locale/en_US/Mana_Db.csv +13 -1
app/locale/en_US/Mana_Filters.csv +4 -2
js/jquery/froogaloop.js +290 -0
js/jquery/froogaloop.min.js +5 -0
js/jquery/history.js +8 -3
js/jquery/jquery-1.7.2.min.js +0 -6
js/jquery/jquery-ui.js +5960 -5485

app/code/local/Mana/Core/Block/Js.php CHANGED Viewed

	@@ -12,6 +12,15 @@
12	*
13	*/
14	class Mana_Core_Block_Js extends Mage_Core_Block_Template {









15	/**
16	* Contains all the translations registered to be passed to client-side scripts
17	* @var array \| null
	@@ -59,12 +68,19 @@ class Mana_Core_Block_Js extends Mage_Core_Block_Template {
59	}
60	/**
61	* Returns all the translations registered to be passed to client-side scripts
62	- * @~~var~~ array \| null
63	*/
64	public function getTranslations() { return $this->_translations; }
65	/**
66	* Returns all key-value pair arrays registered to be passed to client-side scripts
67	- * @~~var~~ array \| null
68	*/
69	public function getOptions() { return $this->_options; }







70	}


12	*
13	*/
14	class Mana_Core_Block_Js extends Mage_Core_Block_Template {
15	+ protected $_config = array();
16	+
17	+ public function setConfig($key, $value) {
18	+ $this->_config[$key] = $value;
19	+ return $this;
20	+ }
21	+ public function getConfig() {
22	+ return $this->_config;
23	+ }
24	/**
25	* Contains all the translations registered to be passed to client-side scripts
26	* @var array \| null

68	}
69	/**
70	* Returns all the translations registered to be passed to client-side scripts
71	+ * @return array \| null
72	*/
73	public function getTranslations() { return $this->_translations; }
74	/**
75	* Returns all key-value pair arrays registered to be passed to client-side scripts
76	+ * @return array \| null
77	*/
78	public function getOptions() { return $this->_options; }
79	+
80	+ protected function _prepareLayout() {
81	+ $this
82	+ ->setConfig('url.base', Mage::getUrl('', array('_nosid' => true)))
83	+ ->setConfig('url.secureBase', Mage::getUrl('', array('_secure' => true, '_nosid' => true)));
84	+ return $this;
85	+ }
86	}

app/code/local/Mana/Core/Block/Require.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Block_Require extends Mage_Core_Block_Template {
13	+ protected function _construct() {
14	+ parent::_construct();
15	+ $this->setTemplate('mana/core/require.phtml');
16	+ }
17	+
18	+ public function getBaseRequireUrl() {
19	+ return Mage::getBaseUrl('js').'m-classes';
20	+ }
21	+ }

app/code/local/Mana/Core/Helper/Data.php CHANGED Viewed

@@ -11,6 +11,8 @@
              * @author Mana Team
              */
             class Mana_Core_Helper_Data extends Mage_Core_Helper_Abstract {
                 /**
                  * Retrieve config value for store by path. By default uses standard Magento function to query core_config_data
                  * table and use config.xml for default value. Though this could be replaced by extensions (in later versions).
@@ -345,7 +347,7 @@ class Mana_Core_Helper_Data extends Mage_Core_Helper_Abstract {
+                    }
                     return $val;
+                }
-            -
                    public function jsonForceObjectAndEncode($data) {
                     return json_encode($this->_forceObjectRecursively($data));
+                }
                 protected function _forceObjectRecursively($data) {
@@ -403,6 +405,16 @@ class Mana_Core_Helper_Data extends Mage_Core_Helper_Abstract {
                         return $request->getRouteName() . '/' . $request->getControllerName() . '/' . $request->getActionName();
+                    }
+                }
                 public function isMageVersionEqualOrGreater($version) {
                     $version = explode('.', $version);
                     $mageVersion = array_values(Mage::getVersionInfo());
@@ -517,4 +529,284 @@ class Mana_Core_Helper_Data extends Mage_Core_Helper_Abstract {
                         return null;
+                    }
+                }
+            }


11	* @author Mana Team
12	*/
13	class Mana_Core_Helper_Data extends Mage_Core_Helper_Abstract {
14	+ protected $_pageTypes;
15	+
16	/**
17	* Retrieve config value for store by path. By default uses standard Magento function to query core_config_data
18	* table and use config.xml for default value. Though this could be replaced by extensions (in later versions).

347	}
348	return $val;
349	}
350	+ public function jsonForceObjectAndEncode($data) {
351	return json_encode($this->_forceObjectRecursively($data));
352	}
353	protected function _forceObjectRecursively($data) {

405	return $request->getRouteName() . '/' . $request->getControllerName() . '/' . $request->getActionName();
406	}
407	}
408	+ public function getRouteParams() {
409	+ $request = Mage::app()->getRequest();
410	+
411	+ $result = '';
412	+ foreach ($request->getUserParams() as $key => $value) {
413	+ $result .= '/'.$key.'/'.$value;
414	+ }
415	+ return $result;
416	+ }
417	+
418	public function isMageVersionEqualOrGreater($version) {
419	$version = explode('.', $version);
420	$mageVersion = array_values(Mage::getVersionInfo());

529	return null;
530	}
531	}
532	+
533	+ public function base64EncodeUrl($url) {
534	+ return base64_encode(Mage::getSingleton('core/url')->sessionUrlVar($url));
535	+ }
536	+
537	+ public function inAdmin() {
538	+ return $this->getRequestModule(Mage::app()->getRequest()) ==
539	+ ((string)Mage::getConfig()->getNode('admin/routers/adminhtml/args/frontName'));
540	+ }
541	+
542	+ public function getRequestModule(Zend_Controller_Request_Http $request) {
543	+ $p = $this->getExplodedPath($request);
544	+ if ($request->getModuleName()) {
545	+ $result = $request->getModuleName();
546	+ }
547	+ else {
548	+ $result = $p[0];
549	+ }
550	+
551	+ return $result;
552	+ }
553	+
554	+ public function getRequestController(Zend_Controller_Request_Http $request) {
555	+ $p = $this->getExplodedPath($request);
556	+ if ($request->getControllerName()) {
557	+ $result = $request->getControllerName();
558	+ }
559	+ else {
560	+ $result = $p[1];
561	+ }
562	+
563	+ return $result;
564	+ }
565	+
566	+ public function getRequestAction(Zend_Controller_Request_Http $request) {
567	+ $p = $this->getExplodedPath($request);
568	+ if ($request->getActionName()) {
569	+ $result = $request->getActionName();
570	+ }
571	+ else {
572	+ $result = $p[2];
573	+ }
574	+
575	+ return $result;
576	+ }
577	+
578	+ public function getExplodedPath(Zend_Controller_Request_Http $request) {
579	+ $defaultPath = array(
580	+ !empty($defaultPath[0]) ? $defaultPath[0] : '',
581	+ !empty($defaultPath[1]) ? $defaultPath[1] : 'index',
582	+ !empty($defaultPath[2]) ? $defaultPath[2] : 'index'
583	+ );
584	+
585	+ $path = trim($request->getPathInfo(), '/');
586	+
587	+ if ($path) {
588	+ $path = explode('/', $path);
589	+ }
590	+ else {
591	+ $path = $defaultPath;
592	+ }
593	+
594	+ return $path;
595	+ }
596	+
597	+ /**
598	+ * @param Mage_Core_Block_Abstract $block
599	+ */
600	+ public function getBlockAlias($block) {
601	+ if (($parent = $block->getParentBlock()) && $this->startsWith($block->getNameInLayout(), $parent->getNameInLayout().'.')) {
602	+ return substr($block->getNameInLayout(), strlen($parent->getNameInLayout() . '.'));
603	+ }
604	+ else {
605	+ return $block->getNameInLayout();
606	+ }
607	+ }
608	+
609	+ public function indexArray($source, $key) {
610	+ $result = array();
611	+ foreach ($source as $value) {
612	+ $result[$value[$key]] = $value;
613	+ }
614	+
615	+ return $result;
616	+ }
617	+
618	+ protected $_attributes = array();
619	+
620	+ public function getAttribute($entityType, $attributeCode, $columns) {
621	+ /* @var $res Mage_Core_Model_Resource */
622	+ $res = Mage::getSingleton('core/resource');
623	+ /* @var $db Varien_Db_Adapter_Pdo_Mysql */
624	+ $db = $res->getConnection('core_read');
625	+
626	+ $key = $entityType . '-' . $attributeCode . '-' . implode('-', $columns);
627	+ if (!isset($this->_attributes[$key])) {
628	+ $this->_attributes[$key] = $db->fetchRow($db->select()
629	+ ->from(array('a' => $res->getTableName('eav_attribute')), $columns)
630	+ ->join(array('t' => $res->getTableName('eav_entity_type')), 't.entity_type_id = a.entity_type_id', null)
631	+ ->where('a.attribute_code = ?', $attributeCode)
632	+ ->where('t.entity_type_code = ?', $entityType));
633	+ }
634	+
635	+ return $this->_attributes[$key];
636	+ }
637	+
638	+ public function getAttributeTable($attribute) {
639	+ return $attribute['backend_table'] ?
640	+ $attribute['backend_table'] :
641	+ 'catalog_category_entity_' . $attribute['backend_type'];
642	+ }
643	+
644	+ /**
645	+ * @param Varien_Db_Adapter_Pdo_Mysql $connection
646	+ * @param $tableName
647	+ * @param array $fields
648	+ * @param bool $onDuplicate
649	+ * @return string
650	+ */
651	+ public function insert($connection, $tableName, $fields = array(), $onDuplicate = true) {
652	+ $sql = "INSERT INTO `{$tableName}` ";
653	+ $sql .= "(`" . implode('`,`', array_keys($fields)) . "`) ";
654	+ $sql .= "VALUES (" . implode(',', $fields) . ") ";
655	+
656	+ if ($onDuplicate && $fields) {
657	+ $sql .= " ON DUPLICATE KEY UPDATE";
658	+ $updateFields = array();
659	+ foreach ($fields as $key => $field) {
660	+ $key = $connection->quoteIdentifier($key);
661	+ $updateFields[] = "{$key}=VALUES({$key})";
662	+ }
663	+ $sql .= " " . implode(', ', $updateFields);
664	+ }
665	+
666	+ return $sql;
667	+ }
668	+
669	+ public function addDotToSuffix($suffix) {
670	+ if ($suffix && $suffix != '/' && strpos($suffix, '.') !== 0) {
671	+ $suffix = '.' . $suffix;
672	+ }
673	+
674	+ return $suffix;
675	+ }
676	+
677	+ /**
678	+ * @param string $helper
679	+ * @return Mana_Core_Helper_PageType[]
680	+ */
681	+ public function getPageTypes($helper = 'helper') {
682	+ if (!isset($this->_pageTypes[$helper])) {
683	+ $result = array();
684	+
685	+ foreach ($this->getSortedXmlChildren(Mage::getConfig()->getNode('mana_core'), 'page_types') as $key => $pageTypeXml) {
686	+ /* @var $pageType Mana_Seo_Helper_PageType */
687	+ $pageType = Mage::helper((string)$pageTypeXml->$helper);
688	+ $pageType->setCode($key);
689	+ $result[$key] = $pageType;
690	+ }
691	+ $this->_pageTypes[$helper] = $result;
692	+ }
693	+
694	+ return $this->_pageTypes[$helper];
695	+ }
696	+
697	+ /**
698	+ * @param string $type
699	+ * @param string $helper
700	+ * @return Mana_Core_Helper_PageType
701	+ */
702	+ public function getPageType($type, $helper = 'helper') {
703	+ $pageTypes = $this->getPageTypes($helper);
704	+
705	+ return $pageTypes[$type];
706	+ }
707	+
708	+ public function isManadevLayeredNavigationInstalled() {
709	+ return $this->isModuleEnabled('Mana_Filters');
710	+ }
711	+
712	+ public function isManadevSeoLayeredNavigationInstalled() {
713	+ return $this->isModuleEnabled('ManaPro_FilterSeoLinks');
714	+ }
715	+
716	+ public function isManadevAttributePageInstalled() {
717	+ return $this->isModuleEnabled('Mana_AttributePage');
718	+ }
719	+
720	+ public function isManadevLayeredNavigationTreeInstalled() {
721	+ return $this->isModuleEnabled('ManaPro_FilterTree');
722	+ }
723	+
724	+ public function isManadevLayeredNavigationColorInstalled()
725	+ {
726	+ return $this->isModuleEnabled('ManaPro_FilterColors');
727	+ }
728	+
729	+ public function isEnterpriseUrlRewriteInstalled() {
730	+ return $this->isModuleEnabled('Enterprise_UrlRewrite');
731	+ }
732	+
733	+ protected $_accentTranslations = array(
734	+ 'à' => 'a',
735	+ 'á' => 'a',
736	+ 'â' => 'a',
737	+ 'ã' => 'a',
738	+ 'ä' => 'a',
739	+ 'ç' => 'c',
740	+ 'è' => 'e',
741	+ 'é' => 'e',
742	+ 'ê' => 'e',
743	+ 'ë' => 'e',
744	+ 'ì' => 'i',
745	+ 'í' => 'i',
746	+ 'î' => 'i',
747	+ 'ï' => 'i',
748	+ 'ñ' => 'n',
749	+ 'ò' => 'o',
750	+ 'ó' => 'o',
751	+ 'ô' => 'o',
752	+ 'õ' => 'o',
753	+ 'ö' => 'o',
754	+ 'ù' => 'u',
755	+ 'ú' => 'u',
756	+ 'û' => 'u',
757	+ 'ü' => 'u',
758	+ 'ý' => 'y',
759	+ 'ÿ' => 'y',
760	+ 'À' => 'A',
761	+ 'Á' => 'A',
762	+ 'Â' => 'A',
763	+ 'Ã' => 'A',
764	+ 'Ä' => 'A',
765	+ 'Ç' => 'C',
766	+ 'È' => 'E',
767	+ 'É' => 'E',
768	+ 'Ê' => 'E',
769	+ 'Ë' => 'E',
770	+ 'Ì' => 'I',
771	+ 'Í' => 'I',
772	+ 'Î' => 'I',
773	+ 'Ï' => 'I',
774	+ 'Ñ' => 'N',
775	+ 'Ò' => 'O',
776	+ 'Ó' => 'O',
777	+ 'Ô' => 'O',
778	+ 'Õ' => 'O',
779	+ 'Ö' => 'O',
780	+ 'Ù' => 'U',
781	+ 'Ú' => 'U',
782	+ 'Û' => 'U',
783	+ 'Ü' => 'U',
784	+ 'Ý' => 'Y',
785	+ );
786	+
787	+ protected $_accentTranslationsOld = array(
788	+ 'from' => 'àáâãäçèéêëìíîïñòóôõöùúûüýÿÀÁÂÃÄÇÈÉÊËÌÍÎÏÑÒÓÔÕÖÙÚÛÜÝ',
789	+ 'to' => 'aaaaaceeeeiiiinooooouuuuyyAAAAACEEEEIIIINOOOOOUUUUY'
790	+ );
791	+
792	+ public function unaccent($s) {
793	+ return strtr($s, $this->_accentTranslations);
794	+ }
795	+
796	+ public function getEmptyBlockHtml($block) {
797	+ Mage::dispatchEvent('core_block_abstract_to_html_before', array('block' => $block));
798	+ if (Mage::getStoreConfig('advanced/modules_disable_output/' . $block->getModuleName())) {
799	+ return '';
800	+ }
801	+
802	+ /**
803	+ * Use single transport object instance for all blocks
804	+ */
805	+ $transportObject = new Varien_Object;
806	+ $transportObject->setHtml('');
807	+ Mage::dispatchEvent('core_block_abstract_to_html_after', array('block' => $block, 'transport' => $transportObject));
808	+ $html = $transportObject->getHtml();
809	+
810	+ return $html;
811	+ }
812	}

app/code/local/Mana/Core/Helper/Debug.php ADDED Viewed

	@@ -0,0 +1,37 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Debug extends Mage_Core_Helper_Abstract
13	+ {
14	+ public function logLayout($method) {
15	+ $filename = "var/log/layout/" . uniqid() . ".xml";
16	+ Mage::log("$method layout is dumped to {$filename}\n", Zend_Log::DEBUG, 'layout.log');
17	+ $filename = BP.'/'.$filename;
18	+
19	+ $out = '<?xml version="1.0" encoding="UTF-8"?>'."\n<!--\n";
20	+ $out .= "Called from: \n $method\n";
21	+ $out .= "Applied handles: \n";
22	+
23	+ /* @var $layout Mage_Core_Model_Layout */
24	+ $layout = Mage::getSingleton('core/layout');
25	+
26	+ foreach ($layout->getUpdate()->getHandles() as $handle) {
27	+ $out .= " $handle\n";
28	+ }
29	+ $out .= "-->\n";
30	+
31	+ $out .= $layout->getNode()->asNiceXml('');
32	+ if (!is_dir(dirname($filename))) {
33	+ mkdir(dirname($filename), 0777, true);
34	+ }
35	+ file_put_contents($filename, $out);
36	+ }
37	+ }

app/code/local/Mana/Core/Helper/Files.php CHANGED Viewed

	@@ -12,15 +12,20 @@
12	*
13	*/
14	class Mana_Core_Helper_Files extends Mage_Core_Helper_Abstract {
15	- ~~public~~ ~~function~~ ~~getFilename~~(~~$relativeUrl~~, ~~$type, $noExistanceCheck = false~~) {


16	$result = $this->getBasePath($type).DS.str_replace('/', DS, $relativeUrl);
17	if (!is_dir(dirname($result))) {
18	mkdir(dirname($result), 0777, true);
19	}
20	return $noExistanceCheck \|\| file_exists($result) ? $result : false;
21	}
22	- public function getBaseUrl($type) {
23	- ~~return~~ ~~Mage::getBaseUrl~~(~~'media'~~)~~.'m-'.str_replace(DS,~~ ~~'/', $type);~~



24	}
25	public function getBasePath($type) {
26	return Mage::getConfig()->getOptions()->getMediaDir().DS.'m-'.str_replace('/', DS, $type);
	@@ -36,10 +41,10 @@ class Mana_Core_Helper_Files extends Mage_Core_Helper_Abstract {
36	}
37	return false;
38	}
39	- public function getUrl($relativeUrl, $type) {
40	if (is_array($type)) {
41	foreach ($type as $candidate) {
42	- if ($url = $this->getUrl($relativeUrl, $candidate)) {
43	return $url;
44	}
45	}
	@@ -47,7 +52,7 @@ class Mana_Core_Helper_Files extends Mage_Core_Helper_Abstract {
47	}
48	else {
49	if ($this->getFilename($relativeUrl, $type)) {
50	- return $this->getBaseUrl($type).'/'.str_replace(DS, '/', $relativeUrl);
51	}
52	else {
53	return false;
	@@ -72,4 +77,29 @@ class Mana_Core_Helper_Files extends Mage_Core_Helper_Abstract {
72	$i++;
73	}
74	}

























75	}


12	*
13	*/
14	class Mana_Core_Helper_Files extends Mage_Core_Helper_Abstract {
15	+ protected $skip = array('.', '..');
16	+
17	+ public function getFilename($relativeUrl, $type, $noExistanceCheck = false) {
18	$result = $this->getBasePath($type).DS.str_replace('/', DS, $relativeUrl);
19	if (!is_dir(dirname($result))) {
20	mkdir(dirname($result), 0777, true);
21	}
22	return $noExistanceCheck \|\| file_exists($result) ? $result : false;
23	}
24	+ public function getBaseUrl($type, $baseUrl = null, $storeId = null) {
25	+ if (!$baseUrl) {
26	+ $baseUrl = Mage::app()->getStore($storeId)->getBaseUrl('media');
27	+ }
28	+ return $baseUrl.'m-'.str_replace(DS, '/', $type);
29	}
30	public function getBasePath($type) {
31	return Mage::getConfig()->getOptions()->getMediaDir().DS.'m-'.str_replace('/', DS, $type);

41	}
42	return false;
43	}
44	+ public function getUrl($relativeUrl, $type, $baseUrl = null) {
45	if (is_array($type)) {
46	foreach ($type as $candidate) {
47	+ if ($url = $this->getUrl($relativeUrl, $candidate, $baseUrl)) {
48	return $url;
49	}
50	}

52	}
53	else {
54	if ($this->getFilename($relativeUrl, $type)) {
55	+ return $this->getBaseUrl($type, $baseUrl).'/'.str_replace(DS, '/', $relativeUrl);
56	}
57	else {
58	return false;

77	$i++;
78	}
79	}
80	+
81	+ public function walkRecursively($dir, $callback) {
82	+ if (file_exists($dir)) {
83	+ $this->_walkRecursively($dir, $callback);
84	+ }
85	+ }
86	+
87	+ protected function _walkRecursively($dir, $callback) {
88	+ if ($handle = opendir($dir)) {
89	+ $files = array();
90	+ while (false !== ($file = readdir($handle))) {
91	+ $files[] = $file;
92	+ }
93	+ closedir($handle);
94	+ foreach ($files as $file) {
95	+ if (!in_array($file, $this->skip)) {
96	+ $filename = $dir . '/' . $file;
97	+ $isDir = is_dir($filename);
98	+ if (call_user_func($callback, $dir . '/' . $file, $isDir) && $isDir) {
99	+ $this->_walkRecursively($filename, $callback);
100	+ }
101	+ }
102	+ }
103	+ }
104	+ }
105	}

app/code/local/Mana/Core/Helper/Js.php CHANGED Viewed

@@ -11,7 +11,474 @@
+             *
              */
             class Mana_Core_Helper_Js extends Mage_Core_Helper_Abstract {
-            -
            	/**
             	 * Makes translations of specified strings to be available in client-side scripts.
             	 * @param array $translations
             	 * @return Mana_Core_Helper_Js
@@ -45,4 +512,5 @@ jQuery.options($options);
             </script>
             EOT;
+            	}
+            }


11	*
12	*/
13	class Mana_Core_Helper_Js extends Mage_Core_Helper_Abstract {
14	+ #region Dynamic JS and CSS file inclusion
15	+ protected $_fileConfig;
16	+ protected $_moduleIndex = array();
17	+ protected $_tagNames = array('block', 'reference');
18	+ protected $_pathKeys = array('full_path', 'minified_path');
19	+ /**
20	+ * @param Mage_Core_Controller_Varien_Action $action
21	+ * @param Mage_Core_Model_Layout $layout
22	+ */
23	+ public function processFiles($action, $layout) {
24	+ // TODO: refactor phases, find positions, then insert all, then delete all
25	+ Mana_Core_Profiler::start(__METHOD__);
26	+
27	+ $layoutXml = $layout->getNode();
28	+ $layoutDom = new DOMDocument('1.0');
29	+ $layoutNode = $layoutDom->importNode(dom_import_simplexml($layoutXml), true);
30	+ $layoutDom->appendChild($layoutNode);
31	+ $layoutXPath = new DOMXPath($layoutDom);
32	+ $layoutModified = false;
33	+
34	+ $headBlock = $this->_findHeadBlock($layoutXPath);
35	+ $prototypeAction = $this->_findPrototypeAction($layoutXPath);
36	+
37	+ $insertOnDemand = array();
38	+ $insertEverywhere = array();
39	+ $delete = array();
40	+
41	+ $onDemandInsertPlace = null;
42	+ $xpath = '';
43	+ foreach ($this->_getFileConfig() as $name => $fileConfig) {
44	+ /* @var $config array */
45	+ /* @var $options array */
46	+ extract($fileConfig);
47	+
48	+ if ($xpath) {
49	+ $xpath .= ' \| ';
50	+ }
51	+ $xpath .= $this->_getActionsXPath($config);
52	+
53	+ }
54	+ foreach ($layoutXPath->query($xpath) as $element) {
55	+ $onDemandInsertPlace = $element;
56	+ break;
57	+ }
58	+
59	+ // handle javascript minification, merging and inclusion on all pages
60	+ foreach ($this->_getFileConfig() as $name => $fileConfig) {
61	+ /* @var $config array */
62	+ /* @var $options array */
63	+ extract($fileConfig);
64	+
65	+ if (in_array('skip', $options)) {
66	+ continue;
67	+ }
68	+
69	+ // find all statically defined actions of including a given script
70	+ $fileActions = $this->_findDomActions($layoutXPath, $config);
71	+
72	+ // prepare layout XML action depending on script parameters
73	+ $action = $this->_createConfigurableAction($layoutDom, $config, $options);
74	+
75	+ // insert script where and if appropriate
76	+ if (in_array('ondemand', $options)) {
77	+ if ($fileAction = $this->_getFirstElement($fileActions)) {
78	+ $insertOnDemand[] = array($action, $onDemandInsertPlace);
79	+ }
80	+ $delete[] = $fileActions;
81	+ }
82	+ elseif (in_array('everywhere', $options)) {
83	+ $insertEverywhere[] = $action;
84	+ foreach (array_reverse($insertOnDemand) as $insertOptions) {
85	+ list($action, $fileAction) = $insertOptions;
86	+ array_unshift($insertEverywhere, $action);
87	+ }
88	+ $insertOnDemand = array();
89	+ $delete[] = $fileActions;
90	+ }
91	+ elseif (in_array('unload', $options)) {
92	+ $delete[] = $fileActions;
93	+ }
94	+ }
95	+
96	+ // insert configurable on demand js files
97	+ foreach ($insertOnDemand as $insertOptions) {
98	+ list($action, $fileAction) = $insertOptions;
99	+ /* @var $fileAction DOMElement */
100	+
101	+ $fileAction->parentNode->insertBefore($action, $fileAction);
102	+ $layoutModified = true;
103	+ }
104	+
105	+ // insert configurable global js files
106	+ if ($prototypeAction) {
107	+ foreach (array_reverse($insertEverywhere) as $action) {
108	+ $prototypeAction->parentNode->insertBefore($action, $prototypeAction->nextSibling);
109	+ $layoutModified = true;
110	+ }
111	+ }
112	+ elseif ($headBlock) {
113	+ foreach (array_reverse($insertEverywhere) as $action) {
114	+ $headBlock->insertBefore($action, $headBlock->firstChild);
115	+ $layoutModified = true;
116	+ }
117	+ }
118	+
119	+ // delete js files includes via layout XML instructions
120	+ foreach ($delete as $fileActions) {
121	+ foreach ($fileActions as $firstFileAction) {
122	+ /* @var $firstFileAction DOMElement */
123	+ $firstFileAction->parentNode->removeChild($firstFileAction);
124	+ $layoutModified = true;
125	+ }
126	+ }
127	+
128	+ if ($layoutModified) {
129	+ $layout->loadDom($layoutNode);
130	+ }
131	+ Mana_Core_Profiler::stop(__METHOD__);
132	+ }
133	+
134	+ public function pageContains($scriptName) {
135	+ $config = $this->_getFileConfig();
136	+ if (isset($config[$scriptName])) {
137	+ $fileConfig = $config[$scriptName];
138	+
139	+ /* @var $config array */
140	+ /* @var $options array */
141	+ extract($fileConfig);
142	+
143	+ if (in_array('ondemand', $options) \|\| in_array('skip', $options)) {
144	+ /* @var $layout Mage_Core_Model_Layout */
145	+ $layout = Mage::getSingleton('core/layout');
146	+
147	+ return count($this->_findSimpleXmlActions($layout->getNode(), $config)) > 0;
148	+ }
149	+ elseif (in_array('everywhere', $options)) {
150	+ return true;
151	+ }
152	+ }
153	+ return false;
154	+ }
155	+
156	+ /**
157	+ * @param DOMXPath $layoutXPath
158	+ * @return DOMElement\|null
159	+ */
160	+ protected function _findPrototypeAction($layoutXPath) {
161	+ return $this->_getFirstElement($layoutXPath->query("//block[@name='head']/action" .
162	+ "[@method='addJs' and script='prototype/prototype.js']"));
163	+ }
164	+
165	+ /**
166	+ * @param DOMXPath $layoutXPath
167	+ * @return DOMElement\|null
168	+ */
169	+ protected function _findHeadBlock($layoutXPath) {
170	+ return $this->_getFirstElement($layoutXPath->query("//block[@name='head']"));
171	+ }
172	+
173	+ /**
174	+ * @param DOMNodeLIst \| DOMNode[] $elements
175	+ * @return DOMElement \| null
176	+ */
177	+ protected function _getFirstElement($elements) {
178	+ foreach ($elements as $element) {
179	+ return $element;
180	+ }
181	+ return null;
182	+ }
183	+
184	+ protected function _getActionsXPath($config) {
185	+ $xpath = '';
186	+ foreach ($this->_tagNames as $tagName) {
187	+ foreach ($this->_pathKeys as $pathKey) {
188	+ if (!$config[$pathKey]) {
189	+ continue;
190	+ }
191	+
192	+ if ($xpath) $xpath .= ' \| ';
193	+ $xpath .= "//{$tagName}[@name='head']/action";
194	+ if ($config['skinnable']) {
195	+ $xpath .= "[@method='addItem' and type='skin_js' and script='{$config[$pathKey]}']";
196	+ }
197	+ else {
198	+ $xpath .= "[@method='addJs' and script='{$config[$pathKey]}']";
199	+ }
200	+ }
201	+ }
202	+ return $xpath;
203	+ }
204	+
205	+ /**
206	+ * @param DOMXPath $layoutXPath
207	+ * @param array $config
208	+ * @return DOMNode[]
209	+ */
210	+ protected function _findDomActions($layoutXPath, $config) {
211	+ $xpath = $this->_getActionsXPath($config);
212	+ $result = array();
213	+ foreach ($layoutXPath->query($xpath) as $element) {
214	+ $result[] = $element;
215	+ }
216	+ return $result;
217	+ }
218	+
219	+ /**
220	+ * @param SimpleXMLElement $layoutSimpleXml
221	+ * @param array $config
222	+ * @return SimpleXMLElement[]
223	+ */
224	+ protected function _findSimpleXmlActions($layoutSimpleXml, $config) {
225	+ $xpath = $this->_getActionsXPath($config);
226	+ return $layoutSimpleXml->xpath($xpath);
227	+ }
228	+
229	+ /**
230	+ * @param DOMDocument $layoutDom
231	+ * @param array $config
232	+ * @param array $options
233	+ * @return DOMElement
234	+ */
235	+ protected function _createConfigurableAction($layoutDom, $config, $options) {
236	+ $pathKey = 'full_path';
237	+ if (in_array('min', $options) && !empty($config['minified_path'])) {
238	+ $pathKey = 'minified_path';
239	+ }
240	+ $jsXml = $config['skinnable']
241	+ ? '<action method="addItem"><type>skin_js</type><name>' . $config[$pathKey] . '</name><params/></action>'
242	+ : '<action method="addJs"><script>' . $config[$pathKey] . '</script></action>';
243	+ return $layoutDom->importNode(dom_import_simplexml(simplexml_load_string($jsXml)), true);
244	+ }
245	+
246	+ protected function _getFileConfig() {
247	+ if (is_null($this->_fileConfig)) {
248	+ $this->_fileConfig = array();
249	+ $jsConfig = Mage::getConfig()->getNode('mana_core/js');
250	+ if ($jsConfig) {
251	+ $jsChildren = (array)$jsConfig->children();
252	+ uasort($jsChildren, array($this, '_compareByModuleAndSortOrder'));
253	+ foreach ($jsChildren as $name => $config) {
254	+ $options = Mage::getStoreConfig("mana/js/$name");
255	+
256	+ /* @var $config Varien_Simplexml_Element */
257	+ if (empty($config->full_path) \|\| !$options) {
258	+ continue;
259	+ }
260	+
261	+ $options = explode('_', $options);
262	+
263	+ $config = array_merge(array(
264	+ 'type' => 'extension',
265	+ 'skinnable' => false,
266	+ 'full_path' => '',
267	+ 'minified_path' => '',
268	+ 'sort_order' => 1000000,
269	+ ), $config->asArray());
270	+
271	+ $this->_fileConfig[$name] = compact('config', 'options');
272	+ }
273	+ }
274	+ }
275	+ return $this->_fileConfig;
276	+ }
277	+
278	+ public function getSectionSeparator() {
279	+ return "\n91b5970cd70e2353d866806f8003c1cd56646961\n";
280	+ }
281	+
282	+ protected function _compareByModuleAndSortOrder($a, $b) {
283	+ if (($result = $this->_compareByModule($a, $b)) != 0) return $result;
284	+ return $this->_compareBySortOrder($a, $b);
285	+ }
286	+
287	+ protected function _compareByModule($a, $b) {
288	+ $aIndex = empty($a['module']) ? 1000000 : $this->_getModuleIndex((string)$a['module']);
289	+ $bIndex = empty($b['module']) ? 1000000 : $this->_getModuleIndex((string)$b['module']);
290	+ if ($aIndex < $bIndex) return -1;
291	+ if ($aIndex > $bIndex) return 1;
292	+ return 0;
293	+ }
294	+
295	+ protected function _compareBySortOrder($a, $b) {
296	+ $aIndex = empty($a->sort_order) ? 1000000 : ((int)(string)$a->sort_order);
297	+ $bIndex = empty($b->sort_order) ? 1000000 : ((int)(string)$b->sort_order);
298	+ if ($aIndex < $bIndex) return -1;
299	+ if ($aIndex > $bIndex) return 1;
300	+
301	+ return 0;
302	+ }
303	+
304	+ protected function _getModuleIndex($moduleName) {
305	+ if (!isset($this->_moduleIndex[$moduleName])) {
306	+ $result = 0;
307	+ foreach (Mage::getConfig()->getNode('modules')->children() as $name => $module) {
308	+ if ($name = $moduleName) {
309	+ break;
310	+ }
311	+ $result++;
312	+ }
313	+
314	+ $this->_moduleIndex[$moduleName] = $result;
315	+ }
316	+
317	+ return $this->_moduleIndex[$moduleName];
318	+ }
319	+ #endregion
320	+ #region Client side block markup
321	+ public function wrapClientSideBlock($contentHtml, $params = false) {
322	+ $info = $this->parseClientSideBlockInfo($params);
323	+
324	+ if ($info['is_enabled'] && !$info['is_self_contained']) {
325	+ return $info['opening_html'].$contentHtml.$info['closing_html'];
326	+ }
327	+ else {
328	+ return $contentHtml;
329	+ }
330	+
331	+ }
332	+
333	+ /**
334	+ * @param string $blockName
335	+ * @return string
336	+ */
337	+ public function getClientSideBlockName($blockName) {
338	+ return str_replace('.', '-', str_replace('_', '-', $blockName));
339	+ }
340	+
341	+ /**
342	+ * @param bool\|array\|Mage_Core_Block_Abstract $params
343	+ * @return array
344	+ */
345	+ public function parseClientSideBlockInfo($params = false) {
346	+ /* @var $core Mana_Core_Helper_Data */
347	+ $core = Mage::helper('mana_core');
348	+
349	+ if ($params instanceof Mage_Core_Block_Abstract) {
350	+ $block = $params;
351	+ $params = $block->getMClientSideBlock();
352	+ if (is_array($params) && empty($params['id']) && !$block->getIsAnonymous()) {
353	+ $params['id'] = $this->getClientSideBlockName($block->getNameInLayout());
354	+ }
355	+ }
356	+
357	+ $is_enabled = false;
358	+ $is_self_contained = false;
359	+ $element = 'div';
360	+ $class = '';
361	+ $style = '';
362	+ $attributes = array();
363	+ $opening_html = $closing_html = $class_html = $style_html = $attribute_html = '';
364	+
365	+ if (is_array($params)) {
366	+ $is_enabled = true;
367	+ if (!empty($params['self_contained'])) {
368	+ $is_self_contained = true;
369	+ unset($params['self_contained']);
370	+ }
371	+
372	+ // decide which element to use
373	+ if (!empty($params['element'])) {
374	+ $element = $params['element'];
375	+ unset($params['element']);
376	+ }
377	+
378	+ // assign client side block a unique identifier if possible
379	+ $id = '';
380	+ if (!empty($params['id'])) {
381	+ $id = $params['id'];
382	+ unset($params['id']);
383	+ }
384	+ $class = $id ? 'mb-' . $id : 'm-block';
385	+ $style = '';
386	+
387	+ // set css properties
388	+ if (isset($params['class'])) {
389	+ $class .= " {$params['class']}";
390	+ unset($params['class']);
391	+ }
392	+ foreach ($params as $key => $value) {
393	+ if ($core->startsWith($key, 'style-')) {
394	+ $style .= "{$value};";
395	+ unset($params[$key]);
396	+ }
397	+ }
398	+
399	+ // decide on client side block type
400	+ if (empty($params['m-block'])) {
401	+ $type = '';
402	+ if (!empty($params['type'])) {
403	+ $type = $params['type'];
404	+ if (in_array($type, array('Mana/Core/Block', 'Mana/Core/NamedBlock'))) {
405	+ $type = '';
406	+ }
407	+ unset($params['type']);
408	+ }
409	+ if ($type) {
410	+ $params['m-block'] = $type;
411	+ }
412	+ }
413	+
414	+ // render client side block element and its contents
415	+ $opening_html = '<' . $element;
416	+ if (isset($params['html'])) {
417	+ foreach ($params['html'] as $key => $value) {
418	+ $attributes[$key] = $value;
419	+ if ($attribute_html) $attribute_html .= ' ';
420	+ $attribute_html .= "$key=\"$value\"";
421	+ }
422	+ unset($params['html']);
423	+ }
424	+ foreach ($params as $key => $value) {
425	+ $attributeKey = 'data-' . str_replace('.', '-', str_replace('_', '-', $key));
426	+ $attributeValue = str_replace('"', '"', str_replace('<', '<', str_replace('>', '>', $value)));
427	+ $attributes[$attributeKey] = $attributeValue;
428	+
429	+ if ($attribute_html) $attribute_html .= ' ';
430	+ $attribute_html .= "$attributeKey=\"$attributeValue\"";
431	+ }
432	+ if ($attribute_html) {
433	+ $opening_html .= ' ' . $attribute_html;
434	+ }
435	+
436	+ if ($class) {
437	+ $class_html = 'class="' . $class . '"';
438	+ $opening_html .= ' '.$class_html;
439	+ }
440	+ if ($style) {
441	+ $style_html = 'style="' . $style . '"';
442	+ $opening_html .= ' ' . $style_html;
443	+ }
444	+ $opening_html .= '>';
445	+ $closing_html = '</' . $element . '>';
446	+
447	+ }
448	+
449	+ return compact('is_enabled', 'is_self_contained', 'element', 'class', 'style', 'attributes',
450	+ 'opening_html', 'closing_html', 'class_html', 'style_html', 'attribute_html');
451	+ }
452	+
453	+ public function setConfig($key, $value) {
454	+ /* @var $layout Mage_Core_Model_Layout */
455	+ $layout = Mage::getSingleton(strtolower('Core/Layout'));
456	+ /* @var $jsBlock Mana_Core_Block_Js */
457	+ $jsBlock = $layout->getBlock('m_js');
458	+
459	+ if ($jsBlock) {
460	+ $jsBlock->setConfig($key, $value);
461	+ }
462	+
463	+ return $this;
464	+ }
465	+
466	+ public function getConfig() {
467	+ /* @var $layout Mage_Core_Model_Layout */
468	+ $layout = Mage::getSingleton(strtolower('Core/Layout'));
469	+ /* @var $jsBlock Mana_Core_Block_Js */
470	+ $jsBlock = $layout->getBlock('m_js');
471	+
472	+ if ($jsBlock) {
473	+ return $jsBlock->getConfig();
474	+ }
475	+
476	+ return false;
477	+ }
478	+
479	+ #endregion
480	+ #region Deprecated API for $.options() and $.__() functions
481	+ /**
482	* Makes translations of specified strings to be available in client-side scripts.
483	* @param array $translations
484	* @return Mana_Core_Helper_Js

512	</script>
513	EOT;
514	}
515	+ #endregion
516	}

app/code/local/Mana/Core/Helper/Json.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Json extends Mage_Core_Helper_Abstract {
13	+ public function encodeAttribute($data) {
14	+ /* @var $core Mana_Core_Helper_Data */
15	+ $core = Mage::helper('mana_core');
16	+
17	+ $result = $core->jsonForceObjectAndEncode($data);
18	+ $result = implode("\"", str_replace("\"", "'", explode("'", $result)));
19	+ $result = $this->escapeHtml($result);
20	+ return $result;
21	+ }
22	+ }

app/code/local/Mana/Core/Helper/Layer.php ADDED Viewed

	@@ -0,0 +1,89 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Layer extends Mage_Core_Helper_Abstract {
13	+ public function useSolrForNavigation() {
14	+ if (!Mage::helper('core')->isModuleEnabled('Enterprise_Search')) {
15	+ return false;
16	+ }
17	+ /* @var $helper Enterprise_Search_Helper_Data */
18	+ $helper = Mage::helper('enterprise_search');
19	+
20	+ return $helper->getIsEngineAvailableForNavigation();
21	+ }
22	+
23	+ public function useSolrForSearch() {
24	+ if (!Mage::helper('core')->isModuleEnabled('Enterprise_Search')) {
25	+ return false;
26	+ }
27	+ /* @var $helper Enterprise_Search_Helper_Data */
28	+ $helper = Mage::helper('enterprise_search');
29	+
30	+ return $helper->isThirdPartSearchEngine() && $helper->isActiveEngine();
31	+ }
32	+
33	+ public function useSolr() {
34	+ switch ($this->getMode()) {
35	+ case 'category':
36	+ return $this->useSolrForNavigation();
37	+ case 'search':
38	+ return $this->useSolrForSearch();
39	+ default:
40	+ throw new Exception('Not implemented');
41	+ }
42	+ }
43	+
44	+ /**
45	+ * @param null $mode
46	+ * @throws Exception
47	+ * @return Mage_Catalog_Model_Layer
48	+ */
49	+ public function getLayer($mode = null) {
50	+ if (!$mode) {
51	+ $mode = $this->getMode();
52	+ }
53	+ switch ($mode) {
54	+ case 'category':
55	+ return Mage::getSingleton($this->useSolrForNavigation()
56	+ ? 'enterprise_search/catalog_layer'
57	+ : 'catalog/layer'
58	+ );
59	+ case 'search':
60	+ return Mage::getSingleton($this->useSolrForSearch()
61	+ ? 'enterprise_search/search_layer'
62	+ : 'catalogsearch/layer'
63	+ );
64	+ default:
65	+ throw new Exception('Not implemented');
66	+ }
67	+ }
68	+
69	+ protected $_mode;
70	+
71	+ public function getMode() {
72	+ if ($this->_mode) {
73	+ return $this->_mode;
74	+ }
75	+ elseif (in_array(Mage::helper('mana_core')->getRoutePath(), array('catalogsearch/result/index', 'manapro_filterajax/search/index'))) {
76	+ return 'search';
77	+ }
78	+ else {
79	+ return 'category';
80	+ }
81	+ }
82	+
83	+ public function setMode($mode) {
84	+ $this->_mode = $mode;
85	+
86	+ return $this;
87	+ }
88	+
89	+ }

app/code/local/Mana/Core/Helper/Layout.php CHANGED Viewed

@@ -34,4 +34,18 @@ class Mana_Core_Helper_Layout extends Mage_Core_Helper_Abstract {
                     if ($a['sortOrder'] > $b['sortOrder']) return 1;
                     return 0;
+                }
+            }


34	if ($a['sortOrder'] > $b['sortOrder']) return 1;
35	return 0;
36	}
37	+
38	+ public function renderBlock($blockName) {
39	+ /* @var $layout Mage_Core_Model_Layout */
40	+ $layout = Mage::getSingleton('core/layout');
41	+
42	+ /* @var $url Mage_Core_Model_Url */
43	+ $url = Mage::getSingleton('core/url');
44	+ if ($block = $layout->getBlock($blockName)) {
45	+ return $url->sessionUrlVar($block->toHtml());
46	+ }
47	+ else {
48	+ return '';
49	+ }
50	+ }
51	}

app/code/local/Mana/Core/Helper/Logger.php ADDED Viewed

	@@ -0,0 +1,110 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Core_Helper_Logger beginSeoMatch(string $message = null)
11	+ * @method Mana_Core_Helper_Logger logSeoMatch(string $message = null)
12	+ * @method Mana_Core_Helper_Logger endSeoMatch(string $message = null)
13	+
14	+ * @method Mana_Core_Helper_Logger beginSeoUrl(string $message = null)
15	+ * @method Mana_Core_Helper_Logger logSeoUrl(string $message = null)
16	+ * @method Mana_Core_Helper_Logger endSeoUrl(string $message = null)
17	+
18	+ * @method Mana_Core_Helper_Logger beginDbIndexerFailure(string $message = null)
19	+ * @method Mana_Core_Helper_Logger logDbIndexerFailure(string $message = null)
20	+ * @method Mana_Core_Helper_Logger endDbIndexerFailure(string $message = null)
21	+
22	+ * @method Mana_Core_Helper_Logger beginUrlIndexer(string $message = null)
23	+ * @method Mana_Core_Helper_Logger logUrlIndexer(string $message = null)
24	+ * @method Mana_Core_Helper_Logger endUrlIndexer(string $message = null)
25	+
26	+ * @method Mana_Core_Helper_Logger beginTemp(string $message = null)
27	+ * @method Mana_Core_Helper_Logger logTemp(string $message = null)
28	+ * @method Mana_Core_Helper_Logger endTemp(string $message = null)
29	+ */
30	+ class Mana_Core_Helper_Logger extends Mage_Core_Helper_Abstract {
31	+ const INDENT_WIDTH = 4;
32	+ protected $_isEnabled = array(
33	+ 'all' => false,
34	+ 'seo_match' => false,
35	+ 'seo_url' => false,
36	+ 'db_indexer_failure' => false,
37	+ 'url_indexer' => false,
38	+ 'temp' => true,
39	+ );
40	+ protected $_indent = array('all' => 0);
41	+
42	+ public function __call($method, $args) {
43	+ /* @var $core Mana_Core_Helper_Data */
44	+ $core = Mage::helper('mana_core');
45	+ if ($core->startsWith($method, 'log')) {
46	+ $key = $this->_underscore(substr($method, 3));
47	+ if ($this->_isEnabled[$key]) {
48	+ if (!isset($this->_indent[$key])) {
49	+ $this->_indent[$key] = 0;
50	+ }
51	+ if (!empty($args[0])) {
52	+ Mage::log(str_repeat(' ', $this->_indent[$key]) . $args[0], Zend_Log::DEBUG, "m_$key.log");
53	+ }
54	+ if ($key != 'all') {
55	+ if (!empty($args[0])) {
56	+ Mage::log(str_repeat(' ', $this->_indent['all']) . $args[0], Zend_Log::DEBUG, "m_all.log");
57	+ }
58	+ }
59	+ }
60	+
61	+ return $this;
62	+ }
63	+ elseif ($core->startsWith($method, 'begin')) {
64	+ $key = $this->_underscore(substr($method, 5));
65	+ if ($this->_isEnabled[$key]) {
66	+ if (!isset($this->_indent[$key])) {
67	+ $this->_indent[$key] = 0;
68	+ }
69	+ if (!empty($args[0])) {
70	+ Mage::log(str_repeat(' ', $this->_indent[$key]). $args[0], Zend_Log::DEBUG, "m_$key.log");
71	+ }
72	+ $this->_indent[$key] += self::INDENT_WIDTH;
73	+ if ($key != 'all') {
74	+ if (!empty($args[0])) {
75	+ Mage::log(str_repeat(' ', $this->_indent['all']) . $args[0], Zend_Log::DEBUG, "m_all.log");
76	+ }
77	+ $this->_indent['all'] += self::INDENT_WIDTH;
78	+ }
79	+ }
80	+
81	+ return $this;
82	+ }
83	+ elseif ($core->startsWith($method, 'end')) {
84	+ $key = $this->_underscore(substr($method, 3));
85	+ if ($this->_isEnabled[$key]) {
86	+ if (!isset($this->_indent[$key])) {
87	+ $this->_indent[$key] = 0;
88	+ }
89	+ $this->_indent[$key] -= self::INDENT_WIDTH;
90	+ if (!empty($args[0])) {
91	+ Mage::log(str_repeat(' ', $this->_indent[$key]) . $args[0], Zend_Log::DEBUG, "m_$key.log");
92	+ }
93	+ if ($key != 'all') {
94	+ $this->_indent['all'] -= self::INDENT_WIDTH;
95	+ if (!empty($args[0])) {
96	+ Mage::log(str_repeat(' ', $this->_indent['all']) . $args[0], Zend_Log::DEBUG, "m_all.log");
97	+ }
98	+ }
99	+ }
100	+
101	+ return $this;
102	+ }
103	+
104	+ throw new Exception("Invalid method " . get_class($this) . "::" . $method . "(" . print_r($args, 1) . ")");
105	+ }
106	+
107	+ protected function _underscore($name) {
108	+ return strtolower(preg_replace('/(.)([A-Z])/', "$1_$2", $name));
109	+ }
110	+ }

app/code/local/Mana/Core/Helper/Mbstring.php ADDED Viewed

	@@ -0,0 +1,69 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Mbstring extends Mage_Core_Helper_Abstract {
13	+ protected $_multiByte;
14	+ public function __construct() {
15	+ $this->_multiByte = function_exists('mb_strpos');
16	+ }
17	+ public function strpos($haystack, $needle, $offset = 0) {
18	+ if ($this->_multiByte) {
19	+ return mb_strpos($haystack, $needle, $offset);
20	+ }
21	+ else {
22	+ return strpos($haystack, $needle, $offset);
23	+ }
24	+ }
25	+
26	+ public function strrpos($haystack, $needle, $offset = null) {
27	+ if ($this->_multiByte) {
28	+ return is_null($offset) ? mb_strrpos($haystack, $needle) : mb_strrpos($haystack, $needle, $offset);
29	+ }
30	+ else {
31	+ return is_null($offset) ? strrpos($haystack, $needle) : strrpos($haystack, $needle, $offset);
32	+ }
33	+ }
34	+
35	+ public function strlen($haystack) {
36	+ if ($this->_multiByte) {
37	+ return mb_strlen($haystack);
38	+ }
39	+ else {
40	+ return strlen($haystack);
41	+ }
42	+ }
43	+
44	+ public function substr($string, $start, $length = null) {
45	+ if ($this->_multiByte) {
46	+ return is_null($length) ? mb_substr($string, $start) : mb_substr($string, $start, $length);
47	+ }
48	+ else {
49	+ return is_null($length) ? substr($string, $start) : substr($string, $start, $length);
50	+ }
51	+ }
52	+
53	+ public function endsWith($haystack, $needle) {
54	+ return ($this->strrpos($haystack, $needle) === $this->strlen($haystack) - $this->strlen($needle));
55	+ }
56	+
57	+ public function startsWith($haystack, $needle) {
58	+ return ($this->strpos($haystack, $needle) === 0);
59	+ }
60	+
61	+ public function stripos($haystack, $needle, $offset = 0) {
62	+ if ($this->_multiByte) {
63	+ return mb_stripos($haystack, $needle, $offset);
64	+ }
65	+ else {
66	+ return stripos($haystack, $needle, $offset);
67	+ }
68	+ }
69	+ }

app/code/local/Mana/Core/Helper/PageType.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ abstract class Mana_Core_Helper_PageType extends Mage_Core_Helper_Abstract {
9	+ protected $_code;
10	+
11	+ abstract public function getRoutePath();
12	+ abstract public function getCurrentSuffix();
13	+ public function setCode($code) {
14	+ $this->_code = $code;
15	+ return $this;
16	+ }
17	+ public function getCode() {
18	+ return $this->_code;
19	+ }
20	+
21	+ public function matchRoute($route) {
22	+ return $route == $this->getRoutePath();
23	+ }
24	+ }

app/code/local/Mana/Core/Helper/PageType/Category.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_PageType_Category extends Mana_Core_Helper_PageType {
13	+ public function getCurrentSuffix() {
14	+ /* @var $categoryHelper Mage_Catalog_Helper_Category */
15	+ $categoryHelper = Mage::helper('catalog/category');
16	+
17	+ return $categoryHelper->getCategoryUrlSuffix();
18	+ }
19	+
20	+
21	+ public function getRoutePath() {
22	+ return 'catalog/category/view';
23	+ }
24	+ }

app/code/local/Mana/Core/Helper/PageType/CmsPage.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_PageType_CmsPage extends Mana_Core_Helper_PageType {
13	+ public function getCurrentSuffix() {
14	+ return Mage::getStoreConfig('mana/seo/cms_page_suffix');
15	+ }
16	+
17	+ public function getRoutePath() {
18	+ return 'cms/page/view';
19	+ }
20	+ }

app/code/local/Mana/Core/Helper/PageType/HomePage.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_PageType_HomePage extends Mana_Core_Helper_PageType {
13	+ public function getCurrentSuffix() {
14	+ return Mage::getStoreConfig('mana/seo/home_page_suffix');
15	+ }
16	+
17	+ public function getRoutePath() {
18	+ return 'cms/index/index';
19	+ }
20	+ }

app/code/local/Mana/Core/Helper/PageType/Search.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_PageType_Search extends Mana_Core_Helper_PageType {
13	+ public function getCurrentSuffix() {
14	+ return Mage::getStoreConfig('mana/seo/search_suffix');
15	+ }
16	+
17	+ public function getRoutePath() {
18	+ return 'catalogsearch/result/index';
19	+ }
20	+ }

app/code/local/Mana/Core/Helper/Router.php ADDED Viewed

	@@ -0,0 +1,91 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Router extends Mage_Core_Helper_Abstract {
13	+ public function forward($route, $request = null, $params = null, $query = null) {
14	+ if (is_array($route)) {
15	+ $this->forward(
16	+ $route['route'],
17	+ isset($action['request']) ? $action['request'] : null,
18	+ isset($action['params']) ? $action['params'] : null,
19	+ isset($action['query']) ? $action['query'] : null
20	+ );
21	+
22	+ return $this;
23	+ }
24	+ if (!$request) {
25	+ $request = Mage::app()->getRequest();
26	+ }
27	+
28	+ $request->initForward();
29	+
30	+ if (!is_null($params)) {
31	+ $request->setParams($params);
32	+ }
33	+
34	+ list($module, $controller, $action) = explode('/', $route);
35	+
36	+ if ($controller != '*') {
37	+ $request->setControllerName($controller);
38	+
39	+ }
40	+
41	+ if ($module != '*') {
42	+ $request->setModuleName($module);
43	+ }
44	+
45	+ if ($action != '*') {
46	+ $request->setActionName($action);
47	+ }
48	+
49	+ $request->setDispatched(false);
50	+
51	+ if (!is_null($query)) {
52	+ $_GET = $query;
53	+ }
54	+
55	+ return $this;
56	+ }
57	+
58	+ public function changePath($path, $request = null) {
59	+ if (!$request) {
60	+ $request = Mage::app()->getRequest();
61	+ }
62	+
63	+ if ($path === '') {
64	+ $path = '/';
65	+ }
66	+ $request
67	+ ->setPathInfo($path)
68	+ ->setModuleName(null)
69	+ ->setControllerName(null)
70	+ ->setActionName(null)
71	+ ->setDispatched(false);
72	+
73	+ return $this;
74	+ }
75	+
76	+ public function processWithoutRendering($target, $method) {
77	+ /* @var $core Mana_Core_Helper_Data */
78	+ $core = Mage::helper('mana_core');
79	+
80	+ Mage::register('m_response_callback', array($target, $method));
81	+ if ($core->inAdmin() && $target instanceof Mage_Adminhtml_Controller_Action) {
82	+ /* @var $adminSession Mage_Adminhtml_Model_Session */
83	+ $adminSession = Mage::getSingleton('adminhtml/session');
84	+ $adminSession->setDataUsingMethod('is_url_notice', $target->getFlag('', 'check_url_settings'));
85	+ }
86	+ Mage::app()->getFrontController()->setDataUsingMethod('no_render', true);
87	+
88	+ return $this;
89	+ }
90	+
91	+ }

app/code/local/Mana/Core/Helper/Seo.php ADDED Viewed

	@@ -0,0 +1,72 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Seo extends Mage_Core_Helper_Abstract {
13	+ protected $_urlSymbols;
14	+
15	+ protected function _initUrlSymbols() {
16	+ if (!$this->_urlSymbols) {
17	+ $this->_urlSymbols = array();
18	+ $this->_urlSymbols['-'] = Mage::getStoreConfig('mana/seo_symbols/dash');
19	+ $this->_urlSymbols['/'] = Mage::getStoreConfig('mana/seo_symbols/slash');
20	+ $this->_urlSymbols['+'] = Mage::getStoreConfig('mana/seo_symbols/plus');
21	+ $this->_urlSymbols['_'] = Mage::getStoreConfig('mana/seo_symbols/underscore');
22	+ $this->_urlSymbols["'"] = Mage::getStoreConfig('mana/seo_symbols/quote');
23	+ $this->_urlSymbols['"'] = Mage::getStoreConfig('mana/seo_symbols/double_quote');
24	+ $this->_urlSymbols['%'] = Mage::getStoreConfig('mana/seo_symbols/percent');
25	+ $this->_urlSymbols['#'] = Mage::getStoreConfig('mana/seo_symbols/hash');
26	+ $this->_urlSymbols['&'] = Mage::getStoreConfig('mana/seo_symbols/ampersand');
27	+ $this->_urlSymbols[' '] = Mage::getStoreConfig('mana/seo_symbols/space');
28	+ }
29	+
30	+ return $this;
31	+ }
32	+
33	+ public function encode($text) {
34	+ $this->_initUrlSymbols();
35	+ foreach ($this->_urlSymbols as $symbol => $urlSymbol) {
36	+ $text = str_replace($symbol, $urlSymbol, $text);
37	+ }
38	+
39	+ return $text;
40	+ }
41	+
42	+ public function decode($text) {
43	+ $this->_initUrlSymbols();
44	+ $result = '';
45	+ for ($i = 0; $i < mb_strlen($text);) {
46	+ $found = false;
47	+ foreach ($this->_urlSymbols as $symbol => $urlSymbol) {
48	+ if (mb_strpos($text, $urlSymbol, $i) === $i) {
49	+ $result .= $symbol;
50	+ $i += mb_strlen($urlSymbol);
51	+ $found = true;
52	+ break;
53	+ }
54	+ }
55	+ if (!$found) {
56	+ $result .= mb_substr($text, $i++, 1);
57	+ }
58	+ }
59	+
60	+ return $result;
61	+ }
62	+
63	+ public function select($expr) {
64	+ $this->_initUrlSymbols();
65	+ foreach ($this->_urlSymbols as $symbol => $urlSymbol) {
66	+ $escapedSymbol = str_replace("'", "\\'", $symbol);
67	+ $expr = "REPLACE($expr, '$escapedSymbol', '$urlSymbol')";
68	+ }
69	+
70	+ return $expr;
71	+ }
72	+ }

app/code/local/Mana/Core/Helper/UrlTemplate.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_UrlTemplate extends Mage_Core_Helper_Abstract {
13	+ public function encodeAttribute($data) {
14	+ if (Mage::app()->getStore()->isAdmin() \|\| Mage::getStoreConfigFlag('mana/ajax/debug')) {
15	+ return $data;
16	+ }
17	+ else {
18	+ return $this->urlEncode($data);
19	+ }
20	+ }
21	+ }

app/code/local/Mana/Core/Helper/Utils.php ADDED Viewed

	@@ -0,0 +1,118 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Helper_Utils extends Mage_Core_Helper_Abstract {
13	+ /**
14	+ * @return Mana_Core_Helper_Utils
15	+ */
16	+ public function reindexAll() {
17	+ /* @var $indexer Mage_Index_Model_Indexer */
18	+ $indexer = Mage::getSingleton('index/indexer');
19	+
20	+ Mage::dispatchEvent('shell_reindex_init_process');
21	+ foreach ($indexer->getProcessesCollection() as $process) {
22	+ /* @var $process Mage_Index_Model_Process */
23	+ $process->reindexEverything();
24	+ Mage::dispatchEvent($process->getIndexerCode() . '_shell_reindex_after');
25	+ }
26	+ Mage::dispatchEvent('shell_reindex_finalize_process');
27	+
28	+ return $this;
29	+ }
30	+
31	+ public function reindex($code) {
32	+ /* @var $indexer Mage_Index_Model_Indexer */
33	+ $indexer = Mage::getSingleton('index/indexer');
34	+
35	+ $indexer->getProcessByCode($code)->reindexAll();
36	+
37	+ return $this;
38	+ }
39	+
40	+ /**
41	+ * @param string $module
42	+ * @return Mana_Core_Helper_Utils
43	+ */
44	+ public function disableModuleOutput($module) {
45	+ /* @var $configData Mage_Core_Model_Config_Data */
46	+ $configData = Mage::getModel('core/config_data');
47	+ /* @noinspection PhpUndefinedMethodInspection */
48	+ $configData
49	+ ->setScope('default')
50	+ ->setScopeId(0)
51	+ ->setPath('advanced/modules_disable_output/'. $module)
52	+ ->setValue(1)
53	+ ->save();
54	+
55	+ return $this;
56	+ }
57	+
58	+ /**
59	+ * @return Mana_Core_Helper_Utils
60	+ */
61	+ public function clearDiskCache() {
62	+ /* @var $fileHelper Mana_Core_Helper_Files */
63	+ $fileHelper = Mage::helper('mana_core/files');
64	+ $fileHelper->walkRecursively(Mage::getBaseDir('cache'), array($this, '_clearDiskCacheEntry'));
65	+
66	+ return $this;
67	+ }
68	+
69	+ public function _clearDiskCacheEntry($filename, $isDir) {
70	+ if (!$isDir) {
71	+ unlink($filename);
72	+ }
73	+
74	+ return true;
75	+ }
76	+
77	+ public function setStoreConfig($path, $value, $scope = 'default', $scopeId = 0) {
78	+ /* @var $res Mage_Core_Model_Resource */
79	+ $res = Mage::getSingleton('core/resource');
80	+
81	+ /* @var $db Varien_Db_Adapter_Pdo_Mysql */
82	+ $db = $res->getConnection('write');
83	+
84	+ /* @var $core Mana_Core_Helper_Data */
85	+ $core = Mage::helper('mana_core');
86	+
87	+ $db->query($core->insert($db, $res->getTableName('core/config_data'), array(
88	+ 'scope' => "'$scope'",
89	+ 'scope_id' => $scopeId,
90	+ 'path' => "'$path'",
91	+ 'value' => "'$value'",
92	+ )));
93	+
94	+ return $this;
95	+ }
96	+
97	+ public function getStoreConfig($path) {
98	+ $scope = 'default';
99	+ $scopeId = 0;
100	+
101	+ /* @var $collection Mage_Core_Model_Mysql4_Config_Data_Collection */
102	+ $collection = Mage::getModel('core/config_data')->getCollection();
103	+
104	+ $collection->getSelect()
105	+ ->where('scope=?', $scope)
106	+ ->where('scope_id=?', $scopeId)
107	+ ->where('path=?', $path);
108	+
109	+ /** @noinspection PhpUnusedLocalVariableInspection */
110	+ foreach ($collection as $result) {
111	+ /* @noinspection PhpUndefinedMethodInspection */
112	+ return $result->getValue();
113	+ }
114	+
115	+ return (string)Mage::getConfig()->getNode('default/'.$path);
116	+ }
117	+
118	+ }

app/code/local/Mana/Core/Model/Callback.php CHANGED Viewed

	@@ -14,15 +14,15 @@
14	*
15	*
16	* @method string \| object getTarget()
17	- * @method bool hasTarget(()
18	- * @method Mana_Core_Model_Callback unsTarget(()
19	- * @method Mana_Core_Model_Callback setTarget(()
20	*
21	*
22	* @method string getMethod()
23	- * @method bool hasMethod(()
24	- * @method Mana_Core_Model_Callback unsMethod(()
25	- * @method Mana_Core_Model_Callback setMethod(()
26	*
27	*/
28	class Mana_Core_Model_Callback extends Mana_Core_Model_Object {


14	*
15	*
16	* @method string \| object getTarget()
17	+ * @method bool hasTarget()
18	+ * @method Mana_Core_Model_Callback unsTarget()
19	+ * @method Mana_Core_Model_Callback setTarget()
20	*
21	*
22	* @method string getMethod()
23	+ * @method bool hasMethod()
24	+ * @method Mana_Core_Model_Callback unsMethod()
25	+ * @method Mana_Core_Model_Callback setMethod()
26	*
27	*/
28	class Mana_Core_Model_Callback extends Mana_Core_Model_Object {

app/code/local/Mana/Core/Model/Closure.php ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Model_Closure extends Varien_Object {
13	+ /**
14	+ * @return mixed
15	+ */
16	+ public function execute() {
17	+ }
18	+ }

app/code/local/Mana/Core/Model/Indexer.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Core_Model_Indexer extends Mage_Index_Model_Indexer_Abstract {
13	+ protected $_code;
14	+ protected $_process;
15	+ protected $_xml = null;
16	+ public function getCode() {
17	+ return $this->_code;
18	+ }
19	+
20	+ /**
21	+ * @return Mage_Index_Model_Process \| bool
22	+ */
23	+ public function getProcess() {
24	+ if (!$this->_process) {
25	+ $this->_process = Mage::getModel('index/process')->load($this->getCode(), 'indexer_code');
26	+ }
27	+
28	+ return $this->_process;
29	+ }
30	+
31	+ /**
32	+ * @return Varien_Simplexml_Element \| bool
33	+ */
34	+ public function getXml() {
35	+ if (is_null($this->_xml)) {
36	+ $result = Mage::getConfig()->getXpath("//global/index/indexer/{$this->getProcess()->getIndexerCode()}");
37	+
38	+ $this->_xml = count($result) == 1 ? $result[0] : false;
39	+ }
40	+ return $this->_xml;
41	+ }
42	+
43	+ /**
44	+ * Get Indexer name
45	+ *
46	+ * @return string
47	+ */
48	+ public function getName() {
49	+ /** @noinspection PhpUndefinedFieldInspection */
50	+ return (string)$this->getXml()->name;
51	+ }
52	+
53	+ /**
54	+ * Retrieve Indexer description
55	+ *
56	+ * @return string
57	+ */
58	+ public function getDescription() {
59	+ /** @noinspection PhpUndefinedFieldInspection */
60	+ return (string)$this->getXml()->description;
61	+ }
62	+ }

app/code/local/Mana/Core/Model/Observer.php CHANGED Viewed

@@ -58,13 +58,14 @@ class Mana_Core_Model_Observer {
                     /* @var $layout Mage_Core_Model_Layout */
                     $layout = $observer->getEvent()->getLayout();
                     if ($node = Mage::getConfig()->getNode('m_block_layout_handle')) {
                         foreach ($node->children() as $ruleName => $ruleConfig) {
                             $if = $ruleConfig->if;
                             $handleName = (string)$ruleConfig->load_handle;
                             if ($type = (string)$if['type']) {
                                 if ($this->_hasBlockInXml($type, $layout)) {
-            -
                                    $action->getLayout()->getUpdate()->fetchPackageLayoutUpdates((string)$handleName);
+                                }
+                            }
+                        }
@@ -91,8 +92,10 @@ class Mana_Core_Model_Observer {
             		/* @var $action Mage_Core_Controller_Varien_Action */ $action = $observer->getEvent()->getAction();
             		/* @var $layout Mage_Core_Model_Layout */ $layout = $observer->getEvent()->getLayout();
                     Mage::helper('mana_core/layout')->prepareDelayedLayoutBlocks();
             		if (Mage::getConfig()->getNode('m_blocks')) {
             			foreach (Mage::getConfig()->getNode('m_blocks')->children() as $name => $config) {
             				if (in_array($name, $layout->getUpdate()->getHandles())) {
@@ -118,6 +121,7 @@ class Mana_Core_Model_Observer {
+            				}
+            			}
+            		}
+            	}
@@ -225,5 +229,122 @@ class Mana_Core_Model_Observer {
                         Mage::register('m_page_is_being_rendered', true);
+                    }
+                }
+            }


58	/* @var $layout Mage_Core_Model_Layout */
59	$layout = $observer->getEvent()->getLayout();
60
61	+ // load javascript and css files if certain blocks are present
62	if ($node = Mage::getConfig()->getNode('m_block_layout_handle')) {
63	foreach ($node->children() as $ruleName => $ruleConfig) {
64	$if = $ruleConfig->if;
65	$handleName = (string)$ruleConfig->load_handle;
66	if ($type = (string)$if['type']) {
67	if ($this->_hasBlockInXml($type, $layout)) {
68	+ $layout->getUpdate()->fetchPackageLayoutUpdates((string)$handleName);
69	}
70	}
71	}

92	/* @var $action Mage_Core_Controller_Varien_Action */ $action = $observer->getEvent()->getAction();
93	/* @var $layout Mage_Core_Model_Layout */ $layout = $observer->getEvent()->getLayout();
94
95	+ // additional layout changes initiated by blocks when all their properties and children are already loaded
96	Mage::helper('mana_core/layout')->prepareDelayedLayoutBlocks();
97
98	+ #region Obsolete, currently does nothing as there is no more m_blocks section in config.xml
99	if (Mage::getConfig()->getNode('m_blocks')) {
100	foreach (Mage::getConfig()->getNode('m_blocks')->children() as $name => $config) {
101	if (in_array($name, $layout->getUpdate()->getHandles())) {

121	}
122	}
123	}
124	+ #endregion
125	}
126
127

229	Mage::register('m_page_is_being_rendered', true);
230	}
231	}
232	+
233	+ /**
234	+ * REPLACE THIS WITH DESCRIPTION (handles event "controller_action_layout_generate_blocks_before")
235	+ * @param Varien_Event_Observer $observer
236	+ */
237	+ public function processJsCssFiles($observer) {
238	+ /* @var $action Mage_Core_Controller_Varien_Action */
239	+ $action = $observer->getEvent()->getAction();
240	+ /* @var $layout Mage_Core_Model_Layout */
241	+ $layout = $observer->getEvent()->getLayout();
242	+
243	+ /* @var $helper Mana_Core_Helper_Js */
244	+ $helper = Mage::helper('mana_core/js');
245	+
246	+ $helper->processFiles($action, $layout);
247	+ }
248	+
249	+ /**
250	+ * wrap all blocks marked as client side blocks into container elements
251	+ * (handles event "core_block_abstract_to_html_after")
252	+ * @param Varien_Event_Observer $observer
253	+ */
254	+ public function addClientSideBlockMarkup($observer) {
255	+ /* @var $block Mage_Core_Block_Abstract */
256	+ $block = $observer->getEvent()->getBlock();
257	+ /* @var $transport Varien_Object */
258	+ $transport = $observer->getEvent()->getTransport();
259	+
260	+ if ($block->getNameInLayout() == 'head' && ($css = $block->getMCss())) {
261	+ /* @var $files Mana_Core_Helper_Files */
262	+ $files = Mage::helper(strtolower('Mana_Core/Files'));
263	+ $html = '';
264	+ foreach ($css as $relativeUrl) {
265	+ if ($files->getFilename($relativeUrl, 'css')) {
266	+ $html .= '<link rel="stylesheet" type="text/css" href="' . $files->getUrl($relativeUrl, 'css') . '" />' . "\n";
267	+ }
268	+ }
269	+ if ($html) {
270	+ $transport->setHtml($transport->getHtml() . $html);
271	+ }
272	+ }
273	+
274	+ /* @var $js Mana_Core_Helper_Js */
275	+ $js = Mage::helper('mana_core/js');
276	+ $transport->setHtml($js->wrapClientSideBlock($transport->getHtml(), $block));
277	+ }
278	+
279	+ /**
280	+ * REPLACE THIS WITH DESCRIPTION (handles event "core_block_abstract_to_html_after")
281	+ * @param Varien_Event_Observer $observer
282	+ */
283	+ public function renderRequireSettings($observer) {
284	+ /* @var $block Mage_Core_Block_Abstract */
285	+ $block = $observer->getEvent()->getBlock();
286	+ /* @var $transport Varien_Object */
287	+ $transport = $observer->getEvent()->getTransport();
288	+
289	+ /* @var $js Mana_Core_Helper_Js */
290	+ $js = Mage::helper('mana_core/js');
291	+
292	+ if ($block->getNameInLayout() == 'head' && $js->pageContains('require')) {
293	+ $require = $block->getLayout()->createBlock('mana_core/require');
294	+ $html = $transport->getHtml();
295	+ $html = $require->toHtml(). $html;
296	+
297	+ // replace original content with wrapped one
298	+ $transport->setHtml($html);
299	+ }
300	+ }
301	+
302	+ /**
303	+ * If relevant global flag is raised, renders AJAX content into JSON response instead of typical full-page
304	+ * HTML response (handles event "controller_front_send_response_before")
305	+ * @param Varien_Event_Observer $observer
306	+ */
307	+ public function renderCustomResponse($observer) {
308	+ if ($callback = Mage::registry('m_response_callback')) {
309	+ call_user_func($callback);
310	+ }
311	+ }
312	+
313	+ /**
314	+ * REPLACE THIS WITH DESCRIPTION (handles event "controller_front_init_before")
315	+ * @param Varien_Event_Observer $observer
316	+ */
317	+ public function registerEarlyRouters($observer) {
318	+ /* @var $front Mage_Core_Controller_Varien_Front */
319	+ $front = $observer->getEvent()->getData('front');
320	+
321	+ foreach ($this->coreHelper()->getSortedXmlChildren(Mage::getConfig()->getNode('mana_core'), 'routers') as $key => $routerXml) {
322	+ $class = (string)$routerXml->class;
323	+ $front->addRouter($key, new $class);
324	+ }
325	+ }
326	+
327	+ /**
328	+ * REPLACE THIS WITH DESCRIPTION (handles event "controller_front_send_response_before")
329	+ * @param Varien_Event_Observer $observer
330	+ */
331	+ public function helpSavingInFullPageCache($observer) {
332	+ if ($queryParameters = Mage::registry('m_temporary_query_parameters')) {
333	+ foreach (array_keys($queryParameters) as $queryParameter) {
334	+ if (isset($_GET[$queryParameter])) {
335	+ unset($_GET[$queryParameter]);
336	+ }
337	+ }
338	+ }
339	+ }
340	+
341	+ #region Dependencies
342	+ /**
343	+ * @return Mana_Core_Helper_Data
344	+ */
345	+ public function coreHelper() {
346	+ return Mage::helper('mana_core');
347	+ }
348	+ #endregion
349	}
350

app/code/local/Mana/Core/Model/Source/Js.php ADDED Viewed

	@@ -0,0 +1,27 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+
9	+ /**
10	+ * Source for options of filter being filterable
11	+ * @author Mana Team
12	+ *
13	+ */
14	+ class Mana_Core_Model_Source_Js extends Mana_Core_Model_Source_Abstract {
15	+ protected function _getAllOptions() {
16	+ /* @var $t Mana_Core_Helper_Data */
17	+ $t = Mage::helper(strtolower('Mana_Core'));
18	+ return array(
19	+ array('value' => 'min_ondemand', 'label' => $t->__('Load if required, minified version (recommended)')),
20	+ array('value' => 'min_everywhere', 'label' => $t->__('Load on all pages, minified version')),
21	+ array('value' => 'full_ondemand', 'label' => $t->__('Load if required, full version with comments')),
22	+ array('value' => 'full_everywhere', 'label' => $t->__('Load on all pages, full version with comments')),
23	+ array('value' => 'unload', 'label' => $t->__('Do not load')),
24	+ array('value' => 'skip', 'label' => $t->__('Take action as defined in theme layout XML files')),
25	+ );
26	+ }
27	+ }

app/code/local/Mana/Core/Model/Source/YesNoDefault.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	+ */
8	+
9	+ /**
10	+ * Source for options of filter being filterable
11	+ * @author Mana Team
12	+ *
13	+ */
14	+ class Mana_Core_Model_Source_YesNoDefault extends Mana_Core_Model_Source_Abstract {
15	+ protected function _getAllOptions() {
16	+ return array(
17	+ array('value' => '1', 'label' => Mage::helper('core')->__('Yes')),
18	+ array('value' => '0', 'label' => Mage::helper('core')->__('No')),
19	+ array('value' => '', 'label' => Mage::helper('core')->__('Use Default')),
20	+ );
21	+ }
22	+ }

app/code/local/Mana/Core/Resource/Indexer.php ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Core_Resource_Indexer extends Mage_Core_Model_Mysql4_Abstract {
13	+ public function insert($tableName, $fields = array(), $onDuplicate = true) {
14	+ /* @var $core Mana_Core_Helper_Data */
15	+ $core = Mage::helper('mana_core');
16	+
17	+ return $core->insert($this->_getWriteAdapter(), $tableName, $fields, $onDuplicate);
18	+ }
19	+ }

app/code/local/Mana/Core/Rewrite/PageCache/Processor.php ADDED Viewed

	@@ -0,0 +1,27 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Core_Rewrite_PageCache_Processor extends Enterprise_PageCache_Model_Processor {
13	+ protected function _getFullPageUrl() {
14	+ if ($url = Mage::registry('m_original_request_uri')) {
15	+ $uri = '';
16	+ if (isset($_SERVER['HTTP_HOST'])) {
17	+ $uri = $_SERVER['HTTP_HOST'];
18	+ } elseif (isset($_SERVER['SERVER_NAME'])) {
19	+ $uri = $_SERVER['SERVER_NAME'];
20	+ }
21	+ if ($uri) {
22	+ return $uri . $url;
23	+ }
24	+ }
25	+ return parent::_getFullPageUrl();
26	+ }
27	+ }

app/code/local/Mana/Core/etc/adminhtml.xml ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <!--
3	+ @category Mana
4	+ @package Mana_Core
5	+ @copyright Copyright (c) http://www.manadev.com
6	+ @license http://www.manadev.com/license Proprietary License
7	+ -->
8	+ <config>
9	+ <menu>
10	+ <mana>
11	+ <title>MANAdev</title>
12	+ <sort_order>79</sort_order>
13	+ <children>
14	+ <system_configuration translate="title" module="mana_core">
15	+ <title>Global Configuration</title>
16	+ <sort_order>20000</sort_order>
17	+ <children>
18	+ <mana translate="title" module="mana_core">
19	+ <title>General</title>
20	+ <action>adminhtml/system_config/edit/section/mana</action>
21	+ <sort_order>50</sort_order>
22	+ </mana>
23	+ </children>
24	+ </system_configuration>
25	+ </children>
26	+ </mana>
27	+ </menu>
28	+ <acl>
29	+ <resources>
30	+ <admin>
31	+ <children>
32	+ <mana translate="title" module="mana_core">
33	+ <title>Configure Mana Extensions</title>
34	+ <sort_order>79</sort_order>
35	+ <children>
36	+ <system_configuration translate="title" module="mana_core">
37	+ <title>Global Configuration</title>
38	+ <sort_order>20000</sort_order>
39	+ <children>
40	+ <mana translate="title" module="mana_core">
41	+ <title>General</title>
42	+ <sort_order>50</sort_order>
43	+ </mana>
44	+ </children>
45	+ </system_configuration>
46	+ </children>
47	+ </mana>
48	+ <system>
49	+ <children>
50	+ <config>
51	+ <children>
52	+ <mana translate="title" module="mana_core">
53	+ <title>MANAdev General Settings</title>
54	+ <sort_order>50050</sort_order>
55	+ </mana>
56	+ </children>
57	+ </config>
58	+ </children>
59	+ </system>
60	+ </children>
61	+ </admin>
62	+ </resources>
63	+ </acl>
64	+ </config>

app/code/local/Mana/Core/etc/config.xml CHANGED Viewed

@@ -12,7 +12,7 @@
             		<Mana_Core>
             		  	<!-- This version number identifies version of database tables specific to this extension. It is written to
             		  	core_resource table.  -->
-            -
            		    <version>12.12.21.19</version>
             		</Mana_Core>
             	</modules>
             	<!-- This section contains module settings which are merged into global configuration during each page load,
@@ -27,11 +27,6 @@
             				Mage::helper() calls. -->
             				<class>Mana_Core_Helper</class>
             			</mana_core>
-            -
                        <catalog>
-            -
                            <rewrite>
-            -
                                <image>Mana_Core_Helper_Image</image>
-            -
                            </rewrite>
-            -
                        </catalog>
                     </helpers>
             		<!-- BASED ON SNIPPET: Blocks/Block support (config.xml) -->
             		<!-- This section registers block classes to be accessible from layout XML files (in type="<block type>") or
@@ -70,6 +65,11 @@
             					<!-- INSERT HERE: table-entity mappings -->
             				</entities>
             			</mana_core_resources>
             			<!-- INSERT HERE: rewrites, ... -->
             		</models>
             		<!-- BASED ON SNIPPET: New Models/Event support (config.xml) -->
@@ -135,7 +135,65 @@
                                 </mana_core>
                             </observers>
                         </controller_action_layout_render_before>
-            -
            		</events>
             		<!-- BASED ON SNIPPET: Resources/Installation script support (config.xml) -->
             		<!-- This tells Magento to analyze sql/mana_core_setup directory for install/upgrade scripts.
             		Installation scripts should be named as 'mysql4-install-<new version>.php'.
@@ -174,7 +232,7 @@
                     <!-- INSERT HERE: layout, translate, routers -->
             	</frontend>
-            -
            	<!-- BASED ON SNIPPET: Static Visuals/Adminhtml section (config.xml) -->
             	<!-- This section enables static visual changes in admin area. -->
             	<adminhtml>
             		<!-- BASED ON SNIPPET: Translation support/Adminhtml (config.xml) -->
@@ -201,12 +259,54 @@
             		</layout>
             		<!-- INSERT HERE: layout, translate, routers -->
             	</adminhtml>
             	<!-- INSERT HERE: adminhtml, frontend, ... -->
-            -
            	<default>
                     <mana_dev>
                         <debug>
                             <jquery_min>1</jquery_min>
                         </debug>
                     </mana_dev>
             	</default>
             </config>


12	<Mana_Core>
13	<!-- This version number identifies version of database tables specific to this extension. It is written to
14	core_resource table. -->
15	+ <version>13.10.17.19</version>
16	</Mana_Core>
17	</modules>
18	<!-- This section contains module settings which are merged into global configuration during each page load,

27	Mage::helper() calls. -->
28	<class>Mana_Core_Helper</class>
29	</mana_core>





30	</helpers>
31	<!-- BASED ON SNIPPET: Blocks/Block support (config.xml) -->
32	<!-- This section registers block classes to be accessible from layout XML files (in type="<block type>") or

65	<!-- INSERT HERE: table-entity mappings -->
66	</entities>
67	</mana_core_resources>
68	+ <enterprise_pagecache>
69	+ <rewrite>
70	+ <processor>Mana_Core_Rewrite_PageCache_Processor</processor>
71	+ </rewrite>
72	+ </enterprise_pagecache>
73	<!-- INSERT HERE: rewrites, ... -->
74	</models>
75	<!-- BASED ON SNIPPET: New Models/Event support (config.xml) -->

135	</mana_core>
136	</observers>
137	</controller_action_layout_render_before>
138	+ <controller_action_layout_generate_blocks_before><!-- this is event name this module listens for -->
139	+ <observers>
140	+ <mana_core>
141	+ <class>mana_core/observer</class>
142	+ <!-- model name of class containing event handler methods -->
143	+ <method>processJsCssFiles</method>
144	+ <!-- event handler method name -->
145	+ </mana_core>
146	+ </observers>
147	+ </controller_action_layout_generate_blocks_before>
148	+ <core_block_abstract_to_html_after><!-- this is event name this module listens for -->
149	+ <observers>
150	+ <mana_core>
151	+ <class>mana_core/observer</class>
152	+ <!-- model name of class containing event handler methods -->
153	+ <method>addClientSideBlockMarkup</method>
154	+ <!-- event handler method name -->
155	+ </mana_core>
156	+ </observers>
157	+ </core_block_abstract_to_html_after>
158	+ <core_block_abstract_to_html_after><!-- this is event name this module listens for -->
159	+ <observers>
160	+ <mana_core_require>
161	+ <class>mana_core/observer</class>
162	+ <!-- model name of class containing event handler methods -->
163	+ <method>renderRequireSettings</method>
164	+ <!-- event handler method name -->
165	+ </mana_core_require>
166	+ </observers>
167	+ </core_block_abstract_to_html_after>
168	+ <controller_front_send_response_before><!-- this is event name this module listens for -->
169	+ <observers>
170	+ <mana_core>
171	+ <class>mana_core/observer</class>
172	+ <!-- model name of class containing event handler methods -->
173	+ <method>renderCustomResponse</method>
174	+ <!-- event handler method name -->
175	+ </mana_core>
176	+ </observers>
177	+ </controller_front_send_response_before>
178	+ <controller_front_init_before><!-- this is event name this module listens for -->
179	+ <observers>
180	+ <mana_core>
181	+ <class>mana_core/observer</class>
182	+ <!-- model name of class containing event handler methods -->
183	+ <method>registerEarlyRouters</method>
184	+ <!-- event handler method name -->
185	+ </mana_core>
186	+ </observers>
187	+ </controller_front_init_before>
188	+ <controller_front_send_response_before>
189	+ <observers>
190	+ <enterprise_pagecache>
191	+ <class>mana_core/observer</class>
192	+ <method>helpSavingInFullPageCache</method>
193	+ </enterprise_pagecache>
194	+ </observers>
195	+ </controller_front_send_response_before>
196	+ </events>
197	<!-- BASED ON SNIPPET: Resources/Installation script support (config.xml) -->
198	<!-- This tells Magento to analyze sql/mana_core_setup directory for install/upgrade scripts.
199	Installation scripts should be named as 'mysql4-install-<new version>.php'.

232
233	<!-- INSERT HERE: layout, translate, routers -->
234	</frontend>
235	+ <!-- BASED ON SNIPPET: Static Visuals/Adminhtml section (config.xml) -->
236	<!-- This section enables static visual changes in admin area. -->
237	<adminhtml>
238	<!-- BASED ON SNIPPET: Translation support/Adminhtml (config.xml) -->

259	</layout>
260	<!-- INSERT HERE: layout, translate, routers -->
261	</adminhtml>
262	+ <mana_core>
263	+ <js>
264	+ <!--<require module="mana_core">
265	+ <type>library</type>
266	+ <skinnable>0</skinnable>
267	+ <full_path>jquery/require.js</full_path>
268	+ <minified_path>jquery/require.min.js</minified_path>
269	+ <sort_order>50</sort_order>
270	+ </require>-->
271	+ <jquery module="mana_core">
272	+ <type>library</type>
273	+ <skinnable>0</skinnable>
274	+ <full_path>jquery/jquery.js</full_path>
275	+ <minified_path>jquery/jquery.min.js</minified_path>
276	+ <sort_order>100</sort_order>
277	+ </jquery>
278	+ </js>
279	+ <page_types>
280	+ <category><helper>mana_core/pageType_category</helper></category>
281	+ <cms_page><helper>mana_core/pageType_cmsPage</helper></cms_page>
282	+ <home_page><helper>mana_core/pageType_homePage</helper></home_page>
283	+ <search><helper>mana_core/pageType_search</helper></search>
284	+ </page_types>
285	+ </mana_core>
286	<!-- INSERT HERE: adminhtml, frontend, ... -->
287	+ <default>
288	<mana_dev>
289	<debug>
290	<jquery_min>1</jquery_min>
291	</debug>
292	</mana_dev>
293	+ <mana>
294	+ <js>
295	+ <!--<require>min_ondemand</require>-->
296	+ <jquery>min_ondemand</jquery>
297	+ </js>
298	+ <seo_symbols>
299	+ <dash>--to-</dash>
300	+ <space>-</space>
301	+ <slash>--per-</slash>
302	+ <plus>--plus-</plus>
303	+ <underscore>--uscore-</underscore>
304	+ <quote>--qt-</quote>
305	+ <double_quote>--dqt-</double_quote>
306	+ <hash>--no-</hash>
307	+ <percent>--percent-</percent>
308	+ <ampersand>--and-</ampersand>
309	+ </seo_symbols>
310	+ </mana>
311	</default>
312	</config>

app/code/local/Mana/Core/etc/system.xml ADDED Viewed

	@@ -0,0 +1,57 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <!--
3	+ @category Mana
4	+ @package Mana_Core
5	+ @copyright Copyright (c) http://www.manadev.com
6	+ @license http://www.manadev.com/license Proprietary License
7	+ -->
8	+ <config>
9	+ <tabs>
10	+ <mana>
11	+ <label>MANAdev</label>
12	+ <sort_order>250</sort_order>
13	+ </mana>
14	+ </tabs>
15	+ <sections>
16	+ <mana translate="label" module="mana_core">
17	+ <label>General</label>
18	+ <tab>mana</tab>
19	+ <frontend_type>text</frontend_type>
20	+ <sort_order>50</sort_order>
21	+ <show_in_default>1</show_in_default>
22	+ <show_in_website>1</show_in_website>
23	+ <show_in_store>1</show_in_store>
24	+ <groups>
25	+ <js translate="label" module="mana_core">
26	+ <label>JavaScript Libraries</label>
27	+ <frontend_type>text</frontend_type>
28	+ <sort_order>10000</sort_order>
29	+ <show_in_default>1</show_in_default>
30	+ <show_in_website>1</show_in_website>
31	+ <show_in_store>1</show_in_store>
32	+ <fields>
33	+ <!--<require translate="label">
34	+ <label>RequireJS (version 2.1.4)</label>
35	+ <frontend_type>select</frontend_type>
36	+ <source_model>mana_core/source_js</source_model>
37	+ <sort_order>50</sort_order>
38	+ <show_in_default>1</show_in_default>
39	+ <show_in_website>1</show_in_website>
40	+ <show_in_store>1</show_in_store>
41	+ </require>-->
42	+ <jquery translate="label comment">
43	+ <label>jQuery (version 1.8.3)</label>
44	+ <comment>Always runs in jQuery.noConflict() mode (slight modification) to prevent conflicts with Prototype JavaScript library used by Magento.</comment>
45	+ <frontend_type>select</frontend_type>
46	+ <source_model>mana_core/source_js</source_model>
47	+ <sort_order>100</sort_order>
48	+ <show_in_default>1</show_in_default>
49	+ <show_in_website>1</show_in_website>
50	+ <show_in_store>1</show_in_store>
51	+ </jquery>
52	+ </fields>
53	+ </js>
54	+ </groups>
55	+ </mana>
56	+ </sections>
57	+ </config>

app/code/local/Mana/Db/Exception/Formula.php ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Exception_Formula extends Exception {
13	+ public function addMessage($message) {
14	+ $this->message .= $message;
15	+ }
16	+ }

app/code/local/Mana/Db/Exception/Validation.php CHANGED Viewed

@@ -1,11 +1,24 @@
             <?php
-            -
             class Mana_Db_Exception_Validation extends Exception {
             	protected $_errors;
             	public function __construct($errors) {
             		$this->_errors = $errors;
+            	}
-            -
            	public function getErrors() {
             		return $this->_errors;
+            	}
+            }


1	<?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	class Mana_Db_Exception_Validation extends Exception {
13	protected $_errors;
14	public function __construct($errors) {
15	$this->_errors = $errors;
16	}
17	+
18	+ /**
19	+ * @return array
20	+ */
21	+ public function getErrors() {
22	return $this->_errors;
23	}
24	}

app/code/local/Mana/Db/Helper/Config.php ADDED Viewed

	@@ -0,0 +1,414 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Config extends Mage_Core_Helper_Abstract {
13	+ const ROLE_PRIMARY_KEY = 'primary_key';
14	+ const ROLE_DEFAULT_VALUE = 'default_value';
15	+ const ROLE_STORE_SPECIFICS = 'store_specifics';
16	+ const ROLE_GRID_EDITING = 'grid_editing';
17	+ const ROLE_FLAT = 'flat';
18	+
19	+ const MODULE_LEVEL = 0;
20	+ const ENTITY_LEVEL = 1;
21	+ const SCOPE_LEVEL = 2;
22	+ const FIELD_LEVEL = 3;
23	+
24	+ protected $_xml;
25	+ protected $_scopeXml = array();
26	+ protected $_configLevels = array(
27	+ self::MODULE_LEVEL => 'module',
28	+ self::ENTITY_LEVEL => 'entity',
29	+ self::SCOPE_LEVEL => 'scope',
30	+ self::FIELD_LEVEL => 'field'
31	+ );
32	+
33	+ /**
34	+ * @param string $setupVersion
35	+ * @return Mana_Db_Model_Setup_Abstract
36	+ * @throws Exception
37	+ */
38	+ public function getSetup($setupVersion) {
39	+ // $setupVersion = $this->getXml()->getNode("modules/{$moduleName}/scripts/v{$version}");
40	+ // if (empty($setupVersion->installer)) {
41	+ // throw new Exception($this->__("Setup version not defined for module '%s' upgrade script %s",
42	+ // $moduleName, $version));
43	+ // }
44	+
45	+ $setupVersion = 'mana_db/setup_v' . str_replace('.', '', $setupVersion);
46	+ if (!($setupVersion = Mage::getModel($setupVersion))) {
47	+ throw new Exception($this->__("Setup version %s not found", $setupVersion));
48	+ }
49	+
50	+ return $setupVersion;
51	+ }
52	+
53	+ /**
54	+ * Load XML config from m_db.xml files and caches it
55	+ *
56	+ * @return Varien_Simplexml_Config
57	+ */
58	+ public function getXml() {
59	+ if (!$this->_xml) {
60	+ $cachedXml = Mage::app()->loadCache('m_db_config');
61	+ if ($cachedXml) {
62	+ $this->_xml = new Varien_Simplexml_Config($cachedXml);
63	+ }
64	+ else {
65	+ $config = new Varien_Simplexml_Config();
66	+ $config->loadString('<?xml version="1.0"?><config></config>');
67	+ Mage::getConfig()->loadModulesConfiguration('m_db.xml', $config);
68	+ $this->_xml = $config;
69	+ $this->_prepareXml();
70	+ if (Mage::app()->useCache('config')) {
71	+ Mage::app()->saveCache($config->getXmlString(), 'm_db_config', array(Mage_Core_Model_Config::CACHE_TAG));
72	+ }
73	+ }
74	+ }
75	+
76	+ return $this->_xml;
77	+ }
78	+
79	+ protected function _prepareXml() {
80	+ $this->iterate(array(
81	+ 'module' => array($this, '_prepareModuleXml'),
82	+ 'entity' => array($this, '_prepareEntityXml'),
83	+ 'scope' => array($this, '_prepareScopeXml'),
84	+ 'field' => array($this, '_prepareFieldXml'),
85	+ ));
86	+
87	+ $this->iterate(array('module' => array($this, '_prepareCustom')));
88	+
89	+ $this->iterate(array(
90	+ 'module' => array($this, '_prepareModuleXml'),
91	+ 'entity' => array($this, '_prepareEntityXml'),
92	+ 'scope' => array($this, '_prepareScopeXml'),
93	+ 'field' => array($this, '_prepareFieldXml'),
94	+ ));
95	+ }
96	+
97	+ /**
98	+ * @param Varien_Object $context
99	+ * @param Varien_Simplexml_Element $module
100	+ */
101	+ protected function _prepareModuleXml($context, $module) {
102	+ $name = $module->getName();
103	+ if (!isset($module['module'])) {
104	+ $module['module'] = $name;
105	+ }
106	+ $this->propagateName($module);
107	+ }
108	+
109	+ /**
110	+ * @param Varien_Object $context
111	+ * @param Varien_Simplexml_Element $module
112	+ * @param Varien_Simplexml_Element $entity
113	+ */
114	+ protected function _prepareEntityXml($context, $module, $entity) {
115	+ $this->propagateAttributes($module, $entity, array('module', 'version'));
116	+ if (empty($entity->scopes)) {
117	+ $entity->scopes->global->name = 'global';
118	+ }
119	+ $this->propagateName($entity);
120	+ }
121	+
122	+ /**
123	+ * @param Varien_Object $context
124	+ * @param Varien_Simplexml_Element $module
125	+ * @param Varien_Simplexml_Element $entity
126	+ * @param Varien_Simplexml_Element $scope
127	+ */
128	+ protected function _prepareScopeXml($context, $module, $entity, $scope) {
129	+ $this->propagateAttributes($entity, $scope, array('module', 'version'));
130	+ foreach ($entity->children() as $child) {
131	+ if ($child->getName() != 'scopes') {
132	+ $scope->extendChild($child);
133	+ }
134	+ }
135	+ if (!empty($scope->unique)) {
136	+ /** @noinspection PhpParamsInspection */
137	+ $this->propagateAttributes($scope, $scope->unique, array('module', 'version'));
138	+ foreach ($scope->unique->children() as $index) {
139	+ /** @noinspection PhpParamsInspection */
140	+ $this->propagateAttributes($scope->unique, $index, array('module', 'version'));
141	+ foreach ($index->children() as $column) {
142	+ $this->propagateAttributes($index, $column, array('module', 'version'));
143	+ }
144	+ }
145	+ }
146	+ $this->propagateName($scope);
147	+ }
148	+
149	+ /**
150	+ * @param Varien_Object $context
151	+ * @param Varien_Simplexml_Element $module
152	+ * @param Varien_Simplexml_Element $entity
153	+ * @param Varien_Simplexml_Element $scope
154	+ * @param Varien_Simplexml_Element $field
155	+ */
156	+ protected function _prepareFieldXml($context, $module, $entity, $scope, $field) {
157	+ $this->propagateAttributes($scope, $field, array('module', 'version'));
158	+ $this->propagateName($field);
159	+ }
160	+
161	+ /**
162	+ * @param Varien_Object $context
163	+ * @param Varien_Simplexml_Element $module
164	+ */
165	+ protected function _prepareCustom($context, $module) {
166	+ if (!$module->installer_versions) {
167	+ return;
168	+ }
169	+
170	+ foreach ($module->installer_versions->children() as $moduleVersion => $version) {
171	+ $version = (string) $version;
172	+
173	+ $setupVersion = $this->getSetup((string)$version);
174	+ $setupVersion
175	+ ->setModuleName((string)$module->name)
176	+ ->setVersion(substr($moduleVersion, 1))
177	+ ->prepare();
178	+ }
179	+ }
180	+ /**
181	+ * @param Varien_Simplexml_Element $source
182	+ * @param Varien_Simplexml_Element $target
183	+ * @param string[] $attributes
184	+ */
185	+ public function propagateAttributes($source, $target, $attributes) {
186	+ foreach ($attributes as $attribute) {
187	+ if (!isset($target[$attribute]) && isset($source[$attribute])) {
188	+ $target[$attribute] = (string)$source[$attribute];
189	+ }
190	+ }
191	+ }
192	+
193	+ /**
194	+ * @param Varien_Simplexml_Element $target
195	+ */
196	+ public function propagateName($target) {
197	+ $target->name = $target->getName();
198	+ }
199	+
200	+ /**
201	+ * @param callable[] $callbacks
202	+ */
203	+ public function iterate($callbacks) {
204	+ $args = array(new Varien_Object());
205	+ $config = $this->_xml ? $this->_xml->getNode() : $this->getXml()->getNode();
206	+ $this->_iterateLevel(self::MODULE_LEVEL, $config->modules, $callbacks, $args,
207	+ array($this, '_iterateEntities'));
208	+ return $args[0];
209	+ }
210	+
211	+ protected function _iterateLevel ($level, $elements, $callbacks, $args, $deeperLevelIterator = null) {
212	+ if (!$elements) {
213	+ return;
214	+ }
215	+ $hasCallbacks = false;
216	+ foreach ($this->_configLevels as $levelIndex =>$levelKey) {
217	+ if ($levelIndex < $level) {
218	+ continue;
219	+ }
220	+ $intersection = array_intersect(array("{$levelKey}_before", $levelKey, "{$levelKey}_after"),
221	+ array_keys($callbacks));
222	+ if (!empty($intersection)) {
223	+ $hasCallbacks = true;
224	+ break;
225	+ }
226	+ }
227	+ if (!$hasCallbacks) {
228	+ return;
229	+ }
230	+
231	+ $callbackKey = $this->_configLevels[$level];
232	+ foreach ($elements->children() as $config) {
233	+ $argsToBePassed = array_merge($args, array($config));
234	+ if (isset($callbacks["{$callbackKey}_before"])) {
235	+ call_user_func_array($callbacks["{$callbackKey}_before"], $argsToBePassed);
236	+ }
237	+ if (isset($callbacks[$callbackKey])) {
238	+ call_user_func_array($callbacks[$callbackKey], $argsToBePassed);
239	+ }
240	+ if ($deeperLevelIterator) {
241	+ call_user_func($deeperLevelIterator, $config, $callbacks, $argsToBePassed);
242	+ }
243	+ if (isset($callbacks["{$callbackKey}_after"])) {
244	+ call_user_func_array($callbacks["{$callbackKey}_after"], $argsToBePassed);
245	+ }
246	+ }
247	+ }
248	+ protected function _iterateEntities($config, $callbacks, $args) {
249	+ $this->_iterateLevel(self::ENTITY_LEVEL, $config->entities, $callbacks, $args,
250	+ array($this, '_iterateScopes'));
251	+ }
252	+ protected function _iterateScopes($config, $callbacks, $args) {
253	+ $this->_iterateLevel(self::SCOPE_LEVEL, $config->scopes, $callbacks, $args,
254	+ array($this, '_iterateFields'));
255	+ }
256	+ protected function _iterateFields($config, $callbacks, $args) {
257	+ $this->_iterateLevel(self::FIELD_LEVEL, $config->fields, $callbacks, $args);
258	+ }
259	+
260	+ /**
261	+ * @param string $entityName
262	+ * @return Varien_Simplexml_Element \| bool
263	+ */
264	+ public function getEntityXml($entityName) {
265	+ $xml = $this->getXml();
266	+ $parts = explode('/', $entityName);
267	+ list($module, $entity) = $parts;
268	+ $entityXml = $xml->getXpath("//modules/$module/entities/$entity");
269	+
270	+ return empty($entityXml) ? false : $entityXml[0];
271	+ }
272	+
273	+ public function getTableXml($entityName) {
274	+ $xml = $this->getXml();
275	+ $parts = explode('/', $entityName);
276	+ list($module, $entity) = $parts;
277	+ $entityXml = $xml->getXpath("//modules/$module/tables/$entity");
278	+
279	+ return empty($entityXml) ? false : $entityXml[0];
280	+ }
281	+
282	+
283	+ /**
284	+ * @param string $fullEntityName
285	+ * @return Varien_Simplexml_Element \| bool
286	+ */
287	+ public function getScopeXml($fullEntityName) {
288	+ if (!isset($this->_scopeXml[$fullEntityName])) {
289	+ $xml = $this->getXml();
290	+ $parts = explode('/', $fullEntityName);
291	+ if (count($parts) > 2) {
292	+ list($module, $entity, $scope) = $parts;
293	+ }
294	+ else {
295	+ list($module, $entity) = $parts;
296	+ $scope = 'global';
297	+ }
298	+ $scopeXml = $xml->getXpath("//modules/$module/entities/$entity/scopes/$scope");
299	+ if (empty($scopeXml) && $scope == 'global') {
300	+ $scopeXml = $xml->getXpath("//modules/$module/entities/$entity");
301	+ }
302	+
303	+ $this->_scopeXml[$fullEntityName] = empty($scopeXml) ? false : $scopeXml[0];
304	+ }
305	+ return $this->_scopeXml[$fullEntityName];
306	+ }
307	+
308	+ /**
309	+ * @param string $entity
310	+ * @param string $field
311	+ * @return Varien_Simplexml_Element \| bool
312	+ */
313	+ public function getFieldXml($entity, $field) {
314	+ $scopeXml = $this->getScopeXml($entity);
315	+
316	+ $resultXml = $scopeXml->xpath("fields/$field");
317	+ return empty($resultXml) ? false : $resultXml[0];
318	+ }
319	+
320	+ public function getForeignKey($parentEntity, $childEntity) {
321	+ /* @var $db Mana_Db_Helper_Data */
322	+ $db = Mage::helper('mana_db');
323	+
324	+ $scopeXml = $this->getScopeXml($childEntity);
325	+
326	+ $resultXml = $scopeXml->xpath("fields/*[foreign/entity='$parentEntity' or ".
327	+ "foreign/entity='{$parentEntity}/global']");
328	+ if (empty($resultXml)) {
329	+ return false;
330	+ }
331	+
332	+ /* @var $fieldXml Varien_Simplexml_Element */
333	+ $fieldXml = $resultXml[0];
334	+ return $fieldXml->getName();
335	+ }
336	+
337	+ /**
338	+ * @param string $entity
339	+ * @return Varien_Simplexml_Element[]
340	+ */
341	+ public function getForeignXmls($entity) {
342	+ /* @var $db Mana_Db_Helper_Data */
343	+ $db = Mage::helper('mana_db');
344	+
345	+ $scopeXml = $this->getScopeXml($entity);
346	+
347	+ return $scopeXml->xpath("fields/*[foreign]");
348	+ }
349	+
350	+ /**
351	+ * @param string $entity
352	+ * @return Varien_Simplexml_Element[]
353	+ */
354	+ public function getScopeValidators($entity) {
355	+ $scopeXml = $this->getScopeXml($entity);
356	+ return $scopeXml->xpath("validation/*");
357	+ }
358	+
359	+ /**
360	+ * @param string $entity
361	+ * @return Varien_Simplexml_Element[]
362	+ */
363	+ public function getScopeFields($entity) {
364	+ $scopeXml = $this->getScopeXml($entity);
365	+
366	+ return $scopeXml->xpath("fields/*");
367	+ }
368	+
369	+ /**
370	+ * @param string $entity
371	+ * @param string $field
372	+ * @return Varien_Simplexml_Element \|\| bool
373	+ */
374	+ public function getScopeField($entity, $field) {
375	+ $scopeXml = $this->getScopeXml($entity);
376	+
377	+ /** @noinspection PhpUndefinedFieldInspection */
378	+ $result = $scopeXml->fields->$field;
379	+ return empty($result) ? false : $result;
380	+ }
381	+
382	+ /**
383	+ * @param string $entity
384	+ * @param string $field
385	+ * @return Varien_Simplexml_Element[]
386	+ */
387	+ public function getFieldValidators($entity, $field = null) {
388	+ $fieldXml = $entity instanceof Varien_Simplexml_Element ? $entity : $this->getFieldXml($entity, $field);
389	+
390	+ return $fieldXml->xpath("validation/*");
391	+ }
392	+
393	+ /**
394	+ * @param string $entity
395	+ * @return Varien_Simplexml_Element[]
396	+ */
397	+ public function getScopePostValidators($entity) {
398	+ $scopeXml = $this->getScopeXml($entity);
399	+
400	+ return $scopeXml->xpath("post_validation/*");
401	+ }
402	+
403	+ /**
404	+ * @param string $entity
405	+ * @param string $field
406	+ * @return Varien_Simplexml_Element[]
407	+ */
408	+ public function getFieldPostValidators($entity, $field = null) {
409	+ $fieldXml = $entity instanceof Varien_Simplexml_Element ? $entity : $this->getFieldXml($entity, $field);
410	+
411	+ return $fieldXml->xpath("post_validation/*");
412	+ }
413	+
414	+ }

app/code/local/Mana/Db/Helper/Data.php CHANGED Viewed

@@ -11,9 +11,36 @@
              * @author Mana Team
              */
             class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
-            -
            	protected $_logQueries = true;
             	public function getLogQueries() {
-            -
            		return $this->_logQueries;
+            	}
             	public function logQuery($action, $query) {
             		if ($this->getLogQueries()) {
@@ -21,7 +48,7 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
+            		}
+            	}
             	public function logAction($action, $object) {
-            -
            		if ($this->getLogQueries()) {
             			Mage::log($action.': '.$object->toJson(), Zend_Log::DEBUG, 'replicate.log');
+            		}
+            	}
@@ -47,7 +74,7 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
+            	}
             	public function joinLeft($select, $alias, $table, $condition) {
             		if (!array_key_exists($alias, $select->getPart(Zend_Db_Select::FROM))) {
-            -
            			$select->joinLeft(array($alias => $table), $condition, null);
+            		}
             		return $select;
+            	}
@@ -102,11 +129,17 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
             		$options = array_merge(array(
             			'db' => Mage::getSingleton('core/resource')->getConnection('core/write'),
                 		'trackKeys' => false,
-            -
                		'transaction' => true,
             			'filter' => array(),
-            -
            			'batchSize' => 10000,
-            -
            			'object' => null,
             		), $options);
             		if (count($options['filter']) == 0) {
             		    $options['db']->resetDdlCache();
+                    }
@@ -136,89 +169,93 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
             	    			$model = Mage::getResourceSingleton($entityName);
             		    		// update existing rows
-            -
            					$target->setSelects(array())->setIsKeyFilterApplied(false);
-            -
            		    		$model->prepareReplicationUpdateSelects($target, $options);
-            -
            					if (count($target->getSelects()) && (!$options['trackKeys'] || $target->getIsKeyFilterApplied())) {
-            -
            						foreach ($target->getSelects() as $select) {
-            -
            							$offset = 0;
-            -
            							$this->logQuery('UPDATE', $select);
-            -
            							do {
-            -
            								$sourceData = $options['db']->fetchAll($select->limit($options['batchSize'], $offset));
-            -
            								if ($sourceData && count($sourceData)) {
-            -
            									foreach ($sourceData as $values) {
-            -
            										if ($object = $model->processReplicationUpdate($values, $options)) {
-            -
            											if ($object != $options['object']) {
-            -
            												$this->logAction('UPDATE', $object);
-            -
            												$object->save();
-            -
            												if ($options['trackKeys']) {
-            -
            													$target->setSavedKey($object->getId(), $object->getId());
-            -
            												}
-            -
            											}
-            -
            											else {
-            -
            												$object->unsetData('_m_prevent_replication');
-            -
            											}
-            -
            										}
-            -
            									}
-            -
            								}
-            -
            								$offset += $options['batchSize'];
-            -
            							} while ($sourceData && count($sourceData));
-            -
            						}
+            					}
-            -
             					// insert rows
-            -
            					$target->setSelects(array())->setIsKeyFilterApplied(false);
-            -
            		    		$model->prepareReplicationInsertSelects($target, $options);
-            -
            					if (count($target->getSelects()) && (!$options['trackKeys'] || $target->getIsKeyFilterApplied())) {
-            -
            						foreach ($target->getSelects() as $select) {
-            -
            							$offset = 0;
-            -
            							$this->logQuery('INSERT', $select);
-            -
            							do {
-            -
            								$sourceData = $options['db']->fetchAll($select->limit($options['batchSize']));
-            -
            								if ($sourceData && count($sourceData)) {
-            -
            									foreach ($sourceData as $values) {
-            -
            										if ($object = $model->processReplicationInsert($values, $options)) {
-            -
            											if ($object != $options['object']) {
-            -
            												$this->logAction('INSERT', $object);
-            -
            												$object->save();
-            -
            												if ($options['trackKeys']) {
-            -
            													$target->setSavedKey($object->getId(), $object->getId());
-            -
            												}
-            -
            											}
-            -
            											else {
-            -
            												$object->unsetData('_m_prevent_replication');
-            -
            											}
-            -
            										}
-            -
            									}
-            -
            								}
-            -
            								$offset += $options['batchSize'];
-            -
            							} while ($sourceData && count($sourceData));
-            -
            						}
+            					}
-            -
             					// delete rows
-            -
            					$target->setSelects(array())->setIsKeyFilterApplied(false);
-            -
            		    		$model->prepareReplicationDeleteSelects($target, $options);
-            -
            					if (count($target->getSelects()) && (!$options['trackKeys'] || $target->getIsKeyFilterApplied())) {
-            -
            						foreach ($target->getSelects() as $select) {
-            -
            							$offset = 0;
-            -
            							$this->logQuery('DELETE', $select);
-            -
            							do {
-            -
            								$ids = $options['db']->fetchCol($select->limit($options['batchSize']));
-            -
            								if ($ids && count($ids)) {
-            -
            									$model->processReplicationDelete($ids, $options);
-            -
            									if ($options['trackKeys']) {
-            -
            										foreach ($ids as $id) {
-            -
            											$target->setDeletedKey($id, $id);
-            -
            										}
-            -
            									}
-            -
            								}
-            -
            								$offset += $options['batchSize'];
-            -
            							} while ($ids && count($ids));
-            -
            						}
-            -
            					}
-            -
            	    		}
-            -
            	    	}
-            -
             			if ($options['transaction']) {
             				$options['db']->commit();
+            			}
@@ -327,6 +364,9 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
                     return $a < $b ? -1 : 1;
+            	}
                 protected $_inEditing = false;
                 public function getInEditing() {
                     return $this->_inEditing;
@@ -360,4 +400,182 @@ class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
                         'deleted' => array(),
                     );
+                }
+            }


11	* @author Mana Team
12	*/
13	class Mana_Db_Helper_Data extends Mage_Core_Helper_Abstract {
14	+ protected $_logQueries = false;
15	+ protected $_resourceSingletons = array();
16	+
17	public function getLogQueries() {
18	+ return Mage::getStoreConfig('mana_db/replicate/log_queries');
19	+ }
20	+ public function getLogActions() {
21	+ return Mage::getStoreConfig('mana_db/replicate/log_actions');
22	+ }
23	+ public function getSkipInserts() {
24	+ return Mage::getStoreConfig('mana_db/replicate/skip_inserts');
25	+ }
26	+ public function getSkipUpdates() {
27	+ return Mage::getStoreConfig('mana_db/replicate/skip_updates');
28	+ }
29	+ public function getSkipDeletes() {
30	+ return Mage::getStoreConfig('mana_db/replicate/skip_deletes');
31	+ }
32	+ public function getBatchSize() {
33	+ $result = Mage::getStoreConfig('mana_db/replicate/batch_size');
34	+ return $result ? $result : 10000;
35	+ }
36	+ public function getNoTransaction() {
37	+ return Mage::getStoreConfig('mana_db/replicate/no_transaction');
38	+ }
39	+ public function getMaxExecutionTime() {
40	+ return Mage::getStoreConfig('mana_db/replicate/max_execution_time');
41	+ }
42	+ public function getMemoryLimit() {
43	+ return Mage::getStoreConfig('mana_db/replicate/memory_limit');
44	}
45	public function logQuery($action, $query) {
46	if ($this->getLogQueries()) {

48	}
49	}
50	public function logAction($action, $object) {
51	+ if ($this->getLogActions()) {
52	Mage::log($action.': '.$object->toJson(), Zend_Log::DEBUG, 'replicate.log');
53	}
54	}

74	}
75	public function joinLeft($select, $alias, $table, $condition) {
76	if (!array_key_exists($alias, $select->getPart(Zend_Db_Select::FROM))) {
77	+ $select->joinLeft(array($alias => $table), $condition, null);
78	}
79	return $select;
80	}

129	$options = array_merge(array(
130	'db' => Mage::getSingleton('core/resource')->getConnection('core/write'),
131	'trackKeys' => false,
132	+ 'transaction' => !$this->getNoTransaction(),
133	'filter' => array(),
134	+ 'batchSize' => $this->getBatchSize(),
135	+ 'object' => null,
136	), $options);
137	+ if ($this->getMaxExecutionTime()) {
138	+ ini_set('max_execution_time', $this->getMaxExecutionTime());
139	+ }
140	+ if ($this->getMemoryLimit()) {
141	+ ini_set('memory_limit', $this->getMemoryLimit());
142	+ }
143	if (count($options['filter']) == 0) {
144	$options['db']->resetDdlCache();
145	}

169	$model = Mage::getResourceSingleton($entityName);
170
171	// update existing rows
172	+ if (!$this->getSkipUpdates()) {
173	+ $target->setSelects(array())->setIsKeyFilterApplied(false);
174	+ $model->prepareReplicationUpdateSelects($target, $options);
175	+ if (count($target->getSelects()) && (!$options['trackKeys'] \|\| $target->getIsKeyFilterApplied())) {
176	+ foreach ($target->getSelects() as $select) {
177	+ $offset = 0;
178	+ $this->logQuery('UPDATE', $select);
179	+ do {
180	+ $sourceData = $options['db']->fetchAll($select->limit($options['batchSize'], $offset));
181	+ if ($sourceData && count($sourceData)) {
182	+ foreach ($sourceData as $values) {
183	+ if ($object = $model->processReplicationUpdate($values, $options)) {
184	+ if ($object != $options['object']) {
185	+ $this->logAction('UPDATE', $object);
186	+ $object->save();
187	+ if ($options['trackKeys']) {
188	+ $target->setSavedKey($object->getId(), $object->getId());
189	+ }
190	+ }
191	+ else {
192	+ $object->unsetData('_m_prevent_replication');
193	+ }
194	+ }
195	+ }
196	+ }
197	+ $offset += $options['batchSize'];
198	+ } while ($sourceData && count($sourceData));
199	+ }
200	+ }
201	}

202	// insert rows
203	+ if (!$this->getSkipInserts()) {
204	+ $target->setSelects(array())->setIsKeyFilterApplied(false);
205	+ $model->prepareReplicationInsertSelects($target, $options);
206	+ if (count($target->getSelects()) && (!$options['trackKeys'] \|\| $target->getIsKeyFilterApplied())) {
207	+ foreach ($target->getSelects() as $select) {
208	+ $offset = 0;
209	+ $this->logQuery('INSERT', $select);
210	+ do {
211	+ $sourceData = $options['db']->fetchAll($select->limit($options['batchSize']));
212	+ if ($sourceData && count($sourceData)) {
213	+ foreach ($sourceData as $values) {
214	+ if ($object = $model->processReplicationInsert($values, $options)) {
215	+ if ($object != $options['object']) {
216	+ $this->logAction('INSERT', $object);
217	+ $object->save();
218	+ if ($options['trackKeys']) {
219	+ $target->setSavedKey($object->getId(), $object->getId());
220	+ }
221	+ }
222	+ else {
223	+ $object->unsetData('_m_prevent_replication');
224	+ }
225	+ }
226	+ }
227	+ }
228	+ $offset += $options['batchSize'];
229	+ } while ($sourceData && count($sourceData));
230	+ }
231	+ }
232	}

233	// delete rows
234	+ if (!$this->getSkipDeletes()) {
235	+ $target->setSelects(array())->setIsKeyFilterApplied(false);
236	+ $model->prepareReplicationDeleteSelects($target, $options);
237	+ if (count($target->getSelects()) && (!$options['trackKeys'] \|\| $target->getIsKeyFilterApplied())) {
238	+ foreach ($target->getSelects() as $select) {
239	+ $offset = 0;
240	+ $this->logQuery('DELETE', $select);
241	+ do {
242	+ $ids = $options['db']->fetchCol($select->limit($options['batchSize']));
243	+ if ($ids && count($ids)) {
244	+ $model->processReplicationDelete($ids, $options);
245	+ if ($options['trackKeys']) {
246	+ foreach ($ids as $id) {
247	+ $target->setDeletedKey($id, $id);
248	+ }
249	+ }
250	+ }
251	+ $offset += $options['batchSize'];
252	+ } while ($ids && count($ids));
253	+ }
254	+ }
255	+ }
256	+ }
257	+ }
258	+
259	if ($options['transaction']) {
260	$options['db']->commit();
261	}

364	return $a < $b ? -1 : 1;
365	}
366
367	+ public function isEditingSessionExpired($editSessionId) {
368	+ return Mage::getResourceSingleton('mana_db/edit_session')->isExpired($editSessionId);
369	+ }
370	protected $_inEditing = false;
371	public function getInEditing() {
372	return $this->_inEditing;

400	'deleted' => array(),
401	);
402	}
403	+
404	+ protected $_resourceSuffixes = array('_collection');
405	+ public function getSuffix ($entityName, $suffixes) {
406	+ /* @var $core Mana_Core_Helper_Data */
407	+ $core = Mage::helper(strtolower('Mana_Core'));
408	+
409	+ foreach ($suffixes as $candidateSuffix) {
410	+ if ($core->endsWith($entityName, $candidateSuffix)) {
411	+ return $candidateSuffix;
412	+ }
413	+ }
414	+ return '';
415	+ }
416	+ public function getScopedName($entityName) {
417	+ if ($suffix = $this->getSuffix($entityName, $this->_resourceSuffixes)) {
418	+ $entityName = substr($entityName, 0, strlen($entityName) - strlen($suffix));
419	+ }
420	+
421	+ $parts = explode('/', $entityName);
422	+ if (count($parts) > 2) {
423	+ if ($parts[2] == 'global') {
424	+ $entityName = "{$parts[0]}/{$parts[1]}";
425	+ }
426	+ else {
427	+ $entityName = "{$parts[0]}/{$parts[1]}_{$parts[2]}";
428	+ }
429	+ }
430	+ return $entityName . $suffix;
431	+ }
432	+
433	+ /**
434	+ * @param string $entityName
435	+ * @param array\|null $arguments
436	+ * @return Mana_Db_Resource_Entity_Collection \| Mana_Db_Resource_Entity
437	+ */
438	+ public function getResourceModel($entityName, $arguments = null) {
439	+ if ($suffix = $this->getSuffix($entityName, $this->_resourceSuffixes)) {
440	+ $entityName = substr($entityName, 0, strlen($entityName) - strlen($suffix));
441	+ }
442	+
443	+ $arguments = array_merge(array(
444	+ 'scope' => $entityName,
445	+ ), $arguments ? (is_array($arguments) ? $arguments : array('resource' => $arguments)) : array());
446	+
447	+
448	+ $arguments = array_merge(array('scope' => $entityName), $arguments);
449	+
450	+ $resolvedEntityName = $this->getScopedName($entityName);
451	+ if ($this->resourceExists($resolvedEntityName . $suffix)) {
452	+ return Mage::getResourceModel($resolvedEntityName . $suffix, $arguments);
453	+ }
454	+
455	+ /* @var $dbConfig Mana_Db_Helper_Config */
456	+ $dbConfig = Mage::helper('mana_db/config');
457	+ if (!($scopeXml = $dbConfig->getScopeXml($entityName))) {
458	+ return Mage::getResourceModel('mana_db/entity' . $suffix, $arguments);
459	+ }
460	+
461	+ if (!empty($scopeXml->flattens)) {
462	+ $entityName = (string)$scopeXml->flattens;
463	+ $resolvedEntityName = $this->getScopedName($entityName);
464	+ if ($this->resourceExists($resolvedEntityName . $suffix)) {
465	+ return Mage::getResourceModel($resolvedEntityName . $suffix, $arguments);
466	+ }
467	+ $scopeXml = $dbConfig->getScopeXml($entityName);
468	+ }
469	+ if (!empty($scopeXml->store_specifics_for)) {
470	+ $entityName = (string)$scopeXml->store_specifics_for;
471	+ $resolvedEntityName = $this->getScopedName($entityName);
472	+ if ($this->resourceExists($resolvedEntityName . $suffix)) {
473	+ return Mage::getResourceModel($resolvedEntityName . $suffix, $arguments);
474	+ }
475	+ }
476	+
477	+ return Mage::getResourceModel('mana_db/entity' . $suffix, $arguments);
478	+ }
479	+
480	+ /**
481	+ * @param string $entityName
482	+ * @param array \| null $arguments
483	+ * @return Mana_Db_Resource_Entity
484	+ */
485	+ public function getResourceSingleton($entityName, $arguments = null) {
486	+ if ($suffix = $this->getSuffix($entityName, $this->_resourceSuffixes)) {
487	+ $entityNameWithoutSuffix = substr($entityName, 0, strlen($entityName) - strlen($suffix));
488	+ }
489	+ else {
490	+ $entityNameWithoutSuffix = $entityName;
491	+ }
492	+
493	+ $arguments = array_merge(array(
494	+ 'scope' => $entityNameWithoutSuffix,
495	+ ), $arguments ? (is_array($arguments) ? $arguments : array('resource' => $arguments)) : array());
496	+
497	+ $resolvedEntityName = $this->getScopedName($entityName);
498	+ if ($this->resourceExists($resolvedEntityName)) {
499	+ return Mage::getResourceSingleton($resolvedEntityName, $arguments);
500	+ }
501	+ else {
502	+ if (!isset($this->_resourceSingletons[$resolvedEntityName])) {
503	+ $this->_resourceSingletons[$resolvedEntityName] = $this->getResourceModel($entityName, $arguments);
504	+ }
505	+ return $this->_resourceSingletons[$resolvedEntityName];
506	+ }
507	+ }
508	+ /**
509	+ * @param string $entityName
510	+ * @param array $arguments
511	+ * @return Mana_Db_Model_Entity
512	+ */
513	+ public function getModel($entityName, $arguments = array()) {
514	+ $arguments = array_merge(array('scope' => $entityName), $arguments);
515	+
516	+ $resolvedEntityName = $this->getScopedName($entityName);
517	+ if ($this->modelExists($resolvedEntityName)) {
518	+ return Mage::getModel($resolvedEntityName, $arguments);
519	+ }
520	+
521	+ /* @var $dbConfig Mana_Db_Helper_Config */
522	+ $dbConfig = Mage::helper('mana_db/config');
523	+ if (!($scopeXml = $dbConfig->getScopeXml($entityName))) {
524	+ return Mage::getModel('mana_db/entity', $arguments);
525	+ }
526	+
527	+ if (!empty($scopeXml->flattens)) {
528	+ $entityName = (string)$scopeXml->flattens;
529	+ $resolvedEntityName = $this->getScopedName($entityName);
530	+ if ($this->modelExists($resolvedEntityName)) {
531	+ return Mage::getModel($resolvedEntityName, $arguments);
532	+ }
533	+ $scopeXml = $dbConfig->getScopeXml($entityName);
534	+ }
535	+ if (!empty($scopeXml->store_specifics_for)) {
536	+ $entityName = (string)$scopeXml->store_specifics_for;
537	+ $resolvedEntityName = $this->getScopedName($entityName);
538	+ if ($this->modelExists($resolvedEntityName)) {
539	+ return Mage::getModel($resolvedEntityName, $arguments);
540	+ }
541	+ }
542	+ return Mage::getModel('mana_db/entity', $arguments);
543	+ }
544	+
545	+ public function resourceExists($entityName) {
546	+ if ($className = Mage::getConfig()->getResourceModelClassName($entityName)) {
547	+ return $this->classExists($className);
548	+ }
549	+ else {
550	+ return false;
551	+ }
552	+
553	+ }
554	+
555	+ public function modelExists($entityName) {
556	+ if ($className = Mage::getConfig()->getModelClassName($entityName)) {
557	+ return $this->classExists($className);
558	+ }
559	+ else {
560	+ return false;
561	+ }
562	+
563	+ }
564	+
565	+ public function classExists($class) {
566	+ if (defined('COMPILER_INCLUDE_PATH')) {
567	+ $classFile = $class;
568	+ }
569	+ else {
570	+ $classFile = str_replace(' ', DIRECTORY_SEPARATOR, ucwords(str_replace('_', ' ', $class)));
571	+ }
572	+ $classFile .= '.php';
573	+ foreach (explode(PS, get_include_path()) as $path) {
574	+ if (file_exists($path.DS.$classFile)) {
575	+ return true;
576	+ }
577	+ }
578	+
579	+ return false;
580	+ }
581	}

app/code/local/Mana/Db/Helper/Formula.php ADDED Viewed

	@@ -0,0 +1,471 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula extends Mage_Core_Helper_Abstract {
13	+ protected $_orders;
14	+ static $_types = array(
15	+ 'varchar' => 'string',
16	+ 'mediumtext' => 'string',
17	+ 'text' => 'string',
18	+ 'tinyint' => 'int',
19	+ 'smallint' => 'int',
20	+ 'int' => 'int',
21	+ 'bigint' => 'int',
22	+ );
23	+ static $_numericTypes = array(
24	+ 8 => 'tinyint',
25	+ 16 => 'smallint',
26	+ 32 => 'int',
27	+ );
28	+
29	+ protected $_typeCache = array();
30	+
31	+ /**
32	+ * @param string $entity
33	+ * @param string[] $formulas
34	+ * @param array $options
35	+ * @throws Exception\|Mana_Db_Exception_Formula
36	+ * @return Mana_Db_Model_Formula_Context
37	+ */
38	+ public function select($entity, $formulas, $options = array()) {
39	+ $options = array_merge(array(
40	+ 'process_all_fields' => true,
41	+ ), $options);
42	+
43	+ /* @var $select Varien_Db_Select */
44	+ /* @var $selector Mana_Db_Helper_Formula_Selector */
45	+ /* @var $context Mana_Db_Model_Formula_Context */
46	+ $this->_initSelect($entity, $options, $select, $context, $selector);
47	+
48	+ // process formulas
49	+ foreach ($this->_getFieldFormulas($context, $formulas, $options) as $field) {
50	+ $context->setField($field);
51	+ try {
52	+ if ($field->getRole()) {
53	+ if ($field->hasFormula()) {
54	+ $selector->selectFormula($context, $field->getFormula());
55	+ $context->addField($field->getName());
56	+ }
57	+ else {
58	+ if ($selector->selectSystemField($context)) {
59	+ $context->addField($field->getName());
60	+ }
61	+ }
62	+ }
63	+ elseif ($field->hasFormula()) {
64	+ $selector->selectFormula($context, $field->getFormula());
65	+ $context->addField($field->getName());
66	+ }
67	+ elseif ($field->hasValue()) {
68	+ $selector->selectValue($context, $field->getValue());
69	+ $context->addField($field->getName());
70	+ }
71	+ else {
72	+ $selector->selectDefaultValue($context);
73	+ $context->addField($field->getName());
74	+ }
75	+ }
76	+ catch (Mana_Db_Exception_Formula $e) {
77	+ if ($context->getOption('provide_field_details_in_exceptions')) {
78	+ if ($field->hasFormula()) {
79	+ $e->addMessage($this->__(" in entity: '%s', field: '%s', formula '%s'", $entity, $field->getName(), $field->getFormulaString()));
80	+ }
81	+ else {
82	+ $e->addMessage($this->__(" in entity: '%s', field: '%s'", $entity, $field->getName()));
83	+ }
84	+ }
85	+ throw $e;
86	+ }
87	+ }
88	+
89	+ return $context;
90	+ }
91	+
92	+ /**
93	+ * @param Mana_Db_Model_Entity $model
94	+ * @return mixed
95	+ */
96	+ public function evaluate($model) {
97	+ /* @var $evaluator Mana_Db_Helper_Formula_Evaluator */
98	+ $evaluator = Mage::helper('mana_db/formula_evaluator');
99	+
100	+ /* @var $context Mana_Db_Model_Formula_Context */
101	+ $context = Mage::getModel('mana_db/formula_context');
102	+ $context
103	+ ->setEntity($model->getScope())
104	+ ->setModel($model)
105	+ ->setProcessor('entity')
106	+ ->setHelper($evaluator);
107	+
108	+ if ($defaultFormulas = $model->getDefaultFormulas()) {
109	+ $defaultFormulas = json_decode($defaultFormulas, true);
110	+ }
111	+ else {
112	+ $defaultFormulas = array();
113	+ }
114	+
115	+ foreach ($this->_getFieldFormulas($context, $defaultFormulas) as $field) {
116	+ if ($field->useDefault($model)) {
117	+ if ($field->hasFormula()) {
118	+ $evaluator->evaluateFormula($context, $field);
119	+ }
120	+ elseif ($field->hasValue()) {
121	+ $evaluator->evaluateValue($context, $field);
122	+ }
123	+ }
124	+ }
125	+
126	+ return $context->getResult();
127	+ }
128	+
129	+ /**
130	+ * @param $formula
131	+ * @return Mana_Db_Model_Formula_Node
132	+ */
133	+ public function parse($formula) {
134	+ /* @var $parser Mana_Db_Helper_Formula_Parser */
135	+ $parser = Mage::helper('mana_db/formula_parser');
136	+
137	+ return $parser->parse($formula);
138	+ }
139	+
140	+ /**
141	+ * @param Mana_Db_Model_Formula_Context $context
142	+ * @param Mana_Db_Model_Formula_Node $formula
143	+ * @return string[]
144	+ */
145	+ public function depends($context, $formula) {
146	+ /* @var $dependencyFinder Mana_Db_Helper_Formula_DependencyFinder */
147	+ $dependencyFinder = Mage::helper('mana_db/formula_dependencyFinder');
148	+ return $dependencyFinder->findInFormula($context, $formula);
149	+ }
150	+
151	+
152	+ public function getFormulaGroups($entity, $options = array()) {
153	+ /* @var $select Varien_Db_Select */
154	+ /* @var $selector Mana_Db_Helper_Formula_Selector */
155	+ /* @var $context Mana_Db_Model_Formula_Context */
156	+ $this->_initSelect($entity, $options, $select, $context, $selector);
157	+ $idExpr = "`{$context->registerAlias('primary')}`.`id`";
158	+ $hashExpr = "`{$context->registerAlias('primary')}`.`default_formula_hash`";
159	+ $formulasExpr = "`{$context->registerAlias('primary')}`.`default_formulas`";
160	+
161	+
162	+ $select
163	+ ->distinct()
164	+ ->columns(array('id' => new Zend_Db_Expr("MIN($idExpr)")))
165	+ ->columns(array('hash' => new Zend_Db_Expr("$hashExpr")))
166	+ ->group('hash');
167	+
168	+ /* @var $resource Mana_Db_Resource_Formula */
169	+ $resource = Mage::getResourceSingleton('mana_db/formula');
170	+ $db = $resource->getReadConnection();
171	+ $hashes = $db->fetchPairs($select);
172	+ if (($nullId = array_search(null, $hashes)) !== false) {
173	+ unset($hashes[$nullId]);
174	+ }
175	+
176	+ if (count($hashes)) {
177	+ $this->_initSelect($entity, $options, $select, $context, $selector);
178	+ $select
179	+ ->columns(array('id' => new Zend_Db_Expr("$idExpr")))
180	+ ->columns(array('formulas' => new Zend_Db_Expr("$formulasExpr")))
181	+ ->where("$idExpr IN (?)", array_keys($hashes));
182	+
183	+ $formulas = $db->fetchPairs($select);
184	+
185	+ $result = array_combine($hashes, $formulas);
186	+ }
187	+ else {
188	+ $result = array();
189	+ }
190	+ if ($nullId !== false) {
191	+ $result[''] = '';
192	+ }
193	+ return $result;
194	+ }
195	+
196	+ /**
197	+ * @param string $entity
198	+ * @param string $targetEntity
199	+ * @param array $options
200	+ * @throws Exception
201	+ * @return string
202	+ */
203	+ public function delete($entity, $targetEntity, $options = array()) {
204	+ throw new Exception('Not implemented');
205	+ /* @var $select Varien_Db_Select */
206	+ /* @var $selector Mana_Db_Helper_Formula_Selector */
207	+ /* @var $context Mana_Db_Model_Formula_Context */
208	+ $this->_initSelect($entity, $options, $select, $context, $selector);
209	+
210	+ /* @var $resource Mana_Db_Resource_Formula */
211	+ $resource = Mage::getResourceSingleton('mana_db/formula');
212	+
213	+ /* @var $dbHelper Mana_Db_Helper_Data */
214	+ $dbHelper = Mage::helper('mana_db');
215	+
216	+ $select->setPart(Varien_Db_Select::FROM, array());
217	+ return $select->deleteFromSelect($resource->getTable($dbHelper->getScopedName($targetEntity)));
218	+ }
219	+
220	+ /**
221	+ * @param string $entity
222	+ * @param array $options
223	+ * @param Varien_Db_Select $select
224	+ * @param Mana_Db_Model_Formula_Context $context
225	+ * @param Mana_Db_Helper_Formula_Selector $selector
226	+ */
227	+ protected function _initSelect($entity, $options, &$select, &$context, &$selector) {
228	+ /* @var $dbConfig Mana_Db_Helper_Config */
229	+ $dbConfig = Mage::helper('mana_db/config');
230	+
231	+ $scopeXml = $dbConfig->getScopeXml($entity);
232	+
233	+ /* @var $selector Mana_Db_Helper_Formula_Selector */
234	+ $selector = Mage::helper('mana_db/formula_selector');
235	+
236	+ /* @var $normalEntity Mana_Db_Helper_Formula_Entity_Normal */
237	+ $normalEntity = Mage::helper('mana_db/formula_entity_normal');
238	+
239	+ /* @var $context Mana_Db_Model_Formula_Context */
240	+ $context = Mage::getModel('mana_db/formula_context');
241	+
242	+ /** @noinspection PhpUndefinedFieldInspection */
243	+ $context
244	+ ->setAlias($this->createAlias(''))
245	+ ->setEntity($entity)
246	+ ->setPrimaryEntity((string)$scopeXml->flattens)
247	+ ->setTargetEntity($entity)
248	+ ->setProcessor('entity')
249	+ ->setEntityHelper($normalEntity)
250	+ ->setHelper($selector)
251	+ ->setOptions($options);
252	+
253	+ /** @noinspection PhpUndefinedFieldInspection */
254	+ $select = $this->createSelect($context, $scopeXml->formula->base);
255	+ }
256	+
257	+ /**
258	+ * @param Mana_Db_Model_Formula_Context $context
259	+ * @param string[] $formulas
260	+ * @return Mana_Db_Model_Formula_Field[]
261	+ */
262	+ protected function _getFieldFormulas($context, $formulas, $options = array()) {
263	+ $result = array();
264	+ $entity = $context->getTargetEntity();
265	+
266	+ /* @var $dbConfig Mana_Db_Helper_Config */
267	+ $dbConfig = Mage::helper('mana_db/config');
268	+
269	+ /* @var $fieldsXml Varien_Simplexml_Element */
270	+ /** @noinspection PhpUndefinedFieldInspection */
271	+ $fieldsXml = $dbConfig->getScopeXml($entity)->fields;
272	+ foreach ($fieldsXml->children() as $name => $fieldXml) {
273	+ if (empty($options['process_all_fields']) && !isset($formulas[$name])) {
274	+ continue;
275	+ }
276	+ /* @var $field Mana_Db_Model_Formula_Field */
277	+ $field = Mage::getModel('mana_db/formula_field');
278	+ $field
279	+ ->setName($name)
280	+ ->setRole(isset($fieldXml->role) ? (string)$fieldXml->role : '')
281	+ ->setType((string)$fieldXml->type);
282	+
283	+ if (isset($fieldXml->no)) {
284	+ $field->setNo((string)$fieldXml->no);
285	+ }
286	+ if (isset($formulas[$name])) {
287	+ $field
288	+ ->setFormulaString($formulas[$name])
289	+ ->setFormula($this->parse($formulas[$name]))
290	+ ->setDependencies($this->depends($context, $field->getFormula()));
291	+ }
292	+ elseif(isset($fieldXml->default_formula)) {
293	+ $field
294	+ ->setFormulaString((string)$fieldXml->default_formula)
295	+ ->setFormula($this->parse((string)$fieldXml->default_formula))
296	+ ->setDependencies($this->depends($context, $field->getFormula()));
297	+ }
298	+ elseif (isset($fieldXml->default_value)) {
299	+ $field->setValue((string)$fieldXml->default_value);
300	+ }
301	+ $result[$name] = $field;
302	+ }
303	+
304	+ $this->_sortByDependency($result);
305	+ return $result;
306	+ }
307	+
308	+ /**
309	+ * @param Mana_Db_Model_Formula_Field[] $fields
310	+ * @throws Mana_Db_Exception_Formula
311	+ * @return Mana_Db_Helper_Formula
312	+ */
313	+ protected function _sortByDependency(&$fields) {
314	+ $count = count($fields);
315	+ $orders = array();
316	+ for ($position = 0; $position < $count; $position++) {
317	+ $found = false;
318	+ foreach ($fields as $fieldName => $field) {
319	+ if (!isset($orders[$fieldName])) {
320	+ $hasUnresolvedDependency = false;
321	+ if ($field->hasDependencies()) {
322	+ foreach ($field->getDependencies() as $dependency) {
323	+ if (!isset($fields[$dependency])) {
324	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__("Field '%s' depends on undefined field '%s'", $fieldName, $dependency));
325	+ }
326	+ if (!isset($orders[$dependency])) {
327	+ // $dependency not yet sorted so $module should wait until that happens
328	+ $hasUnresolvedDependency = true;
329	+ break;
330	+ }
331	+ }
332	+ }
333	+ if (!$hasUnresolvedDependency) {
334	+ $found = $fieldName;
335	+ break;
336	+ }
337	+ }
338	+ }
339	+ if ($found) {
340	+ $orders[$found] = count($orders);
341	+ }
342	+ else {
343	+ $circular = array();
344	+ foreach ($fields as $fieldName => $field) {
345	+ if (!isset($orders[$fieldName])) {
346	+ $circular[] = $fieldName;
347	+ }
348	+ }
349	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__('Field values circularly depends on one another: %s', implode(', ', $circular)));
350	+ }
351	+ }
352	+ $this->_orders = $orders;
353	+ uasort($fields, array($this, '_sortByDependencyCallback'));
354	+
355	+ return $this;
356	+ }
357	+
358	+ /**
359	+ * @param Mana_Db_Model_Formula_Field $a
360	+ * @param Mana_Db_Model_Formula_Field $b
361	+ * @return int
362	+ */
363	+ protected function _sortByDependencyCallback($a, $b) {
364	+ $a = $this->_orders[$a->getName()];
365	+ $b = $this->_orders[$b->getName()];
366	+ if ($a == $b) return 0;
367	+
368	+ return $a < $b ? -1 : 1;
369	+ }
370	+
371	+ public function getType($sqlType) {
372	+ if (!isset($this->_typeCache[$sqlType])) {
373	+ $type = trim(strtolower($sqlType));
374	+ $pos = false;
375	+ if (($foundPos = strpos($type, '(')) !== false) {
376	+ $pos = $foundPos;
377	+ }
378	+ if (($foundPos = strpos($type, ' ')) !== false) {
379	+ $pos = $foundPos;
380	+ }
381	+ if ($pos !== false) {
382	+ $type = substr($type, 0, $pos);
383	+ }
384	+
385	+ $this->_typeCache[$sqlType] = isset(self::$_types[$type]) ? self::$_types[$type] : '';
386	+ }
387	+ return $this->_typeCache[$sqlType];
388	+ }
389	+
390	+ public function getMinimumNumericType($value) {
391	+ foreach (self::$_numericTypes as $bit => $type) {
392	+ if (abs($value) < 1 << $bit - 1) {
393	+ return $type;
394	+ }
395	+ }
396	+ return 'bigint';
397	+ }
398	+
399	+ /**
400	+ * @param Mana_Db_Model_Formula_Context $context
401	+ * @param SimpleXMLElement $selectXml
402	+ * @return Varien_Db_Select
403	+ */
404	+ public function createSelect($context, $selectXml) {
405	+ /* @var $dbHelper Mana_Db_Helper_Data */
406	+ $dbHelper = Mage::helper('mana_db');
407	+
408	+ /* @var $resource Mana_Db_Resource_Formula */
409	+ $resource = Mage::getResourceSingleton('mana_db/formula');
410	+
411	+ $select = $context->getSelect();
412	+
413	+ /* @var $fromXml SimpleXMLElement */
414	+ /** @noinspection PhpUndefinedFieldInspection */
415	+ $fromXml = $selectXml->from;
416	+ foreach ($fromXml->children() as $alias => $definition) {
417	+ $entity = $alias == 'primary' ? $context->getPrimaryEntity() : (string)$definition->entity;
418	+ $select->from(
419	+ array($context->registerAlias($alias) => $resource->getTable($dbHelper->getScopedName($entity))),
420	+ null
421	+ );
422	+ }
423	+
424	+ if (isset($selectXml->join)) {
425	+ $joinXml = $selectXml->join;
426	+ /* @var $joinXml SimpleXMLElement */
427	+ foreach ($joinXml->children() as $alias => $definition) {
428	+ $method = isset($definition->type) ? 'join' . ucfirst($definition->type) : 'joinInner';
429	+ $entity = $alias == 'primary' ? $context->getPrimaryEntity() : (string)$definition->entity;
430	+ $select->$method(
431	+ array($context->registerAlias($alias) => $resource->getTable($dbHelper->getScopedName($entity))),
432	+ $context->resolveAliases((string)$definition->on),
433	+ null
434	+ );
435	+ }
436	+ }
437	+
438	+ if (isset($selectXml->order)) {
439	+ $select->order($context->resolveAliases((string)$selectXml->order, false));
440	+
441	+ }
442	+ if (isset($selectXml->where)) {
443	+ $select->where($context->resolveAliases((string)$selectXml->where));
444	+
445	+ }
446	+
447	+ if ($formula = $context->getOption('entity_filter_formula')) {
448	+ /* @var $selector Mana_Db_Helper_Formula_Selector */
449	+ $selector = Mage::helper('mana_db/formula_selector');
450	+ $selector->filterFormula($context, $this->parse($formula), $context->getOption('entity_filter_id'));
451	+ }
452	+
453	+ return $select;
454	+ }
455	+
456	+ /**
457	+ * @param string \| string[] $value
458	+ * @return Mana_Db_Model_Formula_Alias
459	+ */
460	+ public function createAlias($value) {
461	+ if (!$value \|\| $value == 'this') {
462	+ return Mage::getModel('mana_db/formula_alias_empty');
463	+ }
464	+ elseif (is_array($value)) {
465	+ return Mage::getModel('mana_db/formula_alias_array', $value);
466	+ }
467	+ else {
468	+ return Mage::getModel('mana_db/formula_alias_single', $value);
469	+ }
470	+ }
471	+ }

app/code/local/Mana/Db/Helper/Formula/Abstract.php ADDED Viewed

	@@ -0,0 +1,73 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Abstract extends Mage_Core_Helper_Abstract {
13	+ const CLASS_PREFIX = 'Mana_Db_Model_Formula_Node_';
14	+ protected $_methodPrefix = '';
15	+
16	+ /**
17	+ * @var Mana_Db_Model_Formula_Expr
18	+ */
19	+ protected $_exprPrototype;
20	+
21	+ public function __construct() {
22	+ $this->_exprPrototype = Mage::getModel('mana_db/formula_expr');
23	+ }
24	+
25	+ /**
26	+ * @return Mana_Db_Model_Formula_Expr
27	+ */
28	+ public function expr() {
29	+ return clone $this->_exprPrototype;
30	+ }
31	+
32	+ /**
33	+ * @param Mana_Db_Model_Formula_Expr $expr
34	+ * @param string $type
35	+ * @return Mana_Db_Model_Formula_Expr
36	+ */
37	+ public function cast($expr, $type) {
38	+ return $expr;
39	+ }
40	+
41	+ public function _call($args) {
42	+ /* @var $core Mana_Core_Helper_Data */
43	+ $core = Mage::helper('mana_core');
44	+ $formula = $args[1];
45	+ $class = get_class($formula);
46	+ if ($core->startsWith($class, self::CLASS_PREFIX)) {
47	+ return call_user_func_array(array($this, $this->_methodPrefix . substr($class, strlen(self::CLASS_PREFIX))), $args);
48	+ }
49	+ else {
50	+ throw new $this->__("Formula node class must start with '%s'", self::CLASS_PREFIX);
51	+ }
52	+ }
53	+
54	+ public function __call($name, $args) {
55	+ /* @var $core Mana_Core_Helper_Data */
56	+ $core = Mage::helper('mana_core');
57	+
58	+ if ($core->startsWith($name, $this->_methodPrefix)) {
59	+ return call_user_func_array(array($this, $this->_methodPrefix . 'Node'), $args);
60	+ }
61	+ else {
62	+ throw new $this->__("Unknown method %s::%s", __CLASS__, $name);
63	+ }
64	+ }
65	+
66	+ /**
67	+ * @param string $name
68	+ * @return Mana_Db_Helper_Formula_Function
69	+ */
70	+ public function getFunction($name) {
71	+ return Mage::helper('mana_db/formula_function_' . lcfirst(uc_words(strtolower($name), '')));
72	+ }
73	+ }

app/code/local/Mana/Db/Helper/Formula/DependencyFinder.php ADDED Viewed

	@@ -0,0 +1,100 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_DependencyFinder extends Mana_Db_Helper_Formula_Abstract {
13	+ protected $_methodPrefix = '_findIn';
14	+ /**
15	+ * @param Mana_Db_Model_Formula_Context $context
16	+ * @param Mana_Db_Model_Formula_Node $formula
17	+ * @return string[]
18	+ */
19	+ public function findInFormula(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
20	+ return $this->_call(func_get_args());
21	+ }
22	+
23	+ /**
24	+ * @param Mana_Db_Model_Formula_Context $context
25	+ * @param Mana_Db_Model_Formula_Node_Add $formula
26	+ * @return string[]
27	+ */
28	+ protected function _findInAdd($context, $formula) {
29	+ return array_merge($this->findInFormula($context, $formula->a), $this->findInFormula($context, $formula->b));
30	+ }
31	+
32	+ /**
33	+ * @param Mana_Db_Model_Formula_Context $context
34	+ * @param Mana_Db_Model_Formula_Node_Field $formula
35	+ * @return string[]
36	+ */
37	+ protected function _findInField(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
38	+ if (count($formula->identifiers) == 2 && $formula->identifiers[0] == 'this') {
39	+ return array($formula->identifiers[1]);
40	+ }
41	+ else {
42	+ return array();
43	+ }
44	+ }
45	+
46	+ /**
47	+ * @param Mana_Db_Model_Formula_Context $context
48	+ * @param Mana_Db_Model_Formula_Node_FormulaExpr $formula
49	+ * @return string[]
50	+ */
51	+ protected function _findInFormulaExpr($context, $formula) {
52	+ $result = array();
53	+ foreach ($formula->parts as $part) {
54	+ $result = array_merge($result, $this->findInFormula($context, $part));
55	+ }
56	+ return $result;
57	+ }
58	+
59	+ /**
60	+ * @param Mana_Db_Model_Formula_Context $context
61	+ * @param Mana_Db_Model_Formula_Node_FunctionCall $formula
62	+ * @return string[]
63	+ */
64	+ protected function _findInFunctionCall($context, $formula) {
65	+ $result = array();
66	+ foreach ($formula->args as $arg) {
67	+ $result = array_merge($result, $this->findInFormula($context, $arg));
68	+ }
69	+
70	+ return $result;
71	+ }
72	+
73	+ /**
74	+ * @param Mana_Db_Model_Formula_Context $context
75	+ * @param Mana_Db_Model_Formula_Node_Identifier $formula
76	+ * @return string[]
77	+ */
78	+ protected function _findInIdentifier(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
79	+ return array($formula->identifier);
80	+ }
81	+
82	+ /**
83	+ * @param Mana_Db_Model_Formula_Context $context
84	+ * @param Mana_Db_Model_Formula_Node_Multiply $formula
85	+ * @return string[]
86	+ */
87	+ protected function _findInMultiply($context, $formula) {
88	+ return array_merge($this->findInFormula($context, $formula->a), $this->findInFormula($context, $formula->b));
89	+ }
90	+
91	+ /**
92	+ * @param Mana_Db_Model_Formula_Context $context
93	+ * @param Mana_Db_Model_Formula_Node $formula
94	+ * @return string[]
95	+ */
96	+ protected function _findInNode(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
97	+ return array();
98	+ }
99	+
100	+ }

app/code/local/Mana/Db/Helper/Formula/Entity.php ADDED Viewed

	@@ -0,0 +1,45 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Db_Helper_Formula_Entity extends Mage_Core_Helper_Abstract {
13	+ protected $_name;
14	+
15	+ /**
16	+ *
17	+ * @param Mana_Db_Model_Formula_Context $context
18	+ * @param Mana_Db_Model_Formula_Entity $entity
19	+ */
20	+ public abstract function select($context, $entity);
21	+
22	+ /**
23	+ * @param Mana_Db_Model_Formula_Context $context
24	+ * @param Mana_Db_Model_Formula_Entity $entity
25	+ */
26	+ public function endSelect($context, $entity) {
27	+ }
28	+
29	+ /**
30	+ * @param Mana_Db_Model_Formula_Context $context
31	+ * @param Mana_Db_Model_Formula_Node_Field $formula
32	+ * @param Mana_Db_Model_Formula_Expr $expr
33	+ */
34	+ public abstract function selectField($context, $formula, $expr);
35	+
36	+ public function getName() {
37	+ if (!$this->_name) {
38	+ $class = substr(get_class($this), strlen(__CLASS__ . '_'));
39	+ $this->_name = strtolower($class);
40	+ }
41	+
42	+ return $this->_name;
43	+ }
44	+
45	+ }

app/code/local/Mana/Db/Helper/Formula/Entity/Aggregate.php ADDED Viewed

	@@ -0,0 +1,87 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Entity_Aggregate extends Mana_Db_Helper_Formula_Entity {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Entity $entity
16	+ */
17	+ public function select($context, $entity) {
18	+ switch ($context->getMode()) {
19	+ default:
20	+ $context
21	+ ->setMode($this->getName())
22	+ ->setEntityHelper($this);
23	+
24	+ /* @var $dbHelper Mana_Db_Helper_Data */
25	+ $dbHelper = Mage::helper('mana_db');
26	+
27	+ /* @var $resource Mana_Db_Resource_Formula */
28	+ $resource = Mage::getResourceSingleton('mana_db/formula');
29	+
30	+ $context->incrementPrefix();
31	+
32	+ $alias = explode('.', $entity->getAlias());
33	+ $alias = array_pop($alias);
34	+
35	+ $aggregateContext = $context->createChildContext()
36	+ ->setPrefix($context->getPrefix())
37	+ ->setEntity($entity->getEntity())
38	+ ->setProcessor($entity->getProcessor())
39	+ ->setAlias($alias);
40	+
41	+ $select = $aggregateContext->getSelect()
42	+ ->from(array(
43	+ $aggregateContext->registerAlias($alias)
44	+ => $resource->getTable($dbHelper->getScopedName($entity->getEntity()))
45	+ ), null);
46	+
47	+ if ($entity->getJoin()) {
48	+ foreach ($entity->getJoin() as $alias => $join) {
49	+ $method = isset($join['type']) ? 'join' . ucfirst($join['type']) : 'joinInner';
50	+ $select->$method(
51	+ array(
52	+ $aggregateContext->registerAlias($alias) =>
53	+ $resource->getTable($dbHelper->getScopedName($join['entity']))
54	+ ),
55	+ $aggregateContext->resolveAliases($join['on']),
56	+ null
57	+ );
58	+ }
59	+ }
60	+ if ($entity->getOrder()) {
61	+ $select->order($aggregateContext->resolveAliases($entity->getOrder(), false));
62	+ }
63	+ if ($entity->getWhere()) {
64	+ $select->where($aggregateContext->resolveAliases($entity->getWhere()));
65	+ }
66	+
67	+ $context
68	+ ->setEntity($entity->getEntity())
69	+ ->setProcessor($entity->getProcessor())
70	+ ->setAlias($entity->getAlias())
71	+ ->setAggregateContext($aggregateContext);
72	+ break;
73	+ }
74	+ }
75	+
76	+ /**
77	+ * @param Mana_Db_Model_Formula_Context $context
78	+ * @param Mana_Db_Model_Formula_Node_Field $formula
79	+ * @param Mana_Db_Model_Formula_Expr $expr
80	+ */
81	+ public function selectField($context, $formula, $expr) {
82	+ $expr
83	+ ->setIsAggregate(true)
84	+ ->setSubSelect($context->getAggregateContext()->getSelect());
85	+ }
86	+
87	+ }

app/code/local/Mana/Db/Helper/Formula/Entity/Aggregate/Field.php ADDED Viewed

	@@ -0,0 +1,60 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Entity_Aggregate_Field extends Mana_Db_Helper_Formula_Entity {
13	+ /**
14	+ *
15	+ * @param Mana_Db_Model_Formula_Context $context
16	+ * @param Mana_Db_Model_Formula_Entity $entity
17	+ */
18	+ public function select($context, $entity) {
19	+ switch ($context->getMode()) {
20	+ default:
21	+ $context
22	+ ->setMode($this->getName())
23	+ ->setEntityHelper($this);
24	+
25	+ /* @var $resource Mana_Db_Resource_Formula */
26	+ $resource = Mage::getResourceSingleton('mana_db/formula');
27	+
28	+ /* @var $dbHelper Mana_Db_Helper_Data */
29	+ $dbHelper = Mage::helper('mana_db');
30	+
31	+ foreach ($entity->getAggregateFields() as $field) {
32	+ if (!$context->hasAlias($field['alias'])) {
33	+ $context->getSelect()->joinLeft(
34	+ array(
35	+ $context->registerAlias($field['alias']) =>
36	+ $resource->getTable($dbHelper->getScopedName($field['entity']))
37	+ ),
38	+ $context->resolveAliases($field['join']),
39	+ null
40	+ );
41	+ }
42	+ }
43	+
44	+ $context
45	+ ->setEntity($entity->getEntity())
46	+ ->setProcessor($entity->getProcessor())
47	+ ->setAlias($entity->getAlias());
48	+ break;
49	+ }
50	+ }
51	+
52	+ /**
53	+ * @param Mana_Db_Model_Formula_Context $context
54	+ * @param Mana_Db_Model_Formula_Node_Field $formula
55	+ * @param Mana_Db_Model_Formula_Expr $expr
56	+ */
57	+ public function selectField($context, $formula, $expr) {
58	+ $expr->setIsAggregate(true);
59	+ }
60	+ }

app/code/local/Mana/Db/Helper/Formula/Entity/Foreign.php ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Entity_Foreign extends Mana_Db_Helper_Formula_Entity {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Entity $entity
16	+ */
17	+ public function select($context, $entity) {
18	+ switch ($context->getMode()) {
19	+ default:
20	+ if (!$context->hasAlias($entity->getAlias()->asString(0))) {
21	+ /* @var $resource Mana_Db_Resource_Formula */
22	+ $resource = Mage::getResourceSingleton('mana_db/formula');
23	+
24	+ /* @var $dbHelper Mana_Db_Helper_Data */
25	+ $dbHelper = Mage::helper('mana_db');
26	+
27	+ /* @var $joinClosure Mana_Db_Model_Formula_Closure_ForeignJoinEnd */
28	+ $joinClosure = Mage::getModel('mana_db/formula_closure_foreignJoinEnd', compact('context', 'entity'));
29	+ $context->getAlias()->each($joinClosure);
30	+ }
31	+
32	+ $context
33	+ ->setEntity($entity->getEntity())
34	+ ->setProcessor($entity->getProcessor())
35	+ ->setAlias($entity->getAlias())
36	+ ->setEntityHelper($this);
37	+ break;
38	+ }
39	+
40	+ }
41	+
42	+ /**
43	+ * @param Mana_Db_Model_Formula_Context $context
44	+ * @param Mana_Db_Model_Formula_Node_Field $formula
45	+ * @param Mana_Db_Model_Formula_Expr $expr
46	+ */
47	+ public function selectField($context, $formula, $expr) {
48	+ $expr->setExpr($expr->getFieldExpr());
49	+ }
50	+ }

app/code/local/Mana/Db/Helper/Formula/Entity/Frontend.php ADDED Viewed

	@@ -0,0 +1,43 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Entity_Frontend extends Mana_Db_Helper_Formula_Entity {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Entity $entity
16	+ */
17	+ public function select($context, $entity) {
18	+ switch ($context->getMode()) {
19	+ default:
20	+ $context
21	+ ->setMode($this->getName())
22	+ ->setEntityHelper($this);
23	+
24	+ $context
25	+ ->setEntity($entity->getEntity())
26	+ ->setProcessor($entity->getProcessor())
27	+ ->setAlias($entity->getAlias());
28	+ break;
29	+ }
30	+ }
31	+
32	+ /**
33	+ * @param Mana_Db_Model_Formula_Context $context
34	+ * @param Mana_Db_Model_Formula_Node_Field $formula
35	+ * @param Mana_Db_Model_Formula_Expr $expr
36	+ */
37	+ public function selectField($context, $formula, $expr) {
38	+ $expr
39	+ ->setIsFrontend(true)
40	+ ->setExpr("'{{= {$formula->__toString()} }}'")
41	+ ->setType('varchar(255');
42	+ }
43	+ }

app/code/local/Mana/Db/Helper/Formula/Entity/Normal.php ADDED Viewed

	@@ -0,0 +1,36 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Entity_Normal extends Mana_Db_Helper_Formula_Entity {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Node_Field $formula
16	+ * @param Mana_Db_Model_Formula_Expr $expr
17	+ */
18	+ public function selectField(/** @noinspection PhpUnusedParameterInspection */$context, $formula, $expr) {
19	+ foreach($context->getSelect()->getPart(Varien_Db_Select::COLUMNS) as $column) {
20	+ if ($column[2] == $expr->getFieldName()) {
21	+ $expr->setExpr($column[1]);
22	+ return;
23	+ }
24	+ }
25	+
26	+ throw new Mana_Db_Exception_Formula($this->__("Field '%s' referenced in field '%s' is not defined.", $expr->getFieldName(), $context->getField()->getName()));
27	+ }
28	+
29	+ /**
30	+ *
31	+ * @param Mana_Db_Model_Formula_Context $context
32	+ * @param Mana_Db_Model_Formula_Entity $entity
33	+ */
34	+ public function select($context, $entity) {
35	+ }
36	+ }

app/code/local/Mana/Db/Helper/Formula/Evaluator.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Evaluator extends Mana_Db_Helper_Formula_Abstract {
13	+ public function evaluateFormula($context, $field) {
14	+ throw new Exception('Not implemented');
15	+ }
16	+
17	+ public function evaluateValue($context, $field) {
18	+ throw new Exception('Not implemented');
19	+ }
20	+ }

app/code/local/Mana/Db/Helper/Formula/Function.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Db_Helper_Formula_Function extends Mage_Core_Helper_Abstract {
13	+ protected $_name;
14	+ /**
15	+ * @param Mana_Db_Model_Formula_Context $context
16	+ * @param Mana_Db_Model_Formula_Expr[] $args
17	+ * @return Mana_Db_Model_Formula_Expr
18	+ */
19	+ abstract public function select($context, $args);
20	+
21	+ public function getName() {
22	+ if (!$this->_name) {
23	+ $class = substr(get_class($this), strlen(__CLASS__ . '_'));
24	+ $this->_name = strtoupper(preg_replace('/(.)([A-Z])/', "$1_$2", $class));
25	+ }
26	+ return $this->_name;
27	+ }
28	+ }

app/code/local/Mana/Db/Helper/Formula/Function/Count.php ADDED Viewed

	@@ -0,0 +1,47 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_Count extends Mana_Db_Helper_Formula_Function {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Expr[] $args
16	+ * @throws Mana_Db_Exception_Formula
17	+ * @return Mana_Db_Model_Formula_Expr
18	+ */
19	+ public function select($context, $args) {
20	+ if (count($args) != 1) {
21	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects one parameter", $this->getName()));
22	+ }
23	+ if (!$args[0]->getIsAggregate()) {
24	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects 1 parameter to be a field of aggregate entity", $this->getName()));
25	+ }
26	+
27	+ $helper = $context->getHelper();
28	+
29	+ if ($args[0]->getSubSelect()) {
30	+ $expr = "COUNT({$args[0]->getFieldExpr()})";
31	+
32	+ return $helper->expr()->setExpr("({$args[0]->getSubSelect()->columns($expr)})")->setType('int');
33	+ }
34	+ else {
35	+ $expr = '';
36	+ $fieldExpr = $args[0]->getFieldExpr();
37	+ foreach ($fieldExpr as $field) {
38	+ if ($expr) {
39	+ $expr .= " + ";
40	+ }
41	+ $expr .= "IF ($field IS NULL, 0, 1)";
42	+ }
43	+
44	+ return $helper->expr()->setExpr($expr)->setType('int');
45	+ }
46	+ }
47	+ }

app/code/local/Mana/Db/Helper/Formula/Function/Glue.php ADDED Viewed

	@@ -0,0 +1,83 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_Glue extends Mana_Db_Helper_Formula_Function {
13	+ protected $_separator = '{~#';
14	+ /**
15	+ * @param Mana_Db_Model_Formula_Context $context
16	+ * @param Mana_Db_Model_Formula_Expr[] $args
17	+ * @throws Mana_Db_Exception_Formula
18	+ * @return Mana_Db_Model_Formula_Expr
19	+ */
20	+ public function select($context, $args) {
21	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
22	+ $formulaHelper = Mage::helper('mana_db/formula');
23	+
24	+ if (count($args) < 2 \|\| count($args) > 3) {
25	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects 2 or 3 parameters", $this->getName()));
26	+ }
27	+ if (!$args[0]->getIsAggregate()) {
28	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects 1 parameter to be a field of aggregate entity", $this->getName()));
29	+ }
30	+
31	+ $helper = $context->getHelper();
32	+
33	+ $sep = $helper->cast($args[1], 'varchar (255)')->getExpr();
34	+ $lastSep = count($args) == 3 ? $helper->cast($args[2], 'varchar (255)')->getExpr() : '';
35	+ if ($args[0]->getSubSelect()) {
36	+ $field = $helper->cast($args[0], 'varchar (255)')->getFieldExpr();
37	+ if (count($args) == 3) {
38	+ $expr =
39	+ "IF (COUNT({$args[0]->getFieldExpr()}) > 1, ".
40	+ "REPLACE(CONCAT(".
41	+ "SUBSTRING_INDEX(GROUP_CONCAT({$field} SEPARATOR '{$this->_separator}'), ".
42	+ "'{$this->_separator}', COUNT({$field}) - 1), ".
43	+ "$lastSep, ".
44	+ "SUBSTRING_INDEX(GROUP_CONCAT({$field} SEPARATOR '{$this->_separator}'), ".
45	+ "'{$this->_separator}', -1)".
46	+ "), '{$this->_separator}', $sep), ".
47	+ "GROUP_CONCAT({$field} SEPARATOR $sep)".
48	+ ")";
49	+ }
50	+ else {
51	+ $expr = "GROUP_CONCAT({$field} SEPARATOR $sep)";
52	+ }
53	+
54	+ return $helper->expr()->setExpr("({$args[0]->getSubSelect()->columns($expr)})")->setType('varchar(255)');
55	+ }
56	+ else {
57	+ $expr = '';
58	+ $fieldExpr = $args[0]->getFieldExpr();
59	+ foreach ($fieldExpr as $index => $field) {
60	+ $nextField = isset($fieldExpr[$index + 1]) ? $fieldExpr[$index + 1] : '';
61	+ if ($expr) {
62	+ if (count($args) == 3) {
63	+ if ($nextField) {
64	+ $expr .= ", IF ($field IS NULL, '', CONCAT(IF ($nextField IS NULL, $lastSep, $sep), $field))";
65	+ }
66	+ else {
67	+ $expr .= ", IF ($field IS NULL, '', CONCAT($lastSep, $field))";
68	+ }
69	+ }
70	+ else {
71	+ $expr .= ", IF ($field IS NULL, '', CONCAT($sep, $field))";
72	+ }
73	+ }
74	+ else {
75	+ $expr .= "COALESCE({$helper->cast($args[0]->setExpr($field), 'varchar (255)')->getExpr()}, '')";
76	+ }
77	+ }
78	+ $expr = "CONCAT($expr)";
79	+
80	+ return $helper->expr()->setExpr($expr)->setType('varchar(255)');
81	+ }
82	+ }
83	+ }

app/code/local/Mana/Db/Helper/Formula/Function/If.php ADDED Viewed

	@@ -0,0 +1,51 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_If extends Mana_Db_Helper_Formula_Function {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Expr[] $args
16	+ * @throws Mana_Db_Exception_Formula
17	+ * @throws Exception
18	+ * @return Mana_Db_Model_Formula_Expr
19	+ */
20	+ public function select($context, $args) {
21	+ if (count($args) != 3) {
22	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects three parameters", $this->getName()));
23	+ }
24	+ if ($args[0]->getIsAggregate()) {
25	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
26	+ }
27	+
28	+ /* @var $helper Mana_Db_Helper_Formula_Selector */
29	+ $helper = $context->getHelper();
30	+
31	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
32	+ $formulaHelper = Mage::helper('mana_db/formula');
33	+
34	+ $condition = $args[0]->getExpr();
35	+ switch ($formulaHelper->getType($args[0]->getType())) {
36	+ case 'string':
37	+ $condition .= "<> ''";
38	+ break;
39	+ case 'int':
40	+ $condition .= "<> 0";
41	+ break;
42	+ case 'bool':
43	+ break;
44	+ default:
45	+ throw new Exception('Not implemented');
46	+ }
47	+
48	+ $helper->binaryCast($args[1], $args[2]);
49	+ return $helper->expr()->setExpr("IF({$condition}, {$args[1]->getExpr()}, {$args[2]->getExpr()})")->setType($args[1]->getType());
50	+ }
51	+ }

app/code/local/Mana/Db/Helper/Formula/Function/Lower.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_Lower extends Mana_Db_Helper_Formula_Function {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Expr[] $args
16	+ * @throws Mana_Db_Exception_Formula
17	+ * @return Mana_Db_Model_Formula_Expr
18	+ */
19	+ public function select($context, $args) {
20	+ if (count($args) != 1) {
21	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects one parameter", $this->getName()));
22	+ }
23	+ if ($args[0]->getIsAggregate()) {
24	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
25	+ }
26	+
27	+ $helper = $context->getHelper();
28	+ return $helper->expr()->setExpr("LOWER({$helper->cast($args[0], 'varchar(255)')->getExpr()})")->setType('varchar(255)');
29	+ }
30	+ }

app/code/local/Mana/Db/Helper/Formula/Function/Seo.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_Seo extends Mana_Db_Helper_Formula_Function {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Expr[] $args
16	+ * @throws Mana_Db_Exception_Formula
17	+ * @return Mana_Db_Model_Formula_Expr
18	+ */
19	+ public function select($context, $args) {
20	+ if (count($args) != 1) {
21	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects one parameter", $this->getName()));
22	+ }
23	+ if ($args[0]->getIsAggregate()) {
24	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
25	+ }
26	+
27	+ $helper = $context->getHelper();
28	+ /* @var $seo Mana_Core_Helper_Seo */
29	+ $seo = Mage::helper('mana_core/seo');
30	+
31	+ return $helper->expr()->setExpr("{$seo->select("LOWER({$helper->cast($args[0], 'varchar(255)')->getExpr()})")}")->setType('varchar(255)');
32	+ }
33	+ }

app/code/local/Mana/Db/Helper/Formula/Function/SkinUrl.php ADDED Viewed

	@@ -0,0 +1,32 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Function_SkinUrl extends Mana_Db_Helper_Formula_Function {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param Mana_Db_Model_Formula_Expr[] $args
16	+ * @throws Mana_Db_Exception_Formula
17	+ * @return Mana_Db_Model_Formula_Expr
18	+ */
19	+ public function select($context, $args) {
20	+ if (count($args) != 1) {
21	+ throw new Mana_Db_Exception_Formula($this->__("Function '%s' expects one parameter", $this->getName()));
22	+ }
23	+ if ($args[0]->getIsAggregate()) {
24	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
25	+ }
26	+
27	+ $helper = $context->getHelper();
28	+
29	+ $urlConstant = str_replace('\'', '\\\'', substr($args[0]->getExpr(), 1, strlen($args[0]->getExpr())));
30	+ return $helper->expr()->setExpr("'{{= {$this->getName()}(\\'$urlConstant\\')'")->setType('varchar(255)');
31	+ }
32	+ }

app/code/local/Mana/Db/Helper/Formula/Parser.php ADDED Viewed

	@@ -0,0 +1,379 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ * Language symbols:
12	+ *
13	+ * STRING ::= { ANY - '{{=' }
14	+ * Language syntax:
15	+ *
16	+ * Text ::= { Formula \| String } // no spaces
17	+ * String ::= { ANY } until '{{=' \| EOF )
18	+ * Formula ::= '{{=' Expr '}}' // spaces separate tokens
19	+ * Expr ::= AddExpr
20	+ * AddExpr ::= MulExpr ('+' \| '-') Expr
21	+ * MulExpr ::= PrimaryExpr ('*' \| '/') Expr
22	+ * PrimaryExpr ::= Function \| Field \| String \| Number \| '(' Expr ')'
23	+ * Function ::= identifier '(' { Expr ',' } ')'
24	+ * Field ::= [ identifier '.' ] identifier
25	+ */
26	+ class Mana_Db_Helper_Formula_Parser extends Mage_Core_Helper_Abstract {
27	+ const OPEN_PAR = 1;
28	+ const CLOSE_PAR = 2;
29	+ const OPEN_FORMULA = 3;
30	+ const CLOSE_FORMULA = 4;
31	+ const IDENTIFIER = 5;
32	+ const DOT = 6;
33	+ const NUMBER = 7;
34	+ const STRING = 8;
35	+ const COMMA = 9;
36	+ const MULTIPLY = 10;
37	+ const DIVIDE = 11;
38	+ const ADD = 12;
39	+ const SUBTRACT = 13;
40	+ const EOF = 14;
41	+
42	+ static $_tokens = array(
43	+ self::OPEN_PAR => '(',
44	+ self::CLOSE_PAR => ')',
45	+ self::OPEN_FORMULA => '{{=',
46	+ self::CLOSE_FORMULA => '}}',
47	+ self::DOT => '.',
48	+ self::COMMA => ',',
49	+ self::MULTIPLY => '*',
50	+ self::DIVIDE => '/',
51	+ self::ADD => '+',
52	+ self::SUBTRACT => '-',
53	+ );
54	+ static $_multiplicationOperators = array(self::MULTIPLY, self::DIVIDE);
55	+ static $_additionOperators = array(self::ADD, self::SUBTRACT);
56	+
57	+ static $_numeric = '0123456789';
58	+ static $_firstIdentifierSymbol = '_abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ';
59	+ static $_nextIdentifierSymbol = '_abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789';
60	+ static $_whitespace = " \t\r\n";
61	+ protected $_formula;
62	+ protected $_pos;
63	+ protected $_token;
64	+
65	+ /**
66	+ * @param string $formula
67	+ * @return Mana_Db_Model_Formula_Node
68	+ */
69	+ public function parse($formula) {
70	+ $parts = array();
71	+ $fromPos = 0;
72	+ for ($pos = strpos($formula, self::$_tokens[self::OPEN_FORMULA]); $pos !== false;
73	+ $pos = strpos($formula, self::$_tokens[self::OPEN_FORMULA], $fromPos))
74	+ {
75	+ if ($fromPos < $pos) {
76	+ $parts[] = $this->_parseString(substr($formula, $fromPos, $pos - $fromPos));
77	+ }
78	+ if (($fromPos = strpos($formula, self::$_tokens[self::CLOSE_FORMULA], $pos + strlen(self::$_tokens[self::OPEN_FORMULA]))) !== false) {
79	+ $parts[] = $this->parseFormula(substr($formula, $pos + strlen(self::$_tokens[self::OPEN_FORMULA]), $fromPos - ($pos + 3)));
80	+ $fromPos += strlen(self::$_tokens[self::CLOSE_FORMULA]);
81	+ }
82	+ else {
83	+ $this->_error(self::CLOSE_FORMULA);
84	+ }
85	+ }
86	+ if ($fromPos < strlen($formula)) {
87	+ $parts[] = $this->_parseString(substr($formula, $fromPos));
88	+ }
89	+ if (!count($parts)) {
90	+ $parts[] = $this->_parseNull();
91	+ }
92	+
93	+ if (count($parts) > 1) {
94	+ return new Mana_Db_Model_Formula_Node_FormulaExpr(compact('parts'));
95	+ }
96	+ else {
97	+ return $parts[0];
98	+ }
99	+ }
100	+
101	+ protected function _parseString($value) {
102	+ return new Mana_Db_Model_Formula_Node_StringConstant(compact('value'));
103	+ }
104	+
105	+ public function parseFormula($formula) {
106	+ $this->_formula = $formula;
107	+ $this->_pos = 0;
108	+ $this->_scan();
109	+
110	+ return $this->_parseExpr();
111	+ }
112	+
113	+ protected function _parseNull() {
114	+ return new Mana_Db_Model_Formula_Node_NullValue();
115	+ }
116	+
117	+ protected function _parseExpr() {
118	+ return $this->_parseAddExpr();
119	+ }
120	+
121	+ protected function _parseAddExpr() {
122	+ $a = $this->_parseMulExpr();
123	+ $operator = $this->_token->kind;
124	+
125	+ if (in_array($operator, self::$_additionOperators)) {
126	+ $this->_scan();
127	+ $b = $this->_parseExpr();
128	+ return new Mana_Db_Model_Formula_Node_Add(compact('operator', 'a', 'b'));
129	+ }
130	+ else {
131	+ return $a;
132	+ }
133	+
134	+ }
135	+
136	+ protected function _parseMulExpr() {
137	+ $a = $this->_parsePrimaryExpr();
138	+ $operator = $this->_token->kind;
139	+
140	+ if (in_array($operator, self::$_multiplicationOperators)) {
141	+ $this->_scan();
142	+ $b = $this->_parseExpr();
143	+ return new Mana_Db_Model_Formula_Node_Multiply(compact('operator', 'a', 'b'));
144	+ }
145	+ else {
146	+ return $a;
147	+ }
148	+ }
149	+
150	+ protected function _parsePrimaryExpr() {
151	+ if ($this->_token->kind == self::OPEN_PAR) {
152	+ $this->_scan();
153	+ $result = $this->_parseExpr();
154	+ $this->_expect(self::CLOSE_PAR);
155	+ return $result;
156	+ }
157	+ elseif ($this->_token->kind == self::STRING) {
158	+ $result = new Mana_Db_Model_Formula_Node_StringConstant(array('value' => $this->_token->text));
159	+ $this->_scan();
160	+ return $result;
161	+ }
162	+ elseif ($this->_token->kind == self::NUMBER) {
163	+ $result = new Mana_Db_Model_Formula_Node_NumberConstant(array('value' => $this->_token->text));
164	+ $this->_scan();
165	+ return $result;
166	+ }
167	+ elseif ($this->_token->kind == self::IDENTIFIER) {
168	+ $identifier = $this->_token->text;
169	+ $this->_scan();
170	+ if ($this->_token->kind == self::DOT) {
171	+ return $this->_parseField($identifier);
172	+ }
173	+ elseif ($this->_token->kind == self::OPEN_PAR) {
174	+ return $this->_parseFunction($identifier);
175	+ }
176	+ else {
177	+ return new Mana_Db_Model_Formula_Node_Identifier(compact('identifier'));
178	+ }
179	+ }
180	+ else {
181	+ $this->_error(Mage::helper('mana_db')->__('Invalid expression'));
182	+ return false;
183	+ }
184	+ }
185	+
186	+ protected function _parseField($identifier) {
187	+ $identifiers = array($identifier);
188	+
189	+ while ($this->_token->kind == self::DOT) {
190	+ $this->_scan();
191	+ $identifiers[] = $this->_token->text;
192	+ $this->_expect(self::IDENTIFIER);
193	+ }
194	+
195	+ return new Mana_Db_Model_Formula_Node_Field(compact('identifiers'));
196	+ }
197	+
198	+ protected function _parseFunction($name) {
199	+ $args = array();
200	+
201	+ $this->_expect(self::OPEN_PAR);
202	+
203	+ if ($this->_token->kind != self::CLOSE_PAR) {
204	+ $args[] = $this->_parseExpr();
205	+ while ($this->_token->kind == self::COMMA) {
206	+ $this->_scan();
207	+ $args[] = $this->_parseExpr();
208	+ }
209	+ }
210	+
211	+ $this->_expect(self::CLOSE_PAR);
212	+
213	+ return new Mana_Db_Model_Formula_Node_FunctionCall(compact('name', 'args'));
214	+ }
215	+
216	+ protected function _expect($tokenKind) {
217	+ if ($this->_token->kind != $tokenKind) {
218	+ $this->_error($tokenKind);
219	+ }
220	+ $this->_scan();
221	+ }
222	+
223	+ /**
224	+ * @param $errNo
225	+ * @throws Mana_Db_Exception_Formula
226	+ */
227	+ protected function _error($errNo) {
228	+ if (is_string($errNo)) {
229	+ $err = $errNo;
230	+ }
231	+ else {
232	+ $t = Mage::helper('mana_db');
233	+ switch ($errNo) {
234	+ case self::IDENTIFIER: $err = $t->__("Identifier expected"); break;
235	+ case self::NUMBER: $err = $t->__("Number constant expected"); break;
236	+ case self::STRING: $err = $t->__("String constant expected"); break;
237	+ case self::EOF: $err = $t->__("End of formula expected"); break;
238	+ default:
239	+ if (isset(self::$_tokens[$errNo])) {
240	+ $err = $t->__("'%s' expected", self::$_tokens[$errNo]);
241	+ }
242	+ else {
243	+ $err = $t->__("Syntax error");
244	+ }
245	+ break;
246	+ }
247	+ }
248	+
249	+ throw new Mana_Db_Exception_Formula($err);
250	+ }
251	+
252	+ protected function _scan() {
253	+ $this->_token = $this->_peek(1);
254	+ $this->_pos = $this->_token->pos + $this->_token->length;
255	+ }
256	+
257	+ protected function _peek($count = 1) {
258	+ $token = null;
259	+ for ($pos = $this->_pos, $i = 0; $i < $count; $i++) {
260	+ $token = $this->_internalScan($pos);
261	+ $pos = $token->pos + $token->length;
262	+ }
263	+ return $token;
264	+ }
265	+
266	+ protected function _internalScan($pos = false) {
267	+ $kind = 0;
268	+ $text = '';
269	+ $formulaLength = strlen($this->_formula);
270	+ $state = 0;
271	+ $unexpectedEof = false;
272	+ $found = false;
273	+
274	+ if ($pos === false) {
275	+ $pos = $this->_pos;
276	+ }
277	+ $whitespacePos = $pos;
278	+ while ($pos < $formulaLength) {
279	+ $ch = substr($this->_formula, $whitespacePos++, 1);
280	+ if (strpos(self::$_whitespace, $ch) !== false) {
281	+ $pos++;
282	+ }
283	+ else {
284	+ break;
285	+ }
286	+ }
287	+ $newPos = $pos;
288	+
289	+ while (!$found) {
290	+ if ($newPos < $formulaLength) {
291	+ $ch = substr($this->_formula, $newPos++, 1);
292	+ }
293	+ elseif ($unexpectedEof) {
294	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__('Unexpected end of formula'));
295	+ }
296	+ else {
297	+ $newPos++;
298	+ if ($kind === 0) {
299	+ $kind = self::EOF;
300	+ }
301	+ break;
302	+ }
303	+
304	+ switch ($state) {
305	+ case 0: // analyzing first symbol
306	+ if ($ch == '\'') {
307	+ $kind = self::STRING;
308	+ $state = 1;
309	+ $unexpectedEof = true;
310	+ }
311	+ elseif (strpos(self::$_firstIdentifierSymbol, $ch) !== false) {
312	+ $kind = self::IDENTIFIER;
313	+ $state = 3;
314	+ }
315	+ elseif (strpos(self::$_numeric, $ch) !== false) {
316	+ $kind = self::NUMBER;
317	+ $state = 4;
318	+ }
319	+ else {
320	+ foreach (self::$_tokens as $k => $v) {
321	+ if ($k != self::OPEN_FORMULA && $k != self::CLOSE_FORMULA && strpos($this->_formula, $v, $pos) === $pos) {
322	+ $kind = $k;
323	+ $text = $v;
324	+ $found = true;
325	+ $newPos++;
326	+ break;
327	+ }
328	+ }
329	+ if (!$found) {
330	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__("Unexpected character '%s'", $ch));
331	+ }
332	+ }
333	+ break;
334	+ case 1: // inside string
335	+ if ($ch == '\\') {
336	+ $state = 2;
337	+ }
338	+ elseif ($ch == '\'') {
339	+ $newPos++;
340	+ $found = true;
341	+ }
342	+ else {
343	+ $text .= $ch;
344	+ }
345	+ break;
346	+ case 2: // processing string escape symbol
347	+ switch ($ch) {
348	+ case '\'':
349	+ case '\\':
350	+ $text .= $ch;
351	+ break;
352	+ default:
353	+ $text .= '\\';
354	+ break;
355	+ }
356	+ $state = 1;
357	+ break;
358	+ case 3: // reading identifier
359	+ if (strpos(self::$_nextIdentifierSymbol, $ch) === false) {
360	+ $found = true;
361	+ }
362	+ break;
363	+ case 4: // reading number
364	+ if (strpos(self::$_numeric, $ch) === false) {
365	+ $found = true;
366	+ }
367	+ break;
368	+ }
369	+ }
370	+
371	+ $length = $newPos - $pos - 1;
372	+
373	+ if (!$text && $length) {
374	+ $text = substr($this->_formula, $pos, $length);
375	+ }
376	+ return (object)compact('kind', 'text', 'pos', 'length');
377	+ }
378	+
379	+ }

app/code/local/Mana/Db/Helper/Formula/Processor.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Db_Helper_Formula_Processor extends Mage_Core_Helper_Abstract {
13	+ protected static $_eavEntityTypes = array();
14	+
15	+ /**
16	+ * @param Mana_Db_Model_Formula_Context $context
17	+ * @param string $field
18	+ * @return Mana_Db_Model_Formula_Expr \| bool
19	+ */
20	+ public function selectField(/** @noinspection PhpUnusedParameterInspection */$context, $field) {
21	+ return false;
22	+ }
23	+
24	+ /**
25	+ * @param Mana_Db_Model_Formula_Context $context
26	+ * @param string $entity
27	+ * @return Mana_Db_Model_Formula_Entity \| bool
28	+ */
29	+ public function selectEntity(/** @noinspection PhpUnusedParameterInspection */$context, $entity) {
30	+ return false;
31	+ }
32	+
33	+ abstract public function getPrimaryKey($entity);
34	+
35	+ public function getProcessor($entity) {
36	+ /* @var $dbConfig Mana_Db_Helper_Config */
37	+ $dbConfig = Mage::helper('mana_db/config');
38	+
39	+ if ($dbConfig->getScopeXml($entity)) {
40	+ return 'entity';
41	+ }
42	+ elseif ($this->getEavEntityType($entity)) {
43	+ return 'eav';
44	+ }
45	+ else {
46	+ return 'table';
47	+ }
48	+ }
49	+
50	+ /**
51	+ * @param string $entity
52	+ * @return Mage_Eav_Model_Entity_Type \| bool
53	+ */
54	+ public function getEavEntityType($entity) {
55	+ if (!isset(self::$_eavEntityTypes[$entity])) {
56	+ /* @var $entityType Mage_Eav_Model_Entity_Type */
57	+ $entityType = Mage::getModel('eav/entity_type');
58	+ $entityType->load($entity, 'entity_model');
59	+ self::$_eavEntityTypes[$entity] = $entityType->getId() ? $entityType : false;
60	+ }
61	+ return self::$_eavEntityTypes[$entity];
62	+ }
63	+ }

app/code/local/Mana/Db/Helper/Formula/Processor/Eav.php ADDED Viewed

	@@ -0,0 +1,41 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Processor_Eav extends Mana_Db_Helper_Formula_Processor {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param string $field
16	+ * @return Mana_Db_Model_Formula_Expr \| bool
17	+ */
18	+ public function selectField($context, $field) {
19	+ if ($result = parent::selectField($context, $field)) {
20	+ return $result;
21	+ }
22	+
23	+ $eavEntityType = $this->getEavEntityType($context->getEntity());
24	+ /* @var $attribute Mage_Eav_Model_Entity_Attribute */
25	+ $attribute = $eavEntityType->getAttributeCollection()->getItemByColumnValue('attribute_code', $field);
26	+
27	+ if ($attribute) {
28	+ return $context->getHelper()->expr()
29	+ ->setFieldExpr($context->getAlias()->fieldExpr($context, $field))
30	+ ->setFieldName($field)
31	+ ->setType($attribute->getBackendType());
32	+ }
33	+ else {
34	+ return false;
35	+ }
36	+ }
37	+
38	+ public function getPrimaryKey($entity) {
39	+ return 'entity_id';
40	+ }
41	+ }

app/code/local/Mana/Db/Helper/Formula/Processor/Entity.php ADDED Viewed

	@@ -0,0 +1,178 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Processor_Entity extends Mana_Db_Helper_Formula_Processor {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param string $field
16	+ * @return Mana_Db_Model_Formula_Expr \| bool
17	+ */
18	+ public function selectField($context, $field) {
19	+ if ($result = parent::selectField($context, $field)) {
20	+ return $result;
21	+ }
22	+
23	+ /* @var $dbConfig Mana_Db_Helper_Config */
24	+ $dbConfig = Mage::helper('mana_db/config');
25	+
26	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
27	+ $formulaHelper = Mage::helper('mana_db/formula');
28	+
29	+ /* @var $fieldsXml Varien_Simplexml_Element */
30	+ /** @noinspection PhpUndefinedFieldInspection */
31	+ $fieldsXml = $dbConfig->getScopeXml($context->getEntity())->fields;
32	+
33	+ if (isset($fieldsXml->$field)) {
34	+ $alias = $context->getAlias();
35	+ return $context->getHelper()->expr()
36	+ ->setFieldExpr($alias->fieldExpr($context, $field))
37	+ ->setFieldName($field)
38	+ ->setType((string)$fieldsXml->$field->type);
39	+ }
40	+ else {
41	+ return false;
42	+ }
43	+ }
44	+
45	+ /**
46	+ * @param Mana_Db_Model_Formula_Context $context
47	+ * @param string $entity
48	+ * @return Mana_Db_Model_Formula_Entity \| bool
49	+ */
50	+ public function selectEntity($context, $entity) {
51	+ if ($aggregateContext = parent::selectEntity($context, $entity)) {
52	+ return $aggregateContext;
53	+ }
54	+
55	+ /* @var $dbConfig Mana_Db_Helper_Config */
56	+ $dbConfig = Mage::helper('mana_db/config');
57	+
58	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
59	+ $formulaHelper = Mage::helper('mana_db/formula');
60	+
61	+ $scopeXml = $dbConfig->getScopeXml($context->getEntity());
62	+ if ($result = $this->_selectEntityBasedOnXml($context, $scopeXml->formula->base->from, $entity, 'foreign')) {
63	+ $this->setForeignJoin($context, $result);
64	+ return $result;
65	+ }
66	+ if ($result = $this->_selectEntityBasedOnXml($context, $scopeXml->formula->base->join, $entity, 'foreign')) {
67	+ $this->setForeignJoin($context, $result);
68	+ return $result;
69	+ }
70	+ if ($result = $this->_selectEntityBasedOnXml($context, $scopeXml->formula->aggregate, $entity, 'aggregate')) {
71	+ return $result;
72	+ }
73	+ if ($result = $this->_selectEntityBasedOnXml($context, $scopeXml->formula->frontend, $entity, 'frontend')) {
74	+ return $result;
75	+ }
76	+ $field = $entity.'_id_0';
77	+ if (isset($scopeXml->fields->$field)) {
78	+ $fieldPrefix = $entity . '_id_';
79	+ /* @var $result Mana_Db_Model_Formula_Entity */
80	+ $result = Mage::getModel('mana_db/formula_entity');
81	+
82	+ $entityName = (string)$scopeXml->fields->$field->foreign->entity;
83	+ $fields = array();
84	+
85	+ $result
86	+ ->setHelper('aggregate_field')
87	+ ->setEntity($entityName)
88	+ ->setProcessor($this->getProcessor($entityName));
89	+
90	+ /* @var $core Mana_Core_Helper_Data */
91	+ $core = Mage::helper('mana_core');
92	+ $compositeAlias = array();
93	+
94	+ /* @var $joinClosure Mana_Db_Model_Formula_Closure_AggregateFieldJoin */
95	+ $joinClosure = Mage::getModel('mana_db/formula_closure_aggregateFieldJoin', compact('context', 'result'));
96	+
97	+ foreach ($scopeXml->fields->children() as $fieldName => $fieldXml) {
98	+ if ($core->startsWith($fieldName, $fieldPrefix)) {
99	+ $index = (int)substr($fieldName, strlen($fieldPrefix));
100	+ $context->getAlias()->child($formulaHelper->createAlias($entity . $index))->each($joinClosure
101	+ ->setTargetIndex($index)
102	+ ->setEntityName($entityName)
103	+ ->setFieldXml($fieldXml));
104	+ }
105	+ }
106	+ $compositeAlias = $joinClosure->getCompositeAlias();
107	+ $fields = $joinClosure->getFields();
108	+ ksort($compositeAlias);
109	+ ksort($fields);
110	+
111	+ return $result
112	+ ->setAlias($formulaHelper->createAlias($compositeAlias))
113	+ ->setAggregateFields($fields);
114	+ }
115	+
116	+ return false;
117	+ }
118	+
119	+ /**
120	+ * @param Mana_Db_Model_Formula_Context $context
121	+ * @param Mana_Db_Model_Formula_Entity $entity
122	+ */
123	+ protected function setForeignJoin($context, $entity) {
124	+ /* @var $joinClosure Mana_Db_Model_Formula_Closure_ForeignJoin */
125	+ $joinClosure = Mage::getModel('mana_db/formula_closure_foreignJoin', compact('context', 'entity'));
126	+ $entity->setForeignJoin($context->getAlias()->each($joinClosure));
127	+ }
128	+
129	+ public function getPrimaryKey($entity) {
130	+ return 'id';
131	+ }
132	+
133	+ /**
134	+ * @param Mana_Db_Model_Formula_Context $context
135	+ * @param Varien_Simplexml_Element $xml
136	+ * @param string $entity
137	+ * @param string $mode
138	+ * @return Mana_Db_Model_Formula_Entity
139	+ */
140	+ protected function _selectEntityBasedOnXml($context, $xml, $entity, $mode) {
141	+ if (isset($xml->$entity)) {
142	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
143	+ $formulaHelper = Mage::helper('mana_db/formula');
144	+
145	+ /* @var $entityXml Varien_Simplexml_Element */
146	+ /** @noinspection PhpUndefinedFieldInspection */
147	+ $entityXml = $xml->$entity;
148	+
149	+ /* @var $result Mana_Db_Model_Formula_Entity */
150	+ $result = Mage::getModel('mana_db/formula_entity');
151	+
152	+ if ($entity == 'primary') {
153	+ /* @var $dbConfig Mana_Db_Helper_Config */
154	+ $dbConfig = Mage::helper('mana_db/config');
155	+
156	+ $scopeXml = $dbConfig->getScopeXml($context->getEntity());
157	+ /** @noinspection PhpUndefinedFieldInspection */
158	+ $entityName = (string)$scopeXml->flattens;
159	+ }
160	+ else {
161	+ /** @noinspection PhpUndefinedFieldInspection */
162	+ $entityName = (string)$entityXml->entity;
163	+ }
164	+ $data = $entityXml->asArray();
165	+ $alias = $context->getAlias()->child($formulaHelper->createAlias($entity));
166	+
167	+ return $result
168	+ ->setHelper($mode)
169	+ ->setAlias($alias)
170	+ ->setEntity($entityName)
171	+ ->setProcessor($this->getProcessor($entityName))
172	+ ->addData($data ? $data : array());
173	+ }
174	+ else {
175	+ return false;
176	+ }
177	+ }
178	+ }

app/code/local/Mana/Db/Helper/Formula/Processor/System.php ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Processor_System extends Mana_Db_Helper_Formula_Processor {
13	+ public function getPrimaryKey($entity) {
14	+ return '';
15	+ }
16	+ }

app/code/local/Mana/Db/Helper/Formula/Processor/Table.php ADDED Viewed

	@@ -0,0 +1,86 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Processor_Table extends Mana_Db_Helper_Formula_Processor {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Context $context
15	+ * @param string $field
16	+ * @return Mana_Db_Model_Formula_Expr \| bool
17	+ */
18	+ public function selectField($context, $field) {
19	+ if ($result = parent::selectField($context, $field)) {
20	+ return $result;
21	+ }
22	+
23	+ /* @var $resource Mana_Db_Resource_Formula */
24	+ $resource = Mage::getResourceSingleton('mana_db/formula');
25	+
26	+ $fields = $resource->getTableFields($context->getEntity());
27	+
28	+ if (isset($fields[$field])) {
29	+ return $context->getHelper()->expr()
30	+ ->setFieldExpr($context->getAlias()->fieldExpr($context, $field))
31	+ ->setFieldName($field)
32	+ ->setType($fields[$field]['DATA_TYPE']);
33	+ }
34	+ else {
35	+ /* @var $dbConfig Mana_Db_Helper_Config */
36	+ $dbConfig = Mage::helper('mana_db/config');
37	+
38	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
39	+ $formulaHelper = Mage::helper('mana_db/formula');
40	+
41	+ /* @var $fieldsXml Varien_Simplexml_Element */
42	+ /** @noinspection PhpUndefinedFieldInspection */
43	+ $fieldsXml = $dbConfig->getTableXml($context->getEntity())->fields;
44	+
45	+ if (isset($fieldsXml->$field)) {
46	+ $alias = $context->getAlias();
47	+ $formula = $fieldsXml->$field->formula;
48	+ $context->resetLocalAliases();
49	+
50	+ if (isset($formula->join)) {
51	+ /* @var $joinContainerXml Varien_Simplexml_Element */
52	+ $joinContainerXml = $formula->join;
53	+ foreach ($joinContainerXml->children() as $joinAlias => $definition) {
54	+ /* @var $joinClosure Mana_Db_Model_Formula_Closure_Join */
55	+ $joinClosure = Mage::getModel('mana_db/formula_closure_join', compact('context', 'definition'));
56	+ $alias
57	+ ->child($formulaHelper->createAlias($joinAlias))
58	+ ->each($joinClosure);
59	+
60	+ }
61	+ }
62	+ return $context->getHelper()->expr()
63	+ ->setFieldExpr($alias->expr($context, (string)$formula->expr))
64	+ ->setFieldName($field)
65	+ ->setType((string)$fieldsXml->$field->type);
66	+ }
67	+ else {
68	+ return false;
69	+ }
70	+ }
71	+ }
72	+
73	+ public function getPrimaryKey($entity) {
74	+ /* @var $resource Mana_Db_Resource_Formula */
75	+ $resource = Mage::getResourceSingleton('mana_db/formula');
76	+
77	+ foreach ($resource->getTableFields($entity) as $field) {
78	+ if (!empty($field['PRIMARY'])) {
79	+ return $field['COLUMN_NAME'];
80	+ }
81	+ }
82	+
83	+ return false;
84	+ }
85	+
86	+ }

app/code/local/Mana/Db/Helper/Formula/Selector.php ADDED Viewed

	@@ -0,0 +1,450 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Helper_Formula_Selector extends Mana_Db_Helper_Formula_Abstract {
13	+ protected $_methodPrefix = '_select';
14	+
15	+ /**
16	+ * @param Mana_Db_Model_Formula_Expr $expr
17	+ * @param string $type
18	+ * @throws Mana_Db_Exception_Formula
19	+ * @return Mana_Db_Model_Formula_Expr
20	+ */
21	+ public function cast($expr, $type) {
22	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
23	+ $formulaHelper = Mage::helper('mana_db/formula');
24	+
25	+ $sourceType = $formulaHelper->getType($expr->getType());
26	+ $targetType = $formulaHelper->getType($type);
27	+ if ($targetType == 'string') {
28	+ if ($sourceType != 'string') {
29	+ $expr = $this->expr()->setExpr("CONCAT({$expr->getExpr()})")->setType($type);
30	+ }
31	+ }
32	+ elseif ($targetType == 'int') {
33	+ if ($sourceType != 'int') {
34	+ $expr = $this->expr()->setExpr("CAST({$expr->getExpr()} AS $type)")->setType($type);
35	+ }
36	+ }
37	+
38	+ return $expr;
39	+ }
40	+
41	+ /**
42	+ * @param Mana_Db_Model_Formula_Expr $expr1
43	+ * @param Mana_Db_Model_Formula_Expr $expr2
44	+ */
45	+ public function binaryCast(&$expr1, &$expr2) {
46	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
47	+ $formulaHelper = Mage::helper('mana_db/formula');
48	+
49	+ if ($formulaHelper->getType($expr1->getType()) == 'string' \|\| $formulaHelper->getType($expr2->getType()) == 'string') {
50	+ $expr1 = $this->cast($expr1, 'varchar(255)');
51	+ $expr2 = $this->cast($expr2, 'varchar(255)');
52	+ }
53	+ }
54	+
55	+ /**
56	+ * @param Mana_Db_Model_Formula_Context $context
57	+ * @param Mana_Db_Model_Formula_Node $formula
58	+ */
59	+ public function selectFormula(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
60	+ $expr = $this->_select($context, $formula);
61	+ if ($expr->getIsAggregate()) {
62	+ throw new Mana_Db_Exception_Formula($this->__("Aggregate field used outside of aggregate function"));
63	+ }
64	+ $expr = $this->cast($expr, $context->getField()->getType());
65	+ $expr = $this->_getOverriddenValueExpr($context, $expr->getExpr());
66	+ $context->getSelect()->columns(array($context->getField()->getName() => new Zend_Db_Expr(
67	+ $expr)));
68	+ }
69	+
70	+ public function filterFormula(/** @noinspection PhpUnusedParameterInspection */$context, $formula, $id) {
71	+ $context->getSelect()->where($this->_select($context, $formula)->getExpr() .' = ?', $id);
72	+ }
73	+
74	+ /**
75	+ * @param Mana_Db_Model_Formula_Context $context
76	+ * @param Mana_Db_Model_Formula_Node $formula
77	+ * @return Mana_Db_Model_Formula_Expr
78	+ */
79	+ protected function _select(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
80	+ return $this->_call(func_get_args());
81	+ }
82	+
83	+ /**
84	+ * @param Mana_Db_Model_Formula_Context $context
85	+ * @param mixed $value
86	+ * @throws Exception
87	+ */
88	+ public function selectValue($context, $value) {
89	+ $expr = $this->_getOverriddenValueExpr($context, $this->_getValue($context, $value));
90	+ $context->getSelect()->columns(array($context->getField()->getName() => new Zend_Db_Expr($expr)));
91	+ }
92	+
93	+ /**
94	+ * @param Mana_Db_Model_Formula_Context $context
95	+ * @param mixed $value
96	+ * @return string
97	+ */
98	+ protected function _getValue($context, $value) {
99	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
100	+ $formulaHelper = Mage::helper('mana_db/formula');
101	+
102	+ if ($formulaHelper->getType($context->getField()->getType()) == 'int') {
103	+ return $value;
104	+ }
105	+ else {
106	+ /* @var $resource Mana_Db_Resource_Formula */
107	+ $resource = Mage::getResourceSingleton('mana_db/formula');
108	+
109	+ return $resource->getReadConnection()->quote($value);
110	+ }
111	+ }
112	+
113	+ /**
114	+ * @param Mana_Db_Model_Formula_Context $context
115	+ * @param mixed $value
116	+ * @return string
117	+ */
118	+ protected function _getDefaultValue($context) {
119	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
120	+ $formulaHelper = Mage::helper('mana_db/formula');
121	+
122	+ if ($formulaHelper->getType($context->getField()->getType()) == 'int') {
123	+ return "0";
124	+ }
125	+ else {
126	+ return "''";
127	+ }
128	+ }
129	+
130	+ /**
131	+ * @param Mana_Db_Model_Formula_Context $context
132	+ */
133	+ public function selectDefaultValue($context) {
134	+ $expr = $this->_getOverriddenValueExpr($context, $this->_getDefaultValue($context));
135	+ $context->getSelect()->columns(array($context->getField()->getName() => new Zend_Db_Expr($expr)));
136	+ }
137	+
138	+ /**
139	+ * @param Mana_Db_Model_Formula_Context $context
140	+ * @return bool
141	+ */
142	+ public function selectSystemField($context) {
143	+ if ($context->getField()->getRole() == Mana_Db_Helper_Config::ROLE_PRIMARY_KEY) {
144	+ return false;
145	+ }
146	+
147	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
148	+ $formulaHelper = Mage::helper('mana_db/formula');
149	+
150	+ $fieldExpr = "`{$context->registerAlias('primary')}`.`{$context->getField()->getName()}`";
151	+ if ($context->getField()->hasValue()) {
152	+ $context->getSelect()->columns(array($context->getField()->getName() => new Zend_Db_Expr(
153	+ "COALESCE($fieldExpr, {$this->_getValue($context, $context->getField()->getValue())})")));
154	+ }
155	+ else {
156	+ $context->getSelect()->columns(array(
157	+ $context->getField()->getName() => new Zend_Db_Expr(
158	+ "COALESCE($fieldExpr, {$this->_getDefaultValue($context)})")
159	+ ));
160	+ }
161	+ return true;
162	+ }
163	+
164	+ /**
165	+ * @param Mana_Db_Model_Formula_Context $context
166	+ * @param Mana_Db_Model_Formula_Node_Add $formula
167	+ * @throws Mana_Db_Exception_Formula
168	+ * @throws Exception
169	+ * @return Mana_Db_Model_Formula_Expr
170	+ */
171	+ protected function _selectAdd($context, $formula) {
172	+ if ($context->getIsAggregate()) {
173	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
174	+ }
175	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
176	+ $formulaHelper = Mage::helper('mana_db/formula');
177	+
178	+ $a = $this->_select($context, $formula->a);
179	+ $b = $this->_select($context, $formula->b);
180	+ $this->binaryCast($a, $b);
181	+ switch ($formula->operator) {
182	+ case Mana_Db_Model_Formula_Node_Add::ADD:
183	+ if ($formulaHelper->getType($a->getType()) == 'string') {
184	+ return $this->expr()->setExpr("CONCAT({$a->getExpr()}, {$b->getExpr()})")->setType($a->getType());
185	+ }
186	+ else {
187	+ return $this->expr()->setExpr("{$a->getExpr()} + {$b->getExpr()}")->setType($a->getType());
188	+ }
189	+ case Mana_Db_Model_Formula_Node_Add::SUBTRACT:
190	+ if ($formulaHelper->getType($a->getType()) == 'string') {
191	+ throw new Mana_Db_Exception_Formula($this->__("'%s' operator is not supported on fields of %s type", '-', 'string'));
192	+ }
193	+ else {
194	+ return $this->expr()->setExpr("{$a->getExpr()} - {$b->getExpr()}")->setType($a->getType());
195	+ }
196	+ default:
197	+ throw new Exception('Not implemented');
198	+ }
199	+ }
200	+
201	+ /**
202	+ * Converts parsed field expression $formula into SQL column expression. If needed, introduces new joins in current
203	+ * SELECT.
204	+ *
205	+ * @param Mana_Db_Model_Formula_Context $originalContext
206	+ * @param Mana_Db_Model_Formula_Node_Field $formula
207	+ * @throws Mana_Db_Exception_Formula
208	+ * @return Mana_Db_Model_Formula_Expr
209	+ *
210	+ * Field expression looks like "a.b.c.d".
211	+ *
212	+ * The last identifier is field name (in case of system configuration fields field
213	+ * name consists of 3 last identifiers "b.c.d").
214	+ *
215	+ * All the identifiers before field name ("a.b.c") are entity names. Each of them is either foreign entities,
216	+ * frontend entities or aggregate entities:
217	+ * * foreign entity example: catalog/product for sales/order_item. For foreign entity LEFT or INNER JOIN is added based on
218	+ * foreign key and primary key relationship and column using that foreign key is added.
219	+ * * aggregate entity example sales/order_item for sales/order. Fields from aggregate entities are returned to
220	+ * parent formula node which is expected to be an aggregate formula such as GLUE, SUM, MAX. In final SQL aggregate
221	+ * fields appear as sub selects, so sub select object is returned for aggregate field as well.
222	+ * * frontend entity example: catalog/category for mana_attributepage/page (in database there is no relation to
223	+ * frontend entity, but it is known when calculated in frontend, typically from Mage::registry()). Such entities
224	+ * are left unprocessed (with type = 'formula,int' or 'formula,string') and are only processed before displaying
225	+ * data in frontend. Frontend entities can appear in identifier chain in first position only.
226	+ *
227	+ * How these entity types behave in identifier chain:
228	+ * * foreign entity:
229	+ * * no aggregate or frontend entity met: adds JOIN to main SELECT and changes current entity in main context
230	+ * * inside aggregate, no frontend entity met: adds JOIN to aggregate SUBSELECT and changes current entity in
231	+ * subselect context
232	+ * * inside frontend entity: changes current entity in main context
233	+ * * aggregate entity:
234	+ * * no frontend entity met: creates aggregate context to collect aggregate subselect
235	+ * * inside frontend entity: changes current entity in main context
236	+ * * frontend entity: sets a flag for processing frontend entity
237	+ */
238	+ protected function _selectField($originalContext, $formula) {
239	+ if ($formula->identifiers[0] == 'this') {
240	+ if (count($formula->identifiers) == 1) {
241	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__("'%s' is entity, but field expected", implode('.', $formula->identifiers)));
242	+ }
243	+ $formula->identifiers = array_slice($formula->identifiers, 1);
244	+ if (count($formula->identifiers) == 1) {
245	+ /* @var $identifier Mana_Db_Model_Formula_Node_Identifier */
246	+ $identifier = Mage::getModel('mana_db/formula_node_identifier');
247	+ $identifier->identifier = $formula->identifiers[0];
248	+ $this->_selectIdentifier($originalContext, $identifier);
249	+ }
250	+ }
251	+ $context = clone $originalContext;
252	+ $result = $this->_selectFieldRecursively($context, $formula, 0);
253	+ $originalContext->copyAliases($context);
254	+ return $result;
255	+ }
256	+
257	+ /**
258	+ * Converts parsed field expression $formula into SQL column expression. If needed, introduces new joins in current
259	+ * SELECT.
260	+ *
261	+ * @param Mana_Db_Model_Formula_Context $context
262	+ * @param Mana_Db_Model_Formula_Node_Field $formula
263	+ * @param int $index
264	+ * @throws Mana_Db_Exception_Formula
265	+ * @return Mana_Db_Model_Formula_Expr
266	+ */
267	+ protected function _selectFieldRecursively($context, $formula, $index) {
268	+ $processor = $context->getProcessor();
269	+ if (isset($formula->identifiers[$index])) {
270	+ $identifier = $formula->identifiers[$index];
271	+ }
272	+ else {
273	+ throw new Mana_Db_Exception_Formula(Mage::helper('mana_db')->__("'%s' is entity, but field expected", implode('.', $formula->identifiers)));
274	+ }
275	+
276	+ if ($result = $processor->selectField($context, implode('.', array_slice($formula->identifiers, $index)))) {
277	+ $context->getEntityHelper()->selectField($context, $formula, $result);
278	+ return $result;
279	+ }
280	+ else {
281	+ if ($entity = $processor->selectEntity($context, $identifier)) {
282	+ $entity->getHelper()->select($context, $entity);
283	+ $result = $this->_selectFieldRecursively($context, $formula, ++$index);
284	+ $entity->getHelper()->endSelect($context, $entity);
285	+ return $result;
286	+ }
287	+ elseif ($index == 0) {
288	+ $context->setEntity($context->getPrimaryEntity());
289	+ return $this->_selectFieldRecursively($context, $formula, $index);
290	+ }
291	+ else {
292	+ throw new Mana_Db_Exception_Formula($this->__("Unknown field or entity '%s'", $identifier));
293	+ }
294	+ }
295	+ }
296	+
297	+ /**
298	+ * @param Mana_Db_Model_Formula_Context $context
299	+ * @param Mana_Db_Model_Formula_Node_FormulaExpr $formula
300	+ * @return Mana_Db_Model_Formula_Expr
301	+ */
302	+ protected function _selectFormulaExpr($context, $formula) {
303	+ $parts = array();
304	+ foreach ($formula->parts as $part) {
305	+ $parts[] = $this->cast($this->_select($context, $part), 'varchar(255)')->getExpr();
306	+ }
307	+ $parts = implode(', ', $parts);
308	+ return $this->expr()->setExpr("CONCAT($parts)")->setType('varchar(255)');
309	+ }
310	+
311	+ /**
312	+ * @param Mana_Db_Model_Formula_Context $context
313	+ * @param Mana_Db_Model_Formula_Node_FunctionCall $formula
314	+ * @return Mana_Db_Model_Formula_Expr
315	+ */
316	+ protected function _selectFunctionCall($context, $formula) {
317	+ $args = array();
318	+ foreach ($formula->args as $arg) {
319	+ $args[] = $this->_select($context, $arg);
320	+ }
321	+
322	+ return $this->getFunction($formula->name)->select($context, $args);
323	+ }
324	+
325	+ /**
326	+ * @param Mana_Db_Model_Formula_Context $context
327	+ * @param Mana_Db_Model_Formula_Node_Identifier $formula
328	+ * @throws Mana_Db_Exception_Formula
329	+ * @return Mana_Db_Model_Formula_Expr
330	+ */
331	+ protected function _selectIdentifier($context, $formula) {
332	+ if ($result = $context->getProcessor()->selectField($context, $formula->identifier)) {
333	+ $context->getEntityHelper()->selectField($context, null, $result);
334	+
335	+ return $result;
336	+ }
337	+ else {
338	+ throw new Mana_Db_Exception_Formula($this->__("Can't evaluate '%s'", $formula->identifier));
339	+ }
340	+ }
341	+
342	+ /**
343	+ * @param Mana_Db_Model_Formula_Context $context
344	+ * @param Mana_Db_Model_Formula_Node_Multiply $formula
345	+ * @throws Mana_Db_Exception_Formula
346	+ * @throws Exception
347	+ * @return Mana_Db_Model_Formula_Expr
348	+ */
349	+ protected function _selectMultiply($context, $formula) {
350	+ if ($context->getIsAggregate()) {
351	+ throw new Mana_Db_Exception_Formula($this->__("You can only use aggregate function on aggregate fields"));
352	+ }
353	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
354	+ $formulaHelper = Mage::helper('mana_db/formula');
355	+
356	+ $a = $this->_select($context, $formula->a);
357	+ $b = $this->_select($context, $formula->b);
358	+ $this->binaryCast($a, $b);
359	+ switch ($formula->operator) {
360	+ case Mana_Db_Model_Formula_Node_Multiply::MULTIPLY:
361	+ if ($formulaHelper->getType($a->getType()) == 'string') {
362	+ throw new Mana_Db_Exception_Formula($this->__("'%s' operator is not supported on fields of %s type", '*', 'string'));
363	+ }
364	+ else {
365	+ return $this->expr()->setExpr("{$a->getExpr()} * {$b->getExpr()}")->setType($a->getType());
366	+ }
367	+ case Mana_Db_Model_Formula_Node_Multiply::DIVIDE:
368	+ if ($formulaHelper->getType($a->getType()) == 'string') {
369	+ throw new Mana_Db_Exception_Formula($this->__("'%s' operator is not supported on fields of %s type", '/', 'string'));
370	+ }
371	+ else {
372	+ return $this->expr()->setExpr("{$a->getExpr()} / {$b->getExpr()}")->setType($a->getType());
373	+ }
374	+ default:
375	+ throw new Exception('Not implemented');
376	+ }
377	+ }
378	+
379	+ /**
380	+ * @param Mana_Db_Model_Formula_Context $context
381	+ * @param Mana_Db_Model_Formula_Node_NullValue $formula
382	+ * @return Mana_Db_Model_Formula_Expr
383	+ */
384	+ protected function _selectNullValue(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
385	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
386	+ $formulaHelper = Mage::helper('mana_db/formula');
387	+
388	+ $type = $context->getField()->getType();
389	+ $formulaType = $formulaHelper->getType($type);
390	+ if ($formulaType == 'int') {
391	+ return $this->expr()->setExpr("0")->setType($type);
392	+ }
393	+ else {
394	+ return $this->expr()->setExpr("''")->setType($type);
395	+ }
396	+ }
397	+
398	+ /**
399	+ * @param Mana_Db_Model_Formula_Context $context
400	+ * @param Mana_Db_Model_Formula_Node_NumberConstant $formula
401	+ * @return Mana_Db_Model_Formula_Expr
402	+ */
403	+ protected function _selectNumberConstant(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
404	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
405	+ $formulaHelper = Mage::helper('mana_db/formula');
406	+
407	+ return $this->expr()->setExpr("{$formula->value}")->setType($formulaHelper->getMinimumNumericType($formula->value));
408	+ }
409	+
410	+ /**
411	+ * @param Mana_Db_Model_Formula_Context $context
412	+ * @param Mana_Db_Model_Formula_Node_StringConstant $formula
413	+ * @return Mana_Db_Model_Formula_Expr
414	+ */
415	+ protected function _selectStringConstant(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
416	+ return $this->expr()->setExpr("'{$formula->value}'")->setType('varchar(255)');
417	+ }
418	+
419	+ /**
420	+ * @param Mana_Db_Model_Formula_Context $context
421	+ * @param Mana_Db_Model_Formula_Node $formula
422	+ */
423	+ protected function _selectNode(/** @noinspection PhpUnusedParameterInspection */$context, $formula) {
424	+ // all future nodes ignored
425	+ }
426	+
427	+ /**
428	+ * @param Mana_Db_Model_Formula_Context $context
429	+ * @param string $defaultExpr
430	+ * @return string
431	+ */
432	+ protected function _getOverriddenValueExpr($context, $defaultExpr) {
433	+ if (($no = $context->getField()->getNo()) !== null) {
434	+ $overriddenExpr = "`p`.`{$context->getField()->getName()}`";
435	+ if ($overriddenExpr != $defaultExpr) {
436	+ /* @var $db Mana_Db_Helper_Data */
437	+ $db = Mage::helper('mana_db');
438	+
439	+ $condition = "`p`.`default_mask{$db->getMaskIndex($no)}` & {$db->getMask($no)} = {$db->getMask($no)}";
440	+ return "IF ($condition, $overriddenExpr, $defaultExpr)";
441	+ }
442	+ else {
443	+ return $overriddenExpr;
444	+ }
445	+ }
446	+ else {
447	+ return $defaultExpr;
448	+ }
449	+ }
450	+ }

app/code/local/Mana/Db/Model/Entity.php ADDED Viewed

	@@ -0,0 +1,296 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getScopeName()
11	+ * @method int getEditStatus()
12	+ * @method Mana_Db_Model_Entity setEditStatus(int $value)
13	+ * @method Mana_Db_Model_Entity setEditSessionId(int $value)
14	+ * @method Mana_Db_Model_Entity setEditMassaction(int $value)
15	+ * @method string getDefaultFormulas()
16	+ * @method int getStoreId()
17	+ * @method Mana_Db_Model_Entity setStoreId(int $value)
18	+ * @method int getGlobalId()
19	+ * @method Mana_Seo_Model_Schema setGlobalId(int $value)
20	+ * @method int getPrimaryId()
21	+ * @method Mana_Seo_Model_Schema setPrimaryId(int $value)
22	+ * @method int getPrimaryGlobalId()
23	+ * @method Mana_Seo_Model_Schema setPrimaryGlobalId(int $value)
24	+ */
25	+ class Mana_Db_Model_Entity extends Mage_Core_Model_Abstract {
26	+ protected $_scope;
27	+ protected $_isIndexingDisabled = false;
28	+ protected $_jsons;
29	+
30	+ public function __construct($data = null) {
31	+ if (is_array($data)) {
32	+ if (isset($data['scope'])) {
33	+ $this->_scope = $data['scope'];
34	+ unset($data['scope']);
35	+ }
36	+ }
37	+
38	+ parent::__construct($data);
39	+ }
40	+
41	+ public function loadForStore($id, $storeId, $fieldName = 'global_id') {
42	+ $this->_getResource()->loadForStore($this, $id, $storeId, $fieldName);
43	+ $this->_afterLoad();
44	+ $this->setOrigData();
45	+ $this->_hasDataChanges = false;
46	+
47	+ return $this;
48	+ }
49	+
50	+ protected function _construct() {
51	+ $this->_initScope();
52	+ }
53	+
54	+ protected function _initScope() {
55	+ /* @var $db Mana_Db_Helper_Data */
56	+ $db = Mage::helper('mana_db');
57	+
58	+ $this->_init($db->getScopedName($this->_scope), 'id');
59	+
60	+ return $this;
61	+ }
62	+
63	+ protected function _getResource() {
64	+ /* @var $db Mana_Db_Helper_Data */
65	+ $db = Mage::helper('mana_db');
66	+
67	+ if (empty($this->_resourceName)) {
68	+ Mage::throwException(Mage::helper('core')->__('Resource is not set.'));
69	+ }
70	+
71	+ return $db->getResourceSingleton($this->_resourceName);
72	+ }
73	+
74	+ public function getScope() {
75	+ return $this->_scope;
76	+ }
77	+
78	+ public function assignDefaultValues() {
79	+ $this->setDummy(true);
80	+ return $this;
81	+ }
82	+
83	+ public function addGridCellData($cells) {
84	+ foreach ($cells as $column => $cell) {
85	+ $this->overrideData($column, $cell['value']);
86	+ }
87	+ return $this;
88	+ }
89	+
90	+ public function loadEdited($id, $sessionId) {
91	+ $this->_beforeLoad($id);
92	+
93	+ /* @var $resource Mana_Db_Resource_Entity */
94	+ $resource = $this->_getResource();
95	+ $resource->loadEdited($this, $id, $sessionId);
96	+
97	+ $this->_afterLoad();
98	+ $this->setOrigData();
99	+ $this->_hasDataChanges = false;
100	+ return $this;
101	+ }
102	+
103	+ public function disableIndexing() {
104	+ $this->_isIndexingDisabled = true;
105	+ return $this;
106	+ }
107	+
108	+ public function enableIndexing() {
109	+ $this->_isIndexingDisabled = false;
110	+ return $this;
111	+ }
112	+
113	+ public function updateIndexes() {
114	+ return $this;
115	+ }
116	+
117	+ public function validate($dataSource) {
118	+ /* @var $dbConfig Mana_Db_Helper_Config */
119	+ $dbConfig = Mage::helper('mana_db/config');
120	+
121	+ foreach ($dbConfig->getScopeValidators($this->_scope) as $validator) {
122	+ call_user_func(array($this, $validator->getName()), $dataSource);
123	+ }
124	+
125	+ foreach ($dbConfig->getScopeFields($this->_scope) as $fieldXml) {
126	+ foreach ($dbConfig->getFieldValidators($fieldXml) as $validator) {
127	+ call_user_func(array($this, $validator->getName()), $dataSource, $fieldXml->getName());
128	+ }
129	+ }
130	+ return $this;
131	+ }
132	+
133	+ public function postValidate($dataSource) {
134	+ /* @var $dbConfig Mana_Db_Helper_Config */
135	+ $dbConfig = Mage::helper('mana_db/config');
136	+
137	+ foreach ($dbConfig->getScopePostValidators($this->_scope) as $validator) {
138	+ call_user_func(array($this, $validator->getName()), $dataSource);
139	+ }
140	+
141	+ foreach ($dbConfig->getScopeFields($this->_scope) as $fieldXml) {
142	+ foreach ($dbConfig->getFieldPostValidators($fieldXml) as $validator) {
143	+ call_user_func(array($this, $validator->getName()), $dataSource, $fieldXml->getName());
144	+ }
145	+ }
146	+
147	+ return $this;
148	+ }
149	+
150	+ public function isNotEmpty($dataSource, $field) {
151	+ if (!$this->getData($field)) {
152	+ throw new Mana_Db_Exception_Validation(Mage::helper('mana_db')->__("Please fill in '%s'.", $dataSource->getLabel($this->getScope(), $field)));
153	+ }
154	+ }
155	+
156	+ public function getJson($key) {
157	+ if (!$this->_jsons) {
158	+ $this->_jsons = array();
159	+ }
160	+ if (!isset($this->_jsons[$key])) {
161	+ $data = $this->getData($key);
162	+ if (empty($data)) {
163	+ $this->_jsons[$key] = array();
164	+ }
165	+ else {
166	+ $this->_jsons[$key] = json_decode($data, true);
167	+ if (is_null($this->_jsons[$key])) {
168	+ throw new Exception(json_last_error());
169	+ }
170	+ }
171	+ }
172	+
173	+ return $this->_jsons[$key];
174	+ }
175	+
176	+ public function overrideData($key, $value = null) {
177	+ $this->setData($key, $value);
178	+
179	+ if (is_array($key)) {
180	+ foreach (array_keys($key) as $aKey) {
181	+ $this->_setDefaultMask($aKey, true);
182	+ }
183	+ }
184	+ else {
185	+ $this->_setDefaultMask($key, true);
186	+ }
187	+ return $this;
188	+ }
189	+
190	+ protected function _setDefaultMask($key, $value) {
191	+ /* @var $dbConfig Mana_Db_Helper_Config */
192	+ $dbConfig = Mage::helper('mana_db/config');
193	+
194	+ if (($field = $dbConfig->getScopeField($this->_scope, $key)) && isset($field->no)) {
195	+ /* @var $db Mana_Db_Helper_Data */
196	+ $db = Mage::helper('mana_db');
197	+
198	+ $no = (int)(string)$field->no;
199	+ $maskIndex = $db->getMaskIndex($no);
200	+ $mask = isset($this->_data['default_mask' . $maskIndex]) ? $this->_data['default_mask' . $maskIndex] : 0;
201	+ if ($value) {
202	+ $mask = $mask \| $db->getMask($no);
203	+ }
204	+ else {
205	+ $mask = $mask & ~$db->getMask($no);
206	+ }
207	+ $this->setData('default_mask' . $maskIndex, $mask);
208	+ }
209	+ }
210	+
211	+ public function useDefaultData($key) {
212	+ if (is_array($key)) {
213	+ foreach ($key as $aKey) {
214	+ $this->_setDefaultMask($aKey, false);
215	+ }
216	+ }
217	+ else {
218	+ $this->_setDefaultMask($key, false);
219	+ }
220	+
221	+ return $this;
222	+ }
223	+
224	+ public function isUsingDefaultData($key, $in = '_data') {
225	+ if (($field = $this->dbConfigHelper()->getScopeField($this->_scope, $key)) && isset($field->no)) {
226	+ /* @var $db Mana_Db_Helper_Data */
227	+ $db = Mage::helper('mana_db');
228	+
229	+ $no = (int)(string)$field->no;
230	+ $maskIndex = $db->getMaskIndex($no);
231	+ $data = $this->$in;
232	+ $mask = isset($data['default_mask' . $maskIndex]) ? $data['default_mask' . $maskIndex] : 0;
233	+ return !($mask & $db->getMask($no));
234	+ }
235	+ return false;
236	+ }
237	+
238	+ public function isDefaultable($key) {
239	+ return ($field = $this->dbConfigHelper()->getScopeField($this->_scope, $key)) && isset($field->no);
240	+ }
241	+
242	+ public function getFieldsXml() {
243	+ return $this->dbConfigHelper()->getScopeFields($this->_scope);
244	+ }
245	+
246	+ public function getDefaultableFields() {
247	+ $result = array();
248	+ foreach ($this->getFieldsXml() as $fieldXml) {
249	+ if (isset($fieldXml->no)) {
250	+ $result[] = (string)$fieldXml->name;
251	+ }
252	+ }
253	+ return $result;
254	+ }
255	+
256	+ public function __call($method, $args) {
257	+ if (substr($method, 0, 8) == 'override') {
258	+ //Varien_Profiler::start('SETTER: '.get_class($this).'::'.$method);
259	+ $key = $this->_underscore(substr($method, 8));
260	+ $result = $this->overrideData($key, isset($args[0]) ? $args[0] : null);
261	+
262	+ //Varien_Profiler::stop('SETTER: '.get_class($this).'::'.$method);
263	+ return $result;
264	+ }
265	+ return parent::__call($method, $args);
266	+ }
267	+
268	+ /**
269	+ * Init indexing process after category data commit
270	+ *
271	+ * @return Mage_Catalog_Model_Category
272	+ */
273	+ public function afterCommitCallback() {
274	+ parent::afterCommitCallback();
275	+ if (!Mage::registry('m_prevent_indexing_on_save')) {
276	+ $this->getIndexerSingleton()->processEntityAction($this, $this->getScope(), Mage_Index_Model_Event::TYPE_SAVE);
277	+ }
278	+ return $this;
279	+ }
280	+
281	+ #region Dependencies
282	+ /**
283	+ * @return Mana_Db_Helper_Config
284	+ */
285	+ public function dbConfigHelper() {
286	+ return Mage::helper('mana_db/config');
287	+ }
288	+
289	+ /**
290	+ * @return Mage_Index_Model_Indexer
291	+ */
292	+ public function getIndexerSingleton() {
293	+ return Mage::getSingleton('index/indexer');
294	+ }
295	+ #endregion
296	+ }

app/code/local/Mana/Db/Model/Entity/Indexer.php ADDED Viewed

	@@ -0,0 +1,349 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Entity_Indexer extends Mana_Core_Model_Indexer {
13	+ protected $_code = 'mana_db';
14	+ protected $_standardEventEntities = array(
15	+ 'core_store' => 'core/store',
16	+ );
17	+ /**
18	+ * @var Varien_Object[]
19	+ */
20	+ protected $_matchedEvents = array();
21	+
22	+ public function matchEvent(Mage_Index_Model_Event $event) {
23	+ /* @var $object Mana_Db_Model_Entity */
24	+ $object = $event->getData('data_object');
25	+ $key = $event->getData('entity').'-'.$object->getId();
26	+ if (!isset($this->_matchedEvents[$key])) {
27	+ $this->_matchedEvents[$key] = $this->_matchEntity($event, $object);
28	+ }
29	+ return $this->_matchedEvents[$key]->getData('is_matching');
30	+ }
31	+
32	+ /**
33	+ * @param Mage_Index_Model_Event $event
34	+ * @param Mana_Db_Model_Entity $object
35	+ * @return Varien_Object
36	+ */
37	+ protected function _matchEntity($event, /** @noinspection PhpUnusedParameterInspection */ $object) {
38	+ $result = new Varien_Object(array('is_matching' => false));
39	+ $entityFilters = array();
40	+ $eventEntity = $event->getData('entity');
41	+ if (isset($this->_standardEventEntities[$eventEntity])) {
42	+ $eventEntity = $this->_standardEventEntities[$eventEntity];
43	+ }
44	+ foreach ($this->_sortTargetsByDependency() as $target) {
45	+ if ($entity = (string)$target->entity) {
46	+ foreach ($this->dbConfigHelper()->getEntityXml($entity)->scopes->children() as $scope) {
47	+ if (isset($scope->flattens)) {
48	+ if ($formula = $this->_findEntityFilterFormula($entity . '/' . $scope->getName(), $eventEntity)) {
49	+ $result->setData('is_matching', true);
50	+ $entityFilters[$entity . '/' . $scope->getName()] = $formula;
51	+ }
52	+ }
53	+ }
54	+ }
55	+ }
56	+
57	+ $result->setData('entity_filters', $entityFilters);
58	+ return $result;
59	+ }
60	+ protected function _findEntityFilterFormula($entity, $what) {
61	+ return $this->_findEntityFilterFormulaRecursively($entity, $what, '');
62	+ }
63	+
64	+ protected function _findEntityFilterFormulaRecursively($entity, $what, $formula) {
65	+ if (!($scopeXml = $this->dbConfigHelper()->getScopeXml($entity))) {
66	+ return false;
67	+ }
68	+
69	+ if (!isset($scopeXml->formula)) {
70	+ return false;
71	+ }
72	+
73	+ foreach ($scopeXml->formula->children() as $selectXml) {
74	+ if (isset($selectXml->from)) {
75	+ $fromXml = $selectXml->from;
76	+ foreach ($fromXml->children() as $alias => $definition) {
77	+ $sourceEntity = $alias == 'primary' ? (string)$scopeXml->flattens : (string)$definition->entity;
78	+ if ($sourceEntity == $what) {
79	+ return $formula . $alias . '.' . $this->_getPrimaryKey($sourceEntity);
80	+ }
81	+ else {
82	+ if ($result = $this->_findEntityFilterFormulaRecursively($sourceEntity, $what, $formula . $alias . '.')) {
83	+ return $result;
84	+ }
85	+ }
86	+ }
87	+ }
88	+
89	+ if (isset($selectXml->join)) {
90	+ $joinXml = $selectXml->join;
91	+ /* @var $joinXml SimpleXMLElement */
92	+ foreach ($joinXml->children() as $alias => $definition) {
93	+ $sourceEntity = $alias == 'primary' ? (string)$scopeXml->flattens : (string)$definition->entity;
94	+ if ($sourceEntity == $what) {
95	+ return $formula . $alias . '.' . $this->_getPrimaryKey($sourceEntity);
96	+ }
97	+ else {
98	+ if ($result = $this->_findEntityFilterFormulaRecursively($sourceEntity, $what, $formula . $alias . '.')) {
99	+ return $result;
100	+ }
101	+ }
102	+ }
103	+ }
104	+ }
105	+ return false;
106	+ }
107	+
108	+ protected function _getPrimaryKey($entity) {
109	+ if ($this->dbConfigHelper()->getScopeXml($entity)) {
110	+ return 'id';
111	+ }
112	+ else {
113	+ return $this->tableProcessorHelper()->getPrimaryKey($entity);
114	+ }
115	+ }
116	+
117	+ /**
118	+ * Register indexer required data inside event object
119	+ *
120	+ * @param Mage_Index_Model_Event $event
121	+ */
122	+ protected function _registerEvent(Mage_Index_Model_Event $event) {
123	+ /* @var $object Mana_Db_Model_Entity */
124	+ $object = $event->getData('data_object');
125	+ $key = $event->getData('entity') . '-' . $object->getId();
126	+ if (isset($this->_matchedEvents[$key])) {
127	+ $event
128	+ ->addNewData('entity_filters', $this->_matchedEvents[$key]->getData('entity_filters'))
129	+ ->addNewData('entity_filter_id', $object->getId());
130	+ }
131	+ }
132	+
133	+ /**
134	+ * Process event based on event state data
135	+ *
136	+ * @param Mage_Index_Model_Event $event
137	+ */
138	+ protected function _processEvent(Mage_Index_Model_Event $event) {
139	+ $this->process($event->getNewData());
140	+ }
141	+
142	+ /**
143	+ * @return Mana_Db_Resource_Entity_Indexer
144	+ */
145	+ protected function _getResource() {
146	+ if (!$this->_resourceName) {
147	+ $this->_resourceName = (string)$this->getXml()->resource;
148	+ }
149	+ if (!$this->_resourceName) {
150	+ $this->_resourceName = 'mana_db/entity_indexer';
151	+ }
152	+
153	+ return Mage::getResourceSingleton($this->_resourceName);
154	+ }
155	+
156	+ public function reindexAll() {
157	+ $this->process(array(
158	+ "{$this->getCode()}_reindex_all" => true
159	+ ));
160	+
161	+ return $this;
162	+ }
163	+
164	+ /**
165	+ * @param array $options
166	+ * @return array
167	+ */
168	+ protected function _prepareOptions($options) {
169	+ /* @var $core Mana_Core_Helper_Data */
170	+ $core = Mage::helper('mana_core');
171	+
172	+ $result = array();
173	+ foreach ($options as $key => $value) {
174	+ if ($core->startsWith($key, $this->getCode() . '_')) {
175	+ $key = substr($key, strlen($this->getCode() . '_'));
176	+ }
177	+ $result[$key] = $value;
178	+ }
179	+
180	+ $result = array_merge(array(
181	+ 'reindex_all' => false,
182	+ ), $result);
183	+
184	+ return $result;
185	+ }
186	+
187	+ /**
188	+ * @throws Exception
189	+ * @return Varien_Simplexml_Element[]
190	+ */
191	+ protected function _sortTargetsByDependency() {
192	+ $targets = array();
193	+
194	+ if ($this->getXml()->targets) {
195	+ foreach ($this->getXml()->targets->children() as $target) {
196	+ $targets[] = $target;
197	+ }
198	+ }
199	+
200	+ if ($count = count($targets)) {
201	+ $orders = array();
202	+ for ($position = 0; $position < $count; $position++) {
203	+ $found = false;
204	+ foreach ($targets as $target) {
205	+ if (!isset($orders[$target->getName()])) {
206	+ $hasUnresolvedDependency = false;
207	+ if (isset($target->depends)) {
208	+ foreach ($target->depends->children() as $dependency) {
209	+ if (!isset($orders[$dependency->getName()])) {
210	+ // $dependency not yet sorted so $module should wait until that happens
211	+ $hasUnresolvedDependency = true;
212	+ break;
213	+ }
214	+ }
215	+ }
216	+ if (!$hasUnresolvedDependency) {
217	+ $found = $target;
218	+ break;
219	+ }
220	+ }
221	+ }
222	+ if ($found) {
223	+ $found->sort_order = $orders[$found->getName()] = count($orders);
224	+ }
225	+ else {
226	+ $circular = array();
227	+ foreach ($targets as $target) {
228	+ if (!isset($orders[$target->getName()])) {
229	+ $circular[] = $target->getName();
230	+ }
231	+ }
232	+ throw new Exception(sprintf(
233	+ "Circular target dependency is not allowed. " .
234	+ "Please check these targets: %s.",
235	+ implode(', ', $circular)
236	+ ));
237	+ }
238	+ }
239	+ uasort($targets, array($this, '_compareBySortOrder'));
240	+ }
241	+
242	+ return $targets;
243	+ }
244	+
245	+ protected function _compareBySortOrder($a, $b) {
246	+ if (((int)(string)$a->sort_order) < ((int)(string)$b->sort_order)) return -1;
247	+ if (((int)(string)$a->sort_order) > ((int)(string)$b->sort_order)) return 1;
248	+
249	+ return 0;
250	+ }
251	+
252	+ /**
253	+ * @param Varien_Simplexml_Element $target
254	+ * @param array $options
255	+ */
256	+ protected function _processTarget($target, $options) {
257	+ $entity = (string)$target->entity;
258	+
259	+ /* @var $globalScope Varien_Simplexml_Element */
260	+ $globalScope = null;
261	+ /* @var $storeScope Varien_Simplexml_Element */
262	+ $storeScope = null;
263	+
264	+ foreach ($this->dbConfigHelper()->getEntityXml($entity)->scopes->children() as $scope) {
265	+ if (isset($scope->flattens)) {
266	+ $flattenedScope = (string)$scope->flattens;
267	+ if (isset($this->dbConfigHelper()->getScopeXml($flattenedScope)->store_specifics_for)) {
268	+ $storeScope = $scope;
269	+ }
270	+ else {
271	+ $globalScope = $scope;
272	+ }
273	+ }
274	+ }
275	+
276	+ if ($globalScope) {
277	+ $this->_flattenGlobalScope($target, $globalScope, $options);
278	+ }
279	+ if ($storeScope) {
280	+ $this->_flattenStoreScope($target, $storeScope, $options);
281	+ }
282	+ }
283	+
284	+ /**
285	+ * @param Varien_Simplexml_Element $target
286	+ * @param Varien_Simplexml_Element $scope
287	+ * @param array $options
288	+ */
289	+ protected function _flattenGlobalScope($target, $scope, $options) {
290	+ $this->_getResource()->flattenScope($this, $target, $scope, $options);
291	+ }
292	+
293	+ /**
294	+ * @param Varien_Simplexml_Element $target
295	+ * @param Varien_Simplexml_Element $scope
296	+ * @param array $options
297	+ */
298	+ protected function _flattenStoreScope($target, $scope, $options) {
299	+ $this->_getResource()->flattenScope($this, $target, $scope, $options);
300	+ }
301	+
302	+ /**
303	+ * @param array $options
304	+ */
305	+ public function process($options = array()) {
306	+ $options = $this->_prepareOptions($options);
307	+ $targets = $this->_sortTargetsByDependency();
308	+ foreach ($targets as $target) {
309	+ $this->_processTarget($target, $options);
310	+ }
311	+ }
312	+
313	+ /**
314	+ * Retrieve Indexer description
315	+ *
316	+ * @return string
317	+ */
318	+ public function getDescription() {
319	+ $targets = $this->_sortTargetsByDependency();
320	+ $descriptions = array();
321	+ foreach ($targets as $target) {
322	+ if (isset($target->description)) {
323	+ $descriptions[] = (string)$target->description;
324	+ }
325	+ }
326	+
327	+ $result = parent::getDescription();
328	+ if (count($descriptions)) {
329	+ $result .= ': '.implode(', ', $descriptions);
330	+ }
331	+ return $result;
332	+ }
333	+
334	+ #region Dependencies
335	+ /**
336	+ * @return Mana_Db_Helper_Config
337	+ */
338	+ public function dbConfigHelper() {
339	+ return Mage::helper('mana_db/config');
340	+ }
341	+
342	+ /**
343	+ * @return Mana_Db_Helper_Formula_Processor_Table
344	+ */
345	+ public function tableProcessorHelper() {
346	+ return Mage::helper('mana_db/formula_processor_table');
347	+ }
348	+ #endregion
349	+ }

app/code/local/Mana/Db/Model/Formula/Alias.php ADDED Viewed

	@@ -0,0 +1,58 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ abstract class Mana_Db_Model_Formula_Alias {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Alias $suffix
15	+ * @return Mana_Db_Model_Formula_Alias
16	+ */
17	+ abstract public function child($suffix);
18	+
19	+ /**
20	+ * @param Mana_Db_Model_Formula_Alias_Single $prefix
21	+ * @return Mana_Db_Model_Formula_Alias
22	+ */
23	+ abstract public function singleChild($prefix);
24	+
25	+ /**
26	+ * @param Mana_Db_Model_Formula_Alias_Array $prefix
27	+ * @return Mana_Db_Model_Formula_Alias
28	+ */
29	+ abstract public function arrayChild($prefix);
30	+
31	+ /**
32	+ * @param Mana_Db_Model_Formula_Closure $closure
33	+ * @return mixed
34	+ */
35	+ abstract public function each($closure);
36	+
37	+ /**
38	+ * @param mixed $index
39	+ * @return string
40	+ */
41	+ abstract public function asString($index);
42	+
43	+ /**
44	+ * @param Mana_Db_Model_Formula_Context $context
45	+ * @param string $field
46	+ * @return string \| string[]
47	+ */
48	+ public function fieldExpr($context, $field) {
49	+ return $this->expr($context, "{{= context.$field }}");
50	+ }
51	+
52	+ /**
53	+ * @param Mana_Db_Model_Formula_Context $context
54	+ * @param string $expr
55	+ * @return string \| string[]
56	+ */
57	+ public abstract function expr($context, $expr);
58	+ }

app/code/local/Mana/Db/Model/Formula/Alias/Array.php ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Alias_Array extends Mana_Db_Model_Formula_Alias {
13	+ /**
14	+ * @var string[]
15	+ */
16	+ protected $_aliases;
17	+
18	+ public function __construct($aliases) {
19	+ $this->_aliases = $aliases;
20	+ }
21	+
22	+ public function getAliases() {
23	+ return $this->_aliases;
24	+ }
25	+
26	+ /**
27	+ * @param Mana_Db_Model_Formula_Alias $suffix
28	+ * @return Mana_Db_Model_Formula_Alias
29	+ */
30	+ public function child($suffix) {
31	+ return $suffix->arrayChild($this);
32	+ }
33	+
34	+ /**
35	+ * @param Mana_Db_Model_Formula_Alias_Single $prefix
36	+ * @return Mana_Db_Model_Formula_Alias
37	+ */
38	+ public function singleChild($prefix) {
39	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
40	+ $formulaHelper = Mage::helper('mana_db/formula');
41	+
42	+ $aliases = array();
43	+ foreach ($this->getAliases() as $index => $alias) {
44	+ $aliases[$index] = $prefix->getAlias() . '.' . $alias;
45	+ }
46	+
47	+ return $formulaHelper->createAlias($aliases);
48	+ }
49	+
50	+ /**
51	+ * @param Mana_Db_Model_Formula_Alias_Array $prefix
52	+ * @return Mana_Db_Model_Formula_Alias
53	+ */
54	+ public function arrayChild($prefix) {
55	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
56	+ $formulaHelper = Mage::helper('mana_db/formula');
57	+
58	+ $aliases = array();
59	+ foreach ($this->getAliases() as $thisIndex => $thisAlias) {
60	+ foreach ($prefix->getAliases() as $prefixIndex => $prefixAlias) {
61	+ $aliases["$prefixIndex.$thisIndex"] = $prefixAlias . '.' . $thisAlias;
62	+ }
63	+ }
64	+
65	+ return $formulaHelper->createAlias($aliases);
66	+ }
67	+
68	+ /**
69	+ * @param Mana_Db_Model_Formula_Closure $closure
70	+ * @return mixed
71	+ */
72	+ public function each($closure) {
73	+ $closure->setAlias($this);
74	+ $result = array();
75	+ foreach ($this->getAliases() as $index => $alias) {
76	+ $result[$index] = $closure
77	+ ->setIndex($index)
78	+ ->execute();
79	+ }
80	+ return $result;
81	+ }
82	+
83	+ /**
84	+ * @param mixed $index
85	+ * @return string
86	+ */
87	+ public function asString($index) {
88	+ return $this->_aliases[$index];
89	+ }
90	+
91	+ /**
92	+ * @param Mana_Db_Model_Formula_Context $context
93	+ * @param string $expr
94	+ * @return string \| string[]
95	+ */
96	+ public function expr($context, $expr) {
97	+ $result = array();
98	+ foreach ($this->getAliases() as $index => $alias) {
99	+ $result[$index] = $context->resolveAliases($expr, true, $index);
100	+ }
101	+ return $result;
102	+ }
103	+
104	+ }

app/code/local/Mana/Db/Model/Formula/Alias/Empty.php ADDED Viewed

	@@ -0,0 +1,68 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Alias_Empty extends Mana_Db_Model_Formula_Alias {
13	+ /**
14	+ * @param Mana_Db_Model_Formula_Alias $suffix
15	+ * @return Mana_Db_Model_Formula_Alias
16	+ */
17	+ public function child($suffix) {
18	+ return $suffix;
19	+ }
20	+
21	+ /**
22	+ * @param Mana_Db_Model_Formula_Alias_Single $prefix
23	+ * @throws Exception
24	+ * @return Mana_Db_Model_Formula_Alias
25	+ */
26	+ public function singleChild($prefix) {
27	+ return $prefix;
28	+ }
29	+
30	+ /**
31	+ * @param Mana_Db_Model_Formula_Alias_Array $prefix
32	+ * @throws Exception
33	+ * @return Mana_Db_Model_Formula_Alias
34	+ */
35	+ public function arrayChild($prefix) {
36	+ return $prefix;
37	+ }
38	+
39	+ /**
40	+ * @param Mana_Db_Model_Formula_Closure $closure
41	+ * @return mixed
42	+ */
43	+ public function each($closure) {
44	+ return $closure
45	+ ->setIndex(null)
46	+ ->setAlias($this)
47	+ ->execute();
48	+ }
49	+
50	+ /**
51	+ * @param mixed $index
52	+ * @throws Exception
53	+ * @return string
54	+ */
55	+ public function asString($index) {
56	+ return 'primary';
57	+ }
58	+
59	+ /**
60	+ * @param Mana_Db_Model_Formula_Context $context
61	+ * @param string $expr
62	+ * @throws Exception
63	+ * @return string \| string[]
64	+ */
65	+ public function expr($context, $expr) {
66	+ return $context->resolveAliases($expr);
67	+ }
68	+ }

app/code/local/Mana/Db/Model/Formula/Alias/Single.php ADDED Viewed

	@@ -0,0 +1,86 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Alias_Single extends Mana_Db_Model_Formula_Alias {
13	+ /**
14	+ * @var string
15	+ */
16	+ protected $_alias;
17	+ public function __construct($alias) {
18	+ $this->_alias = $alias;
19	+ }
20	+
21	+ public function getAlias() {
22	+ return $this->_alias;
23	+ }
24	+
25	+ /**
26	+ * @param Mana_Db_Model_Formula_Alias $suffix
27	+ * @return Mana_Db_Model_Formula_Alias
28	+ */
29	+ public function child($suffix) {
30	+ return $suffix->singleChild($this);
31	+ }
32	+
33	+ /**
34	+ * @param Mana_Db_Model_Formula_Alias_Single $prefix
35	+ * @return Mana_Db_Model_Formula_Alias
36	+ */
37	+ public function singleChild($prefix) {
38	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
39	+ $formulaHelper = Mage::helper('mana_db/formula');
40	+
41	+ return $formulaHelper->createAlias($prefix->getAlias().'.'.$this->getAlias());
42	+ }
43	+
44	+ /**
45	+ * @param Mana_Db_Model_Formula_Alias_Array $prefix
46	+ * @return Mana_Db_Model_Formula_Alias
47	+ */
48	+ public function arrayChild($prefix) {
49	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
50	+ $formulaHelper = Mage::helper('mana_db/formula');
51	+
52	+ $aliases = array();
53	+ foreach ($prefix->getAliases() as $index => $alias) {
54	+ $aliases[$index] = $alias . '.' . $this->getAlias();
55	+ }
56	+ return $formulaHelper->createAlias($aliases);
57	+ }
58	+
59	+ /**
60	+ * @param Mana_Db_Model_Formula_Closure $closure
61	+ * @return mixed
62	+ */
63	+ public function each($closure) {
64	+ return $closure
65	+ ->setIndex(null)
66	+ ->setAlias($this)
67	+ ->execute();
68	+ }
69	+
70	+ /**
71	+ * @param mixed $index
72	+ * @return string
73	+ */
74	+ public function asString($index) {
75	+ return $this->getAlias();
76	+ }
77	+
78	+ /**
79	+ * @param Mana_Db_Model_Formula_Context $context
80	+ * @param string $expr
81	+ * @return string \| string[]
82	+ */
83	+ public function expr($context, $expr) {
84	+ return $context->resolveAliases($expr);
85	+ }
86	+ }

app/code/local/Mana/Db/Model/Formula/Closure.php ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method mixed getIndex()
11	+ * @method Mana_Db_Model_Formula_Closure setIndex(mixed $value)
12	+ * @method Mana_Db_Model_Formula_Alias getAlias()
13	+ * @method Mana_Db_Model_Formula_Closure setAlias(Mana_Db_Model_Formula_Alias $value)
14	+ */
15	+ class Mana_Db_Model_Formula_Closure extends Mana_Core_Model_Closure {
16	+ }

app/code/local/Mana/Db/Model/Formula/Closure/AggregateFieldJoin.php ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Db_Model_Formula_Context getContext()
11	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setContext(Mana_Db_Model_Formula_Context $value)
12	+ * @method int getTargetIndex()
13	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setTargetIndex(int $value)
14	+ * @method Mana_Db_Model_Formula_Entity getResult()
15	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setResult(Mana_Db_Model_Formula_Entity $value)
16	+ * @method array getCompositeAlias()
17	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setCompositeAlias(array $value)
18	+ * @method array getFields()
19	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setFields(array $value)
20	+ * @method string getEntityName()
21	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setEntityName(string $value)
22	+ * @method Varien_Simplexml_Element getFieldXml()
23	+ * @method Mana_Db_Model_Formula_Closure_AggregateFieldJoin setFieldXml(Varien_Simplexml_Element $value)
24	+ *
25	+ */
26	+ class Mana_Db_Model_Formula_Closure_AggregateFieldJoin extends Mana_Db_Model_Formula_Closure {
27	+ /**
28	+ * @return mixed\|void
29	+ */
30	+ public function execute() {
31	+ $context = $this->getContext();
32	+ $fieldXml = $this->getFieldXml();
33	+
34	+ $fieldAlias = $this->getAlias()->asString($this->getIndex());
35	+
36	+ $compositeAlias = $this->getCompositeAlias() ? $this->getCompositeAlias() : array();
37	+ $compositeAlias[$this->getTargetIndex()] = $fieldAlias;
38	+ $this->setCompositeAlias($compositeAlias);
39	+
40	+ $fields = $this->getFields() ? $this->getFields() : array();
41	+ /** @noinspection PhpUndefinedFieldInspection */
42	+ $fields[$this->getTargetIndex()] = array(
43	+ 'alias' => $fieldAlias,
44	+ 'entity' => (string)$fieldXml->foreign->entity,
45	+ 'join' => "{{= {$fieldAlias}.{$this->getResult()->getProcessor()->getPrimaryKey($this->getEntityName())} }} = " .
46	+ "{{= {$context->getAlias()->asString($this->getIndex())}.{$fieldXml->getName()} }}",
47	+ );
48	+ $this->setFields($fields);
49	+ }
50	+ }

app/code/local/Mana/Db/Model/Formula/Closure/ForeignJoin.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Db_Model_Formula_Context getContext()
11	+ * @method Mana_Db_Model_Formula_Closure_ForeignJoin setContext(Mana_Db_Model_Formula_Context $value)
12	+ * @method Mana_Db_Model_Formula_Entity getEntity()
13	+ * @method Mana_Db_Model_Formula_Closure_ForeignJoin setEntity(Mana_Db_Model_Formula_Entity $value)
14	+ */
15	+ class Mana_Db_Model_Formula_Closure_ForeignJoin extends Mana_Db_Model_Formula_Closure {
16	+ /**
17	+ * @return mixed\|void
18	+ */
19	+ public function execute() {
20	+ /* @var $dbConfig Mana_Db_Helper_Config */
21	+ $dbConfig = Mage::helper('mana_db/config');
22	+
23	+ $entity = $this->getEntity();
24	+ $context = $this->getContext();
25	+ return "{{= {$entity->getAlias()->asString($this->getIndex())}.{$entity->getProcessor()->getPrimaryKey($entity->getEntity())} }} = " .
26	+ "{{= {$context->getAlias()->asString($this->getIndex())}.{$dbConfig->getForeignKey($entity->getEntity(), $context->getEntity())} }}";
27	+ }
28	+ }

app/code/local/Mana/Db/Model/Formula/Closure/ForeignJoinEnd.php ADDED Viewed

	@@ -0,0 +1,38 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Db_Model_Formula_Context getContext()
11	+ * @method Mana_Db_Model_Formula_Closure_ForeignJoin setContext(Mana_Db_Model_Formula_Context $value)
12	+ * @method Mana_Db_Model_Formula_Entity getEntity()
13	+ * @method Mana_Db_Model_Formula_Closure_ForeignJoin setEntity(Mana_Db_Model_Formula_Entity $value)
14	+ */
15	+ class Mana_Db_Model_Formula_Closure_ForeignJoinEnd extends Mana_Db_Model_Formula_Closure {
16	+ /**
17	+ * @return mixed\|void
18	+ */
19	+ public function execute() {
20	+ /* @var $resource Mana_Db_Resource_Formula */
21	+ $resource = Mage::getResourceSingleton('mana_db/formula');
22	+
23	+ /* @var $dbHelper Mana_Db_Helper_Data */
24	+ $dbHelper = Mage::helper('mana_db');
25	+
26	+ $entity = $this->getEntity();
27	+ $context = $this->getContext();
28	+
29	+ $context->getSelect()->joinLeft(
30	+ array(
31	+ $context->registerAlias($entity->getAlias()->asString($this->getIndex())) =>
32	+ $resource->getTable($dbHelper->getScopedName($entity->getEntity()))
33	+ ),
34	+ $context->resolveAliases($entity->getForeignJoin()),
35	+ null
36	+ );
37	+ }
38	+ }

app/code/local/Mana/Db/Model/Formula/Closure/Join.php ADDED Viewed

	@@ -0,0 +1,44 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Db_Model_Formula_Context getContext()
11	+ * @method Mana_Db_Model_Formula_Closure_Join setContext(Mana_Db_Model_Formula_Context $value)
12	+ * @method Varien_Simplexml_Element getDefinition()
13	+ * @method Mana_Db_Model_Formula_Closure_Join setDefinitionVarien_Simplexml_Element $value)
14	+ */
15	+ class Mana_Db_Model_Formula_Closure_Join extends Mana_Db_Model_Formula_Closure {
16	+ /**
17	+ * @return mixed\|void
18	+ */
19	+ public function execute() {
20	+ /* @var $dbHelper Mana_Db_Helper_Data */
21	+ $dbHelper = Mage::helper('mana_db');
22	+
23	+ /* @var $resource Mana_Db_Resource_Formula */
24	+ $resource = Mage::getResourceSingleton('mana_db/formula');
25	+
26	+ $definition = $this->getDefinition();
27	+ $alias = $definition->getName();
28	+ $fullAlias = $this->getAlias()->asString($this->getIndex());
29	+
30	+ $this->getContext()->addLocalAlias($alias, $this->getAlias());
31	+ if (!$this->getContext()->hasAlias($fullAlias)) {
32	+ /** @noinspection PhpUndefinedFieldInspection */
33	+ $entity = $alias == 'primary' ? $this->getContext()->getPrimaryEntity() : (string)$definition->entity;
34	+ $method = isset($definition->type) ? 'join' . ucfirst($definition->type) : 'joinInner';
35	+
36	+ /** @noinspection PhpUndefinedFieldInspection */
37	+ $this->getContext()->getSelect()->$method(
38	+ array($this->getContext()->registerAlias($fullAlias) => $resource->getTable($dbHelper->getScopedName($entity))),
39	+ $this->getContext()->resolveAliases((string)$definition->on, true, $this->getIndex()),
40	+ null
41	+ );
42	+ }
43	+ }
44	+ }

app/code/local/Mana/Db/Model/Formula/Context.php ADDED Viewed

	@@ -0,0 +1,217 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getMode()
11	+ * @method Mana_Db_Model_Formula_Context setMode(string $value)
12	+ * @method string getPrefix()
13	+ * @method Mana_Db_Model_Formula_Context setPrefix(string $value)
14	+ * @method string getEntity()
15	+ * @method Mana_Db_Model_Formula_Context setEntity(string $value)
16	+ * @method string getTargetEntity()
17	+ * @method Mana_Db_Model_Formula_Context setTargetEntity(string $value)
18	+ * @method string getPrimaryEntity()
19	+ * @method Mana_Db_Model_Formula_Context setPrimaryEntity(string $value)
20	+ * @method Mage_Core_Model_Abstract getModel()
21	+ * @method Mana_Db_Model_Formula_Context setModel(Mage_Core_Model_Abstract $value)
22	+ * @method Mana_Db_Helper_Formula_Processor getProcessor()
23	+ * @method mixed getResult()
24	+ * @method Mana_Db_Model_Formula_Context setResult(mixed $value)
25	+ * @method Mana_Db_Model_Formula_Field getField()
26	+ * @method Mana_Db_Model_Formula_Context setField(Mana_Db_Model_Formula_Field $value)
27	+ * @method Mana_Db_Helper_Formula_Abstract getHelper()
28	+ * @method Mana_Db_Model_Formula_Context setHelper(Mana_Db_Helper_Formula_Abstract $value)
29	+ * @method bool getIsAggregate()
30	+ * @method Mana_Db_Model_Formula_Context setIsAggregate(bool $value)
31	+ * @method Mana_Db_Model_Formula_Context getParentContext()
32	+ * @method Mana_Db_Model_Formula_Context setParentContext(Mana_Db_Model_Formula_Context $value)
33	+ * @method Mana_Db_Model_Formula_Context getAggregateContext()
34	+ * @method Mana_Db_Model_Formula_Context setAggregateContext(Mana_Db_Model_Formula_Context $value)
35	+ * @method Mana_Db_Model_Formula_Alias getAlias()
36	+ * @method Mana_Db_Model_Formula_Context setAlias(Mana_Db_Model_Formula_Alias $value)
37	+ * @method string __getGlobalEntity()
38	+ * @method Mana_Db_Model_Formula_Context __setGlobalEntity(string $value)
39	+ * @method Mana_Db_Helper_Formula_Entity getEntityHelper()
40	+ * @method Mana_Db_Model_Formula_Context setEntityHelper(Mana_Db_Helper_Formula_Entity $value)
41	+ */
42	+ class Mana_Db_Model_Formula_Context extends Varien_Object {
43	+ /**
44	+ * @var Varien_Db_Select()
45	+ */
46	+ protected $_select;
47	+ /**
48	+ * @var string[]
49	+ */
50	+ protected $_fields = array();
51	+ protected $_aliases = array();
52	+ protected $_localAliases = array();
53	+
54	+ protected $_options = array();
55	+
56	+ static protected $_quoteFieldsAndEntities = true;
57	+ static protected $_aliasIndex = null;
58	+
59	+ /**
60	+ * @param Mana_Db_Helper_Formula_Processor \| string $processor
61	+ * @return Mana_Db_Model_Formula_Context
62	+ */
63	+ public function setProcessor($processor) {
64	+ if (is_string($processor)) {
65	+ $processor = Mage::helper('mana_db/formula_processor_' . $processor);
66	+ }
67	+ $this->setData('processor', $processor);
68	+
69	+ return $this;
70	+ }
71	+
72	+ /**
73	+ * @return Mana_Db_Model_Formula_Context
74	+ */
75	+ public function createChildContext() {
76	+ /* @var $result Mana_Db_Model_Formula_Context */
77	+ $result = Mage::getModel('mana_db/formula_context');
78	+ return $result
79	+ ->setHelper($this->getHelper())
80	+ ->setParentContext($this);
81	+ }
82	+
83	+ /**
84	+ * @param Mana_Db_Model_Formula_Context $context
85	+ * @return Mana_Db_Model_Formula_Context
86	+ */
87	+ public function copyAliases($context) {
88	+ $this->_aliases = $context->_aliases;
89	+ return $this;
90	+ }
91	+
92	+ public function registerAlias($alias) {
93	+ if (!isset($this->_aliases[$alias])) {
94	+ $relativeAlias = explode('.', $alias);
95	+ $relativeAlias = array_pop($relativeAlias);
96	+ $letter = $this->getPrefix().substr($relativeAlias, 0, 1);
97	+ for ($i = 1, $result = $letter; in_array($result, $this->_aliases); $i++, $result = $letter . $i) ;
98	+ $this->_aliases[$alias] = $result;
99	+ }
100	+ return $this->_aliases[$alias];
101	+ }
102	+
103	+ public function resolveAliases($expr, $quoteFieldsAndEntities = true, $aliasIndex = null) {
104	+ self::$_quoteFieldsAndEntities = $quoteFieldsAndEntities;
105	+ self::$_aliasIndex = $aliasIndex;
106	+ return preg_replace_callback('/{{=([^}]*)}}/', array($this, '_resolveAlias'), $expr);
107	+ }
108	+
109	+ public function hasAlias($alias) {
110	+ return isset($this->_aliases[$alias]);
111	+ }
112	+
113	+
114	+ public function resetLocalAliases() {
115	+ $this->_localAliases = array();
116	+
117	+ return $this;
118	+ }
119	+
120	+ public function addLocalAlias($localAlias, $globalAlias) {
121	+ $this->_localAliases[$localAlias] = $globalAlias;
122	+ return $this;
123	+ }
124	+
125	+ protected function _resolveAlias($matches) {
126	+ return $this->_doResolveAlias($matches[1]);
127	+ }
128	+
129	+ public function resolveAlias($fieldExpr, $quoteFieldsAndEntities = true, $aliasIndex = null) {
130	+ self::$_quoteFieldsAndEntities = $quoteFieldsAndEntities;
131	+ self::$_aliasIndex = $aliasIndex;
132	+ return $this->_doResolveAlias($fieldExpr);
133	+ }
134	+ protected function _doResolveAlias($fieldExpr) {
135	+ $fieldExpr = explode('.', $fieldExpr);
136	+ foreach ($fieldExpr as $index => $field) {
137	+ $fieldExpr[$index] = trim($field);
138	+ }
139	+ if ($fieldExpr[0] == 'parent') {
140	+ return $this->getParentContext()->_doResolveAlias(implode('.', array_slice($fieldExpr, 1)));
141	+ }
142	+ else {
143	+ $field = array_pop($fieldExpr);
144	+ $alias = implode('.', $fieldExpr);
145	+ if (!$alias) {
146	+ $alias = 'primary';
147	+ }
148	+
149	+ if ($fieldExpr[0] == 'context') {
150	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
151	+ $formulaHelper = Mage::helper('mana_db/formula');
152	+
153	+ $alias = $this->getAlias()->child($formulaHelper->createAlias(implode('.', array_slice($fieldExpr, 1))));
154	+ }
155	+ elseif (isset($this->_localAliases[$alias])) {
156	+ $alias = $this->_localAliases[$alias];
157	+ }
158	+
159	+ if (!is_string($alias)) {
160	+ $alias = $alias->asString(self::$_aliasIndex);
161	+ }
162	+
163	+ if (self::$_quoteFieldsAndEntities) {
164	+ return "`{$this->registerAlias($alias)}`.`$field`";
165	+ }
166	+ else {
167	+ return "{$this->registerAlias($alias)}.$field";
168	+ }
169	+ }
170	+ }
171	+
172	+ /**
173	+ * @return Varien_Db_Select
174	+ */
175	+ public function getSelect() {
176	+ if (!$this->_select) {
177	+ /* @var $resource Mana_Db_Resource_Formula */
178	+ $resource = Mage::getResourceSingleton('mana_db/formula');
179	+
180	+ $this->_select = $resource->select();
181	+ }
182	+ return $this->_select;
183	+ }
184	+
185	+ public function incrementPrefix() {
186	+ $alias = $this->getAlias() ? $this->getAlias() : 'primary';
187	+ $prefix = $this->getPrefix() . $this->registerAlias($alias);
188	+ $this->setPrefix($prefix);
189	+ return $prefix;
190	+ }
191	+
192	+ public function decrementPrefix() {
193	+ $alias = $this->getAlias() ? $this->getAlias() : 'primary';
194	+ $prefix = substr($this->getPrefix(), 0, strlen($this->getPrefix()) - strlen($this->registerAlias($alias)));
195	+ $this->setPrefix($prefix);
196	+
197	+ return $prefix;
198	+ }
199	+
200	+ public function getFields() {
201	+ return $this->_fields;
202	+ }
203	+
204	+ public function addField($field) {
205	+ $this->_fields[] = $field;
206	+ return $this;
207	+ }
208	+
209	+ public function setOptions($options) {
210	+ $this->_options = $options;
211	+ return $this;
212	+ }
213	+
214	+ public function getOption($option) {
215	+ return isset($this->_options[$option]) ? $this->_options[$option] : false;
216	+ }
217	+ }

app/code/local/Mana/Db/Model/Formula/Entity.php ADDED Viewed

	@@ -0,0 +1,53 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mana_Db_Helper_Formula_Entity getHelper()
11	+ * @method Mana_Db_Model_Formula_Alias getAlias()
12	+ * @method Mana_Db_Model_Formula_Entity setAlias(Mana_Db_Model_Formula_Alias $value)
13	+ * @method string getForeignJoin()
14	+ * @method Mana_Db_Model_Formula_Entity setForeignJoin(string $value)
15	+ * @method string getEntity()
16	+ * @method Mana_Db_Model_Formula_Entity setEntity(string $value)
17	+ * @method string[] \| bool getJoin()
18	+ * @method Mana_Db_Model_Formula_Entity setJoin(array $value)
19	+ * @method string getOrder()
20	+ * @method Mana_Db_Model_Formula_Entity setOrder(string $value)
21	+ * @method string getWhere()
22	+ * @method Mana_Db_Model_Formula_Entity setWhere(string $value)
23	+ * @method Mana_Db_Helper_Formula_Processor getProcessor()
24	+ * @method string[] \| bool getAggregateFields()
25	+ * @method Mana_Db_Model_Formula_Entity setAggregateFields(array $value)
26	+ */
27	+ class Mana_Db_Model_Formula_Entity extends Varien_Object {
28	+ /**
29	+ * @param Mana_Db_Helper_Formula_Entity \| string $entity
30	+ * @return Mana_Db_Model_Formula_Entity
31	+ */
32	+ public function setHelper($entity) {
33	+ if (is_string($entity)) {
34	+ $entity = Mage::helper('mana_db/formula_entity_' . $entity);
35	+ }
36	+ $this->setData('helper', $entity);
37	+
38	+ return $this;
39	+ }
40	+
41	+ /**
42	+ * @param Mana_Db_Helper_Formula_Processor \| string $processor
43	+ * @return Mana_Db_Model_Formula_Entity
44	+ */
45	+ public function setProcessor($processor) {
46	+ if (is_string($processor)) {
47	+ $processor = Mage::helper('mana_db/formula_processor_' . $processor);
48	+ }
49	+ $this->setData('processor', $processor);
50	+
51	+ return $this;
52	+ }
53	+ }

app/code/local/Mana/Db/Model/Formula/Expr.php ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getType()
11	+ * @method Mana_Db_Model_Formula_Expr setType(string $value)
12	+ * @method string getExpr()
13	+ * @method Mana_Db_Model_Formula_Expr setExpr(string $value)
14	+ * @method string \| string[] getFieldExpr()
15	+ * @method Mana_Db_Model_Formula_Expr setFieldExpr(mixed $value)
16	+ * @method string getFieldName()
17	+ * @method Mana_Db_Model_Formula_Expr setFieldName(string $value)
18	+ * @method Varien_Db_Select getSubSelect()
19	+ * @method Mana_Db_Model_Formula_Expr setSubSelect(Varien_Db_Select $value)
20	+ * @method bool getIsAggregate()
21	+ * @method Mana_Db_Model_Formula_Expr setIsAggregate(bool $value)
22	+ * @method bool getIsFrontend()
23	+ * @method Mana_Db_Model_Formula_Expr setIsFrontend(bool $value)
24	+ */
25	+ class Mana_Db_Model_Formula_Expr extends Varien_Object {
26	+ }

app/code/local/Mana/Db/Model/Formula/Field.php ADDED Viewed

	@@ -0,0 +1,37 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getName()
11	+ * @method Mana_Db_Model_Formula_Field setName(string $value)
12	+ * @method string getType()
13	+ * @method Mana_Db_Model_Formula_Field setType(string $value)
14	+ * @method string getRole()
15	+ * @method Mana_Db_Model_Formula_Field setRole(string $value)
16	+ * @method int getNo()
17	+ * @method Mana_Db_Model_Formula_Field setNo(int $value)
18	+ * @method bool hasFormula()
19	+ * @method Mana_Db_Model_Formula_Node getFormula()
20	+ * @method Mana_Db_Model_Formula_Field setFormula(Mana_Db_Model_Formula_Node $value)
21	+ * @method bool hasValue()
22	+ * @method string getValue()
23	+ * @method Mana_Db_Model_Formula_Field setValue(string $value)
24	+ * @method bool hasDependencies()
25	+ * @method string[] getDependencies()
26	+ * @method Mana_Db_Model_Formula_Field setDependencies(array $value)
27	+ * @method string getFormulaString()
28	+ * @method Mana_Db_Model_Formula_Field setFormulaString(string $value)
29	+ */
30	+ class Mana_Db_Model_Formula_Field extends Varien_Object {
31	+ /**
32	+ * @param Mana_Db_Model_Entity $model
33	+ * @return bool
34	+ */
35	+ public function useDefault($model) {
36	+ }
37	+ }

app/code/local/Mana/Db/Model/Formula/Node.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ */
11	+ class Mana_Db_Model_Formula_Node {
12	+ public function __construct($data = array()) {
13	+ foreach ($data as $property => $value) {
14	+ $this->$property = $value;
15	+ }
16	+ }
17	+ }

app/code/local/Mana/Db/Model/Formula/Node/Add.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_Add extends Mana_Db_Model_Formula_Node {
13	+ const ADD = Mana_Db_Helper_Formula_Parser::ADD;
14	+ const SUBTRACT = Mana_Db_Helper_Formula_Parser::SUBTRACT;
15	+
16	+ /**
17	+ * @var int
18	+ */
19	+ public $operator;
20	+ /**
21	+ * @var Mana_Db_Model_Formula_Node
22	+ */
23	+ public $a;
24	+ /**
25	+ * @var Mana_Db_Model_Formula_Node
26	+ */
27	+ public $b;
28	+ }

app/code/local/Mana/Db/Model/Formula/Node/Field.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_Field extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var string[]
15	+ */
16	+ public $identifiers;
17	+
18	+ public function __toString() {
19	+ return implode('.', $this->identifiers);
20	+ }
21	+ }

app/code/local/Mana/Db/Model/Formula/Node/FormulaExpr.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_FormulaExpr extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var Mana_Db_Model_Formula_Node[]
15	+ */
16	+ public $parts;
17	+ }

app/code/local/Mana/Db/Model/Formula/Node/FunctionCall.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_FunctionCall extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var string
15	+ */
16	+ public $name;
17	+ /**
18	+ * @var Mana_Db_Model_Formula_Node[]
19	+ */
20	+ public $args;
21	+ }

app/code/local/Mana/Db/Model/Formula/Node/Identifier.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_Identifier extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var string
15	+ */
16	+ public $identifier;
17	+ }

app/code/local/Mana/Db/Model/Formula/Node/Multiply.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_Multiply extends Mana_Db_Model_Formula_Node {
13	+ const MULTIPLY = Mana_Db_Helper_Formula_Parser::MULTIPLY;
14	+ const DIVIDE = Mana_Db_Helper_Formula_Parser::DIVIDE;
15	+
16	+ /**
17	+ * @var int
18	+ */
19	+ public $operator;
20	+ /**
21	+ * @var Mana_Db_Model_Formula_Node
22	+ */
23	+ public $a;
24	+ /**
25	+ * @var Mana_Db_Model_Formula_Node
26	+ */
27	+ public $b;
28	+ }

app/code/local/Mana/Db/Model/Formula/Node/NullValue.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_NullValue extends Mana_Db_Model_Formula_Node {
13	+ }

app/code/local/Mana/Db/Model/Formula/Node/NumberConstant.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_NumberConstant extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var string
15	+ */
16	+ public $value;
17	+ }

app/code/local/Mana/Db/Model/Formula/Node/StringConstant.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Formula_Node_StringConstant extends Mana_Db_Model_Formula_Node {
13	+ /**
14	+ * @var string
15	+ */
16	+ public $value;
17	+ }

app/code/local/Mana/Db/Model/Indexer.php CHANGED Viewed

	@@ -20,7 +20,7 @@ class Mana_Db_Model_Indexer extends Mage_Index_Model_Indexer_Abstract {
20	}
21	public function getName()
22	{
23	- return Mage::helper('mana_db')->__('Default Values');
24	}
25	public function getDescription()
26	{


20	}
21	public function getName()
22	{
23	+ return Mage::helper('mana_db')->__('Default Values (MANAdev)');
24	}
25	public function getDescription()
26	{

app/code/local/Mana/Db/Model/Observer.php CHANGED Viewed

@@ -28,7 +28,19 @@ class Mana_Db_Model_Observer {
             			Mage::unregister('m_run_db_replication');
             			$this->_getProcess()->changeStatus(Mage_Index_Model_Process::STATUS_REQUIRE_REINDEX)->reindexAll();
+            		}
-            -
            	}
             	/**
             	 * Enter description here ...
             	 * @param unknown_type $observer
@@ -101,13 +113,28 @@ class Mana_Db_Model_Observer {
             	 * Runs data replication actions if related configuration changed (handles event "core_config_data_save_commit_after")
             	 * @param Varien_Event_Observer $observer
             	 */
-            -
            	public function afterConfigSave($observer) {
-            -
            		$configData = $observer->getEvent()->getObject();
-            -
            		if ($configData->getResourceName() == 'core/config_data' &&
-            -
            			Mage::helper('mana_db')->isReplicatedConfigChanged($configData))
+            		{
             			Mage::register('m_run_db_replication', true);
+            		}
+            	}
-            -
+            }


28	Mage::unregister('m_run_db_replication');
29	$this->_getProcess()->changeStatus(Mage_Index_Model_Process::STATUS_REQUIRE_REINDEX)->reindexAll();
30	}
31	+
32	+ /* @var $indexer Mage_Index_Model_Indexer */
33	+ $indexer = Mage::getSingleton('index/indexer');
34	+
35	+ if ($reindex = Mage::registry('m_reindex')) {
36	+ foreach ($reindex as $code) {
37	+ $indexer->getProcessByCode($code)
38	+ ->changeStatus(Mage_Index_Model_Process::STATUS_REQUIRE_REINDEX)
39	+ ->reindexAll();
40	+ }
41	+ }
42	+
43	+ }
44	/**
45	* Enter description here ...
46	* @param unknown_type $observer

113	* Runs data replication actions if related configuration changed (handles event "core_config_data_save_commit_after")
114	* @param Varien_Event_Observer $observer
115	*/
116	+ public function afterSaveCommit($observer) {
117	+ $object = $observer->getEvent()->getObject();
118	+ if ($object->getResourceName() == 'core/config_data' &&
119	+ Mage::helper('mana_db')->isReplicatedConfigChanged($object))
120	{
121	Mage::register('m_run_db_replication', true);
122	}
123	+ elseif ($object->getResourceName() == 'cms/page') {
124	+ if (!Mage::registry('m_prevent_indexing_on_save')) {
125	+ $this->getIndexerSingleton()->processEntityAction($object, 'cms/page', Mage_Index_Model_Event::TYPE_SAVE);
126	+ }
127	+ }
128	}
129	+
130	+ public function afterConfigSave($observer) {}
131	+
132	+ #region Dependencies
133	+ /**
134	+ * @return Mage_Index_Model_Indexer
135	+ */
136	+ public function getIndexerSingleton() {
137	+ return Mage::getSingleton('index/indexer');
138	+ }
139	+ #endregion
140	}

app/code/local/Mana/Db/Model/Setup.php ADDED Viewed

	@@ -0,0 +1,84 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mage_Core_Model_Resource_Setup getInstaller()
11	+ * @method Mana_Db_Model_Setup setInstaller(Mage_Core_Model_Resource_Setup $value)
12	+ * @method string getModuleName()
13	+ * @method Mana_Db_Model_Setup setModuleName(string $value)
14	+ * @method string getVersion()
15	+ * @method Mana_Db_Model_Setup setVersion(string $value)
16	+ * @method string getSetupVersion()
17	+ * @method Mana_Db_Model_Setup setSetupVersion(string $value)
18	+ */
19	+ class Mana_Db_Model_Setup extends Varien_Object {
20	+ public function run ($installer, $moduleName, $version) {
21	+ /* @var $configHelper Mana_Db_Helper_Config */
22	+ $configHelper = Mage::helper('mana_db/config');
23	+
24	+ $installerKey = 'v'.$version;
25	+ $setupVersion = $configHelper->getXml()->getNode()->modules->$moduleName->installer_versions->$installerKey;
26	+
27	+ $this
28	+ ->setInstaller($installer)
29	+ ->setModuleName($moduleName)
30	+ ->setVersion($version)
31	+ ->setSetupVersion($setupVersion)
32	+ ->_beforeRun()
33	+ ->_run()
34	+ ->_afterRun();
35	+ }
36	+ protected function _beforeRun() {
37	+ $installer = $this->getInstaller();
38	+
39	+ if (defined('COMPILER_INCLUDE_PATH')) {
40	+ throw new Exception(Mage::helper('mana_core')->__(
41	+ 'This Magento installation contains pending database installation/upgrade scripts. Please turn off Magento compilation feature while installing/upgrading new modules in Admin Panel menu System->Tools->Compilation.'
42	+ ));
43	+ }
44	+
45	+ if (method_exists($installer->getConnection(), 'allowDdlCache')) {
46	+ $installer->getConnection()->allowDdlCache();
47	+ }
48	+
49	+ return $this;
50	+ }
51	+ protected function _run() {
52	+ /* @var $configHelper Mana_Db_Helper_Config */
53	+ $configHelper = Mage::helper('mana_db/config');
54	+
55	+ $setupVersion = $configHelper->getSetup($this->getSetupVersion());
56	+ $setupVersion->setData($this->getData());
57	+ $setupVersion->run();
58	+
59	+ return $this;
60	+ }
61	+ protected function _afterRun() {
62	+ $installer = $this->getInstaller();
63	+
64	+ if (method_exists($installer->getConnection(), 'disallowDdlCache')) {
65	+ $installer->getConnection()->disallowDdlCache();
66	+ }
67	+ $installer->endSetup();
68	+
69	+ return $this;
70	+ }
71	+
72	+ public function scheduleReindexing($code) {
73	+ if ($reindex = Mage::registry('m_reindex')) {
74	+ Mage::unregister('m_reindex');
75	+ }
76	+ else {
77	+ $reindex = array();
78	+ }
79	+ $reindex[$code] = $code;
80	+ Mage::register('m_reindex', $reindex);
81	+
82	+ return $this;
83	+ }
84	+ }

app/code/local/Mana/Db/Model/Setup/Abstract.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method Mage_Core_Model_Resource_Setup getInstaller()
11	+ * @method Mana_Db_Model_Setup_Abstract setInstaller(Mage_Core_Model_Resource_Setup $value)
12	+ * @method string getModuleName()
13	+ * @method Mana_Db_Model_Setup_Abstract setModuleName(string $value)
14	+ * @method string getVersion()
15	+ * @method Mana_Db_Model_Setup_Abstract setVersion(string $value)
16	+ * @method string getSql()
17	+ * @method Mana_Db_Model_Setup_Abstract setSql(string $value)
18	+ */
19	+ class Mana_Db_Model_Setup_Abstract extends Varien_Object {
20	+ public function getTable($entityName) {
21	+ /* @var $db Mana_Db_Helper_Data */
22	+ $db = Mage::helper('mana_db');
23	+
24	+ return $this->getInstaller()->getTable($db->getScopedName($entityName));
25	+ }
26	+ public function prepare() {
27	+ return $this;
28	+ }
29	+
30	+ public function run() {
31	+ return $this;
32	+ }
33	+ }

app/code/local/Mana/Db/Model/Setup/V13012122.php ADDED Viewed

	@@ -0,0 +1,478 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Model_Setup_V13012122 extends Mana_Db_Model_Setup_Abstract {
13	+ protected $_toBeCreated = array();
14	+ protected $_toBeAltered = array();
15	+
16	+ public function prepare() {
17	+ /* @var $configHelper Mana_Db_Helper_Config */
18	+ $configHelper = Mage::helper('mana_db/config');
19	+
20	+ $configHelper->iterate(array('scope' => array($this, '_createPrimaryKey')));
21	+ $configHelper->iterate(array('scope' => array($this, '_createDefaultValueInfrastructure')));
22	+ $configHelper->iterate(array('scope' => array($this, '_createStoreSpecificsInfrastructure')));
23	+ $configHelper->iterate(array('scope' => array($this, '_createGridEditingInfrastructure')));
24	+ $configHelper->iterate(array('scope' => array($this, '_createFlatInfrastructure')));
25	+
26	+ return $this;
27	+ }
28	+
29	+ public function run() {
30	+ /* @var $configHelper Mana_Db_Helper_Config */
31	+ $configHelper = Mage::helper('mana_db/config');
32	+
33	+ $result = $configHelper->iterate(array(
34	+ 'scope_before' => array($this, '_beginTableScript'),
35	+ 'field' => array($this, '_fieldScript'),
36	+ 'scope_after' => array($this, '_endTableScript'),
37	+ ));
38	+
39	+ if ($result->getSql()) {
40	+ $this->getInstaller()->run($result->getSql());
41	+ }
42	+ return $this;
43	+ }
44	+
45	+ /**
46	+ * @param Varien_Object $context
47	+ * @param Varien_Simplexml_Element $module
48	+ * @param Varien_Simplexml_Element $entity
49	+ * @param Varien_Simplexml_Element $scope
50	+ */
51	+ public function _createPrimaryKey($context, $module, $entity, $scope) {
52	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
53	+ return;
54	+ }
55	+ /* @var $configHelper Mana_Db_Helper_Config */
56	+ $configHelper = Mage::helper('mana_db/config');
57	+
58	+ $primaryField = $scope->xpath('fields/*[primary="1"]');
59	+ if (empty($primaryField)) {
60	+ $scope->fields->id->type = 'bigint';
61	+ $field = $scope->fields->id;
62	+ $field->primary = 1;
63	+ $field->role = Mana_Db_Helper_Config::ROLE_PRIMARY_KEY;
64	+ $configHelper->propagateName($field);
65	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
66	+ }
67	+ }
68	+
69	+ /**
70	+ * @param Varien_Object $context
71	+ * @param Varien_Simplexml_Element $module
72	+ * @param Varien_Simplexml_Element $entity
73	+ * @param Varien_Simplexml_Element $scope
74	+ */
75	+ public function _createDefaultValueInfrastructure($context, $module, $entity, $scope) {
76	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
77	+ return;
78	+ }
79	+
80	+ /* @var $configHelper Mana_Db_Helper_Config */
81	+ $configHelper = Mage::helper('mana_db/config');
82	+
83	+ if (!empty($scope->max_defaultable_fields) && empty($scope->flattens)) {
84	+ $maxFields = (int)(string)$scope->max_defaultable_fields;
85	+ for ($i = 0; $i * 15 < $maxFields; $i++) {
86	+ $fieldName = "default_mask{$i}";
87	+ $scope->fields->$fieldName->type = 'int unsigned';
88	+ $field = $scope->fields->$fieldName;
89	+ $field->default_value = 0;
90	+ $field->role = Mana_Db_Helper_Config::ROLE_DEFAULT_VALUE;
91	+ $configHelper->propagateName($field);
92	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
93	+ }
94	+
95	+ $fieldName = 'default_formula_hash';
96	+ $scope->fields->$fieldName->type = 'varchar(40)';
97	+ $field = $scope->fields->$fieldName;
98	+ $field->indexed = 1;
99	+ $field->role = Mana_Db_Helper_Config::ROLE_DEFAULT_VALUE;
100	+ $configHelper->propagateName($field);
101	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
102	+
103	+
104	+ $fieldName = 'default_formulas';
105	+ $scope->fields->$fieldName->type = 'mediumtext';
106	+ $field = $scope->fields->$fieldName;
107	+ $field->role = Mana_Db_Helper_Config::ROLE_DEFAULT_VALUE;
108	+ $configHelper->propagateName($field);
109	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
110	+ }
111	+ }
112	+
113	+ /**
114	+ * @param Varien_Object $context
115	+ * @param Varien_Simplexml_Element $module
116	+ * @param Varien_Simplexml_Element $entity
117	+ * @param Varien_Simplexml_Element $scope
118	+ */
119	+ public function _createStoreSpecificsInfrastructure($context, $module, $entity, $scope) {
120	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
121	+ return;
122	+ }
123	+
124	+ /* @var $configHelper Mana_Db_Helper_Config */
125	+ $configHelper = Mage::helper('mana_db/config');
126	+
127	+ if (!empty($scope->store_specifics_for)) {
128	+ $globalScope = (string)$scope->store_specifics_for;
129	+
130	+ $fieldName = 'global_id';
131	+ $scope->fields->$fieldName->type = 'bigint';
132	+ $field = $scope->fields->$fieldName;
133	+ $field->foreign->entity = $globalScope;
134	+ $field->foreign->field = 'id';
135	+ $field->foreign->on_update = 'cascade';
136	+ $field->foreign->on_delete = 'cascade';
137	+ $field->role = Mana_Db_Helper_Config::ROLE_STORE_SPECIFICS;
138	+ $configHelper->propagateName($field);
139	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
140	+
141	+ $fieldName = 'store_id';
142	+ $scope->fields->$fieldName->type = 'smallint(5) unsigned';
143	+ $field = $scope->fields->$fieldName;
144	+ $field->foreign->entity = 'core/store';
145	+ $field->foreign->field = 'store_id';
146	+ $field->foreign->on_update = 'cascade';
147	+ $field->foreign->on_delete = 'cascade';
148	+ $field->role = Mana_Db_Helper_Config::ROLE_STORE_SPECIFICS;
149	+ $configHelper->propagateName($field);
150	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
151	+
152	+
153	+ }
154	+ }
155	+
156	+ /**
157	+ * @param Varien_Object $context
158	+ * @param Varien_Simplexml_Element $module
159	+ * @param Varien_Simplexml_Element $entity
160	+ * @param Varien_Simplexml_Element $scope
161	+ */
162	+ public function _createGridEditingInfrastructure($context, $module, $entity, $scope) {
163	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
164	+ return;
165	+ }
166	+
167	+ /* @var $configHelper Mana_Db_Helper_Config */
168	+ $configHelper = Mage::helper('mana_db/config');
169	+
170	+ if (!empty($scope->editable_in_grid)) {
171	+
172	+ $fieldName = 'edit_session_id';
173	+ $scope->fields->$fieldName->type = 'bigint';
174	+ $field = $scope->fields->$fieldName;
175	+ $field->default_value = 0;
176	+ $field->foreign->entity = 'mana_db/edit_session';
177	+ $field->foreign->field = 'id';
178	+ $field->foreign->on_update = 'cascade';
179	+ $field->foreign->on_delete = 'cascade';
180	+ $field->role = Mana_Db_Helper_Config::ROLE_GRID_EDITING;
181	+ $configHelper->propagateName($field);
182	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
183	+
184	+ $fieldName = 'edit_status';
185	+ $scope->fields->$fieldName->type = 'bigint';
186	+ $field = $scope->fields->$fieldName;
187	+ $field->default_value = 0;
188	+ $field->indexed = 1;
189	+ $field->role = Mana_Db_Helper_Config::ROLE_GRID_EDITING;
190	+ $configHelper->propagateName($field);
191	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
192	+
193	+ $fieldName = 'edit_massaction';
194	+ $scope->fields->$fieldName->type = 'tinyint';
195	+ $field = $scope->fields->$fieldName;
196	+ $field->default_value = 0;
197	+ $field->indexed = 1;
198	+ $field->role = Mana_Db_Helper_Config::ROLE_GRID_EDITING;
199	+ $configHelper->propagateName($field);
200	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
201	+
202	+ }
203	+ }
204	+
205	+ /**
206	+ * @param Varien_Object $context
207	+ * @param Varien_Simplexml_Element $module
208	+ * @param Varien_Simplexml_Element $entity
209	+ * @param Varien_Simplexml_Element $scope
210	+ */
211	+ public function _createFlatInfrastructure($context, $module, $entity, $scope) {
212	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
213	+ return;
214	+ }
215	+
216	+ /* @var $configHelper Mana_Db_Helper_Config */
217	+ $configHelper = Mage::helper('mana_db/config');
218	+
219	+ if (!empty($scope->flattens)) {
220	+ $flattenedScopeXml = $configHelper->getScopeXml((string)$scope->flattens);
221	+ if (!empty($flattenedScopeXml->store_specifics_for)) {
222	+ $global = (string)$flattenedScopeXml->store_specifics_for;
223	+ $fieldName = 'global_id';
224	+ $scope->fields->$fieldName->type = 'bigint';
225	+ $field = $scope->fields->$fieldName;
226	+ $field->foreign->entity = substr($global, 0, strrpos($global, '/')).'/flat';
227	+ $field->foreign->field = 'id';
228	+ $field->foreign->on_update = 'cascade';
229	+ $field->foreign->on_delete = 'cascade';
230	+ $field->role = Mana_Db_Helper_Config::ROLE_STORE_SPECIFICS;
231	+ $field->default_formula = '{{= global.id }}';
232	+ $configHelper->propagateName($field);
233	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
234	+
235	+ $fieldName = 'store_id';
236	+ $scope->fields->$fieldName->type = 'smallint(5) unsigned';
237	+ $field = $scope->fields->$fieldName;
238	+ $field->foreign->entity = 'core/store';
239	+ $field->foreign->field = 'store_id';
240	+ $field->foreign->on_update = 'cascade';
241	+ $field->foreign->on_delete = 'cascade';
242	+ $field->role = Mana_Db_Helper_Config::ROLE_STORE_SPECIFICS;
243	+ $field->default_formula = '{{= store.store_id }}';
244	+ $configHelper->propagateName($field);
245	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
246	+
247	+ $fieldName = 'primary_global_id';
248	+ $scope->fields->$fieldName->type = 'bigint';
249	+ $field = $scope->fields->$fieldName;
250	+ $field->foreign->entity = (string)$flattenedScopeXml->store_specifics_for;
251	+ $field->foreign->field = 'id';
252	+ $field->role = Mana_Db_Helper_Config::ROLE_FLAT;
253	+ $field->default_formula = '{{= global.primary.id }}';
254	+ $field->nullable = 1;
255	+ $configHelper->propagateName($field);
256	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
257	+
258	+ $fieldName = 'primary_id';
259	+ $scope->fields->$fieldName->type = 'bigint';
260	+ $field = $scope->fields->$fieldName;
261	+ $field->foreign->entity = (string)$scope->flattens;
262	+ $field->foreign->field = 'id';
263	+ $field->foreign->on_update = 'cascade';
264	+ $field->foreign->on_delete = 'cascade';
265	+ $field->role = Mana_Db_Helper_Config::ROLE_FLAT;
266	+ $field->default_formula = '{{= primary.id }}';
267	+ $field->nullable = 1;
268	+ $configHelper->propagateName($field);
269	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
270	+
271	+ $scope->unique->primary->global_id = '';
272	+ $scope->unique->primary->store_id = '';
273	+ }
274	+ else {
275	+ $fieldName = 'primary_id';
276	+ $scope->fields->$fieldName->type = 'bigint';
277	+ $field = $scope->fields->$fieldName;
278	+ $field->foreign->entity = (string)$scope->flattens;
279	+ $field->foreign->field = 'id';
280	+ $field->foreign->on_update = 'cascade';
281	+ $field->foreign->on_delete = 'cascade';
282	+ $field->role = Mana_Db_Helper_Config::ROLE_FLAT;
283	+ $field->default_formula = '{{= primary.id }}';
284	+ $field->nullable = 1;
285	+ $field->unique = 1;
286	+ $configHelper->propagateName($field);
287	+ $configHelper->propagateAttributes($scope, $field, array('module', 'version'));
288	+ }
289	+ }
290	+ }
291	+
292	+ /**
293	+ * @param Varien_Object $context
294	+ * @param Varien_Simplexml_Element $module
295	+ * @param Varien_Simplexml_Element $entity
296	+ * @param Varien_Simplexml_Element $scope
297	+ */
298	+ public function _beginTableScript($context, $module, $entity, $scope) {
299	+ $context->setFields(array());
300	+ $context->setIndexes(array());
301	+ $context->setConstraints(array());
302	+ }
303	+
304	+ /**
305	+ * @param Varien_Object $context
306	+ * @param Varien_Simplexml_Element $module
307	+ * @param Varien_Simplexml_Element $entity
308	+ * @param Varien_Simplexml_Element $scope
309	+ * @param Varien_Simplexml_Element $field
310	+ */
311	+ public function _fieldScript($context, $module, $entity, $scope, $field) {
312	+ if (((string)$field['module']) != $this->getModuleName() \|\| ((string)$field['version']) != $this->getVersion()) {
313	+ return;
314	+ }
315	+ $fields = $context->getFields();
316	+ $fields[] = $field;
317	+ $context->setFields($fields);
318	+
319	+ if (isset($field->indexed) \|\| isset($field->foreign) \|\| !empty($field->primary)) {
320	+ $indexes = $context->getIndexes();
321	+ $indexes[] = $field;
322	+ $context->setIndexes($indexes);
323	+ }
324	+
325	+ if (isset($field->foreign)) {
326	+ $constraints = $context->getConstraints();
327	+ $constraints[] = $field;
328	+ $context->setConstraints($constraints);
329	+ }
330	+ }
331	+
332	+ /**
333	+ * @param Varien_Object $context
334	+ * @param Varien_Simplexml_Element $module
335	+ * @param Varien_Simplexml_Element $entity
336	+ * @param Varien_Simplexml_Element $scope
337	+ */
338	+ public function _endTableScript($context, $module, $entity, $scope) {
339	+ $scope = $scope;
340	+ if (!empty($scope->unique)) {
341	+ /* @var $resource Mage_Core_Model_Mysql4_Resource */
342	+ $resource = Mage::getResourceSingleton('core/resource');
343	+
344	+ $indexes = $context->getIndexes();
345	+ foreach ($scope->unique->children() as $unique) {
346	+ $index = (object)array('unique' => 1, 'name' => 'unique_'.$unique->getName(), 'indexed_fields' => array());
347	+ $includeUniqueIndex = false;
348	+ foreach ($unique->children() as $field => $def) {
349	+ if (((string)$def['module']) == $this->getModuleName() && ((string)$def['version']) == $this->getVersion()) {
350	+ $includeUniqueIndex = true;
351	+ $index->indexed_fields[] = $field;
352	+ }
353	+ else {
354	+ $installedVersion = $resource->getDbVersion(((string)$def['module']).'_setup');
355	+ if ($installedVersion && version_compare($installedVersion, (string)$def['version']) >= 0) {
356	+ $index->indexed_fields[] = $field;
357	+ }
358	+ }
359	+ }
360	+ if ($includeUniqueIndex) {
361	+ if (!(((string)$scope->unique['module']) == $this->getModuleName() && ((string)$scope->unique['version']) == $this->getVersion())) {
362	+ $index->rebuild = true;
363	+ }
364	+ $indexes[] = $index;
365	+ }
366	+ }
367	+ $context->setIndexes($indexes);
368	+ }
369	+
370	+ $sql = $context->getSql();
371	+ $context->setTable(
372	+ $this->getTable(((string)$module->name) . '/' .
373	+ ((string)$entity->name) . '/' .
374	+ ((string)$scope->name)));
375	+ if (((string)$scope['module']) != $this->getModuleName() \|\| ((string)$scope['version']) != $this->getVersion()) {
376	+ foreach ($context->getFields() as $field) {
377	+ $sql .= "ALTER TABLE `{$context->getTable()}` ADD COLUMN ( ";
378	+ $sql .= $this->_renderField($field);
379	+ $sql .= ");\n";
380	+ }
381	+ foreach ($context->getIndexes() as $index) {
382	+ if (!empty($index->rebuild)) {
383	+ $sql .= "ALTER TABLE `{$context->getTable()}` DROP KEY `".(string)$index->name."`";
384	+ $sql .= ";\n";
385	+ }
386	+ $sql .= "ALTER TABLE `{$context->getTable()}` ADD ";
387	+ $sql .= $this->_renderIndex($index);
388	+ $sql .= ";\n";
389	+ }
390	+ }
391	+ else {
392	+ if (count($context->getFields()) \|\| count($context->getIndexes())) {
393	+ $sql .= "DROP TABLE IF EXISTS `{$context->getTable()}`;\n";
394	+ $sql .= "CREATE TABLE `{$context->getTable()}` ( \n";
395	+ $sep = false;
396	+ foreach ($context->getFields() as $field) {
397	+ if ($sep) $sql .= ", \n"; else $sep = true;
398	+ $sql .= " ".$this->_renderField($field);
399	+ }
400	+ foreach ($context->getIndexes() as $index) {
401	+ if ($sep) $sql .= ", \n"; else $sep = true;
402	+ $sql .= " " .$this->_renderIndex($index);
403	+ }
404	+ $sql .= "\n";
405	+ $sql .= ") ENGINE=InnoDB DEFAULT CHARSET=utf8 COMMENT='';\n";
406	+ }
407	+ }
408	+ foreach ($context->getConstraints() as $constraint) {
409	+ $sql .= "ALTER TABLE `{$context->getTable()}` ADD CONSTRAINT ";
410	+ $sql .= $this->_renderConstraint($context, $constraint);
411	+ $sql .= ";\n";
412	+ }
413	+
414	+ $context->setSql($sql);
415	+ }
416	+
417	+ protected function _renderField($field) {
418	+ $sql = '';
419	+ $sql .= "`".((string)$field->name)."` ";
420	+ $sql .= ((string)$field->type) ." ";
421	+ if (isset($field->nullable)) {
422	+ $sql .= "null ";
423	+ }
424	+ else {
425	+ $sql .= "NOT null ";
426	+ if (!empty($field->default_value) && strpos(strtolower((string)$field->type), 'text') === false) {
427	+ $sql .= "DEFAULT '".((string)$field->default_value)."' ";
428	+ }
429	+ elseif (strpos((string)$field->type, 'varchar') !== false) {
430	+ $sql .= "DEFAULT '' ";
431	+ }
432	+ }
433	+ if (!empty($field->primary)) {
434	+ $sql .= "AUTO_INCREMENT ";
435	+ }
436	+ return $sql;
437	+ }
438	+
439	+ protected function _renderIndex($field) {
440	+ $sql = '';
441	+ if (!empty($field->primary)) {
442	+ $sql .= "PRIMARY KEY ";
443	+ }
444	+ elseif (!empty($field->unique)) {
445	+ $sql .= "UNIQUE KEY `" . ((string)$field->name) . "` ";
446	+ }
447	+ else {
448	+ $sql .= "KEY `" . ((string)$field->name) . "` ";
449	+ }
450	+ if (empty($field->indexed_fields)) {
451	+ $sql .= "(`" . ((string)$field->name) . "`) ";
452	+ }
453	+ else {
454	+ $indexedFields = array();
455	+ foreach ($field->indexed_fields as $indexedField) {
456	+ $indexedFields[] = "`$indexedField`";
457	+ }
458	+ $sql .= "(" . implode(', ', $indexedFields) . ") ";
459	+ }
460	+
461	+ return $sql;
462	+ }
463	+
464	+ protected function _renderConstraint($context, $field) {
465	+ $sql = '';
466	+ $sql .= "`FK_{$context->getTable()}_". ((string)$field->name)."` ";
467	+ $sql .= "FOREIGN KEY (`" . ((string)$field->name). "`) ";
468	+ $sql .= "REFERENCES `{$this->getTable((string)$field->foreign->entity)}` (`".((string)$field->foreign->field)."`) ";
469	+ if (!empty($field->foreign->on_delete)) {
470	+ $sql .= "ON DELETE " . ((string)$field->foreign->on_delete) . " ";
471	+ }
472	+ if (!empty($field->foreign->on_update)) {
473	+ $sql .= "ON UPDATE ".((string)$field->foreign->on_update)." ";
474	+ }
475	+
476	+ return $sql;
477	+ }
478	+ }

app/code/local/Mana/Db/Resource/Edit/Session.php CHANGED Viewed

@@ -45,4 +45,15 @@ class Mana_Db_Resource_Edit_Session extends Mage_Core_Model_Mysql4_Abstract {//M
                 		throw $e;
+                	}
+                }
+            }


45	throw $e;
46	}
47	}
48	+
49	+ public function isExpired($editSessionId) {
50	+ $db = $this->_getReadAdapter();
51	+ $table = Mage::getSingleton('core/resource')->getTableName('mana_db/edit_session');
52	+
53	+ $select = $db->select()
54	+ ->from($table, 'id')
55	+ ->where("id = ?", $editSessionId);
56	+
57	+ return $db->fetchOne($select) ? false : true;
58	+ }
59	}

app/code/local/Mana/Db/Resource/Entity.php ADDED Viewed

	@@ -0,0 +1,86 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getScopeName()
11	+ *
12	+ */
13	+ class Mana_Db_Resource_Entity extends Mage_Core_Model_Mysql4_Abstract {
14	+ protected $_scope;
15	+
16	+ public function __construct($data = null) {
17	+ if (is_array($data)) {
18	+ if (isset($data['scope'])) {
19	+ $this->_scope = $data['scope'];
20	+ }
21	+ }
22	+
23	+ parent::__construct();
24	+ }
25	+
26	+ /**
27	+ * @param Mana_Db_Model_Entity $object
28	+ * @param int $id
29	+ * @param int $storeId
30	+ * @param string $fieldName
31	+ * @return Mana_Db_Resource_Entity
32	+ */
33	+ public function loadForStore($object, $id, $storeId, $fieldName) {
34	+ $read = $this->_getReadAdapter();
35	+ $select = $this->_getReadAdapter()->select()
36	+ ->from($this->getMainTable())
37	+ ->where("{$this->getMainTable()}.`$fieldName` = ?", $id)
38	+ ->where("{$this->getMainTable()}.`store_id` = ?", $storeId);
39	+ $data = $read->fetchRow($select);
40	+
41	+ if ($data) {
42	+ $object->setData($data);
43	+ }
44	+
45	+ $this->unserializeFields($object);
46	+ $this->_afterLoad($object);
47	+
48	+ return $this;
49	+ }
50	+
51	+ protected function _construct() {
52	+ $this->_initScope();
53	+ }
54	+ protected function _initScope() {
55	+
56	+ /* @var $db Mana_Db_Helper_Data */
57	+ $db = Mage::helper('mana_db');
58	+
59	+ $this->_init($db->getScopedName($this->_scope), 'id');
60	+ return $this;
61	+ }
62	+
63	+ /**
64	+ * @param Mana_Db_Model_Entity $object
65	+ * @param int $id
66	+ * @param int $sessionId
67	+ * @return Mana_Db_Resource_Entity
68	+ */
69	+ public function loadEdited($object, $id, $sessionId) {
70	+ $read = $this->_getReadAdapter();
71	+ $select = $read->select()
72	+ ->from($this->getMainTable())
73	+ ->where("{$this->getMainTable()}.`edit_status` = ?", $id)
74	+ ->where("{$this->getMainTable()}.`edit_session_id` = ?", $sessionId);
75	+ $data = $read->fetchRow($select);
76	+
77	+ if ($data) {
78	+ $object->setData($data);
79	+ }
80	+
81	+ $this->unserializeFields($object);
82	+ $this->_afterLoad($object);
83	+
84	+ return $this;
85	+ }
86	+ }

app/code/local/Mana/Db/Resource/Entity/Collection.php ADDED Viewed

	@@ -0,0 +1,124 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getScopeName()
11	+ */
12	+ class Mana_Db_Resource_Entity_Collection extends Mage_Core_Model_Mysql4_Collection_Abstract {
13	+ protected $_scope;
14	+ protected $_editFilter = null;
15	+ protected $_parentCondition = '';
16	+
17	+ public function __construct($resource = null) {
18	+ if (is_array($resource)) {
19	+ if (isset($resource['scope'])) {
20	+ $this->_scope = $resource['scope'];
21	+ }
22	+ $resource = isset($resource['resource']) ? $resource['resource'] : null;
23	+ }
24	+
25	+ parent::__construct($resource);
26	+ }
27	+
28	+ protected function _construct() {
29	+ $this->_initScope();
30	+ }
31	+ protected function _initScope() {
32	+
33	+ /* @var $db Mana_Db_Helper_Data */
34	+ $db = Mage::helper('mana_db');
35	+
36	+ $this->_init($this->_scope);
37	+ return $this;
38	+ }
39	+
40	+ /**
41	+ * Get resource instance
42	+ *
43	+ * @return Mage_Core_Model_Mysql4_Abstract
44	+ */
45	+ public function getResource() {
46	+ if (empty($this->_resource)) {
47	+ /* @var $db Mana_Db_Helper_Data */
48	+ $db = Mage::helper('mana_db');
49	+
50	+ $this->_resource = $db->getResourceSingleton($this->getResourceModelName());
51	+ }
52	+
53	+ return $this->_resource;
54	+ }
55	+
56	+ public function getNewEmptyItem() {
57	+ /* @var $db Mana_Db_Helper_Data */
58	+ $db = Mage::helper('mana_db');
59	+
60	+ return $db->getModel($this->_model);
61	+ }
62	+
63	+ public function setEditFilter($editFilter, $parentCondition = '') {
64	+ $this->_editFilter = $editFilter;
65	+ $this->_parentCondition = $parentCondition;
66	+
67	+ return $this;
68	+ }
69	+
70	+ public function setStoreFilter($storeId = null) {
71	+ if ($storeId === null) {
72	+ $storeId = Mage::app()->getStore()->getId();
73	+ }
74	+
75	+ $this->getSelect()->where("`main_table`.`store_id` = ?", $storeId);
76	+ return $this;
77	+ }
78	+
79	+ protected function _beforeLoad() {
80	+ $this->_renderEditFilter();
81	+ parent::_beforeLoad();
82	+
83	+ return $this;
84	+ }
85	+
86	+ protected function _renderEditFilter($select = null) {
87	+ if (!$select) {
88	+ $select = $this->getSelect();
89	+ }
90	+ $alias = 'main_table';
91	+ if (is_array($this->_editFilter)) {
92	+ $sql = count($this->_editFilter['saved'])
93	+ ? $this->getConnection()->quoteInto("$alias.edit_status = 0 AND $alias.id NOT IN (?)", array_keys($this->_editFilter['saved']))
94	+ : "$alias.edit_status = 0";
95	+ if ($this->_parentCondition) {
96	+ $sql .= " AND ($alias.{$this->_parentCondition})";
97	+ }
98	+ if (count($this->_editFilter['saved'])) {
99	+ $sql = "($sql) OR ({$this->getConnection()->quoteInto(
100	+ "$alias.edit_status <> 0 AND $alias.edit_session_id = ?", $this->_editFilter['sessionId'])})";
101	+ }
102	+ if (count($this->_editFilter['deleted'])) {
103	+ $sql = "($sql)" .
104	+ " AND ({$this->getConnection()->quoteInto("$alias.id NOT IN (?)", $this->_editFilter['deleted'])})";
105	+ //" AND ({$this->getConnection()->quoteInto("$alias.edit_status NOT IN (?)", $this->_editFilter['deleted'])})";
106	+ }
107	+ $select->where($sql);
108	+ }
109	+ elseif ($this->_editFilter) {
110	+ $select->where("$alias.edit_status = 0");
111	+ if ($this->_parentCondition) {
112	+ $select->where("$alias.{$this->_parentCondition}");
113	+ }
114	+ }
115	+
116	+ return $this;
117	+ }
118	+
119	+ public function getSelectCountSql() {
120	+ $sql = parent::getSelectCountSql();
121	+ $this->_renderEditFilter($sql);
122	+ return $sql;
123	+ }
124	+ }

app/code/local/Mana/Db/Resource/Entity/Indexer.php ADDED Viewed

	@@ -0,0 +1,89 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+
13	+ class Mana_Db_Resource_Entity_Indexer extends Mage_Core_Model_Mysql4_Abstract {
14	+ /**
15	+ * Resource initialization
16	+ */
17	+ protected function _construct() {
18	+ $this->_setResource('core');
19	+ }
20	+
21	+ /**
22	+ * @param Mana_Db_Model_Entity_Indexer $indexer provides access to process record and indexer setup
23	+ * @param Varien_Simplexml_Element $target setup in config.xml
24	+ * @param Varien_Simplexml_Element $scope setup in m_db.xml
25	+ * @param array $options on which records to run
26	+ * @return void
27	+ */
28	+ public function flattenScope($indexer, $target, $scope, $options) {
29	+ /** @noinspection PhpUndefinedFieldInspection */
30	+ $targetEntity = ((string)$target->entity) . '/' . $scope->getName();
31	+
32	+ if (isset($options['entity_filters']) && !isset($options['entity_filters'][$targetEntity])) {
33	+ return;
34	+ }
35	+ $options = array_merge(array(
36	+ 'provide_field_details_in_exceptions' => true,
37	+ ), $options);
38	+ if (isset($options['entity_filters']) && !isset($options['entity_filter_formula'])) {
39	+ $options['entity_filter_formula'] = '{{= ' . $options['entity_filters'][$targetEntity] . '}}';
40	+ }
41	+ $db = $this->_getWriteAdapter();
42	+ /* @var $res Mage_Core_Model_Resource */
43	+ $res = Mage::getSingleton('core/resource');
44	+ /* @var $dbHelper Mana_Db_Helper_Data */
45	+ $dbHelper = Mage::helper('mana_db');
46	+ /* @var $formulaHelper Mana_Db_Helper_Formula */
47	+ $formulaHelper = Mage::helper('mana_db/formula');
48	+
49	+
50	+ // get basic select from all source tables, properly joined (based on m_db.xml)
51	+ /** @noinspection PhpUndefinedFieldInspection */
52	+ $entity = (string)$scope->flattens;
53	+ //$db->query($formulaHelper->delete($entity, $targetEntity));
54	+
55	+ // get formula hashes and formula texts
56	+ $formulaGroups = $formulaHelper->getFormulaGroups($targetEntity, $options);
57	+
58	+ // for each formula hash => formula text
59	+ foreach ($formulaGroups as $formulas) {
60	+ $formulas = $formulas ? json_decode($formulas, true) : array();
61	+
62	+ // filter basic select by formula hash
63	+ $context = $formulaHelper->select($targetEntity, $formulas, $options);
64	+
65	+ // convert SELECT into UPDATE which acts as INSERT on DUPLICATE unique keys
66	+ $sql = $context->getSelect()->insertFromSelect(
67	+ $res->getTableName($dbHelper->getScopedName($targetEntity)),
68	+ $context->getFields());
69	+
70	+ // run the statement
71	+ try {
72	+ $db->query($sql);
73	+ }
74	+ catch (Exception $e) {
75	+ /* @var $logger Mana_Core_Helper_Logger */
76	+ $logger = Mage::helper('mana_core/logger');
77	+ $logger->logDbIndexerFailure($sql);
78	+ throw $e;
79	+ }
80	+
81	+ }
82	+ }
83	+
84	+ protected function _getUpdateSelect($basicSelect, $formulaHash) {
85	+ $select = clone $basicSelect;
86	+
87	+ return $select;
88	+ }
89	+ }

app/code/local/Mana/Db/Resource/Entity/JsonCollection.php ADDED Viewed

	@@ -0,0 +1,186 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ * @method string getScopeName()
11	+ */
12	+ class Mana_Db_Resource_Entity_JsonCollection extends Varien_Data_Collection {
13	+ protected $_rawData = array();
14	+ protected $_data = array();
15	+ protected $_mFilters = array();
16	+
17	+ /**
18	+ * @param $data
19	+ * @return Mana_Db_Resource_Entity_JsonCollection
20	+ */
21	+ public function setData($data) {
22	+ foreach (array_keys($data) as $index) {
23	+ if (!isset($data[$index]['id'])) {
24	+ $data[$index]['id'] = $index;
25	+ }
26	+ }
27	+ $this->_data = $data;
28	+ $this->_rawData = $data;
29	+
30	+ return $this;
31	+ }
32	+
33	+ public function getData() {
34	+ return $this->_data;
35	+ }
36	+ public function load($printQuery = false, $logQuery = false) {
37	+ if ($this->isLoaded()) {
38	+ return $this;
39	+ }
40	+
41	+ $this->_beforeLoad();
42	+
43	+ $this->_renderFilters()
44	+ ->_renderOrders()
45	+ ->_renderLimit();
46	+
47	+ $data = $this->getData();
48	+
49	+ if (is_array($data)) {
50	+ foreach ($data as $row) {
51	+ $item = $this->getNewEmptyItem();
52	+ $item->addData($row);
53	+ $this->addItem($item);
54	+ }
55	+ }
56	+
57	+ $this->_setIsLoaded();
58	+ $this->_afterLoad();
59	+
60	+ return $this;
61	+ }
62	+
63	+ protected function _beforeLoad() {
64	+ return $this;
65	+ }
66	+
67	+ protected function _afterLoad() {
68	+ return $this;
69	+ }
70	+
71	+ /**
72	+ * @return Mana_Db_Resource_Entity_JsonCollection
73	+ */
74	+ protected function _renderFilters() {
75	+ $this->_data = array_filter($this->_data, array($this, '_filterItem'));
76	+ return $this;
77	+ }
78	+
79	+ /**
80	+ * Render sql select orders
81	+ *
82	+ * @return Mana_Db_Resource_Entity_JsonCollection
83	+ */
84	+ protected function _renderOrders() {
85	+ if (count($this->_orders)) {
86	+ uasort($this->_data, array($this, '_compareItems'));
87	+ }
88	+
89	+ return $this;
90	+ }
91	+
92	+ /**
93	+ * Render sql select limit
94	+ *
95	+ * @return Mana_Db_Resource_Entity_JsonCollection
96	+ */
97	+ protected function _renderLimit() {
98	+ if ($this->_pageSize !== false) {
99	+ $offset = ($this->_curPage - 1) * $this->_pageSize;
100	+ $count = count($this->_data);
101	+ if ($count > $offset) {
102	+ if ($count >= $offset + $this->_pageSize) {
103	+ $this->_data = array_slice($this->_data, $offset, $this->_pageSize);
104	+ }
105	+ else {
106	+ $this->_data = array_slice($this->_data, $offset);
107	+ }
108	+ }
109	+ else {
110	+ $this->_data = array();
111	+ }
112	+ }
113	+
114	+ return $this;
115	+ }
116	+
117	+ public function getRawData() {
118	+ return $this->_rawData;
119	+ }
120	+
121	+ /**
122	+ * @param array $a
123	+ * @param array $b
124	+ * @return int
125	+ */
126	+ protected function _compareItems($a, $b) {
127	+ foreach ($this->_orders as $column => $direction) {
128	+ if (isset($a[$column])) {
129	+ if (isset($b[$column])) {
130	+ if ($a[$column] < $b[$column]) {
131	+ return strtolower($direction) == 'desc' ? 1 : -1;
132	+ }
133	+ if ($a[$column] > $b[$column]) {
134	+ return strtolower($direction) == 'desc' ? -1 : 1;
135	+ }
136	+ }
137	+ else {
138	+ return strtolower($direction) == 'desc' ? -1 : 1;
139	+ }
140	+ }
141	+ else {
142	+ if (isset($b[$column])) {
143	+ return strtolower($direction) == 'desc' ? 1 : -1;
144	+ }
145	+ }
146	+ }
147	+ return 0;
148	+ }
149	+
150	+ /**
151	+ * @param array $a
152	+ * @return bool
153	+ */
154	+ protected function _filterItem($a) {
155	+ foreach ($this->_mFilters as $filter) {
156	+ $value = isset($a[$filter['attribute']]) ? $a[$filter['attribute']] : '';
157	+ if (isset($filter['condition']['like'])) {
158	+ $test = $filter['condition']['like'];
159	+ if ($this->getMbstring()->stripos($value, $this->getMbstring()->substr($test, 1, mb_strlen($test) - 2)) === false) {
160	+ return false;
161	+ }
162	+ }
163	+ elseif (isset($filter['condition']['eq'])) {
164	+ $test = $filter['condition']['eq'];
165	+ if ($value != $test) {
166	+ return false;
167	+ }
168	+ }
169	+ }
170	+
171	+ return true;
172	+ }
173	+ public function addFieldToFilter($attribute, $condition = null) {
174	+ $this->_mFilters[] = array('attribute' => $attribute, 'condition' => $condition);
175	+ }
176	+
177	+ #region Dependencies
178	+
179	+ /**
180	+ * @return Mana_Core_Helper_Mbstring
181	+ */
182	+ public function getMbstring() {
183	+ return Mage::helper('mana_core/mbstring');
184	+ }
185	+ #endregion
186	+ }

app/code/local/Mana/Db/Resource/Formula.php ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Db
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Db_Resource_Formula extends Mage_Core_Model_Mysql4_Abstract {
13	+ /**
14	+ * Resource initialization
15	+ */
16	+ protected function _construct() {
17	+ $this->_setResource('core');
18	+ }
19	+
20	+ /**
21	+ * @param Mana_Db_Model_Formula_Context $context
22	+ * @param Mana_Db_Model_Formula_Expr $expr
23	+ * @return Varien_Db_Select
24	+ */
25	+ public function getAggregateSubSelect($context, $expr) {
26	+ /* @var $db Varien_Db_Adapter_Pdo_Mysql */
27	+ $db = $this->getReadConnection();
28	+
29	+ $select = $db->select();
30	+ throw new Exception('Not implemented');
31	+ }
32	+
33	+ public function getTableFields($entity) {
34	+ /* @var $dbHelper Mana_Db_Helper_Data */
35	+ $dbHelper = Mage::helper('mana_db');
36	+
37	+ return $this->getReadConnection()->describeTable($this->getTable($dbHelper->getScopedName($entity)));
38	+ }
39	+
40	+ /**
41	+ * @return Varien_Db_Select
42	+ */
43	+ public function select() {
44	+ /* @var $db Varien_Db_Adapter_Pdo_Mysql */
45	+ $db = $this->getReadConnection();
46	+
47	+ return $db->select();
48	+ }
49	+
50	+ }

app/code/local/Mana/Db/etc/config.xml CHANGED Viewed

	@@ -12,7 +12,7 @@
12	<Mana_Db>
13	<!-- This version number identifies version of database tables specific to this extension. It is written to
14	core_resource table. -->
15	- <version>12.04.16.22</version>
16	</Mana_Db>
17	</modules>
18	<!-- This section contains module settings which are merged into global configuration during each page load,
	@@ -72,6 +72,12 @@
72	<mana_db_replicator>
73	<model>mana_db/indexer</model>
74	</mana_db_replicator>






75	</indexer>
76	</index>
77	<!-- BASED ON SNIPPET: New Models/Event support (config.xml) -->
	@@ -138,7 +144,7 @@
138	<observers>
139	<mana_db>
140	<class>mana_db/observer</class> <!-- model name of class containing event handler methods -->
141	- <method>~~afterConfigSave~~</method> <!-- event handler method name -->
142	</mana_db>
143	</observers>
144	</model_save_commit_after>


12	<Mana_Db>
13	<!-- This version number identifies version of database tables specific to this extension. It is written to
14	core_resource table. -->
15	+ <version>13.09.25.14</version>
16	</Mana_Db>
17	</modules>
18	<!-- This section contains module settings which are merged into global configuration during each page load,

72	<mana_db_replicator>
73	<model>mana_db/indexer</model>
74	</mana_db_replicator>
75	+ <mana_db translate="name description" module="mana_db">
76	+ <model>mana_db/entity_indexer</model>
77	+ <name>Entity Flat Data (MANAdev)</name>
78	+ <description>Reorganizes entity data to flat structure</description>
79	+ <targets/>
80	+ </mana_db>
81	</indexer>
82	</index>
83	<!-- BASED ON SNIPPET: New Models/Event support (config.xml) -->

144	<observers>
145	<mana_db>
146	<class>mana_db/observer</class> <!-- model name of class containing event handler methods -->
147	+ <method>afterSaveCommit</method> <!-- event handler method name -->
148	</mana_db>
149	</observers>
150	</model_save_commit_after>

app/code/local/Mana/Db/etc/m_db.xml ADDED Viewed

	@@ -0,0 +1,44 @@


1	+ <?xml version="1.0" encoding="UTF-8"?>
2	+ <!--
3	+ @category Mana
4	+ @package Mana_Db
5	+ @copyright Copyright (c) http://www.manadev.com
6	+ @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	+ -->
8	+ <!-- BASED ON SNIPPET: New Module/etc/config.xml -->
9	+ <config>
10	+ <modules>
11	+ <eav>
12	+ <tables>
13	+ <attribute_option>
14	+ <fields>
15	+ <global_label>
16	+ <formula>
17	+ <expr>{{= value.value }}</expr>
18	+ <join>
19	+ <value>
20	+ <type>left</type>
21	+ <entity>eav/attribute_option_value</entity>
22	+ <on>{{= value.option_id }} = {{= context.option_id }} AND {{= value.store_id }} = 0</on>
23	+ </value>
24	+ </join>
25	+ </formula>
26	+ </global_label>
27	+ <store_label>
28	+ <formula>
29	+ <expr>{{= value.value }}</expr>
30	+ <join>
31	+ <value>
32	+ <type>left</type>
33	+ <entity>eav/attribute_option_value</entity>
34	+ <on>{{= value.option_id }} = {{= context.option_id }} AND {{= value.store_id }} = {{= store.store_id }}</on>
35	+ </value>
36	+ </join>
37	+ </formula>
38	+ </store_label>
39	+ </fields>
40	+ </attribute_option>
41	+ </tables>
42	+ </eav>
43	+ </modules>
44	+ </config>

app/code/local/Mana/Filters/Block/Filter.php CHANGED Viewed

@@ -9,6 +9,8 @@
              * Block type for showing options for filter based on custom attribute
              * @author Mana Team
              * Injected into layout instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_View_Category::_initBlocks.
              */
             class Mana_Filters_Block_Filter extends Mage_Catalog_Block_Layer_Filter_Abstract {
                 protected $_isBlockPrepared = false;
@@ -66,17 +68,36 @@ class Mana_Filters_Block_Filter extends Mage_Catalog_Block_Layer_Filter_Abstract
                     foreach ($this->getItems() as $item) {
                         /* @var $item Mana_Filters_Model_Item */
                         if ($item->getMSelected()) {
-            -
                            $result[] = $item->getSeoValue();
+                        }
+                    }
-            -
                    return implode('_', $result);
+                }
                 public function getItemsCount() {
                     $this->_prepareFilterBlockOnce();
                     return $this->getHidden() ? 0 : $this->_filter->getItemsCount();
+                }
                 protected function _initFilter() {
                     if ($filter = Mage::getSingleton('mana_filters/repository')->getFilter($this->getFilterOptions()->getCode())) {
                         $this->_filter = $filter;
@@ -103,4 +124,31 @@ class Mana_Filters_Block_Filter extends Mage_Catalog_Block_Layer_Filter_Abstract
+                    }
                     return $this;
+                }
+            }


9	* Block type for showing options for filter based on custom attribute
10	* @author Mana Team
11	* Injected into layout instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_View_Category::_initBlocks.
12	+ *
13	+ * @method Mana_Filters_Model_Filter2_Store getFilterOptions()
14	*/
15	class Mana_Filters_Block_Filter extends Mage_Catalog_Block_Layer_Filter_Abstract {
16	protected $_isBlockPrepared = false;

68	foreach ($this->getItems() as $item) {
69	/* @var $item Mana_Filters_Model_Item */
70	if ($item->getMSelected()) {
71	+ $result[$item->getSeoValue()] = $item->getSeoData();
72	}
73	}
74	+
75	+ return $this->jsonHelper()->encodeAttribute($result);
76	}
77
78	+ public function getPopupBlockName() {
79	+ $displayOptions = $this->getFilterOptions()->getDisplayOptions();
80	+ return (string)$displayOptions->popup_class;
81	+ }
82	public function getItemsCount() {
83	$this->_prepareFilterBlockOnce();
84	return $this->getHidden() ? 0 : $this->_filter->getItemsCount();
85	}
86
87	+ public function getMultipleValueSeparator() {
88	+ if (((string)Mage::getConfig()->getNode('modules/ManaPro_FilterSeoLinks/active')) == 'true') {
89	+ /* @var $seo Mana_Seo_Helper_Data */
90	+ $seo = Mage::helper('mana_seo');
91	+
92	+ $schema = $seo->getActiveSchema(Mage::app()->getStore()->getId());
93	+
94	+ return $schema->getMultipleValueSeparator();
95	+ }
96	+ else {
97	+ return '_';
98	+ }
99	+ }
100	+
101	protected function _initFilter() {
102	if ($filter = Mage::getSingleton('mana_filters/repository')->getFilter($this->getFilterOptions()->getCode())) {
103	$this->_filter = $filter;

124	}
125	return $this;
126	}
127	+
128	+ public function getListItemClass($item) {
129	+ $result = '';
130	+ if ($item->getMShowSelected()) {
131	+ $result .= 'm-selected-ln-item';
132	+ }
133	+ if (!($item->getCount() \|\| $item->getMSelected())) {
134	+ if ($result) {
135	+ $result .= ' ';
136	+ }
137	+ $result .= 'm-disabled';
138	+ }
139	+ if ($result) {
140	+ $result = "class=\"$result\"";
141	+ }
142	+ return $result;
143	+ }
144	+
145	+ #region Dependencies
146	+
147	+ /**
148	+ * @return Mana_Core_Helper_Json
149	+ */
150	+ public function jsonHelper() {
151	+ return Mage::helper('mana_core/json');
152	+ }
153	+ #endregion
154	}

app/code/local/Mana/Filters/Block/View.php CHANGED Viewed

	@@ -29,7 +29,7 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
29	{
30	/* @var $layoutHelper Mana_Core_Helper_Layout */
31	$layoutHelper = Mage::helper('mana_core/layout');
32	- $layoutHelper->delayPrepareLayout($this, ~~1000~~);
33
34	return $this;
35	}
	@@ -52,7 +52,7 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
52
53	$showState = 'all';
54	if ($showInFilter = $this->getShowInFilter()) {
55	- if ($template = Mage::getStoreConfig('mana_filters/positioning/' . $showInFilter)) {
56	$this->setTemplate($template);
57	}
58	$showState = Mage::getStoreConfig('mana_filters/positioning/show_state_' . $showInFilter);
	@@ -81,7 +81,7 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
81	'query' => $query,
82	'layer' => $layer,
83	'attribute_model' => $filterOptions->getAttribute(),
84	- 'mode' => $~~helper~~->getMode(),
85	));
86	$block->init();
87	$this->setChild($filterOptions->getCode() . '_filter', $block);
	@@ -94,6 +94,17 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
94	return $this;
95	}
96











97	public function getFilters() {
98	/* @var $helper Mana_Filters_Helper_Data */
99	$helper = Mage::helper(strtolower('Mana_Filters'));
	@@ -125,14 +136,14 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
125	/* @var $helper Mana_Filters_Helper_Data */
126	$helper = Mage::helper(strtolower('Mana_Filters'));
127
128	- return $helper->getLayer();
129	}
130
131	public function canShowBlock() {
132	/* @var $helper Mana_Filters_Helper_Data */
133	$helper = Mage::helper(strtolower('Mana_Filters'));
134
135	- switch ($~~helper~~->getMode()) {
136	case 'category':
137	return $this->_canShowBlockInCategory();
138	case 'search':
	@@ -153,16 +164,29 @@ class Mana_Filters_Block_View extends Mage_Catalog_Block_Layer_View {
153	}
154	}
155	public function _canShowBlockInSearch() {
156	- $~~_isLNAllowedByEngine~~ = Mage::helper('catalogsearch')->getEngine()~~->isLeyeredNavigationAllowed()~~;




157	if (!$_isLNAllowedByEngine) {
158	return false;
159	}
160	$availableResCount = (int) Mage::app()->getStore()
161	->getConfig(Mage_CatalogSearch_Model_Layer::XML_PATH_DISPLAY_LAYER_COUNT);
162
163	- if (~~$availableResCount && $availableResCount<$~~this->~~getLayer~~()->~~getProductCollection~~()~~->getSize())~~ {


164	return false;
165	}
166	return $this->_canShowBlockInCategory();
167	}







168	}


29	{
30	/* @var $layoutHelper Mana_Core_Helper_Layout */
31	$layoutHelper = Mage::helper('mana_core/layout');
32	+ $layoutHelper->delayPrepareLayout($this, 200);
33
34	return $this;
35	}

52
53	$showState = 'all';
54	if ($showInFilter = $this->getShowInFilter()) {
55	+ if (($template = Mage::getStoreConfig('mana_filters/positioning/' . $showInFilter)) && !$this->getTakeTemplateFromXml()) {
56	$this->setTemplate($template);
57	}
58	$showState = Mage::getStoreConfig('mana_filters/positioning/show_state_' . $showInFilter);

81	'query' => $query,
82	'layer' => $layer,
83	'attribute_model' => $filterOptions->getAttribute(),
84	+ 'mode' => $this->getMode(),
85	));
86	$block->init();
87	$this->setChild($filterOptions->getCode() . '_filter', $block);

94	return $this;
95	}
96
97	+ public function getMode() {
98	+ /* @var $helper Mana_Filters_Helper_Data */
99	+ $helper = Mage::helper(strtolower('Mana_Filters'));
100	+
101	+ if ($mode = $this->_getData('mode')) {
102	+ return $mode;
103	+ }
104	+ else {
105	+ return $helper->getMode();
106	+ }
107	+ }
108	public function getFilters() {
109	/* @var $helper Mana_Filters_Helper_Data */
110	$helper = Mage::helper(strtolower('Mana_Filters'));

136	/* @var $helper Mana_Filters_Helper_Data */
137	$helper = Mage::helper(strtolower('Mana_Filters'));
138
139	+ return $helper->getLayer($this->getMode());
140	}
141
142	public function canShowBlock() {
143	/* @var $helper Mana_Filters_Helper_Data */
144	$helper = Mage::helper(strtolower('Mana_Filters'));
145
146	+ switch ($this->getMode()) {
147	case 'category':
148	return $this->_canShowBlockInCategory();
149	case 'search':

164	}
165	}
166	public function _canShowBlockInSearch() {
167	+ $engine = Mage::helper('catalogsearch')->getEngine();
168	+ $_isLNAllowedByEngine = $engine->isLeyeredNavigationAllowed();
169	+ if (!$_isLNAllowedByEngine && method_exists($engine, 'isLayeredNavigationAllowed')) {
170	+ $_isLNAllowedByEngine = $engine->isLayeredNavigationAllowed();
171	+ }
172	if (!$_isLNAllowedByEngine) {
173	return false;
174	}
175	$availableResCount = (int) Mage::app()->getStore()
176	->getConfig(Mage_CatalogSearch_Model_Layer::XML_PATH_DISPLAY_LAYER_COUNT);
177
178	+ if (!$this->layerHelper()->useSolr() && $availableResCount &&
179	+ $availableResCount < $this->getLayer()->getProductCollection()->getSize())
180	+ {
181	return false;
182	}
183	return $this->_canShowBlockInCategory();
184	}
185	+
186	+ /**
187	+ * @return Mana_Filters_Helper_Data
188	+ */
189	+ public function layerHelper() {
190	+ return Mage::helper('mana_filters');
191	+ }
192	}

app/code/local/Mana/Filters/Helper/Data.php CHANGED Viewed

	@@ -10,7 +10,7 @@
10	* Generic helper functions for Mana_Filters module. This class is a must for any module even if empty.
11	* @author Mana Team
12	*/
13	- class Mana_Filters_Helper_Data extends ~~Mage_Core_Helper_Abstract~~ {
14	/**
15	* Return unique filter name.
16	* OO purists would say that kind of ifs should be done using virtual functions. Here we ignore OO-ness and
	@@ -73,9 +73,9 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
73	}
74	else {
75	if (!$this->_filterOptionsCollection) {
76	- Mana_Core_Profiler::start('mln', __CLASS__, __METHOD__, '$productCollection->getSetIds()');
77	$setIds = Mage::getSingleton('catalog/layer')->getProductCollection()->getSetIds();
78	- Mana_Core_Profiler::stop('mln', __CLASS__, __METHOD__, '$productCollection->getSetIds()');
79	$this->_filterOptionsCollection = Mage::getResourceModel('mana_filters/filter2_store_collection')
80	->addFieldToSelect('*')
81	->addCodeFilter($this->_getAttributeCodes($setIds))
	@@ -115,7 +115,7 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
115	}
116	return $url;
117	}
118	- public function getClearUrl($markUrl = true, $clearListParams = false) {
119	$filterState = array();
120	foreach ($this->getLayer()->getState()->getFilters() as $item) {
121	$filterState[$item->getFilter()->getRequestVar()] = $item->getFilter()->getCleanValue();
	@@ -135,8 +135,19 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
135	$params['_m_escape'] = '';
136	$filterState['m-layered'] = null;
137	$params['_query'] = $filterState;



138	$result = Mage::getUrl('//*', $params);
139	- if ($~~markUrl~~) {








140	$result = $this->markLayeredNavigationUrl($result, '//*', $params);
141	}
142	return $result;
	@@ -175,17 +186,6 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
175	}
176	$select->setPart(Zend_Db_Select::WHERE, $where);
177	}
178	- /**
179	- * @return Mage_Catalog_Model_Layer
180	- */
181	- public function getMode() {
182	- if (in_array(Mage::helper('mana_core')->getRoutePath(), array('catalogsearch/result/index', 'manapro_filterajax/search/index'))) {
183	- return 'search';
184	- }
185	- else {
186	- return 'category';
187	- }
188	- }
189
190	/**
191	* @param Mana_Filters_Model_Filter2_Store $filterOptions
	@@ -202,26 +202,6 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
202	throw new Exception('Not implemented');
203	}
204	}
205	- /**
206	- * @return Mage_Catalog_Model_Layer
207	- * @throws Exception
208	- */
209	- public function getLayer () {
210	- switch ($this->getMode()) {
211	- case 'category':
212	- return Mage::getSingleton($this->useSolrForNavigation()
213	- ? 'enterprise_search/catalog_layer'
214	- : 'catalog/layer'
215	- );
216	- case 'search':
217	- return Mage::getSingleton($this->useSolrForSearch()
218	- ? 'enterprise_search/search_layer'
219	- : 'catalogsearch/layer'
220	- );
221	- default:
222	- throw new Exception('Not implemented');
223	- }
224	- }
225	public function canShowFilterInBlock($block, $filter) {
226	if ($block->getData('show_'.$filter->getCode())) {
227	return true;
	@@ -229,6 +209,12 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
229	elseif ($block->getData('hide_' . $filter->getCode())) {
230	return false;
231	}






232	elseif ($showInFilter = $block->getShowInFilter()) {
233	$showIn = $filter->getShowIn();
234	if (!is_array($showIn)) {
	@@ -397,33 +383,31 @@ class Mana_Filters_Helper_Data extends Mage_Core_Helper_Abstract {
397	return $result;
398	}
399
400	- public function ~~useSolrForNavigation~~() {
401	- if ~~(!Mage::helper('~~core~~')->isModuleEnabled('Enterprise_Search'))~~ {
402	- ~~return~~ ~~false~~;
403	- }
404	- /* @var $helper Enterprise_Search_Helper_Data */
405	- $helper = Mage::helper('enterprise_search');
406
407	- ~~return~~ $~~helper~~->~~getIsEngineAvailableForNavigation~~();











408	}
409	- public function useSolrForSearch() {
410	- if (!Mage::helper('core')->isModuleEnabled('Enterprise_Search')) {
411	- return false;
412	- }
413	- /* @var $helper Enterprise_Search_Helper_Data */
414	- $helper = Mage::helper('enterprise_search');
415
416	- ~~return~~ ~~$helper->isThirdPartSearchEngine() && $helper->isActiveEngine();~~
417	- }
418
419	- ~~public function useSolr() {~~
420	- ~~switch~~ ~~($this->getMode())~~ {
421	- ~~case 'category':~~
422	- ~~return~~ ~~$this->useSolrForNavigation~~();
423	- ~~case~~ '~~search~~':
424	- return $this->useSolrForSearch();
425	- default:
426	- throw new Exception('Not implemented');
427	- }
428	}

429	}


10	* Generic helper functions for Mana_Filters module. This class is a must for any module even if empty.
11	* @author Mana Team
12	*/
13	+ class Mana_Filters_Helper_Data extends Mana_Core_Helper_Layer {
14	/**
15	* Return unique filter name.
16	* OO purists would say that kind of ifs should be done using virtual functions. Here we ignore OO-ness and

73	}
74	else {
75	if (!$this->_filterOptionsCollection) {
76	+ Mana_Core_Profiler::start('mln' . '::' . __CLASS__ . '::' . __METHOD__ . '::' . '$productCollection->getSetIds()');
77	$setIds = Mage::getSingleton('catalog/layer')->getProductCollection()->getSetIds();
78	+ Mana_Core_Profiler::stop('mln' . '::' . __CLASS__ . '::' . __METHOD__ . '::' . '$productCollection->getSetIds()');
79	$this->_filterOptionsCollection = Mage::getResourceModel('mana_filters/filter2_store_collection')
80	->addFieldToSelect('*')
81	->addCodeFilter($this->_getAttributeCodes($setIds))

115	}
116	return $url;
117	}
118	+ public function getClearUrl($markUrl = true, $clearListParams = false, $nosid = false, $clearAllParams = false) {
119	$filterState = array();
120	foreach ($this->getLayer()->getState()->getFilters() as $item) {
121	$filterState[$item->getFilter()->getRequestVar()] = $item->getFilter()->getCleanValue();

135	$params['_m_escape'] = '';
136	$filterState['m-layered'] = null;
137	$params['_query'] = $filterState;
138	+ if ($nosid) {
139	+ $params['_nosid'] = true;
140	+ }
141	$result = Mage::getUrl('//*', $params);
142	+ if ($clearAllParams) {
143	+ /* @var $mbstring Mana_Core_Helper_Mbstring */
144	+ $mbstring = Mage::helper('mana_core/mbstring');
145	+
146	+ if ($pos = $mbstring->strpos($result, '?')) {
147	+ $result = $mbstring->substr($result, 0, $pos);
148	+ }
149	+ }
150	+ elseif ($markUrl) {
151	$result = $this->markLayeredNavigationUrl($result, '//*', $params);
152	}
153	return $result;

186	}
187	$select->setPart(Zend_Db_Select::WHERE, $where);
188	}











189
190	/**
191	* @param Mana_Filters_Model_Filter2_Store $filterOptions

202	throw new Exception('Not implemented');
203	}
204	}




















205	public function canShowFilterInBlock($block, $filter) {
206	if ($block->getData('show_'.$filter->getCode())) {
207	return true;

209	elseif ($block->getData('hide_' . $filter->getCode())) {
210	return false;
211	}
212	+ elseif ($block->getData('show_all_filters')) {
213	+ return true;
214	+ }
215	+ elseif ($block->getData('hide_all_filters')) {
216	+ return false;
217	+ }
218	elseif ($showInFilter = $block->getShowInFilter()) {
219	$showIn = $filter->getShowIn();
220	if (!is_array($showIn)) {

383	return $result;
384	}
385
386	+ public function isTreeVisible() {
387	+ /* @var $core Mana_Core_Helper_Data */
388	+ $core = Mage::helper('mana_core');



389
390	+ if ($core->isManadevLayeredNavigationTreeInstalled()) {
391	+ $filterCollection = $this->getFilterOptionsCollection(true);
392	+ foreach ($filterCollection as $filter) {
393	+ /* @var $filter Mana_Filters_Model_Filter2_Store */
394	+ if ($filter->getType() == 'category') {
395	+ if ($filter->getData('display') == 'tree') {
396	+ return true;
397	+ }
398	+ }
399	+ }
400	+ }
401	+ return false;
402	}






403
404	+ #region Dependencies

405
406	+ /**
407	+ * @return Mana_Core_Helper_Data
408	+ */
409	+ public function coreHelper() {
410	+ return Mage::helper('mana_core');




411	}
412	+ #endregion
413	}

app/code/local/Mana/Filters/Model/Filter/Attribute.php CHANGED Viewed

	@@ -9,6 +9,8 @@
9	* Model type for holding information in memory about possible or applied filter which is based on an attribute
10	* @author Mana Team
11	* Injected instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_Filter_Attribute constructor.


12	*/
13	class Mana_Filters_Model_Filter_Attribute
14	extends Mage_Catalog_Model_Layer_Filter_Attribute
	@@ -104,12 +106,13 @@ class Mana_Filters_Model_Filter_Attribute
104	);
105
106	$tags = $this->getLayer()->getStateTags($tags);
107	- ~~if ($sortMethod = $this->getFilterOptions()->getSortMethod()) {~~
108	- ~~foreach (~~$~~data~~ as $~~position~~ => ~~&$item~~) {
109	- $~~item['position']~~ = $position;
110	- }
111	- usort($data, array(Mage::getSingleton('mana_filters/sort'), $sortMethod));
112	}


113	$this->getLayer()->getAggregator()->saveCacheData($data, $key, $tags);
114	}
115


9	* Model type for holding information in memory about possible or applied filter which is based on an attribute
10	* @author Mana Team
11	* Injected instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_Filter_Attribute constructor.
12	+ *
13	+ * @method Mana_Filters_Model_Filter2_Store getFilterOptions()
14	*/
15	class Mana_Filters_Model_Filter_Attribute
16	extends Mage_Catalog_Model_Layer_Filter_Attribute

106	);
107
108	$tags = $this->getLayer()->getStateTags($tags);
109	+
110	+ $sortMethod = $this->getFilterOptions()->getSortMethod() ? $this->getFilterOptions()->getSortMethod() : 'byPosition';
111	+ foreach ($data as $position => &$item) {
112	+ $item['position'] = $position;

113	}
114	+ usort($data, array(Mage::getSingleton('mana_filters/sort'), $sortMethod));
115	+
116	$this->getLayer()->getAggregator()->saveCacheData($data, $key, $tags);
117	}
118

app/code/local/Mana/Filters/Model/Filter/Category.php CHANGED Viewed

	@@ -9,6 +9,7 @@
9	* Model type for holding information in memory about possible or applied category filter
10	* @author Mana Team
11	* Injected instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_Filter_Category constructor.

12	*/
13	class Mana_Filters_Model_Filter_Category
14	extends Mage_Catalog_Model_Layer_Filter_Category
	@@ -58,7 +59,8 @@ class Mana_Filters_Model_Filter_Category
58	{
59	$data = array();
60	foreach ($categories as $category) {
61	- if ($category->getIsActive() && ~~$category->getProductCount()) {~~

62	$data[] = array(
63	'label' => Mage::helper('core')->htmlEscape($category->getName()),
64	'value' => $category->getId(),
	@@ -314,4 +316,29 @@ class Mana_Filters_Model_Filter_Category
314	}
315	#endregion
316

























317	}


9	* Model type for holding information in memory about possible or applied category filter
10	* @author Mana Team
11	* Injected instead of standard catalog/layer_filter_attribute in Mana_Filters_Block_Filter_Category constructor.
12	+ * @method Mana_Filters_Model_Filter2_Store getFilterOptions()
13	*/
14	class Mana_Filters_Model_Filter_Category
15	extends Mage_Catalog_Model_Layer_Filter_Category

59	{
60	$data = array();
61	foreach ($categories as $category) {
62	+ if ($category->getIsActive() &&
63	+ ($this->filterHelper()->isFilterEnabled($this->getFilterOptions()) == 2 \|\| $category->getProductCount())) {
64	$data[] = array(
65	'label' => Mage::helper('core')->htmlEscape($category->getName()),
66	'value' => $category->getId(),

316	}
317	#endregion
318
319	+ public function getResetValue() {
320	+ if ($this->_appliedCategory) {
321	+ /**
322	+ * Revert path ids
323	+ */
324	+ $pathIds = array_reverse($this->_appliedCategory->getPathIds());
325	+ $curCategoryId = $this->getLayer()->getCurrentCategory()->getId();
326	+
327	+ if ($pathIds[0] != $curCategoryId && in_array($curCategoryId, $pathIds) && isset($pathIds[1]) && $pathIds[1] != $curCategoryId) {
328	+ return $pathIds[1];
329	+ }
330	+ }
331	+
332	+ return null;
333	+ }
334	+
335	+ #region Dependencies
336	+
337	+ /**
338	+ * @return Mana_Filters_Helper_Data
339	+ */
340	+ public function filterHelper() {
341	+ return Mage::helper('mana_filters');
342	+ }
343	+ #endregion
344	}

app/code/local/Mana/Filters/Model/Filter/Decimal.php CHANGED Viewed

	@@ -30,8 +30,8 @@ class Mana_Filters_Model_Filter_Decimal
30	return $result->getLabel();
31	} else {
32	$store = Mage::app()->getStore();
33	- $fromPrice = $store->formatPrice($range['from']);
34	- $toPrice = $store->formatPrice($range['to']);
35
36	return Mage::helper('catalog')->__('%s - %s', $fromPrice, $toPrice);
37	}
	@@ -55,8 +55,10 @@ class Mana_Filters_Model_Filter_Decimal
55	if ($this->_getIsFilterable() == 2) {
56	$nonEmptyRanges = $dbRanges;
57	$dbRanges = array();
58	- ~~for (~~$i = 1; (~~$i + 1~~) * $~~range > $~~this->getMinValue() && ($~~i - 1) * $~~range ~~< $this->getMaxValue(~~); ~~$i++) {~~
59	- $~~dbRanges[$i]~~ = ~~isset~~($~~nonEmptyRanges[$i]~~) ? $~~nonEmptyRanges[$i] : 0~~;


60	}
61	}
62	$data = array();
	@@ -305,7 +307,7 @@ class Mana_Filters_Model_Filter_Decimal
305	$range = $this->getData('range');
306
307	$value = $this->getMSelectedValues();
308	- if (!empty($value)) {
309	list($index, $range) = explode(',', $value[0]);
310	}
311
	@@ -392,9 +394,11 @@ class Mana_Filters_Model_Filter_Decimal
392	* Returns all values currently selected for this filter
393	*/
394	public function getMSelectedValues() {
395	- $values = Mage::helper('mana_core')->sanitizeRequestNumberParam($this->_requestVar,
396	- array(~~array(~~'sep' => '_', 'as_string' => true), ~~array('sep' => ',', 'as_string' => true)));~~
397	- ~~return~~ ~~$values~~ ~~? array_filter(explode(~~'_', ~~$values))~~ : ~~array(~~);


398	}
399
400	/**
	@@ -416,17 +420,19 @@ class Mana_Filters_Model_Filter_Decimal
416	public function addToState()
417	{
418	foreach ($this->getMSelectedValues() as $selection) {
419	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
420	- $~~this->getLayer(~~)~~->getState~~()~~->addFilter(~~
421	- $this->~~_createItemEx~~(
422	- ~~array~~(
423	- ~~'label' => $this->_renderItemLabel~~(~~$range, $index),~~
424	- '~~value~~' => $~~selection~~,
425	- '~~m_selected~~' => ~~true~~,
426	- '~~m_show_selected~~' => ~~$this->getFilterOptions()->getIsReverse()~~,


427	)
428	- )
429	- );
430	}
431	}
432


30	return $result->getLabel();
31	} else {
32	$store = Mage::app()->getStore();
33	+ $fromPrice = $store->formatPrice($range['from'], false);
34	+ $toPrice = $store->formatPrice($range['to'], false);
35
36	return Mage::helper('catalog')->__('%s - %s', $fromPrice, $toPrice);
37	}

55	if ($this->_getIsFilterable() == 2) {
56	$nonEmptyRanges = $dbRanges;
57	$dbRanges = array();
58	+ $from = (int)floor($this->getMinValue() / $range);
59	+ $to = (int)floor($this->getMaxValue() / $range);
60	+ for ($i = $from; $i <= $to; $i++) {
61	+ $dbRanges[$i] = isset($nonEmptyRanges[$i]) ? $nonEmptyRanges[$i] : 0;
62	}
63	}
64	$data = array();

307	$range = $this->getData('range');
308
309	$value = $this->getMSelectedValues();
310	+ if (!empty($value) && strpos($value[0], ',') !== false) {
311	list($index, $range) = explode(',', $value[0]);
312	}
313

394	* Returns all values currently selected for this filter
395	*/
396	public function getMSelectedValues() {
397	+ $values = Mage::helper('mana_core')->sanitizeRequestNumberParam($this->_requestVar, array(
398	+ array('sep' => '_', 'as_string' => true),
399	+ array('sep' => ',', 'as_string' => true)
400	+ ));
401	+ return $values ? explode('_', $values) : array();
402	}
403
404	/**

420	public function addToState()
421	{
422	foreach ($this->getMSelectedValues() as $selection) {
423	+ if (strpos($selection, ',') !== false) {
424	+ list($index, $range) = explode(',', $selection);
425	+ $this->getLayer()->getState()->addFilter(
426	+ $this->_createItemEx(
427	+ array(
428	+ 'label' => $this->_renderItemLabel($range, $index),
429	+ 'value' => $selection,
430	+ 'm_selected' => true,
431	+ 'm_show_selected' => $this->getFilterOptions()->getIsReverse(),
432	+ )
433	)
434	+ );
435	+ }
436	}
437	}
438

app/code/local/Mana/Filters/Model/Filter/Price.php CHANGED Viewed

@@ -110,10 +110,16 @@ class Mana_Filters_Model_Filter_Price
                                 ->setStoreId(Mage::app()->getStore()->getId())
                                 ->load(Mage::app()->getStore()->getRootCategoryId());
                             $currentCategory = $this->getLayer()->getCurrentCategory();
-            -
                            $this->getLayer()->setCurrentCategory($rootCategory);
-            -
                            $queryResult = $query->getFilterRange($this->getFilterOptions()->getCode(), false,
-            -
                                $this->getLayer()->getProductCollection(), false);
-            -
                            $this->getLayer()->setCurrentCategory($currentCategory);
                             $this->_maxPriceInt = $queryResult['max'];
                             $this->_hasNoResults = true;
+                        }
@@ -310,66 +316,70 @@ class Mana_Filters_Model_Filter_Price
+            	}
                 public function getPriceRange() {
-            -
                    $range = $this->getData('price_range');
-            -
-            -
                    $value = $this->getMSelectedValues();
-            -
                    if (!empty($value)) {
-            -
                        list($index, $range) = explode(',', $value[0]);
-            -
                    }
-            -
                    if (!$range) {
-            -
                        if (Mage::helper('mana_db')->hasOverriddenValueEx($this->getFilterOptions(), 24)) {
-            -
                            $range = (float)$this->getFilterOptions()->getRangeStep();
-            -
                        }
-            -
                        elseif (Mage::helper('mana_db')->hasOverriddenValueEx($this->getFilterOptions(), 24, 'global_default_mask')) {
-            -
                            $range = (float)$this->getFilterOptions()->getGlobalRangeStep();
-            -
                        }
-            -
                    }
-            -
                    if (!$range) {
-            -
                        $currentCategory = Mage::registry('current_category_filter');
-            -
                        if ($currentCategory) {
-            -
                            $range = $currentCategory->getFilterPriceRange();
-            -
                        } else {
-            -
                            $range = $this->getLayer()->getCurrentCategory()->getFilterPriceRange();
+                        }
-            -
                        $maxPrice = $this->getMaxPriceInt();
                         if (!$range) {
-            -
                            $calculation = Mage::app()->getStore()->getConfig('catalog/layered_navigation/price_range_calculation');
-            -
                            if (!$calculation) {
-            -
                                $calculation = 'auto';
+                            }
-            -
                            if ($calculation == 'auto') {
-            -
                                if ($this->hasNoResults()) {
-            -
                                    $range = 1;
-            -
                                    while (ceil($maxPrice / $range) > 10) {
-            -
                                        $range *= 10;
-            -
                                    }
+                                }
-            -
                                else {
-            -
                                    $index = 1;
-            -
                                    do {
-            -
                                        $range = pow(10, (strlen(floor($maxPrice)) - $index));
-            -
                                        $this->setData('price_range', $range);
-            -
                                        /* @var $query Mana_Filters_Model_Query */
-            -
                                        $query = $this->getQuery();
-            -
                                        $items = $query->getFilterCounts($this->getFilterOptions()->getCode(), false);
-            -
                                        $index++;
+                                    }
-            -
                                    while($range > self::MIN_RANGE_POWER && count($items) < 2);
-            -
                                    while (ceil($maxPrice / $range) > 25) {
-            -
                                        $range *= 10;
+                                    }
+                                }
-            -
                            } else {
-            -
                                $range = Mage::app()->getStore()->getConfig('catalog/layered_navigation/price_range_step');
+                            }
-            -
                        }
+                    }
-            -
                    $this->setData('price_range', $range);
                     return $this->getData('price_range');
+                }
                 public function init() {
@@ -378,9 +388,11 @@ class Mana_Filters_Model_Filter_Price
                  * Returns all values currently selected for this filter
                  */
                 public function getMSelectedValues() {
-            -
                    $values = Mage::helper('mana_core')->sanitizeRequestNumberParam($this->_requestVar,
-            -
                            array(array('sep' => '_', 'as_string' => true), array('sep' => ',', 'as_string' => true)));
-            -
                    return $values ? array_filter(explode('_', $values)) : array();
+                }
                 /**
@@ -391,17 +403,19 @@ class Mana_Filters_Model_Filter_Price
                 public function addToState()
+                {
                     foreach ($this->getMSelectedValues() as $selection) {
-            -
                        list($index, $range) = explode(',', $selection);
-            -
                        $this->getLayer()->getState()->addFilter(
-            -
                            $this->_createItemEx(
-            -
                                array(
-            -
                                    'label' => $this->_renderItemLabel($range, $index),
-            -
                                    'value' => $selection,
-            -
                                    'm_selected' => true,
-            -
                                    'm_show_selected' => $this->getFilterOptions()->getIsReverse(),
+                                )
-            -
                            )
-            -
                        );
+                    }
+                }


110	->setStoreId(Mage::app()->getStore()->getId())
111	->load(Mage::app()->getStore()->getRootCategoryId());
112	$currentCategory = $this->getLayer()->getCurrentCategory();
113	+ if ($rootCategory->getId() != $currentCategory->getId()) {
114	+ $this->getLayer()->setCurrentCategory($rootCategory);
115	+ $queryResult = $query->getFilterRange($this->getFilterOptions()->getCode(), false,
116	+ $this->getLayer()->getProductCollection(), false);
117	+ $this->getLayer()->setCurrentCategory($currentCategory);
118	+ }
119	+ else {
120	+ $queryResult = $query->getFilterRange($this->getFilterOptions()->getCode(), false,
121	+ $query->createProductCollection(), false);
122	+ }
123	$this->_maxPriceInt = $queryResult['max'];
124	$this->_hasNoResults = true;
125	}

316	}
317
318	public function getPriceRange() {
319	+ if (!$this->getData('price_range_set')) {
320	+ $this->setData('price_range_set', true);
321	+ $range = $this->getData('price_range');



322
323	+ $value = $this->getMSelectedValues();
324	+ if (!empty($value) && strpos($value[0], ',') !== false) {
325	+ list($index, $range) = explode(',', $value[0]);











326	}
327

328	if (!$range) {
329	+ if (Mage::helper('mana_db')->hasOverriddenValueEx($this->getFilterOptions(), 24)) {
330	+ $range = (float)$this->getFilterOptions()->getRangeStep();

331	}
332	+ elseif (Mage::helper('mana_db')->hasOverriddenValueEx($this->getFilterOptions(), 24, 'global_default_mask')) {
333	+ $range = (float)$this->getFilterOptions()->getGlobalRangeStep();
334	+ }
335	+ }
336	+ if (!$range) {
337	+ $currentCategory = Mage::registry('current_category_filter');
338	+ if ($currentCategory) {
339	+ $range = $currentCategory->getFilterPriceRange();
340	+ }
341	+ else {
342	+ $range = $this->getLayer()->getCurrentCategory()->getFilterPriceRange();
343	+ }
344	+
345	+ $maxPrice = $this->getMaxPriceInt();
346	+ if (!$range) {
347	+ $calculation = Mage::app()->getStore()->getConfig('catalog/layered_navigation/price_range_calculation');
348	+ if (!$calculation) {
349	+ $calculation = 'auto';
350	}
351	+ if ($calculation == 'auto') {
352	+ if ($this->hasNoResults()) {
353	+ $range = 1;
354	+ while (ceil($maxPrice / $range) > 10) {
355	+ $range *= 10;
356	+ }



357	}
358	+ else {
359	+ $index = 1;
360	+ do {
361	+ $range = pow(10, (strlen(floor($maxPrice)) - $index));
362	+ $this->setData('price_range', $range);
363	+ /* @var $query Mana_Filters_Model_Query */
364	+ $query = $this->getQuery();
365	+ $items = $query->getFilterCounts($this->getFilterOptions()->getCode(), false);
366	+ $index++;
367	+ } while ($range > self::MIN_RANGE_POWER && count($items) < 2);
368
369
370	+ while (ceil($maxPrice / $range) > 25) {
371	+ $range *= 10;
372	+ }
373	}
374	}
375	+ else {
376	+ $range = Mage::app()->getStore()->getConfig('catalog/layered_navigation/price_range_step');
377	+ }
378	}

379
380	+ }
381	+ $this->setData('price_range', $range);
382	}

383	return $this->getData('price_range');
384	}
385	public function init() {

388	* Returns all values currently selected for this filter
389	*/
390	public function getMSelectedValues() {
391	+ $values = Mage::helper('mana_core')->sanitizeRequestNumberParam($this->_requestVar, array(
392	+ array('sep' => '_', 'as_string' => true),
393	+ array('sep' => ',', 'as_string' => true)
394	+ ));
395	+ return $values ? explode('_', $values) : array();
396	}
397
398	/**

403	public function addToState()
404	{
405	foreach ($this->getMSelectedValues() as $selection) {
406	+ if (strpos($selection, ',') !== false) {
407	+ list($index, $range) = explode(',', $selection);
408	+ $this->getLayer()->getState()->addFilter(
409	+ $this->_createItemEx(
410	+ array(
411	+ 'label' => $this->_renderItemLabel($range, $index),
412	+ 'value' => $selection,
413	+ 'm_selected' => true,
414	+ 'm_show_selected' => $this->getFilterOptions()->getIsReverse(),
415	+ )
416	)
417	+ );
418	+ }
419	}
420	}
421

app/code/local/Mana/Filters/Model/Filter2.php CHANGED Viewed

@@ -10,9 +10,11 @@
             /**
              * INSERT HERE: what is this model for
              * @author Mana Team
              */
             class Mana_Filters_Model_Filter2 extends Mana_Db_Model_Object {
                 protected $_eventPrefix = 'mana_filter';
                 /**
                  * Invoked during model creation process, this method associates this model with resource and resource
@@ -58,4 +60,27 @@ class Mana_Filters_Model_Filter2 extends Mana_Db_Model_Object {
                 public function getCode() {
                     return isset($this->_data['code']) ? $this->_data['code'] : null;
+                }
+            }


10	/**
11	* INSERT HERE: what is this model for
12	* @author Mana Team
13	+ * @method string getType()
14	*/
15	class Mana_Filters_Model_Filter2 extends Mana_Db_Model_Object {
16	protected $_eventPrefix = 'mana_filter';
17	+ protected $_entity = 'mana_filters/filter2';
18
19	/**
20	* Invoked during model creation process, this method associates this model with resource and resource

60	public function getCode() {
61	return isset($this->_data['code']) ? $this->_data['code'] : null;
62	}
63	+
64	+ /**
65	+ * Init indexing process after category data commit
66	+ *
67	+ * @return Mage_Catalog_Model_Category
68	+ */
69	+ public function afterCommitCallback() {
70	+ parent::afterCommitCallback();
71	+ if (!Mage::registry('m_prevent_indexing_on_save')) {
72	+ $this->getIndexerSingleton()->processEntityAction($this, $this->_entity, Mage_Index_Model_Event::TYPE_SAVE);
73	+ }
74	+
75	+ return $this;
76	+ }
77	+
78	+ #region Dependencies
79	+ /**
80	+ * @return Mage_Index_Model_Indexer
81	+ */
82	+ public function getIndexerSingleton() {
83	+ return Mage::getSingleton('index/indexer');
84	+ }
85	+ #endregion
86	}

app/code/local/Mana/Filters/Model/Filter2/Store.php CHANGED Viewed

	@@ -13,6 +13,8 @@
13	*/
14	class Mana_Filters_Model_Filter2_Store extends Mana_Filters_Model_Filter2 {
15	protected $_eventPrefix = 'mana_filter_store';


16	/**
17	* Invoked during model creation process, this method associates this model with resource and resource
18	* collection classes
	@@ -30,7 +32,8 @@ class Mana_Filters_Model_Filter2_Store extends Mana_Filters_Model_Filter2 {
30	$result = $this->getData($field);
31	$store = Mage::app()->getStore();
32	if ($result == '$0') {
33	- return ~~$store->getCurrentCurrency~~(~~)->formatPrecision(0~~, 0, ~~array~~(), ~~false~~, ~~false);~~

34	}
35	else {
36	return $result;


13	*/
14	class Mana_Filters_Model_Filter2_Store extends Mana_Filters_Model_Filter2 {
15	protected $_eventPrefix = 'mana_filter_store';
16	+ protected $_entity = 'mana_filters/filter2_store';
17	+
18	/**
19	* Invoked during model creation process, this method associates this model with resource and resource
20	* collection classes

32	$result = $this->getData($field);
33	$store = Mage::app()->getStore();
34	if ($result == '$0') {
35	+ return str_replace('.00', '', str_replace(',00', '',
36	+ $store->getCurrentCurrency()->formatPrecision(0, 0, array(), false, false)));
37	}
38	else {
39	return $result;

app/code/local/Mana/Filters/Model/Filter2/Value.php CHANGED Viewed

@@ -20,4 +20,15 @@ class Mana_Filters_Model_Filter2_Value extends Mana_Db_Model_Object {
             	protected function _construct() {
             		$this->_init(strtolower('Mana_Filters/Filter2_Value'));
+            	}
+            }


20	protected function _construct() {
21	$this->_init(strtolower('Mana_Filters/Filter2_Value'));
22	}
23	+
24	+ public function loadByFilterPosition($filterId, $position) {
25	+ /* @var $resource Mana_Filters_Resource_Filter2_Value */
26	+ $resource = $this->_getResource();
27	+ $resource->loadByFilterPosition($this, $filterId, $position);
28	+ $this->_afterLoad();
29	+ $this->setOrigData();
30	+ $this->_hasDataChanges = false;
31	+
32	+ return $this;
33	+ }
34	}

app/code/local/Mana/Filters/Model/Item.php CHANGED Viewed

@@ -14,6 +14,8 @@
              * method.
              */
             class Mana_Filters_Model_Item extends Mage_Catalog_Model_Layer_Filter_Item {
                 /**
                  * Returns URL which should be loaded if person chooses to add this filter item into active filters
                  * @return string
@@ -101,14 +103,42 @@ class Mana_Filters_Model_Item extends Mage_Catalog_Model_Layer_Filter_Item {
             		return 'filter_'.$helper->getFilterName($block, $this->getFilter()).'_'.$this->getValue();
+            	}
-            -
            	public function getSeoValue() {
-            -
            	    $urlValue = $this->getValue();
-            -
            	    /* @var $core Mana_Core_Helper_Data */ $core = Mage::helper(strtolower('Mana_Core'));
-            -
                    if (Mage::app()->getRequest()->getParam('m-seo-enabled', true) && ((string)Mage::getConfig()->getNode('modules/ManaPro_FilterSeoLinks/active')) == 'true') {
-            -
                        $url = Mage::getModel('manapro_filterseolinks/url');
-            -
                        /* @var $url ManaPro_FilterSeoLinks_Model_Url */
-            -
                        $urlValue = $url->encodeValue($this->getFilter()->getRequestVar(), $urlValue);
+                   }
-            -
                   return $urlValue;
+            	}
+            }


14	* method.
15	*/
16	class Mana_Filters_Model_Item extends Mage_Catalog_Model_Layer_Filter_Item {
17	+ protected $_seoData;
18	+
19	/**
20	* Returns URL which should be loaded if person chooses to add this filter item into active filters
21	* @return string

103	return 'filter_'.$helper->getFilterName($block, $this->getFilter()).'_'.$this->getValue();
104	}
105
106	+ /**
107	+ * @return string
108	+ */
109	+ public function getSeoValue() {
110	+ return $this->getSeoData('url');
111	+ }
112	+
113	+ public function getSeoPrefix()
114	+ {
115	+ return $this->getSeoData('prefix');
116	+ }
117	+
118	+ public function getSeoPosition()
119	+ {
120	+ return $this->getSeoData('position');
121	+ }
122	+
123	+ public function getSeoData($key = false) {
124	+ if (!$this->_seoData) {
125	+ if (Mage::app()->getRequest()->getParam('m-seo-enabled', true) &&
126	+ ((string)Mage::getConfig()->getNode('modules/ManaPro_FilterSeoLinks/active')) == 'true'
127	+ ) {
128	+ /* @var $url Mana_Seo_Rewrite_Url */
129	+ $url = Mage::getModel('core/url');
130	+ $this->_seoData = $url->getItemData($this->getFilter()->getRequestVar(), $this->getValue());
131	+ }
132	+ else {
133	+ $this->_seoData = array(
134	+ 'url' => $this->getValue(),
135	+ 'prefix' => '',
136	+ 'position' => 0,
137	+ 'id' => 0,
138	+ );
139	+ }
140	}
141	+
142	+ return $key !== false ? $this->_seoData[$key] : $this->_seoData;
143	}
144	}

app/code/local/Mana/Filters/Model/Observer.php CHANGED Viewed

@@ -29,6 +29,7 @@ class Mana_Filters_Model_Observer {
             			'mana_filters/display/category',
             			'mana_filters/display/decimal',
                         'mana_filters/display/sort_method',
             		));
+            	}
             	/**
@@ -50,7 +51,11 @@ class Mana_Filters_Model_Observer {
             	 * @param Varien_Event_Observer $observer
             	 */
             	public function fixAttributeIndexerSelectForConfigurableProductDefaultValues($observer) {
-            -
            	    /* @var $select Varien_Db_Select */ $select = $observer->getEvent()->getSelect();
             		/* @var $entityField Zend_Db_Expr */ $entityField = $observer->getEvent()->getEntityField();
                     /* @var $res Mage_Core_Model_Resource */ $res = Mage::getSingleton('core/resource');
@@ -69,4 +74,43 @@ class Mana_Filters_Model_Observer {
                             ->where("NOT((m_configurable_product.type_id = 'configurable') AND (m_configurable_attribute.is_configurable = 1))");
+                    }
+                }
+            }


29	'mana_filters/display/category',
30	'mana_filters/display/decimal',
31	'mana_filters/display/sort_method',
32	+ 'mana_filters/display/disable_no_result_options',
33	));
34	}
35	/**

51	* @param Varien_Event_Observer $observer
52	*/
53	public function fixAttributeIndexerSelectForConfigurableProductDefaultValues($observer) {
54	+ if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
55	+ return;
56	+ }
57	+
58	+ /* @var $select Varien_Db_Select */ $select = $observer->getEvent()->getSelect();
59	/* @var $entityField Zend_Db_Expr */ $entityField = $observer->getEvent()->getEntityField();
60
61	/* @var $res Mage_Core_Model_Resource */ $res = Mage::getSingleton('core/resource');

74	->where("NOT((m_configurable_product.type_id = 'configurable') AND (m_configurable_attribute.is_configurable = 1))");
75	}
76	}
77	+
78	+ /**
79	+ * REPLACE THIS WITH DESCRIPTION (handles event "core_block_abstract_to_html_after")
80	+ * @param Varien_Event_Observer $observer
81	+ */
82	+ public function hideCmsContentOnFilteredPages($observer) {
83	+ /* @var $block Mage_Core_Block_Abstract */
84	+ $block = $observer->getEvent()->getBlock();
85	+ /* @var $transport Varien_Object */
86	+ $transport = $observer->getEvent()->getData('transport');
87	+
88	+ if ($block->getNameInLayout() == 'cms_page' &&
89	+ ($block->getData('hide_cms_content_when_filters_applied') \|\| Mage::getStoreConfigFlag('mana_filters/display/hide_cms_page_content')) &&
90	+ in_array($this->coreHelper()->getRoutePath(), array('cms/page/view', 'cms/index/index')) &&
91	+ ($state = $this->filterHelper()->getLayer()->getState()) &&
92	+ $state->getFilters())
93	+
94	+ {
95	+ $transport->setData('html', '');
96	+ }
97	+ // INSERT HERE: event handler code
98	+ }
99	+
100	+ #region Dependencies
101	+
102	+ /**
103	+ * @return Mana_Core_Helper_Data
104	+ */
105	+ public function coreHelper() {
106	+ return Mage::helper('mana_core');
107	+ }
108	+
109	+ /**
110	+ * @return Mana_Filters_Helper_Data
111	+ */
112	+ public function filterHelper() {
113	+ return Mage::helper('mana_filters');
114	+ }
115	+ #endregion
116	}

app/code/local/Mana/Filters/Model/Query.php CHANGED Viewed

	@@ -160,6 +160,7 @@ class Mana_Filters_Model_Query extends Varien_Object
160	$filterModel->applyToCollection($collection);
161	}
162	}

163	$counts = $currentFilterModel->countOnCollection($collection);
164	$currentFilter['processedCounts'] = $currentFilterModel->processCounts($counts);
165


160	$filterModel->applyToCollection($collection);
161	}
162	}
163	+
164	$counts = $currentFilterModel->countOnCollection($collection);
165	$currentFilter['processedCounts'] = $currentFilterModel->processCounts($counts);
166

app/code/local/Mana/Filters/Model/Solr/Attribute.php CHANGED Viewed

@@ -19,11 +19,40 @@ class Mana_Filters_Model_Solr_Attribute extends Mana_Filters_Model_Filter_Attrib
                     /* @var $collection Enterprise_Search_Model_Resource_Collection */
                     $collection = $counts;
-            -
                    $attribute = $this->getAttributeModel();
                     $engine = Mage::getResourceSingleton('enterprise_search/engine');
-            -
                    $fieldName = $engine->getSearchEngineFieldName($attribute, 'nav');
-            -
                    return $collection->getFacetedData($fieldName);
+                }
                 /**
@@ -32,9 +61,7 @@ class Mana_Filters_Model_Solr_Attribute extends Mana_Filters_Model_Filter_Attrib
                  */
                 public function countOnCollection($collection)
+                {
-            -
                    $engine = Mage::getResourceSingleton('enterprise_search/engine');
-            -
                    $facetField = $engine->getSearchEngineFieldName($this->getAttributeModel(), 'nav');
-            -
                    $collection->setFacetCondition($facetField);
                     return $collection;
+                }
@@ -44,9 +71,16 @@ class Mana_Filters_Model_Solr_Attribute extends Mana_Filters_Model_Filter_Attrib
                  */
                 public function applyToCollection($collection)
+                {
                     $engine = Mage::getResourceSingleton('enterprise_search/engine');
-            -
                    $facetField = $engine->getSearchEngineFieldName($this->getAttributeModel(), 'nav');
-            -
                    $collection->addFqFilter(array($facetField => array('or' => $this->getMSelectedValues())));
+                }
+            }


19	/* @var $collection Enterprise_Search_Model_Resource_Collection */
20	$collection = $counts;
21
22	+ $result = $collection->getFacetedData($this->getFilterField(), array('fields' => array('id')));
23	$engine = Mage::getResourceSingleton('enterprise_search/engine');
24	+ if (method_exists($engine, 'getSearchEngineFieldName')) {
25	+ return $result;
26	+ }
27	+ else {
28	+ $attribute = $this->getAttributeModel();
29	+ $options = $attribute->getFrontend()->getSelectOptions();
30	+ $idResult = array();
31	+ foreach ($options as $option) {
32	+ if (!$option \|\| is_array($option['value'])) {
33	+ continue;
34	+ }
35	+ if (isset($result[$option['label']])) {
36	+ $idResult[$option['value']] = $result[$option['label']];
37	+ }
38	+ }
39	+ return $idResult;
40	+ }
41	+ }
42
43	+ /**
44	+ * Get facet field name
45	+ *
46	+ * @return string
47	+ */
48	+ public function getFilterField() {
49	+ $engine = Mage::getResourceSingleton('enterprise_search/engine');
50	+ if (method_exists($engine, 'getSearchEngineFieldName')) {
51	+ return $engine->getSearchEngineFieldName($this->getAttributeModel(), 'nav');
52	+ }
53	+ else {
54	+ return Mage::helper('enterprise_search')->getAttributeSolrFieldName($this->getAttributeModel());
55	+ }
56	}
57
58	/**

61	*/
62	public function countOnCollection($collection)
63	{
64	+ $collection->setFacetCondition($this->getFilterField());


65
66	return $collection;
67	}

71	*/
72	public function applyToCollection($collection)
73	{
74	+ $values = $this->getMSelectedValues();
75	$engine = Mage::getResourceSingleton('enterprise_search/engine');
76	+ if (!method_exists($engine, 'getSearchEngineFieldName')) {
77	+ $labels = array();
78	+ foreach ($values as $value) {
79	+ $labels[] = $this->getAttributeModel()->getFrontend()->getOption($value);
80	+ }
81	+ $values = $labels;
82	+ }
83	+ $collection->addFqFilter(array($this->getFilterField() => array('or' => $values)));
84	}
85
86	}

app/code/local/Mana/Filters/Model/Solr/Category.php CHANGED Viewed

	@@ -15,11 +15,26 @@ class Mana_Filters_Model_Solr_Category extends Mana_Filters_Model_Filter_Categor
15	return true;
16	}
17















18	public function processCounts($counts) {
19	/* @var $collection Enterprise_Search_Model_Resource_Collection */
20	$collection = $counts;
21
22	- $facetedData = $collection->getFacetedData(~~'category_ids'~~);
23	foreach ($this->getCountedCategories() as $category) {
24	if (isset($facetedData[$category->getId()])) {
25	$category->setProductCount($facetedData[$category->getId()]);
	@@ -42,7 +57,7 @@ class Mana_Filters_Model_Solr_Category extends Mana_Filters_Model_Filter_Categor
42	? array_keys($this->getCountedCategories())
43	: array_keys($this->getCountedCategories()->toArray()));
44
45	- $collection->setFacetCondition(~~'category_ids'~~, $categories);
46
47	return $collection;
48	}
	@@ -52,7 +67,7 @@ class Mana_Filters_Model_Solr_Category extends Mana_Filters_Model_Filter_Categor
52	*/
53	public function applyToCollection($collection)
54	{
55	- $collection->addFqFilter(array(~~'category_ids'~~ => array('or' => $this->getMSelectedValues())));
56	}
57
58	public function isFilterAppliedWhenCounting($modelToBeApplied) {


15	return true;
16	}
17
18	+ /**
19	+ * Get facet field name based on current website and customer group
20	+ *
21	+ * @return string
22	+ */
23	+ protected function _getFilterField() {
24	+ $engine = Mage::getResourceSingleton('enterprise_search/engine');
25	+ if (method_exists($engine, 'getSearchEngineFieldName')) {
26	+ return 'category_ids';
27	+ }
28	+ else {
29	+ return 'categories';
30	+ }
31	+ }
32	+
33	public function processCounts($counts) {
34	/* @var $collection Enterprise_Search_Model_Resource_Collection */
35	$collection = $counts;
36
37	+ $facetedData = $collection->getFacetedData($this->_getFilterField());
38	foreach ($this->getCountedCategories() as $category) {
39	if (isset($facetedData[$category->getId()])) {
40	$category->setProductCount($facetedData[$category->getId()]);

57	? array_keys($this->getCountedCategories())
58	: array_keys($this->getCountedCategories()->toArray()));
59
60	+ $collection->setFacetCondition($this->_getFilterField(), $categories);
61
62	return $collection;
63	}

67	*/
68	public function applyToCollection($collection)
69	{
70	+ $collection->addFqFilter(array($this->_getFilterField() => array('or' => $this->getMSelectedValues())));
71	}
72
73	public function isFilterAppliedWhenCounting($modelToBeApplied) {

app/code/local/Mana/Filters/Model/Solr/Decimal.php CHANGED Viewed

	@@ -72,12 +72,14 @@ class Mana_Filters_Model_Solr_Decimal extends Mana_Filters_Model_Filter_Decimal
72
73	$fq = array();
74	foreach ($this->getMSelectedValues() as $selection) {
75	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
76	- $range = ~~$this->_getResource~~(~~)->getRange($index~~, $~~range~~);
77	- $~~fq[]~~ = ~~array~~(
78	- ~~'from' =>~~ $~~range~~[~~'from'~~],
79	- 'to' => $range['to'] ~~- ($this->isUpperBoundInclusive() ? 0 : 0.001)~~,
80	- );


81	}
82
83	$collection->addFqFilter(array($field => array('or' => $fq)));


72
73	$fq = array();
74	foreach ($this->getMSelectedValues() as $selection) {
75	+ if (strpos($selection, ',') !== false) {
76	+ list($index, $range) = explode(',', $selection);
77	+ $range = $this->_getResource()->getRange($index, $range);
78	+ $fq[] = array(
79	+ 'from' => $range['from'],
80	+ 'to' => $range['to'] - ($this->isUpperBoundInclusive() ? 0 : 0.001),
81	+ );
82	+ }
83	}
84
85	$collection->addFqFilter(array($field => array('or' => $fq)));

app/code/local/Mana/Filters/Model/Solr/Price.php CHANGED Viewed

	@@ -26,7 +26,7 @@ class Mana_Filters_Model_Solr_Price extends Mana_Filters_Model_Filter_Price
26	*/
27	public function countOnCollection($collection)
28	{
29	- if (Mage::app()->getStore()->getConfig(self::XML_PATH_RANGE_CALCULATION) == ~~self::RANGE_CALCULATION_IMPROVED~~) {
30	return $this->_addCalculatedFacetConditionToCollection($collection);
31	}
32
	@@ -79,17 +79,19 @@ class Mana_Filters_Model_Solr_Price extends Mana_Filters_Model_Filter_Price
79	$field = $this->_getFilterField();
80	$fq = array();
81	foreach ($this->getMSelectedValues() as $selection) {
82	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
83	- $range = ~~$this->_getResource~~(~~)->getPriceRange($index~~, $~~range~~);
84	- $to = $range~~['to']~~;
85	- ~~if (~~$to < $~~this->getMaxPriceInt() && !$this->isUpperBoundInclusive()) {~~
86	- $to -= ~~0.001;~~
87	- }

88
89	- $fq[] = array(
90	- 'from' => $range['from'],
91	- 'to' => $to,
92	- );

93	}
94
95	$collection->addFqFilter(array($field => array('or' => $fq)));
	@@ -120,7 +122,14 @@ class Mana_Filters_Model_Solr_Price extends Mana_Filters_Model_Filter_Price
120	protected function _getFilterField()
121	{
122	$engine = Mage::getResourceSingleton('enterprise_search/engine');
123	- ~~$priceField~~ = $engine->getSearchEngineFieldName('~~price'~~);







124
125	return $priceField;
126	}
	@@ -274,7 +283,7 @@ class Mana_Filters_Model_Solr_Price extends Mana_Filters_Model_Filter_Price
274
275	$max = $stats[$this->_getFilterField()]['max'];
276	if (!is_numeric($max)) {
277	- ~~$max~~ = parent::getRangeOnCollection($collection);
278	} else {
279	$max = floor($max * $this->getCurrencyRate());
280	}


26	*/
27	public function countOnCollection($collection)
28	{
29	+ if (Mage::app()->getStore()->getConfig(self::XML_PATH_RANGE_CALCULATION) == 'improved') {
30	return $this->_addCalculatedFacetConditionToCollection($collection);
31	}
32

79	$field = $this->_getFilterField();
80	$fq = array();
81	foreach ($this->getMSelectedValues() as $selection) {
82	+ if (strpos($selection, ',') !== false) {
83	+ list($index, $range) = explode(',', $selection);
84	+ $range = $this->_getResource()->getPriceRange($index, $range);
85	+ $to = $range['to'];
86	+ if ($to < $this->getMaxPriceInt() && !$this->isUpperBoundInclusive()) {
87	+ $to -= 0.001;
88	+ }
89
90	+ $fq[] = array(
91	+ 'from' => $range['from'],
92	+ 'to' => $to,
93	+ );
94	+ }
95	}
96
97	$collection->addFqFilter(array($field => array('or' => $fq)));

122	protected function _getFilterField()
123	{
124	$engine = Mage::getResourceSingleton('enterprise_search/engine');
125	+ if (method_exists($engine, 'getSearchEngineFieldName')) {
126	+ $priceField = $engine->getSearchEngineFieldName('price');
127	+ }
128	+ else {
129	+ $websiteId = Mage::app()->getStore()->getWebsiteId();
130	+ $customerGroupId = Mage::getSingleton('customer/session')->getCustomerGroupId();
131	+ $priceField = 'price_' . $customerGroupId . '_' . $websiteId;
132	+ }
133
134	return $priceField;
135	}

283
284	$max = $stats[$this->_getFilterField()]['max'];
285	if (!is_numeric($max)) {
286	+ return parent::getRangeOnCollection($collection);
287	} else {
288	$max = floor($max * $this->getCurrencyRate());
289	}

app/code/local/Mana/Filters/Model/Solr/Reverse/Attribute.php CHANGED Viewed

	@@ -17,8 +17,7 @@ class Mana_Filters_Model_Solr_Reverse_Attribute extends Mana_Filters_Model_Solr_
17	public function applyToCollection($collection)
18	{
19	$engine = Mage::getResourceSingleton('enterprise_search/engine');
20	- $~~facetField = $engine~~->~~getSearchEngineFieldName~~($this->~~getAttributeModel~~(), '~~nav~~');
21	- $collection->addFqFilter(array($facetField => array('reverse' => $this->getMSelectedValues())));
22	}
23
24	}


17	public function applyToCollection($collection)
18	{
19	$engine = Mage::getResourceSingleton('enterprise_search/engine');
20	+ $collection->addFqFilter(array($this->getFilterField() => array('reverse' => $this->getMSelectedValues())));

21	}
22
23	}

app/code/local/Mana/Filters/Model/Solr/Reverse/Decimal.php CHANGED Viewed

	@@ -21,11 +21,13 @@ class Mana_Filters_Model_Solr_Reverse_Decimal extends Mana_Filters_Model_Solr_De
21
22	$fq = array();
23	foreach ($this->getMSelectedValues() as $selection) {
24	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
25	- $~~fq[]~~ = ~~array~~(
26	- ~~'from' => (~~$~~range~~ * (~~$index - 1)),~~
27	- 'to' => $range * $index - ~~($this->isUpperBoundInclusive(~~) ~~? 0 : 0.001~~),
28	- );


29	}
30
31	$collection->addFqFilter(array($field => array('reverse' => $fq)));


21
22	$fq = array();
23	foreach ($this->getMSelectedValues() as $selection) {
24	+ if (strpos($selection, ',') !== false) {
25	+ list($index, $range) = explode(',', $selection);
26	+ $fq[] = array(
27	+ 'from' => ($range * ($index - 1)),
28	+ 'to' => $range * $index - ($this->isUpperBoundInclusive() ? 0 : 0.001),
29	+ );
30	+ }
31	}
32
33	$collection->addFqFilter(array($field => array('reverse' => $fq)));

app/code/local/Mana/Filters/Model/Solr/Reverse/Price.php CHANGED Viewed

	@@ -22,16 +22,18 @@ class Mana_Filters_Model_Solr_Reverse_Price extends Mana_Filters_Model_Solr_Pric
22	$field = $this->_getFilterField();
23	$fq = array();
24	foreach ($this->getMSelectedValues() as $selection) {
25	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
26	- $to = $range * $~~index~~;
27	- ~~if (~~$to < $~~this->getMaxPriceInt()~~ && ~~!$this->isUpperBoundInclusive()) {~~
28	- $to -= ~~0.001;~~
29	- }

30
31	- $fq[] = array(
32	- 'from' => ($range * ($index - 1)),
33	- 'to' => $to,
34	- );

35	}
36
37	$collection->addFqFilter(array($field => array('reverse' => $fq)));


22	$field = $this->_getFilterField();
23	$fq = array();
24	foreach ($this->getMSelectedValues() as $selection) {
25	+ if (strpos($selection, ',') !== false) {
26	+ list($index, $range) = explode(',', $selection);
27	+ $to = $range * $index;
28	+ if ($to < $this->getMaxPriceInt() && !$this->isUpperBoundInclusive()) {
29	+ $to -= 0.001;
30	+ }
31
32	+ $fq[] = array(
33	+ 'from' => ($range * ($index - 1)),
34	+ 'to' => $to,
35	+ );
36	+ }
37	}
38
39	$collection->addFqFilter(array($field => array('reverse' => $fq)));

app/code/local/Mana/Filters/Resource/Filter/Decimal.php CHANGED Viewed

@@ -62,25 +62,27 @@ class Mana_Filters_Resource_Filter_Decimal extends Mage_Catalog_Model_Resource_E
                         $connection->quoteInto("{$tableAlias}.store_id = ?", $collection->getStoreId())
                     );
-            -
                    $collection->getSelect()->join(
-            -
                        array($tableAlias => $this->getMainTable()),
-            -
                        join(' AND ', $conditions),
-            -
                        array()
-            -
                    );
-            -
-            -
            		// MANA BEGIN: modify select formation to include multiple price ranges
                     $condition = '';
                     foreach ($value as $selection) {
-            -
                    	list($index, $range) = explode(',', $selection);
-            -
                    	$range = $this->getRange($index, $range);
-            -
                    	if ($condition != '') $condition .= ' OR ';
-            -
                    	$condition .= '(('."{$tableAlias}.value" . ' >= '. $range['from'].') '.
-            -
                    		'AND ('."{$tableAlias}.value" . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
+                    }
-            -
                    $collection->getSelect()
-            -
                        ->distinct()
-            -
                    	->where($condition);
-            -
                    // MANA END
                     return $this;
+                }
@@ -122,7 +124,7 @@ class Mana_Filters_Resource_Filter_Decimal extends Mage_Catalog_Model_Resource_E
                  */
                 public function getMinMaxForCollection($filter, $collection)
+                {
-            -
                    $select     = $this->_getSelect($filter, $collection);
                     $connection = $this->_getReadAdapter();
                     $table = 'decimal_index';


62	$connection->quoteInto("{$tableAlias}.store_id = ?", $collection->getStoreId())
63	);
64







65	$condition = '';
66	foreach ($value as $selection) {
67	+ if (strpos($selection, ',') !== false) {
68	+ list($index, $range) = explode(',', $selection);
69	+ $range = $this->getRange($index, $range);
70	+ if ($condition != '') $condition .= ' OR ';
71	+ $condition .= '(('."{$tableAlias}.value" . ' >= '. $range['from'].') '.
72	+ 'AND ('."{$tableAlias}.value" . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
73	+ }
74	+ }
75	+
76	+ if ($condition) {
77	+ $collection->getSelect()
78	+ ->join(
79	+ array($tableAlias => $this->getMainTable()),
80	+ join(' AND ', $conditions),
81	+ array()
82	+ )
83	+ ->distinct()
84	+ ->where($condition);
85	}




86
87	return $this;
88	}

124	*/
125	public function getMinMaxForCollection($filter, $collection)
126	{
127	+ $select = $this->_getSelectForCollection($filter, $collection);
128	$connection = $this->_getReadAdapter();
129
130	$table = 'decimal_index';

app/code/local/Mana/Filters/Resource/Filter/Price.php CHANGED Viewed

	@@ -25,14 +25,11 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
25	{
26	$collection->addPriceData($filter->getCustomerGroupId(), $filter->getWebsiteId());
27
28	- if ~~(!is_null(~~$collection->~~getCatalogPreparedSelect~~()~~)) {~~
29	- $select = clone $collection->getCatalogPreparedSelect();
30	- } else {
31	- $select = clone $collection->getSelect();
32	- }
33
34	// reset columns, order and limitation conditions
35	$select->reset(Zend_Db_Select::COLUMNS);

36	$select->reset(Zend_Db_Select::ORDER);
37	$select->reset(Zend_Db_Select::LIMIT_COUNT);
38	$select->reset(Zend_Db_Select::LIMIT_OFFSET);
	@@ -100,15 +97,15 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
100	if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
101	$table = Mage_Catalog_Model_Resource_Product_Collection::MAIN_TABLE_ALIAS;
102	$select = $this->_getSelectOnCollection($collection, $model);
103	- $~~priceExpression~~ = $~~this~~->~~_getFullPriceExpression~~(~~$model, $select~~);

104
105	$range = floatval($model->getPriceRange());
106	if ($range == 0) {
107	$range = 1;
108	}
109	- $fix = $this->_getConfigurablePriceFix();
110	$countExpr = new Zend_Db_Expr('COUNT(*)');
111	- $rangeExpr = new Zend_Db_Expr("FLOOR(({$priceExpression} ~~{$fix}~~) / {$range}) + 1");
112
113	$select->columns(array(
114	'range' => $rangeExpr,
	@@ -119,6 +116,8 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
119	Mage::helper('mana_filters')->resetProductCollectionWhereClause($select);
120	$select->where("{$table}.min_price > 0");
121


122	return $this->_getReadAdapter()->fetchPairs($select);
123	}
124	else {
	@@ -174,15 +173,20 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
174
175	$condition = '';
176	foreach ($model->getMSelectedValues() as $selection) {
177	- ~~list~~($~~index~~, ~~$range) = explode(~~',', ~~$selection~~);
178	- $range = ~~$this->getPriceRange~~(~~$index~~, $~~range~~);
179	- if ($~~condition~~ ~~!= ''~~) ~~$condition .= ' OR '~~;
180	- $condition .= '(('~~.$priceExpr~~ . ' >= '. ~~$range['from'].')~~ '.
181	- '~~AND~~ ('.$priceExpr . ~~($this->isUpperBoundInclusive() ?~~ ' <= ' ~~: ' < ')~~. $range['to'].'))';








182	}
183	- $select
184	- ->distinct()
185	- ->where($condition);
186	return $this;
187	}
188
	@@ -201,21 +205,19 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
201	{
202	$select = $this->_getSelectOnCollection($collection, $filter);
203	$connection = $this->_getReadAdapter();
204	- $response = $this->_dispatchPreparePriceEvent($filter, $select);
205
206	if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
207	- $~~table~~ = ~~Mage_Catalog_Model_Resource_Product_Collection::MAIN_TABLE_ALIAS~~;
208	- $additional = $this->_replaceTableAlias(join('', $response->getAdditionalCalculations()));
209	}
210	else {

211	$table = $this->_getIndexTableAlias();
212	$additional = join('', $response->getAdditionalCalculations());


213	}
214
215	- ~~$fix = $this~~->~~_getConfigurablePriceFix~~();
216	- $maxPriceExpr = new Zend_Db_Expr("MAX({$table}.min_price {$additional} {$fix}) AS m_max_price");
217	-
218	- Mage::helper('mana_filters')->resetProductCollectionWhereClause($select);
219	$select->columns(array($maxPriceExpr))->order('m_max_price DESC');
220
221	$result = $connection->fetchOne($select) * $filter->getCurrencyRate();
	@@ -255,4 +257,49 @@ class Mana_Filters_Resource_Filter_Price extends Mage_Catalog_Model_Resource_Eav
255	}
256	return $subSelect ? " + COALESCE(($subSelect), 0)" : '';
257	}













































258	}


25	{
26	$collection->addPriceData($filter->getCustomerGroupId(), $filter->getWebsiteId());
27
28	+ $select = clone $collection->getSelect();




29
30	// reset columns, order and limitation conditions
31	$select->reset(Zend_Db_Select::COLUMNS);
32	+ $select->reset(Zend_Db_Select::GROUP);
33	$select->reset(Zend_Db_Select::ORDER);
34	$select->reset(Zend_Db_Select::LIMIT_COUNT);
35	$select->reset(Zend_Db_Select::LIMIT_OFFSET);

97	if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
98	$table = Mage_Catalog_Model_Resource_Product_Collection::MAIN_TABLE_ALIAS;
99	$select = $this->_getSelectOnCollection($collection, $model);
100	+ $rate = $model->getCurrencyRate();
101	+ $priceExpression = "({$this->_getPriceExpression($model, $select)}) * {$rate}";
102
103	$range = floatval($model->getPriceRange());
104	if ($range == 0) {
105	$range = 1;
106	}

107	$countExpr = new Zend_Db_Expr('COUNT(*)');
108	+ $rangeExpr = new Zend_Db_Expr("FLOOR(({$priceExpression}) / {$range}) + 1");
109
110	$select->columns(array(
111	'range' => $rangeExpr,

116	Mage::helper('mana_filters')->resetProductCollectionWhereClause($select);
117	$select->where("{$table}.min_price > 0");
118
119	+ //Mage::log($select->__toString(), Zend_Log::DEBUG, 'price.log' );
120	+ //Mage::log(json_encode($this->_getReadAdapter()->fetchPairs($select)), Zend_Log::DEBUG, 'price.log' );
121	return $this->_getReadAdapter()->fetchPairs($select);
122	}
123	else {

173
174	$condition = '';
175	foreach ($model->getMSelectedValues() as $selection) {
176	+ if (strpos($selection, ',') !== false) {
177	+ list($index, $range) = explode(',', $selection);
178	+ $range = $this->getPriceRange($index, $range);
179	+ if ($condition != '') $condition .= ' OR ';
180	+ $condition .= '(('.$priceExpr . ' >= '. $range['from'].') '.
181	+ 'AND ('.$priceExpr . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
182	+ }
183	+ }
184	+
185	+ if ($condition) {
186	+ $select
187	+ ->distinct()
188	+ ->where($condition);
189	}



190	return $this;
191	}
192

205	{
206	$select = $this->_getSelectOnCollection($collection, $filter);
207	$connection = $this->_getReadAdapter();

208
209	if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
210	+ $maxPriceExpr = new Zend_Db_Expr("MAX({$this->_getPriceExpression($filter, $select)}) AS m_max_price");

211	}
212	else {
213	+ $response = $this->_dispatchPreparePriceEvent($filter, $select);
214	$table = $this->_getIndexTableAlias();
215	$additional = join('', $response->getAdditionalCalculations());
216	+ $fix = $this->_getConfigurablePriceFix();
217	+ $maxPriceExpr = new Zend_Db_Expr("MAX({$table}.min_price {$additional} {$fix}) AS m_max_price");
218	}
219
220	+ //Mage::helper('mana_filters')->resetProductCollectionWhereClause($select);



221	$select->columns(array($maxPriceExpr))->order('m_max_price DESC');
222
223	$result = $connection->fetchOne($select) * $filter->getCurrencyRate();

257	}
258	return $subSelect ? " + COALESCE(($subSelect), 0)" : '';
259	}
260	+
261	+ protected $_preparedExpressions = array();
262	+
263	+ protected function _getPriceExpression($filter, $select, $replaceAlias = true) {
264	+ foreach ($this->_preparedExpressions as $expr) {
265	+ if ($expr['select'] == $select) {
266	+ return $expr['result'];
267	+ }
268	+ }
269	+
270	+ $response = new Varien_Object();
271	+ $response->setAdditionalCalculations(array());
272	+ $tableAliases = array_keys($select->getPart(Zend_Db_Select::FROM));
273	+ if (in_array(Mage_Catalog_Model_Resource_Product_Collection::INDEX_TABLE_ALIAS, $tableAliases)) {
274	+ $table = Mage_Catalog_Model_Resource_Product_Collection::INDEX_TABLE_ALIAS;
275	+ }
276	+ else {
277	+ $table = reset($tableAliases);
278	+ }
279	+
280	+ // prepare event arguments
281	+ $eventArgs = array(
282	+ 'select' => $select,
283	+ 'table' => $table,
284	+ 'store_id' => $filter->getStoreId(),
285	+ 'response_object' => $response
286	+ );
287	+
288	+ Mage::dispatchEvent('catalog_prepare_price_select', $eventArgs);
289	+
290	+ $table = Mage_Catalog_Model_Resource_Product_Collection::MAIN_TABLE_ALIAS;
291	+ $additional = $this->_replaceTableAlias(join('', $response->getAdditionalCalculations()));
292	+
293	+ $fix = $this->_getConfigurablePriceFix();
294	+ $result = "{$table}.min_price {$additional} {$fix}";
295	+
296	+ if ($replaceAlias) {
297	+ $result = $this->_replaceTableAlias($result);
298	+ }
299	+
300	+ $this->_preparedExpressions[] = compact('select', 'result');
301	+
302	+ return $result;
303	+ }
304	+
305	}

app/code/local/Mana/Filters/Resource/Filter/Reverse/Decimal.php CHANGED Viewed

@@ -28,25 +28,27 @@ class Mana_Filters_Resource_Filter_Reverse_Decimal extends Mana_Filters_Resource
                         $connection->quoteInto("{$tableAlias}.store_id = ?", $collection->getStoreId())
                     );
-            -
                    $collection->getSelect()->join(
-            -
                        array($tableAlias => $this->getMainTable()),
-            -
                        join(' AND ', $conditions),
-            -
                        array()
-            -
                    );
-            -
-            -
            		// MANA BEGIN: modify select formation to include multiple price ranges
                     $condition = '';
                     foreach ($value as $selection) {
-            -
                    	list($index, $range) = explode(',', $selection);
-            -
                    	$range = $this->getRange($index, $range);
-            -
                    	if ($condition != '') $condition .= ' OR ';
-            -
                    	$condition .= '(('."{$tableAlias}.value" . ' >= '. $range['from'].') '.
-            -
                    		'AND ('."{$tableAlias}.value" . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
+                    }
-            -
                    $collection->getSelect()
-            -
                        ->distinct()
-            -
                    	->where("NOT ($condition)");
-            -
                    // MANA END
                     return $this;
+                }


28	$connection->quoteInto("{$tableAlias}.store_id = ?", $collection->getStoreId())
29	);
30







31	$condition = '';
32	foreach ($value as $selection) {
33	+ if (strpos($selection, ',') !== false) {
34	+ list($index, $range) = explode(',', $selection);
35	+ $range = $this->getRange($index, $range);
36	+ if ($condition != '') $condition .= ' OR ';
37	+ $condition .= '(('."{$tableAlias}.value" . ' >= '. $range['from'].') '.
38	+ 'AND ('."{$tableAlias}.value" . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
39	+ }
40	+ }
41	+
42	+ if ($condition) {
43	+ $collection->getSelect()
44	+ ->join(
45	+ array($tableAlias => $this->getMainTable()),
46	+ join(' AND ', $conditions),
47	+ array()
48	+ )
49	+ ->distinct()
50	+ ->where("NOT ($condition)");
51	}




52
53	return $this;
54	}

app/code/local/Mana/Filters/Resource/Filter/Reverse/Price.php CHANGED Viewed

@@ -38,15 +38,20 @@ class Mana_Filters_Resource_Filter_Reverse_Price extends Mana_Filters_Resource_F
                     $condition = '';
                     foreach ($model->getMSelectedValues() as $selection) {
-            -
                    	list($index, $range) = explode(',', $selection);
-            -
                    	$range = $this->getPriceRange($index, $range);
-            -
                    	if ($condition != '') $condition .= ' OR ';
-            -
                    	$condition .= '(('.$priceExpr . ' >= '. $range['from'].') '.
-            -
                    		'AND ('.$priceExpr . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
+                    }
-            -
                    $select
-            -
                        ->distinct()
-            -
                    	->where("NOT ($condition)");
                     return $this;
+                }


38
39	$condition = '';
40	foreach ($model->getMSelectedValues() as $selection) {
41	+ if (strpos($selection, ',') !== false) {
42	+ list($index, $range) = explode(',', $selection);
43	+ $range = $this->getPriceRange($index, $range);
44	+ if ($condition != '') $condition .= ' OR ';
45	+ $condition .= '(('.$priceExpr . ' >= '. $range['from'].') '.
46	+ 'AND ('.$priceExpr . ($this->isUpperBoundInclusive() ? ' <= ' : ' < '). $range['to'].'))';
47	+ }
48	+ }
49	+
50	+ if ($condition) {
51	+ $select
52	+ ->distinct()
53	+ ->where("NOT ($condition)");
54	}



55	return $this;
56	}
57

app/code/local/Mana/Filters/Resource/Filter2.php CHANGED Viewed

	@@ -53,6 +53,12 @@ class Mana_Filters_Resource_Filter2 extends Mana_Db_Resource_Object {
53	const DM_HELP_WIDTH = 33;
54
55	const DM_IS_REVERSE = 34;






56	#endregion
57
58	/**
	@@ -161,6 +167,9 @@ class Mana_Filters_Resource_Filter2 extends Mana_Db_Resource_Object {
161	if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_SORT_METHOD)) {
162	$object->setSortMethod(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/sort_method'));
163	}



164	}
165
166	/**
	@@ -238,6 +247,7 @@ class Mana_Filters_Resource_Filter2 extends Mana_Db_Resource_Object {
238	$object->setIsEnabledInSearch($values['is_enabled_in_search']);
239	$object->setPosition($values['position']);
240	$object->setSortMethod(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/sort_method'));

241	}
242	/**
243	* Enter description here ...
	@@ -265,6 +275,8 @@ class Mana_Filters_Resource_Filter2 extends Mana_Db_Resource_Object {
265	'target.code = eav_attribute.attribute_code'.$attributeJoin, null)
266	->joinLeft(array('eav_attribute_additional' => Mage::getSingleton('core/resource')->getTableName('catalog/eav_attribute')),
267	'eav_attribute.attribute_id = eav_attribute_additional.attribute_id', null)


268	->distinct()
269	->where('(eav_attribute.attribute_id IS NULL) OR (eav_attribute_additional.is_filterable = 0)')
270	->where("target.code <> 'category'");
	@@ -292,6 +304,7 @@ class Mana_Filters_Resource_Filter2 extends Mana_Db_Resource_Object {
292	Mage::helper('mana_db')->updateDefaultableField($object, 'sort_method', Mana_Filters_Resource_Filter2::DM_SORT_METHOD, $fields, $useDefault);
293	Mage::helper('mana_db')->updateDefaultableField($object, 'operation', Mana_Filters_Resource_Filter2::DM_OPERATION, $fields, $useDefault);
294	Mage::helper('mana_db')->updateDefaultableField($object, 'is_reverse', Mana_Filters_Resource_Filter2::DM_IS_REVERSE, $fields, $useDefault);

295	}
296	protected function _afterSave(Mage_Core_Model_Abstract $object) {
297	if ($edit = $object->getValueData()) {


53	const DM_HELP_WIDTH = 33;
54
55	const DM_IS_REVERSE = 34;
56	+
57	+ const DM_INCLUDE_IN_URL = 35;
58	+ const DM_URL_POSITION = 36;
59	+
60	+ const DM_DISABLE_NO_RESULT_OPTIONS = 37;
61	+
62	#endregion
63
64	/**

167	if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_SORT_METHOD)) {
168	$object->setSortMethod(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/sort_method'));
169	}
170	+ if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_DISABLE_NO_RESULT_OPTIONS)) {
171	+ $object->setDisableNoResultOptions(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/disable_no_result_options'));
172	+ }
173	}
174
175	/**

247	$object->setIsEnabledInSearch($values['is_enabled_in_search']);
248	$object->setPosition($values['position']);
249	$object->setSortMethod(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/sort_method'));
250	+ $object->setDisableNoResultOptions(Mage::helper('mana_db')->getLatestConfig('mana_filters/display/disable_no_result_options'));
251	}
252	/**
253	* Enter description here ...

275	'target.code = eav_attribute.attribute_code'.$attributeJoin, null)
276	->joinLeft(array('eav_attribute_additional' => Mage::getSingleton('core/resource')->getTableName('catalog/eav_attribute')),
277	'eav_attribute.attribute_id = eav_attribute_additional.attribute_id', null)
278	+ ->joinLeft(array('eav_entity_type' => Mage::getSingleton('core/resource')->getTableName('eav/entity_type')),
279	+ "eav_entity_type.entity_type_id = eav_attribute.entity_type_id AND eav_entity_type.entity_type_code = 'catalog_product'", null)
280	->distinct()
281	->where('(eav_attribute.attribute_id IS NULL) OR (eav_attribute_additional.is_filterable = 0)')
282	->where("target.code <> 'category'");

304	Mage::helper('mana_db')->updateDefaultableField($object, 'sort_method', Mana_Filters_Resource_Filter2::DM_SORT_METHOD, $fields, $useDefault);
305	Mage::helper('mana_db')->updateDefaultableField($object, 'operation', Mana_Filters_Resource_Filter2::DM_OPERATION, $fields, $useDefault);
306	Mage::helper('mana_db')->updateDefaultableField($object, 'is_reverse', Mana_Filters_Resource_Filter2::DM_IS_REVERSE, $fields, $useDefault);
307	+ Mage::helper('mana_db')->updateDefaultableField($object, 'disable_no_result_options', Mana_Filters_Resource_Filter2::DM_DISABLE_NO_RESULT_OPTIONS, $fields, $useDefault);
308	}
309	protected function _afterSave(Mage_Core_Model_Abstract $object) {
310	if ($edit = $object->getValueData()) {

app/code/local/Mana/Filters/Resource/Filter2/Store.php CHANGED Viewed

	@@ -53,6 +53,7 @@ class Mana_Filters_Resource_Filter2_Store extends Mana_Filters_Resource_Filter2
53	'global.sort_method AS sort_method',
54	'global.operation AS operation',
55	'global.is_reverse AS is_reverse',

56	));
57	if ($options['trackKeys']) {
58	if (($keys = $options['targets'][$globalEntityName]->getSavedKeys()) && count($keys)) {
	@@ -107,6 +108,9 @@ class Mana_Filters_Resource_Filter2_Store extends Mana_Filters_Resource_Filter2
107	if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_IS_REVERSE)) {
108	$object->setIsReverse($values['is_reverse']);
109	}



110	}
111	/**
112	* Enter description here ...
	@@ -137,6 +141,7 @@ class Mana_Filters_Resource_Filter2_Store extends Mana_Filters_Resource_Filter2
137	'global.sort_method AS sort_method',
138	'global.operation AS operation',
139	'global.is_reverse AS is_reverse',

140	));
141	if ($options['trackKeys']) {
142	if (($keys = $options['targets'][$globalEntityName]->getSavedKeys()) && count($keys)) {
	@@ -170,6 +175,7 @@ class Mana_Filters_Resource_Filter2_Store extends Mana_Filters_Resource_Filter2
170	$object->setSortMethod($values['sort_method']);
171	$object->setOperation($values['operation']);
172	$object->setIsReverse($values['is_reverse']);

173	}
174	/**
175	* Enter description here ...


53	'global.sort_method AS sort_method',
54	'global.operation AS operation',
55	'global.is_reverse AS is_reverse',
56	+ 'global.disable_no_result_options AS disable_no_result_options',
57	));
58	if ($options['trackKeys']) {
59	if (($keys = $options['targets'][$globalEntityName]->getSavedKeys()) && count($keys)) {

108	if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_IS_REVERSE)) {
109	$object->setIsReverse($values['is_reverse']);
110	}
111	+ if (!Mage::helper('mana_db')->hasOverriddenValue($object, $values, Mana_Filters_Resource_Filter2::DM_DISABLE_NO_RESULT_OPTIONS)) {
112	+ $object->setDisableNoResultOptions($values['disable_no_result_options']);
113	+ }
114	}
115	/**
116	* Enter description here ...

141	'global.sort_method AS sort_method',
142	'global.operation AS operation',
143	'global.is_reverse AS is_reverse',
144	+ 'global.disable_no_result_options AS disable_no_result_options',
145	));
146	if ($options['trackKeys']) {
147	if (($keys = $options['targets'][$globalEntityName]->getSavedKeys()) && count($keys)) {

175	$object->setSortMethod($values['sort_method']);
176	$object->setOperation($values['operation']);
177	$object->setIsReverse($values['is_reverse']);
178	+ $object->setDisableNoResultOptions($values['disable_no_result_options']);
179	}
180	/**
181	* Enter description here ...

app/code/local/Mana/Filters/Resource/Filter2/Value.php CHANGED Viewed

@@ -22,8 +22,32 @@ class Mana_Filters_Resource_Filter2_Value extends Mana_Db_Resource_Object {
                 const DM_NORMAL_HOVERED_IMAGE = 5;
                 const DM_SELECTED_HOVERED_IMAGE = 6;
                 const DM_STATE_IMAGE = 7;
                 #endregion
                 /**
                  * Invoked during resource model creation process, this method associates this resource model with model class
                  * and with DB table name


22	const DM_NORMAL_HOVERED_IMAGE = 5;
23	const DM_SELECTED_HOVERED_IMAGE = 6;
24	const DM_STATE_IMAGE = 7;
25	+
26	#endregion
27
28	+ public function loadByFilterPosition($object, $filterId, $position)
29	+ {
30	+ $read = $this->_getReadAdapter();
31	+
32	+ $select = $this->_getReadAdapter()->select()
33	+ ->from($this->getMainTable())
34	+ ->where($this->getMainTable() . '.' . 'filter_id' . '=?', $filterId)
35	+ ->where($this->getMainTable() . '.' . 'position' . '=?', $position);
36	+
37	+ if ($read) {
38	+ $data = $read->fetchRow($select);
39	+
40	+ if ($data) {
41	+ $object->setData($data);
42	+ }
43	+ }
44	+
45	+ $this->unserializeFields($object);
46	+ $this->_afterLoad($object);
47	+
48	+ return $this;
49	+ }
50	+
51	/**
52	* Invoked during resource model creation process, this method associates this resource model with model class
53	* and with DB table name

app/code/local/Mana/Filters/Resource/Filter2/Value/Store.php CHANGED Viewed

	@@ -122,7 +122,7 @@ class Mana_Filters_Resource_Filter2_Value_Store extends Mana_Filters_Resource_Fi
122	->joinLeft(array('store_option_value' => Mage::getSingleton('core/resource')->getTableName('eav/attribute_option_value')),
123	'store_option_value.option_id = eav_attribute_option.option_id AND store_option_value.store_id = core_store.store_id', null)
124	->joinLeft(array('target' => Mage::getSingleton('core/resource')->getTableName($this->getEntityName())),
125	- 'target.global_id = global.id AND target.store_id = core_store.store_id', null)
126	->distinct()
127	->where('core_store.store_id <> 0')
128	->where('global.edit_status = 0')
	@@ -168,4 +168,8 @@ class Mana_Filters_Resource_Filter2_Value_Store extends Mana_Filters_Resource_Fi
168	$object->setName($values['name']);
169	$object->setPosition($values['position']);
170	}




171	}


122	->joinLeft(array('store_option_value' => Mage::getSingleton('core/resource')->getTableName('eav/attribute_option_value')),
123	'store_option_value.option_id = eav_attribute_option.option_id AND store_option_value.store_id = core_store.store_id', null)
124	->joinLeft(array('target' => Mage::getSingleton('core/resource')->getTableName($this->getEntityName())),
125	+ 'target.global_id = global.id AND target.store_id = core_store.store_id', null)
126	->distinct()
127	->where('core_store.store_id <> 0')
128	->where('global.edit_status = 0')

168	$object->setName($values['name']);
169	$object->setPosition($values['position']);
170	}
171	+
172	+ public function loadByFilterPosition($object, $filterId, $position) {
173	+ throw new Exception('Not implemented');
174	+ }
175	}

app/code/local/Mana/Filters/Resource/Indexer/Source.php CHANGED Viewed

	@@ -11,6 +11,9 @@
11	*/
12	class Mana_Filters_Resource_Indexer_Source extends Mage_Catalog_Model_Resource_Eav_Mysql4_Product_Indexer_Eav_Source {
13	public function reindexEntities($processIds) {



14	$adapter = $this->_getWriteAdapter();
15
16	$this->clearTemporaryIndexTable();


11	*/
12	class Mana_Filters_Resource_Indexer_Source extends Mage_Catalog_Model_Resource_Eav_Mysql4_Product_Indexer_Eav_Source {
13	public function reindexEntities($processIds) {
14	+ // if (Mage::helper('mana_core')->isMageVersionEqualOrGreater('1.7')) {
15	+ // return parent::reindexEntities($processIds);
16	+ // }
17	$adapter = $this->_getWriteAdapter();
18
19	$this->clearTemporaryIndexTable();

app/code/local/Mana/Filters/Resource/Solr/And/Attribute.php CHANGED Viewed

	@@ -19,8 +19,6 @@ class Mana_Filters_Resource_Solr_And_Attribute extends Mana_Filters_Resource_Sol
19	*/
20	public function applyToCollection($collection, $model, $value)
21	{
22	- $~~engine~~ = ~~Mage::getResourceSingleton~~('~~enterprise_search/engine~~');
23	- $facetField = $engine->getSearchEngineFieldName($model->getAttributeModel(), 'nav');
24	- $collection->addFqFilter(array($facetField => array('and' => $value)));
25	}
26	}


19	*/
20	public function applyToCollection($collection, $model, $value)
21	{
22	+ $collection->addFqFilter(array($model->getFilterField() => array('and' => $value)));


23	}
24	}

app/code/local/Mana/Filters/Resource/Solr/Attribute.php CHANGED Viewed

	@@ -13,14 +13,12 @@ class Mana_Filters_Resource_Solr_Attribute extends Mana_Filters_Resource_Filter_
13	{
14	/**
15	* @param Enterprise_Search_Model_Resource_Collection $collection
16	- * @param ~~Mana_Filters_Model_Filter_Attribute~~ $model
17	* @return Mana_Filters_Resource_Solr_Attribute
18	*/
19	public function countOnCollection($collection, $model)
20	{
21	- $~~engine = Mage::getResourceSingleton~~(~~'enterprise_search/engine'~~);
22	- $facetField = $engine->getSearchEngineFieldName($model->getAttributeModel(), 'nav');
23	- $collection->setFacetCondition($facetField);
24
25	return $collection;
26	}
	@@ -33,8 +31,6 @@ class Mana_Filters_Resource_Solr_Attribute extends Mana_Filters_Resource_Filter_
33	*/
34	public function applyToCollection($collection, $model, $value)
35	{
36	- $~~engine~~ = ~~Mage::getResourceSingleton~~('~~enterprise_search/engine~~');
37	- $facetField = $engine->getSearchEngineFieldName($model->getAttributeModel(), 'nav');
38	- $collection->addFqFilter(array($facetField => array('or' => $value)));
39	}
40	}


13	{
14	/**
15	* @param Enterprise_Search_Model_Resource_Collection $collection
16	+ * @param Mana_Filters_Model_Solr_Attribute $model
17	* @return Mana_Filters_Resource_Solr_Attribute
18	*/
19	public function countOnCollection($collection, $model)
20	{
21	+ $collection->setFacetCondition($model->getFilterField());


22
23	return $collection;
24	}

31	*/
32	public function applyToCollection($collection, $model, $value)
33	{
34	+ $collection->addFqFilter(array($model->getFilterField() => array('or' => $value)));


35	}
36	}

app/code/local/Mana/Filters/Resource/Solr/Collection.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Filters
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Filters_Resource_Solr_Collection extends Enterprise_Search_Model_Resource_Collection {
13	+ /**
14	+ * Flag that defines if faceted data needs to be loaded
15	+ *
16	+ * @var bool
17	+ */
18	+ protected $_facetedDataIsLoaded = false;
19	+
20	+ /**
21	+ * Load faceted data if not loaded
22	+ *
23	+ * @return Enterprise_Search_Model_Resource_Collection
24	+ */
25	+ public function loadFacetedData($additionalParams = array()) {
26	+ if (empty($this->_facetedConditions)) {
27	+ $this->_facetedData = array();
28	+
29	+ return $this;
30	+ }
31	+
32	+ list($query, $params) = $this->_prepareBaseParams();
33	+ $params['solr_params']['facet'] = 'on';
34	+ $params['facet'] = $this->_facetedConditions;
35	+ $params = array_merge($params, $additionalParams);
36	+
37	+ $result = $this->_engine->getResultForRequest($query, $params);
38	+ $this->_facetedData = isset($result['faceted_data']) ? $result['faceted_data'] : $result['facets'];
39	+ $this->_facetedDataIsLoaded = true;
40	+
41	+ return $this;
42	+ }
43	+
44	+ /**
45	+ * Return field faceted data from faceted search result
46	+ *
47	+ * @param string $field
48	+ *
49	+ * @return array
50	+ */
51	+ public function getFacetedData($field, $additionalParams = array()) {
52	+ if (!$this->_facetedDataIsLoaded) {
53	+ $this->loadFacetedData($additionalParams);
54	+ }
55	+
56	+ if (isset($this->_facetedData[$field])) {
57	+ return $this->_facetedData[$field];
58	+ }
59	+
60	+ return array();
61	+ }
62	+ }

app/code/local/Mana/Filters/Resource/Solr/Engine.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Filters
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /**
9	+ * @author Mana Team
10	+ *
11	+ */
12	+ class Mana_Filters_Resource_Solr_Engine extends Enterprise_Search_Model_Resource_Engine {
13	+ /**
14	+ * Retrieve results for search request
15	+ *
16	+ * @param string $query
17	+ * @param array $params
18	+ * @param string $entityType 'product'\|'cms'
19	+ * @return array
20	+ */
21	+ public function getResultForRequest($query, $params = array(), $entityType = 'product') {
22	+ return $this->_adapter->search($query, $params);
23	+ }
24	+ }

app/code/local/Mana/Filters/Resource/Solr/Reverse/Attribute.php CHANGED Viewed

	@@ -19,8 +19,6 @@ class Mana_Filters_Resource_Solr_Reverse_Attribute extends Mana_Filters_Resource
19	*/
20	public function applyToCollection($collection, $model, $value)
21	{
22	- $~~engine~~ = ~~Mage::getResourceSingleton~~('~~enterprise_search/engine~~');
23	- $facetField = $engine->getSearchEngineFieldName($model->getAttributeModel(), 'nav');
24	- $collection->addFqFilter(array($facetField => array('reverse' => $value)));
25	}
26	}


19	*/
20	public function applyToCollection($collection, $model, $value)
21	{
22	+ $collection->addFqFilter(array($model->getFilterField() => array('reverse' => $value)));


23	}
24	}

app/code/local/Mana/Filters/etc/config.xml CHANGED Viewed

	@@ -12,7 +12,7 @@
12	<Mana_Filters>
13	<!-- This version number identifies version of database tables specific to this extension. It is written to
14	core_resource table. -->
15	- <version>12.12.21.19</version>
16	</Mana_Filters>
17	</modules>
18
	@@ -65,6 +65,12 @@
65	<adapter_phpExtension>Mana_Filters_Model_Solr_Adapter_PhpExtension</adapter_phpExtension>
66	</rewrite>
67	</enterprise_search>






68	<!-- BASED ON SNIPPET: Resources/Resource support (config.xml) -->
69	<!-- This says that string 'mana_filters' corresponds to Mana_Filters_Resource pseudo-namespace in
70	getResourceModel() calls. -->
	@@ -135,6 +141,16 @@
135	</mana_filters>
136	</observers>
137	</prepare_catalog_product_index_select>










138	</events>
139	<!-- INSERT HERE: blocks, models, ... -->
140	</global>
	@@ -221,7 +237,8 @@
221	<reverse_resource>mana_filters/filter_reverse_attribute</reverse_resource>
222	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
223	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
224	- </~~list~~>

225	<standard translate="title" module="mana_filters">
226	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
227	<block>mana_filters/filter</block>
	@@ -234,7 +251,8 @@
234	<reverse_resource>mana_filters/filter_reverse_attribute</reverse_resource>
235	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
236	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
237	- </~~standard~~>

238	</attribute>
239	<price> <!-- available display options for price filter -->
240	<!-- by default, filter items are displayed as HTML list -->
	@@ -248,7 +266,8 @@
248	<reverse_resource>mana_filters/filter_reverse_price</reverse_resource>
249	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
250	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
251	- </~~list~~>

252	<standard translate="title" module="mana_filters">
253	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
254	<block>mana_filters/filter</block>
	@@ -259,7 +278,8 @@
259	<reverse_resource>mana_filters/filter_reverse_price</reverse_resource>
260	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
261	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
262	- </~~standard~~>

263	</price>
264	<category> <!-- available display options for category filter -->
265	<!-- by default, filter items are displayed as HTML list -->
	@@ -270,7 +290,8 @@
270	<solr_model>mana_filters/solr_category</solr_model>
271	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
272	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
273	- </~~standard~~>

274	</category>
275	<decimal> <!-- available display options for decimal filters -->
276	<!-- by default, filter items are displayed as HTML list -->
	@@ -284,7 +305,8 @@
284	<reverse_resource>mana_filters/filter_reverse_decimal</reverse_resource>
285	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
286	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
287	- </~~list~~>

288	<standard translate="title" module="mana_filters">
289	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
290	<block>mana_filters/filter</block>
	@@ -295,7 +317,8 @@
295	<reverse_resource>mana_filters/filter_reverse_decimal</reverse_resource>
296	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
297	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
298	- </~~standard~~>

299	</decimal>
300	</display>
301


12	<Mana_Filters>
13	<!-- This version number identifies version of database tables specific to this extension. It is written to
14	core_resource table. -->
15	+ <version>13.10.14.16</version>
16	</Mana_Filters>
17	</modules>
18

65	<adapter_phpExtension>Mana_Filters_Model_Solr_Adapter_PhpExtension</adapter_phpExtension>
66	</rewrite>
67	</enterprise_search>
68	+ <enterprise_search_resource>
69	+ <rewrite>
70	+ <collection>Mana_Filters_Resource_Solr_Collection</collection>
71	+ <engine>Mana_Filters_Resource_Solr_Engine</engine>
72	+ </rewrite>
73	+ </enterprise_search_resource>
74	<!-- BASED ON SNIPPET: Resources/Resource support (config.xml) -->
75	<!-- This says that string 'mana_filters' corresponds to Mana_Filters_Resource pseudo-namespace in
76	getResourceModel() calls. -->

141	</mana_filters>
142	</observers>
143	</prepare_catalog_product_index_select>
144	+ <core_block_abstract_to_html_after><!-- this is event name this module listens for -->
145	+ <observers>
146	+ <mana_filters>
147	+ <class>mana_filters/observer</class>
148	+ <!-- model name of class containing event handler methods -->
149	+ <method>hideCmsContentOnFilteredPages</method>
150	+ <!-- event handler method name -->
151	+ </mana_filters>
152	+ </observers>
153	+ </core_block_abstract_to_html_after>
154	</events>
155	<!-- INSERT HERE: blocks, models, ... -->
156	</global>

237	<reverse_resource>mana_filters/filter_reverse_attribute</reverse_resource>
238	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
239	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
240	+ <popup_class>Mana/LayeredNavigation/Popup/List</popup_class>
241	+ </list>
242	<standard translate="title" module="mana_filters">
243	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
244	<block>mana_filters/filter</block>

251	<reverse_resource>mana_filters/filter_reverse_attribute</reverse_resource>
252	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
253	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
254	+ <popup_class>Mana/LayeredNavigation/Popup/Standard</popup_class>
255	+ </standard>
256	</attribute>
257	<price> <!-- available display options for price filter -->
258	<!-- by default, filter items are displayed as HTML list -->

266	<reverse_resource>mana_filters/filter_reverse_price</reverse_resource>
267	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
268	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
269	+ <popup_class>Mana/LayeredNavigation/Popup/List</popup_class>
270	+ </list>
271	<standard translate="title" module="mana_filters">
272	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
273	<block>mana_filters/filter</block>

278	<reverse_resource>mana_filters/filter_reverse_price</reverse_resource>
279	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
280	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
281	+ <popup_class>Mana/LayeredNavigation/Popup/Standard</popup_class>
282	+ </standard>
283	</price>
284	<category> <!-- available display options for category filter -->
285	<!-- by default, filter items are displayed as HTML list -->

290	<solr_model>mana_filters/solr_category</solr_model>
291	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
292	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
293	+ <popup_class>Mana/LayeredNavigation/Popup/Standard</popup_class>
294	+ </standard>
295	</category>
296	<decimal> <!-- available display options for decimal filters -->
297	<!-- by default, filter items are displayed as HTML list -->

305	<reverse_resource>mana_filters/filter_reverse_decimal</reverse_resource>
306	<template>mana/filters/items/list.phtml</template><!-- PHTML to be rendered -->
307	<sort_order>50</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
308	+ <popup_class>Mana/LayeredNavigation/Popup/List</popup_class>
309	+ </list>
310	<standard translate="title" module="mana_filters">
311	<title>Text (One Item Can Be Selected At A Time)</title><!-- this one is displayed in admin -->
312	<block>mana_filters/filter</block>

317	<reverse_resource>mana_filters/filter_reverse_decimal</reverse_resource>
318	<template>mana/filters/items/standard.phtml</template><!-- PHTML to be rendered -->
319	<sort_order>100</sort_order><!-- Position in "Display as" list. The item with least position is the default one. -->
320	+ <popup_class>Mana/LayeredNavigation/Popup/Standard</popup_class>
321	+ </standard>
322	</decimal>
323	</display>
324

app/code/local/Mana/Filters/sql/mana_filters_setup/mysql4-upgrade-13.09.11.14-13.09.23.17.php ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ <?php
2	+
3	+ /* BASED ON SNIPPET: Resources/Install/upgrade script */
4	+ if (defined('COMPILER_INCLUDE_PATH')) {
5	+ throw new Exception(Mage::helper('mana_core')->__('This Magento installation contains pending database installation/upgrade scripts. Please turn off Magento compilation feature while installing/upgrading new modules in Admin Panel menu System->Tools->Compilation.'));
6	+ }
7	+
8	+ /* @var $installer Mage_Core_Model_Resource_Setup */
9	+ $installer = $this;
10	+ if (method_exists($this->getConnection(), 'allowDdlCache')) {
11	+ $this->getConnection()->allowDdlCache();
12	+ }
13	+
14	+ foreach (array('mana_filters/filter2', 'mana_filters/filter2_store') as $table) {
15	+ $installer->run("
16	+ ALTER TABLE `{$this->getTable($table)}` ADD COLUMN (
17	+ `disable_no_result_options` tinyint NOT NULL default '1'
18	+ );
19	+ ");
20	+ }
21	+
22	+ if (method_exists($this->getConnection(), 'disallowDdlCache')) {
23	+ $this->getConnection()->disallowDdlCache();
24	+ }
25	+ $installer->endSetup();
26	+
27	+ if (!Mage::registry('m_run_db_replication')) {
28	+ Mage::register('m_run_db_replication', true);
29	+ }

app/design/adminhtml/default/default/layout/mana_core.xml CHANGED Viewed

	@@ -26,8 +26,11 @@ examples on what kind of actions can be applied to referenced blocks.
26	</default>
27	<jquery_core>
28	<reference name="head">
29	- ~~<action~~ ~~method="addJs"~~ ~~ifconfig="mana_dev/debug/jquery"><script>jquery/jquery.js</script></action>~~
30	- <action method="addJs" ~~ifconfig="mana_dev/debug/jquery_min"~~><script>jquery/~~jquery~~.~~min.~~js</script></action>



31	<action method="addJs"><script>jquery/jquery.printf.js</script></action>
32	<action method="addJs"><script>mana/core.js</script></action>
33	<action method="addCss"><stylesheet>css/mana_core.css</stylesheet></action>


26	</default>
27	<jquery_core>
28	<reference name="head">
29	+ <!-- BEGIN: files which are managed in System->Configuration->MANAdev->General->JavaScript Libraries -->
30	+ <!--<action method="addJs"><script>jquery/require.js</script></action>-->
31	+ <action method="addJs"><script>jquery/jquery.js</script></action>
32	+ <!-- END: files which are managed in System->Configuration->MANAdev->General->JavaScript Libraries -->
33	+
34	<action method="addJs"><script>jquery/jquery.printf.js</script></action>
35	<action method="addJs"><script>mana/core.js</script></action>
36	<action method="addCss"><stylesheet>css/mana_core.css</stylesheet></action>

app/design/adminhtml/default/default/template/mana/core/js.phtml CHANGED Viewed

	@@ -6,6 +6,10 @@
6	* @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	*/
8	/* @var $this Mana_Core_Block_Js */




9	?>
10	<script type="text/javascript">
11	//<![CDATA[
	@@ -17,5 +21,10 @@
17	$.options(<?php echo json_encode($_options) ?>);
18	<?php endif; ?>
19	})(jQuery);





20	//]]>
21	</script>


6	* @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	*/
8	/* @var $this Mana_Core_Block_Js */
9	+
10	+ /* @var $core Mana_Core_Helper_Data */
11	+ $core = Mage::helper('mana_core');
12	+
13	?>
14	<script type="text/javascript">
15	//<![CDATA[

21	$.options(<?php echo json_encode($_options) ?>);
22	<?php endif; ?>
23	})(jQuery);
24	+ <?php if ($_config = $this->getConfig()) : ?>
25	+ Mana.require(['singleton:Mana/Core/Config'], function(config) {
26	+ config.set(<?php echo $core->jsonForceObjectAndEncode($_config)?>);
27	+ });
28	+ <?php endif; ?>
29	//]]>
30	</script>

app/design/adminhtml/default/default/template/mana/core/require.phtml ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /* @var $this Mana_Core_Block_Require */
9	+ ?>
10	+ <script type="text/javascript">
11	+ var require = {
12	+ baseUrl: '<?php echo $this->getBaseRequireUrl() ?>'
13	+ };
14	+ </script>

app/design/frontend/base/default/layout/mana_core.xml CHANGED Viewed

	@@ -26,8 +26,11 @@ examples on what kind of actions can be applied to referenced blocks.
26	</default>
27	<jquery_core>
28	<reference name="head">
29	- ~~<action~~ ~~method="addJs"~~ ~~ifconfig="mana_dev/debug/jquery"><script>jquery/jquery.js</script></action>~~
30	- <action method="addJs" ~~ifconfig="mana_dev/debug/jquery_min"~~><script>jquery/~~jquery~~.~~min.~~js</script></action>



31	<action method="addJs"><script>jquery/jquery.printf.js</script></action>
32	<action method="addJs"><script>mana/core.js</script></action>
33	<action method="addCss"><stylesheet>css/mana_core.css</stylesheet></action>


26	</default>
27	<jquery_core>
28	<reference name="head">
29	+ <!-- BEGIN: files which are managed in System->Configuration->MANAdev->General->JavaScript Libraries -->
30	+ <!--<action method="addJs"><script>jquery/require.js</script></action>-->
31	+ <action method="addJs"><script>jquery/jquery.js</script></action>
32	+ <!-- END: files which are managed in System->Configuration->MANAdev->General->JavaScript Libraries -->
33	+
34	<action method="addJs"><script>jquery/jquery.printf.js</script></action>
35	<action method="addJs"><script>mana/core.js</script></action>
36	<action method="addCss"><stylesheet>css/mana_core.css</stylesheet></action>

app/design/frontend/base/default/template/mana/core/js.phtml CHANGED Viewed

	@@ -6,6 +6,10 @@
6	* @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	*/
8	/* @var $this Mana_Core_Block_Js */




9	?>
10	<script type="text/javascript">
11	//<![CDATA[
	@@ -16,6 +20,11 @@
16	<?php if ($_options = $this->getOptions()) : ?>
17	$.options(<?php echo json_encode($_options) ?>);
18	<?php endif; ?>





19	})(jQuery);
20	//]]>
21	</script>


6	* @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	*/
8	/* @var $this Mana_Core_Block_Js */
9	+
10	+ /* @var $core Mana_Core_Helper_Data */
11	+ $core = Mage::helper('mana_core');
12	+
13	?>
14	<script type="text/javascript">
15	//<![CDATA[

20	<?php if ($_options = $this->getOptions()) : ?>
21	$.options(<?php echo json_encode($_options) ?>);
22	<?php endif; ?>
23	+ <?php if ($_config = $this->getConfig()) : ?>
24	+ Mana.require(['singleton:Mana/Core/Config'], function (config) {
25	+ config.set(<?php echo $core->jsonForceObjectAndEncode($_config)?>);
26	+ });
27	+ <?php endif; ?>
28	})(jQuery);
29	//]]>
30	</script>

app/design/frontend/base/default/template/mana/core/require.phtml ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ <?php
2	+ /**
3	+ * @category Mana
4	+ * @package Mana_Core
5	+ * @copyright Copyright (c) http://www.manadev.com
6	+ * @license http://www.manadev.com/license Proprietary License
7	+ */
8	+ /* @var $this Mana_Core_Block_Require */
9	+ ?>
10	+ <script type="text/javascript">
11	+ var require = {
12	+ baseUrl: '<?php echo $this->getBaseRequireUrl() ?>'
13	+ };
14	+ </script>

app/design/frontend/base/default/template/mana/filters/cms.phtml CHANGED Viewed

@@ -5,5 +5,25 @@
              * @copyright   Copyright (c) http://www.manadev.com
              * @license     http://opensource.org/licenses/osl-3.0.php  Open Software License (OSL 3.0)
              */
             ?>
-            -
            <?php echo $this->getChildHtml('product_list') ?>


5	* @copyright Copyright (c) http://www.manadev.com
6	* @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
7	*/
8	+
9	+ /* @var $this Mage_Core_Block_Template */
10	+
11	+ /* @var $_core Mana_Core_Helper_Data */
12	+ $_core = Mage::helper('mana_core');
13	+
14	+ /* @var $core Mana_Filters_Helper_Data */
15	+ $_filters = Mage::helper('mana_filters');
16	+
17	+ $_hideWhenNoFiltersApplied =
18	+ ($this->hasData('hide_when_no_filters_applied')
19	+ ? $this->getData('hide_when_no_filters_applied')
20	+ : Mage::getStoreConfigFlag('mana_filters/display/hide_cms_product_list'));
21	+ $_isFilterApplied = ($state = $_filters->getLayer()->getState()) && $state->getFilters();
22	+ $_isProductListVisible = $_isFilterApplied \|\| !$_hideWhenNoFiltersApplied;
23	+
24	?>
25	+ <?php if ($_isProductListVisible) : ?>
26	+ <?php echo $this->getChildHtml('product_list') ?>
27	+ <?php else: ?>
28	+ <?php echo $_core->getEmptyBlockHtml($this->getChild('product_list')) ?>
29	+ <?php endif; ?>

app/design/frontend/base/default/template/mana/filters/items/list.phtml CHANGED Viewed

	@@ -19,11 +19,11 @@
19	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
20	<?php // MANA BEGIN ?>
21	<?php if ($_item->getMSelected()): ?>
22	- <span class="m-selected-filter-item"><?php echo $_item->getLabel() ?></span>
23	<?php else : ?>
24	- <?php if ($_item->getCount() > 0): ?>
25	- <a href="<?php echo $this->urlEscape($_item->getUrl()) ?>" title="<?php echo $_item->getLabel() ?>"><?php echo $_item->getLabel() ?></a>
26	- <?php else: echo $_item->getLabel() ?>
27	<?php endif; ?>
28	<?php endif; ?>
29	<?php // MANA END ?>


19	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
20	<?php // MANA BEGIN ?>
21	<?php if ($_item->getMSelected()): ?>
22	+ <span class="m-selected-filter-item"><?php echo $this->escapeHtml($_item->getLabel()) ?></span>
23	<?php else : ?>
24	+ <?php if (!$this->getFilterOptions()->getDisableNoResultOptions() \|\| $_item->getCount() > 0 \|\| $_item->getMSelected()): ?>
25	+ <a href="<?php echo $this->urlEscape($_item->getUrl()) ?>" title="<?php echo $this->escapeHtml($_item->getLabel()) ?>"><?php echo $this->escapeHtml($_item->getLabel()) ?></a>
26	+ <?php else: echo $this->escapeHtml($_item->getLabel()) ?>
27	<?php endif; ?>
28	<?php endif; ?>
29	<?php // MANA END ?>

app/design/frontend/base/default/template/mana/filters/items/list_popup.phtml CHANGED Viewed

	@@ -11,6 +11,8 @@
11	/* @var $this Mana_Filters_Block_Filter_Attribute */
12	/* @var $filters Mana_Filters_Helper_Data */ $filters = Mage::helper(strtolower('Mana_Filters'));
13	/* @var $showmore ManaPro_FilterShowMore_Helper_Data */ $showmore = Mage::helper(strtolower('ManaPro_FilterShowMore'));


14	$MAX_ROW_COUNT = $showmore->getMaxRowCount(); // 20
15	$MAX_COLUMN_COUNT = $showmore->getMaxColumnCount(); // 4
16	$items = $this->getItems();
	@@ -25,11 +27,13 @@ list($rowCount, $columnCount) = $showmore->getPopupDimensions($items, $MAX_ROW_C
25	<?php $_item = $items[$columnIndex * $rowCount + $rowIndex]; ?>
26	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
27	<?php //if ($_item->getCount() > 0): ?>
28	- <a href="#" title="<?php echo $_item->getLabel() ?>"
29	- ~~onClick~~="~~jQuery(this).parent().toggleClass('m-selected-ln-item'); jQuery(this).children().toggleClass('m-selected-filter-item'); return jQuery.mShowMorePopupSelect('~~<?php echo $~~_item~~->~~getSeoValue~~(~~) ?>', <?php echo~~ $~~this~~->~~getFilterOptions~~()~~->getIsReverse(~~) ~~? '!' : ''~~ ?> ~~jQuery(this).parent().hasClass('m-selected-ln-item'));~~">
30	- ~~<span <?php if ($_item->getMShowSelected()): ?>class="m~~-~~selected~~-~~filter-item~~"<?php ~~endif; ?> ><?php~~ echo $~~_item~~->~~getLabel~~() ~~?></span>~~


31	</a>
32	- <?php //else: echo $_item->getLabel(); ?>
33	<?php //endif; ?>
34	<?php if (Mage::getStoreConfigFlag('mana_filters/display/count')) : ?>
35	(<?php echo $_item->getCount() ?>)
	@@ -41,11 +45,9 @@ list($rowCount, $columnCount) = $showmore->getPopupDimensions($items, $MAX_ROW_C
41	<?php endfor; ?>
42	</ol>
43	<div class="buttons-set">
44	- <button type="button" title="<?php echo $this->__('Close') ?>" class="button"
45	- onclick="return jQuery.mClosePopup();">
46	<span><span><?php echo $this->__('Close') ?></span></span></button>
47	- <button type="button" title="<?php echo $this->__('Apply') ?>" class="button"
48	- onclick="return jQuery.mShowMorePopupApply();">
49	<span><span><?php echo $this->__('Apply') ?></span></span></button>
50	</div>
51	</div>


11	/* @var $this Mana_Filters_Block_Filter_Attribute */
12	/* @var $filters Mana_Filters_Helper_Data */ $filters = Mage::helper(strtolower('Mana_Filters'));
13	/* @var $showmore ManaPro_FilterShowMore_Helper_Data */ $showmore = Mage::helper(strtolower('ManaPro_FilterShowMore'));
14	+ /* @var $jsonHelper Mana_Core_Helper_Json */
15	+ $jsonHelper = Mage::helper('mana_core/json');
16	$MAX_ROW_COUNT = $showmore->getMaxRowCount(); // 20
17	$MAX_COLUMN_COUNT = $showmore->getMaxColumnCount(); // 4
18	$items = $this->getItems();

27	<?php $_item = $items[$columnIndex * $rowCount + $rowIndex]; ?>
28	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
29	<?php //if ($_item->getCount() > 0): ?>
30	+ <a href="#" title="<?php echo $this->escapeHtml($_item->getLabel()) ?>"
31	+ data-item="<?php echo $jsonHelper->encodeAttribute($_item->getSeoData()) ?>"
32	+ data-is-reverse="<?php echo $this->getFilterOptions()->getIsReverse() ?>"
33	+ data-index="<?php echo $columnIndex * $rowCount + $rowIndex ?>">
34	+ <span <?php if ($_item->getMShowSelected()): ?>class="m-selected-filter-item"<?php endif; ?> ><?php echo $this->escapeHtml($_item->getLabel()) ?></span>
35	</a>
36	+ <?php //else: echo $this->escapeHtml($_item->getLabel()); ?>
37	<?php //endif; ?>
38	<?php if (Mage::getStoreConfigFlag('mana_filters/display/count')) : ?>
39	(<?php echo $_item->getCount() ?>)

45	<?php endfor; ?>
46	</ol>
47	<div class="buttons-set">
48	+ <button type="button" title="<?php echo $this->__('Close') ?>" class="button m-close">

49	<span><span><?php echo $this->__('Close') ?></span></span></button>
50	+ <button type="button" title="<?php echo $this->__('Apply') ?>" class="button m-apply">

51	<span><span><?php echo $this->__('Apply') ?></span></span></button>
52	</div>
53	</div>

app/design/frontend/base/default/template/mana/filters/items/standard.phtml CHANGED Viewed

	@@ -19,11 +19,11 @@
19	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
20	<?php // MANA BEGIN ?>
21	<?php if ($_item->getMSelected()): ?>
22	- <span class="m-selected-filter-item"><?php echo $_item->getLabel() ?></span>
23	<?php else : ?>
24	- <?php if ($_item->getCount() > 0): ?>
25	- <a href="<?php echo $this->urlEscape($_item->getReplaceUrl()) ?>" title="<?php echo $_item->getLabel() ?>"><?php echo $_item->getLabel() ?></a>
26	- <?php else: echo $_item->getLabel() ?>
27	<?php endif; ?>
28	<?php endif; ?>
29	<?php // MANA END ?>


19	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
20	<?php // MANA BEGIN ?>
21	<?php if ($_item->getMSelected()): ?>
22	+ <span class="m-selected-filter-item"><?php echo $this->escapeHtml($_item->getLabel()) ?></span>
23	<?php else : ?>
24	+ <?php if (!$this->getFilterOptions()->getDisableNoResultOptions() \|\| $_item->getCount() > 0 \|\| $_item->getMSelected()): ?>
25	+ <a href="<?php echo $this->urlEscape($_item->getReplaceUrl()) ?>" title="<?php echo $this->escapeHtml($_item->getLabel()) ?>"><?php echo $this->escapeHtml($_item->getLabel()) ?></a>
26	+ <?php else: echo $this->escapeHtml($_item->getLabel()) ?>
27	<?php endif; ?>
28	<?php endif; ?>
29	<?php // MANA END ?>

app/design/frontend/base/default/template/mana/filters/items/standard_popup.phtml CHANGED Viewed

	@@ -11,6 +11,8 @@
11	/* @var $this Mana_Filters_Block_Filter_Attribute */
12	/* @var $filters Mana_Filters_Helper_Data */ $filters = Mage::helper(strtolower('Mana_Filters'));
13	/* @var $showmore ManaPro_FilterShowMore_Helper_Data */ $showmore = Mage::helper(strtolower('ManaPro_FilterShowMore'));


14	$MAX_ROW_COUNT = $showmore->getMaxRowCount(); // 20
15	$MAX_COLUMN_COUNT = $showmore->getMaxColumnCount(); // 4
16	$items = $this->getItems();
	@@ -25,12 +27,15 @@ list($rowCount, $columnCount) = $showmore->getPopupDimensions($items, $MAX_ROW_C
25	<?php $_item = $items[$columnIndex * $rowCount + $rowIndex]; ?>
26	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
27	<?php if ($_item->getMSelected()): ?>
28	- <span class="m-selected-filter-item"><?php echo $_item->getLabel() ?></span>
29	<?php else : ?>
30	- <?php if ($_item->getCount() > 0): ?>
31	- <a href="#" ~~onClick~~="~~return jQuery.mShowMorePopupApply('~~<?php echo $_item->~~getSeoValue~~() ?>~~');~~"
32	- ~~title~~="<?php echo $~~_item~~->~~getLabel~~(~~) ?>"><?php echo~~ $_item->~~getLabel~~() ~~?></a>~~
33	- <?php ~~else:~~ echo $~~_item~~->~~getLabel~~() ?>



34	<?php endif; ?>
35	<?php endif; ?>
36	<?php if (Mage::getStoreConfigFlag('mana_filters/display/count')) : ?>


11	/* @var $this Mana_Filters_Block_Filter_Attribute */
12	/* @var $filters Mana_Filters_Helper_Data */ $filters = Mage::helper(strtolower('Mana_Filters'));
13	/* @var $showmore ManaPro_FilterShowMore_Helper_Data */ $showmore = Mage::helper(strtolower('ManaPro_FilterShowMore'));
14	+ /* @var $jsonHelper Mana_Core_Helper_Json */
15	+ $jsonHelper = Mage::helper('mana_core/json');
16	$MAX_ROW_COUNT = $showmore->getMaxRowCount(); // 20
17	$MAX_COLUMN_COUNT = $showmore->getMaxColumnCount(); // 4
18	$items = $this->getItems();

27	<?php $_item = $items[$columnIndex * $rowCount + $rowIndex]; ?>
28	<li <?php if ($_item->getMShowSelected()): ?>class="m-selected-ln-item"<?php endif; ?>>
29	<?php if ($_item->getMSelected()): ?>
30	+ <span class="m-selected-filter-item"><?php echo $this->escapeHtml($_item->getLabel()) ?></span>
31	<?php else : ?>
32	+ <?php if (!$this->getFilterOptions()->getDisableNoResultOptions() \|\| $_item->getCount() > 0 \|\| $_item->getMSelected()): ?>
33	+ <a href="#" title="<?php echo $this->escapeHtml($_item->getLabel()) ?>"
34	+ data-item="<?php echo $jsonHelper->encodeAttribute($_item->getSeoData()) ?>"
35	+ data-is-reverse="<?php echo $this->getFilterOptions()->getIsReverse() ?>"
36	+ data-index="<?php echo $columnIndex * $rowCount + $rowIndex ?>">
37	+ <?php echo $this->escapeHtml($_item->getLabel()) ?></a>
38	+ <?php else: echo $this->escapeHtml($_item->getLabel()) ?>
39	<?php endif; ?>
40	<?php endif; ?>
41	<?php if (Mage::getStoreConfigFlag('mana_filters/display/count')) : ?>

app/design/frontend/base/default/template/mana/filters/state.phtml CHANGED Viewed

	@@ -12,6 +12,7 @@
12	*
13	* @see Mage_Catalog_Block_Layer_State
14	*/

15	?>
16	<?php $_filters = $this->getActiveFilters() ?>
17	<?php if(!empty($_filters)): ?>


12	*
13	* @see Mage_Catalog_Block_Layer_State
14	*/
15	+ /* @var $this Mage_Catalog_Block_Layer_State */
16	?>
17	<?php $_filters = $this->getActiveFilters() ?>
18	<?php if(!empty($_filters)): ?>

app/etc/modules/Mana_Core.xml CHANGED Viewed

	@@ -15,6 +15,12 @@
15	<active>true</active>
16	<!-- This instructs Magento to search for module code in app/code/local directory. -->
17	<codePool>local</codePool>






18	<!-- INSERT HERE: depends -->
19	</Mana_Core>
20	</modules>


15	<active>true</active>
16	<!-- This instructs Magento to search for module code in app/code/local directory. -->
17	<codePool>local</codePool>
18	+
19	+ <Enterprise_PageCache>
20	+ <depends>
21	+ <Mana_Core />
22	+ </depends>
23	+ </Enterprise_PageCache>
24	<!-- INSERT HERE: depends -->
25	</Mana_Core>
26	</modules>

app/locale/en_US/Mana_Core.csv CHANGED Viewed

@@ -17,3 +17,19 @@
             "Configure Mana Extensions","Configure Mana Extensions"
             "Please wait...","Please wait..."
             "Loading...","Loading..."


17	"Configure Mana Extensions","Configure Mana Extensions"
18	"Please wait...","Please wait..."
19	"Loading...","Loading..."
20	+ "General","General"
21	+ "MANAdev General Settings","MANAdev General Settings"
22	+ "JavaScript Libraries","JavaScript Libraries"
23	+
24	+ "jQuery (version 1.8.3)","jQuery (version 1.8.3)"
25	+
26	+ "Always runs in jQuery.noConflict() mode (slight modification) to prevent conflicts with Prototype JavaScript library used by Magento.","Always runs in jQuery.noConflict() mode (slight modification) to prevent conflicts with Prototype JavaScript library used by Magento."
27	+ "Load if required, minified version (recommended)","Load if required, minified version (recommended)"
28	+ "Load on all pages, minified version","Load on all pages, minified version"
29	+ "Load if required, full version with comments","Load if required, full version with comments"
30	+ "Load on all pages, full version with comments","Load on all pages, full version with comments"
31	+ "Do not load","Do not load"
32	+ "Take action as defined in theme layout XML files","Take action as defined in theme layout XML files"
33	+ "Use Default","Use Default"
34	+ "Advices, Warnings and Messages","Advices, Warnings and Messages"
35	+ "Global Configuration","Global Configuration"

app/locale/en_US/Mana_Db.csv CHANGED Viewed

@@ -9,6 +9,18 @@
             "Altering database keys currently not supported","Altering database keys currently not supported"
             "%s/%s/%s: %s parameter is required","%s/%s/%s: %s parameter is required"
             "Entities with circular dependencies found: %s","Entities with circular dependencies found: %s"
-            -
            "Default Values","Default Values"
             "Propagate default values throughout the system","Propagate default values throughout the system"
             "Use Default","Use Default"


9	"Altering database keys currently not supported","Altering database keys currently not supported"
10	"%s/%s/%s: %s parameter is required","%s/%s/%s: %s parameter is required"
11	"Entities with circular dependencies found: %s","Entities with circular dependencies found: %s"
12	+ "Default Values (MANAdev)","Default Values (MANAdev)"
13	"Propagate default values throughout the system","Propagate default values throughout the system"
14	"Use Default","Use Default"
15	+ "Setup version %s not found","Setup version %s not found"
16	+ "Entity Flat Data (MANAdev)","Entity Flat Data (MANAdev)"
17	+ "Reorganizes entity data to flat structure","Reorganizes entity data to flat structure"
18	+ "",""
19	+ "",""
20	+ "",""
21	+ "",""
22	+ "",""
23	+ "",""
24	+ "",""
25	+ "",""
26	+ "",""

app/locale/en_US/Mana_Filters.csv CHANGED Viewed

	@@ -10,7 +10,7 @@
10	"Can Store Customer Select Multiple Values","Can Store Customer Select Multiple Values"
11	"Code","Code"
12	"Name","Name"
13	- "Use ~~Product~~ ~~Attribute~~","Use ~~Product~~ ~~Attribute~~"
14	"Display Filter Items As","Display Filter Items As"
15	"Position (selected at the top)","Position (selected at the top)"
16	"Name","Name"
	@@ -21,4 +21,6 @@
21	"Logical AND","Logical AND"
22	"Reverse Mode","Reverse Mode"
23	"If enabled, shows all items as selected and lets user to deselect items he/she is not interested in","If enabled, shows all items as selected and lets user to deselect items he/she is not interested in"
24	- "not","not"


10	"Can Store Customer Select Multiple Values","Can Store Customer Select Multiple Values"
11	"Code","Code"
12	"Name","Name"
13	+ "Use Attribute Configuration","Use Attribute Configuration"
14	"Display Filter Items As","Display Filter Items As"
15	"Position (selected at the top)","Position (selected at the top)"
16	"Name","Name"

21	"Logical AND","Logical AND"
22	"Reverse Mode","Reverse Mode"
23	"If enabled, shows all items as selected and lets user to deselect items he/she is not interested in","If enabled, shows all items as selected and lets user to deselect items he/she is not interested in"
24	+ "not","not"
25	+ "Layered Navigation (MANAdev)","Layered Navigation (MANAdev)"
26	+ "Recalculates formula-based layered navigation settings","Recalculates formula-based layered navigation settings"

js/jquery/froogaloop.js ADDED Viewed

	@@ -0,0 +1,290 @@


1	+ ; // for better merging
2	+
3	+ // Init style shamelessly stolen from jQuery http://jquery.com
4	+ var Froogaloop = (function(){
5	+ // Define a local copy of Froogaloop
6	+ function Froogaloop(iframe) {
7	+ // The Froogaloop object is actually just the init constructor
8	+ return new Froogaloop.fn.init(iframe);
9	+ }
10	+
11	+ var eventCallbacks = {},
12	+ hasWindowEvent = false,
13	+ isReady = false,
14	+ slice = Array.prototype.slice,
15	+ playerDomain = '';
16	+
17	+ Froogaloop.fn = Froogaloop.prototype = {
18	+ element: null,
19	+
20	+ init: function(iframe) {
21	+ if (typeof iframe === "string") {
22	+ iframe = document.getElementById(iframe);
23	+ }
24	+
25	+ this.element = iframe;
26	+
27	+ // Register message event listeners
28	+ playerDomain = getDomainFromUrl(this.element.getAttribute('src'));
29	+
30	+ return this;
31	+ },
32	+
33	+ /*
34	+ * Calls a function to act upon the player.
35	+ *
36	+ * @param {string} method The name of the Javascript API method to call. Eg: 'play'.
37	+ * @param {Array\|Function} valueOrCallback params Array of parameters to pass when calling an API method
38	+ * or callback function when the method returns a value.
39	+ */
40	+ api: function(method, valueOrCallback) {
41	+ if (!this.element \|\| !method) {
42	+ return false;
43	+ }
44	+
45	+ var self = this,
46	+ element = self.element,
47	+ target_id = element.id !== '' ? element.id : null,
48	+ params = !isFunction(valueOrCallback) ? valueOrCallback : null,
49	+ callback = isFunction(valueOrCallback) ? valueOrCallback : null;
50	+
51	+ // Store the callback for get functions
52	+ if (callback) {
53	+ storeCallback(method, callback, target_id);
54	+ }
55	+
56	+ postMessage(method, params, element);
57	+ return self;
58	+ },
59	+
60	+ /*
61	+ * Registers an event listener and a callback function that gets called when the event fires.
62	+ *
63	+ * @param eventName (String): Name of the event to listen for.
64	+ * @param callback (Function): Function that should be called when the event fires.
65	+ */
66	+ addEvent: function(eventName, callback) {
67	+ if (!this.element) {
68	+ return false;
69	+ }
70	+
71	+ var self = this,
72	+ element = self.element,
73	+ target_id = element.id !== '' ? element.id : null;
74	+
75	+
76	+ storeCallback(eventName, callback, target_id);
77	+
78	+ // The ready event is not registered via postMessage. It fires regardless.
79	+ if (eventName != 'ready') {
80	+ postMessage('addEventListener', eventName, element);
81	+ }
82	+ else if (eventName == 'ready' && isReady) {
83	+ callback.call(null, target_id);
84	+ }
85	+
86	+ return self;
87	+ },
88	+
89	+ /*
90	+ * Unregisters an event listener that gets called when the event fires.
91	+ *
92	+ * @param eventName (String): Name of the event to stop listening for.
93	+ */
94	+ removeEvent: function(eventName) {
95	+ if (!this.element) {
96	+ return false;
97	+ }
98	+
99	+ var self = this,
100	+ element = self.element,
101	+ target_id = element.id !== '' ? element.id : null,
102	+ removed = removeCallback(eventName, target_id);
103	+
104	+ // The ready event is not registered
105	+ if (eventName != 'ready' && removed) {
106	+ postMessage('removeEventListener', eventName, element);
107	+ }
108	+ }
109	+ };
110	+
111	+ /**
112	+ * Handles posting a message to the parent window.
113	+ *
114	+ * @param method (String): name of the method to call inside the player. For api calls
115	+ * this is the name of the api method (api_play or api_pause) while for events this method
116	+ * is api_addEventListener.
117	+ * @param params (Object or Array): List of parameters to submit to the method. Can be either
118	+ * a single param or an array list of parameters.
119	+ * @param target (HTMLElement): Target iframe to post the message to.
120	+ */
121	+ function postMessage(method, params, target) {
122	+ if (!target.contentWindow.postMessage) {
123	+ return false;
124	+ }
125	+
126	+ var url = target.getAttribute('src').split('?')[0],
127	+ data = JSON.stringify({
128	+ method: method,
129	+ value: params
130	+ });
131	+
132	+ if (url.substr(0, 2) === '//') {
133	+ url = window.location.protocol + url;
134	+ }
135	+
136	+ target.contentWindow.postMessage(data, url);
137	+ }
138	+
139	+ /**
140	+ * Event that fires whenever the window receives a message from its parent
141	+ * via window.postMessage.
142	+ */
143	+ function onMessageReceived(event) {
144	+ var data, method;
145	+
146	+ try {
147	+ data = JSON.parse(event.data);
148	+ method = data.event \|\| data.method;
149	+ }
150	+ catch(e) {
151	+ //fail silently... like a ninja!
152	+ }
153	+
154	+ if (method == 'ready' && !isReady) {
155	+ isReady = true;
156	+ }
157	+
158	+ // Handles messages from moogaloop only
159	+ if (event.origin != playerDomain) {
160	+ return false;
161	+ }
162	+
163	+ var value = data.value,
164	+ eventData = data.data,
165	+ target_id = target_id === '' ? null : data.player_id,
166	+
167	+ callback = getCallback(method, target_id),
168	+ params = [];
169	+
170	+ if (!callback) {
171	+ return false;
172	+ }
173	+
174	+ if (value !== undefined) {
175	+ params.push(value);
176	+ }
177	+
178	+ if (eventData) {
179	+ params.push(eventData);
180	+ }
181	+
182	+ if (target_id) {
183	+ params.push(target_id);
184	+ }
185	+
186	+ return params.length > 0 ? callback.apply(null, params) : callback.call();
187	+ }
188	+
189	+
190	+ /**
191	+ * Stores submitted callbacks for each iframe being tracked and each
192	+ * event for that iframe.
193	+ *
194	+ * @param eventName (String): Name of the event. Eg. api_onPlay
195	+ * @param callback (Function): Function that should get executed when the
196	+ * event is fired.
197	+ * @param target_id (String) [Optional]: If handling more than one iframe then
198	+ * it stores the different callbacks for different iframes based on the iframe's
199	+ * id.
200	+ */
201	+ function storeCallback(eventName, callback, target_id) {
202	+ if (target_id) {
203	+ if (!eventCallbacks[target_id]) {
204	+ eventCallbacks[target_id] = {};
205	+ }
206	+ eventCallbacks[target_id][eventName] = callback;
207	+ }
208	+ else {
209	+ eventCallbacks[eventName] = callback;
210	+ }
211	+ }
212	+
213	+ /**
214	+ * Retrieves stored callbacks.
215	+ */
216	+ function getCallback(eventName, target_id) {
217	+ if (target_id) {
218	+ return eventCallbacks[target_id][eventName];
219	+ }
220	+ else {
221	+ return eventCallbacks[eventName];
222	+ }
223	+ }
224	+
225	+ function removeCallback(eventName, target_id) {
226	+ if (target_id && eventCallbacks[target_id]) {
227	+ if (!eventCallbacks[target_id][eventName]) {
228	+ return false;
229	+ }
230	+ eventCallbacks[target_id][eventName] = null;
231	+ }
232	+ else {
233	+ if (!eventCallbacks[eventName]) {
234	+ return false;
235	+ }
236	+ eventCallbacks[eventName] = null;
237	+ }
238	+
239	+ return true;
240	+ }
241	+
242	+ /**
243	+ * Returns a domain's root domain.
244	+ * Eg. returns http://vimeo.com when http://vimeo.com/channels is sbumitted
245	+ *
246	+ * @param url (String): Url to test against.
247	+ * @return url (String): Root domain of submitted url
248	+ */
249	+ function getDomainFromUrl(url) {
250	+ if (url.substr(0, 2) === '//') {
251	+ url = window.location.protocol + url;
252	+ }
253	+
254	+ var url_pieces = url.split('/'),
255	+ domain_str = '';
256	+
257	+ for(var i = 0, length = url_pieces.length; i < length; i++) {
258	+ if(i<3) {domain_str += url_pieces[i];}
259	+ else {break;}
260	+ if(i<2) {domain_str += '/';}
261	+ }
262	+
263	+ return domain_str;
264	+ }
265	+
266	+ function isFunction(obj) {
267	+ return !!(obj && obj.constructor && obj.call && obj.apply);
268	+ }
269	+
270	+ function isArray(obj) {
271	+ return toString.call(obj) === '[object Array]';
272	+ }
273	+
274	+ // Give the init function the Froogaloop prototype for later instantiation
275	+ Froogaloop.fn.init.prototype = Froogaloop.fn;
276	+
277	+ // Listens for the message event.
278	+ // W3C
279	+ if (window.addEventListener) {
280	+ window.addEventListener('message', onMessageReceived, false);
281	+ }
282	+ // IE
283	+ else {
284	+ window.attachEvent('onmessage', onMessageReceived);
285	+ }
286	+
287	+ // Expose froogaloop to the global object
288	+ return (window.Froogaloop = window.$f = Froogaloop);
289	+
290	+ })();

js/jquery/froogaloop.min.js ADDED Viewed

	@@ -0,0 +1,5 @@


1	+ ; // for better merging
2	+ var Froogaloop=function(){function e(a){return new e.fn.init(a)}function h(a,c,b){if(!b.contentWindow.postMessage)return!1;var f=b.getAttribute("src").split("?")[0],a=JSON.stringify({method:a,value:c});"//"===f.substr(0,2)&&(f=window.location.protocol+f);b.contentWindow.postMessage(a,f)}function j(a){var c,b;try{c=JSON.parse(a.data),b=c.event\|\|c.method}catch(f){}"ready"==b&&!i&&(i=!0);if(a.origin!=k)return!1;var a=c.value,e=c.data,g=""===g?null:c.player_id;c=g?d[g][b]:d[b];b=[];if(!c)return!1;void 0!==
3	+ a&&b.push(a);e&&b.push(e);g&&b.push(g);return 0<b.length?c.apply(null,b):c.call()}function l(a,c,b){b?(d[b]\|\|(d[b]={}),d[b][a]=c):d[a]=c}var d={},i=!1,k="";e.fn=e.prototype={element:null,init:function(a){"string"===typeof a&&(a=document.getElementById(a));this.element=a;a=this.element.getAttribute("src");"//"===a.substr(0,2)&&(a=window.location.protocol+a);for(var a=a.split("/"),c="",b=0,f=a.length;b<f;b++){if(3>b)c+=a[b];else break;2>b&&(c+="/")}k=c;return this},api:function(a,c){if(!this.element\|\|
4	+ !a)return!1;var b=this.element,f=""!==b.id?b.id:null,d=!c\|\|!c.constructor\|\|!c.call\|\|!c.apply?c:null,e=c&&c.constructor&&c.call&&c.apply?c:null;e&&l(a,e,f);h(a,d,b);return this},addEvent:function(a,c){if(!this.element)return!1;var b=this.element,d=""!==b.id?b.id:null;l(a,c,d);"ready"!=a?h("addEventListener",a,b):"ready"==a&&i&&c.call(null,d);return this},removeEvent:function(a){if(!this.element)return!1;var c=this.element,b;a:{if((b=""!==c.id?c.id:null)&&d[b]){if(!d[b][a]){b=!1;break a}d[b][a]=null}else{if(!d[a]){b=
5	+ !1;break a}d[a]=null}b=!0}"ready"!=a&&b&&h("removeEventListener",a,c)}};e.fn.init.prototype=e.fn;window.addEventListener?window.addEventListener("message",j,!1):window.attachEvent("onmessage",j);return window.Froogaloop=window.$f=e}();

js/jquery/history.js CHANGED Viewed

	@@ -1026,15 +1026,20 @@
1026	var result = str;
1027
1028	// Unescape hash
1029	- var tmp;
1030	- ~~while~~ ( ~~true~~ ) {
1031	- tmp = window.unescape(result);
1032	if ( tmp === result ) {

1033	break;
1034	}
1035	result = tmp;
1036	}
1037




1038	// Return result
1039	return result;
1040	};


1026	var result = str;
1027
1028	// Unescape hash
1029	+ var tmp, success = false;
1030	+ for (var i = 0; i < 3; i++) {
1031	+ tmp = window.unescape(encodeURIComponent(result));
1032	if ( tmp === result ) {
1033	+ success = true;
1034	break;
1035	}
1036	result = tmp;
1037	}
1038
1039	+ if (!success) {
1040	+ throw 'History.unescapeString(): unable to unescape ' + str;
1041	+ }
1042	+
1043	// Return result
1044	return result;
1045	};

js/jquery/jquery-1.7.2.min.js DELETED Viewed

@@ -1,6 +0,0 @@
-            -
            /*! jQuery v1.7.2 jquery.com | jquery.org/license */
-            -
            (function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cu(a){if(!cj[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),b.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write((f.support.boxModel?"<!doctype html>":"")+"<html><body>"),cl.close();d=cl.createElement(a),cl.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ck)}cj[a]=e}return cj[a]}function ct(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function cs(){cq=b}function cr(){setTimeout(cs,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bD.test(a)?d(a,e):b_(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&f.type(b)==="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function bZ(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bS,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bZ(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bZ(a,c,d,e,"*",g));return l}function bY(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bO),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bB(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?1:0,g=4;if(d>0){if(c!=="border")for(;e<g;e+=2)c||(d-=parseFloat(f.css(a,"padding"+bx[e]))||0),c==="margin"?d+=parseFloat(f.css(a,c+bx[e]))||0:d-=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0;return d+"px"}d=by(a,b);if(d<0||d==null)d=a.style[b];if(bt.test(d))return d;d=parseFloat(d)||0;if(c)for(;e<g;e+=2)d+=parseFloat(f.css(a,"padding"+bx[e]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+bx[e]))||0);return d+"px"}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;b.nodeType===1&&(b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase(),c==="object"?b.outerHTML=a.outerHTML:c!=="input"||a.type!=="checkbox"&&a.type!=="radio"?c==="option"?b.selected=a.defaultSelected:c==="input"||c==="textarea"?b.defaultValue=a.defaultValue:c==="script"&&b.text!==a.text&&(b.text=a.text):(a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value)),b.removeAttribute(f.expando),b.removeAttribute("_submit_attached"),b.removeAttribute("_change_attached"))}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c,i[c][d])}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?+d:j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){if(typeof c!="string"||!c)return null;var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h,i){var j,k=d==null,l=0,m=a.length;if(d&&typeof d=="object"){for(l in d)e.access(a,c,l,d[l],1,h,f);g=1}else if(f!==b){j=i===b&&e.isFunction(f),k&&(j?(j=c,c=function(a,b,c){return j.call(e(a),c)}):(c.call(a,f),c=null));if(c)for(;l<m;l++)c(a[l],d,j?f.call(a[l],l,c(a[l],d)):f,i);g=1}return g?a:k?c.call(a):m?c(a[0],d):h},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m,n=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?n(g):h==="function"&&(!a.unique||!p.has(g))&&c.push(g)},o=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,j=!0,m=k||0,k=0,l=c.length;for(;c&&m<l;m++)if(c[m].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}j=!1,c&&(a.once?e===!0?p.disable():c=[]:d&&d.length&&(e=d.shift(),p.fireWith(e[0],e[1])))},p={add:function(){if(c){var a=c.length;n(arguments),j?l=c.length:e&&e!==!0&&(k=a,o(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){j&&f<=l&&(l--,f<=m&&m--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&p.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(j?a.once||d.push([b,c]):(!a.once||!e)&&o(b,c));return this},fire:function(){p.fireWith(this,arguments);return this},fired:function(){return!!i}};return p};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p=c.createElement("div"),q=c.documentElement;p.setAttribute("className","t"),p.innerHTML="   <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=p.getElementsByTagName("*"),e=p.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=p.getElementsByTagName("input")[0],b={leadingWhitespace:p.firstChild.nodeType===3,tbody:!p.getElementsByTagName("tbody").length,htmlSerialize:!!p.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:p.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,pixelMargin:!0},f.boxModel=b.boxModel=c.compatMode==="CSS1Compat",i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete p.test}catch(r){b.deleteExpando=!1}!p.addEventListener&&p.attachEvent&&p.fireEvent&&(p.attachEvent("onclick",function(){b.noCloneEvent=!1}),p.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),i.setAttribute("name","t"),p.appendChild(i),j=c.createDocumentFragment(),j.appendChild(p.lastChild),b.checkClone=j.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,j.removeChild(i),j.appendChild(p);if(p.attachEvent)for(n in{submit:1,change:1,focusin:1})m="on"+n,o=m in p,o||(p.setAttribute(m,"return;"),o=typeof p[m]=="function"),b[n+"Bubbles"]=o;j.removeChild(p),j=g=h=p=i=null,f(function(){var d,e,g,h,i,j,l,m,n,q,r,s,t,u=c.getElementsByTagName("body")[0];!u||(m=1,t="padding:0;margin:0;border:",r="position:absolute;top:0;left:0;width:1px;height:1px;",s=t+"0;visibility:hidden;",n="style='"+r+t+"5px solid #000;",q="<div "+n+"display:block;'><div style='"+t+"0;display:block;overflow:hidden;'></div></div>"+"<table "+n+"' cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",d=c.createElement("div"),d.style.cssText=s+"width:0;height:0;position:static;top:0;margin-top:"+m+"px",u.insertBefore(d,u.firstChild),p=c.createElement("div"),d.appendChild(p),p.innerHTML="<table><tr><td style='"+t+"0;display:none'></td><td>t</td></tr></table>",k=p.getElementsByTagName("td"),o=k[0].offsetHeight===0,k[0].style.display="",k[1].style.display="none",b.reliableHiddenOffsets=o&&k[0].offsetHeight===0,a.getComputedStyle&&(p.innerHTML="",l=c.createElement("div"),l.style.width="0",l.style.marginRight="0",p.style.width="2px",p.appendChild(l),b.reliableMarginRight=(parseInt((a.getComputedStyle(l,null)||{marginRight:0}).marginRight,10)||0)===0),typeof p.style.zoom!="undefined"&&(p.innerHTML="",p.style.width=p.style.padding="1px",p.style.border=0,p.style.overflow="hidden",p.style.display="inline",p.style.zoom=1,b.inlineBlockNeedsLayout=p.offsetWidth===3,p.style.display="block",p.style.overflow="visible",p.innerHTML="<div style='width:5px;'></div>",b.shrinkWrapBlocks=p.offsetWidth!==3),p.style.cssText=r+s,p.innerHTML=q,e=p.firstChild,g=e.firstChild,i=e.nextSibling.firstChild.firstChild,j={doesNotAddBorder:g.offsetTop!==5,doesAddBorderForTableAndCells:i.offsetTop===5},g.style.position="fixed",g.style.top="20px",j.fixedPosition=g.offsetTop===20||g.offsetTop===15,g.style.position=g.style.top="",e.style.overflow="hidden",e.style.position="relative",j.subtractsBorderForOverflowNotVisible=g.offsetTop===-5,j.doesNotIncludeMarginInBodyOffset=u.offsetTop!==m,a.getComputedStyle&&(p.style.marginTop="1%",b.pixelMargin=(a.getComputedStyle(p,null)||{marginTop:0}).marginTop!=="1%"),typeof d.style.zoom!="undefined"&&(d.style.zoom=1),u.removeChild(d),l=p=d=null,f.extend(b,j))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h,i,j=this[0],k=0,m=null;if(a===b){if(this.length){m=f.data(j);if(j.nodeType===1&&!f._data(j,"parsedAttrs")){g=j.attributes;for(i=g.length;k<i;k++)h=g[k].name,h.indexOf("data-")===0&&(h=f.camelCase(h.substring(5)),l(j,h,m[h]));f._data(j,"parsedAttrs",!0)}}return m}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split(".",2),d[1]=d[1]?"."+d[1]:"",e=d[1]+"!";return f.access(this,function(c){if(c===b){m=this.triggerHandler("getData"+e,[d[0]]),m===b&&j&&(m=f.data(j,a),m=l(j,a,m));return m===b&&d[1]?this.data(d[0]):m}d[1]=c,this.each(function(){var b=f(this);b.triggerHandler("setData"+e,d),f.data(this,a,c),b.triggerHandler("changeData"+e,d)})},null,c,arguments.length>1,null,!1)},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){var d=2;typeof a!="string"&&(c=a,a="fx",d--);if(arguments.length<d)return f.queue(this[0],a);return c===b?this:this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise(c)}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,f.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,f.prop,a,b,arguments.length>1)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.type]||f.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.type]||f.valHooks[g.nodeName.toLowerCase()];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h,i=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;i<g;i++)e=d[i],e&&(c=f.propFix[e]||e,h=u.test(e),h||f.attr(a,e,""),a.removeAttribute(v?e:c),h&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0,coords:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/(?:^|\s)hover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(
-            -
            a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")};f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler,g=p.selector),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:g&&G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=f.event.special[c.type]||{},j=[],k,l,m,n,o,p,q,r,s,t,u;g[0]=c,c.delegateTarget=this;if(!i.preDispatch||i.preDispatch.call(this,c)!==!1){if(e&&(!c.button||c.type!=="click")){n=f(this),n.context=this.ownerDocument||this;for(m=c.target;m!=this;m=m.parentNode||this)if(m.disabled!==!0){p={},r=[],n[0]=m;for(k=0;k<e;k++)s=d[k],t=s.selector,p[t]===b&&(p[t]=s.quick?H(m,s.quick):n.is(t)),p[t]&&r.push(s);r.length&&j.push({elem:m,matches:r})}}d.length>e&&j.push({elem:this,matches:d.slice(e)});for(k=0;k<j.length&&!c.isPropagationStopped();k++){q=j[k],c.currentTarget=q.elem;for(l=0;l<q.matches.length&&!c.isImmediatePropagationStopped();l++){s=q.matches[l];if(h||!c.namespace&&!s.namespace||c.namespace_re&&c.namespace_re.test(s.namespace))c.data=s.data,c.handleObj=s,o=((f.event.special[s.origType]||{}).handle||s.handler).apply(q.elem,g),o!==b&&(c.result=o,o===!1&&(c.preventDefault(),c.stopPropagation()))}}i.postDispatch&&i.postDispatch.call(this,c);return c.result}},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){a._submit_bubble=!0}),d._submit_attached=!0)})},postDispatch:function(a){a._submit_bubble&&(delete a._submit_bubble,this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0))},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=d||c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.origType+"."+e.namespace:e.origType,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9||d===11){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));o.match.globalPOS=p;var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.globalPOS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")[\\s/>]","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){return f.access(this,function(a){return a===b?f.text(this):this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f
-            -
            .clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){return f.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(;d<e;d++)c=this[d]||{},c.nodeType===1&&(f.cleanData(c.getElementsByTagName("*")),c.innerHTML=a);c=0}catch(g){}}c&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,function(a,b){b.src?f.ajax({type:"GET",global:!1,url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)})}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||f.isXMLDoc(a)||!bc.test("<"+a.nodeName+">")?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g,h,i,j=[];b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);for(var k=0,l;(l=a[k])!=null;k++){typeof l=="number"&&(l+="");if(!l)continue;if(typeof l=="string")if(!_.test(l))l=b.createTextNode(l);else{l=l.replace(Y,"<$1></$2>");var m=(Z.exec(l)||["",""])[1].toLowerCase(),n=bg[m]||bg._default,o=n[0],p=b.createElement("div"),q=bh.childNodes,r;b===c?bh.appendChild(p):U(b).appendChild(p),p.innerHTML=n[1]+l+n[2];while(o--)p=p.lastChild;if(!f.support.tbody){var s=$.test(l),t=m==="table"&&!s?p.firstChild&&p.firstChild.childNodes:n[1]==="<table>"&&!s?p.childNodes:[];for(i=t.length-1;i>=0;--i)f.nodeName(t[i],"tbody")&&!t[i].childNodes.length&&t[i].parentNode.removeChild(t[i])}!f.support.leadingWhitespace&&X.test(l)&&p.insertBefore(b.createTextNode(X.exec(l)[0]),p.firstChild),l=p.childNodes,p&&(p.parentNode.removeChild(p),q.length>0&&(r=q[q.length-1],r&&r.parentNode&&r.parentNode.removeChild(r)))}var u;if(!f.support.appendChecked)if(l[0]&&typeof (u=l.length)=="number")for(i=0;i<u;i++)bn(l[i]);else bn(l);l.nodeType?j.push(l):j=f.merge(j,l)}if(d){g=function(a){return!a.type||be.test(a.type)};for(k=0;j[k];k++){h=j[k];if(e&&f.nodeName(h,"script")&&(!h.type||be.test(h.type)))e.push(h.parentNode?h.parentNode.removeChild(h):h);else{if(h.nodeType===1){var v=f.grep(h.getElementsByTagName("script"),g);j.splice.apply(j,[k+1,0].concat(v))}d.appendChild(h)}}}return j},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bp=/alpha\([^)]*\)/i,bq=/opacity=([^)]*)/,br=/([A-Z]|^ms)/g,bs=/^[\-+]?(?:\d*\.)?\d+$/i,bt=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,bu=/^([\-+])=([\-+.\de]+)/,bv=/^margin/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Top","Right","Bottom","Left"],by,bz,bA;f.fn.css=function(a,c){return f.access(this,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)},a,c,arguments.length>1)},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=by(a,"opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bu.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(by)return by(a,c)},swap:function(a,b,c){var d={},e,f;for(f in b)d[f]=a.style[f],a.style[f]=b[f];e=c.call(a);for(f in b)a.style[f]=d[f];return e}}),f.curCSS=f.css,c.defaultView&&c.defaultView.getComputedStyle&&(bz=function(a,b){var c,d,e,g,h=a.style;b=b.replace(br,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b))),!f.support.pixelMargin&&e&&bv.test(b)&&bt.test(c)&&(g=h.width,h.width=c,c=e.width,h.width=g);return c}),c.documentElement.currentStyle&&(bA=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f==null&&g&&(e=g[b])&&(f=e),bt.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),by=bz||bA,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth!==0?bB(a,b,d):f.swap(a,bw,function(){return bB(a,b,d)})},set:function(a,b){return bs.test(b)?b+"px":b}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bq.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bp,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bp.test(g)?g.replace(bp,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){return f.swap(a,{display:"inline-block"},function(){return b?by(a,"margin-right"):a.style.marginRight})}})}),f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)}),f.each({margin:"",padding:"",border:"Width"},function(a,b){f.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bx[d]+b]=e[d]||e[d-2]||e[0];return f}}});var bC=/%20/g,bD=/\[\]$/,bE=/\r?\n/g,bF=/#.*$/,bG=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bH=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bI=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bJ=/^(?:GET|HEAD)$/,bK=/^\/\//,bL=/\?/,bM=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bN=/^(?:select|textarea)/i,bO=/\s+/,bP=/([?&])_=[^&]*/,bQ=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bR=f.fn.load,bS={},bT={},bU,bV,bW=["*/"]+["*"];try{bU=e.href}catch(bX){bU=c.createElement("a"),bU.href="",bU=bU.href}bV=bQ.exec(bU.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bR)return bR.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bM,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bN.test(this.nodeName)||bH.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bE,"\r\n")}}):{name:b.name,value:c.replace(bE,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b$(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b$(a,b);return a},ajaxSettings:{url:bU,isLocal:bI.test(bV[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bY(bS),ajaxTransport:bY(bT),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?ca(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cb(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bG.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bF,"").replace(bK,bV[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bO),d.crossDomain==null&&(r=bQ.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bV[1]&&r[2]==bV[2]&&(r[3]||(r[1]==="http:"?80:443))==(bV[3]||(bV[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bZ(bS,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bJ.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bL.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bP,"$1_="+x);d.url=y+(y===d.url?(bL.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bW+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bZ(bT,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bC,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=typeof b.data=="string"&&/^application\/x\-www\-form\-urlencoded/.test(b.contentType);if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n);try{m.text=h.responseText}catch(a){}try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(ct("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),(e===""&&f.css(d,"display")==="none"||!f.contains(d.ownerDocument.documentElement,d))&&f._data(d,"olddisplay",cu(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(ct("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(ct("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o,p,q;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]);if((k=f.cssHooks[g])&&"expand"in k){l=k.expand(a[g]),delete a[g];for(i in l)i in a||(a[i]=l[i])}}for(g in a){h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cu(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cm.test(h)?(q=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),q?(f._data(this,"toggle"+i,q==="show"?"hide":"show"),j[q]()):j[h]()):(m=cn.exec(h),n=j.cur(),m?(o=parseFloat(m[2]),p=m[3]||(f.cssNumber[i]?"":"px"),p!=="px"&&(f.style(this,i,(o||1)+p),n=(o||1)/j.cur()*n,f.style(this,i,n+p)),m[1]&&(o=(m[1]==="-="?-1:1)*o+n),j.custom(n,o,p)):j.custom(n,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:ct("show",1),slideUp:ct("hide",1),slideToggle:ct("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a){return a},swing:function(a){return-Math.cos(a*Math.PI)/2+.5}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cq||cr(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){f._data(e.elem,"fxshow"+e.prop)===b&&(e.options.hide?f._data(e.elem,"fxshow"+e.prop,e.start):e.options.show&&f._data(e.elem,"fxshow"+e.prop,e.end))},h()&&f.timers.push(h)&&!co&&(co=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cq||cr(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(cp.concat.apply([],cp),function(a,b){b.indexOf("margin")&&(f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)})}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cv,cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?cv=function(a,b,c,d){try{d=a.getBoundingClientRect()}catch(e){}if(!d||!f.contains(c,a))return d?{top:d.top,left:d.left}:{top:0,left:0};var g=b.body,h=cy(b),i=c.clientTop||g.clientTop||0,j=c.clientLeft||g.clientLeft||0,k=h.pageYOffset||f.support.boxModel&&c.scrollTop||g.scrollTop,l=h.pageXOffset||f.support.boxModel&&c.scrollLeft||g.scrollLeft,m=d.top+k-i,n=d.left+l-j;return{top:m,left:n}}:cv=function(a,b,c){var d,e=a.offsetParent,g=a,h=b.body,i=b.defaultView,j=i?i.getComputedStyle(a,null):a.currentStyle,k=a.offsetTop,l=a.offsetLeft;while((a=a.parentNode)&&a!==h&&a!==c){if(f.support.fixedPosition&&j.position==="fixed")break;d=i?i.getComputedStyle(a,null):a.currentStyle,k-=a.scrollTop,l-=a.scrollLeft,a===e&&(k+=a.offsetTop,l+=a.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(a.nodeName))&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),g=e,e=a.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),j=d}if(j.position==="relative"||j.position==="static")k+=h.offsetTop,l+=h.offsetLeft;f.support.fixedPosition&&j.position==="fixed"&&(k+=Math.max(c.scrollTop,h.scrollTop),l+=Math.max(c.scrollLeft,h.scrollLeft));return{top:k,left:l}},f.fn.offset=function(a){if(arguments.length)return a===b?this:this.each(function(b){f.offset.setOffset(this,a,b)});var c=this[0],d=c&&c.ownerDocument;if(!d)return null;if(c===d.body)return f.offset.bodyOffset(c);return cv(c,d,d.documentElement)},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);f.fn[a]=function(e){return f.access(this,function(a,e,g){var h=cy(a);if(g===b)return h?c in h?h[c]:f.support.boxModel&&h.document.documentElement[e]||h.document.body[e]:a[e];h?h.scrollTo(d?f(h).scrollLeft():g,d?g:f(h).scrollTop()):a[e]=g},a,e,arguments.length,null)}}),f.each({Height:"height",Width:"width"},function(a,c){var d="client"+a,e="scroll"+a,g="offset"+a;f.fn["inner"+a]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,c,"padding")):this[c]():null},f.fn["outer"+a]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,c,a?"margin":"border")):this[c]():null},f.fn[c]=function(a){return f.access(this,function(a,c,h){var i,j,k,l;if(f.isWindow(a)){i=a.document,j=i.documentElement[d];return f.support.boxModel&&j||i.body&&i.body[d]||j}if(a.nodeType===9){i=a.documentElement;if(i[d]>=i[e])return i[d];return Math.max(a.body[e],i[e],a.body[g],i[g])}if(h===b){k=f.css(a,c),l=parseFloat(k);return f.isNumeric(l)?l:k}f(a).css(c,h)},c,a,arguments.length,null)}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
-            -
-            -
            jQuery.noConflict();

js/jquery/jquery-ui.js CHANGED Viewed

@@ -1,43 +1,28 @@
-            -
            /*!
-            -
             * jQuery UI 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI
-            -
             */
-            -
            ;(function( $, undefined ) {
-            -
            // prevent duplicate loading
-            -
            // this is only a problem because we proxy existing functions
-            -
            // and we don't want to double proxy them
             $.ui = $.ui || {};
-            -
            if ( $.ui.version ) {
-            -
            	return;
-            -
            }
             $.extend( $.ui, {
-            -
            	version: "1.8.17",
             	keyCode: {
-            -
            		ALT: 18,
             		BACKSPACE: 8,
-            -
            		CAPS_LOCK: 20,
             		COMMA: 188,
-            -
            		COMMAND: 91,
-            -
            		COMMAND_LEFT: 91, // COMMAND
-            -
            		COMMAND_RIGHT: 93,
-            -
            		CONTROL: 17,
             		DELETE: 46,
             		DOWN: 40,
             		END: 35,
             		ENTER: 13,
             		ESCAPE: 27,
             		HOME: 36,
-            -
            		INSERT: 45,
             		LEFT: 37,
-            -
            		MENU: 93, // COMMAND_RIGHT
             		NUMPAD_ADD: 107,
             		NUMPAD_DECIMAL: 110,
             		NUMPAD_DIVIDE: 111,
@@ -48,46 +33,43 @@ $.extend( $.ui, {
             		PAGE_UP: 33,
             		PERIOD: 190,
             		RIGHT: 39,
-            -
            		SHIFT: 16,
             		SPACE: 32,
             		TAB: 9,
-            -
            		UP: 38,
-            -
            		WINDOWS: 91 // COMMAND
+            	}
             });
             // plugins
             $.fn.extend({
-            -
            	propAttr: $.fn.prop || $.fn.attr,
-            -
-            -
            	_focus: $.fn.focus,
-            -
            	focus: function( delay, fn ) {
-            -
            		return typeof delay === "number" ?
-            -
            			this.each(function() {
-            -
            				var elem = this;
-            -
            				setTimeout(function() {
-            -
            					$( elem ).focus();
-            -
            					if ( fn ) {
-            -
            						fn.call( elem );
-            -
            					}
-            -
            				}, delay );
-            -
            			}) :
-            -
            			this._focus.apply( this, arguments );
-            -
            	},
             	scrollParent: function() {
             		var scrollParent;
-            -
            		if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
             			scrollParent = this.parents().filter(function() {
-            -
            				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
             			}).eq(0);
             		} else {
             			scrollParent = this.parents().filter(function() {
-            -
            				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
             			}).eq(0);
+            		}
-            -
            		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
             	},
             	zIndex: function( zIndex ) {
@@ -119,95 +101,63 @@ $.fn.extend({
             		return 0;
             	},
-            -
            	disableSelection: function() {
-            -
            		return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
-            -
            			".ui-disableSelection", function( event ) {
-            -
            				event.preventDefault();
-            -
            			});
-            -
            	},
-            -
-            -
            	enableSelection: function() {
-            -
            		return this.unbind( ".ui-disableSelection" );
-            -
            	}
-            -
            });
-            -
-            -
            $.each( [ "Width", "Height" ], function( i, name ) {
-            -
            	var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
-            -
            		type = name.toLowerCase(),
-            -
            		orig = {
-            -
            			innerWidth: $.fn.innerWidth,
-            -
            			innerHeight: $.fn.innerHeight,
-            -
            			outerWidth: $.fn.outerWidth,
-            -
            			outerHeight: $.fn.outerHeight
-            -
            		};
-            -
-            -
            	function reduce( elem, size, border, margin ) {
-            -
            		$.each( side, function() {
-            -
            			size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
-            -
            			if ( border ) {
-            -
            				size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
-            -
            			}
-            -
            			if ( margin ) {
-            -
            				size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
-            -
            			}
-            -
            		});
-            -
            		return size;
-            -
            	}
-            -
-            -
            	$.fn[ "inner" + name ] = function( size ) {
-            -
            		if ( size === undefined ) {
-            -
            			return orig[ "inner" + name ].call( this );
-            -
            		}
-            -
             		return this.each(function() {
-            -
            			$( this ).css( type, reduce( this, size ) + "px" );
             		});
-            -
            	};
-            -
-            -
            	$.fn[ "outer" + name] = function( size, margin ) {
-            -
            		if ( typeof size !== "number" ) {
-            -
            			return orig[ "outer" + name ].call( this, size );
-            -
            		}
             		return this.each(function() {
-            -
            			$( this).css( type, reduce( this, size, true, margin ) + "px" );
             		});
-            -
            	};
             });
             // selectors
             function focusable( element, isTabIndexNotNaN ) {
-            -
            	var nodeName = element.nodeName.toLowerCase();
             	if ( "area" === nodeName ) {
-            -
            		var map = element.parentNode,
-            -
            			mapName = map.name,
-            -
            			img;
             		if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
             			return false;
+            		}
             		img = $( "img[usemap=#" + mapName + "]" )[0];
             		return !!img && visible( img );
+            	}
-            -
            	return ( /input|select|textarea|button|object/.test( nodeName )
-            -
            		? !element.disabled
-            -
            		: "a" == nodeName
-            -
            			? element.href || isTabIndexNotNaN
-            -
            			: isTabIndexNotNaN)
             		// the element and all of its ancestors must be visible
-            -
            		&& visible( element );
+            }
             function visible( element ) {
-            -
            	return !$( element ).parents().andSelf().filter(function() {
-            -
            		return $.curCSS( this, "visibility" ) === "hidden" ||
-            -
            			$.expr.filters.hidden( this );
-            -
            	}).length;
+            }
             $.extend( $.expr[ ":" ], {
-            -
            	data: function( elem, i, match ) {
-            -
            		return !!$.data( elem, match[ 3 ] );
-            -
            	},
             	focusable: function( element ) {
             		return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
@@ -220,77 +170,137 @@ $.extend( $.expr[ ":" ], {
+            	}
             });
-            -
            // support
-            -
            $(function() {
-            -
            	var body = document.body,
-            -
            		div = body.appendChild( div = document.createElement( "div" ) );
-            -
            	$.extend( div.style, {
-            -
            		minHeight: "100px",
-            -
            		height: "auto",
-            -
            		padding: 0,
-            -
            		borderWidth: 0
             	});
-            -
            	$.support.minHeight = div.offsetHeight === 100;
-            -
            	$.support.selectstart = "onselectstart" in div;
-            -
            	// set display to none to avoid a layout bug in IE
-            -
            	// http://dev.jquery.com/ticket/4014
-            -
            	body.removeChild( div ).style.display = "none";
-            -
            });
             // deprecated
             $.extend( $.ui, {
             	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
             	plugin: {
             		add: function( module, option, set ) {
-            -
            			var proto = $.ui[ module ].prototype;
-            -
            			for ( var i in set ) {
             				proto.plugins[ i ] = proto.plugins[ i ] || [];
             				proto.plugins[ i ].push( [ option, set[ i ] ] );
+            			}
             		},
             		call: function( instance, name, args ) {
-            -
            			var set = instance.plugins[ name ];
-            -
            			if ( !set || !instance.element[ 0 ].parentNode ) {
             				return;
+            			}
-            -
-            -
            			for ( var i = 0; i < set.length; i++ ) {
             				if ( instance.options[ set[ i ][ 0 ] ] ) {
             					set[ i ][ 1 ].apply( instance.element, args );
+            				}
+            			}
+            		}
             	},
-            -
-            -
            	// will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
-            -
            	contains: function( a, b ) {
-            -
            		return document.compareDocumentPosition ?
-            -
            			a.compareDocumentPosition( b ) & 16 :
-            -
            			a !== b && a.contains( b );
-            -
            	},
-            -
             	// only used by resizable
             	hasScroll: function( el, a ) {
-            -
             		//If overflow is hidden, the element might have extra content, but the user wants to hide it
             		if ( $( el ).css( "overflow" ) === "hidden") {
             			return false;
+            		}
-            -
             		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
             			has = false;
-            -
             		if ( el[ scroll ] > 0 ) {
             			return true;
+            		}
-            -
             		// TODO: determine which cases actually cause this to happen
             		// if the element doesn't have the scroll set, see if it's possible to
             		// set the scroll
@@ -298,65 +308,33 @@ $.extend( $.ui, {
             		has = ( el[ scroll ] > 0 );
             		el[ scroll ] = 0;
             		return has;
-            -
            	},
-            -
-            -
            	// these are odd functions, fix the API or move into individual plugins
-            -
            	isOverAxis: function( x, reference, size ) {
-            -
            		//Determines when x coordinate is over "b" element axis
-            -
            		return ( x > reference ) && ( x < ( reference + size ) );
-            -
            	},
-            -
            	isOver: function( y, x, top, left, height, width ) {
-            -
            		//Determines when x, y coordinates is over "b" element
-            -
            		return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+            	}
             });
             })( jQuery );
-            -
            /*!
-            -
             * jQuery UI Widget 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Widget
-            -
             */
             (function( $, undefined ) {
-            -
            // jQuery 1.4+
-            -
            if ( $.cleanData ) {
-            -
            	var _cleanData = $.cleanData;
-            -
            	$.cleanData = function( elems ) {
-            -
            		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-            -
            			try {
-            -
            				$( elem ).triggerHandler( "remove" );
-            -
            			// http://bugs.jquery.com/ticket/8235
-            -
            			} catch( e ) {}
-            -
            		}
-            -
            		_cleanData( elems );
-            -
            	};
-            -
            } else {
-            -
            	var _remove = $.fn.remove;
-            -
            	$.fn.remove = function( selector, keepData ) {
-            -
            		return this.each(function() {
-            -
            			if ( !keepData ) {
-            -
            				if ( !selector || $.filter( selector, [ this ] ).length ) {
-            -
            					$( "*", this ).add( [ this ] ).each(function() {
-            -
            						try {
-            -
            							$( this ).triggerHandler( "remove" );
-            -
            						// http://bugs.jquery.com/ticket/8235
-            -
            						} catch( e ) {}
-            -
            					});
-            -
            				}
-            -
            			}
-            -
            			return _remove.call( $(this), selector, keepData );
-            -
            		});
-            -
            	};
-            -
            }
             $.widget = function( name, base, prototype ) {
-            -
            	var namespace = name.split( "." )[ 0 ],
-            -
            		fullName;
             	name = name.split( "." )[ 1 ];
             	fullName = namespace + "-" + name;
@@ -366,81 +344,167 @@ $.widget = function( name, base, prototype ) {
+            	}
             	// create selector for plugin
-            -
            	$.expr[ ":" ][ fullName ] = function( elem ) {
-            -
            		return !!$.data( elem, name );
             	};
             	$[ namespace ] = $[ namespace ] || {};
-            -
            	$[ namespace ][ name ] = function( options, element ) {
             		// allow instantiation without initializing for simple inheritance
             		if ( arguments.length ) {
             			this._createWidget( options, element );
+            		}
             	};
-            -
            	var basePrototype = new base();
             	// we need to make the options hash a property directly on the new instance
             	// otherwise we'll modify the options hash on the prototype that we're
             	// inheriting from
-            -
            //	$.each( basePrototype, function( key, val ) {
-            -
            //		if ( $.isPlainObject(val) ) {
-            -
            //			basePrototype[ key ] = $.extend( {}, val );
-            -
            //		}
-            -
            //	});
-            -
            	basePrototype.options = $.extend( true, {}, basePrototype.options );
-            -
            	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
             		namespace: namespace,
             		widgetName: name,
-            -
            		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
-            -
            		widgetBaseClass: fullName
-            -
            	}, prototype );
-            -
            	$.widget.bridge( name, $[ namespace ][ name ] );
             };
             $.widget.bridge = function( name, object ) {
             	$.fn[ name ] = function( options ) {
             		var isMethodCall = typeof options === "string",
-            -
            			args = Array.prototype.slice.call( arguments, 1 ),
             			returnValue = this;
             		// allow multiple hashes to be passed on init
             		options = !isMethodCall && args.length ?
-            -
            			$.extend.apply( null, [ true, options ].concat(args) ) :
             			options;
-            -
            		// prevent calls to internal methods
-            -
            		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
-            -
            			return returnValue;
-            -
            		}
-            -
             		if ( isMethodCall ) {
             			this.each(function() {
-            -
            				var instance = $.data( this, name ),
-            -
            					methodValue = instance && $.isFunction( instance[options] ) ?
-            -
            						instance[ options ].apply( instance, args ) :
-            -
            						instance;
-            -
            				// TODO: add this back in 1.9 and use $.error() (see #5972)
-            -
            //				if ( !instance ) {
-            -
            //					throw "cannot call methods on " + name + " prior to initialization; " +
-            -
            //						"attempted to call method '" + options + "'";
-            -
            //				}
-            -
            //				if ( !$.isFunction( instance[options] ) ) {
-            -
            //					throw "no such method '" + options + "' for " + name + " widget instance";
-            -
            //				}
-            -
            //				var methodValue = instance[ options ].apply( instance, args );
             				if ( methodValue !== instance && methodValue !== undefined ) {
-            -
            					returnValue = methodValue;
             					return false;
+            				}
             			});
             		} else {
             			this.each(function() {
-            -
            				var instance = $.data( this, name );
             				if ( instance ) {
             					instance.option( options || {} )._init();
             				} else {
-            -
            					$.data( this, name, new object( options, this ) );
+            				}
             			});
+            		}
@@ -449,74 +513,123 @@ $.widget.bridge = function( name, object ) {
             	};
             };
-            -
            $.Widget = function( options, element ) {
-            -
            	// allow instantiation without initializing for simple inheritance
-            -
            	if ( arguments.length ) {
-            -
            		this._createWidget( options, element );
-            -
            	}
-            -
            };
             $.Widget.prototype = {
             	widgetName: "widget",
             	widgetEventPrefix: "",
             	options: {
-            -
            		disabled: false
             	},
             	_createWidget: function( options, element ) {
-            -
            		// $.widget.bridge stores the plugin instance, but we do it anyway
-            -
            		// so that it's stored even before the _create function runs
-            -
            		$.data( element, this.widgetName, this );
             		this.element = $( element );
-            -
            		this.options = $.extend( true, {},
             			this.options,
             			this._getCreateOptions(),
             			options );
-            -
            		var self = this;
-            -
            		this.element.bind( "remove." + this.widgetName, function() {
-            -
            			self.destroy();
-            -
            		});
             		this._create();
-            -
            		this._trigger( "create" );
             		this._init();
             	},
-            -
            	_getCreateOptions: function() {
-            -
            		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
-            -
            	},
-            -
            	_create: function() {},
-            -
            	_init: function() {},
             	destroy: function() {
             		this.element
-            -
            			.unbind( "." + this.widgetName )
-            -
            			.removeData( this.widgetName );
             		this.widget()
-            -
            			.unbind( "." + this.widgetName )
             			.removeAttr( "aria-disabled" )
             			.removeClass(
-            -
            				this.widgetBaseClass + "-disabled " +
             				"ui-state-disabled" );
             	},
             	widget: function() {
             		return this.element;
             	},
             	option: function( key, value ) {
-            -
            		var options = key;
             		if ( arguments.length === 0 ) {
             			// don't return a reference to the internal hash
-            -
            			return $.extend( {}, this.options );
+            		}
-            -
            		if  (typeof key === "string" ) {
-            -
            			if ( value === undefined ) {
-            -
            				return this.options[ key ];
-            -
            			}
             			options = {};
-            -
            			options[ key ] = value;
+            		}
             		this._setOptions( options );
@@ -524,10 +637,11 @@ $.Widget.prototype = {
             		return this;
             	},
             	_setOptions: function( options ) {
-            -
            		var self = this;
-            -
            		$.each( options, function( key, value ) {
-            -
            			self._setOption( key, value );
-            -
            		});
             		return this;
             	},
@@ -536,10 +650,10 @@ $.Widget.prototype = {
             		if ( key === "disabled" ) {
             			this.widget()
-            -
            				[ value ? "addClass" : "removeClass"](
-            -
            					this.widgetBaseClass + "-disabled" + " " +
-            -
            					"ui-state-disabled" )
             				.attr( "aria-disabled", value );
+            		}
             		return this;
@@ -552,6 +666,97 @@ $.Widget.prototype = {
             		return this._setOption( "disabled", true );
             	},
             	_trigger: function( type, event, data ) {
             		var prop, orig,
             			callback = this.options[ type ];
@@ -576,49 +781,74 @@ $.Widget.prototype = {
+            		}
             		this.element.trigger( event, data );
-            -
-            -
            		return !( $.isFunction(callback) &&
-            -
            			callback.call( this.element[0], event, data ) === false ||
             			event.isDefaultPrevented() );
+            	}
             };
             })( jQuery );
-            -
            /*!
-            -
             * jQuery UI Mouse 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Mouse
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.widget.js
-            -
             */
             (function( $, undefined ) {
             var mouseHandled = false;
-            -
            $( document ).mouseup( function( e ) {
             	mouseHandled = false;
             });
             $.widget("ui.mouse", {
             	options: {
-            -
            		cancel: ':input,option',
             		distance: 1,
             		delay: 0
             	},
             	_mouseInit: function() {
-            -
            		var self = this;
             		this.element
-            -
            			.bind('mousedown.'+this.widgetName, function(event) {
-            -
            				return self._mouseDown(event);
             			})
-            -
            			.bind('click.'+this.widgetName, function(event) {
-            -
            				if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
-            -
            				    $.removeData(event.target, self.widgetName + '.preventClickEvent');
             					event.stopImmediatePropagation();
             					return false;
+            				}
@@ -630,23 +860,28 @@ $.widget("ui.mouse", {
             	// TODO: make sure destroying one instance of mouse doesn't mess with
             	// other instances of mouse
             	_mouseDestroy: function() {
-            -
            		this.element.unbind('.'+this.widgetName);
             	},
             	_mouseDown: function(event) {
             		// don't let more than one widget handle mouseStart
-            -
            		if( mouseHandled ) { return };
             		// we may have missed mouseup (out of window)
             		(this._mouseStarted && this._mouseUp(event));
             		this._mouseDownEvent = event;
-            -
            		var self = this,
-            -
            			btnIsLeft = (event.which == 1),
             			// event.target.nodeName works around a bug in IE 8 with
             			// disabled inputs (#7620)
-            -
            			elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
             		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
             			return true;
+            		}
@@ -654,7 +889,7 @@ $.widget("ui.mouse", {
             		this.mouseDelayMet = !this.options.delay;
             		if (!this.mouseDelayMet) {
             			this._mouseDelayTimer = setTimeout(function() {
-            -
            				self.mouseDelayMet = true;
             			}, this.options.delay);
+            		}
@@ -667,30 +902,30 @@ $.widget("ui.mouse", {
+            		}
             		// Click event may never have fired (Gecko & Opera)
-            -
            		if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
-            -
            			$.removeData(event.target, this.widgetName + '.preventClickEvent');
+            		}
             		// these delegates are required to keep context
             		this._mouseMoveDelegate = function(event) {
-            -
            			return self._mouseMove(event);
             		};
             		this._mouseUpDelegate = function(event) {
-            -
            			return self._mouseUp(event);
             		};
             		$(document)
-            -
            			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-            -
            			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
             		event.preventDefault();
-            -
             		mouseHandled = true;
             		return true;
             	},
             	_mouseMove: function(event) {
             		// IE mouseup check - mouseup happened when mouse was out of window
-            -
            		if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
             			return this._mouseUp(event);
+            		}
@@ -710,14 +945,14 @@ $.widget("ui.mouse", {
             	_mouseUp: function(event) {
             		$(document)
-            -
            			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-            -
            			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
             		if (this._mouseStarted) {
             			this._mouseStarted = false;
-            -
            			if (event.target == this._mouseDownEvent.target) {
-            -
            			    $.data(event.target, this.widgetName + '.preventClickEvent', true);
+            			}
             			this._mouseStop(event);
@@ -734,383 +969,74 @@ $.widget("ui.mouse", {
             		);
             	},
-            -
            	_mouseDelayMet: function(event) {
             		return this.mouseDelayMet;
             	},
             	// These are placeholder methods, to be overriden by extending plugin
-            -
            	_mouseStart: function(event) {},
-            -
            	_mouseDrag: function(event) {},
-            -
            	_mouseStop: function(event) {},
-            -
            	_mouseCapture: function(event) { return true; }
             });
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Position 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Position
-            -
             */
             (function( $, undefined ) {
-            -
            $.ui = $.ui || {};
-            -
            var horizontalPositions = /left|center|right/,
-            -
            	verticalPositions = /top|center|bottom/,
-            -
            	center = "center",
-            -
            	support = {},
-            -
            	_position = $.fn.position,
-            -
            	_offset = $.fn.offset;
-            -
            $.fn.position = function( options ) {
-            -
            	if ( !options || !options.of ) {
-            -
            		return _position.apply( this, arguments );
-            -
            	}
-            -
-            -
            	// make a copy, we don't want to modify arguments
-            -
            	options = $.extend( {}, options );
-            -
-            -
            	var target = $( options.of ),
-            -
            		targetElem = target[0],
-            -
            		collision = ( options.collision || "flip" ).split( " " ),
-            -
            		offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
-            -
            		targetWidth,
-            -
            		targetHeight,
-            -
            		basePosition;
-            -
-            -
            	if ( targetElem.nodeType === 9 ) {
-            -
            		targetWidth = target.width();
-            -
            		targetHeight = target.height();
-            -
            		basePosition = { top: 0, left: 0 };
-            -
            	// TODO: use $.isWindow() in 1.9
-            -
            	} else if ( targetElem.setTimeout ) {
-            -
            		targetWidth = target.width();
-            -
            		targetHeight = target.height();
-            -
            		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
-            -
            	} else if ( targetElem.preventDefault ) {
-            -
            		// force left top to allow flipping
-            -
            		options.at = "left top";
-            -
            		targetWidth = targetHeight = 0;
-            -
            		basePosition = { top: options.of.pageY, left: options.of.pageX };
-            -
            	} else {
-            -
            		targetWidth = target.outerWidth();
-            -
            		targetHeight = target.outerHeight();
-            -
            		basePosition = target.offset();
-            -
            	}
-            -
-            -
            	// force my and at to have valid horizontal and veritcal positions
-            -
            	// if a value is missing or invalid, it will be converted to center
-            -
            	$.each( [ "my", "at" ], function() {
-            -
            		var pos = ( options[this] || "" ).split( " " );
-            -
            		if ( pos.length === 1) {
-            -
            			pos = horizontalPositions.test( pos[0] ) ?
-            -
            				pos.concat( [center] ) :
-            -
            				verticalPositions.test( pos[0] ) ?
-            -
            					[ center ].concat( pos ) :
-            -
            					[ center, center ];
-            -
            		}
-            -
            		pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
-            -
            		pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
-            -
            		options[ this ] = pos;
-            -
            	});
-            -
-            -
            	// normalize collision option
-            -
            	if ( collision.length === 1 ) {
-            -
            		collision[ 1 ] = collision[ 0 ];
-            -
            	}
-            -
-            -
            	// normalize offset option
-            -
            	offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
-            -
            	if ( offset.length === 1 ) {
-            -
            		offset[ 1 ] = offset[ 0 ];
-            -
            	}
-            -
            	offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
-            -
-            -
            	if ( options.at[0] === "right" ) {
-            -
            		basePosition.left += targetWidth;
-            -
            	} else if ( options.at[0] === center ) {
-            -
            		basePosition.left += targetWidth / 2;
-            -
            	}
-            -
-            -
            	if ( options.at[1] === "bottom" ) {
-            -
            		basePosition.top += targetHeight;
-            -
            	} else if ( options.at[1] === center ) {
-            -
            		basePosition.top += targetHeight / 2;
-            -
            	}
-            -
-            -
            	basePosition.left += offset[ 0 ];
-            -
            	basePosition.top += offset[ 1 ];
-            -
-            -
            	return this.each(function() {
-            -
            		var elem = $( this ),
-            -
            			elemWidth = elem.outerWidth(),
-            -
            			elemHeight = elem.outerHeight(),
-            -
            			marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
-            -
            			marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
-            -
            			collisionWidth = elemWidth + marginLeft +
-            -
            				( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
-            -
            			collisionHeight = elemHeight + marginTop +
-            -
            				( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
-            -
            			position = $.extend( {}, basePosition ),
-            -
            			collisionPosition;
-            -
-            -
            		if ( options.my[0] === "right" ) {
-            -
            			position.left -= elemWidth;
-            -
            		} else if ( options.my[0] === center ) {
-            -
            			position.left -= elemWidth / 2;
-            -
            		}
-            -
-            -
            		if ( options.my[1] === "bottom" ) {
-            -
            			position.top -= elemHeight;
-            -
            		} else if ( options.my[1] === center ) {
-            -
            			position.top -= elemHeight / 2;
-            -
            		}
-            -
-            -
            		// prevent fractions if jQuery version doesn't support them (see #5280)
-            -
            		if ( !support.fractions ) {
-            -
            			position.left = Math.round( position.left );
-            -
            			position.top = Math.round( position.top );
-            -
            		}
-            -
-            -
            		collisionPosition = {
-            -
            			left: position.left - marginLeft,
-            -
            			top: position.top - marginTop
-            -
            		};
-            -
-            -
            		$.each( [ "left", "top" ], function( i, dir ) {
-            -
            			if ( $.ui.position[ collision[i] ] ) {
-            -
            				$.ui.position[ collision[i] ][ dir ]( position, {
-            -
            					targetWidth: targetWidth,
-            -
            					targetHeight: targetHeight,
-            -
            					elemWidth: elemWidth,
-            -
            					elemHeight: elemHeight,
-            -
            					collisionPosition: collisionPosition,
-            -
            					collisionWidth: collisionWidth,
-            -
            					collisionHeight: collisionHeight,
-            -
            					offset: offset,
-            -
            					my: options.my,
-            -
            					at: options.at
-            -
            				});
-            -
            			}
-            -
            		});
-            -
-            -
            		if ( $.fn.bgiframe ) {
-            -
            			elem.bgiframe();
-            -
            		}
-            -
            		elem.offset( $.extend( position, { using: options.using } ) );
-            -
            	});
-            -
            };
-            -
-            -
            $.ui.position = {
-            -
            	fit: {
-            -
            		left: function( position, data ) {
-            -
            			var win = $( window ),
-            -
            				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
-            -
            			position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
-            -
            		},
-            -
            		top: function( position, data ) {
-            -
            			var win = $( window ),
-            -
            				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
-            -
            			position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
-            -
            		}
-            -
            	},
-            -
-            -
            	flip: {
-            -
            		left: function( position, data ) {
-            -
            			if ( data.at[0] === center ) {
-            -
            				return;
-            -
            			}
-            -
            			var win = $( window ),
-            -
            				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
-            -
            				myOffset = data.my[ 0 ] === "left" ?
-            -
            					-data.elemWidth :
-            -
            					data.my[ 0 ] === "right" ?
-            -
            						data.elemWidth :
-            -
            						0,
-            -
            				atOffset = data.at[ 0 ] === "left" ?
-            -
            					data.targetWidth :
-            -
            					-data.targetWidth,
-            -
            				offset = -2 * data.offset[ 0 ];
-            -
            			position.left += data.collisionPosition.left < 0 ?
-            -
            				myOffset + atOffset + offset :
-            -
            				over > 0 ?
-            -
            					myOffset + atOffset + offset :
-            -
            					0;
-            -
            		},
-            -
            		top: function( position, data ) {
-            -
            			if ( data.at[1] === center ) {
-            -
            				return;
-            -
            			}
-            -
            			var win = $( window ),
-            -
            				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
-            -
            				myOffset = data.my[ 1 ] === "top" ?
-            -
            					-data.elemHeight :
-            -
            					data.my[ 1 ] === "bottom" ?
-            -
            						data.elemHeight :
-            -
            						0,
-            -
            				atOffset = data.at[ 1 ] === "top" ?
-            -
            					data.targetHeight :
-            -
            					-data.targetHeight,
-            -
            				offset = -2 * data.offset[ 1 ];
-            -
            			position.top += data.collisionPosition.top < 0 ?
-            -
            				myOffset + atOffset + offset :
-            -
            				over > 0 ?
-            -
            					myOffset + atOffset + offset :
-            -
            					0;
+            		}
-            -
            	}
-            -
            };
-            -
-            -
            // offset setter from jQuery 1.4
-            -
            if ( !$.offset.setOffset ) {
-            -
            	$.offset.setOffset = function( elem, options ) {
-            -
            		// set position first, in-case top/left are set even on static elem
-            -
            		if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
-            -
            			elem.style.position = "relative";
-            -
            		}
-            -
            		var curElem   = $( elem ),
-            -
            			curOffset = curElem.offset(),
-            -
            			curTop    = parseInt( $.curCSS( elem, "top",  true ), 10 ) || 0,
-            -
            			curLeft   = parseInt( $.curCSS( elem, "left", true ), 10)  || 0,
-            -
            			props     = {
-            -
            				top:  (options.top  - curOffset.top)  + curTop,
-            -
            				left: (options.left - curOffset.left) + curLeft
-            -
            			};
-            -
-            -
            		if ( 'using' in options ) {
-            -
            			options.using.call( elem, props );
-            -
            		} else {
-            -
            			curElem.css( props );
+            		}
-            -
            	};
-            -
-            -
            	$.fn.offset = function( options ) {
-            -
            		var elem = this[ 0 ];
-            -
            		if ( !elem || !elem.ownerDocument ) { return null; }
-            -
            		if ( options ) {
-            -
            			return this.each(function() {
-            -
            				$.offset.setOffset( this, options );
-            -
            			});
+            		}
-            -
            		return _offset.call( this );
-            -
            	};
-            -
            }
-            -
-            -
            // fraction support test (older versions of jQuery don't support fractions)
-            -
            (function () {
-            -
            	var body = document.getElementsByTagName( "body" )[ 0 ],
-            -
            		div = document.createElement( "div" ),
-            -
            		testElement, testElementParent, testElementStyle, offset, offsetTotal;
-            -
-            -
            	//Create a "fake body" for testing based on method used in jQuery.support
-            -
            	testElement = document.createElement( body ? "div" : "body" );
-            -
            	testElementStyle = {
-            -
            		visibility: "hidden",
-            -
            		width: 0,
-            -
            		height: 0,
-            -
            		border: 0,
-            -
            		margin: 0,
-            -
            		background: "none"
-            -
            	};
-            -
            	if ( body ) {
-            -
            		jQuery.extend( testElementStyle, {
-            -
            			position: "absolute",
-            -
            			left: "-1000px",
-            -
            			top: "-1000px"
-            -
            		});
-            -
            	}
-            -
            	for ( var i in testElementStyle ) {
-            -
            		testElement.style[ i ] = testElementStyle[ i ];
-            -
            	}
-            -
            	testElement.appendChild( div );
-            -
            	testElementParent = body || document.documentElement;
-            -
            	testElementParent.insertBefore( testElement, testElementParent.firstChild );
-            -
-            -
            	div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;";
-            -
-            -
            	offset = $( div ).offset( function( _, offset ) {
-            -
            		return offset;
-            -
            	}).offset();
-            -
-            -
            	testElement.innerHTML = "";
-            -
            	testElementParent.removeChild( testElement );
-            -
-            -
            	offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 );
-            -
            	support.fractions = offsetTotal > 21 && offsetTotal < 22;
-            -
            })();
-            -
-            -
            }( jQuery ));
-            -
            /*
-            -
             * jQuery UI Draggable 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Draggables
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            $.widget("ui.draggable", $.ui.mouse, {
-            -
            	widgetEventPrefix: "drag",
-            -
            	options: {
-            -
            		addClasses: true,
-            -
            		appendTo: "parent",
-            -
            		axis: false,
-            -
            		connectToSortable: false,
-            -
            		containment: false,
-            -
            		cursor: "auto",
-            -
            		cursorAt: false,
-            -
            		grid: false,
-            -
            		handle: false,
-            -
            		helper: "original",
-            -
            		iframeFix: false,
-            -
            		opacity: false,
-            -
            		refreshPositions: false,
-            -
            		revert: false,
-            -
            		revertDuration: 500,
-            -
            		scope: "default",
-            -
            		scroll: true,
-            -
            		scrollSensitivity: 20,
-            -
            		scrollSpeed: 20,
-            -
            		snap: false,
-            -
            		snapMode: "both",
-            -
            		snapTolerance: 20,
-            -
            		stack: false,
-            -
            		zIndex: false
-            -
            	},
-            -
            	_create: function() {
-            -
-            -
            		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
-            -
            			this.element[0].style.position = 'relative';
-            -
-            -
            		(this.options.addClasses && this.element.addClass("ui-draggable"));
-            -
            		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
             		this._mouseInit();
             	},
-            -
            	destroy: function() {
-            -
            		if(!this.element.data('draggable')) return;
-            -
            		this.element
-            -
            			.removeData("draggable")
-            -
            			.unbind(".draggable")
-            -
            			.removeClass("ui-draggable"
-            -
            				+ " ui-draggable-dragging"
-            -
            				+ " ui-draggable-disabled");
             		this._mouseDestroy();
-            -
-            -
            		return this;
             	},
             	_mouseCapture: function(event) {
@@ -1118,26 +1044,26 @@ $.widget("ui.draggable", $.ui.mouse, {
             		var o = this.options;
             		// among others, prevent a drag on a resizable-handle
-            -
            		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
             			return false;
             		//Quit if we're not on a valid handle
             		this.handle = this._getHandle(event);
-            -
            		if (!this.handle)
             			return false;
-            -
-            -
            		if ( o.iframeFix ) {
-            -
            			$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
-            -
            				$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
-            -
            				.css({
-            -
            					width: this.offsetWidth+"px", height: this.offsetHeight+"px",
-            -
            					position: "absolute", opacity: "0.001", zIndex: 1000
-            -
            				})
-            -
            				.css($(this).offset())
-            -
            				.appendTo("body");
-            -
            			});
+            		}
             		return true;
             	},
@@ -1149,12 +1075,15 @@ $.widget("ui.draggable", $.ui.mouse, {
             		//Create and append the visible helper
             		this.helper = this._createHelper(event);
             		//Cache the helper size
             		this._cacheHelperProportions();
             		//If ddmanager is used for droppables, set the global draggable
-            -
            		if($.ui.ddmanager)
             			$.ui.ddmanager.current = this;
             		/*
             		 * - Position generation -
@@ -1189,12 +1118,13 @@ $.widget("ui.draggable", $.ui.mouse, {
             		this.originalPageX = event.pageX;
             		this.originalPageY = event.pageY;
-            -
            		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
             		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
             		//Set a containment if given in the options
-            -
            		if(o.containment)
             			this._setContainment();
             		//Trigger event + callbacks
             		if(this._trigger("start", event) === false) {
@@ -1206,15 +1136,18 @@ $.widget("ui.draggable", $.ui.mouse, {
             		this._cacheHelperProportions();
             		//Prepare the droppable offsets
-            -
            		if ($.ui.ddmanager && !o.dropBehaviour)
             			$.ui.ddmanager.prepareOffsets(this, event);
-            -
            		this.helper.addClass("ui-draggable-dragging");
             		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
-            -
             		//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
-            -
            		if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
-            -
             		return true;
             	},
@@ -1227,16 +1160,22 @@ $.widget("ui.draggable", $.ui.mouse, {
             		//Call plugins and callbacks and use the resulting position if something is returned
             		if (!noPropagation) {
             			var ui = this._uiHash();
-            -
            			if(this._trigger('drag', event, ui) === false) {
             				this._mouseUp({});
             				return false;
+            			}
             			this.position = ui.position;
+            		}
-            -
            		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
-            -
            		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
-            -
            		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
             		return false;
             	},
@@ -1244,25 +1183,35 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_mouseStop: function(event) {
             		//If we are using droppables, inform the manager about the drop
-            -
            		var dropped = false;
-            -
            		if ($.ui.ddmanager && !this.options.dropBehaviour)
             			dropped = $.ui.ddmanager.drop(this, event);
             		//if a drop comes from outside (a sortable)
             		if(this.dropped) {
             			dropped = this.dropped;
             			this.dropped = false;
+            		}
-            -
-            -
            		//if the original element is removed, don't bother to continue if helper is set to "original"
-            -
            		if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
             			return false;
-            -
            		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
-            -
            			var self = this;
             			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
-            -
            				if(self._trigger("stop", event) !== false) {
-            -
            					self._clear();
+            				}
             			});
             		} else {
@@ -1273,78 +1222,73 @@ $.widget("ui.draggable", $.ui.mouse, {
             		return false;
             	},
-            -
             	_mouseUp: function(event) {
-            -
            		if (this.options.iframeFix === true) {
-            -
            			$("div.ui-draggable-iframeFix").each(function() {
-            -
            				this.parentNode.removeChild(this);
-            -
            			}); //Remove frame helpers
-            -
            		}
-            -
             		//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
-            -
            		if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
-            -
             		return $.ui.mouse.prototype._mouseUp.call(this, event);
             	},
-            -
             	cancel: function() {
-            -
             		if(this.helper.is(".ui-draggable-dragging")) {
             			this._mouseUp({});
             		} else {
             			this._clear();
+            		}
-            -
             		return this;
-            -
             	},
             	_getHandle: function(event) {
-            -
-            -
            		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
-            -
            		$(this.options.handle, this.element)
-            -
            			.find("*")
-            -
            			.andSelf()
-            -
            			.each(function() {
-            -
            				if(this == event.target) handle = true;
-            -
            			});
-            -
-            -
            		return handle;
-            -
             	},
             	_createHelper: function(event) {
-            -
            		var o = this.options;
-            -
            		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
-            -
            		if(!helper.parents('body').length)
-            -
            			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
-            -
            		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
             			helper.css("position", "absolute");
             		return helper;
             	},
             	_adjustOffsetFromHelper: function(obj) {
-            -
            		if (typeof obj == 'string') {
-            -
            			obj = obj.split(' ');
+            		}
             		if ($.isArray(obj)) {
             			obj = {left: +obj[0], top: +obj[1] || 0};
+            		}
-            -
            		if ('left' in obj) {
             			this.offset.click.left = obj.left + this.margins.left;
+            		}
-            -
            		if ('right' in obj) {
             			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+            		}
-            -
            		if ('top' in obj) {
             			this.offset.click.top = obj.top + this.margins.top;
+            		}
-            -
            		if ('bottom' in obj) {
             			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+            		}
             	},
@@ -1359,14 +1303,17 @@ $.widget("ui.draggable", $.ui.mouse, {
             		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
             		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
             		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
-            -
            		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
             			po.left += this.scrollParent.scrollLeft();
             			po.top += this.scrollParent.scrollTop();
+            		}
-            -
            		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
-            -
            		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
             			po = { top: 0, left: 0 };
             		return {
             			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
@@ -1377,7 +1324,7 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_getRelativeOffset: function() {
-            -
            		if(this.cssPosition == "relative") {
             			var p = this.element.position();
             			return {
             				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
@@ -1407,30 +1354,40 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_setContainment: function() {
-            -
            		var o = this.options;
-            -
            		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
-            -
            		if(o.containment == 'document' || o.containment == 'window') this.containment = [
-            -
            			o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
-            -
            			o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
-            -
            			(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
-            -
            			(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
-            -
            		];
-            -
            		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
-            -
            		        var c = $(o.containment);
-            -
            			var ce = c[0]; if(!ce) return;
-            -
            			var co = c.offset();
-            -
            			var over = ($(ce).css("overflow") != 'hidden');
             			this.containment = [
             				(parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
             				(parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
-            -
            				(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
-            -
            				(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top  - this.margins.bottom
             			];
             			this.relative_container = c;
-            -
            		} else if(o.containment.constructor == Array) {
             			this.containment = o.containment;
+            		}
@@ -1438,22 +1395,25 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_convertPositionTo: function(d, pos) {
-            -
            		if(!pos) pos = this.position;
-            -
            		var mod = d == "absolute" ? 1 : -1;
-            -
            		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
             		return {
             			top: (
-            -
            				pos.top																	// The absolute mouse position
-            -
            				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
-            -
            				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
             			),
             			left: (
-            -
            				pos.left																// The absolute mouse position
-            -
            				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
-            -
            				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+            			)
             		};
@@ -1461,9 +1421,12 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_generatePosition: function(event) {
-            -
            		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-            -
            		var pageX = event.pageX;
-            -
            		var pageY = event.pageY;
             		/*
             		 * - Position constraining -
@@ -1471,50 +1434,57 @@ $.widget("ui.draggable", $.ui.mouse, {
             		 */
             		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-            -
            		         var containment;
-            -
            		         if(this.containment) {
-            -
            				 if (this.relative_container){
-            -
            				     var co = this.relative_container.offset();
-            -
            				     containment = [ this.containment[0] + co.left,
-            -
            						     this.containment[1] + co.top,
-            -
            						     this.containment[2] + co.left,
-            -
            						     this.containment[3] + co.top ];
-            -
            				 }
-            -
            				 else {
-            -
            				     containment = this.containment;
-            -
            				 }
-            -
-            -
            				if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
-            -
            				if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
-            -
            				if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
-            -
            				if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+            			}
             			if(o.grid) {
             				//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
-            -
            				var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
-            -
            				pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-            -
            				var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
-            -
            				pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+            			}
+            		}
             		return {
             			top: (
-            -
            				pageY																// The absolute mouse position
-            -
            				- this.offset.click.top													// Click offset (relative to the element)
-            -
            				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
-            -
            				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
             			),
             			left: (
-            -
            				pageX																// The absolute mouse position
-            -
            				- this.offset.click.left												// Click offset (relative to the element)
-            -
            				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
-            -
            				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+            			)
             		};
@@ -1522,8 +1492,9 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_clear: function() {
             		this.helper.removeClass("ui-draggable-dragging");
-            -
            		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
-            -
            		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
             		this.helper = null;
             		this.cancelHelperRemoval = false;
             	},
@@ -1533,13 +1504,16 @@ $.widget("ui.draggable", $.ui.mouse, {
             	_trigger: function(type, event, ui) {
             		ui = ui || this._uiHash();
             		$.ui.plugin.call(this, type, [event, ui]);
-            -
            		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
             		return $.Widget.prototype._trigger.call(this, type, event, ui);
             	},
             	plugins: {},
-            -
            	_uiHash: function(event) {
             		return {
             			helper: this.helper,
             			position: this.position,
@@ -1550,18 +1524,14 @@ $.widget("ui.draggable", $.ui.mouse, {
             });
-            -
            $.extend($.ui.draggable, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
             $.ui.plugin.add("draggable", "connectToSortable", {
             	start: function(event, ui) {
-            -
            		var inst = $(this).data("draggable"), o = inst.options,
             			uiSortable = $.extend({}, ui, { item: inst.element });
             		inst.sortables = [];
             		$(o.connectToSortable).each(function() {
-            -
            			var sortable = $.data(this, 'sortable');
             			if (sortable && !sortable.options.disabled) {
             				inst.sortables.push({
             					instance: sortable,
@@ -1576,7 +1546,7 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             	stop: function(event, ui) {
             		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
-            -
            		var inst = $(this).data("draggable"),
             			uiSortable = $.extend({}, ui, { item: inst.element });
             		$.each(inst.sortables, function() {
@@ -1587,8 +1557,10 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
             				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
-            -
            				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
-            -
            				if(this.shouldRevert) this.instance.options.revert = true;
             				//Trigger the stop of the sortable
             				this.instance._mouseStop(event);
@@ -1596,8 +1568,9 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             				this.instance.options.helper = this.instance.options._helper;
             				//If the helper has been the original item, restore properties in the sortable
-            -
            				if(inst.options.helper == 'original')
-            -
            					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
             			} else {
             				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
@@ -1609,26 +1582,36 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             	},
             	drag: function(event, ui) {
-            -
            		var inst = $(this).data("draggable"), self = this;
-            -
            		var checkPos = function(o) {
-            -
            			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
-            -
            			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
-            -
            			var itemHeight = o.height, itemWidth = o.width;
-            -
            			var itemTop = o.top, itemLeft = o.left;
-            -
            			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
-            -
            		};
-            -
            		$.each(inst.sortables, function(i) {
-            -
             			//Copy over some variables to allow calling the sortable's native _intersectsWith
             			this.instance.positionAbs = inst.positionAbs;
             			this.instance.helperProportions = inst.helperProportions;
             			this.instance.offset.click = inst.offset.click;
-            -
             			if(this.instance._intersectsWith(this.instance.containerCache)) {
             				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
             				if(!this.instance.isOver) {
@@ -1636,7 +1619,7 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             					//Now we fake the start of dragging for the sortable instance,
             					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
             					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
-            -
            					this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
             					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
             					this.instance.options.helper = function() { return ui.helper[0]; };
@@ -1659,7 +1642,9 @@ $.ui.plugin.add("draggable", "connectToSortable", {
+            				}
             				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
-            -
            				if(this.instance.currentItem) this.instance._mouseDrag(event);
             			} else {
@@ -1669,25 +1654,27 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             					this.instance.isOver = 0;
             					this.instance.cancelHelperRemoval = true;
-            -
             					//Prevent reverting on this forced stop
             					this.instance.options.revert = false;
-            -
             					// The out event needs to be triggered independently
-            -
            					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-            -
             					this.instance._mouseStop(event, true);
             					this.instance.options.helper = this.instance.options._helper;
             					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
             					this.instance.currentItem.remove();
-            -
            					if(this.instance.placeholder) this.instance.placeholder.remove();
             					inst._trigger("fromSortable", event);
             					inst.dropped = false; //draggable revert needs that
+            				}
-            -
            			};
             		});
@@ -1695,212 +1682,257 @@ $.ui.plugin.add("draggable", "connectToSortable", {
             });
             $.ui.plugin.add("draggable", "cursor", {
-            -
            	start: function(event, ui) {
-            -
            		var t = $('body'), o = $(this).data('draggable').options;
-            -
            		if (t.css("cursor")) o._cursor = t.css("cursor");
             		t.css("cursor", o.cursor);
             	},
-            -
            	stop: function(event, ui) {
-            -
            		var o = $(this).data('draggable').options;
-            -
            		if (o._cursor) $('body').css("cursor", o._cursor);
+            	}
             });
             $.ui.plugin.add("draggable", "opacity", {
             	start: function(event, ui) {
-            -
            		var t = $(ui.helper), o = $(this).data('draggable').options;
-            -
            		if(t.css("opacity")) o._opacity = t.css("opacity");
-            -
            		t.css('opacity', o.opacity);
             	},
             	stop: function(event, ui) {
-            -
            		var o = $(this).data('draggable').options;
-            -
            		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+            	}
             });
             $.ui.plugin.add("draggable", "scroll", {
-            -
            	start: function(event, ui) {
-            -
            		var i = $(this).data("draggable");
-            -
            		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
             	},
-            -
            	drag: function(event, ui) {
-            -
            		var i = $(this).data("draggable"), o = i.options, scrolled = false;
-            -
            		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
-            -
            			if(!o.axis || o.axis != 'x') {
-            -
            				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
             					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
-            -
            				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
             					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+            			}
-            -
            			if(!o.axis || o.axis != 'y') {
-            -
            				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
             					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
-            -
            				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
             					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+            			}
             		} else {
-            -
            			if(!o.axis || o.axis != 'x') {
-            -
            				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
             					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
-            -
            				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
             					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+            			}
-            -
            			if(!o.axis || o.axis != 'y') {
-            -
            				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
             					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
-            -
            				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
             					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+            			}
+            		}
-            -
            		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
             			$.ui.ddmanager.prepareOffsets(i, event);
+            	}
             });
             $.ui.plugin.add("draggable", "snap", {
-            -
            	start: function(event, ui) {
-            -
            		var i = $(this).data("draggable"), o = i.options;
             		i.snapElements = [];
-            -
            		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
-            -
            			var $t = $(this); var $o = $t.offset();
-            -
            			if(this != i.element[0]) i.snapElements.push({
-            -
            				item: this,
-            -
            				width: $t.outerWidth(), height: $t.outerHeight(),
-            -
            				top: $o.top, left: $o.left
-            -
            			});
             		});
             	},
             	drag: function(event, ui) {
-            -
            		var inst = $(this).data("draggable"), o = inst.options;
-            -
            		var d = o.snapTolerance;
-            -
-            -
            		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
             			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
-            -
            		for (var i = inst.snapElements.length - 1; i >= 0; i--){
-            -
            			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
-            -
            				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
             			//Yes, I know, this is insane ;)
             			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
-            -
            				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
             				inst.snapElements[i].snapping = false;
             				continue;
+            			}
-            -
            			if(o.snapMode != 'inner') {
-            -
            				var ts = Math.abs(t - y2) <= d;
-            -
            				var bs = Math.abs(b - y1) <= d;
-            -
            				var ls = Math.abs(l - x2) <= d;
-            -
            				var rs = Math.abs(r - x1) <= d;
-            -
            				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
-            -
            				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
-            -
            				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
-            -
            				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+            			}
-            -
            			var first = (ts || bs || ls || rs);
-            -
            			if(o.snapMode != 'outer') {
-            -
            				var ts = Math.abs(t - y1) <= d;
-            -
            				var bs = Math.abs(b - y2) <= d;
-            -
            				var ls = Math.abs(l - x1) <= d;
-            -
            				var rs = Math.abs(r - x2) <= d;
-            -
            				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
-            -
            				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
-            -
            				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
-            -
            				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+            			}
-            -
            			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
             				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
             			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
-            -
            		};
+            	}
             });
             $.ui.plugin.add("draggable", "stack", {
-            -
            	start: function(event, ui) {
-            -
-            -
            		var o = $(this).data("draggable").options;
-            -
            		var group = $.makeArray($(o.stack)).sort(function(a,b) {
-            -
            			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
-            -
            		});
             		if (!group.length) { return; }
-            -
-            -
            		var min = parseInt(group[0].style.zIndex) || 0;
             		$(group).each(function(i) {
-            -
            			this.style.zIndex = min + i;
             		});
-            -
-            -
            		this[0].style.zIndex = min + group.length;
-            -
+            	}
             });
             $.ui.plugin.add("draggable", "zIndex", {
             	start: function(event, ui) {
-            -
            		var t = $(ui.helper), o = $(this).data("draggable").options;
-            -
            		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
-            -
            		t.css('zIndex', o.zIndex);
             	},
             	stop: function(event, ui) {
-            -
            		var o = $(this).data("draggable").options;
-            -
            		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+            	}
             });
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Droppable 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Droppables
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.draggable.js
-            -
             */
             (function( $, undefined ) {
             $.widget("ui.droppable", {
             	widgetEventPrefix: "drop",
             	options: {
-            -
            		accept: '*',
             		activeClass: false,
             		addClasses: true,
             		greedy: false,
             		hoverClass: false,
-            -
            		scope: 'default',
-            -
            		tolerance: 'intersect'
             	},
             	_create: function() {
-            -
            		var o = this.options, accept = o.accept;
-            -
            		this.isover = 0; this.isout = 1;
             		this.accept = $.isFunction(accept) ? accept : function(d) {
             			return d.is(accept);
@@ -1917,23 +1949,22 @@ $.widget("ui.droppable", {
             	},
-            -
            	destroy: function() {
-            -
            		var drop = $.ui.ddmanager.droppables[this.options.scope];
-            -
            		for ( var i = 0; i < drop.length; i++ )
-            -
            			if ( drop[i] == this )
-            -
            				drop.splice(i, 1);
-            -
            		this.element
-            -
            			.removeClass("ui-droppable ui-droppable-disabled")
-            -
            			.removeData("droppable")
-            -
            			.unbind(".droppable");
-            -
            		return this;
             	},
             	_setOption: function(key, value) {
-            -
            		if(key == 'accept') {
             			this.accept = $.isFunction(value) ? value : function(d) {
             				return d.is(value);
             			};
@@ -1943,24 +1974,38 @@ $.widget("ui.droppable", {
             	_activate: function(event) {
             		var draggable = $.ui.ddmanager.current;
-            -
            		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
-            -
            		(draggable && this._trigger('activate', event, this.ui(draggable)));
             	},
             	_deactivate: function(event) {
             		var draggable = $.ui.ddmanager.current;
-            -
            		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
-            -
            		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
             	},
             	_over: function(event) {
             		var draggable = $.ui.ddmanager.current;
-            -
            		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
             		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-            -
            			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
-            -
            			this._trigger('over', event, this.ui(draggable));
+            		}
             	},
@@ -1968,37 +2013,53 @@ $.widget("ui.droppable", {
             	_out: function(event) {
             		var draggable = $.ui.ddmanager.current;
-            -
            		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
             		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-            -
            			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
-            -
            			this._trigger('out', event, this.ui(draggable));
+            		}
             	},
             	_drop: function(event,custom) {
-            -
            		var draggable = custom || $.ui.ddmanager.current;
-            -
            		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
-            -
            		var childrenIntersection = false;
-            -
            		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
-            -
            			var inst = $.data(this, 'droppable');
             			if(
-            -
            				inst.options.greedy
-            -
            				&& !inst.options.disabled
-            -
            				&& inst.options.scope == draggable.options.scope
-            -
            				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
-            -
            				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
             			) { childrenIntersection = true; return false; }
             		});
-            -
            		if(childrenIntersection) return false;
             		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-            -
            			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
-            -
            			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
-            -
            			this._trigger('drop', event, this.ui(draggable));
             			return this.element;
+            		}
@@ -2017,50 +2078,42 @@ $.widget("ui.droppable", {
             });
-            -
            $.extend($.ui.droppable, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
             $.ui.intersect = function(draggable, droppable, toleranceMode) {
-            -
            	if (!droppable.offset) return false;
-            -
            	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
-            -
            		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
-            -
            	var l = droppable.offset.left, r = l + droppable.proportions.width,
             		t = droppable.offset.top, b = t + droppable.proportions.height;
             	switch (toleranceMode) {
-            -
            		case 'fit':
-            -
            			return (l <= x1 && x2 <= r
-            -
            				&& t <= y1 && y2 <= b);
-            -
            			break;
-            -
            		case 'intersect':
-            -
            			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
-            -
            				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
-            -
            				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
-            -
            				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
-            -
            			break;
-            -
            		case 'pointer':
-            -
            			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
-            -
            				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
-            -
            				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
-            -
            			return isOver;
-            -
            			break;
-            -
            		case 'touch':
             			return (
-            -
            					(y1 >= t && y1 <= b) ||	// Top edge touching
-            -
            					(y2 >= t && y2 <= b) ||	// Bottom edge touching
-            -
            					(y1 < t && y2 > b)		// Surrounded vertically
-            -
            				) && (
-            -
            					(x1 >= l && x1 <= r) ||	// Left edge touching
-            -
            					(x2 >= l && x2 <= r) ||	// Right edge touching
-            -
            					(x1 < l && x2 > r)		// Surrounded horizontally
-            -
            				);
-            -
            			break;
             		default:
             			return false;
-            -
            			break;
+            		}
             };
@@ -2070,20 +2123,38 @@ $.ui.intersect = function(draggable, droppable, toleranceMode) {
             */
             $.ui.ddmanager = {
             	current: null,
-            -
            	droppables: { 'default': [] },
             	prepareOffsets: function(t, event) {
-            -
            		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
-            -
            		var type = event ? event.type : null; // workaround for #2317
-            -
            		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
-            -
            		droppablesLoop: for (var i = 0; i < m.length; i++) {
-            -
            			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
-            -
            			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
-            -
            			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
-            -
            			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
             			m[i].offset = m[i].element.offset();
             			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
@@ -2094,14 +2165,19 @@ $.ui.ddmanager = {
             	drop: function(draggable, event) {
             		var dropped = false;
-            -
            		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
-            -
            			if(!this.options) return;
-            -
            			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
             				dropped = this._drop.call(this, event) || dropped;
             			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-            -
            				this.isout = 1; this.isover = 0;
             				this._deactivate.call(this, event);
+            			}
@@ -2111,77 +2187,89 @@ $.ui.ddmanager = {
             	},
             	dragStart: function( draggable, event ) {
             		//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
-            -
            		draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
-            -
            			if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
             		});
             	},
             	drag: function(draggable, event) {
             		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
-            -
            		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
             		//Run through all droppables and check their positions based on specific tolerance options
             		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
-            -
            			if(this.options.disabled || this.greedyChild || !this.visible) return;
-            -
            			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
-            -
            			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
-            -
            			if(!c) return;
-            -
            			var parentInstance;
             			if (this.options.greedy) {
-            -
            				var parent = this.element.parents(':data(droppable):eq(0)');
             				if (parent.length) {
-            -
            					parentInstance = $.data(parent[0], 'droppable');
-            -
            					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+            				}
+            			}
             			// we just moved into a greedy child
-            -
            			if (parentInstance && c == 'isover') {
-            -
            				parentInstance['isover'] = 0;
-            -
            				parentInstance['isout'] = 1;
             				parentInstance._out.call(parentInstance, event);
+            			}
-            -
            			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
-            -
            			this[c == "isover" ? "_over" : "_out"].call(this, event);
             			// we just moved out of a greedy child
-            -
            			if (parentInstance && c == 'isout') {
-            -
            				parentInstance['isout'] = 0;
-            -
            				parentInstance['isover'] = 1;
             				parentInstance._over.call(parentInstance, event);
+            			}
             		});
             	},
             	dragStop: function( draggable, event ) {
-            -
            		draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
             		//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
-            -
            		if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+            	}
             };
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Resizable 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Resizables
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
             (function( $, undefined ) {
             $.widget("ui.resizable", $.ui.mouse, {
             	widgetEventPrefix: "resize",
             	options: {
             		alsoResize: false,
@@ -2199,11 +2287,19 @@ $.widget("ui.resizable", $.ui.mouse, {
             		maxWidth: null,
             		minHeight: 10,
             		minWidth: 10,
-            -
            		zIndex: 1000
             	},
             	_create: function() {
-            -
            		var self = this, o = this.options;
             		this.element.addClass("ui-resizable");
             		$.extend(this, {
@@ -2211,30 +2307,26 @@ $.widget("ui.resizable", $.ui.mouse, {
             			aspectRatio: o.aspectRatio,
             			originalElement: this.element,
             			_proportionallyResizeElements: [],
-            -
            			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
             		});
             		//Wrap the element if it cannot hold child nodes
             		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
-            -
            			//Opera fix for relative positioning
-            -
            			if (/relative/.test(this.element.css('position')) && $.browser.opera)
-            -
            				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
-            -
             			//Create a wrapper element and set the wrapper to the new current internal element
             			this.element.wrap(
-            -
            				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
-            -
            					position: this.element.css('position'),
             					width: this.element.outerWidth(),
             					height: this.element.outerHeight(),
-            -
            					top: this.element.css('top'),
-            -
            					left: this.element.css('left')
             				})
             			);
             			//Overwrite the original this.element
             			this.element = this.element.parent().data(
-            -
            				"resizable", this.element.data('resizable')
             			);
             			this.elementIsWrapper = true;
@@ -2244,42 +2336,46 @@ $.widget("ui.resizable", $.ui.mouse, {
             			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
             			//Prevent Safari textarea resize
-            -
            			this.originalResizeStyle = this.originalElement.css('resize');
-            -
            			this.originalElement.css('resize', 'none');
             			//Push the actual element to our proportionallyResize internal array
-            -
            			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
             			// avoid IE jump (hard set the margin)
-            -
            			this.originalElement.css({ margin: this.originalElement.css('margin') });
             			// fix handlers offset
             			this._proportionallyResize();
+            		}
-            -
            		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
-            -
            		if(this.handles.constructor == String) {
-            -
            			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
-            -
            			var n = this.handles.split(","); this.handles = {};
-            -
            			for(var i = 0; i < n.length; i++) {
-            -
            				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
-            -
            				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
-            -
            				// increase zIndex of sw, se, ne, nw axis
-            -
            				//TODO : this modifies original option
-            -
            				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
             				//TODO : What's going on here?
-            -
            				if ('se' == handle) {
-            -
            					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
-            -
            				};
             				//Insert into internal handles object and append to element
-            -
            				this.handles[handle] = '.ui-resizable-'+handle;
             				this.element.append(axis);
+            			}
@@ -2287,26 +2383,29 @@ $.widget("ui.resizable", $.ui.mouse, {
             		this._renderAxis = function(target) {
             			target = target || this.element;
-            -
            			for(var i in this.handles) {
-            -
            				if(this.handles[i].constructor == String)
             					this.handles[i] = $(this.handles[i], this.element).show();
             				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
             				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
-            -
            					var axis = $(this.handles[i], this.element), padWrapper = 0;
             					//Checking the correct pad and border
             					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
             					//The padding type i have to apply...
-            -
            					var padPos = [ 'padding',
-            -
            						/ne|nw|n/.test(i) ? 'Top' :
-            -
            						/se|sw|s/.test(i) ? 'Bottom' :
-            -
            						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
             					target.css(padPos, padWrapper);
@@ -2315,25 +2414,26 @@ $.widget("ui.resizable", $.ui.mouse, {
+            				}
             				//TODO: What's that good for? There's not anything to be executed left
-            -
            				if(!$(this.handles[i]).length)
             					continue;
-            -
+            			}
             		};
             		//TODO: make renderAxis a prototype function
             		this._renderAxis(this.element);
-            -
            		this._handles = $('.ui-resizable-handle', this.element)
             			.disableSelection();
             		//Matching axis name
             		this._handles.mouseover(function() {
-            -
            			if (!self.resizing) {
-            -
            				if (this.className)
-            -
            					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
             				//Axis, default = se
-            -
            				self.axis = axis && axis[1] ? axis[1] : 'se';
+            			}
             		});
@@ -2342,16 +2442,20 @@ $.widget("ui.resizable", $.ui.mouse, {
             			this._handles.hide();
             			$(this.element)
             				.addClass("ui-resizable-autohide")
-            -
            				.hover(function() {
-            -
            					if (o.disabled) return;
             					$(this).removeClass("ui-resizable-autohide");
-            -
            					self._handles.show();
-            -
            				},
-            -
            				function(){
-            -
            					if (o.disabled) return;
-            -
            					if (!self.resizing) {
             						$(this).addClass("ui-resizable-autohide");
-            -
            						self._handles.hide();
+            					}
             				});
+            		}
@@ -2361,66 +2465,70 @@ $.widget("ui.resizable", $.ui.mouse, {
             	},
-            -
            	destroy: function() {
             		this._mouseDestroy();
-            -
            		var _destroy = function(exp) {
-            -
            			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
-            -
            				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
-            -
            		};
             		//TODO: Unwrap at same DOM position
             		if (this.elementIsWrapper) {
             			_destroy(this.element);
-            -
            			var wrapper = this.element;
-            -
            			wrapper.after(
-            -
            				this.originalElement.css({
-            -
            					position: wrapper.css('position'),
-            -
            					width: wrapper.outerWidth(),
-            -
            					height: wrapper.outerHeight(),
-            -
            					top: wrapper.css('top'),
-            -
            					left: wrapper.css('left')
-            -
            				})
-            -
            			).remove();
-            -
            		}
-            -
-            -
            		this.originalElement.css('resize', this.originalResizeStyle);
             		_destroy(this.originalElement);
             		return this;
             	},
             	_mouseCapture: function(event) {
-            -
            		var handle = false;
-            -
            		for (var i in this.handles) {
-            -
            			if ($(this.handles[i])[0] == event.target) {
-            -
            				handle = true;
+            			}
+            		}
-            -
            		return !this.options.disabled && handle;
             	},
             	_mouseStart: function(event) {
-            -
            		var o = this.options, iniPos = this.element.position(), el = this.element;
             		this.resizing = true;
-            -
            		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
             		// bugfix for http://dev.jquery.com/ticket/1749
-            -
            		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
-            -
            			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+            		}
-            -
            		//Opera fixing relative position
-            -
            		if ($.browser.opera && (/relative/).test(el.css('position')))
-            -
            			el.css({ position: 'relative', top: 'auto', left: 'auto' });
-            -
             		this._renderProxy();
-            -
            		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
             		if (o.containment) {
             			curleft += $(o.containment).scrollLeft() || 0;
@@ -2437,10 +2545,10 @@ $.widget("ui.resizable", $.ui.mouse, {
             		this.originalMousePosition = { left: event.pageX, top: event.pageY };
             		//Aspect Ratio
-            -
            		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
-            -
            	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
-            -
            	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
             		el.addClass("ui-resizable-resizing");
             		this._propagate("start", event);
@@ -2450,38 +2558,60 @@ $.widget("ui.resizable", $.ui.mouse, {
             	_mouseDrag: function(event) {
             		//Increase performance, avoid regex
-            -
            		var el = this.helper, o = this.options, props = {},
-            -
            			self = this, smp = this.originalMousePosition, a = this.axis;
-            -
-            -
            		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
-            -
            		var trigger = this._change[a];
-            -
            		if (!trigger) return false;
             		// Calculate the attrs that will be change
-            -
            		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
             		// Put this in the mouseDrag handler since the user can start pressing shift while resizing
             		this._updateVirtualBoundaries(event.shiftKey);
-            -
            		if (this._aspectRatio || event.shiftKey)
             			data = this._updateRatio(data, event);
             		data = this._respectSize(data, event);
             		// plugins callbacks need to be called first
             		this._propagate("resize", event);
-            -
            		el.css({
-            -
            			top: this.position.top + "px", left: this.position.left + "px",
-            -
            			width: this.size.width + "px", height: this.size.height + "px"
-            -
            		});
-            -
            		if (!this._helper && this._proportionallyResizeElements.length)
             			this._proportionallyResize();
-            -
            		this._updateCache(data);
-            -
-            -
            		// calling the user callback at the end
-            -
            		this._trigger('resize', event, this.ui());
             		return false;
             	},
@@ -2489,84 +2619,114 @@ $.widget("ui.resizable", $.ui.mouse, {
             	_mouseStop: function(event) {
             		this.resizing = false;
-            -
            		var o = this.options, self = this;
             		if(this._helper) {
-            -
            			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
-            -
            				soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
-            -
            				soffsetw = ista ? 0 : self.sizeDiff.width;
-            -
            			var s = { width: (self.helper.width()  - soffsetw), height: (self.helper.height() - soffseth) },
-            -
            				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
-            -
            				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-            -
            			if (!o.animate)
             				this.element.css($.extend(s, { top: top, left: left }));
-            -
            			self.helper.height(self.size.height);
-            -
            			self.helper.width(self.size.width);
-            -
            			if (this._helper && !o.animate) this._proportionallyResize();
+            		}
-            -
            		$('body').css('cursor', 'auto');
             		this.element.removeClass("ui-resizable-resizing");
             		this._propagate("stop", event);
-            -
            		if (this._helper) this.helper.remove();
             		return false;
             	},
-            -
                _updateVirtualBoundaries: function(forceAspectRatio) {
-            -
                    var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
-            -
                    b = {
-            -
                        minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
-            -
                        maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
-            -
                        minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
-            -
                        maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
-            -
                    };
-            -
                    if(this._aspectRatio || forceAspectRatio) {
-            -
                        // We want to create an enclosing box whose aspect ration is the requested one
-            -
                        // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
-            -
                        pMinWidth = b.minHeight * this.aspectRatio;
-            -
                        pMinHeight = b.minWidth / this.aspectRatio;
-            -
                        pMaxWidth = b.maxHeight * this.aspectRatio;
-            -
                        pMaxHeight = b.maxWidth / this.aspectRatio;
-            -
                        if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
-            -
                        if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
-            -
                        if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
-            -
                        if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
-            -
                    }
-            -
                    this._vBoundaries = b;
-            -
                },
             	_updateCache: function(data) {
-            -
            		var o = this.options;
             		this.offset = this.helper.offset();
-            -
            		if (isNumber(data.left)) this.position.left = data.left;
-            -
            		if (isNumber(data.top)) this.position.top = data.top;
-            -
            		if (isNumber(data.height)) this.size.height = data.height;
-            -
            		if (isNumber(data.width)) this.size.width = data.width;
             	},
-            -
            	_updateRatio: function(data, event) {
-            -
            		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
-            -
            		if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
-            -
            		else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
-            -
            		if (a == 'sw') {
             			data.left = cpos.left + (csize.width - data.width);
             			data.top = null;
+            		}
-            -
            		if (a == 'nw') {
             			data.top = cpos.top + (csize.height - data.height);
             			data.left = cpos.left + (csize.width - data.width);
+            		}
@@ -2574,62 +2734,80 @@ $.widget("ui.resizable", $.ui.mouse, {
             		return data;
             	},
-            -
            	_respectSize: function(data, event) {
-            -
            		var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
-            -
            				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
-            -
            					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
-            -
-            -
            		if (isminw) data.width = o.minWidth;
-            -
            		if (isminh) data.height = o.minHeight;
-            -
            		if (ismaxw) data.width = o.maxWidth;
-            -
            		if (ismaxh) data.height = o.maxHeight;
-            -
-            -
            		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
-            -
            		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
-            -
            		if (isminw && cw) data.left = dw - o.minWidth;
-            -
            		if (ismaxw && cw) data.left = dw - o.maxWidth;
-            -
            		if (isminh && ch)	data.top = dh - o.minHeight;
-            -
            		if (ismaxh && ch)	data.top = dh - o.maxHeight;
             		// fixing jump error on top/left - bug #2330
-            -
            		var isNotwh = !data.width && !data.height;
-            -
            		if (isNotwh && !data.left && data.top) data.top = null;
-            -
            		else if (isNotwh && !data.top && data.left) data.left = null;
             		return data;
             	},
             	_proportionallyResize: function() {
-            -
            		var o = this.options;
-            -
            		if (!this._proportionallyResizeElements.length) return;
-            -
            		var element = this.helper || this.element;
-            -
            		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
-            -
            			var prel = this._proportionallyResizeElements[i];
             			if (!this.borderDif) {
-            -
            				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
-            -
            					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
-            -
            				this.borderDif = $.map(b, function(v, i) {
-            -
            					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
-            -
            					return border + padding;
-            -
            				});
+            			}
-            -
            			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
-            -
            				continue;
-            -
             			prel.css({
             				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
             				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
             			});
-            -
            		};
             	},
@@ -2640,18 +2818,14 @@ $.widget("ui.resizable", $.ui.mouse, {
             		if(this._helper) {
-            -
            			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
-            -
-            -
            			// fix ie6 offset TODO: This seems broken
-            -
            			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
-            -
            			pxyoffset = ( ie6 ? 2 : -1 );
             			this.helper.addClass(this._helper).css({
-            -
            				width: this.element.outerWidth() + pxyoffset,
-            -
            				height: this.element.outerHeight() + pxyoffset,
-            -
            				position: 'absolute',
-            -
            				left: this.elementOffset.left - ie6offset +'px',
-            -
            				top: this.elementOffset.top - ie6offset +'px',
             				zIndex: ++o.zIndex //TODO: Don't modify option
             			});
@@ -2666,15 +2840,15 @@ $.widget("ui.resizable", $.ui.mouse, {
             	},
             	_change: {
-            -
            		e: function(event, dx, dy) {
             			return { width: this.originalSize.width + dx };
             		},
-            -
            		w: function(event, dx, dy) {
-            -
            			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
             			return { left: sp.left + dx, width: cs.width - dx };
             		},
             		n: function(event, dx, dy) {
-            -
            			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
             			return { top: sp.top + dy, height: cs.height - dy };
             		},
             		s: function(event, dx, dy) {
@@ -2696,7 +2870,7 @@ $.widget("ui.resizable", $.ui.mouse, {
             	_propagate: function(n, event) {
             		$.ui.plugin.call(this, n, [event, this.ui()]);
-            -
            		(n != "resize" && this._trigger(n, event, this.ui()));
             	},
             	plugins: {},
@@ -2715,129 +2889,43 @@ $.widget("ui.resizable", $.ui.mouse, {
             });
-            -
            $.extend($.ui.resizable, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
             /*
              * Resizable Extensions
              */
-            -
            $.ui.plugin.add("resizable", "alsoResize", {
-            -
-            -
            	start: function (event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options;
-            -
-            -
            		var _store = function (exp) {
-            -
            			$(exp).each(function() {
-            -
            				var el = $(this);
-            -
            				el.data("resizable-alsoresize", {
-            -
            					width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
-            -
            					left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
-            -
            					position: el.css('position') // to reset Opera on stop()
-            -
            				});
-            -
            			});
-            -
            		};
-            -
            		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
-            -
            			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
-            -
            			else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
-            -
            		}else{
-            -
            			_store(o.alsoResize);
-            -
            		}
-            -
            	},
-            -
            	resize: function (event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
-            -
            		var delta = {
-            -
            			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
-            -
            			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
-            -
            		},
-            -
            		_alsoResize = function (exp, c) {
-            -
            			$(exp).each(function() {
-            -
            				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
-            -
            					css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
-            -
-            -
            				$.each(css, function (i, prop) {
-            -
            					var sum = (start[prop]||0) + (delta[prop]||0);
-            -
            					if (sum && sum >= 0)
-            -
            						style[prop] = sum || null;
-            -
            				});
-            -
-            -
            				// Opera fixing relative position
-            -
            				if ($.browser.opera && /relative/.test(el.css('position'))) {
-            -
            					self._revertToRelativePosition = true;
-            -
            					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
-            -
            				}
-            -
-            -
            				el.css(style);
-            -
            			});
-            -
            		};
-            -
-            -
            		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
-            -
            			$.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
-            -
            		}else{
-            -
            			_alsoResize(o.alsoResize);
-            -
            		}
-            -
            	},
-            -
-            -
            	stop: function (event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options;
-            -
-            -
            		var _reset = function (exp) {
-            -
            			$(exp).each(function() {
-            -
            				var el = $(this);
-            -
            				// reset position for Opera - no need to verify it was changed
-            -
            				el.css({ position: el.data("resizable-alsoresize").position });
-            -
            			});
-            -
            		};
-            -
-            -
            		if (self._revertToRelativePosition) {
-            -
            			self._revertToRelativePosition = false;
-            -
            			if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
-            -
            				$.each(o.alsoResize, function (exp) { _reset(exp); });
-            -
            			}else{
-            -
            				_reset(o.alsoResize);
-            -
            			}
-            -
            		}
-            -
-            -
            		$(this).removeData("resizable-alsoresize");
-            -
            	}
-            -
            });
-            -
-            -
            $.ui.plugin.add("resizable", "animate", {
-            -
-            -
            	stop: function(event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options;
-            -
-            -
            		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
-            -
            					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
-            -
            						soffsetw = ista ? 0 : self.sizeDiff.width;
-            -
-            -
            		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
-            -
            					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
-            -
            						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-            -
-            -
            		self.element.animate(
-            -
            			$.extend(style, top && left ? { top: top, left: left } : {}), {
-            -
            				duration: o.animateDuration,
-            -
            				easing: o.animateEasing,
-            -
            				step: function() {
-            -
-            -
            					var data = {
-            -
            						width: parseInt(self.element.css('width'), 10),
-            -
            						height: parseInt(self.element.css('height'), 10),
-            -
            						top: parseInt(self.element.css('top'), 10),
-            -
            						left: parseInt(self.element.css('left'), 10)
-            -
            					};
-            -
-            -
            					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
-            -
-            -
            					// propagating resize, and updating values for each animation step
-            -
            					self._updateCache(data);
-            -
            					self._propagate("resize", event);
+            				}
+            			}
@@ -2848,18 +2936,25 @@ $.ui.plugin.add("resizable", "animate", {
             $.ui.plugin.add("resizable", "containment", {
-            -
            	start: function(event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options, el = self.element;
-            -
            		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
-            -
            		if (!ce) return;
-            -
            		self.containerElement = $(ce);
-            -
            		if (/document/.test(oc) || oc == document) {
-            -
            			self.containerOffset = { left: 0, top: 0 };
-            -
            			self.containerPosition = { left: 0, top: 0 };
-            -
            			self.parentData = {
             				element: $(document), left: 0, top: 0,
             				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
             			};
@@ -2867,185 +2962,290 @@ $.ui.plugin.add("resizable", "containment", {
             		// i'm a node, so compute top, left, right, bottom
             		else {
-            -
            			var element = $(ce), p = [];
             			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
-            -
            			self.containerOffset = element.offset();
-            -
            			self.containerPosition = element.position();
-            -
            			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
-            -
            			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
-            -
            						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
-            -
            			self.parentData = {
             				element: ce, left: co.left, top: co.top, width: width, height: height
             			};
+            		}
             	},
-            -
            	resize: function(event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options,
-            -
            				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
-            -
            				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
-            -
            		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
-            -
            		if (cp.left < (self._helper ? co.left : 0)) {
-            -
            			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
-            -
            			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
-            -
            			self.position.left = o.helper ? co.left : 0;
+            		}
-            -
            		if (cp.top < (self._helper ? co.top : 0)) {
-            -
            			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
-            -
            			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
-            -
            			self.position.top = self._helper ? co.top : 0;
+            		}
-            -
            		self.offset.left = self.parentData.left+self.position.left;
-            -
            		self.offset.top = self.parentData.top+self.position.top;
-            -
            		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
-            -
            					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
-            -
            		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
-            -
            		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
-            -
            		if(isParent && isOffsetRelative) woset -= self.parentData.left;
-            -
            		if (woset + self.size.width >= self.parentData.width) {
-            -
            			self.size.width = self.parentData.width - woset;
-            -
            			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+            		}
-            -
            		if (hoset + self.size.height >= self.parentData.height) {
-            -
            			self.size.height = self.parentData.height - hoset;
-            -
            			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+            		}
             	},
-            -
            	stop: function(event, ui){
-            -
            		var self = $(this).data("resizable"), o = self.options, cp = self.position,
-            -
            				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
-            -
-            -
            		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
-            -
            		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
             			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-            -
            		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
             			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+            	}
             });
             $.ui.plugin.add("resizable", "ghost", {
-            -
            	start: function(event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options, cs = self.size;
-            -
            		self.ghost = self.originalElement.clone();
-            -
            		self.ghost
-            -
            			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
-            -
            			.addClass('ui-resizable-ghost')
-            -
            			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
-            -
            		self.ghost.appendTo(self.helper);
             	},
-            -
            	resize: function(event, ui){
-            -
            		var self = $(this).data("resizable"), o = self.options;
-            -
            		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
             	},
-            -
            	stop: function(event, ui){
-            -
            		var self = $(this).data("resizable"), o = self.options;
-            -
            		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+            	}
             });
             $.ui.plugin.add("resizable", "grid", {
-            -
            	resize: function(event, ui) {
-            -
            		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
-            -
            		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
-            -
            		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
             		if (/^(se|s|e)$/.test(a)) {
-            -
            			self.size.width = os.width + ox;
-            -
            			self.size.height = os.height + oy;
-            -
            		}
-            -
            		else if (/^(ne)$/.test(a)) {
-            -
            			self.size.width = os.width + ox;
-            -
            			self.size.height = os.height + oy;
-            -
            			self.position.top = op.top - oy;
-            -
            		}
-            -
            		else if (/^(sw)$/.test(a)) {
-            -
            			self.size.width = os.width + ox;
-            -
            			self.size.height = os.height + oy;
-            -
            			self.position.left = op.left - ox;
-            -
            		}
-            -
            		else {
-            -
            			self.size.width = os.width + ox;
-            -
            			self.size.height = os.height + oy;
-            -
            			self.position.top = op.top - oy;
-            -
            			self.position.left = op.left - ox;
+            		}
+            	}
             });
-            -
            var num = function(v) {
-            -
            	return parseInt(v, 10) || 0;
-            -
            };
-            -
-            -
            var isNumber = function(value) {
-            -
            	return !isNaN(parseInt(value, 10));
-            -
            };
-            -
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Selectable 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Selectables
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
             (function( $, undefined ) {
             $.widget("ui.selectable", $.ui.mouse, {
             	options: {
-            -
            		appendTo: 'body',
             		autoRefresh: true,
             		distance: 0,
-            -
            		filter: '*',
-            -
            		tolerance: 'touch'
             	},
             	_create: function() {
-            -
            		var self = this;
             		this.element.addClass("ui-selectable");
             		this.dragged = false;
             		// cache selectee children based on filter
-            -
            		var selectees;
             		this.refresh = function() {
-            -
            			selectees = $(self.options.filter, self.element[0]);
             			selectees.addClass("ui-selectee");
             			selectees.each(function() {
-            -
            				var $this = $(this);
-            -
            				var pos = $this.offset();
             				$.data(this, "selectable-item", {
             					element: this,
             					$element: $this,
@@ -3054,9 +3254,9 @@ $.widget("ui.selectable", $.ui.mouse, {
             					right: pos.left + $this.outerWidth(),
             					bottom: pos.top + $this.outerHeight(),
             					startselected: false,
-            -
            					selected: $this.hasClass('ui-selected'),
-            -
            					selecting: $this.hasClass('ui-selecting'),
-            -
            					unselecting: $this.hasClass('ui-unselecting')
             				});
             			});
             		};
@@ -3069,28 +3269,24 @@ $.widget("ui.selectable", $.ui.mouse, {
             		this.helper = $("<div class='ui-selectable-helper'></div>");
             	},
-            -
            	destroy: function() {
             		this.selectees
             			.removeClass("ui-selectee")
             			.removeData("selectable-item");
             		this.element
-            -
            			.removeClass("ui-selectable ui-selectable-disabled")
-            -
            			.removeData("selectable")
-            -
            			.unbind(".selectable");
             		this._mouseDestroy();
-            -
-            -
            		return this;
             	},
             	_mouseStart: function(event) {
-            -
            		var self = this;
             		this.opos = [event.pageX, event.pageY];
-            -
            		if (this.options.disabled)
             			return;
-            -
-            -
            		var options = this.options;
             		this.selectees = $(options.filter, this.element[0]);
@@ -3099,8 +3295,8 @@ $.widget("ui.selectable", $.ui.mouse, {
             		$(options.appendTo).append(this.helper);
             		// position helper (lasso)
             		this.helper.css({
-            -
            			"left": event.clientX,
-            -
            			"top": event.clientY,
             			"width": 0,
             			"height": 0
             		});
@@ -3109,25 +3305,26 @@ $.widget("ui.selectable", $.ui.mouse, {
             			this.refresh();
+            		}
-            -
            		this.selectees.filter('.ui-selected').each(function() {
             			var selectee = $.data(this, "selectable-item");
             			selectee.startselected = true;
             			if (!event.metaKey && !event.ctrlKey) {
-            -
            				selectee.$element.removeClass('ui-selected');
             				selectee.selected = false;
-            -
            				selectee.$element.addClass('ui-unselecting');
             				selectee.unselecting = true;
             				// selectable UNSELECTING callback
-            -
            				self._trigger("unselecting", event, {
             					unselecting: selectee.element
             				});
+            			}
             		});
-            -
            		$(event.target).parents().andSelf().each(function() {
-            -
            			var selectee = $.data(this, "selectable-item");
             			if (selectee) {
-            -
            				var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
             				selectee.$element
             					.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
             					.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
@@ -3136,11 +3333,11 @@ $.widget("ui.selectable", $.ui.mouse, {
             				selectee.selected = doSelect;
             				// selectable (UN)SELECTING callback
             				if (doSelect) {
-            -
            					self._trigger("selecting", event, {
             						selecting: selectee.element
             					});
             				} else {
-            -
            					self._trigger("unselecting", event, {
             						unselecting: selectee.element
             					});
+            				}
@@ -3151,46 +3348,55 @@ $.widget("ui.selectable", $.ui.mouse, {
             	},
             	_mouseDrag: function(event) {
-            -
            		var self = this;
             		this.dragged = true;
-            -
            		if (this.options.disabled)
             			return;
-            -
            		var options = this.options;
-            -
            		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
-            -
            		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
-            -
            		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
             		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
             		this.selectees.each(function() {
-            -
            			var selectee = $.data(this, "selectable-item");
             			//prevent helper from being selected if appendTo: selectable
-            -
            			if (!selectee || selectee.element == self.element[0])
             				return;
-            -
            			var hit = false;
-            -
            			if (options.tolerance == 'touch') {
             				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
-            -
            			} else if (options.tolerance == 'fit') {
             				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+            			}
             			if (hit) {
             				// SELECT
             				if (selectee.selected) {
-            -
            					selectee.$element.removeClass('ui-selected');
             					selectee.selected = false;
+            				}
             				if (selectee.unselecting) {
-            -
            					selectee.$element.removeClass('ui-unselecting');
             					selectee.unselecting = false;
+            				}
             				if (!selectee.selecting) {
-            -
            					selectee.$element.addClass('ui-selecting');
             					selectee.selecting = true;
             					// selectable SELECTING callback
-            -
            					self._trigger("selecting", event, {
             						selecting: selectee.element
             					});
+            				}
@@ -3198,32 +3404,32 @@ $.widget("ui.selectable", $.ui.mouse, {
             				// UNSELECT
             				if (selectee.selecting) {
             					if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
-            -
            						selectee.$element.removeClass('ui-selecting');
             						selectee.selecting = false;
-            -
            						selectee.$element.addClass('ui-selected');
             						selectee.selected = true;
             					} else {
-            -
            						selectee.$element.removeClass('ui-selecting');
             						selectee.selecting = false;
             						if (selectee.startselected) {
-            -
            							selectee.$element.addClass('ui-unselecting');
             							selectee.unselecting = true;
+            						}
             						// selectable UNSELECTING callback
-            -
            						self._trigger("unselecting", event, {
             							unselecting: selectee.element
             						});
+            					}
+            				}
             				if (selectee.selected) {
             					if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
-            -
            						selectee.$element.removeClass('ui-selected');
             						selectee.selected = false;
-            -
            						selectee.$element.addClass('ui-unselecting');
             						selectee.unselecting = true;
             						// selectable UNSELECTING callback
-            -
            						self._trigger("unselecting", event, {
             							unselecting: selectee.element
             						});
+            					}
@@ -3235,28 +3441,26 @@ $.widget("ui.selectable", $.ui.mouse, {
             	},
             	_mouseStop: function(event) {
-            -
            		var self = this;
             		this.dragged = false;
-            -
            		var options = this.options;
-            -
-            -
            		$('.ui-unselecting', this.element[0]).each(function() {
             			var selectee = $.data(this, "selectable-item");
-            -
            			selectee.$element.removeClass('ui-unselecting');
             			selectee.unselecting = false;
             			selectee.startselected = false;
-            -
            			self._trigger("unselected", event, {
             				unselected: selectee.element
             			});
             		});
-            -
            		$('.ui-selecting', this.element[0]).each(function() {
             			var selectee = $.data(this, "selectable-item");
-            -
            			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
             			selectee.selecting = false;
             			selectee.selected = true;
             			selectee.startselected = true;
-            -
            			self._trigger("selected", event, {
             				selected: selectee.element
             			});
             		});
@@ -3269,35 +3473,30 @@ $.widget("ui.selectable", $.ui.mouse, {
             });
-            -
            $.extend($.ui.selectable, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Sortable 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Sortables
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
             (function( $, undefined ) {
             $.widget("ui.sortable", $.ui.mouse, {
             	widgetEventPrefix: "sort",
             	options: {
             		appendTo: "parent",
             		axis: false,
             		connectWith: false,
             		containment: false,
-            -
            		cursor: 'auto',
             		cursorAt: false,
             		dropOnEmpty: true,
             		forcePlaceholderSize: false,
@@ -3305,7 +3504,7 @@ $.widget("ui.sortable", $.ui.mouse, {
             		grid: false,
             		handle: false,
             		helper: "original",
-            -
            		items: '> *',
             		opacity: false,
             		placeholder: false,
             		revert: false,
@@ -3314,7 +3513,21 @@ $.widget("ui.sortable", $.ui.mouse, {
             		scrollSpeed: 20,
             		scope: "default",
             		tolerance: "intersect",
-            -
            		zIndex: 1000
             	},
             	_create: function() {
@@ -3326,7 +3539,7 @@ $.widget("ui.sortable", $.ui.mouse, {
             		this.refresh();
             		//Let's determine if the items are being displayed horizontally
-            -
            		this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
             		//Let's determine the parent's offset
             		this.offset = this.element.offset();
@@ -3334,15 +3547,19 @@ $.widget("ui.sortable", $.ui.mouse, {
             		//Initialize mouse events for interaction
             		this._mouseInit();
             	},
-            -
            	destroy: function() {
             		this.element
             			.removeClass("ui-sortable ui-sortable-disabled");
             		this._mouseDestroy();
-            -
            		for ( var i = this.items.length - 1; i >= 0; i-- )
             			this.items[i].item.removeData(this.widgetName + "-item");
             		return this;
             	},
@@ -3350,9 +3567,8 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_setOption: function(key, value){
             		if ( key === "disabled" ) {
             			this.options[ key ] = value;
-            -
-            -
            			this.widget()
-            -
            				[ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
             		} else {
             			// Don't call widget base _setOption for disable as it adds ui-state-disabled class
             			$.Widget.prototype._setOption.apply(this, arguments);
@@ -3360,32 +3576,44 @@ $.widget("ui.sortable", $.ui.mouse, {
             	},
             	_mouseCapture: function(event, overrideHandle) {
-            -
            		var that = this;
             		if (this.reverting) {
             			return false;
+            		}
-            -
            		if(this.options.disabled || this.options.type == 'static') return false;
             		//We have to refresh the items data once first
             		this._refreshItems(event);
             		//Find out if the clicked node (or one of its parents) is a actual item in this.items
-            -
            		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
-            -
            			if($.data(this, that.widgetName + '-item') == self) {
             				currentItem = $(this);
             				return false;
+            			}
             		});
-            -
            		if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target);
-            -
            		if(!currentItem) return false;
             		if(this.options.handle && !overrideHandle) {
-            -
            			var validHandle = false;
-            -
-            -
            			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
-            -
            			if(!validHandle) return false;
+            		}
             		this.currentItem = currentItem;
@@ -3396,7 +3624,9 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_mouseStart: function(event, overrideHandle, noActivation) {
-            -
            		var o = this.options, self = this;
             		this.currentContainer = this;
             		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
@@ -3426,11 +3656,6 @@ $.widget("ui.sortable", $.ui.mouse, {
             			left: this.offset.left - this.margins.left
             		};
-            -
            		// Only after we got the offset, we can change the helper's position to absolute
-            -
            		// TODO: Still need to figure out a way to make relative sorting possible
-            -
            		this.helper.css("position", "absolute");
-            -
            		this.cssPosition = this.helper.css("position");
-            -
             		$.extend(this.offset, {
             			click: { //Where the click happened, relative to the element
             				left: event.pageX - this.offset.left,
@@ -3440,19 +3665,24 @@ $.widget("ui.sortable", $.ui.mouse, {
             			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
             		});
             		//Generate the original position
             		this.originalPosition = this._generatePosition(event);
             		this.originalPageX = event.pageX;
             		this.originalPageY = event.pageY;
-            -
            		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
             		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
             		//Cache the former DOM position
             		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
             		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
-            -
            		if(this.helper[0] != this.currentItem[0]) {
             			this.currentItem.hide();
+            		}
@@ -3460,47 +3690,63 @@ $.widget("ui.sortable", $.ui.mouse, {
             		this._createPlaceholder();
             		//Set a containment if given in the options
-            -
            		if(o.containment)
             			this._setContainment();
-            -
            		if(o.cursor) { // cursor option
-            -
            			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
-            -
            			$('body').css("cursor", o.cursor);
+            		}
             		if(o.opacity) { // opacity option
-            -
            			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
             			this.helper.css("opacity", o.opacity);
+            		}
             		if(o.zIndex) { // zIndex option
-            -
            			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
             			this.helper.css("zIndex", o.zIndex);
+            		}
             		//Prepare scrolling
-            -
            		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
             			this.overflowOffset = this.scrollParent.offset();
             		//Call callbacks
             		this._trigger("start", event, this._uiHash());
             		//Recache the helper size
-            -
            		if(!this._preserveHelperProportions)
             			this._cacheHelperProportions();
-            -
            		//Post 'activate' events to possible containers
-            -
            		if(!noActivation) {
-            -
            			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+            		}
             		//Prepare possible droppables
-            -
            		if($.ui.ddmanager)
             			$.ui.ddmanager.current = this;
-            -
            		if ($.ui.ddmanager && !o.dropBehaviour)
             			$.ui.ddmanager.prepareOffsets(this, event);
             		this.dragging = true;
@@ -3511,6 +3757,9 @@ $.widget("ui.sortable", $.ui.mouse, {
             	},
             	_mouseDrag: function(event) {
             		//Compute the helpers position
             		this.position = this._generatePosition(event);
@@ -3522,61 +3771,86 @@ $.widget("ui.sortable", $.ui.mouse, {
             		//Do scrolling
             		if(this.options.scroll) {
-            -
            			var o = this.options, scrolled = false;
-            -
            			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
-            -
            				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
             					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
-            -
            				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
             					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
-            -
            				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
             					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
-            -
            				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
             					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
             			} else {
-            -
            				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
             					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
-            -
            				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
             					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
-            -
            				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
             					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
-            -
            				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
             					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+            			}
-            -
            			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
             				$.ui.ddmanager.prepareOffsets(this, event);
+            		}
             		//Regenerate the absolute position used for position checks
             		this.positionAbs = this._convertPositionTo("absolute");
             		//Set the helper position
-            -
            		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
-            -
            		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
             		//Rearrange
-            -
            		for (var i = this.items.length - 1; i >= 0; i--) {
             			//Cache variables and intersection, continue if no intersection
-            -
            			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
-            -
            			if (!intersection) continue;
-            -
-            -
            			if(itemElement != this.currentItem[0] //cannot intersect with itself
-            -
            				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
-            -
            				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
-            -
            				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
-            -
            				//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
             			) {
-            -
            				this.direction = intersection == 1 ? "down" : "up";
-            -
            				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
             					this._rearrange(event, item);
             				} else {
             					break;
@@ -3591,10 +3865,12 @@ $.widget("ui.sortable", $.ui.mouse, {
             		this._contactContainers(event);
             		//Interconnect with droppables
-            -
            		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
             		//Call callbacks
-            -
            		this._trigger('sort', event, this._uiHash());
             		this.lastPositionAbs = this.positionAbs;
             		return false;
@@ -3603,23 +3879,30 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_mouseStop: function(event, noPropagation) {
-            -
            		if(!event) return;
             		//If we are using droppables, inform the manager about the drop
-            -
            		if ($.ui.ddmanager && !this.options.dropBehaviour)
             			$.ui.ddmanager.drop(this, event);
             		if(this.options.revert) {
-            -
            			var self = this;
-            -
            			var cur = self.placeholder.offset();
-            -
            			self.reverting = true;
-            -
-            -
            			$(this.helper).animate({
-            -
            				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
-            -
            				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
-            -
            			}, parseInt(this.options.revert, 10) || 500, function() {
-            -
            				self._clear(event);
             			});
             		} else {
             			this._clear(event, noPropagation);
@@ -3631,22 +3914,21 @@ $.widget("ui.sortable", $.ui.mouse, {
             	cancel: function() {
-            -
            		var self = this;
-            -
             		if(this.dragging) {
             			this._mouseUp({ target: null });
-            -
            			if(this.options.helper == "original")
             				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
-            -
            			else
             				this.currentItem.show();
             			//Post deactivating events to containers
             			for (var i = this.containers.length - 1; i >= 0; i--){
-            -
            				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
             				if(this.containers[i].containerCache.over) {
-            -
            					this.containers[i]._trigger("out", null, self._uiHash(this));
             					this.containers[i].containerCache.over = 0;
+            				}
+            			}
@@ -3655,8 +3937,12 @@ $.widget("ui.sortable", $.ui.mouse, {
             		if (this.placeholder) {
             			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
-            -
            			if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-            -
            			if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
             			$.extend(this, {
             				helper: null,
@@ -3678,28 +3964,33 @@ $.widget("ui.sortable", $.ui.mouse, {
             	serialize: function(o) {
-            -
            		var items = this._getItemsAsjQuery(o && o.connected);
-            -
            		var str = []; o = o || {};
             		$(items).each(function() {
-            -
            			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
-            -
            			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
             		});
             		if(!str.length && o.key) {
-            -
            			str.push(o.key + '=');
+            		}
-            -
            		return str.join('&');
             	},
             	toArray: function(o) {
-            -
            		var items = this._getItemsAsjQuery(o && o.connected);
-            -
            		var ret = []; o = o || {};
-            -
            		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
             		return ret;
             	},
@@ -3710,73 +4001,71 @@ $.widget("ui.sortable", $.ui.mouse, {
             		var x1 = this.positionAbs.left,
             			x2 = x1 + this.helperProportions.width,
             			y1 = this.positionAbs.top,
-            -
            			y2 = y1 + this.helperProportions.height;
-            -
-            -
            		var l = item.left,
             			r = l + item.width,
             			t = item.top,
-            -
            			b = t + item.height;
-            -
-            -
            		var dyClick = this.offset.click.top,
-            -
            			dxClick = this.offset.click.left;
-            -
-            -
            		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
-            -
-            -
            		if(	   this.options.tolerance == "pointer"
-            -
            			|| this.options.forcePointerForContainers
-            -
            			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
             		) {
             			return isOverElement;
             		} else {
-            -
            			return (l < x1 + (this.helperProportions.width / 2) // Right Half
-            -
            				&& x2 - (this.helperProportions.width / 2) < r // Left Half
-            -
            				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
-            -
            				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
+            		}
             	},
             	_intersectsWithPointer: function(item) {
-            -
            		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
-            -
            			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
             			isOverElement = isOverElementHeight && isOverElementWidth,
             			verticalDirection = this._getDragVerticalDirection(),
             			horizontalDirection = this._getDragHorizontalDirection();
-            -
            		if (!isOverElement)
             			return false;
             		return this.floating ?
-            -
            			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
-            -
            			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
             	},
             	_intersectsWithSides: function(item) {
-            -
            		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
-            -
            			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
             			verticalDirection = this._getDragVerticalDirection(),
             			horizontalDirection = this._getDragHorizontalDirection();
             		if (this.floating && horizontalDirection) {
-            -
            			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
             		} else {
-            -
            			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+            		}
             	},
             	_getDragVerticalDirection: function() {
             		var delta = this.positionAbs.top - this.lastPositionAbs.top;
-            -
            		return delta != 0 && (delta > 0 ? "down" : "up");
             	},
             	_getDragHorizontalDirection: function() {
             		var delta = this.positionAbs.left - this.lastPositionAbs.left;
-            -
            		return delta != 0 && (delta > 0 ? "right" : "left");
             	},
             	refresh: function(event) {
@@ -3787,37 +4076,35 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_connectWith: function() {
             		var options = this.options;
-            -
            		return options.connectWith.constructor == String
-            -
            			? [options.connectWith]
-            -
            			: options.connectWith;
             	},
-            -
             	_getItemsAsjQuery: function(connected) {
-            -
            		var self = this;
-            -
            		var items = [];
-            -
            		var queries = [];
-            -
            		var connectWith = this._connectWith();
             		if(connectWith && connected) {
-            -
            			for (var i = connectWith.length - 1; i >= 0; i--){
-            -
            				var cur = $(connectWith[i]);
-            -
            				for (var j = cur.length - 1; j >= 0; j--){
-            -
            					var inst = $.data(cur[j], this.widgetName);
-            -
            					if(inst && inst != this && !inst.options.disabled) {
-            -
            						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+            					}
-            -
            				};
-            -
            			};
+            		}
-            -
            		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
-            -
            		for (var i = queries.length - 1; i >= 0; i--){
             			queries[i][0].each(function() {
             				items.push(this);
             			});
-            -
            		};
             		return $(items);
@@ -3827,14 +4114,14 @@ $.widget("ui.sortable", $.ui.mouse, {
             		var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
-            -
            		for (var i=0; i < this.items.length; i++) {
-            -
             			for (var j=0; j < list.length; j++) {
-            -
            				if(list[j] == this.items[i].item[0])
-            -
            					this.items.splice(i,1);
-            -
            			};
-            -
-            -
            		};
             	},
@@ -3842,32 +4129,33 @@ $.widget("ui.sortable", $.ui.mouse, {
             		this.items = [];
             		this.containers = [this];
-            -
            		var items = this.items;
-            -
            		var self = this;
-            -
            		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
-            -
            		var connectWith = this._connectWith();
-            -
-            -
            		if(connectWith) {
-            -
            			for (var i = connectWith.length - 1; i >= 0; i--){
-            -
            				var cur = $(connectWith[i]);
-            -
            				for (var j = cur.length - 1; j >= 0; j--){
-            -
            					var inst = $.data(cur[j], this.widgetName);
-            -
            					if(inst && inst != this && !inst.options.disabled) {
             						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
             						this.containers.push(inst);
+            					}
-            -
            				};
-            -
            			};
+            		}
-            -
            		for (var i = queries.length - 1; i >= 0; i--) {
-            -
            			var targetData = queries[i][1];
-            -
            			var _queries = queries[i][0];
-            -
            			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
-            -
            				var item = $(_queries[j]);
-            -
            				item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager)
             				items.push({
             					item: item,
@@ -3875,8 +4163,8 @@ $.widget("ui.sortable", $.ui.mouse, {
             					width: 0, height: 0,
             					left: 0, top: 0
             				});
-            -
            			};
-            -
            		};
             	},
@@ -3887,105 +4175,124 @@ $.widget("ui.sortable", $.ui.mouse, {
             			this.offset.parent = this._getParentOffset();
+            		}
-            -
            		for (var i = this.items.length - 1; i >= 0; i--){
-            -
            			var item = this.items[i];
             			//We ignore calculating positions of all connected containers when we're not over them
-            -
            			if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
             				continue;
-            -
            			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
             			if (!fast) {
             				item.width = t.outerWidth();
             				item.height = t.outerHeight();
+            			}
-            -
            			var p = t.offset();
             			item.left = p.left;
             			item.top = p.top;
-            -
            		};
             		if(this.options.custom && this.options.custom.refreshContainers) {
             			this.options.custom.refreshContainers.call(this);
             		} else {
-            -
            			for (var i = this.containers.length - 1; i >= 0; i--){
-            -
            				var p = this.containers[i].element.offset();
             				this.containers[i].containerCache.left = p.left;
             				this.containers[i].containerCache.top = p.top;
             				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
             				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
-            -
            			};
+            		}
             		return this;
             	},
             	_createPlaceholder: function(that) {
-            -
            		var self = that || this, o = self.options;
-            -
-            -
            		if(!o.placeholder || o.placeholder.constructor == String) {
-            -
            			var className = o.placeholder;
             			o.placeholder = {
             				element: function() {
-            -
            					var el = $(document.createElement(self.currentItem[0].nodeName))
-            -
            						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
-            -
            						.removeClass("ui-sortable-helper")[0];
-            -
            					if(!className)
-            -
            						el.style.visibility = "hidden";
-            -
            					return el;
             				},
             				update: function(container, p) {
             					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
             					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
-            -
            					if(className && !o.forcePlaceholderSize) return;
             					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
-            -
            					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
-            -
            					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+            				}
             			};
+            		}
             		//Create the placeholder
-            -
            		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
             		//Append it after the actual current item
-            -
            		self.currentItem.after(self.placeholder);
             		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
-            -
            		o.placeholder.update(self, self.placeholder);
             	},
             	_contactContainers: function(event) {
-            -
-            -
            		// get innermost container that intersects with item
-            -
            		var innermostContainer = null, innermostIndex = null;
-            -
-            -
-            -
            		for (var i = this.containers.length - 1; i >= 0; i--){
-            -
-            -
            			// never consider a container that's located within the item itself
-            -
            			if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
-            -
            				continue;
-            -
            			if(this._intersectsWith(this.containers[i].containerCache)) {
-            -
            				// if we've already found a container and it's more "inner" than this, then continue
-            -
            				if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
             					continue;
-            -
            				innermostContainer = this.containers[i];
             				innermostIndex = i;
-            -
             			} else {
-            -
            				// container doesn't intersect. trigger "out" event if necessary
             				if(this.containers[i].containerCache.over) {
             					this.containers[i]._trigger("out", event, this._uiHash(this));
             					this.containers[i].containerCache.over = 0;
@@ -3993,79 +4300,116 @@ $.widget("ui.sortable", $.ui.mouse, {
+            			}
+            		}
-            -
-            -
            		// if no intersecting containers found, return
-            -
            		if(!innermostContainer) return;
             		// move the item into the container if it's not there already
             		if(this.containers.length === 1) {
             			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
             			this.containers[innermostIndex].containerCache.over = 1;
-            -
            		} else if(this.currentContainer != this.containers[innermostIndex]) {
-            -
-            -
            			//When entering a new container, we will find the item with the least distance and append our item near it
-            -
            			var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
-            -
            			for (var j = this.items.length - 1; j >= 0; j--) {
-            -
            				if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
-            -
            				var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
-            -
            				if(Math.abs(cur - base) < dist) {
-            -
            					dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
-            -
            				}
-            -
            			}
-            -
-            -
            			if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
-            -
            				return;
-            -
-            -
            			this.currentContainer = this.containers[innermostIndex];
-            -
            			itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
-            -
            			this._trigger("change", event, this._uiHash());
-            -
            			this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
-            -
-            -
            			//Update the placeholder
-            -
            			this.options.placeholder.update(this.currentContainer, this.placeholder);
-            -
-            -
            			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
-            -
            			this.containers[innermostIndex].containerCache.over = 1;
-            -
            		}
-            -
-            -
             	},
             	_createHelper: function(event) {
-            -
            		var o = this.options;
-            -
            		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
-            -
            		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
-            -
            			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
-            -
            		if(helper[0] == this.currentItem[0])
             			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
-            -
            		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
-            -
            		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
             		return helper;
             	},
             	_adjustOffsetFromHelper: function(obj) {
-            -
            		if (typeof obj == 'string') {
-            -
            			obj = obj.split(' ');
+            		}
             		if ($.isArray(obj)) {
             			obj = {left: +obj[0], top: +obj[1] || 0};
+            		}
-            -
            		if ('left' in obj) {
             			this.offset.click.left = obj.left + this.margins.left;
+            		}
-            -
            		if ('right' in obj) {
             			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+            		}
-            -
            		if ('top' in obj) {
             			this.offset.click.top = obj.top + this.margins.top;
+            		}
-            -
            		if ('bottom' in obj) {
             			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+            		}
             	},
@@ -4081,14 +4425,16 @@ $.widget("ui.sortable", $.ui.mouse, {
             		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
             		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
             		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
-            -
            		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
             			po.left += this.scrollParent.scrollLeft();
             			po.top += this.scrollParent.scrollTop();
+            		}
-            -
            		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
-            -
            		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
             			po = { top: 0, left: 0 };
             		return {
             			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
@@ -4099,7 +4445,7 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_getRelativeOffset: function() {
-            -
            		if(this.cssPosition == "relative") {
             			var p = this.currentItem.position();
             			return {
             				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
@@ -4127,19 +4473,24 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_setContainment: function() {
-            -
            		var o = this.options;
-            -
            		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
-            -
            		if(o.containment == 'document' || o.containment == 'window') this.containment = [
-            -
            			0 - this.offset.relative.left - this.offset.parent.left,
-            -
            			0 - this.offset.relative.top - this.offset.parent.top,
-            -
            			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
-            -
            			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
-            -
            		];
             		if(!(/^(document|window|parent)$/).test(o.containment)) {
-            -
            			var ce = $(o.containment)[0];
-            -
            			var co = $(o.containment).offset();
-            -
            			var over = ($(ce).css("overflow") != 'hidden');
             			this.containment = [
             				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
@@ -4153,22 +4504,25 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_convertPositionTo: function(d, pos) {
-            -
            		if(!pos) pos = this.position;
-            -
            		var mod = d == "absolute" ? 1 : -1;
-            -
            		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
             		return {
             			top: (
-            -
            				pos.top																	// The absolute mouse position
-            -
            				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
-            -
            				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
             			),
             			left: (
-            -
            				pos.left																// The absolute mouse position
-            -
            				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
-            -
            				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+            			)
             		};
@@ -4176,19 +4530,20 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_generatePosition: function(event) {
-            -
            		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
             		// This is another very weird special case that only happens for relative elements:
             		// 1. If the css position is relative
             		// 2. and the scroll parent is the document or similar to the offset parent
             		// we have to refresh the relative offset during the scroll so there are no jumps
-            -
            		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
             			this.offset.relative = this._getRelativeOffset();
+            		}
-            -
            		var pageX = event.pageX;
-            -
            		var pageY = event.pageY;
-            -
             		/*
             		 * - Position constraining -
             		 * Constrain the position to a mix of grid, containment.
@@ -4197,36 +4552,44 @@ $.widget("ui.sortable", $.ui.mouse, {
             		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
             			if(this.containment) {
-            -
            				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
-            -
            				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
-            -
            				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
-            -
            				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+            			}
             			if(o.grid) {
-            -
            				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
-            -
            				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-            -
            				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
-            -
            				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+            			}
+            		}
             		return {
             			top: (
-            -
            				pageY																// The absolute mouse position
-            -
            				- this.offset.click.top													// Click offset (relative to the element)
-            -
            				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
-            -
            				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
             			),
             			left: (
-            -
            				pageX																// The absolute mouse position
-            -
            				- this.offset.click.left												// Click offset (relative to the element)
-            -
            				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
-            -
            				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
-            -
            				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+            			)
             		};
@@ -4234,7 +4597,7 @@ $.widget("ui.sortable", $.ui.mouse, {
             	_rearrange: function(event, i, a, hardRefresh) {
-            -
            		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
             		//Various things done here to improve the performance:
             		// 1. we create a setTimeout, that calls refreshPositions
@@ -4242,11 +4605,13 @@ $.widget("ui.sortable", $.ui.mouse, {
             		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
             		// 4. this lets only the last addition to the timeout stack through
             		this.counter = this.counter ? ++this.counter : 1;
-            -
            		var self = this, counter = this.counter;
-            -
            		window.setTimeout(function() {
-            -
            			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
-            -
            		},0);
             	},
@@ -4255,37 +4620,50 @@ $.widget("ui.sortable", $.ui.mouse, {
             		this.reverting = false;
             		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
             		// everything else normalized again
-            -
            		var delayedTriggers = [], self = this;
             		// We first have to update the dom position of the actual currentItem
             		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
-            -
            		if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem);
             		this._noFinalSort = null;
-            -
            		if(this.helper[0] == this.currentItem[0]) {
-            -
            			for(var i in this._storedCSS) {
-            -
            				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+            			}
             			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
             		} else {
             			this.currentItem.show();
+            		}
-            -
            		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
-            -
            		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
-            -
            		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
-            -
            			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
-            -
            			for (var i = this.containers.length - 1; i >= 0; i--){
-            -
            				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
-            -
            					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
-            -
            					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
-            -
            				}
-            -
            			};
-            -
            		};
             		//Post events to containers
-            -
            		for (var i = this.containers.length - 1; i >= 0; i--){
-            -
            			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
             			if(this.containers[i].containerCache.over) {
             				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
             				this.containers[i].containerCache.over = 0;
@@ -4293,29 +4671,47 @@ $.widget("ui.sortable", $.ui.mouse, {
+            		}
             		//Do what was originally in plugins
-            -
            		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
-            -
            		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
-            -
            		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
             		this.dragging = false;
             		if(this.cancelHelperRemoval) {
             			if(!noPropagation) {
             				this._trigger("beforeStop", event, this._uiHash());
-            -
            				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
             				this._trigger("stop", event, this._uiHash());
+            			}
             			return false;
+            		}
-            -
            		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
             		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
             		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-            -
            		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
             		if(!noPropagation) {
-            -
            			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
             			this._trigger("stop", event, this._uiHash());
+            		}
@@ -4330,7498 +4726,10262 @@ $.widget("ui.sortable", $.ui.mouse, {
+            		}
             	},
-            -
            	_uiHash: function(inst) {
-            -
            		var self = inst || this;
             		return {
-            -
            			helper: self.helper,
-            -
            			placeholder: self.placeholder || $([]),
-            -
            			position: self.position,
-            -
            			originalPosition: self.originalPosition,
-            -
            			offset: self.positionAbs,
-            -
            			item: self.currentItem,
-            -
            			sender: inst ? inst.element : null
             		};
+            	}
             });
-            -
            $.extend($.ui.sortable, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
             })(jQuery);
-            -
            /*
-            -
             * jQuery UI Accordion 1.8.17
+             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
              * http://jquery.org/license
+             *
-            -
             * http://docs.jquery.com/UI/Accordion
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
              */
-            -
            (function( $, undefined ) {
-            -
            $.widget( "ui.accordion", {
-            -
            	options: {
-            -
            		active: 0,
-            -
            		animated: "slide",
-            -
            		autoHeight: true,
-            -
            		clearStyle: false,
-            -
            		collapsible: false,
-            -
            		event: "click",
-            -
            		fillSpace: false,
-            -
            		header: "> li > :first-child,> :not(li):even",
-            -
            		icons: {
-            -
            			header: "ui-icon-triangle-1-e",
-            -
            			headerSelected: "ui-icon-triangle-1-s"
             		},
-            -
            		navigation: false,
-            -
            		navigationFilter: function() {
-            -
            			return this.href.toLowerCase() === location.href.toLowerCase();
+            		}
             	},
-            -
            	_create: function() {
-            -
            		var self = this,
-            -
            			options = self.options;
-            -
            		self.running = 0;
-            -
            		self.element
-            -
            			.addClass( "ui-accordion ui-widget ui-helper-reset" )
-            -
            			// in lack of child-selectors in CSS
-            -
            			// we need to mark top-LIs in a UL-accordion for some IE-fix
-            -
            			.children( "li" )
-            -
            				.addClass( "ui-accordion-li-fix" );
-            -
            		self.headers = self.element.find( options.header )
-            -
            			.addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
-            -
            			.bind( "mouseenter.accordion", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).addClass( "ui-state-hover" );
-            -
            			})
-            -
            			.bind( "mouseleave.accordion", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).removeClass( "ui-state-hover" );
-            -
            			})
-            -
            			.bind( "focus.accordion", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).addClass( "ui-state-focus" );
-            -
            			})
-            -
            			.bind( "blur.accordion", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).removeClass( "ui-state-focus" );
-            -
            			});
-            -
            		self.headers.next()
-            -
            			.addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
-            -
            		if ( options.navigation ) {
-            -
            			var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
-            -
            			if ( current.length ) {
-            -
            				var header = current.closest( ".ui-accordion-header" );
-            -
            				if ( header.length ) {
-            -
            					// anchor within header
-            -
            					self.active = header;
-            -
            				} else {
-            -
            					// anchor within content
-            -
            					self.active = current.closest( ".ui-accordion-content" ).prev();
-            -
            				}
-            -
            			}
+            		}
-            -
            		self.active = self._findActive( self.active || options.active )
-            -
            			.addClass( "ui-state-default ui-state-active" )
-            -
            			.toggleClass( "ui-corner-all" )
-            -
            			.toggleClass( "ui-corner-top" );
-            -
            		self.active.next().addClass( "ui-accordion-content-active" );
-            -
            		self._createIcons();
-            -
            		self.resize();
-            -
-            -
            		// ARIA
-            -
            		self.element.attr( "role", "tablist" );
-            -
            		self.headers
-            -
            			.attr( "role", "tab" )
-            -
            			.bind( "keydown.accordion", function( event ) {
-            -
            				return self._keydown( event );
-            -
            			})
-            -
            			.next()
-            -
            				.attr( "role", "tabpanel" );
-            -
            		self.headers
-            -
            			.not( self.active || "" )
-            -
            			.attr({
-            -
            				"aria-expanded": "false",
-            -
            				"aria-selected": "false",
-            -
            				tabIndex: -1
-            -
            			})
-            -
            			.next()
-            -
            				.hide();
-            -
            		// make sure at least one header is in the tab order
-            -
            		if ( !self.active.length ) {
-            -
            			self.headers.eq( 0 ).attr( "tabIndex", 0 );
-            -
            		} else {
-            -
            			self.active
-            -
            				.attr({
-            -
            					"aria-expanded": "true",
-            -
            					"aria-selected": "true",
-            -
            					tabIndex: 0
-            -
            				});
+            		}
-            -
            		// only need links in tab order for Safari
-            -
            		if ( !$.browser.safari ) {
-            -
            			self.headers.find( "a" ).attr( "tabIndex", -1 );
+            		}
-            -
            		if ( options.event ) {
-            -
            			self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
-            -
            				self._clickHandler.call( self, event, this );
-            -
            				event.preventDefault();
             			});
+            		}
-            -
            	},
-            -
            	_createIcons: function() {
-            -
            		var options = this.options;
-            -
            		if ( options.icons ) {
-            -
            			$( "<span></span>" )
-            -
            				.addClass( "ui-icon " + options.icons.header )
-            -
            				.prependTo( this.headers );
-            -
            			this.active.children( ".ui-icon" )
-            -
            				.toggleClass(options.icons.header)
-            -
            				.toggleClass(options.icons.headerSelected);
-            -
            			this.element.addClass( "ui-accordion-icons" );
+            		}
             	},
-            -
            	_destroyIcons: function() {
-            -
            		this.headers.children( ".ui-icon" ).remove();
-            -
            		this.element.removeClass( "ui-accordion-icons" );
             	},
-            -
            	destroy: function() {
-            -
            		var options = this.options;
-            -
-            -
            		this.element
-            -
            			.removeClass( "ui-accordion ui-widget ui-helper-reset" )
-            -
            			.removeAttr( "role" );
-            -
            		this.headers
-            -
            			.unbind( ".accordion" )
-            -
            			.removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
-            -
            			.removeAttr( "role" )
-            -
            			.removeAttr( "aria-expanded" )
-            -
            			.removeAttr( "aria-selected" )
-            -
            			.removeAttr( "tabIndex" );
-            -
            		this.headers.find( "a" ).removeAttr( "tabIndex" );
-            -
            		this._destroyIcons();
-            -
            		var contents = this.headers.next()
-            -
            			.css( "display", "" )
-            -
            			.removeAttr( "role" )
-            -
            			.removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
-            -
            		if ( options.autoHeight || options.fillHeight ) {
-            -
            			contents.css( "height", "" );
+            		}
-            -
            		return $.Widget.prototype.destroy.call( this );
             	},
-            -
            	_setOption: function( key, value ) {
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
-            -
-            -
            		if ( key == "active" ) {
-            -
            			this.activate( value );
-            -
            		}
-            -
            		if ( key == "icons" ) {
-            -
            			this._destroyIcons();
-            -
            			if ( value ) {
-            -
            				this._createIcons();
-            -
            			}
-            -
            		}
-            -
            		// #5332 - opacity doesn't cascade to positioned elements in IE
-            -
            		// so we need to add the disabled class to the headers and panels
-            -
            		if ( key == "disabled" ) {
-            -
            			this.headers.add(this.headers.next())
-            -
            				[ value ? "addClass" : "removeClass" ](
-            -
            					"ui-accordion-disabled ui-state-disabled" );
+            		}
             	},
-            -
            	_keydown: function( event ) {
-            -
            		if ( this.options.disabled || event.altKey || event.ctrlKey ) {
-            -
            			return;
+            		}
-            -
            		var keyCode = $.ui.keyCode,
-            -
            			length = this.headers.length,
-            -
            			currentIndex = this.headers.index( event.target ),
-            -
            			toFocus = false;
-            -
            		switch ( event.keyCode ) {
-            -
            			case keyCode.RIGHT:
-            -
            			case keyCode.DOWN:
-            -
            				toFocus = this.headers[ ( currentIndex + 1 ) % length ];
-            -
            				break;
-            -
            			case keyCode.LEFT:
-            -
            			case keyCode.UP:
-            -
            				toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
-            -
            				break;
-            -
            			case keyCode.SPACE:
-            -
            			case keyCode.ENTER:
-            -
            				this._clickHandler( { target: event.target }, event.target );
-            -
            				event.preventDefault();
-            -
            		}
-            -
-            -
            		if ( toFocus ) {
-            -
            			$( event.target ).attr( "tabIndex", -1 );
-            -
            			$( toFocus ).attr( "tabIndex", 0 );
-            -
            			toFocus.focus();
-            -
            			return false;
-            -
            		}
-            -
-            -
            		return true;
             	},
-            -
            	resize: function() {
-            -
            		var options = this.options,
-            -
            			maxHeight;
-            -
            		if ( options.fillSpace ) {
-            -
            			if ( $.browser.msie ) {
-            -
            				var defOverflow = this.element.parent().css( "overflow" );
-            -
            				this.element.parent().css( "overflow", "hidden");
-            -
            			}
-            -
            			maxHeight = this.element.parent().height();
-            -
            			if ($.browser.msie) {
-            -
            				this.element.parent().css( "overflow", defOverflow );
-            -
            			}
-            -
            			this.headers.each(function() {
-            -
            				maxHeight -= $( this ).outerHeight( true );
-            -
            			});
-            -
            			this.headers.next()
-            -
            				.each(function() {
-            -
            					$( this ).height( Math.max( 0, maxHeight -
-            -
            						$( this ).innerHeight() + $( this ).height() ) );
-            -
            				})
-            -
            				.css( "overflow", "auto" );
-            -
            		} else if ( options.autoHeight ) {
-            -
            			maxHeight = 0;
-            -
            			this.headers.next()
-            -
            				.each(function() {
-            -
            					maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
-            -
            				})
-            -
            				.height( maxHeight );
-            -
            		}
-            -
            		return this;
-            -
            	},
-            -
            	activate: function( index ) {
-            -
            		// TODO this gets called on init, changing the option without an explicit call for that
-            -
            		this.options.active = index;
-            -
            		// call clickHandler with custom event
-            -
            		var active = this._findActive( index )[ 0 ];
-            -
            		this._clickHandler( { target: active }, active );
-            -
            		return this;
-            -
            	},
-            -
            	_findActive: function( selector ) {
-            -
            		return selector
-            -
            			? typeof selector === "number"
-            -
            				? this.headers.filter( ":eq(" + selector + ")" )
-            -
            				: this.headers.not( this.headers.not( selector ) )
-            -
            			: selector === false
-            -
            				? $( [] )
-            -
            				: this.headers.filter( ":eq(0)" );
-            -
            	},
-            -
            	// TODO isn't event.target enough? why the separate target argument?
-            -
            	_clickHandler: function( event, target ) {
-            -
            		var options = this.options;
-            -
            		if ( options.disabled ) {
-            -
            			return;
+            		}
-            -
-            -
            		// called only when using activate(false) to close all parts programmatically
-            -
            		if ( !event.target ) {
-            -
            			if ( !options.collapsible ) {
-            -
            				return;
-            -
            			}
-            -
            			this.active
-            -
            				.removeClass( "ui-state-active ui-corner-top" )
-            -
            				.addClass( "ui-state-default ui-corner-all" )
-            -
            				.children( ".ui-icon" )
-            -
            					.removeClass( options.icons.headerSelected )
-            -
            					.addClass( options.icons.header );
-            -
            			this.active.next().addClass( "ui-accordion-content-active" );
-            -
            			var toHide = this.active.next(),
-            -
            				data = {
-            -
            					options: options,
-            -
            					newHeader: $( [] ),
-            -
            					oldHeader: options.active,
-            -
            					newContent: $( [] ),
-            -
            					oldContent: toHide
-            -
            				},
-            -
            				toShow = ( this.active = $( [] ) );
-            -
            			this._toggle( toShow, toHide, data );
-            -
            			return;
+            		}
-            -
            		// get the click target
-            -
            		var clicked = $( event.currentTarget || target ),
-            -
            			clickedIsActive = clicked[0] === this.active[0];
-            -
            		// TODO the option is changed, is that correct?
-            -
            		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
-            -
            		options.active = options.collapsible && clickedIsActive ?
-            -
            			false :
-            -
            			this.headers.index( clicked );
-            -
            		// if animations are still active, or the active header is the target, ignore click
-            -
            		if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
             			return;
+            		}
-            -
            		// find elements to show and hide
-            -
            		var active = this.active,
-            -
            			toShow = clicked.next(),
-            -
            			toHide = this.active.next(),
-            -
            			data = {
-            -
            				options: options,
-            -
            				newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
-            -
            				oldHeader: this.active,
-            -
            				newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
-            -
            				oldContent: toHide
-            -
            			},
-            -
            			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
-            -
-            -
            		// when the call to ._toggle() comes after the class changes
-            -
            		// it causes a very odd bug in IE 8 (see #6720)
-            -
            		this.active = clickedIsActive ? $([]) : clicked;
-            -
            		this._toggle( toShow, toHide, data, clickedIsActive, down );
-            -
-            -
            		// switch classes
-            -
            		active
-            -
            			.removeClass( "ui-state-active ui-corner-top" )
-            -
            			.addClass( "ui-state-default ui-corner-all" )
-            -
            			.children( ".ui-icon" )
-            -
            				.removeClass( options.icons.headerSelected )
-            -
            				.addClass( options.icons.header );
-            -
            		if ( !clickedIsActive ) {
-            -
            			clicked
-            -
            				.removeClass( "ui-state-default ui-corner-all" )
-            -
            				.addClass( "ui-state-active ui-corner-top" )
-            -
            				.children( ".ui-icon" )
-            -
            					.removeClass( options.icons.header )
-            -
            					.addClass( options.icons.headerSelected );
-            -
            			clicked
-            -
            				.next()
-            -
            				.addClass( "ui-accordion-content-active" );
-            -
            		}
-            -
            		return;
-            -
            	},
-            -
            	_toggle: function( toShow, toHide, data, clickedIsActive, down ) {
-            -
            		var self = this,
-            -
            			options = self.options;
-            -
            		self.toShow = toShow;
-            -
            		self.toHide = toHide;
-            -
            		self.data = data;
-            -
            		var complete = function() {
-            -
            			if ( !self ) {
-            -
            				return;
+            			}
-            -
            			return self._completed.apply( self, arguments );
             		};
-            -
            		// trigger changestart event
-            -
            		self._trigger( "changestart", null, self.data );
-            -
            		// count elements to animate
-            -
            		self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
-            -
            		if ( options.animated ) {
-            -
            			var animOptions = {};
-            -
            			if ( options.collapsible && clickedIsActive ) {
-            -
            				animOptions = {
-            -
            					toShow: $( [] ),
-            -
            					toHide: toHide,
-            -
            					complete: complete,
-            -
            					down: down,
-            -
            					autoHeight: options.autoHeight || options.fillSpace
-            -
            				};
-            -
            			} else {
-            -
            				animOptions = {
-            -
            					toShow: toShow,
-            -
            					toHide: toHide,
-            -
            					complete: complete,
-            -
            					down: down,
-            -
            					autoHeight: options.autoHeight || options.fillSpace
-            -
            				};
-            -
            			}
-            -
            			if ( !options.proxied ) {
-            -
            				options.proxied = options.animated;
-            -
            			}
-            -
            			if ( !options.proxiedDuration ) {
-            -
            				options.proxiedDuration = options.duration;
-            -
            			}
-            -
            			options.animated = $.isFunction( options.proxied ) ?
-            -
            				options.proxied( animOptions ) :
-            -
            				options.proxied;
-            -
            			options.duration = $.isFunction( options.proxiedDuration ) ?
-            -
            				options.proxiedDuration( animOptions ) :
-            -
            				options.proxiedDuration;
-            -
            			var animations = $.ui.accordion.animations,
-            -
            				duration = options.duration,
-            -
            				easing = options.animated;
-            -
            			if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
-            -
            				easing = "slide";
+            			}
-            -
            			if ( !animations[ easing ] ) {
-            -
            				animations[ easing ] = function( options ) {
-            -
            					this.slide( options, {
-            -
            						easing: easing,
-            -
            						duration: duration || 700
-            -
            					});
-            -
            				};
+            			}
-            -
            			animations[ easing ]( animOptions );
-            -
            		} else {
-            -
            			if ( options.collapsible && clickedIsActive ) {
-            -
            				toShow.toggle();
-            -
            			} else {
-            -
            				toHide.hide();
-            -
            				toShow.show();
-            -
            			}
-            -
            			complete( true );
-            -
            		}
-            -
            		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
-            -
            		toHide.prev()
-            -
            			.attr({
-            -
            				"aria-expanded": "false",
-            -
            				"aria-selected": "false",
-            -
            				tabIndex: -1
-            -
            			})
-            -
            			.blur();
-            -
            		toShow.prev()
-            -
            			.attr({
-            -
            				"aria-expanded": "true",
-            -
            				"aria-selected": "true",
-            -
            				tabIndex: 0
-            -
            			})
-            -
            			.focus();
-            -
            	},
-            -
            	_completed: function( cancel ) {
-            -
            		this.running = cancel ? 0 : --this.running;
-            -
            		if ( this.running ) {
-            -
            			return;
+            		}
-            -
            		if ( this.options.clearStyle ) {
-            -
            			this.toShow.add( this.toHide ).css({
-            -
            				height: "",
-            -
            				overflow: ""
-            -
            			});
-            -
            		}
-            -
            		// other classes are removed before the animation; this one needs to stay until completed
-            -
            		this.toHide.removeClass( "ui-accordion-content-active" );
-            -
            		// Work around for rendering bug in IE (#5421)
-            -
            		if ( this.toHide.length ) {
-            -
            			this.toHide.parent()[0].className = this.toHide.parent()[0].className;
-            -
            		}
-            -
            		this._trigger( "change", null, this.data );
-            -
            	}
-            -
            });
-            -
            $.extend( $.ui.accordion, {
-            -
            	version: "1.8.17",
-            -
            	animations: {
-            -
            		slide: function( options, additions ) {
-            -
            			options = $.extend({
-            -
            				easing: "swing",
-            -
            				duration: 300
-            -
            			}, options, additions );
-            -
            			if ( !options.toHide.size() ) {
-            -
            				options.toShow.animate({
-            -
            					height: "show",
-            -
            					paddingTop: "show",
-            -
            					paddingBottom: "show"
-            -
            				}, options );
-            -
            				return;
-            -
            			}
-            -
            			if ( !options.toShow.size() ) {
-            -
            				options.toHide.animate({
-            -
            					height: "hide",
-            -
            					paddingTop: "hide",
-            -
            					paddingBottom: "hide"
-            -
            				}, options );
-            -
            				return;
-            -
            			}
-            -
            			var overflow = options.toShow.css( "overflow" ),
-            -
            				percentDone = 0,
-            -
            				showProps = {},
-            -
            				hideProps = {},
-            -
            				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
-            -
            				originalWidth;
-            -
            			// fix width before calculating height of hidden element
-            -
            			var s = options.toShow;
-            -
            			originalWidth = s[0].style.width;
-            -
            			s.width( s.parent().width()
-            -
            				- parseFloat( s.css( "paddingLeft" ) )
-            -
            				- parseFloat( s.css( "paddingRight" ) )
-            -
            				- ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 )
-            -
            				- ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) );
-            -
-            -
            			$.each( fxAttrs, function( i, prop ) {
-            -
            				hideProps[ prop ] = "hide";
-            -
-            -
            				var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
-            -
            				showProps[ prop ] = {
-            -
            					value: parts[ 1 ],
-            -
            					unit: parts[ 2 ] || "px"
-            -
            				};
-            -
            			});
-            -
            			options.toShow.css({ height: 0, overflow: "hidden" }).show();
-            -
            			options.toHide
-            -
            				.filter( ":hidden" )
-            -
            					.each( options.complete )
-            -
            				.end()
-            -
            				.filter( ":visible" )
-            -
            				.animate( hideProps, {
-            -
            				step: function( now, settings ) {
-            -
            					// only calculate the percent when animating height
-            -
            					// IE gets very inconsistent results when animating elements
-            -
            					// with small values, which is common for padding
-            -
            					if ( settings.prop == "height" ) {
-            -
            						percentDone = ( settings.end - settings.start === 0 ) ? 0 :
-            -
            							( settings.now - settings.start ) / ( settings.end - settings.start );
-            -
            					}
-            -
            					options.toShow[ 0 ].style[ settings.prop ] =
-            -
            						( percentDone * showProps[ settings.prop ].value )
-            -
            						+ showProps[ settings.prop ].unit;
-            -
            				},
-            -
            				duration: options.duration,
-            -
            				easing: options.easing,
-            -
            				complete: function() {
-            -
            					if ( !options.autoHeight ) {
-            -
            						options.toShow.css( "height", "" );
-            -
            					}
-            -
            					options.toShow.css({
-            -
            						width: originalWidth,
-            -
            						overflow: overflow
-            -
            					});
-            -
            					options.complete();
+            				}
             			});
-            -
            		},
-            -
            		bounceslide: function( options ) {
-            -
            			this.slide( options, {
-            -
            				easing: options.down ? "easeOutBounce" : "swing",
-            -
            				duration: options.down ? 1000 : 200
             			});
-            -
            		}
+            	}
             });
-            -
            })( jQuery );
-            -
            /*
-            -
             * jQuery UI Autocomplete 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Autocomplete
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
-            -
             *	jquery.ui.position.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
            // used to prevent race conditions with remote data sources
-            -
            var requestIndex = 0;
-            -
            $.widget( "ui.autocomplete", {
-            -
            	options: {
-            -
            		appendTo: "body",
-            -
            		autoFocus: false,
-            -
            		delay: 300,
-            -
            		minLength: 1,
-            -
            		position: {
-            -
            			my: "left top",
-            -
            			at: "left bottom",
-            -
            			collision: "none"
-            -
            		},
-            -
            		source: null
-            -
            	},
-            -
            	pending: 0,
-            -
            	_create: function() {
-            -
            		var self = this,
-            -
            			doc = this.element[ 0 ].ownerDocument,
-            -
            			suppressKeyPress;
-            -
            		this.element
-            -
            			.addClass( "ui-autocomplete-input" )
-            -
            			.attr( "autocomplete", "off" )
-            -
            			// TODO verify these actually work as intended
-            -
            			.attr({
-            -
            				role: "textbox",
-            -
            				"aria-autocomplete": "list",
-            -
            				"aria-haspopup": "true"
-            -
            			})
-            -
            			.bind( "keydown.autocomplete", function( event ) {
-            -
            				if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
-            -
            					return;
+            				}
-            -
-            -
            				suppressKeyPress = false;
-            -
            				var keyCode = $.ui.keyCode;
-            -
            				switch( event.keyCode ) {
-            -
            				case keyCode.PAGE_UP:
-            -
            					self._move( "previousPage", event );
-            -
            					break;
-            -
            				case keyCode.PAGE_DOWN:
-            -
            					self._move( "nextPage", event );
-            -
            					break;
-            -
            				case keyCode.UP:
-            -
            					self._move( "previous", event );
-            -
            					// prevent moving cursor to beginning of text field in some browsers
-            -
            					event.preventDefault();
-            -
            					break;
-            -
            				case keyCode.DOWN:
-            -
            					self._move( "next", event );
-            -
            					// prevent moving cursor to end of text field in some browsers
-            -
            					event.preventDefault();
-            -
            					break;
-            -
            				case keyCode.ENTER:
-            -
            				case keyCode.NUMPAD_ENTER:
-            -
            					// when menu is open and has focus
-            -
            					if ( self.menu.active ) {
-            -
            						// #6055 - Opera still allows the keypress to occur
-            -
            						// which causes forms to submit
-            -
            						suppressKeyPress = true;
-            -
            						event.preventDefault();
-            -
            					}
-            -
            					//passthrough - ENTER and TAB both select the current element
-            -
            				case keyCode.TAB:
-            -
            					if ( !self.menu.active ) {
-            -
            						return;
-            -
            					}
-            -
            					self.menu.select( event );
-            -
            					break;
-            -
            				case keyCode.ESCAPE:
-            -
            					self.element.val( self.term );
-            -
            					self.close( event );
-            -
            					break;
-            -
            				default:
-            -
            					// keypress is triggered before the input value is changed
-            -
            					clearTimeout( self.searching );
-            -
            					self.searching = setTimeout(function() {
-            -
            						// only search if the value has changed
-            -
            						if ( self.term != self.element.val() ) {
-            -
            							self.selectedItem = null;
-            -
            							self.search( null, event );
-            -
            						}
-            -
            					}, self.options.delay );
-            -
            					break;
-            -
            				}
-            -
            			})
-            -
            			.bind( "keypress.autocomplete", function( event ) {
-            -
            				if ( suppressKeyPress ) {
-            -
            					suppressKeyPress = false;
-            -
            					event.preventDefault();
-            -
            				}
-            -
            			})
-            -
            			.bind( "focus.autocomplete", function() {
-            -
            				if ( self.options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
-            -
            				self.selectedItem = null;
-            -
            				self.previous = self.element.val();
-            -
            			})
-            -
            			.bind( "blur.autocomplete", function( event ) {
-            -
            				if ( self.options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
-            -
            				clearTimeout( self.searching );
-            -
            				// clicks on the menu (or a button to trigger a search) will cause a blur event
-            -
            				self.closing = setTimeout(function() {
-            -
            					self.close( event );
-            -
            					self._change( event );
-            -
            				}, 150 );
-            -
            			});
-            -
            		this._initSource();
-            -
            		this.response = function() {
-            -
            			return self._response.apply( self, arguments );
-            -
            		};
-            -
            		this.menu = $( "<ul></ul>" )
-            -
            			.addClass( "ui-autocomplete" )
-            -
            			.appendTo( $( this.options.appendTo || "body", doc )[0] )
-            -
            			// prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
-            -
            			.mousedown(function( event ) {
-            -
            				// clicking on the scrollbar causes focus to shift to the body
-            -
            				// but we can't detect a mouseup or a click immediately afterward
-            -
            				// so we have to track the next mousedown and close the menu if
-            -
            				// the user clicks somewhere outside of the autocomplete
-            -
            				var menuElement = self.menu.element[ 0 ];
-            -
            				if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
-            -
            					setTimeout(function() {
-            -
            						$( document ).one( 'mousedown', function( event ) {
-            -
            							if ( event.target !== self.element[ 0 ] &&
-            -
            								event.target !== menuElement &&
-            -
            								!$.ui.contains( menuElement, event.target ) ) {
-            -
            								self.close();
-            -
            							}
-            -
            						});
-            -
            					}, 1 );
-            -
            				}
-            -
-            -
            				// use another timeout to make sure the blur-event-handler on the input was already triggered
-            -
            				setTimeout(function() {
-            -
            					clearTimeout( self.closing );
-            -
            				}, 13);
-            -
            			})
-            -
            			.menu({
-            -
            				focus: function( event, ui ) {
-            -
            					var item = ui.item.data( "item.autocomplete" );
-            -
            					if ( false !== self._trigger( "focus", event, { item: item } ) ) {
-            -
            						// use value to match what will end up in the input, if it was a key event
-            -
            						if ( /^key/.test(event.originalEvent.type) ) {
-            -
            							self.element.val( item.value );
-            -
            						}
-            -
            					}
-            -
            				},
-            -
            				selected: function( event, ui ) {
-            -
            					var item = ui.item.data( "item.autocomplete" ),
-            -
            						previous = self.previous;
-            -
-            -
            					// only trigger when focus was lost (click on menu)
-            -
            					if ( self.element[0] !== doc.activeElement ) {
-            -
            						self.element.focus();
-            -
            						self.previous = previous;
-            -
            						// #6109 - IE triggers two focus events and the second
-            -
            						// is asynchronous, so we need to reset the previous
-            -
            						// term synchronously and asynchronously :-(
-            -
            						setTimeout(function() {
-            -
            							self.previous = previous;
-            -
            							self.selectedItem = item;
-            -
            						}, 1);
-            -
            					}
-            -
-            -
            					if ( false !== self._trigger( "select", event, { item: item } ) ) {
-            -
            						self.element.val( item.value );
-            -
            					}
-            -
            					// reset the term after the select event
-            -
            					// this allows custom select handling to work properly
-            -
            					self.term = self.element.val();
-            -
-            -
            					self.close( event );
-            -
            					self.selectedItem = item;
-            -
            				},
-            -
            				blur: function( event, ui ) {
-            -
            					// don't set the value of the text field if it's already correct
-            -
            					// this prevents moving the cursor unnecessarily
-            -
            					if ( self.menu.element.is(":visible") &&
-            -
            						( self.element.val() !== self.term ) ) {
-            -
            						self.element.val( self.term );
-            -
            					}
-            -
            				}
-            -
            			})
-            -
            			.zIndex( this.element.zIndex() + 1 )
-            -
            			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
-            -
            			.css({ top: 0, left: 0 })
-            -
            			.hide()
-            -
            			.data( "menu" );
-            -
            		if ( $.fn.bgiframe ) {
-            -
            			 this.menu.element.bgiframe();
+            		}
-            -
            		// turning off autocomplete prevents the browser from remembering the
-            -
            		// value when navigating through history, so we re-enable autocomplete
-            -
            		// if the page is unloaded before the widget is destroyed. #7790
-            -
            		self.beforeunloadHandler = function() {
-            -
            			self.element.removeAttr( "autocomplete" );
-            -
            		};
-            -
            		$( window ).bind( "beforeunload", self.beforeunloadHandler );
-            -
            	},
-            -
-            -
            	destroy: function() {
-            -
            		this.element
-            -
            			.removeClass( "ui-autocomplete-input" )
-            -
            			.removeAttr( "autocomplete" )
-            -
            			.removeAttr( "role" )
-            -
            			.removeAttr( "aria-autocomplete" )
-            -
            			.removeAttr( "aria-haspopup" );
-            -
            		this.menu.element.remove();
-            -
            		$( window ).unbind( "beforeunload", this.beforeunloadHandler );
-            -
            		$.Widget.prototype.destroy.call( this );
             	},
-            -
            	_setOption: function( key, value ) {
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
-            -
            		if ( key === "source" ) {
-            -
            			this._initSource();
-            -
            		}
-            -
            		if ( key === "appendTo" ) {
-            -
            			this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
-            -
            		}
-            -
            		if ( key === "disabled" && value && this.xhr ) {
-            -
            			this.xhr.abort();
+            		}
             	},
-            -
            	_initSource: function() {
-            -
            		var self = this,
-            -
            			array,
-            -
            			url;
-            -
            		if ( $.isArray(this.options.source) ) {
-            -
            			array = this.options.source;
-            -
            			this.source = function( request, response ) {
-            -
            				response( $.ui.autocomplete.filter(array, request.term) );
-            -
            			};
-            -
            		} else if ( typeof this.options.source === "string" ) {
-            -
            			url = this.options.source;
-            -
            			this.source = function( request, response ) {
-            -
            				if ( self.xhr ) {
-            -
            					self.xhr.abort();
-            -
            				}
-            -
            				self.xhr = $.ajax({
-            -
            					url: url,
-            -
            					data: request,
-            -
            					dataType: "json",
-            -
            					autocompleteRequest: ++requestIndex,
-            -
            					success: function( data, status ) {
-            -
            						if ( this.autocompleteRequest === requestIndex ) {
-            -
            							response( data );
-            -
            						}
-            -
            					},
-            -
            					error: function() {
-            -
            						if ( this.autocompleteRequest === requestIndex ) {
-            -
            							response( [] );
-            -
            						}
-            -
            					}
-            -
            				});
-            -
            			};
-            -
            		} else {
-            -
            			this.source = this.options.source;
+            		}
             	},
-            -
            	search: function( value, event ) {
-            -
            		value = value != null ? value : this.element.val();
-            -
-            -
            		// always save the actual value, not the one passed as an argument
-            -
            		this.term = this.element.val();
-            -
            		if ( value.length < this.options.minLength ) {
-            -
            			return this.close( event );
+            		}
-            -
            		clearTimeout( this.closing );
-            -
            		if ( this._trigger( "search", event ) === false ) {
-            -
            			return;
+            		}
-            -
            		return this._search( value );
-            -
            	},
-            -
            	_search: function( value ) {
-            -
            		this.pending++;
-            -
            		this.element.addClass( "ui-autocomplete-loading" );
-            -
            		this.source( { term: value }, this.response );
-            -
            	},
-            -
            	_response: function( content ) {
-            -
            		if ( !this.options.disabled && content && content.length ) {
-            -
            			content = this._normalize( content );
-            -
            			this._suggest( content );
-            -
            			this._trigger( "open" );
             		} else {
-            -
            			this.close();
-            -
            		}
-            -
            		this.pending--;
-            -
            		if ( !this.pending ) {
-            -
            			this.element.removeClass( "ui-autocomplete-loading" );
-            -
            		}
-            -
            	},
-            -
-            -
            	close: function( event ) {
-            -
            		clearTimeout( this.closing );
-            -
            		if ( this.menu.element.is(":visible") ) {
-            -
            			this.menu.element.hide();
-            -
            			this.menu.deactivate();
-            -
            			this._trigger( "close", event );
-            -
            		}
-            -
            	},
-            -
-            -
            	_change: function( event ) {
-            -
            		if ( this.previous !== this.element.val() ) {
-            -
            			this._trigger( "change", event, { item: this.selectedItem } );
+            		}
-            -
            	},
-            -
            	_normalize: function( items ) {
-            -
            		// assume all items have the right format when the first item is complete
-            -
            		if ( items.length && items[0].label && items[0].value ) {
-            -
            			return items;
-            -
            		}
-            -
            		return $.map( items, function(item) {
-            -
            			if ( typeof item === "string" ) {
-            -
            				return {
-            -
            					label: item,
-            -
            					value: item
-            -
            				};
-            -
            			}
-            -
            			return $.extend({
-            -
            				label: item.label || item.value,
-            -
            				value: item.value || item.label
-            -
            			}, item );
-            -
            		});
             	},
-            -
            	_suggest: function( items ) {
-            -
            		var ul = this.menu.element
-            -
            			.empty()
-            -
            			.zIndex( this.element.zIndex() + 1 );
-            -
            		this._renderMenu( ul, items );
-            -
            		// TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
-            -
            		this.menu.deactivate();
-            -
            		this.menu.refresh();
-            -
            		// size and position menu
-            -
            		ul.show();
-            -
            		this._resizeMenu();
-            -
            		ul.position( $.extend({
-            -
            			of: this.element
-            -
            		}, this.options.position ));
-            -
            		if ( this.options.autoFocus ) {
-            -
            			this.menu.next( new $.Event("mouseover") );
+            		}
-            -
            	},
-            -
            	_resizeMenu: function() {
-            -
            		var ul = this.menu.element;
-            -
            		ul.outerWidth( Math.max(
-            -
            			// Firefox wraps long text (possibly a rounding bug)
-            -
            			// so we add 1px to avoid the wrapping (#7513)
-            -
            			ul.width( "" ).outerWidth() + 1,
-            -
            			this.element.outerWidth()
-            -
            		) );
             	},
-            -
            	_renderMenu: function( ul, items ) {
-            -
            		var self = this;
-            -
            		$.each( items, function( index, item ) {
-            -
            			self._renderItem( ul, item );
             		});
-            -
            	},
-            -
            	_renderItem: function( ul, item) {
-            -
            		return $( "<li></li>" )
-            -
            			.data( "item.autocomplete", item )
-            -
            			.append( $( "<a></a>" ).text( item.label ) )
-            -
            			.appendTo( ul );
-            -
            	},
-            -
            	_move: function( direction, event ) {
-            -
            		if ( !this.menu.element.is(":visible") ) {
-            -
            			this.search( null, event );
-            -
            			return;
-            -
            		}
-            -
            		if ( this.menu.first() && /^previous/.test(direction) ||
-            -
            				this.menu.last() && /^next/.test(direction) ) {
-            -
            			this.element.val( this.term );
-            -
            			this.menu.deactivate();
-            -
            			return;
-            -
            		}
-            -
            		this.menu[ direction ]( event );
-            -
            	},
-            -
            	widget: function() {
-            -
            		return this.menu.element;
+            	}
-            -
            });
-            -
            $.extend( $.ui.autocomplete, {
-            -
            	escapeRegex: function( value ) {
-            -
            		return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
-            -
            	},
-            -
            	filter: function(array, term) {
-            -
            		var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
-            -
            		return $.grep( array, function(value) {
-            -
            			return matcher.test( value.label || value.value || value );
-            -
            		});
+            	}
-            -
            });
-            -
            }( jQuery ));
-            -
            /*
-            -
             * jQuery UI Menu (not officially released)
-            -
             *
-            -
             * This widget isn't yet finished and the API is subject to change. We plan to finish
-            -
             * it for the next release. You're welcome to give it a try anyway and give us feedback,
-            -
             * as long as you're okay with migrating your code later on. We can help with that, too.
-            -
             *
-            -
             * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Menu
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *  jquery.ui.widget.js
-            -
             */
-            -
            (function($) {
-            -
            $.widget("ui.menu", {
-            -
            	_create: function() {
-            -
            		var self = this;
-            -
            		this.element
-            -
            			.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
-            -
            			.attr({
-            -
            				role: "listbox",
-            -
            				"aria-activedescendant": "ui-active-menuitem"
-            -
            			})
-            -
            			.click(function( event ) {
-            -
            				if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
-            -
            					return;
-            -
            				}
-            -
            				// temporary
-            -
            				event.preventDefault();
-            -
            				self.select( event );
-            -
            			});
-            -
            		this.refresh();
-            -
            	},
-            -
-            -
            	refresh: function() {
-            -
            		var self = this;
-            -
-            -
            		// don't refresh list items that are already adapted
-            -
            		var items = this.element.children("li:not(.ui-menu-item):has(a)")
-            -
            			.addClass("ui-menu-item")
-            -
            			.attr("role", "menuitem");
-            -
-            -
            		items.children("a")
-            -
            			.addClass("ui-corner-all")
-            -
            			.attr("tabindex", -1)
-            -
            			// mouseenter doesn't work with event delegation
-            -
            			.mouseenter(function( event ) {
-            -
            				self.activate( event, $(this).parent() );
-            -
            			})
-            -
            			.mouseleave(function() {
-            -
            				self.deactivate();
-            -
            			});
-            -
            	},
-            -
            	activate: function( event, item ) {
-            -
            		this.deactivate();
-            -
            		if (this.hasScroll()) {
-            -
            			var offset = item.offset().top - this.element.offset().top,
-            -
            				scroll = this.element.scrollTop(),
-            -
            				elementHeight = this.element.height();
-            -
            			if (offset < 0) {
-            -
            				this.element.scrollTop( scroll + offset);
-            -
            			} else if (offset >= elementHeight) {
-            -
            				this.element.scrollTop( scroll + offset - elementHeight + item.height());
-            -
            			}
-            -
            		}
-            -
            		this.active = item.eq(0)
-            -
            			.children("a")
-            -
            				.addClass("ui-state-hover")
-            -
            				.attr("id", "ui-active-menuitem")
-            -
            			.end();
-            -
            		this._trigger("focus", event, { item: item });
-            -
            	},
-            -
            	deactivate: function() {
-            -
            		if (!this.active) { return; }
-            -
            		this.active.children("a")
-            -
            			.removeClass("ui-state-hover")
-            -
            			.removeAttr("id");
-            -
            		this._trigger("blur");
-            -
            		this.active = null;
-            -
            	},
-            -
            	next: function(event) {
-            -
            		this.move("next", ".ui-menu-item:first", event);
-            -
            	},
-            -
            	previous: function(event) {
-            -
            		this.move("prev", ".ui-menu-item:last", event);
-            -
            	},
-            -
            	first: function() {
-            -
            		return this.active && !this.active.prevAll(".ui-menu-item").length;
-            -
            	},
-            -
            	last: function() {
-            -
            		return this.active && !this.active.nextAll(".ui-menu-item").length;
-            -
            	},
-            -
            	move: function(direction, edge, event) {
-            -
            		if (!this.active) {
-            -
            			this.activate(event, this.element.children(edge));
-            -
            			return;
-            -
            		}
-            -
            		var next = this.active[direction + "All"](".ui-menu-item").eq(0);
-            -
            		if (next.length) {
-            -
            			this.activate(event, next);
-            -
            		} else {
-            -
            			this.activate(event, this.element.children(edge));
+            		}
-            -
            	},
-            -
            	// TODO merge with previousPage
-            -
            	nextPage: function(event) {
-            -
            		if (this.hasScroll()) {
-            -
            			// TODO merge with no-scroll-else
-            -
            			if (!this.active || this.last()) {
-            -
            				this.activate(event, this.element.children(".ui-menu-item:first"));
-            -
            				return;
+            			}
-            -
            			var base = this.active.offset().top,
-            -
            				height = this.element.height(),
-            -
            				result = this.element.children(".ui-menu-item").filter(function() {
-            -
            					var close = $(this).offset().top - base - height + $(this).height();
-            -
            					// TODO improve approximation
-            -
            					return close < 10 && close > -10;
-            -
            				});
-            -
            			// TODO try to catch this earlier when scrollTop indicates the last page anyway
-            -
            			if (!result.length) {
-            -
            				result = this.element.children(".ui-menu-item:last");
+            			}
-            -
            			this.activate(event, result);
-            -
            		} else {
-            -
            			this.activate(event, this.element.children(".ui-menu-item")
-            -
            				.filter(!this.active || this.last() ? ":first" : ":last"));
+            		}
             	},
-            -
            	// TODO merge with nextPage
-            -
            	previousPage: function(event) {
-            -
            		if (this.hasScroll()) {
-            -
            			// TODO merge with no-scroll-else
-            -
            			if (!this.active || this.first()) {
-            -
            				this.activate(event, this.element.children(".ui-menu-item:last"));
-            -
            				return;
+            			}
-            -
            			var base = this.active.offset().top,
-            -
            				height = this.element.height();
-            -
            				result = this.element.children(".ui-menu-item").filter(function() {
-            -
            					var close = $(this).offset().top - base + height - $(this).height();
-            -
            					// TODO improve approximation
-            -
            					return close < 10 && close > -10;
-            -
            				});
-            -
            			// TODO try to catch this earlier when scrollTop indicates the last page anyway
-            -
            			if (!result.length) {
-            -
            				result = this.element.children(".ui-menu-item:first");
+            			}
-            -
            			this.activate(event, result);
-            -
            		} else {
-            -
            			this.activate(event, this.element.children(".ui-menu-item")
-            -
            				.filter(!this.active || this.first() ? ":last" : ":first"));
-            -
            		}
-            -
            	},
-            -
            	hasScroll: function() {
-            -
            		return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
-            -
            	},
-            -
            	select: function( event ) {
-            -
            		this._trigger("selected", event, { item: this.active });
+            	}
             });
-            -
            }(jQuery));
-            -
            /*
-            -
             * jQuery UI Button 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Button
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
            var lastActive, startXPos, startYPos, clickDragged,
-            -
            	baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
-            -
            	stateClasses = "ui-state-hover ui-state-active ",
-            -
            	typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
-            -
            	formResetHandler = function() {
-            -
            		var buttons = $( this ).find( ":ui-button" );
-            -
            		setTimeout(function() {
-            -
            			buttons.button( "refresh" );
-            -
            		}, 1 );
             	},
-            -
            	radioGroup = function( radio ) {
-            -
            		var name = radio.name,
-            -
            			form = radio.form,
-            -
            			radios = $( [] );
-            -
            		if ( name ) {
-            -
            			if ( form ) {
-            -
            				radios = $( form ).find( "[name='" + name + "']" );
-            -
            			} else {
-            -
            				radios = $( "[name='" + name + "']", radio.ownerDocument )
-            -
            					.filter(function() {
-            -
            						return !this.form;
-            -
            					});
-            -
            			}
-            -
            		}
-            -
            		return radios;
             	};
-            -
            $.widget( "ui.button", {
             	options: {
-            -
            		disabled: null,
-            -
            		text: true,
-            -
            		label: null,
             		icons: {
-            -
            			primary: null,
-            -
            			secondary: null
-            -
            		}
             	},
             	_create: function() {
-            -
            		this.element.closest( "form" )
-            -
            			.unbind( "reset.button" )
-            -
            			.bind( "reset.button", formResetHandler );
-            -
            		if ( typeof this.options.disabled !== "boolean" ) {
-            -
            			this.options.disabled = this.element.propAttr( "disabled" );
+            		}
-            -
            		this._determineButtonType();
-            -
            		this.hasTitle = !!this.buttonElement.attr( "title" );
-            -
            		var self = this,
-            -
            			options = this.options,
-            -
            			toggleButton = this.type === "checkbox" || this.type === "radio",
-            -
            			hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
-            -
            			focusClass = "ui-state-focus";
-            -
            		if ( options.label === null ) {
-            -
            			options.label = this.buttonElement.html();
+            		}
-            -
            		if ( this.element.is( ":disabled" ) ) {
-            -
            			options.disabled = true;
-            -
            		}
-            -
            		this.buttonElement
-            -
            			.addClass( baseClasses )
-            -
            			.attr( "role", "button" )
-            -
            			.bind( "mouseenter.button", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).addClass( "ui-state-hover" );
-            -
            				if ( this === lastActive ) {
-            -
            					$( this ).addClass( "ui-state-active" );
-            -
            				}
-            -
            			})
-            -
            			.bind( "mouseleave.button", function() {
-            -
            				if ( options.disabled ) {
-            -
            					return;
-            -
            				}
-            -
            				$( this ).removeClass( hoverClass );
-            -
            			})
-            -
            			.bind( "click.button", function( event ) {
-            -
            				if ( options.disabled ) {
-            -
            					event.preventDefault();
-            -
            					event.stopImmediatePropagation();
-            -
            				}
-            -
            			});
             		this.element
-            -
            			.bind( "focus.button", function() {
-            -
            				// no need to check disabled, focus won't be triggered anyway
-            -
            				self.buttonElement.addClass( focusClass );
-            -
            			})
-            -
            			.bind( "blur.button", function() {
-            -
            				self.buttonElement.removeClass( focusClass );
-            -
            			});
-            -
            		if ( toggleButton ) {
-            -
            			this.element.bind( "change.button", function() {
-            -
            				if ( clickDragged ) {
-            -
            					return;
+            				}
-            -
            				self.refresh();
-            -
            			});
-            -
            			// if mouse moves between mousedown and mouseup (drag) set clickDragged flag
-            -
            			// prevents issue where button state changes but checkbox/radio checked state
-            -
            			// does not in Firefox (see ticket #6970)
-            -
            			this.buttonElement
-            -
            				.bind( "mousedown.button", function( event ) {
-            -
            					if ( options.disabled ) {
-            -
            						return;
-            -
            					}
-            -
            					clickDragged = false;
-            -
            					startXPos = event.pageX;
-            -
            					startYPos = event.pageY;
-            -
            				})
-            -
            				.bind( "mouseup.button", function( event ) {
-            -
            					if ( options.disabled ) {
-            -
            						return;
-            -
            					}
-            -
            					if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
-            -
            						clickDragged = true;
-            -
            					}
             			});
-            -
            		}
-            -
            		if ( this.type === "checkbox" ) {
-            -
            			this.buttonElement.bind( "click.button", function() {
-            -
            				if ( options.disabled || clickDragged ) {
-            -
            					return false;
+            				}
-            -
            				$( this ).toggleClass( "ui-state-active" );
-            -
            				self.buttonElement.attr( "aria-pressed", self.element[0].checked );
             			});
-            -
            		} else if ( this.type === "radio" ) {
-            -
            			this.buttonElement.bind( "click.button", function() {
-            -
            				if ( options.disabled || clickDragged ) {
-            -
            					return false;
-            -
            				}
-            -
            				$( this ).addClass( "ui-state-active" );
-            -
            				self.buttonElement.attr( "aria-pressed", "true" );
-            -
            				var radio = self.element[ 0 ];
-            -
            				radioGroup( radio )
-            -
            					.not( radio )
-            -
            					.map(function() {
-            -
            						return $( this ).button( "widget" )[ 0 ];
-            -
            					})
-            -
            					.removeClass( "ui-state-active" )
-            -
            					.attr( "aria-pressed", "false" );
-            -
            			});
-            -
            		} else {
-            -
            			this.buttonElement
-            -
            				.bind( "mousedown.button", function() {
-            -
            					if ( options.disabled ) {
-            -
            						return false;
-            -
            					}
-            -
            					$( this ).addClass( "ui-state-active" );
-            -
            					lastActive = this;
-            -
            					$( document ).one( "mouseup", function() {
-            -
            						lastActive = null;
-            -
            					});
-            -
            				})
-            -
            				.bind( "mouseup.button", function() {
-            -
            					if ( options.disabled ) {
-            -
            						return false;
-            -
            					}
-            -
            					$( this ).removeClass( "ui-state-active" );
-            -
            				})
-            -
            				.bind( "keydown.button", function(event) {
-            -
            					if ( options.disabled ) {
-            -
            						return false;
-            -
            					}
-            -
            					if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
-            -
            						$( this ).addClass( "ui-state-active" );
-            -
            					}
-            -
            				})
-            -
            				.bind( "keyup.button", function() {
-            -
            					$( this ).removeClass( "ui-state-active" );
-            -
            				});
-            -
            			if ( this.buttonElement.is("a") ) {
-            -
            				this.buttonElement.keyup(function(event) {
-            -
            					if ( event.keyCode === $.ui.keyCode.SPACE ) {
-            -
            						// TODO pass through original event correctly (just as 2nd argument doesn't work)
-            -
            						$( this ).click();
-            -
            					}
-            -
            				});
+            			}
+            		}
-            -
            		// TODO: pull out $.Widget's handling for the disabled option into
-            -
            		// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
-            -
            		// be overridden by individual plugins
-            -
            		this._setOption( "disabled", options.disabled );
-            -
            		this._resetButton();
-            -
            	},
-            -
-            -
            	_determineButtonType: function() {
-            -
            		if ( this.element.is(":checkbox") ) {
-            -
            			this.type = "checkbox";
-            -
            		} else if ( this.element.is(":radio") ) {
-            -
            			this.type = "radio";
-            -
            		} else if ( this.element.is("input") ) {
-            -
            			this.type = "input";
-            -
            		} else {
-            -
            			this.type = "button";
+            		}
-            -
            		if ( this.type === "checkbox" || this.type === "radio" ) {
-            -
            			// we don't search against the document in case the element
-            -
            			// is disconnected from the DOM
-            -
            			var ancestor = this.element.parents().filter(":last"),
-            -
            				labelSelector = "label[for='" + this.element.attr("id") + "']";
-            -
            			this.buttonElement = ancestor.find( labelSelector );
-            -
            			if ( !this.buttonElement.length ) {
-            -
            				ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
-            -
            				this.buttonElement = ancestor.filter( labelSelector );
-            -
            				if ( !this.buttonElement.length ) {
-            -
            					this.buttonElement = ancestor.find( labelSelector );
-            -
            				}
+            			}
-            -
            			this.element.addClass( "ui-helper-hidden-accessible" );
-            -
            			var checked = this.element.is( ":checked" );
-            -
            			if ( checked ) {
-            -
            				this.buttonElement.addClass( "ui-state-active" );
-            -
            			}
-            -
            			this.buttonElement.attr( "aria-pressed", checked );
-            -
            		} else {
-            -
            			this.buttonElement = this.element;
+            		}
             	},
-            -
            	widget: function() {
-            -
            		return this.buttonElement;
-            -
            	},
-            -
            	destroy: function() {
-            -
            		this.element
-            -
            			.removeClass( "ui-helper-hidden-accessible" );
-            -
            		this.buttonElement
-            -
            			.removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
-            -
            			.removeAttr( "role" )
-            -
            			.removeAttr( "aria-pressed" )
-            -
            			.html( this.buttonElement.find(".ui-button-text").html() );
-            -
            		if ( !this.hasTitle ) {
-            -
            			this.buttonElement.removeAttr( "title" );
+            		}
-            -
            		$.Widget.prototype.destroy.call( this );
             	},
-            -
            	_setOption: function( key, value ) {
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
-            -
            		if ( key === "disabled" ) {
-            -
            			if ( value ) {
-            -
            				this.element.propAttr( "disabled", true );
-            -
            			} else {
-            -
            				this.element.propAttr( "disabled", false );
-            -
            			}
-            -
            			return;
+            		}
-            -
            		this._resetButton();
             	},
             	refresh: function() {
-            -
            		var isDisabled = this.element.is( ":disabled" );
-            -
            		if ( isDisabled !== this.options.disabled ) {
-            -
            			this._setOption( "disabled", isDisabled );
-            -
            		}
-            -
            		if ( this.type === "radio" ) {
-            -
            			radioGroup( this.element[0] ).each(function() {
-            -
            				if ( $( this ).is( ":checked" ) ) {
-            -
            					$( this ).button( "widget" )
-            -
            						.addClass( "ui-state-active" )
-            -
            						.attr( "aria-pressed", "true" );
-            -
            				} else {
-            -
            					$( this ).button( "widget" )
-            -
            						.removeClass( "ui-state-active" )
-            -
            						.attr( "aria-pressed", "false" );
-            -
            				}
-            -
            			});
-            -
            		} else if ( this.type === "checkbox" ) {
-            -
            			if ( this.element.is( ":checked" ) ) {
-            -
            				this.buttonElement
-            -
            					.addClass( "ui-state-active" )
-            -
            					.attr( "aria-pressed", "true" );
             			} else {
-            -
            				this.buttonElement
-            -
            					.removeClass( "ui-state-active" )
-            -
            					.attr( "aria-pressed", "false" );
+            			}
+            		}
-            -
            	},
-            -
            	_resetButton: function() {
-            -
            		if ( this.type === "input" ) {
-            -
            			if ( this.options.label ) {
-            -
            				this.element.val( this.options.label );
-            -
            			}
-            -
            			return;
-            -
            		}
-            -
            		var buttonElement = this.buttonElement.removeClass( typeClasses ),
-            -
            			buttonText = $( "<span></span>", this.element[0].ownerDocument )
-            -
            				.addClass( "ui-button-text" )
-            -
            				.html( this.options.label )
-            -
            				.appendTo( buttonElement.empty() )
-            -
            				.text(),
-            -
            			icons = this.options.icons,
-            -
            			multipleIcons = icons.primary && icons.secondary,
-            -
            			buttonClasses = [];
-            -
            		if ( icons.primary || icons.secondary ) {
-            -
            			if ( this.options.text ) {
-            -
            				buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
-            -
            			}
-            -
            			if ( icons.primary ) {
-            -
            				buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
-            -
            			}
-            -
            			if ( icons.secondary ) {
-            -
            				buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
-            -
            			}
-            -
            			if ( !this.options.text ) {
-            -
            				buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
-            -
            				if ( !this.hasTitle ) {
-            -
            					buttonElement.attr( "title", buttonText );
+            				}
-            -
            			}
             		} else {
-            -
            			buttonClasses.push( "ui-button-text-only" );
+            		}
-            -
            		buttonElement.addClass( buttonClasses.join( " " ) );
-            -
            	}
-            -
            });
-            -
            $.widget( "ui.buttonset", {
-            -
            	options: {
-            -
            		items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
             	},
-            -
            	_create: function() {
-            -
            		this.element.addClass( "ui-buttonset" );
             	},
-            -
-            -
            	_init: function() {
-            -
            		this.refresh();
             	},
-            -
            	_setOption: function( key, value ) {
-            -
            		if ( key === "disabled" ) {
-            -
            			this.buttons.button( "option", key, value );
+            		}
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
             	},
-            -
-            -
            	refresh: function() {
-            -
            		var rtl = this.element.css( "direction" ) === "rtl";
-            -
-            -
            		this.buttons = this.element.find( this.options.items )
-            -
            			.filter( ":ui-button" )
-            -
            				.button( "refresh" )
-            -
            			.end()
-            -
            			.not( ":ui-button" )
-            -
            				.button()
-            -
            			.end()
-            -
            			.map(function() {
-            -
            				return $( this ).button( "widget" )[ 0 ];
-            -
            			})
-            -
            				.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
-            -
            				.filter( ":first" )
-            -
            					.addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
-            -
            				.end()
-            -
            				.filter( ":last" )
-            -
            					.addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
-            -
            				.end()
-            -
            			.end();
-            -
            	},
-            -
-            -
            	destroy: function() {
-            -
            		this.element.removeClass( "ui-buttonset" );
-            -
            		this.buttons
-            -
            			.map(function() {
-            -
            				return $( this ).button( "widget" )[ 0 ];
-            -
            			})
-            -
            				.removeClass( "ui-corner-left ui-corner-right" )
-            -
            			.end()
-            -
            			.button( "destroy" );
-            -
-            -
            		$.Widget.prototype.destroy.call( this );
-            -
            	}
-            -
            });
-            -
-            -
            }( jQuery ) );
-            -
            /*
-            -
             * jQuery UI Dialog 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Dialog
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
-            -
             *  jquery.ui.button.js
-            -
             *	jquery.ui.draggable.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.position.js
-            -
             *	jquery.ui.resizable.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
            var uiDialogClasses =
-            -
            		'ui-dialog ' +
-            -
            		'ui-widget ' +
-            -
            		'ui-widget-content ' +
-            -
            		'ui-corner-all ',
-            -
            	sizeRelatedOptions = {
-            -
            		buttons: true,
-            -
            		height: true,
-            -
            		maxHeight: true,
-            -
            		maxWidth: true,
-            -
            		minHeight: true,
-            -
            		minWidth: true,
-            -
            		width: true
-            -
            	},
-            -
            	resizableRelatedOptions = {
-            -
            		maxHeight: true,
-            -
            		maxWidth: true,
-            -
            		minHeight: true,
-            -
            		minWidth: true
-            -
            	},
-            -
            	// support for jQuery 1.3.2 - handle common attrFn methods for dialog
-            -
            	attrFn = $.attrFn || {
-            -
            		val: true,
-            -
            		css: true,
-            -
            		html: true,
-            -
            		text: true,
-            -
            		data: true,
-            -
            		width: true,
-            -
            		height: true,
-            -
            		offset: true,
-            -
            		click: true
-            -
            	};
-            -
            $.widget("ui.dialog", {
-            -
            	options: {
-            -
            		autoOpen: true,
-            -
            		buttons: {},
-            -
            		closeOnEscape: true,
-            -
            		closeText: 'close',
-            -
            		dialogClass: '',
-            -
            		draggable: true,
-            -
            		hide: null,
-            -
            		height: 'auto',
-            -
            		maxHeight: false,
-            -
            		maxWidth: false,
-            -
            		minHeight: 150,
-            -
            		minWidth: 150,
-            -
            		modal: false,
-            -
            		position: {
-            -
            			my: 'center',
-            -
            			at: 'center',
-            -
            			collision: 'fit',
-            -
            			// ensure that the titlebar is never outside the document
-            -
            			using: function(pos) {
-            -
            				var topOffset = $(this).css(pos).offset().top;
-            -
            				if (topOffset < 0) {
-            -
            					$(this).css('top', pos.top - topOffset);
-            -
            				}
-            -
            			}
-            -
            		},
-            -
            		resizable: true,
-            -
            		show: null,
-            -
            		stack: true,
-            -
            		title: '',
-            -
            		width: 300,
-            -
            		zIndex: 1000
-            -
            	},
-            -
            	_create: function() {
-            -
            		this.originalTitle = this.element.attr('title');
-            -
            		// #5742 - .attr() might return a DOMElement
-            -
            		if ( typeof this.originalTitle !== "string" ) {
-            -
            			this.originalTitle = "";
+            		}
-            -
            		this.options.title = this.options.title || this.originalTitle;
-            -
            		var self = this,
-            -
            			options = self.options,
-            -
-            -
            			title = options.title || '&#160;',
-            -
            			titleId = $.ui.dialog.getTitleId(self.element),
-            -
-            -
            			uiDialog = (self.uiDialog = $('<div></div>'))
-            -
            				.appendTo(document.body)
-            -
            				.hide()
-            -
            				.addClass(uiDialogClasses + options.dialogClass)
-            -
            				.css({
-            -
            					zIndex: options.zIndex
-            -
            				})
-            -
            				// setting tabIndex makes the div focusable
-            -
            				// setting outline to 0 prevents a border on focus in Mozilla
-            -
            				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
-            -
            					if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
-            -
            						event.keyCode === $.ui.keyCode.ESCAPE) {
-            -
-            -
            						self.close(event);
-            -
            						event.preventDefault();
-            -
            					}
-            -
            				})
-            -
            				.attr({
-            -
            					role: 'dialog',
-            -
            					'aria-labelledby': titleId
-            -
            				})
-            -
            				.mousedown(function(event) {
-            -
            					self.moveToTop(false, event);
-            -
            				}),
-            -
-            -
            			uiDialogContent = self.element
-            -
            				.show()
-            -
            				.removeAttr('title')
-            -
            				.addClass(
-            -
            					'ui-dialog-content ' +
-            -
            					'ui-widget-content')
-            -
            				.appendTo(uiDialog),
-            -
-            -
            			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
-            -
            				.addClass(
-            -
            					'ui-dialog-titlebar ' +
-            -
            					'ui-widget-header ' +
-            -
            					'ui-corner-all ' +
-            -
            					'ui-helper-clearfix'
-            -
            				)
-            -
            				.prependTo(uiDialog),
-            -
-            -
            			uiDialogTitlebarClose = $('<a href="#"></a>')
-            -
            				.addClass(
-            -
            					'ui-dialog-titlebar-close ' +
-            -
            					'ui-corner-all'
-            -
            				)
-            -
            				.attr('role', 'button')
-            -
            				.hover(
-            -
            					function() {
-            -
            						uiDialogTitlebarClose.addClass('ui-state-hover');
-            -
            					},
-            -
            					function() {
-            -
            						uiDialogTitlebarClose.removeClass('ui-state-hover');
-            -
            					}
-            -
            				)
-            -
            				.focus(function() {
-            -
            					uiDialogTitlebarClose.addClass('ui-state-focus');
-            -
            				})
-            -
            				.blur(function() {
-            -
            					uiDialogTitlebarClose.removeClass('ui-state-focus');
-            -
            				})
-            -
            				.click(function(event) {
-            -
            					self.close(event);
-            -
            					return false;
-            -
            				})
-            -
            				.appendTo(uiDialogTitlebar),
-            -
-            -
            			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
-            -
            				.addClass(
-            -
            					'ui-icon ' +
-            -
            					'ui-icon-closethick'
-            -
            				)
-            -
            				.text(options.closeText)
-            -
            				.appendTo(uiDialogTitlebarClose),
-            -
-            -
            			uiDialogTitle = $('<span></span>')
-            -
            				.addClass('ui-dialog-title')
-            -
            				.attr('id', titleId)
-            -
            				.html(title)
-            -
            				.prependTo(uiDialogTitlebar);
-            -
-            -
            		//handling of deprecated beforeclose (vs beforeClose) option
-            -
            		//Ticket #4669 http://dev.jqueryui.com/ticket/4669
-            -
            		//TODO: remove in 1.9pre
-            -
            		if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
-            -
            			options.beforeClose = options.beforeclose;
-            -
            		}
-            -
            		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
-            -
            		if (options.draggable && $.fn.draggable) {
-            -
            			self._makeDraggable();
-            -
            		}
-            -
            		if (options.resizable && $.fn.resizable) {
-            -
            			self._makeResizable();
+            		}
-            -
            		self._createButtons(options.buttons);
-            -
            		self._isOpen = false;
-            -
            		if ($.fn.bgiframe) {
-            -
            			uiDialog.bgiframe();
+            		}
             	},
-            -
            	_init: function() {
-            -
            		if ( this.options.autoOpen ) {
-            -
            			this.open();
-            -
            		}
-            -
            	},
-            -
            	destroy: function() {
-            -
            		var self = this;
-            -
-            -
            		if (self.overlay) {
-            -
            			self.overlay.destroy();
+            		}
-            -
            		self.uiDialog.hide();
-            -
            		self.element
-            -
            			.unbind('.dialog')
-            -
            			.removeData('dialog')
-            -
            			.removeClass('ui-dialog-content ui-widget-content')
-            -
            			.hide().appendTo('body');
-            -
            		self.uiDialog.remove();
-            -
            		if (self.originalTitle) {
-            -
            			self.element.attr('title', self.originalTitle);
+            		}
-            -
            		return self;
             	},
-            -
            	widget: function() {
-            -
            		return this.uiDialog;
-            -
            	},
-            -
            	close: function(event) {
-            -
            		var self = this,
-            -
            			maxZ, thisZ;
-            -
-            -
            		if (false === self._trigger('beforeClose', event)) {
-            -
            			return;
+            		}
-            -
-            -
            		if (self.overlay) {
-            -
            			self.overlay.destroy();
+            		}
-            -
            		self.uiDialog.unbind('keypress.ui-dialog');
-            -
            		self._isOpen = false;
-            -
-            -
            		if (self.options.hide) {
-            -
            			self.uiDialog.hide(self.options.hide, function() {
-            -
            				self._trigger('close', event);
-            -
            			});
-            -
            		} else {
-            -
            			self.uiDialog.hide();
-            -
            			self._trigger('close', event);
+            		}
-            -
            		$.ui.dialog.overlay.resize();
-            -
-            -
            		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
-            -
            		if (self.options.modal) {
-            -
            			maxZ = 0;
-            -
            			$('.ui-dialog').each(function() {
-            -
            				if (this !== self.uiDialog[0]) {
-            -
            					thisZ = $(this).css('z-index');
-            -
            					if(!isNaN(thisZ)) {
-            -
            						maxZ = Math.max(maxZ, thisZ);
+            					}
+            				}
             			});
-            -
            			$.ui.dialog.maxZ = maxZ;
-            -
            		}
-            -
-            -
            		return self;
             	},
-            -
            	isOpen: function() {
-            -
            		return this._isOpen;
-            -
            	},
-            -
            	// the force parameter allows us to move modal dialogs to their correct
-            -
            	// position on open
-            -
            	moveToTop: function(force, event) {
-            -
            		var self = this,
-            -
            			options = self.options,
-            -
            			saveScroll;
-            -
            		if ((options.modal && !force) ||
-            -
            			(!options.stack && !options.modal)) {
-            -
            			return self._trigger('focus', event);
+            		}
-            -
            		if (options.zIndex > $.ui.dialog.maxZ) {
-            -
            			$.ui.dialog.maxZ = options.zIndex;
-            -
            		}
-            -
            		if (self.overlay) {
-            -
            			$.ui.dialog.maxZ += 1;
-            -
            			self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
-            -
            		}
-            -
            		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
-            -
            		//  http://ui.jquery.com/bugs/ticket/3193
-            -
            		saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
-            -
            		$.ui.dialog.maxZ += 1;
-            -
            		self.uiDialog.css('z-index', $.ui.dialog.maxZ);
-            -
            		self.element.attr(saveScroll);
-            -
            		self._trigger('focus', event);
-            -
            		return self;
-            -
            	},
-            -
            	open: function() {
-            -
            		if (this._isOpen) { return; }
-            -
            		var self = this,
-            -
            			options = self.options,
-            -
            			uiDialog = self.uiDialog;
-            -
            		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
-            -
            		self._size();
-            -
            		self._position(options.position);
-            -
            		uiDialog.show(options.show);
-            -
            		self.moveToTop(true);
-            -
            		// prevent tabbing out of modal dialogs
-            -
            		if ( options.modal ) {
-            -
            			uiDialog.bind( "keydown.ui-dialog", function( event ) {
-            -
            				if ( event.keyCode !== $.ui.keyCode.TAB ) {
             					return;
+            				}
-            -
            				var tabbables = $(':tabbable', this),
-            -
            					first = tabbables.filter(':first'),
-            -
            					last  = tabbables.filter(':last');
-            -
-            -
            				if (event.target === last[0] && !event.shiftKey) {
-            -
            					first.focus(1);
-            -
            					return false;
-            -
            				} else if (event.target === first[0] && event.shiftKey) {
-            -
            					last.focus(1);
-            -
            					return false;
+            				}
-            -
            			});
-            -
            		}
-            -
            		// set focus to the first tabbable element in the content area or the first button
-            -
            		// if there are no tabbable elements, set focus on the dialog itself
-            -
            		$(self.element.find(':tabbable').get().concat(
-            -
            			uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
-            -
            				uiDialog.get()))).eq(0).focus();
-            -
            		self._isOpen = true;
-            -
            		self._trigger('open');
-            -
            		return self;
-            -
            	},
-            -
            	_createButtons: function(buttons) {
-            -
            		var self = this,
-            -
            			hasButtons = false,
-            -
            			uiDialogButtonPane = $('<div></div>')
-            -
            				.addClass(
-            -
            					'ui-dialog-buttonpane ' +
-            -
            					'ui-widget-content ' +
-            -
            					'ui-helper-clearfix'
-            -
            				),
-            -
            			uiButtonSet = $( "<div></div>" )
-            -
            				.addClass( "ui-dialog-buttonset" )
-            -
            				.appendTo( uiDialogButtonPane );
-            -
            		// if we already have a button pane, remove it
-            -
            		self.uiDialog.find('.ui-dialog-buttonpane').remove();
-            -
            		if (typeof buttons === 'object' && buttons !== null) {
-            -
            			$.each(buttons, function() {
-            -
            				return !(hasButtons = true);
-            -
            			});
-            -
            		}
-            -
            		if (hasButtons) {
-            -
            			$.each(buttons, function(name, props) {
-            -
            				props = $.isFunction( props ) ?
-            -
            					{ click: props, text: name } :
-            -
            					props;
-            -
            				var button = $('<button type="button"></button>')
-            -
            					.click(function() {
-            -
            						props.click.apply(self.element[0], arguments);
-            -
            					})
-            -
            					.appendTo(uiButtonSet);
-            -
            				// can't use .attr( props, true ) with jQuery 1.3.2.
-            -
            				$.each( props, function( key, value ) {
-            -
            					if ( key === "click" ) {
-            -
            						return;
-            -
            					}
-            -
            					if ( key in attrFn ) {
-            -
            						button[ key ]( value );
-            -
            					} else {
-            -
            						button.attr( key, value );
+            					}
-            -
            				});
-            -
            				if ($.fn.button) {
-            -
            					button.button();
+            				}
-            -
            			});
-            -
            			uiDialogButtonPane.appendTo(self.uiDialog);
-            -
            		}
-            -
            	},
-            -
            	_makeDraggable: function() {
-            -
            		var self = this,
-            -
            			options = self.options,
-            -
            			doc = $(document),
-            -
            			heightBeforeDrag;
-            -
            		function filteredUi(ui) {
-            -
            			return {
-            -
            				position: ui.position,
-            -
            				offset: ui.offset
-            -
            			};
-            -
            		}
-            -
            		self.uiDialog.draggable({
-            -
            			cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
-            -
            			handle: '.ui-dialog-titlebar',
-            -
            			containment: 'document',
-            -
            			start: function(event, ui) {
-            -
            				heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
-            -
            				$(this).height($(this).height()).addClass("ui-dialog-dragging");
-            -
            				self._trigger('dragStart', event, filteredUi(ui));
-            -
            			},
-            -
            			drag: function(event, ui) {
-            -
            				self._trigger('drag', event, filteredUi(ui));
-            -
            			},
-            -
            			stop: function(event, ui) {
-            -
            				options.position = [ui.position.left - doc.scrollLeft(),
-            -
            					ui.position.top - doc.scrollTop()];
-            -
            				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
-            -
            				self._trigger('dragStop', event, filteredUi(ui));
-            -
            				$.ui.dialog.overlay.resize();
+            			}
             		});
-            -
            	},
-            -
-            -
            	_makeResizable: function(handles) {
-            -
            		handles = (handles === undefined ? this.options.resizable : handles);
-            -
            		var self = this,
-            -
            			options = self.options,
-            -
            			// .ui-resizable has position: relative defined in the stylesheet
-            -
            			// but dialogs have to use absolute or fixed positioning
-            -
            			position = self.uiDialog.css('position'),
-            -
            			resizeHandles = (typeof handles === 'string' ?
-            -
            				handles	:
-            -
            				'n,e,s,w,se,sw,ne,nw'
-            -
            			);
-            -
            		function filteredUi(ui) {
-            -
            			return {
-            -
            				originalPosition: ui.originalPosition,
-            -
            				originalSize: ui.originalSize,
-            -
            				position: ui.position,
-            -
            				size: ui.size
-            -
            			};
-            -
            		}
-            -
            		self.uiDialog.resizable({
-            -
            			cancel: '.ui-dialog-content',
-            -
            			containment: 'document',
-            -
            			alsoResize: self.element,
-            -
            			maxWidth: options.maxWidth,
-            -
            			maxHeight: options.maxHeight,
-            -
            			minWidth: options.minWidth,
-            -
            			minHeight: self._minHeight(),
-            -
            			handles: resizeHandles,
-            -
            			start: function(event, ui) {
-            -
            				$(this).addClass("ui-dialog-resizing");
-            -
            				self._trigger('resizeStart', event, filteredUi(ui));
-            -
            			},
-            -
            			resize: function(event, ui) {
-            -
            				self._trigger('resize', event, filteredUi(ui));
-            -
            			},
-            -
            			stop: function(event, ui) {
-            -
            				$(this).removeClass("ui-dialog-resizing");
-            -
            				options.height = $(this).height();
-            -
            				options.width = $(this).width();
-            -
            				self._trigger('resizeStop', event, filteredUi(ui));
-            -
            				$.ui.dialog.overlay.resize();
+            			}
-            -
            		})
-            -
            		.css('position', position)
-            -
            		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
             	},
-            -
            	_minHeight: function() {
-            -
            		var options = this.options;
-            -
-            -
            		if (options.height === 'auto') {
-            -
            			return options.minHeight;
-            -
            		} else {
-            -
            			return Math.min(options.minHeight, options.height);
-            -
            		}
             	},
-            -
            	_position: function(position) {
-            -
            		var myAt = [],
-            -
            			offset = [0, 0],
-            -
            			isVisible;
-            -
-            -
            		if (position) {
-            -
            			// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
-            -
            	//		if (typeof position == 'string' || $.isArray(position)) {
-            -
            	//			myAt = $.isArray(position) ? position : position.split(' ');
-            -
-            -
            			if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
-            -
            				myAt = position.split ? position.split(' ') : [position[0], position[1]];
-            -
            				if (myAt.length === 1) {
-            -
            					myAt[1] = myAt[0];
-            -
            				}
-            -
-            -
            				$.each(['left', 'top'], function(i, offsetPosition) {
-            -
            					if (+myAt[i] === myAt[i]) {
-            -
            						offset[i] = myAt[i];
-            -
            						myAt[i] = offsetPosition;
-            -
            					}
-            -
            				});
-            -
-            -
            				position = {
-            -
            					my: myAt.join(" "),
-            -
            					at: myAt.join(" "),
-            -
            					offset: offset.join(" ")
-            -
            				};
-            -
            			}
-            -
-            -
            			position = $.extend({}, $.ui.dialog.prototype.options.position, position);
-            -
            		} else {
-            -
            			position = $.ui.dialog.prototype.options.position;
+            		}
-            -
-            -
            		// need to show the dialog to get the actual offset in the position plugin
-            -
            		isVisible = this.uiDialog.is(':visible');
-            -
            		if (!isVisible) {
-            -
            			this.uiDialog.show();
+            		}
-            -
            		this.uiDialog
-            -
            			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
-            -
            			.css({ top: 0, left: 0 })
-            -
            			.position($.extend({ of: window }, position));
-            -
            		if (!isVisible) {
-            -
            			this.uiDialog.hide();
+            		}
             	},
-            -
            	_setOptions: function( options ) {
-            -
            		var self = this,
-            -
            			resizableOptions = {},
-            -
            			resize = false;
-            -
-            -
            		$.each( options, function( key, value ) {
-            -
            			self._setOption( key, value );
-            -
-            -
            			if ( key in sizeRelatedOptions ) {
-            -
            				resize = true;
-            -
            			}
-            -
            			if ( key in resizableRelatedOptions ) {
-            -
            				resizableOptions[ key ] = value;
-            -
            			}
-            -
            		});
-            -
            		if ( resize ) {
-            -
            			this._size();
+            		}
-            -
            		if ( this.uiDialog.is( ":data(resizable)" ) ) {
-            -
            			this.uiDialog.resizable( "option", resizableOptions );
+            		}
-            -
            	},
-            -
            	_setOption: function(key, value){
-            -
            		var self = this,
-            -
            			uiDialog = self.uiDialog;
-            -
-            -
            		switch (key) {
-            -
            			//handling of deprecated beforeclose (vs beforeClose) option
-            -
            			//Ticket #4669 http://dev.jqueryui.com/ticket/4669
-            -
            			//TODO: remove in 1.9pre
-            -
            			case "beforeclose":
-            -
            				key = "beforeClose";
-            -
            				break;
-            -
            			case "buttons":
-            -
            				self._createButtons(value);
-            -
            				break;
-            -
            			case "closeText":
-            -
            				// ensure that we always pass a string
-            -
            				self.uiDialogTitlebarCloseText.text("" + value);
-            -
            				break;
-            -
            			case "dialogClass":
-            -
            				uiDialog
-            -
            					.removeClass(self.options.dialogClass)
-            -
            					.addClass(uiDialogClasses + value);
-            -
            				break;
-            -
            			case "disabled":
-            -
            				if (value) {
-            -
            					uiDialog.addClass('ui-dialog-disabled');
-            -
            				} else {
-            -
            					uiDialog.removeClass('ui-dialog-disabled');
-            -
            				}
-            -
            				break;
-            -
            			case "draggable":
-            -
            				var isDraggable = uiDialog.is( ":data(draggable)" );
-            -
            				if ( isDraggable && !value ) {
-            -
            					uiDialog.draggable( "destroy" );
-            -
            				}
-            -
-            -
            				if ( !isDraggable && value ) {
-            -
            					self._makeDraggable();
-            -
            				}
-            -
            				break;
-            -
            			case "position":
-            -
            				self._position(value);
-            -
            				break;
-            -
            			case "resizable":
-            -
            				// currently resizable, becoming non-resizable
-            -
            				var isResizable = uiDialog.is( ":data(resizable)" );
-            -
            				if (isResizable && !value) {
-            -
            					uiDialog.resizable('destroy');
-            -
            				}
-            -
            				// currently resizable, changing handles
-            -
            				if (isResizable && typeof value === 'string') {
-            -
            					uiDialog.resizable('option', 'handles', value);
-            -
            				}
-            -
            				// currently non-resizable, becoming resizable
-            -
            				if (!isResizable && value !== false) {
-            -
            					self._makeResizable(value);
+            				}
-            -
            				break;
-            -
            			case "title":
-            -
            				// convert whatever was passed in o a string, for html() to not throw up
-            -
            				$(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
-            -
            				break;
+            		}
-            -
-            -
            		$.Widget.prototype._setOption.apply(self, arguments);
             	},
-            -
            	_size: function() {
-            -
            		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
-            -
            		 * divs will both have width and height set, so we need to reset them
-            -
            		 */
-            -
            		var options = this.options,
-            -
            			nonContentHeight,
-            -
            			minContentHeight,
-            -
            			isVisible = this.uiDialog.is( ":visible" );
-            -
            		// reset content sizing
-            -
            		this.element.show().css({
-            -
            			width: 'auto',
-            -
            			minHeight: 0,
-            -
            			height: 0
-            -
            		});
-            -
            		if (options.minWidth > options.width) {
-            -
            			options.width = options.minWidth;
-            -
            		}
-            -
            		// reset wrapper sizing
-            -
            		// determine the height of all the non-content elements
-            -
            		nonContentHeight = this.uiDialog.css({
-            -
            				height: 'auto',
-            -
            				width: options.width
-            -
            			})
-            -
            			.height();
-            -
            		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
-            -
-            -
            		if ( options.height === "auto" ) {
-            -
            			// only needed for IE6 support
-            -
            			if ( $.support.minHeight ) {
-            -
            				this.element.css({
-            -
            					minHeight: minContentHeight,
-            -
            					height: "auto"
-            -
            				});
-            -
            			} else {
-            -
            				this.uiDialog.show();
-            -
            				var autoHeight = this.element.css( "height", "auto" ).height();
-            -
            				if ( !isVisible ) {
-            -
            					this.uiDialog.hide();
-            -
            				}
-            -
            				this.element.height( Math.max( autoHeight, minContentHeight ) );
-            -
            			}
-            -
            		} else {
-            -
            			this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+            		}
-            -
            		if (this.uiDialog.is(':data(resizable)')) {
-            -
            			this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+            		}
-            -
            	}
-            -
            });
-            -
            $.extend($.ui.dialog, {
-            -
            	version: "1.8.17",
-            -
            	uuid: 0,
-            -
            	maxZ: 0,
-            -
            	getTitleId: function($el) {
-            -
            		var id = $el.attr('id');
-            -
            		if (!id) {
-            -
            			this.uuid += 1;
-            -
            			id = this.uuid;
-            -
            		}
-            -
            		return 'ui-dialog-title-' + id;
             	},
-            -
            	overlay: function(dialog) {
-            -
            		this.$el = $.ui.dialog.overlay.create(dialog);
-            -
            	}
-            -
            });
-            -
            $.extend($.ui.dialog.overlay, {
-            -
            	instances: [],
-            -
            	// reuse old instances due to IE memory leak with alpha transparency (see #5185)
-            -
            	oldInstances: [],
-            -
            	maxZ: 0,
-            -
            	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
-            -
            		function(event) { return event + '.dialog-overlay'; }).join(' '),
-            -
            	create: function(dialog) {
-            -
            		if (this.instances.length === 0) {
-            -
            			// prevent use of anchors and inputs
-            -
            			// we use a setTimeout in case the overlay is created from an
-            -
            			// event that we're going to be cancelling (see #2804)
-            -
            			setTimeout(function() {
-            -
            				// handle $(el).dialog().dialog('close') (see #4065)
-            -
            				if ($.ui.dialog.overlay.instances.length) {
-            -
            					$(document).bind($.ui.dialog.overlay.events, function(event) {
-            -
            						// stop events if the z-index of the target is < the z-index of the overlay
-            -
            						// we cannot return true when we don't want to cancel the event (#3523)
-            -
            						if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
-            -
            							return false;
-            -
            						}
-            -
            					});
-            -
            				}
-            -
            			}, 1);
-            -
            			// allow closing by pressing the escape key
-            -
            			$(document).bind('keydown.dialog-overlay', function(event) {
-            -
            				if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
-            -
            					event.keyCode === $.ui.keyCode.ESCAPE) {
-            -
-            -
            					dialog.close(event);
-            -
            					event.preventDefault();
-            -
            				}
-            -
            			});
-            -
            			// handle window resize
-            -
            			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+            		}
-            -
-            -
            		var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
-            -
            			.appendTo(document.body)
-            -
            			.css({
-            -
            				width: this.width(),
-            -
            				height: this.height()
-            -
            			});
-            -
-            -
            		if ($.fn.bgiframe) {
-            -
            			$el.bgiframe();
+            		}
-            -
            		this.instances.push($el);
-            -
            		return $el;
             	},
-            -
            	destroy: function($el) {
-            -
            		var indexOf = $.inArray($el, this.instances);
-            -
            		if (indexOf != -1){
-            -
            			this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+            		}
-            -
            		if (this.instances.length === 0) {
-            -
            			$([document, window]).unbind('.dialog-overlay');
+            		}
-            -
            		$el.remove();
-            -
-            -
            		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
-            -
            		var maxZ = 0;
-            -
            		$.each(this.instances, function() {
-            -
            			maxZ = Math.max(maxZ, this.css('z-index'));
             		});
-            -
            		this.maxZ = maxZ;
             	},
-            -
            	height: function() {
-            -
            		var scrollHeight,
-            -
            			offsetHeight;
-            -
            		// handle IE 6
-            -
            		if ($.browser.msie && $.browser.version < 7) {
-            -
            			scrollHeight = Math.max(
-            -
            				document.documentElement.scrollHeight,
-            -
            				document.body.scrollHeight
-            -
            			);
-            -
            			offsetHeight = Math.max(
-            -
            				document.documentElement.offsetHeight,
-            -
            				document.body.offsetHeight
-            -
            			);
-            -
            			if (scrollHeight < offsetHeight) {
-            -
            				return $(window).height() + 'px';
-            -
            			} else {
-            -
            				return scrollHeight + 'px';
-            -
            			}
-            -
            		// handle "good" browsers
-            -
            		} else {
-            -
            			return $(document).height() + 'px';
+            		}
             	},
-            -
            	width: function() {
-            -
            		var scrollWidth,
-            -
            			offsetWidth;
-            -
            		// handle IE
-            -
            		if ( $.browser.msie ) {
-            -
            			scrollWidth = Math.max(
-            -
            				document.documentElement.scrollWidth,
-            -
            				document.body.scrollWidth
-            -
            			);
-            -
            			offsetWidth = Math.max(
-            -
            				document.documentElement.offsetWidth,
-            -
            				document.body.offsetWidth
-            -
            			);
-            -
-            -
            			if (scrollWidth < offsetWidth) {
-            -
            				return $(window).width() + 'px';
-            -
            			} else {
-            -
            				return scrollWidth + 'px';
-            -
            			}
-            -
            		// handle "good" browsers
-            -
            		} else {
-            -
            			return $(document).width() + 'px';
-            -
            		}
             	},
-            -
            	resize: function() {
-            -
            		/* If the dialog is draggable and the user drags it past the
-            -
            		 * right edge of the window, the document becomes wider so we
-            -
            		 * need to stretch the overlay. If the user then drags the
-            -
            		 * dialog back to the left, the document will become narrower,
-            -
            		 * so we need to shrink the overlay to the appropriate size.
-            -
            		 * This is handled by shrinking the overlay before setting it
-            -
            		 * to the full document size.
-            -
            		 */
-            -
            		var $overlays = $([]);
-            -
            		$.each($.ui.dialog.overlay.instances, function() {
-            -
            			$overlays = $overlays.add(this);
             		});
-            -
            		$overlays.css({
-            -
            			width: 0,
-            -
            			height: 0
-            -
            		}).css({
-            -
            			width: $.ui.dialog.overlay.width(),
-            -
            			height: $.ui.dialog.overlay.height()
-            -
            		});
+            	}
             });
-            -
            $.extend($.ui.dialog.overlay.prototype, {
-            -
            	destroy: function() {
-            -
            		$.ui.dialog.overlay.destroy(this.$el);
+            	}
             });
-            -
            }(jQuery));
-            -
            /*
-            -
             * jQuery UI Slider 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Slider
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.mouse.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            // number of pages in a slider
-            -
            // (how many times can you page up/down to go through the whole range)
-            -
            var numPages = 5;
-            -
-            -
            $.widget( "ui.slider", $.ui.mouse, {
-            -
-            -
            	widgetEventPrefix: "slide",
             	options: {
-            -
            		animate: false,
-            -
            		distance: 0,
-            -
            		max: 100,
-            -
            		min: 0,
-            -
            		orientation: "horizontal",
-            -
            		range: false,
-            -
            		step: 1,
-            -
            		value: 0,
-            -
            		values: null
             	},
-            -
            	_create: function() {
-            -
            		var self = this,
-            -
            			o = this.options,
-            -
            			existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
-            -
            			handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
-            -
            			handleCount = ( o.values && o.values.length ) || 1,
-            -
            			handles = [];
-            -
-            -
            		this._keySliding = false;
-            -
            		this._mouseSliding = false;
-            -
            		this._animateOff = true;
-            -
            		this._handleIndex = null;
-            -
            		this._detectOrientation();
-            -
            		this._mouseInit();
-            -
            		this.element
-            -
            			.addClass( "ui-slider" +
-            -
            				" ui-slider-" + this.orientation +
-            -
            				" ui-widget" +
-            -
            				" ui-widget-content" +
-            -
            				" ui-corner-all" +
-            -
            				( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
-            -
            		this.range = $([]);
-            -
            		if ( o.range ) {
-            -
            			if ( o.range === true ) {
-            -
            				if ( !o.values ) {
-            -
            					o.values = [ this._valueMin(), this._valueMin() ];
-            -
            				}
-            -
            				if ( o.values.length && o.values.length !== 2 ) {
-            -
            					o.values = [ o.values[0], o.values[0] ];
-            -
            				}
+            			}
-            -
            			this.range = $( "<div></div>" )
-            -
            				.appendTo( this.element )
-            -
            				.addClass( "ui-slider-range" +
-            -
            				// note: this isn't the most fittingly semantic framework class for this element,
-            -
            				// but worked best visually with a variety of themes
-            -
            				" ui-widget-header" +
-            -
            				( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+            		}
-            -
            		for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
-            -
            			handles.push( handle );
+            		}
-            -
            		this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
-            -
            		this.handle = this.handles.eq( 0 );
-            -
            		this.handles.add( this.range ).filter( "a" )
-            -
            			.click(function( event ) {
-            -
            				event.preventDefault();
-            -
            			})
-            -
            			.hover(function() {
-            -
            				if ( !o.disabled ) {
-            -
            					$( this ).addClass( "ui-state-hover" );
-            -
            				}
-            -
            			}, function() {
-            -
            				$( this ).removeClass( "ui-state-hover" );
-            -
            			})
-            -
            			.focus(function() {
-            -
            				if ( !o.disabled ) {
-            -
            					$( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
-            -
            					$( this ).addClass( "ui-state-focus" );
-            -
            				} else {
-            -
            					$( this ).blur();
-            -
            				}
-            -
            			})
-            -
            			.blur(function() {
-            -
            				$( this ).removeClass( "ui-state-focus" );
-            -
            			});
-            -
            		this.handles.each(function( i ) {
-            -
            			$( this ).data( "index.ui-slider-handle", i );
-            -
            		});
-            -
            		this.handles
-            -
            			.keydown(function( event ) {
-            -
            				var ret = true,
-            -
            					index = $( this ).data( "index.ui-slider-handle" ),
-            -
            					allowed,
-            -
            					curVal,
-            -
            					newVal,
-            -
            					step;
-            -
-            -
            				if ( self.options.disabled ) {
             					return;
+            				}
-            -
-            -
            				switch ( event.keyCode ) {
-            -
            					case $.ui.keyCode.HOME:
-            -
            					case $.ui.keyCode.END:
-            -
            					case $.ui.keyCode.PAGE_UP:
-            -
            					case $.ui.keyCode.PAGE_DOWN:
-            -
            					case $.ui.keyCode.UP:
-            -
            					case $.ui.keyCode.RIGHT:
-            -
            					case $.ui.keyCode.DOWN:
-            -
            					case $.ui.keyCode.LEFT:
-            -
            						ret = false;
-            -
            						if ( !self._keySliding ) {
-            -
            							self._keySliding = true;
-            -
            							$( this ).addClass( "ui-state-active" );
-            -
            							allowed = self._start( event, index );
-            -
            							if ( allowed === false ) {
-            -
            								return;
-            -
            							}
-            -
            						}
-            -
            						break;
-            -
            				}
-            -
-            -
            				step = self.options.step;
-            -
            				if ( self.options.values && self.options.values.length ) {
-            -
            					curVal = newVal = self.values( index );
-            -
            				} else {
-            -
            					curVal = newVal = self.value();
+            				}
-            -
-            -
            				switch ( event.keyCode ) {
-            -
            					case $.ui.keyCode.HOME:
-            -
            						newVal = self._valueMin();
-            -
            						break;
-            -
            					case $.ui.keyCode.END:
-            -
            						newVal = self._valueMax();
-            -
            						break;
-            -
            					case $.ui.keyCode.PAGE_UP:
-            -
            						newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
-            -
            						break;
-            -
            					case $.ui.keyCode.PAGE_DOWN:
-            -
            						newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
-            -
            						break;
-            -
            					case $.ui.keyCode.UP:
-            -
            					case $.ui.keyCode.RIGHT:
-            -
            						if ( curVal === self._valueMax() ) {
-            -
            							return;
-            -
            						}
-            -
            						newVal = self._trimAlignValue( curVal + step );
-            -
            						break;
-            -
            					case $.ui.keyCode.DOWN:
-            -
            					case $.ui.keyCode.LEFT:
-            -
            						if ( curVal === self._valueMin() ) {
-            -
            							return;
-            -
            						}
-            -
            						newVal = self._trimAlignValue( curVal - step );
-            -
            						break;
+            				}
-            -
-            -
            				self._slide( event, index, newVal );
-            -
-            -
            				return ret;
-            -
             			})
-            -
            			.keyup(function( event ) {
-            -
            				var index = $( this ).data( "index.ui-slider-handle" );
-            -
-            -
            				if ( self._keySliding ) {
-            -
            					self._keySliding = false;
-            -
            					self._stop( event, index );
-            -
            					self._change( event, index );
-            -
            					$( this ).removeClass( "ui-state-active" );
+            				}
-            -
             			});
-            -
            		this._refreshValue();
-            -
-            -
            		this._animateOff = false;
-            -
            	},
-            -
-            -
            	destroy: function() {
-            -
            		this.handles.remove();
-            -
            		this.range.remove();
-            -
             		this.element
-            -
            			.removeClass( "ui-slider" +
-            -
            				" ui-slider-horizontal" +
-            -
            				" ui-slider-vertical" +
-            -
            				" ui-slider-disabled" +
-            -
            				" ui-widget" +
-            -
            				" ui-widget-content" +
-            -
            				" ui-corner-all" )
-            -
            			.removeData( "slider" )
-            -
            			.unbind( ".slider" );
-            -
-            -
            		this._mouseDestroy();
-            -
-            -
            		return this;
-            -
            	},
-            -
-            -
            	_mouseCapture: function( event ) {
-            -
            		var o = this.options,
-            -
            			position,
-            -
            			normValue,
-            -
            			distance,
-            -
            			closestHandle,
-            -
            			self,
-            -
            			index,
-            -
            			allowed,
-            -
            			offset,
-            -
            			mouseOverHandle;
-            -
            		if ( o.disabled ) {
-            -
            			return false;
+            		}
-            -
            		this.elementSize = {
-            -
            			width: this.element.outerWidth(),
-            -
            			height: this.element.outerHeight()
-            -
            		};
-            -
            		this.elementOffset = this.element.offset();
-            -
-            -
            		position = { x: event.pageX, y: event.pageY };
-            -
            		normValue = this._normValueFromMouse( position );
-            -
            		distance = this._valueMax() - this._valueMin() + 1;
-            -
            		self = this;
-            -
            		this.handles.each(function( i ) {
-            -
            			var thisDistance = Math.abs( normValue - self.values(i) );
-            -
            			if ( distance > thisDistance ) {
-            -
            				distance = thisDistance;
-            -
            				closestHandle = $( this );
-            -
            				index = i;
-            -
            			}
-            -
            		});
-            -
-            -
            		// workaround for bug #3736 (if both handles of a range are at 0,
-            -
            		// the first is always used as the one with least distance,
-            -
            		// and moving it is obviously prevented by preventing negative ranges)
-            -
            		if( o.range === true && this.values(1) === o.min ) {
-            -
            			index += 1;
-            -
            			closestHandle = $( this.handles[index] );
-            -
            		}
-            -
            		allowed = this._start( event, index );
-            -
            		if ( allowed === false ) {
-            -
            			return false;
-            -
            		}
-            -
            		this._mouseSliding = true;
-            -
-            -
            		self._handleIndex = index;
-            -
-            -
            		closestHandle
-            -
            			.addClass( "ui-state-active" )
-            -
            			.focus();
-            -
-            -
            		offset = closestHandle.offset();
-            -
            		mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
-            -
            		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
-            -
            			left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
-            -
            			top: event.pageY - offset.top -
-            -
            				( closestHandle.height() / 2 ) -
-            -
            				( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
-            -
            				( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
-            -
            				( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
-            -
            		};
-            -
            		if ( !this.handles.hasClass( "ui-state-hover" ) ) {
-            -
            			this._slide( event, index, normValue );
+            		}
-            -
            		this._animateOff = true;
-            -
            		return true;
-            -
            	},
-            -
-            -
            	_mouseStart: function( event ) {
-            -
            		return true;
-            -
            	},
-            -
-            -
            	_mouseDrag: function( event ) {
-            -
            		var position = { x: event.pageX, y: event.pageY },
-            -
            			normValue = this._normValueFromMouse( position );
-            -
-            -
            		this._slide( event, this._handleIndex, normValue );
-            -
            		return false;
             	},
-            -
            	_mouseStop: function( event ) {
-            -
            		this.handles.removeClass( "ui-state-active" );
-            -
            		this._mouseSliding = false;
-            -
            		this._stop( event, this._handleIndex );
-            -
            		this._change( event, this._handleIndex );
-            -
            		this._handleIndex = null;
-            -
            		this._clickOffset = null;
-            -
            		this._animateOff = false;
-            -
            		return false;
             	},
-            -
-            -
            	_detectOrientation: function() {
-            -
            		this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
             	},
-            -
            	_normValueFromMouse: function( position ) {
-            -
            		var pixelTotal,
-            -
            			pixelMouse,
-            -
            			percentMouse,
-            -
            			valueTotal,
-            -
            			valueMouse;
-            -
            		if ( this.orientation === "horizontal" ) {
-            -
            			pixelTotal = this.elementSize.width;
-            -
            			pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
-            -
            		} else {
-            -
            			pixelTotal = this.elementSize.height;
-            -
            			pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+            		}
-            -
            		percentMouse = ( pixelMouse / pixelTotal );
-            -
            		if ( percentMouse > 1 ) {
-            -
            			percentMouse = 1;
-            -
            		}
-            -
            		if ( percentMouse < 0 ) {
-            -
            			percentMouse = 0;
-            -
            		}
-            -
            		if ( this.orientation === "vertical" ) {
-            -
            			percentMouse = 1 - percentMouse;
+            		}
-            -
            		valueTotal = this._valueMax() - this._valueMin();
-            -
            		valueMouse = this._valueMin() + percentMouse * valueTotal;
-            -
            		return this._trimAlignValue( valueMouse );
             	},
-            -
            	_start: function( event, index ) {
-            -
            		var uiHash = {
-            -
            			handle: this.handles[ index ],
-            -
            			value: this.value()
-            -
            		};
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			uiHash.value = this.values( index );
-            -
            			uiHash.values = this.values();
+            		}
-            -
            		return this._trigger( "start", event, uiHash );
-            -
            	},
-            -
            	_slide: function( event, index, newVal ) {
-            -
            		var otherVal,
-            -
            			newValues,
-            -
            			allowed;
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			otherVal = this.values( index ? 0 : 1 );
-            -
            			if ( ( this.options.values.length === 2 && this.options.range === true ) &&
-            -
            					( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
-            -
            				) {
-            -
            				newVal = otherVal;
+            			}
-            -
            			if ( newVal !== this.values( index ) ) {
-            -
            				newValues = this.values();
-            -
            				newValues[ index ] = newVal;
-            -
            				// A slide can be canceled by returning false from the slide callback
-            -
            				allowed = this._trigger( "slide", event, {
-            -
            					handle: this.handles[ index ],
-            -
            					value: newVal,
-            -
            					values: newValues
-            -
            				} );
-            -
            				otherVal = this.values( index ? 0 : 1 );
-            -
            				if ( allowed !== false ) {
-            -
            					this.values( index, newVal, true );
+            				}
+            			}
             		} else {
-            -
            			if ( newVal !== this.value() ) {
-            -
            				// A slide can be canceled by returning false from the slide callback
-            -
            				allowed = this._trigger( "slide", event, {
-            -
            					handle: this.handles[ index ],
-            -
            					value: newVal
-            -
            				} );
-            -
            				if ( allowed !== false ) {
-            -
            					this.value( newVal );
-            -
            				}
-            -
            			}
-            -
            		}
-            -
            	},
-            -
-            -
            	_stop: function( event, index ) {
-            -
            		var uiHash = {
-            -
            			handle: this.handles[ index ],
-            -
            			value: this.value()
-            -
            		};
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			uiHash.value = this.values( index );
-            -
            			uiHash.values = this.values();
+            		}
-            -
            		this._trigger( "stop", event, uiHash );
             	},
-            -
            	_change: function( event, index ) {
-            -
            		if ( !this._keySliding && !this._mouseSliding ) {
-            -
            			var uiHash = {
-            -
            				handle: this.handles[ index ],
-            -
            				value: this.value()
-            -
            			};
-            -
            			if ( this.options.values && this.options.values.length ) {
-            -
            				uiHash.value = this.values( index );
-            -
            				uiHash.values = this.values();
-            -
            			}
-            -
            			this._trigger( "change", event, uiHash );
-            -
            		}
             	},
-            -
            	value: function( newValue ) {
-            -
            		if ( arguments.length ) {
-            -
            			this.options.value = this._trimAlignValue( newValue );
-            -
            			this._refreshValue();
-            -
            			this._change( null, 0 );
-            -
            			return;
+            		}
-            -
            		return this._value();
             	},
-            -
            	values: function( index, newValue ) {
-            -
            		var vals,
-            -
            			newValues,
-            -
            			i;
-            -
-            -
            		if ( arguments.length > 1 ) {
-            -
            			this.options.values[ index ] = this._trimAlignValue( newValue );
-            -
            			this._refreshValue();
-            -
            			this._change( null, index );
-            -
            			return;
-            -
            		}
-            -
            		if ( arguments.length ) {
-            -
            			if ( $.isArray( arguments[ 0 ] ) ) {
-            -
            				vals = this.options.values;
-            -
            				newValues = arguments[ 0 ];
-            -
            				for ( i = 0; i < vals.length; i += 1 ) {
-            -
            					vals[ i ] = this._trimAlignValue( newValues[ i ] );
-            -
            					this._change( null, i );
-            -
            				}
-            -
            				this._refreshValue();
-            -
            			} else {
-            -
            				if ( this.options.values && this.options.values.length ) {
-            -
            					return this._values( index );
-            -
            				} else {
-            -
            					return this.value();
-            -
            				}
-            -
            			}
-            -
            		} else {
-            -
            			return this._values();
-            -
            		}
             	},
-            -
            	_setOption: function( key, value ) {
-            -
            		var i,
-            -
            			valsLength = 0;
-            -
            		if ( $.isArray( this.options.values ) ) {
-            -
            			valsLength = this.options.values.length;
-            -
            		}
-            -
            		$.Widget.prototype._setOption.apply( this, arguments );
-            -
            		switch ( key ) {
-            -
            			case "disabled":
-            -
            				if ( value ) {
-            -
            					this.handles.filter( ".ui-state-focus" ).blur();
-            -
            					this.handles.removeClass( "ui-state-hover" );
-            -
            					this.handles.propAttr( "disabled", true );
-            -
            					this.element.addClass( "ui-disabled" );
-            -
            				} else {
-            -
            					this.handles.propAttr( "disabled", false );
-            -
            					this.element.removeClass( "ui-disabled" );
-            -
            				}
-            -
            				break;
-            -
            			case "orientation":
-            -
            				this._detectOrientation();
-            -
            				this.element
-            -
            					.removeClass( "ui-slider-horizontal ui-slider-vertical" )
-            -
            					.addClass( "ui-slider-" + this.orientation );
-            -
            				this._refreshValue();
-            -
            				break;
-            -
            			case "value":
-            -
            				this._animateOff = true;
-            -
            				this._refreshValue();
-            -
            				this._change( null, 0 );
-            -
            				this._animateOff = false;
-            -
            				break;
-            -
            			case "values":
-            -
            				this._animateOff = true;
-            -
            				this._refreshValue();
-            -
            				for ( i = 0; i < valsLength; i += 1 ) {
-            -
            					this._change( null, i );
-            -
            				}
-            -
            				this._animateOff = false;
-            -
            				break;
-            -
            		}
-            -
            	},
-            -
            	//internal value getter
-            -
            	// _value() returns value trimmed by min and max, aligned by step
-            -
            	_value: function() {
-            -
            		var val = this.options.value;
-            -
            		val = this._trimAlignValue( val );
-            -
            		return val;
-            -
            	},
-            -
            	//internal values getter
-            -
            	// _values() returns array of values trimmed by min and max, aligned by step
-            -
            	// _values( index ) returns single value trimmed by min and max, aligned by step
-            -
            	_values: function( index ) {
-            -
            		var val,
-            -
            			vals,
-            -
            			i;
-            -
            		if ( arguments.length ) {
-            -
            			val = this.options.values[ index ];
-            -
            			val = this._trimAlignValue( val );
-            -
            			return val;
-            -
            		} else {
-            -
            			// .slice() creates a copy of the array
-            -
            			// this copy gets trimmed by min and max and then returned
-            -
            			vals = this.options.values.slice();
-            -
            			for ( i = 0; i < vals.length; i+= 1) {
-            -
            				vals[ i ] = this._trimAlignValue( vals[ i ] );
-            -
            			}
-            -
            			return vals;
-            -
            		}
             	},
-            -
-            -
            	// returns the step-aligned value that val is closest to, between (inclusive) min and max
-            -
            	_trimAlignValue: function( val ) {
-            -
            		if ( val <= this._valueMin() ) {
-            -
            			return this._valueMin();
-            -
            		}
-            -
            		if ( val >= this._valueMax() ) {
-            -
            			return this._valueMax();
-            -
            		}
-            -
            		var step = ( this.options.step > 0 ) ? this.options.step : 1,
-            -
            			valModStep = (val - this._valueMin()) % step,
-            -
            			alignValue = val - valModStep;
-            -
            		if ( Math.abs(valModStep) * 2 >= step ) {
-            -
            			alignValue += ( valModStep > 0 ) ? step : ( -step );
-            -
            		}
-            -
            		// Since JavaScript has problems with large floats, round
-            -
            		// the final value to 5 digits after the decimal point (see #4124)
-            -
            		return parseFloat( alignValue.toFixed(5) );
             	},
-            -
            	_valueMin: function() {
-            -
            		return this.options.min;
             	},
-            -
            	_valueMax: function() {
-            -
            		return this.options.max;
             	},
-            -
-            -
            	_refreshValue: function() {
-            -
            		var oRange = this.options.range,
-            -
            			o = this.options,
-            -
            			self = this,
-            -
            			animate = ( !this._animateOff ) ? o.animate : false,
-            -
            			valPercent,
-            -
            			_set = {},
-            -
            			lastValPercent,
-            -
            			value,
-            -
            			valueMin,
-            -
            			valueMax;
-            -
            		if ( this.options.values && this.options.values.length ) {
-            -
            			this.handles.each(function( i, j ) {
-            -
            				valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
-            -
            				_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
-            -
            				$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
-            -
            				if ( self.options.range === true ) {
-            -
            					if ( self.orientation === "horizontal" ) {
-            -
            						if ( i === 0 ) {
-            -
            							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
-            -
            						}
-            -
            						if ( i === 1 ) {
-            -
            							self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            						}
-            -
            					} else {
-            -
            						if ( i === 0 ) {
-            -
            							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
-            -
            						}
-            -
            						if ( i === 1 ) {
-            -
            							self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            						}
-            -
            					}
-            -
            				}
-            -
            				lastValPercent = valPercent;
-            -
            			});
-            -
            		} else {
-            -
            			value = this.value();
-            -
            			valueMin = this._valueMin();
-            -
            			valueMax = this._valueMax();
-            -
            			valPercent = ( valueMax !== valueMin ) ?
-            -
            					( value - valueMin ) / ( valueMax - valueMin ) * 100 :
-            -
            					0;
-            -
            			_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
-            -
            			this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
-            -
            			if ( oRange === "min" && this.orientation === "horizontal" ) {
-            -
            				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
-            -
            			}
-            -
            			if ( oRange === "max" && this.orientation === "horizontal" ) {
-            -
            				this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            			}
-            -
            			if ( oRange === "min" && this.orientation === "vertical" ) {
-            -
            				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
-            -
            			}
-            -
            			if ( oRange === "max" && this.orientation === "vertical" ) {
-            -
            				this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
-            -
            			}
+            		}
-            -
            	}
-            -
-            -
            });
-            -
-            -
            $.extend( $.ui.slider, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
-            -
            }(jQuery));
-            -
            /*
-            -
             * jQuery UI Tabs 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Tabs
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             *	jquery.ui.widget.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
-            -
            var tabId = 0,
-            -
            	listId = 0;
-            -
            function getNextTabId() {
-            -
            	return ++tabId;
-            -
            }
-            -
            function getNextListId() {
-            -
            	return ++listId;
-            -
            }
-            -
            $.widget( "ui.tabs", {
-            -
            	options: {
-            -
            		add: null,
-            -
            		ajaxOptions: null,
-            -
            		cache: false,
-            -
            		cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
-            -
            		collapsible: false,
-            -
            		disable: null,
-            -
            		disabled: [],
-            -
            		enable: null,
-            -
            		event: "click",
-            -
            		fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
-            -
            		idPrefix: "ui-tabs-",
-            -
            		load: null,
-            -
            		panelTemplate: "<div></div>",
-            -
            		remove: null,
-            -
            		select: null,
-            -
            		show: null,
-            -
            		spinner: "<em>Loading&#8230;</em>",
-            -
            		tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
             	},
-            -
            	_create: function() {
-            -
            		this._tabify( true );
-            -
            	},
-            -
            	_setOption: function( key, value ) {
-            -
            		if ( key == "selected" ) {
-            -
            			if (this.options.collapsible && value == this.options.selected ) {
-            -
            				return;
+            			}
-            -
            			this.select( value );
-            -
            		} else {
-            -
            			this.options[ key ] = value;
-            -
            			this._tabify();
+            		}
             	},
-            -
            	_tabId: function( a ) {
-            -
            		return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
-            -
            			this.options.idPrefix + getNextTabId();
             	},
-            -
            	_sanitizeSelector: function( hash ) {
-            -
            		// we need this because an id may contain a ":"
-            -
            		return hash.replace( /:/g, "\\:" );
-            -
            	},
-            -
            	_cookie: function() {
-            -
            		var cookie = this.cookie ||
-            -
            			( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
-            -
            		return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
-            -
            	},
-            -
            	_ui: function( tab, panel ) {
-            -
            		return {
-            -
            			tab: tab,
-            -
            			panel: panel,
-            -
            			index: this.anchors.index( tab )
-            -
            		};
-            -
            	},
-            -
            	_cleanup: function() {
-            -
            		// restore all former loading tabs labels
-            -
            		this.lis.filter( ".ui-state-processing" )
-            -
            			.removeClass( "ui-state-processing" )
-            -
            			.find( "span:data(label.tabs)" )
-            -
            				.each(function() {
-            -
            					var el = $( this );
-            -
            					el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
-            -
            				});
             	},
-            -
            	_tabify: function( init ) {
-            -
            		var self = this,
-            -
            			o = this.options,
-            -
            			fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
-            -
            		this.list = this.element.find( "ol,ul" ).eq( 0 );
-            -
            		this.lis = $( " > li:has(a[href])", this.list );
-            -
            		this.anchors = this.lis.map(function() {
-            -
            			return $( "a", this )[ 0 ];
-            -
            		});
-            -
            		this.panels = $( [] );
-            -
-            -
            		this.anchors.each(function( i, a ) {
-            -
            			var href = $( a ).attr( "href" );
-            -
            			// For dynamically created HTML that contains a hash as href IE < 8 expands
-            -
            			// such href to the full page url with hash and then misinterprets tab as ajax.
-            -
            			// Same consideration applies for an added tab with a fragment identifier
-            -
            			// since a[href=#fragment-identifier] does unexpectedly not match.
-            -
            			// Thus normalize href attribute...
-            -
            			var hrefBase = href.split( "#" )[ 0 ],
-            -
            				baseEl;
-            -
            			if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
-            -
            					( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
-            -
            				href = a.hash;
-            -
            				a.href = href;
-            -
            			}
-            -
            			// inline tab
-            -
            			if ( fragmentId.test( href ) ) {
-            -
            				self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
-            -
            			// remote tab
-            -
            			// prevent loading the page itself if href is just "#"
-            -
            			} else if ( href && href !== "#" ) {
-            -
            				// required for restore on destroy
-            -
            				$.data( a, "href.tabs", href );
-            -
-            -
            				// TODO until #3808 is fixed strip fragment identifier from url
-            -
            				// (IE fails to load from such url)
-            -
            				$.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
-            -
-            -
            				var id = self._tabId( a );
-            -
            				a.href = "#" + id;
-            -
            				var $panel = self.element.find( "#" + id );
-            -
            				if ( !$panel.length ) {
-            -
            					$panel = $( o.panelTemplate )
-            -
            						.attr( "id", id )
-            -
            						.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
-            -
            						.insertAfter( self.panels[ i - 1 ] || self.list );
-            -
            					$panel.data( "destroy.tabs", true );
-            -
            				}
-            -
            				self.panels = self.panels.add( $panel );
-            -
            			// invalid tab href
-            -
            			} else {
-            -
            				o.disabled.push( i );
-            -
            			}
-            -
            		});
-            -
            		// initialization from scratch
-            -
            		if ( init ) {
-            -
            			// attach necessary classes for styling
-            -
            			this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
-            -
            			this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
-            -
            			this.lis.addClass( "ui-state-default ui-corner-top" );
-            -
            			this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
-            -
-            -
            			// Selected tab
-            -
            			// use "selected" option or try to retrieve:
-            -
            			// 1. from fragment identifier in url
-            -
            			// 2. from cookie
-            -
            			// 3. from selected class attribute on <li>
-            -
            			if ( o.selected === undefined ) {
-            -
            				if ( location.hash ) {
-            -
            					this.anchors.each(function( i, a ) {
-            -
            						if ( a.hash == location.hash ) {
-            -
            							o.selected = i;
-            -
            							return false;
-            -
            						}
-            -
            					});
-            -
            				}
-            -
            				if ( typeof o.selected !== "number" && o.cookie ) {
-            -
            					o.selected = parseInt( self._cookie(), 10 );
-            -
            				}
-            -
            				if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
-            -
            					o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
-            -
            				}
-            -
            				o.selected = o.selected || ( this.lis.length ? 0 : -1 );
-            -
            			} else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
-            -
            				o.selected = -1;
-            -
            			}
-            -
            			// sanity check - default to first tab...
-            -
            			o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
-            -
            				? o.selected
-            -
            				: 0;
-            -
            			// Take disabling tabs via class attribute from HTML
-            -
            			// into account and update option properly.
-            -
            			// A selected tab cannot become disabled.
-            -
            			o.disabled = $.unique( o.disabled.concat(
-            -
            				$.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
-            -
            					return self.lis.index( n );
-            -
            				})
-            -
            			) ).sort();
-            -
            			if ( $.inArray( o.selected, o.disabled ) != -1 ) {
-            -
            				o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
-            -
            			}
-            -
            			// highlight selected tab
-            -
            			this.panels.addClass( "ui-tabs-hide" );
-            -
            			this.lis.removeClass( "ui-tabs-selected ui-state-active" );
-            -
            			// check for length avoids error when initializing empty list
-            -
            			if ( o.selected >= 0 && this.anchors.length ) {
-            -
            				self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
-            -
            				this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
-            -
            				// seems to be expected behavior that the show callback is fired
-            -
            				self.element.queue( "tabs", function() {
-            -
            					self._trigger( "show", null,
-            -
            						self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
-            -
            				});
-            -
            				this.load( o.selected );
+            			}
-            -
            			// clean up to avoid memory leaks in certain versions of IE 6
-            -
            			// TODO: namespace this event
-            -
            			$( window ).bind( "unload", function() {
-            -
            				self.lis.add( self.anchors ).unbind( ".tabs" );
-            -
            				self.lis = self.anchors = self.panels = null;
-            -
            			});
-            -
            		// update selected after add/remove
-            -
            		} else {
-            -
            			o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+            		}
-            -
            		// update collapsible
-            -
            		// TODO: use .toggleClass()
-            -
            		this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
-            -
            		// set or update cookie after init and add/remove respectively
-            -
            		if ( o.cookie ) {
-            -
            			this._cookie( o.selected, o.cookie );
+            		}
-            -
            		// disable tabs
-            -
            		for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
-            -
            			$( li )[ $.inArray( i, o.disabled ) != -1 &&
-            -
            				// TODO: use .toggleClass()
-            -
            				!$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+            		}
-            -
            		// reset cache if switching from cached to not cached
-            -
            		if ( o.cache === false ) {
-            -
            			this.anchors.removeData( "cache.tabs" );
-            -
            		}
-            -
-            -
            		// remove all handlers before, tabify may run on existing tabs after add or option change
-            -
            		this.lis.add( this.anchors ).unbind( ".tabs" );
-            -
            		if ( o.event !== "mouseover" ) {
-            -
            			var addState = function( state, el ) {
-            -
            				if ( el.is( ":not(.ui-state-disabled)" ) ) {
-            -
            					el.addClass( "ui-state-" + state );
+            				}
-            -
            			};
-            -
            			var removeState = function( state, el ) {
-            -
            				el.removeClass( "ui-state-" + state );
-            -
            			};
-            -
            			this.lis.bind( "mouseover.tabs" , function() {
-            -
            				addState( "hover", $( this ) );
-            -
            			});
-            -
            			this.lis.bind( "mouseout.tabs", function() {
-            -
            				removeState( "hover", $( this ) );
-            -
            			});
-            -
            			this.anchors.bind( "focus.tabs", function() {
-            -
            				addState( "focus", $( this ).closest( "li" ) );
-            -
            			});
-            -
            			this.anchors.bind( "blur.tabs", function() {
-            -
            				removeState( "focus", $( this ).closest( "li" ) );
-            -
            			});
+            		}
-            -
            		// set up animations
-            -
            		var hideFx, showFx;
-            -
            		if ( o.fx ) {
-            -
            			if ( $.isArray( o.fx ) ) {
-            -
            				hideFx = o.fx[ 0 ];
-            -
            				showFx = o.fx[ 1 ];
-            -
            			} else {
-            -
            				hideFx = showFx = o.fx;
-            -
            			}
+            		}
-            -
            		// Reset certain styles left over from animation
-            -
            		// and prevent IE's ClearType bug...
-            -
            		function resetStyle( $el, fx ) {
-            -
            			$el.css( "display", "" );
-            -
            			if ( !$.support.opacity && fx.opacity ) {
-            -
            				$el[ 0 ].style.removeAttribute( "filter" );
-            -
            			}
+            		}
-            -
            		// Show a tab...
-            -
            		var showTab = showFx
-            -
            			? function( clicked, $show ) {
-            -
            				$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
-            -
            				$show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
-            -
            					.animate( showFx, showFx.duration || "normal", function() {
-            -
            						resetStyle( $show, showFx );
-            -
            						self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
-            -
            					});
-            -
            			}
-            -
            			: function( clicked, $show ) {
-            -
            				$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
-            -
            				$show.removeClass( "ui-tabs-hide" );
-            -
            				self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
-            -
            			};
-            -
            		// Hide a tab, $show is optional...
-            -
            		var hideTab = hideFx
-            -
            			? function( clicked, $hide ) {
-            -
            				$hide.animate( hideFx, hideFx.duration || "normal", function() {
-            -
            					self.lis.removeClass( "ui-tabs-selected ui-state-active" );
-            -
            					$hide.addClass( "ui-tabs-hide" );
-            -
            					resetStyle( $hide, hideFx );
-            -
            					self.element.dequeue( "tabs" );
-            -
            				});
-            -
            			}
-            -
            			: function( clicked, $hide, $show ) {
-            -
            				self.lis.removeClass( "ui-tabs-selected ui-state-active" );
-            -
            				$hide.addClass( "ui-tabs-hide" );
-            -
            				self.element.dequeue( "tabs" );
-            -
            			};
-            -
            		// attach tab event handler, unbind to avoid duplicates from former tabifying...
-            -
            		this.anchors.bind( o.event + ".tabs", function() {
-            -
            			var el = this,
-            -
            				$li = $(el).closest( "li" ),
-            -
            				$hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
-            -
            				$show = self.element.find( self._sanitizeSelector( el.hash ) );
-            -
-            -
            			// If tab is already selected and not collapsible or tab disabled or
-            -
            			// or is already loading or click callback returns false stop here.
-            -
            			// Check if click handler returns false last so that it is not executed
-            -
            			// for a disabled or loading tab!
-            -
            			if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
-            -
            				$li.hasClass( "ui-state-disabled" ) ||
-            -
            				$li.hasClass( "ui-state-processing" ) ||
-            -
            				self.panels.filter( ":animated" ).length ||
-            -
            				self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
-            -
            				this.blur();
-            -
            				return false;
-            -
            			}
-            -
            			o.selected = self.anchors.index( this );
-            -
            			self.abort();
-            -
            			// if tab may be closed
-            -
            			if ( o.collapsible ) {
-            -
            				if ( $li.hasClass( "ui-tabs-selected" ) ) {
-            -
            					o.selected = -1;
-            -
            					if ( o.cookie ) {
-            -
            						self._cookie( o.selected, o.cookie );
-            -
            					}
-            -
            					self.element.queue( "tabs", function() {
-            -
            						hideTab( el, $hide );
-            -
            					}).dequeue( "tabs" );
-            -
            					this.blur();
-            -
            					return false;
-            -
            				} else if ( !$hide.length ) {
-            -
            					if ( o.cookie ) {
-            -
            						self._cookie( o.selected, o.cookie );
-            -
            					}
-            -
            					self.element.queue( "tabs", function() {
-            -
            						showTab( el, $show );
-            -
            					});
-            -
            					// TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
-            -
            					self.load( self.anchors.index( this ) );
-            -
            					this.blur();
-            -
            					return false;
+            				}
+            			}
-            -
-            -
            			if ( o.cookie ) {
-            -
            				self._cookie( o.selected, o.cookie );
+            			}
-            -
            			// show new tab
-            -
            			if ( $show.length ) {
-            -
            				if ( $hide.length ) {
-            -
            					self.element.queue( "tabs", function() {
-            -
            						hideTab( el, $hide );
-            -
            					});
-            -
            				}
-            -
            				self.element.queue( "tabs", function() {
-            -
            					showTab( el, $show );
-            -
            				});
-            -
-            -
            				self.load( self.anchors.index( this ) );
-            -
            			} else {
-            -
            				throw "jQuery UI Tabs: Mismatching fragment identifier.";
-            -
            			}
-            -
            			// Prevent IE from keeping other link focussed when using the back button
-            -
            			// and remove dotted border from clicked link. This is controlled via CSS
-            -
            			// in modern browsers; blur() removes focus from address bar in Firefox
-            -
            			// which can become a usability and annoying problem with tabs('rotate').
-            -
            			if ( $.browser.msie ) {
-            -
            				this.blur();
-            -
            			}
-            -
            		});
-            -
            		// disable click in any case
-            -
            		this.anchors.bind( "click.tabs", function(){
-            -
            			return false;
-            -
            		});
-            -
            	},
-            -
                _getIndex: function( index ) {
-            -
            		// meta-function to give users option to provide a href string instead of a numerical index.
-            -
            		// also sanitizes numerical indexes to valid values.
-            -
            		if ( typeof index == "string" ) {
-            -
            			index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) );
+            		}
-            -
            		return index;
-            -
            	},
-            -
            	destroy: function() {
-            -
            		var o = this.options;
-            -
            		this.abort();
-            -
            		this.element
-            -
            			.unbind( ".tabs" )
-            -
            			.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
-            -
            			.removeData( "tabs" );
-            -
            		this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
-            -
            		this.anchors.each(function() {
-            -
            			var href = $.data( this, "href.tabs" );
-            -
            			if ( href ) {
-            -
            				this.href = href;
-            -
            			}
-            -
            			var $this = $( this ).unbind( ".tabs" );
-            -
            			$.each( [ "href", "load", "cache" ], function( i, prefix ) {
-            -
            				$this.removeData( prefix + ".tabs" );
-            -
            			});
-            -
            		});
-            -
            		this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
-            -
            			if ( $.data( this, "destroy.tabs" ) ) {
-            -
            				$( this ).remove();
             			} else {
-            -
            				$( this ).removeClass([
-            -
            					"ui-state-default",
-            -
            					"ui-corner-top",
-            -
            					"ui-tabs-selected",
-            -
            					"ui-state-active",
-            -
            					"ui-state-hover",
-            -
            					"ui-state-focus",
-            -
            					"ui-state-disabled",
-            -
            					"ui-tabs-panel",
-            -
            					"ui-widget-content",
-            -
            					"ui-corner-bottom",
-            -
            					"ui-tabs-hide"
-            -
            				].join( " " ) );
+            			}
-            -
            		});
-            -
            		if ( o.cookie ) {
-            -
            			this._cookie( null, o.cookie );
+            		}
-            -
-            -
            		return this;
             	},
-            -
            	add: function( url, label, index ) {
-            -
            		if ( index === undefined ) {
-            -
            			index = this.anchors.length;
-            -
            		}
-            -
-            -
            		var self = this,
-            -
            			o = this.options,
-            -
            			$li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
-            -
            			id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
-            -
-            -
            		$li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
-            -
-            -
            		// try to find an existing element before creating a new one
-            -
            		var $panel = self.element.find( "#" + id );
-            -
            		if ( !$panel.length ) {
-            -
            			$panel = $( o.panelTemplate )
-            -
            				.attr( "id", id )
-            -
            				.data( "destroy.tabs", true );
+            		}
-            -
            		$panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
-            -
            		if ( index >= this.lis.length ) {
-            -
            			$li.appendTo( this.list );
-            -
            			$panel.appendTo( this.list[ 0 ].parentNode );
-            -
            		} else {
-            -
            			$li.insertBefore( this.lis[ index ] );
-            -
            			$panel.insertBefore( this.panels[ index ] );
+            		}
-            -
            		o.disabled = $.map( o.disabled, function( n, i ) {
-            -
            			return n >= index ? ++n : n;
-            -
            		});
-            -
            		this._tabify();
-            -
            		if ( this.anchors.length == 1 ) {
-            -
            			o.selected = 0;
-            -
            			$li.addClass( "ui-tabs-selected ui-state-active" );
-            -
            			$panel.removeClass( "ui-tabs-hide" );
-            -
            			this.element.queue( "tabs", function() {
-            -
            				self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
-            -
            			});
-            -
            			this.load( 0 );
-            -
            		}
-            -
            		this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
-            -
            		return this;
             	},
-            -
            	remove: function( index ) {
-            -
            		index = this._getIndex( index );
-            -
            		var o = this.options,
-            -
            			$li = this.lis.eq( index ).remove(),
-            -
            			$panel = this.panels.eq( index ).remove();
-            -
            		// If selected tab was removed focus tab to the right or
-            -
            		// in case the last tab was removed the tab to the left.
-            -
            		if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
-            -
            			this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+            		}
-            -
            		o.disabled = $.map(
-            -
            			$.grep( o.disabled, function(n, i) {
-            -
            				return n != index;
-            -
            			}),
-            -
            			function( n, i ) {
-            -
            				return n >= index ? --n : n;
-            -
            			});
-            -
-            -
            		this._tabify();
-            -
-            -
            		this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
-            -
            		return this;
             	},
-            -
            	enable: function( index ) {
-            -
            		index = this._getIndex( index );
-            -
            		var o = this.options;
-            -
            		if ( $.inArray( index, o.disabled ) == -1 ) {
             			return;
+            		}
-            -
            		this.lis.eq( index ).removeClass( "ui-state-disabled" );
-            -
            		o.disabled = $.grep( o.disabled, function( n, i ) {
-            -
            			return n != index;
-            -
            		});
-            -
-            -
            		this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
-            -
            		return this;
-            -
            	},
-            -
            	disable: function( index ) {
-            -
            		index = this._getIndex( index );
-            -
            		var self = this, o = this.options;
-            -
            		// cannot disable already selected tab
-            -
            		if ( index != o.selected ) {
-            -
            			this.lis.eq( index ).addClass( "ui-state-disabled" );
-            -
            			o.disabled.push( index );
-            -
            			o.disabled.sort();
-            -
            			this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+            		}
-            -
            		return this;
             	},
-            -
            	select: function( index ) {
-            -
            		index = this._getIndex( index );
-            -
            		if ( index == -1 ) {
-            -
            			if ( this.options.collapsible && this.options.selected != -1 ) {
-            -
            				index = this.options.selected;
-            -
            			} else {
-            -
            				return this;
-            -
            			}
+            		}
-            -
            		this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
-            -
            		return this;
-            -
            	},
-            -
            	load: function( index ) {
-            -
            		index = this._getIndex( index );
-            -
            		var self = this,
-            -
            			o = this.options,
-            -
            			a = this.anchors.eq( index )[ 0 ],
-            -
            			url = $.data( a, "load.tabs" );
-            -
            		this.abort();
-            -
            		// not remote or from cache
-            -
            		if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
-            -
            			this.element.dequeue( "tabs" );
             			return;
+            		}
-            -
            		// load remote from here on
-            -
            		this.lis.eq( index ).addClass( "ui-state-processing" );
-            -
            		if ( o.spinner ) {
-            -
            			var span = $( "span", a );
-            -
            			span.data( "label.tabs", span.html() ).html( o.spinner );
+            		}
-            -
            		this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
-            -
            			url: url,
-            -
            			success: function( r, s ) {
-            -
            				self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
-            -
            				// take care of tab labels
-            -
            				self._cleanup();
-            -
            				if ( o.cache ) {
-            -
            					$.data( a, "cache.tabs", true );
-            -
            				}
-            -
            				self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
-            -
            				try {
-            -
            					o.ajaxOptions.success( r, s );
-            -
            				}
-            -
            				catch ( e ) {}
-            -
            			},
-            -
            			error: function( xhr, s, e ) {
-            -
            				// take care of tab labels
-            -
            				self._cleanup();
-            -
            				self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
-            -
            				try {
-            -
            					// Passing index avoid a race condition when this method is
-            -
            					// called after the user has selected another tab.
-            -
            					// Pass the anchor that initiated this request allows
-            -
            					// loadError to manipulate the tab content panel via $(a.hash)
-            -
            					o.ajaxOptions.error( xhr, s, index, a );
-            -
            				}
-            -
            				catch ( e ) {}
-            -
            			}
-            -
            		} ) );
-            -
            		// last, so that load event is fired before show...
-            -
            		self.element.dequeue( "tabs" );
-            -
            		return this;
             	},
-            -
            	abort: function() {
-            -
            		// stop possibly running animations
-            -
            		this.element.queue( [] );
-            -
            		this.panels.stop( false, true );
-            -
            		// "tabs" queue must not contain more than two elements,
-            -
            		// which are the callbacks for the latest clicked tab...
-            -
            		this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
-            -
            		// terminate pending requests from other tabs
-            -
            		if ( this.xhr ) {
-            -
            			this.xhr.abort();
-            -
            			delete this.xhr;
+            		}
-            -
            		// take care of tab labels
-            -
            		this._cleanup();
-            -
            		return this;
             	},
-            -
            	url: function( index, url ) {
-            -
            		this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
-            -
            		return this;
             	},
-            -
            	length: function() {
-            -
            		return this.anchors.length;
-            -
            	}
-            -
            });
-            -
            $.extend( $.ui.tabs, {
-            -
            	version: "1.8.17"
-            -
            });
-            -
            /*
-            -
             * Tabs Extensions
-            -
             */
-            -
            /*
-            -
             * Rotate
-            -
             */
-            -
            $.extend( $.ui.tabs.prototype, {
-            -
            	rotation: null,
-            -
            	rotate: function( ms, continuing ) {
-            -
            		var self = this,
-            -
            			o = this.options;
-            -
            		var rotate = self._rotate || ( self._rotate = function( e ) {
-            -
            			clearTimeout( self.rotation );
-            -
            			self.rotation = setTimeout(function() {
-            -
            				var t = o.selected;
-            -
            				self.select( ++t < self.anchors.length ? t : 0 );
-            -
            			}, ms );
-            -
-            -
            			if ( e ) {
-            -
            				e.stopPropagation();
-            -
            			}
-            -
            		});
-            -
            		var stop = self._unrotate || ( self._unrotate = !continuing
-            -
            			? function(e) {
-            -
            				if (e.clientX) { // in case of a true click
-            -
            					self.rotate(null);
+            				}
+            			}
-            -
            			: function( e ) {
-            -
            				t = o.selected;
-            -
            				rotate();
-            -
            			});
-            -
            		// start rotation
-            -
            		if ( ms ) {
-            -
            			this.element.bind( "tabsshow", rotate );
-            -
            			this.anchors.bind( o.event + ".tabs", stop );
-            -
            			rotate();
-            -
            		// stop rotation
-            -
            		} else {
-            -
            			clearTimeout( self.rotation );
-            -
            			this.element.unbind( "tabsshow", rotate );
-            -
            			this.anchors.unbind( o.event + ".tabs", stop );
-            -
            			delete this._rotate;
-            -
            			delete this._unrotate;
+            		}
-            -
            		return this;
-            -
            	}
-            -
            });
-            -
            })( jQuery );
-            -
            /*
-            -
             * jQuery UI Datepicker 1.8.17
-            -
             *
-            -
             * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
-            -
             * Dual licensed under the MIT or GPL Version 2 licenses.
-            -
             * http://jquery.org/license
-            -
             *
-            -
             * http://docs.jquery.com/UI/Datepicker
-            -
             *
-            -
             * Depends:
-            -
             *	jquery.ui.core.js
-            -
             */
-            -
            (function( $, undefined ) {
-            -
            $.extend($.ui, { datepicker: { version: "1.8.17" } });
-            -
            var PROP_NAME = 'datepicker';
-            -
            var dpuuid = new Date().getTime();
-            -
            var instActive;
-            -
            /* Date picker manager.
-            -
               Use the singleton instance of this class, $.datepicker, to interact with the date picker.
-            -
               Settings for (groups of) date pickers are maintained in an instance object,
-            -
               allowing multiple different settings on the same page. */
-            -
            function Datepicker() {
-            -
            	this.debug = false; // Change this to true to start debugging
-            -
            	this._curInst = null; // The current instance in use
-            -
            	this._keyEvent = false; // If the last event was a key event
-            -
            	this._disabledInputs = []; // List of date picker inputs that have been disabled
-            -
            	this._datepickerShowing = false; // True if the popup picker is showing , false if not
-            -
            	this._inDialog = false; // True if showing within a "dialog", false if not
-            -
            	this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
-            -
            	this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
-            -
            	this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
-            -
            	this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
-            -
            	this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
-            -
            	this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
-            -
            	this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
-            -
            	this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
-            -
            	this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
-            -
            	this.regional = []; // Available regional settings, indexed by language code
-            -
            	this.regional[''] = { // Default regional settings
-            -
            		closeText: 'Done', // Display text for close link
-            -
            		prevText: 'Prev', // Display text for previous month link
-            -
            		nextText: 'Next', // Display text for next month link
-            -
            		currentText: 'Today', // Display text for current month link
-            -
            		monthNames: ['January','February','March','April','May','June',
-            -
            			'July','August','September','October','November','December'], // Names of months for drop-down and formatting
-            -
            		monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
-            -
            		dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
-            -
            		dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
-            -
            		dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
-            -
            		weekHeader: 'Wk', // Column header for week of the year
-            -
            		dateFormat: 'mm/dd/yy', // See format options on parseDate
-            -
            		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
-            -
            		isRTL: false, // True if right-to-left language, false if left-to-right
-            -
            		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
-            -
            		yearSuffix: '' // Additional text to append to the year in the month headers
-            -
            	};
-            -
            	this._defaults = { // Global defaults for all the date picker instances
-            -
            		showOn: 'focus', // 'focus' for popup on focus,
-            -
            			// 'button' for trigger button, or 'both' for either
-            -
            		showAnim: 'fadeIn', // Name of jQuery animation for popup
-            -
            		showOptions: {}, // Options for enhanced animations
-            -
            		defaultDate: null, // Used when field is blank: actual date,
-            -
            			// +/-number for offset from today, null for today
-            -
            		appendText: '', // Display text following the input box, e.g. showing the format
-            -
            		buttonText: '...', // Text for trigger button
-            -
            		buttonImage: '', // URL for trigger button image
-            -
            		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
-            -
            		hideIfNoPrevNext: false, // True to hide next/previous month links
-            -
            			// if not applicable, false to just disable them
-            -
            		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
-            -
            		gotoCurrent: false, // True if today link goes back to current selection instead
-            -
            		changeMonth: false, // True if month can be selected directly, false if only prev/next
-            -
            		changeYear: false, // True if year can be selected directly, false if only prev/next
-            -
            		yearRange: 'c-10:c+10', // Range of years to display in drop-down,
-            -
            			// either relative to today's year (-nn:+nn), relative to currently displayed year
-            -
            			// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
-            -
            		showOtherMonths: false, // True to show dates in other months, false to leave blank
-            -
            		selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
-            -
            		showWeek: false, // True to show week of the year, false to not show it
-            -
            		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
-            -
            			// takes a Date and returns the number of the week for it
-            -
            		shortYearCutoff: '+10', // Short year values < this are in the current century,
-            -
            			// > this are in the previous century,
-            -
            			// string value starting with '+' for current year + value
-            -
            		minDate: null, // The earliest selectable date, or null for no limit
-            -
            		maxDate: null, // The latest selectable date, or null for no limit
-            -
            		duration: 'fast', // Duration of display/closure
-            -
            		beforeShowDay: null, // Function that takes a date and returns an array with
-            -
            			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
-            -
            			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
-            -
            		beforeShow: null, // Function that takes an input field and
-            -
            			// returns a set of custom settings for the date picker
-            -
            		onSelect: null, // Define a callback function when a date is selected
-            -
            		onChangeMonthYear: null, // Define a callback function when the month or year is changed
-            -
            		onClose: null, // Define a callback function when the datepicker is closed
-            -
            		numberOfMonths: 1, // Number of months to show at a time
-            -
            		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
-            -
            		stepMonths: 1, // Number of months to step back/forward
-            -
            		stepBigMonths: 12, // Number of months to step back/forward for the big links
-            -
            		altField: '', // Selector for an alternate field to store selected dates into
-            -
            		altFormat: '', // The date format to use for the alternate field
-            -
            		constrainInput: true, // The input is constrained by the current date format
-            -
            		showButtonPanel: false, // True to show button panel, false to not show it
-            -
            		autoSize: false, // True to size the input for the date format, false to leave as is
-            -
            		disabled: false // The initial disabled state
-            -
            	};
-            -
            	$.extend(this._defaults, this.regional['']);
-            -
            	this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
-            -
            }
-            -
-            -
            $.extend(Datepicker.prototype, {
-            -
            	/* Class name added to elements to indicate already configured with a date picker. */
-            -
            	markerClassName: 'hasDatepicker',
-            -
-            -
            	//Keep track of the maximum number of rows displayed (see #7043)
-            -
            	maxRows: 4,
-            -
            	/* Debug logging (if enabled). */
-            -
            	log: function () {
-            -
            		if (this.debug)
-            -
            			console.log.apply('', arguments);
-            -
            	},
-            -
-            -
            	// TODO rename to "widget" when switching to widget factory
-            -
            	_widgetDatepicker: function() {
-            -
            		return this.dpDiv;
             	},
-            -
            	/* Override the default settings for all instances of the date picker.
-            -
            	   @param  settings  object - the new settings to use as defaults (anonymous object)
-            -
            	   @return the manager object */
-            -
            	setDefaults: function(settings) {
-            -
            		extendRemove(this._defaults, settings || {});
-            -
            		return this;
-            -
            	},
-            -
            	/* Attach the date picker to a jQuery selection.
-            -
            	   @param  target    element - the target input field or division or span
-            -
            	   @param  settings  object - the new settings to use for this date picker instance (anonymous) */
-            -
            	_attachDatepicker: function(target, settings) {
-            -
            		// check for settings on the control itself - in namespace 'date:'
-            -
            		var inlineSettings = null;
-            -
            		for (var attrName in this._defaults) {
-            -
            			var attrValue = target.getAttribute('date:' + attrName);
-            -
            			if (attrValue) {
-            -
            				inlineSettings = inlineSettings || {};
-            -
            				try {
-            -
            					inlineSettings[attrName] = eval(attrValue);
-            -
            				} catch (err) {
-            -
            					inlineSettings[attrName] = attrValue;
+            				}
+            			}
+            		}
-            -
            		var nodeName = target.nodeName.toLowerCase();
-            -
            		var inline = (nodeName == 'div' || nodeName == 'span');
-            -
            		if (!target.id) {
-            -
            			this.uuid += 1;
-            -
            			target.id = 'dp' + this.uuid;
-            -
            		}
-            -
            		var inst = this._newInst($(target), inline);
-            -
            		inst.settings = $.extend({}, settings || {}, inlineSettings || {});
-            -
            		if (nodeName == 'input') {
-            -
            			this._connectDatepicker(target, inst);
-            -
            		} else if (inline) {
-            -
            			this._inlineDatepicker(target, inst);
-            -
            		}
             	},
-            -
            	/* Create a new instance object. */
-            -
            	_newInst: function(target, inline) {
-            -
            		var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
-            -
            		return {id: id, input: target, // associated target
-            -
            			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
-            -
            			drawMonth: 0, drawYear: 0, // month being drawn
-            -
            			inline: inline, // is datepicker inline or not
-            -
            			dpDiv: (!inline ? this.dpDiv : // presentation div
-            -
            			bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
             	},
-            -
            	/* Attach the date picker to an input field. */
-            -
            	_connectDatepicker: function(target, inst) {
-            -
            		var input = $(target);
-            -
            		inst.append = $([]);
-            -
            		inst.trigger = $([]);
-            -
            		if (input.hasClass(this.markerClassName))
             			return;
-            -
            		this._attachments(input, inst);
-            -
            		input.addClass(this.markerClassName).keydown(this._doKeyDown).
-            -
            			keypress(this._doKeyPress).keyup(this._doKeyUp).
-            -
            			bind("setData.datepicker", function(event, key, value) {
-            -
            				inst.settings[key] = value;
-            -
            			}).bind("getData.datepicker", function(event, key) {
-            -
            				return this._get(inst, key);
-            -
            			});
-            -
            		this._autoSize(inst);
-            -
            		$.data(target, PROP_NAME, inst);
-            -
            		//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
-            -
            		if( inst.settings.disabled ) {
-            -
            			this._disableDatepicker( target );
+            		}
-            -
            	},
-            -
            	/* Make attachments based on settings. */
-            -
            	_attachments: function(input, inst) {
-            -
            		var appendText = this._get(inst, 'appendText');
-            -
            		var isRTL = this._get(inst, 'isRTL');
-            -
            		if (inst.append)
-            -
            			inst.append.remove();
-            -
            		if (appendText) {
-            -
            			inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
-            -
            			input[isRTL ? 'before' : 'after'](inst.append);
-            -
            		}
-            -
            		input.unbind('focus', this._showDatepicker);
-            -
            		if (inst.trigger)
-            -
            			inst.trigger.remove();
-            -
            		var showOn = this._get(inst, 'showOn');
-            -
            		if (showOn == 'focus' || showOn == 'both') // pop-


1	+ /*! jQuery UI - v1.10.2 - 2013-03-14
2	+ * http://jqueryui.com
3	+ * Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.effect.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js
4	+ * Copyright 2013 jQuery Foundation and other contributors; Licensed MIT */
5	+ (function( $, undefined ) {





6
7	+ var uuid = 0,
8	+ runiqueId = /^ui-id-\d+$/;
9	+
10	+ // $.ui might exist from components with no dependencies, e.g., $.ui.position
11	$.ui = $.ui \|\| {};



12
13	$.extend( $.ui, {
14	+ version: "1.10.2",
15
16	keyCode: {

17	BACKSPACE: 8,

18	COMMA: 188,




19	DELETE: 46,
20	DOWN: 40,
21	END: 35,
22	ENTER: 13,
23	ESCAPE: 27,
24	HOME: 36,

25	LEFT: 37,

26	NUMPAD_ADD: 107,
27	NUMPAD_DECIMAL: 110,
28	NUMPAD_DIVIDE: 111,

33	PAGE_UP: 33,
34	PERIOD: 190,
35	RIGHT: 39,

36	SPACE: 32,
37	TAB: 9,
38	+ UP: 38

39	}
40	});
41
42	// plugins
43	$.fn.extend({
44	+ focus: (function( orig ) {
45	+ return function( delay, fn ) {
46	+ return typeof delay === "number" ?
47	+ this.each(function() {
48	+ var elem = this;
49	+ setTimeout(function() {
50	+ $( elem ).focus();
51	+ if ( fn ) {
52	+ fn.call( elem );
53	+ }
54	+ }, delay );
55	+ }) :
56	+ orig.apply( this, arguments );
57	+ };
58	+ })( $.fn.focus ),

59
60	scrollParent: function() {
61	var scrollParent;
62	+ if (($.ui.ie && (/(static\|relative)/).test(this.css("position"))) \|\| (/absolute/).test(this.css("position"))) {
63	scrollParent = this.parents().filter(function() {
64	+ return (/(relative\|absolute\|fixed)/).test($.css(this,"position")) && (/(auto\|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x"));
65	}).eq(0);
66	} else {
67	scrollParent = this.parents().filter(function() {
68	+ return (/(auto\|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x"));
69	}).eq(0);
70	}
71
72	+ return (/fixed/).test(this.css("position")) \|\| !scrollParent.length ? $(document) : scrollParent;
73	},
74
75	zIndex: function( zIndex ) {

101	return 0;
102	},
103
104	+ uniqueId: function() {







































105	return this.each(function() {
106	+ if ( !this.id ) {
107	+ this.id = "ui-id-" + (++uuid);
108	+ }
109	});
110	+ },





111
112	+ removeUniqueId: function() {
113	return this.each(function() {
114	+ if ( runiqueId.test( this.id ) ) {
115	+ $( this ).removeAttr( "id" );
116	+ }
117	});
118	+ }
119	});
120
121	// selectors
122	function focusable( element, isTabIndexNotNaN ) {
123	+ var map, mapName, img,
124	+ nodeName = element.nodeName.toLowerCase();
125	if ( "area" === nodeName ) {
126	+ map = element.parentNode;
127	+ mapName = map.name;

128	if ( !element.href \|\| !mapName \|\| map.nodeName.toLowerCase() !== "map" ) {
129	return false;
130	}
131	img = $( "img[usemap=#" + mapName + "]" )[0];
132	return !!img && visible( img );
133	}
134	+ return ( /input\|select\|textarea\|button\|object/.test( nodeName ) ?
135	+ !element.disabled :
136	+ "a" === nodeName ?
137	+ element.href \|\| isTabIndexNotNaN :
138	+ isTabIndexNotNaN) &&
139	// the element and all of its ancestors must be visible
140	+ visible( element );
141	}
142
143	function visible( element ) {
144	+ return $.expr.filters.visible( element ) &&
145	+ !$( element ).parents().addBack().filter(function() {
146	+ return $.css( this, "visibility" ) === "hidden";
147	+ }).length;
148	}
149
150	$.extend( $.expr[ ":" ], {
151	+ data: $.expr.createPseudo ?
152	+ $.expr.createPseudo(function( dataName ) {
153	+ return function( elem ) {
154	+ return !!$.data( elem, dataName );
155	+ };
156	+ }) :
157	+ // support: jQuery <1.8
158	+ function( elem, i, match ) {
159	+ return !!$.data( elem, match[ 3 ] );
160	+ },
161
162	focusable: function( element ) {
163	return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );

170	}
171	});
172
173	+ // support: jQuery <1.8
174	+ if ( !$( "<a>" ).outerWidth( 1 ).jquery ) {
175	+ $.each( [ "Width", "Height" ], function( i, name ) {
176	+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
177	+ type = name.toLowerCase(),
178	+ orig = {
179	+ innerWidth: $.fn.innerWidth,
180	+ innerHeight: $.fn.innerHeight,
181	+ outerWidth: $.fn.outerWidth,
182	+ outerHeight: $.fn.outerHeight
183	+ };
184	+
185	+ function reduce( elem, size, border, margin ) {
186	+ $.each( side, function() {
187	+ size -= parseFloat( $.css( elem, "padding" + this ) ) \|\| 0;
188	+ if ( border ) {
189	+ size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) \|\| 0;
190	+ }
191	+ if ( margin ) {
192	+ size -= parseFloat( $.css( elem, "margin" + this ) ) \|\| 0;
193	+ }
194	+ });
195	+ return size;
196	+ }
197	+
198	+ $.fn[ "inner" + name ] = function( size ) {
199	+ if ( size === undefined ) {
200	+ return orig[ "inner" + name ].call( this );
201	+ }
202
203	+ return this.each(function() {
204	+ $( this ).css( type, reduce( this, size ) + "px" );
205	+ });
206	+ };
207	+
208	+ $.fn[ "outer" + name] = function( size, margin ) {
209	+ if ( typeof size !== "number" ) {
210	+ return orig[ "outer" + name ].call( this, size );
211	+ }
212	+
213	+ return this.each(function() {
214	+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
215	+ });
216	+ };
217	});
218	+ }
219
220	+ // support: jQuery <1.8
221	+ if ( !$.fn.addBack ) {
222	+ $.fn.addBack = function( selector ) {
223	+ return this.add( selector == null ?
224	+ this.prevObject : this.prevObject.filter( selector )
225	+ );
226	+ };
227	+ }
228
229	+ // support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
230	+ if ( $( "<a>" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) {
231	+ $.fn.removeData = (function( removeData ) {
232	+ return function( key ) {
233	+ if ( arguments.length ) {
234	+ return removeData.call( this, $.camelCase( key ) );
235	+ } else {
236	+ return removeData.call( this );
237	+ }
238	+ };
239	+ })( $.fn.removeData );
240	+ }
241
242
243
244
245
246	// deprecated
247	+ $.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() );
248	+
249	+ $.support.selectstart = "onselectstart" in document.createElement( "div" );
250	+ $.fn.extend({
251	+ disableSelection: function() {
252	+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
253	+ ".ui-disableSelection", function( event ) {
254	+ event.preventDefault();
255	+ });
256	+ },
257	+
258	+ enableSelection: function() {
259	+ return this.unbind( ".ui-disableSelection" );
260	+ }
261	+ });
262	+
263	$.extend( $.ui, {
264	// $.ui.plugin is deprecated. Use the proxy pattern instead.
265	plugin: {
266	add: function( module, option, set ) {
267	+ var i,
268	+ proto = $.ui[ module ].prototype;
269	+ for ( i in set ) {
270	proto.plugins[ i ] = proto.plugins[ i ] \|\| [];
271	proto.plugins[ i ].push( [ option, set[ i ] ] );
272	}
273	},
274	call: function( instance, name, args ) {
275	+ var i,
276	+ set = instance.plugins[ name ];
277	+ if ( !set \|\| !instance.element[ 0 ].parentNode \|\| instance.element[ 0 ].parentNode.nodeType === 11 ) {
278	return;
279	}
280	+
281	+ for ( i = 0; i < set.length; i++ ) {
282	if ( instance.options[ set[ i ][ 0 ] ] ) {
283	set[ i ][ 1 ].apply( instance.element, args );
284	}
285	}
286	}
287	},
288	+







289	// only used by resizable
290	hasScroll: function( el, a ) {
291	+
292	//If overflow is hidden, the element might have extra content, but the user wants to hide it
293	if ( $( el ).css( "overflow" ) === "hidden") {
294	return false;
295	}
296	+
297	var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
298	has = false;
299	+
300	if ( el[ scroll ] > 0 ) {
301	return true;
302	}
303	+
304	// TODO: determine which cases actually cause this to happen
305	// if the element doesn't have the scroll set, see if it's possible to
306	// set the scroll

308	has = ( el[ scroll ] > 0 );
309	el[ scroll ] = 0;
310	return has;










311	}
312	});
313
314	})( jQuery );
315	+








316	(function( $, undefined ) {
317
318	+ var uuid = 0,
319	+ slice = Array.prototype.slice,
320	+ _cleanData = $.cleanData;
321	+ $.cleanData = function( elems ) {
322	+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
323	+ try {
324	+ $( elem ).triggerHandler( "remove" );
325	+ // http://bugs.jquery.com/ticket/8235
326	+ } catch( e ) {}
327	+ }
328	+ _cleanData( elems );
329	+ };


















330
331	$.widget = function( name, base, prototype ) {
332	+ var fullName, existingConstructor, constructor, basePrototype,
333	+ // proxiedPrototype allows the provided prototype to remain unmodified
334	+ // so that it can be used as a mixin for multiple widgets (#8876)
335	+ proxiedPrototype = {},
336	+ namespace = name.split( "." )[ 0 ];
337	+
338	name = name.split( "." )[ 1 ];
339	fullName = namespace + "-" + name;
340

344	}
345
346	// create selector for plugin
347	+ $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
348	+ return !!$.data( elem, fullName );
349	};
350
351	$[ namespace ] = $[ namespace ] \|\| {};
352	+ existingConstructor = $[ namespace ][ name ];
353	+ constructor = $[ namespace ][ name ] = function( options, element ) {
354	+ // allow instantiation without "new" keyword
355	+ if ( !this._createWidget ) {
356	+ return new constructor( options, element );
357	+ }
358	+
359	// allow instantiation without initializing for simple inheritance
360	+ // must use "new" keyword (the code above always passes args)
361	if ( arguments.length ) {
362	this._createWidget( options, element );
363	}
364	};
365	+ // extend with the existing constructor to carry over any static properties
366	+ $.extend( constructor, existingConstructor, {
367	+ version: prototype.version,
368	+ // copy the object used to create the prototype in case we need to
369	+ // redefine the widget later
370	+ _proto: $.extend( {}, prototype ),
371	+ // track widgets that inherit from this widget in case this widget is
372	+ // redefined after a widget inherits from it
373	+ _childConstructors: []
374	+ });
375
376	+ basePrototype = new base();
377	// we need to make the options hash a property directly on the new instance
378	// otherwise we'll modify the options hash on the prototype that we're
379	// inheriting from
380	+ basePrototype.options = $.widget.extend( {}, basePrototype.options );
381	+ $.each( prototype, function( prop, value ) {
382	+ if ( !$.isFunction( value ) ) {
383	+ proxiedPrototype[ prop ] = value;
384	+ return;
385	+ }
386	+ proxiedPrototype[ prop ] = (function() {
387	+ var _super = function() {
388	+ return base.prototype[ prop ].apply( this, arguments );
389	+ },
390	+ _superApply = function( args ) {
391	+ return base.prototype[ prop ].apply( this, args );
392	+ };
393	+ return function() {
394	+ var __super = this._super,
395	+ __superApply = this._superApply,
396	+ returnValue;
397	+
398	+ this._super = _super;
399	+ this._superApply = _superApply;
400	+
401	+ returnValue = value.apply( this, arguments );
402	+
403	+ this._super = __super;
404	+ this._superApply = __superApply;
405	+
406	+ return returnValue;
407	+ };
408	+ })();
409	+ });
410	+ constructor.prototype = $.widget.extend( basePrototype, {
411	+ // TODO: remove support for widgetEventPrefix
412	+ // always use the name + a colon as the prefix, e.g., draggable:start
413	+ // don't prefix for widgets that aren't DOM-based
414	+ widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name
415	+ }, proxiedPrototype, {
416	+ constructor: constructor,
417	namespace: namespace,
418	widgetName: name,
419	+ widgetFullName: fullName
420	+ });
421	+
422	+ // If this widget is being redefined then we need to find all widgets that
423	+ // are inheriting from it and redefine all of them so that they inherit from
424	+ // the new version of this widget. We're essentially trying to replace one
425	+ // level in the prototype chain.
426	+ if ( existingConstructor ) {
427	+ $.each( existingConstructor._childConstructors, function( i, child ) {
428	+ var childPrototype = child.prototype;
429	+
430	+ // redefine the child widget using the same prototype that was
431	+ // originally used, but inherit from the new version of the base
432	+ $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto );
433	+ });
434	+ // remove the list of existing child constructors from the old constructor
435	+ // so the old child constructors can be garbage collected
436	+ delete existingConstructor._childConstructors;
437	+ } else {
438	+ base._childConstructors.push( constructor );
439	+ }
440	+
441	+ $.widget.bridge( name, constructor );
442	+ };
443
444	+ $.widget.extend = function( target ) {
445	+ var input = slice.call( arguments, 1 ),
446	+ inputIndex = 0,
447	+ inputLength = input.length,
448	+ key,
449	+ value;
450	+ for ( ; inputIndex < inputLength; inputIndex++ ) {
451	+ for ( key in input[ inputIndex ] ) {
452	+ value = input[ inputIndex ][ key ];
453	+ if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
454	+ // Clone objects
455	+ if ( $.isPlainObject( value ) ) {
456	+ target[ key ] = $.isPlainObject( target[ key ] ) ?
457	+ $.widget.extend( {}, target[ key ], value ) :
458	+ // Don't extend strings, arrays, etc. with objects
459	+ $.widget.extend( {}, value );
460	+ // Copy everything else by reference
461	+ } else {
462	+ target[ key ] = value;
463	+ }
464	+ }
465	+ }
466	+ }
467	+ return target;
468	};
469
470	$.widget.bridge = function( name, object ) {
471	+ var fullName = object.prototype.widgetFullName \|\| name;
472	$.fn[ name ] = function( options ) {
473	var isMethodCall = typeof options === "string",
474	+ args = slice.call( arguments, 1 ),
475	returnValue = this;
476
477	// allow multiple hashes to be passed on init
478	options = !isMethodCall && args.length ?
479	+ $.widget.extend.apply( null, [ options ].concat(args) ) :
480	options;
481





482	if ( isMethodCall ) {
483	this.each(function() {
484	+ var methodValue,
485	+ instance = $.data( this, fullName );
486	+ if ( !instance ) {
487	+ return $.error( "cannot call methods on " + name + " prior to initialization; " +
488	+ "attempted to call method '" + options + "'" );
489	+ }
490	+ if ( !$.isFunction( instance[options] ) \|\| options.charAt( 0 ) === "_" ) {
491	+ return $.error( "no such method '" + options + "' for " + name + " widget instance" );
492	+ }
493	+ methodValue = instance[ options ].apply( instance, args );



494	if ( methodValue !== instance && methodValue !== undefined ) {
495	+ returnValue = methodValue && methodValue.jquery ?
496	+ returnValue.pushStack( methodValue.get() ) :
497	+ methodValue;
498	return false;
499	}
500	});
501	} else {
502	this.each(function() {
503	+ var instance = $.data( this, fullName );
504	if ( instance ) {
505	instance.option( options \|\| {} )._init();
506	} else {
507	+ $.data( this, fullName, new object( options, this ) );
508	}
509	});
510	}

513	};
514	};
515
516	+ $.Widget = function( /* options, element */ ) {};
517	+ $.Widget._childConstructors = [];




518
519	$.Widget.prototype = {
520	widgetName: "widget",
521	widgetEventPrefix: "",
522	+ defaultElement: "<div>",
523	options: {
524	+ disabled: false,
525	+
526	+ // callbacks
527	+ create: null
528	},
529	_createWidget: function( options, element ) {
530	+ element = $( element \|\| this.defaultElement \|\| this )[ 0 ];


531	this.element = $( element );
532	+ this.uuid = uuid++;
533	+ this.eventNamespace = "." + this.widgetName + this.uuid;
534	+ this.options = $.widget.extend( {},
535	this.options,
536	this._getCreateOptions(),
537	options );
538
539	+ this.bindings = $();
540	+ this.hoverable = $();
541	+ this.focusable = $();
542	+
543	+ if ( element !== this ) {
544	+ $.data( element, this.widgetFullName, this );
545	+ this._on( true, this.element, {
546	+ remove: function( event ) {
547	+ if ( event.target === element ) {
548	+ this.destroy();
549	+ }
550	+ }
551	+ });
552	+ this.document = $( element.style ?
553	+ // element within the document
554	+ element.ownerDocument :
555	+ // element is window or document
556	+ element.document \|\| element );
557	+ this.window = $( this.document[0].defaultView \|\| this.document[0].parentWindow );
558	+ }
559
560	this._create();
561	+ this._trigger( "create", null, this._getCreateEventData() );
562	this._init();
563	},
564	+ _getCreateOptions: $.noop,
565	+ _getCreateEventData: $.noop,
566	+ _create: $.noop,
567	+ _init: $.noop,

568
569	destroy: function() {
570	+ this._destroy();
571	+ // we can probably remove the unbind calls in 2.0
572	+ // all event bindings should go through this._on()
573	this.element
574	+ .unbind( this.eventNamespace )
575	+ // 1.9 BC for #7810
576	+ // TODO remove dual storage
577	+ .removeData( this.widgetName )
578	+ .removeData( this.widgetFullName )
579	+ // support: jquery <1.6.3
580	+ // http://bugs.jquery.com/ticket/9413
581	+ .removeData( $.camelCase( this.widgetFullName ) );
582	this.widget()
583	+ .unbind( this.eventNamespace )
584	.removeAttr( "aria-disabled" )
585	.removeClass(
586	+ this.widgetFullName + "-disabled " +
587	"ui-state-disabled" );
588	+
589	+ // clean up events and states
590	+ this.bindings.unbind( this.eventNamespace );
591	+ this.hoverable.removeClass( "ui-state-hover" );
592	+ this.focusable.removeClass( "ui-state-focus" );
593	},
594	+ _destroy: $.noop,
595
596	widget: function() {
597	return this.element;
598	},
599
600	option: function( key, value ) {
601	+ var options = key,
602	+ parts,
603	+ curOption,
604	+ i;
605
606	if ( arguments.length === 0 ) {
607	// don't return a reference to the internal hash
608	+ return $.widget.extend( {}, this.options );
609	}
610
611	+ if ( typeof key === "string" ) {
612	+ // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }


613	options = {};
614	+ parts = key.split( "." );
615	+ key = parts.shift();
616	+ if ( parts.length ) {
617	+ curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
618	+ for ( i = 0; i < parts.length - 1; i++ ) {
619	+ curOption[ parts[ i ] ] = curOption[ parts[ i ] ] \|\| {};
620	+ curOption = curOption[ parts[ i ] ];
621	+ }
622	+ key = parts.pop();
623	+ if ( value === undefined ) {
624	+ return curOption[ key ] === undefined ? null : curOption[ key ];
625	+ }
626	+ curOption[ key ] = value;
627	+ } else {
628	+ if ( value === undefined ) {
629	+ return this.options[ key ] === undefined ? null : this.options[ key ];
630	+ }
631	+ options[ key ] = value;
632	+ }
633	}
634
635	this._setOptions( options );

637	return this;
638	},
639	_setOptions: function( options ) {
640	+ var key;
641	+
642	+ for ( key in options ) {
643	+ this._setOption( key, options[ key ] );
644	+ }
645
646	return this;
647	},

650
651	if ( key === "disabled" ) {
652	this.widget()
653	+ .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value )


654	.attr( "aria-disabled", value );
655	+ this.hoverable.removeClass( "ui-state-hover" );
656	+ this.focusable.removeClass( "ui-state-focus" );
657	}
658
659	return this;

666	return this._setOption( "disabled", true );
667	},
668
669	+ _on: function( suppressDisabledCheck, element, handlers ) {
670	+ var delegateElement,
671	+ instance = this;
672	+
673	+ // no suppressDisabledCheck flag, shuffle arguments
674	+ if ( typeof suppressDisabledCheck !== "boolean" ) {
675	+ handlers = element;
676	+ element = suppressDisabledCheck;
677	+ suppressDisabledCheck = false;
678	+ }
679	+
680	+ // no element argument, shuffle and use this.element
681	+ if ( !handlers ) {
682	+ handlers = element;
683	+ element = this.element;
684	+ delegateElement = this.widget();
685	+ } else {
686	+ // accept selectors, DOM elements
687	+ element = delegateElement = $( element );
688	+ this.bindings = this.bindings.add( element );
689	+ }
690	+
691	+ $.each( handlers, function( event, handler ) {
692	+ function handlerProxy() {
693	+ // allow widgets to customize the disabled handling
694	+ // - disabled as an array instead of boolean
695	+ // - disabled class as method for disabling individual parts
696	+ if ( !suppressDisabledCheck &&
697	+ ( instance.options.disabled === true \|\|
698	+ $( this ).hasClass( "ui-state-disabled" ) ) ) {
699	+ return;
700	+ }
701	+ return ( typeof handler === "string" ? instance[ handler ] : handler )
702	+ .apply( instance, arguments );
703	+ }
704	+
705	+ // copy the guid so direct unbinding works
706	+ if ( typeof handler !== "string" ) {
707	+ handlerProxy.guid = handler.guid =
708	+ handler.guid \|\| handlerProxy.guid \|\| $.guid++;
709	+ }
710	+
711	+ var match = event.match( /^(\w+)\s(.)$/ ),
712	+ eventName = match[1] + instance.eventNamespace,
713	+ selector = match[2];
714	+ if ( selector ) {
715	+ delegateElement.delegate( selector, eventName, handlerProxy );
716	+ } else {
717	+ element.bind( eventName, handlerProxy );
718	+ }
719	+ });
720	+ },
721	+
722	+ _off: function( element, eventName ) {
723	+ eventName = (eventName \|\| "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace;
724	+ element.unbind( eventName ).undelegate( eventName );
725	+ },
726	+
727	+ _delay: function( handler, delay ) {
728	+ function handlerProxy() {
729	+ return ( typeof handler === "string" ? instance[ handler ] : handler )
730	+ .apply( instance, arguments );
731	+ }
732	+ var instance = this;
733	+ return setTimeout( handlerProxy, delay \|\| 0 );
734	+ },
735	+
736	+ _hoverable: function( element ) {
737	+ this.hoverable = this.hoverable.add( element );
738	+ this._on( element, {
739	+ mouseenter: function( event ) {
740	+ $( event.currentTarget ).addClass( "ui-state-hover" );
741	+ },
742	+ mouseleave: function( event ) {
743	+ $( event.currentTarget ).removeClass( "ui-state-hover" );
744	+ }
745	+ });
746	+ },
747	+
748	+ _focusable: function( element ) {
749	+ this.focusable = this.focusable.add( element );
750	+ this._on( element, {
751	+ focusin: function( event ) {
752	+ $( event.currentTarget ).addClass( "ui-state-focus" );
753	+ },
754	+ focusout: function( event ) {
755	+ $( event.currentTarget ).removeClass( "ui-state-focus" );
756	+ }
757	+ });
758	+ },
759	+
760	_trigger: function( type, event, data ) {
761	var prop, orig,
762	callback = this.options[ type ];

781	}
782
783	this.element.trigger( event, data );
784	+ return !( $.isFunction( callback ) &&
785	+ callback.apply( this.element[0], [ event ].concat( data ) ) === false \|\|

786	event.isDefaultPrevented() );
787	}
788	};
789
790	+ $.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
791	+ $.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
792	+ if ( typeof options === "string" ) {
793	+ options = { effect: options };
794	+ }
795	+ var hasOptions,
796	+ effectName = !options ?
797	+ method :
798	+ options === true \|\| typeof options === "number" ?
799	+ defaultEffect :
800	+ options.effect \|\| defaultEffect;
801	+ options = options \|\| {};
802	+ if ( typeof options === "number" ) {
803	+ options = { duration: options };
804	+ }
805	+ hasOptions = !$.isEmptyObject( options );
806	+ options.complete = callback;
807	+ if ( options.delay ) {
808	+ element.delay( options.delay );
809	+ }
810	+ if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
811	+ element[ method ]( options );
812	+ } else if ( effectName !== method && element[ effectName ] ) {
813	+ element[ effectName ]( options.duration, options.easing, callback );
814	+ } else {
815	+ element.queue(function( next ) {
816	+ $( this )[ method ]();
817	+ if ( callback ) {
818	+ callback.call( element[ 0 ] );
819	+ }
820	+ next();
821	+ });
822	+ }
823	+ };
824	+ });
825	+
826	})( jQuery );
827	+











828	(function( $, undefined ) {
829
830	var mouseHandled = false;
831	+ $( document ).mouseup( function() {
832	mouseHandled = false;
833	});
834
835	$.widget("ui.mouse", {
836	+ version: "1.10.2",
837	options: {
838	+ cancel: "input,textarea,button,select,option",
839	distance: 1,
840	delay: 0
841	},
842	_mouseInit: function() {
843	+ var that = this;
844
845	this.element
846	+ .bind("mousedown."+this.widgetName, function(event) {
847	+ return that._mouseDown(event);
848	})
849	+ .bind("click."+this.widgetName, function(event) {
850	+ if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) {
851	+ $.removeData(event.target, that.widgetName + ".preventClickEvent");
852	event.stopImmediatePropagation();
853	return false;
854	}

860	// TODO: make sure destroying one instance of mouse doesn't mess with
861	// other instances of mouse
862	_mouseDestroy: function() {
863	+ this.element.unbind("."+this.widgetName);
864	+ if ( this._mouseMoveDelegate ) {
865	+ $(document)
866	+ .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate)
867	+ .unbind("mouseup."+this.widgetName, this._mouseUpDelegate);
868	+ }
869	},
870
871	_mouseDown: function(event) {
872	// don't let more than one widget handle mouseStart
873	+ if( mouseHandled ) { return; }
874
875	// we may have missed mouseup (out of window)
876	(this._mouseStarted && this._mouseUp(event));
877
878	this._mouseDownEvent = event;
879
880	+ var that = this,
881	+ btnIsLeft = (event.which === 1),
882	// event.target.nodeName works around a bug in IE 8 with
883	// disabled inputs (#7620)
884	+ elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
885	if (!btnIsLeft \|\| elIsCancel \|\| !this._mouseCapture(event)) {
886	return true;
887	}

889	this.mouseDelayMet = !this.options.delay;
890	if (!this.mouseDelayMet) {
891	this._mouseDelayTimer = setTimeout(function() {
892	+ that.mouseDelayMet = true;
893	}, this.options.delay);
894	}
895

902	}
903
904	// Click event may never have fired (Gecko & Opera)
905	+ if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
906	+ $.removeData(event.target, this.widgetName + ".preventClickEvent");
907	}
908
909	// these delegates are required to keep context
910	this._mouseMoveDelegate = function(event) {
911	+ return that._mouseMove(event);
912	};
913	this._mouseUpDelegate = function(event) {
914	+ return that._mouseUp(event);
915	};
916	$(document)
917	+ .bind("mousemove."+this.widgetName, this._mouseMoveDelegate)
918	+ .bind("mouseup."+this.widgetName, this._mouseUpDelegate);
919
920	event.preventDefault();
921	+
922	mouseHandled = true;
923	return true;
924	},
925
926	_mouseMove: function(event) {
927	// IE mouseup check - mouseup happened when mouse was out of window
928	+ if ($.ui.ie && ( !document.documentMode \|\| document.documentMode < 9 ) && !event.button) {
929	return this._mouseUp(event);
930	}
931

945
946	_mouseUp: function(event) {
947	$(document)
948	+ .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate)
949	+ .unbind("mouseup."+this.widgetName, this._mouseUpDelegate);
950
951	if (this._mouseStarted) {
952	this._mouseStarted = false;
953
954	+ if (event.target === this._mouseDownEvent.target) {
955	+ $.data(event.target, this.widgetName + ".preventClickEvent", true);
956	}
957
958	this._mouseStop(event);

969	);
970	},
971
972	+ _mouseDelayMet: function(/* event */) {
973	return this.mouseDelayMet;
974	},
975
976	// These are placeholder methods, to be overriden by extending plugin
977	+ _mouseStart: function(/* event */) {},
978	+ _mouseDrag: function(/* event */) {},
979	+ _mouseStop: function(/* event */) {},
980	+ _mouseCapture: function(/* event */) { return true; }
981	});
982
983	})(jQuery);
984	+








985	(function( $, undefined ) {
986
987	+ $.widget("ui.draggable", $.ui.mouse, {
988	+ version: "1.10.2",
989	+ widgetEventPrefix: "drag",
990	+ options: {
991	+ addClasses: true,
992	+ appendTo: "parent",
993	+ axis: false,
994	+ connectToSortable: false,
995	+ containment: false,
996	+ cursor: "auto",
997	+ cursorAt: false,
998	+ grid: false,
999	+ handle: false,
1000	+ helper: "original",
1001	+ iframeFix: false,
1002	+ opacity: false,
1003	+ refreshPositions: false,
1004	+ revert: false,
1005	+ revertDuration: 500,
1006	+ scope: "default",
1007	+ scroll: true,
1008	+ scrollSensitivity: 20,
1009	+ scrollSpeed: 20,
1010	+ snap: false,
1011	+ snapMode: "both",
1012	+ snapTolerance: 20,
1013	+ stack: false,
1014	+ zIndex: false,
1015
1016	+ // callbacks
1017	+ drag: null,
1018	+ start: null,
1019	+ stop: null
1020	+ },
1021	+ _create: function() {
1022
1023	+ if (this.options.helper === "original" && !(/^(?:r\|a\|f)/).test(this.element.css("position"))) {
1024	+ this.element[0].style.position = "relative";

































































































































































































1025	}
1026	+ if (this.options.addClasses){
1027	+ this.element.addClass("ui-draggable");





















1028	}
1029	+ if (this.options.disabled){
1030	+ this.element.addClass("ui-draggable-disabled");







1031	}



































































































1032
1033	this._mouseInit();
1034
1035	},
1036
1037	+ _destroy: function() {
1038	+ this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" );






1039	this._mouseDestroy();


1040	},
1041
1042	_mouseCapture: function(event) {

1044	var o = this.options;
1045
1046	// among others, prevent a drag on a resizable-handle
1047	+ if (this.helper \|\| o.disabled \|\| $(event.target).closest(".ui-resizable-handle").length > 0) {
1048	return false;
1049	+ }
1050
1051	//Quit if we're not on a valid handle
1052	this.handle = this._getHandle(event);
1053	+ if (!this.handle) {
1054	return false;











1055	}
1056
1057	+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
1058	+ $("<div class='ui-draggable-iframeFix' style='background: #fff;'></div>")
1059	+ .css({
1060	+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
1061	+ position: "absolute", opacity: "0.001", zIndex: 1000
1062	+ })
1063	+ .css($(this).offset())
1064	+ .appendTo("body");
1065	+ });
1066	+
1067	return true;
1068
1069	},

1075	//Create and append the visible helper
1076	this.helper = this._createHelper(event);
1077
1078	+ this.helper.addClass("ui-draggable-dragging");
1079	+
1080	//Cache the helper size
1081	this._cacheHelperProportions();
1082
1083	//If ddmanager is used for droppables, set the global draggable
1084	+ if($.ui.ddmanager) {
1085	$.ui.ddmanager.current = this;
1086	+ }
1087
1088	/*
1089	* - Position generation -

1118	this.originalPageX = event.pageX;
1119	this.originalPageY = event.pageY;
1120
1121	+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
1122	(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
1123
1124	//Set a containment if given in the options
1125	+ if(o.containment) {
1126	this._setContainment();
1127	+ }
1128
1129	//Trigger event + callbacks
1130	if(this._trigger("start", event) === false) {

1136	this._cacheHelperProportions();
1137
1138	//Prepare the droppable offsets
1139	+ if ($.ui.ddmanager && !o.dropBehaviour) {
1140	$.ui.ddmanager.prepareOffsets(this, event);
1141	+ }
1142	+
1143

1144	this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
1145	+
1146	//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
1147	+ if ( $.ui.ddmanager ) {
1148	+ $.ui.ddmanager.dragStart(this, event);
1149	+ }
1150	+
1151	return true;
1152	},
1153

1160	//Call plugins and callbacks and use the resulting position if something is returned
1161	if (!noPropagation) {
1162	var ui = this._uiHash();
1163	+ if(this._trigger("drag", event, ui) === false) {
1164	this._mouseUp({});
1165	return false;
1166	}
1167	this.position = ui.position;
1168	}
1169
1170	+ if(!this.options.axis \|\| this.options.axis !== "y") {
1171	+ this.helper[0].style.left = this.position.left+"px";
1172	+ }
1173	+ if(!this.options.axis \|\| this.options.axis !== "x") {
1174	+ this.helper[0].style.top = this.position.top+"px";
1175	+ }
1176	+ if($.ui.ddmanager) {
1177	+ $.ui.ddmanager.drag(this, event);
1178	+ }
1179
1180	return false;
1181	},

1183	_mouseStop: function(event) {
1184
1185	//If we are using droppables, inform the manager about the drop
1186	+ var element,
1187	+ that = this,
1188	+ elementInDom = false,
1189	+ dropped = false;
1190	+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
1191	dropped = $.ui.ddmanager.drop(this, event);
1192	+ }
1193
1194	//if a drop comes from outside (a sortable)
1195	if(this.dropped) {
1196	dropped = this.dropped;
1197	this.dropped = false;
1198	}
1199	+
1200	+ //if the original element is no longer in the DOM don't bother to continue (see #8269)
1201	+ element = this.element[0];
1202	+ while ( element && (element = element.parentNode) ) {
1203	+ if (element === document ) {
1204	+ elementInDom = true;
1205	+ }
1206	+ }
1207	+ if ( !elementInDom && this.options.helper === "original" ) {
1208	return false;
1209	+ }
1210
1211	+ if((this.options.revert === "invalid" && !dropped) \|\| (this.options.revert === "valid" && dropped) \|\| this.options.revert === true \|\| ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {

1212	$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
1213	+ if(that._trigger("stop", event) !== false) {
1214	+ that._clear();
1215	}
1216	});
1217	} else {

1222
1223	return false;
1224	},
1225	+
1226	_mouseUp: function(event) {
1227	+ //Remove frame helpers
1228	+ $("div.ui-draggable-iframeFix").each(function() {
1229	+ this.parentNode.removeChild(this);
1230	+ });
1231	+

1232	//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
1233	+ if( $.ui.ddmanager ) {
1234	+ $.ui.ddmanager.dragStop(this, event);
1235	+ }
1236	+
1237	return $.ui.mouse.prototype._mouseUp.call(this, event);
1238	},
1239	+
1240	cancel: function() {
1241	+
1242	if(this.helper.is(".ui-draggable-dragging")) {
1243	this._mouseUp({});
1244	} else {
1245	this._clear();
1246	}
1247	+
1248	return this;
1249	+
1250	},
1251
1252	_getHandle: function(event) {
1253	+ return this.options.handle ?
1254	+ !!$( event.target ).closest( this.element.find( this.options.handle ) ).length :
1255	+ true;








1256	},
1257
1258	_createHelper: function(event) {
1259
1260	+ var o = this.options,
1261	+ helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element);
1262
1263	+ if(!helper.parents("body").length) {
1264	+ helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo));
1265	+ }
1266
1267	+ if(helper[0] !== this.element[0] && !(/(fixed\|absolute)/).test(helper.css("position"))) {
1268	helper.css("position", "absolute");
1269	+ }
1270
1271	return helper;
1272
1273	},
1274
1275	_adjustOffsetFromHelper: function(obj) {
1276	+ if (typeof obj === "string") {
1277	+ obj = obj.split(" ");
1278	}
1279	if ($.isArray(obj)) {
1280	obj = {left: +obj[0], top: +obj[1] \|\| 0};
1281	}
1282	+ if ("left" in obj) {
1283	this.offset.click.left = obj.left + this.margins.left;
1284	}
1285	+ if ("right" in obj) {
1286	this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
1287	}
1288	+ if ("top" in obj) {
1289	this.offset.click.top = obj.top + this.margins.top;
1290	}
1291	+ if ("bottom" in obj) {
1292	this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
1293	}
1294	},

1303	// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
1304	// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
1305	// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
1306	+ if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
1307	po.left += this.scrollParent.scrollLeft();
1308	po.top += this.scrollParent.scrollTop();
1309	}
1310
1311	+ //This needs to be actually done for all browsers, since pageX/pageY includes this information
1312	+ //Ugly IE fix
1313	+ if((this.offsetParent[0] === document.body) \|\|
1314	+ (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
1315	po = { top: 0, left: 0 };
1316	+ }
1317
1318	return {
1319	top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) \|\| 0),

1324
1325	_getRelativeOffset: function() {
1326
1327	+ if(this.cssPosition === "relative") {
1328	var p = this.element.position();
1329	return {
1330	top: p.top - (parseInt(this.helper.css("top"),10) \|\| 0) + this.scrollParent.scrollTop(),

1354
1355	_setContainment: function() {
1356
1357	+ var over, c, ce,
1358	+ o = this.options;
1359	+
1360	+ if(o.containment === "parent") {
1361	+ o.containment = this.helper[0].parentNode;
1362	+ }
1363	+ if(o.containment === "document" \|\| o.containment === "window") {
1364	+ this.containment = [
1365	+ o.containment === "document" ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
1366	+ o.containment === "document" ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
1367	+ (o.containment === "document" ? 0 : $(window).scrollLeft()) + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left,
1368	+ (o.containment === "document" ? 0 : $(window).scrollTop()) + ($(o.containment === "document" ? document : window).height() \|\| document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
1369	+ ];
1370	+ }
1371
1372	+ if(!(/^(document\|window\|parent)$/).test(o.containment) && o.containment.constructor !== Array) {
1373	+ c = $(o.containment);
1374	+ ce = c[0];
1375	+
1376	+ if(!ce) {
1377	+ return;
1378	+ }
1379	+
1380	+ over = ($(ce).css("overflow") !== "hidden");
1381
1382	this.containment = [
1383	(parseInt($(ce).css("borderLeftWidth"),10) \|\| 0) + (parseInt($(ce).css("paddingLeft"),10) \|\| 0),
1384	(parseInt($(ce).css("borderTopWidth"),10) \|\| 0) + (parseInt($(ce).css("paddingTop"),10) \|\| 0),
1385	+ (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderRightWidth"),10) \|\| 0) - (parseInt($(ce).css("paddingRight"),10) \|\| 0) - this.helperProportions.width - this.margins.left - this.margins.right,
1386	+ (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderBottomWidth"),10) \|\| 0) - (parseInt($(ce).css("paddingBottom"),10) \|\| 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
1387	];
1388	this.relative_container = c;
1389
1390	+ } else if(o.containment.constructor === Array) {
1391	this.containment = o.containment;
1392	}
1393

1395
1396	_convertPositionTo: function(d, pos) {
1397
1398	+ if(!pos) {
1399	+ pos = this.position;
1400	+ }
1401	+
1402	+ var mod = d === "absolute" ? 1 : -1,
1403	+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html\|body)/i).test(scroll[0].tagName);
1404
1405	return {
1406	top: (
1407	+ pos.top + // The absolute mouse position
1408	+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
1409	+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
1410	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
1411	),
1412	left: (
1413	+ pos.left + // The absolute mouse position
1414	+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
1415	+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
1416	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
1417	)
1418	};
1419

1421
1422	_generatePosition: function(event) {
1423
1424	+ var containment, co, top, left,
1425	+ o = this.options,
1426	+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
1427	+ scrollIsRootNode = (/(html\|body)/i).test(scroll[0].tagName),
1428	+ pageX = event.pageX,
1429	+ pageY = event.pageY;
1430
1431	/*
1432	* - Position constraining -

1434	*/
1435
1436	if(this.originalPosition) { //If we are not dragging yet, we won't check for options
1437	+ if(this.containment) {
1438	+ if (this.relative_container){
1439	+ co = this.relative_container.offset();
1440	+ containment = [ this.containment[0] + co.left,
1441	+ this.containment[1] + co.top,
1442	+ this.containment[2] + co.left,
1443	+ this.containment[3] + co.top ];
1444	+ }
1445	+ else {
1446	+ containment = this.containment;
1447	+ }
1448	+
1449	+ if(event.pageX - this.offset.click.left < containment[0]) {
1450	+ pageX = containment[0] + this.offset.click.left;
1451	+ }
1452	+ if(event.pageY - this.offset.click.top < containment[1]) {
1453	+ pageY = containment[1] + this.offset.click.top;
1454	+ }
1455	+ if(event.pageX - this.offset.click.left > containment[2]) {
1456	+ pageX = containment[2] + this.offset.click.left;
1457	+ }
1458	+ if(event.pageY - this.offset.click.top > containment[3]) {
1459	+ pageY = containment[3] + this.offset.click.top;
1460	+ }
1461	}
1462
1463	if(o.grid) {
1464	//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
1465	+ top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
1466	+ pageY = containment ? ((top - this.offset.click.top >= containment[1] \|\| top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
1467
1468	+ left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
1469	+ pageX = containment ? ((left - this.offset.click.left >= containment[0] \|\| left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
1470	}
1471
1472	}
1473
1474	return {
1475	top: (
1476	+ pageY - // The absolute mouse position
1477	+ this.offset.click.top - // Click offset (relative to the element)
1478	+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
1479	+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
1480	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
1481	),
1482	left: (
1483	+ pageX - // The absolute mouse position
1484	+ this.offset.click.left - // Click offset (relative to the element)
1485	+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
1486	+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
1487	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
1488	)
1489	};
1490

1492
1493	_clear: function() {
1494	this.helper.removeClass("ui-draggable-dragging");
1495	+ if(this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
1496	+ this.helper.remove();
1497	+ }
1498	this.helper = null;
1499	this.cancelHelperRemoval = false;
1500	},

1504	_trigger: function(type, event, ui) {
1505	ui = ui \|\| this._uiHash();
1506	$.ui.plugin.call(this, type, [event, ui]);
1507	+ //The absolute position has to be recalculated after plugins
1508	+ if(type === "drag") {
1509	+ this.positionAbs = this._convertPositionTo("absolute");
1510	+ }
1511	return $.Widget.prototype._trigger.call(this, type, event, ui);
1512	},
1513
1514	plugins: {},
1515
1516	+ _uiHash: function() {
1517	return {
1518	helper: this.helper,
1519	position: this.position,

1524
1525	});
1526




1527	$.ui.plugin.add("draggable", "connectToSortable", {
1528	start: function(event, ui) {
1529
1530	+ var inst = $(this).data("ui-draggable"), o = inst.options,
1531	uiSortable = $.extend({}, ui, { item: inst.element });
1532	inst.sortables = [];
1533	$(o.connectToSortable).each(function() {
1534	+ var sortable = $.data(this, "ui-sortable");
1535	if (sortable && !sortable.options.disabled) {
1536	inst.sortables.push({
1537	instance: sortable,

1546	stop: function(event, ui) {
1547
1548	//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
1549	+ var inst = $(this).data("ui-draggable"),
1550	uiSortable = $.extend({}, ui, { item: inst.element });
1551
1552	$.each(inst.sortables, function() {

1557	inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
1558	this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
1559
1560	+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: "valid/invalid"
1561	+ if(this.shouldRevert) {
1562	+ this.instance.options.revert = this.shouldRevert;
1563	+ }
1564
1565	//Trigger the stop of the sortable
1566	this.instance._mouseStop(event);

1568	this.instance.options.helper = this.instance.options._helper;
1569
1570	//If the helper has been the original item, restore properties in the sortable
1571	+ if(inst.options.helper === "original") {
1572	+ this.instance.currentItem.css({ top: "auto", left: "auto" });
1573	+ }
1574
1575	} else {
1576	this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance

1582	},
1583	drag: function(event, ui) {
1584
1585	+ var inst = $(this).data("ui-draggable"), that = this;
1586
1587	+ $.each(inst.sortables, function() {




1588
1589	+ var innermostIntersecting = false,
1590	+ thisSortable = this;
1591


1592	//Copy over some variables to allow calling the sortable's native _intersectsWith
1593	this.instance.positionAbs = inst.positionAbs;
1594	this.instance.helperProportions = inst.helperProportions;
1595	this.instance.offset.click = inst.offset.click;
1596	+
1597	if(this.instance._intersectsWith(this.instance.containerCache)) {
1598	+ innermostIntersecting = true;
1599	+ $.each(inst.sortables, function () {
1600	+ this.instance.positionAbs = inst.positionAbs;
1601	+ this.instance.helperProportions = inst.helperProportions;
1602	+ this.instance.offset.click = inst.offset.click;
1603	+ if (this !== thisSortable &&
1604	+ this.instance._intersectsWith(this.instance.containerCache) &&
1605	+ $.contains(thisSortable.instance.element[0], this.instance.element[0])
1606	+ ) {
1607	+ innermostIntersecting = false;
1608	+ }
1609	+ return innermostIntersecting;
1610	+ });
1611	+ }
1612
1613	+
1614	+ if(innermostIntersecting) {
1615	//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
1616	if(!this.instance.isOver) {
1617

1619	//Now we fake the start of dragging for the sortable instance,
1620	//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
1621	//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
1622	+ this.instance.currentItem = $(that).clone().removeAttr("id").appendTo(this.instance.element).data("ui-sortable-item", true);
1623	this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
1624	this.instance.options.helper = function() { return ui.helper[0]; };
1625

1642	}
1643
1644	//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
1645	+ if(this.instance.currentItem) {
1646	+ this.instance._mouseDrag(event);
1647	+ }
1648
1649	} else {
1650

1654
1655	this.instance.isOver = 0;
1656	this.instance.cancelHelperRemoval = true;
1657	+
1658	//Prevent reverting on this forced stop
1659	this.instance.options.revert = false;
1660	+
1661	// The out event needs to be triggered independently
1662	+ this.instance._trigger("out", event, this.instance._uiHash(this.instance));
1663	+
1664	this.instance._mouseStop(event, true);
1665	this.instance.options.helper = this.instance.options._helper;
1666
1667	//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
1668	this.instance.currentItem.remove();
1669	+ if(this.instance.placeholder) {
1670	+ this.instance.placeholder.remove();
1671	+ }
1672
1673	inst._trigger("fromSortable", event);
1674	inst.dropped = false; //draggable revert needs that
1675	}
1676
1677	+ }
1678
1679	});
1680

1682	});
1683
1684	$.ui.plugin.add("draggable", "cursor", {
1685	+ start: function() {
1686	+ var t = $("body"), o = $(this).data("ui-draggable").options;
1687	+ if (t.css("cursor")) {
1688	+ o._cursor = t.css("cursor");
1689	+ }
1690	t.css("cursor", o.cursor);
1691	},
1692	+ stop: function() {
1693	+ var o = $(this).data("ui-draggable").options;
1694	+ if (o._cursor) {
1695	+ $("body").css("cursor", o._cursor);
1696	+ }
1697	}
1698	});
1699
1700	$.ui.plugin.add("draggable", "opacity", {
1701	start: function(event, ui) {
1702	+ var t = $(ui.helper), o = $(this).data("ui-draggable").options;
1703	+ if(t.css("opacity")) {
1704	+ o._opacity = t.css("opacity");
1705	+ }
1706	+ t.css("opacity", o.opacity);
1707	},
1708	stop: function(event, ui) {
1709	+ var o = $(this).data("ui-draggable").options;
1710	+ if(o._opacity) {
1711	+ $(ui.helper).css("opacity", o._opacity);
1712	+ }
1713	}
1714	});
1715
1716	$.ui.plugin.add("draggable", "scroll", {
1717	+ start: function() {
1718	+ var i = $(this).data("ui-draggable");
1719	+ if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {
1720	+ i.overflowOffset = i.scrollParent.offset();
1721	+ }
1722	},
1723	+ drag: function( event ) {
1724
1725	+ var i = $(this).data("ui-draggable"), o = i.options, scrolled = false;
1726
1727	+ if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {
1728
1729	+ if(!o.axis \|\| o.axis !== "x") {
1730	+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
1731	i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
1732	+ } else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
1733	i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
1734	+ }
1735	}
1736
1737	+ if(!o.axis \|\| o.axis !== "y") {
1738	+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
1739	i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
1740	+ } else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
1741	i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
1742	+ }
1743	}
1744
1745	} else {
1746
1747	+ if(!o.axis \|\| o.axis !== "x") {
1748	+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
1749	scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
1750	+ } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
1751	scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
1752	+ }
1753	}
1754
1755	+ if(!o.axis \|\| o.axis !== "y") {
1756	+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
1757	scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
1758	+ } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
1759	scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
1760	+ }
1761	}
1762
1763	}
1764
1765	+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
1766	$.ui.ddmanager.prepareOffsets(i, event);
1767	+ }
1768
1769	}
1770	});
1771
1772	$.ui.plugin.add("draggable", "snap", {
1773	+ start: function() {
1774	+
1775	+ var i = $(this).data("ui-draggable"),
1776	+ o = i.options;
1777

1778	i.snapElements = [];
1779
1780	+ $(o.snap.constructor !== String ? ( o.snap.items \|\| ":data(ui-draggable)" ) : o.snap).each(function() {
1781	+ var $t = $(this),
1782	+ $o = $t.offset();
1783	+ if(this !== i.element[0]) {
1784	+ i.snapElements.push({
1785	+ item: this,
1786	+ width: $t.outerWidth(), height: $t.outerHeight(),
1787	+ top: $o.top, left: $o.left
1788	+ });
1789	+ }
1790	});
1791
1792	},
1793	drag: function(event, ui) {
1794
1795	+ var ts, bs, ls, rs, l, r, t, b, i, first,
1796	+ inst = $(this).data("ui-draggable"),
1797	+ o = inst.options,
1798	+ d = o.snapTolerance,
1799	+ x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
1800	y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
1801
1802	+ for (i = inst.snapElements.length - 1; i >= 0; i--){
1803
1804	+ l = inst.snapElements[i].left;
1805	+ r = l + inst.snapElements[i].width;
1806	+ t = inst.snapElements[i].top;
1807	+ b = t + inst.snapElements[i].height;
1808
1809	//Yes, I know, this is insane ;)
1810	if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) \|\| (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) \|\| (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) \|\| (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
1811	+ if(inst.snapElements[i].snapping) {
1812	+ (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
1813	+ }
1814	inst.snapElements[i].snapping = false;
1815	continue;
1816	}
1817
1818	+ if(o.snapMode !== "inner") {
1819	+ ts = Math.abs(t - y2) <= d;
1820	+ bs = Math.abs(b - y1) <= d;
1821	+ ls = Math.abs(l - x2) <= d;
1822	+ rs = Math.abs(r - x1) <= d;
1823	+ if(ts) {
1824	+ ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
1825	+ }
1826	+ if(bs) {
1827	+ ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
1828	+ }
1829	+ if(ls) {
1830	+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
1831	+ }
1832	+ if(rs) {
1833	+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
1834	+ }
1835	}
1836
1837	+ first = (ts \|\| bs \|\| ls \|\| rs);
1838
1839	+ if(o.snapMode !== "outer") {
1840	+ ts = Math.abs(t - y1) <= d;
1841	+ bs = Math.abs(b - y2) <= d;
1842	+ ls = Math.abs(l - x1) <= d;
1843	+ rs = Math.abs(r - x2) <= d;
1844	+ if(ts) {
1845	+ ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
1846	+ }
1847	+ if(bs) {
1848	+ ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
1849	+ }
1850	+ if(ls) {
1851	+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
1852	+ }
1853	+ if(rs) {
1854	+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
1855	+ }
1856	}
1857
1858	+ if(!inst.snapElements[i].snapping && (ts \|\| bs \|\| ls \|\| rs \|\| first)) {
1859	(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
1860	+ }
1861	inst.snapElements[i].snapping = (ts \|\| bs \|\| ls \|\| rs \|\| first);
1862
1863	+ }
1864
1865	}
1866	});
1867
1868	$.ui.plugin.add("draggable", "stack", {
1869	+ start: function() {
1870	+ var min,
1871	+ o = this.data("ui-draggable").options,
1872	+ group = $.makeArray($(o.stack)).sort(function(a,b) {
1873	+ return (parseInt($(a).css("zIndex"),10) \|\| 0) - (parseInt($(b).css("zIndex"),10) \|\| 0);
1874	+ });
1875



1876	if (!group.length) { return; }
1877	+
1878	+ min = parseInt($(group[0]).css("zIndex"), 10) \|\| 0;
1879	$(group).each(function(i) {
1880	+ $(this).css("zIndex", min + i);
1881	});
1882	+ this.css("zIndex", (min + group.length));


1883	}
1884	});
1885
1886	$.ui.plugin.add("draggable", "zIndex", {
1887	start: function(event, ui) {
1888	+ var t = $(ui.helper), o = $(this).data("ui-draggable").options;
1889	+ if(t.css("zIndex")) {
1890	+ o._zIndex = t.css("zIndex");
1891	+ }
1892	+ t.css("zIndex", o.zIndex);
1893	},
1894	stop: function(event, ui) {
1895	+ var o = $(this).data("ui-draggable").options;
1896	+ if(o._zIndex) {
1897	+ $(ui.helper).css("zIndex", o._zIndex);
1898	+ }
1899	}
1900	});
1901
1902	})(jQuery);
1903	+














1904	(function( $, undefined ) {
1905
1906	+ function isOverAxis( x, reference, size ) {
1907	+ return ( x > reference ) && ( x < ( reference + size ) );
1908	+ }
1909	+
1910	$.widget("ui.droppable", {
1911	+ version: "1.10.2",
1912	widgetEventPrefix: "drop",
1913	options: {
1914	+ accept: "*",
1915	activeClass: false,
1916	addClasses: true,
1917	greedy: false,
1918	hoverClass: false,
1919	+ scope: "default",
1920	+ tolerance: "intersect",
1921	+
1922	+ // callbacks
1923	+ activate: null,
1924	+ deactivate: null,
1925	+ drop: null,
1926	+ out: null,
1927	+ over: null
1928	},
1929	_create: function() {
1930
1931	+ var o = this.options,
1932	+ accept = o.accept;
1933	+
1934	+ this.isover = false;
1935	+ this.isout = true;
1936
1937	this.accept = $.isFunction(accept) ? accept : function(d) {
1938	return d.is(accept);

1949
1950	},
1951
1952	+ _destroy: function() {
1953	+ var i = 0,
1954	+ drop = $.ui.ddmanager.droppables[this.options.scope];


1955
1956	+ for ( ; i < drop.length; i++ ) {
1957	+ if ( drop[i] === this ) {
1958	+ drop.splice(i, 1);
1959	+ }
1960	+ }
1961
1962	+ this.element.removeClass("ui-droppable ui-droppable-disabled");
1963	},
1964
1965	_setOption: function(key, value) {
1966
1967	+ if(key === "accept") {
1968	this.accept = $.isFunction(value) ? value : function(d) {
1969	return d.is(value);
1970	};

1974
1975	_activate: function(event) {
1976	var draggable = $.ui.ddmanager.current;
1977	+ if(this.options.activeClass) {
1978	+ this.element.addClass(this.options.activeClass);
1979	+ }
1980	+ if(draggable){
1981	+ this._trigger("activate", event, this.ui(draggable));
1982	+ }
1983	},
1984
1985	_deactivate: function(event) {
1986	var draggable = $.ui.ddmanager.current;
1987	+ if(this.options.activeClass) {
1988	+ this.element.removeClass(this.options.activeClass);
1989	+ }
1990	+ if(draggable){
1991	+ this._trigger("deactivate", event, this.ui(draggable));
1992	+ }
1993	},
1994
1995	_over: function(event) {
1996
1997	var draggable = $.ui.ddmanager.current;
1998	+
1999	+ // Bail if draggable and droppable are same element
2000	+ if (!draggable \|\| (draggable.currentItem \|\| draggable.element)[0] === this.element[0]) {
2001	+ return;
2002	+ }
2003
2004	if (this.accept.call(this.element[0],(draggable.currentItem \|\| draggable.element))) {
2005	+ if(this.options.hoverClass) {
2006	+ this.element.addClass(this.options.hoverClass);
2007	+ }
2008	+ this._trigger("over", event, this.ui(draggable));
2009	}
2010
2011	},

2013	_out: function(event) {
2014
2015	var draggable = $.ui.ddmanager.current;
2016	+
2017	+ // Bail if draggable and droppable are same element
2018	+ if (!draggable \|\| (draggable.currentItem \|\| draggable.element)[0] === this.element[0]) {
2019	+ return;
2020	+ }
2021
2022	if (this.accept.call(this.element[0],(draggable.currentItem \|\| draggable.element))) {
2023	+ if(this.options.hoverClass) {
2024	+ this.element.removeClass(this.options.hoverClass);
2025	+ }
2026	+ this._trigger("out", event, this.ui(draggable));
2027	}
2028
2029	},
2030
2031	_drop: function(event,custom) {
2032
2033	+ var draggable = custom \|\| $.ui.ddmanager.current,
2034	+ childrenIntersection = false;
2035	+
2036	+ // Bail if draggable and droppable are same element
2037	+ if (!draggable \|\| (draggable.currentItem \|\| draggable.element)[0] === this.element[0]) {
2038	+ return false;
2039	+ }
2040
2041	+ this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function() {
2042	+ var inst = $.data(this, "ui-droppable");

2043	if(
2044	+ inst.options.greedy &&
2045	+ !inst.options.disabled &&
2046	+ inst.options.scope === draggable.options.scope &&
2047	+ inst.accept.call(inst.element[0], (draggable.currentItem \|\| draggable.element)) &&
2048	+ $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
2049	) { childrenIntersection = true; return false; }
2050	});
2051	+ if(childrenIntersection) {
2052	+ return false;
2053	+ }
2054
2055	if(this.accept.call(this.element[0],(draggable.currentItem \|\| draggable.element))) {
2056	+ if(this.options.activeClass) {
2057	+ this.element.removeClass(this.options.activeClass);
2058	+ }
2059	+ if(this.options.hoverClass) {
2060	+ this.element.removeClass(this.options.hoverClass);
2061	+ }
2062	+ this._trigger("drop", event, this.ui(draggable));
2063	return this.element;
2064	}
2065

2078
2079	});
2080




2081	$.ui.intersect = function(draggable, droppable, toleranceMode) {
2082
2083	+ if (!droppable.offset) {
2084	+ return false;
2085	+ }
2086
2087	+ var draggableLeft, draggableTop,
2088	+ x1 = (draggable.positionAbs \|\| draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
2089	+ y1 = (draggable.positionAbs \|\| draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height,
2090	+ l = droppable.offset.left, r = l + droppable.proportions.width,
2091	t = droppable.offset.top, b = t + droppable.proportions.height;
2092
2093	switch (toleranceMode) {
2094	+ case "fit":
2095	+ return (l <= x1 && x2 <= r && t <= y1 && y2 <= b);
2096	+ case "intersect":
2097	+ return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half
2098	+ x2 - (draggable.helperProportions.width / 2) < r && // Left Half
2099	+ t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half
2100	+ y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
2101	+ case "pointer":
2102	+ draggableLeft = ((draggable.positionAbs \|\| draggable.position.absolute).left + (draggable.clickOffset \|\| draggable.offset.click).left);
2103	+ draggableTop = ((draggable.positionAbs \|\| draggable.position.absolute).top + (draggable.clickOffset \|\| draggable.offset.click).top);
2104	+ return isOverAxis( draggableTop, t, droppable.proportions.height ) && isOverAxis( draggableLeft, l, droppable.proportions.width );
2105	+ case "touch":





2106	return (
2107	+ (y1 >= t && y1 <= b) \|\| // Top edge touching
2108	+ (y2 >= t && y2 <= b) \|\| // Bottom edge touching
2109	+ (y1 < t && y2 > b) // Surrounded vertically
2110	+ ) && (
2111	+ (x1 >= l && x1 <= r) \|\| // Left edge touching
2112	+ (x2 >= l && x2 <= r) \|\| // Right edge touching
2113	+ (x1 < l && x2 > r) // Surrounded horizontally
2114	+ );

2115	default:
2116	return false;

2117	}
2118
2119	};

2123	*/
2124	$.ui.ddmanager = {
2125	current: null,
2126	+ droppables: { "default": [] },
2127	prepareOffsets: function(t, event) {
2128
2129	+ var i, j,
2130	+ m = $.ui.ddmanager.droppables[t.options.scope] \|\| [],
2131	+ type = event ? event.type : null, // workaround for #2317
2132	+ list = (t.currentItem \|\| t.element).find(":data(ui-droppable)").addBack();
2133	+
2134	+ droppablesLoop: for (i = 0; i < m.length; i++) {
2135
2136	+ //No disabled and non-accepted
2137	+ if(m[i].options.disabled \|\| (t && !m[i].accept.call(m[i].element[0],(t.currentItem \|\| t.element)))) {
2138	+ continue;
2139	+ }
2140	+
2141	+ // Filter out elements in the current dragged item
2142	+ for (j=0; j < list.length; j++) {
2143	+ if(list[j] === m[i].element[0]) {
2144	+ m[i].proportions.height = 0;
2145	+ continue droppablesLoop;
2146	+ }
2147	+ }
2148
2149	+ m[i].visible = m[i].element.css("display") !== "none";
2150	+ if(!m[i].visible) {
2151	+ continue;
2152	+ }
2153
2154	+ //Activate the droppable if used directly from draggables
2155	+ if(type === "mousedown") {
2156	+ m[i]._activate.call(m[i], event);
2157	+ }
2158
2159	m[i].offset = m[i].element.offset();
2160	m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };

2165	drop: function(draggable, event) {
2166
2167	var dropped = false;
2168	+ // Create a copy of the droppables in case the list changes during the drop (#9116)
2169	+ $.each(($.ui.ddmanager.droppables[draggable.options.scope] \|\| []).slice(), function() {
2170
2171	+ if(!this.options) {
2172	+ return;
2173	+ }
2174	+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) {
2175	dropped = this._drop.call(this, event) \|\| dropped;
2176	+ }
2177
2178	if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem \|\| draggable.element))) {
2179	+ this.isout = true;
2180	+ this.isover = false;
2181	this._deactivate.call(this, event);
2182	}
2183

2187	},
2188	dragStart: function( draggable, event ) {
2189	//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
2190	+ draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() {
2191	+ if( !draggable.options.refreshPositions ) {
2192	+ $.ui.ddmanager.prepareOffsets( draggable, event );
2193	+ }
2194	});
2195	},
2196	drag: function(draggable, event) {
2197
2198	//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
2199	+ if(draggable.options.refreshPositions) {
2200	+ $.ui.ddmanager.prepareOffsets(draggable, event);
2201	+ }
2202
2203	//Run through all droppables and check their positions based on specific tolerance options
2204	$.each($.ui.ddmanager.droppables[draggable.options.scope] \|\| [], function() {
2205
2206	+ if(this.options.disabled \|\| this.greedyChild \|\| !this.visible) {
2207	+ return;
2208	+ }
2209
2210	+ var parentInstance, scope, parent,
2211	+ intersects = $.ui.intersect(draggable, this, this.options.tolerance),
2212	+ c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null);
2213	+ if(!c) {
2214	+ return;
2215	+ }
2216

2217	if (this.options.greedy) {
2218	+ // find droppable parents with same scope
2219	+ scope = this.options.scope;
2220	+ parent = this.element.parents(":data(ui-droppable)").filter(function () {
2221	+ return $.data(this, "ui-droppable").options.scope === scope;
2222	+ });
2223	+
2224	if (parent.length) {
2225	+ parentInstance = $.data(parent[0], "ui-droppable");
2226	+ parentInstance.greedyChild = (c === "isover");
2227	}
2228	}
2229
2230	// we just moved into a greedy child
2231	+ if (parentInstance && c === "isover") {
2232	+ parentInstance.isover = false;
2233	+ parentInstance.isout = true;
2234	parentInstance._out.call(parentInstance, event);
2235	}
2236
2237	+ this[c] = true;
2238	+ this[c === "isout" ? "isover" : "isout"] = false;
2239	+ this[c === "isover" ? "_over" : "_out"].call(this, event);
2240
2241	// we just moved out of a greedy child
2242	+ if (parentInstance && c === "isout") {
2243	+ parentInstance.isout = false;
2244	+ parentInstance.isover = true;
2245	parentInstance._over.call(parentInstance, event);
2246	}
2247	});
2248
2249	},
2250	dragStop: function( draggable, event ) {
2251	+ draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" );
2252	//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
2253	+ if( !draggable.options.refreshPositions ) {
2254	+ $.ui.ddmanager.prepareOffsets( draggable, event );
2255	+ }
2256	}
2257	};
2258
2259	})(jQuery);
2260	+













2261	(function( $, undefined ) {
2262
2263	+ function num(v) {
2264	+ return parseInt(v, 10) \|\| 0;
2265	+ }
2266	+
2267	+ function isNumber(value) {
2268	+ return !isNaN(parseInt(value, 10));
2269	+ }
2270	+
2271	$.widget("ui.resizable", $.ui.mouse, {
2272	+ version: "1.10.2",
2273	widgetEventPrefix: "resize",
2274	options: {
2275	alsoResize: false,

2287	maxWidth: null,
2288	minHeight: 10,
2289	minWidth: 10,
2290	+ // See #7960
2291	+ zIndex: 90,
2292	+
2293	+ // callbacks
2294	+ resize: null,
2295	+ start: null,
2296	+ stop: null
2297	},
2298	_create: function() {
2299
2300	+ var n, i, handle, axis, hname,
2301	+ that = this,
2302	+ o = this.options;
2303	this.element.addClass("ui-resizable");
2304
2305	$.extend(this, {

2307	aspectRatio: o.aspectRatio,
2308	originalElement: this.element,
2309	_proportionallyResizeElements: [],
2310	+ _helper: o.helper \|\| o.ghost \|\| o.animate ? o.helper \|\| "ui-resizable-helper" : null
2311	});
2312
2313	//Wrap the element if it cannot hold child nodes
2314	if(this.element[0].nodeName.match(/canvas\|textarea\|input\|select\|button\|img/i)) {
2315




2316	//Create a wrapper element and set the wrapper to the new current internal element
2317	this.element.wrap(
2318	+ $("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
2319	+ position: this.element.css("position"),
2320	width: this.element.outerWidth(),
2321	height: this.element.outerHeight(),
2322	+ top: this.element.css("top"),
2323	+ left: this.element.css("left")
2324	})
2325	);
2326
2327	//Overwrite the original this.element
2328	this.element = this.element.parent().data(
2329	+ "ui-resizable", this.element.data("ui-resizable")
2330	);
2331
2332	this.elementIsWrapper = true;

2336	this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
2337
2338	//Prevent Safari textarea resize
2339	+ this.originalResizeStyle = this.originalElement.css("resize");
2340	+ this.originalElement.css("resize", "none");
2341
2342	//Push the actual element to our proportionallyResize internal array
2343	+ this._proportionallyResizeElements.push(this.originalElement.css({ position: "static", zoom: 1, display: "block" }));
2344
2345	// avoid IE jump (hard set the margin)
2346	+ this.originalElement.css({ margin: this.originalElement.css("margin") });
2347
2348	// fix handlers offset
2349	this._proportionallyResize();
2350
2351	}
2352
2353	+ this.handles = o.handles \|\| (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : { n: ".ui-resizable-n", e: ".ui-resizable-e", s: ".ui-resizable-s", w: ".ui-resizable-w", se: ".ui-resizable-se", sw: ".ui-resizable-sw", ne: ".ui-resizable-ne", nw: ".ui-resizable-nw" });
2354	+ if(this.handles.constructor === String) {
2355	+
2356	+ if ( this.handles === "all") {
2357	+ this.handles = "n,e,s,w,se,sw,ne,nw";
2358	+ }
2359
2360	+ n = this.handles.split(",");
2361	+ this.handles = {};
2362
2363	+ for(i = 0; i < n.length; i++) {
2364
2365	+ handle = $.trim(n[i]);
2366	+ hname = "ui-resizable-"+handle;
2367	+ axis = $("<div class='ui-resizable-handle " + hname + "'></div>");
2368
2369	+ // Apply zIndex to all handles - see #7960
2370	+ axis.css({ zIndex: o.zIndex });

2371
2372	//TODO : What's going on here?
2373	+ if ("se" === handle) {
2374	+ axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se");
2375	+ }
2376
2377	//Insert into internal handles object and append to element
2378	+ this.handles[handle] = ".ui-resizable-"+handle;
2379	this.element.append(axis);
2380	}
2381

2383
2384	this._renderAxis = function(target) {
2385
2386	+ var i, axis, padPos, padWrapper;
2387	+
2388	target = target \|\| this.element;
2389
2390	+ for(i in this.handles) {
2391
2392	+ if(this.handles[i].constructor === String) {
2393	this.handles[i] = $(this.handles[i], this.element).show();
2394	+ }
2395
2396	//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
2397	if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea\|input\|select\|button/i)) {
2398
2399	+ axis = $(this.handles[i], this.element);
2400
2401	//Checking the correct pad and border
2402	padWrapper = /sw\|ne\|nw\|se\|n\|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
2403
2404	//The padding type i have to apply...
2405	+ padPos = [ "padding",
2406	+ /ne\|nw\|n/.test(i) ? "Top" :
2407	+ /se\|sw\|s/.test(i) ? "Bottom" :
2408	+ /^e$/.test(i) ? "Right" : "Left" ].join("");
2409
2410	target.css(padPos, padWrapper);
2411

2414	}
2415
2416	//TODO: What's that good for? There's not anything to be executed left
2417	+ if(!$(this.handles[i]).length) {
2418	continue;
2419	+ }
2420	}
2421	};
2422
2423	//TODO: make renderAxis a prototype function
2424	this._renderAxis(this.element);
2425
2426	+ this._handles = $(".ui-resizable-handle", this.element)
2427	.disableSelection();
2428
2429	//Matching axis name
2430	this._handles.mouseover(function() {
2431	+ if (!that.resizing) {
2432	+ if (this.className) {
2433	+ axis = this.className.match(/ui-resizable-(se\|sw\|ne\|nw\|n\|e\|s\|w)/i);
2434	+ }
2435	//Axis, default = se
2436	+ that.axis = axis && axis[1] ? axis[1] : "se";
2437	}
2438	});
2439

2442	this._handles.hide();
2443	$(this.element)
2444	.addClass("ui-resizable-autohide")
2445	+ .mouseenter(function() {
2446	+ if (o.disabled) {
2447	+ return;
2448	+ }
2449	$(this).removeClass("ui-resizable-autohide");
2450	+ that._handles.show();
2451	+ })
2452	+ .mouseleave(function(){
2453	+ if (o.disabled) {
2454	+ return;
2455	+ }
2456	+ if (!that.resizing) {
2457	$(this).addClass("ui-resizable-autohide");
2458	+ that._handles.hide();
2459	}
2460	});
2461	}

2465
2466	},
2467
2468	+ _destroy: function() {
2469
2470	this._mouseDestroy();
2471
2472	+ var wrapper,
2473	+ _destroy = function(exp) {
2474	+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
2475	+ .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove();
2476	+ };
2477
2478	//TODO: Unwrap at same DOM position
2479	if (this.elementIsWrapper) {
2480	_destroy(this.element);
2481	+ wrapper = this.element;
2482	+ this.originalElement.css({
2483	+ position: wrapper.css("position"),
2484	+ width: wrapper.outerWidth(),
2485	+ height: wrapper.outerHeight(),
2486	+ top: wrapper.css("top"),
2487	+ left: wrapper.css("left")
2488	+ }).insertAfter( wrapper );
2489	+ wrapper.remove();
2490	+ }
2491	+
2492	+ this.originalElement.css("resize", this.originalResizeStyle);

2493	_destroy(this.originalElement);
2494
2495	return this;
2496	},
2497
2498	_mouseCapture: function(event) {
2499	+ var i, handle,
2500	+ capture = false;
2501	+
2502	+ for (i in this.handles) {
2503	+ handle = $(this.handles[i])[0];
2504	+ if (handle === event.target \|\| $.contains(handle, event.target)) {
2505	+ capture = true;
2506	}
2507	}
2508
2509	+ return !this.options.disabled && capture;
2510	},
2511
2512	_mouseStart: function(event) {
2513
2514	+ var curleft, curtop, cursor,
2515	+ o = this.options,
2516	+ iniPos = this.element.position(),
2517	+ el = this.element;
2518
2519	this.resizing = true;

2520
2521	// bugfix for http://dev.jquery.com/ticket/1749
2522	+ if ( (/absolute/).test( el.css("position") ) ) {
2523	+ el.css({ position: "absolute", top: el.css("top"), left: el.css("left") });
2524	+ } else if (el.is(".ui-draggable")) {
2525	+ el.css({ position: "absolute", top: iniPos.top, left: iniPos.left });
2526	}
2527




2528	this._renderProxy();
2529
2530	+ curleft = num(this.helper.css("left"));
2531	+ curtop = num(this.helper.css("top"));
2532
2533	if (o.containment) {
2534	curleft += $(o.containment).scrollLeft() \|\| 0;

2545	this.originalMousePosition = { left: event.pageX, top: event.pageY };
2546
2547	//Aspect Ratio
2548	+ this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) \|\| 1);
2549
2550	+ cursor = $(".ui-resizable-" + this.axis).css("cursor");
2551	+ $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);
2552
2553	el.addClass("ui-resizable-resizing");
2554	this._propagate("start", event);

2558	_mouseDrag: function(event) {
2559
2560	//Increase performance, avoid regex
2561	+ var data,
2562	+ el = this.helper, props = {},
2563	+ smp = this.originalMousePosition,
2564	+ a = this.axis,
2565	+ prevTop = this.position.top,
2566	+ prevLeft = this.position.left,
2567	+ prevWidth = this.size.width,
2568	+ prevHeight = this.size.height,
2569	+ dx = (event.pageX-smp.left)\|\|0,
2570	+ dy = (event.pageY-smp.top)\|\|0,
2571	+ trigger = this._change[a];
2572	+
2573	+ if (!trigger) {
2574	+ return false;
2575	+ }
2576
2577	// Calculate the attrs that will be change
2578	+ data = trigger.apply(this, [event, dx, dy]);
2579
2580	// Put this in the mouseDrag handler since the user can start pressing shift while resizing
2581	this._updateVirtualBoundaries(event.shiftKey);
2582	+ if (this._aspectRatio \|\| event.shiftKey) {
2583	data = this._updateRatio(data, event);
2584	+ }
2585
2586	data = this._respectSize(data, event);
2587
2588	+ this._updateCache(data);
2589	+
2590	// plugins callbacks need to be called first
2591	this._propagate("resize", event);
2592
2593	+ if (this.position.top !== prevTop) {
2594	+ props.top = this.position.top + "px";
2595	+ }
2596	+ if (this.position.left !== prevLeft) {
2597	+ props.left = this.position.left + "px";
2598	+ }
2599	+ if (this.size.width !== prevWidth) {
2600	+ props.width = this.size.width + "px";
2601	+ }
2602	+ if (this.size.height !== prevHeight) {
2603	+ props.height = this.size.height + "px";
2604	+ }
2605	+ el.css(props);
2606
2607	+ if (!this._helper && this._proportionallyResizeElements.length) {
2608	this._proportionallyResize();
2609	+ }
2610
2611	+ // Call the user callback if the element was resized
2612	+ if ( ! $.isEmptyObject(props) ) {
2613	+ this._trigger("resize", event, this.ui());
2614	+ }
2615
2616	return false;
2617	},

2619	_mouseStop: function(event) {
2620
2621	this.resizing = false;
2622	+ var pr, ista, soffseth, soffsetw, s, left, top,
2623	+ o = this.options, that = this;
2624
2625	if(this._helper) {



2626
2627	+ pr = this._proportionallyResizeElements;
2628	+ ista = pr.length && (/textarea/i).test(pr[0].nodeName);
2629	+ soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height;
2630	+ soffsetw = ista ? 0 : that.sizeDiff.width;
2631	+
2632	+ s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) };
2633	+ left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) \|\| null;
2634	+ top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) \|\| null;
2635
2636	+ if (!o.animate) {
2637	this.element.css($.extend(s, { top: top, left: left }));
2638	+ }
2639
2640	+ that.helper.height(that.size.height);
2641	+ that.helper.width(that.size.width);
2642
2643	+ if (this._helper && !o.animate) {
2644	+ this._proportionallyResize();
2645	+ }
2646	}
2647
2648	+ $("body").css("cursor", "auto");
2649
2650	this.element.removeClass("ui-resizable-resizing");
2651
2652	this._propagate("stop", event);
2653
2654	+ if (this._helper) {
2655	+ this.helper.remove();
2656	+ }
2657	+
2658	return false;
2659
2660	},
2661
2662	+ _updateVirtualBoundaries: function(forceAspectRatio) {
2663	+ var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
2664	+ o = this.options;
2665
2666	+ b = {
2667	+ minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
2668	+ maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
2669	+ minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
2670	+ maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
2671	+ };
2672
2673	+ if(this._aspectRatio \|\| forceAspectRatio) {
2674	+ // We want to create an enclosing box whose aspect ration is the requested one
2675	+ // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
2676	+ pMinWidth = b.minHeight * this.aspectRatio;
2677	+ pMinHeight = b.minWidth / this.aspectRatio;
2678	+ pMaxWidth = b.maxHeight * this.aspectRatio;
2679	+ pMaxHeight = b.maxWidth / this.aspectRatio;
2680
2681	+ if(pMinWidth > b.minWidth) {
2682	+ b.minWidth = pMinWidth;
2683	+ }
2684	+ if(pMinHeight > b.minHeight) {
2685	+ b.minHeight = pMinHeight;
2686	+ }
2687	+ if(pMaxWidth < b.maxWidth) {
2688	+ b.maxWidth = pMaxWidth;
2689	+ }
2690	+ if(pMaxHeight < b.maxHeight) {
2691	+ b.maxHeight = pMaxHeight;
2692	+ }
2693	+ }
2694	+ this._vBoundaries = b;
2695	+ },
2696
2697	_updateCache: function(data) {

2698	this.offset = this.helper.offset();
2699	+ if (isNumber(data.left)) {
2700	+ this.position.left = data.left;
2701	+ }
2702	+ if (isNumber(data.top)) {
2703	+ this.position.top = data.top;
2704	+ }
2705	+ if (isNumber(data.height)) {
2706	+ this.size.height = data.height;
2707	+ }
2708	+ if (isNumber(data.width)) {
2709	+ this.size.width = data.width;
2710	+ }
2711	},
2712
2713	+ _updateRatio: function( data ) {
2714
2715	+ var cpos = this.position,
2716	+ csize = this.size,
2717	+ a = this.axis;
2718
2719	+ if (isNumber(data.height)) {
2720	+ data.width = (data.height * this.aspectRatio);
2721	+ } else if (isNumber(data.width)) {
2722	+ data.height = (data.width / this.aspectRatio);
2723	+ }
2724
2725	+ if (a === "sw") {
2726	data.left = cpos.left + (csize.width - data.width);
2727	data.top = null;
2728	}
2729	+ if (a === "nw") {
2730	data.top = cpos.top + (csize.height - data.height);
2731	data.left = cpos.left + (csize.width - data.width);
2732	}

2734	return data;
2735	},
2736
2737	+ _respectSize: function( data ) {
2738
2739	+ var o = this._vBoundaries,
2740	+ a = this.axis,
2741	+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
2742	+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height),
2743	+ dw = this.originalPosition.left + this.originalSize.width,
2744	+ dh = this.position.top + this.size.height,
2745	+ cw = /sw\|nw\|w/.test(a), ch = /nw\|ne\|n/.test(a);
2746	+ if (isminw) {
2747	+ data.width = o.minWidth;
2748	+ }
2749	+ if (isminh) {
2750	+ data.height = o.minHeight;
2751	+ }
2752	+ if (ismaxw) {
2753	+ data.width = o.maxWidth;
2754	+ }
2755	+ if (ismaxh) {
2756	+ data.height = o.maxHeight;
2757	+ }
2758
2759	+ if (isminw && cw) {
2760	+ data.left = dw - o.minWidth;
2761	+ }
2762	+ if (ismaxw && cw) {
2763	+ data.left = dw - o.maxWidth;
2764	+ }
2765	+ if (isminh && ch) {
2766	+ data.top = dh - o.minHeight;
2767	+ }
2768	+ if (ismaxh && ch) {
2769	+ data.top = dh - o.maxHeight;
2770	+ }
2771
2772	// fixing jump error on top/left - bug #2330
2773	+ if (!data.width && !data.height && !data.left && data.top) {
2774	+ data.top = null;
2775	+ } else if (!data.width && !data.height && !data.top && data.left) {
2776	+ data.left = null;
2777	+ }
2778
2779	return data;
2780	},
2781
2782	_proportionallyResize: function() {
2783
2784	+ if (!this._proportionallyResizeElements.length) {
2785	+ return;
2786	+ }
2787	+
2788	+ var i, j, borders, paddings, prel,
2789	+ element = this.helper \|\| this.element;
2790
2791	+ for ( i=0; i < this._proportionallyResizeElements.length; i++) {
2792
2793	+ prel = this._proportionallyResizeElements[i];
2794
2795	if (!this.borderDif) {
2796	+ this.borderDif = [];
2797	+ borders = [prel.css("borderTopWidth"), prel.css("borderRightWidth"), prel.css("borderBottomWidth"), prel.css("borderLeftWidth")];
2798	+ paddings = [prel.css("paddingTop"), prel.css("paddingRight"), prel.css("paddingBottom"), prel.css("paddingLeft")];
2799
2800	+ for ( j = 0; j < borders.length; j++ ) {
2801	+ this.borderDif[ j ] = ( parseInt( borders[ j ], 10 ) \|\| 0 ) + ( parseInt( paddings[ j ], 10 ) \|\| 0 );
2802	+ }

2803	}
2804



2805	prel.css({
2806	height: (element.height() - this.borderDif[0] - this.borderDif[2]) \|\| 0,
2807	width: (element.width() - this.borderDif[1] - this.borderDif[3]) \|\| 0
2808	});
2809
2810	+ }
2811
2812	},
2813

2818
2819	if(this._helper) {
2820
2821	+ this.helper = this.helper \|\| $("<div style='overflow:hidden;'></div>");




2822
2823	this.helper.addClass(this._helper).css({
2824	+ width: this.element.outerWidth() - 1,
2825	+ height: this.element.outerHeight() - 1,
2826	+ position: "absolute",
2827	+ left: this.elementOffset.left +"px",
2828	+ top: this.elementOffset.top +"px",
2829	zIndex: ++o.zIndex //TODO: Don't modify option
2830	});
2831

2840	},
2841
2842	_change: {
2843	+ e: function(event, dx) {
2844	return { width: this.originalSize.width + dx };
2845	},
2846	+ w: function(event, dx) {
2847	+ var cs = this.originalSize, sp = this.originalPosition;
2848	return { left: sp.left + dx, width: cs.width - dx };
2849	},
2850	n: function(event, dx, dy) {
2851	+ var cs = this.originalSize, sp = this.originalPosition;
2852	return { top: sp.top + dy, height: cs.height - dy };
2853	},
2854	s: function(event, dx, dy) {

2870
2871	_propagate: function(n, event) {
2872	$.ui.plugin.call(this, n, [event, this.ui()]);
2873	+ (n !== "resize" && this._trigger(n, event, this.ui()));
2874	},
2875
2876	plugins: {},

2889
2890	});
2891




2892	/*
2893	* Resizable Extensions
2894	*/
2895
2896	+ $.ui.plugin.add("resizable", "animate", {














2897
2898	+ stop: function( event ) {
2899	+ var that = $(this).data("ui-resizable"),
2900	+ o = that.options,
2901	+ pr = that._proportionallyResizeElements,
2902	+ ista = pr.length && (/textarea/i).test(pr[0].nodeName),
2903	+ soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height,
2904	+ soffsetw = ista ? 0 : that.sizeDiff.width,
2905	+ style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) },
2906	+ left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) \|\| null,
2907	+ top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) \|\| null;
2908	+
2909	+ that.element.animate(
2910	+ $.extend(style, top && left ? { top: top, left: left } : {}), {
2911	+ duration: o.animateDuration,
2912	+ easing: o.animateEasing,
2913	+ step: function() {
2914
2915	+ var data = {
2916	+ width: parseInt(that.element.css("width"), 10),
2917	+ height: parseInt(that.element.css("height"), 10),
2918	+ top: parseInt(that.element.css("top"), 10),
2919	+ left: parseInt(that.element.css("left"), 10)
2920	+ };
2921
2922	+ if (pr && pr.length) {
2923	+ $(pr[0]).css({ width: data.width, height: data.height });
2924	+ }

2925
2926	+ // propagating resize, and updating values for each animation step
2927	+ that._updateCache(data);
2928	+ that._propagate("resize", event);
















































































2929
2930	}
2931	}

2936
2937	$.ui.plugin.add("resizable", "containment", {
2938
2939	+ start: function() {
2940	+ var element, p, co, ch, cw, width, height,
2941	+ that = $(this).data("ui-resizable"),
2942	+ o = that.options,
2943	+ el = that.element,
2944	+ oc = o.containment,
2945	+ ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
2946	+
2947	+ if (!ce) {
2948	+ return;
2949	+ }
2950
2951	+ that.containerElement = $(ce);
2952
2953	+ if (/document/.test(oc) \|\| oc === document) {
2954	+ that.containerOffset = { left: 0, top: 0 };
2955	+ that.containerPosition = { left: 0, top: 0 };
2956
2957	+ that.parentData = {
2958	element: $(document), left: 0, top: 0,
2959	width: $(document).width(), height: $(document).height() \|\| document.body.parentNode.scrollHeight
2960	};

2962
2963	// i'm a node, so compute top, left, right, bottom
2964	else {
2965	+ element = $(ce);
2966	+ p = [];
2967	$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
2968
2969	+ that.containerOffset = element.offset();
2970	+ that.containerPosition = element.position();
2971	+ that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
2972
2973	+ co = that.containerOffset;
2974	+ ch = that.containerSize.height;
2975	+ cw = that.containerSize.width;
2976	+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw );
2977	+ height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
2978
2979	+ that.parentData = {
2980	element: ce, left: co.left, top: co.top, width: width, height: height
2981	};
2982	}
2983	},
2984
2985	+ resize: function( event ) {
2986	+ var woset, hoset, isParent, isOffsetRelative,
2987	+ that = $(this).data("ui-resizable"),
2988	+ o = that.options,
2989	+ co = that.containerOffset, cp = that.position,
2990	+ pRatio = that._aspectRatio \|\| event.shiftKey,
2991	+ cop = { top:0, left:0 }, ce = that.containerElement;
2992
2993	+ if (ce[0] !== document && (/static/).test(ce.css("position"))) {
2994	+ cop = co;
2995	+ }
2996
2997	+ if (cp.left < (that._helper ? co.left : 0)) {
2998	+ that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left));
2999	+ if (pRatio) {
3000	+ that.size.height = that.size.width / that.aspectRatio;
3001	+ }
3002	+ that.position.left = o.helper ? co.left : 0;
3003	}
3004
3005	+ if (cp.top < (that._helper ? co.top : 0)) {
3006	+ that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top);
3007	+ if (pRatio) {
3008	+ that.size.width = that.size.height * that.aspectRatio;
3009	+ }
3010	+ that.position.top = that._helper ? co.top : 0;
3011	}
3012
3013	+ that.offset.left = that.parentData.left+that.position.left;
3014	+ that.offset.top = that.parentData.top+that.position.top;
3015
3016	+ woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width );
3017	+ hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height );
3018
3019	+ isParent = that.containerElement.get(0) === that.element.parent().get(0);
3020	+ isOffsetRelative = /relative\|absolute/.test(that.containerElement.css("position"));
3021
3022	+ if(isParent && isOffsetRelative) {
3023	+ woset -= that.parentData.left;
3024	+ }
3025
3026	+ if (woset + that.size.width >= that.parentData.width) {
3027	+ that.size.width = that.parentData.width - woset;
3028	+ if (pRatio) {
3029	+ that.size.height = that.size.width / that.aspectRatio;
3030	+ }
3031	}
3032
3033	+ if (hoset + that.size.height >= that.parentData.height) {
3034	+ that.size.height = that.parentData.height - hoset;
3035	+ if (pRatio) {
3036	+ that.size.width = that.size.height * that.aspectRatio;
3037	+ }
3038	}
3039	},
3040
3041	+ stop: function(){
3042	+ var that = $(this).data("ui-resizable"),
3043	+ o = that.options,
3044	+ co = that.containerOffset,
3045	+ cop = that.containerPosition,
3046	+ ce = that.containerElement,
3047	+ helper = $(that.helper),
3048	+ ho = helper.offset(),
3049	+ w = helper.outerWidth() - that.sizeDiff.width,
3050	+ h = helper.outerHeight() - that.sizeDiff.height;
3051
3052	+ if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) {
3053	$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
3054	+ }
3055
3056	+ if (that._helper && !o.animate && (/static/).test(ce.css("position"))) {
3057	$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
3058	+ }
3059	+
3060	+ }
3061	+ });
3062	+
3063	+ $.ui.plugin.add("resizable", "alsoResize", {
3064	+
3065	+ start: function () {
3066	+ var that = $(this).data("ui-resizable"),
3067	+ o = that.options,
3068	+ _store = function (exp) {
3069	+ $(exp).each(function() {
3070	+ var el = $(this);
3071	+ el.data("ui-resizable-alsoresize", {
3072	+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
3073	+ left: parseInt(el.css("left"), 10), top: parseInt(el.css("top"), 10)
3074	+ });
3075	+ });
3076	+ };
3077	+
3078	+ if (typeof(o.alsoResize) === "object" && !o.alsoResize.parentNode) {
3079	+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
3080	+ else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
3081	+ }else{
3082	+ _store(o.alsoResize);
3083	+ }
3084	+ },
3085	+
3086	+ resize: function (event, ui) {
3087	+ var that = $(this).data("ui-resizable"),
3088	+ o = that.options,
3089	+ os = that.originalSize,
3090	+ op = that.originalPosition,
3091	+ delta = {
3092	+ height: (that.size.height - os.height) \|\| 0, width: (that.size.width - os.width) \|\| 0,
3093	+ top: (that.position.top - op.top) \|\| 0, left: (that.position.left - op.left) \|\| 0
3094	+ },
3095	+
3096	+ _alsoResize = function (exp, c) {
3097	+ $(exp).each(function() {
3098	+ var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {},
3099	+ css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"];
3100	+
3101	+ $.each(css, function (i, prop) {
3102	+ var sum = (start[prop]\|\|0) + (delta[prop]\|\|0);
3103	+ if (sum && sum >= 0) {
3104	+ style[prop] = sum \|\| null;
3105	+ }
3106	+ });
3107	+
3108	+ el.css(style);
3109	+ });
3110	+ };
3111
3112	+ if (typeof(o.alsoResize) === "object" && !o.alsoResize.nodeType) {
3113	+ $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
3114	+ }else{
3115	+ _alsoResize(o.alsoResize);
3116	+ }
3117	+ },
3118	+
3119	+ stop: function () {
3120	+ $(this).removeData("resizable-alsoresize");
3121	}
3122	});
3123
3124	$.ui.plugin.add("resizable", "ghost", {
3125
3126	+ start: function() {
3127
3128	+ var that = $(this).data("ui-resizable"), o = that.options, cs = that.size;
3129
3130	+ that.ghost = that.originalElement.clone();
3131	+ that.ghost
3132	+ .css({ opacity: 0.25, display: "block", position: "relative", height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
3133	+ .addClass("ui-resizable-ghost")
3134	+ .addClass(typeof o.ghost === "string" ? o.ghost : "");
3135
3136	+ that.ghost.appendTo(that.helper);
3137
3138	},
3139
3140	+ resize: function(){
3141	+ var that = $(this).data("ui-resizable");
3142	+ if (that.ghost) {
3143	+ that.ghost.css({ position: "relative", height: that.size.height, width: that.size.width });
3144	+ }
3145	},
3146
3147	+ stop: function() {
3148	+ var that = $(this).data("ui-resizable");
3149	+ if (that.ghost && that.helper) {
3150	+ that.helper.get(0).removeChild(that.ghost.get(0));
3151	+ }
3152	}
3153
3154	});
3155
3156	$.ui.plugin.add("resizable", "grid", {
3157
3158	+ resize: function() {
3159	+ var that = $(this).data("ui-resizable"),
3160	+ o = that.options,
3161	+ cs = that.size,
3162	+ os = that.originalSize,
3163	+ op = that.originalPosition,
3164	+ a = that.axis,
3165	+ grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
3166	+ gridX = (grid[0]\|\|1),
3167	+ gridY = (grid[1]\|\|1),
3168	+ ox = Math.round((cs.width - os.width) / gridX) * gridX,
3169	+ oy = Math.round((cs.height - os.height) / gridY) * gridY,
3170	+ newWidth = os.width + ox,
3171	+ newHeight = os.height + oy,
3172	+ isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
3173	+ isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
3174	+ isMinWidth = o.minWidth && (o.minWidth > newWidth),
3175	+ isMinHeight = o.minHeight && (o.minHeight > newHeight);
3176	+
3177	+ o.grid = grid;
3178	+
3179	+ if (isMinWidth) {
3180	+ newWidth = newWidth + gridX;
3181	+ }
3182	+ if (isMinHeight) {
3183	+ newHeight = newHeight + gridY;
3184	+ }
3185	+ if (isMaxWidth) {
3186	+ newWidth = newWidth - gridX;
3187	+ }
3188	+ if (isMaxHeight) {
3189	+ newHeight = newHeight - gridY;
3190	+ }
3191
3192	if (/^(se\|s\|e)$/.test(a)) {
3193	+ that.size.width = newWidth;
3194	+ that.size.height = newHeight;
3195	+ } else if (/^(ne)$/.test(a)) {
3196	+ that.size.width = newWidth;
3197	+ that.size.height = newHeight;
3198	+ that.position.top = op.top - oy;
3199	+ } else if (/^(sw)$/.test(a)) {
3200	+ that.size.width = newWidth;
3201	+ that.size.height = newHeight;
3202	+ that.position.left = op.left - ox;
3203	+ } else {
3204	+ that.size.width = newWidth;
3205	+ that.size.height = newHeight;
3206	+ that.position.top = op.top - oy;
3207	+ that.position.left = op.left - ox;



3208	}
3209	}
3210
3211	});
3212








3213	})(jQuery);
3214	+













3215	(function( $, undefined ) {
3216
3217	$.widget("ui.selectable", $.ui.mouse, {
3218	+ version: "1.10.2",
3219	options: {
3220	+ appendTo: "body",
3221	autoRefresh: true,
3222	distance: 0,
3223	+ filter: "*",
3224	+ tolerance: "touch",
3225	+
3226	+ // callbacks
3227	+ selected: null,
3228	+ selecting: null,
3229	+ start: null,
3230	+ stop: null,
3231	+ unselected: null,
3232	+ unselecting: null
3233	},
3234	_create: function() {
3235	+ var selectees,
3236	+ that = this;
3237
3238	this.element.addClass("ui-selectable");
3239
3240	this.dragged = false;
3241
3242	// cache selectee children based on filter

3243	this.refresh = function() {
3244	+ selectees = $(that.options.filter, that.element[0]);
3245	selectees.addClass("ui-selectee");
3246	selectees.each(function() {
3247	+ var $this = $(this),
3248	+ pos = $this.offset();
3249	$.data(this, "selectable-item", {
3250	element: this,
3251	$element: $this,

3254	right: pos.left + $this.outerWidth(),
3255	bottom: pos.top + $this.outerHeight(),
3256	startselected: false,
3257	+ selected: $this.hasClass("ui-selected"),
3258	+ selecting: $this.hasClass("ui-selecting"),
3259	+ unselecting: $this.hasClass("ui-unselecting")
3260	});
3261	});
3262	};

3269	this.helper = $("<div class='ui-selectable-helper'></div>");
3270	},
3271
3272	+ _destroy: function() {
3273	this.selectees
3274	.removeClass("ui-selectee")
3275	.removeData("selectable-item");
3276	this.element
3277	+ .removeClass("ui-selectable ui-selectable-disabled");


3278	this._mouseDestroy();


3279	},
3280
3281	_mouseStart: function(event) {
3282	+ var that = this,
3283	+ options = this.options;
3284
3285	this.opos = [event.pageX, event.pageY];
3286
3287	+ if (this.options.disabled) {
3288	return;
3289	+ }

3290
3291	this.selectees = $(options.filter, this.element[0]);
3292

3295	$(options.appendTo).append(this.helper);
3296	// position helper (lasso)
3297	this.helper.css({
3298	+ "left": event.pageX,
3299	+ "top": event.pageY,
3300	"width": 0,
3301	"height": 0
3302	});

3305	this.refresh();
3306	}
3307
3308	+ this.selectees.filter(".ui-selected").each(function() {
3309	var selectee = $.data(this, "selectable-item");
3310	selectee.startselected = true;
3311	if (!event.metaKey && !event.ctrlKey) {
3312	+ selectee.$element.removeClass("ui-selected");
3313	selectee.selected = false;
3314	+ selectee.$element.addClass("ui-unselecting");
3315	selectee.unselecting = true;
3316	// selectable UNSELECTING callback
3317	+ that._trigger("unselecting", event, {
3318	unselecting: selectee.element
3319	});
3320	}
3321	});
3322
3323	+ $(event.target).parents().addBack().each(function() {
3324	+ var doSelect,
3325	+ selectee = $.data(this, "selectable-item");
3326	if (selectee) {
3327	+ doSelect = (!event.metaKey && !event.ctrlKey) \|\| !selectee.$element.hasClass("ui-selected");
3328	selectee.$element
3329	.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
3330	.addClass(doSelect ? "ui-selecting" : "ui-unselecting");

3333	selectee.selected = doSelect;
3334	// selectable (UN)SELECTING callback
3335	if (doSelect) {
3336	+ that._trigger("selecting", event, {
3337	selecting: selectee.element
3338	});
3339	} else {
3340	+ that._trigger("unselecting", event, {
3341	unselecting: selectee.element
3342	});
3343	}

3348	},
3349
3350	_mouseDrag: function(event) {
3351	+
3352	this.dragged = true;
3353
3354	+ if (this.options.disabled) {
3355	return;
3356	+ }
3357
3358	+ var tmp,
3359	+ that = this,
3360	+ options = this.options,
3361	+ x1 = this.opos[0],
3362	+ y1 = this.opos[1],
3363	+ x2 = event.pageX,
3364	+ y2 = event.pageY;
3365
3366	+ if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; }
3367	+ if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; }

3368	this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
3369
3370	this.selectees.each(function() {
3371	+ var selectee = $.data(this, "selectable-item"),
3372	+ hit = false;
3373	+
3374	//prevent helper from being selected if appendTo: selectable
3375	+ if (!selectee \|\| selectee.element === that.element[0]) {
3376	return;
3377	+ }
3378	+
3379	+ if (options.tolerance === "touch") {
3380	hit = ( !(selectee.left > x2 \|\| selectee.right < x1 \|\| selectee.top > y2 \|\| selectee.bottom < y1) );
3381	+ } else if (options.tolerance === "fit") {
3382	hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
3383	}
3384
3385	if (hit) {
3386	// SELECT
3387	if (selectee.selected) {
3388	+ selectee.$element.removeClass("ui-selected");
3389	selectee.selected = false;
3390	}
3391	if (selectee.unselecting) {
3392	+ selectee.$element.removeClass("ui-unselecting");
3393	selectee.unselecting = false;
3394	}
3395	if (!selectee.selecting) {
3396	+ selectee.$element.addClass("ui-selecting");
3397	selectee.selecting = true;
3398	// selectable SELECTING callback
3399	+ that._trigger("selecting", event, {
3400	selecting: selectee.element
3401	});
3402	}

3404	// UNSELECT
3405	if (selectee.selecting) {
3406	if ((event.metaKey \|\| event.ctrlKey) && selectee.startselected) {
3407	+ selectee.$element.removeClass("ui-selecting");
3408	selectee.selecting = false;
3409	+ selectee.$element.addClass("ui-selected");
3410	selectee.selected = true;
3411	} else {
3412	+ selectee.$element.removeClass("ui-selecting");
3413	selectee.selecting = false;
3414	if (selectee.startselected) {
3415	+ selectee.$element.addClass("ui-unselecting");
3416	selectee.unselecting = true;
3417	}
3418	// selectable UNSELECTING callback
3419	+ that._trigger("unselecting", event, {
3420	unselecting: selectee.element
3421	});
3422	}
3423	}
3424	if (selectee.selected) {
3425	if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
3426	+ selectee.$element.removeClass("ui-selected");
3427	selectee.selected = false;
3428
3429	+ selectee.$element.addClass("ui-unselecting");
3430	selectee.unselecting = true;
3431	// selectable UNSELECTING callback
3432	+ that._trigger("unselecting", event, {
3433	unselecting: selectee.element
3434	});
3435	}

3441	},
3442
3443	_mouseStop: function(event) {
3444	+ var that = this;
3445
3446	this.dragged = false;
3447
3448	+ $(".ui-unselecting", this.element[0]).each(function() {


3449	var selectee = $.data(this, "selectable-item");
3450	+ selectee.$element.removeClass("ui-unselecting");
3451	selectee.unselecting = false;
3452	selectee.startselected = false;
3453	+ that._trigger("unselected", event, {
3454	unselected: selectee.element
3455	});
3456	});
3457	+ $(".ui-selecting", this.element[0]).each(function() {
3458	var selectee = $.data(this, "selectable-item");
3459	+ selectee.$element.removeClass("ui-selecting").addClass("ui-selected");
3460	selectee.selecting = false;
3461	selectee.selected = true;
3462	selectee.startselected = true;
3463	+ that._trigger("selected", event, {
3464	selected: selectee.element
3465	});
3466	});

3473
3474	});
3475




3476	})(jQuery);
3477	+













3478	(function( $, undefined ) {
3479
3480	+ /jshint loopfunc: true /
3481	+
3482	+ function isOverAxis( x, reference, size ) {
3483	+ return ( x > reference ) && ( x < ( reference + size ) );
3484	+ }
3485	+
3486	+ function isFloating(item) {
3487	+ return (/left\|right/).test(item.css("float")) \|\| (/inline\|table-cell/).test(item.css("display"));
3488	+ }
3489	+
3490	$.widget("ui.sortable", $.ui.mouse, {
3491	+ version: "1.10.2",
3492	widgetEventPrefix: "sort",
3493	+ ready: false,
3494	options: {
3495	appendTo: "parent",
3496	axis: false,
3497	connectWith: false,
3498	containment: false,
3499	+ cursor: "auto",
3500	cursorAt: false,
3501	dropOnEmpty: true,
3502	forcePlaceholderSize: false,

3504	grid: false,
3505	handle: false,
3506	helper: "original",
3507	+ items: "> *",
3508	opacity: false,
3509	placeholder: false,
3510	revert: false,

3513	scrollSpeed: 20,
3514	scope: "default",
3515	tolerance: "intersect",
3516	+ zIndex: 1000,
3517	+
3518	+ // callbacks
3519	+ activate: null,
3520	+ beforeStop: null,
3521	+ change: null,
3522	+ deactivate: null,
3523	+ out: null,
3524	+ over: null,
3525	+ receive: null,
3526	+ remove: null,
3527	+ sort: null,
3528	+ start: null,
3529	+ stop: null,
3530	+ update: null
3531	},
3532	_create: function() {
3533

3539	this.refresh();
3540
3541	//Let's determine if the items are being displayed horizontally
3542	+ this.floating = this.items.length ? o.axis === "x" \|\| isFloating(this.items[0].item) : false;
3543
3544	//Let's determine the parent's offset
3545	this.offset = this.element.offset();

3547	//Initialize mouse events for interaction
3548	this._mouseInit();
3549
3550	+ //We're ready to go
3551	+ this.ready = true;
3552	+
3553	},
3554
3555	+ _destroy: function() {
3556	this.element
3557	.removeClass("ui-sortable ui-sortable-disabled");
3558	this._mouseDestroy();
3559
3560	+ for ( var i = this.items.length - 1; i >= 0; i-- ) {
3561	this.items[i].item.removeData(this.widgetName + "-item");
3562	+ }
3563
3564	return this;
3565	},

3567	_setOption: function(key, value){
3568	if ( key === "disabled" ) {
3569	this.options[ key ] = value;
3570	+
3571	+ this.widget().toggleClass( "ui-sortable-disabled", !!value );

3572	} else {
3573	// Don't call widget base _setOption for disable as it adds ui-state-disabled class
3574	$.Widget.prototype._setOption.apply(this, arguments);

3576	},
3577
3578	_mouseCapture: function(event, overrideHandle) {
3579	+ var currentItem = null,
3580	+ validHandle = false,
3581	+ that = this;
3582
3583	if (this.reverting) {
3584	return false;
3585	}
3586
3587	+ if(this.options.disabled \|\| this.options.type === "static") {
3588	+ return false;
3589	+ }
3590
3591	//We have to refresh the items data once first
3592	this._refreshItems(event);
3593
3594	//Find out if the clicked node (or one of its parents) is a actual item in this.items
3595	+ $(event.target).parents().each(function() {
3596	+ if($.data(this, that.widgetName + "-item") === that) {
3597	currentItem = $(this);
3598	return false;
3599	}
3600	});
3601	+ if($.data(event.target, that.widgetName + "-item") === that) {
3602	+ currentItem = $(event.target);
3603	+ }
3604
3605	+ if(!currentItem) {
3606	+ return false;
3607	+ }
3608	if(this.options.handle && !overrideHandle) {
3609	+ $(this.options.handle, currentItem).find("*").addBack().each(function() {
3610	+ if(this === event.target) {
3611	+ validHandle = true;
3612	+ }
3613	+ });
3614	+ if(!validHandle) {
3615	+ return false;
3616	+ }
3617	}
3618
3619	this.currentItem = currentItem;

3624
3625	_mouseStart: function(event, overrideHandle, noActivation) {
3626
3627	+ var i, body,
3628	+ o = this.options;
3629	+
3630	this.currentContainer = this;
3631
3632	//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture

3656	left: this.offset.left - this.margins.left
3657	};
3658





3659	$.extend(this.offset, {
3660	click: { //Where the click happened, relative to the element
3661	left: event.pageX - this.offset.left,

3665	relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
3666	});
3667
3668	+ // Only after we got the offset, we can change the helper's position to absolute
3669	+ // TODO: Still need to figure out a way to make relative sorting possible
3670	+ this.helper.css("position", "absolute");
3671	+ this.cssPosition = this.helper.css("position");
3672	+
3673	//Generate the original position
3674	this.originalPosition = this._generatePosition(event);
3675	this.originalPageX = event.pageX;
3676	this.originalPageY = event.pageY;
3677
3678	+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
3679	(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
3680
3681	//Cache the former DOM position
3682	this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
3683
3684	//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
3685	+ if(this.helper[0] !== this.currentItem[0]) {
3686	this.currentItem.hide();
3687	}
3688

3690	this._createPlaceholder();
3691
3692	//Set a containment if given in the options
3693	+ if(o.containment) {
3694	this._setContainment();
3695	+ }
3696	+
3697	+ if( o.cursor && o.cursor !== "auto" ) { // cursor option
3698	+ body = this.document.find( "body" );
3699
3700	+ // support: IE
3701	+ this.storedCursor = body.css( "cursor" );
3702	+ body.css( "cursor", o.cursor );
3703	+
3704	+ this.storedStylesheet = $( "<style>*{ cursor: "+o.cursor+" !important; }</style>" ).appendTo( body );
3705	}
3706
3707	if(o.opacity) { // opacity option
3708	+ if (this.helper.css("opacity")) {
3709	+ this._storedOpacity = this.helper.css("opacity");
3710	+ }
3711	this.helper.css("opacity", o.opacity);
3712	}
3713
3714	if(o.zIndex) { // zIndex option
3715	+ if (this.helper.css("zIndex")) {
3716	+ this._storedZIndex = this.helper.css("zIndex");
3717	+ }
3718	this.helper.css("zIndex", o.zIndex);
3719	}
3720
3721	//Prepare scrolling
3722	+ if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {
3723	this.overflowOffset = this.scrollParent.offset();
3724	+ }
3725
3726	//Call callbacks
3727	this._trigger("start", event, this._uiHash());
3728
3729	//Recache the helper size
3730	+ if(!this._preserveHelperProportions) {
3731	this._cacheHelperProportions();
3732	+ }
3733
3734
3735	+ //Post "activate" events to possible containers
3736	+ if( !noActivation ) {
3737	+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
3738	+ this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) );
3739	+ }
3740	}
3741
3742	//Prepare possible droppables
3743	+ if($.ui.ddmanager) {
3744	$.ui.ddmanager.current = this;
3745	+ }
3746
3747	+ if ($.ui.ddmanager && !o.dropBehaviour) {
3748	$.ui.ddmanager.prepareOffsets(this, event);
3749	+ }
3750
3751	this.dragging = true;
3752

3757	},
3758
3759	_mouseDrag: function(event) {
3760	+ var i, item, itemElement, intersection,
3761	+ o = this.options,
3762	+ scrolled = false;
3763
3764	//Compute the helpers position
3765	this.position = this._generatePosition(event);

3771
3772	//Do scrolling
3773	if(this.options.scroll) {
3774	+ if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {

3775
3776	+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
3777	this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
3778	+ } else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
3779	this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
3780	+ }
3781
3782	+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
3783	this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
3784	+ } else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
3785	this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
3786	+ }
3787
3788	} else {
3789
3790	+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
3791	scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
3792	+ } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
3793	scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
3794	+ }
3795
3796	+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
3797	scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
3798	+ } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
3799	scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
3800	+ }
3801
3802	}
3803
3804	+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
3805	$.ui.ddmanager.prepareOffsets(this, event);
3806	+ }
3807	}
3808
3809	//Regenerate the absolute position used for position checks
3810	this.positionAbs = this._convertPositionTo("absolute");
3811
3812	//Set the helper position
3813	+ if(!this.options.axis \|\| this.options.axis !== "y") {
3814	+ this.helper[0].style.left = this.position.left+"px";
3815	+ }
3816	+ if(!this.options.axis \|\| this.options.axis !== "x") {
3817	+ this.helper[0].style.top = this.position.top+"px";
3818	+ }
3819
3820	//Rearrange
3821	+ for (i = this.items.length - 1; i >= 0; i--) {
3822
3823	//Cache variables and intersection, continue if no intersection
3824	+ item = this.items[i];
3825	+ itemElement = item.item[0];
3826	+ intersection = this._intersectsWithPointer(item);
3827	+ if (!intersection) {
3828	+ continue;
3829	+ }
3830	+
3831	+ // Only put the placeholder inside the current Container, skip all
3832	+ // items form other containers. This works because when moving
3833	+ // an item from one container to another the
3834	+ // currentContainer is switched before the placeholder is moved.
3835	+ //
3836	+ // Without this moving items in "sub-sortables" can cause the placeholder to jitter
3837	+ // beetween the outer and inner container.
3838	+ if (item.instance !== this.currentContainer) {
3839	+ continue;
3840	+ }
3841	+
3842	+ // cannot intersect with itself
3843	+ // no useless actions that have been done before
3844	+ // no action if the item moved is the parent of the item checked
3845	+ if (itemElement !== this.currentItem[0] &&
3846	+ this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement &&
3847	+ !$.contains(this.placeholder[0], itemElement) &&
3848	+ (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true)
3849	) {
3850
3851	+ this.direction = intersection === 1 ? "down" : "up";
3852
3853	+ if (this.options.tolerance === "pointer" \|\| this._intersectsWithSides(item)) {
3854	this._rearrange(event, item);
3855	} else {
3856	break;

3865	this._contactContainers(event);
3866
3867	//Interconnect with droppables
3868	+ if($.ui.ddmanager) {
3869	+ $.ui.ddmanager.drag(this, event);
3870	+ }
3871
3872	//Call callbacks
3873	+ this._trigger("sort", event, this._uiHash());
3874
3875	this.lastPositionAbs = this.positionAbs;
3876	return false;

3879
3880	_mouseStop: function(event, noPropagation) {
3881
3882	+ if(!event) {
3883	+ return;
3884	+ }
3885
3886	//If we are using droppables, inform the manager about the drop
3887	+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
3888	$.ui.ddmanager.drop(this, event);
3889	+ }
3890
3891	if(this.options.revert) {
3892	+ var that = this,
3893	+ cur = this.placeholder.offset(),
3894	+ axis = this.options.axis,
3895	+ animation = {};
3896
3897	+ if ( !axis \|\| axis === "x" ) {
3898	+ animation.left = cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollLeft);
3899	+ }
3900	+ if ( !axis \|\| axis === "y" ) {
3901	+ animation.top = cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollTop);
3902	+ }
3903	+ this.reverting = true;
3904	+ $(this.helper).animate( animation, parseInt(this.options.revert, 10) \|\| 500, function() {
3905	+ that._clear(event);
3906	});
3907	} else {
3908	this._clear(event, noPropagation);

3914
3915	cancel: function() {
3916


3917	if(this.dragging) {
3918
3919	this._mouseUp({ target: null });
3920
3921	+ if(this.options.helper === "original") {
3922	this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
3923	+ } else {
3924	this.currentItem.show();
3925	+ }
3926
3927	//Post deactivating events to containers
3928	for (var i = this.containers.length - 1; i >= 0; i--){
3929	+ this.containers[i]._trigger("deactivate", null, this._uiHash(this));
3930	if(this.containers[i].containerCache.over) {
3931	+ this.containers[i]._trigger("out", null, this._uiHash(this));
3932	this.containers[i].containerCache.over = 0;
3933	}
3934	}

3937
3938	if (this.placeholder) {
3939	//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
3940	+ if(this.placeholder[0].parentNode) {
3941	+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
3942	+ }
3943	+ if(this.options.helper !== "original" && this.helper && this.helper[0].parentNode) {
3944	+ this.helper.remove();
3945	+ }
3946
3947	$.extend(this, {
3948	helper: null,

3964
3965	serialize: function(o) {
3966
3967	+ var items = this._getItemsAsjQuery(o && o.connected),
3968	+ str = [];
3969	+ o = o \|\| {};
3970
3971	$(items).each(function() {
3972	+ var res = ($(o.item \|\| this).attr(o.attribute \|\| "id") \|\| "").match(o.expression \|\| (/(.+)[\-=_](.+)/));
3973	+ if (res) {
3974	+ str.push((o.key \|\| res[1]+"[]")+"="+(o.key && o.expression ? res[1] : res[2]));
3975	+ }
3976	});
3977
3978	if(!str.length && o.key) {
3979	+ str.push(o.key + "=");
3980	}
3981
3982	+ return str.join("&");
3983
3984	},
3985
3986	toArray: function(o) {
3987
3988	+ var items = this._getItemsAsjQuery(o && o.connected),
3989	+ ret = [];
3990	+
3991	+ o = o \|\| {};
3992
3993	+ items.each(function() { ret.push($(o.item \|\| this).attr(o.attribute \|\| "id") \|\| ""); });
3994	return ret;
3995
3996	},

4001	var x1 = this.positionAbs.left,
4002	x2 = x1 + this.helperProportions.width,
4003	y1 = this.positionAbs.top,
4004	+ y2 = y1 + this.helperProportions.height,
4005	+ l = item.left,

4006	r = l + item.width,
4007	t = item.top,
4008	+ b = t + item.height,
4009	+ dyClick = this.offset.click.top,
4010	+ dxClick = this.offset.click.left,
4011	+ isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
4012	+
4013	+ if ( this.options.tolerance === "pointer" \|\|
4014	+ this.options.forcePointerForContainers \|\|
4015	+ (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"])


4016	) {
4017	return isOverElement;
4018	} else {
4019
4020	+ return (l < x1 + (this.helperProportions.width / 2) && // Right Half
4021	+ x2 - (this.helperProportions.width / 2) < r && // Left Half
4022	+ t < y1 + (this.helperProportions.height / 2) && // Bottom Half
4023	+ y2 - (this.helperProportions.height / 2) < b ); // Top Half
4024
4025	}
4026	},
4027
4028	_intersectsWithPointer: function(item) {
4029
4030	+ var isOverElementHeight = (this.options.axis === "x") \|\| isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
4031	+ isOverElementWidth = (this.options.axis === "y") \|\| isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
4032	isOverElement = isOverElementHeight && isOverElementWidth,
4033	verticalDirection = this._getDragVerticalDirection(),
4034	horizontalDirection = this._getDragHorizontalDirection();
4035
4036	+ if (!isOverElement) {
4037	return false;
4038	+ }
4039
4040	return this.floating ?
4041	+ ( ((horizontalDirection && horizontalDirection === "right") \|\| verticalDirection === "down") ? 2 : 1 )
4042	+ : ( verticalDirection && (verticalDirection === "down" ? 2 : 1) );
4043
4044	},
4045
4046	_intersectsWithSides: function(item) {
4047
4048	+ var isOverBottomHalf = isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
4049	+ isOverRightHalf = isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
4050	verticalDirection = this._getDragVerticalDirection(),
4051	horizontalDirection = this._getDragHorizontalDirection();
4052
4053	if (this.floating && horizontalDirection) {
4054	+ return ((horizontalDirection === "right" && isOverRightHalf) \|\| (horizontalDirection === "left" && !isOverRightHalf));
4055	} else {
4056	+ return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) \|\| (verticalDirection === "up" && !isOverBottomHalf));
4057	}
4058
4059	},
4060
4061	_getDragVerticalDirection: function() {
4062	var delta = this.positionAbs.top - this.lastPositionAbs.top;
4063	+ return delta !== 0 && (delta > 0 ? "down" : "up");
4064	},
4065
4066	_getDragHorizontalDirection: function() {
4067	var delta = this.positionAbs.left - this.lastPositionAbs.left;
4068	+ return delta !== 0 && (delta > 0 ? "right" : "left");
4069	},
4070
4071	refresh: function(event) {

4076
4077	_connectWith: function() {
4078	var options = this.options;
4079	+ return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith;


4080	},
4081	+
4082	_getItemsAsjQuery: function(connected) {
4083
4084	+ var i, j, cur, inst,
4085	+ items = [],
4086	+ queries = [],
4087	+ connectWith = this._connectWith();
4088
4089	if(connectWith && connected) {
4090	+ for (i = connectWith.length - 1; i >= 0; i--){
4091	+ cur = $(connectWith[i]);
4092	+ for ( j = cur.length - 1; j >= 0; j--){
4093	+ inst = $.data(cur[j], this.widgetFullName);
4094	+ if(inst && inst !== this && !inst.options.disabled) {
4095	+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]);
4096	}
4097	+ }
4098	+ }
4099	}
4100
4101	+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]);
4102
4103	+ for (i = queries.length - 1; i >= 0; i--){
4104	queries[i][0].each(function() {
4105	items.push(this);
4106	});
4107	+ }
4108
4109	return $(items);
4110

4114
4115	var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
4116
4117	+ this.items = $.grep(this.items, function (item) {

4118	for (var j=0; j < list.length; j++) {
4119	+ if(list[j] === item.item[0]) {
4120	+ return false;
4121	+ }
4122	+ }
4123	+ return true;
4124	+ });
4125
4126	},
4127

4129
4130	this.items = [];
4131	this.containers = [this];
4132	+
4133	+ var i, j, cur, inst, targetData, _queries, item, queriesLength,
4134	+ items = this.items,
4135	+ queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]],
4136	+ connectWith = this._connectWith();
4137	+
4138	+ if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
4139	+ for (i = connectWith.length - 1; i >= 0; i--){
4140	+ cur = $(connectWith[i]);
4141	+ for (j = cur.length - 1; j >= 0; j--){
4142	+ inst = $.data(cur[j], this.widgetFullName);
4143	+ if(inst && inst !== this && !inst.options.disabled) {
4144	queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
4145	this.containers.push(inst);
4146	}
4147	+ }
4148	+ }
4149	}
4150
4151	+ for (i = queries.length - 1; i >= 0; i--) {
4152	+ targetData = queries[i][1];
4153	+ _queries = queries[i][0];
4154
4155	+ for (j=0, queriesLength = _queries.length; j < queriesLength; j++) {
4156	+ item = $(_queries[j]);
4157
4158	+ item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager)
4159
4160	items.push({
4161	item: item,

4163	width: 0, height: 0,
4164	left: 0, top: 0
4165	});
4166	+ }
4167	+ }
4168
4169	},
4170

4175	this.offset.parent = this._getParentOffset();
4176	}
4177
4178	+ var i, item, t, p;
4179	+
4180	+ for (i = this.items.length - 1; i >= 0; i--){
4181	+ item = this.items[i];
4182
4183	//We ignore calculating positions of all connected containers when we're not over them
4184	+ if(item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) {
4185	continue;
4186	+ }
4187
4188	+ t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
4189
4190	if (!fast) {
4191	item.width = t.outerWidth();
4192	item.height = t.outerHeight();
4193	}
4194
4195	+ p = t.offset();
4196	item.left = p.left;
4197	item.top = p.top;
4198	+ }
4199
4200	if(this.options.custom && this.options.custom.refreshContainers) {
4201	this.options.custom.refreshContainers.call(this);
4202	} else {
4203	+ for (i = this.containers.length - 1; i >= 0; i--){
4204	+ p = this.containers[i].element.offset();
4205	this.containers[i].containerCache.left = p.left;
4206	this.containers[i].containerCache.top = p.top;
4207	this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
4208	this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
4209	+ }
4210	}
4211
4212	return this;
4213	},
4214
4215	_createPlaceholder: function(that) {
4216	+ that = that \|\| this;
4217	+ var className,
4218	+ o = that.options;
4219
4220	+ if(!o.placeholder \|\| o.placeholder.constructor === String) {
4221	+ className = o.placeholder;


4222	o.placeholder = {
4223	element: function() {
4224
4225	+ var nodeName = that.currentItem[0].nodeName.toLowerCase(),
4226	+ element = $( that.document[0].createElement( nodeName ) )
4227	+ .addClass(className \|\| that.currentItem[0].className+" ui-sortable-placeholder")
4228	+ .removeClass("ui-sortable-helper");
4229	+
4230	+ if ( nodeName === "tr" ) {
4231	+ // Use a high colspan to force the td to expand the full
4232	+ // width of the table (browsers are smart enough to
4233	+ // handle this properly)
4234	+ element.append( "<td colspan='99'> </td>" );
4235	+ } else if ( nodeName === "img" ) {
4236	+ element.attr( "src", that.currentItem.attr( "src" ) );
4237	+ }
4238
4239	+ if ( !className ) {
4240	+ element.css( "visibility", "hidden" );
4241	+ }
4242
4243	+ return element;
4244	},
4245	update: function(container, p) {
4246
4247	// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
4248	// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
4249	+ if(className && !o.forcePlaceholderSize) {
4250	+ return;
4251	+ }
4252
4253	//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
4254	+ if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop")\|\|0, 10) - parseInt(that.currentItem.css("paddingBottom")\|\|0, 10)); }
4255	+ if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft")\|\|0, 10) - parseInt(that.currentItem.css("paddingRight")\|\|0, 10)); }
4256	}
4257	};
4258	}
4259
4260	//Create the placeholder
4261	+ that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
4262
4263	//Append it after the actual current item
4264	+ that.currentItem.after(that.placeholder);
4265
4266	//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
4267	+ o.placeholder.update(that, that.placeholder);
4268
4269	},
4270
4271	_contactContainers: function(event) {
4272	+ var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, base, cur, nearBottom, floating,
4273	+ innermostContainer = null,
4274	+ innermostIndex = null;







4275
4276	+ // get innermost container that intersects with item
4277	+ for (i = this.containers.length - 1; i >= 0; i--) {
4278
4279	+ // never consider a container that's located within the item itself
4280	+ if($.contains(this.currentItem[0], this.containers[i].element[0])) {
4281	+ continue;
4282	+ }
4283	+
4284	+ if(this._intersectsWith(this.containers[i].containerCache)) {
4285	+
4286	+ // if we've already found a container and it's more "inner" than this, then continue
4287	+ if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) {
4288	continue;
4289	+ }
4290
4291	+ innermostContainer = this.containers[i];
4292	innermostIndex = i;
4293	+
4294	} else {
4295	+ // container doesn't intersect. trigger "out" event if necessary
4296	if(this.containers[i].containerCache.over) {
4297	this.containers[i]._trigger("out", event, this._uiHash(this));
4298	this.containers[i].containerCache.over = 0;

4300	}
4301
4302	}
4303	+
4304	+ // if no intersecting containers found, return
4305	+ if(!innermostContainer) {
4306	+ return;
4307	+ }
4308
4309	// move the item into the container if it's not there already
4310	if(this.containers.length === 1) {
4311	+ if (!this.containers[innermostIndex].containerCache.over) {
4312	+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
4313	+ this.containers[innermostIndex].containerCache.over = 1;
4314	+ }
4315	+ } else {
4316	+
4317	+ //When entering a new container, we will find the item with the least distance and append our item near it
4318	+ dist = 10000;
4319	+ itemWithLeastDistance = null;
4320	+ floating = innermostContainer.floating \|\| isFloating(this.currentItem);
4321	+ posProperty = floating ? "left" : "top";
4322	+ sizeProperty = floating ? "width" : "height";
4323	+ base = this.positionAbs[posProperty] + this.offset.click[posProperty];
4324	+ for (j = this.items.length - 1; j >= 0; j--) {
4325	+ if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) {
4326	+ continue;
4327	+ }
4328	+ if(this.items[j].item[0] === this.currentItem[0]) {
4329	+ continue;
4330	+ }
4331	+ if (floating && !isOverAxis(this.positionAbs.top + this.offset.click.top, this.items[j].top, this.items[j].height)) {
4332	+ continue;
4333	+ }
4334	+ cur = this.items[j].item.offset()[posProperty];
4335	+ nearBottom = false;
4336	+ if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){
4337	+ nearBottom = true;
4338	+ cur += this.items[j][sizeProperty];
4339	+ }
4340	+
4341	+ if(Math.abs(cur - base) < dist) {
4342	+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
4343	+ this.direction = nearBottom ? "up": "down";
4344	+ }
4345	+ }
4346	+
4347	+ //Check if dropOnEmpty is enabled
4348	+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) {
4349	+ return;
4350	+ }
4351	+
4352	+ if(this.currentContainer === this.containers[innermostIndex]) {
4353	+ return;
4354	+ }
4355	+
4356	+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
4357	+ this._trigger("change", event, this._uiHash());
4358	+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
4359	+ this.currentContainer = this.containers[innermostIndex];
4360	+
4361	+ //Update the placeholder
4362	+ this.options.placeholder.update(this.currentContainer, this.placeholder);
4363	+
4364	this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
4365	this.containers[innermostIndex].containerCache.over = 1;
4366	+ }
4367	+
4368	+

























4369	},
4370
4371	_createHelper: function(event) {
4372
4373	+ var o = this.options,
4374	+ helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem);
4375
4376	+ //Add the helper to the DOM if that didn't happen already
4377	+ if(!helper.parents("body").length) {
4378	+ $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
4379	+ }
4380
4381	+ if(helper[0] === this.currentItem[0]) {
4382	this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
4383	+ }
4384
4385	+ if(!helper[0].style.width \|\| o.forceHelperSize) {
4386	+ helper.width(this.currentItem.width());
4387	+ }
4388	+ if(!helper[0].style.height \|\| o.forceHelperSize) {
4389	+ helper.height(this.currentItem.height());
4390	+ }
4391
4392	return helper;
4393
4394	},
4395
4396	_adjustOffsetFromHelper: function(obj) {
4397	+ if (typeof obj === "string") {
4398	+ obj = obj.split(" ");
4399	}
4400	if ($.isArray(obj)) {
4401	obj = {left: +obj[0], top: +obj[1] \|\| 0};
4402	}
4403	+ if ("left" in obj) {
4404	this.offset.click.left = obj.left + this.margins.left;
4405	}
4406	+ if ("right" in obj) {
4407	this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
4408	}
4409	+ if ("top" in obj) {
4410	this.offset.click.top = obj.top + this.margins.top;
4411	}
4412	+ if ("bottom" in obj) {
4413	this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
4414	}
4415	},

4425	// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
4426	// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
4427	// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
4428	+ if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
4429	po.left += this.scrollParent.scrollLeft();
4430	po.top += this.scrollParent.scrollTop();
4431	}
4432
4433	+ // This needs to be actually done for all browsers, since pageX/pageY includes this information
4434	+ // with an ugly IE fix
4435	+ if( this.offsetParent[0] === document.body \|\| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
4436	po = { top: 0, left: 0 };
4437	+ }
4438
4439	return {
4440	top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) \|\| 0),

4445
4446	_getRelativeOffset: function() {
4447
4448	+ if(this.cssPosition === "relative") {
4449	var p = this.currentItem.position();
4450	return {
4451	top: p.top - (parseInt(this.helper.css("top"),10) \|\| 0) + this.scrollParent.scrollTop(),

4473
4474	_setContainment: function() {
4475
4476	+ var ce, co, over,
4477	+ o = this.options;
4478	+ if(o.containment === "parent") {
4479	+ o.containment = this.helper[0].parentNode;
4480	+ }
4481	+ if(o.containment === "document" \|\| o.containment === "window") {
4482	+ this.containment = [
4483	+ 0 - this.offset.relative.left - this.offset.parent.left,
4484	+ 0 - this.offset.relative.top - this.offset.parent.top,
4485	+ $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left,
4486	+ ($(o.containment === "document" ? document : window).height() \|\| document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
4487	+ ];
4488	+ }
4489
4490	if(!(/^(document\|window\|parent)$/).test(o.containment)) {
4491	+ ce = $(o.containment)[0];
4492	+ co = $(o.containment).offset();
4493	+ over = ($(ce).css("overflow") !== "hidden");
4494
4495	this.containment = [
4496	co.left + (parseInt($(ce).css("borderLeftWidth"),10) \|\| 0) + (parseInt($(ce).css("paddingLeft"),10) \|\| 0) - this.margins.left,

4504
4505	_convertPositionTo: function(d, pos) {
4506
4507	+ if(!pos) {
4508	+ pos = this.position;
4509	+ }
4510	+ var mod = d === "absolute" ? 1 : -1,
4511	+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
4512	+ scrollIsRootNode = (/(html\|body)/i).test(scroll[0].tagName);
4513
4514	return {
4515	top: (
4516	+ pos.top + // The absolute mouse position
4517	+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
4518	+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
4519	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
4520	),
4521	left: (
4522	+ pos.left + // The absolute mouse position
4523	+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
4524	+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
4525	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
4526	)
4527	};
4528

4530
4531	_generatePosition: function(event) {
4532
4533	+ var top, left,
4534	+ o = this.options,
4535	+ pageX = event.pageX,
4536	+ pageY = event.pageY,
4537	+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html\|body)/i).test(scroll[0].tagName);
4538
4539	// This is another very weird special case that only happens for relative elements:
4540	// 1. If the css position is relative
4541	// 2. and the scroll parent is the document or similar to the offset parent
4542	// we have to refresh the relative offset during the scroll so there are no jumps
4543	+ if(this.cssPosition === "relative" && !(this.scrollParent[0] !== document && this.scrollParent[0] !== this.offsetParent[0])) {
4544	this.offset.relative = this._getRelativeOffset();
4545	}
4546



4547	/*
4548	* - Position constraining -
4549	* Constrain the position to a mix of grid, containment.

4552	if(this.originalPosition) { //If we are not dragging yet, we won't check for options
4553
4554	if(this.containment) {
4555	+ if(event.pageX - this.offset.click.left < this.containment[0]) {
4556	+ pageX = this.containment[0] + this.offset.click.left;
4557	+ }
4558	+ if(event.pageY - this.offset.click.top < this.containment[1]) {
4559	+ pageY = this.containment[1] + this.offset.click.top;
4560	+ }
4561	+ if(event.pageX - this.offset.click.left > this.containment[2]) {
4562	+ pageX = this.containment[2] + this.offset.click.left;
4563	+ }
4564	+ if(event.pageY - this.offset.click.top > this.containment[3]) {
4565	+ pageY = this.containment[3] + this.offset.click.top;
4566	+ }
4567	}
4568
4569	if(o.grid) {
4570	+ top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
4571	+ pageY = this.containment ? ( (top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
4572
4573	+ left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
4574	+ pageX = this.containment ? ( (left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
4575	}
4576
4577	}
4578
4579	return {
4580	top: (
4581	+ pageY - // The absolute mouse position
4582	+ this.offset.click.top - // Click offset (relative to the element)
4583	+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
4584	+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
4585	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
4586	),
4587	left: (
4588	+ pageX - // The absolute mouse position
4589	+ this.offset.click.left - // Click offset (relative to the element)
4590	+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
4591	+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
4592	+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
4593	)
4594	};
4595

4597
4598	_rearrange: function(event, i, a, hardRefresh) {
4599
4600	+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling));
4601
4602	//Various things done here to improve the performance:
4603	// 1. we create a setTimeout, that calls refreshPositions

4605	// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
4606	// 4. this lets only the last addition to the timeout stack through
4607	this.counter = this.counter ? ++this.counter : 1;
4608	+ var counter = this.counter;
4609
4610	+ this._delay(function() {
4611	+ if(counter === this.counter) {
4612	+ this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
4613	+ }
4614	+ });
4615
4616	},
4617

4620	this.reverting = false;
4621	// We delay all events that have to be triggered to after the point where the placeholder has been removed and
4622	// everything else normalized again
4623	+ var i,
4624	+ delayedTriggers = [];
4625
4626	// We first have to update the dom position of the actual currentItem
4627	// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
4628	+ if(!this._noFinalSort && this.currentItem.parent().length) {
4629	+ this.placeholder.before(this.currentItem);
4630	+ }
4631	this._noFinalSort = null;
4632
4633	+ if(this.helper[0] === this.currentItem[0]) {
4634	+ for(i in this._storedCSS) {
4635	+ if(this._storedCSS[i] === "auto" \|\| this._storedCSS[i] === "static") {
4636	+ this._storedCSS[i] = "";
4637	+ }
4638	}
4639	this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
4640	} else {
4641	this.currentItem.show();
4642	}
4643
4644	+ if(this.fromOutside && !noPropagation) {
4645	+ delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
4646	+ }
4647	+ if((this.fromOutside \|\| this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] \|\| this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) {
4648	+ delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
4649	+ }
4650	+
4651	+ // Check if the items Container has Changed and trigger appropriate
4652	+ // events.
4653	+ if (this !== this.currentContainer) {
4654	+ if(!noPropagation) {
4655	+ delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
4656	+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
4657	+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
4658	+ }
4659	+ }
4660	+
4661
4662	//Post events to containers
4663	+ for (i = this.containers.length - 1; i >= 0; i--){
4664	+ if(!noPropagation) {
4665	+ delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
4666	+ }
4667	if(this.containers[i].containerCache.over) {
4668	delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
4669	this.containers[i].containerCache.over = 0;

4671	}
4672
4673	//Do what was originally in plugins
4674	+ if ( this.storedCursor ) {
4675	+ this.document.find( "body" ).css( "cursor", this.storedCursor );
4676	+ this.storedStylesheet.remove();
4677	+ }
4678	+ if(this._storedOpacity) {
4679	+ this.helper.css("opacity", this._storedOpacity);
4680	+ }
4681	+ if(this._storedZIndex) {
4682	+ this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex);
4683	+ }
4684
4685	this.dragging = false;
4686	if(this.cancelHelperRemoval) {
4687	if(!noPropagation) {
4688	this._trigger("beforeStop", event, this._uiHash());
4689	+ for (i=0; i < delayedTriggers.length; i++) {
4690	+ delayedTriggers[i].call(this, event);
4691	+ } //Trigger all delayed events
4692	this._trigger("stop", event, this._uiHash());
4693	}
4694	+
4695	+ this.fromOutside = false;
4696	return false;
4697	}
4698
4699	+ if(!noPropagation) {
4700	+ this._trigger("beforeStop", event, this._uiHash());
4701	+ }
4702
4703	//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
4704	this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
4705
4706	+ if(this.helper[0] !== this.currentItem[0]) {
4707	+ this.helper.remove();
4708	+ }
4709	+ this.helper = null;
4710
4711	if(!noPropagation) {
4712	+ for (i=0; i < delayedTriggers.length; i++) {
4713	+ delayedTriggers[i].call(this, event);
4714	+ } //Trigger all delayed events
4715	this._trigger("stop", event, this._uiHash());
4716	}
4717

4726	}
4727	},
4728
4729	+ _uiHash: function(_inst) {
4730	+ var inst = _inst \|\| this;
4731	return {
4732	+ helper: inst.helper,
4733	+ placeholder: inst.placeholder \|\| $([]),
4734	+ position: inst.position,
4735	+ originalPosition: inst.originalPosition,
4736	+ offset: inst.positionAbs,
4737	+ item: inst.currentItem,
4738	+ sender: _inst ? _inst.element : null
4739	};
4740	}
4741
4742	});
4743




4744	})(jQuery);
4745	+
4746	+ (function($, undefined) {
4747	+
4748	+ var dataSpace = "ui-effects-";
4749	+
4750	+ $.effects = {
4751	+ effect: {}
4752	+ };
4753	+
4754	+ /*!
4755	+ * jQuery Color Animations v2.1.2
4756	+ * https://github.com/jquery/jquery-color
4757	*
4758	+ * Copyright 2013 jQuery Foundation and other contributors
4759	+ * Released under the MIT license.
4760	* http://jquery.org/license
4761	*
4762	+ * Date: Wed Jan 16 08:47:09 2013 -0600




4763	*/
4764	+ (function( jQuery, undefined ) {
4765	+
4766	+ var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
4767	+
4768	+ // plusequals test for += 100 -= 100
4769	+ rplusequals = /^([\-+])=\s(\d+\.?\d)/,
4770	+ // a set of RE's that can match strings and generate color tuples.
4771	+ stringParsers = [{
4772	+ re: /rgba?$\s(\d{1,3})\s,\s(\d{1,3})\s,\s(\d{1,3})\s(?:,\s(\d?(?:\.\d+)?)\s)?$/,
4773	+ parse: function( execResult ) {
4774	+ return [
4775	+ execResult[ 1 ],
4776	+ execResult[ 2 ],
4777	+ execResult[ 3 ],
4778	+ execResult[ 4 ]
4779	+ ];
4780	+ }
4781	+ }, {
4782	+ re: /rgba?$\s(\d+(?:\.\d+)?)\%\s,\s(\d+(?:\.\d+)?)\%\s,\s(\d+(?:\.\d+)?)\%\s(?:,\s(\d?(?:\.\d+)?)\s)?$/,
4783	+ parse: function( execResult ) {
4784	+ return [
4785	+ execResult[ 1 ] * 2.55,
4786	+ execResult[ 2 ] * 2.55,
4787	+ execResult[ 3 ] * 2.55,
4788	+ execResult[ 4 ]
4789	+ ];
4790	+ }
4791	+ }, {
4792	+ // this regex ignores A-F because it's compared against an already lowercased string
4793	+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
4794	+ parse: function( execResult ) {
4795	+ return [
4796	+ parseInt( execResult[ 1 ], 16 ),
4797	+ parseInt( execResult[ 2 ], 16 ),
4798	+ parseInt( execResult[ 3 ], 16 )
4799	+ ];
4800	+ }
4801	+ }, {
4802	+ // this regex ignores A-F because it's compared against an already lowercased string
4803	+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
4804	+ parse: function( execResult ) {
4805	+ return [
4806	+ parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
4807	+ parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
4808	+ parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
4809	+ ];
4810	+ }
4811	+ }, {
4812	+ re: /hsla?$\s(\d+(?:\.\d+)?)\s,\s(\d+(?:\.\d+)?)\%\s,\s(\d+(?:\.\d+)?)\%\s(?:,\s(\d?(?:\.\d+)?)\s)?$/,
4813	+ space: "hsla",
4814	+ parse: function( execResult ) {
4815	+ return [
4816	+ execResult[ 1 ],
4817	+ execResult[ 2 ] / 100,
4818	+ execResult[ 3 ] / 100,
4819	+ execResult[ 4 ]
4820	+ ];
4821	+ }
4822	+ }],
4823	+
4824	+ // jQuery.Color( )
4825	+ color = jQuery.Color = function( color, green, blue, alpha ) {
4826	+ return new jQuery.Color.fn.parse( color, green, blue, alpha );
4827	+ },
4828	+ spaces = {
4829	+ rgba: {
4830	+ props: {
4831	+ red: {
4832	+ idx: 0,
4833	+ type: "byte"
4834	+ },
4835	+ green: {
4836	+ idx: 1,
4837	+ type: "byte"
4838	+ },
4839	+ blue: {
4840	+ idx: 2,
4841	+ type: "byte"
4842	+ }
4843	+ }
4844	+ },
4845
4846	+ hsla: {
4847	+ props: {
4848	+ hue: {
4849	+ idx: 0,
4850	+ type: "degrees"
4851	+ },
4852	+ saturation: {
4853	+ idx: 1,
4854	+ type: "percent"
4855	+ },
4856	+ lightness: {
4857	+ idx: 2,
4858	+ type: "percent"
4859	+ }
4860	+ }
4861	+ }
4862	+ },
4863	+ propTypes = {
4864	+ "byte": {
4865	+ floor: true,
4866	+ max: 255
4867	},
4868	+ "percent": {
4869	+ max: 1
4870	+ },
4871	+ "degrees": {
4872	+ mod: 360,
4873	+ floor: true
4874	}
4875	},
4876	+ support = color.support = {},
4877
4878	+ // element for support tests
4879	+ supportElem = jQuery( "<p>" )[ 0 ],

4880
4881	+ // colors = jQuery.Color.names
4882	+ colors,
4883
4884	+ // local aliases of functions called often
4885	+ each = jQuery.each;




4886
4887	+ // determine rgba support immediately
4888	+ supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
4889	+ support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
4890	+
4891	+ // define cache name and alpha properties
4892	+ // for rgba and hsla spaces
4893	+ each( spaces, function( spaceName, space ) {
4894	+ space.cache = "_" + spaceName;
4895	+ space.props.alpha = {
4896	+ idx: 3,
4897	+ type: "percent",
4898	+ def: 1
4899	+ };
4900	+ });












4901
4902	+ function clamp( value, prop, allowEmpty ) {
4903	+ var type = propTypes[ prop.type ] \|\| {};
4904
4905	+ if ( value == null ) {
4906	+ return (allowEmpty \|\| !prop.def) ? null : prop.def;
4907	+ }
4908	+
4909	+ // ~~ is an short way of doing floor for positive numbers
4910	+ value = type.floor ? ~~value : parseFloat( value );
4911	+
4912	+ // IE will pass in empty strings as value for alpha,
4913	+ // which will hit this case
4914	+ if ( isNaN( value ) ) {
4915	+ return prop.def;
4916	+ }
4917	+
4918	+ if ( type.mod ) {
4919	+ // we add mod before modding to make sure that negatives values
4920	+ // get converted properly: -10 -> 350
4921	+ return (value + type.mod) % type.mod;
4922	+ }
4923	+
4924	+ // for now all property types without mod have min and max
4925	+ return 0 > value ? 0 : type.max < value ? type.max : value;
4926	+ }
4927	+
4928	+ function stringParse( string ) {
4929	+ var inst = color(),
4930	+ rgba = inst._rgba = [];
4931	+
4932	+ string = string.toLowerCase();
4933	+
4934	+ each( stringParsers, function( i, parser ) {
4935	+ var parsed,
4936	+ match = parser.re.exec( string ),
4937	+ values = match && parser.parse( match ),
4938	+ spaceName = parser.space \|\| "rgba";
4939	+
4940	+ if ( values ) {
4941	+ parsed = inst[ spaceName ]( values );
4942	+
4943	+ // if this was an rgba parse the assignment might happen twice
4944	+ // oh well....
4945	+ inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
4946	+ rgba = inst._rgba = parsed._rgba;
4947	+
4948	+ // exit each( stringParsers ) here because we matched
4949	+ return false;
4950	}
4951	+ });
4952
4953	+ // Found a stringParser that handled it
4954	+ if ( rgba.length ) {



4955
4956	+ // if this came from a parsed string, force "transparent" when alpha is 0
4957	+ // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
4958	+ if ( rgba.join() === "0,0,0,0" ) {
4959	+ jQuery.extend( rgba, colors.transparent );
4960	+ }
4961	+ return inst;
4962	+ }
4963
4964	+ // named colors
4965	+ return colors[ string ];
4966	+ }




4967
4968	+ color.fn = jQuery.extend( color.prototype, {
4969	+ parse: function( red, green, blue, alpha ) {
4970	+ if ( red === undefined ) {
4971	+ this._rgba = [ null, null, null, null ];
4972	+ return this;
4973	+ }
4974	+ if ( red.jquery \|\| red.nodeType ) {
4975	+ red = jQuery( red ).css( green );
4976	+ green = undefined;
4977	+ }
4978
4979	+ var inst = this,
4980	+ type = jQuery.type( red ),
4981	+ rgba = this._rgba = [];
4982	+
4983	+ // more than 1 argument specified - assume ( red, green, blue, alpha )
4984	+ if ( green !== undefined ) {
4985	+ red = [ red, green, blue, alpha ];
4986	+ type = "array";


4987	}
4988
4989	+ if ( type === "string" ) {
4990	+ return this.parse( stringParse( red ) \|\| colors._default );

4991	}
4992
4993	+ if ( type === "array" ) {
4994	+ each( spaces.rgba.props, function( key, prop ) {
4995	+ rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );

4996	});
4997	+ return this;
4998	}

4999
5000	+ if ( type === "object" ) {
5001	+ if ( red instanceof color ) {
5002	+ each( spaces, function( spaceName, space ) {
5003	+ if ( red[ space.cache ] ) {
5004	+ inst[ space.cache ] = red[ space.cache ].slice();
5005	+ }
5006	+ });
5007	+ } else {
5008	+ each( spaces, function( spaceName, space ) {
5009	+ var cache = space.cache;
5010	+ each( space.props, function( key, prop ) {
5011	+
5012	+ // if the cache doesn't exist, and we know how to convert
5013	+ if ( !inst[ cache ] && space.to ) {
5014	+
5015	+ // if the value was null, we don't need to copy it
5016	+ // if the key was alpha, we don't need to copy it either
5017	+ if ( key === "alpha" \|\| red[ key ] == null ) {
5018	+ return;
5019	+ }
5020	+ inst[ cache ] = space.to( inst._rgba );
5021	+ }
5022	+
5023	+ // this is the only case where we allow nulls for ALL properties.
5024	+ // call clamp with alwaysAllowEmpty
5025	+ inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
5026	+ });
5027	+
5028	+ // everything defined but alpha?
5029	+ if ( inst[ cache ] && jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
5030	+ // use the default of 1
5031	+ inst[ cache ][ 3 ] = 1;
5032	+ if ( space.from ) {
5033	+ inst._rgba = space.from( inst[ cache ] );
5034	+ }
5035	+ }
5036	+ });
5037	+ }
5038	+ return this;
5039	}
5040	},
5041	+ is: function( compare ) {
5042	+ var is = color( compare ),
5043	+ same = true,
5044	+ inst = this;
5045
5046	+ each( spaces, function( _, space ) {
5047	+ var localCache,
5048	+ isCache = is[ space.cache ];
5049	+ if (isCache) {
5050	+ localCache = inst[ space.cache ] \|\| space.to && space.to( inst._rgba ) \|\| [];
5051	+ each( space.props, function( _, prop ) {
5052	+ if ( isCache[ prop.idx ] != null ) {
5053	+ same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
5054	+ return same;
5055	+ }
5056	+ });
5057	+ }
5058	+ return same;
5059	+ });
5060	+ return same;
5061	},
5062	+ _space: function() {
5063	+ var used = [],
5064	+ inst = this;
5065	+ each( spaces, function( spaceName, space ) {
5066	+ if ( inst[ space.cache ] ) {
5067	+ used.push( spaceName );
5068	+ }
5069	+ });
5070	+ return used.pop();
5071	+ },
5072	+ transition: function( other, distance ) {
5073	+ var end = color( other ),
5074	+ spaceName = end._space(),
5075	+ space = spaces[ spaceName ],
5076	+ startColor = this.alpha() === 0 ? color( "transparent" ) : this,
5077	+ start = startColor[ space.cache ] \|\| space.to( startColor._rgba ),
5078	+ result = start.slice();
5079	+
5080	+ end = end[ space.cache ];
5081	+ each( space.props, function( key, prop ) {
5082	+ var index = prop.idx,
5083	+ startValue = start[ index ],
5084	+ endValue = end[ index ],
5085	+ type = propTypes[ prop.type ] \|\| {};
5086	+
5087	+ // if null, don't override start value
5088	+ if ( endValue === null ) {
5089	+ return;
5090	+ }
5091	+ // if null - use end
5092	+ if ( startValue === null ) {
5093	+ result[ index ] = endValue;
5094	+ } else {
5095	+ if ( type.mod ) {
5096	+ if ( endValue - startValue > type.mod / 2 ) {
5097	+ startValue += type.mod;
5098	+ } else if ( startValue - endValue > type.mod / 2 ) {
5099	+ startValue -= type.mod;
5100	+ }
5101	+ }
5102	+ result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
5103	+ }
5104	+ });
5105	+ return this[ spaceName ]( result );
5106	+ },
5107	+ blend: function( opaque ) {
5108	+ // if we are already opaque - return ourself
5109	+ if ( this._rgba[ 3 ] === 1 ) {
5110	+ return this;
5111	+ }
5112
5113	+ var rgb = this._rgba.slice(),
5114	+ a = rgb.pop(),
5115	+ blend = color( opaque )._rgba;



5116
5117	+ return color( jQuery.map( rgb, function( v, i ) {
5118	+ return ( 1 - a ) * blend[ i ] + a * v;
5119	+ }));
5120	+ },
5121	+ toRgbaString: function() {
5122	+ var prefix = "rgba(",
5123	+ rgba = jQuery.map( this._rgba, function( v, i ) {
5124	+ return v == null ? ( i > 2 ? 1 : 0 ) : v;
5125	+ });
5126
5127	+ if ( rgba[ 3 ] === 1 ) {
5128	+ rgba.pop();
5129	+ prefix = "rgb(";





5130	}
5131
5132	+ return prefix + rgba.join() + ")";
5133	},
5134	+ toHslaString: function() {
5135	+ var prefix = "hsla(",
5136	+ hsla = jQuery.map( this.hsla(), function( v, i ) {
5137	+ if ( v == null ) {
5138	+ v = i > 2 ? 1 : 0;
5139	+ }
5140
5141	+ // catch 1 and 2
5142	+ if ( i && i < 3 ) {
5143	+ v = Math.round( v * 100 ) + "%";
5144	+ }
5145	+ return v;
5146	+ });
5147	+
5148	+ if ( hsla[ 3 ] === 1 ) {
5149	+ hsla.pop();
5150	+ prefix = "hsl(";








5151	}
5152	+ return prefix + hsla.join() + ")";
5153	},
5154	+ toHexString: function( includeAlpha ) {
5155	+ var rgba = this._rgba.slice(),
5156	+ alpha = rgba.pop();
5157
5158	+ if ( includeAlpha ) {
5159	+ rgba.push( ~~( alpha * 255 ) );

5160	}
5161
5162	+ return "#" + jQuery.map( rgba, function( v ) {



5163
5164	+ // default to 0 when nulls exist
5165	+ v = ( v \|\| 0 ).toString( 16 );
5166	+ return v.length === 1 ? "0" + v : v;
5167	+ }).join("");



















5168	},
5169	+ toString: function() {
5170	+ return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
5171	+ }
5172	+ });
5173	+ color.fn.parse.prototype = color.fn;
5174
5175	+ // hsla conversions adapted from:
5176	+ // https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021

5177
5178	+ function hue2rgb( p, q, h ) {
5179	+ h = ( h + 1 ) % 1;
5180	+ if ( h * 6 < 1 ) {
5181	+ return p + (q - p) * h * 6;
5182	+ }
5183	+ if ( h * 2 < 1) {
5184	+ return q;
5185	+ }
5186	+ if ( h * 3 < 2 ) {
5187	+ return p + (q - p) * ((2/3) - h) * 6;
5188	+ }
5189	+ return p;
5190	+ }
5191
5192	+ spaces.hsla.to = function ( rgba ) {
5193	+ if ( rgba[ 0 ] == null \|\| rgba[ 1 ] == null \|\| rgba[ 2 ] == null ) {
5194	+ return [ null, null, null, rgba[ 3 ] ];
5195	+ }
5196	+ var r = rgba[ 0 ] / 255,
5197	+ g = rgba[ 1 ] / 255,
5198	+ b = rgba[ 2 ] / 255,
5199	+ a = rgba[ 3 ],
5200	+ max = Math.max( r, g, b ),
5201	+ min = Math.min( r, g, b ),
5202	+ diff = max - min,
5203	+ add = max + min,
5204	+ l = add * 0.5,
5205	+ h, s;
5206	+
5207	+ if ( min === max ) {
5208	+ h = 0;
5209	+ } else if ( r === max ) {
5210	+ h = ( 60 * ( g - b ) / diff ) + 360;
5211	+ } else if ( g === max ) {
5212	+ h = ( 60 * ( b - r ) / diff ) + 120;
5213	+ } else {
5214	+ h = ( 60 * ( r - g ) / diff ) + 240;
5215	+ }
5216
5217	+ // chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
5218	+ // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
5219	+ if ( diff === 0 ) {
5220	+ s = 0;
5221	+ } else if ( l <= 0.5 ) {
5222	+ s = diff / add;
5223	+ } else {
5224	+ s = diff / ( 2 - add );
5225	+ }
5226	+ return [ Math.round(h) % 360, s, l, a == null ? 1 : a ];
5227	+ };



5228
5229	+ spaces.hsla.from = function ( hsla ) {
5230	+ if ( hsla[ 0 ] == null \|\| hsla[ 1 ] == null \|\| hsla[ 2 ] == null ) {
5231	+ return [ null, null, null, hsla[ 3 ] ];
5232	+ }
5233	+ var h = hsla[ 0 ] / 360,
5234	+ s = hsla[ 1 ],
5235	+ l = hsla[ 2 ],
5236	+ a = hsla[ 3 ],
5237	+ q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
5238	+ p = 2 * l - q;
5239	+
5240	+ return [
5241	+ Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
5242	+ Math.round( hue2rgb( p, q, h ) * 255 ),
5243	+ Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
5244	+ a
5245	+ ];
5246	+ };
5247






5248
5249	+ each( spaces, function( spaceName, space ) {
5250	+ var props = space.props,
5251	+ cache = space.cache,
5252	+ to = space.to,
5253	+ from = space.from;
5254
5255	+ // makes rgba() and hsla()
5256	+ color.fn[ spaceName ] = function( value ) {







5257
5258	+ // generate a cache for this space if it doesn't exist
5259	+ if ( to && !this[ cache ] ) {
5260	+ this[ cache ] = to( this._rgba );


5261	}
5262	+ if ( value === undefined ) {
5263	+ return this[ cache ].slice();






















5264	}
5265
5266	+ var ret,
5267	+ type = jQuery.type( value ),
5268	+ arr = ( type === "array" \|\| type === "object" ) ? value : arguments,
5269	+ local = this[ cache ].slice();
5270	+
5271	+ each( props, function( key, prop ) {
5272	+ var val = arr[ type === "object" ? key : prop.idx ];
5273	+ if ( val == null ) {
5274	+ val = local[ prop.idx ];
5275	+ }
5276	+ local[ prop.idx ] = clamp( val, prop );
5277	+ });
5278
5279	+ if ( from ) {
5280	+ ret = color( from( local ) );
5281	+ ret[ cache ] = local;
5282	+ return ret;
5283	+ } else {
5284	+ return color( local );
5285	+ }
5286	+ };
5287
5288	+ // makes red() green() blue() alpha() hue() saturation() lightness()
5289	+ each( props, function( key, prop ) {
5290	+ // alpha is included in more than one space
5291	+ if ( color.fn[ key ] ) {
5292	return;
5293	}
5294	+ color.fn[ key ] = function( value ) {
5295	+ var vtype = jQuery.type( value ),
5296	+ fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
5297	+ local = this[ fn ](),
5298	+ cur = local[ prop.idx ],
5299	+ match;
5300
5301	+ if ( vtype === "undefined" ) {
5302	+ return cur;
5303	+ }

































5304
5305	+ if ( vtype === "function" ) {
5306	+ value = value.call( this, cur );
5307	+ vtype = jQuery.type( value );
5308	+ }
5309	+ if ( value == null && prop.empty ) {
5310	+ return this;
5311	+ }
5312	+ if ( vtype === "string" ) {
5313	+ match = rplusequals.exec( value );
5314	+ if ( match ) {
5315	+ value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
5316	+ }
5317	+ }
5318	+ local[ prop.idx ] = value;
5319	+ return this[ fn ]( local );
5320	+ };
5321	+ });
5322	+ });
5323
5324	+ // add cssHook and .fx.step function for each named hook.
5325	+ // accept a space separated string of properties
5326	+ color.hook = function( hook ) {
5327	+ var hooks = hook.split( " " );
5328	+ each( hooks, function( i, hook ) {
5329	+ jQuery.cssHooks[ hook ] = {
5330	+ set: function( elem, value ) {
5331	+ var parsed, curElem,
5332	+ backgroundColor = "";
5333	+
5334	+ if ( value !== "transparent" && ( jQuery.type( value ) !== "string" \|\| ( parsed = stringParse( value ) ) ) ) {
5335	+ value = color( parsed \|\| value );
5336	+ if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
5337	+ curElem = hook === "backgroundColor" ? elem.parentNode : elem;
5338	+ while (
5339	+ (backgroundColor === "" \|\| backgroundColor === "transparent") &&
5340	+ curElem && curElem.style
5341	+ ) {
5342	+ try {
5343	+ backgroundColor = jQuery.css( curElem, "backgroundColor" );
5344	+ curElem = curElem.parentNode;
5345	+ } catch ( e ) {
5346	+ }
5347	+ }
5348
5349	+ value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
5350	+ backgroundColor :
5351	+ "_default" );
5352	+ }
5353
5354	+ value = value.toRgbaString();
5355	+ }
5356	+ try {
5357	+ elem.style[ hook ] = value;
5358	+ } catch( e ) {
5359	+ // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit'
5360	+ }
5361	}

5362	};
5363	+ jQuery.fx.step[ hook ] = function( fx ) {
5364	+ if ( !fx.colorInit ) {
5365	+ fx.start = color( fx.elem, hook );
5366	+ fx.end = color( fx.end );
5367	+ fx.colorInit = true;
5368	+ }
5369	+ jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
5370	+ };
5371	+ });
5372
5373	+ };

5374
5375	+ color.hook( stepHooks );

5376
5377	+ jQuery.cssHooks.borderColor = {
5378	+ expand: function( value ) {
5379	+ var expanded = {};
5380
5381	+ each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
5382	+ expanded[ "border" + part + "Color" ] = value;
5383	+ });
5384	+ return expanded;
5385	+ }
5386	+ };











5387
5388	+ // Basic color names only.
5389	+ // Usage of any of the other color names requires adding yourself or including
5390	+ // jquery.color.svg-names.js.
5391	+ colors = jQuery.Color.names = {
5392	+ // 4.1. Basic color keywords
5393	+ aqua: "#00ffff",
5394	+ black: "#000000",
5395	+ blue: "#0000ff",
5396	+ fuchsia: "#ff00ff",
5397	+ gray: "#808080",
5398	+ green: "#008000",
5399	+ lime: "#00ff00",
5400	+ maroon: "#800000",
5401	+ navy: "#000080",
5402	+ olive: "#808000",
5403	+ purple: "#800080",
5404	+ red: "#ff0000",
5405	+ silver: "#c0c0c0",
5406	+ teal: "#008080",
5407	+ white: "#ffffff",
5408	+ yellow: "#ffff00",
5409	+
5410	+ // 4.2.3. "transparent" color keyword
5411	+ transparent: [ null, null, null, 0 ],
5412	+
5413	+ _default: "#ffffff"
5414	+ };
5415
5416	+ })( jQuery );
5417	+
5418	+
5419	+ /******************************************************************************/
5420	+ /**************************** CLASS ANIMATIONS ****************************/
5421	+ /******************************************************************************/
5422	+ (function() {
5423
5424	+ var classAnimationActions = [ "add", "remove", "toggle" ],
5425	+ shorthandStyles = {
5426	+ border: 1,
5427	+ borderBottom: 1,
5428	+ borderColor: 1,
5429	+ borderLeft: 1,
5430	+ borderRight: 1,
5431	+ borderTop: 1,
5432	+ borderWidth: 1,
5433	+ margin: 1,
5434	+ padding: 1
5435	+ };
5436
5437	+ $.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) {
5438	+ $.fx.step[ prop ] = function( fx ) {
5439	+ if ( fx.end !== "none" && !fx.setAttr \|\| fx.pos === 1 && !fx.setAttr ) {
5440	+ jQuery.style( fx.elem, prop, fx.end );
5441	+ fx.setAttr = true;
5442	+ }
5443	+ };
5444	+ });
5445
5446	+ function getElementStyles( elem ) {
5447	+ var key, len,
5448	+ style = elem.ownerDocument.defaultView ?
5449	+ elem.ownerDocument.defaultView.getComputedStyle( elem, null ) :
5450	+ elem.currentStyle,
5451	+ styles = {};
5452
5453	+ if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
5454	+ len = style.length;
5455	+ while ( len-- ) {
5456	+ key = style[ len ];
5457	+ if ( typeof style[ key ] === "string" ) {
5458	+ styles[ $.camelCase( key ) ] = style[ key ];
5459	}
5460	+ }
5461	+ // support: Opera, IE <9
5462	+ } else {
5463	+ for ( key in style ) {
5464	+ if ( typeof style[ key ] === "string" ) {
5465	+ styles[ key ] = style[ key ];

5466	}
5467	+ }
5468	+ }
5469
5470	+ return styles;
5471	+ }






5472


5473
5474	+ function styleDifference( oldStyle, newStyle ) {
5475	+ var diff = {},
5476	+ name, value;













5477
5478	+ for ( name in newStyle ) {
5479	+ value = newStyle[ name ];
5480	+ if ( oldStyle[ name ] !== value ) {
5481	+ if ( !shorthandStyles[ name ] ) {
5482	+ if ( $.fx.step[ name ] \|\| !isNaN( parseFloat( value ) ) ) {
5483	+ diff[ name ] = value;
5484	+ }
5485	+ }
5486	}
5487	+ }
5488
5489	+ return diff;
5490	+ }




5491
5492	+ // support: jQuery <1.8
5493	+ if ( !$.fn.addBack ) {
5494	+ $.fn.addBack = function( selector ) {
5495	+ return this.add( selector == null ?
5496	+ this.prevObject : this.prevObject.filter( selector )
5497	+ );
5498	+ };
5499	+ }
5500
5501	+ $.effects.animateClass = function( value, duration, easing, callback ) {
5502	+ var o = $.speed( duration, easing, callback );

5503
5504	+ return this.queue( function() {
5505	+ var animated = $( this ),
5506	+ baseClass = animated.attr( "class" ) \|\| "",
5507	+ applyClassChange,
5508	+ allAnimations = o.children ? animated.find( "*" ).addBack() : animated;


























































5509
5510	+ // map the animated objects to store the original styles.
5511	+ allAnimations = allAnimations.map(function() {
5512	+ var el = $( this );
5513	+ return {
5514	+ el: el,
5515	+ start: getElementStyles( this )
5516	+ };
5517	+ });
5518	+
5519	+ // apply class change
5520	+ applyClassChange = function() {
5521	+ $.each( classAnimationActions, function(i, action) {
5522	+ if ( value[ action ] ) {
5523	+ animated[ action + "Class" ]( value[ action ] );

5524	}
5525	});
5526	+ };
5527	+ applyClassChange();
5528	+
5529	+ // map all animated objects again - calculate new styles and diff
5530	+ allAnimations = allAnimations.map(function() {
5531	+ this.end = getElementStyles( this.el[ 0 ] );
5532	+ this.diff = styleDifference( this.start, this.end );
5533	+ return this;
5534	+ });
5535	+
5536	+ // apply original class
5537	+ animated.attr( "class", baseClass );
5538	+
5539	+ // map all animated objects again - this time collecting a promise
5540	+ allAnimations = allAnimations.map(function() {
5541	+ var styleInfo = this,
5542	+ dfd = $.Deferred(),
5543	+ opts = $.extend({}, o, {
5544	+ queue: false,
5545	+ complete: function() {
5546	+ dfd.resolve( styleInfo );
5547	+ }
5548	+ });
5549	+
5550	+ this.el.animate( this.diff, opts );
5551	+ return dfd.promise();
5552	+ });
5553	+
5554	+ // once all animations have completed:
5555	+ $.when.apply( $, allAnimations.get() ).done(function() {
5556	+
5557	+ // set the final class
5558	+ applyClassChange();
5559	+
5560	+ // for each animated element,
5561	+ // clear all css properties that were animated
5562	+ $.each( arguments, function() {
5563	+ var el = this.el;
5564	+ $.each( this.diff, function(key) {
5565	+ el.css( key, "" );
5566	+ });
5567	});
5568	+
5569	+ // this is guarnteed to be there if you use jQuery.speed()
5570	+ // it also handles dequeuing the next anim...
5571	+ o.complete.call( animated[ 0 ] );
5572	+ });
5573	+ });
5574	+ };
5575	+
5576	+ $.fn.extend({
5577	+ addClass: (function( orig ) {
5578	+ return function( classNames, speed, easing, callback ) {
5579	+ return speed ?
5580	+ $.effects.animateClass.call( this,
5581	+ { add: classNames }, speed, easing, callback ) :
5582	+ orig.apply( this, arguments );
5583	+ };
5584	+ })( $.fn.addClass ),
5585	+
5586	+ removeClass: (function( orig ) {
5587	+ return function( classNames, speed, easing, callback ) {
5588	+ return arguments.length > 1 ?
5589	+ $.effects.animateClass.call( this,
5590	+ { remove: classNames }, speed, easing, callback ) :
5591	+ orig.apply( this, arguments );
5592	+ };
5593	+ })( $.fn.removeClass ),
5594	+
5595	+ toggleClass: (function( orig ) {
5596	+ return function( classNames, force, speed, easing, callback ) {
5597	+ if ( typeof force === "boolean" \|\| force === undefined ) {
5598	+ if ( !speed ) {
5599	+ // without speed parameter
5600	+ return orig.apply( this, arguments );
5601	+ } else {
5602	+ return $.effects.animateClass.call( this,
5603	+ (force ? { add: classNames } : { remove: classNames }),
5604	+ speed, easing, callback );
5605	+ }
5606	+ } else {
5607	+ // without force parameter
5608	+ return $.effects.animateClass.call( this,
5609	+ { toggle: classNames }, force, speed, easing );
5610	+ }
5611	+ };
5612	+ })( $.fn.toggleClass ),
5613	+
5614	+ switchClass: function( remove, add, speed, easing, callback) {
5615	+ return $.effects.animateClass.call( this, {
5616	+ add: add,
5617	+ remove: remove
5618	+ }, speed, easing, callback );
5619	}
5620	});
5621
5622	+ })();















5623
5624	+ /******************************************************************************/
5625	+ /********************************* EFFECTS ********************************/
5626	+ /******************************************************************************/
5627
5628	+ (function() {












5629
5630	+ $.extend( $.effects, {
5631	+ version: "1.10.2",
5632
5633	+ // Saves a set of properties in a data storage
5634	+ save: function( element, set ) {
5635	+ for( var i=0; i < set.length; i++ ) {
5636	+ if ( set[ i ] !== null ) {
5637	+ element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
5638	+ }
5639	+ }
5640	+ },
5641
5642	+ // Restores a set of previously saved properties from a data storage
5643	+ restore: function( element, set ) {
5644	+ var val, i;
5645	+ for( i=0; i < set.length; i++ ) {
5646	+ if ( set[ i ] !== null ) {
5647	+ val = element.data( dataSpace + set[ i ] );
5648	+ // support: jQuery 1.6.2
5649	+ // http://bugs.jquery.com/ticket/9917
5650	+ // jQuery 1.6.2 incorrectly returns undefined for any falsy value.
5651	+ // We can't differentiate between "" and 0 here, so we just assume
5652	+ // empty string since it's likely to be a more common value...
5653	+ if ( val === undefined ) {
5654	+ val = "";
5655	}
5656	+ element.css( set[ i ], val );
5657	+ }

































































































































































5658	}



















5659	},
5660
5661	+ setMode: function( el, mode ) {
5662	+ if (mode === "toggle") {
5663	+ mode = el.is( ":hidden" ) ? "show" : "hide";







5664	}
5665	+ return mode;
5666	},
5667
5668	+ // Translates a [top,left] array into a baseline value
5669	+ // this should be a little more flexible in the future to handle a string & hash
5670	+ getBaseline: function( origin, original ) {
5671	+ var y, x;
5672	+ switch ( origin[ 0 ] ) {
5673	+ case "top": y = 0; break;
5674	+ case "middle": y = 0.5; break;
5675	+ case "bottom": y = 1; break;
5676	+ default: y = origin[ 0 ] / original.height;
5677	+ }
5678	+ switch ( origin[ 1 ] ) {
5679	+ case "left": x = 0; break;
5680	+ case "center": x = 0.5; break;
5681	+ case "right": x = 1; break;
5682	+ default: x = origin[ 1 ] / original.width;



















5683	}
5684	+ return {
5685	+ x: x,
5686	+ y: y
5687	+ };
5688	},
5689
5690	+ // Wraps the element around a wrapper that copies position properties
5691	+ createWrapper: function( element ) {



5692
5693	+ // if the element is already wrapped, return it
5694	+ if ( element.parent().is( ".ui-effects-wrapper" )) {
5695	+ return element.parent();
5696	}
5697
5698	+ // wrap the element
5699	+ var props = {
5700	+ width: element.outerWidth(true),
5701	+ height: element.outerHeight(true),
5702	+ "float": element.css( "float" )
5703	+ },
5704	+ wrapper = $( "<div></div>" )
5705	+ .addClass( "ui-effects-wrapper" )
5706	+ .css({
5707	+ fontSize: "100%",
5708	+ background: "transparent",
5709	+ border: "none",
5710	+ margin: 0,
5711	+ padding: 0
5712	+ }),
5713	+ // Store the size in case width/height are defined in % - Fixes #5245
5714	+ size = {
5715	+ width: element.width(),
5716	+ height: element.height()
5717	+ },
5718	+ active = document.activeElement;
5719	+
5720	+ // support: Firefox
5721	+ // Firefox incorrectly exposes anonymous content
5722	+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
5723	+ try {
5724	+ active.id;
5725	+ } catch( e ) {
5726	+ active = document.body;
5727	}
5728
5729	+ element.wrap( wrapper );

5730
5731	+ // Fixes #7595 - Elements lose focus when wrapped.
5732	+ if ( element[ 0 ] === active \|\| $.contains( element[ 0 ], active ) ) {
5733	+ $( active ).focus();
5734	+ }
5735
5736	+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element

5737
5738	+ // transfer positioning properties to the wrapper
5739	+ if ( element.css( "position" ) === "static" ) {
5740	+ wrapper.css({ position: "relative" });
5741	+ element.css({ position: "relative" });

5742	} else {
5743	+ $.extend( props, {
5744	+ position: element.css( "position" ),
5745	+ zIndex: element.css( "z-index" )
5746	+ });
5747	+ $.each([ "top", "left", "bottom", "right" ], function(i, pos) {
5748	+ props[ pos ] = element.css( pos );
5749	+ if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
5750	+ props[ pos ] = "auto";
5751	+ }
5752	+ });
5753	+ element.css({
5754	+ position: "relative",
5755	+ top: 0,
5756	+ left: 0,
5757	+ right: "auto",
5758	+ bottom: "auto"
5759	+ });



5760	}
5761	+ element.css(size);
5762
5763	+ return wrapper.css( props ).show();
















5764	},
5765
5766	+ removeWrapper: function( element ) {
5767	+ var active = document.activeElement;






5768
5769	+ if ( element.parent().is( ".ui-effects-wrapper" ) ) {
5770	+ element.parent().replaceWith( element );




5771
5772	+ // Fixes #7595 - Elements lose focus when wrapped.
5773	+ if ( element[ 0 ] === active \|\| $.contains( element[ 0 ], active ) ) {
5774	+ $( active ).focus();
5775	+ }
5776	}

5777
5778	+
5779	+ return element;






5780	},
5781
5782	+ setTransition: function( element, list, factor, value ) {
5783	+ value = value \|\| {};
5784	+ $.each( list, function( i, x ) {
5785	+ var unit = element.cssUnit( x );
5786	+ if ( unit[ 0 ] > 0 ) {
5787	+ value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
5788	+ }
5789	});
5790	+ return value;
5791	+ }
5792	+ });
5793
5794	+ // return an effect options object for the given parameters:
5795	+ function _normalizeArguments( effect, options, speed, callback ) {




5796
5797	+ // allow passing all options as the first parameter
5798	+ if ( $.isPlainObject( effect ) ) {
5799	+ options = effect;
5800	+ effect = effect.effect;
5801	+ }








5802
5803	+ // convert to an object
5804	+ effect = { effect: effect };
5805	+
5806	+ // catch (effect, null, ...)
5807	+ if ( options == null ) {
5808	+ options = {};
5809	}

5810
5811	+ // catch (effect, callback)
5812	+ if ( $.isFunction( options ) ) {
5813	+ callback = options;
5814	+ speed = null;
5815	+ options = {};




5816	}

5817
5818	+ // catch (effect, speed, ?)
5819	+ if ( typeof options === "number" \|\| $.fx.speeds[ options ] ) {
5820	+ callback = speed;
5821	+ speed = options;
5822	+ options = {};
5823	+ }
5824
5825	+ // catch (effect, options, callback)
5826	+ if ( $.isFunction( speed ) ) {
5827	+ callback = speed;
5828	+ speed = null;
5829	+ }













5830
5831	+ // add options to effect
5832	+ if ( options ) {
5833	+ $.extend( effect, options );
5834	+ }



































5835
5836	+ speed = speed \|\| options.duration;
5837	+ effect.duration = $.fx.off ? 0 :
5838	+ typeof speed === "number" ? speed :
5839	+ speed in $.fx.speeds ? $.fx.speeds[ speed ] :
5840	+ $.fx.speeds._default;














5841
5842	+ effect.complete = callback \|\| options.complete;

5843
5844	+ return effect;
5845	+ }




5846
5847	+ function standardAnimationOption( option ) {
5848	+ // Valid standard speeds (nothing, number, named speed)
5849	+ if ( !option \|\| typeof option === "number" \|\| $.fx.speeds[ option ] ) {
5850	+ return true;
5851	+ }
5852
5853	+ // Invalid strings - treat as "normal" speed
5854	+ if ( typeof option === "string" && !$.effects.effect[ option ] ) {
5855	+ return true;
5856	+ }
5857
5858	+ // Complete callback
5859	+ if ( $.isFunction( option ) ) {
5860	+ return true;
5861	+ }
5862
5863	+ // Options hash (but not naming an effect)
5864	+ if ( typeof option === "object" && !option.effect ) {
5865	+ return true;
5866	+ }
5867
5868	+ // Didn't match any standard API
5869	+ return false;
5870	+ }
5871	+
5872	+ $.fn.extend({
5873	+ effect: function( /* effect, options, speed, callback */ ) {
5874	+ var args = _normalizeArguments.apply( this, arguments ),
5875	+ mode = args.mode,
5876	+ queue = args.queue,
5877	+ effectMethod = $.effects.effect[ args.effect ];
5878	+
5879	+ if ( $.fx.off \|\| !effectMethod ) {
5880	+ // delegate to the original method (e.g., .show()) if possible
5881	+ if ( mode ) {
5882	+ return this[ mode ]( args.duration, args.complete );
5883	+ } else {
5884	+ return this.each( function() {
5885	+ if ( args.complete ) {
5886	+ args.complete.call( this );
5887	+ }
5888	+ });
5889	+ }
5890	}

5891
5892	+ function run( next ) {
5893	+ var elem = $( this ),
5894	+ complete = args.complete,
5895	+ mode = args.mode;
5896	+
5897	+ function done() {
5898	+ if ( $.isFunction( complete ) ) {
5899	+ complete.call( elem[0] );
5900	+ }
5901	+ if ( $.isFunction( next ) ) {
5902	+ next();
5903	+ }
5904	}







5905
5906	+ // If the element already has the correct final state, delegate to
5907	+ // the core methods so the internal tracking of "olddisplay" works.
5908	+ if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
5909	+ elem[ mode ]();
5910	+ done();
5911	+ } else {
5912	+ effectMethod.call( elem[0], args, done );
5913	}




5914	}
5915	+
5916	+ return queue === false ? this.each( run ) : this.queue( queue \|\| "fx", run );
5917	},
5918
5919	+ show: (function( orig ) {
5920	+ return function( option ) {
5921	+ if ( standardAnimationOption( option ) ) {
5922	+ return orig.apply( this, arguments );
5923	+ } else {
5924	+ var args = _normalizeArguments.apply( this, arguments );
5925	+ args.mode = "show";
5926	+ return this.effect.call( this, args );
5927	}
5928	+ };
5929	+ })( $.fn.show ),
5930
5931	+ hide: (function( orig ) {
5932	+ return function( option ) {
5933	+ if ( standardAnimationOption( option ) ) {
5934	+ return orig.apply( this, arguments );
5935	+ } else {
5936	+ var args = _normalizeArguments.apply( this, arguments );
5937	+ args.mode = "hide";
5938	+ return this.effect.call( this, args );
5939	+ }
5940	+ };
5941	+ })( $.fn.hide ),
5942
5943	+ toggle: (function( orig ) {
5944	+ return function( option ) {
5945	+ if ( standardAnimationOption( option ) \|\| typeof option === "boolean" ) {
5946	+ return orig.apply( this, arguments );
5947	+ } else {
5948	+ var args = _normalizeArguments.apply( this, arguments );
5949	+ args.mode = "toggle";
5950	+ return this.effect.call( this, args );
5951	}
5952	+ };
5953	+ })( $.fn.toggle ),




5954
5955	+ // helper functions
5956	+ cssUnit: function(key) {
5957	+ var style = this.css( key ),
5958	+ val = [];
5959
5960	+ $.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
5961	+ if ( style.indexOf( unit ) > 0 ) {
5962	+ val = [ parseFloat( style ), unit ];
5963	+ }
5964	+ });
5965	+ return val;
5966	}
5967	});
5968
5969	+ })();














5970
5971	+ /******************************************************************************/
5972	+ /********************************* EASING *********************************/
5973	+ /******************************************************************************/
5974	+
5975	+ (function() {
5976	+
5977	+ // based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
5978	+
5979	+ var baseEasings = {};
5980	+
5981	+ $.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
5982	+ baseEasings[ name ] = function( p ) {
5983	+ return Math.pow( p, i + 2 );
5984	+ };
5985	+ });
5986	+
5987	+ $.extend( baseEasings, {
5988	+ Sine: function ( p ) {
5989	+ return 1 - Math.cos( p * Math.PI / 2 );
5990	},
5991	+ Circ: function ( p ) {
5992	+ return 1 - Math.sqrt( 1 - p * p );
5993	+ },
5994	+ Elastic: function( p ) {
5995	+ return p === 0 \|\| p === 1 ? p :
5996	+ -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 );
5997	+ },
5998	+ Back: function( p ) {
5999	+ return p * p * ( 3 * p - 2 );
6000	+ },
6001	+ Bounce: function ( p ) {
6002	+ var pow2,
6003	+ bounce = 4;
6004	+
6005	+ while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
6006	+ return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
6007	+ }
6008	+ });
6009	+
6010	+ $.each( baseEasings, function( name, easeIn ) {
6011	+ $.easing[ "easeIn" + name ] = easeIn;
6012	+ $.easing[ "easeOut" + name ] = function( p ) {
6013	+ return 1 - easeIn( 1 - p );
6014	+ };
6015	+ $.easing[ "easeInOut" + name ] = function( p ) {
6016	+ return p < 0.5 ?
6017	+ easeIn( p * 2 ) / 2 :
6018	+ 1 - easeIn( p * -2 + 2 ) / 2;
6019	};
6020	+ });
6021
6022	+ })();
6023	+
6024	+ })(jQuery);
6025	+
6026	+ (function( $, undefined ) {
6027	+
6028	+ var uid = 0,
6029	+ hideProps = {},
6030	+ showProps = {};
6031	+
6032	+ hideProps.height = hideProps.paddingTop = hideProps.paddingBottom =
6033	+ hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide";
6034	+ showProps.height = showProps.paddingTop = showProps.paddingBottom =
6035	+ showProps.borderTopWidth = showProps.borderBottomWidth = "show";
6036	+
6037	+ $.widget( "ui.accordion", {
6038	+ version: "1.10.2",
6039	options: {
6040	+ active: 0,
6041	+ animate: {},
6042	+ collapsible: false,
6043	+ event: "click",
6044	+ header: "> li > :first-child,> :not(li):even",
6045	+ heightStyle: "auto",
6046	icons: {
6047	+ activeHeader: "ui-icon-triangle-1-s",
6048	+ header: "ui-icon-triangle-1-e"
6049	+ },
6050	+
6051	+ // callbacks
6052	+ activate: null,
6053	+ beforeActivate: null
6054	},
6055	+
6056	_create: function() {
6057	+ var options = this.options;
6058	+ this.prevShow = this.prevHide = $();
6059	+ this.element.addClass( "ui-accordion ui-widget ui-helper-reset" )
6060	+ // ARIA
6061	+ .attr( "role", "tablist" );
6062
6063	+ // don't allow collapsible: false and active: false / null
6064	+ if ( !options.collapsible && (options.active === false \|\| options.active == null) ) {
6065	+ options.active = 0;
6066	}
6067
6068	+ this._processPanels();
6069	+ // handle negative values
6070	+ if ( options.active < 0 ) {
6071	+ options.active += this.headers.length;
6072	+ }
6073	+ this._refresh();
6074	+ },
6075
6076	+ _getCreateEventData: function() {
6077	+ return {
6078	+ header: this.active,
6079	+ panel: !this.active.length ? $() : this.active.next(),
6080	+ content: !this.active.length ? $() : this.active.next()
6081	+ };
6082	+ },
6083
6084	+ _createIcons: function() {
6085	+ var icons = this.options.icons;
6086	+ if ( icons ) {
6087	+ $( "<span>" )
6088	+ .addClass( "ui-accordion-header-icon ui-icon " + icons.header )
6089	+ .prependTo( this.headers );
6090	+ this.active.children( ".ui-accordion-header-icon" )
6091	+ .removeClass( icons.header )
6092	+ .addClass( icons.activeHeader );
6093	+ this.headers.addClass( "ui-accordion-icons" );
6094	}
6095	+ },
6096
6097	+ _destroyIcons: function() {
6098	+ this.headers
6099	+ .removeClass( "ui-accordion-icons" )
6100	+ .children( ".ui-accordion-header-icon" )
6101	+ .remove();
6102	+ },
6103
6104	+ _destroy: function() {
6105	+ var contents;






















6106
6107	+ // clean up main element
6108	this.element
6109	+ .removeClass( "ui-accordion ui-widget ui-helper-reset" )
6110	+ .removeAttr( "role" );





6111
6112	+ // clean up headers
6113	+ this.headers
6114	+ .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
6115	+ .removeAttr( "role" )
6116	+ .removeAttr( "aria-selected" )
6117	+ .removeAttr( "aria-controls" )
6118	+ .removeAttr( "tabIndex" )
6119	+ .each(function() {
6120	+ if ( /^ui-accordion/.test( this.id ) ) {
6121	+ this.removeAttribute( "id" );
6122	}





















6123	});
6124	+ this._destroyIcons();
6125
6126	+ // clean up content panels
6127	+ contents = this.headers.next()
6128	+ .css( "display", "" )
6129	+ .removeAttr( "role" )
6130	+ .removeAttr( "aria-expanded" )
6131	+ .removeAttr( "aria-hidden" )
6132	+ .removeAttr( "aria-labelledby" )
6133	+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" )
6134	+ .each(function() {
6135	+ if ( /^ui-accordion/.test( this.id ) ) {
6136	+ this.removeAttribute( "id" );
6137	}


6138	});
6139	+ if ( this.options.heightStyle !== "content" ) {
6140	+ contents.css( "height", "" );
6141	+ }
6142	+ },



6143
6144	+ _setOption: function( key, value ) {
6145	+ if ( key === "active" ) {
6146	+ // _activate() will handle invalid values and update this.options
6147	+ this._activate( value );
6148	+ return;
6149	+ }
































6150
6151	+ if ( key === "event" ) {
6152	+ if ( this.options.event ) {
6153	+ this._off( this.headers, this.options.event );




6154	}
6155	+ this._setupEvents( value );
6156	}
6157
6158	+ this._super( key, value );







6159
6160	+ // setting collapsible: false while collapsed; open first panel
6161	+ if ( key === "collapsible" && !value && this.options.active === false ) {
6162	+ this._activate( 0 );





6163	}
6164
6165	+ if ( key === "icons" ) {
6166	+ this._destroyIcons();
6167	+ if ( value ) {
6168	+ this._createIcons();








6169	}
6170	+ }
6171
6172	+ // #5332 - opacity doesn't cascade to positioned elements in IE
6173	+ // so we need to add the disabled class to the headers and panels
6174	+ if ( key === "disabled" ) {
6175	+ this.headers.add( this.headers.next() )
6176	+ .toggleClass( "ui-state-disabled", !!value );


6177	}
6178	},
6179
6180	+ _keydown: function( event ) {
6181	+ /jshint maxcomplexity:15/
6182	+ if ( event.altKey \|\| event.ctrlKey ) {
6183	+ return;
6184	+ }
6185
6186	+ var keyCode = $.ui.keyCode,
6187	+ length = this.headers.length,
6188	+ currentIndex = this.headers.index( event.target ),
6189	+ toFocus = false;




6190
6191	+ switch ( event.keyCode ) {
6192	+ case keyCode.RIGHT:
6193	+ case keyCode.DOWN:
6194	+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
6195	+ break;
6196	+ case keyCode.LEFT:
6197	+ case keyCode.UP:
6198	+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
6199	+ break;
6200	+ case keyCode.SPACE:
6201	+ case keyCode.ENTER:
6202	+ this._eventHandler( event );
6203	+ break;
6204	+ case keyCode.HOME:
6205	+ toFocus = this.headers[ 0 ];
6206	+ break;
6207	+ case keyCode.END:
6208	+ toFocus = this.headers[ length - 1 ];
6209	+ break;
6210	}
6211
6212	+ if ( toFocus ) {
6213	+ $( event.target ).attr( "tabIndex", -1 );
6214	+ $( toFocus ).attr( "tabIndex", 0 );
6215	+ toFocus.focus();
6216	+ event.preventDefault();
6217	+ }
6218	},
6219
6220	+ _panelKeyDown : function( event ) {
6221	+ if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
6222	+ $( event.currentTarget ).prev().focus();






6223	}

6224	},
6225
6226	refresh: function() {
6227	+ var options = this.options;
6228	+ this._processPanels();
6229	+
6230	+ // was collapsed or no panel
6231	+ if ( ( options.active === false && options.collapsible === true ) \|\| !this.headers.length ) {
6232	+ options.active = false;
6233	+ this.active = $();
6234	+ // active false only when collapsible is true
6235	+ } if ( options.active === false ) {
6236	+ this._activate( 0 );
6237	+ // was active, but active panel is gone
6238	+ } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
6239	+ // all remaining panel are disabled
6240	+ if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) {
6241	+ options.active = false;
6242	+ this.active = $();
6243	+ // activate previous panel




6244	} else {
6245	+ this._activate( Math.max( 0, options.active - 1 ) );


6246	}
6247	+ // was active, active panel still exists
6248	+ } else {
6249	+ // make sure active index is correct
6250	+ options.active = this.headers.index( this.active );
6251	}

6252
6253	+ this._destroyIcons();















6254
6255	+ this._refresh();
6256	+ },


6257
6258	+ _processPanels: function() {
6259	+ this.headers = this.element.find( this.options.header )
6260	+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" );
6261
6262	+ this.headers.next()
6263	+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" )
6264	+ .filter(":not(.ui-accordion-content-active)")
6265	+ .hide();
6266	+ },
6267
6268	+ _refresh: function() {
6269	+ var maxHeight,
6270	+ options = this.options,
6271	+ heightStyle = options.heightStyle,
6272	+ parent = this.element.parent(),
6273	+ accordionId = this.accordionId = "ui-accordion-" +
6274	+ (this.element.attr( "id" ) \|\| ++uid);
6275	+
6276	+ this.active = this._findActive( options.active )
6277	+ .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" )
6278	+ .removeClass( "ui-corner-all" );
6279	+ this.active.next()
6280	+ .addClass( "ui-accordion-content-active" )
6281	+ .show();
6282
6283	+ this.headers
6284	+ .attr( "role", "tab" )
6285	+ .each(function( i ) {
6286	+ var header = $( this ),
6287	+ headerId = header.attr( "id" ),
6288	+ panel = header.next(),
6289	+ panelId = panel.attr( "id" );
6290	+ if ( !headerId ) {
6291	+ headerId = accordionId + "-header-" + i;
6292	+ header.attr( "id", headerId );
6293	}
6294	+ if ( !panelId ) {
6295	+ panelId = accordionId + "-panel-" + i;
6296	+ panel.attr( "id", panelId );
6297	+ }
6298	+ header.attr( "aria-controls", panelId );
6299	+ panel.attr( "aria-labelledby", headerId );
6300	+ })
6301	+ .next()
6302	+ .attr( "role", "tabpanel" );
6303	+
6304	+ this.headers
6305	+ .not( this.active )
6306	+ .attr({
6307	+ "aria-selected": "false",
6308	+ tabIndex: -1
6309	+ })
6310	+ .next()
6311	+ .attr({
6312	+ "aria-expanded": "false",
6313	+ "aria-hidden": "true"
6314	+ })
6315	+ .hide();
6316	+
6317	+ // make sure at least one header is in the tab order
6318	+ if ( !this.active.length ) {
6319	+ this.headers.eq( 0 ).attr( "tabIndex", 0 );
6320	} else {
6321	+ this.active.attr({
6322	+ "aria-selected": "true",
6323	+ tabIndex: 0
6324	+ })
6325	+ .next()
6326	+ .attr({
6327	+ "aria-expanded": "true",
6328	+ "aria-hidden": "false"
6329	+ });
6330	}



6331
6332	+ this._createIcons();
6333	+
6334	+ this._setupEvents( options.event );
6335	+
6336	+ if ( heightStyle === "fill" ) {
6337	+ maxHeight = parent.height();
6338	+ this.element.siblings( ":visible" ).each(function() {
6339	+ var elem = $( this ),
6340	+ position = elem.css( "position" );
6341	+
6342	+ if ( position === "absolute" \|\| position === "fixed" ) {
6343	+ return;
6344	+ }
6345	+ maxHeight -= elem.outerHeight( true );
6346	+ });
6347	+
6348	+ this.headers.each(function() {
6349	+ maxHeight -= $( this ).outerHeight( true );
6350	+ });
6351	+
6352	+ this.headers.next()
6353	+ .each(function() {
6354	+ $( this ).height( Math.max( 0, maxHeight -
6355	+ $( this ).innerHeight() + $( this ).height() ) );
6356	+ })
6357	+ .css( "overflow", "auto" );
6358	+ } else if ( heightStyle === "auto" ) {
6359	+ maxHeight = 0;
6360	+ this.headers.next()
6361	+ .each(function() {
6362	+ maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
6363	+ })
6364	+ .height( maxHeight );
6365	+ }
6366	},
6367
6368	+ _activate: function( index ) {
6369	+ var active = this._findActive( index )[ 0 ];
6370	+
6371	+ // trying to activate the already active panel
6372	+ if ( active === this.active[ 0 ] ) {
6373	+ return;
6374	+ }
6375	+
6376	+ // trying to collapse, simulate a click on the currently active header
6377	+ active = active \|\| this.active[ 0 ];
6378	+
6379	+ this._eventHandler({
6380	+ target: active,
6381	+ currentTarget: active,
6382	+ preventDefault: $.noop
6383	+ });
6384	},
6385	+
6386	+ _findActive: function( selector ) {
6387	+ return typeof selector === "number" ? this.headers.eq( selector ) : $();
6388	},
6389
6390	+ _setupEvents: function( event ) {
6391	+ var events = {
6392	+ keydown: "_keydown"
6393	+ };
6394	+ if ( event ) {
6395	+ $.each( event.split(" "), function( index, eventName ) {
6396	+ events[ eventName ] = "_eventHandler";
6397	+ });
6398	}
6399
6400	+ this._off( this.headers.add( this.headers.next() ) );
6401	+ this._on( this.headers, events );
6402	+ this._on( this.headers.next(), { keydown: "_panelKeyDown" });
6403	+ this._hoverable( this.headers );
6404	+ this._focusable( this.headers );
6405	},


























































6406
6407	+ _eventHandler: function( event ) {
6408	+ var options = this.options,
6409	+ active = this.active,
6410	+ clicked = $( event.currentTarget ),
6411	+ clickedIsActive = clicked[ 0 ] === active[ 0 ],
6412	+ collapsing = clickedIsActive && options.collapsible,
6413	+ toShow = collapsing ? $() : clicked.next(),
6414	+ toHide = active.next(),
6415	+ eventData = {
6416	+ oldHeader: active,
6417	+ oldPanel: toHide,
6418	+ newHeader: collapsing ? $() : clicked,
6419	+ newPanel: toShow
6420	+ };


















6421
6422	+ event.preventDefault();

































6423
6424	+ if (
6425	+ // click on active header, but not collapsible
6426	+ ( clickedIsActive && !options.collapsible ) \|\|
6427	+ // allow canceling activation
6428	+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
6429	+ return;
6430	}
6431
6432	+ options.active = collapsing ? false : this.headers.index( clicked );






























































































6433
6434	+ // when the call to ._toggle() comes after the class changes
6435	+ // it causes a very odd bug in IE 8 (see #6720)
6436	+ this.active = clickedIsActive ? $() : clicked;
6437	+ this._toggle( eventData );
6438
6439	+ // switch classes
6440	+ // corner classes on the previously active header stay after the animation
6441	+ active.removeClass( "ui-accordion-header-active ui-state-active" );
6442	+ if ( options.icons ) {
6443	+ active.children( ".ui-accordion-header-icon" )
6444	+ .removeClass( options.icons.activeHeader )
6445	+ .addClass( options.icons.header );
6446	}
6447
6448	+ if ( !clickedIsActive ) {
6449	+ clicked
6450	+ .removeClass( "ui-corner-all" )
6451	+ .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" );
6452	+ if ( options.icons ) {
6453	+ clicked.children( ".ui-accordion-header-icon" )
6454	+ .removeClass( options.icons.header )
6455	+ .addClass( options.icons.activeHeader );
6456	+ }
6457
6458	+ clicked
6459	+ .next()
6460	+ .addClass( "ui-accordion-content-active" );
6461	}
6462	},
6463
6464	+ _toggle: function( data ) {
6465	+ var toShow = data.newPanel,
6466	+ toHide = this.prevShow.length ? this.prevShow : data.oldPanel;


6467
6468	+ // handle activating a panel during the animation for another activation
6469	+ this.prevShow.add( this.prevHide ).stop( true, true );
6470	+ this.prevShow = toShow;
6471	+ this.prevHide = toHide;
6472	+
6473	+ if ( this.options.animate ) {
6474	+ this._animate( toShow, toHide, data );
6475	+ } else {
6476	+ toHide.hide();
6477	+ toShow.show();
6478	+ this._toggleComplete( data );
6479	}







6480
6481	+ toHide.attr({
6482	+ "aria-expanded": "false",
6483	+ "aria-hidden": "true"
6484	+ });
6485	+ toHide.prev().attr( "aria-selected", "false" );
6486	+ // if we're switching panels, remove the old header from the tab order
6487	+ // if we're opening from collapsed state, remove the previous header from the tab order
6488	+ // if we're collapsing, then keep the collapsing header in the tab order
6489	+ if ( toShow.length && toHide.length ) {
6490	+ toHide.prev().attr( "tabIndex", -1 );
6491	+ } else if ( toShow.length ) {
6492	+ this.headers.filter(function() {
6493	+ return $( this ).attr( "tabIndex" ) === 0;
6494	+ })
6495	+ .attr( "tabIndex", -1 );
6496	}
6497
6498	+ toShow
6499	+ .attr({
6500	+ "aria-expanded": "true",
6501	+ "aria-hidden": "false"
6502	+ })
6503	+ .prev()
6504	+ .attr({
6505	+ "aria-selected": "true",
6506	+ tabIndex: 0
6507	+ });
6508	},
6509
6510	+ _animate: function( toShow, toHide, data ) {
6511	+ var total, easing, duration,
6512	+ that = this,
6513	+ adjust = 0,
6514	+ down = toShow.length &&
6515	+ ( !toHide.length \|\| ( toShow.index() < toHide.index() ) ),
6516	+ animate = this.options.animate \|\| {},
6517	+ options = down && animate.down \|\| animate,
6518	+ complete = function() {
6519	+ that._toggleComplete( data );
6520	+ };
6521
6522	+ if ( typeof options === "number" ) {
6523	+ duration = options;




6524	}
6525	+ if ( typeof options === "string" ) {
6526	+ easing = options;

6527	}
6528	+ // fall back from options to animation in case of partial down settings
6529	+ easing = easing \|\| options.easing \|\| animate.easing;
6530	+ duration = duration \|\| options.duration \|\| animate.duration;
6531
6532	+ if ( !toHide.length ) {
6533	+ return toShow.animate( showProps, duration, easing, complete );
6534	+ }
6535	+ if ( !toShow.length ) {
6536	+ return toHide.animate( hideProps, duration, easing, complete );




6537	}
6538
6539	+ total = toShow.show().outerHeight();
6540	+ toHide.animate( hideProps, {
6541	+ duration: duration,
6542	+ easing: easing,
6543	+ step: function( now, fx ) {
6544	+ fx.now = Math.round( now );
6545	+ }
6546	+ });
6547	+ toShow
6548	+ .hide()
6549	+ .animate( showProps, {
6550	+ duration: duration,
6551	+ easing: easing,
6552	+ complete: complete,
6553	+ step: function( now, fx ) {
6554	+ fx.now = Math.round( now );
6555	+ if ( fx.prop !== "height" ) {
6556	+ adjust += fx.now;
6557	+ } else if ( that.options.heightStyle !== "content" ) {
6558	+ fx.now = Math.round( total - toHide.outerHeight() - adjust );
6559	+ adjust = 0;
6560	}
6561	}
6562	});




6563	},
6564
6565	+ _toggleComplete: function( data ) {
6566	+ var toHide = data.oldPanel;

6567
6568	+ toHide
6569	+ .removeClass( "ui-accordion-content-active" )
6570	+ .prev()
6571	+ .removeClass( "ui-corner-top" )
6572	+ .addClass( "ui-corner-all" );

6573
6574	+ // Work around for rendering bug in IE (#5421)
6575	+ if ( toHide.length ) {
6576	+ toHide.parent()[0].className = toHide.parent()[0].className;
6577	}
6578
6579	+ this._trigger( "activate", null, data );
6580	+ }
6581	+ });




6582
6583	+ })( jQuery );






6584
6585	+ (function( $, undefined ) {

6586
6587	+ // used to prevent race conditions with remote data sources
6588	+ var requestIndex = 0;
6589	+
6590	+ $.widget( "ui.autocomplete", {
6591	+ version: "1.10.2",
6592	+ defaultElement: "<input>",
6593	+ options: {
6594	+ appendTo: null,
6595	+ autoFocus: false,
6596	+ delay: 300,
6597	+ minLength: 1,
6598	+ position: {
6599	+ my: "left top",
6600	+ at: "left bottom",
6601	+ collision: "none"
6602	+ },
6603	+ source: null,
6604
6605	+ // callbacks
6606	+ change: null,
6607	+ close: null,
6608	+ focus: null,
6609	+ open: null,
6610	+ response: null,
6611	+ search: null,
6612	+ select: null
6613	+ },
6614
6615	+ pending: 0,




6616
6617	+ _create: function() {
6618	+ // Some browsers only repeat keydown events, not keypress events,
6619	+ // so we use the suppressKeyPress flag to determine if we've already
6620	+ // handled the keydown event. #7269
6621	+ // Unfortunately the code for & in keypress is the same as the up arrow,
6622	+ // so we use the suppressKeyPressRepeat flag to avoid handling keypress
6623	+ // events when we know the keydown event was used to modify the
6624	+ // search term. #7799
6625	+ var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
6626	+ nodeName = this.element[0].nodeName.toLowerCase(),
6627	+ isTextarea = nodeName === "textarea",
6628	+ isInput = nodeName === "input";
6629	+
6630	+ this.isMultiLine =
6631	+ // Textareas are always multi-line
6632	+ isTextarea ? true :
6633	+ // Inputs are always single-line, even if inside a contentEditable element
6634	+ // IE also treats inputs as contentEditable
6635	+ isInput ? false :
6636	+ // All other element types are determined by whether or not they're contentEditable
6637	+ this.element.prop( "isContentEditable" );
6638	+
6639	+ this.valueMethod = this.element[ isTextarea \|\| isInput ? "val" : "text" ];
6640	+ this.isNewMenu = true;
6641	+
6642	+ this.element
6643	+ .addClass( "ui-autocomplete-input" )
6644	+ .attr( "autocomplete", "off" );
6645	+
6646	+ this._on( this.element, {
6647	+ keydown: function( event ) {
6648	+ /jshint maxcomplexity:15/
6649	+ if ( this.element.prop( "readOnly" ) ) {
6650	+ suppressKeyPress = true;
6651	+ suppressInput = true;
6652	+ suppressKeyPressRepeat = true;
6653	return;
6654	}
6655
6656	+ suppressKeyPress = false;
6657	+ suppressInput = false;
6658	+ suppressKeyPressRepeat = false;
6659	+ var keyCode = $.ui.keyCode;
6660	+ switch( event.keyCode ) {
6661	+ case keyCode.PAGE_UP:
6662	+ suppressKeyPress = true;
6663	+ this._move( "previousPage", event );
6664	+ break;
6665	+ case keyCode.PAGE_DOWN:
6666	+ suppressKeyPress = true;
6667	+ this._move( "nextPage", event );
6668	+ break;
6669	+ case keyCode.UP:
6670	+ suppressKeyPress = true;
6671	+ this._keyEvent( "previous", event );
6672	+ break;
6673	+ case keyCode.DOWN:
6674	+ suppressKeyPress = true;
6675	+ this._keyEvent( "next", event );
6676	+ break;
6677	+ case keyCode.ENTER:
6678	+ case keyCode.NUMPAD_ENTER:
6679	+ // when menu is open and has focus
6680	+ if ( this.menu.active ) {
6681	+ // #6055 - Opera still allows the keypress to occur
6682	+ // which causes forms to submit
6683	+ suppressKeyPress = true;
6684	+ event.preventDefault();
6685	+ this.menu.select( event );
6686	+ }
6687	+ break;
6688	+ case keyCode.TAB:
6689	+ if ( this.menu.active ) {
6690	+ this.menu.select( event );
6691	+ }
6692	+ break;
6693	+ case keyCode.ESCAPE:
6694	+ if ( this.menu.element.is( ":visible" ) ) {
6695	+ this._value( this.term );
6696	+ this.close( event );
6697	+ // Different browsers have different default behavior for escape
6698	+ // Single press can mean undo or clear
6699	+ // Double press in IE means clear the whole form
6700	+ event.preventDefault();
6701	+ }
6702	+ break;
6703	+ default:
6704	+ suppressKeyPressRepeat = true;
6705	+ // search timeout should be triggered before the input value is changed
6706	+ this._searchTimeout( event );
6707	+ break;
6708	+ }
6709	+ },
6710	+ keypress: function( event ) {
6711	+ if ( suppressKeyPress ) {
6712	+ suppressKeyPress = false;
6713	+ event.preventDefault();
6714	+ return;
6715	+ }
6716	+ if ( suppressKeyPressRepeat ) {
6717	+ return;
6718	}


6719
6720	+ // replicate some key handlers to allow them to repeat in Firefox and Opera
6721	+ var keyCode = $.ui.keyCode;
6722	+ switch( event.keyCode ) {
6723	+ case keyCode.PAGE_UP:
6724	+ this._move( "previousPage", event );
6725	+ break;
6726	+ case keyCode.PAGE_DOWN:
6727	+ this._move( "nextPage", event );
6728	+ break;
6729	+ case keyCode.UP:
6730	+ this._keyEvent( "previous", event );
6731	+ break;
6732	+ case keyCode.DOWN:
6733	+ this._keyEvent( "next", event );
6734	+ break;
6735	+ }
6736	+ },
6737	+ input: function( event ) {
6738	+ if ( suppressInput ) {
6739	+ suppressInput = false;
6740	+ event.preventDefault();
6741	+ return;
6742	+ }
6743	+ this._searchTimeout( event );
6744	+ },
6745	+ focus: function() {
6746	+ this.selectedItem = null;
6747	+ this.previous = this._value();
6748	+ },
6749	+ blur: function( event ) {
6750	+ if ( this.cancelBlur ) {
6751	+ delete this.cancelBlur;
6752	+ return;
6753	+ }
6754
6755	+ clearTimeout( this.searching );
6756	+ this.close( event );
6757	+ this._change( event );
6758	+ }
6759	+ });
6760
6761	+ this._initSource();
6762	+ this.menu = $( "<ul>" )
6763	+ .addClass( "ui-autocomplete ui-front" )
6764	+ .appendTo( this._appendTo() )
6765	+ .menu({
6766	+ // custom key handling for now
6767	+ input: $(),
6768	+ // disable ARIA support, the live region takes care of that
6769	+ role: null
6770	+ })
6771	+ .hide()
6772	+ .data( "ui-menu" );
6773
6774	+ this._on( this.menu.element, {
6775	+ mousedown: function( event ) {
6776	+ // prevent moving focus out of the text field
6777	+ event.preventDefault();








6778
6779	+ // IE doesn't prevent moving focus even with event.preventDefault()
6780	+ // so we set a flag to know when we should ignore the blur event
6781	+ this.cancelBlur = true;
6782	+ this._delay(function() {
6783	+ delete this.cancelBlur;
6784	+ });
6785
6786	+ // clicking on the scrollbar causes focus to shift to the body
6787	+ // but we can't detect a mouseup or a click immediately afterward
6788	+ // so we have to track the next mousedown and close the menu if
6789	+ // the user clicks somewhere outside of the autocomplete
6790	+ var menuElement = this.menu.element[ 0 ];
6791	+ if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
6792	+ this._delay(function() {
6793	+ var that = this;
6794	+ this.document.one( "mousedown", function( event ) {
6795	+ if ( event.target !== that.element[ 0 ] &&
6796	+ event.target !== menuElement &&
6797	+ !$.contains( menuElement, event.target ) ) {
6798	+ that.close();
6799	+ }
6800	+ });
6801	+ });
6802	+ }
6803	+ },
6804	+ menufocus: function( event, ui ) {
6805	+ // support: Firefox
6806	+ // Prevent accidental activation of menu items in Firefox (#7024 #9118)
6807	+ if ( this.isNewMenu ) {
6808	+ this.isNewMenu = false;
6809	+ if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
6810	+ this.menu.blur();
6811	+
6812	+ this.document.one( "mousemove", function() {
6813	+ $( event.target ).trigger( event.originalEvent );
6814	+ });
6815	+
6816	+ return;
6817	}



6818	}




6819
6820	+ var item = ui.item.data( "ui-autocomplete-item" );
6821	+ if ( false !== this._trigger( "focus", event, { item: item } ) ) {
6822	+ // use value to match what will end up in the input, if it was a key event
6823	+ if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
6824	+ this._value( item.value );
6825	+ }
6826	+ } else {
6827	+ // Normally the input is populated with the item's value as the
6828	+ // menu is navigated, causing screen readers to notice a change and
6829	+ // announce the item. Since the focus event was canceled, this doesn't
6830	+ // happen, so we update the live region so that screen readers can
6831	+ // still notice the change and announce it.
6832	+ this.liveRegion.text( item.value );
6833	+ }
6834	+ },
6835	+ menuselect: function( event, ui ) {
6836	+ var item = ui.item.data( "ui-autocomplete-item" ),
6837	+ previous = this.previous;
6838	+
6839	+ // only trigger when focus was lost (click on menu)
6840	+ if ( this.element[0] !== this.document[0].activeElement ) {
6841	+ this.element.focus();
6842	+ this.previous = previous;
6843	+ // #6109 - IE triggers two focus events and the second
6844	+ // is asynchronous, so we need to reset the previous
6845	+ // term synchronously and asynchronously :-(
6846	+ this._delay(function() {
6847	+ this.previous = previous;
6848	+ this.selectedItem = item;
6849	+ });
6850	+ }
6851
6852	+ if ( false !== this._trigger( "select", event, { item: item } ) ) {
6853	+ this._value( item.value );
6854	+ }
6855	+ // reset the term after the select event
6856	+ // this allows custom select handling to work properly
6857	+ this.term = this._value();
6858
6859	+ this.close( event );
6860	+ this.selectedItem = item;
















6861	}
6862	});













6863
6864	+ this.liveRegion = $( "<span>", {
6865	+ role: "status",
6866	+ "aria-live": "polite"
6867	+ })
6868	+ .addClass( "ui-helper-hidden-accessible" )
6869	+ .insertAfter( this.element );


6870
6871	+ // turning off autocomplete prevents the browser from remembering the
6872	+ // value when navigating through history, so we re-enable autocomplete
6873	+ // if the page is unloaded before the widget is destroyed. #7790
6874	+ this._on( this.window, {
6875	+ beforeunload: function() {
6876	+ this.element.removeAttr( "autocomplete" );
















6877	}
6878	+ });


6879	},
6880
6881	+ _destroy: function() {
6882	+ clearTimeout( this.searching );
6883	+ this.element
6884	+ .removeClass( "ui-autocomplete-input" )
6885	+ .removeAttr( "autocomplete" );
6886	+ this.menu.element.remove();
6887	+ this.liveRegion.remove();

6888	},
6889
6890	+ _setOption: function( key, value ) {
6891	+ this._super( key, value );
6892	+ if ( key === "source" ) {
6893	+ this._initSource();





























6894	}
6895	+ if ( key === "appendTo" ) {
6896	+ this.menu.element.appendTo( this._appendTo() );



6897	}
6898	+ if ( key === "disabled" && value && this.xhr ) {
6899	+ this.xhr.abort();




6900	}
6901	},
6902
6903	+ _appendTo: function() {
6904	+ var element = this.options.appendTo;













6905
6906	+ if ( element ) {
6907	+ element = element.jquery \|\| element.nodeType ?
6908	+ $( element ) :
6909	+ this.document.find( element ).eq( 0 );
6910	}
6911	+
6912	+ if ( !element ) {
6913	+ element = this.element.closest( ".ui-front" );
6914	}

6915
6916	+ if ( !element.length ) {
6917	+ element = this.document[0].body;
6918	+ }














































6919
6920	+ return element;
6921	+ },


6922
6923	+ _initSource: function() {
6924	+ var array, url,
6925	+ that = this;
6926	+ if ( $.isArray(this.options.source) ) {
6927	+ array = this.options.source;
6928	+ this.source = function( request, response ) {
6929	+ response( $.ui.autocomplete.filter( array, request.term ) );
6930	+ };
6931	+ } else if ( typeof this.options.source === "string" ) {
6932	+ url = this.options.source;
6933	+ this.source = function( request, response ) {
6934	+ if ( that.xhr ) {
6935	+ that.xhr.abort();
6936	}
6937	+ that.xhr = $.ajax({
6938	+ url: url,
6939	+ data: request,
6940	+ dataType: "json",
6941	+ success: function( data ) {
6942	+ response( data );
6943	+ },
6944	+ error: function() {
6945	+ response( [] );
6946	+ }
6947	+ });
6948	+ };
6949	+ } else {
6950	+ this.source = this.options.source;
6951	}


6952	},
6953
6954	+ _searchTimeout: function( event ) {
6955	+ clearTimeout( this.searching );
6956	+ this.searching = this._delay(function() {
6957	+ // only search if the value has changed
6958	+ if ( this.term !== this._value() ) {
6959	+ this.selectedItem = null;
6960	+ this.search( null, event );
6961	+ }
6962	+ }, this.options.delay );
6963	+ },
6964
6965	+ search: function( value, event ) {
6966	+ value = value != null ? value : this._value();




6967
6968	+ // always save the actual value, not the one passed as an argument
6969	+ this.term = this._value();

6970
6971	+ if ( value.length < this.options.minLength ) {
6972	+ return this.close( event );
























6973	}
6974
6975	+ if ( this._trigger( "search", event ) === false ) {
6976	+ return;
6977	}


6978
6979	+ return this._search( value );
6980	+ },
6981
6982	+ _search: function( value ) {
6983	+ this.pending++;
6984	+ this.element.addClass( "ui-autocomplete-loading" );
6985	+ this.cancelSearch = false;
6986
6987	+ this.source( { term: value }, this._response() );






6988	},
6989
6990	+ _response: function() {
6991	+ var that = this,
6992	+ index = ++requestIndex;

6993
6994	+ return function( content ) {
6995	+ if ( index === requestIndex ) {
6996	+ that.__response( content );
6997	+ }




















6998
6999	+ that.pending--;
7000	+ if ( !that.pending ) {
7001	+ that.element.removeClass( "ui-autocomplete-loading" );
7002	+ }
7003	+ };
7004	+ },



7005
7006	+ __response: function( content ) {
7007	+ if ( content ) {
7008	+ content = this._normalize( content );
7009	}
7010	+ this._trigger( "response", null, { content: content } );
7011	+ if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
7012	+ this._suggest( content );
7013	+ this._trigger( "open" );
7014	+ } else {
7015	+ // use ._close() instead of .close() so we don't cancel future searches
7016	+ this._close();



7017	}
7018	+ },
7019
7020	+ close: function( event ) {
7021	+ this.cancelSearch = true;
7022	+ this._close( event );
7023	},
7024
7025	+ _close: function( event ) {
7026	+ if ( this.menu.element.is( ":visible" ) ) {
7027	+ this.menu.element.hide();
7028	+ this.menu.blur();
7029	+ this.isNewMenu = true;
7030	+ this._trigger( "close", event );
7031	}
7032	+ },
7033
7034	+ _change: function( event ) {
7035	+ if ( this.previous !== this._value() ) {
7036	+ this._trigger( "change", event, { item: this.selectedItem } );
7037	}
7038	+ },
7039
7040	+ _normalize: function( items ) {
7041	+ // assume all items have the right format when the first item is complete
7042	+ if ( items.length && items[0].label && items[0].value ) {
7043	+ return items;
7044	+ }
7045	+ return $.map( items, function( item ) {
7046	+ if ( typeof item === "string" ) {
7047	+ return {
7048	+ label: item,
7049	+ value: item
7050	+ };
7051	+ }
7052	+ return $.extend({
7053	+ label: item.label \|\| item.value,
7054	+ value: item.value \|\| item.label
7055	+ }, item );
7056	});

7057	},
7058
7059	+ _suggest: function( items ) {
7060	+ var ul = this.menu.element.empty();
7061	+ this._renderMenu( ul, items );
7062	+ this.isNewMenu = true;
7063	+ this.menu.refresh();








7064
7065	+ // size and position menu
7066	+ ul.show();
7067	+ this._resizeMenu();
7068	+ ul.position( $.extend({
7069	+ of: this.element
7070	+ }, this.options.position ));
7071	+
7072	+ if ( this.options.autoFocus ) {
7073	+ this.menu.next();
7074	}
7075	},
7076
7077	+ _resizeMenu: function() {
7078	+ var ul = this.menu.element;
7079	+ ul.outerWidth( Math.max(
7080	+ // Firefox wraps long text (possibly a rounding bug)
7081	+ // so we add 1px to avoid the wrapping (#7513)
7082	+ ul.width( "" ).outerWidth() + 1,
7083	+ this.element.outerWidth()
7084	+ ) );















7085	},
7086
7087	+ _renderMenu: function( ul, items ) {
7088	+ var that = this;
7089	+ $.each( items, function( index, item ) {
7090	+ that._renderItemData( ul, item );








7091	});
7092	+ },
7093
7094	+ _renderItemData: function( ul, item ) {
7095	+ return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
7096	+ },
7097	+
7098	+ _renderItem: function( ul, item ) {
7099	+ return $( "<li>" )
7100	+ .append( $( "<a>" ).text( item.label ) )
7101	+ .appendTo( ul );
7102	+ },
7103	+
7104	+ _move: function( direction, event ) {
7105	+ if ( !this.menu.element.is( ":visible" ) ) {
7106	+ this.search( null, event );
7107	+ return;
7108	+ }
7109	+ if ( this.menu.isFirstItem() && /^previous/.test( direction ) \|\|
7110	+ this.menu.isLastItem() && /^next/.test( direction ) ) {
7111	+ this._value( this.term );
7112	+ this.menu.blur();
7113	+ return;
7114	+ }
7115	+ this.menu[ direction ]( event );
7116	+ },
7117	+
7118	+ widget: function() {
7119	+ return this.menu.element;
7120	+ },
7121	+
7122	+ _value: function() {
7123	+ return this.valueMethod.apply( this.element, arguments );
7124	+ },
7125	+
7126	+ _keyEvent: function( keyEvent, event ) {
7127	+ if ( !this.isMultiLine \|\| this.menu.element.is( ":visible" ) ) {
7128	+ this._move( keyEvent, event );
7129	+
7130	+ // prevents moving cursor to beginning/end of the text field in some browsers
7131	+ event.preventDefault();
7132	+ }
7133	}
7134	});
7135
7136	+ $.extend( $.ui.autocomplete, {
7137	+ escapeRegex: function( value ) {
7138	+ return value.replace(/[\-\[\]{}()*+?.,\\\^$\|#\s]/g, "\\$&");
7139	+ },
7140	+ filter: function(array, term) {
7141	+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
7142	+ return $.grep( array, function(value) {
7143	+ return matcher.test( value.label \|\| value.value \|\| value );
7144	+ });
7145	}
7146	});
7147
























7148
7149	+ // live region extension, adding a `messages` option
7150	+ // NOTE: This is an experimental API. We are still investigating
7151	+ // a full solution for string manipulation and internationalization.
7152	+ $.widget( "ui.autocomplete", $.ui.autocomplete, {
7153	options: {
7154	+ messages: {
7155	+ noResults: "No search results.",
7156	+ results: function( amount ) {
7157	+ return amount + ( amount > 1 ? " results are" : " result is" ) +
7158	+ " available, use up and down arrow keys to navigate.";
7159	+ }
7160	+ }


7161	},
7162
7163	+ __response: function( content ) {
7164	+ var message;
7165	+ this._superApply( arguments );
7166	+ if ( this.options.disabled \|\| this.cancelSearch ) {
7167	+ return;
7168	+ }
7169	+ if ( content && content.length ) {
7170	+ message = this.options.messages.results( content.length );
7171	+ } else {
7172	+ message = this.options.messages.noResults;
7173	+ }
7174	+ this.liveRegion.text( message );
7175	+ }
7176	+ });
7177
7178	+ }( jQuery ));






7179
7180	+ (function( $, undefined ) {
7181
7182	+ var lastActive, startXPos, startYPos, clickDragged,
7183	+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
7184	+ stateClasses = "ui-state-hover ui-state-active ",
7185	+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
7186	+ formResetHandler = function() {
7187	+ var buttons = $( this ).find( ":ui-button" );
7188	+ setTimeout(function() {
7189	+ buttons.button( "refresh" );
7190	+ }, 1 );
7191	+ },
7192	+ radioGroup = function( radio ) {
7193	+ var name = radio.name,
7194	+ form = radio.form,
7195	+ radios = $( [] );
7196	+ if ( name ) {
7197	+ name = name.replace( /'/g, "\\'" );
7198	+ if ( form ) {
7199	+ radios = $( form ).find( "[name='" + name + "']" );
7200	+ } else {
7201	+ radios = $( "[name='" + name + "']", radio.ownerDocument )
7202	+ .filter(function() {
7203	+ return !this.form;
7204	+ });
7205	}
7206	+ }
7207	+ return radios;
7208	+ };
7209
7210	+ $.widget( "ui.button", {
7211	+ version: "1.10.2",
7212	+ defaultElement: "<button>",
7213	+ options: {
7214	+ disabled: null,
7215	+ text: true,
7216	+ label: null,
7217	+ icons: {
7218	+ primary: null,
7219	+ secondary: null
7220	}
7221	+ },
7222	+ _create: function() {
7223	+ this.element.closest( "form" )
7224	+ .unbind( "reset" + this.eventNamespace )
7225	+ .bind( "reset" + this.eventNamespace, formResetHandler );
7226
7227	+ if ( typeof this.options.disabled !== "boolean" ) {
7228	+ this.options.disabled = !!this.element.prop( "disabled" );
7229	+ } else {
7230	+ this.element.prop( "disabled", this.options.disabled );
7231	}
7232
7233	+ this._determineButtonType();
7234	+ this.hasTitle = !!this.buttonElement.attr( "title" );
7235
7236	+ var that = this,
7237	+ options = this.options,
7238	+ toggleButton = this.type === "checkbox" \|\| this.type === "radio",
7239	+ activeClass = !toggleButton ? "ui-state-active" : "",
7240	+ focusClass = "ui-state-focus";
7241
7242	+ if ( options.label === null ) {
7243	+ options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html());
7244	+ }



















7245
7246	+ this._hoverable( this.buttonElement );


7247
7248	+ this.buttonElement
7249	+ .addClass( baseClasses )
7250	+ .attr( "role", "button" )
7251	+ .bind( "mouseenter" + this.eventNamespace, function() {
7252	+ if ( options.disabled ) {





7253	return;
7254	}
7255	+ if ( this === lastActive ) {
7256	+ $( this ).addClass( "ui-state-active" );

























7257	}
7258	+ })
7259	+ .bind( "mouseleave" + this.eventNamespace, function() {
7260	+ if ( options.disabled ) {
7261	+ return;
























7262	}
7263	+ $( this ).removeClass( activeClass );




7264	})
7265	+ .bind( "click" + this.eventNamespace, function( event ) {
7266	+ if ( options.disabled ) {
7267	+ event.preventDefault();
7268	+ event.stopImmediatePropagation();




7269	}

7270	});
7271









7272	this.element
7273	+ .bind( "focus" + this.eventNamespace, function() {
7274	+ // no need to check disabled, focus won't be triggered anyway
7275	+ that.buttonElement.addClass( focusClass );
7276	+ })
7277	+ .bind( "blur" + this.eventNamespace, function() {
7278	+ that.buttonElement.removeClass( focusClass );
7279	+ });



















7280
7281	+ if ( toggleButton ) {
7282	+ this.element.bind( "change" + this.eventNamespace, function() {
7283	+ if ( clickDragged ) {
7284	+ return;
7285	+ }
7286	+ that.refresh();
7287	+ });
7288	+ // if mouse moves between mousedown and mouseup (drag) set clickDragged flag
7289	+ // prevents issue where button state changes but checkbox/radio checked state
7290	+ // does not in Firefox (see ticket #6970)
7291	+ this.buttonElement
7292	+ .bind( "mousedown" + this.eventNamespace, function( event ) {
7293	+ if ( options.disabled ) {
7294	+ return;
7295	+ }
7296	+ clickDragged = false;
7297	+ startXPos = event.pageX;
7298	+ startYPos = event.pageY;
7299	+ })
7300	+ .bind( "mouseup" + this.eventNamespace, function( event ) {
7301	+ if ( options.disabled ) {
7302	+ return;
7303	+ }
7304	+ if ( startXPos !== event.pageX \|\| startYPos !== event.pageY ) {
7305	+ clickDragged = true;
7306	+ }
7307	+ });
7308	}
7309
7310	+ if ( this.type === "checkbox" ) {
7311	+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
7312	+ if ( options.disabled \|\| clickDragged ) {
7313	+ return false;
7314	+ }
7315	+ });
7316	+ } else if ( this.type === "radio" ) {
7317	+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
7318	+ if ( options.disabled \|\| clickDragged ) {
7319	+ return false;
7320	+ }
7321	+ $( this ).addClass( "ui-state-active" );
7322	+ that.buttonElement.attr( "aria-pressed", "true" );













7323
7324	+ var radio = that.element[ 0 ];
7325	+ radioGroup( radio )
7326	+ .not( radio )
7327	+ .map(function() {
7328	+ return $( this ).button( "widget" )[ 0 ];
7329	+ })
7330	+ .removeClass( "ui-state-active" )
7331	+ .attr( "aria-pressed", "false" );
7332	+ });
7333	+ } else {
7334	+ this.buttonElement
7335	+ .bind( "mousedown" + this.eventNamespace, function() {
7336	+ if ( options.disabled ) {
7337	+ return false;
7338	+ }
7339	+ $( this ).addClass( "ui-state-active" );
7340	+ lastActive = this;
7341	+ that.document.one( "mouseup", function() {
7342	+ lastActive = null;
7343	+ });
7344	+ })
7345	+ .bind( "mouseup" + this.eventNamespace, function() {
7346	+ if ( options.disabled ) {
7347	+ return false;
7348	+ }
7349	+ $( this ).removeClass( "ui-state-active" );
7350	+ })
7351	+ .bind( "keydown" + this.eventNamespace, function(event) {
7352	+ if ( options.disabled ) {
7353	+ return false;
7354	+ }
7355	+ if ( event.keyCode === $.ui.keyCode.SPACE \|\| event.keyCode === $.ui.keyCode.ENTER ) {
7356	+ $( this ).addClass( "ui-state-active" );
7357	+ }
7358	+ })
7359	+ // see #8559, we bind to blur here in case the button element loses
7360	+ // focus between keydown and keyup, it would be left in an "active" state
7361	+ .bind( "keyup" + this.eventNamespace + " blur" + this.eventNamespace, function() {
7362	+ $( this ).removeClass( "ui-state-active" );
7363	+ });
7364
7365	+ if ( this.buttonElement.is("a") ) {
7366	+ this.buttonElement.keyup(function(event) {
7367	+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
7368	+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
7369	+ $( this ).click();
7370	+ }
7371	+ });
7372	+ }
7373	}













7374
7375	+ // TODO: pull out $.Widget's handling for the disabled option into
7376	+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
7377	+ // be overridden by individual plugins
7378	+ this._setOption( "disabled", options.disabled );
7379	+ this._resetButton();
7380	},
7381
7382	+ _determineButtonType: function() {
7383	+ var ancestor, labelSelector, checked;

7384
7385	+ if ( this.element.is("[type=checkbox]") ) {
7386	+ this.type = "checkbox";
7387	+ } else if ( this.element.is("[type=radio]") ) {
7388	+ this.type = "radio";
7389	+ } else if ( this.element.is("input") ) {
7390	+ this.type = "input";
7391	+ } else {
7392	+ this.type = "button";
7393	+ }
7394
7395	+ if ( this.type === "checkbox" \|\| this.type === "radio" ) {
7396	+ // we don't search against the document in case the element
7397	+ // is disconnected from the DOM
7398	+ ancestor = this.element.parents().last();
7399	+ labelSelector = "label[for='" + this.element.attr("id") + "']";
7400	+ this.buttonElement = ancestor.find( labelSelector );
7401	+ if ( !this.buttonElement.length ) {
7402	+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
7403	+ this.buttonElement = ancestor.filter( labelSelector );
7404	+ if ( !this.buttonElement.length ) {
7405	+ this.buttonElement = ancestor.find( labelSelector );
7406	+ }
7407	+ }
7408	+ this.element.addClass( "ui-helper-hidden-accessible" );
7409
7410	+ checked = this.element.is( ":checked" );
7411	+ if ( checked ) {
7412	+ this.buttonElement.addClass( "ui-state-active" );
7413	+ }
7414	+ this.buttonElement.prop( "aria-pressed", checked );
7415	+ } else {
7416	+ this.buttonElement = this.element;
7417	+ }
7418	},
7419	+
7420	+ widget: function() {
7421	+ return this.buttonElement;
7422	},
7423
7424	+ _destroy: function() {
7425	+ this.element
7426	+ .removeClass( "ui-helper-hidden-accessible" );
7427	+ this.buttonElement
7428	+ .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
7429	+ .removeAttr( "role" )
7430	+ .removeAttr( "aria-pressed" )
7431	+ .html( this.buttonElement.find(".ui-button-text").html() );
7432
7433	+ if ( !this.hasTitle ) {
7434	+ this.buttonElement.removeAttr( "title" );




7435	}
7436	+ },
7437
7438	+ _setOption: function( key, value ) {
7439	+ this._super( key, value );
7440	+ if ( key === "disabled" ) {
7441	+ if ( value ) {
7442	+ this.element.prop( "disabled", true );
7443	+ } else {
7444	+ this.element.prop( "disabled", false );
7445	+ }
7446	+ return;
7447	}
7448	+ this._resetButton();
7449	+ },
7450
7451	+ refresh: function() {
7452	+ //See #8237 & #8828
7453	+ var isDisabled = this.element.is( "input, button" ) ? this.element.is( ":disabled" ) : this.element.hasClass( "ui-button-disabled" );
7454
7455	+ if ( isDisabled !== this.options.disabled ) {
7456	+ this._setOption( "disabled", isDisabled );
7457	+ }
7458	+ if ( this.type === "radio" ) {
7459	+ radioGroup( this.element[0] ).each(function() {
7460	+ if ( $( this ).is( ":checked" ) ) {
7461	+ $( this ).button( "widget" )
7462	+ .addClass( "ui-state-active" )
7463	+ .attr( "aria-pressed", "true" );
7464	+ } else {
7465	+ $( this ).button( "widget" )
7466	+ .removeClass( "ui-state-active" )
7467	+ .attr( "aria-pressed", "false" );
7468	+ }
7469	+ });
7470	+ } else if ( this.type === "checkbox" ) {
7471	+ if ( this.element.is( ":checked" ) ) {
7472	+ this.buttonElement
7473	+ .addClass( "ui-state-active" )
7474	+ .attr( "aria-pressed", "true" );
7475	+ } else {
7476	+ this.buttonElement
7477	+ .removeClass( "ui-state-active" )
7478	+ .attr( "aria-pressed", "false" );
7479	+ }
7480	+ }
7481	},
7482
7483	+ _resetButton: function() {
7484	+ if ( this.type === "input" ) {
7485	+ if ( this.options.label ) {
7486	+ this.element.val( this.options.label );
7487	+ }
7488	+ return;


7489	}
7490	+ var buttonElement = this.buttonElement.removeClass( typeClasses ),
7491	+ buttonText = $( "<span></span>", this.document[0] )
7492	+ .addClass( "ui-button-text" )
7493	+ .html( this.options.label )
7494	+ .appendTo( buttonElement.empty() )
7495	+ .text(),
7496	+ icons = this.options.icons,
7497	+ multipleIcons = icons.primary && icons.secondary,
7498	+ buttonClasses = [];
7499
7500	+ if ( icons.primary \|\| icons.secondary ) {
7501	+ if ( this.options.text ) {
7502	+ buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
7503	+ }
7504
7505	+ if ( icons.primary ) {
7506	+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
7507	+ }
7508
7509	+ if ( icons.secondary ) {
7510	+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );


7511	}
7512
7513	+ if ( !this.options.text ) {
7514	+ buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
7515	+
7516	+ if ( !this.hasTitle ) {
7517	+ buttonElement.attr( "title", $.trim( buttonText ) );







7518	}
7519	}
7520	} else {
7521	+ buttonClasses.push( "ui-button-text-only" );




















7522	}
7523	+ buttonElement.addClass( buttonClasses.join( " " ) );
7524	+ }
7525	+ });
7526
7527	+ $.widget( "ui.buttonset", {
7528	+ version: "1.10.2",
7529	+ options: {
7530	+ items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"
7531	},
7532
7533	+ _create: function() {
7534	+ this.element.addClass( "ui-buttonset" );
7535	+ },







7536
7537	+ _init: function() {
7538	+ this.refresh();
7539	},
7540
7541	+ _setOption: function( key, value ) {
7542	+ if ( key === "disabled" ) {
7543	+ this.buttons.button( "option", key, value );



7544	}
7545
7546	+ this._super( key, value );
7547	},
7548
7549	+ refresh: function() {
7550	+ var rtl = this.element.css( "direction" ) === "rtl";









7551
7552	+ this.buttons = this.element.find( this.options.items )
7553	+ .filter( ":ui-button" )
7554	+ .button( "refresh" )
7555	+ .end()
7556	+ .not( ":ui-button" )
7557	+ .button()
7558	+ .end()
7559	+ .map(function() {
7560	+ return $( this ).button( "widget" )[ 0 ];
7561	+ })
7562	+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
7563	+ .filter( ":first" )
7564	+ .addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
7565	+ .end()
7566	+ .filter( ":last" )
7567	+ .addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
7568	+ .end()
7569	+ .end();

7570	},
7571
7572	+ _destroy: function() {
7573	+ this.element.removeClass( "ui-buttonset" );
7574	+ this.buttons
7575	+ .map(function() {
7576	+ return $( this ).button( "widget" )[ 0 ];
7577	+ })
7578	+ .removeClass( "ui-corner-left ui-corner-right" )
7579	+ .end()
7580	+ .button( "destroy" );
7581	+ }
7582	+ });
7583
7584	+ }( jQuery ) );


7585
7586	+ (function( $, undefined ) {
7587
7588	+ $.extend($.ui, { datepicker: { version: "1.10.2" } });


































7589
7590	+ var PROP_NAME = "datepicker",
7591	+ dpuuid = new Date().getTime(),
7592	+ instActive;


7593
7594	+ /* Date picker manager.
7595	+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
7596	+ Settings for (groups of) date pickers are maintained in an instance object,
7597	+ allowing multiple different settings on the same page. */
7598
7599	+ function Datepicker() {
7600	+ this._curInst = null; // The current instance in use
7601	+ this._keyEvent = false; // If the last event was a key event
7602	+ this._disabledInputs = []; // List of date picker inputs that have been disabled
7603	+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
7604	+ this._inDialog = false; // True if showing within a "dialog", false if not
7605	+ this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
7606	+ this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
7607	+ this._appendClass = "ui-datepicker-append"; // The name of the append marker class
7608	+ this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
7609	+ this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
7610	+ this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
7611	+ this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
7612	+ this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
7613	+ this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
7614	+ this.regional = []; // Available regional settings, indexed by language code
7615	+ this.regional[""] = { // Default regional settings
7616	+ closeText: "Done", // Display text for close link
7617	+ prevText: "Prev", // Display text for previous month link
7618	+ nextText: "Next", // Display text for next month link
7619	+ currentText: "Today", // Display text for current month link
7620	+ monthNames: ["January","February","March","April","May","June",
7621	+ "July","August","September","October","November","December"], // Names of months for drop-down and formatting
7622	+ monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting
7623	+ dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting
7624	+ dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting
7625	+ dayNamesMin: ["Su","Mo","Tu","We","Th","Fr","Sa"], // Column headings for days starting at Sunday
7626	+ weekHeader: "Wk", // Column header for week of the year
7627	+ dateFormat: "mm/dd/yy", // See format options on parseDate
7628	+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
7629	+ isRTL: false, // True if right-to-left language, false if left-to-right
7630	+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
7631	+ yearSuffix: "" // Additional text to append to the year in the month headers
7632	+ };
7633	+ this._defaults = { // Global defaults for all the date picker instances
7634	+ showOn: "focus", // "focus" for popup on focus,
7635	+ // "button" for trigger button, or "both" for either
7636	+ showAnim: "fadeIn", // Name of jQuery animation for popup
7637	+ showOptions: {}, // Options for enhanced animations
7638	+ defaultDate: null, // Used when field is blank: actual date,
7639	+ // +/-number for offset from today, null for today
7640	+ appendText: "", // Display text following the input box, e.g. showing the format
7641	+ buttonText: "...", // Text for trigger button
7642	+ buttonImage: "", // URL for trigger button image
7643	+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
7644	+ hideIfNoPrevNext: false, // True to hide next/previous month links
7645	+ // if not applicable, false to just disable them
7646	+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
7647	+ gotoCurrent: false, // True if today link goes back to current selection instead
7648	+ changeMonth: false, // True if month can be selected directly, false if only prev/next
7649	+ changeYear: false, // True if year can be selected directly, false if only prev/next
7650	+ yearRange: "c-10:c+10", // Range of years to display in drop-down,
7651	+ // either relative to today's year (-nn:+nn), relative to currently displayed year
7652	+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
7653	+ showOtherMonths: false, // True to show dates in other months, false to leave blank
7654	+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
7655	+ showWeek: false, // True to show week of the year, false to not show it
7656	+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
7657	+ // takes a Date and returns the number of the week for it
7658	+ shortYearCutoff: "+10", // Short year values < this are in the current century,
7659	+ // > this are in the previous century,
7660	+ // string value starting with "+" for current year + value
7661	+ minDate: null, // The earliest selectable date, or null for no limit
7662	+ maxDate: null, // The latest selectable date, or null for no limit
7663	+ duration: "fast", // Duration of display/closure
7664	+ beforeShowDay: null, // Function that takes a date and returns an array with
7665	+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
7666	+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
7667	+ beforeShow: null, // Function that takes an input field and
7668	+ // returns a set of custom settings for the date picker
7669	+ onSelect: null, // Define a callback function when a date is selected
7670	+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
7671	+ onClose: null, // Define a callback function when the datepicker is closed
7672	+ numberOfMonths: 1, // Number of months to show at a time
7673	+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
7674	+ stepMonths: 1, // Number of months to step back/forward
7675	+ stepBigMonths: 12, // Number of months to step back/forward for the big links
7676	+ altField: "", // Selector for an alternate field to store selected dates into
7677	+ altFormat: "", // The date format to use for the alternate field
7678	+ constrainInput: true, // The input is constrained by the current date format
7679	+ showButtonPanel: false, // True to show button panel, false to not show it
7680	+ autoSize: false, // True to size the input for the date format, false to leave as is
7681	+ disabled: false // The initial disabled state
7682	+ };
7683	+ $.extend(this._defaults, this.regional[""]);
7684	+ this.dpDiv = bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"));
7685	+ }
7686
7687	+ $.extend(Datepicker.prototype, {
7688	+ /* Class name added to elements to indicate already configured with a date picker. */
7689	+ markerClassName: "hasDatepicker",
7690
7691	+ //Keep track of the maximum number of rows displayed (see #7043)
7692	+ maxRows: 4,






7693
7694	+ // TODO rename to "widget" when switching to widget factory
7695	+ _widgetDatepicker: function() {
7696	+ return this.dpDiv;
7697	},












7698
7699	+ /* Override the default settings for all instances of the date picker.
7700	+ * @param settings object - the new settings to use as defaults (anonymous object)
7701	+ * @return the manager object
7702	+ */
7703	+ setDefaults: function(settings) {
7704	+ extendRemove(this._defaults, settings \|\| {});
7705	+ return this;
7706	+ },
7707
7708	+ /* Attach the date picker to a jQuery selection.
7709	+ * @param target element - the target input field or division or span
7710	+ * @param settings object - the new settings to use for this date picker instance (anonymous)
7711	+ */
7712	+ _attachDatepicker: function(target, settings) {
7713	+ var nodeName, inline, inst;
7714	+ nodeName = target.nodeName.toLowerCase();
7715	+ inline = (nodeName === "div" \|\| nodeName === "span");
7716	+ if (!target.id) {
7717	+ this.uuid += 1;
7718	+ target.id = "dp" + this.uuid;
7719	+ }
7720	+ inst = this._newInst($(target), inline);
7721	+ inst.settings = $.extend({}, settings \|\| {});
7722	+ if (nodeName === "input") {
7723	+ this._connectDatepicker(target, inst);
7724	+ } else if (inline) {
7725	+ this._inlineDatepicker(target, inst);
7726	+ }
7727	},
7728
7729	+ /* Create a new instance object. */
7730	+ _newInst: function(target, inline) {
7731	+ var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars
7732	+ return {id: id, input: target, // associated target
7733	+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
7734	+ drawMonth: 0, drawYear: 0, // month being drawn
7735	+ inline: inline, // is datepicker inline or not
7736	+ dpDiv: (!inline ? this.dpDiv : // presentation div
7737	+ bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))};
7738	},
7739
7740	+ /* Attach the date picker to an input field. */
7741	+ _connectDatepicker: function(target, inst) {
7742	+ var input = $(target);
7743	+ inst.append = $([]);
7744	+ inst.trigger = $([]);
7745	+ if (input.hasClass(this.markerClassName)) {
7746	+ return;
7747	+ }
7748	+ this._attachments(input, inst);
7749	+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
7750	+ keypress(this._doKeyPress).keyup(this._doKeyUp);
7751	+ this._autoSize(inst);
7752	+ $.data(target, PROP_NAME, inst);
7753	+ //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
7754	+ if( inst.settings.disabled ) {
7755	+ this._disableDatepicker( target );
7756	+ }
7757	},












7758
7759	+ /* Make attachments based on settings. */
7760	+ _attachments: function(input, inst) {
7761	+ var showOn, buttonText, buttonImage,
7762	+ appendText = this._get(inst, "appendText"),
7763	+ isRTL = this._get(inst, "isRTL");




























7764
7765	+ if (inst.append) {
7766	+ inst.append.remove();
7767	+ }
7768	+ if (appendText) {
7769	+ inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>");
7770	+ input[isRTL ? "before" : "after"](inst.append);






7771	}


























7772
7773	+ input.unbind("focus", this._showDatepicker);


7774
7775	+ if (inst.trigger) {
7776	+ inst.trigger.remove();
7777	+ }
7778
7779	+ showOn = this._get(inst, "showOn");
7780	+ if (showOn === "focus" \|\| showOn === "both") { // pop-up date picker when in the marked field
7781	+ input.focus(this._showDatepicker);
7782	+ }
7783	+ if (showOn === "button" \|\| showOn === "both") { // pop-up date picker when button clicked
7784	+ buttonText = this._get(inst, "buttonText");
7785	+ buttonImage = this._get(inst, "buttonImage");
7786	+ inst.trigger = $(this._get(inst, "buttonImageOnly") ?
7787	+ $("<img/>").addClass(this._triggerClass).
7788	+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
7789	+ $("<button type='button'></button>").addClass(this._triggerClass).
7790	+ html(!buttonImage ? buttonText : $("<img/>").attr(
7791	+ { src:buttonImage, alt:buttonText, title:buttonText })));
7792	+ input[isRTL ? "before" : "after"](inst.trigger);
7793	+ inst.trigger.click(function() {
7794	+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
7795	+ $.datepicker._hideDatepicker();
7796	+ } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
7797	+ $.datepicker._hideDatepicker();
7798	+ $.datepicker._showDatepicker(input[0]);
7799	+ } else {
7800	+ $.datepicker._showDatepicker(input[0]);
7801	+ }
7802	+ return false;
7803	+ });
7804	+ }
7805	},
7806
7807	+ /* Apply the maximum length for the date format. */
7808	+ _autoSize: function(inst) {
7809	+ if (this._get(inst, "autoSize") && !inst.inline) {
7810	+ var findMax, max, maxI, i,
7811	+ date = new Date(2009, 12 - 1, 20), // Ensure double digits
7812	+ dateFormat = this._get(inst, "dateFormat");
7813
7814	+ if (dateFormat.match(/[DM]/)) {
7815	+ findMax = function(names) {
7816	+ max = 0;
7817	+ maxI = 0;
7818	+ for (i = 0; i < names.length; i++) {
7819	+ if (names[i].length > max) {
7820	+ max = names[i].length;
7821	+ maxI = i;
7822	+ }
7823	+ }
7824	+ return maxI;
7825	+ };
7826	+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
7827	+ "monthNames" : "monthNamesShort"))));
7828	+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
7829	+ "dayNames" : "dayNamesShort"))) + 20 - date.getDay());
7830	}
7831	+ inst.input.attr("size", this._formatDate(inst, date).length);



7832	}
7833	},
7834
7835	+ /* Attach an inline date picker to a div. */
7836	+ _inlineDatepicker: function(target, inst) {
7837	+ var divSpan = $(target);
7838	+ if (divSpan.hasClass(this.markerClassName)) {
7839	+ return;
7840	+ }
7841	+ divSpan.addClass(this.markerClassName).append(inst.dpDiv);
7842	+ $.data(target, PROP_NAME, inst);
7843	+ this._setDate(inst, this._getDefaultDate(inst), true);
7844	+ this._updateDatepicker(inst);
7845	+ this._updateAlternate(inst);
7846	+ //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
7847	+ if( inst.settings.disabled ) {
7848	+ this._disableDatepicker( target );
7849	+ }
7850	+ // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
7851	+ // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
7852	+ inst.dpDiv.css( "display", "block" );
7853	},
7854
7855	+ /* Pop-up the date picker in a "dialog" box.
7856	+ * @param input element - ignored
7857	+ * @param date string or Date - the initial date to display
7858	+ * @param onSelect function - the function to call when a date is selected
7859	+ * @param settings object - update the dialog date picker instance's settings (anonymous object)
7860	+ * @param pos int[2] - coordinates for the dialog's position within the screen or
7861	+ * event - with x/y coordinates or
7862	+ * leave empty for default (screen centre)
7863	+ * @return the manager object
7864	+ */
7865	+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
7866	+ var id, browserWidth, browserHeight, scrollX, scrollY,
7867	+ inst = this._dialogInst; // internal instance
7868
7869	+ if (!inst) {
7870	+ this.uuid += 1;
7871	+ id = "dp" + this.uuid;
7872	+ this._dialogInput = $("<input type='text' id='" + id +
7873	+ "' style='position: absolute; top: -100px; width: 0px;'/>");
7874	+ this._dialogInput.keydown(this._doKeyDown);
7875	+ $("body").append(this._dialogInput);
7876	+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
7877	+ inst.settings = {};
7878	+ $.data(this._dialogInput[0], PROP_NAME, inst);
7879	+ }
7880	+ extendRemove(inst.settings, settings \|\| {});
7881	+ date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
7882	+ this._dialogInput.val(date);
7883
7884	+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
7885	+ if (!this._pos) {
7886	+ browserWidth = document.documentElement.clientWidth;
7887	+ browserHeight = document.documentElement.clientHeight;
7888	+ scrollX = document.documentElement.scrollLeft \|\| document.body.scrollLeft;
7889	+ scrollY = document.documentElement.scrollTop \|\| document.body.scrollTop;
7890	+ this._pos = // should use actual width/height below
7891	+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
7892	+ }
7893
7894	+ // move input on screen for focus, but hidden behind dialog
7895	+ this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px");
7896	+ inst.settings.onSelect = onSelect;
7897	+ this._inDialog = true;
7898	+ this.dpDiv.addClass(this._dialogClass);
7899	+ this._showDatepicker(this._dialogInput[0]);
7900	+ if ($.blockUI) {
7901	+ $.blockUI(this.dpDiv);
7902	+ }
7903	+ $.data(this._dialogInput[0], PROP_NAME, inst);
7904	+ return this;
7905	},
7906
7907	+ /* Detach a datepicker from its control.
7908	+ * @param target element - the target input field or division or span
7909	+ */
7910	+ _destroyDatepicker: function(target) {
7911	+ var nodeName,
7912	+ $target = $(target),
7913	+ inst = $.data(target, PROP_NAME);
7914
7915	+ if (!$target.hasClass(this.markerClassName)) {
7916	+ return;
7917	+ }


















7918
7919	+ nodeName = target.nodeName.toLowerCase();
7920	+ $.removeData(target, PROP_NAME);
7921	+ if (nodeName === "input") {
7922	+ inst.append.remove();
7923	+ inst.trigger.remove();
7924	+ $target.removeClass(this.markerClassName).
7925	+ unbind("focus", this._showDatepicker).
7926	+ unbind("keydown", this._doKeyDown).
7927	+ unbind("keypress", this._doKeyPress).
7928	+ unbind("keyup", this._doKeyUp);
7929	+ } else if (nodeName === "div" \|\| nodeName === "span") {
7930	+ $target.removeClass(this.markerClassName).empty();
7931	+ }
7932	+ },















7933
7934	+ /* Enable the date picker to a jQuery selection.
7935	+ * @param target element - the target input field or division or span
7936	+ */
7937	+ _enableDatepicker: function(target) {
7938	+ var nodeName, inline,
7939	+ $target = $(target),
7940	+ inst = $.data(target, PROP_NAME);

























7941
7942	+ if (!$target.hasClass(this.markerClassName)) {
7943	+ return;
7944	+ }

7945
7946	+ nodeName = target.nodeName.toLowerCase();
7947	+ if (nodeName === "input") {
7948	+ target.disabled = false;
7949	+ inst.trigger.filter("button").
7950	+ each(function() { this.disabled = false; }).end().
7951	+ filter("img").css({opacity: "1.0", cursor: ""});
7952	+ } else if (nodeName === "div" \|\| nodeName === "span") {
7953	+ inline = $target.children("." + this._inlineClass);
7954	+ inline.children().removeClass("ui-state-disabled");
7955	+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
7956	+ prop("disabled", false);
7957	+ }
7958	+ this._disabledInputs = $.map(this._disabledInputs,
7959	+ function(value) { return (value === target ? null : value); }); // delete entry
7960	+ },
7961
7962	+ /* Disable the date picker to a jQuery selection.
7963	+ * @param target element - the target input field or division or span
7964	+ */
7965	+ _disableDatepicker: function(target) {
7966	+ var nodeName, inline,
7967	+ $target = $(target),
7968	+ inst = $.data(target, PROP_NAME);
7969
7970	+ if (!$target.hasClass(this.markerClassName)) {
7971	+ return;
7972	+ }




7973
7974	+ nodeName = target.nodeName.toLowerCase();
7975	+ if (nodeName === "input") {
7976	+ target.disabled = true;
7977	+ inst.trigger.filter("button").
7978	+ each(function() { this.disabled = true; }).end().
7979	+ filter("img").css({opacity: "0.5", cursor: "default"});
7980	+ } else if (nodeName === "div" \|\| nodeName === "span") {
7981	+ inline = $target.children("." + this._inlineClass);
7982	+ inline.children().addClass("ui-state-disabled");
7983	+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
7984	+ prop("disabled", true);
7985	+ }
7986	+ this._disabledInputs = $.map(this._disabledInputs,
7987	+ function(value) { return (value === target ? null : value); }); // delete entry
7988	+ this._disabledInputs[this._disabledInputs.length] = target;
7989	+ },
7990
7991	+ /* Is the first field in a jQuery collection disabled as a datepicker?
7992	+ * @param target element - the target input field or division or span
7993	+ * @return boolean - true if disabled, false if enabled
7994	+ */
7995	+ _isDisabledDatepicker: function(target) {
7996	+ if (!target) {
7997	+ return false;
7998	+ }
7999	+ for (var i = 0; i < this._disabledInputs.length; i++) {
8000	+ if (this._disabledInputs[i] === target) {
8001	+ return true;
8002	}
8003	+ }
8004	+ return false;
8005	+ },
8006
8007	+ /* Retrieve the instance data for the target control.
8008	+ * @param target element - the target input field or division or span
8009	+ * @return object - the associated instance data
8010	+ * @throws error if a jQuery problem getting data
8011	+ */
8012	+ _getInst: function(target) {
8013	+ try {
8014	+ return $.data(target, PROP_NAME);
8015	+ }
8016	+ catch (err) {
8017	+ throw "Missing instance data for this datepicker";
8018	}
8019	+ },
8020
8021	+ /* Update or retrieve the settings for a date picker attached to an input field or division.
8022	+ * @param target element - the target input field or division or span
8023	+ * @param name object - the new settings to update or
8024	+ * string - the name of the setting to change or retrieve,
8025	+ * when retrieving also "all" for all instance settings or
8026	+ * "defaults" for all global defaults
8027	+ * @param value any - the new value for the setting
8028	+ * (omit if above is an object or to retrieve a value)
8029	+ */
8030	+ _optionDatepicker: function(target, name, value) {
8031	+ var settings, date, minDate, maxDate,
8032	+ inst = this._getInst(target);
8033
8034	+ if (arguments.length === 2 && typeof name === "string") {
8035	+ return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
8036	+ (inst ? (name === "all" ? $.extend({}, inst.settings) :
8037	+ this._get(inst, name)) : null));
8038	}
8039
8040	+ settings = name \|\| {};
8041	+ if (typeof name === "string") {
8042	+ settings = {};
8043	+ settings[name] = value;

8044	}
8045
8046	+ if (inst) {
8047	+ if (this._curInst === inst) {
8048	+ this._hideDatepicker();
8049	+ }



8050
8051	+ date = this._getDateDatepicker(target, true);
8052	+ minDate = this._getMinMaxDate(inst, "min");
8053	+ maxDate = this._getMinMaxDate(inst, "max");
8054	+ extendRemove(inst.settings, settings);
8055	+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
8056	+ if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) {
8057	+ inst.settings.minDate = this._formatDate(inst, minDate);
8058	+ }
8059	+ if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) {
8060	+ inst.settings.maxDate = this._formatDate(inst, maxDate);
8061	+ }
8062	+ if ( "disabled" in settings ) {
8063	+ if ( settings.disabled ) {
8064	+ this._disableDatepicker(target);
8065	+ } else {
8066	+ this._enableDatepicker(target);
8067	}
8068	+ }
8069	+ this._attachments($(target), inst);
8070	+ this._autoSize(inst);
8071	+ this._setDate(inst, date);
8072	+ this._updateAlternate(inst);
8073	+ this._updateDatepicker(inst);










8074	}
8075	+ },
8076
8077	+ // change method deprecated
8078	+ _changeDatepicker: function(target, name, value) {
8079	+ this._optionDatepicker(target, name, value);
8080	+ },
8081	+
8082	+ /* Redraw the date picker attached to an input field or division.
8083	+ * @param target element - the target input field or division or span
8084	+ */
8085	+ _refreshDatepicker: function(target) {
8086	+ var inst = this._getInst(target);
8087	+ if (inst) {
8088	+ this._updateDatepicker(inst);
8089	}
8090	+ },
8091
8092	+ /* Set the dates for a jQuery selection.
8093	+ * @param target element - the target input field or division or span
8094	+ * @param date Date - the new date
8095	+ */
8096	+ _setDateDatepicker: function(target, date) {
8097	+ var inst = this._getInst(target);
8098	+ if (inst) {
8099	+ this._setDate(inst, date);
8100	+ this._updateDatepicker(inst);
8101	+ this._updateAlternate(inst);
8102	}
8103	+ },
8104
8105	+ /* Get the date(s) for the first entry in a jQuery selection.
8106	+ * @param target element - the target input field or division or span
8107	+ * @param noDefault boolean - true if no default date is to be used
8108	+ * @return Date - the current date
8109	+ */
8110	+ _getDateDatepicker: function(target, noDefault) {
8111	+ var inst = this._getInst(target);
8112	+ if (inst && !inst.inline) {
8113	+ this._setDateFromField(inst, noDefault);
8114	+ }
8115	+ return (inst ? this._getDate(inst) : null);
8116	+ },



8117
8118	+ /* Handle keystrokes. */
8119	+ _doKeyDown: function(event) {
8120	+ var onSelect, dateStr, sel,
8121	+ inst = $.datepicker._getInst(event.target),
8122	+ handled = true,
8123	+ isRTL = inst.dpDiv.is(".ui-datepicker-rtl");









8124
8125	+ inst._keyEvent = true;
8126	+ if ($.datepicker._datepickerShowing) {
8127	+ switch (event.keyCode) {
8128	+ case 9: $.datepicker._hideDatepicker();
8129	+ handled = false;
8130	+ break; // hide on tab out
8131	+ case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." +
8132	+ $.datepicker._currentClass + ")", inst.dpDiv);
8133	+ if (sel[0]) {
8134	+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
8135	+ }








8136
8137	+ onSelect = $.datepicker._get(inst, "onSelect");
8138	+ if (onSelect) {
8139	+ dateStr = $.datepicker._formatDate(inst);
8140
8141	+ // trigger custom callback
8142	+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
8143	+ } else {
8144	+ $.datepicker._hideDatepicker();
8145	+ }
8146
8147	+ return false; // don't submit the form
8148	+ case 27: $.datepicker._hideDatepicker();
8149	+ break; // hide on escape
8150	+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
8151	+ -$.datepicker._get(inst, "stepBigMonths") :
8152	+ -$.datepicker._get(inst, "stepMonths")), "M");
8153	+ break; // previous month/year on page up/+ ctrl
8154	+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
8155	+ +$.datepicker._get(inst, "stepBigMonths") :
8156	+ +$.datepicker._get(inst, "stepMonths")), "M");
8157	+ break; // next month/year on page down/+ ctrl
8158	+ case 35: if (event.ctrlKey \|\| event.metaKey) {
8159	+ $.datepicker._clearDate(event.target);
8160	+ }
8161	+ handled = event.ctrlKey \|\| event.metaKey;
8162	+ break; // clear on ctrl or command +end
8163	+ case 36: if (event.ctrlKey \|\| event.metaKey) {
8164	+ $.datepicker._gotoToday(event.target);
8165	+ }
8166	+ handled = event.ctrlKey \|\| event.metaKey;
8167	+ break; // current on ctrl or command +home
8168	+ case 37: if (event.ctrlKey \|\| event.metaKey) {
8169	+ $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
8170	+ }
8171	+ handled = event.ctrlKey \|\| event.metaKey;
8172	+ // -1 day on ctrl or command +left
8173	+ if (event.originalEvent.altKey) {
8174	+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
8175	+ -$.datepicker._get(inst, "stepBigMonths") :
8176	+ -$.datepicker._get(inst, "stepMonths")), "M");
8177	+ }
8178	+ // next month/year on alt +left on Mac
8179	+ break;
8180	+ case 38: if (event.ctrlKey \|\| event.metaKey) {
8181	+ $.datepicker._adjustDate(event.target, -7, "D");
8182	+ }
8183	+ handled = event.ctrlKey \|\| event.metaKey;
8184	+ break; // -1 week on ctrl or command +up
8185	+ case 39: if (event.ctrlKey \|\| event.metaKey) {
8186	+ $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
8187	+ }
8188	+ handled = event.ctrlKey \|\| event.metaKey;
8189	+ // +1 day on ctrl or command +right
8190	+ if (event.originalEvent.altKey) {
8191	+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
8192	+ +$.datepicker._get(inst, "stepBigMonths") :
8193	+ +$.datepicker._get(inst, "stepMonths")), "M");
8194	+ }
8195	+ // next month/year on alt +right
8196	+ break;
8197	+ case 40: if (event.ctrlKey \|\| event.metaKey) {
8198	+ $.datepicker._adjustDate(event.target, +7, "D");
8199	+ }
8200	+ handled = event.ctrlKey \|\| event.metaKey;
8201	+ break; // +1 week on ctrl or command +down
8202	+ default: handled = false;
8203	+ }
8204	+ } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home
8205	+ $.datepicker._showDatepicker(this);
8206	+ } else {
8207	+ handled = false;
8208	+ }
8209
8210	+ if (handled) {
8211	+ event.preventDefault();
8212	+ event.stopPropagation();
8213	+ }
8214	+ },
8215
8216	+ /* Filter entered characters - based on date format. */
8217	+ _doKeyPress: function(event) {
8218	+ var chars, chr,
8219	+ inst = $.datepicker._getInst(event.target);
8220
8221	+ if ($.datepicker._get(inst, "constrainInput")) {
8222	+ chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
8223	+ chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode);
8224	+ return event.ctrlKey \|\| event.metaKey \|\| (chr < " " \|\| !chars \|\| chars.indexOf(chr) > -1);
8225	+ }
8226	+ },
8227
8228	+ /* Synchronise manual entry and field/alternate field. */
8229	+ _doKeyUp: function(event) {
8230	+ var date,
8231	+ inst = $.datepicker._getInst(event.target);
8232
8233	+ if (inst.input.val() !== inst.lastVal) {
8234	+ try {
8235	+ date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
8236	+ (inst.input ? inst.input.val() : null),
8237	+ $.datepicker._getFormatConfig(inst));
8238
8239	+ if (date) { // only if valid
8240	+ $.datepicker._setDateFromField(inst);
8241	+ $.datepicker._updateAlternate(inst);
8242	+ $.datepicker._updateDatepicker(inst);
8243	}
8244	}
8245	+ catch (err) {


8246	}
8247	+ }
8248	+ return true;
8249	+ },
8250
8251	+ /* Pop-up the date picker for a given input field.
8252	+ * If false returned from beforeShow event handler do not show.
8253	+ * @param input element - the input field attached to the date picker or
8254	+ * event - if triggered by focus
8255	+ */
8256	+ _showDatepicker: function(input) {
8257	+ input = input.target \|\| input;
8258	+ if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
8259	+ input = $("input", input.parentNode)[0];
8260	+ }





8261
8262	+ if ($.datepicker._isDisabledDatepicker(input) \|\| $.datepicker._lastInput === input) { // already here
8263	+ return;
8264	+ }





8265
8266	+ var inst, beforeShow, beforeShowSettings, isFixed,
8267	+ offset, showAnim, duration;



8268
8269	+ inst = $.datepicker._getInst(input);
8270	+ if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
8271	+ $.datepicker._curInst.dpDiv.stop(true, true);
8272	+ if ( inst && $.datepicker._datepickerShowing ) {
8273	+ $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
8274	+ }
8275	}
8276
8277	+ beforeShow = $.datepicker._get(inst, "beforeShow");
8278	+ beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
8279	+ if(beforeShowSettings === false){
8280	+ return;
8281	+ }
8282	+ extendRemove(inst.settings, beforeShowSettings);
8283
8284	+ inst.lastVal = null;
8285	+ $.datepicker._lastInput = input;
8286	+ $.datepicker._setDateFromField(inst);
8287
8288	+ if ($.datepicker._inDialog) { // hide cursor
8289	+ input.value = "";
8290	+ }
8291	+ if (!$.datepicker._pos) { // position below input
8292	+ $.datepicker._pos = $.datepicker._findPos(input);
8293	+ $.datepicker._pos[1] += input.offsetHeight; // add the height
8294	+ }
8295
8296	+ isFixed = false;
8297	+ $(input).parents().each(function() {
8298	+ isFixed \|= $(this).css("position") === "fixed";
8299	+ return !isFixed;
8300	+ });
8301
8302	+ offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
8303	+ $.datepicker._pos = null;
8304	+ //to avoid flashes on Firefox
8305	+ inst.dpDiv.empty();
8306	+ // determine sizing offscreen
8307	+ inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"});
8308	+ $.datepicker._updateDatepicker(inst);
8309	+ // fix width for dynamic number of date pickers
8310	+ // and adjust position before showing
8311	+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
8312	+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
8313	+ "static" : (isFixed ? "fixed" : "absolute")), display: "none",
8314	+ left: offset.left + "px", top: offset.top + "px"});
8315
8316	+ if (!inst.inline) {
8317	+ showAnim = $.datepicker._get(inst, "showAnim");
8318	+ duration = $.datepicker._get(inst, "duration");
8319	+ inst.dpDiv.zIndex($(input).zIndex()+1);
8320	+ $.datepicker._datepickerShowing = true;





8321
8322	+ if ( $.effects && $.effects.effect[ showAnim ] ) {
8323	+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);

8324	} else {
8325	+ inst.dpDiv[showAnim \|\| "show"](showAnim ? duration : null);












8326	}

8327
8328	+ if (inst.input.is(":visible") && !inst.input.is(":disabled")) {
8329	+ inst.input.focus();
8330	+ }
8331	+ $.datepicker._curInst = inst;
8332	}


8333	},
8334
8335	+ /* Generate the date picker content. */
8336	+ _updateDatepicker: function(inst) {
8337	+ this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
8338	+ instActive = inst; // for delegate hover events
8339	+ inst.dpDiv.empty().append(this._generateHTML(inst));
8340	+ this._attachHandlers(inst);
8341	+ inst.dpDiv.find("." + this._dayOverClass + " a").mouseover();
8342	+
8343	+ var origyearshtml,
8344	+ numMonths = this._getNumberOfMonths(inst),
8345	+ cols = numMonths[1],
8346	+ width = 17;
8347	+
8348	+ inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");
8349	+ if (cols > 1) {
8350	+ inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em");
8351	+ }
8352	+ inst.dpDiv[(numMonths[0] !== 1 \|\| numMonths[1] !== 1 ? "add" : "remove") +
8353	+ "Class"]("ui-datepicker-multi");
8354	+ inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
8355	+ "Class"]("ui-datepicker-rtl");
8356	+
8357	+ // #6694 - don't focus the input if it's already focused
8358	+ // this breaks the change event in IE
8359	+ if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
8360	+ inst.input.is(":visible") && !inst.input.is(":disabled") && inst.input[0] !== document.activeElement) {
8361	+ inst.input.focus();
8362	}

8363
8364	+ // deffered render of the years select (to avoid flashes on Firefox)
8365	+ if( inst.yearshtml ){
8366	+ origyearshtml = inst.yearshtml;
8367	+ setTimeout(function(){
8368	+ //assure that inst.yearshtml didn't change.
8369	+ if( origyearshtml === inst.yearshtml && inst.yearshtml ){
8370	+ inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml);
8371	+ }
8372	+ origyearshtml = inst.yearshtml = null;
8373	+ }, 0);
8374	}
8375	+ },
8376
8377	+ /* Retrieve the size of left and top borders for an element.
8378	+ * @param elem (jQuery object) the element of interest
8379	+ * @return (number[2]) the left and top borders
8380	+ */
8381	+ _getBorders: function(elem) {
8382	+ var convert = function(value) {
8383	+ return {thin: 1, medium: 2, thick: 3}[value] \|\| value;
8384	+ };
8385	+ return [parseFloat(convert(elem.css("border-left-width"))),
8386	+ parseFloat(convert(elem.css("border-top-width")))];
8387	+ },
8388
8389	+ /* Check positioning to remain on screen. */
8390	+ _checkOffset: function(inst, offset, isFixed) {
8391	+ var dpWidth = inst.dpDiv.outerWidth(),
8392	+ dpHeight = inst.dpDiv.outerHeight(),
8393	+ inputWidth = inst.input ? inst.input.outerWidth() : 0,
8394	+ inputHeight = inst.input ? inst.input.outerHeight() : 0,
8395	+ viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
8396	+ viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
8397
8398	+ offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
8399	+ offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0;
8400	+ offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;




8401
8402	+ // now check if datepicker is showing outside window viewport - move to a better place if so.
8403	+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
8404	+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
8405	+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
8406	+ Math.abs(dpHeight + inputHeight) : 0);
8407
8408	+ return offset;

8409	},
8410
8411	+ /* Find an object's position on the screen. */
8412	+ _findPos: function(obj) {
8413	+ var position,
8414	+ inst = this._getInst(obj),
8415	+ isRTL = this._get(inst, "isRTL");
8416
8417	+ while (obj && (obj.type === "hidden" \|\| obj.nodeType !== 1 \|\| $.expr.filters.hidden(obj))) {
8418	+ obj = obj[isRTL ? "previousSibling" : "nextSibling"];


8419	}
8420
8421	+ position = $(obj).offset();
8422	+ return [position.left, position.top];










8423	},
8424
8425	+ /* Hide the date picker from view.
8426	+ * @param input element - the input field attached to the date picker
8427	+ */
8428	+ _hideDatepicker: function(input) {
8429	+ var showAnim, duration, postProcess, onClose,
8430	+ inst = this._curInst;
8431	+
8432	+ if (!inst \|\| (input && inst !== $.data(input, PROP_NAME))) {
8433	return;
8434	}
8435
8436	+ if (this._datepickerShowing) {
8437	+ showAnim = this._get(inst, "showAnim");
8438	+ duration = this._get(inst, "duration");
8439	+ postProcess = function() {
8440	+ $.datepicker._tidyDialog(inst);
8441	+ };


8442
8443	+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
8444	+ if ( $.effects && ( $.effects.effect[ showAnim ] \|\| $.effects[ showAnim ] ) ) {
8445	+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess);
8446	+ } else {
8447	+ inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
8448	+ (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess);
8449	+ }
8450	+
8451	+ if (!showAnim) {
8452	+ postProcess();
8453	+ }
8454	+ this._datepickerShowing = false;
8455
8456	+ onClose = this._get(inst, "onClose");
8457	+ if (onClose) {
8458	+ onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]);
8459	+ }
8460
8461	+ this._lastInput = null;
8462	+ if (this._inDialog) {
8463	+ this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" });
8464	+ if ($.blockUI) {
8465	+ $.unblockUI();
8466	+ $("body").append(this.dpDiv);
8467	+ }
8468	+ }
8469	+ this._inDialog = false;
8470	}
8471	+ },
8472
8473	+ /* Tidy up after a dialog display. */
8474	+ _tidyDialog: function(inst) {
8475	+ inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar");
8476	},
8477
8478	+ /* Close date picker if clicked elsewhere. */
8479	+ _checkExternalClick: function(event) {
8480	+ if (!$.datepicker._curInst) {
8481	+ return;




8482	}



8483
8484	+ var $target = $(event.target),
8485	+ inst = $.datepicker._getInst($target[0]);
8486	+
8487	+ if ( ( ( $target[0].id !== $.datepicker._mainDivId &&
8488	+ $target.parents("#" + $.datepicker._mainDivId).length === 0 &&
8489	+ !$target.hasClass($.datepicker.markerClassName) &&
8490	+ !$target.closest("." + $.datepicker._triggerClass).length &&
8491	+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) \|\|
8492	+ ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst ) ) {
8493	+ $.datepicker._hideDatepicker();
8494	+ }
8495	+ },
8496
8497	+ /* Adjust one of the date sub-fields. */
8498	+ _adjustDate: function(id, offset, period) {
8499	+ var target = $(id),
8500	+ inst = this._getInst(target[0]);
8501
8502	+ if (this._isDisabledDatepicker(target[0])) {


8503	return;
8504	}
8505	+ this._adjustInstDate(inst, offset +
8506	+ (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning
8507	+ period);
8508	+ this._updateDatepicker(inst);
8509	+ },
8510
8511	+ /* Action for current link. */
8512	+ _gotoToday: function(id) {
8513	+ var date,
8514	+ target = $(id),
8515	+ inst = this._getInst(target[0]);
8516
8517	+ if (this._get(inst, "gotoCurrent") && inst.currentDay) {
8518	+ inst.selectedDay = inst.currentDay;
8519	+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
8520	+ inst.drawYear = inst.selectedYear = inst.currentYear;
8521	+ } else {
8522	+ date = new Date();
8523	+ inst.selectedDay = date.getDate();
8524	+ inst.drawMonth = inst.selectedMonth = date.getMonth();
8525	+ inst.drawYear = inst.selectedYear = date.getFullYear();
8526	}
8527	+ this._notifyChange(inst);
8528	+ this._adjustDate(target);
8529	+ },
8530
8531	+ /* Action for selecting a new month/year. */
8532	+ _selectMonthYear: function(id, select, period) {
8533	+ var target = $(id),
8534	+ inst = this._getInst(target[0]);
8535
8536	+ inst["selected" + (period === "M" ? "Month" : "Year")] =
8537	+ inst["draw" + (period === "M" ? "Month" : "Year")] =
8538	+ parseInt(select.options[select.selectedIndex].value,10);
8539
8540	+ this._notifyChange(inst);
8541	+ this._adjustDate(target);
8542	+ },
8543
8544	+ /* Action for selecting a day. */
8545	+ _selectDay: function(id, month, year, td) {
8546	+ var inst,
8547	+ target = $(id);





8548
8549	+ if ($(td).hasClass(this._unselectableClass) \|\| this._isDisabledDatepicker(target[0])) {
8550	+ return;
8551	+ }








8552
8553	+ inst = this._getInst(target[0]);
8554	+ inst.selectedDay = inst.currentDay = $("a", td).html();
8555	+ inst.selectedMonth = inst.currentMonth = month;
8556	+ inst.selectedYear = inst.currentYear = year;
8557	+ this._selectDate(id, this._formatDate(inst,
8558	+ inst.currentDay, inst.currentMonth, inst.currentYear));
8559	+ },
8560
8561	+ /* Erase the input field and hide the date picker. */
8562	+ _clearDate: function(id) {
8563	+ var target = $(id);
8564	+ this._selectDate(target, "");
8565	},
8566
8567	+ /* Update the input field with the selected date. */
8568	+ _selectDate: function(id, dateStr) {
8569	+ var onSelect,
8570	+ target = $(id),
8571	+ inst = this._getInst(target[0]);
8572
8573	+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
8574	+ if (inst.input) {
8575	+ inst.input.val(dateStr);
8576	+ }
8577	+ this._updateAlternate(inst);
8578
8579	+ onSelect = this._get(inst, "onSelect");
8580	+ if (onSelect) {
8581	+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
8582	+ } else if (inst.input) {
8583	+ inst.input.trigger("change"); // fire the change event
8584	}
8585
8586	+ if (inst.inline){
8587	+ this._updateDatepicker(inst);
8588	+ } else {
8589	+ this._hideDatepicker();
8590	+ this._lastInput = inst.input[0];
8591	+ if (typeof(inst.input[0]) !== "object") {
8592	+ inst.input.focus(); // restore focus
8593	+ }
8594	+ this._lastInput = null;
8595	+ }
8596	},
8597
8598	+ /* Update any alternate field to synchronise with the main field. */
8599	+ _updateAlternate: function(inst) {
8600	+ var altFormat, date, dateStr,
8601	+ altField = this._get(inst, "altField");
8602	+
8603	+ if (altField) { // update alternate field too
8604	+ altFormat = this._get(inst, "altFormat") \|\| this._get(inst, "dateFormat");
8605	+ date = this._getDate(inst);
8606	+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
8607	+ $(altField).each(function() { $(this).val(dateStr); });
8608	+ }
8609	},
8610
8611	+ /* Set as beforeShowDay function to prevent selection of weekends.
8612	+ * @param date Date - the date to customise
8613	+ * @return [boolean, string] - is this date selectable?, what is its CSS class?
8614	+ */
8615	+ noWeekends: function(date) {
8616	+ var day = date.getDay();
8617	+ return [(day > 0 && day < 6), ""];
8618	+ },
8619
8620	+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
8621	+ * @param date Date - the date to get the week for
8622	+ * @return number - the number of the week within the year that contains this date
8623	+ */
8624	+ iso8601Week: function(date) {
8625	+ var time,
8626	+ checkDate = new Date(date.getTime());
8627
8628	+ // Find Thursday of this week starting on Monday
8629	+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() \|\| 7));

8630
8631	+ time = checkDate.getTime();
8632	+ checkDate.setMonth(0); // Compare with Jan 1
8633	+ checkDate.setDate(1);
8634	+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
8635	+ },



8636
8637	+ /* Parse a string value into a date object.
8638	+ * See formatDate below for the possible formats.
8639	+ *
8640	+ * @param format string - the expected format of the date
8641	+ * @param value string - the date in the above format
8642	+ * @param settings Object - attributes include:
8643	+ * shortYearCutoff number - the cutoff year for determining the century (optional)
8644	+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
8645	+ * dayNames string[7] - names of the days from Sunday (optional)
8646	+ * monthNamesShort string[12] - abbreviated names of the months (optional)
8647	+ * monthNames string[12] - names of the months (optional)
8648	+ * @return Date - the extracted date value or null if value is blank
8649	+ */
8650	+ parseDate: function (format, value, settings) {
8651	+ if (format == null \|\| value == null) {
8652	+ throw "Invalid arguments";
8653	+ }
8654	+
8655	+ value = (typeof value === "object" ? value.toString() : value + "");
8656	+ if (value === "") {
8657	+ return null;
8658	+ }
8659	+
8660	+ var iFormat, dim, extra,
8661	+ iValue = 0,
8662	+ shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) \|\| this._defaults.shortYearCutoff,
8663	+ shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
8664	+ new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
8665	+ dayNamesShort = (settings ? settings.dayNamesShort : null) \|\| this._defaults.dayNamesShort,
8666	+ dayNames = (settings ? settings.dayNames : null) \|\| this._defaults.dayNames,
8667	+ monthNamesShort = (settings ? settings.monthNamesShort : null) \|\| this._defaults.monthNamesShort,
8668	+ monthNames = (settings ? settings.monthNames : null) \|\| this._defaults.monthNames,
8669	+ year = -1,
8670	+ month = -1,
8671	+ day = -1,
8672	+ doy = -1,
8673	+ literal = false,
8674	+ date,
8675	+ // Check whether a format character is doubled
8676	+ lookAhead = function(match) {
8677	+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
8678	+ if (matches) {
8679	+ iFormat++;
8680	+ }
8681	+ return matches;
8682	+ },
8683	+ // Extract a number from the string value
8684	+ getNumber = function(match) {
8685	+ var isDoubled = lookAhead(match),
8686	+ size = (match === "@" ? 14 : (match === "!" ? 20 :
8687	+ (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
8688	+ digits = new RegExp("^\\d{1," + size + "}"),
8689	+ num = value.substring(iValue).match(digits);
8690	+ if (!num) {
8691	+ throw "Missing number at position " + iValue;
8692	+ }
8693	+ iValue += num[0].length;
8694	+ return parseInt(num[0], 10);
8695	+ },
8696	+ // Extract a name from the string value and convert to an index
8697	+ getName = function(match, shortNames, longNames) {
8698	+ var index = -1,
8699	+ names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
8700	+ return [ [k, v] ];
8701	+ }).sort(function (a, b) {
8702	+ return -(a[1].length - b[1].length);
8703	+ });
8704	+
8705	+ $.each(names, function (i, pair) {
8706	+ var name = pair[1];
8707	+ if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
8708	+ index = pair[0];
8709	+ iValue += name.length;
8710	+ return false;
8711	+ }
8712	+ });
8713	+ if (index !== -1) {
8714	+ return index + 1;
8715	+ } else {
8716	+ throw "Unknown name at position " + iValue;
8717	+ }
8718	+ },
8719	+ // Confirm that a literal character matches the string value
8720	+ checkLiteral = function() {
8721	+ if (value.charAt(iValue) !== format.charAt(iFormat)) {
8722	+ throw "Unexpected literal at position " + iValue;
8723	+ }
8724	+ iValue++;
8725	+ };
8726
8727	+ for (iFormat = 0; iFormat < format.length; iFormat++) {
8728	+ if (literal) {
8729	+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
8730	+ literal = false;
8731	+ } else {
8732	+ checkLiteral();
8733	+ }
8734	+ } else {
8735	+ switch (format.charAt(iFormat)) {
8736	+ case "d":
8737	+ day = getNumber("d");
8738	+ break;
8739	+ case "D":
8740	+ getName("D", dayNamesShort, dayNames);
8741	+ break;
8742	+ case "o":
8743	+ doy = getNumber("o");
8744	+ break;
8745	+ case "m":
8746	+ month = getNumber("m");
8747	+ break;
8748	+ case "M":
8749	+ month = getName("M", monthNamesShort, monthNames);
8750	+ break;
8751	+ case "y":
8752	+ year = getNumber("y");
8753	+ break;
8754	+ case "@":
8755	+ date = new Date(getNumber("@"));
8756	+ year = date.getFullYear();
8757	+ month = date.getMonth() + 1;
8758	+ day = date.getDate();
8759	+ break;
8760	+ case "!":
8761	+ date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
8762	+ year = date.getFullYear();
8763	+ month = date.getMonth() + 1;
8764	+ day = date.getDate();
8765	+ break;
8766	+ case "'":
8767	+ if (lookAhead("'")){
8768	+ checkLiteral();
8769	+ } else {
8770	+ literal = true;
8771	+ }
8772	+ break;
8773	+ default:
8774	+ checkLiteral();
8775	}
8776	}
8777	+ }



8778
8779	+ if (iValue < value.length){
8780	+ extra = value.substr(iValue);
8781	+ if (!/^\s+/.test(extra)) {
8782	+ throw "Extra/unparsed characters found in date: " + extra;
8783	+ }







8784	}
8785
8786	+ if (year === -1) {
8787	+ year = new Date().getFullYear();
8788	+ } else if (year < 100) {
8789	+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
8790	+ (year <= shortYearCutoff ? 0 : -100);
8791	+ }
8792
8793	+ if (doy > -1) {
8794	+ month = 1;
8795	+ day = doy;
8796	+ do {
8797	+ dim = this._getDaysInMonth(year, month - 1);
8798	+ if (day <= dim) {
8799	+ break;
8800	+ }
8801	+ month++;
8802	+ day -= dim;
8803	+ } while (true);
8804	+ }


8805
8806	+ date = this._daylightSavingAdjust(new Date(year, month - 1, day));
8807	+ if (date.getFullYear() !== year \|\| date.getMonth() + 1 !== month \|\| date.getDate() !== day) {
8808	+ throw "Invalid date"; // E.g. 31/02/00
8809	+ }
8810	+ return date;
8811	+ },
8812
8813	+ /* Standard date formats. */
8814	+ ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
8815	+ COOKIE: "D, dd M yy",
8816	+ ISO_8601: "yy-mm-dd",
8817	+ RFC_822: "D, d M y",
8818	+ RFC_850: "DD, dd-M-y",
8819	+ RFC_1036: "D, d M y",
8820	+ RFC_1123: "D, d M yy",
8821	+ RFC_2822: "D, d M yy",
8822	+ RSS: "D, d M y", // RFC 822
8823	+ TICKS: "!",
8824	+ TIMESTAMP: "@",
8825	+ W3C: "yy-mm-dd", // ISO 8601
8826
8827	+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
8828	+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),


8829
8830	+ /* Format a date object into a string value.
8831	+ * The format can be combinations of the following:
8832	+ * d - day of month (no leading zero)
8833	+ * dd - day of month (two digit)
8834	+ * o - day of year (no leading zeros)
8835	+ * oo - day of year (three digit)
8836	+ * D - day name short
8837	+ * DD - day name long
8838	+ * m - month of year (no leading zero)
8839	+ * mm - month of year (two digit)
8840	+ * M - month name short
8841	+ * MM - month name long
8842	+ * y - year (two digit)
8843	+ * yy - year (four digit)
8844	+ * @ - Unix timestamp (ms since 01/01/1970)
8845	+ * ! - Windows ticks (100ns since 01/01/0001)
8846	+ * "..." - literal text
8847	+ * '' - single quote
8848	+ *
8849	+ * @param format string - the desired format of the date
8850	+ * @param date Date - the date value to format
8851	+ * @param settings Object - attributes include:
8852	+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
8853	+ * dayNames string[7] - names of the days from Sunday (optional)
8854	+ * monthNamesShort string[12] - abbreviated names of the months (optional)
8855	+ * monthNames string[12] - names of the months (optional)
8856	+ * @return string - the date in the above format
8857	+ */
8858	+ formatDate: function (format, date, settings) {
8859	+ if (!date) {
8860	+ return "";
8861	+ }
8862	+
8863	+ var iFormat,
8864	+ dayNamesShort = (settings ? settings.dayNamesShort : null) \|\| this._defaults.dayNamesShort,
8865	+ dayNames = (settings ? settings.dayNames : null) \|\| this._defaults.dayNames,
8866	+ monthNamesShort = (settings ? settings.monthNamesShort : null) \|\| this._defaults.monthNamesShort,
8867	+ monthNames = (settings ? settings.monthNames : null) \|\| this._defaults.monthNames,
8868	+ // Check whether a format character is doubled
8869	+ lookAhead = function(match) {
8870	+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
8871	+ if (matches) {
8872	+ iFormat++;
8873	+ }
8874	+ return matches;
8875	+ },
8876	+ // Format a number, with leading zero if necessary
8877	+ formatNumber = function(match, value, len) {
8878	+ var num = "" + value;
8879	+ if (lookAhead(match)) {
8880	+ while (num.length < len) {
8881	+ num = "0" + num;
8882	+ }
8883	+ }
8884	+ return num;
8885	+ },
8886	+ // Format a name, short or long as requested
8887	+ formatName = function(match, value, shortNames, longNames) {
8888	+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
8889	+ },
8890	+ output = "",
8891	+ literal = false;

































8892
8893	+ if (date) {
8894	+ for (iFormat = 0; iFormat < format.length; iFormat++) {
8895	+ if (literal) {
8896	+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
8897	+ literal = false;
8898	+ } else {
8899	+ output += format.charAt(iFormat);
8900	+ }
8901	+ } else {
8902	+ switch (format.charAt(iFormat)) {
8903	+ case "d":
8904	+ output += formatNumber("d", date.getDate(), 2);
8905	+ break;
8906	+ case "D":
8907	+ output += formatName("D", date.getDay(), dayNamesShort, dayNames);
8908	+ break;
8909	+ case "o":
8910	+ output += formatNumber("o",
8911	+ Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
8912	+ break;
8913	+ case "m":
8914	+ output += formatNumber("m", date.getMonth() + 1, 2);
8915	+ break;
8916	+ case "M":
8917	+ output += formatName("M", date.getMonth(), monthNamesShort, monthNames);
8918	+ break;
8919	+ case "y":
8920	+ output += (lookAhead("y") ? date.getFullYear() :
8921	+ (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100);
8922	+ break;
8923	+ case "@":
8924	+ output += date.getTime();
8925	+ break;
8926	+ case "!":
8927	+ output += date.getTime() * 10000 + this._ticksTo1970;
8928	+ break;
8929	+ case "'":
8930	+ if (lookAhead("'")) {
8931	+ output += "'";
8932	+ } else {
8933	+ literal = true;
8934	+ }
8935	+ break;
8936	+ default:
8937	+ output += format.charAt(iFormat);
8938	+ }
8939	+ }
8940	+ }
8941	+ }
8942	+ return output;
8943	},
8944
8945	+ /* Extract all possible characters from the date format. */
8946	+ _possibleChars: function (format) {
8947	+ var iFormat,
8948	+ chars = "",
8949	+ literal = false,
8950	+ // Check whether a format character is doubled
8951	+ lookAhead = function(match) {
8952	+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
8953	+ if (matches) {
8954	+ iFormat++;
8955	+ }
8956	+ return matches;
8957	+ };
8958
8959	+ for (iFormat = 0; iFormat < format.length; iFormat++) {
8960	+ if (literal) {
8961	+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
8962	+ literal = false;
8963	+ } else {
8964	+ chars += format.charAt(iFormat);
8965	+ }
8966	+ } else {
8967	+ switch (format.charAt(iFormat)) {
8968	+ case "d": case "m": case "y": case "@":
8969	+ chars += "0123456789";
8970	+ break;
8971	+ case "D": case "M":
8972	+ return null; // Accept anything
8973	+ case "'":
8974	+ if (lookAhead("'")) {
8975	+ chars += "'";
8976	+ } else {
8977	+ literal = true;
8978	+ }
8979	+ break;
8980	+ default:
8981	+ chars += format.charAt(iFormat);
8982	}
8983	}
8984	}
8985	+ return chars;












8986	},
8987
8988	+ /* Get a setting value, defaulting if necessary. */
8989	+ _get: function(inst, name) {
8990	+ return inst.settings[name] !== undefined ?
8991	+ inst.settings[name] : this._defaults[name];





8992	},
8993
8994	+ /* Parse existing date and initialise date picker. */
8995	+ _setDateFromField: function(inst, noDefault) {
8996	+ if (inst.input.val() === inst.lastVal) {



8997	return;













8998	}

8999