PI_Oopsprofile - Version 0.2.0

Version Notes

This is a stable version.

Release Info

Developer	pureimagination
Extension	PI_Oopsprofile
Version	0.2.0
Comparing to
See all releases

Version 0.2.0

Files changed (88) hide show

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile.php +46 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit.php +68 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Form.php +58 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/General.php +228 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profilefilter.php +28 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profiletemplate.php +12 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profileway.php +13 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Run.php +56 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tabs.php +64 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Grid.php +151 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Renderer/Parsetype.php +20 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Renderer/Way.php +24 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/Run.php +200 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/System/Config/Cron/Schedule.php +190 -0
app/code/community/PI/Oopsprofile/Block/Adminhtml/System/Convert/Gui/Grid.php +67 -0
app/code/community/PI/Oopsprofile/Block/Rule/Conditions.php +46 -0
app/code/community/PI/Oopsprofile/Helper/Data.php +185 -0
app/code/community/PI/Oopsprofile/Helper/Mail.php +63 -0
app/code/community/PI/Oopsprofile/Helper/Table.php +255 -0
app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Api.php +71 -0
app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Http.php +73 -0
app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Io.php +434 -0
app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Mail.php +279 -0
app/code/community/PI/Oopsprofile/Model/Convert/Parser/Csv.php +206 -0
app/code/community/PI/Oopsprofile/Model/Convert/Parser/Txt.php +6 -0
app/code/community/PI/Oopsprofile/Model/Createapiobserver.php +89 -0
app/code/community/PI/Oopsprofile/Model/CronObserver.php +310 -0
app/code/community/PI/Oopsprofile/Model/Customergroup/Convert/Adapter/Customergroup.php +103 -0
app/code/community/PI/Oopsprofile/Model/Customergroup/Convert/Parser/Customergroup.php +47 -0
app/code/community/PI/Oopsprofile/Model/Dataflow/Batch/Io.php +22 -0
app/code/community/PI/Oopsprofile/Model/Dataflow/Convert/Mapper/Column.php +114 -0
app/code/community/PI/Oopsprofile/Model/Dataflow/Profile.php +783 -0
app/code/community/PI/Oopsprofile/Model/Dataflow/Profile/History.php +28 -0
app/code/community/PI/Oopsprofile/Model/Mail.php +54 -0
app/code/community/PI/Oopsprofile/Model/Mysql4/Oopsprofile.php +10 -0
app/code/community/PI/Oopsprofile/Model/Mysql4/Oopsprofile/Collection.php +10 -0
app/code/community/PI/Oopsprofile/Model/Oopsprofile.php +26 -0
app/code/community/PI/Oopsprofile/Model/Oopsprofileapi.php +167 -0
app/code/community/PI/Oopsprofile/Model/Product/Convert/Adapter/Product.php +2168 -0
app/code/community/PI/Oopsprofile/Model/Product/Convert/Parser/Product.php +864 -0
app/code/community/PI/Oopsprofile/Model/Rule.php +62 -0
app/code/community/PI/Oopsprofile/Model/Rule/Condition/Combine.php +34 -0
app/code/community/PI/Oopsprofile/Model/Rule/Condition/Product.php +17 -0
app/code/community/PI/Oopsprofile/Model/Varien/Io/Sftp.php +15 -0
app/code/community/PI/Oopsprofile/controllers/Adminhtml/OopsprofileController.php +550 -0
app/code/community/PI/Oopsprofile/controllers/ApiController.php +214 -0
app/code/community/PI/Oopsprofile/controllers/OopsprofileController.php +88 -0
app/code/community/PI/Oopsprofile/etc/adminhtml.xml +35 -0
app/code/community/PI/Oopsprofile/etc/config.xml +162 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-install-0.1.0.php +16 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.0-0.1.1.php +17 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.1-0.1.2.php +21 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.2-0.1.3.php +15 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.3-0.1.4.php +17 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.4-0.1.5.php +13 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.5-0.1.6.php +19 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.6-0.1.7.php +17 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.7-0.1.8.php +20 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.8-0.1.9.php +15 -0
app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.9-0.2.0.php +15 -0
app/design/adminhtml/default/default/layout/oopsprofile.xml +47 -0
app/design/adminhtml/default/default/template/oopsprofile/general.phtml +417 -0
app/design/adminhtml/default/default/template/oopsprofile/process.phtml +206 -0
app/design/adminhtml/default/default/template/oopsprofile/profilefilter.phtml +156 -0
app/design/adminhtml/default/default/template/oopsprofile/profiletemplate.phtml +127 -0
app/design/adminhtml/default/default/template/oopsprofile/profileway.phtml +91 -0
app/design/adminhtml/default/default/template/oopsprofile/run.phtml +60 -0
app/etc/modules/PI_Oopsprofile.xml +9 -0
package.xml +20 -0
skin/adminhtml/default/default/oopsprofile/css/jquery-ui-1.8.12.custom.css +578 -0
skin/adminhtml/default/default/oopsprofile/css/jquery.checkboxtree.css +12 -0
skin/adminhtml/default/default/oopsprofile/css/oopsprofile.css +33 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_flat_0_aaaaaa_40x100.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_flat_75_ffffff_40x100.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_55_fbf9ee_1x400.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_65_ffffff_1x400.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_75_dadada_1x400.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_75_e6e6e6_1x400.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_95_fef1ec_1x400.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-bg_highlight-soft_75_cccccc_1x100.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-icons_222222_256x240.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-icons_2e83ff_256x240.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-icons_454545_256x240.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-icons_888888_256x240.png +0 -0
skin/adminhtml/default/default/oopsprofile/images/ui-icons_cd0a0a_256x240.png +0 -0
skin/adminhtml/default/default/oopsprofile/js/jquery-1.4.4.js +7180 -0
skin/adminhtml/default/default/oopsprofile/js/jquery-ui-1.8.12.custom.min.js +783 -0
skin/adminhtml/default/default/oopsprofile/js/jquery.checkboxtree.js +628 -0

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile.php ADDED Viewed

	@@ -0,0 +1,46 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Adminhtml
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+ /**
28	+ * Adminhtml convert profiles list block
29	+ *
30	+ * @category Mage
31	+ * @package Mage_Adminhtml
32	+ * @author Magento Core Team <core@magentocommerce.com>
33	+ */
34	+
35	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile extends Mage_Adminhtml_Block_Widget_Grid_Container
36	+ {
37	+ public function __construct()
38	+ {
39	+ $this->_controller = 'adminhtml_oopsprofile';
40	+ $this->_blockGroup = 'oopsprofile';
41	+ $this->_headerText = Mage::helper('adminhtml')->__('Profiles');
42	+ $this->_addButtonLabel = Mage::helper('adminhtml')->__('Add New Profile');
43	+
44	+ parent::__construct();
45	+ }
46	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit.php ADDED Viewed

	@@ -0,0 +1,68 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Adminhtml
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+ /**
28	+ * Convert profile edit block
29	+ *
30	+ * @category Mage
31	+ * @package Mage_Adminhtml
32	+ * @author Magento Core Team <core@magentocommerce.com>
33	+ */
34	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit extends Mage_Adminhtml_Block_Widget_Form_Container
35	+ {
36	+ public function __construct()
37	+ {
38	+ $this->_objectId = 'id';
39	+ $this->_controller = 'adminhtml_oopsprofile';
40	+ $this->_blockGroup = 'oopsprofile';
41	+
42	+ parent::__construct();
43	+
44	+ $this->_updateButton('save', 'label', Mage::helper('adminhtml')->__('Save Profile'));
45	+ $this->_updateButton('delete', 'label', Mage::helper('adminhtml')->__('Delete Profile'));
46	+ $this->_addButton('savecontinue', array(
47	+ 'label' => Mage::helper('adminhtml')->__('Save and Continue Edit'),
48	+ 'onclick' => "$('edit_form').action += 'continue/true/'; editForm.submit();",
49	+ 'class' => 'save',
50	+ ), -100);
51	+
52	+ }
53	+
54	+ public function getProfileId()
55	+ {
56	+ return Mage::registry('current_convert_profile')->getId();
57	+ }
58	+
59	+ public function getHeaderText()
60	+ {
61	+ if (Mage::registry('current_convert_profile')->getId()) {
62	+ return $this->escapeHtml(Mage::registry('current_convert_profile')->getName());
63	+ }
64	+ else {
65	+ return Mage::helper('adminhtml')->__('New Profile');
66	+ }
67	+ }
68	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Form.php ADDED Viewed

	@@ -0,0 +1,58 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Adminhtml
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+ /**
28	+ * Adminhtml convert profile edit form block
29	+ *
30	+ * @category Mage
31	+ * @package Mage_Adminhtml
32	+ * @author Magento Core Team <core@magentocommerce.com>
33	+ */
34	+
35	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Form extends Mage_Adminhtml_Block_Widget_Form
36	+ {
37	+ protected function _prepareForm()
38	+ {
39	+ $form = new Varien_Data_Form(array('id' => 'edit_form',
40	+ 'action' => $this->getUrl('//save', array('id' => $this->getRequest()->getParam('id'))),
41	+ 'method' => 'post',
42	+ 'enctype' => 'multipart/form-data')
43	+ );
44	+
45	+ $model = Mage::registry('current_convert_profile');
46	+
47	+ if ($model->getId()) {
48	+ $form->addField('profile_id', 'hidden', array(
49	+ 'name' => 'profile_id',
50	+ ));
51	+ $form->setValues($model->getData());
52	+ }
53	+
54	+ $form->setUseContainer(true);
55	+ $this->setForm($form);
56	+ return parent::_prepareForm();
57	+ }
58	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/General.php ADDED Viewed

	@@ -0,0 +1,228 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_General extends Mage_Adminhtml_Block_Widget_Container
3	+ {
4	+
5	+ protected $_storeModel;
6	+ protected $_attributes;
7	+ protected $_addMapButtonHtml;
8	+ protected $_removeMapButtonHtml;
9	+ protected $_shortDateFormat;
10	+
11	+ public function __construct()
12	+ {
13	+ parent::__construct();
14	+ $this->setTemplate('oopsprofile/general.phtml');
15	+ }
16	+
17	+ protected function _prepareLayout()
18	+ {
19	+ if ($head = $this->getLayout()->getBlock('head')) {
20	+ $head->setCanLoadCalendarJs(true);
21	+ }
22	+ return $this;
23	+ }
24	+
25	+ public function getOopsSelected($key, $value)
26	+ {
27	+ return $this->getOopsData($key)==$value ? 'selected="selected"' : '';
28	+ }
29	+
30	+ public function getOopsData($key)
31	+ {
32	+ $oopsData = Mage::registry('current_convert_oopsprofile');
33	+ return $oopsData[$key];
34	+ }
35	+
36	+ public function getAttributes($entityType)
37	+ {
38	+ if (!isset($this->_attributes[$entityType])) {
39	+ switch ($entityType) {
40	+ case 'product':
41	+ $attributes = Mage::getSingleton('catalog/convert_parser_product')
42	+ ->getExternalAttributes();
43	+ break;
44	+
45	+ case 'customer':
46	+ $attributes = Mage::getSingleton('customer/convert_parser_customer')
47	+ ->getExternalAttributes();
48	+ break;
49	+ case 'order':
50	+ $attributes = Mage::helper('oopsprofile/table')->getOrderFields();
51	+ break;
52	+ case 'invoice':
53	+ $attributes = Mage::helper('oopsprofile/table')->getInvoiceFields();
54	+ break;
55	+ case 'shipment':
56	+ $attributes = Mage::helper('oopsprofile/table')->getShipmentFields();
57	+ break;
58	+ case 'creditmemo':
59	+ $attributes = Mage::helper('oopsprofile/table')->getCreditmemoFields();
60	+ break;
61	+ }
62	+
63	+ array_splice($attributes, 0, 0, array(''=>$this->__('Choose an attribute')));
64	+ $this->_attributes[$entityType] = $attributes;
65	+ }
66	+ return $this->_attributes[$entityType];
67	+ }
68	+
69	+ public function getValue($key, $default='', $defaultNew = null)
70	+ {
71	+ if (null !== $defaultNew) {
72	+ if (0 == $this->getProfileId()) {
73	+ $default = $defaultNew;
74	+ }
75	+ }
76	+
77	+ $value = $this->getData($key);
78	+ return $this->escapeHtml(strlen($value) > 0 ? $value : $default);
79	+ }
80	+
81	+ public function getSelected($key, $value)
82	+ {
83	+ return $this->getData($key)==$value ? 'selected="selected"' : '';
84	+ }
85	+
86	+ public function getChecked($key)
87	+ {
88	+ return $this->getData($key) ? 'checked="checked"' : '';
89	+ }
90	+
91	+ public function getMappings($entityType)
92	+ {
93	+ $maps = $this->getData('gui_data/map/'.$entityType.'/db');
94	+ return $maps ? $maps : array();
95	+ }
96	+
97	+ public function getAddMapButtonHtml()
98	+ {
99	+ if (!$this->_addMapButtonHtml) {
100	+ $this->_addMapButtonHtml = $this->getLayout()->createBlock('adminhtml/widget_button')->setType('button')
101	+ ->setClass('add')->setLabel($this->__('Add Field Mapping'))
102	+ ->setOnClick("addFieldMapping()")->toHtml();
103	+ }
104	+ return $this->_addMapButtonHtml;
105	+ }
106	+
107	+ public function getRemoveMapButtonHtml()
108	+ {
109	+ if (!$this->_removeMapButtonHtml) {
110	+ $this->_removeMapButtonHtml = $this->getLayout()->createBlock('adminhtml/widget_button')->setType('button')
111	+ ->setClass('delete')->setLabel($this->__('Remove'))
112	+ ->setOnClick("removeFieldMapping(this)")->toHtml();
113	+ }
114	+ return $this->_removeMapButtonHtml;
115	+ }
116	+
117	+ public function getProductTypeFilterOptions()
118	+ {
119	+ $options = Mage::getSingleton('catalog/product_type')->getOptionArray();
120	+ array_splice($options, 0, 0, array(''=>$this->__('Any Type')));
121	+ return $options;
122	+ }
123	+
124	+ public function getProductAttributeSetFilterOptions()
125	+ {
126	+ $options = Mage::getResourceModel('eav/entity_attribute_set_collection')
127	+ ->setEntityTypeFilter(Mage::getModel('catalog/product')->getResource()->getTypeId())
128	+ ->load()
129	+ ->toOptionHash();
130	+
131	+ $opt = array();
132	+ $opt = array(''=>$this->__('Any Attribute Set'));
133	+ if ($options) foreach($options as $index => $value) {
134	+ $opt[$index] = $value;
135	+ }
136	+ //array_slice($options, 0, 0, array(''=>$this->__('Any Attribute Set')));
137	+ return $opt;
138	+ }
139	+
140	+ public function getProductVisibilityFilterOptions()
141	+ {
142	+ $options = Mage::getSingleton('catalog/product_visibility')->getOptionArray();
143	+
144	+ array_splice($options, 0, 0, array(''=>$this->__('Any Visibility')));
145	+ return $options;
146	+ }
147	+
148	+ public function getProductStatusFilterOptions()
149	+ {
150	+ $options = Mage::getSingleton('catalog/product_status')->getOptionArray();
151	+
152	+ array_splice($options, 0, 0, array(''=>$this->__('Any Status')));
153	+ return $options;
154	+ }
155	+
156	+ public function getStoreFilterOptions()
157	+ {
158	+ if (!$this->_filterStores) {
159	+ #$this->_filterStores = array(''=>$this->__('Any Store'));
160	+ $this->_filterStores = array();
161	+ foreach (Mage::getConfig()->getNode('stores')->children() as $storeNode) {
162	+ if ($storeNode->getName()==='default') {
163	+ //continue;
164	+ }
165	+ $this->_filterStores[$storeNode->getName()] = (string)$storeNode->system->store->name;
166	+ }
167	+ }
168	+ return $this->_filterStores;
169	+ }
170	+
171	+ public function getCustomerGroupFilterOptions()
172	+ {
173	+ $options = Mage::getResourceModel('customer/group_collection')
174	+ ->addFieldToFilter('customer_group_id', array('gt'=>0))
175	+ ->load()
176	+ ->toOptionHash();
177	+
178	+ array_splice($options, 0, 0, array(''=>$this->__('Any Group')));
179	+ return $options;
180	+ }
181	+
182	+ public function getCountryFilterOptions()
183	+ {
184	+ $options = Mage::getResourceModel('directory/country_collection')
185	+ ->load()->toOptionArray(false);
186	+ array_unshift($options, array('value'=>'', 'label'=>Mage::helper('adminhtml')->__('All countries')));
187	+ return $options;
188	+ }
189	+
190	+ /**
191	+ * Retrieve system store model
192	+ *
193	+ * @return Mage_Adminhtml_Model_System_Store
194	+ */
195	+ protected function _getStoreModel() {
196	+ if (is_null($this->_storeModel)) {
197	+ $this->_storeModel = Mage::getSingleton('adminhtml/system_store');
198	+ }
199	+ return $this->_storeModel;
200	+ }
201	+
202	+ public function getWebsiteCollection()
203	+ {
204	+ return $this->_getStoreModel()->getWebsiteCollection();
205	+ }
206	+
207	+ public function getGroupCollection()
208	+ {
209	+ return $this->_getStoreModel()->getGroupCollection();
210	+ }
211	+
212	+ public function getStoreCollection()
213	+ {
214	+ return $this->_getStoreModel()->getStoreCollection();
215	+ }
216	+
217	+ public function getShortDateFormat()
218	+ {
219	+ if (!$this->_shortDateFormat) {
220	+ $this->_shortDateFormat = Mage::app()->getLocale()->getDateStrFormat(
221	+ Mage_Core_Model_Locale::FORMAT_TYPE_SHORT
222	+ );
223	+ }
224	+ return $this->_shortDateFormat;
225	+ }
226	+
227	+ }
228	+

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profilefilter.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_Profilefilter extends PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_General
3	+ {
4	+
5	+ public function __construct()
6	+ {
7	+ parent::__construct();
8	+ $this->setTemplate('oopsprofile/profilefilter.phtml');
9	+ $this->setData(Mage::registry('current_convert_profile')->getData());
10	+ }
11	+
12	+ public function getMultipleSelect($data,$value)
13	+ {
14	+ $selected = $this->getData($data);
15	+ if(!empty($selected))
16	+ {
17	+ if (in_array($value, $selected, true)) {
18	+ return 'selected="selected"';
19	+ }
20	+
21	+ else
22	+ {
23	+ return '';
24	+ }
25	+ }
26	+ return '';
27	+ }
28	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profiletemplate.php ADDED Viewed

	@@ -0,0 +1,12 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_Profiletemplate extends PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_General
3	+ {
4	+
5	+ public function __construct()
6	+ {
7	+ parent::__construct();
8	+ $this->setTemplate('oopsprofile/profiletemplate.phtml');
9	+ $this->setData(Mage::registry('current_convert_profile')->getData());
10	+ }
11	+ }
12	+

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Profileway.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_Profileway extends PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_General
4	+ {
5	+
6	+ public function __construct()
7	+ {
8	+ parent::__construct();
9	+ $this->setTemplate('oopsprofile/profileway.phtml');
10	+ $this->setData(Mage::registry('current_convert_profile')->getData());
11	+ }
12	+ }
13	+

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tab/Run.php ADDED Viewed

	@@ -0,0 +1,56 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tab_Run extends Mage_Adminhtml_Block_Template
4	+ {
5	+ public function __construct()
6	+ {
7	+ parent::__construct();
8	+ $this->setTemplate('oopsprofile/run.phtml');
9	+ $this->setData(Mage::registry('current_convert_profile')->getData());
10	+ }
11	+
12	+ public function getRunButtonHtml()
13	+ {
14	+ $html = '';
15	+
16	+ $html .= $this->getLayout()->createBlock('adminhtml/widget_button')->setType('button')
17	+ ->setClass('save')->setLabel($this->__('Run Profile in Popup'))
18	+ ->setOnClick('runProfile(true)')
19	+ ->toHtml();
20	+
21	+ return $html;
22	+ }
23	+
24	+ public function getProfileId()
25	+ {
26	+ return Mage::registry('current_convert_profile')->getId();
27	+ }
28	+
29	+ public function getImportedFiles()
30	+ {
31	+ $files = array();
32	+ $path = Mage::app()->getConfig()->getTempVarDir().'/import';
33	+ if (!is_readable($path)) {
34	+ return $files;
35	+ }
36	+ $dir = dir($path);
37	+ while (false !== ($entry = $dir->read())) {
38	+ if($entry != '.'
39	+ && $entry != '..'
40	+ && in_array(strtolower(substr($entry, strrpos($entry, '.')+1)), array($this->getParseType())))
41	+ {
42	+ $files[] = $entry;
43	+ }
44	+ }
45	+ sort($files);
46	+ $dir->close();
47	+ return $files;
48	+ }
49	+
50	+ public function getParseType()
51	+ {
52	+ $data = Mage::registry('current_convert_profile')->getGuiData();
53	+ if ($data)
54	+ return $data['parse']['type'];
55	+ }
56	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Edit/Tabs.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Edit_Tabs extends Mage_Adminhtml_Block_Widget_Tabs
4	+ {
5	+ public function __construct()
6	+ {
7	+ parent::__construct();
8	+ $this->setId('convert_profile_tabs');
9	+ $this->setDestElementId('edit_form');
10	+ $this->setTitle(Mage::helper('adminhtml')->__('Import/Export Profile'));
11	+ }
12	+
13	+ protected function _beforeToHtml()
14	+ {
15	+ $profile = Mage::registry('current_convert_profile');
16	+
17	+ $wizardBlock = $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tab_general');
18	+ $wizardBlock->addData($profile->getData());
19	+
20	+ $new = !$profile->getId();
21	+
22	+ $this->addTab('wizard', array(
23	+ 'label' => Mage::helper('adminhtml')->__('General Information'),
24	+ 'content' => $wizardBlock->toHtml(),
25	+ 'active' => true,
26	+ ));
27	+
28	+ $this->addTab('profileway', array(
29	+ 'label' => Mage::helper('adminhtml')->__('Import/Export Way'),
30	+ 'content' => $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tab_profileway')->toHtml(),
31	+ ));
32	+
33	+ $this->addTab('profiletemplate', array(
34	+ 'label' => Mage::helper('adminhtml')->__('Format and Fields'),
35	+ 'content' => $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tab_profiletemplate')->toHtml(),
36	+ ));
37	+
38	+ $this->addTab('profilefilter', array(
39	+ 'label' => Mage::helper('adminhtml')->__('Apply Filters'),
40	+ 'content' => $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tab_profilefilter')->toHtml(),
41	+ ));
42	+
43	+ if (!$new) {
44	+
45	+ $this->addTab('view', array(
46	+ 'label' => Mage::helper('adminhtml')->__('Profile Actions XML'),
47	+ 'content' => $this->getLayout()->createBlock('adminhtml/system_convert_gui_edit_tab_view')->initForm()->toHtml(),
48	+ ));
49	+
50	+ $this->addTab('run', array(
51	+ 'label' => Mage::helper('adminhtml')->__('Run Profile'),
52	+ 'content' => $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tab_run')->toHtml(),
53	+ ));
54	+
55	+ $this->addTab('history', array(
56	+ 'label' => Mage::helper('adminhtml')->__('Profile History'),
57	+ 'content' => $this->getLayout()->createBlock('adminhtml/system_convert_profile_edit_tab_history')->toHtml(),
58	+ ));
59	+ }
60	+
61	+
62	+ return parent::_beforeToHtml();
63	+ }
64	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Oopsprofile/Grid.php ADDED Viewed

	@@ -0,0 +1,151 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Adminhtml
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+ /**
28	+ * Convert profiles grid
29	+ *
30	+ * @category Mage
31	+ * @package Mage_Adminhtml
32	+ * @author Magento Core Team <core@magentocommerce.com>
33	+ */
34	+ class PI_Oopsprofile_Block_Adminhtml_Oopsprofile_Grid extends Mage_Adminhtml_Block_Widget_Grid
35	+ {
36	+
37	+ public function __construct()
38	+ {
39	+ parent::__construct();
40	+ $this->setId('convertProfileGrid');
41	+ $this->setDefaultSort('oops_profile_id');
42	+ }
43	+
44	+ protected function _prepareCollection()
45	+ {
46	+ /*$collection = Mage::getResourceModel('dataflow/profile_collection')
47	+ ->addFieldToFilter('entity_type', array('notnull'=>''));*/
48	+
49	+ $resource = Mage::getSingleton('core/resource');
50	+ $dataflowTable = $resource->getTableName('dataflow_profile');
51	+
52	+ $collection = Mage::getResourceModel('oopsprofile/oopsprofile_collection');
53	+ $collection->getSelect()->joinLeft( array('dataflow'=>$dataflowTable),
54	+ 'main_table.dataflow_profile_id = dataflow.profile_id');
55	+
56	+ //echo '<pre>';print_r($collection->getData());exit;
57	+
58	+ $this->setCollection($collection);
59	+
60	+ return parent::_prepareCollection();
61	+ }
62	+
63	+ protected function _prepareColumns()
64	+ {
65	+ $entityArray = array('product'=>'Products', 'customer'=>'Customers','customergroup'=>'Customer Group','order'=>'Order','shipment'=>'Shipment','invoice'=>'Invoice','creditmemo'=>'Creditmemo');
66	+
67	+ $this->addColumn('oops_profile_id', array(
68	+ 'header' => Mage::helper('adminhtml')->__('ID'),
69	+ 'width' => '50px',
70	+ 'index' => 'oops_profile_id',
71	+ ));
72	+ $this->addColumn('name', array(
73	+ 'header' => Mage::helper('adminhtml')->__('Profile Name'),
74	+ 'index' => 'name',
75	+ ));
76	+ $this->addColumn('direction', array(
77	+ 'header' => Mage::helper('adminhtml')->__('Profile Direction'),
78	+ 'index' => 'direction',
79	+ 'type' => 'options',
80	+ 'options' => array('import'=>'Import', 'export'=>'Export'),
81	+ 'width' => '120px',
82	+ ));
83	+ $this->addColumn('entity_type', array(
84	+ 'header' => Mage::helper('adminhtml')->__('Entity Type'),
85	+ 'index' => 'entity_type',
86	+ 'type' => 'options',
87	+ 'options' => $entityArray,
88	+ 'width' => '120px',
89	+ ));
90	+
91	+ /*$this->addColumn('store_id', array(
92	+ 'header' => Mage::helper('adminhtml')->__('Store'),
93	+ 'type' => 'options',
94	+ 'align' => 'center',
95	+ 'index' => 'store_id',
96	+ 'type' => 'store',
97	+ 'width' => '200px',
98	+ ));*/
99	+
100	+ $this->addColumn('data_transfer', array(
101	+ 'header' => Mage::helper('adminhtml')->__('Profile Way'),
102	+ 'index' => 'data_transfer',
103	+ 'width' => '120px',
104	+ 'renderer' => new PI_Oopsprofile_Block_Adminhtml_Renderer_Way,
105	+ ));
106	+
107	+ $this->addColumn('parse_type', array(
108	+ 'header' => Mage::helper('adminhtml')->__('Data Format Type'),
109	+ 'index' => 'oops_profile_id',
110	+ 'width' => '120px',
111	+ 'renderer' => new PI_Oopsprofile_Block_Adminhtml_Renderer_Parsetype,
112	+ ));
113	+
114	+ $this->addColumn('created_at', array(
115	+ 'header' => Mage::helper('adminhtml')->__('Created At'),
116	+ 'type' => 'datetime',
117	+ 'align' => 'center',
118	+ 'index' => 'created_at',
119	+ ));
120	+ $this->addColumn('updated_at', array(
121	+ 'header' => Mage::helper('adminhtml')->__('Updated At'),
122	+ 'type' => 'datetime',
123	+ 'align' => 'center',
124	+ 'index' => 'updated_at',
125	+ ));
126	+
127	+ $this->addColumn('action', array(
128	+ 'header' => Mage::helper('adminhtml')->__('Action'),
129	+ 'width' => '60px',
130	+ 'align' => 'center',
131	+ 'sortable' => false,
132	+ 'filter' => false,
133	+ 'type' => 'action',
134	+ 'actions' => array(
135	+ array(
136	+ 'url' => $this->getUrl('//edit') . 'id/$profile_id',
137	+ 'caption' => Mage::helper('adminhtml')->__('Edit')
138	+ )
139	+ )
140	+ ));
141	+
142	+ return parent::_prepareColumns();
143	+ }
144	+
145	+ public function getRowUrl($row)
146	+ {
147	+ return $this->getUrl('//edit', array('id'=>$row->getDataflowProfileId()));
148	+ }
149	+
150	+ }
151	+

app/code/community/PI/Oopsprofile/Block/Adminhtml/Renderer/Parsetype.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_Renderer_Parsetype extends Mage_Adminhtml_Block_Widget_Grid_Column_Renderer_Abstract
3	+ {
4	+ public function render(Varien_Object $row)
5	+ {
6	+ //print_r($row->getData($this->getColumn()->getIndex()));
7	+ $data = $row->getData($this->getColumn()->getIndex());
8	+
9	+ if($data == "")
10	+ {
11	+ return "";
12	+ }
13	+ else
14	+ {
15	+ $guidData = unserialize($row->getGuiData());
16	+ return $guidData['parse']['type'];
17	+
18	+ }
19	+ }
20	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Renderer/Way.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_Renderer_Way extends Mage_Adminhtml_Block_Widget_Grid_Column_Renderer_Abstract
3	+ {
4	+ public function render(Varien_Object $row)
5	+ {
6	+ //print_r($row->getData($this->getColumn()->getIndex()));
7	+ $data = $row->getData($this->getColumn()->getIndex());
8	+
9	+ if($data == "")
10	+ {
11	+ return "";
12	+ }
13	+ else
14	+ {
15	+ $dataTransfer = $row->getDataTransfer();
16	+ if($row->getDataTransfer() == 'file')
17	+ {
18	+ $guidData = unserialize($row->getGuiData());
19	+ return $guidData['file']['type'];
20	+ }
21	+ return $row->getDataTransfer();
22	+ }
23	+ }
24	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/Run.php ADDED Viewed

	@@ -0,0 +1,200 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Adminhtml
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+ /**
28	+ * Convert profiles run block
29	+ *
30	+ * @category Mage
31	+ * @package Mage_Adminhtml
32	+ * @author Magento Core Team <core@magentocommerce.com>
33	+ */
34	+ class PI_Oopsprofile_Block_Adminhtml_Run extends Mage_Adminhtml_Block_Abstract
35	+ {
36	+ /**
37	+ * Flag for batch model
38	+ * @var boolean
39	+ */
40	+ protected $_batchModelPrepared = false;
41	+ /**
42	+ * Batch model instance
43	+ * @var Mage_Dataflow_Model_Batch
44	+ */
45	+ protected $_batchModel = null;
46	+ /**
47	+ * Preparing batch model (initialization)
48	+ * @return Mage_Adminhtml_Block_System_Convert_Profile_Run
49	+ */
50	+ protected function _prepareBatchModel()
51	+ {
52	+ if ($this->_batchModelPrepared) {
53	+ return $this;
54	+ }
55	+ $this->setShowFinished(true);
56	+ $batchModel = Mage::getSingleton('dataflow/batch');
57	+ $this->_batchModel = $batchModel;
58	+ if ($batchModel->getId()) {
59	+ if ($batchModel->getAdapter()) {
60	+ $this->setBatchModelHasAdapter(true);
61	+ $numberOfRecords = $this->getProfile()->getData('gui_data/import/number_of_records');
62	+ if (!$numberOfRecords) {
63	+ $batchParams = $batchModel->getParams();
64	+ $numberOfRecords = isset($batchParams['number_of_records']) ? $batchParams['number_of_records'] : 1;
65	+ }
66	+ $this->setNumberOfRecords($numberOfRecords);
67	+ $this->setShowFinished(false);
68	+ $batchImportModel = $batchModel->getBatchImportModel();
69	+ $importIds = $batchImportModel->getIdCollection();
70	+ $this->setBatchItemsCount(count($importIds));
71	+ $this->setBatchConfig(
72	+ array(
73	+ 'styles' => array(
74	+ 'error' => array(
75	+ 'icon' => Mage::getDesign()->getSkinUrl('images/error_msg_icon.gif'),
76	+ 'bg' => '#FDD'
77	+ ),
78	+ 'message' => array(
79	+ 'icon' => Mage::getDesign()->getSkinUrl('images/fam_bullet_success.gif'),
80	+ 'bg' => '#DDF'
81	+ ),
82	+ 'loader' => Mage::getDesign()->getSkinUrl('images/ajax-loader.gif')
83	+ ),
84	+ 'template' => '<li style="#{style}" id="#{id}">'
85	+ . '<img id="#{id}_img" src="#{image}" class="v-middle" style="margin-right:5px"/>'
86	+ . '<span id="#{id}_status" class="text">#{text}</span>'
87	+ . '</li>',
88	+ 'text' => $this->__('Processed <strong>%s%% %s/%d</strong> records', '#{percent}', '#{updated}', $this->getBatchItemsCount()),
89	+ 'successText' => $this->__('Imported <strong>%s</strong> records', '#{updated}')
90	+ )
91	+ );
92	+ $jsonIds = array_chunk($importIds, $numberOfRecords);
93	+ $importData = array();
94	+ foreach ($jsonIds as $part => $ids) {
95	+ $importData[] = array(
96	+ 'batch_id' => $batchModel->getId(),
97	+ 'rows[]' => $ids
98	+ );
99	+ }
100	+ $this->setImportData($importData);
101	+ } else {
102	+ $this->setBatchModelHasAdapter(false);
103	+ $batchModel->delete();
104	+ }
105	+ }
106	+ $this->_batchModelPrepared = true;
107	+ return $this;
108	+ }
109	+ /**
110	+ * Return a batch model instance
111	+ * @return Mage_Dataflow_Model_Batch
112	+ */
113	+ protected function _getBatchModel()
114	+ {
115	+ return $this->_batchModel;
116	+ }
117	+ /**
118	+ * Return a batch model config JSON
119	+ * @return string
120	+ */
121	+ public function getBatchConfigJson()
122	+ {
123	+ return Mage::helper('core')->jsonEncode(
124	+ $this->getBatchConfig()
125	+ );
126	+ }
127	+ /**
128	+ * Encoding to JSON
129	+ * @param string $source
130	+ * @return string JSON
131	+ */
132	+ public function jsonEncode($source)
133	+ {
134	+ return Mage::helper('core')->jsonEncode($source);
135	+ }
136	+ /**
137	+ * Get a profile
138	+ * @return object
139	+ */
140	+ public function getProfile()
141	+ {
142	+ return Mage::registry('current_convert_profile');
143	+ }
144	+ /**
145	+ * Generating form key
146	+ * @return string
147	+ */
148	+ public function getFormKey()
149	+ {
150	+ return Mage::getSingleton('core/session')->getFormKey();
151	+ }
152	+ /**
153	+ * Return batch model and initialize it if need
154	+ * @return Mage_Dataflow_Model_Batch
155	+ */
156	+ public function getBatchModel()
157	+ {
158	+ return $this->_prepareBatchModel()
159	+ ->_getBatchModel();
160	+ }
161	+ /**
162	+ * Generating exceptions data
163	+ * @return array
164	+ */
165	+ public function getExceptions()
166	+ {
167	+ if (!is_null(parent::getExceptions()))
168	+ return parent::getExceptions();
169	+ $exceptions = array();
170	+ $this->getProfile()->run();
171	+ foreach ($this->getProfile()->getExceptions() as $e) {
172	+ switch ($e->getLevel()) {
173	+ case Varien_Convert_Exception::FATAL:
174	+ $img = 'error_msg_icon.gif';
175	+ $liStyle = 'background-color:#FBB; ';
176	+ break;
177	+ case Varien_Convert_Exception::ERROR:
178	+ $img = 'error_msg_icon.gif';
179	+ $liStyle = 'background-color:#FDD; ';
180	+ break;
181	+ case Varien_Convert_Exception::WARNING:
182	+ $img = 'fam_bullet_error.gif';
183	+ $liStyle = 'background-color:#FFD; ';
184	+ break;
185	+ case Varien_Convert_Exception::NOTICE:
186	+ $img = 'fam_bullet_success.gif';
187	+ $liStyle = 'background-color:#DDF; ';
188	+ break;
189	+ }
190	+ $exceptions[] = array(
191	+ "style" => $liStyle,
192	+ "src" => Mage::getDesign()->getSkinUrl('images/'.$img),
193	+ "message" => $e->getMessage(),
194	+ "position" => $e->getPosition()
195	+ );
196	+ }
197	+ parent::setExceptions($exceptions);
198	+ return $exceptions;
199	+ }
200	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/System/Config/Cron/Schedule.php ADDED Viewed

	@@ -0,0 +1,190 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Block_Adminhtml_System_Config_Cron_Schedule extends Mage_Adminhtml_Block_Widget_Form{
4	+
5	+ protected function _prepareForm(){
6	+
7	+ $profile = Mage::registry('current_convert_profile');
8	+ $oopsprofile = Mage::registry('current_convert_oopsprofile');
9	+
10	+ $freqSource = Mage::getModel('adminhtml/system_config_source_cron_frequency');
11	+ $freqSourceOptions = $freqSource->toOptionArray();
12	+ array_unshift($freqSourceOptions, array(
13	+ 'label' => Mage::helper('oopsprofile')->__('Please Select'),
14	+ 'value' => ''
15	+ )
16	+ );
17	+
18	+ $cronExprKeyPath = 'crontab/jobs/oopsprofile_cron_' . $profile->getId() . '_schedule/cron_expr';
19	+ $cronModelKeyPath = 'crontab/jobs/oopsprofile_cron_' . $profile->getId() . '_run/model';
20	+
21	+ try {
22	+ $cronExprValue = Mage::getModel('core/config_data')->load($cronExprKeyPath, 'path');
23	+ $cronModelValue = Mage::getModel('core/config_data')->load($cronModelKeyPath, 'path');
24	+
25	+ }
26	+ catch (Exception $e) {
27	+ Mage::throwException(Mage::helper('adminhtml')->__('Cron expression no more exist in system for this profile'));
28	+ }
29	+
30	+ $form = new Varien_Data_Form();
31	+
32	+ $fieldset = $form->addFieldset('schedule_run', array('legend'=>Mage::helper('catalog')->__(' Cron Schedule')));
33	+
34	+ if(Mage::helper('oopsprofile/cron')->isHeartbeatCheckDisabled() == 0){
35	+
36	+ /*Check if master cron is configured/
37	+ $heartbeatStatus = Mage::helper('oopsprofile/cron')->checkHeartbeat();
38	+ if(is_array($heartbeatStatus) && !empty($heartbeatStatus)){
39	+
40	+ if($heartbeatStatus['status'] == 0){
41	+ $cronStatusElement = $fieldset->addField('cron_heartbeat_status', 'textarea', array(
42	+ 'label'=> 'Master Cron Status',
43	+ 'readonly' => true,
44	+ 'rows'=> 2,
45	+ 'cols'=> 3,
46	+ 'title'=> Mage::helper('oopsprofile')->__('Master Cron Status'),
47	+ 'class'=> 'beating'
48	+ ));
49	+ }else{
50	+ $cronStatusElement = $fieldset->addField('cron_heartbeat_status', 'textarea', array(
51	+ 'label'=> 'Master Cron Status',
52	+ 'title'=> Mage::helper('oopsprofile')->__('Master Cron Status'),
53	+ 'class'=> 'dead',
54	+ 'readonly' => true,
55	+ ));
56	+ }
57	+
58	+ $oopsprofile->setData('cron_heartbeat_status', $heartbeatStatus['msg']);
59	+ }
60	+ /**Ends**/
61	+ }
62	+
63	+
64	+ $cronEnabledElement = $fieldset->addField('cron_enabled', 'select', array(
65	+ 'label'=> Mage::helper('oopsprofile')->__('Enable Cron'),
66	+ 'title'=> Mage::helper('oopsprofile')->__('Enable Cron'),
67	+ 'name'=>'cron_enabled',
68	+ 'values' => array(
69	+ 0 => Mage::helper('oopsprofile')->__('No'),
70	+ 1 => Mage::helper('oopsprofile')->__('Yes')
71	+ ),
72	+ 'onchange' => 'hideShowCronSchedule(this);',
73	+ ));
74	+
75	+
76	+
77	+ $cronFrequencyElement = $fieldset->addField('cron_frequency', 'select', array(
78	+ 'label' => Mage::helper('oopsprofile')->__('Cron Frequency'),
79	+ 'title' => Mage::helper('oopsprofile')->__('Cron Frequency'),
80	+ 'name' =>'cron_frequency',
81	+ 'class' =>'cron_frequency',
82	+ 'values'=> $freqSourceOptions
83	+ ));
84	+
85	+
86	+ $timeElement = $fieldset->addField('cron_start_time', 'time', array(
87	+ 'label'=> Mage::helper('oopsprofile')->__('Cron Start Time'),
88	+ 'title'=> Mage::helper('oopsprofile')->__('Cron Start Time'),
89	+ 'name'=>'cron_start_time',
90	+ 'class'=>'cron_start_time'
91	+ ));
92	+
93	+ $expertModeElement = $fieldset->addField('cron_expert_mode', 'checkbox', array(
94	+ 'label'=> Mage::helper('oopsprofile')->__('Schedule in Expert Mode'),
95	+ 'title'=> Mage::helper('oopsprofile')->__('Manually Enter Cron Expression'),
96	+ 'name'=>'cron_expert_mode',
97	+ 'class'=>'cron_expert_mode',
98	+ 'onchange'=> 'hideShowCronExprField(this);',
99	+ 'checked'=> $oopsprofile->getData('cron_expert_mode') ? true: false,
100	+ 'note'=> Mage::helper('oopsprofile')->__('Manually Enter Cron Expression.'),
101	+ ));
102	+
103	+ $oopsprofile->setData('cron_expert_mode', 1);
104	+
105	+ $cronExprElement = $fieldset->addField('cron_expression', 'text', array(
106	+ 'label'=> Mage::helper('oopsprofile')->__('Cron Expression'),
107	+ 'title'=> Mage::helper('oopsprofile')->__('Cron Expression'),
108	+ 'name'=>'cron_expression',
109	+ 'class'=>'cron_expression',
110	+ 'note'=> Mage::helper('oopsprofile')->__('Ex. * 2 * * *(every night at 2pm) <strong>\|</strong> Seperate characters by space. <strong>\|</strong> Frequency must be enough to get the task completed.'),
111	+ ));
112	+
113	+ if($oopsprofile->getData('cron_enabled')){
114	+ if($oopsprofile->getData('cron_expert_mode') != 1){
115	+ $cronFrequencyElement->setRequired(true);
116	+ $timeElement->setRequired(true);
117	+ }else{
118	+ $cronExprElement->setRequired(true);
119	+ }
120	+ }
121	+
122	+ $cronExprElement->setAfterElementHtml(
123	+ '<script type="text/javascript">'
124	+ . '//<![CDATA[
125	+ function hideShowCronExprField(element){
126	+
127	+ if (element.checked) {
128	+ $("cron_expression").up("tr").show();
129	+ $("cron_frequency").disabled = true;
130	+ $("cron_frequency").removeClassName("required-entry");
131	+ $("cron_expression").addClassName("required-entry");
132	+ $$(".cron_start_time").each(function(em){
133	+ em.disabled = true;
134	+ });
135	+ } else {
136	+ $("cron_expression").up("tr").hide();
137	+ $("cron_frequency").disabled = false;
138	+ if($("cron_enabled").value == 1){
139	+ console.log("required entry added");
140	+ $("cron_frequency").addClassName("required-entry");
141	+ }
142	+ $("cron_expression").removeClassName("required-entry");
143	+ $$(".cron_start_time").each(function(em){
144	+ em.disabled = false;
145	+ });
146	+ }
147	+ return true;
148	+ }'
149	+
150	+ . 'document.observe("dom:loaded", hideShowCronExprField($("cron_expert_mode")));'
151	+ . '//]]> '
152	+ . '</script>'
153	+ );
154	+
155	+ $timeElement->setAfterElementHtml(
156	+ '<script type="text/javascript">'
157	+ . '//<![CDATA[
158	+ function hideShowCronSchedule(element){
159	+ console.log(element.value);
160	+ if (element.value == 1) {
161	+ $("cron_frequency").up("tr").show();
162	+ $("cron_frequency").addClassName("required-entry");
163	+ $$(".cron_start_time").each(function(em){
164	+ em.up("tr").show();
165	+ //em.addClassName("required-entry");
166	+ });
167	+
168	+ } else {
169	+ $("cron_frequency").removeClassName("required-entry");
170	+ $("cron_frequency").up("tr").hide();
171	+ $$(".cron_start_time").each(function(em){
172	+ em.up("tr").hide();
173	+ //em.removeClassName("required-entry");
174	+ });
175	+
176	+ }
177	+ return true;
178	+ }'
179	+
180	+ . 'document.observe("dom:loaded", hideShowCronSchedule($("cron_enabled")));'
181	+ . '//]]> '
182	+ . '</script>'
183	+ );
184	+
185	+ $form->setValues($oopsprofile->getData());
186	+ $this->setForm($form);
187	+
188	+ return parent::_prepareForm();
189	+ }
190	+ }

app/code/community/PI/Oopsprofile/Block/Adminhtml/System/Convert/Gui/Grid.php ADDED Viewed

	@@ -0,0 +1,67 @@


1	+ <?php
2	+ class PI_Oopsprofile_Block_Adminhtml_System_Convert_Gui_Grid extends Mage_Adminhtml_Block_System_Convert_Gui_Grid
3	+ {
4	+
5	+ protected function _widgetprepareCollection()
6	+ {
7	+ if ($this->getCollection()) {
8	+
9	+ $this->_preparePage();
10	+
11	+ $columnId = $this->getParam($this->getVarNameSort(), $this->_defaultSort);
12	+ $dir = $this->getParam($this->getVarNameDir(), $this->_defaultDir);
13	+ $filter = $this->getParam($this->getVarNameFilter(), null);
14	+
15	+ if (is_null($filter)) {
16	+ $filter = $this->_defaultFilter;
17	+ }
18	+
19	+ if (is_string($filter)) {
20	+ $data = $this->helper('adminhtml')->prepareFilterString($filter);
21	+ $this->_setFilterValues($data);
22	+ }
23	+ else if ($filter && is_array($filter)) {
24	+ $this->_setFilterValues($filter);
25	+ }
26	+ else if(0 !== sizeof($this->_defaultFilter)) {
27	+ $this->_setFilterValues($this->_defaultFilter);
28	+ }
29	+
30	+ if (isset($this->_columns[$columnId]) && $this->_columns[$columnId]->getIndex()) {
31	+ $dir = (strtolower($dir)=='desc') ? 'desc' : 'asc';
32	+ $this->_columns[$columnId]->setDir($dir);
33	+ $this->_setCollectionOrder($this->_columns[$columnId]);
34	+ }
35	+
36	+ if (!$this->_isExport) {
37	+ $this->getCollection()->load();
38	+ $this->_afterLoadCollection();
39	+ }
40	+ }
41	+
42	+ return $this;
43	+ }
44	+
45	+ protected function _prepareCollection()
46	+ {
47	+
48	+ $resource = Mage::getSingleton('core/resource');
49	+ $oopsdataflowTable = $resource->getTableName('oopsprofile/oopsprofile');
50	+
51	+ $oopsProfileIds = Mage::getResourceModel('oopsprofile/oopsprofile_collection')->getData();
52	+ $ids = array();
53	+ foreach($oopsProfileIds as $oopsProfileId)
54	+ {
55	+ $ids[] = $oopsProfileId['dataflow_profile_id'];
56	+ }
57	+ //print_r($ids);exit;
58	+
59	+ $collection = Mage::getResourceModel('dataflow/profile_collection')
60	+ ->addFieldToFilter('entity_type', array('notnull'=>''))
61	+ ->addFieldToFilter('profile_id', array('nin'=>$ids));
62	+
63	+ $this->setCollection($collection);
64	+
65	+ return $this->_widgetprepareCollection();
66	+ }
67	+ }

app/code/community/PI/Oopsprofile/Block/Rule/Conditions.php ADDED Viewed

	@@ -0,0 +1,46 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Open Software License (OSL 3.0)
8	+ * that is bundled with this package in the file LICENSE.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/osl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category Mage
22	+ * @package Mage_Rule
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/osl-3.0.php Open Software License (OSL 3.0)
25	+ */
26	+
27	+
28	+ class PI_Oopsprofile_Block_Rule_Conditions implements Varien_Data_Form_Element_Renderer_Interface
29	+ {
30	+ public function render(Varien_Data_Form_Element_Abstract $element)
31	+ {
32	+ $ruleClass = get_class($element->getRule());
33	+ $RuleCombine = get_class(Mage::getModel('oopsprofile/rule_condition_combine'));
34	+ if($ruleClass === $RuleCombine)
35	+ {
36	+ $ruleModel = Mage::getModel('oopsprofile/rule');
37	+
38	+ return $ruleModel->getConditions()->asHtmlRecursive();
39	+
40	+ }
41	+ if ($element->getRule() && $element->getRule()->getConditions()) {
42	+ return $element->getRule()->getConditions()->asHtmlRecursive();
43	+ }
44	+ return '';
45	+ }
46	+ }

app/code/community/PI/Oopsprofile/Helper/Data.php ADDED Viewed

	@@ -0,0 +1,185 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Helper_Data extends Mage_Core_Helper_Abstract
4	+ {
5	+ /Run Profile On the basis of profile id/
6	+ public function RunOopsProfile($profileId)
7	+ {
8	+
9	+ if ($profileId) {
10	+ $profile = Mage::getModel('dataflow/profile')->load($profileId);
11	+ //$profile->load($profileId);
12	+ $id = $profile->getId();
13	+ if (empty($id))//if profile not exist
14	+ {
15	+ return;
16	+ }
17	+ else
18	+ {
19	+ $oopsprofile = Mage::getModel('oopsprofile/oopsprofile')
20	+ ->getCollection()
21	+ ->addFieldToFilter('profile_enable','1')
22	+ ->addFieldToFilter('dataflow_profile_id',$id)
23	+ ->getFirstItem();
24	+ $enable = $oopsprofile->getProfileEnable();
25	+ if($enable == 1)//if profile is disable
26	+ {
27	+ return;
28	+ }
29	+ else
30	+ {
31	+ Mage::register('current_convert_profile', $profile);
32	+ $profile->run();
33	+ Mage::unregister('current_convert_profile');
34	+ }
35	+ }
36	+ }
37	+
38	+ return;
39	+ }
40	+
41	+ public function entityTypeArray()
42	+ {
43	+ $arr['product'] = 'Products';
44	+ $arr['customer'] = 'Customers';
45	+ return $arr;
46	+ }
47	+
48	+ public function entityAttrTypeArray()
49	+ {
50	+ $arr = array( 'product',
51	+ 'customer',
52	+ );
53	+ return $arr;
54	+ }
55	+
56	+ public function wayTypeArray()
57	+ {
58	+ $arr['file'] = 'Local Server';
59	+ $arr['http'] = 'Http Server';
60	+ return $arr;
61	+ }
62	+ public function formatTypeArray()
63	+ {
64	+
65	+ $arr['csv'] = 'CSV';
66	+ $arr['txt'] = 'TXT';
67	+
68	+ return $arr;
69	+ }
70	+ public function delimiterTypeArray()
71	+ {
72	+
73	+ $arr[','] = 'Comma';
74	+ $arr['\t'] = 'Tab';
75	+ $arr[':'] = 'Colon';
76	+ $arr[' '] = 'Space';
77	+ $arr['\|'] = 'Vertical Pipe';
78	+ $arr[';'] = 'Semicolon';
79	+
80	+ return $arr;
81	+ }
82	+ public function enclosureTypeArray()
83	+ {
84	+
85	+ $arr['"'] = '"';
86	+ $arr["'"] = "'";
87	+
88	+ return $arr;
89	+ }
90	+
91	+ /Fetch Product's attributes/
92	+ public function getProductAttributeData()
93	+ {
94	+ $productAttrs = Mage::getResourceModel('catalog/product_attribute_collection')->getData();
95	+ foreach($productAttrs as $productAttr)
96	+ {
97	+ if($productAttr['frontend_label']!='')
98	+ {
99	+ $attr[$productAttr['attribute_code']] = $productAttr['frontend_label'];
100	+ }
101	+ }
102	+ $attr['url_path'] = 'Url Path';
103	+ return $attr;
104	+ }
105	+
106	+ /Fetch Product's stock fields/
107	+ public function getStockFieldsArray()
108	+ {
109	+ $colData='';
110	+ $resource = Mage::getSingleton('core/resource');
111	+ $stockTable = $resource->getTableName('cataloginventory_stock_item');
112	+ $read = $resource->getConnection('core_read');
113	+ $query = 'show columns from '.$stockTable;
114	+ $fields = $read->fetchAll($query);
115	+ $unsetKeys = array(
116	+ 'item_id',
117	+ 'product_id',
118	+ 'stock_id',
119	+ );
120	+ foreach($fields as $field)
121	+ {
122	+ $colName = $field['Field'];
123	+ $value = ucwords(implode(' ',explode('_',$colName)));
124	+ //$colData['inventory_'.$colName]=$value;
125	+ $colData[$colName]=$value;
126	+ if(in_array($colName,$unsetKeys))
127	+ {
128	+ unset($colData[$colName]);
129	+ }
130	+ }
131	+ return $colData;
132	+ }
133	+
134	+
135	+
136	+
137	+ /Fetch Dataflow profile id and name/
138	+ public function getProfileArray()
139	+ {
140	+
141	+ $profileArray = array();
142	+ $OopsDataProfileIds = array();
143	+
144	+ $oopsProfiles = Mage::getModel('oopsprofile/oopsprofile')
145	+ ->getCollection()
146	+ ->setOrder('oops_profile_id');
147	+
148	+ $profileArray[0] = '--Select a profile--';
149	+ foreach($oopsProfiles as $oopsprofile)
150	+ {
151	+ $profile = '';
152	+ $OopsDataProfileIds = $oopsprofile->getDataflowProfileId();
153	+ $profile = Mage::getModel('dataflow/profile')->getCollection()
154	+ ->addFieldToFilter('profile_id',$OopsDataProfileIds)
155	+ ->addFieldToFilter('entity_type','product')
156	+ ->getFirstItem();
157	+ if($profile->getId())
158	+ {
159	+ $profileArray[$profile->getId()] = $profile->getName();
160	+ }
161	+ else
162	+ {
163	+ continue;
164	+ }
165	+ }
166	+
167	+ return $profileArray;
168	+ }
169	+
170	+ /Fetch Category Mapping id and name/
171	+ public function getMappingArray()
172	+ {
173	+ $mappings = Mage::getModel('oopsprofile/mapping')->getCollection();
174	+
175	+ $mappingArray = array();
176	+
177	+ $mappingArray[0] = '--Select a mapping--';
178	+ foreach($mappings as $mapping)
179	+ {
180	+ $mappingArray[$mapping->getId()] = $mapping->getCategoryMapName();
181	+ }
182	+ return $mappingArray;
183	+ }
184	+
185	+ }

app/code/community/PI/Oopsprofile/Helper/Mail.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Helper_Mail extends Mage_Core_Helper_Abstract {
4	+
5	+ protected function _saveAttachment($attachment, $path, $file) {
6	+
7	+ //try{
8	+
9	+ $io = new Varien_Io_File();
10	+ $io->setAllowCreateFolders(true);
11	+ $io->open(array('path' => $path));
12	+ $io->streamOpen($file, 'w+');
13	+ $io->streamLock(true);
14	+
15	+ if ($attachment['encoding'] == 'base64') {
16	+ $fileContent = base64_decode($attachment['content']);
17	+ } else {
18	+ $fileContent = $attachment['content'];
19	+ }
20	+
21	+ $io->streamWrite($fileContent);
22	+ $io->close();
23	+ //}catch(Exception $e){
24	+ //}
25	+
26	+ return $this;
27	+ }
28	+
29	+ public function getFileNameWithPrefix($attachmentName) {
30	+
31	+ $storeId = Mage::app()->getStore()->getId();
32	+ //Get the timestamp
33	+ $filePrefix = 'oops_' . Mage::app()->getLocale()->storeTimeStamp($storeId);
34	+
35	+ return $filePrefix . '_' . $attachmentName;
36	+ }
37	+
38	+ /*
39	+ * Save attachments to var/attachments
40	+ */
41	+
42	+ public function _saveAllAttachments($allAttachments, $path) {
43	+
44	+
45	+ $files = array();
46	+ if (substr($path, -1) != DS) {
47	+ $path .= DS;
48	+ }
49	+
50	+ //$path = Mage::getBaseDir('var') . DS . 'import' . DS . 'attachments' . DS;
51	+
52	+ foreach ($allAttachments as $msgId => $attachments) {
53	+ foreach ($attachments as $attachment) {
54	+ $filename = $this->getFileNameWithPrefix($attachment['filename']);
55	+ $this->_saveAttachment($attachment, $path, $filename);
56	+ $files[] = $filename;
57	+ }
58	+ }
59	+
60	+ return $files;
61	+ }
62	+
63	+ }

app/code/community/PI/Oopsprofile/Helper/Table.php ADDED Viewed

	@@ -0,0 +1,255 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Helper_Table extends Mage_Core_Helper_Abstract
4	+ {
5	+
6	+
7	+
8	+ //return column names of table
9	+ protected function getTableColumns($Table,$prefix = '')
10	+ {
11	+ $orderTable = Mage::getSingleton('core/resource')->getTableName($Table);
12	+
13	+ $read = Mage::getSingleton('core/resource')->getConnection('core_read');
14	+
15	+ $columnsDeatil = $read->describeTable($orderTable);//column descriptions for a table
16	+
17	+ $columns = array_keys($columnsDeatil);//fetch array keys
18	+
19	+ if($prefix!='')
20	+ {
21	+ foreach($columns as $col)
22	+ {
23	+ $newcol[] = $prefix.$col;
24	+ }
25	+ $columns = $newcol;
26	+ }
27	+ $columns = array_combine($columns, $columns);//assign array values to its keys
28	+
29	+ return $columns;
30	+ }
31	+
32	+ /**
33	+ Return order field names
34	+ **/
35	+ public function getOrderFields()
36	+ {
37	+
38	+ //fetch columns from order table
39	+ $orderColumns = $this->getTableColumns('sales/order');
40	+
41	+ $unsetOrderKeys = array('protect_code',
42	+ 'remote_ip',
43	+ 'x_forwarded_for',
44	+ 'edit_increment',
45	+ 'email_sent',
46	+ 'forced_shipment_with_incoice',
47	+ 'payment_authorization_amount',
48	+ 'payment_authorization_expiration',
49	+ 'forced_do_shipment_with_invoice',
50	+ 'base_shipping_hidden_tax_amount',
51	+ 'store_name'
52	+ );
53	+
54	+ foreach($unsetOrderKeys as $unsetOrderKey)
55	+ {
56	+ unset($orderColumns[$unsetOrderKey]);
57	+ }
58	+
59	+ //columns for billing and shipping address
60	+
61	+ $orderColumns['orderbilling_region_id'] = 'orderbilling_region_id';
62	+ $orderColumns['orderbilling_region'] = 'orderbilling_region';
63	+ $orderColumns['orderbilling_postcode'] = 'orderbilling_postcode';
64	+ $orderColumns['orderbilling_street'] = 'orderbilling_street';
65	+ $orderColumns['orderbilling_city'] = 'orderbilling_city';
66	+ $orderColumns['orderbilling_country_id'] = 'orderbilling_country_id';
67	+ $orderColumns['orderbilling_prefix'] = 'orderbilling_prefix';
68	+ $orderColumns['orderbilling_firstname'] = 'orderbilling_firstname';
69	+ $orderColumns['orderbilling_middlename'] = 'orderbilling_middlename';
70	+ $orderColumns['orderbilling_lastname'] = 'orderbilling_lastname';
71	+ $orderColumns['orderbilling_suffix'] = 'orderbilling_suffix';
72	+ $orderColumns['orderbilling_email'] = 'orderbilling_email';
73	+ $orderColumns['orderbilling_telephone'] = 'orderbilling_telephone';
74	+
75	+ $orderColumns['ordershipping_region_id'] = 'ordershipping_region_id';
76	+ $orderColumns['ordershipping_region'] = 'ordershipping_region';
77	+ $orderColumns['ordershipping_postcode'] = 'ordershipping_postcode';
78	+ $orderColumns['ordershipping_street'] = 'ordershipping_street';
79	+ $orderColumns['ordershipping_city'] = 'ordershipping_city';
80	+ $orderColumns['ordershipping_country_id'] = 'ordershipping_country_id';
81	+ $orderColumns['ordershipping_prefix'] = 'ordershipping_prefix';
82	+ $orderColumns['ordershipping_firstname'] = 'ordershipping_firstname';
83	+ $orderColumns['ordershipping_middlename'] = 'ordershipping_middlename';
84	+ $orderColumns['ordershipping_lastname'] = 'ordershipping_lastname';
85	+ $orderColumns['ordershipping_suffix'] = 'ordershipping_suffix';
86	+ $orderColumns['ordershipping_email'] = 'ordershipping_email';
87	+ $orderColumns['ordershipping_telephone'] = 'ordershipping_telephone';
88	+
89	+
90	+ //column for order payment
91	+ $orderColumns['orderpayment_method'] = 'orderpayment_method';
92	+
93	+
94	+ //column for comments
95	+ $orderColumns['comment_data'] = 'comment_data';
96	+
97	+ //fetch column for order items
98	+ $itemColumns = $this->getTableColumns('sales/order_item','orderitem_');
99	+
100	+ $unsetItemKeys = array('orderitem_item_id',
101	+ 'orderitem_order_id',
102	+ 'orderitem_store_id',
103	+ 'orderitem_created_at',
104	+ 'orderitem_updated_at',
105	+ 'orderitem_applied_rule_ids',
106	+ 'orderitem_additional_data',
107	+ 'orderitem_is_virtual'
108	+ );
109	+ foreach($unsetItemKeys as $unsetItemKey)
110	+ {
111	+ unset($itemColumns[$unsetItemKey]);
112	+ }
113	+
114	+ $orderColumns = array_merge($orderColumns,$itemColumns);
115	+
116	+ return $orderColumns;
117	+ }
118	+
119	+
120	+ /**
121	+ Return Invoice field names
122	+ **/
123	+ public function getInvoiceFields()
124	+ {
125	+ //fetch columns from invoice table
126	+ $invoiceColumns = $this->getTableColumns('sales/invoice');
127	+
128	+ foreach($invoiceColumns as $key=>$value)
129	+ {
130	+ if($key=='increment_id')
131	+ {
132	+ $invoiceColumns['invoice_increment_id']='invoice_increment_id';
133	+ unset($invoiceColumns['increment_id']);
134	+ break;
135	+ }
136	+ }
137	+
138	+ //column for comments
139	+ $invoiceColumns['comment_data'] = 'comment_data';
140	+
141	+ //column for grid data
142	+ $invoiceColumns['order_increment_id'] = 'order_increment_id';
143	+ $invoiceColumns['invoicegrid_order_created_at'] = 'invoicegrid_order_created_at';
144	+ $invoiceColumns['invoicegrid_billing_name'] = 'invoicegrid_billing_name';
145	+
146	+ //fetch columns for items
147	+ $itemColumns = $this->getTableColumns('sales/invoice_item','invoiceitem_');
148	+
149	+ $unsetItemKeys = array('invoiceitem_entity_id',
150	+ 'invoiceitem_parent_id',
151	+ 'invoiceitem_order_item_id'
152	+ );
153	+
154	+ foreach($unsetItemKeys as $unsetItemKey)
155	+ {
156	+ unset($itemColumns[$unsetItemKey]);
157	+ }
158	+
159	+ $invoiceColumns = array_merge($invoiceColumns,$itemColumns);
160	+
161	+ return $invoiceColumns;
162	+ }
163	+
164	+ /**
165	+ Return Shipment field names
166	+ **/
167	+ public function getShipmentFields()
168	+ {
169	+ //fetch columns from shipment table
170	+ $shipmentColumns = $this->getTableColumns('sales/shipment');
171	+
172	+ foreach($shipmentColumns as $key=>$value)
173	+ {
174	+ if($key=='increment_id')
175	+ {
176	+ $shipmentColumns['shipment_increment_id']='shipment_increment_id';
177	+ unset($shipmentColumns['increment_id']);
178	+ break;
179	+ }
180	+ }
181	+
182	+ //column for comments
183	+ $shipmentColumns['comment_data'] = 'comment_data';
184	+
185	+ //column for track data
186	+ $shipmentColumns['track_data'] = 'track_data';
187	+
188	+ //column for grid data
189	+ $shipmentColumns['order_increment_id'] = 'order_increment_id';
190	+ $shipmentColumns['shipmentgrid_order_created_at'] = 'shipmentgrid_order_created_at';
191	+ $shipmentColumns['shipmentgrid_shipping_name'] = 'shipmentgrid_shipping_name';
192	+
193	+ //fetch columns for items
194	+ $itemColumns = $this->getTableColumns('sales/shipment_item','shipmentitem_');
195	+
196	+ $unsetItemKeys = array('shipmentitem_entity_id',
197	+ 'shipmentitem_parent_id',
198	+ 'shipmentitem_order_item_id'
199	+ );
200	+
201	+ foreach($unsetItemKeys as $unsetItemKey)
202	+ {
203	+ unset($itemColumns[$unsetItemKey]);
204	+ }
205	+
206	+ $shipmentColumns = array_merge($shipmentColumns,$itemColumns);
207	+
208	+ return $shipmentColumns;
209	+ }
210	+
211	+
212	+ /**
213	+ Return Creditmemo field names
214	+ **/
215	+ public function getCreditmemoFields()
216	+ {
217	+ //fetch columns from creditmemo table
218	+ $creditmemoColumns = $this->getTableColumns('sales/creditmemo');
219	+
220	+ foreach($creditmemoColumns as $key=>$value)
221	+ {
222	+ if($key=='increment_id')
223	+ {
224	+ $creditmemoColumns['creditmemo_increment_id']='creditmemo_increment_id';
225	+ unset($creditmemoColumns['increment_id']);
226	+ break;
227	+ }
228	+ }
229	+
230	+ //column for comments
231	+ $creditmemoColumns['comment_data'] = 'comment_data';
232	+
233	+ //column for grid data
234	+ $creditmemoColumns['order_increment_id'] = 'order_increment_id';
235	+ $creditmemoColumns['creditmemogrid_order_created_at'] = 'creditmemogrid_order_created_at';
236	+ $creditmemoColumns['creditmemogrid_billing_name'] = 'creditmemogrid_billing_name';
237	+
238	+ //fetch columns for items
239	+ $itemColumns = $this->getTableColumns('sales/creditmemo_item','creditmemoitem_');
240	+
241	+ $unsetItemKeys = array('creditmemoitem_entity_id',
242	+ 'creditmemoitem_parent_id',
243	+ 'creditmemoitem_order_item_id'
244	+ );
245	+
246	+ foreach($unsetItemKeys as $unsetItemKey)
247	+ {
248	+ unset($itemColumns[$unsetItemKey]);
249	+ }
250	+
251	+ $creditmemoColumns = array_merge($creditmemoColumns,$itemColumns);
252	+
253	+ return $creditmemoColumns;
254	+ }
255	+ }

app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Api.php ADDED Viewed

	@@ -0,0 +1,71 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Convert_Adapter_Api extends Mage_Dataflow_Model_Convert_Adapter_Abstract
4	+ {
5	+
6	+ /**
7	+ * @return Varien_Io_File
8	+ */
9	+ public function getResource($forWrite = false)
10	+ {
11	+ if (!$this->_resource) {
12	+ $className = 'Varien_Io_File';
13	+
14	+ $this->_resource = new $className();
15	+
16	+ }
17	+ return $this->_resource;
18	+ }
19	+
20	+ public function load()
21	+ {
22	+ //$resultxml = $this->connecttoApi();
23	+
24	+ return $this;
25	+ }
26	+
27	+ public function save()
28	+ {
29	+ if (!$this->getResource(true)) {
30	+ return $this;
31	+ }
32	+
33	+ $fileformat = 'xml';
34	+
35	+ $batchModel = Mage::getSingleton('dataflow/batch');
36	+
37	+ $dataFile = $batchModel->getIoAdapter()->getFile(true);
38	+
39	+ $path = 'apiexport';
40	+
41	+ //create path if not exist
42	+ if (!file_exists($path)) {
43	+ mkdir($path, 0777, true);
44	+ }
45	+
46	+
47	+
48	+ $profile = Mage::registry('current_convert_profile');//current profile
49	+
50	+ $oopsprofile = Mage::getModel('oopsprofile/oopsprofile')
51	+ ->getCollection()
52	+ ->addFieldToFilter('dataflow_profile_id',$profile->getId())
53	+ ->getFirstItem();
54	+
55	+ $filename = $path.'/export_'.$this->getVar('entitytype').'_'.$oopsprofile->getId().'.'.$fileformat;
56	+
57	+ $result = $this->getResource()->write($filename, $dataFile, 0777);
58	+
59	+ if (false === $result) {
60	+ $message = Mage::helper('dataflow')->__('Could not save file: %s.', $filename);
61	+ Mage::throwException($message);
62	+ } else {
63	+ $message = Mage::helper('dataflow')->__('Saved successfully: "%s" [%d byte(s)].', $filename, $batchModel->getIoAdapter()->getFileSize());
64	+ if ($this->getVar('link')) {
65	+ $message .= Mage::helper('dataflow')->__('<a href="%s" target="_blank">Link</a>', $this->getVar('link'));
66	+ }
67	+ $this->addException($message);
68	+ }
69	+ return $this;
70	+ }
71	+ }

app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Http.php ADDED Viewed

	@@ -0,0 +1,73 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Convert_Adapter_Http extends Mage_Dataflow_Model_Convert_Adapter_Http
4	+ {
5	+
6	+ /**
7	+ * @return Varien_Io_File
8	+ */
9	+ public function getResource($forWrite = false)
10	+ {
11	+ if (!$this->_resource) {
12	+ $className = 'Varien_Io_File';
13	+
14	+ $this->_resource = new $className();
15	+
16	+ }
17	+ return $this->_resource;
18	+ }
19	+
20	+
21	+ /**
22	+ * Save result to destination file from temporary
23	+ *
24	+ * @return PI_Oopsprofile_Model_Convert_Adapter_Io
25	+ */
26	+ public function save()
27	+ {
28	+ if (!$this->getResource(true)) {
29	+ return $this;
30	+ }
31	+
32	+ $fileformat = $this->getVar('fileformat');
33	+
34	+
35	+ /***
36	+ **** Code if format is xls or xlsx
37	+ ***/
38	+ if($fileformat=='xls' \|\| $fileformat=='xlsx')
39	+ {
40	+ return $this;
41	+ }
42	+
43	+
44	+ $batchModel = Mage::getSingleton('dataflow/batch');
45	+
46	+ $dataFile = $batchModel->getIoAdapter()->getFile(true);
47	+
48	+ $path = 'httpexport';
49	+
50	+ //create path if not exist
51	+ if (!file_exists($path)) {
52	+ mkdir($path, 0777, true);
53	+ }
54	+
55	+ $profile = Mage::registry('current_convert_profile');//current profile
56	+
57	+ $filename = $path.'/export_'.$this->getVar('entitytype').'_'.$profile->getId().'.'.$fileformat;
58	+
59	+ $result = $this->getResource()->write($filename, $dataFile, 0777);
60	+
61	+ if (false === $result) {
62	+ $message = Mage::helper('dataflow')->__('Could not save file: %s.', $filename);
63	+ Mage::throwException($message);
64	+ } else {
65	+ $message = Mage::helper('dataflow')->__('Saved successfully: "%s" [%d byte(s)].', $filename, $batchModel->getIoAdapter()->getFileSize());
66	+ if ($this->getVar('link')) {
67	+ $message .= Mage::helper('dataflow')->__('<a href="%s" target="_blank">Link</a>', $this->getVar('link'));
68	+ }
69	+ $this->addException($message);
70	+ }
71	+ return $this;
72	+ }
73	+ }

app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Io.php ADDED Viewed

	@@ -0,0 +1,434 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Convert_Adapter_Io extends Mage_Dataflow_Model_Convert_Adapter_Io
3	+ {
4	+
5	+
6	+ /**
7	+ * @return Varien_Io_Abstract or PI_Oopsprofile_Model_Varien_Io_sftp in case of sftp
8	+ */
9	+ public function getResource($forWrite = false)
10	+ {
11	+ if (!$this->_resource) {
12	+ $type = $this->getVar('type', 'file');
13	+ $className = 'Varien_Io_' . ucwords($type);
14	+ if($this->getVar('type')=='sftp')
15	+ {
16	+ $className = 'PI_Oopsprofile_Model_Varien_Io_sftp';
17	+ }
18	+ $this->_resource = new $className();
19	+
20	+ $isError = false;
21	+
22	+ $ioConfig = $this->getVars();
23	+ switch ($this->getVar('type', 'file')) {
24	+ case 'file':
25	+ //validate export/import path
26	+ $path = rtrim($ioConfig['path'], '\\/')
27	+ . DS . $ioConfig['filename'];
28	+ /** @var $validator Mage_Core_Model_File_Validator_AvailablePath */
29	+ $validator = Mage::getModel('core/file_validator_availablePath');
30	+ $validator->setPaths( Mage::getStoreConfig(self::XML_PATH_EXPORT_LOCAL_VALID_PATH) );
31	+ if (!$validator->isValid($path)) {
32	+ foreach ($validator->getMessages() as $message) {
33	+ Mage::throwException($message);
34	+ return false;
35	+ }
36	+ }
37	+
38	+ if (preg_match('#^' . preg_quote(DS, '#').'#', $this->getVar('path')) \|\|
39	+ preg_match('#^[a-z]:' . preg_quote(DS, '#') . '#i', $this->getVar('path'))) {
40	+
41	+ $path = $this->_resource->getCleanPath($this->getVar('path'));
42	+ } else {
43	+ $baseDir = Mage::getBaseDir();
44	+ $path = $this->_resource->getCleanPath($baseDir . DS . trim($this->getVar('path'), DS));
45	+ }
46	+
47	+ $this->_resource->checkAndCreateFolder($path);
48	+
49	+ $realPath = realpath($path);
50	+
51	+ if (!$isError && $realPath === false) {
52	+ $message = Mage::helper('dataflow')->__('The destination folder "%s" does not exist or there is no access to create it.', $ioConfig['path']);
53	+ Mage::throwException($message);
54	+ } elseif (!$isError && !is_dir($realPath)) {
55	+ $message = Mage::helper('dataflow')->__('Destination folder "%s" is not a directory.', $realPath);
56	+ Mage::throwException($message);
57	+ } elseif (!$isError) {
58	+ if ($forWrite && !is_writeable($realPath)) {
59	+ $message = Mage::helper('dataflow')->__('Destination folder "%s" is not writable.', $realPath);
60	+ Mage::throwException($message);
61	+ } else {
62	+ $ioConfig['path'] = rtrim($realPath, DS);
63	+ }
64	+ }
65	+ break;
66	+ default:
67	+ $ioConfig['path'] = rtrim($this->getVar('path'), '/');
68	+ break;
69	+ }
70	+
71	+ if ($isError) {
72	+ return false;
73	+ }
74	+ try {
75	+ $this->_resource->open($ioConfig);
76	+ } catch (Exception $e) {
77	+ $message = Mage::helper('dataflow')->__('An error occurred while opening file: "%s".', $e->getMessage());
78	+ Mage::throwException($message);
79	+ }
80	+ }
81	+ return $this->_resource;
82	+ }
83	+
84	+ /**
85	+ * Load data
86	+ *
87	+ * @return PI_Oopsprofile_Model_Convert_Adapter_Io
88	+ */
89	+ public function load()
90	+ {
91	+ if (!$this->getResource()) {
92	+ return $this;
93	+ }
94	+
95	+ $result = '';
96	+
97	+ $filename = '';
98	+ $fileformat = $this->getVar('fileformat');
99	+
100	+ $batchModel = Mage::getSingleton('dataflow/batch');
101	+ $destFile = $batchModel->getIoAdapter()->getFile(true);
102	+ $filename = $this->getVar('filename');
103	+
104	+ if($this->getVar('path') && $fileformat=='xml')
105	+ {
106	+ $filename = $this->getVar('path').'/'.$filename;
107	+ }
108	+
109	+ if($fileformat=='xml' \|\| $fileformat=='xls' \|\| $fileformat=='xlsx')
110	+ {
111	+ if($this->getVar('type')=='sftp')
112	+ {
113	+ $filename = $this->saveOnLocalFromSftp();//copy file from ftp to local server
114	+ }
115	+ else if($this->getVar('type')=='ftp')
116	+ {
117	+ $filename = $this->saveOnLocalFromFtp();//copy file from ftp to local server
118	+ }
119	+ }
120	+ else
121	+ {
122	+
123	+ if($this->getVar('path') && $this->getVar('type')=='sftp')
124	+ {
125	+ $filename = $this->getVar('path').'/'.$filename;
126	+ }
127	+
128	+ $result = $this->getResource()->read($filename, $destFile);
129	+
130	+ $filename = $this->getResource()->pwd() . '/' . $this->getVar('filename');
131	+
132	+ if (false === $result) {
133	+ $message = Mage::helper('dataflow')->__('Could not load file: "%s".', $filename);
134	+ Mage::throwException($message);
135	+ } else {
136	+ $message = Mage::helper('dataflow')->__('Loaded successfully: "%s".', $filename);
137	+ $this->addException($message);
138	+ }
139	+ }
140	+
141	+ Mage::register('filename_with_path',$filename);// set file name with path
142	+
143	+ $this->setData($result);
144	+ return $this;
145	+ }
146	+
147	+
148	+ /**
149	+ * Save result to destination file from temporary
150	+ *
151	+ * @return PI_Oopsprofile_Model_Convert_Adapter_Io
152	+ */
153	+ public function save()
154	+ {
155	+ if (!$this->getResource(true)) {
156	+ return $this;
157	+ }
158	+
159	+ $fileformat = $this->getVar('fileformat');
160	+
161	+
162	+ /***
163	+ **** Code if format is xls or xlsx
164	+ ***/
165	+ if($fileformat=='xls' \|\| $fileformat=='xlsx')
166	+ {
167	+ if($this->getVar('type')=='ftp')
168	+ {
169	+ $this->saveOnFtp();//copy local Excel file from temp folder(var/export/ftp) to remote server
170	+ }
171	+ if($this->getVar('type')=='sftp')
172	+ {
173	+ $file = 'var/export/ftp/export_file.'.$this->getVar('fileformat');//temp file path on local server
174	+ $remote_file = $this->getVar('filename');
175	+ if($this->getVar('path'))
176	+ {
177	+ $remote_file = $this->getVar('path').'/'.$remote_file;
178	+ }
179	+ $result = $this->getResource()->write($remote_file, $file);
180	+ }
181	+
182	+ return $this;
183	+ }
184	+
185	+
186	+ $batchModel = Mage::getSingleton('dataflow/batch');
187	+
188	+ $dataFile = $batchModel->getIoAdapter()->getFile(true);
189	+
190	+
191	+ $filename = $this->getVar('filename');
192	+
193	+ if($this->getVar('path') && $this->getVar('type')=='sftp')
194	+ {
195	+ $filename = $this->getVar('path').'/'.$filename;
196	+ }
197	+
198	+
199	+
200	+ /**
201	+ * Save products separately in case of all formats except xls and xlsx
202	+ **/
203	+ $profileId = Mage::registry('current_convert_profile')->getId();
204	+
205	+ $entityType = Mage::registry('current_convert_profile')->getEntityType();
206	+
207	+ $oopprofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
208	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
209	+ ->getFirstItem();
210	+
211	+ $saveMultipleCopies = $oopprofile->getSaveProductsSeparately();
212	+ if($saveMultipleCopies==1 && $entityType=='product')//if "Save Products Separately" enable
213	+ {
214	+ $batchId = $batchModel->getId();
215	+
216	+ //$i = 1;
217	+ $fileName = $filename;
218	+ foreach(glob('var/tmp/batch_'.$batchId.'*.tmp') as $dataFileName)
219	+ {
220	+ $dFile1 = explode('.',$dataFileName);
221	+ $dFile2 = explode('_',$dFile1[0]);
222	+ $id = $dFile2[count($dFile2)-1];
223	+
224	+ $filename = '';
225	+ $explodedata = explode('.',$fileName);
226	+ $Name = $explodedata[0].'_'.$id;
227	+ $filename = $Name.'.'.$explodedata[1];
228	+ $result = $this->getResource()->write($filename, $dataFileName, 0777);
229	+ if (false === $result) {
230	+ $message = Mage::helper('dataflow')->__('Could not save file: %s.', $filename);
231	+ Mage::throwException($message);
232	+ } else {
233	+
234	+ /**
235	+ * Save Local copies in case of all formats except xls and xlsx
236	+ **/
237	+ $profileId = Mage::registry('current_convert_profile')->getId();
238	+
239	+ $oopprofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
240	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
241	+ ->getFirstItem();
242	+
243	+ $saveLocalCopies = $oopprofile->getSaveLocalCopy();
244	+
245	+ if($saveLocalCopies)//save if "save local copies" enable
246	+ {
247	+ $localpath = 'oopsprofile/'.$oopprofile->getId();
248	+ //create path if not exist
249	+ if (!file_exists($localpath)) {
250	+ mkdir($localpath, 0777, true);
251	+ }
252	+ $fileWithPath = $localpath.'/'.$filename;
253	+
254	+ $localResource = new Varien_Io_File();
255	+
256	+ $localResource->write($fileWithPath, $dataFileName, 0777);
257	+ }
258	+
259	+
260	+
261	+ $message = Mage::helper('dataflow')->__('Saved successfully: "%s" [%d byte(s)].', $filename, $batchModel->getIoAdapter()->getFileSize());
262	+ if ($this->getVar('link')) {
263	+ $message .= Mage::helper('dataflow')->__('<a href="%s" target="_blank">Link</a>', $this->getVar('link'));
264	+ }
265	+ $this->addException($message);
266	+ }
267	+ }
268	+ }
269	+ else
270	+ {
271	+
272	+ $result = $this->getResource()->write($filename, $dataFile, 0777);
273	+
274	+ if (false === $result) {
275	+ $message = Mage::helper('dataflow')->__('Could not save file: %s.', $filename);
276	+ Mage::throwException($message);
277	+ } else {
278	+
279	+ /**
280	+ * Save Local copies in case of all formats except xls and xlsx
281	+ **/
282	+ $profileId = Mage::registry('current_convert_profile')->getId();
283	+
284	+ $oopprofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
285	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
286	+ ->getFirstItem();
287	+
288	+ $saveLocalCopies = $oopprofile->getSaveLocalCopy();
289	+
290	+ if($saveLocalCopies)//save if "save local copies" enable
291	+ {
292	+ $localpath = 'oopsprofile/'.$oopprofile->getId();
293	+ //create path if not exist
294	+ if (!file_exists($localpath)) {
295	+ mkdir($localpath, 0777, true);
296	+ }
297	+ $fileWithPath = $localpath.'/'.$this->getVar('filename');
298	+
299	+ $localResource = new Varien_Io_File();
300	+
301	+ $localResource->write($fileWithPath, $dataFile, 0777);
302	+ }
303	+
304	+
305	+
306	+ $message = Mage::helper('dataflow')->__('Saved successfully: "%s" [%d byte(s)].', $filename, $batchModel->getIoAdapter()->getFileSize());
307	+ if ($this->getVar('link')) {
308	+ $message .= Mage::helper('dataflow')->__('<a href="%s" target="_blank">Link</a>', $this->getVar('link'));
309	+ }
310	+ $this->addException($message);
311	+ }
312	+ }
313	+
314	+
315	+ return $this;
316	+ }
317	+
318	+ public function saveOnFtp()
319	+ {
320	+ $file = 'var/export/ftp/export_file.'.$this->getVar('fileformat');//temp file path on local server
321	+ $remote_file = $this->getVar('filename');
322	+
323	+ // set up basic connection
324	+ $conn_id = ftp_connect($this->getVar('host'));
325	+
326	+ // login with username and password
327	+ $login_result = ftp_login($conn_id, $this->getVar('user'), $this->getVar('password'));
328	+
329	+ if($this->getVar('file_mode')==2)
330	+ {
331	+ $fileMode = FTP_BINARY;
332	+ }
333	+ else
334	+ {
335	+ $fileMode = FTP_ASCII;
336	+ }
337	+
338	+
339	+ if($this->getVar('path'))
340	+ {
341	+ $remote_file = $this->getVar('path').'/'.$remote_file;
342	+ //ftp_chdir($conn_id, $this->getVar('path'));
343	+ }
344	+
345	+ // upload a file
346	+ if (ftp_put($conn_id, $remote_file, $file, $fileMode)) {
347	+ $message = Mage::helper('dataflow')->__('successfully uploaded '). $remote_file;
348	+ $this->addException($message);
349	+ } else {
350	+ $message = Mage::helper('dataflow')->__('There was a problem while uploading '). $remote_file;
351	+ Mage::throwException($message);
352	+ }
353	+
354	+ // close the connection and the file handler
355	+ ftp_close($conn_id);
356	+
357	+ return $this;
358	+ }
359	+
360	+ public function saveOnLocalFromFtp()
361	+ {
362	+ $path = 'var/import/ftp';
363	+ $file = $path.'/import_file.'.$this->getVar('fileformat');//temp file path on local server
364	+ $remote_file = $this->getVar('filename');
365	+
366	+ //create path if not exist
367	+ if (!file_exists($path)) {
368	+ mkdir($path, 0777, true);
369	+ }
370	+
371	+ // set up basic connection
372	+ $conn_id = ftp_connect($this->getVar('host'));
373	+
374	+ // login with username and password
375	+ $login_result = ftp_login($conn_id, $this->getVar('user'), $this->getVar('password'));
376	+
377	+ if($this->getVar('file_mode')==2)
378	+ {
379	+ $fileMode = FTP_BINARY;
380	+ }
381	+ else
382	+ {
383	+ $fileMode = FTP_ASCII;
384	+ }
385	+
386	+
387	+ if($this->getVar('path'))
388	+ {
389	+ $remote_file = $this->getVar('path').'/'.$remote_file;
390	+ //ftp_chdir($conn_id, $this->getVar('path'));
391	+ }
392	+
393	+ // upload a file
394	+ if (ftp_get($conn_id, $file,$remote_file, $fileMode)) {
395	+ $message = Mage::helper('dataflow')->__('successfully loaded '). $remote_file;
396	+ $this->addException($message);
397	+ } else {
398	+ $message = Mage::helper('dataflow')->__('There was a problem while loading '). $remote_file;
399	+ Mage::throwException($message);
400	+ }
401	+ // close the connection and the file handler
402	+ ftp_close($conn_id);
403	+
404	+ return $file;
405	+ }
406	+
407	+ public function saveOnLocalFromSftp()
408	+ {
409	+ $path = 'var/import/ftp';
410	+ $file = $path.'/import_file.'.$this->getVar('fileformat');//temp file path on local server
411	+ $remote_file = $this->getVar('filename');
412	+
413	+ //create path if not exist
414	+ if (!file_exists($path)) {
415	+ mkdir($path, 0777, true);
416	+ }
417	+ if($this->getVar('path'))
418	+ {
419	+ $remote_file = $this->getVar('path').'/'.$remote_file;
420	+ }
421	+ $result = $this->getResource()->read($remote_file,$file);
422	+
423	+ // upload a file
424	+ if ($result===false) {
425	+ $message = Mage::helper('dataflow')->__('There was a problem while loading '). $remote_file;
426	+ Mage::throwException($message);
427	+ } else {
428	+ $message = Mage::helper('dataflow')->__('successfully loaded '). $remote_file;
429	+ $this->addException($message);
430	+ }
431	+ return $file;
432	+
433	+ }
434	+ }

app/code/community/PI/Oopsprofile/Model/Convert/Adapter/Mail.php ADDED Viewed

	@@ -0,0 +1,279 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Convert_Adapter_Mail extends Mage_Dataflow_Model_Convert_Adapter_Io {
4	+ const DEFAULT_PROTOCOL = 'IMAP';
5	+ const DEFAULT_HOST = '127.0.0.1';
6	+ const DEFAULT_IMAP_PORT = 143;
7	+ const IMAP_SSL_PORT = 993;
8	+
9	+ const GOOGLE_IMAP_SERVICE = 'imap.gmail.com';
10	+ protected $_encryptionTypes = array(
11	+ 'TLS',
12	+ 'SSL',
13	+ );
14	+
15	+ const DEFAULT_ATTACHMENT_SUBJECT = 'attachment';
16	+ const DEFAULT_ATTACHMENT_SAVE_PATH = 'var/import/attachments';
17	+
18	+ protected function readAccessTokenByService($service, $profileId) {
19	+
20	+ $tokenName = 'oops_' . $profileId . '_mail.tmp';
21	+ $tokenPath = Mage::getBaseDir('var') . DS . 'token';
22	+
23	+ $io = new Varien_Io_File();
24	+ $io->open(array('path' => $tokenPath));
25	+ $content = $io->read($tokenName);
26	+ $io->close();
27	+ return json_decode($content, true);
28	+ }
29	+
30	+ protected function _constructAuthString($username, $token) {
31	+
32	+ $accessToken = null;
33	+ if (false === strpos($username, '@gmail.com')) {
34	+ $email = $username . '@gmail.com';
35	+ } else {
36	+ $email = $username;
37	+ }
38	+
39	+ if (isset($token['access_token'])) {
40	+ $accessToken = $token['access_token'];
41	+ }
42	+ if ($accessToken) {
43	+ return base64_encode("user=$email\1auth=Bearer $accessToken\1\1");
44	+ }
45	+ return false;
46	+ }
47	+
48	+ protected function _sendAuthenticationRequest($imap, $username, $tokenData) {
49	+
50	+ if ($authString = $this->_constructAuthString($username, $tokenData)) {
51	+ $authenticateParams = array('XOAUTH2', $authString);
52	+ $imap->sendRequest('AUTHENTICATE', $authenticateParams); //send request
53	+ while (true) {
54	+ $response = "";
55	+ $is_plus = $imap->readLine($response, '+', true);
56	+ if ($is_plus) {
57	+ $errorMsg = sprintf("got an extra server challenge: %s", $response);
58	+ Mage::log($errorMsg);
59	+ // Send empty client response.
60	+ $imap->sendRequest('');
61	+ } else {
62	+ if (preg_match('/^NO /i', $response) \|\|
63	+ preg_match('/^BAD /i', $response)) {
64	+ //error_log("got failure response: $response");
65	+ $errorMsg = sprintf("got failure response: %s", $response);
66	+ Mage::log($errorMsg);
67	+ return false;
68	+ } else if (preg_match("/^OK /i", $response)) {
69	+ return true;
70	+ } else {
71	+ Mage::log('Some untagged response, such as CAPABILITY');
72	+ }
73	+ }
74	+ }
75	+ }
76	+ }
77	+
78	+ protected function _buildProtocolConfig(&$config, $vars){
79	+
80	+ $config['encryption'] = false; //overrided in case of a service provider like 'Gmail'
81	+
82	+ if (isset($vars['host'])) {
83	+ $config['host'] = $vars['host'];
84	+ }
85	+
86	+ if (isset($vars['port'])) {
87	+ $config['port'] = $vars['port'];
88	+ }
89	+
90	+ if (isset($vars['encryption'])) {
91	+ $config['ssl'] = $vars['encryption'];
92	+ }
93	+
94	+ if (isset($vars['username'])) {
95	+ $config['user'] = $vars['username'];
96	+ }
97	+
98	+ if (isset($vars['password'])) {
99	+ $config['password'] = $vars['password'];
100	+ }
101	+
102	+ if (isset($vars['service_provider']) && $vars['service_provider'] == 'gmail') {
103	+ $config['encryption'] = true;
104	+ }
105	+ }
106	+
107	+ /*
108	+ * Return the storage object
109	+ */
110	+
111	+ public function getMailResource() {
112	+
113	+ $mailStorage = null;
114	+ $protocolConfig = array();
115	+
116	+ $protocol = strtoupper($this->getVar('protocol', self::DEFAULT_PROTOCOL));
117	+
118	+ $host = $this->getVar('host', self::DEFAULT_HOST);
119	+ $port = $this->getVar('port');
120	+ $pswd = $this->getVar('password');
121	+ $username = $this->getVar('username');
122	+ $encryption = $this->getVar('encryption');
123	+ $serviceProvider = $this->getVar('service_provider', null);
124	+
125	+ $currentProfile = Mage::app()->getRequest()->getParam('id');
126	+
127	+ //updates the $protocolConfig by reference
128	+ $this->_buildProtocolConfig($protocolConfig, $this->getVars());
129	+
130	+ switch ($protocol) {
131	+ case 'POP3'://not implemented
132	+ default:
133	+ if ($serviceProvider) {
134	+ switch ($serviceProvider) {
135	+ case 'gmail':
136	+ //connect google imap service args => array('host'=> value,'port'=> value,'ssl'=> true)
137	+ $imap = Mage::getModel('oopsprofile/mail_protocol_imap', $protocolConfig);
138	+
139	+ /* read the current profile access token
140	+ * if not available display message to generate one using allow acess
141	+ */
142	+ $tokenData = $this->readAccessTokenByService($serviceProvider, $currentProfile);
143	+ //validate token with gmail
144	+ $isTokenOk = $this->_sendAuthenticationRequest($imap, $username, $tokenData);
145	+ if(true === $isTokenOk){
146	+ $mailStorage = Mage::getModel('oopsprofile/mail_storage_imap', $imap);
147	+ }
148	+
149	+ }
150	+ }else{
151	+
152	+ //Attempt to open imap connection using array('host', 'port', 'username', 'password', 'ssl')
153	+ //print_r($protocolConfig);exit;
154	+ $mailStorage = Mage::getModel('oopsprofile/mail_storage_imap', $protocolConfig);
155	+
156	+
157	+ }
158	+
159	+ }
160	+
161	+ return $mailStorage;
162	+ }
163	+
164	+ /*
165	+ * Fetch Attachment
166	+ */
167	+
168	+ public function load() {
169	+
170	+ $savedAttachments = array();
171	+
172	+ if (!$mailStorage = $this->getMailResource()) {
173	+ $message = Mage::helper('oopsprofile')->__('Could not connect to the Mail server.');
174	+ Mage::throwException($message);
175	+ }
176	+
177	+ $attachmentSubject = $this->getVar('mailsubject', self::DEFAULT_ATTACHMENT_SUBJECT);
178	+ $attachmentSavePath = $this->getVar('attachmentsavepath', self::DEFAULT_ATTACHMENT_SAVE_PATH);
179	+ $checkOnlyNewFlag = $this->getVar('checkonlynewmsgs', false); //only scan msgs with RECENT FLAG
180	+ $deleteAttachmentFlag = $this->getVar('deleteattachment', false); //delete mails after fetching the attachments
181	+ //try{
182	+ //Attachments will be saved locally as per given subject to the path provided
183	+ $savedAttachments = $mailStorage->fetchNSaveAttachmentsToImport(
184	+ $attachmentSubject, $attachmentSavePath, $checkOnlyNewFlag, $deleteAttachmentFlag
185	+ );
186	+ //}catch(Exception $e){
187	+ // Mage::log($e);
188	+ //}
189	+
190	+ /*
191	+ * Set vars to $this as if they were defined in the xml
192	+ */
193	+ //echo 'helooo';exit;
194	+ //print_r($savedAttachments);exit;
195	+
196	+ if (!empty($savedAttachments)) {
197	+ foreach ($savedAttachments as $file) {
198	+ $this->setVar('filename', $file);
199	+ $this->setVar('path', $attachmentSavePath);
200	+ $this->setVar('type', 'file');
201	+ }
202	+ } else {
203	+ $message = Mage::helper('oopsprofile')->__('Failed to fetch attachments from the mail server OR No attachments found on server.');
204	+ Mage::throwException($message);
205	+ }
206	+
207	+ if (!$this->getResource()) {
208	+ return $this;
209	+ }
210	+
211	+ $batchModel = Mage::getSingleton('dataflow/batch');
212	+ $destFile = $batchModel->getIoAdapter()->getFile(true);
213	+
214	+
215	+ $result = $this->getResource()->read($this->getVar('filename'), $destFile);
216	+ $filename = $this->getResource()->pwd() . '/' . $this->getVar('filename');
217	+ if (false === $result) {
218	+ $message = Mage::helper('dataflow')->__('Could not load file: "%s".', $filename);
219	+ Mage::throwException($message);
220	+ } else {
221	+ $message = Mage::helper('dataflow')->__('Loaded successfully: "%s".', $filename);
222	+ $this->addException($message);
223	+ }
224	+
225	+ $this->setData($result);
226	+ return $this;
227	+ }
228	+
229	+ /**
230	+ * Save result to destination file from temporary
231	+ *
232	+ * @return Mage_Dataflow_Model_Convert_Adapter_Io
233	+ */
234	+ public function save() {
235	+
236	+ $helper = Mage::helper('oopsprofile/mail');
237	+
238	+ $attachmentSubject = $this->getVar('mailsubject', self::DEFAULT_ATTACHMENT_SUBJECT);
239	+ $attachmentSavePath = $this->getVar('attachmentsavepath', self::DEFAULT_ATTACHMENT_SAVE_PATH);
240	+ $checkOnlyNewFlag = $this->getVar('checkonlynewmsgs', false); //only scan msgs with RECENT FLAG
241	+ $deleteAttachmentFlag = $this->getVar('deleteattachment', false); //delete mails after fetching the attachments
242	+
243	+ $this->setVar('path', $attachmentSavePath);
244	+
245	+
246	+ if (!$this->getResource(true)) {
247	+ return $this;
248	+ }
249	+
250	+ $batchModel = Mage::getSingleton('dataflow/batch');
251	+
252	+ $dataFile = $batchModel->getIoAdapter()->getFile(true);
253	+
254	+ $filename = $this->getVar('filename');
255	+
256	+ $result = $this->getResource()->write($filename, $dataFile, 0777);
257	+
258	+ //attach the file as attachment and email it
259	+ $mail = Mage::getModel('oopsprofile/mail');
260	+ $mail->sendMailWithAttachment($this->getVars());
261	+
262	+ if ($result === true) {
263	+
264	+ }
265	+
266	+ if (false === $result) {
267	+ $message = Mage::helper('dataflow')->__('Could not save file: %s.', $filename);
268	+ Mage::throwException($message);
269	+ } else {
270	+ $message = Mage::helper('dataflow')->__('Saved successfully: "%s" [%d byte(s)].', $filename, $batchModel->getIoAdapter()->getFileSize());
271	+ if ($this->getVar('link')) {
272	+ $message .= Mage::helper('dataflow')->__('<a href="%s" target="_blank">Link</a>', $this->getVar('link'));
273	+ }
274	+ $this->addException($message);
275	+ }
276	+ return $this;
277	+ }
278	+
279	+ }

app/code/community/PI/Oopsprofile/Model/Convert/Parser/Csv.php ADDED Viewed

	@@ -0,0 +1,206 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Convert_Parser_Csv extends Mage_Dataflow_Model_Convert_Parser_Csv
4	+ {
5	+
6	+ /**
7	+ * Read data collection and write to temporary file
8	+ *
9	+ * @return PI_Oopsprofile_Model_Convert_Parser_Csv
10	+ */
11	+ public function unparse()
12	+ {
13	+ $batchExport = $this->getBatchExportModel()
14	+ ->setBatchId($this->getBatchModel()->getId());
15	+ $fieldList = $this->getBatchModel()->getFieldList();
16	+ $batchExportIds = $batchExport->getIdCollection();
17	+
18	+ $io = $this->getBatchModel()->getIoAdapter();
19	+
20	+
21	+
22	+ /**
23	+ * Save products separately
24	+ **/
25	+ $profileId = Mage::registry('current_convert_profile')->getId();
26	+
27	+ $entityType = Mage::registry('current_convert_profile')->getEntityType();
28	+
29	+ $oopprofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
30	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
31	+ ->getFirstItem();
32	+
33	+ $saveMultipleCopies = $oopprofile->getSaveProductsSeparately();
34	+ if($saveMultipleCopies==1 && $entityType=='product')//if "Save Products Separately" enable
35	+ {
36	+
37	+ if (!$batchExportIds) {
38	+ $io->write("");
39	+ $io->close();
40	+ return $this;
41	+ }
42	+
43	+ $i=1;
44	+ foreach ($batchExportIds as $batchExportId) {
45	+
46	+ $io->openMulty($i++);
47	+
48	+
49	+ if ($this->getVar('fieldnames')) {
50	+ $csvData = $this->getCsvString($fieldList);
51	+ $io->write($csvData);
52	+ }
53	+
54	+ $csvData = array();
55	+ $batchExport->load($batchExportId);
56	+ $row = $batchExport->getBatchData();
57	+
58	+ foreach ($fieldList as $field) {
59	+ $csvData[] = isset($row[$field]) ? $row[$field] : '';
60	+ }
61	+ $csvData = $this->getCsvString($csvData);
62	+ $io->write($csvData);
63	+ $io->close();
64	+ }
65	+ }
66	+ else
67	+ {
68	+ $io->open();
69	+
70	+
71	+ if (!$batchExportIds) {
72	+ $io->write("");
73	+ $io->close();
74	+ return $this;
75	+ }
76	+
77	+ if ($this->getVar('fieldnames')) {
78	+ $csvData = $this->getCsvString($fieldList);
79	+ $io->write($csvData);
80	+ }
81	+
82	+ foreach ($batchExportIds as $batchExportId) {
83	+ $csvData = array();
84	+ $batchExport->load($batchExportId);
85	+ $row = $batchExport->getBatchData();
86	+
87	+ foreach ($fieldList as $field) {
88	+ $csvData[] = isset($row[$field]) ? $row[$field] : '';
89	+ }
90	+ $csvData = $this->getCsvString($csvData);
91	+ $io->write($csvData);
92	+ }
93	+
94	+ $io->close();
95	+ }
96	+
97	+ return $this;
98	+ }
99	+
100	+
101	+ public function parse()
102	+ {
103	+ // fixed for multibyte characters
104	+ setlocale(LC_ALL, Mage::app()->getLocale()->getLocaleCode().'.UTF-8');
105	+
106	+ $fDel = $this->getVar('delimiter', ',');
107	+ $fEnc = $this->getVar('enclose', '"');
108	+ if ($fDel == '\t') {
109	+ $fDel = "\t";
110	+ }
111	+
112	+ $adapterName = $this->getVar('adapter', null);
113	+ $adapterMethod = $this->getVar('method', 'saveRow');
114	+
115	+ if (!$adapterName \|\| !$adapterMethod) {
116	+ $message = Mage::helper('dataflow')->__('Please declare "adapter" and "method" nodes first.');
117	+ $this->addException($message, Mage_Dataflow_Model_Convert_Exception::FATAL);
118	+ return $this;
119	+ }
120	+
121	+ try {
122	+ $adapter = Mage::getModel($adapterName);
123	+ }
124	+ catch (Exception $e) {
125	+ $message = Mage::helper('dataflow')->__('Declared adapter %s was not found.', $adapterName);
126	+ $this->addException($message, Mage_Dataflow_Model_Convert_Exception::FATAL);
127	+ return $this;
128	+ }
129	+
130	+ if (!method_exists($adapter, $adapterMethod)) {
131	+ $message = Mage::helper('dataflow')->__('Method "%s" not defined in adapter %s.', $adapterMethod, $adapterName);
132	+ $this->addException($message, Mage_Dataflow_Model_Convert_Exception::FATAL);
133	+ return $this;
134	+ }
135	+
136	+ $batchModel = $this->getBatchModel();
137	+ $batchIoAdapter = $this->getBatchModel()->getIoAdapter();
138	+
139	+ if (Mage::app()->getRequest()->getParam('files')) {
140	+ $file = Mage::app()->getConfig()->getTempVarDir().'/import/'
141	+ . urldecode(Mage::app()->getRequest()->getParam('files'));
142	+ $this->_copy($file);
143	+ }
144	+
145	+ $batchIoAdapter->open(false);
146	+
147	+ $isFieldNames = $this->getVar('fieldnames', '') == 'true' ? true : false;
148	+ if (!$isFieldNames && is_array($this->getVar('map'))) {
149	+ $fieldNames = $this->getVar('map');
150	+ }
151	+ else {
152	+
153	+ $fieldNames = array();
154	+ foreach ($batchIoAdapter->read(true, $fDel, $fEnc) as $v) {
155	+ $fieldNames[$v] = $v;
156	+ }
157	+
158	+ if(is_array($this->getVar('map')))
159	+ {
160	+ $mappedfields = $this->getVar('map');
161	+
162	+ $fieldNames = array_merge($fieldNames,$mappedfields);
163	+ }
164	+
165	+
166	+ }
167	+
168	+ //echo '<pre>';print_r($fieldNames);exit;
169	+
170	+ $countRows = 0;
171	+ while (($csvData = $batchIoAdapter->read(true, $fDel, $fEnc)) !== false) {
172	+ if (count($csvData) == 1 && $csvData[0] === null) {
173	+ continue;
174	+ }
175	+
176	+
177	+ $itemData = array();
178	+ $countRows ++; $i = 0;
179	+ foreach ($fieldNames as $field) {
180	+ $itemData[$field] = isset($csvData[$i]) ? $csvData[$i] : null;
181	+ $i ++;
182	+ }
183	+ //echo '<pre>';print_r($itemData);
184	+ $batchImportModel = $this->getBatchImportModel()
185	+ ->setId(null)
186	+ ->setBatchId($this->getBatchModel()->getId())
187	+ ->setBatchData($itemData)
188	+ ->setStatus(1)
189	+ ->save();
190	+ }
191	+
192	+
193	+ $this->addException(Mage::helper('dataflow')->__('Found %d rows.', $countRows));
194	+ $this->addException(Mage::helper('dataflow')->__('Starting %s :: %s', $adapterName, $adapterMethod));
195	+
196	+ $batchModel->setParams($this->getVars())
197	+ ->setAdapter($adapterName)
198	+ ->save();
199	+
200	+ //$adapter->$adapterMethod();
201	+
202	+ return $this;
203	+ }
204	+
205	+ }
206	+ ?>

app/code/community/PI/Oopsprofile/Model/Convert/Parser/Txt.php ADDED Viewed

	@@ -0,0 +1,6 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Convert_Parser_Txt extends PI_Oopsprofile_Model_Convert_Parser_Csv
4	+ {
5	+ }
6	+ ?>

app/code/community/PI/Oopsprofile/Model/Createapiobserver.php ADDED Viewed

	@@ -0,0 +1,89 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Createapiobserver
3	+ {
4	+
5	+ public function createapi()
6	+ {
7	+
8	+ try
9	+ {
10	+ $apiUserModel = Mage::getModel('api/user');
11	+
12	+ $apiId = $apiUserModel->getCollection()->addFieldToFilter('username','OopsProfileUser')->getFirstItem()->getId();
13	+ if($apiId=='')//if api user is not exist
14	+ {
15	+ $apiRoleId = $this->createApiRole();
16	+
17	+ $this->craeteApiUser($apiUserModel,$apiRoleId);
18	+ }
19	+ }
20	+ catch(Exception $e)
21	+ {
22	+ Mage::getSingleton('adminhtml/session')->addError($e->getMessage());
23	+ }
24	+ }
25	+
26	+
27	+ //code to create role with their resources
28	+ protected function createApiRole()
29	+ {
30	+
31	+ //assign resources to role
32	+ $resource = array('_root_',
33	+ 'oopsprofile',
34	+ 'oopsprofile/exportproductdata',
35	+ 'oopsprofile/exportcustomerdata',
36	+ 'oopsprofile/exportcustomergroupdata',
37	+ 'oopsprofile/exportorderdata',
38	+ 'oopsprofile/exportshipmentdata',
39	+ 'oopsprofile/exportinvoicedata',
40	+ 'oopsprofile/exportcreditmemodata'
41	+ );
42	+
43	+ $roleModel = Mage::getModel('api/roles');
44	+
45	+ $roleId = $roleModel->getCollection()->addFieldToFilter('role_name','OopsRole')->getFirstItem()->getId();
46	+
47	+ if($roleId=='')//if role id is not exist
48	+ {
49	+
50	+ //create new Role
51	+ $role = $roleModel
52	+ ->setName('OopsRole')
53	+ ->setPid(0)
54	+ ->setRoleType('G')
55	+ ->save(); //save in api_role
56	+
57	+ Mage::getModel("api/rules")
58	+ ->setRoleId($role->getId())
59	+ ->setResources($resource)
60	+ ->saveRel(); //save resources in api_rule and assign it to a role
61	+
62	+ return $role->getId();
63	+ }
64	+
65	+ return $this;
66	+ }
67	+
68	+ //create api user with their role
69	+ protected function craeteApiUser($apiUserModel,$apiRoleId)
70	+ {
71	+ $userRoles = array ($apiRoleId);
72	+
73	+ $data['username'] = 'OopsProfileUser';
74	+ $data['firstname'] = 'profile';
75	+ $data['lastname'] = 'user';
76	+ $data['api_key'] = 'oopsprofileapikey';
77	+ $data['is_active'] = 1;
78	+ $data['email'] = 'profileemail@email.com';
79	+
80	+ $apiUserModel->setData($data)->save();//save data in api_user
81	+
82	+ $role = $apiUserModel->setRoleIds($userRoles)
83	+ ->setRoleUserId($apiUserModel->getUserId())
84	+ ->saveRelations(); // save data in api_role and assign role to user
85	+
86	+ return $this;
87	+ }
88	+
89	+ }

app/code/community/PI/Oopsprofile/Model/CronObserver.php ADDED Viewed

	@@ -0,0 +1,310 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_CronObserver extends Varien_Object{
3	+
4	+ const CRON_MODEL_PATH = 'crontab/jobs/oopsprofile_cron/run/model';
5	+ const PROFILE_JOB_CODE_PREFIX = 'oopsprofile_cron_';
6	+ const OOPS_PROFILE_LOG_FILE = 'oops.log';
7	+
8	+ /*
9	+ * Save Cron Schedule to Core_Config_Data
10	+ */
11	+ public function saveCronSchedule($observer){
12	+
13	+ $oopsprofile = $observer->getEvent()->getOopsprofile();
14	+
15	+ $cronExprKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/schedule/cron_expr';
16	+ $cronModelKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/run/model';
17	+ // 0 means profile is enabled
18	+ $isEnabled = $oopsprofile->getData('profile_enable') == 0;
19	+
20	+ if($oopsprofile->getData('cron_enabled') == 1 && $isEnabled){
21	+
22	+ $cronExprString = '';
23	+ $time = '';
24	+ $frequency = '';
25	+
26	+ $frequencyDaily = Mage_Adminhtml_Model_System_Config_Source_Cron_Frequency::CRON_DAILY;
27	+ $frequencyWeekly = Mage_Adminhtml_Model_System_Config_Source_Cron_Frequency::CRON_WEEKLY;
28	+ $frequencyMonthly = Mage_Adminhtml_Model_System_Config_Source_Cron_Frequency::CRON_MONTHLY;
29	+
30	+ $time = $oopsprofile->getData('cron_start_time');
31	+ $frequency = $oopsprofile->getData('cron_frequency');
32	+
33	+ $isExpertMode = $oopsprofile->getData('cron_expert_mode');
34	+
35	+ if($time && $frequency \|\| $isExpertMode){
36	+
37	+ $cronDayOfWeek = date('N');
38	+ $cronExprArray = array(
39	+ intval($time[1]), # Minute
40	+ intval($time[0]), # Hour
41	+ ($frequency == $frequencyMonthly) ? '1' : '*', # Day of the Month
42	+ '*', # Month of the Year
43	+ ($frequency == $frequencyWeekly) ? '1' : '*', # Day of the Week
44	+ );
45	+ $cronExprString = join(' ', $cronExprArray);
46	+
47	+ $cronModelValue = 'oopsprofile/cronObserver::runProfile';
48	+
49	+ if($isExpertMode){
50	+ $cronExprString = $oopsprofile->getData('cron_expression');
51	+ }
52	+
53	+ try {
54	+ Mage::getModel('core/config_data')
55	+ ->load($cronExprKeyPath, 'path')
56	+ ->setValue($cronExprString)
57	+ ->setPath($cronExprKeyPath)
58	+ ->save();
59	+
60	+ Mage::getModel('core/config_data')
61	+ ->load($cronModelKeyPath, 'path')
62	+ ->setValue($cronModelValue)
63	+ ->setPath($cronModelKeyPath)
64	+ ->save();
65	+ }catch (Exception $e) {
66	+ Mage::throwException(Mage::helper('adminhtml')->__('Unable to save the cron expression.'));
67	+ }
68	+ }
69	+
70	+ }else{
71	+ try {
72	+ $configExpr = Mage::getModel('core/config_data')->load($cronExprKeyPath, 'path');
73	+ if($configExpr){
74	+ $configExpr->delete();
75	+ }
76	+
77	+ $configModel = Mage::getModel('core/config_data')->load($cronModelKeyPath, 'path');
78	+ if($configModel){
79	+ $configModel->delete();
80	+ }
81	+
82	+ }catch (Exception $e) {
83	+ Mage::throwException(Mage::helper('adminhtml')->__('Unable to save the cron expression.'));
84	+ }
85	+ }
86	+
87	+ if($isEnabled!=1)
88	+ {
89	+ $msg = Mage::helper('oopsprofile')->__('You can shedule the cron after enabling the profile');
90	+ Mage::getSingleton('adminhtml/session')->addNotice($msg);
91	+ }
92	+
93	+ return $this;
94	+ }
95	+
96	+
97	+ /*
98	+ * Save Oops Cron Schedule to Core_Config_Data
99	+ */
100	+ public function saveOopsCronSchedule($observer){
101	+
102	+ $oopsprofile = $observer->getEvent()->getOopsprofile();
103	+
104	+ $cronExprKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/schedule/cron_expr';
105	+ $cronModelKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/run/model';
106	+ // 0 means profile is enabled
107	+ $isEnabled = $oopsprofile->getData('profile_enable') == 0;
108	+
109	+ if($oopsprofile->getData('cron_enabled') == 1 && $isEnabled){
110	+
111	+ $cronExprString = $oopsprofile->getData('cron_expression');
112	+
113	+
114	+ $cronModelValue = 'oopsprofile/cronObserver::runProfile';
115	+
116	+
117	+ try {
118	+ Mage::getModel('core/config_data')
119	+ ->load($cronExprKeyPath, 'path')
120	+ ->setValue($cronExprString)
121	+ ->setPath($cronExprKeyPath)
122	+ ->save();
123	+
124	+ Mage::getModel('core/config_data')
125	+ ->load($cronModelKeyPath, 'path')
126	+ ->setValue($cronModelValue)
127	+ ->setPath($cronModelKeyPath)
128	+ ->save();
129	+ }catch (Exception $e) {
130	+ Mage::throwException(Mage::helper('adminhtml')->__('Unable to save the cron expression.'));
131	+ }
132	+
133	+
134	+ }else{
135	+ try {
136	+ $configExpr = Mage::getModel('core/config_data')->load($cronExprKeyPath, 'path');
137	+ if($configExpr){
138	+ $configExpr->delete();
139	+ }
140	+
141	+ $configModel = Mage::getModel('core/config_data')->load($cronModelKeyPath, 'path');
142	+ if($configModel){
143	+ $configModel->delete();
144	+ }
145	+
146	+ }catch (Exception $e) {
147	+ Mage::throwException(Mage::helper('adminhtml')->__('Unable to save the cron expression.'));
148	+ }
149	+ }
150	+
151	+ if($isEnabled!=1)
152	+ {
153	+ $msg = Mage::helper('oopsprofile')->__('You can shedule the cron after enabling the profile');
154	+ Mage::getSingleton('adminhtml/session')->addNotice($msg);
155	+ }
156	+
157	+ return $this;
158	+ }
159	+
160	+ /*
161	+ * delete cron schedule from core_config_data when related oopsprofile is deleted
162	+ **/
163	+ public function deleteCronSchedule($observer){
164	+
165	+ $oopsprofile = $observer->getEvent()->getOopsprofile();
166	+
167	+ //$oopsProfileId = $oopsprofile->getId();
168	+
169	+ //if($oopsprofile->getData('cron_enabled') == 1){
170	+ $cronExprKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/schedule/cron_expr';
171	+ $cronModelKeyPath = 'crontab/jobs/oopsprofile_cron_' . $oopsprofile->getId() . '/run/model';
172	+
173	+ try{
174	+ $configExpr = Mage::getModel('core/config_data')->load($cronExprKeyPath, 'path');
175	+ $configExpr->delete();
176	+
177	+ $configModel = Mage::getModel('core/config_data')->load($cronModelKeyPath, 'path');
178	+ $configModel->delete();
179	+
180	+ }catch (Exception $e) {
181	+ Mage::throwException(Mage::helper('adminhtml')->__('Unable to delete the cron expression.'));
182	+ }
183	+ //}
184	+
185	+ return $this;
186	+ }
187	+
188	+
189	+
190	+
191	+
192	+ protected function _initOopsProfile($id){
193	+
194	+ Mage::app()->setCurrentStore(Mage_Core_Model_App::ADMIN_STORE_ID);
195	+
196	+ $userModel = Mage::getModel('admin/user');
197	+ $userModel->setUserId(0);
198	+ Mage::getSingleton('admin/session')->setUser($userModel);
199	+
200	+ $oopsprofile = Mage::getModel('oopsprofile/oopsprofile')->load($id);
201	+
202	+ $dataflowProfileId = $oopsprofile->getData('dataflow_profile_id');
203	+ $dataflowProfile = Mage::getModel('dataflow/profile')->load($dataflowProfileId);
204	+ if (!$dataflowProfile->getId()) {
205	+ Mage::log('ERROR: Incorrect profile id', null, self::OOPS_PROFILE_LOG_FILE);
206	+ }
207	+
208	+ Mage::unregister('current_convert_profile');
209	+ Mage::unregister('current_convert_oopsprofile');
210	+
211	+ //Mage::register('current_convert_profile', $dataflowProfile);
212	+ Mage::register('current_convert_oopsprofile', $oopsprofile);
213	+
214	+ return $dataflowProfile;
215	+ }
216	+
217	+ /Run Oopsprofile Via Cron/
218	+ public function runProfile($schedule){
219	+
220	+ $jobCode = $schedule->getData('job_code');
221	+ $pos = strpos((string)$jobCode, self::PROFILE_JOB_CODE_PREFIX);
222	+ $strLen = strlen(self::PROFILE_JOB_CODE_PREFIX);
223	+
224	+ $logFileName = self::OOPS_PROFILE_LOG_FILE;
225	+
226	+ //Re-confirm that its a oops profile
227	+ if(substr($jobCode, 0,$strLen) == self::PROFILE_JOB_CODE_PREFIX){
228	+
229	+ $profileId = substr($jobCode, $strLen);
230	+
231	+ //load & set oopsprofile & dataflow profile to registry
232	+ $profile = $this->_initOopsProfile($profileId);
233	+
234	+ Mage::log('Oopsprofile:: ' . $profileId . ' Started.', null, $logFileName);
235	+
236	+ //try{
237	+
238	+ Mage::log('Is Cron Disabled:: '. Mage::registry('current_convert_oopsprofile')->getData('cron_enable'), null, $logFileName);
239	+ if(Mage::registry('current_convert_oopsprofile')->getData('cron_enable') == 1){
240	+ Mage::log('Halting Execution:: profile disabled.', null, $logFileName);
241	+ return false;
242	+ }
243	+
244	+ //$profile = Mage::registry('current_convert_profile');
245	+ $profile->run();
246	+
247	+ $batchModel = Mage::getSingleton('dataflow/batch');
248	+ if ($batchModel->getId()) {
249	+ if ($batchModel->getAdapter()) {
250	+
251	+ $batchId = $batchModel->getId();
252	+ $batchImportModel = $batchModel->getBatchImportModel();
253	+ $importIds = $batchImportModel->getIdCollection();
254	+
255	+ Mage::log('Ids to import::', null, $logFileName);
256	+ Mage::log($importIds, null, $logFileName);
257	+
258	+ $batchModel = Mage::getModel('dataflow/batch')->load($batchId);
259	+ $adapter = Mage::getModel($batchModel->getAdapter());
260	+
261	+ $recordCount = 0;
262	+ foreach ($importIds as $importId) {
263	+
264	+ $recordCount++;
265	+ try{
266	+
267	+ $batchImportModel->load($importId);
268	+ if (!$batchImportModel->getId()) {
269	+ $errors[] = Mage::helper('dataflow')->__('Skip undefined row');
270	+ continue;
271	+ }
272	+
273	+ $importData = $batchImportModel->getBatchData();
274	+ try {
275	+ $adapter->saveRow($importData);
276	+ } catch (Exception $e) {
277	+ Mage::log($e->getMessage(),null,$logFileName);
278	+ continue;
279	+ }
280	+
281	+ if ($recordCount%20 == 0) {
282	+ Mage::log($recordCount . ' - Completed!!',null,$logFileName);
283	+ }
284	+
285	+ } catch(Exception $ex) {
286	+ Mage::log('Record# ' . $recordCount . ' - SKU = ' . $importData['sku']. ' - Error - ' . $ex->getMessage(),null,$logFileName);
287	+ }
288	+ }
289	+
290	+ if(!empty($errors)){
291	+ Mage::log('Rows Skipped::', null, $logFileName);
292	+ Mage::log($errors, null, $logFileName);
293	+ }
294	+ } else {
295	+ Mage::log('setBatchModelHasAdapter::false', null, $logFileName);
296	+ Mage::log('Export '.$profileId.' Complete. BatchID: '.$batchModel->getId(), null, $logFileName);
297	+ $batchModel->delete();
298	+ }
299	+ }
300	+ //}catch(Exception $e){
301	+ // Mage::log($e, null, $logFileName);
302	+ //}
303	+ }
304	+ }
305	+
306	+ public function heartbeat($observer){
307	+ return true;
308	+ }
309	+
310	+ }

app/code/community/PI/Oopsprofile/Model/Customergroup/Convert/Adapter/Customergroup.php ADDED Viewed

	@@ -0,0 +1,103 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Customergroup_Convert_Adapter_Customergroup
4	+ extends Mage_Eav_Model_Convert_Adapter_Entity
5	+ {
6	+ public function load()
7	+ {
8	+ try
9	+ {
10	+ $collection = $this->getCustomerGroupModel()
11	+ ->getCollection();
12	+ $entityIds = $collection->getAllIds();
13	+ $message = Mage::helper('eav')->__("Loaded %d records", count($entityIds));
14	+ $this->addException($message);
15	+ }
16	+ catch (Varien_Convert_Exception $e) {
17	+ throw $e;
18	+ }
19	+ catch (Exception $e) {
20	+ $message = Mage::helper('eav')->__('Problem loading the collection, aborting. Error: %s', $e->getMessage());
21	+ $this->addException($message, Varien_Convert_Exception::FATAL);
22	+ }
23	+ /**
24	+ * Set collection ids
25	+ */
26	+ $this->setData($entityIds);
27	+ return $this;
28	+ }
29	+
30	+ public function parse()
31	+ {
32	+ $batchModel = Mage::getSingleton('dataflow/batch');
33	+ /* @var $batchModel Mage_Dataflow_Model_Batch */
34	+
35	+ $batchImportModel = $batchModel->getBatchImportModel();
36	+ $importIds = $batchImportModel->getIdCollection();
37	+
38	+ foreach ($importIds as $importId) {
39	+ $batchImportModel->load($importId);
40	+ $importData = $batchImportModel->getBatchData();
41	+
42	+ $this->saveRow($importData);
43	+ }
44	+ }
45	+
46	+ /*
47	+ * saveRow function for saving each customer group
48	+ *
49	+ * params args array
50	+ * return array
51	+ */
52	+ public function saveRow($importData)
53	+ {
54	+ try
55	+ {
56	+ $taxClassModel = Mage::getModel('tax/class');
57	+ $taxClassIds = $taxClassModel->getCollection()->getAllIds();
58	+ $customergroup = $this->getCustomerGroupModel();
59	+
60	+ if(!empty($importData))
61	+ {
62	+ if(array_search($importData['tax_class_id'],$taxClassIds))
63	+ {
64	+ $customergroup->setTaxClassId($importData['tax_class_id'])->setCustomerGroupCode($importData['customer_group_code']);
65	+ $groupId = $customergroup->getCollection()->addFieldToFilter('customer_group_code',$importData['customer_group_code'])->getFirstItem()->getId();
66	+ if(!empty($groupId))
67	+ {
68	+ $customergroup->setId($groupId);
69	+ }
70	+ else
71	+ {
72	+ $customergroup->setId(null);
73	+ }
74	+
75	+ $customergroup->save();
76	+ }
77	+ else
78	+ {
79	+ $message = Mage::helper('oopsprofile')->__('tax_class_id %s is not exist',$importData['tax_class_id']);
80	+ Mage::throwException($message);
81	+ }
82	+ }
83	+ else
84	+ {
85	+ $message = Mage::helper('oopsprofile')->__('There is no row to import');
86	+ Mage::throwException($message);
87	+ }
88	+
89	+
90	+ }
91	+ catch (Varien_Convert_Exception $e)
92	+ {
93	+ throw $e;
94	+ }
95	+
96	+ return $this;
97	+ }
98	+
99	+ public function getCustomerGroupModel()
100	+ {
101	+ return Mage::getModel('customer/group');
102	+ }
103	+ }

app/code/community/PI/Oopsprofile/Model/Customergroup/Convert/Parser/Customergroup.php ADDED Viewed

	@@ -0,0 +1,47 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Customergroup_Convert_Parser_Customergroup
4	+ extends Mage_Eav_Model_Convert_Parser_Abstract
5	+ {
6	+
7	+ /**
8	+ * Function must be provided but has no meaning here.
9	+ */
10	+
11	+ public function parse()
12	+ {
13	+
14	+ }
15	+
16	+ public function unparse()
17	+ {
18	+ try
19	+ {
20	+ $entityIds = $this->getData();
21	+ foreach ($entityIds as $entityId)
22	+ {
23	+ $customergroup = Mage::getModel('customer/group')
24	+ ->load($entityId)->getData();
25	+
26	+ //echo '<pre>';print_r($customergroup);exit;
27	+ unset($customergroup['customer_group_id']);
28	+
29	+ $batchExport = $this->getBatchExportModel()
30	+ ->setId(null)
31	+ ->setBatchId($this->getBatchModel()->getId())
32	+ ->setBatchData($customergroup)
33	+ ->setStatus(1)
34	+ ->save();
35	+
36	+ //parse field list data to batch model
37	+ $this->getBatchModel()->parseFieldList($customergroup);
38	+ }
39	+ }
40	+ catch (Varien_Convert_Exception $e) {
41	+ throw $e;
42	+ }
43	+
44	+ return $this;
45	+
46	+ }
47	+ }

app/code/community/PI/Oopsprofile/Model/Dataflow/Batch/Io.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Dataflow_Batch_Io extends Mage_Dataflow_Model_Batch_Io
3	+ {
4	+ public function openMulty($id,$write = true)
5	+ {
6	+ $mode = $write ? 'w+' : 'r+';
7	+ $ioConfig = array(
8	+ 'path' => $this->getPath()
9	+ );
10	+ $this->getIoAdapter()->setAllowCreateFolders(true);
11	+ $this->getIoAdapter()->open($ioConfig);
12	+ $explodedata = explode('.',$this->getFile());
13	+ $Name = $explodedata[0].'_'.$id;
14	+ $fileName = $Name.'.'.$explodedata[1];
15	+ $this->getIoAdapter()->streamOpen($fileName, $mode);
16	+
17	+ $this->_fileSize = 0;
18	+
19	+ return $this;
20	+ }
21	+ }
22	+ ?>

app/code/community/PI/Oopsprofile/Model/Dataflow/Convert/Mapper/Column.php ADDED Viewed

	@@ -0,0 +1,114 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Dataflow_Convert_Mapper_Column extends Mage_Dataflow_Model_Convert_Mapper_Column
4	+ {
5	+ public function map()
6	+ {
7	+
8	+ $batchModel = $this->getBatchModel();
9	+ $batchExport = $this->getBatchExportModel();
10	+
11	+ $batchExportIds = $batchExport
12	+ ->setBatchId($this->getBatchModel()->getId())
13	+ ->getIdCollection();
14	+
15	+
16	+ if ($this->getVar('map') && is_array($this->getVar('map'))) {
17	+ $attributesToSelect = $this->getVar('map');
18	+ }
19	+ else {
20	+ $attributesToSelect = array();
21	+ }
22	+
23	+
24	+ /Fetch category mapping detail/
25	+ $profileId = Mage::registry('current_convert_profile')->getId();
26	+
27	+ $oopsrofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
28	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
29	+ ->getFirstItem();
30	+ $selectedProfile = $oopsrofile->getProfileTemplate();
31	+
32	+ $tempModel = Mage::getModel('oopsprofile/template')->load($selectedProfile);
33	+
34	+ $categoryMapping = $tempModel->getCategoryMapping();
35	+
36	+ $mappingDetail = '';
37	+
38	+ if($categoryMapping!='')
39	+ {
40	+ $categoryMappingModel = Mage::getModel('oopsprofile/mapping')->load($categoryMapping);
41	+ $mappingDetail = unserialize($categoryMappingModel->getMappingDetail());
42	+ }
43	+
44	+ //print_r($categoryMapping);
45	+
46	+
47	+ foreach ($batchExportIds as $batchExportId) {
48	+ $batchExport = $this->getBatchExportModel()->load($batchExportId);
49	+ $row = $batchExport->getBatchData();
50	+
51	+ $newRow = array();
52	+
53	+ foreach($row as $field => $value)
54	+ {
55	+
56	+ if($field == 'category_ids' && $value!='')
57	+ {
58	+ $value = $this->_fetchCategoryNames($value,$mappingDetail);
59	+ }
60	+
61	+ if(!empty($attributesToSelect[$field])) //apply field mapping
62	+ {
63	+ $newRow[$attributesToSelect[$field]] = $value;
64	+ }
65	+ else
66	+ {
67	+ $newRow[$field] = $value;
68	+ }
69	+ }
70	+
71	+ $batchExport->setBatchData($newRow)
72	+ ->setStatus(2)
73	+ ->save();
74	+ $this->getBatchModel()->parseFieldList($batchExport->getBatchData());
75	+ }
76	+
77	+ //exit;
78	+
79	+ return $this;
80	+ }
81	+
82	+ protected function _fetchCategoryNames($category_ids,$mappingDetail)
83	+ {
84	+ $category_ids = explode(',',$category_ids);
85	+ $categoryCollection = Mage::getModel('catalog/category')->getCollection()
86	+ ->addAttributeToSelect('name')
87	+ ->addAttributeToFilter('entity_id',array('in'=>array($category_ids)));
88	+
89	+
90	+ $categoryName = array();
91	+ foreach($categoryCollection as $category)
92	+ {
93	+
94	+ if(!empty($mappingDetail))
95	+ {
96	+ if(!empty($mappingDetail[$category->getId()]))
97	+ {
98	+ $categoryName[] = $mappingDetail[$category->getId()];
99	+ }
100	+ else
101	+ {
102	+ $categoryName[] = $category->getName();
103	+ }
104	+ }
105	+ else
106	+ {
107	+ $categoryName[] = $category->getName();
108	+ }
109	+ }
110	+ $categoryName = implode(',',$categoryName);
111	+ //echo '<pre>';print_r($categoryName);
112	+ return $categoryName;
113	+ }
114	+ }

app/code/community/PI/Oopsprofile/Model/Dataflow/Profile.php ADDED Viewed

	@@ -0,0 +1,783 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Dataflow_Profile extends Mage_Dataflow_Model_Profile {
4	+
5	+ protected function _beforeSave() {
6	+ $data = $this->getData();
7	+ if(!empty($data['oops_profile']))
8	+ {
9	+ if ($data['oops_profile']) {//saving data for oops profile
10	+ $this->_oopsbeforeSave();
11	+ }
12	+ }
13	+ else
14	+ {
15	+ parent::_beforeSave();
16	+ }
17	+ }
18	+
19	+ /**
20	+ ** Upload File On Basis of Profile Way **
21	+ **/
22	+ protected function uploadImportFile($_files,$selectedFormat,$guiDataFile)
23	+ {
24	+ $profileWay = $guiDataFile['type'];
25	+ $fileName = $guiDataFile['filename'];
26	+ $filePath = $guiDataFile['path'];
27	+
28	+
29	+ $uplodedInfo = array();
30	+
31	+ /* Get the uploaded file information */
32	+ $name_of_uploaded_file = basename($_files['uploaded_file']['name']);
33	+
34	+ $type_of_uploaded_file = substr($name_of_uploaded_file, strrpos($name_of_uploaded_file, '.') + 1);
35	+
36	+ $size_of_uploaded_file = $_files["uploaded_file"]["size"] / 1024; //size in KBs
37	+
38	+ //Settings
39	+ $max_allowed_file_size = 1000; // size in KB
40	+ $allowed_extensions = array($selectedFormat);
41	+
42	+ if ($size_of_uploaded_file > $max_allowed_file_size)
43	+ {
44	+ $errors = Mage::helper('oopsprofile')->__("Size of uploded file should be less than $max_allowed_file_size KB");
45	+ Mage::throwException($errors);
46	+ }
47	+ if(!in_array($type_of_uploaded_file, $allowed_extensions))
48	+ {
49	+ $errors = Mage::helper('oopsprofile')->__("The uploaded file type $type_of_uploaded_file is not allowed for current profile");
50	+ Mage::throwException($errors);
51	+ }
52	+
53	+ if($fileName=='')//if filename is not defined
54	+ {
55	+ $fileName = $name_of_uploaded_file;
56	+ }
57	+
58	+ //create path if not exist
59	+ if (!file_exists($filePath) && $filePath!='') {
60	+ mkdir($filePath, 0777, true);
61	+ }
62	+
63	+ $tmp_path = $_files["uploaded_file"]["tmp_name"];
64	+
65	+ $fileWithPath = $filePath.'/'.$fileName;
66	+
67	+ if (is_uploaded_file($tmp_path))
68	+ {
69	+ switch($profileWay)
70	+ {
71	+ case 'file':
72	+ $localResource = new Varien_Io_File();
73	+ $localResource->write($fileWithPath, $tmp_path, 0777);
74	+ break;
75	+ case 'ftp':
76	+ case 'sftp':
77	+ $this->saveOnFtp($tmp_path,$fileName,$guiDataFile);
78	+ break;
79	+ }
80	+ }
81	+
82	+ $uplodedInfo['filename'] = $fileName;
83	+
84	+ return $uplodedInfo;
85	+ }
86	+
87	+
88	+ /**
89	+ Upload File on Ftp
90	+ **/
91	+ public function saveOnFtp($tmp_path,$fileName,$guiDataFile)
92	+ {
93	+ $file = $tmp_path;//temp file path on local server
94	+ $remote_file = $fileName;
95	+
96	+ // set up basic connection
97	+ $conn_id = ftp_connect($guiDataFile['host']);
98	+
99	+ // login with username and password
100	+ $login_result = ftp_login($conn_id, $guiDataFile['user'], $guiDataFile['password']);
101	+
102	+ if($guiDataFile['file_mode']==2)
103	+ {
104	+ $fileMode = FTP_BINARY;
105	+ }
106	+ else
107	+ {
108	+ $fileMode = FTP_ASCII;
109	+ }
110	+
111	+
112	+ if($guiDataFile['path'])
113	+ {
114	+ $remote_file = $guiDataFile['path'].'/'.$remote_file;
115	+ $this->make_directory($conn_id, $guiDataFile['path']);
116	+ }
117	+ else
118	+ {
119	+ $remote_file = $remote_file;
120	+ }
121	+
122	+ // upload a file
123	+ if (!ftp_put($conn_id, $remote_file, $file, $fileMode))
124	+ {
125	+ $message = Mage::helper('dataflow')->__('There was a problem while uploading '). $fileName;
126	+ Mage::throwException($message);
127	+ }
128	+
129	+ // close the connection and the file handler
130	+ ftp_close($conn_id);
131	+
132	+ return $this;
133	+ }
134	+
135	+ /**
136	+ Recursively create directory on ftp
137	+ **/
138	+ public function make_directory($ftp_stream, $dir)
139	+ {
140	+ //if directory already exists or can be immediately created return true
141	+ if ($this->ftp_is_dir($ftp_stream, $dir) \|\| @ftp_mkdir($ftp_stream, $dir))
142	+ return true;
143	+
144	+ //otherwise recursively try to make the directory
145	+ if (!$this->make_directory($ftp_stream, dirname($dir)))
146	+ return false;
147	+
148	+ // final step to create the directory
149	+ return ftp_mkdir($ftp_stream, $dir);
150	+ }
151	+ public function ftp_is_dir($ftp_stream, $dir)
152	+ {
153	+ // get current directory
154	+ $original_directory = ftp_pwd($ftp_stream);
155	+
156	+ if ( @ftp_chdir( $ftp_stream, $dir ) )
157	+ {
158	+ // If it is a directory, then change the directory back to the original directory
159	+ ftp_chdir( $ftp_stream, $original_directory );
160	+ return true;
161	+ }
162	+ else
163	+ {
164	+ return false;
165	+ }
166	+ }
167	+
168	+
169	+
170	+
171	+
172	+ protected function _oopsbeforeSave() {
173	+ if (!$this->getId()) {
174	+ $this->isObjectNew(true);
175	+ }
176	+ $actionsXML = $this->getData('actions_xml');
177	+ if (strlen($actionsXML) < 0 &&
178	+ @simplexml_load_string('<data>' . $actionsXML . '</data>', null, LIBXML_NOERROR) === false) {
179	+ Mage::throwException(Mage::helper('dataflow')->__("Actions XML is not valid."));
180	+ }
181	+
182	+ if (is_array($this->getGuiData())) {
183	+ $data = $this->getData();
184	+ //echo '<pre>';print_r($data);exit;
185	+ $guiData = $this->getGuiData();
186	+
187	+
188	+ /**
189	+ ** Apply Selected file format **
190	+ **/
191	+ $guiFileName = explode('.',$guiData['file']['filename']);
192	+ $guiFileFormat='';
193	+ if(count($guiFileName)>1)//if file name has format
194	+ {
195	+ $guiFileFormat = array_pop($guiFileName);//fetch the format(fetch the last word of string and remove it from array)
196	+ }
197	+ $orgFileFormat = $guiData['parse']['type'];//selected file format
198	+
199	+ if($guiFileFormat != $orgFileFormat)//match file format
200	+ {
201	+ $guiData['file']['filename'] = implode('.',$guiFileName).'.'.$orgFileFormat;//add selected file format in file name
202	+ }
203	+
204	+
205	+
206	+
207	+ $charSingleList = array('\\', '/', '.', '!', '@', '#', '$', '%', '&', '*', '~', '^');
208	+ if (isset($teguiData['file']['type']) && $guiData['file']['type'] == 'file') {
209	+ if (empty($guiData['file']['path'])
210	+ \|\| (strlen($guiData['file']['path']) == 1
211	+ && in_array($guiData['file']['path'], $charSingleList))) {
212	+ $guiData['file']['path'] = self::DEFAULT_EXPORT_PATH;
213	+ }
214	+ if (empty($guiData['file']['filename'])) {
215	+ $guiData['file']['filename'] = self::DEFAULT_EXPORT_FILENAME . $data['entity_type']
216	+ . '.' . $guiData['parse']['type'];
217	+ }
218	+
219	+ //validate export available path
220	+ $path = rtrim($guiData['file']['path'], '\\/')
221	+ . DS . $guiData['file']['filename'];
222	+ /** @var $validator Mage_Core_Model_File_Validator_AvailablePath */
223	+ $validator = Mage::getModel('core/file_validator_availablePath');
224	+ /** @var $helperImportExport Mage_ImportExport_Helper_Data */
225	+ $helperImportExport = Mage::helper('importexport');
226	+ $validator->setPaths($helperImportExport->getLocalValidPaths());
227	+ //echo $path;exit;
228	+ if (!$validator->isValid($path)) {
229	+ foreach ($validator->getMessages() as $message) {
230	+ Mage::throwException($message);
231	+ }
232	+ }
233	+
234	+
235	+ /**
236	+ ** If uploading a file and data transfer ways are "local/ftp/sftp" **
237	+ **/
238	+ if($this->getDirection()=='import' && !empty($_FILES))
239	+ {
240	+ if($_FILES["uploaded_file"]['name']!='')
241	+ {
242	+ $uploadedData = $this->uploadImportFile($_FILES,$guiData['parse']['type'],$guiData['file']);
243	+ $guiData['file']['filename'] = $uploadedData['filename'];
244	+ }
245	+ }
246	+
247	+ $this->setGuiData($guiData);
248	+ }
249	+
250	+ if(isset($guiData['file']['type']) && ($guiData['file']['type'] == 'ftp' \|\| $guiData['file']['type'] == 'sftp'))
251	+ {
252	+
253	+ /**
254	+ ** If uploading a file and data transfer ways are "local/ftp/sftp" **
255	+ **/
256	+ if($this->getDirection()=='import' && !empty($_FILES))
257	+ {
258	+ if($_FILES["uploaded_file"]['name']!='')
259	+ {
260	+ $uploadedData = $this->uploadImportFile($_FILES,$guiData['parse']['type'],$guiData['file']);
261	+ $guiData['file']['filename'] = $uploadedData['filename'];
262	+ }
263	+ }
264	+
265	+ $this->setGuiData($guiData);
266	+ }
267	+
268	+ //generate and save the access token
269	+ $this->generateAuthUrlByService($guiData);
270	+
271	+ $this->_parseOopsGuiData();
272	+
273	+ $this->setGuiData(serialize($this->getGuiData()));
274	+ //echo '<pre>';print_r($guiData);exit;
275	+ }
276	+
277	+ if ($this->_getResource()->isProfileExists($this->getName(), $this->getId())) {
278	+ Mage::throwException(Mage::helper('dataflow')->__("Profile with the same name already exists."));
279	+ }
280	+ }
281	+
282	+ protected function _saveAuthUrlToTable($service, $url){
283	+ $oopsProfile = Mage::getModel('oopsprofile/oopsprofile')->loadByProfile($this);
284	+ $oopsProfile->setServiceType($service)->setOauthUrl($url)->setIsTokenAvailable(0)->save();
285	+ }
286	+
287	+ /*
288	+ * generate the oAuth token by service
289	+ */
290	+ protected function generateAuthUrlByService($guiData) {
291	+
292	+ $service = isset($guiData['email']['service_provider']) ? $guiData['email']['service_provider'] : null;
293	+
294	+ if (!is_null($service)) {
295	+
296	+ $path = Mage::getBaseDir('var') . DS . $service;
297	+ $file = 'oops_profile_mail_client.tmp';
298	+
299	+ switch ($service) {
300	+ case 'gmail':
301	+
302	+ $client = Mage::getSingleton('oopsprofile/mail_google_client');
303	+
304	+ $client->setClientId($guiData['email'][$service]['client_id']);
305	+ $client->setClientSecret($guiData['email'][$service]['client_secret']);
306	+ $client->setRedirectUri($guiData['email'][$service]['redirect_uri']);
307	+ $client->setDeveloperKey($guiData['email'][$service]['developer_key']);
308	+
309	+ $client->setScopes("https://mail.google.com/");
310	+
311	+ $authUrl = $client->createAuthUrl();
312	+
313	+ $io = new Varien_Io_File();
314	+ $io->setAllowCreateFolders(true);
315	+ $io->open(array('path' => $path));
316	+ $io->streamOpen($file, 'w');
317	+ $io->streamLock(true);
318	+ $guiData['profile_id'] = $this->getId();
319	+ $io->streamWrite(serialize($guiData));
320	+ $io->close();
321	+
322	+ $this->_saveAuthUrlToTable($service, $authUrl);
323	+ }
324	+ }
325	+ }
326	+
327	+ protected function _parseOopsGuiData() {
328	+
329	+ $nl = "\r\n";
330	+ $import = $this->getDirection() === 'import';
331	+ $p = $this->getGuiData();
332	+
333	+ $data = $this->getData();
334	+
335	+ //$profileTemplate = $data['profile_template'];
336	+ //$profileTemplate = $p['profile_template'];
337	+ $profileTemplate='';
338	+
339	+ $applyTemplate = false;
340	+ $tempMappingXml = '';
341	+ $tempDataXml = '';
342	+
343	+ if($profileTemplate!=0 && $this->getEntityType() == 'product')//if predefind template is selected
344	+ {
345	+ $applyTemplate = true;
346	+
347	+ $tempMappingXml = $p['field_mapping_xml'];
348	+
349	+ $tempDataXml = $p['data_format_xml'];
350	+
351	+ }
352	+
353	+
354	+
355	+ //parent::_parseGuiData();
356	+ switch ($this->getDataTransfer()) {
357	+ case 'email':
358	+ $setXml = $this->generateEmailXML($nl, $import, $p);
359	+ break;
360	+ case 'file':
361	+ $setXml = $this->generateFileXML($nl, $import, $p);
362	+ break;
363	+ case 'http':
364	+ $setXml = $this->generateHttpXML($nl, $import, $p);
365	+ break;
366	+ case 'api':
367	+ $setXml = $this->generateApiXML($nl, $import, $p);
368	+ break;
369	+ }
370	+
371	+
372	+ if ($import) {
373	+ $setXml .= '<var name="format"><![CDATA[' . $p['parse']['type'] . ']]></var>' . $nl;
374	+ }
375	+
376	+ $setXml .= '</action>' . $nl . $nl;
377	+
378	+
379	+ if($this->getDataTransfer()=='api')
380	+ {
381	+ $p['parse']['type'] = 'xml';
382	+ }
383	+
384	+ switch ($p['parse']['type']) {
385	+ case 'csv':
386	+ $parseXml = '<action type="oopsprofile/convert_parser_csv" method="'
387	+ . ($import ? 'parse' : 'unparse') . '">' . $nl;
388	+
389	+ if($applyTemplate)//if predefind template is selected
390	+ {
391	+ $parseXml .= $tempDataXml;
392	+ }
393	+ else
394	+ {
395	+ $parseXml .= ' <var name="delimiter"><![CDATA['
396	+ . $p['parse']['csv']['delimiter'] . ']]></var>' . $nl;
397	+ $parseXml .= ' <var name="enclose"><![CDATA['
398	+ . $p['parse']['csv']['enclose'] . ']]></var>' . $nl;
399	+ }
400	+ break;
401	+ case 'txt':
402	+ $parseXml = '<action type="oopsprofile/convert_parser_txt" method="'
403	+ . ($import ? 'parse' : 'unparse') . '">' . $nl;
404	+ if($applyTemplate)//if predefind template is selected
405	+ {
406	+ $parseXml .= $tempDataXml;
407	+ }
408	+ else
409	+ {
410	+ $parseXml .= ' <var name="delimiter"><![CDATA['
411	+ . $p['parse']['txt']['delimiter'] . ']]></var>' . $nl;
412	+ $parseXml .= ' <var name="enclose"><![CDATA['
413	+ . $p['parse']['txt']['enclose'] . ']]></var>' . $nl;
414	+ }
415	+ break;
416	+ case 'xml':
417	+ $parseXml = '<action type="oopsprofile/convert_parser_xml" method="'
418	+ . ($import ? 'parse' : 'unparse') . '">' . $nl;
419	+
420	+ $parseXml .= ' <var name="entity_type">'. $this->getEntityType() .'</var>' . $nl;
421	+
422	+ $parseXml .= ' <var name="profile_template">'. $profileTemplate .'</var>' . $nl;
423	+
424	+ if($import && $this->getDataTransfer()=='api')
425	+ {
426	+ $parseXml .= ' <var name="data_transfer">api</var>' . $nl;
427	+ $parseXml .= ' <var name="apiurl">'. $p['api']['url'] .'</var>' . $nl;
428	+ $parseXml .= ' <var name="apikey">'. $p['api']['key'] .'</var>' . $nl;
429	+ $parseXml .= ' <var name="apiuser">'. $p['api']['user'] .'</var>' . $nl;
430	+ $parseXml .= ' <var name="apimethod">'. $p['api']['method'] .'</var>' . $nl;
431	+ $parseXml .= ' <var name="apiprofileId">'. $p['api']['profileId'] .'</var>' . $nl;
432	+ }
433	+ break;
434	+ case 'xls':
435	+ $parseXml = '<action type="oopsprofile/convert_parser_xls" method="'
436	+ . ($import ? 'parse' : 'unparse') . '">' . $nl;
437	+
438	+ if($this->getDataTransfer()=='file')
439	+ {
440	+ $parseXml .= ' <var name="path">' . $p['file']['path'] . '</var>' . $nl;
441	+ $parseXml .= ' <var name="filename"><![CDATA[' . $p['file']['filename'] . ']]></var>' . $nl;
442	+ $parseXml .= ' <var name="filetype">' . $p['file']['type'] . '</var>' . $nl;
443	+
444	+ }
445	+ if($this->getDataTransfer()=='http')
446	+ {
447	+ $parseXml .= ' <var name="filetype">http</var>' . $nl;
448	+ $parseXml .= ' <var name="entitytype">'.$this->getEntityType().'</var>' . $nl;
449	+ }
450	+ if($applyTemplate)//if predefind template is selected
451	+ {
452	+ $parseXml .= $tempDataXml;
453	+ }
454	+ break;
455	+ case 'xlsx':
456	+ $parseXml = '<action type="oopsprofile/convert_parser_xlsx" method="'
457	+ . ($import ? 'parse' : 'unparse') . '">' . $nl;
458	+
459	+ if($this->getDataTransfer()=='file')
460	+ {
461	+ $parseXml .= ' <var name="path">' . $p['file']['path'] . '</var>' . $nl;
462	+ $parseXml .= ' <var name="filename"><![CDATA[' . $p['file']['filename'] . ']]></var>' . $nl;
463	+ $parseXml .= ' <var name="filetype">' . $p['file']['type'] . '</var>' . $nl;
464	+ }
465	+ if($this->getDataTransfer()=='http')
466	+ {
467	+ $parseXml .= ' <var name="filetype">http</var>' . $nl;
468	+ $parseXml .= ' <var name="entitytype">'.$this->getEntityType().'</var>' . $nl;
469	+ }
470	+ if($applyTemplate)//if predefind template is selected
471	+ {
472	+ $parseXml .= $tempDataXml;
473	+ }
474	+ break;
475	+ }
476	+ if(!$applyTemplate)//if predefind template is not selected
477	+ {
478	+ $parseXml .= ' <var name="fieldnames">' . $p['parse']['fieldnames'] . '</var>' . $nl;
479	+ }
480	+ $parseXmlInter = $parseXml;
481	+ $parseXml .= '</action>' . $nl . $nl;
482	+
483	+
484	+ $mapXml = '';
485	+
486	+ if (isset($p['map']) && is_array($p['map'])) {
487	+ foreach ($p['map'] as $side => $fields) {
488	+ if (!is_array($fields)) {
489	+ continue;
490	+ }
491	+ foreach ($fields['db'] as $i => $k) {
492	+ if ($k == '' \|\| $k == '0') {
493	+ unset($p['map'][$side]['db'][$i]); //DB FIELD
494	+ unset($p['map'][$side]['file'][$i]); //MAPPING FIELD
495	+ }
496	+ }
497	+ }
498	+ }
499	+
500	+ if($applyTemplate)//if predefind template is selected
501	+ {
502	+
503	+ $tempMappingData = unserialize($tempMappingXml);
504	+ $parseXmlInter .= ' <var name="map">' . $nl;
505	+ $mapXml .= '<action type="oopsprofile/dataflow_convert_mapper_column" method="map">' . $nl;
506	+ $mapXml .= ' <var name="map">' . $nl;
507	+ if($tempMappingXml!='')
508	+ {
509	+ foreach ($tempMappingData as $key => $value) {
510	+ $mapXml .= ' <map name="' . $key . '"><![CDATA[' . $value . ']]></map>' . $nl;
511	+ $parseXmlInter .= ' <map name="' . $value . '"><![CDATA[' . $key . ']]></map>' . $nl;
512	+ }
513	+ }
514	+ $mapXml .= ' </var>' . $nl;
515	+ $parseXmlInter .= ' </var>' . $nl;
516	+ $mapXml .= '</action>' . $nl . $nl;
517	+
518	+ }
519	+ else
520	+ {
521	+ $enable = '';
522	+ if($this->getEnableContent()!=NULL)
523	+ {
524	+ $enable = $this->getEnableContent();
525	+ }
526	+ else //saving from outside
527	+ {
528	+ $DataflowId = $this->getProfileId();
529	+ $oopsProfile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
530	+ ->addFieldToFilter('dataflow_profile_id',$DataflowId)
531	+ ->getFirstItem();
532	+ $enable = $oopsProfile->getEnableContent();
533	+ }
534	+
535	+
536	+ if($p['parse']['type'] == 'xml' && $enable == 1)
537	+ {
538	+ $mapXml .= '<action type="oopsprofile/dataflow_convert_mapper_column" method="map">' . $nl;
539	+ $mapXml .= '</action>' . $nl . $nl;
540	+ }
541	+ else
542	+ {
543	+
544	+ /Apply Mapping/
545	+ if($this->getEntityType()!='customergroup')
546	+ {
547	+ $mapXml .= '<action type="dataflow/convert_mapper_column" method="map">' . $nl;
548	+ $map = $p['map'][$this->getEntityType()];
549	+ if (sizeof($map['db']) > 0) {
550	+ $from = $map[$import ? 'file' : 'db'];
551	+ $to = $map[$import ? 'db' : 'file'];
552	+ $mapXml .= ' <var name="map">' . $nl;
553	+ $parseXmlInter .= ' <var name="map">' . $nl;
554	+ foreach ($from as $i => $f) {
555	+ $mapXml .= ' <map name="' . $f . '"><![CDATA[' . $to[$i] . ']]></map>' . $nl;
556	+ $parseXmlInter .= ' <map name="' . $f . '"><![CDATA[' . $to[$i] . ']]></map>' . $nl;
557	+ }
558	+ $mapXml .= ' </var>' . $nl;
559	+ $parseXmlInter .= ' </var>' . $nl;
560	+ }
561	+ if ($p['map']['only_specified']) {
562	+ $mapXml .= ' <var name="_only_specified">' . $p['map']['only_specified'] . '</var>' . $nl;
563	+ //$mapXml .= ' <var name="map">' . $nl;
564	+ $parseXmlInter .= ' <var name="_only_specified">' . $p['map']['only_specified'] . '</var>' . $nl;
565	+ }
566	+ $mapXml .= '</action>' . $nl . $nl;
567	+ }
568	+ }
569	+ }
570	+
571	+ $parsers = array(
572	+ 'product' => 'oopsprofile/product_convert_parser_product',
573	+ 'customer' => 'customer/convert_parser_customer',
574	+ 'customergroup' => 'oopsprofile/customergroup_convert_parser_customergroup',
575	+ 'order' => 'oopsprofile/order_convert_parser_order',
576	+ 'shipment' => 'oopsprofile/shipment_convert_parser_shipment',
577	+ 'invoice' => 'oopsprofile/invoice_convert_parser_invoice',
578	+ 'creditmemo' => 'oopsprofile/creditmemo_convert_parser_creditmemo',
579	+ );
580	+
581	+ if ($import) {
582	+
583	+ $parseXmlInter .= ' <var name="store"><![CDATA[' . $this->getStoreId() . ']]></var>' . $nl;
584	+ } else {
585	+ $parseDataXml = '<action type="' . $parsers[$this->getEntityType()] . '" method="unparse">' . $nl;
586	+ $parseDataXml .= ' <var name="store"><![CDATA[' . $this->getStoreId() . ']]></var>' . $nl;
587	+ if (isset($p['export']['add_url_field'])) {
588	+ $parseDataXml .= ' <var name="url_field"><![CDATA['
589	+ . $p['export']['add_url_field'] . ']]></var>' . $nl;
590	+ }
591	+ $parseDataXml .= '</action>' . $nl . $nl;
592	+ }
593	+
594	+
595	+
596	+ $adapters = array(
597	+ 'product' => 'oopsprofile/product_convert_adapter_product',
598	+ 'customer' => 'customer/convert_adapter_customer',
599	+ 'customergroup' => 'oopsprofile/customergroup_convert_adapter_customergroup',
600	+ 'order' => 'oopsprofile/order_convert_adapter_order',
601	+ 'shipment' => 'oopsprofile/shipment_convert_adapter_shipment',
602	+ 'invoice' => 'oopsprofile/invoice_convert_adapter_invoice',
603	+ 'creditmemo' => 'oopsprofile/creditmemo_convert_adapter_creditmemo',
604	+ );
605	+
606	+ if ($import) {
607	+ $entityXml = '<action type="' . $adapters[$this->getEntityType()] . '" method="save">' . $nl;
608	+ $entityXml .= ' <var name="store"><![CDATA[' . $this->getStoreId() . ']]></var>' . $nl;
609	+ $entityXml .= '</action>' . $nl . $nl;
610	+ } else {
611	+ $entityXml = '<action type="' . $adapters[$this->getEntityType()] . '" method="load">' . $nl;
612	+ $entityXml .= ' <var name="store"><![CDATA[' . $this->getStoreId() . ']]></var>' . $nl;
613	+ if($p['filter']['fromdate']!='')
614	+ {
615	+ $entityXml .= ' <var name="fromdate">' . $p['filter']['fromdate'] . '</var>' . $nl;
616	+ }
617	+ if($p['filter']['todate']!='')
618	+ {
619	+ $entityXml .= ' <var name="todate">' . $p['filter']['todate'] . '</var>' . $nl;
620	+ }
621	+ if(!empty($p['filter']['hiddentype']))
622	+ {
623	+ $filters = $p['filter']['hiddentype'];
624	+ $count = count($filters);
625	+ $i = 1;
626	+ $entityXml .= ' <var name="hiddentype">';
627	+ foreach($filters as $filter)
628	+ {
629	+ $entityXml .= $filter ;
630	+ if($count != $i++)
631	+ {
632	+ $entityXml .= ',' ;
633	+ }
634	+ }
635	+ $entityXml .= '</var>' . $nl;
636	+ }
637	+ $entityXml .= '</action>' . $nl . $nl;
638	+ }
639	+
640	+ // Need to rewrite the whole xml action format
641	+ if ($import) {
642	+
643	+ $xml = $setXml;
644	+ $xml .= $parseXmlInter;
645	+
646	+ $xml .= ' <var name="root_catalog_id"></var>' . $nl;
647	+ $xml .= ' <var name="reimport_images"><![CDATA[true]]></var>' . $nl;
648	+ $xml .= ' <var name="deleteall_andreimport_images"><![CDATA[true]]></var>' . $nl;
649	+ $xml .= ' <var name="exclude_images"><![CDATA[false]]></var>' . $nl;
650	+ $xml .= ' <var name="exclude_gallery_images"><![CDATA[false]]></var>' . $nl;
651	+ $xml .= ' <var name="append_tier_prices"><![CDATA[true]]></var>' . $nl;
652	+ $xml .= ' <var name="append_group_prices"><![CDATA[false]]></var>' . $nl;
653	+ $xml .= ' <var name="append_categories"><![CDATA[false]]></var>' . $nl;
654	+
655	+
656	+ $xml .= ' <var name="adapter">' . $adapters[$this->getEntityType()] . '</var>' . $nl;
657	+ $xml .= ' <var name="method">parse</var>' . $nl;
658	+ $xml .= '</action>';
659	+ } else {
660	+ $xml = $entityXml . $parseDataXml . $mapXml . $parseXml . $setXml;
661	+ }
662	+
663	+ $this->setGuiData($p);
664	+ $this->setActionsXml($xml);
665	+
666	+ /* echo "<pre>" . print_r($p,1) . "</pre>";
667	+ echo "<xmp>" . $xml . "</xmp>";
668	+ die; */
669	+ return $this;
670	+ }
671	+
672	+ protected function generateApiXML($nl, $import, $p) {
673	+ $apiXml = '<action type="oopsprofile/convert_adapter_api" method="'
674	+ . ($import ? 'load' : 'save') . '">' . $nl;
675	+
676	+ $apiXml .= ' <var name="entitytype">'. $this->getEntityType() .'</var>' . $nl;
677	+
678	+ return $apiXml;
679	+ }
680	+
681	+ protected function generateHttpXML($nl, $import, $p) {
682	+ $httpXml = '<action type="oopsprofile/convert_adapter_http" method="'
683	+ . ($import ? 'load' : 'save') . '">' . $nl;
684	+
685	+ $httpXml .= ' <var name="fileformat">' . $p['parse']['type'] . '</var>' . $nl;
686	+ $httpXml .= ' <var name="entitytype">'. $this->getEntityType() .'</var>' . $nl;
687	+
688	+ return $httpXml;
689	+ }
690	+
691	+ protected function generateEmailXML($nl, $import, $p) {
692	+
693	+ $fileName = Mage::helper('oopsprofile/mail')->getFileNameWithPrefix($p['email']['mailsubject']);
694	+
695	+ $emailXml = '<action type="oopsprofile/convert_adapter_mail" method="'. ($import ? 'load' : 'save') . '">' . $nl;
696	+
697	+ if(isset($p['email']['service_provider']) && $p['email']['service_provider'] != null){
698	+
699	+ $emailXml .= ' <var name="service_provider">' . $p['email']['service_provider'] . '</var>' . $nl;
700	+ $emailXml .= ' <var name="' . $p['email']['service_provider'] . '_client_id"><![CDATA[' . $p['email'][$p['email']['service_provider']]['client_id'] . ']]></var>' . $nl;
701	+ $emailXml .= ' <var name="' . $p['email']['service_provider'] . '_client_secret"><![CDATA[' . $p['email'][$p['email']['service_provider']]['client_secret'] . ']]></var>' . $nl;
702	+ $emailXml .= ' <var name="' . $p['email']['service_provider'] . '_redirect_uri"><![CDATA[' . $p['email'][$p['email']['service_provider']]['redirect_uri'] . ']]></var>' . $nl;
703	+ $emailXml .= ' <var name="' . $p['email']['service_provider'] . '_developer_key"><![CDATA[' . $p['email'][$p['email']['service_provider']]['developer_key'] . ']]></var>' . $nl;
704	+ }
705	+
706	+ $emailXml .= ' <var name="host">' . $p['email']['host'] . '</var>' . $nl;
707	+ $emailXml .= ' <var name="port">' . $p['email']['port'] . '</var>' . $nl;
708	+ $emailXml .= ' <var name="username"><![CDATA[' . $p['email']['username'] . ']]></var>' . $nl;
709	+ $emailXml .= ' <var name="password"><![CDATA[' . $p['email']['pass'] . ']]></var>' . $nl;
710	+ $emailXml .= ' <var name="mailsubject"><![CDATA[' . $p['email']['mailsubject'] . ']]></var>' . $nl;
711	+ $emailXml .= ' <var name="emailto"><![CDATA[' . $p['email']['sendto'] . ']]></var>' . $nl;
712	+ $emailXml .= ' <var name="attachmentsavepath"><![CDATA[' . $p['email']['attachmentsavepath'] . ']]></var>' . $nl;
713	+ $emailXml .= ' <var name="deleteattachment"></var>' . $nl;
714	+ $emailXml .= ' <var name="checkonlynewmsgs"></var>' . $nl;
715	+ if (!$import) {
716	+ $emailXml .= ' <var name="filename">' . $fileName . '.' . $p['parse']['type'] . '</var>' . $nl;
717	+ }
718	+
719	+
720	+ return $emailXml;
721	+ }
722	+
723	+ protected function generateFileXML($nl, $import, $p) {
724	+
725	+ //if($p['parse']['type']=='xml' \|\| $p['parse']['type']=='xls' \|\| $p['parse']['type']=='xlsx')
726	+ //{
727	+ $fileXml = '<action type="oopsprofile/convert_adapter_io" method="'
728	+ . ($import ? 'load' : 'save') . '">' . $nl;
729	+ /* }
730	+ else
731	+ {
732	+ $fileXml = '<action type="dataflow/convert_adapter_io" method="'
733	+ . ($import ? 'load' : 'save') . '">' . $nl;
734	+ }*/
735	+
736	+ $fileXml .= ' <var name="fileformat">' . $p['parse']['type'] . '</var>' . $nl;
737	+
738	+
739	+ $fileXml .= ' <var name="type">' . $p['file']['type'] . '</var>' . $nl;
740	+ $fileXml .= ' <var name="path">' . $p['file']['path'] . '</var>' . $nl;
741	+ $fileXml .= ' <var name="filename"><![CDATA[' . $p['file']['filename'] . ']]></var>' . $nl;
742	+ if ($p['file']['type'] === 'ftp') {
743	+ $hostArr = explode(':', $p['file']['host']);
744	+ $fileXml .= ' <var name="host"><![CDATA[' . $hostArr[0] . ']]></var>' . $nl;
745	+ if (isset($hostArr[1])) {
746	+ $fileXml .= ' <var name="port"><![CDATA[' . $hostArr[1] . ']]></var>' . $nl;
747	+ }
748	+ if (!empty($p['file']['passive'])) {
749	+ $fileXml .= ' <var name="passive">true</var>' . $nl;
750	+ }
751	+ if ((!empty($p['file']['file_mode']))
752	+ && ($p['file']['file_mode'] == FTP_ASCII \|\| $p['file']['file_mode'] == FTP_BINARY)
753	+ ) {
754	+ $fileXml .= ' <var name="file_mode">' . $p['file']['file_mode'] . '</var>' . $nl;
755	+ }
756	+ if (!empty($p['file']['user'])) {
757	+ $fileXml .= ' <var name="user"><![CDATA[' . $p['file']['user'] . ']]></var>' . $nl;
758	+ }
759	+ if (!empty($p['file']['password'])) {
760	+ $fileXml .= ' <var name="password"><![CDATA[' . $p['file']['password'] . ']]></var>' . $nl;
761	+ }
762	+ }
763	+
764	+ if ($p['file']['type'] === 'sftp') {
765	+ $hostArr = explode(':', $p['file']['host']);
766	+ $fileXml .= ' <var name="host"><![CDATA[' . $hostArr[0] . ']]></var>' . $nl;
767	+ if (isset($hostArr[1])) {
768	+ $fileXml .= ' <var name="port"><![CDATA[' . $hostArr[1] . ']]></var>' . $nl;
769	+ }
770	+ if (!empty($p['file']['user'])) {
771	+ $fileXml .= ' <var name="username"><![CDATA[' . $p['file']['user'] . ']]></var>' . $nl;
772	+ }
773	+ if (!empty($p['file']['password'])) {
774	+ $fileXml .= ' <var name="password"><![CDATA[' . $p['file']['password'] . ']]></var>' . $nl;
775	+ }
776	+ }
777	+
778	+
779	+ return $fileXml;
780	+ }
781	+
782	+ }
783	+

app/code/community/PI/Oopsprofile/Model/Dataflow/Profile/History.php ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Dataflow_Profile_History extends Mage_Dataflow_Model_Profile_History
3	+ {
4	+
5	+ protected function _beforeSave()
6	+ {
7	+ if (!$this->getProfileId()) {
8	+ $profile = Mage::registry('current_convert_profile');
9	+ if ($profile) {
10	+ $this->setProfileId($profile->getId());
11	+ }
12	+ }
13	+
14	+ //set current user id
15	+ $adminUserId = Mage::getSingleton('admin/session')->getUser()->getId();
16	+ if(!empty($adminUserId))
17	+ {
18	+ $this->setUserId($adminUserId);
19	+ }
20	+
21	+ if(!$this->hasData('user_id')) {
22	+ $this->setUserId(0);
23	+ }
24	+
25	+ parent::_beforeSave();
26	+ return $this;
27	+ }
28	+ }

app/code/community/PI/Oopsprofile/Model/Mail.php ADDED Viewed

	@@ -0,0 +1,54 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Mail extends Zend_Mail{
4	+
5	+
6	+
7	+
8	+ public function sendMailWithAttachment($config){
9	+
10	+ $filename = $config['filename'];
11	+ $filepath = $config['path'];
12	+ $storeId = Mage::app()->getStore()->getId();
13	+
14	+ $timestamp = Mage::app()->getLocale()->storeDate($storeId);
15	+
16	+ $mailTo = explode(',', $config['emailto']);
17	+ if(!empty($mailTo)){
18	+ $serviceProvider = isset($config['service_provider']) ? $config['service_provider'] : null;
19	+ switch($serviceProvider){
20	+ case 'gmail':
21	+ $email = $config['username']. '@' .'gmail.com';
22	+ break;
23	+ default:
24	+ $email = $config['username'];
25	+ }
26	+
27	+ $this->addTo($mailTo);
28	+ $this->setFrom($email);
29	+ $this->setSubject($config['mailsubject']);
30	+ $this->setBodyHtml(sprintf('File generated at: %s </br> Filename: %s', $timestamp, $filename));
31	+ $this->addFileAsAttachment($filename, $filepath);
32	+ try{
33	+ $this->send();
34	+ }catch(Exception $e){
35	+ Mage::log($e);
36	+ Mage::throwException($e->getMessage());
37	+ }
38	+ }
39	+ }
40	+
41	+ protected function addFileAsAttachment($filename, $filepath){
42	+
43	+ $fullPath = $filepath . DS . $filename ;
44	+ $filedata = file_get_contents($fullPath);
45	+ $this->createAttachment(
46	+ $filedata,
47	+ Zend_Mime::TYPE_OCTETSTREAM,
48	+ Zend_Mime::DISPOSITION_ATTACHMENT,
49	+ Zend_Mime::ENCODING_BASE64,
50	+ $filename
51	+ );
52	+ return $this;
53	+ }
54	+ }

app/code/community/PI/Oopsprofile/Model/Mysql4/Oopsprofile.php ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Mysql4_Oopsprofile extends Mage_Core_Model_Mysql4_Abstract
4	+ {
5	+ public function _construct()
6	+ {
7	+ // Note that the oops_profile_id refers to the key field in your database table.
8	+ $this->_init('oopsprofile/oopsprofile', 'oops_profile_id');
9	+ }
10	+ }

app/code/community/PI/Oopsprofile/Model/Mysql4/Oopsprofile/Collection.php ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Mysql4_Oopsprofile_Collection extends Mage_Core_Model_Mysql4_Collection_Abstract
4	+ {
5	+ public function _construct()
6	+ {
7	+ parent::_construct();
8	+ $this->_init('oopsprofile/oopsprofile');
9	+ }
10	+ }

app/code/community/PI/Oopsprofile/Model/Oopsprofile.php ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Oopsprofile extends Mage_Core_Model_Abstract
4	+ {
5	+
6	+ protected $_eventPrefix = 'oopsprofile_profile';
7	+ protected $_eventObject = 'oopsprofile';
8	+
9	+ public function _construct(){
10	+ parent::_construct();
11	+ $this->_init('oopsprofile/oopsprofile');
12	+ }
13	+
14	+
15	+ public function loadByProfile($profile){
16	+
17	+ if(is_numeric($profile)){
18	+ $profile = Mage::getModel('dataflow/profile')->load($profile);
19	+ }
20	+ $collection = Mage::getResourceModel('oopsprofile/oopsprofile_collection');
21	+ $collection->addFieldToFilter('dataflow_profile_id', $profile->getId());
22	+
23	+ $oopsProfile = $collection->getFirstItem();
24	+ return $oopsProfile;
25	+ }
26	+ }

app/code/community/PI/Oopsprofile/Model/Oopsprofileapi.php ADDED Viewed

	@@ -0,0 +1,167 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Oopsprofileapi extends Mage_Api_Model_Resource_Abstract
3	+ {
4	+
5	+ public function exportproductdata($request)
6	+ {
7	+ try
8	+ {
9	+ $filename = Mage::getBaseDir().'/apiexport/export_product_'.$request['profileid'].'.xml';
10	+ if(glob($filename))
11	+ {
12	+ $xmlInstance = new Varien_Simplexml_Config($filename);
13	+ $xml = $xmlInstance->getNode()->asNiceXml();
14	+ return $xml;
15	+ }
16	+ else
17	+ {
18	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
19	+ }
20	+ }
21	+
22	+ catch (Exception $e)
23	+ {
24	+ // fault with the code tag data_invalid
25	+ $this->_fault('data_invalid', $e->getMessage());
26	+ }
27	+ }
28	+ public function exportcustomerdata($request)
29	+ {
30	+ try
31	+ {
32	+ $filename = Mage::getBaseDir().'/apiexport/export_customer_'.$request['profileid'].'.xml';
33	+ if(glob($filename))
34	+ {
35	+ $xmlInstance = new Varien_Simplexml_Config($filename);
36	+ $xml = $xmlInstance->getNode()->asNiceXml();
37	+ return $xml;
38	+ }
39	+ else
40	+ {
41	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
42	+ }
43	+ }
44	+
45	+ catch (Exception $e)
46	+ {
47	+ // fault with the code tag data_invalid
48	+ $this->_fault('data_invalid', $e->getMessage());
49	+ }
50	+ }
51	+ public function exportcustomergroupdata($request)
52	+ {
53	+ try
54	+ {
55	+ $filename = Mage::getBaseDir().'/apiexport/export_customergroup_'.$request['profileid'].'.xml';
56	+ if(glob($filename))
57	+ {
58	+ $xmlInstance = new Varien_Simplexml_Config($filename);
59	+ $xml = $xmlInstance->getNode()->asNiceXml();
60	+ return $xml;
61	+ }
62	+ else
63	+ {
64	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
65	+ }
66	+ }
67	+
68	+ catch (Exception $e)
69	+ {
70	+ // fault with the code tag data_invalid
71	+ $this->_fault('data_invalid', $e->getMessage());
72	+ }
73	+ }
74	+ public function exportorderdata($request)
75	+ {
76	+ try
77	+ {
78	+ $filename = Mage::getBaseDir().'/apiexport/export_order_'.$request['profileid'].'.xml';
79	+ if(glob($filename))
80	+ {
81	+ $xmlInstance = new Varien_Simplexml_Config($filename);
82	+ $xml = $xmlInstance->getNode()->asNiceXml();
83	+ return $xml;
84	+ }
85	+ else
86	+ {
87	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
88	+ }
89	+ }
90	+
91	+ catch (Exception $e)
92	+ {
93	+ // fault with the code tag data_invalid
94	+ $this->_fault('data_invalid', $e->getMessage());
95	+ }
96	+ }
97	+ public function exportshipmentdata($request)
98	+ {
99	+ try
100	+ {
101	+ $filename = Mage::getBaseDir().'/apiexport/export_shipment_'.$request['profileid'].'.xml';
102	+ if(glob($filename))
103	+ {
104	+ $xmlInstance = new Varien_Simplexml_Config($filename);
105	+ $xml = $xmlInstance->getNode()->asNiceXml();
106	+ return $xml;
107	+ }
108	+ else
109	+ {
110	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
111	+ }
112	+ }
113	+
114	+ catch (Exception $e)
115	+ {
116	+ // fault with the code tag data_invalid
117	+ $this->_fault('data_invalid', $e->getMessage());
118	+ }
119	+ }
120	+ public function exportinvoicedata($request)
121	+ {
122	+ try
123	+ {
124	+ $filename = Mage::getBaseDir().'/apiexport/export_invoice_'.$request['profileid'].'.xml';
125	+ if(glob($filename))
126	+ {
127	+ $xmlInstance = new Varien_Simplexml_Config($filename);
128	+ $xml = $xmlInstance->getNode()->asNiceXml();
129	+ return $xml;
130	+ }
131	+ else
132	+ {
133	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
134	+ }
135	+ }
136	+
137	+ catch (Exception $e)
138	+ {
139	+ // fault with the code tag data_invalid
140	+ $this->_fault('data_invalid', $e->getMessage());
141	+ }
142	+ }
143	+ public function exportcreditmemodata($request)
144	+ {
145	+ try
146	+ {
147	+ $filename = Mage::getBaseDir().'/apiexport/export_creditmemo_'.$request['profileid'].'.xml';
148	+ if(glob($filename))
149	+ {
150	+ $xmlInstance = new Varien_Simplexml_Config($filename);
151	+ $xml = $xmlInstance->getNode()->asNiceXml();
152	+ return $xml;
153	+ }
154	+ else
155	+ {
156	+ return "<error>".Mage::helper('oopsprofile')->__('No Data Exist For Current Details')."</error>";
157	+ }
158	+ }
159	+
160	+ catch (Exception $e)
161	+ {
162	+ // fault with the code tag data_invalid
163	+ $this->_fault('data_invalid', $e->getMessage());
164	+ }
165	+ }
166	+
167	+ }

app/code/community/PI/Oopsprofile/Model/Product/Convert/Adapter/Product.php ADDED Viewed

	@@ -0,0 +1,2168 @@


1	+ <?php
2	+ /**
3	+ * Product_import.php
4	+ * CommerceThemes @ InterSEC Solutions LLC.
5	+ *
6	+ * NOTICE OF LICENSE
7	+ *
8	+ * This source file is subject to the EULA
9	+ * that is bundled with this package in the file LICENSE.txt.
10	+ * It is also available through the world-wide-web at this URL:
11	+ * http://www.commercethemes.com/LICENSE-M1.txt
12	+ *
13	+ * @category Product
14	+ * @package Productimport
15	+ * @copyright Copyright (c) 2003-2009 CommerceThemes @ InterSEC Solutions LLC. (http://www.commercethemes.com)
16	+ * @license http://www.commercethemes.com/LICENSE-M1.txt
17	+ */
18	+
19	+ class PI_Oopsprofile_Model_Product_Convert_Adapter_Product
20	+ extends Mage_Catalog_Model_Convert_Adapter_Product
21	+ {
22	+ /**
23	+ * Affected entity ids
24	+ *
25	+ * @var array
26	+ */
27	+ protected $_affectedEntityIds = array();
28	+
29	+ /**
30	+ * Store affected entity ids
31	+ *
32	+ * @param int\|array $ids
33	+ * @return Mage_Catalog_Model_Convert_Adapter_Product
34	+ */
35	+ protected function _addAffectedEntityIds($ids)
36	+ {
37	+ if (is_array($ids)) {
38	+ foreach ($ids as $id) {
39	+ $this->_addAffectedEntityIds($id);
40	+ }
41	+ } else {
42	+ $this->_affectedEntityIds[] = $ids;
43	+ }
44	+
45	+ return $this;
46	+ }
47	+
48	+ protected function _defaultFilterOnProduct()
49	+ {
50	+ $attrFilterArray = array();
51	+ $attrFilterArray ['name'] = 'like';
52	+ $attrFilterArray ['sku'] = 'startsWith';
53	+ $attrFilterArray ['type'] = 'eq';
54	+ $attrFilterArray ['attribute_set'] = 'eq';
55	+ $attrFilterArray ['visibility'] = 'eq';
56	+ $attrFilterArray ['status'] = 'eq';
57	+ $attrFilterArray ['price'] = 'fromTo';
58	+ $attrFilterArray ['qty'] = 'fromTo';
59	+ $attrFilterArray ['store_id'] = 'eq';
60	+
61	+ $attrToDb = array(
62	+ 'type' => 'type_id',
63	+ 'attribute_set' => 'attribute_set_id'
64	+ );
65	+
66	+ $filters = $this->_parseVars();
67	+
68	+ if ($qty = $this->getFieldValue($filters, 'qty')) {
69	+ $qtyFrom = isset($qty['from']) ? (float) $qty['from'] : 0;
70	+ $qtyTo = isset($qty['to']) ? (float) $qty['to'] : 0;
71	+
72	+ $qtyAttr = array();
73	+ $qtyAttr['alias'] = 'qty';
74	+ $qtyAttr['attribute'] = 'cataloginventory/stock_item';
75	+ $qtyAttr['field'] = 'qty';
76	+ $qtyAttr['bind'] = 'product_id=entity_id';
77	+ $qtyAttr['cond'] = "{{table}}.qty between '{$qtyFrom}' AND '{$qtyTo}'";
78	+ $qtyAttr['joinType'] = 'inner';
79	+
80	+ $this->setJoinField($qtyAttr);
81	+ }
82	+
83	+ parent::setFilter($attrFilterArray, $attrToDb);
84	+
85	+ if ($price = $this->getFieldValue($filters, 'price')) {
86	+ $this->_filter[] = array(
87	+ 'attribute' => 'price',
88	+ 'from' => $price['from'],
89	+ 'to' => $price['to']
90	+ );
91	+ $this->setJoinAttr(array(
92	+ 'alias' => 'price',
93	+ 'attribute' => 'catalog_product/price',
94	+ 'bind' => 'entity_id',
95	+ 'joinType' => 'LEFT'
96	+ ));
97	+ }
98	+ }
99	+
100	+ protected function _applyDateFilterOnExport()
101	+ {
102	+
103	+ /**
104	+ * Apply Installation Date Filter
105	+ **/
106	+ $profileId = Mage::registry('current_convert_profile')->getId();
107	+
108	+ $oopprofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
109	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
110	+ ->getFirstItem();
111	+
112	+ $AlreadyDone = $oopprofile->getProductsAllreadyDone();
113	+
114	+ if(!$AlreadyDone)
115	+ {
116	+ if(Mage::getStoreConfigFlag('oopsprofile/installation/date'))
117	+ {
118	+ $installationDate = Mage::getStoreConfig('oopsprofile/installation/date');
119	+
120	+ $this->_filter[] = array(
121	+ 'attribute' => 'created_at',
122	+ 'from' => $installationDate
123	+ );
124	+ }
125	+ }
126	+
127	+
128	+
129	+ /**
130	+ * Apply date from and to filter
131	+ **/
132	+
133	+ if($this->getVar('fromdate')!='')
134	+ {
135	+
136	+ $fromDate = Mage::app()->getLocale()->date()
137	+ ->setDate($this->getVar('fromdate'))
138	+ ->setTime('00:00:00')
139	+ ->toString(Varien_Date::DATETIME_INTERNAL_FORMAT);
140	+
141	+ $this->_filter[] = array(
142	+ 'attribute' => 'created_at',
143	+ 'from' => $fromDate
144	+ );
145	+
146	+
147	+ }
148	+
149	+ if($this->getVar('todate')!='')
150	+ {
151	+
152	+ $toDate = Mage::app()->getLocale()->date()
153	+ ->setDate($this->getVar('todate'))
154	+ ->setTime('23:59:59')
155	+ ->toString(Varien_Date::DATETIME_INTERNAL_FORMAT);
156	+
157	+ $this->_filter[] = array(
158	+ 'attribute' => 'created_at',
159	+ 'to' => $toDate
160	+ );
161	+ }
162	+ return $this;
163	+ }
164	+
165	+ protected function _applyProductFilterOnExport()
166	+ {
167	+ //echo $this->getVar('hiddentype');exit;
168	+ $hiddenProductTypes = explode(',',$this->getVar('hiddentype'));
169	+ if($this->getVar('hiddentype')!='')
170	+ {
171	+ $this->_filter[] = array(
172	+ 'attribute' => 'type_id',
173	+ 'nin' => $hiddenProductTypes
174	+ );
175	+ }
176	+
177	+ }
178	+
179	+ protected function fetchConditionArray()
180	+ {
181	+ $profile = Mage::registry('current_convert_profile');
182	+
183	+ $ruleCollection = Mage::getModel('oopsprofile/oopsprofile')
184	+ ->getCollection()
185	+ ->addFieldToFilter('dataflow_profile_id ',$profile->getId())
186	+ ->getFirstItem();
187	+
188	+ $conditions = $ruleCollection->getConditionsSerialized();
189	+ if (!empty($conditions)) {
190	+ $conditions = unserialize($conditions);
191	+ }
192	+ // echo '<pre>';print_r($conditions);
193	+
194	+ // exit;
195	+
196	+ return $conditions;
197	+ }
198	+
199	+ protected function applySubCondition($conditins,$aggregator,$sql)
200	+ {
201	+ $resource = Mage::getSingleton('core/resource');
202	+ $productCategoryTable = $resource->getTableName('catalog/category_product');
203	+
204	+ if(!empty($conditins))
205	+ {
206	+ $aggregator = $aggregator;
207	+ $i=0;
208	+ if($aggregator=='all')
209	+ {
210	+ $sqlcond = 'and';
211	+ }
212	+ else
213	+ {
214	+ $sqlcond = 'or';
215	+ }
216	+
217	+ //$sql = $sql.' where ';
218	+ $count = count($conditins);
219	+ foreach($conditins as $con)
220	+ {
221	+ $i++;
222	+ $sql = $sql.'(';
223	+ if(!empty($con['conditions']))
224	+ {
225	+ $this->applySubCondition($con['conditions'],$con['aggregator'],$sql);
226	+ }
227	+ else
228	+ {
229	+ $attribute = $con['attribute'];
230	+
231	+ $operator = $con['operator'];
232	+ $value = $con['value'];
233	+
234	+ $Optval = $this->fetchOperator($operator,$value);
235	+ $operator = $Optval['operator'];
236	+ $value = $Optval['value'];
237	+
238	+ if($attribute=='category_ids')
239	+ {
240	+ $sql = $sql.'entity_id in (select product_id from '.$productCategoryTable.' where category_id '.$operator.' '.$value.')';
241	+ }
242	+ else
243	+ {
244	+ $sql = $sql.$attribute.' '.$operator.' '.$value;
245	+ }
246	+ }
247	+ $sql = $sql.') ';
248	+ if($count!=$i)
249	+ {
250	+ $sql = $sql.$sqlcond.' ';
251	+ }
252	+ }
253	+ }
254	+
255	+ return $sql;
256	+ }
257	+
258	+ protected function fetchOperator($operator,$value)
259	+ {
260	+ $opt = array();
261	+ $opt['value'] = "'".$value."'";
262	+ $opt['operator'] = $operator;
263	+ switch ($operator){
264	+ case '==':
265	+ $opt['operator'] = '=';
266	+ break;
267	+ case '!=':
268	+ $operator = '!=';
269	+ break;
270	+ case '{}':
271	+ $opt['operator'] = 'like';
272	+ $opt['value'] = "'%".$value."%'";
273	+ break;
274	+ case '!{}':
275	+ $opt['operator'] = 'not like';
276	+ $opt['value'] = "'%".$value."%'";
277	+ break;
278	+ case '()':
279	+ $opt['operator'] = 'in';
280	+ $opt['value'] = '('.$opt['value'].')';
281	+ break;
282	+ case '!()':
283	+ $opt['operator'] = 'not in';
284	+ $opt['value'] = '('.$opt['value'].')';
285	+ break;
286	+ }
287	+ return $opt;
288	+
289	+ }
290	+
291	+
292	+ public function load()
293	+ {
294	+ $this->_defaultFilterOnProduct();
295	+
296	+ $this->_applyDateFilterOnExport();
297	+
298	+ $this->_applyProductFilterOnExport();
299	+
300	+ $this->loadEntityIds();
301	+
302	+ //return parent::load();
303	+ }
304	+
305	+ protected function loadEntityIds()
306	+ {
307	+ if (!($entityType = $this->getVar('entity_type'))
308	+ \|\| !(Mage::getResourceSingleton($entityType) instanceof Mage_Eav_Model_Entity_Interface)) {
309	+ $this->addException(Mage::helper('eav')->__('Invalid entity specified'), Varien_Convert_Exception::FATAL);
310	+ }
311	+ try {
312	+ $collection = $this->_getCollectionForLoad($entityType);
313	+
314	+ if (isset($this->_joinAttr) && is_array($this->_joinAttr)) {
315	+ foreach ($this->_joinAttr as $val) {
316	+ // print_r($val);
317	+
318	+ $collection->joinAttribute(
319	+ $val['alias'],
320	+ $val['attribute'],
321	+ $val['bind'],
322	+ null,
323	+ strtolower($val['joinType']),
324	+ $val['storeId']
325	+ );
326	+ }
327	+ }
328	+
329	+ $filterQuery = $this->getFilter();
330	+ if (is_array($filterQuery)) {
331	+ foreach ($filterQuery as $val) {
332	+ $collection->addFieldToFilter(array($val));
333	+ }
334	+ }
335	+
336	+ $joinFields = $this->_joinField;
337	+ if (isset($joinFields) && is_array($joinFields)) {
338	+ foreach ($joinFields as $field) {
339	+ // print_r($field);
340	+ $collection->joinField(
341	+ $field['alias'],
342	+ $field['attribute'],
343	+ $field['field'],
344	+ $field['bind'],
345	+ $field['cond'],
346	+ $field['joinType']);
347	+ }
348	+ }
349	+
350	+ /**
351	+ * Load collection ids
352	+ */
353	+ $entityIds = $collection->getAllIds();
354	+
355	+
356	+
357	+
358	+
359	+ /*****
360	+ *** Appy Rule Filter
361	+ *****/
362	+
363	+ $ruleConditions = $this->fetchConditionArray();
364	+ if(!empty($ruleConditions['conditions']))
365	+ {
366	+
367	+ $conditins = $ruleConditions['conditions'];
368	+ //echo '<pre>';print_r($ruleConditions);
369	+ if(!empty($conditins))
370	+ {
371	+ $sql = $collection->getSelectSql();
372	+
373	+
374	+ $resource = Mage::getSingleton('core/resource');
375	+ $productCategoryTable = $resource->getTableName('catalog/category_product');
376	+
377	+ //Add category id(category_id) in collection
378	+ //$collection->joinField('category_id',$productCategoryTable,'category_id','product_id=entity_id',null,'left');
379	+
380	+
381	+ $aggregator = $ruleConditions['aggregator'];
382	+ $i=0;
383	+ if($aggregator=='all')
384	+ {
385	+ $sqlcond = 'and';
386	+ }
387	+ else
388	+ {
389	+ $sqlcond = 'or';
390	+ }
391	+
392	+
393	+ //echo stripos($sql,'where');
394	+ if(stripos($sql,'where')!='')
395	+ {
396	+ $sql = $sql.' and ';
397	+ }
398	+ else
399	+ {
400	+ $sql = $sql.' where ';
401	+ }
402	+
403	+
404	+ $count = count($conditins);
405	+ foreach($conditins as $con)
406	+ {
407	+ $i++;
408	+ $sql = $sql.'(';
409	+ if(!empty($con['conditions']))
410	+ {
411	+ $sql = $this->applySubCondition($con['conditions'],$con['aggregator'],$sql);
412	+ }
413	+ else
414	+ {
415	+ $attribute = $con['attribute'];
416	+ $operator = $con['operator'];
417	+ $value = $con['value'];
418	+
419	+ $Optval = $this->fetchOperator($operator,$value);
420	+ $operator = $Optval['operator'];
421	+ $value = $Optval['value'];
422	+
423	+ if($attribute=='category_ids')
424	+ {
425	+ $sql = $sql.'entity_id in (select product_id from '.$productCategoryTable.' where category_id '.$operator.' '.$value.')';
426	+ }
427	+ else
428	+ {
429	+ $sql = $sql.$attribute.' '.$operator.' '.$value;
430	+ }
431	+ }
432	+ $sql = $sql.') ';
433	+ if($count!=$i)
434	+ {
435	+ $sql = $sql.$sqlcond.' ';
436	+ }
437	+ }
438	+ }
439	+ //echo $sql;
440	+ //exit;
441	+
442	+ if(!empty($sql))
443	+ {
444	+ $read = $resource->getConnection('core_read');
445	+ $fields = $read->fetchCol($sql);
446	+
447	+ $entityIds = $fields;
448	+
449	+ //echo '<pre>';print_r($fields);
450	+ }
451	+ }
452	+
453	+
454	+
455	+ //exit;
456	+ //echo '<pre>';print_r($collection->getData());
457	+
458	+
459	+
460	+ $message = Mage::helper('eav')->__("Loaded %d records", count($entityIds));
461	+ $this->addException($message);
462	+ }
463	+ catch (Varien_Convert_Exception $e) {
464	+ throw $e;
465	+ }
466	+ catch (Exception $e) {
467	+ $message = Mage::helper('eav')->__('Problem loading the collection, aborting. Error: %s', $e->getMessage());
468	+ $this->addException($message, Varien_Convert_Exception::FATAL);
469	+ }
470	+
471	+ /**
472	+ * Set collection ids
473	+ */
474	+ $this->setData($entityIds);
475	+ return $this;
476	+ }
477	+
478	+
479	+ /**
480	+ * Save product (import)
481	+ *
482	+ * @param array $importData
483	+ * @throws Mage_Core_Exception
484	+ * @return bool
485	+ */
486	+ public function saveRow( array $importData )
487	+ {
488	+ #$product = $this -> getProductModel();
489	+ $product = $this->getProductModel()
490	+ ->reset();
491	+ #$product -> setData( array() );
492	+
493	+ #if ( $stockItem = $product -> getStockItem() ) {
494	+ #$stockItem -> setData( array() );
495	+ #}
496	+
497	+ if (empty($importData['store'])) {
498	+ if (!is_null($this->getBatchParams('store'))) {
499	+ $store = $this->getStoreById($this->getBatchParams('store'));
500	+ } else {
501	+ $message = Mage::helper('catalog')->__('Skip import row, required field "%s" not defined', 'store');
502	+ Mage::throwException($message);
503	+ Mage::log(sprintf('Skip import row, required field "store" not defined', $message), null,'ce_product_import_export_errors.log');
504	+ }
505	+ }
506	+ else {
507	+ $store = $this->getStoreByCode($importData['store']);
508	+ }
509	+
510	+ if ($store === false) {
511	+ $message = Mage::helper('catalog')->__('Skip import row, store "%s" field not exists', $importData['store']);
512	+ Mage::throwException($message);
513	+ Mage::log(sprintf('Skip import row, store "'.$importData['store'].'" field not exists', $message), null,'ce_product_import_export_errors.log');
514	+ }
515	+
516	+ if (empty($importData['sku'])) {
517	+ $message = Mage::helper('catalog')->__('Skip import row, required field "%s" not defined', 'sku');
518	+ Mage::throwException($message);
519	+ Mage::log(sprintf('Skip import row, required field "sku" not defined', $message), null,'ce_product_import_export_errors.log');
520	+ }
521	+ $product->setStoreId($store->getId());
522	+ $productId = $product->getIdBySku($importData['sku']);
523	+
524	+ $iscustomoptions = "false"; //sets currentcustomoptionstofalse
525	+ $iscustomoptionsrequired = "false";
526	+ $finalsuperattributepricing = "";
527	+ $finalgroup_price_price = "";
528	+ $finalsuperattributetype = $importData['type'];
529	+ if (isset($importData['super_attribute_pricing']) && $importData['super_attribute_pricing'] !="") {
530	+ $finalsuperattributepricing = $importData['super_attribute_pricing'];
531	+ }
532	+ if (isset($importData['group_price_price']) && $importData['group_price_price'] !="") {
533	+ $finalgroup_price_price = $importData['group_price_price'];
534	+ }
535	+ $new = true; // fix for duplicating attributes error
536	+
537	+ if ($productId) {
538	+ $product->load($productId);
539	+ $new = false; // fix for duplicating attributes error
540	+ }
541	+ else {
542	+ $productTypes = $this->getProductTypes();
543	+ $productAttributeSets = $this->getProductAttributeSets();
544	+
545	+ /**
546	+ * Check product define type
547	+ */
548	+ if (empty($importData['type']) \|\| !isset($productTypes[strtolower($importData['type'])])) {
549	+ $value = isset($importData['type']) ? $importData['type'] : '';
550	+ $message = Mage::helper('catalog')->__('Skip import row, is not valid value "%s" for field "%s"', $value, 'type');
551	+ Mage::throwException($message);
552	+ Mage::log(sprintf('Skip import row, is not valid value "'.$value.'" for field type', $message), null,'ce_product_import_export_errors.log');
553	+ }
554	+ $product->setTypeId($productTypes[strtolower($importData['type'])]);
555	+ /**
556	+ * Check product define attribute set
557	+ */
558	+ if (empty($importData['attribute_set']) \|\| !isset($productAttributeSets[$importData['attribute_set']])) {
559	+ $value = isset($importData['attribute_set']) ? $importData['attribute_set'] : '';
560	+ $message = Mage::helper('catalog')->__('Skip import row, is not valid value "%s" for field "%s"', $value, 'attribute_set');
561	+ Mage::throwException($message);
562	+ Mage::log(sprintf('Skip import row, is not valid value "'.$value.'" for field attribute_set', $message), null,'ce_product_import_export_errors.log');
563	+ }
564	+ $product->setAttributeSetId($productAttributeSets[$importData['attribute_set']]);
565	+
566	+ foreach ($this->_requiredFields as $field) {
567	+ $attribute = $this->getAttribute($field);
568	+ if (!isset($importData[$field]) && $attribute && $attribute->getIsRequired()) {
569	+ $message = Mage::helper('catalog')->__('Skip import row, required field "%s" for new products not defined', $field);
570	+ Mage::throwException($message);
571	+ }
572	+ }
573	+ }
574	+
575	+ $this->setProductTypeInstance($product);
576	+
577	+ // delete disabled products
578	+ // note "Disabled text should be converted to handle multi-lanugage values aka age::helper('catalog')->__(''); type deal
579	+
580	+ if ( $importData['status'] == 'Delete' \|\| $importData['status'] == 'delete' ) {
581	+ $product = Mage :: getSingleton( 'catalog/product' ) -> load( $productId );
582	+ $this -> _removeFile( Mage :: getSingleton( 'catalog/product_media_config' ) -> getMediaPath( $product -> getData( 'image' ) ) );
583	+ $this -> _removeFile( Mage :: getSingleton( 'catalog/product_media_config' ) -> getMediaPath( $product -> getData( 'small_image' ) ) );
584	+ $this -> _removeFile( Mage :: getSingleton( 'catalog/product_media_config' ) -> getMediaPath( $product -> getData( 'thumbnail' ) ) );
585	+ $media_gallery = $product -> getData( 'media_gallery' );
586	+ foreach ( $media_gallery['images'] as $image ) {
587	+ $this -> _removeFile( Mage :: getSingleton( 'catalog/product_media_config' ) -> getMediaPath( $image['file'] ) );
588	+ }
589	+ $product -> delete();
590	+ return true;
591	+ }
592	+
593	+
594	+ $currentproducttype = $importData['type'];
595	+
596	+ if ($importData['type'] == 'configurable') {
597	+
598	+ $product->setCanSaveConfigurableAttributes(true);
599	+ $configAttributeCodes = $this->userCSVDataAsArray($importData['config_attributes']);
600	+ $usingAttributeIds = array();
601	+
602	+ /***
603	+ * Check the product's super attributes (see catalog_product_super_attribute table), and make a determination that way.
604	+ **/
605	+ $cspa = $product->getTypeInstance()->getConfigurableAttributesAsArray($product);
606	+ $attr_codes = array();
607	+ if(isset($cspa) && !empty($cspa)){ //found attributes
608	+ foreach($cspa as $cs_attr){
609	+ //$attr_codes[$cs_attr['attribute_id']] = $cs_attr['attribute_code'];
610	+ $attr_codes[] = $cs_attr['attribute_id'];
611	+ }
612	+ }
613	+
614	+
615	+ foreach($configAttributeCodes as $attributeCode) {
616	+ $attribute = $product->getResource()->getAttribute($attributeCode);
617	+ if ($product->getTypeInstance()->canUseAttribute($attribute)) {
618	+ //if (!in_array($attributeCode,$attr_codes)) { // fix for duplicating attributes error
619	+ if ($new) { // fix for duplicating attributes error // <---------- this must be true to fill $usingAttributes
620	+ $usingAttributeIds[] = $attribute->getAttributeId();
621	+ }
622	+ }
623	+ }
624	+ if (!empty($usingAttributeIds)) {
625	+ $product->getTypeInstance()->setUsedProductAttributeIds($usingAttributeIds);
626	+ $updateconfigurablearray = array();
627	+ $insidearraycount=0;
628	+ $finalarraytoimport = $product->getTypeInstance()->getConfigurableAttributesAsArray();
629	+ $updateconfigurablearray = $product->getTypeInstance()->getConfigurableAttributesAsArray();
630	+
631	+ foreach($updateconfigurablearray as $eacharrayvalue) {
632	+ if($this->getBatchParams('configurable_use_default') != "") {
633	+ $finalarraytoimport[$insidearraycount]['use_default'] = $this->getBatchParams('configurable_use_default'); //added in 1.5.x
634	+ //<var name="configurable_use_default"><![CDATA[1]]></var>
635	+ }
636	+ $finalarraytoimport[$insidearraycount]['label'] = $eacharrayvalue['frontend_label'];
637	+ #$finalarraytoimport[$insidearraycount]['values'] = array( );
638	+ #$attribute = Mage::getModel('catalog/product_type_configurable_attribute')->setProductAttribute($eacharrayvalue['attribute_id']);
639	+ #$attribute->setStoreLabel($eacharrayvalue['frontend_label']);
640	+ #print_r($attribute->getStoreLabel());
641	+ $insidearraycount+=1;
642	+ }
643	+ $product->setConfigurableAttributesData($finalarraytoimport);
644	+ $product->setCanSaveConfigurableAttributes(true);
645	+ $product->setCanSaveCustomOptions(true);
646	+ }
647	+ if (isset($importData['associated'])) {
648	+ $product->setConfigurableProductsData($this->skusToIds($importData['associated'], $product));
649	+ }
650	+ }
651	+ //THIS IS FOR DOWNLOADABLE PRODUCTS
652	+ if ($importData['type'] == 'downloadable' && $importData['downloadable_options'] != "") {
653	+ if ($new) {
654	+ $downloadableitems = array();
655	+ $filearrayforimport = array();
656	+ $filenameforsamplearrayforimport = array();
657	+ #$filenameforsamplearrayforimport = "";
658	+ $downloadableitemsoptionscount=0;
659	+ //THIS IS FOR DOWNLOADABLE OPTIONS
660	+ $commadelimiteddata = explode('\|',$importData['downloadable_options']);
661	+ foreach ($commadelimiteddata as $data) {
662	+ $configBundleOptionsCodes = $this->userCSVDataAsArray($data);
663	+
664	+ $downloadableitems['link'][$downloadableitemsoptionscount]['is_delete'] = 0;
665	+ $downloadableitems['link'][$downloadableitemsoptionscount]['link_id'] = 0;
666	+ $downloadableitems['link'][$downloadableitemsoptionscount]['title'] = $configBundleOptionsCodes[0];
667	+ $downloadableitems['link'][$downloadableitemsoptionscount]['price'] = $configBundleOptionsCodes[1];
668	+ $downloadableitems['link'][$downloadableitemsoptionscount]['number_of_downloads'] = $configBundleOptionsCodes[2];
669	+ $downloadableitems['link'][$downloadableitemsoptionscount]['is_shareable'] = 2;
670	+ if(isset($configBundleOptionsCodes[6])) {
671	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = '';
672	+ if($configBundleOptionsCodes[3] == "file") {
673	+ #$filenameforsamplearrayforimport = $configBundleOptionsCodes[6];
674	+ if(isset($configBundleOptionsCodes[7])) {
675	+ $sampleproductitle = $configBundleOptionsCodes[7];
676	+ } else {
677	+ $sampleproductitle = $configBundleOptionsCodes[0];
678	+ }
679	+ $filenameforsamplearrayforimport[] = array('file' => ''.$configBundleOptionsCodes[6].'' , 'name' => ''.$sampleproductitle.'' , 'price' => ''.$configBundleOptionsCodes[1].'');
680	+ //Create and send the JSON structure instead of the file name
681	+ $tempSampleFile = '[{"file": "'.$configBundleOptionsCodes[6].'", "status": "new"}]';
682	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('file' => ''.$tempSampleFile.'', 'type' => 'file', 'url' => '');
683	+
684	+ //$downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('file' => ''.$configBundleOptionsCodes[6].'', 'type' => 'file', 'url' => '');
685	+ } else {
686	+
687	+ if(isset($configBundleOptionsCodes[7])) {
688	+ $sampleproductitle = $configBundleOptionsCodes[7];
689	+ } else {
690	+ $sampleproductitle = $configBundleOptionsCodes[0];
691	+ }
692	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('name' => ''.$sampleproductitle.'','file' => '[]', 'type' => 'url', 'url' => ''.$configBundleOptionsCodes[6].'');
693	+ }
694	+ } else {
695	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = '';
696	+ }
697	+ $downloadableitems['link'][$downloadableitemsoptionscount]['file'] = '';
698	+ $downloadableitems['link'][$downloadableitemsoptionscount]['type'] = $configBundleOptionsCodes[3];
699	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['link_url'] = $configBundleOptionsCodes[4];
700	+ if($configBundleOptionsCodes[3] == "file") {
701	+ #$filearrayforimport = array('file' => 'media/import/mypdf.pdf' , 'name' => 'asdad.txt', 'size' => '316', 'status' => 'old');
702	+ #$document_directory = Mage :: getBaseDir( 'media' ) . DS . 'import' . DS;
703	+ #echo "DIRECTORY: " . $document_directory;
704	+ #$filearrayforimport = '[{"file": "/home/discou33/public_html/media/import/mypdf.pdf", "name": "mypdf.pdf", "status": "new"}]';
705	+ #$filearrayforimport = '[{"file": "mypdf.pdf", "name": "quickstart.pdf", "size": 324075, "status": "new"}]';
706	+ $filearrayforimport[] = array('file' => ''.$configBundleOptionsCodes[4].'' , 'name' => ''.$configBundleOptionsCodes[0].'' , 'price' => ''.$configBundleOptionsCodes[1].'');
707	+
708	+ if(isset($configBundleOptionsCodes[8])) {
709	+ if($configBundleOptionsCodes[8] == 0) {
710	+ $linkspurchasedstatus = 0;
711	+ $linkspurchasedstatustext = false;
712	+ } else {
713	+ $linkspurchasedstatus = 1;
714	+ $linkspurchasedstatustext = true;
715	+ }
716	+ $product->setLinksPurchasedSeparately($linkspurchasedstatus);
717	+ $product->setLinksPurchasedSeparately($linkspurchasedstatustext);
718	+ }
719	+
720	+
721	+ #$product->setLinksPurchasedSeparately(0);
722	+ #$product->setLinksPurchasedSeparately(false);
723	+
724	+ #$files = Zend_Json::decode($filearrayforimport);
725	+ #$files = "mypdf.pdf";
726	+
727	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['file'] = $filearrayforimport;
728	+ } else if($configBundleOptionsCodes[3] == "url") {
729	+ $downloadableitems['link'][$downloadableitemsoptionscount]['link_url'] = $configBundleOptionsCodes[4];
730	+ }
731	+ if(isset($configBundleOptionsCodes[5])) {
732	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sort_order'] = $configBundleOptionsCodes[5];
733	+ } else {
734	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sort_order'] = 0;
735	+ }
736	+ $product->setDownloadableData($downloadableitems);
737	+ $downloadableitemsoptionscount+=1;
738	+ }
739	+ #print_r($downloadableitems);
740	+ } else {
741	+ //first delete all links then we update
742	+ $download_info=Mage::getModel('downloadable/product_type');
743	+ $download_info->setProduct($product);
744	+ if ($download_info->hasLinks()) {
745	+ $_links=$download_info->getLinks();
746	+ foreach ($_links as $_link) {
747	+ $_link->delete();
748	+ }
749	+ }
750	+
751	+ //begin update
752	+ $downloadableitems = array();
753	+ $filearrayforimport = array();
754	+ //$filenameforsamplearrayforimport = "";
755	+ $filenameforsamplearrayforimport = array(); //bug fix
756	+ $downloadableitemsoptionscount=0;
757	+ //THIS IS FOR DOWNLOADABLE OPTIONS
758	+ $commadelimiteddata = explode('\|',$importData['downloadable_options']);
759	+ foreach ($commadelimiteddata as $data) {
760	+ $configBundleOptionsCodes = $this->userCSVDataAsArray($data);
761	+
762	+ $downloadableitems['link'][$downloadableitemsoptionscount]['is_delete'] = 0;
763	+ $downloadableitems['link'][$downloadableitemsoptionscount]['link_id'] = 0;
764	+ $downloadableitems['link'][$downloadableitemsoptionscount]['title'] = $configBundleOptionsCodes[0];
765	+ $downloadableitems['link'][$downloadableitemsoptionscount]['price'] = $configBundleOptionsCodes[1];
766	+ $downloadableitems['link'][$downloadableitemsoptionscount]['number_of_downloads'] = $configBundleOptionsCodes[2];
767	+ $downloadableitems['link'][$downloadableitemsoptionscount]['is_shareable'] = 2;
768	+ if(isset($configBundleOptionsCodes[6])) {
769	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = '';
770	+ if($configBundleOptionsCodes[3] == "file") {
771	+ #$filenameforsamplearrayforimport = $configBundleOptionsCodes[6];
772	+ if(isset($configBundleOptionsCodes[7])) {
773	+ $sampleproductitle = $configBundleOptionsCodes[7];
774	+ } else {
775	+ $sampleproductitle = $configBundleOptionsCodes[0];
776	+ }
777	+ $filenameforsamplearrayforimport[] = array('file' => ''.$configBundleOptionsCodes[6].'' , 'name' => ''.$sampleproductitle.'' , 'price' => ''.$configBundleOptionsCodes[1].'');
778	+ //Create and send the JSON structure instead of the file name
779	+ $tempSampleFile = '[{"file": "'.$configBundleOptionsCodes[6].'", "status": "new"}]';
780	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('file' => ''.$tempSampleFile.'', 'type' => 'file', 'url' => '');
781	+ //$downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('file' => ''.$configBundleOptionsCodes[6].'', 'type' => 'file', 'url' => '');
782	+ } else {
783	+ if(isset($configBundleOptionsCodes[7])) {
784	+ $sampleproductitle = $configBundleOptionsCodes[7];
785	+ } else {
786	+ $sampleproductitle = $configBundleOptionsCodes[0];
787	+ }
788	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = array('name' => ''.$sampleproductitle.'', 'file' => '[]', 'type' => 'url', 'url' => ''.$configBundleOptionsCodes[6].'');
789	+ }
790	+ } else {
791	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sample'] = '';
792	+ }
793	+ $downloadableitems['link'][$downloadableitemsoptionscount]['file'] = '';
794	+ $downloadableitems['link'][$downloadableitemsoptionscount]['type'] = $configBundleOptionsCodes[3];
795	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['link_url'] = $configBundleOptionsCodes[4];
796	+ if($configBundleOptionsCodes[3] == "file") {
797	+ #$filearrayforimport = array('file' => 'media/import/mypdf.pdf' , 'name' => 'asdad.txt', 'size' => '316', 'status' => 'old');
798	+ #$document_directory = Mage :: getBaseDir( 'media' ) . DS . 'import' . DS;
799	+ #echo "DIRECTORY: " . $document_directory;
800	+ #$filearrayforimport = '[{"file": "/home/discou33/public_html/media/import/mypdf.pdf", "name": "mypdf.pdf", "status": "new"}]';
801	+ #$filearrayforimport = '[{"file": "mypdf.pdf", "name": "quickstart.pdf", "size": 324075, "status": "new"}]';
802	+ #echo "FILE: " . $configBundleOptionsCodes[4];
803	+ $filearrayforimport[] = array('file' => ''.$configBundleOptionsCodes[4].'' , 'name' => ''.$configBundleOptionsCodes[0].'' , 'price' => ''.$configBundleOptionsCodes[1].'');
804	+
805	+ if(isset($configBundleOptionsCodes[8])) {
806	+ if($configBundleOptionsCodes[8] == 0) {
807	+ $linkspurchasedstatus = 0;
808	+ $linkspurchasedstatustext = false;
809	+ } else {
810	+ $linkspurchasedstatus = 1;
811	+ $linkspurchasedstatustext = true;
812	+ }
813	+ $product->setLinksPurchasedSeparately($linkspurchasedstatus);
814	+ $product->setLinksPurchasedSeparately($linkspurchasedstatustext);
815	+ }
816	+
817	+
818	+ #$product->setLinksPurchasedSeparately(0);
819	+ #$product->setLinksPurchasedSeparately(false);
820	+
821	+ #$files = Zend_Json::decode($filearrayforimport);
822	+ #$files = "mypdf.pdf";
823	+
824	+ #$downloadableitems['link'][$downloadableitemsoptionscount]['file'] = $filearrayforimport;
825	+ } else if($configBundleOptionsCodes[3] == "url") {
826	+ $downloadableitems['link'][$downloadableitemsoptionscount]['link_url'] = $configBundleOptionsCodes[4];
827	+ }
828	+
829	+ if(isset($configBundleOptionsCodes[5])) {
830	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sort_order'] = $configBundleOptionsCodes[5];
831	+ } else {
832	+ $downloadableitems['link'][$downloadableitemsoptionscount]['sort_order'] = 0;
833	+ }
834	+ $product->setDownloadableData($downloadableitems);
835	+ $downloadableitemsoptionscount+=1;
836	+ }
837	+
838	+ }
839	+ }
840	+ //THIS IS FOR BUNDLE PRODUCTS
841	+ if ($importData['type'] == 'bundle') {
842	+ if ($new) {
843	+ $optionscount=0;
844	+ $items = array();
845	+ //THIS IS FOR BUNDLE OPTIONS
846	+ $commadelimiteddata = explode('\|',$importData['bundle_options']);
847	+ foreach ($commadelimiteddata as $data) {
848	+ $configBundleOptionsCodes = $this->userCSVDataAsArray($data);
849	+ $titlebundleselection = ucfirst(str_replace('_',' ',$configBundleOptionsCodes[0]));
850	+ $items[$optionscount]['title'] = $titlebundleselection;
851	+ $items[$optionscount]['type'] = $configBundleOptionsCodes[1];
852	+ $items[$optionscount]['required'] = $configBundleOptionsCodes[2];
853	+ $items[$optionscount]['position'] = $configBundleOptionsCodes[3];
854	+ $items[$optionscount]['delete'] = 0;
855	+ $optionscount+=1;
856	+
857	+
858	+ if ($items) {
859	+ $product->setBundleOptionsData($items);
860	+ }
861	+ $options_id = $product->getOptionId();
862	+ $selections = array();
863	+ $bundleConfigData = array();
864	+ $optionscountselection=0;
865	+ //THIS IS FOR BUNDLE SELECTIONS
866	+ $commadelimiteddataselections = explode('\|',$importData['bundle_selections']);
867	+ foreach ($commadelimiteddataselections as $selection) {
868	+ $configBundleSelectionCodes = $this->userCSVDataAsArray($selection);
869	+ $selectionscount=0;
870	+ foreach ($configBundleSelectionCodes as $selectionItem) {
871	+ $bundleConfigData = explode(':',$selectionItem);
872	+ $selections[$optionscountselection][$selectionscount]['option_id'] = $options_id;
873	+ $selections[$optionscountselection][$selectionscount]['product_id'] = $product->getIdBySku($bundleConfigData[0]);
874	+ $selections[$optionscountselection][$selectionscount]['selection_price_type'] = $bundleConfigData[1];
875	+ $selections[$optionscountselection][$selectionscount]['selection_price_value'] = $bundleConfigData[2];
876	+ $selections[$optionscountselection][$selectionscount]['is_default'] = $bundleConfigData[3];
877	+ if(isset($bundleConfigData) && isset($bundleConfigData[4]) && $bundleConfigData[4] != '') {
878	+ $selections[$optionscountselection][$selectionscount]['selection_qty'] = $bundleConfigData[4];
879	+ $selections[$optionscountselection][$selectionscount]['selection_can_change_qty'] = $bundleConfigData[5];
880	+ }
881	+ if(isset($bundleConfigData) && isset($bundleConfigData[6]) && $bundleConfigData[6] != '') {
882	+ $selections[$optionscountselection][$selectionscount]['position'] = $bundleConfigData[6];
883	+ }
884	+ $selections[$optionscountselection][$selectionscount]['delete'] = 0;
885	+ $selectionscount+=1;
886	+ }
887	+ $optionscountselection+=1;
888	+ }
889	+ if ($selections) {
890	+ $product->setBundleSelectionsData($selections);
891	+ }
892	+
893	+ }
894	+
895	+
896	+ if ($product->getPriceType() == '0') {
897	+ $product->setCanSaveCustomOptions(true);
898	+ if ($customOptions = $product->getProductOptions()) {
899	+ foreach ($customOptions as $key => $customOption) {
900	+ $customOptions[$key]['is_delete'] = 1;
901	+ }
902	+ $product->setProductOptions($customOptions);
903	+ }
904	+ }
905	+
906	+ $product->setCanSaveBundleSelections();
907	+ }
908	+ }
909	+ if ( isset( $importData['related'] ) ) {
910	+ $pos = strpos($importData['related'], ":");
911	+ if ($pos !== false) {
912	+ $linkIds = $this -> skusToIdswithPosition( $importData['related'], $product );
913	+ } else {
914	+ $linkIds = $this -> skusToIds( $importData['related'], $product );
915	+ }
916	+ if ( !empty( $linkIds ) ) {
917	+ $product -> setRelatedLinkData( $linkIds );
918	+ }
919	+ }
920	+
921	+ if ( isset( $importData['upsell'] ) ) {
922	+ $pos = strpos($importData['upsell'], ":");
923	+ if ($pos !== false) {
924	+ $linkIds = $this -> skusToIdswithPosition( $importData['upsell'], $product );
925	+ } else {
926	+ $linkIds = $this -> skusToIds( $importData['upsell'], $product );
927	+ }
928	+ if ( !empty( $linkIds ) ) {
929	+ $product -> setUpSellLinkData( $linkIds );
930	+ }
931	+ }
932	+
933	+ if ( isset( $importData['crosssell'] ) ) {
934	+ $pos = strpos($importData['crosssell'], ":");
935	+ if ($pos !== false) {
936	+ $linkIds = $this -> skusToIdswithPosition( $importData['crosssell'], $product );
937	+ } else {
938	+ $linkIds = $this -> skusToIds( $importData['crosssell'], $product );
939	+ }
940	+ if ( !empty( $linkIds ) ) {
941	+ $product -> setCrossSellLinkData( $linkIds );
942	+ }
943	+ }
944	+ /*
945	+ if ( isset( $importData['grouped'] ) ) {
946	+ $linkIds = $this -> skusToIds( $importData['grouped'], $product );
947	+ if ( !empty( $linkIds ) ) {
948	+ $product -> setGroupedLinkData( $linkIds );
949	+ }
950	+ }
951	+ */
952	+ /* MODDED TO ALLOW FOR GROUP POSITION AS WELL AND SHOULD WORK IF NO POSITION IS SET AS WELL CAN COMBO */
953	+ if ( isset( $importData['grouped'] ) && $importData['grouped'] != "" ) {
954	+
955	+ $finalIDssthatneedtobeconvertedto=array();
956	+ $finalskusthatneedtobeconvertedtoID="";
957	+ $groupedpositioncounter=0;
958	+ $finalskusforarraytoexplode = explode(",",$importData['grouped']);
959	+ foreach($finalskusforarraytoexplode as $productskuexploded)
960	+ {
961	+ $pos = strpos($productskuexploded, ":");
962	+ if ($pos !== false) {
963	+ //if( isset($finalidsforarraytoexplode[1]) ) {
964	+ $finalidsforarraytoexplode = explode(":",$productskuexploded);
965	+ $finalIDssthatneedtobeconvertedto[$groupedpositioncounter]['position'] = $finalidsforarraytoexplode[0];
966	+ $finalIDssthatneedtobeconvertedto[$groupedpositioncounter]['sku'] = $finalidsforarraytoexplode[1];
967	+ if ($finalidsforarraytoexplode[2]) {
968	+ $finalIDssthatneedtobeconvertedto[$groupedpositioncounter]['qty'] = $finalidsforarraytoexplode[2];
969	+ }
970	+ $finalskusthatneedtobeconvertedtoID .= $finalidsforarraytoexplode[1] . ",";
971	+ } else {
972	+ $finalskusthatneedtobeconvertedtoID .= $productskuexploded . ",";
973	+ }
974	+ $groupedpositioncounter++;
975	+ }
976	+ $linkIds = $this -> skusToIds( $finalskusthatneedtobeconvertedtoID, $product );
977	+ if ( !empty( $linkIds ) ) {
978	+ $product -> setGroupedLinkData( $linkIds );
979	+ }
980	+ }
981	+
982	+ /**
983	+ Assign product to category by "Category Name"
984	+ **/
985	+ /*
986	+ if(isset( $importData['category_names'] ))
987	+ {
988	+ $catsarray = explode(",",$importData['category_names']);
989	+ $catsarray = Mage::getModel('catalog/category')
990	+ ->getCollection()
991	+ ->addAttributeToSelect('name')
992	+ ->addAttributeToFilter('name',array('in' => $catsarray))
993	+ ->getAllIds();
994	+
995	+ $product -> setCategoryIds($catsarray);
996	+ }*/
997	+
998	+ /**
999	+ Assign
1000	+ product to category by "Category Ids"
1001	+ **/
1002	+ if ( isset( $importData['category_ids'] ) )
1003	+ {
1004	+
1005	+ /Fetch category mapping detail/
1006	+ $profileId = Mage::getSingleton('core/session')->getTemplateProfileId();
1007	+
1008	+ $oopsrofile = Mage::getModel('oopsprofile/oopsprofile')->getCollection()
1009	+ ->addFieldToFilter('dataflow_profile_id',$profileId)
1010	+ ->getFirstItem();
1011	+ //$selectedProfile = $oopsrofile->getProfileTemplate();
1012	+
1013	+ //$tempModel = Mage::getModel('oopsprofile/template')->load($selectedProfile);
1014	+
1015	+ //$categoryMapping = $tempModel->getCategoryMapping();
1016	+ $categoryMapping = '';
1017	+
1018	+ $mappingDetail = '';
1019	+
1020	+ if($categoryMapping!='')//if category mapping exist
1021	+ {
1022	+ $categoryMappingModel = Mage::getModel('oopsprofile/mapping')->load($categoryMapping);
1023	+ $mappingDetail = unserialize($categoryMappingModel->getMappingDetail());
1024	+
1025	+ $catsarray = explode(",",$importData['category_ids']);
1026	+
1027	+ $result = array_intersect($mappingDetail, $catsarray);
1028	+
1029	+ $catIds = array_keys($result);
1030	+
1031	+ $product -> setCategoryIds( $catIds );
1032	+
1033	+ }
1034	+ else
1035	+ {
1036	+
1037	+ #keeps existing category_ids and adds new ones to them
1038	+ if($this->getBatchParams('append_categories') == "true") {
1039	+ $cats = $product->getCategoryIds();
1040	+ $catsarray = explode(",",$importData['category_ids']);
1041	+ $finalcatsimport = array_merge($cats, $catsarray);
1042	+ $product -> setCategoryIds( $finalcatsimport );
1043	+ } else {
1044	+ $catsarray = explode(",",$importData['category_ids']);//convert in array form
1045	+ $product -> setCategoryIds($catsarray);
1046	+ }
1047	+ }
1048	+ }
1049	+
1050	+
1051	+ if( isset($importData['tier_prices']) && !empty($importData['tier_prices']) ) {
1052	+ $this->_editTierPrices($product, $importData['tier_prices'], $store);
1053	+ }
1054	+
1055	+
1056	+ if ( isset( $importData['categories'] ) && $importData['categories'] !="" ) {
1057	+ if (!empty($importData['store'])) {
1058	+ $cat_store = $this -> _stores[$importData['store']];
1059	+ } else {
1060	+ $message = Mage :: helper( 'catalog' ) -> __( 'Skip import row, required field "store" for new products not defined', $field );
1061	+ Mage :: throwException( $message );
1062	+ }
1063	+ $categoryIds = $this -> _addCategories( $importData['categories'], $cat_store );
1064	+ if ( $categoryIds ) {
1065	+ #keeps existing category_ids and adds new ones to them
1066	+ if($this->getBatchParams('append_categories') == "true") {
1067	+ $cats = $product->getCategoryIds();
1068	+ $catsarray = explode(",",$categoryIds);
1069	+ $finalcatsimport = array_merge($cats, $catsarray);
1070	+ $product -> setCategoryIds( $finalcatsimport );
1071	+ } else {
1072	+ $product -> setCategoryIds( $categoryIds );
1073	+ }
1074	+ }
1075	+ }
1076	+
1077	+ foreach ( $this -> _ignoreFields as $field ) {
1078	+ if ( isset( $importData[$field] ) ) {
1079	+ unset( $importData[$field] );
1080	+ }
1081	+ }
1082	+
1083	+ if ($store->getId() != 0) {
1084	+ $websiteIds = $product->getWebsiteIds();
1085	+ if (!is_array($websiteIds)) {
1086	+ $websiteIds = array();
1087	+ }
1088	+ if (!in_array($store->getWebsiteId(), $websiteIds)) {
1089	+ $websiteIds[] = $store->getWebsiteId();
1090	+ }
1091	+ $product->setWebsiteIds($websiteIds);
1092	+ }
1093	+
1094	+ if ( isset( $importData['websites'] ) ) {
1095	+ $websiteIds = $product -> getWebsiteIds();
1096	+ if ( !is_array( $websiteIds ) ) {
1097	+ $websiteIds = array();
1098	+ }
1099	+ $websiteCodes = explode( ',', $importData['websites'] );
1100	+ foreach ( $websiteCodes as $websiteCode ) {
1101	+ try {
1102	+ $website = Mage :: app() -> getWebsite( trim( $websiteCode ) );
1103	+ if ( !in_array( $website -> getId(), $websiteIds ) ) {
1104	+ $websiteIds[] = $website -> getId();
1105	+ }
1106	+ }
1107	+ catch ( Exception $e ) {
1108	+ }
1109	+ }
1110	+ $product -> setWebsiteIds( $websiteIds );
1111	+ unset( $websiteIds );
1112	+ }
1113	+
1114	+ $custom_options = array();
1115	+
1116	+ foreach ( $importData as $field => $value ) {
1117	+ //SEEMS TO BE CONFLICTING ISSUES WITH THESE 2 CHOICES AND DOESNT SEEM TO REQUIRE THIS IN ALL THE TESTING SO LEAVING COMMENTED
1118	+ //if ( in_array( $field, $this -> _inventoryFields ) ) {
1119	+ //continue;
1120	+ //}
1121	+ /*
1122	+ if (in_array($field, $this->_inventorySimpleFields))
1123	+ {
1124	+ continue;
1125	+ }
1126	+ */
1127	+ if ( in_array( $field, $this -> _imageFields ) ) {
1128	+ continue;
1129	+ }
1130	+
1131	+ $attribute = $this -> getAttribute( $field );
1132	+ if ( !$attribute ) {
1133	+ /* CUSTOM OPTION CODE */
1134	+ if(strpos($field,':')!==FALSE && strlen($value)) {
1135	+ $values=explode('\|',$value);
1136	+ if(count($values)>0) {
1137	+ $iscustomoptions = "true";
1138	+
1139	+ foreach($values as $v) {
1140	+ $parts = explode(':',$v);
1141	+ $title = $parts[0];
1142	+ }
1143	+ //RANDOM ISSUE HERE SOMETIMES WITH TITLES OF LAST ITEM IN DROPDOWN SHOWING AS TITLE MIGHT NEED TO SEPERATE TITLE variables
1144	+ @list($title,$type,$is_required,$sort_order) = explode(':',$field);
1145	+ $title2 = ucfirst(str_replace('_',' ',$title));
1146	+ $custom_options[] = array(
1147	+ 'is_delete'=>0,
1148	+ 'title'=>$title2,
1149	+ 'previous_group'=>'',
1150	+ 'previous_type'=>'',
1151	+ 'type'=>$type,
1152	+ 'is_require'=>$is_required,
1153	+ 'sort_order'=>$sort_order,
1154	+ 'values'=>array()
1155	+ );
1156	+ if($is_required ==1) {
1157	+ $iscustomoptionsrequired = "true";
1158	+ }
1159	+ foreach($values as $v) {
1160	+ $parts = explode(':',$v);
1161	+ $title = $parts[0];
1162	+ if(count($parts)>1) {
1163	+ $price_type = $parts[1];
1164	+ } else {
1165	+ $price_type = 'fixed';
1166	+ }
1167	+ if(count($parts)>2) {
1168	+ $price = $parts[2];
1169	+ } else {
1170	+ $price =0;
1171	+ }
1172	+ if(count($parts)>3) {
1173	+ $sku = $parts[3];
1174	+ } else {
1175	+ $sku='';
1176	+ }
1177	+ if(count($parts)>4) {
1178	+ $sort_order = $parts[4];
1179	+ } else {
1180	+ $sort_order = 0;
1181	+ }
1182	+ if(count($parts)>5) {
1183	+ $max_characters = $parts[5];
1184	+ } else {
1185	+ $max_characters = '';
1186	+ }
1187	+ if(count($parts)>6) {
1188	+ $file_extension = $parts[6];
1189	+ } else {
1190	+ $file_extension = '';
1191	+ }
1192	+ if(count($parts)>7) {
1193	+ $image_size_x = $parts[7];
1194	+ } else {
1195	+ $image_size_x = '';
1196	+ }
1197	+ if(count($parts)>8) {
1198	+ $image_size_y = $parts[8];
1199	+ } else {
1200	+ $image_size_y = '';
1201	+ }
1202	+ switch($type) {
1203	+ case 'file':
1204	+ /* TODO */
1205	+ $custom_options[count($custom_options) - 1]['price_type'] = $price_type;
1206	+ $custom_options[count($custom_options) - 1]['price'] = $price;
1207	+ $custom_options[count($custom_options) - 1]['sku'] = $sku;
1208	+ $custom_options[count($custom_options) - 1]['file_extension'] = $file_extension;
1209	+ $custom_options[count($custom_options) - 1]['image_size_x'] = $image_size_x;
1210	+ $custom_options[count($custom_options) - 1]['image_size_y'] = $image_size_y;
1211	+ break;
1212	+
1213	+ case 'field':
1214	+ $custom_options[count($custom_options) - 1]['max_characters'] = $max_characters;
1215	+ case 'area':
1216	+ $custom_options[count($custom_options) - 1]['max_characters'] = $max_characters;
1217	+ /* NO BREAK */
1218	+
1219	+ case 'date':
1220	+ case 'date_time':
1221	+ case 'time':
1222	+ $custom_options[count($custom_options) - 1]['price_type'] = $price_type;
1223	+ $custom_options[count($custom_options) - 1]['price'] = $price;
1224	+ $custom_options[count($custom_options) - 1]['sku'] = $sku;
1225	+ break;
1226	+
1227	+ case 'drop_down':
1228	+ case 'radio':
1229	+ case 'checkbox':
1230	+ case 'multiple':
1231	+ default:
1232	+ $custom_options[count($custom_options) - 1]['values'][]=array(
1233	+ 'is_delete'=>0,
1234	+ 'title'=>$title,
1235	+ 'option_type_id'=>-1,
1236	+ 'price_type'=>$price_type,
1237	+ 'price'=>$price,
1238	+ 'sku'=>$sku,
1239	+ 'sort_order'=>$sort_order,
1240	+ 'max_characters'=>$max_characters,
1241	+ );
1242	+ break;
1243	+ }
1244	+ }
1245	+ }
1246	+ }
1247	+ /* END CUSTOM OPTION CODE */
1248	+ continue;
1249	+ }
1250	+
1251	+ $isArray = false;
1252	+ $setValue = $value;
1253	+
1254	+ if ( $attribute -> getFrontendInput() == 'multiselect' ) {
1255	+ $value = explode( self :: MULTI_DELIMITER, $value );
1256	+ $isArray = true;
1257	+ $setValue = array();
1258	+ }
1259	+
1260	+ if ( $value && $attribute -> getBackendType() == 'decimal' ) {
1261	+ //$setValue = $this -> getNumber( $value );
1262	+ $setValue = $value ;
1263	+ }
1264	+
1265	+ if ( $attribute -> usesSource() ) {
1266	+ $options = $attribute -> getSource() -> getAllOptions( false );
1267	+
1268	+ if ($isArray) {
1269	+ foreach ($options as $item) {
1270	+ if (in_array($item['label'], $value)) {
1271	+ $setValue[] = $item['value'];
1272	+ }
1273	+ }
1274	+ } else {
1275	+ $setValue = false;
1276	+ foreach ($options as $item) {
1277	+ if (is_array($item['value'])) {
1278	+ foreach ($item['value'] as $subValue) {
1279	+ if (isset($subValue['value']) && $subValue['value'] == $value) {
1280	+ $setValue = $value;
1281	+ }
1282	+ }
1283	+ } else if ($item['label'] == $value) {
1284	+ $setValue = $item['value'];
1285	+ }
1286	+ }
1287	+ }
1288	+ }
1289	+
1290	+ #$product -> setData( $field, $setValue );
1291	+ //FIX FOR WHEN IMAGES LOOSE RADIO BUTTON SETTINGS
1292	+ if($new \|\| $this->getBatchParams('reimport_images') == "true") {
1293	+ $product -> setData( $field, $setValue );
1294	+ } else {
1295	+ if (!in_array($field, array('image', 'thumbnail', 'small_image', 'gallery'))) {
1296	+ $product->setData($field, $setValue);
1297	+ }
1298	+ }
1299	+ }
1300	+
1301	+ if ( !$product -> getVisibility() ) {
1302	+ $product -> setVisibility( Mage_Catalog_Model_Product_Visibility :: VISIBILITY_NOT_VISIBLE );
1303	+ }
1304	+
1305	+ $stockData = array();
1306	+ $inventoryFields = isset($this->_inventoryFieldsProductTypes[$product->getTypeId()])
1307	+ ? $this->_inventoryFieldsProductTypes[$product->getTypeId()]
1308	+ : array();
1309	+
1310	+ foreach ( $inventoryFields as $field ) {
1311	+ if ( isset( $importData[$field] ) ) {
1312	+ if ( in_array( $field, $this -> _toNumber ) ) {
1313	+ //$stockData[$field] = $this -> getNumber( $importData[$field] );
1314	+ $stockData[$field] = $importData[$field] ;
1315	+ }
1316	+ else {
1317	+ $stockData[$field] = $importData[$field];
1318	+ }
1319	+ }
1320	+ }
1321	+ $product -> setStockData( $stockData );
1322	+
1323	+ if(!isset($importData["image"]))
1324	+ {
1325	+ $importData["image"] = '';
1326	+ }
1327	+ if(!isset($importData["small_image"]))
1328	+ {
1329	+ $importData["small_image"] = '';
1330	+ }
1331	+ if(!isset($importData["thumbnail"]))
1332	+ {
1333	+ $importData["thumbnail"] = '';
1334	+ }
1335	+
1336	+ if($new \|\| $this->getBatchParams('reimport_images') == "true") { //starts CHECK FOR IF REIMPORTING IMAGES TO PRODUCTS IS TRUE
1337	+ //this is a check if we want to delete all images before import of images from csv
1338	+ if($this->getBatchParams('deleteall_andreimport_images') == "true" && $importData["image"] != "" && $importData["small_image"] != "" && $importData["thumbnail"] != "") {
1339	+ $attributes = $product->getTypeInstance()->getSetAttributes();
1340	+ if (isset($attributes['media_gallery'])) {
1341	+ $gallery = $attributes['media_gallery'];
1342	+ //Get the images
1343	+ $galleryData = $product->getMediaGallery();
1344	+ if(!empty($galleryData)) {
1345	+ foreach($galleryData['images'] as $image){
1346	+ //If image exists
1347	+ if ($gallery->getBackend()->getImage($product, $image['file'])) {
1348	+ $gallery->getBackend()->removeImage($product, $image['file']);
1349	+ //if ( file_exists(Mage::getBaseDir('media') . DS . 'catalog' . DS . 'product' . $image['file'] ) ) {
1350	+ if ( file_exists( $image['file'] ) ) {
1351	+ $ext = substr(strrchr($image['file'], '.'), 1);
1352	+ //if( strlen( $ext ) == 3 ) { //maybe needs to be 3
1353	+ if( strlen( $ext ) == 4 ) {
1354	+ unlink (Mage::getBaseDir('media') . DS . 'catalog' . DS . 'product' . $image['file']);
1355	+ }
1356	+ }
1357	+ }
1358	+ }
1359	+ }
1360	+ }
1361	+ }
1362	+ if($importData["image"] != "" \|\| $importData["small_image"] != "" \|\| $importData["thumbnail"] != "" ) {
1363	+ $mediaGalleryBackendModel = $this->getAttribute('media_gallery')->getBackend();
1364	+
1365	+ $arrayToMassAdd = array();
1366	+
1367	+ foreach ($product->getMediaAttributes() as $mediaAttributeCode => $mediaAttribute) {
1368	+ if (isset($importData[$mediaAttributeCode])) {
1369	+ $file = $importData[$mediaAttributeCode];
1370	+ if(file_exists(Mage :: getBaseDir( 'media' ) . DS . 'import' . $file)){
1371	+ if (trim($file) && !$mediaGalleryBackendModel->getImage($product, $file)) {
1372	+ $arrayToMassAdd[] = array('file' => trim($file), 'mediaAttribute' => $mediaAttributeCode);
1373	+ }
1374	+ }
1375	+ }
1376	+ }
1377	+
1378	+ if($this->getBatchParams('exclude_images') == "true") {
1379	+ #$product -> addImageToMediaGallery( Mage :: getBaseDir( 'media' ) . DS . 'import/' . $file, $fields, false );
1380	+ $addedFilesCorrespondence = $mediaGalleryBackendModel->addImagesWithDifferentMediaAttributes($product, $arrayToMassAdd, Mage::getBaseDir('media') . DS . 'import', false);
1381	+ } else {
1382	+ #$product -> addImageToMediaGallery( Mage :: getBaseDir( 'media' ) . DS . 'import/' . $file, $fields, false, false );
1383	+ $addedFilesCorrespondence = $mediaGalleryBackendModel->addImagesWithDifferentMediaAttributes($product, $arrayToMassAdd, Mage::getBaseDir('media') . DS . 'import', false, false);
1384	+ }
1385	+
1386	+ foreach ($product->getMediaAttributes() as $mediaAttributeCode => $mediaAttribute) {
1387	+ $addedFile = '';
1388	+ if (isset($importData[$mediaAttributeCode . '_label'])) {
1389	+ $fileLabel = trim($importData[$mediaAttributeCode . '_label']);
1390	+ if (isset($importData[$mediaAttributeCode])) {
1391	+ $keyInAddedFile = array_search($importData[$mediaAttributeCode],
1392	+ $addedFilesCorrespondence['alreadyAddedFiles']);
1393	+ if ($keyInAddedFile !== false) {
1394	+ $addedFile = $addedFilesCorrespondence['alreadyAddedFilesNames'][$keyInAddedFile];
1395	+ }
1396	+ }
1397	+
1398	+ if (!$addedFile) {
1399	+ $addedFile = $product->getData($mediaAttributeCode);
1400	+ }
1401	+ if ($fileLabel && $addedFile) {
1402	+ $mediaGalleryBackendModel->updateImage($product, $addedFile, array('label' => $fileLabel));
1403	+ }
1404	+ }
1405	+ }
1406	+
1407	+ } //end check on empty values
1408	+
1409	+ if ( !empty( $importData['gallery'] ) ) {
1410	+ $galleryData = explode( ',', $importData["gallery"] );
1411	+ foreach( $galleryData as $gallery_img ) {
1412	+ try {
1413	+ //FIX STOPS INSERT OF DUPLICATE IMAGE INTO GALLERY FROM SMALL/MAIN/THUMB WHEN TRANSFERING FROM OLDER TO NEWER INSTALLS THIS COULD OCCUR
1414	+ #if(trim($gallery_img) != $importData["image"] \|\| trim($gallery_img) != $importData["small_image"] \|\| trim($gallery_img) != $importData["thumbnail"])
1415	+ #{
1416	+ if($this->getBatchParams('exclude_gallery_images') == "true") {
1417	+ $product -> addImageToMediaGallery( Mage :: getBaseDir( 'media' ) . DS . 'import' . $gallery_img, null, false, true );
1418	+ } else {
1419	+ $product -> addImageToMediaGallery( Mage :: getBaseDir( 'media' ) . DS . 'import' . $gallery_img, null, false, false );
1420	+ }
1421	+ #}
1422	+ }
1423	+ catch ( Exception $e ) {
1424	+ Mage::log(sprintf('failed to import gallery images: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1425	+ }
1426	+ }
1427	+ }
1428	+
1429	+
1430	+ #} // this ends check if enabled
1431	+ } // this else is for check for if we can reimport products
1432	+ $product -> setIsMassupdate( true );
1433	+ $product -> setExcludeUrlRewrite( true );
1434	+ //PATCH FOR Fatal error: Call to a member function getStoreId() on a non-object in D:\web\magento\app\code\core\Mage\Bundle\Model\Selection.php on line 52
1435	+ if (!Mage::registry('product')) {
1436	+ Mage::register('product', Mage::getModel('catalog/product')->setStoreId(0));
1437	+ //Mage::register('product', $product); maybe this is needed for when importing multi-store bundle vs above
1438	+ }
1439	+ $product -> save();
1440	+
1441	+ // Store affected products ids
1442	+ $this->_addAffectedEntityIds($product->getId());
1443	+
1444	+ if ( isset( $importData['product_tags'] ) && $importData['product_tags'] !="" ) {
1445	+
1446	+ #$configProductTags = $this->userCSVDataAsArray($importData['product_tags']);
1447	+ $configProductTags = explode(',', $importData['product_tags']);
1448	+
1449	+ #foreach ($commadelimiteddata as $dataseperated) {
1450	+ if(!empty($configProductTags)) {
1451	+ foreach ($configProductTags as $tagName) {
1452	+ try {
1453	+ $commadelimiteddata = explode(':',$tagName);
1454	+
1455	+ $tagName = $commadelimiteddata[1];
1456	+ $tagModel = Mage::getModel('tag/tag');
1457	+ $result = $tagModel->loadByName($tagName);
1458	+ #echo $result;
1459	+ #echo "PRODID: " . $product -> getIdBySku( $importData['sku'] ) . " Name: " . $tagName;
1460	+ $tagModel->setName($tagName)
1461	+ ->setStoreId($importData['store'])
1462	+ ->setStatus($tagModel->getApprovedStatus())
1463	+ ->save();
1464	+
1465	+ $tagRelationModel = Mage::getModel('tag/tag_relation');
1466	+ /$tagRelationModel->loadByTagCustomer($product -> getIdBySku( $importData['sku'] ), $tagModel->getId(), '13194', Mage::app()->getStore()->getId());/
1467	+ if(isset($importData['customerID'])) {
1468	+ if($importData['customerID'] != "NULL") {
1469	+ $tagRelationModel->setTagId($tagModel->getId())
1470	+ ->setCustomerId(trim($commadelimiteddata[0]))
1471	+ ->setProductId($product -> getIdBySku( $importData['sku'] ))
1472	+ ->setStoreId($importData['store'])
1473	+ ->setCreatedAt( now() )
1474	+ ->setActive(1)
1475	+ ->save();
1476	+ } else {
1477	+ #echo "HERE";
1478	+ $data['tag_id'] = $tagModel->getId();
1479	+ $data['name'] = trim($tagName);
1480	+ $data['status'] = $tagModel->getApprovedStatus();
1481	+ $data['first_customer_id'] = "0";
1482	+ $data['first_store_id'] = "0";
1483	+ $data['visible_in_store_ids'] = array();
1484	+ $data['store_id'] = "1";
1485	+ $data['base_popularity'] = (isset($importData['base_popularity'])) ? $importData['base_popularity'] : 0;
1486	+ $data['store'] = $importData['store'];
1487	+ $tagModel2 = Mage::getModel('tag/tag');
1488	+ $tagModel2->addData($data);
1489	+ $productIds[] = $product->getIdBySku($importData['sku']);
1490	+ #print_r($productIds);
1491	+ #print_r($tagModel2);
1492	+ $tagRelationModel2 = Mage::getModel('tag/tag_relation');
1493	+ $tagRelationModel2->addRelations($tagModel2, $productIds);
1494	+ $tagModel2->save();
1495	+ $tagModel2->aggregate();
1496	+ }
1497	+ } else {
1498	+ $data['tag_id'] = $tagModel->getId();
1499	+ $data['name'] = trim($tagName);
1500	+ $data['status'] = $tagModel->getApprovedStatus();
1501	+ $data['first_customer_id'] = "0";
1502	+ $data['first_store_id'] = "0";
1503	+ $data['visible_in_store_ids'] = array();
1504	+ $data['store_id'] = "1";
1505	+ $data['base_popularity'] = (isset($importData['base_popularity'])) ? $importData['base_popularity'] : 0;
1506	+ $data['store'] = $importData['store'];
1507	+ $tagModel2 = Mage::getModel('tag/tag');
1508	+ $tagModel2->addData($data);
1509	+ $productIds[] = $product->getIdBySku($importData['sku']);
1510	+ #print_r($productIds);
1511	+ #print_r($tagModel2);
1512	+ $tagRelationModel2 = Mage::getModel('tag/tag_relation');
1513	+ $tagRelationModel2->addRelations($tagModel2, $productIds);
1514	+ $tagModel2->save();
1515	+ $tagModel2->aggregate();
1516	+ }
1517	+ $tagModel->aggregate();
1518	+ }
1519	+ catch ( Exception $e ) {
1520	+ Mage::log(sprintf('failed to import product tags: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1521	+ }
1522	+ }
1523	+ }//check is array is not empty
1524	+ }
1525	+
1526	+
1527	+
1528	+ /* Add the custom options specified in the CSV import file */
1529	+ if(count($custom_options)) {
1530	+
1531	+ /* Remove existing custom options attached to the product */
1532	+ foreach ($product->getOptions() as $o) {
1533	+ $o->getValueInstance()->deleteValue($o->getId());
1534	+ $o->deletePrices($o->getId());
1535	+ $o->deleteTitles($o->getId());
1536	+ $o->delete();
1537	+ }
1538	+ foreach($custom_options as $option) {
1539	+ try {
1540	+ $opt = Mage::getModel('catalog/product_option');
1541	+ $opt->setProduct($product);
1542	+ $opt->addOption($option);
1543	+ $opt->saveOptions();
1544	+ }
1545	+ catch (Exception $e) {
1546	+ Mage::log(sprintf('failed to import custom options: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1547	+ }
1548	+ }
1549	+ }
1550	+
1551	+ if($iscustomoptions == "true") {
1552	+ ######### CUSTOM QUERY FIX FOR DISAPPEARING OPTIONS #################
1553	+ // fetch write database connection that is used in Mage_Core module
1554	+ /*
1555	+ if($currentproducttype == "simple") {
1556	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1557	+ $fixOptions = Mage::getSingleton('core/resource')->getConnection('core_write');
1558	+ // now $write is an instance of Zend_Db_Adapter_Abstract
1559	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET has_options = 1 WHERE type_id = 'simple' AND entity_id IN (SELECT distinct(product_id) FROM ".$prefix."catalog_product_option)");
1560	+
1561	+ } else if ($currentproducttype == "configurable") {
1562	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1563	+ $fixOptions = Mage::getSingleton('core/resource')->getConnection('core_write');
1564	+ // now $write is an instance of Zend_Db_Adapter_Abstract
1565	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET has_options = 1 WHERE type_id = 'configurable' AND entity_id IN (SELECT distinct(product_id) FROM ".$prefix."catalog_product_option)");
1566	+ }
1567	+ */
1568	+
1569	+ ######### CUSTOM QUERY FIX FOR DISAPPEARING OPTIONS #################
1570	+ // fetch write database connection that is used in Mage_Core module
1571	+ if($productId == "") {
1572	+ $productId = $product->getId();
1573	+ }
1574	+ if($currentproducttype == "simple") {
1575	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1576	+ $fixOptions = Mage::getSingleton('core/resource')->getConnection('core_write');
1577	+ // now $write is an instance of Zend_Db_Adapter_Abstract
1578	+ if($iscustomoptionsrequired == "true") {
1579	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET required_options = 1 WHERE has_options = 1 AND type_id = 'simple' AND entity_id = '".$productId."'");
1580	+ } else {
1581	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET has_options = 1 WHERE has_options = 0 AND type_id = 'simple' AND entity_id = '".$productId."'");
1582	+ }
1583	+ } else if ($currentproducttype == "configurable") {
1584	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1585	+ $fixOptions = Mage::getSingleton('core/resource')->getConnection('core_write');
1586	+ // now $write is an instance of Zend_Db_Adapter_Abstract
1587	+
1588	+ if($iscustomoptionsrequired == "true") {
1589	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET required_options = 1 WHERE has_options = 1 AND type_id = 'configurable' AND entity_id = '".$productId."'");
1590	+
1591	+ } else {
1592	+ $fixOptions->query("UPDATE ".$prefix."catalog_product_entity SET has_options = 1 WHERE has_options = 0 AND type_id = 'configurable' AND entity_id = '".$productId."'");
1593	+ }
1594	+ }
1595	+ }
1596	+
1597	+
1598	+
1599	+ /* DOWNLOADBLE PRODUCT FILE METHOD START */
1600	+ #print_r($filearrayforimport);
1601	+ if(isset($filearrayforimport)) {
1602	+ $filecounterinternall=1;
1603	+ foreach($filearrayforimport as $fileinfo) {
1604	+ $document_directory = Mage :: getBaseDir( 'media' ) . DS . 'import' . DS;
1605	+ $files = $fileinfo['file'];
1606	+ #echo "FILE: " . $fileinfo['file'];
1607	+ #echo "ID: " . $product->getId();
1608	+ $resource = Mage::getSingleton('core/resource');
1609	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1610	+ $write = $resource->getConnection('core_write');
1611	+ $read = $resource->getConnection('core_read');
1612	+ $select_qry =$read->query("SHOW TABLE STATUS LIKE '".$prefix."downloadable_link' ");
1613	+ $row = $select_qry->fetch();
1614	+ $next_id = $row['Auto_increment'];
1615	+
1616	+ $okvalueformodelID = $next_id - $filecounterinternall;
1617	+ #echo "next_id: " . $okvalueformodelID;
1618	+ $linkModel = Mage::getModel('downloadable/link')->load($okvalueformodelID);
1619	+
1620	+ $link_file = $document_directory . $files;
1621	+
1622	+ $file = realpath($link_file);
1623	+
1624	+ if (!$file \|\| !file_exists($file)) {
1625	+ Mage::throwException(Mage::helper('catalog')->__('Link file '.$file.' not exists'));
1626	+ }
1627	+ $pathinfo = pathinfo($file);
1628	+
1629	+
1630	+ $linkfile = Varien_File_Uploader::getCorrectFileName($pathinfo['basename']);
1631	+ $dispretionPath = Varien_File_Uploader::getDispretionPath($linkfile);
1632	+ $linkfile = $dispretionPath . DS . $linkfile;
1633	+
1634	+ $linkfile = $dispretionPath . DS
1635	+ . Varien_File_Uploader::getNewFileName(Mage_Downloadable_Model_Link::getBasePath().DS.$linkfile);
1636	+
1637	+ $ioAdapter = new Varien_Io_File();
1638	+ $ioAdapter->setAllowCreateFolders(true);
1639	+ $distanationDirectory = dirname(Mage_Downloadable_Model_Link::getBasePath().DS.$linkfile);
1640	+
1641	+
1642	+ try {
1643	+ $ioAdapter->open(array(
1644	+ 'path'=>$distanationDirectory
1645	+ ));
1646	+
1647	+ $ioAdapter->cp($file, Mage_Downloadable_Model_Link::getBasePath().DS.$linkfile);
1648	+ $ioAdapter->chmod(Mage_Downloadable_Model_Link::getBasePath().DS.$linkfile, 0777);
1649	+
1650	+ }
1651	+ catch (Exception $e) {
1652	+ Mage::throwException(Mage::helper('catalog')->__('Failed to move file: %s', $e->getMessage()));
1653	+ Mage::log(sprintf('failed to move file: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1654	+ }
1655	+
1656	+ $linkfile = str_replace(DS, '/', $linkfile);
1657	+
1658	+ #echo "SET: " . $linkfile;
1659	+ $linkModel->setLinkFile($linkfile);
1660	+ $linkModel->save();
1661	+
1662	+ $intesdf = $next_id - $filecounterinternall;
1663	+ $write->query("UPDATE `".$prefix."downloadable_link_title` SET title = \"".addslashes($fileinfo['name'])."\" WHERE link_id = '".$intesdf."'");
1664	+ $write->query("UPDATE `".$prefix."downloadable_link_price` SET price = '".$fileinfo['price']."' WHERE link_id = '".$intesdf."'");
1665	+ #$product->setLinksPurchasedSeparately(false);
1666	+ #$product->setLinksPurchasedSeparately(0);
1667	+ $filecounterinternall++;
1668	+ }
1669	+ }
1670	+ /* END DOWNLOADBLE METHOD */
1671	+
1672	+ /* SAMPLE FILE DOWNLOADBLE PRODUCT SAMPLE FILE METHOD START */
1673	+ #print_r($filenameforsamplearrayforimport);
1674	+ if(isset($filenameforsamplearrayforimport)) {
1675	+ $filecounterinternall=1;
1676	+ foreach($filenameforsamplearrayforimport as $fileinfo) {
1677	+ $document_directory = Mage :: getBaseDir( 'media' ) . DS . 'import';
1678	+ $samplefiles = $fileinfo['file'];
1679	+ #print_r($filenameforsamplearrayforimport);
1680	+ #echo "ID: " . $fileinfo['name'] ."<br/>";
1681	+ $resource = Mage::getSingleton('core/resource');
1682	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1683	+ $write = $resource->getConnection('core_write');
1684	+ $read = $resource->getConnection('core_read');
1685	+ $select_qry =$read->query("SHOW TABLE STATUS LIKE '".$prefix."downloadable_link' ");
1686	+ $row = $select_qry->fetch();
1687	+ $next_id = $row['Auto_increment'];
1688	+
1689	+ $okvalueformodelID = $next_id - $filecounterinternall;
1690	+ #echo "next_id: " . $okvalueformodelID."<br/>";
1691	+ $linkSampleModel = Mage::getModel('downloadable/link')->load($okvalueformodelID);
1692	+ $link_sample_file = $document_directory . $samplefiles;
1693	+
1694	+ $file = realpath($link_sample_file);
1695	+
1696	+ if (!$file \|\| !file_exists($file)) {
1697	+ Mage::throwException(Mage::helper('catalog')->__('Link sample file '.$file.' not exists'));
1698	+ Mage::log(sprintf('downloadable product sample file '.$file.' link does not exist: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1699	+ }
1700	+ $pathinfo = pathinfo($file);
1701	+ $linksamplefile = Varien_File_Uploader::getCorrectFileName($pathinfo['basename']);
1702	+ $dispretionPath = Varien_File_Uploader::getDispretionPath($linksamplefile);
1703	+ $linksamplefile = $dispretionPath . DS . $linksamplefile;
1704	+ $linksamplefile = $dispretionPath . DS . Varien_File_Uploader::getNewFileName(Mage_Downloadable_Model_Link::getBaseSamplePath().DS.$linksamplefile);
1705	+
1706	+ $ioAdapter = new Varien_Io_File();
1707	+ $ioAdapter->setAllowCreateFolders(true);
1708	+ $distanationDirectory = dirname(Mage_Downloadable_Model_Link::getBaseSamplePath().DS.$linksamplefile);
1709	+
1710	+ try {
1711	+ $ioAdapter->open(array(
1712	+ 'path'=>$distanationDirectory
1713	+ ));
1714	+
1715	+ $ioAdapter->cp($file, Mage_Downloadable_Model_Link::getBaseSamplePath().$linksamplefile);
1716	+ $ioAdapter->chmod(Mage_Downloadable_Model_Link::getBaseSamplePath().$linksamplefile, 0777);
1717	+
1718	+ }
1719	+ catch (Exception $e) {
1720	+ Mage::throwException(Mage::helper('catalog')->__('Failed to move sample file: %s', $e->getMessage()));
1721	+ Mage::log(sprintf('Failed to move sample file: %s', $e->getMessage()), null,'ce_product_import_export_errors.log');
1722	+ }
1723	+
1724	+ $linksamplefile = str_replace(DS, '/', $linksamplefile);
1725	+ $linkSampleModel->setSampleFile($linksamplefile);
1726	+ $linkSampleModel->save();
1727	+
1728	+ #$intesdf = $next_id-1;
1729	+ $intesdf = $next_id - $filecounterinternall;
1730	+ $write->query("UPDATE `".$prefix."downloadable_link_title` SET title = \"".addslashes($fileinfo['name'])."\" WHERE link_id = '".$intesdf."'");
1731	+ $write->query("UPDATE `".$prefix."downloadable_link_price` SET price = '".$fileinfo['price']."' WHERE link_id = '".$intesdf."'");
1732	+ $filecounterinternall++;
1733	+ }
1734	+ }
1735	+ /* END SAMPLE FILE DOWNLOADBLE METHOD */
1736	+ /* START OF SUPER ATTRIBUTE PRICING */
1737	+
1738	+
1739	+ if ($finalsuperattributetype == 'configurable') {
1740	+ if ($finalsuperattributepricing != "") {
1741	+
1742	+ $adapter = Mage::getSingleton('core/resource')->getConnection('core_write');
1743	+ $read = Mage::getSingleton('core/resource')->getConnection('core_read');
1744	+ $superProduct = Mage :: getModel ( 'catalog/product' )-> load ( $product -> getId ());
1745	+ $superArray = $superProduct -> getTypeInstance ()-> getConfigurableAttributesAsArray ();
1746	+
1747	+ #print_r($superArray);
1748	+
1749	+ $SuperAttributePricingData = array();
1750	+ $FinalSuperAttributeData = array();
1751	+ $SuperAttributePricingData = explode('\|',$finalsuperattributepricing);
1752	+
1753	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1754	+ foreach( $superArray AS $key => $val ) {
1755	+ #$x = 0 ;
1756	+ foreach( $val[ 'values' ] AS $keyValues => $valValues ) {
1757	+
1758	+
1759	+ foreach($SuperAttributePricingData as $singleattributeData) {
1760	+ $FinalSuperAttributeData = explode(':',$singleattributeData);
1761	+
1762	+ if($FinalSuperAttributeData[0] == $superArray[$key][ 'values' ][$keyValues][ 'label' ]) {
1763	+ if($new) {
1764	+ $insertPrice='INSERT into '.$prefix.'catalog_product_super_attribute_pricing (product_super_attribute_id, value_index, is_percent, pricing_value) VALUES
1765	+ ("'.$superArray[$key][ 'values' ][$keyValues][ 'product_super_attribute_id' ].'", "'.$superArray[$key][ 'values' ][$keyValues][ 'value_index' ].'", "'.$FinalSuperAttributeData[2].'", "'.$FinalSuperAttributeData[1].'");';
1766	+ #echo "SQL2: " . $insertPrice;
1767	+ $adapter->query($insertPrice);
1768	+ } else {
1769	+ if($FinalSuperAttributeData[1] != "") {
1770	+
1771	+
1772	+ $finalpriceforupdate = $FinalSuperAttributeData[1];
1773	+
1774	+ $select_qry2 = $read->query("SELECT value_id FROM ".$prefix."catalog_product_super_attribute_pricing WHERE product_super_attribute_id = '".$superArray[$key][ 'values' ][$keyValues][ 'product_super_attribute_id' ]."' AND value_index = '".$superArray[$key][ 'values' ][$keyValues][ 'value_index' ]."'");
1775	+ $newrowItemId2 = $select_qry2->fetch();
1776	+ $db_product_id = $newrowItemId2['value_id'];
1777	+ if($db_product_id == "") {
1778	+ $insertPrice='INSERT into '.$prefix.'catalog_product_super_attribute_pricing (product_super_attribute_id, value_index, is_percent, pricing_value) VALUES
1779	+ ("'.$superArray[$key][ 'values' ][$keyValues][ 'product_super_attribute_id' ].'", "'.$superArray[$key][ 'values' ][$keyValues][ 'value_index' ].'", "'.$FinalSuperAttributeData[2].'", "'.$FinalSuperAttributeData[1].'");';
1780	+ #echo "SQL2: " . $insertPrice;
1781	+ $adapter->query($insertPrice);
1782	+
1783	+ } else {
1784	+ $updatePrice="UPDATE ".$prefix."catalog_product_super_attribute_pricing SET pricing_value = '".$finalpriceforupdate."' WHERE value_id = '".$db_product_id."'";
1785	+ #echo "SQL UPDATE: " . $updatePrice;
1786	+ $adapter->query($updatePrice);
1787	+ }
1788	+ }
1789	+
1790	+
1791	+ }
1792	+ }
1793	+ }
1794	+ }
1795	+ }
1796	+ }
1797	+ }
1798	+ /* END OF SUPER ATTRIBUTE PRICING */
1799	+ /* START OF GROUPED POSITION */
1800	+ if ($finalsuperattributetype == 'grouped') {
1801	+ #print_r($finalIDssthatneedtobeconvertedto);
1802	+ foreach($finalIDssthatneedtobeconvertedto as $data_product_position_id)
1803	+ {
1804	+ $resource = Mage::getSingleton('core/resource');
1805	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1806	+ $read = $resource->getConnection('core_read');
1807	+ $write = $resource->getConnection('core_write');
1808	+ $data_productID = ( int )$product -> getIdBySku( $data_product_position_id['sku'] );
1809	+ #$data_productID = (int)$product->getId();
1810	+
1811	+ $select_qry3 = $read->query("SELECT link_type_id FROM ".$prefix."catalog_product_link_type WHERE code = 'super'");
1812	+ $newrowItemId3 = $select_qry3->fetch();
1813	+ $link_type_id = $newrowItemId3['link_type_id'];
1814	+
1815	+ $select_qry_catalog_product_link = "SELECT link_id FROM ".$prefix."catalog_product_link WHERE linked_product_id = '" . trim($data_productID) . "' AND link_type_id = '".$link_type_id."'";
1816	+
1817	+ #echo "T: SELECT link_id FROM ".$prefix."catalog_product_link WHERE linked_product_id= '". trim($data_productID) . "'";
1818	+ $catalog_product_link_rows = $read->fetchAll($select_qry_catalog_product_link);
1819	+ foreach($catalog_product_link_rows as $data_catalog_product_link)
1820	+ {
1821	+ $write->query("UPDATE ".$prefix."catalog_product_link_attribute_int SET value = '" . $data_product_position_id['position'] . "' WHERE link_id = '". $data_catalog_product_link['link_id'] . "'");
1822	+
1823	+ $select_qry2 = $read->query("SELECT value_id FROM ".$prefix."catalog_product_link_attribute_decimal WHERE link_id = '".$data_catalog_product_link['link_id']."'");
1824	+
1825	+ $select_qry4 = $read->query("SELECT product_link_attribute_id FROM ".$prefix."catalog_product_link_attribute WHERE product_link_attribute_code = 'qty' AND link_type_id = '".$link_type_id."'");
1826	+
1827	+ $newrowItemId2 = $select_qry2->fetch();
1828	+ $newrowItemId4 = $select_qry4->fetch();
1829	+
1830	+ $db_product_id = $newrowItemId2['value_id'];
1831	+ $product_link_attribute_id = $newrowItemId4['product_link_attribute_id'];
1832	+
1833	+ $adapter = Mage::getSingleton('core/resource')->getConnection('core_write');
1834	+ $read = Mage::getSingleton('core/resource')->getConnection('core_read');
1835	+
1836	+ if(isset($data_product_position_id['qty'])) {
1837	+ if($db_product_id == "") {
1838	+ $insertPrice='INSERT into '.$prefix.'catalog_product_link_attribute_decimal (product_link_attribute_id, link_id, value) VALUES
1839	+ ("'.$product_link_attribute_id.'", "'.$data_catalog_product_link['link_id'].'", "'.$data_product_position_id['qty'].'");';
1840	+ #echo "SQL2: " . $insertPrice;
1841	+ $adapter->query($insertPrice);
1842	+
1843	+ } else {
1844	+ $updatePrice="UPDATE ".$prefix."catalog_product_link_attribute_decimal SET value = '" . $data_product_position_id['qty'] . "' WHERE link_id = '". $data_catalog_product_link['link_id'] . "'";
1845	+ #echo "SQL UPDATE: " . $updatePrice;
1846	+ $adapter->query($updatePrice);
1847	+ }
1848	+ }
1849	+ }
1850	+ }
1851	+ }
1852	+ /* END OF GROUPED POSITION */
1853	+ /* START OF GROUPED PRICINGPRICING 1.7.x beta rc1 */
1854	+ #if ($finalsuperattributetype == 'grouped') {
1855	+ if ($finalgroup_price_price != "") {
1856	+ $resource = Mage::getSingleton('core/resource');
1857	+ $adapter = Mage::getSingleton('core/resource')->getConnection('core_write');
1858	+ $read = Mage::getSingleton('core/resource')->getConnection('core_read');
1859	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1860	+
1861	+ if($this->getBatchParams('append_group_prices') != "true") {
1862	+ //delete existing group prices
1863	+ $select_qry2 = $read->query("DELETE FROM ".$resource->getTableName('catalog/product_attribute_group_price')." WHERE entity_id = '".$product->getId()."'");
1864	+ }
1865	+ $groupedProductModel = Mage::getModel('catalog/product')->load($product->getId());
1866	+ if($finalgroup_price_price != "delete") {
1867	+ $group_price_priceData = explode('\|',$finalgroup_price_price);
1868	+
1869	+ foreach($group_price_priceData as $singleattributeData) {
1870	+ $FinalGroupedPriceData = explode('=',$singleattributeData);
1871	+
1872	+ if($FinalGroupedPriceData[0] != "") {
1873	+ if($new) {
1874	+ #echo "SQL2: ";
1875	+ $insertPrice='INSERT into '.$resource->getTableName('catalog/product_attribute_group_price').' (entity_id,all_groups,customer_group_id,value,website_id) VALUES ("'.$product->getId().'","0","'.$FinalGroupedPriceData[0].'","'.$FinalGroupedPriceData[1].'","0");';
1876	+ $adapter->query($insertPrice);
1877	+
1878	+ } else {
1879	+ #echo "SQL UPDATE: " . $updatePrice;
1880	+ $select_qry2 = $read->query("SELECT value_id FROM ".$resource->getTableName('catalog/product_attribute_group_price')." WHERE value = '".$FinalGroupedPriceData[1]."' AND customer_group_id = '".$FinalGroupedPriceData[0]."' AND entity_id = '".$product->getId()."'");
1881	+ $newrowItemId2 = $select_qry2->fetch();
1882	+ $db_product_id = $newrowItemId2['value_id'];
1883	+ if($db_product_id == "") {
1884	+ $insertPrice='INSERT into '.$resource->getTableName('catalog/product_attribute_group_price').' (entity_id,all_groups,customer_group_id,value,website_id) VALUES ("'.$product->getId().'","0","'.$FinalGroupedPriceData[0].'","'.$FinalGroupedPriceData[1].'","0");';
1885	+ #echo "INSERT SQL2: " . $insertPrice;
1886	+ $adapter->query($insertPrice);
1887	+
1888	+ } else {
1889	+ #echo "VALUE ID: " . $db_product_id;
1890	+ #echo "SQL UPDATE2: ";
1891	+
1892	+ $updatePrice="UPDATE ".$resource->getTableName('catalog/product_attribute_group_price')." SET customer_group_id = '".$FinalGroupedPriceData[0]."', value = '".$FinalGroupedPriceData[1]."' WHERE value_id = '".$db_product_id."'";
1893	+ $adapter->query($updatePrice);
1894	+ }
1895	+ }
1896	+ }
1897	+ }
1898	+ }
1899	+ }
1900	+ #}
1901	+ /* END OF GROUPED PRICING PRICING */
1902	+ /* ADDED FIX FOR IMAGE LABELS */
1903	+
1904	+ if(isset($imagelabeldataforimport)) {
1905	+
1906	+ #echo "PROD ID: " . $product->getId() . "<br/>";
1907	+ #echo "LABELS: " . $imagelabeldataforimport . "<br/>";
1908	+ $resource = Mage::getSingleton('core/resource');
1909	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1910	+ $prefixlabels = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1911	+ $readlabels = $resource->getConnection('core_read');
1912	+ $writelabels = $resource->getConnection('core_write');
1913	+ $select_qry_labels =$readlabels->query("SELECT value_id FROM ".$prefixlabels."catalog_product_entity_media_gallery WHERE entity_id = '". $product->getId() ."'");
1914	+ $row_labels = $select_qry_labels->fetch();
1915	+ $value_id = $row_labels['value_id'];
1916	+ // now $write label to db
1917	+ $writelabels->query("UPDATE ".$prefix."catalog_product_entity_media_gallery_value SET label = '".$imagelabeldataforimport."' WHERE value_id = '".$value_id."'");
1918	+ //this is for if you have flat product catalog enabled.. need to write values to both places
1919	+ #$writelabels->query("UPDATE ".$prefix."catalog_product_flat_1 SET image_label = '".$imagelabeldataforimport."' WHERE entity_id = '". $product->getId() ."'");
1920	+ #$writelabels->query("UPDATE ".$prefix."catalog_product_flat_1 SET image_label = '".$imagelabeldataforimport."' WHERE entity_id = '". $product->getId() ."'");
1921	+ #SELECT attribute_id FROM ".$prefixlabels."eav_attribute WHERE attribute_code = 'image_label';
1922	+ #$writelabels->query("UPDATE ".$prefix."catalog_product_entity_varchar SET value = '".$imagelabeldataforimport."' WHERE entity_id = '". $product->getId() ."' AND attribute_id = 101");
1923	+
1924	+ }
1925	+ if(isset($smallimagelabeldataforimport)) {
1926	+
1927	+ #echo "PROD ID: " . $product->getId() . "<br/>";
1928	+ #echo "LABELS: " . $smallimagelabeldataforimport . "<br/>";
1929	+ $resource = Mage::getSingleton('core/resource');
1930	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1931	+ $prefixlabels = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1932	+ $readlabels = $resource->getConnection('core_read');
1933	+ $writelabels = $resource->getConnection('core_write');
1934	+ $select_qry_labels =$readlabels->query("SELECT value_id FROM ".$prefixlabels."catalog_product_entity_media_gallery WHERE entity_id = '". $product->getId() ."'");
1935	+ $row_labels = $select_qry_labels->fetch();
1936	+ $value_id = $row_labels['value_id']+1;
1937	+ // now $write label to db
1938	+ $writelabels->query("UPDATE ".$prefix."catalog_product_entity_media_gallery_value SET label = '".$smallimagelabeldataforimport."' WHERE value_id = '".$value_id."'");
1939	+
1940	+ }
1941	+ if(isset($thumbnailimagelabeldataforimport)) {
1942	+
1943	+ #echo "PROD ID: " . $product->getId() . "<br/>";
1944	+ #echo "LABELS: " . $smallimagelabeldataforimport . "<br/>";
1945	+ $resource = Mage::getSingleton('core/resource');
1946	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1947	+ $prefixlabels = Mage::getConfig()->getNode('global/resources/db/table_prefix');
1948	+ $readlabels = $resource->getConnection('core_read');
1949	+ $writelabels = $resource->getConnection('core_write');
1950	+ $select_qry_labels =$readlabels->query("SELECT value_id FROM ".$prefixlabels."catalog_product_entity_media_gallery WHERE entity_id = '". $product->getId() ."'");
1951	+ $row_labels = $select_qry_labels->fetch();
1952	+ $value_id = $row_labels['value_id']+2;
1953	+ // now $write label to db
1954	+ $writelabels->query("UPDATE ".$prefix."catalog_product_entity_media_gallery_value SET label = '".$thumbnailimagelabeldataforimport."' WHERE value_id = '".$value_id."'");
1955	+
1956	+ }
1957	+
1958	+ /* END FIX FOR IMAGE LABLES */
1959	+ return true;
1960	+ }
1961	+ /**
1962	+ * Edit tier prices
1963	+ *
1964	+ * Uses a pipe-delimited string of qty:price to set tiers for the product row and appends.
1965	+ * Removes if REMOVE is present.
1966	+ *
1967	+ * @todo Prevent duplicate tiers (by qty) being set
1968	+ * @internal Magento will save duplicate tiers; no enforcing unique tiers by qty, so we have to do this manually
1969	+ * @param Mage_Catalog_Model_Product $product Current product row
1970	+ * @param string $tier_prices_field Pipe-separated in the form of qty:price (e.g. 0=250=12.75\|0=500=12.00)
1971	+ */
1972	+ private function _editTierPrices(&$product, $tier_prices_field = false, $store)
1973	+ {
1974	+ if (($tier_prices_field) && !empty($tier_prices_field)) {
1975	+
1976	+ if(trim($tier_prices_field) == 'REMOVE'){
1977	+
1978	+ $product->setTierPrice(array());
1979	+
1980	+ } else {
1981	+
1982	+
1983	+ if($this->getBatchParams('append_tier_prices') == "true") {
1984	+ //get current product tier prices
1985	+ $existing_tps = $product->getTierPrice();
1986	+ } else {
1987	+ $existing_tps = array();
1988	+ }
1989	+
1990	+ $etp_lookup = array();
1991	+ //make a lookup array to prevent dup tiers by qty
1992	+ foreach($existing_tps as $key => $etp){
1993	+ $etp_lookup[intval($etp['price_qty'])] = $key;
1994	+ }
1995	+
1996	+ //parse incoming tier prices string
1997	+ $incoming_tierps = explode('\|',$tier_prices_field);
1998	+ $tps_toAdd = array();
1999	+ $tierpricecount=0;
2000	+ foreach($incoming_tierps as $tier_str){
2001	+ //echo "t: " . $tier_str;
2002	+ if (empty($tier_str)) continue;
2003	+
2004	+ $tmp = array();
2005	+ $tmp = explode('=',$tier_str);
2006	+
2007	+ if ($tmp[1] == 0 && $tmp[2] == 0) continue;
2008	+ //echo ('adding tier');
2009	+ //print_r($tmp);
2010	+ $tps_toAdd[$tierpricecount] = array(
2011	+ 'website_id' => 0, // !!!! this is hard-coded for now
2012	+ #'website_id' => $tmp[0], // !!!! this is hard-coded for now
2013	+ #'website_id' => $store->getWebsiteId(),
2014	+ 'cust_group' => $tmp[0], // !!! so is this
2015	+ 'price_qty' => $tmp[1],
2016	+ 'price' => $tmp[2],
2017	+ 'delete' => ''
2018	+ );
2019	+
2020	+ //drop any existing tier values by qty
2021	+ if(isset($etp_lookup[intval($tmp[1])])){
2022	+ unset($existing_tps[$etp_lookup[intval($tmp[1])]]);
2023	+ }
2024	+ $tierpricecount++;
2025	+ }
2026	+
2027	+ //combine array
2028	+ $tps_toAdd = array_merge($existing_tps, $tps_toAdd);
2029	+
2030	+ //print_r($tps_toAdd);
2031	+ //save it
2032	+ $product->setTierPrice($tps_toAdd);
2033	+ }
2034	+
2035	+ }
2036	+ }
2037	+
2038	+
2039	+ protected function userCSVDataAsArray( $data )
2040	+ {
2041	+ return explode( ',', str_replace( " ", " ", $data ) );
2042	+ }
2043	+
2044	+ protected function skusToIds( $userData, $product )
2045	+ {
2046	+ $productIds = array();
2047	+ foreach ( $this -> userCSVDataAsArray( $userData ) as $oneSku ) {
2048	+ if ( ( $a_sku = ( int )$product -> getIdBySku( $oneSku ) ) > 0 ) {
2049	+ parse_str( "position=", $productIds[$a_sku] );
2050	+ }
2051	+ }
2052	+ return $productIds;
2053	+ }
2054	+
2055	+
2056	+ protected function skusToIdswithPosition( $userData, $product )
2057	+ {
2058	+
2059	+ $productIds = array();
2060	+ foreach ( $this -> userCSVDataAsArray( $userData ) as $oneSku ) {
2061	+ $oneSkuexploded = explode(':', $oneSku);
2062	+ if($oneSkuexploded[0] !="" && $oneSkuexploded[1] !="") {
2063	+ $final_position_value = $oneSkuexploded[0];
2064	+ } else {
2065	+ $final_position_value = "";
2066	+ }
2067	+ if($oneSkuexploded[1] !="") {
2068	+ $final_sku_value = $oneSkuexploded[1];
2069	+ } else {
2070	+ $final_sku_value = $oneSku;
2071	+ }
2072	+ if ( ( $a_sku = ( int )$product -> getIdBySku( $final_sku_value ) ) > 0 ) {
2073	+ parse_str( "position=".$final_position_value."", $productIds[$a_sku] );
2074	+ }
2075	+ }
2076	+ return $productIds;
2077	+ }
2078	+ protected $_categoryCache = array();
2079	+ protected function _addCategories($categories, $store)
2080	+ {
2081	+ // $rootId = $store->getRootCategoryId();
2082	+ // $rootId = Mage::app()->getStore()->getRootCategoryId();
2083	+ //$rootId = 2; // our store's root category id
2084	+ $delimitertouse = $this->getBatchParams('categorydelimiter');
2085	+ if($this->getBatchParams('root_catalog_id') != "") {
2086	+ $rootId = $this->getBatchParams('root_catalog_id');
2087	+ } else {
2088	+ $rootId = 2;
2089	+ }
2090	+ if (!$rootId) {
2091	+ return array();
2092	+ }
2093	+ $rootPath = '1/'.$rootId;
2094	+ if (empty($this->_categoryCache[$store->getId()])) {
2095	+ $collection = Mage::getModel('catalog/category')->getCollection()
2096	+ ->setStore($store)
2097	+ ->addAttributeToSelect('name');
2098	+ $collection->getSelect()->where("path like '".$rootPath."/%'");
2099	+
2100	+ foreach ($collection as $cat) {
2101	+ $pathArr = explode('/', $cat->getPath());
2102	+ $namePath = '';
2103	+ for ($i=2, $l=sizeof($pathArr); $i<$l; $i++) {
2104	+ //if(!is_null($collection->getItemById($pathArr[$i]))) { }
2105	+ $name = $collection->getItemById($pathArr[$i])->getName();
2106	+ $namePath .= (empty($namePath) ? '' : '/').trim($name);
2107	+ }
2108	+ $cat->setNamePath($namePath);
2109	+ }
2110	+
2111	+ $cache = array();
2112	+ foreach ($collection as $cat) {
2113	+ $cache[strtolower($cat->getNamePath())] = $cat;
2114	+ $cat->unsNamePath();
2115	+ }
2116	+ $this->_categoryCache[$store->getId()] = $cache;
2117	+ }
2118	+ $cache =& $this->_categoryCache[$store->getId()];
2119	+
2120	+ $catIds = array();
2121	+ //->setIsAnchor(1)
2122	+ //Delimiter is ' , ' so people can use ', ' in multiple categorynames
2123	+ $cat_details = explode(' , ', $categories);
2124	+ foreach ($cat_details as $categoryPathStr) {
2125	+ //Remove this line if your using ^ vs / as delimiter for categories.. fix for cat names with / in them
2126	+ $categoryPathStr = preg_replace('#\s/\s#', '/', trim($categoryPathStr));
2127	+ if (!empty($cache[$categoryPathStr])) {
2128	+ $catIds[] = $cache[$categoryPathStr]->getId();
2129	+ continue;
2130	+ }
2131	+ $path = $rootPath;
2132	+ $namePath = '';
2133	+ #foreach (explode($delimitertouse, $categoryPathStr) as $catName) {
2134	+ $catPathStr = explode('/', $categoryPathStr);
2135	+ foreach ($catPathStr as $catName) {
2136	+ $namePath .= (empty($namePath) ? '' : '/').strtolower($catName);
2137	+ if (empty($cache[$namePath])) {
2138	+ $cat = Mage::getModel('catalog/category')
2139	+ ->setStoreId($store->getId())
2140	+ ->setPath($path)
2141	+ ->setName($catName)
2142	+ ->setIsActive(1)
2143	+ ->save();
2144	+ $cache[$namePath] = $cat;
2145	+ }
2146	+ $catId = $cache[$namePath]->getId();
2147	+ $path .= '/'.$catId;
2148	+ }
2149	+ if ($catId) {
2150	+ $catIds[] = $catId;
2151	+ }
2152	+ }
2153	+ return join(',', $catIds);
2154	+ }
2155	+
2156	+ protected function _removeFile( $file )
2157	+ {
2158	+ if ( file_exists( $file ) ) {
2159	+ $ext = substr(strrchr($file, '.'), 1);
2160	+ if( strlen( $ext ) == 4 ) {
2161	+ if ( unlink( $file ) ) {
2162	+ return true;
2163	+ }
2164	+ }
2165	+ }
2166	+ return false;
2167	+ }
2168	+ }

app/code/community/PI/Oopsprofile/Model/Product/Convert/Parser/Product.php ADDED Viewed

	@@ -0,0 +1,864 @@


1	+ <?php
2	+
3	+
4	+ class PI_Oopsprofile_Model_Product_Convert_Parser_Product
5	+ extends Mage_Eav_Model_Convert_Parser_Abstract
6	+ {
7	+ const MULTI_DELIMITER = ' , ';
8	+ protected $_resource;
9	+
10	+ /**
11	+ * Product collections per store
12	+ *
13	+ * @var array
14	+ */
15	+ protected $_collections;
16	+
17	+ protected $_productTypes = array(
18	+ 'simple'=>'Simple',
19	+ 'bundle'=>'Bundle',
20	+ 'configurable'=>'Configurable',
21	+ 'grouped'=>'Grouped',
22	+ 'virtual'=>'Virtual',
23	+ );
24	+
25	+ protected $_inventoryFields = array();
26	+
27	+ protected $_imageFields = array();
28	+
29	+ protected $_systemFields = array();
30	+ protected $_internalFields = array();
31	+ protected $_externalFields = array();
32	+
33	+ protected $_inventoryItems = array();
34	+
35	+ protected $_productModel;
36	+
37	+ protected $_setInstances = array();
38	+
39	+ protected $_store;
40	+ protected $_storeId;
41	+ protected $_attributes = array();
42	+
43	+ public function __construct()
44	+ {
45	+ foreach (Mage::getConfig()->getFieldset('catalog_product_dataflow', 'admin') as $code=>$node) {
46	+ if ($node->is('inventory')) {
47	+ $this->_inventoryFields[] = $code;
48	+ if ($node->is('use_config')) {
49	+ $this->_inventoryFields[] = 'use_config_'.$code;
50	+ }
51	+ }
52	+ if ($node->is('internal')) {
53	+ $this->_internalFields[] = $code;
54	+ }
55	+ if ($node->is('system')) {
56	+ $this->_systemFields[] = $code;
57	+ }
58	+ if ($node->is('external')) {
59	+ $this->_externalFields[$code] = $code;
60	+ }
61	+ if ($node->is('img')) {
62	+ $this->_imageFields[] = $code;
63	+ }
64	+ }
65	+ }
66	+
67	+ /**
68	+ * @return Mage_Catalog_Model_Mysql4_Convert
69	+ */
70	+ public function getResource()
71	+ {
72	+ if (!$this->_resource) {
73	+ $this->_resource = Mage::getResourceSingleton('catalog_entity/convert');
74	+ #->loadStores()
75	+ #->loadProducts()
76	+ #->loadAttributeSets()
77	+ #->loadAttributeOptions();
78	+ }
79	+ return $this->_resource;
80	+ }
81	+
82	+ public function getCollection($storeId)
83	+ {
84	+ if (!isset($this->_collections[$storeId])) {
85	+ $this->_collections[$storeId] = Mage::getResourceModel('catalog/product_collection');
86	+ $this->_collections[$storeId]->getEntity()->setStore($storeId);
87	+ }
88	+ return $this->_collections[$storeId];
89	+ }
90	+
91	+ /**
92	+ * Retrieve product type options
93	+ *
94	+ * @return array
95	+ */
96	+ public function getProductTypes()
97	+ {
98	+ if (is_null($this->_productTypes)) {
99	+ $this->_productTypes = Mage::getSingleton('catalog/product_type')
100	+ ->getOptionArray();
101	+ }
102	+ return $this->_productTypes;
103	+ }
104	+
105	+ /**
106	+ * Retrieve Product type name by code
107	+ *
108	+ * @param string $code
109	+ * @return string
110	+ */
111	+ public function getProductTypeName($code)
112	+ {
113	+ $productTypes = $this->getProductTypes();
114	+ if (isset($productTypes[$code])) {
115	+ return $productTypes[$code];
116	+ }
117	+ return false;
118	+ }
119	+
120	+ /**
121	+ * Retrieve product type code by name
122	+ *
123	+ * @param string $name
124	+ * @return string
125	+ */
126	+ public function getProductTypeId($name)
127	+ {
128	+ $productTypes = $this->getProductTypes();
129	+ if ($code = array_search($name, $productTypes)) {
130	+ return $code;
131	+ }
132	+ return false;
133	+ }
134	+
135	+ /**
136	+ * Retrieve product model cache
137	+ *
138	+ * @return Mage_Catalog_Model_Product
139	+ */
140	+ public function getProductModel()
141	+ {
142	+ if (is_null($this->_productModel)) {
143	+ $productModel = Mage::getModel('catalog/product');
144	+ $this->_productModel = Mage::objects()->save($productModel);
145	+ }
146	+ return Mage::objects()->load($this->_productModel);
147	+ }
148	+
149	+ /**
150	+ * Retrieve current store model
151	+ *
152	+ * @return Mage_Core_Model_Store
153	+ */
154	+ public function getStore()
155	+ {
156	+ if (is_null($this->_store)) {
157	+ try {
158	+ $store = Mage::app()->getStore($this->getVar('store'));
159	+ }
160	+ catch (Exception $e) {
161	+ $this->addException(Mage::helper('catalog')->__('Invalid store specified'), Varien_Convert_Exception::FATAL);
162	+ throw $e;
163	+ }
164	+ $this->_store = $store;
165	+ }
166	+ return $this->_store;
167	+ }
168	+
169	+ /**
170	+ * Retrieve store ID
171	+ *
172	+ * @return int
173	+ */
174	+ public function getStoreId()
175	+ {
176	+ if (is_null($this->_storeId)) {
177	+ $this->_storeId = $this->getStore()->getId();
178	+ }
179	+ return $this->_storeId;
180	+ }
181	+
182	+ /**
183	+ * ReDefine Product Type Instance to Product
184	+ *
185	+ * @param Mage_Catalog_Model_Product $product
186	+ * @return Mage_Catalog_Model_Convert_Adapter_Product
187	+ */
188	+ public function setProductTypeInstance(Mage_Catalog_Model_Product $product)
189	+ {
190	+ $type = $product->getTypeId();
191	+ if (!isset($this->_productTypeInstances[$type])) {
192	+ $this->_productTypeInstances[$type] = Mage::getSingleton('catalog/product_type')
193	+ ->factory($product, true);
194	+ }
195	+ $product->setTypeInstance($this->_productTypeInstances[$type], true);
196	+ return $this;
197	+ }
198	+
199	+ public function getAttributeSetInstance()
200	+ {
201	+ $productType = $this->getProductModel()->getType();
202	+ $attributeSetId = $this->getProductModel()->getAttributeSetId();
203	+
204	+ if (!isset($this->_setInstances[$productType][$attributeSetId])) {
205	+ $this->_setInstances[$productType][$attributeSetId] =
206	+ Mage::getSingleton('catalog/product_type')->factory($this->getProductModel());
207	+ }
208	+
209	+ return $this->_setInstances[$productType][$attributeSetId];
210	+ }
211	+
212	+ /**
213	+ * Retrieve eav entity attribute model
214	+ *
215	+ * @param string $code
216	+ * @return Mage_Eav_Model_Entity_Attribute
217	+ */
218	+ public function getAttribute($code)
219	+ {
220	+ if (!isset($this->_attributes[$code])) {
221	+ $this->_attributes[$code] = $this->getProductModel()->getResource()->getAttribute($code);
222	+ }
223	+ return $this->_attributes[$code];
224	+ }
225	+
226	+ /**
227	+ * @deprecated not used anymore
228	+ */
229	+ public function parse()
230	+ {
231	+ $data = $this->getData();
232	+
233	+ $entityTypeId = Mage::getSingleton('eav/config')->getEntityType('catalog_product')->getId();
234	+
235	+ $result = array();
236	+ $inventoryFields = array();
237	+ foreach ($data as $i=>$row) {
238	+ $this->setPosition('Line: '.($i+1));
239	+ try {
240	+ // validate SKU
241	+ if (empty($row['sku'])) {
242	+ $this->addException(Mage::helper('catalog')->__('Missing SKU, skipping the record'), Mage_Dataflow_Model_Convert_Exception::ERROR);
243	+ continue;
244	+ }
245	+ $this->setPosition('Line: '.($i+1).', SKU: '.$row['sku']);
246	+
247	+ // try to get entity_id by sku if not set
248	+ if (empty($row['entity_id'])) {
249	+ $row['entity_id'] = $this->getResource()->getProductIdBySku($row['sku']);
250	+ }
251	+
252	+ // if attribute_set not set use default
253	+ if (empty($row['attribute_set'])) {
254	+ $row['attribute_set'] = 'Default';
255	+ }
256	+ // get attribute_set_id, if not throw error
257	+ $row['attribute_set_id'] = $this->getAttributeSetId($entityTypeId, $row['attribute_set']);
258	+ if (!$row['attribute_set_id']) {
259	+ $this->addException(Mage::helper('catalog')->__("Invalid attribute set specified, skipping the record"), Mage_Dataflow_Model_Convert_Exception::ERROR);
260	+ continue;
261	+ }
262	+
263	+ if (empty($row['type'])) {
264	+ $row['type'] = 'Simple';
265	+ }
266	+ // get product type_id, if not throw error
267	+ $row['type_id'] = $this->getProductTypeId($row['type']);
268	+ if (!$row['type_id']) {
269	+ $this->addException(Mage::helper('catalog')->__("Invalid product type specified, skipping the record"), Mage_Dataflow_Model_Convert_Exception::ERROR);
270	+ continue;
271	+ }
272	+
273	+ // get store ids
274	+ $storeIds = $this->getStoreIds(isset($row['store']) ? $row['store'] : $this->getVar('store'));
275	+ if (!$storeIds) {
276	+ $this->addException(Mage::helper('catalog')->__("Invalid store specified, skipping the record"), Mage_Dataflow_Model_Convert_Exception::ERROR);
277	+ continue;
278	+ }
279	+
280	+ // import data
281	+ $rowError = false;
282	+ foreach ($storeIds as $storeId) {
283	+ $collection = $this->getCollection($storeId);
284	+ $entity = $collection->getEntity();
285	+
286	+ $model = Mage::getModel('catalog/product');
287	+ $model->setStoreId($storeId);
288	+ if (!empty($row['entity_id'])) {
289	+ $model->load($row['entity_id']);
290	+ }
291	+ foreach ($row as $field=>$value) {
292	+ $attribute = $entity->getAttribute($field);
293	+
294	+ if (!$attribute) {
295	+ //$inventoryFields[$row['sku']][$field] = $value;
296	+
297	+ if (in_array($field, $this->_inventoryFields)) {
298	+ $inventoryFields[$row['sku']][$field] = $value;
299	+ }
300	+ continue;
301	+ #$this->addException(Mage::helper('catalog')->__("Unknown attribute: %s", $field), Mage_Dataflow_Model_Convert_Exception::ERROR);
302	+ }
303	+ if ($attribute->usesSource()) {
304	+ $source = $attribute->getSource();
305	+ $optionId = $this->getSourceOptionId($source, $value);
306	+ if (is_null($optionId)) {
307	+ $rowError = true;
308	+ $this->addException(Mage::helper('catalog')->__("Invalid attribute option specified for attribute %s (%s), skipping the record", $field, $value), Mage_Dataflow_Model_Convert_Exception::ERROR);
309	+ continue;
310	+ }
311	+ $value = $optionId;
312	+ }
313	+ $model->setData($field, $value);
314	+
315	+ }//foreach ($row as $field=>$value)
316	+
317	+ //echo 'Before **********************<br/><pre>';
318	+ //print_r($model->getData());
319	+ if (!$rowError) {
320	+ $collection->addItem($model);
321	+ }
322	+ unset($model);
323	+ } //foreach ($storeIds as $storeId)
324	+ } catch (Exception $e) {
325	+ if (!$e instanceof Mage_Dataflow_Model_Convert_Exception) {
326	+ $this->addException(Mage::helper('catalog')->__("Error during retrieval of option value: %s", $e->getMessage()), Mage_Dataflow_Model_Convert_Exception::FATAL);
327	+ }
328	+ }
329	+ }
330	+
331	+ // set importinted to adaptor
332	+ if (sizeof($inventoryFields) > 0) {
333	+ Mage::register('current_imported_inventory', $inventoryFields);
334	+ //$this->setInventoryItems($inventoryFields);
335	+ } // end setting imported to adaptor
336	+
337	+ $this->setData($this->_collections);
338	+ return $this;
339	+ }
340	+
341	+ public function setInventoryItems($items)
342	+ {
343	+ $this->_inventoryItems = $items;
344	+ }
345	+
346	+ public function getInventoryItems()
347	+ {
348	+ return $this->_inventoryItems;
349	+ }
350	+
351	+ /**
352	+ * Unparse (prepare data) loaded products
353	+ *
354	+ * @return Mage_Catalog_Model_Convert_Parser_Product
355	+ */
356	+ public function unparse()
357	+ {
358	+ $entityIds = $this->getData();
359	+ //$recordlimitstart = $this->getVar('recordlimitstart');
360	+ //$recordlimitend = $this->getVar('recordlimitend');
361	+ $overallcount = 1;
362	+ #array_reverse($entityIds);
363	+ foreach ($entityIds as $i => $entityId) {
364	+ if ($overallcount) {
365	+ $product = $this->getProductModel()
366	+ ->reset()
367	+ ->setStoreId($this->getStoreId())
368	+ ->load($entityId);
369	+ $this->setProductTypeInstance($product);
370	+ /* @var $product Mage_Catalog_Model_Product */
371	+
372	+ $position = Mage::helper('catalog')->__('Line %d, SKU: %s', ($i+1), $product->getSku());
373	+ $this->setPosition($position);
374	+
375	+ $row = array(
376	+ 'store' => $this->getStore()->getCode(),
377	+ 'websites' => '',
378	+ 'attribute_set' => $this->getAttributeSetName($product->getEntityTypeId(), $product->getAttributeSetId()),
379	+ 'type' => $product->getTypeId(),
380	+ 'category_ids' => join(',', $product->getCategoryIds())
381	+ );
382	+
383	+ if ($this->getStore()->getCode() == Mage_Core_Model_Store::ADMIN_CODE) {
384	+ $websiteCodes = array();
385	+ foreach ($product->getWebsiteIds() as $websiteId) {
386	+ $websiteCode = Mage::app()->getWebsite($websiteId)->getCode();
387	+ $websiteCodes[$websiteCode] = $websiteCode;
388	+ }
389	+ $row['websites'] = join(',', $websiteCodes);
390	+ }
391	+ else {
392	+ $row['websites'] = $this->getStore()->getWebsite()->getCode();
393	+ if ($this->getVar('url_field')) {
394	+ $row['url'] = $product->getProductUrl(false);
395	+ }
396	+ }
397	+
398	+ foreach ($product->getData() as $field => $value) {
399	+ if (in_array($field, $this->_systemFields) \|\| is_object($value)) {
400	+ continue;
401	+ }
402	+
403	+ $attribute = $this->getAttribute($field);
404	+ if (!$attribute) {
405	+ continue;
406	+ }
407	+ #print_r($attribute);
408	+ if ($attribute->usesSource()) {
409	+
410	+ $finalproductattributes = "";
411	+ $row['config_attributes'] = '';
412	+ if($product->getTypeId() == "configurable") {
413	+ $cProduct = Mage::getModel('catalog/product')->load($product->getId());
414	+ //check if product is a configurable type or not
415	+ if ($cProduct->getData('type_id') == "configurable")
416	+ {
417	+ //get the configurable data from the product
418	+ $config = $cProduct->getTypeInstance(true);
419	+ //loop through the attributes
420	+ foreach($config->getConfigurableAttributesAsArray($cProduct) as $attributes)
421	+ {
422	+ #$finalproductattributes .= $attributes["label"] . ",";
423	+ $finalproductattributes .= $attributes['attribute_code'] . ",";
424	+
425	+ }
426	+ }
427	+
428	+ }
429	+ $row['config_attributes'] = substr_replace($finalproductattributes,"",-1);
430	+ if (is_object($attribute->usesSource())) {
431	+ $option = $attribute->getSource()->getOptionText($value);
432	+ } else if ($field != "meta_robots" && $field != "canonical_url"){ //3rd party patch here for these fields.. attribute non-object error
433	+ $attributes = Mage::getResourceModel('eav/entity_attribute_collection')
434	+ ->setEntityTypeFilter($product->getResource()->getTypeId())
435	+ ->addFieldToFilter('attribute_code', $field);
436	+ $attribute = $attributes->getFirstItem()->setEntity($product->getResource());
437	+ #echo "FIELD: " . $field . "<br/>";
438	+ #echo "VALUE: " . $attribute->getSource()->getOptionText($value). "<br/>";
439	+ $option = $attribute->getSource()->getOptionText($value);
440	+ #exit;
441	+ } else {
442	+ $option ="";
443	+ }
444	+ if ($value && empty($option) && $field != "meta_robots") {
445	+ $message = Mage::helper('catalog')->__("Invalid option id specified for %s (%s), skipping the record", $field, $value);
446	+ #$this->addException($message, Mage_Dataflow_Model_Convert_Exception::ERROR);
447	+ continue;
448	+ }
449	+ if (is_array($option)) {
450	+ $value = join(self::MULTI_DELIMITER, $option);
451	+ } else {
452	+ $value = $option;
453	+ }
454	+ unset($option);
455	+ }
456	+ elseif (is_array($value)) {
457	+ continue;
458	+ }
459	+
460	+ $row[$field] = $value;
461	+ }
462	+
463	+
464	+ if ($stockItem = $product->getStockItem()) {
465	+ foreach ($stockItem->getData() as $field => $value) {
466	+ if (in_array($field, $this->_systemFields) \|\| is_object($value)) {
467	+ continue;
468	+ }
469	+ $row[$field] = $value;
470	+ }
471	+ }
472	+
473	+ foreach ($this->_imageFields as $field) {
474	+ if (isset($row[$field]) && $row[$field] == 'no_selection') {
475	+ $row[$field] = null;
476	+ }
477	+ }
478	+
479	+ #$row['product_id'] = $product->getId();
480	+ if($this->getVar('export_category_paths') == "true") {
481	+
482	+ /* ADDITIONAL CATEGORY ID EXPORT FOR 1.4 ONLY [START] */
483	+ $finalcategoryIds = "";
484	+ $resource = Mage::getSingleton('core/resource');
485	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
486	+ $read = $resource->getConnection('core_read');
487	+ $select_qryvalues2 = $read->query("SELECT category_id FROM `".$prefix."catalog_category_product` WHERE product_id = '".$product->getId()."'");
488	+ foreach($select_qryvalues2->fetchAll() as $datavalues2)
489	+ {
490	+ $finalcategoryIds .= $datavalues2['category_id'] . ",";
491	+ }
492	+ $row['categorys_ids'] = substr_replace($finalcategoryIds,"",-1);
493	+ /* ADDITIONAL CATEGORY ID EXPORT FOR 1.4 ONLY [END] */
494	+
495	+ /* PRODUCT CATEGORIES EXPORT START */
496	+ #print_r($row['categorys_ids']);
497	+ if($row['categorys_ids'] != "") {
498	+ $finalimportofcategories = "";
499	+ $okforallcategoriesnow = "";
500	+ $finalvcategoriesproductoptions1 = "";
501	+ $finalvcategoriesproductoptions2 = "";
502	+ $finalvcategoriesproductoptions2before = "";
503	+ foreach(explode(',',$row['categorys_ids']) as $productcategoryId)
504	+ {
505	+ $cat = Mage::getModel('catalog/category')->load($productcategoryId);
506	+ $finalvcategoriesproductoptions1 = $cat->getName();
507	+ $subcatsforreverse = $cat->getParentIds();
508	+ $subcats = array_shift($subcatsforreverse);
509	+ $subcats1 = array_shift($subcatsforreverse);
510	+ #print_r($subcatsforreverse);
511	+ $finalvcategoriesproductoptions2before = "";
512	+ foreach($subcatsforreverse as $subcatsproductcategoryId)
513	+ {
514	+ $subcat = Mage::getModel('catalog/category')->load($subcatsproductcategoryId);
515	+ #echo "CAT1: " . $subcat->getName() . "<br/>";
516	+ $finalvcategoriesproductoptions2before .= $subcat->getName() . "/";
517	+ $subsubcats = $subcat->getChildren();
518	+ }
519	+ $finalimportofcategories .= $finalvcategoriesproductoptions2before .
520	+ $finalvcategoriesproductoptions1 . " , ";
521	+ }
522	+ $okforallcategoriesnow = substr_replace($finalimportofcategories,"",-3);
523	+ $row['categories'] = $okforallcategoriesnow;
524	+
525	+ }
526	+ /* PRODUCT CATEGORIES EXPORT END */
527	+
528	+ } else {
529	+
530	+ /* ADDITIONAL CATEGORY ID EXPORT FOR 1.4 ONLY [START] */
531	+ $finalcategoryIds = "";
532	+ $resource = Mage::getSingleton('core/resource');
533	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
534	+ $read = $resource->getConnection('core_read');
535	+ $select_qryvalues2 = $read->query("SELECT category_id FROM `".$prefix."catalog_category_product` WHERE product_id = '".$product->getId()."'");
536	+ foreach($select_qryvalues2->fetchAll() as $datavalues2)
537	+ {
538	+ $finalcategoryIds .= $datavalues2['category_id'] . ",";
539	+ }
540	+ $row['category_ids'] = substr_replace($finalcategoryIds,"",-1);
541	+ /* ADDITIONAL CATEGORY ID EXPORT FOR 1.4 ONLY [END] */
542	+
543	+ }
544	+ /* ADDITIONAL IMAGE EXPORT FOR 1.4 ONLY [START] */
545	+ $finalgalleryimages = "";
546	+ $galleryImagesModel = Mage::getModel('catalog/product')->load($product->getId())->getMediaGalleryImages();
547	+
548	+ if (count($galleryImagesModel) > 0) {
549	+ foreach ($galleryImagesModel as $_image) {
550	+ $finalgalleryimages .= $_image->getFile() . ",";
551	+ //$finalgalleryimages .= $_image['file'] . ", ";
552	+ //$finalgallerylabels .= $_image['label'] . ", ";
553	+ }
554	+ }
555	+ $row['gallery'] = substr_replace($finalgalleryimages,"",-1);
556	+ #print_r($galleryImagesModel);
557	+ /* ADDITIONAL IMAGE EXPORT FOR 1.4 ONLY [END] */
558	+
559	+ $row['related'] = "";
560	+ $incoming_RelatedProducts = $product->getRelatedProducts();
561	+ foreach($incoming_RelatedProducts as $relatedproducts_str){
562	+ #print_r($relatedproducts_str);
563	+ #echo "SKU: " . $relatedproducts_str->getSku();
564	+ if($this->getVar('export_related_position') == "true") {
565	+ $row['related'] .= $relatedproducts_str['position'] .":". $relatedproducts_str->getSku() . ",";
566	+ } else {
567	+ $row['related'] .= $relatedproducts_str->getSku() . ",";
568	+ }
569	+ }
570	+
571	+ $row['upsell'] = "";
572	+ $incoming_UpSellProducts = $product->getUpSellProducts();
573	+ foreach($incoming_UpSellProducts as $UpSellproducts_str){
574	+ #print_r($relatedproducts_str);
575	+ #echo "SKU: " . $UpSellproducts_str->getSku();
576	+ if($this->getVar('export_upsell_position') == "true") {
577	+ $row['upsell'] .= $UpSellproducts_str['position'] .":". $UpSellproducts_str->getSku() . ",";
578	+ } else {
579	+ $row['upsell'] .= $UpSellproducts_str->getSku() . ",";
580	+ }
581	+ }
582	+
583	+ $row['crosssell'] = "";
584	+ $incoming_CrossSellProducts = $product->getCrossSellProducts ();
585	+ foreach($incoming_CrossSellProducts as $CrossSellproducts_str){
586	+ #print_r($relatedproducts_str);
587	+ #echo "SKU: " . $CrossSellproducts_str->getSku();
588	+ if($this->getVar('export_upsell_position') == "true") {
589	+ #echo "SKU crosssell: " . $CrossSellproducts_str['position'] . " -- " . $CrossSellproducts_str->getSku();
590	+ $row['crosssell'] .= $CrossSellproducts_str['position'] .":". $CrossSellproducts_str->getSku() . ",";
591	+ } else {
592	+ $row['crosssell'] .= $CrossSellproducts_str->getSku() . ",";
593	+ }
594	+ }
595	+
596	+ /* EXPORTS TIER PRICING */
597	+ #print_r($product->getTierPrice());
598	+ $row['tier_prices'] = "";
599	+ #$incoming_tierps = $product->getTierPrice();
600	+ $incoming_tierps = $product->getData('tier_price');
601	+ if(is_array($incoming_tierps)) {
602	+ foreach($incoming_tierps as $tier_str){
603	+ #print_r($tier_str);
604	+ $row['tier_prices'] .= $tier_str['cust_group'] . "=" . round($tier_str['price_qty']) . "=" . $tier_str['price'] . "\|";
605	+ }
606	+ }
607	+ /* EXPORTS ASSOICATED CONFIGURABLE SKUS */
608	+ $row['associated'] = '';
609	+ if($product->getTypeId() == "configurable") {
610	+ $associatedProducts = Mage::getSingleton('catalog/product_type')->factory($product)->getUsedProducts($product);
611	+ #print_r($associatedProducts->getUsedProducts($product));
612	+ #echo "ID: " . $product2->getId();
613	+ foreach($associatedProducts as $associatedProduct) {
614	+ $row['associated'] .= $associatedProduct->getSku() . ",";
615	+ }
616	+ }
617	+
618	+ /* EXPORTS ASSOICATED BUNDLE SKUS */
619	+ $row['bundle_options'] = '';
620	+ if($product->getTypeId() == "bundle") {
621	+ $finalbundleoptions = "";
622	+ $finalbundleselectionoptions = "";
623	+ $finalbundleselectionoptionssorting = "";
624	+ $optionModel = Mage::getModel('bundle/option')->getResourceCollection()->setProductIdFilter($product->getId());
625	+
626	+ foreach($optionModel as $eachOption) {
627	+ $resource = Mage::getSingleton('core/resource');
628	+ $OptiondataDB = $resource->getConnection('catalog_write');
629	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
630	+
631	+ $selectOptionID = "SELECT title FROM ".$prefix."catalog_product_bundle_option_value WHERE option_id = ".$eachOption->getData('option_id')."";
632	+ $Optiondatarows = $OptiondataDB->fetchAll($selectOptionID);
633	+ foreach($Optiondatarows as $Option_row)
634	+ {
635	+ $finaltitle = str_replace(' ','_',$Option_row['title']);
636	+ }
637	+ $finalbundleoptions .= $finaltitle . "," . $eachOption->getData('type') . "," . $eachOption->getData('required') . "," . $eachOption->getData('position') . "\|";
638	+
639	+
640	+ $selectionModel = Mage::getModel('bundle/selection')->setOptionId($eachOption->getData('option_id'))->getResourceCollection();
641	+ #print_r($selectionModel->getData());
642	+ foreach($selectionModel as $eachselectionOption) {
643	+ #echo "t: " . $eachselectionOption->getData('selection_price_type');
644	+ if($eachselectionOption->getData('option_id') == $eachOption->getData('option_id')) {
645	+ $finalbundleselectionoptionssorting .= $eachselectionOption->getData('sku') . ":" . $eachselectionOption->getData('selection_price_type') . ":" . $eachselectionOption->getData('selection_price_value') . ":" . $eachselectionOption->getData('is_default') . ":" . $eachselectionOption->getData('selection_qty') . ":" . $eachselectionOption->getData('selection_can_change_qty'). ":" . $eachselectionOption->getData('position') . ",";
646	+ }
647	+ }
648	+ $finalbundleselectionoptionssorting = substr_replace($finalbundleselectionoptionssorting,"",-1);
649	+ $finalbundleselectionoptionssorting .= "\|";
650	+ $finalbundleselectionoptions = substr_replace($finalbundleselectionoptionssorting,"",-1);
651	+ }
652	+ $row['bundle_options'] = substr_replace($finalbundleoptions,"",-1);
653	+ $row['bundle_selections'] = substr_replace($finalbundleselectionoptions,"",-1);
654	+ }
655	+
656	+
657	+ /* EXPORTS ASSOICATED GROUPED SKUS */
658	+ $row['grouped'] = '';
659	+ if($product->getTypeId() == "grouped") {
660	+ $associatedProducts = Mage::getSingleton('catalog/product_type')->factory($product)->getAssociatedProducts($product);
661	+ foreach($associatedProducts as $associatedProduct) {
662	+ if($this->getVar('export_grouped_position') == "true") {
663	+ $row['grouped'] .= $associatedProduct->getPosition() . ":" . $associatedProduct->getSku() . ":" . $associatedProduct->getQty() . ",";
664	+ } else {
665	+ $row['grouped'] .= $associatedProduct->getSku() . ",";
666	+ }
667	+ }
668	+ }
669	+
670	+ /EXPORTS GROUPED PRICES 1.7.x beta rc1 /
671	+
672	+ $resource = Mage::getSingleton('core/resource');
673	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
674	+ $read = $resource->getConnection('core_read');
675	+ $finalgrouped_prices_info="";
676	+ $select_qry_grouped_pricing = "SELECT * FROM ".$resource->getTableName('catalog/product_attribute_group_price')." WHERE entity_id = '".$product->getId()."'";
677	+ $rows = $read->fetchAll($select_qry_grouped_pricing);
678	+
679	+ if(!empty($rows)) {
680	+ foreach($rows as $groupRow)
681	+ {
682	+ #print_r($groupRow);
683	+ #echo "ID: " . $groupRow['customer_group_id'];
684	+ $finalgrouped_prices_info .= $groupRow['customer_group_id'] . "=" . $groupRow['value'] . "\|";
685	+ #$row['group_price_customer_group'] = $groupRow['all_groups'];
686	+ #$row['group_price_website'] = $groupRow['website_id'];
687	+ }
688	+ }
689	+ $row['group_price_price'] = '';
690	+ $row['group_price_price'] = substr_replace($finalgrouped_prices_info,"",-1);
691	+
692	+ /* EXPORTS DOWNLOADABLE OPTIONS */
693	+ $row['downloadable_options'] = '';
694	+ $finaldownloabledproductoptions = "";
695	+ if($product->getTypeId() == "downloadable") {
696	+
697	+ $_linkCollection = Mage::getModel('downloadable/link')->getCollection()
698	+ ->addProductToFilter($product->getId())
699	+ ->addTitleToResult($product->getStoreId())
700	+ ->addPriceToResult($product->getStore()->getWebsiteId());
701	+
702	+ foreach ($_linkCollection as $link) {
703	+ /* @var Mage_Downloadable_Model_Link $link */
704	+ #print_r($link);
705	+ #Main file,0.00,3,file,/test.mp3,/sample.mp
706	+ if($link->getLinkUrl() !="" && $link->getSampleUrl() !="") {
707	+ $finaldownloabledproductoptions .= $link->getTitle() . "," . $link->getPrice() . "," . $link->getNumberOfDownloads() . "," . $link->getLinkType() . "," . $link->getLinkUrl() . "," . $link->getSampleUrl() . "\|";
708	+ } else if($link->getLinkUrl() !="") {
709	+ $finaldownloabledproductoptions .= $link->getTitle() . "," . $link->getPrice() . "," . $link->getNumberOfDownloads() . "," . $link->getLinkType() . "," . $link->getLinkUrl() . "\|";
710	+ } else if($link->getLinkFile() !="" && $link->getSampleFile() !="") {
711	+ $finaldownloabledproductoptions .= $link->getTitle() . "," . $link->getPrice() . "," . $link->getNumberOfDownloads() . "," . $link->getLinkType() . "," . $link->getLinkFile() . "," . $link->getSampleFile() . "\|";
712	+ } else {
713	+ $finaldownloabledproductoptions .= $link->getTitle() . "," . $link->getPrice() . "," . $link->getNumberOfDownloads() . "," . $link->getLinkType() . "," . $link->getLinkFile() . "\|";
714	+ }
715	+ }
716	+ $row['downloadable_options'] = substr_replace($finaldownloabledproductoptions,"",-1);
717	+
718	+ }
719	+
720	+ /* EXPORTS SUPER ATTRIBUTE PRICING [START] */
721	+ $row['super_attribute_pricing'] = "";
722	+ $finalsuper_attribute_pricing_product_options = "";
723	+ $resource = Mage::getSingleton('core/resource');
724	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
725	+ $read = $resource->getConnection('core_read');
726	+
727	+ if($product->getTypeId() == "configurable") {
728	+ $cProduct = Mage::getModel('catalog/product')->load($product->getId());
729	+ //check if product is a configurable type or not
730	+ if ($cProduct->getData('type_id') == "configurable")
731	+ {
732	+ //get the configurable data from the product
733	+ $config = $cProduct->getTypeInstance(true);
734	+ //loop through the attributes
735	+ foreach($config->getConfigurableAttributesAsArray($cProduct) as $attributes)
736	+ {
737	+ #print_r($attributes);
738	+ #$finalproductattributes .= $attributes["label"] . ",";
739	+ foreach($attributes['values'] as $attributedata)
740	+ {
741	+ $select_qry_for_super_attribute_pricing = "SELECT * FROM `".$prefix."catalog_product_super_attribute_pricing` WHERE ".$prefix."catalog_product_super_attribute_pricing.product_super_attribute_id = '".$attributedata['product_super_attribute_id']."' AND ".$prefix."catalog_product_super_attribute_pricing.value_index = '".$attributedata['value_index']."'";
742	+ #echo "SQL: " . $select_qry_for_super_attribute_pricing;
743	+ $rows = $read->fetchAll($select_qry_for_super_attribute_pricing);
744	+
745	+ if(!empty($rows)) {
746	+ foreach($rows as $data_sap)
747	+ {
748	+ //[value_id] => 4 [product_super_attribute_id] => 3 [value_index] => 39 [is_percent] => 0 [pricing_value] => 1.0000
749	+ #print_r($data_sap);
750	+ $finalsuper_attribute_pricing_product_options .= $attributedata['label'] . ":" . $data_sap['pricing_value'] . ":" . $data_sap['is_percent'] . "\|";
751	+ }
752	+ } else {
753	+ $finalsuper_attribute_pricing_product_options .= $attributedata['label'] . ":" . $attributedata['pricing_value'] . ":" . $attributedata['is_percent'] . "\|";
754	+ }
755	+ }
756	+ }
757	+ }
758	+
759	+ }
760	+ $row['super_attribute_pricing'] = substr_replace($finalsuper_attribute_pricing_product_options,"",-1);
761	+ /* EXPORTS SUPER ATTRIBUTE PRICING [END] */
762	+
763	+ /* EXPORTS PRODUCT TAGS START*/
764	+ $row['product_tags'] = '';
765	+ $producttagcustomerID="";
766	+ $all_tags="";
767	+ $resource = Mage::getSingleton('core/resource');
768	+ $read = $resource->getConnection('catalog_read');
769	+ $prefix = Mage::getConfig()->getNode('global/resources/db/table_prefix');
770	+
771	+ $select = "SELECT customer_id FROM `".$prefix."tag_relation` WHERE product_id = " . $product->getId() . " LIMIT 1";
772	+
773	+ $rows = $read->fetchAll($select);
774	+ foreach($rows as $row1)
775	+ {
776	+ $producttagcustomerID = $row1['customer_id'];
777	+ }
778	+
779	+ $tagsCollection = Mage::getModel('tag/tag')->getResourceCollection();
780	+ $tagsCollection->addPopularity()
781	+ ->addProductFilter($product->getId())
782	+ ->setActiveFilter();
783	+ #print_r($tagsCollection);
784	+ foreach( $tagsCollection as $_tag ) {
785	+ #print_r($_tag->getData());
786	+ $all_tags .= $producttagcustomerID . ":".str_replace(" ","_", $_tag->getData('name')) . ", ";
787	+ }
788	+ #$row['product_tags'] = $all_tags;
789	+ $row['product_tags'] = substr_replace($all_tags,"",-2);
790	+
791	+
792	+ /* EXPORT PRODUCT TAGS END */
793	+ /* EXPORTS CUSTOM OPTIONS */
794	+ #print_r($product->getOptions());
795	+ foreach ($product->getOptions() as $o) {
796	+ #print_r($o->getData());
797	+ #echo "CUSTOM OPTIONS NAME: " . $o->getData('title') . ":" . $o->getData('type') . ":" . $o->getData('is_require') . ":". $o->getData('sort_order');
798	+ $customoptionvalues = "";
799	+ $customoptionstitle = $o->getData('title') . ":" . $o->getData('type') . ":" . $o->getData('is_require') . ":". $o->getData('sort_order');
800	+ if($o->getData('type')=="checkbox" \|\| $o->getData('type')=="drop_down" \|\| $o->getData('type')=="radio" \|\| $o->getData('type')=="multiple") {
801	+ foreach ( $o->getValues() as $oValues ) {
802	+ if($oValues->getData('price_type')=="") { $price_type = "fixed"; } else { $price_type = $oValues->getData('price_type'); }
803	+ if($oValues->getData('price')=="") { $price = "0.0000"; } else { $price = $oValues->getData('price'); }
804	+ if($oValues->getData('sku')=="") { $sku = " "; } else { $sku = $oValues->getData('sku'); }
805	+ if($oValues->getData('sort_order')=="") { $sort_order = "0"; } else { $sort_order = $oValues->getData('sort_order'); }
806	+ if($oValues->getData('max_characters')=="") { $max_characters = "0"; } else { $max_characters = $oValues->getData('max_characters'); }
807	+
808	+ $customoptionvalues .= $oValues->getData('title') . ":" . $price_type . ":" . $price . ":" . $sku . ":" . $sort_order . ":" . $max_characters . "\|";
809	+
810	+ }
811	+ } else {
812	+ #print_r($o->getData());
813	+ if($o->getData('price_type')=="") { $price_type = "fixed"; } else { $price_type = $o->getData('price_type'); }
814	+ if($o->getData('price')=="") { $price = "0.0000"; } else { $price = $o->getData('price'); }
815	+ if($o->getData('sku')=="") { $sku = " "; } else { $sku = $o->getData('sku'); }
816	+ if($o->getData('sort_order')=="") { $sort_order = "0"; } else { $sort_order = $o->getData('sort_order'); }
817	+ if($o->getData('max_characters')=="") { $max_characters = "0"; } else { $max_characters = $o->getData('max_characters'); }
818	+
819	+ $customoptionvalues .= $o->getData('title') . ":" . $price_type . ":" . $price . ":" . $sku . ":" . $sort_order . ":" . $max_characters . "\|";
820	+ }
821	+ $row[$customoptionstitle] = substr_replace($customoptionvalues,"",-1);
822	+ }
823	+
824	+ $batchExport = $this->getBatchExportModel()
825	+ ->setId(null)
826	+ ->setBatchId($this->getBatchModel()->getId())
827	+ ->setBatchData($row)
828	+ ->setStatus(1)
829	+ ->save();
830	+ } #ends check on count of orders being exported
831	+ $overallcount+=1;
832	+ }
833	+
834	+ return $this;
835	+ }
836	+
837	+ /**
838	+ * Retrieve accessible external product attributes
839	+ *
840	+ * @return array
841	+ */
842	+ public function getExternalAttributes()
843	+ {
844	+ $entityTypeId = Mage::getSingleton('eav/config')->getEntityType('catalog_product')->getId();
845	+ $productAttributes = Mage::getResourceModel('catalog/product_attribute_collection')
846	+ ->load();
847	+
848	+ $attributes = $this->_externalFields;
849	+
850	+ foreach ($productAttributes as $attr) {
851	+ $code = $attr->getAttributeCode();
852	+ if (in_array($code, $this->_internalFields) \|\| $attr->getFrontendInput() == 'hidden') {
853	+ continue;
854	+ }
855	+ $attributes[$code] = $code;
856	+ }
857	+
858	+ foreach ($this->_inventoryFields as $field) {
859	+ $attributes[$field] = $field;
860	+ }
861	+
862	+ return $attributes;
863	+ }
864	+ }

app/code/community/PI/Oopsprofile/Model/Rule.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Rule extends Mage_Rule_Model_Abstract
4	+ {
5	+ /**
6	+ * Getter for rule combine conditions instance
7	+ *
8	+ * @return PI_Oopsprofile_Model_Rule_Condition_Combine
9	+ */
10	+ public function getConditionsInstance()
11	+ {
12	+ return Mage::getModel('oopsprofile/rule_condition_combine');
13	+ }
14	+
15	+ public function getConditions()
16	+ {
17	+ $profile = Mage::registry('current_convert_profile');
18	+
19	+ $ruleCollection = Mage::getModel('oopsprofile/oopsprofile')
20	+ ->getCollection()
21	+ ->addFieldToFilter('dataflow_profile_id ',$profile->getId())
22	+ ->getFirstItem();
23	+
24	+ if (empty($this->_conditions)) {
25	+ $this->_resetConditions();
26	+ }
27	+
28	+ // Load rule conditions if it is applicable
29	+ if ($ruleCollection->hasConditionsSerialized()) {
30	+ $conditions = $ruleCollection->getConditionsSerialized();
31	+ if (!empty($conditions)) {
32	+ $conditions = unserialize($conditions);
33	+ if (is_array($conditions) && !empty($conditions)) {
34	+ $this->_conditions->loadArray($conditions);
35	+ }
36	+ }
37	+ $this->unsConditionsSerialized();
38	+ }
39	+
40	+ return $this->_conditions;
41	+ }
42	+
43	+ public function loadPost(array $data)
44	+ {
45	+ $arr = $this->_convertFlatToRecursive($data);
46	+ if (isset($arr['conditions'])) {
47	+ $this->getConditions()->setConditions(array())->loadArray($arr['conditions'][1]);
48	+ }
49	+
50	+ return $arr;
51	+ }
52	+
53	+ /**
54	+ * Getter for rule actions collection instance
55	+ *
56	+ * @return Mage_Rule_Model_Action_Collection
57	+ */
58	+ public function getActionsInstance()
59	+ {
60	+ return '';
61	+ }
62	+ }

app/code/community/PI/Oopsprofile/Model/Rule/Condition/Combine.php ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Rule_Condition_Combine extends Mage_Rule_Model_Condition_Combine
4	+ {
5	+ public function __construct()
6	+ {
7	+ parent::__construct();
8	+ $this->setType('oopsprofile/rule_condition_combine');
9	+ }
10	+
11	+ public function getNewChildSelectOptions()
12	+ {
13	+ $productCondition = Mage::getModel('oopsprofile/rule_condition_product');
14	+ $productAttributes = $productCondition->loadAttributeOptions()->getAttributeOption();
15	+ $attributes = array();
16	+ foreach ($productAttributes as $code=>$label) {
17	+ $attributes[] = array('value'=>'oopsprofile/rule_condition_product\|'.$code, 'label'=>$label);
18	+ }
19	+ $conditions = parent::getNewChildSelectOptions();
20	+ $conditions = array_merge_recursive($conditions, array(
21	+ array('value'=>'oopsprofile/rule_condition_combine', 'label'=>Mage::helper('oopsprofile')->__('Conditions Combination')),
22	+ array('label'=>Mage::helper('oopsprofile')->__('Product Attribute'), 'value'=>$attributes),
23	+ ));
24	+ return $conditions;
25	+ }
26	+
27	+ public function collectValidatedAttributes($productCollection)
28	+ {
29	+ foreach ($this->getConditions() as $condition) {
30	+ $condition->collectValidatedAttributes($productCollection);
31	+ }
32	+ return $this;
33	+ }
34	+ }

app/code/community/PI/Oopsprofile/Model/Rule/Condition/Product.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Model_Rule_Condition_Product extends Mage_Rule_Model_Condition_Product_Abstract
4	+ {
5	+ /**
6	+ * Add special attributes
7	+ *
8	+ * @param array $attributes
9	+ */
10	+ protected function _addSpecialAttributes(array &$attributes)
11	+ {
12	+ $attributes['attribute_set_id'] = Mage::helper('catalogrule')->__('Attribute Set');
13	+ $attributes['category_ids'] = Mage::helper('catalogrule')->__('Category');
14	+ //$attributes['sku'] = Mage::helper('catalogrule')->__('Sku');
15	+ //$attributes['entity_id'] = Mage::helper('catalogrule')->__('Id');
16	+ }
17	+ }

app/code/community/PI/Oopsprofile/Model/Varien/Io/Sftp.php ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ <?php
2	+ class PI_Oopsprofile_Model_Varien_Io_Sftp extends Varien_Io_Sftp
3	+ {
4	+
5	+ /**
6	+ * Write a file
7	+ * @param $src Must be a local file path with name
8	+ */
9	+ public function write($filename, $src, $mode=null)
10	+ {
11	+ return $this->_connection->put($filename, $src,NET_SFTP_LOCAL_FILE);//"NET_SFTP_LOCAL_FILE" use to save from local file
12	+ }
13	+
14	+
15	+ }

app/code/community/PI/Oopsprofile/controllers/Adminhtml/OopsprofileController.php ADDED Viewed

	@@ -0,0 +1,550 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_Adminhtml_OopsprofileController extends Mage_Adminhtml_Controller_Action
4	+ {
5	+
6	+ protected function _isAllowed()
7	+ {
8	+ return Mage::getSingleton('admin/session')->isAllowed('system/config');
9	+ }
10	+
11	+ public function preDispatch()
12	+ {
13	+
14	+ parent::preDispatch();
15	+
16	+ Mage::dispatchEvent('oopsprofile_create_api',array());
17	+
18	+ /**
19	+ * Save Installation Date in core_config_data
20	+ **/
21	+
22	+ $configSet = Mage::getStoreConfigFlag('oopsprofile/installation/date');
23	+
24	+ if(!$configSet)//if data is not exist in config
25	+ {
26	+
27	+ $currentDate = date("Y-m-d H:i:s", Mage::getModel('core/date')->timestamp(time()));
28	+
29	+ $ConfigDataModel = Mage::getModel('core/config_data');
30	+
31	+ $ConfigDataModel->setScope('default')
32	+ ->setScopeId(0)
33	+ ->setPath('oopsprofile/installation/date')
34	+ ->setValue($currentDate)
35	+ ->setId(Null)
36	+ ->save();
37	+
38	+ }
39	+
40	+
41	+ return $this;
42	+ }
43	+
44	+ protected function _initProfile($idFieldName = 'id')
45	+ {
46	+ $this->_title($this->__('System'))
47	+ ->_title($this->__('Import and Export'))
48	+ ->_title($this->__('Profiles'));
49	+
50	+ $profileId = (int) $this->getRequest()->getParam($idFieldName);
51	+ $profile = Mage::getModel('dataflow/profile');
52	+
53	+ if ($profileId) {
54	+ $profile->load($profileId);
55	+ if (!$profile->getId()) {
56	+ Mage::getSingleton('adminhtml/session')->addError(
57	+ $this->__('The profile you are trying to save no longer exists'));
58	+ $this->_redirect('/');
59	+ return false;
60	+ }
61	+ }
62	+
63	+ Mage::register('current_convert_profile', $profile);
64	+
65	+ $id = Mage::registry('current_convert_profile')->getId();
66	+
67	+
68	+ //set session for import
69	+ Mage::getSingleton('core/session')->setTemplateProfileId($id);
70	+
71	+ return $this;
72	+ }
73	+
74	+ /**
75	+ * Profiles list action
76	+ */
77	+ public function indexAction()
78	+ {
79	+ $this->_title($this->__('System'))
80	+ ->_title($this->__('Import and Export'))
81	+ ->_title($this->__('Profiles'));
82	+
83	+ if ($this->getRequest()->getQuery('ajax')) {
84	+ $this->_forward('grid');
85	+ return;
86	+ }
87	+ $this->loadLayout();
88	+
89	+ /**
90	+ * Set active menu item
91	+ */
92	+ $this->_setActiveMenu('oopsimportexport');
93	+
94	+ /**
95	+ * Append profiles block to content
96	+ */
97	+ $this->_addContent(
98	+ $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile')
99	+ );
100	+
101	+ /**
102	+ * Add breadcrumb item
103	+ */
104	+ $this->_addBreadcrumb(Mage::helper('adminhtml')->__('Import/Export'), Mage::helper('adminhtml')->__('Import/Export'));
105	+ $this->_addBreadcrumb(Mage::helper('adminhtml')->__('Profiles'), Mage::helper('adminhtml')->__('Profiles'));
106	+
107	+ $this->renderLayout();
108	+ }
109	+
110	+ public function gridAction()
111	+ {
112	+ $this->getResponse()->setBody($this->getLayout()->createBlock('opsprofile/adminhtml_oopsprofile_grid')->toHtml());
113	+ }
114	+
115	+ /**
116	+ * Profile edit action
117	+ */
118	+ public function editAction()
119	+ {
120	+
121	+ $this->_initProfile();
122	+ $this->loadLayout();
123	+
124	+ $profile = Mage::registry('current_convert_profile');
125	+
126	+ // set entered data if was error when we do save
127	+ $data = Mage::getSingleton('adminhtml/session')->getConvertProfileData(true);
128	+
129	+ //set oopsprofile data in registry
130	+ $oopsprofile = Mage::getModel('oopsprofile/oopsprofile')->loadByProfile($profile);
131	+ Mage::register('current_convert_oopsprofile', $oopsprofile);
132	+
133	+
134	+ $ruleModel = Mage::getModel('oopsprofile/rule')->getConditions()->setJsFormObject('rule_conditions_fieldset');
135	+
136	+ Mage::register('current_oops_rule', $ruleModel);
137	+
138	+ if (!empty($data)) {
139	+ $profile->addData($data);
140	+ }
141	+
142	+ $this->_title($profile->getId() ? $profile->getName() : $this->__('New Profile'));
143	+
144	+ $this->_setActiveMenu('oopsimportexport');
145	+
146	+
147	+ $this->_addContent(
148	+ $this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit', 'oopsprofile_edit')
149	+ );
150	+
151	+ /**
152	+ * Append edit tabs to left block
153	+ */
154	+ $this->_addLeft($this->getLayout()->createBlock('oopsprofile/adminhtml_oopsprofile_edit_tabs'));
155	+
156	+ //$this->getLayout()->getBlock('head')->setCanLoadExtJs(true);
157	+
158	+ $this->renderLayout();
159	+ }
160	+
161	+ /**
162	+ * Create new profile action
163	+ */
164	+ public function newAction()
165	+ {
166	+ $this->_forward('edit');
167	+ }
168	+
169	+ /**
170	+ * Save profile action
171	+ */
172	+ public function saveAction(){
173	+
174	+ if ($data = $this->getRequest()->getPost()) {
175	+
176	+
177	+ if (!$this->_initProfile('profile_id')) {
178	+ return;
179	+ }
180	+
181	+ $profile = Mage::registry('current_convert_profile');
182	+
183	+ // Prepare profile saving data
184	+ if (isset($data)) {
185	+ $profile->addData($data);
186	+ }
187	+
188	+ try {
189	+ $profile->save();
190	+
191	+ $conditions = '';
192	+ if(!empty($data['rule']))
193	+ {
194	+ $data['conditions'] = $data['rule']['conditions'];
195	+ unset($data['rule']);
196	+
197	+ $rulemodel = Mage::getModel('oopsprofile/rule');
198	+ $arr = $rulemodel->loadPost($data);
199	+ $conditions = $arr['conditions'][1];
200	+
201	+ //echo '<pre>';print_r($conditions);exit;
202	+
203	+ if(!empty($conditions))
204	+ {
205	+ $conditions = serialize($conditions);
206	+ }
207	+ }
208	+
209	+
210	+ $dataflowId = $profile->getId();
211	+ $oopsprofileModel = Mage::getModel('oopsprofile/oopsprofile');
212	+ $oopsprofileId = $oopsprofileModel->getCollection()
213	+ ->addFieldToFilter('dataflow_profile_id',$dataflowId)
214	+ ->getFirstItem()
215	+ ->getId();
216	+
217	+ //echo $data['save_local_copy'];exit;
218	+ //echo $conditions;exit;
219	+
220	+ /**if($data['save_local_copy']==1)
221	+ {
222	+ if($data['data_transfer']=='http' \|\| $data['data_transfer']=='api' \|\| $data['data_transfer']=='mail' \|\| $data['direction']=='import')//if way type is api or http or direction is import
223	+ {
224	+ $data['save_local_copy']=0;
225	+ }
226	+ }**/
227	+
228	+ /**if($data['save_products_separately']==1)
229	+ {
230	+ if($data['data_transfer']=='http' \|\| $data['data_transfer']=='api' \|\| $data['data_transfer']=='mail' \|\| $data['direction']=='import')//if way type is api/http/mail or direction is import
231	+ {
232	+ $data['save_products_separately']=0;
233	+ }
234	+ }**/
235	+
236	+ $oopsprofileModel->setDataflowProfileId($dataflowId)
237	+ ->setConditionsSerialized($conditions)
238	+ //->setRunOnProductSave($data['run_on_product_save'])
239	+ //->setRunOnCategorySave($data['run_on_category_save'])
240	+ ->setProfileEnable($data['profile_enable'])
241	+ //->setSaveLocalCopy($data['save_local_copy'])
242	+ ->setProductsAllreadyDone($data['products_allready_done'])
243	+ //->setSaveProductsSeparately($data['save_products_separately'])
244	+ //->setXmlContent($data['xml_content'])
245	+ //->setEnableContent($data['enable_content'])
246	+ ->setProfileDirection($data['direction']);
247	+
248	+
249	+
250	+
251	+
252	+
253	+
254	+
255	+
256	+ //save data in oops profile
257	+ if($oopsprofileId==''){
258	+ $oopsprofileModel->save();
259	+ }
260	+ else{
261	+ $oopsprofileModel->setId($oopsprofileId)->save();
262	+ }
263	+
264	+ Mage::getSingleton('adminhtml/session')->addSuccess(
265	+ Mage::helper('adminhtml')->__('The profile has been saved.')
266	+ );
267	+ } catch (Exception $e){
268	+ Mage::getSingleton('adminhtml/session')->addError($e->getMessage());
269	+ Mage::getSingleton('adminhtml/session')->setConvertProfileData($data);
270	+ $this->getResponse()->setRedirect($this->getUrl('//edit', array('id' => $profile->getId())));
271	+ return;
272	+ }
273	+ if ($this->getRequest()->getParam('continue')) {
274	+ $this->_redirect('//edit', array('id' => $profile->getId()));
275	+ } else {
276	+ $this->_redirect('/');
277	+ }
278	+ } else {
279	+ Mage::getSingleton('adminhtml/session')->addError(
280	+ $this->__('Invalid POST data (please check post_max_size and upload_max_filesize settings in your php.ini file).')
281	+ );
282	+ $this->_redirect('/');
283	+ }
284	+ }
285	+
286	+ public function runAction()
287	+ {
288	+
289	+
290	+ $id = $this->getRequest()->getParams('id');
291	+ $oopsprofile = Mage::getModel('oopsprofile/oopsprofile')
292	+ ->getCollection()
293	+ ->addFieldToFilter('dataflow_profile_id',$id)
294	+ ->getFirstItem();
295	+ $isDisabled = $oopsprofile->getProfileEnable();
296	+ if($isDisabled == 1)//if profile is disable
297	+ {
298	+ Mage::getSingleton('adminhtml/session')->addError(Mage::helper('adminhtml')->__('The profile is disable.'));
299	+
300	+
301	+
302	+
303	+
304	+ $this->_redirect('/');
305	+ }
306	+ else
307	+ {
308	+ $this->_initProfile();
309	+ $this->loadLayout();
310	+ $this->renderLayout();
311	+ }
312	+
313	+
314	+ }
315	+
316	+
317	+ /**
318	+ * Delete profile action
319	+ */
320	+ public function deleteAction()
321	+ {
322	+ $this->_initProfile();
323	+ $profile = Mage::registry('current_convert_profile');
324	+ if ($profile->getId()) {
325	+ try {
326	+ //delete from oops profile
327	+ $oopsprofileModel = Mage::getModel('oopsprofile/oopsprofile');
328	+ $oopsprofileId = $oopsprofileModel->getCollection()->addFieldToFilter('dataflow_profile_id',$profile->getId())->getFirstItem()->getId();
329	+ if($oopsprofileId!='')
330	+ {
331	+ $oopsprofileModel->setId($oopsprofileId)->delete();
332	+ }
333	+
334	+ $profile->delete();
335	+ Mage::getSingleton('adminhtml/session')->addSuccess(
336	+ Mage::helper('adminhtml')->__('The profile has been deleted.'));
337	+ } catch (Exception $e){
338	+ Mage::getSingleton('adminhtml/session')->addError($e->getMessage());
339	+ }
340	+ }
341	+ $this->_redirect('/');
342	+ }
343	+
344	+ public function batchRunAction()
345	+ {
346	+ if ($this->getRequest()->isPost()) {
347	+ $batchId = $this->getRequest()->getPost('batch_id', 0);
348	+ $rowIds = $this->getRequest()->getPost('rows');
349	+
350	+ /* @var $batchModel Mage_Dataflow_Model_Batch */
351	+ $batchModel = Mage::getModel('dataflow/batch')->load($batchId);
352	+
353	+ if (!$batchModel->getId()) {
354	+ return;
355	+ }
356	+ if (!is_array($rowIds) \|\| count($rowIds) < 1) {
357	+ return;
358	+ }
359	+ if (!$batchModel->getAdapter()) {
360	+ return;
361	+ }
362	+
363	+ $batchImportModel = $batchModel->getBatchImportModel();
364	+ $importIds = $batchImportModel->getIdCollection();
365	+
366	+ $adapter = Mage::getModel($batchModel->getAdapter());
367	+ $adapter->setBatchParams($batchModel->getParams());
368	+
369	+ $errors = array();
370	+ $saved = 0;
371	+ foreach ($rowIds as $importId) {
372	+ $batchImportModel->load($importId);
373	+ if (!$batchImportModel->getId()) {
374	+ $errors[] = Mage::helper('dataflow')->__('Skip undefined row.');
375	+ continue;
376	+ }
377	+
378	+ try {
379	+ $importData = $batchImportModel->getBatchData();
380	+ $adapter->saveRow($importData);
381	+ } catch (Exception $e) {
382	+ $errors[] = $e->getMessage();
383	+ continue;
384	+ }
385	+ $saved ++;
386	+ }
387	+
388	+ if (method_exists($adapter, 'getEventPrefix')) {
389	+ /**
390	+ * Event for process rules relations after products import
391	+ */
392	+ Mage::dispatchEvent($adapter->getEventPrefix() . '_finish_before', array(
393	+ 'adapter' => $adapter
394	+ ));
395	+
396	+ /**
397	+ * Clear affected ids for adapter possible reuse
398	+ */
399	+ $adapter->clearAffectedEntityIds();
400	+ }
401	+
402	+ $result = array(
403	+ 'savedRows' => $saved,
404	+ 'errors' => $errors
405	+ );
406	+ $this->getResponse()->setBody(Mage::helper('core')->jsonEncode($result));
407	+ }
408	+ }
409	+
410	+ public function batchFinishAction()
411	+ {
412	+ $batchId = $this->getRequest()->getParam('id');
413	+ if ($batchId) {
414	+ $batchModel = Mage::getModel('dataflow/batch')->load($batchId);
415	+ /* @var $batchModel Mage_Dataflow_Model_Batch */
416	+
417	+ if ($batchModel->getId()) {
418	+ $result = array();
419	+ try {
420	+ $batchModel->beforeFinish();
421	+ } catch (Mage_Core_Exception $e) {
422	+ $result['error'] = $e->getMessage();
423	+ } catch (Exception $e) {
424	+ $result['error'] = Mage::helper('adminhtml')->__('An error occurred while finishing process. Please refresh the cache');
425	+ }
426	+ $batchModel->delete();
427	+ $this->getResponse()->setBody(Mage::helper('core')->jsonEncode($result));
428	+ }
429	+ }
430	+ }
431	+
432	+ /Download File/
433	+ public function downloadFileAction()
434	+ {
435	+ $data = $this->getRequest()->getParams();
436	+ $filepath = $data['filepath'];
437	+ $id = $data['profileid'];
438	+ $filetype = $data['fileType'];
439	+ if($filetype == 'ftp' \|\| $filetype == 'sftp')
440	+ {
441	+ $filepath = $this->saveOnLocalFromFtp($data);
442	+ }
443	+
444	+
445	+ if($filepath!='')
446	+ {
447	+ if(file_exists($filepath))
448	+ {
449	+ $responce = $this->getResponse();
450	+ $responce->setHttpResponseCode( 200 );
451	+ $responce->setHeader( 'Cache-Control', 'must-revalidate, post-check=0, pre-check=0', true );
452	+ $responce->setHeader( 'Pragma', 'public', true );
453	+ $responce->setHeader( 'Content-type', 'application/force-download' );
454	+ $responce->setHeader( 'Content-Length', filesize($filepath) );
455	+ $responce->setHeader('Content-Disposition', 'attachment' . '; filename=' . basename($filepath) );
456	+ $responce->clearBody();
457	+ $responce->sendHeaders();
458	+ readfile( $filepath );
459	+ return;
460	+ }
461	+ else
462	+ {
463	+ Mage::getSingleton('adminhtml/session')->addError(
464	+ $this->__('No file exist for current profile')
465	+ );
466	+ $this->getResponse()->setRedirect($this->getUrl('//edit', array('id' => $id)));
467	+ }
468	+ }
469	+ else
470	+ {
471	+ Mage::getSingleton('adminhtml/session')->addError(
472	+ $this->__('file path and name is not defined')
473	+ );
474	+ $this->getResponse()->setRedirect($this->getUrl('//edit', array('id' => $id)));
475	+ }
476	+ }
477	+
478	+ //save file fron ftp to local server
479	+ public function saveOnLocalFromFtp($data)
480	+ {
481	+ $filepath = $data['filepath'];
482	+ $path = 'var/export/ftp';
483	+ $file = $path.$filepath;//temp file path on local server
484	+ $exported = explode('/',$file);
485	+ $filename = $exported[count($exported)-1];
486	+ unset($exported[count($exported)-1]);
487	+
488	+
489	+
490	+ $remote_file = $filepath;//remote file path
491	+
492	+ //create path if not exist
493	+ $tempPath = implode('/',$exported);
494	+ if (!file_exists($tempPath)) {
495	+ mkdir($tempPath, 0777, true);
496	+ }
497	+
498	+ // set up basic connection
499	+ $conn_id = ftp_connect($data['host']);
500	+
501	+ // login with username and password
502	+ $login_result = ftp_login($conn_id, $data['user'], $data['pass']);
503	+
504	+
505	+ $fileMode = FTP_BINARY;
506	+
507	+
508	+ if (ftp_get($conn_id, $file,$remote_file, $fileMode)) {
509	+ $message = Mage::helper('dataflow')->__('successfully loaded '). $remote_file;
510	+ //$this->addException($message);
511	+ } else {
512	+ $message = Mage::helper('dataflow')->__('There was a problem while loading '). $remote_file;
513	+ Mage::getSingleton('adminhtml/session')->addError(
514	+ $this->__('file path / name is not defined')
515	+ );
516	+ $this->getResponse()->setRedirect($this->getUrl('//edit', array('id' => $id)));
517	+ }
518	+ // close the connection and the file handler
519	+ ftp_close($conn_id);
520	+
521	+ return $file;
522	+ }
523	+
524	+
525	+ /**
526	+ * Customer orders grid
527	+ *
528	+ */
529	+ public function historyAction() {
530	+ $this->_initProfile();
531	+ $this->getResponse()->setBody(
532	+ $this->getLayout()->createBlock('adminhtml/system_convert_profile_edit_tab_history')->toHtml()
533	+ );
534	+ }
535	+
536	+ /*
537	+ public function authenticateTokenAction(){
538	+ if (isset($_GET['code'])) {
539	+ echo '<pre>';
540	+ $client = Mage::getSingleton('core/session')->getGmailClient();
541	+ var_dump($client);
542	+ $client->authenticate($_GET['code']);
543	+ Mage::getSingleton('core/session')->setGmailToken($client->getAccessToken());
544	+ var_dump(Mage::getSingleton('core/session')->getGmailToken());
545	+
546	+ }
547	+ }
548	+ */
549	+ }
550	+

app/code/community/PI/Oopsprofile/controllers/ApiController.php ADDED Viewed

	@@ -0,0 +1,214 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_ApiController extends Mage_Core_Controller_Front_Action {
4	+
5	+ //Display Api responsce action
6	+ public function indexAction()
7	+ {
8	+ try{
9	+ $this->getResponse()->setHeader('Content-type', 'text/xml; charset=UTF-8');
10	+
11	+ $request = $this->getRequest()->getParams();
12	+
13	+ $baseUrl = Mage::getBaseUrl();
14	+
15	+ $result = '';
16	+
17	+ $client = new Zend_XmlRpc_Client($baseUrl.'api/xmlrpc/');
18	+
19	+ //$client = new Zend_XmlRpc_Client('http://magento.PI.tv/extensions/magento-1.7.0.2/index.php/api/xmlrpc/');
20	+
21	+ // If somestuff requires api authentification,
22	+ // then get a session token
23	+ $session = $client->call('login', array('OopsProfileUser', 'oopsprofileapikey'));
24	+
25	+ if($request['entity']=='product')
26	+ {
27	+ $result = $client->call('call', array($session, 'oopsprofile.exportproductdata', array(array('profileid'=>$request['id']))));
28	+ }
29	+ else if($request['entity']=='customer')
30	+ {
31	+ $result = $client->call('call', array($session, 'oopsprofile.exportcustomerdata', array(array('profileid'=>$request['id']))));
32	+ }
33	+ else if($request['entity']=='customergroup')
34	+ {
35	+ $result = $client->call('call', array($session, 'oopsprofile.exportcustomergroupdata', array(array('profileid'=>$request['id']))));
36	+ }
37	+ else if($request['entity']=='order')
38	+ {
39	+ $result = $client->call('call', array($session, 'oopsprofile.exportorderdata', array(array('profileid'=>$request['id']))));
40	+ }
41	+ else if($request['entity']=='invoice')
42	+ {
43	+ $result = $client->call('call', array($session, 'oopsprofile.exportinvoicedata', array(array('profileid'=>$request['id']))));
44	+ }
45	+ else if($request['entity']=='shipment')
46	+ {
47	+ $result = $client->call('call', array($session, 'oopsprofile.exportshipmentdata', array(array('profileid'=>$request['id']))));
48	+ }
49	+ else if($request['entity']=='creditmemo')
50	+ {
51	+ $result = $client->call('call', array($session, 'oopsprofile.exportcreditmemodata', array(array('profileid'=>$request['id']))));
52	+ }
53	+ else
54	+ {
55	+ $result = "<error>".Mage::helper('oopsprofile')->__('Entity data not exist')."</error>";
56	+ }
57	+ }
58	+ catch(Exception $e)
59	+ {
60	+ $result = "<error>".$e->getMessage()."</error>";
61	+ }
62	+
63	+ $this->getResponse()->setBody($result);
64	+
65	+ // end session
66	+ $client->call('endSession', array($session));
67	+ }
68	+
69	+ public function testAction()
70	+ {
71	+ //echo 1;
72	+ $fileName = Mage::getBaseDir().'/samplexml.xml';
73	+ echo $Name = Mage::getBaseDir().'/finalxml.xml';
74	+
75	+ $xmlInstance = new Varien_Simplexml_Config($fileName);
76	+
77	+ $xml = $xmlInstance->getNode();
78	+
79	+ //$feed = file_get_contents($fileName);
80	+ //$xml = new SimpleXmlElement($feed);
81	+
82	+ //print_r($xml);
83	+
84	+ //file_put_contents($Name,$xmlInstance->getNode()->loadString());
85	+
86	+ $xmlArray = array();
87	+
88	+ if($xml->hasChildren())
89	+ {
90	+ $subXml = $xml->children();
91	+ foreach($subXml as $key=>$value)
92	+ {
93	+ echo $key;
94	+
95	+ $this->_hasChildXml($value);
96	+
97	+ }
98	+ }
99	+ else
100	+ {
101	+ //echo $xml;
102	+ }
103	+
104	+
105	+ /*foreach ($xml->channel->item as $entry){
106	+ echo $entry->title;
107	+ echo $entry->description;
108	+ $namespaces = $entry->getNameSpaces(true);
109	+ foreach($namespaces as $key=>$url)
110	+ {
111	+ $alias = $entry->children($url);
112	+ echo $alias->price;
113	+ }
114	+ }*/
115	+
116	+ //echo '<pre>';print_r($xmlArray);
117	+
118	+ }
119	+
120	+ public function _hasChildXml($value)
121	+ {
122	+ echo '<br/>';
123	+ if($value->hasChildren())
124	+ {
125	+ $xml = $value;
126	+ $subXml = $xml->children();
127	+
128	+ foreach($subXml as $key=>$value)
129	+ {
130	+ echo $key;
131	+
132	+
133	+
134	+ $this->_hasChildXml($value);
135	+
136	+
137	+ }
138	+ }
139	+ else
140	+ {
141	+ //echo $value;
142	+ }
143	+ }
144	+
145	+ public function test2Action()
146	+ {
147	+
148	+ $fileName = Mage::getBaseDir().'/samplexml.xml';
149	+ $Name = Mage::getBaseDir().'/finalxml.xml';
150	+
151	+
152	+ $file = fopen($fileName, "r");
153	+ //Output a line of the file until the end is reached
154	+ while(!feof($file))
155	+ {
156	+ echo $content = fgets($file);
157	+
158	+
159	+ $fileput = fopen($Name,"w");
160	+ fputs($fileput,$content);
161	+ exit;
162	+
163	+ }
164	+
165	+ fclose($file);
166	+ }
167	+
168	+ public function test3Action()
169	+ {
170	+ $fileName = '<?xml version="1.0" encoding="utf-8" ?>
171	+ <xmlcontent>
172	+ <rss version="2.0" xmlns:g="http://base.google.com/ns/1.0">
173	+ <channel>
174	+ <title>Data feed Title</title>
175	+ <link>{base_url}</link>
176	+ <description>Data feed description.</description>
177	+ {each type="product"}
178	+ <item>
179	+ <title><![CDATA[{name}]]></title>
180	+ <link><![CDATA[{url}]]></link>
181	+ <g:price>{price}</g:price>
182	+ <g:online_only>y</g:online_only>
183	+ <description><![CDATA[{description,[strip_tags]}]]></description>
184	+ <g:product_type><![CDATA[{category_path}]]></g:product_type>
185	+ <g:google_product_category><![CDATA[]]></g:google_product_category>
186	+ <g:image_link>{image}</g:image_link>
187	+ <g:condition>new</g:condition>
188	+ <g:availability>in stock</g:availability>
189	+ <g:quantity>{qty}</g:quantity>
190	+ <g:color><![CDATA[{color}]]></g:color>
191	+ <g:shipping_weight>{weight, [number_format 2]} kilograms</g:shipping_weight>
192	+ <g:manufacturer><![CDATA[{manufacturer}]]></g:manufacturer>
193	+ <g:brand><![CDATA[{manufacturer}]]></g:brand>
194	+ <g:mpn><![CDATA[{sku}]]></g:mpn>
195	+ <g:gtin><![CDATA[{upc}]]></g:gtin>
196	+ </item>
197	+ {/each}
198	+ </channel>
199	+ </rss>
200	+ </xmlcontent>';
201	+
202	+
203	+ $content = explode('{each type="product"}',$fileName);
204	+ $top = $content[0];
205	+ //echo $content[1];
206	+ $content1 = explode('{/each}',$content[1]);
207	+ $middle = $content1[0];
208	+ $bottom = $content1[1];
209	+ $key = 'name';
210	+ $middle = str_replace('{'.$key.'}','testing',$middle);
211	+ echo $middle;
212	+ }
213	+
214	+ }

app/code/community/PI/Oopsprofile/controllers/OopsprofileController.php ADDED Viewed

	@@ -0,0 +1,88 @@


1	+ <?php
2	+
3	+ class PI_Oopsprofile_OopsprofileController extends Mage_Core_Controller_Front_Action {
4	+
5	+ protected function readProfileFromFile() {
6	+
7	+ $path = Mage::getBaseDir('var') . DS . 'gmail';
8	+ $file = 'oops_profile_mail_client.tmp';
9	+
10	+ $io = new Varien_Io_File();
11	+ $io->open(array('path' => $path));
12	+ $content = $io->read($file);
13	+ $io->rm($file); //remove file
14	+ $io->close();
15	+
16	+ return unserialize($content);
17	+ }
18	+
19	+ /*
20	+ * Save Token for the oopsprofile
21	+ */
22	+
23	+ public function authenticateNsaveTokenAction() {
24	+
25	+ Mage::getSingleton('adminhtml/session')->unsAuthenticationUrl();
26	+ if ($code = Mage::app()->getRequest()->getParam('code')) {
27	+
28	+ $config = $this->readProfileFromFile();
29	+ if (!$config) {
30	+
31	+ return Mage::getSingleton('core/session')->addError('unable to read the profile.');
32	+ } else {
33	+
34	+ $tokenFile = 'oops_' . $config['profile_id'] . '_' . 'mail.tmp';
35	+ $tokenPath = Mage::getBaseDir('var') . DS . 'token';
36	+
37	+ try {
38	+
39	+ $client = Mage::getSingleton('oopsprofile/mail_google_client');
40	+ $client->setClientId($config['email']['gmail']['client_id']);
41	+ $client->setClientSecret($config['email']['gmail']['client_secret']);
42	+ $client->setRedirectUri($config['email']['gmail']['redirect_uri']);
43	+ $client->setDeveloperKey($config['email']['gmail']['developer_key']);
44	+
45	+ $client->setScopes("https://mail.google.com/");
46	+
47	+ $client->authenticate($code);
48	+
49	+ if ($token = $client->getAccessToken()) {
50	+
51	+ $io = new Varien_Io_File();
52	+ $io->setAllowCreateFolders(true);
53	+ $io->open(array('path' => $tokenPath));
54	+ $io->streamOpen($tokenFile, 'w');
55	+ $io->streamLock(true);
56	+ $io->streamWrite($token);
57	+ $io->close();
58	+
59	+ //set Access Token has been generated to the table serialize and save it to DB
60	+ $oopsProfile = Mage::getModel('oopsprofile/oopsprofile')->loadByProfile($config['profile_id']);
61	+ $oopsProfile->setIsTokenAvailable(1)->save();
62	+
63	+ $this->loadLayout();
64	+
65	+ Mage::getSingleton('core/session')->setAccessTokenGmail($token);
66	+ Mage::getSingleton('core/session')->addSuccess(Mage::helper('oopsprofile')->__('Access token has been saved.'));
67	+ } else {
68	+ Mage::getSingleton('core/session')->addError(Mage::helper('oopsprofile')->__('Problem detected saving access token.'));
69	+ }
70	+ } catch (Exception $e) {
71	+ //print_r($e);
72	+ Mage::log($e);
73	+ }
74	+ }
75	+ }
76	+
77	+ $this->renderLayout();
78	+ }
79	+
80	+ /*public function testAction()
81	+ {
82	+ $processes = Mage::getSingleton('index/indexer')->getProcessesCollection();
83	+ $processes->walk('setMode', array(Mage_Index_Model_Process::MODE_MANUAL));
84	+ $processes->walk('save');
85	+ }*/
86	+
87	+
88	+ }

app/code/community/PI/Oopsprofile/etc/adminhtml.xml ADDED Viewed

	@@ -0,0 +1,35 @@


1	+ <?xml version="1.0"?>
2	+ <config>
3	+ <menu>
4	+ <oopsimportexport>
5	+ <title>PI Import Export</title>
6	+ <sort_order>80</sort_order>
7	+ <children>
8	+ <profile_way module="oopsprofile">
9	+ <title>Manage Profile</title>
10	+ <sort_order>2</sort_order>
11	+ <action>adminhtml/oopsprofile</action>
12	+ </profile_way>
13	+ </children>
14	+ </oopsimportexport>
15	+ </menu>
16	+ <acl>
17	+ <resources>
18	+ <all>
19	+ <title>Allow Everything</title>
20	+ </all>
21	+ <admin>
22	+ <children>
23	+ <oopsimportexport>
24	+ <title>PI Import Export</title>
25	+ <sort_order>250</sort_order>
26	+ <profile_way>
27	+ <title>Manage Profile</title>
28	+ <sort_order>10</sort_order>
29	+ </profile_way>
30	+ </oopsimportexport>
31	+ </children>
32	+ </admin>
33	+ </resources>
34	+ </acl>
35	+ </config>

app/code/community/PI/Oopsprofile/etc/config.xml ADDED Viewed

	@@ -0,0 +1,162 @@


1	+ <?xml version="1.0"?>
2	+ <config>
3	+ <modules>
4	+ <PI_Oopsprofile>
5	+ <version>0.2.0</version>
6	+ </PI_Oopsprofile>
7	+ </modules>
8	+
9	+ <frontend>
10	+ <routers>
11	+ <oopsprofile>
12	+ <use>standard</use>
13	+ <args>
14	+ <module>PI_Oopsprofile</module>
15	+ <frontName>oopsprofile</frontName>
16	+ </args>
17	+ </oopsprofile>
18	+ </routers>
19	+ </frontend>
20	+
21	+ <admin>
22	+ <routers>
23	+ <adminhtml>
24	+ <args>
25	+ <modules>
26	+ <PI_Oopsprofile before="Mage_Adminhtml">PI_Oopsprofile_Adminhtml</PI_Oopsprofile>
27	+ </modules>
28	+ </args>
29	+ </adminhtml>
30	+ </routers>
31	+ </admin>
32	+ <adminhtml>
33	+ <layout>
34	+ <updates>
35	+ <oopsprofile>
36	+ <file>oopsprofile.xml</file>
37	+ </oopsprofile>
38	+ </updates>
39	+ </layout>
40	+ </adminhtml>
41	+ <global>
42	+ <events>
43	+ <oopsprofile_create_api>
44	+ <observers>
45	+ <createapi>
46	+ <class>PI_Oopsprofile_Model_Createapiobserver</class>
47	+ <method>createapi</method>
48	+ </createapi>
49	+ </observers>
50	+ </oopsprofile_create_api>
51	+ <!--Save with magento's default form-->
52	+ <!--oopsprofile_profile_save_after>
53	+ <observers>
54	+ <save_cron_info>
55	+ <type>singleton</type>
56	+ <class>PI_Oopsprofile_Model_CronObserver</class>
57	+ <method>saveCronSchedule</method>
58	+ </save_cron_info>
59	+ </observers>
60	+ </oopsprofile_profile_save_after-->
61	+
62	+ <oopsprofile_profile_save_after>
63	+ <observers>
64	+ <save_cron_info>
65	+ <type>singleton</type>
66	+ <class>PI_Oopsprofile_Model_CronObserver</class>
67	+ <method>saveOopsCronSchedule</method>
68	+ </save_cron_info>
69	+ </observers>
70	+ </oopsprofile_profile_save_after>
71	+ <oopsprofile_profile_delete_after>
72	+ <observers>
73	+ <delete_cron_info>
74	+ <type>singleton</type>
75	+ <class>PI_Oopsprofile_Model_CronObserver</class>
76	+ <method>deleteCronSchedule</method>
77	+ </delete_cron_info>
78	+ </observers>
79	+ </oopsprofile_profile_delete_after>
80	+ </events>
81	+ <models>
82	+ <dataflow>
83	+ <rewrite>
84	+ <profile>PI_Oopsprofile_Model_Dataflow_Profile</profile>
85	+ <profile_history>PI_Oopsprofile_Model_Dataflow_Profile_History</profile_history>
86	+ <batch_io>PI_Oopsprofile_Model_Dataflow_Batch_Io</batch_io>
87	+ </rewrite>
88	+ </dataflow>
89	+ <oopsprofile>
90	+ <class>PI_Oopsprofile_Model</class>
91	+ <resourceModel>oopsprofile_mysql4</resourceModel>
92	+ </oopsprofile>
93	+ <oopsprofile_mysql4>
94	+ <class>PI_Oopsprofile_Model_Mysql4</class>
95	+ <entities>
96	+ <oopsprofile>
97	+ <table>oops_importexport_profile</table>
98	+ </oopsprofile>
99	+ <mapping>
100	+ <table>oops_category_mapping</table>
101	+ </mapping>
102	+ <template>
103	+ <table>oops_template</table>
104	+ </template>
105	+ </entities>
106	+ </oopsprofile_mysql4>
107	+ </models>
108	+ <resources>
109	+ <oopsprofile_setup>
110	+ <setup>
111	+ <module>PI_Oopsprofile</module>
112	+ </setup>
113	+ <connection>
114	+ <use>core_setup</use>
115	+ </connection>
116	+ </oopsprofile_setup>
117	+ <oopsprofile_write>
118	+ <connection>
119	+ <use>core_write</use>
120	+ </connection>
121	+ </oopsprofile_write>
122	+ <oopsprofile_read>
123	+ <connection>
124	+ <use>core_read</use>
125	+ </connection>
126	+ </oopsprofile_read>
127	+ </resources>
128	+ <blocks>
129	+ <!--rule>
130	+ <rewrite>
131	+ <conditions>PI_Oopsprofile_Block_Rule_Conditions</conditions>
132	+ </rewrite>
133	+ </rule-->
134	+ <adminhtml>
135	+ <rewrite>
136	+ <system_convert_gui_grid>PI_Oopsprofile_Block_Adminhtml_System_Convert_Gui_Grid</system_convert_gui_grid>
137	+ </rewrite>
138	+ </adminhtml>
139	+ <oopsprofile>
140	+ <class>PI_Oopsprofile_Block</class>
141	+ </oopsprofile>
142	+ </blocks>
143	+ <helpers>
144	+ <oopsprofile>
145	+ <class>PI_Oopsprofile_Helper</class>
146	+ </oopsprofile>
147	+ </helpers>
148	+ </global>
149	+ <default>
150	+ <general>
151	+ <file>
152	+ <importexport_local_valid_paths>
153	+ <available>
154	+ <export_txt>var/export//.txt</export_txt>
155	+ <import_txt>var/import//.txt</import_txt>
156	+ </available>
157	+ </importexport_local_valid_paths>
158	+ <bunch_size>100</bunch_size>
159	+ </file>
160	+ </general>
161	+ </default>
162	+ </config>

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-install-0.1.0.php ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ <?php
2	+
3	+ $installer = $this;
4	+
5	+ $installer->startSetup();
6	+
7	+ $installer->run("
8	+ DROP TABLE IF EXISTS {$this->getTable('oopsprofile/oopsprofile')};
9	+ CREATE TABLE {$this->getTable('oopsprofile/oopsprofile')} (
10	+ `oops_profile_id` int(11) unsigned NOT NULL auto_increment,
11	+ `dataflow_profile_id` int(11) UNSIGNED,
12	+ PRIMARY KEY (`oops_profile_id`)
13	+ ) ENGINE = INNODB CHARSET=utf8;
14	+
15	+ ");
16	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.0-0.1.1.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+ /*
3	+ * Add 'service', 'oauth_url' to the oops table
4	+ */
5	+
6	+
7	+ $installer = $this;
8	+
9	+ $table = $installer->getTable('oopsprofile/oopsprofile');
10	+
11	+ $installer->startSetup();
12	+
13	+ $installer->getConnection()->addColumn($table, 'service_type', 'varchar(255)');
14	+ $installer->getConnection()->addColumn($table, 'oauth_url', 'varchar(510)');
15	+ $installer->getConnection()->addColumn($table, 'is_token_available', 'smallint(5)');
16	+
17	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.1-0.1.2.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+
3	+
4	+ $installer = $this;
5	+
6	+ $table = $installer->getTable('oopsprofile/oopsprofile');
7	+
8	+ $installer->startSetup();
9	+
10	+ $installer->getConnection()
11	+ ->addConstraint(
12	+ 'FK_ITEMS_RELATION_ITEM',
13	+ $table,
14	+ 'dataflow_profile_id',
15	+ $installer->getTable('dataflow/profile'),
16	+ 'profile_id',
17	+ 'cascade',
18	+ 'cascade'
19	+ );
20	+
21	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.2-0.1.3.php ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ <?php
2	+ /*
3	+ * Add 'conditions_serialized' to the oops table
4	+ */
5	+
6	+
7	+ $installer = $this;
8	+
9	+ $table = $installer->getTable('oopsprofile/oopsprofile');
10	+
11	+ $installer->startSetup();
12	+
13	+ $installer->getConnection()->addColumn($table,'conditions_serialized','mediumtext');
14	+
15	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.3-0.1.4.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+
3	+
4	+
5	+ $installer = $this;
6	+
7	+ $table = $installer->getTable('oopsprofile/oopsprofile');
8	+
9	+ $installer->startSetup();
10	+
11	+ //$installer->getConnection()->addColumn($table,'run_on_product_save','int(5)');
12	+
13	+ //$installer->getConnection()->addColumn($table,'run_on_category_save','int(5)');
14	+
15	+ $installer->getConnection()->addColumn($table,'profile_direction','varchar(50)');
16	+
17	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.4-0.1.5.php ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ <?php
2	+
3	+
4	+
5	+ $installer = $this;
6	+
7	+ $table = $installer->getTable('oopsprofile/oopsprofile');
8	+
9	+ $installer->startSetup();
10	+
11	+ $installer->getConnection()->addColumn($table,'profile_enable','int(5)');
12	+
13	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.5-0.1.6.php ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ <?php
2	+
3	+
4	+
5	+ $installer = $this;
6	+
7	+ $table = $installer->getTable('oopsprofile/oopsprofile');
8	+
9	+ $installer->startSetup();
10	+
11	+ $installer->getConnection()->addColumn($table,'save_local_copy','int(5) default 0');
12	+
13	+ $installer->getConnection()->addColumn($table,'products_allready_done','int(5) default 1');
14	+
15	+ $installer->getConnection()->addColumn($table,'save_products_separately','int(5) default 0');
16	+
17	+ $installer->getConnection()->addColumn($table,'profile_template','int(5) default 0 ');
18	+
19	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.6-0.1.7.php ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ <?php
2	+
3	+ $installer = $this;
4	+
5	+ $installer->startSetup();
6	+
7	+ $installer->run("
8	+ DROP TABLE IF EXISTS {$this->getTable('oopsprofile/mapping')};
9	+ CREATE TABLE {$this->getTable('oopsprofile/mapping')} (
10	+ `category_map_id` int(11) unsigned NOT NULL auto_increment,
11	+ `category_map_name` varchar(255),
12	+ `mapping_detail` varchar(1000),
13	+ PRIMARY KEY (`category_map_id`)
14	+ ) ENGINE = INNODB CHARSET=utf8;
15	+
16	+ ");
17	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.7-0.1.8.php ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?php
2	+
3	+ $installer = $this;
4	+
5	+ $installer->startSetup();
6	+
7	+ $installer->run("
8	+ DROP TABLE IF EXISTS {$this->getTable('oopsprofile/template')};
9	+ CREATE TABLE {$this->getTable('oopsprofile/template')} (
10	+ `temp_id` int(11) unsigned NOT NULL auto_increment,
11	+ `temp_name` varchar(255),
12	+ `temp_file_type` varchar(255),
13	+ `fields_mapping_xml` varchar(1000),
14	+ `data_format_xml` varchar(500),
15	+ `gui_data` varchar(5000),
16	+ PRIMARY KEY (`temp_id`)
17	+ ) ENGINE = INNODB CHARSET=utf8;
18	+
19	+ ");
20	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.8-0.1.9.php ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ <?php
2	+
3	+
4	+
5	+ $installer = $this;
6	+
7	+ $table = $installer->getTable('oopsprofile/template');
8	+
9	+ $installer->startSetup();
10	+
11	+ $installer->getConnection()->addColumn($table,'selected_profile','int(5) default 0 ');
12	+
13	+ $installer->getConnection()->addColumn($table,'category_mapping','int(5) default 0 ');
14	+
15	+ $installer->endSetup();

app/code/community/PI/Oopsprofile/sql/oopsprofile_setup/mysql4-upgrade-0.1.9-0.2.0.php ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ <?php
2	+
3	+
4	+
5	+ $installer = $this;
6	+
7	+ $table = $installer->getTable('oopsprofile/oopsprofile');
8	+
9	+ $installer->startSetup();
10	+
11	+ $installer->getConnection()->addColumn($table,'xml_content','varchar(10000) default "" ');
12	+
13	+ $installer->getConnection()->addColumn($table,'enable_content','int(5) default 0');
14	+
15	+ $installer->endSetup();

app/design/adminhtml/default/default/layout/oopsprofile.xml ADDED Viewed

	@@ -0,0 +1,47 @@


1	+ <?xml version="1.0"?>
2	+ <layout>
3	+ <adminhtml_oopsprofile_run>
4	+ <remove name="root"/>
5	+ <block type="adminhtml/page" name="convert_root" output="toHtml" template="page.phtml">
6	+ <block type="adminhtml/page_head" name="convert_root_head" as="head" template="page/head.phtml">
7	+ <action method="addJs"><script>prototype/prototype.js</script></action>
8	+ <action method="addJs"><script>prototype/validation.js</script></action>
9	+ <action method="addJs"><script>varien/js.js</script></action>
10	+ <action method="addJs"><script>mage/translate.js</script></action>
11	+ <action method="addJs"><script>mage/adminhtml/tools.js</script></action>
12	+ </block>
13	+ <block type="oopsprofile/adminhtml_run" name="oopsprofile_run" template="oopsprofile/process.phtml" output="toHtml"/>
14	+ </block>
15	+ </adminhtml_oopsprofile_run>
16	+ <adminhtml_oopsprofile_edit>
17	+ <reference name="head">
18	+ <action method="setCanLoadExtJs"><flag>1</flag></action>
19	+ <action method="setCanLoadRulesJs"><flag>1</flag></action>
20	+ <action method="addItem"><type>skin_css</type><name>oopsprofile/css/oopsprofile.css</name></action>
21	+ </reference>
22	+ </adminhtml_oopsprofile_edit>
23	+ <adminhtml_mapping_edit>
24	+ <reference name="head">
25	+ <action method="addItem"><type>skin_css</type><name>oopsprofile/css/oopsprofile.css</name></action>
26	+ <action method="addItem"><type>skin_js</type><name>oopsprofile/js/jquery-1.4.4.js</name></action>
27	+ <action method="addItem"><type>skin_css</type><name>oopsprofile/css/jquery-ui-1.8.12.custom.css</name></action>
28	+ <action method="addItem"><type>skin_css</type><name>oopsprofile/css/jquery.checkboxtree.css</name></action>
29	+ <action method="addItem"><type>skin_js</type><name>oopsprofile/js/jquery-ui-1.8.12.custom.min.js</name></action>
30	+ <action method="addItem"><type>skin_js</type><name>oopsprofile/js/jquery.checkboxtree.js</name></action>
31	+ </reference>
32	+ </adminhtml_mapping_edit>
33	+
34	+ <adminhtml_template_run>
35	+ <remove name="root"/>
36	+ <block type="adminhtml/page" name="convert_root" output="toHtml" template="page.phtml">
37	+ <block type="adminhtml/page_head" name="convert_root_head" as="head" template="page/head.phtml">
38	+ <action method="addJs"><script>prototype/prototype.js</script></action>
39	+ <action method="addJs"><script>prototype/validation.js</script></action>
40	+ <action method="addJs"><script>varien/js.js</script></action>
41	+ <action method="addJs"><script>mage/translate.js</script></action>
42	+ <action method="addJs"><script>mage/adminhtml/tools.js</script></action>
43	+ </block>
44	+ <block type="oopsprofile/adminhtml_run" name="oopsprofile_run" template="oopsprofile/process.phtml" output="toHtml"/>
45	+ </block>
46	+ </adminhtml_template_run>
47	+ </layout>

app/design/adminhtml/default/default/template/oopsprofile/general.phtml ADDED Viewed

	@@ -0,0 +1,417 @@


1	+ <?php
2	+ /**
3	+ * @methods
4	+ * - getValue($key, $default)
5	+ * - getSelected($key, $value)
6	+ * - getChecked($key)
7	+ * - getAttributes()
8	+ * - getMappings()
9	+ * - getAddMapButtonHtml()
10	+ * - getRemoveMapButtonHtml()
11	+ */
12	+ ?>
13	+
14	+ <script type="text/javascript">
15	+ //<![CDATA[
16	+ var profileImportOnly = ['profile_number_of_records', 'profile_decimal_separator'];
17	+ var check=0;
18	+ function showOption(select)
19	+ {
20	+ select = $(select);
21	+ for (var i = 0, l = select.options.length; i<l; i++) {
22	+ $$('.'+select.id+'_'+select.options[i].value).each(function (el) {
23	+ el.style.display = select.selectedIndex==i ? '' : 'none';
24	+ });
25	+ }
26	+
27	+ var Selectedvalue = select.value;
28	+
29	+ var selectDataFormat = document.getElementById("parse_type");
30	+ var selectProfileWay=document.getElementById("profile_data_transfer");
31	+
32	+
33	+ if(selectDataFormat.value!='')
34	+ {
35	+ displayFirstRowSelect(selectDataFormat.value);
36	+ }
37	+
38	+ var entityType = $('profile_entity_type').value;
39	+
40	+ if(Selectedvalue=='import' \|\| Selectedvalue=='export')
41	+ {
42	+ displayBasedOnProfileDirection(Selectedvalue);
43	+ //displayBasedOnEntity(entityType);
44	+ }
45	+ if(Selectedvalue=='import' \|\| Selectedvalue=='export' \|\| entityType!='')
46	+ {
47	+ //displayBasedOnProfileDirection(Selectedvalue);
48	+ displayBasedOnEntity(entityType);
49	+ }
50	+
51	+ var wayType = $('profile_data_transfer').value;
52	+ if(wayType!='')
53	+ {
54	+ displyBasedOnWayType(wayType);
55	+ }
56	+
57	+
58	+ if(selectProfileWay.value!='')
59	+ {
60	+ displayBasedOnWay(selectProfileWay.value);
61	+ }
62	+
63	+
64	+ /Check xml content is enable or not(in case of export && product)/
65	+ //var isContent = $('enable_content').value;
66	+ var direction = $('profile_direction').value;
67	+ var format = $('parse_type').value;
68	+ /**if(direction == 'export' && entityType=='product' && format == 'xml')
69	+ {
70	+ //$('parse_type_xml').show();
71	+ }
72	+ else
73	+ {
74	+ //$('parse_type_xml').hide();
75	+ $('enable_content').value = 0;
76	+ }
77	+ if(isContent == 1)
78	+ {
79	+ $('xml_content_row').show();
80	+ //$('product_attr_xml_parsing').show();
81	+ }
82	+ else
83	+ {
84	+ $('xml_content_row').hide();
85	+ //$('product_attr_xml_parsing').hide();
86	+ $('enable_content').value = 0;
87	+ }**/
88	+
89	+ //display attribute for xml format
90	+ //var Productattr = $('product_attrs').value;
91	+ var Productattr = '';
92	+
93	+ if(Productattr!='')
94	+ {
95	+
96	+ //$('display_att_field').innerHTML = '{'+Productattr+'}';
97	+ }
98	+ }
99	+
100	+ function displyBasedOnWayType(wayType)
101	+ {
102	+ var entityType = $('profile_entity_type').value;
103	+
104	+ var direction = $('profile_direction').value;
105	+
106	+ if(wayType=='api' \|\| wayType=='http' \|\| wayType=='mail')
107	+ {
108	+ //Element.hide($('save_local_copy_row'));
109	+
110	+ //Element.hide($('save_products_separately_row'));
111	+
112	+ if(entityType!='product' && entityType!='customer' && wayType=='api')
113	+ {
114	+ Element.hide($('convert_profile_tabs_profiletemplate'));
115	+ }
116	+
117	+ }
118	+ else
119	+ {
120	+ if(entityType=='product' && direction=='export')
121	+ {
122	+ //Element.show($('save_products_separately_row'));
123	+ }
124	+ else
125	+ {
126	+ //Element.hide($('save_products_separately_row'));
127	+ }
128	+ if(direction=='export')
129	+ {
130	+ //Element.show($('save_local_copy_row'));
131	+ }
132	+ Element.show($('convert_profile_tabs_profiletemplate'));
133	+ }
134	+ }
135	+
136	+ function displayBasedOnEntity(entityType)
137	+ {
138	+ var direction = $('profile_direction').value;
139	+
140	+
141	+
142	+ if(entityType=='product' \|\| entityType=='customer')
143	+ {
144	+ Element.show($('__fieldmapping'));
145	+ if(direction=='export')
146	+ {
147	+ Element.show($('profile_direction_export_row'));
148	+ }
149	+ if(entityType=='product' && direction=='export')
150	+ {
151	+ Element.show($('convert_profile_tabs_profilefilter'));
152	+ Element.show($('filters-for-product'));
153	+
154	+ Element.show($('products_allready_done_row'));
155	+
156	+ }
157	+ else
158	+ {
159	+ Element.hide($('products_allready_done_row'));
160	+ Element.hide($('convert_profile_tabs_profilefilter'));
161	+
162	+ }
163	+ }
164	+ else
165	+ {
166	+
167	+ if(entityType!='customergroup' && direction=='export')
168	+ {
169	+ Element.show($('convert_profile_tabs_profilefilter'));
170	+ }
171	+ else
172	+ {
173	+ Element.hide($('convert_profile_tabs_profilefilter'));
174	+ }
175	+
176	+ if(entityType=='customergroup')
177	+ {
178	+ Element.hide($('__fieldmapping'));
179	+ Element.hide($('profile_direction_export_row'));
180	+ }
181	+ else
182	+ {
183	+ Element.show($('__fieldmapping'));
184	+ if(direction=='export')
185	+ {
186	+ Element.show($('profile_direction_export_row'));
187	+ }
188	+ }
189	+
190	+ Element.hide($('filters-for-product'));
191	+ Element.hide($('products_allready_done_row'));
192	+ }
193	+ }
194	+
195	+ function displayBasedOnWay(value)
196	+ {
197	+
198	+ var selectDataFormat=document.getElementById("parse_type");
199	+ var selectedProfileDirection=document.getElementById("profile_direction");
200	+
201	+
202	+
203	+ if(value == 'api')
204	+ {
205	+ Element.hide($('parse_type_row'));
206	+ Element.hide($('parse_type_csv'));//if we add a new profile with api
207	+ if(selectedProfileDirection.value=='export')
208	+ {
209	+ Element.hide($('first-row-display-row1'));
210	+ Element.hide($('first-row-display-row2'));
211	+ Element.show($('data-format-display-div'));
212	+ }
213	+ else
214	+ {
215	+ Element.hide($('data-format-display-div'));
216	+ }
217	+ }
218	+ else
219	+ {
220	+ Element.show($('data-format-display-div'));
221	+ Element.show($('first-row-display-row1'));
222	+ Element.show($('first-row-display-row2'));
223	+ Element.show($('parse_type_row'));
224	+ if(selectDataFormat.value=='csv')
225	+ {
226	+ Element.show($('parse_type_csv'));//if we add a new profile with api
227	+ }
228	+ }
229	+
230	+ }
231	+
232	+ function addFieldMapping()
233	+ {
234	+ var entityType = $('profile_entity_type').value;
235	+ Element.insert($('map_container_'+entityType), {bottom: $('map_template_'+entityType).innerHTML});
236	+ }
237	+
238	+ function removeFieldMapping(button)
239	+ {
240	+ Element.remove(button.parentNode);
241	+ }
242	+
243	+ function setMapFileField(select)
244	+ {
245	+ select.parentNode.getElementsByTagName('input')[0].value = select.value;
246	+ }
247	+
248	+ function exportUrlField()
249	+ {
250	+ var urlFieldEl = $('profile_add_url_field').up();
251	+ var entityType = $('profile_entity_type').value;
252	+ var direction = $('profile_direction').value;
253	+ var storeId = $('profile_store_id').value;
254	+
255	+ if (entityType == 'product' && direction == 'export' && storeId > 0) {
256	+ urlFieldEl.show();
257	+ }
258	+ else {
259	+ urlFieldEl.hide();
260	+ }
261	+ }
262	+
263	+ function changeEntityType()
264	+ {
265	+ changeDirection();
266	+ }
267	+
268	+
269	+ function changeDirection()
270	+ {
271	+
272	+ if ($('profile_direction').value == 'import') {
273	+ profileImportOnly.each(function(id){if ($(id))$(id).up(1).show();});
274	+ }
275	+ else {
276	+ profileImportOnly.each(function(id){if ($(id))$(id).up(1).hide();});
277	+ }
278	+
279	+ }
280	+
281	+ function displayFirstRowSelect(value)
282	+ {
283	+ if(value=='xml')
284	+ {
285	+ Element.hide($('first-row-display-select'));
286	+ }
287	+ else
288	+ {
289	+ Element.show($('first-row-display-select'));
290	+ }
291	+ }
292	+
293	+ function displayBasedOnProfileDirection(value)
294	+ {
295	+ var selectobject=document.getElementById("profile_data_transfer");
296	+ if(value=='import')
297	+ {
298	+ selectobject.remove(2);
299	+ check=1;
300	+
301	+ }
302	+ else
303	+ {
304	+
305	+ var entityType = $('profile_entity_type').value;
306	+
307	+
308	+ if(check==1)
309	+ {
310	+ var option = document.createElement("option");
311	+ option.text = "Http Server";
312	+ option.value = "http";
313	+ selectobject.add(option,selectobject[2]);
314	+ check=0;
315	+ }
316	+ }
317	+ }
318	+
319	+
320	+ function updateRun(select)
321	+ {
322	+ if ($('file_list') != null){
323	+ $('file_list').hide();
324	+ }
325	+ var formatType = document.getElementById('parse_type').value;
326	+
327	+
328	+ var profileDirection = document.getElementById('profile_direction').value;
329	+
330	+ }
331	+
332	+ Event.observe(window, 'load', function(){
333	+
334	+
335	+ /Check for Selected Template/
336	+ //var selectedTemp = $('oops_profile_temp_id').value;
337	+ var selectedTemp = '';
338	+ var format = $('parse_type').value;
339	+ if(selectedTemp!=0 && format!='xml')
340	+ {
341	+ //$('data-format-predefined-div').show();
342	+ $('data-format-and-fields').hide();
343	+ }
344	+ else
345	+ {
346	+ if(selectedTemp!=0 && format=='xml')
347	+ {
348	+ //$('data-format-predefined-div').show();
349	+ $('data-format-and-fields').show();
350	+ }
351	+ else
352	+ {
353	+ //$('data-format-predefined-div').hide();
354	+ $('data-format-and-fields').show();
355	+ }
356	+ }
357	+
358	+
359	+
360	+ var entityType = $('profile_entity_type').value;
361	+ displayBasedOnEntity(entityType);
362	+
363	+
364	+ if($('profile_data_transfer')) {
365	+ updateRun('profile_data_transfer');
366	+ }
367	+ });
368	+ //]]>
369	+ </script>
370	+
371	+ <div id="profile-generator" class="entry-edit profile-generator">
372	+ <div class="entry-edit-head">
373	+ <h4 class="icon-head head-edit-form fieldset-legend"><?php echo $this->__("Profile Information") ?></h4>
374	+ </div>
375	+ <fieldset>
376	+ <legend><?php echo $this->__("Profile Information") ?></legend>
377	+ <span class="no-display"><input type="hidden" name="oops_profile" value="1"></span>
378	+ <span class="field-row">
379	+ <label for="profile_name"><?php echo $this->__("Name:") ?> <span class="required">*</span></label>
380	+ <input class="required-entry required-entry input-text" id="profile_name" name="name" value="<?php echo $this->getValue('name') ?>"/>
381	+ </span>
382	+ <span class="field-row">
383	+ <label for="profile_entity_type"><?php echo $this->__("Entity type:") ?></label>
384	+ <?php $oopsentityTypes = Mage::helper('oopsprofile')->entityTypeArray()?>
385	+ <select id="profile_entity_type" name="entity_type" onchange="showOption(this);changeEntityType();" class="option-control">
386	+ <?php foreach($oopsentityTypes as $key=>$value):?>
387	+ <option value="<?php echo $key?>" <?php echo $this->getSelected('entity_type', $key) ?>><?php echo $value ?></option>
388	+ <?php endforeach;?>
389	+ </select>
390	+ </span>
391	+ <span class="field-row">
392	+ <label for="profile_direction"><?php echo $this->__("Direction:") ?></label>
393	+ <select id="profile_direction" name="direction" onchange="showOption(this);changeDirection();" class="option-control">
394	+ <option value="import" <?php echo $this->getSelected('direction', 'import') ?>><?php echo $this->__("Import") ?></option>
395	+ <option value="export" <?php echo $this->getSelected('direction', 'export') ?>><?php echo $this->__("Export") ?></option>
396	+ </select>
397	+ </span>
398	+ <span class="field-row" id="profile_enable_row">
399	+ <label for="profile_enable"><?php echo $this->__("Disable Profile:") ?></label>
400	+ <select id="profile_enable" name="profile_enable" onchange="showOption(this);" class="option-control">
401	+ <option value="0" <?php echo $this->getOopsSelected('profile_enable', '0') ?>><?php echo $this->__("No") ?></option>
402	+ <option value="1" <?php echo $this->getOopsSelected('profile_enable', '1') ?>><?php echo $this->__("Yes") ?></option>
403	+ </select>
404	+ </span>
405	+ <span class="field-row profile_direction_export" id="products_allready_done_row">
406	+ <label for="products_allready_done"><?php echo $this->__("Considerate Products already done:") ?></label>
407	+ <select id="products_allready_done" name="products_allready_done" onchange="showOption(this);" class="option-control">
408	+ <option value="1" <?php echo $this->getOopsSelected('products_allready_done', '1') ?>><?php echo $this->__("Yes") ?></option>
409	+ <option value="0" <?php echo $this->getOopsSelected('products_allready_done', '0') ?>><?php echo $this->__("No") ?></option>
410	+ </select>
411	+ <small>
412	+ <?php echo $this->__(" (considerate just new products or considerate all products after installation of extension)") ?>
413	+ </small>
414	+ </span>
415	+ </fieldset>
416	+
417	+ </div>

app/design/adminhtml/default/default/template/oopsprofile/process.phtml ADDED Viewed

	@@ -0,0 +1,206 @@


1	+ <?php
2	+ /**
3	+ * Magento
4	+ *
5	+ * NOTICE OF LICENSE
6	+ *
7	+ * This source file is subject to the Academic Free License (AFL 3.0)
8	+ * that is bundled with this package in the file LICENSE_AFL.txt.
9	+ * It is also available through the world-wide-web at this URL:
10	+ * http://opensource.org/licenses/afl-3.0.php
11	+ * If you did not receive a copy of the license and are unable to
12	+ * obtain it through the world-wide-web, please send an email
13	+ * to license@magentocommerce.com so we can send you a copy immediately.
14	+ *
15	+ * DISCLAIMER
16	+ *
17	+ * Do not edit or add to this file if you wish to upgrade Magento to newer
18	+ * versions in the future. If you wish to customize Magento for your
19	+ * needs please refer to http://www.magentocommerce.com for more information.
20	+ *
21	+ * @category design
22	+ * @package default_default
23	+ * @copyright Copyright (c) 2013 Magento Inc. (http://www.magentocommerce.com)
24	+ * @license http://opensource.org/licenses/afl-3.0.php Academic Free License (AFL 3.0)
25	+ */
26	+ ?>
27	+
28	+ <style type="text/css" >
29	+ ul { list-style-type:none; padding:0; margin:0; }
30	+ li { margin-left:0; border:1px solid #ccc; margin:2px; padding:2px 2px 2px 2px; font:normal 12px sans-serif; }
31	+ img { margin-right:5px; }
32	+ </style>
33	+ <script type="text/javascript">
34	+ var FORM_KEY = "<?php echo $this->getFormKey();?>";
35	+ </script>
36	+ <ul>
37	+ <li>
38	+ <?php if ($this->getProfile()->getId()):?>
39	+ <img src="<?php echo $this->getSkinUrl('images/note_msg_icon.gif')?>" class="v-middle" style="margin-right:5px"/>
40	+ <?php echo $this->__("Starting profile execution, please wait...");?>
41	+ </li>
42	+ <li style="background-color:#FFD;">
43	+ <img src="<?php echo $this->getSkinUrl('images/fam_bullet_error.gif');?>" class="v-middle" style="margin-right:5px"/>
44	+ <?php echo $this->__("Warning: Please do not close the window during importing/exporting data");?>
45	+ <?php else:?>
46	+ <img src="<?php echo $this->getSkinUrl('images/error_msg_icon.gif');?>" class="v-middle" style="margin-right:5px"/>
47	+ <?php echo $this->__("No profile loaded...");?>
48	+ <?php endif;?>
49	+ </li>
50	+ </ul>
51	+
52	+ <?php if ($this->getProfile()->getId()):?>
53	+ <ul id="profileRows">
54	+ <?php foreach ($this->getExceptions() as $exceptionInfo):?>
55	+ <li style="<?php echo $exceptionInfo['style'];?>">
56	+ <img src="<?php echo $exceptionInfo['src'];?>" class="v-middle"/>
57	+ <?php echo $exceptionInfo['message'];?>
58	+ <?php if ($exceptionInfo['position']):?>
59	+ <small>(<?php echo $exceptionInfo['position'];?>)</small>
60	+ <?php endif;?>
61	+ </li>
62	+ <?php endforeach;?>
63	+ <?php if($this->getProfile()->getEntityType() == 'product' && $this->getProfile()->getDirection() == 'import'):?>
64	+ <li id="liBeforeFinish" style="background-color:#FFD; display:none;">
65	+ <img src="<?php echo $this->getSkinUrl('images/fam_bullet_error.gif');?>" class="v-middle" style="margin-right:5px"/>
66	+ <?php echo $this->__("Please wait while the indexes are being refreshed.");?>
67	+ <img id="before-finish-wait-img" src="<?php echo $this->getSkinUrl('images/rule-ajax-loader.gif');?>" class="v-middle" style="margin-right:5px"/>
68	+ </li>
69	+ <?php endif;?>
70	+ <li id="liFinished" style="display:none;">
71	+ <img src="<?php echo $this->getSkinUrl('images/note_msg_icon.gif');?>" class="v-middle" style="margin-right:5px"/>
72	+ <?php echo $this->__("Finished profile execution.");?>
73	+ </li>
74	+ </ul>
75	+ <?php if ($batchId = $this->getBatchModel()->getId()):?>
76	+ <?php if ($this->getBatchModelHasAdapter()):?>
77	+ <script type="text/javascript">
78	+ var countOfStartedProfiles = 0;
79	+ var countOfUpdated = 0;
80	+ var countOfError = 0;
81	+ var importData = [];
82	+ var totalRecords = <?php echo $this->getBatchItemsCount();?>;
83	+ var config= <?php echo $this->getBatchConfigJson();?>;
84	+ </script>
85	+ <script type="text/javascript">
86	+ function addImportData(data) {
87	+ importData.push(data);
88	+ }
89	+
90	+ function execImportData() {
91	+ if (importData.length == 0) {
92	+ $("updatedRows_img").src = config.styles.message.icon;
93	+ $("updatedRows").style.backgroundColor = config.styles.message.bg;
94	+ Element.insert($("liFinished"), {before: config.tpl.evaluate({
95	+ style: "background-color:"+config.styles.message.bg,
96	+ image: config.styles.message.icon,
97	+ text: config.tplSccTxt.evaluate({updated:(countOfUpdated-countOfError)}),
98	+ id: "updatedFinish"
99	+ })});
100	+
101	+ if ($("liBeforeFinish")) {
102	+ Element.insert($("liFinished"), {before: $("liBeforeFinish")});
103	+ $("liBeforeFinish").show();
104	+ }
105	+
106	+ new Ajax.Request("<?php echo $this->getUrl('//batchFinish', array('id' => $batchId));?>", {
107	+ method: "post",
108	+ parameters: {form_key: FORM_KEY},
109	+ onComplete: function(transport) {
110	+ if (transport.responseText.isJSON()) {
111	+ var response = transport.responseText.evalJSON();
112	+ if (response.error) {
113	+ Element.insert($("liFinished"), {before: config.tpl.evaluate({
114	+ style: "background-color:"+config.styles.error.bg,
115	+ image: config.styles.error.icon,
116	+ text: response.error.escapeHTML(),
117	+ id: "error-finish"
118	+ })});
119	+ }
120	+ }
121	+
122	+ if ($("before-finish-wait-img")) {
123	+ $("before-finish-wait-img").hide();
124	+ }
125	+
126	+ $('liFinished').show();
127	+ }
128	+ });
129	+ } else {
130	+ sendImportData(importData.shift());
131	+ }
132	+ }
133	+
134	+ function sendImportData(data) {
135	+ if (!config.tpl) {
136	+ config.tpl = new Template(config.template);
137	+ config.tplTxt = new Template(config.text);
138	+ config.tplSccTxt = new Template(config.successText);
139	+ }
140	+ if (!$("updatedRows")) {
141	+ Element.insert($("liFinished"), {before: config.tpl.evaluate({
142	+ style: "background-color: #FFD;",
143	+ image: config.styles.loader,
144	+ text: config.tplTxt.evaluate({updated:countOfUpdated, percent:getPercent()}),
145	+ id: "updatedRows"
146	+ })});
147	+ }
148	+ countOfStartedProfiles++;
149	+ if (!data.form_key) {
150	+ data.form_key = FORM_KEY;
151	+ }
152	+
153	+ new Ajax.Request("<?php echo $this->getUrl('//batchRun');?>", {
154	+ method: "post",
155	+ parameters: data,
156	+ onSuccess: function(transport) {
157	+ countOfStartedProfiles --;
158	+ countOfUpdated += data["rows[]"].length;
159	+ if (transport.responseText.isJSON()) {
160	+ addProfileRow(transport.responseText.evalJSON());
161	+ } else {
162	+ Element.insert($("updatedRows"), {before: config.tpl.evaluate({
163	+ style: "background-color:"+config.styles.error.bg,
164	+ image: config.styles.error.icon,
165	+ text: transport.responseText.escapeHTML(),
166	+ id: "error-" + countOfStartedProfiles
167	+ })});
168	+ countOfError += data["rows[]"].length;
169	+ }
170	+ execImportData();
171	+ }
172	+ });
173	+ }
174	+
175	+ function getPercent() {
176	+ return Math.ceil((countOfUpdated/totalRecords)*1000)/10;
177	+ }
178	+
179	+ function addProfileRow(data) {
180	+ if (data.errors.length > 0) {
181	+ for (var i=0, length=data.errors.length; i<length; i++) {
182	+ Element.insert($("updatedRows"), {before: config.tpl.evaluate({
183	+ style: "background-color:"+config.styles.error.bg,
184	+ image: config.styles.error.icon,
185	+ text: data.errors[i],
186	+ id: "id-" + (countOfUpdated + i + 1)
187	+ })});
188	+ countOfError ++;
189	+ }
190	+ }
191	+ $("updatedRows_status").update(config.tplTxt.evaluate({updated:countOfUpdated, percent:getPercent()}));
192	+ }
193	+ </script>
194	+ <?php $importData = $this->getImportData();?>
195	+ <script type="text/javascript">
196	+ <?php foreach ($importData as $importValue):?>
197	+ addImportData(<?php echo $this->jsonEncode($importValue);?>);
198	+ <?php endforeach;?>
199	+ execImportData();
200	+ </script>
201	+ <?php endif;?>
202	+ <?php endif;?>
203	+ <?php if ($this->getShowFinished()):?>
204	+ <script type="text/javascript">$('liFinished').show();</script>
205	+ <?php endif;?>
206	+ <?php endif;?>

app/design/adminhtml/default/default/template/oopsprofile/profilefilter.phtml ADDED Viewed

	@@ -0,0 +1,156 @@


1	+ <div class="entry-edit profile-generator oopsprofile-generator">
2	+ <div class="entry-edit-head">
3	+ <h4 class="icon-head head-edit-form fieldset-legend"><?php echo $this->__("Profile Filters") ?></h4>
4	+ </div>
5	+ <fieldset>
6	+ <legend><?php echo $this->__("Profile Filters") ?></legend>
7	+ <span class="field-row">
8	+ <label for="profile_store_id"><?php echo $this->__("Store:") ?></label>
9	+ <span class="with-tip">
10	+ <select id="profile_store_id" name="store_id" onchange="exportUrlField();">
11	+ <option value="0"><?php echo $this->__('Default (Admin) Values') ?></option>
12	+ <?php foreach ($this->getWebsiteCollection() as $_website): ?>
13	+ <?php $_websiteShow=false; ?>
14	+ <?php foreach ($this->getGroupCollection() as $_group): ?>
15	+ <?php if ($_website->getId() != $_group->getWebsiteId()) continue; ?>
16	+ <?php $_groupShow=false; ?>
17	+ <?php foreach ($this->getStoreCollection() as $_store): ?>
18	+ <?php if ($_group->getId() != $_store->getGroupId()) continue; ?>
19	+ <?php if (!$_websiteShow): ?>
20	+ <?php $_websiteShow=true; ?>
21	+ <optgroup label="<?php echo $_website->getName() ?>"></optgroup>
22	+ <?php endif; ?>
23	+ <?php if (!$_groupShow): ?>
24	+ <?php $_groupShow=true; ?>
25	+ <optgroup label="    <?php echo $_group->getName() ?>">
26	+ <?php endif; ?>
27	+ <option value="<?php echo $_store->getId() ?>" <?php echo $this->getSelected('store_id', $_store->getId()) ?>>    <?php echo $_store->getName() ?></option>
28	+ <?php endforeach; ?>
29	+ <?php if ($_groupShow): ?>
30	+ </optgroup>
31	+ <?php endif; ?>
32	+ <?php endforeach; ?>
33	+ <?php endforeach; ?>
34	+ </select>
35	+ <small class="profile_direction_import profile_entity_type_product">
36	+ <?php echo $this->__("(Products will be added/updated to this store if 'store' column is blank or missing in the import file.)") ?>
37	+ </small>
38	+ </span>
39	+ </span>
40	+ <div id="filters-for-product">
41	+ <span class="field-row profile_direction_export">
42	+ <label for="filter_fromdate_img"><?php echo $this->__("Export Product from date") ?></label>
43	+ <span class="with-tip">
44	+ <input class="input-text" id="filter_fromdate" name="gui_data[filter][fromdate]" value="<?php echo $this->getValue('gui_data/filter/fromdate') ?>"/>
45	+ <img style="" title="Select Date" id="filter_fromdate_img" class="v-middle" alt="" src="<?php echo $this->getSkinUrl('images/grid-cal.gif');?> "/>
46	+ </span>
47	+ <script type="text/javascript">
48	+ //<![CDATA[
49	+ Calendar.setup({
50	+ inputField: "filter_fromdate",
51	+ ifFormat: "%m/%e/%Y",
52	+ showsTime: false,
53	+ button: "filter_fromdate_img",
54	+ align: "Bl",
55	+ singleClick : true
56	+ });
57	+ //]]>
58	+ </script>
59	+ </span>
60	+ <span class="field-row profile_direction_export">
61	+ <label for="filter_todate_img"><?php echo $this->__("Export Product to date") ?></label>
62	+ <span class="with-tip">
63	+ <input class="input-text" id="filter_todate" name="gui_data[filter][todate]" value="<?php echo $this->getValue('gui_data/filter/todate') ?>"/>
64	+ <img style="" title="Select Date" id="filter_todate_img" class="v-middle" alt="" src="<?php echo $this->getSkinUrl('images/grid-cal.gif');?> "/>
65	+ </span>
66	+ <script type="text/javascript">
67	+ //<![CDATA[
68	+ Calendar.setup({
69	+ inputField: "filter_todate",
70	+ ifFormat: "%m/%e/%Y",
71	+ showsTime: false,
72	+ button: "filter_todate_img",
73	+ align: "Bl",
74	+ singleClick : true
75	+ });
76	+ //]]>
77	+ </script>
78	+ </span>
79	+ <?php $productTypes = Mage::getModel('catalog/product_type')->getOptionArray();?>
80	+ <span class="field-row profile_direction_export">
81	+ <label for="filter_todate_img"><?php echo $this->__("Hidden Product Types") ?></label>
82	+ <span class="with-tip">
83	+ <select id="profile_data_transfer" name="gui_data[filter][hiddentype][]" onchange="showOption(this);updateRun(this)" class="option-control" multiple="multiple">
84	+ <?php foreach($productTypes as $key=>$value):?>
85	+ <option value="<?php echo $key?>" <?php echo $this->getMultipleSelect('gui_data/filter/hiddentype',$key);?>><?php echo $value ?></option>
86	+ <?php endforeach;?>
87	+ <option value=""></option>
88	+ </select>
89	+ <small>
90	+ <?php echo $this->__("(Selected product types won't be exported)") ?>
91	+ </small>
92	+ </span>
93	+ </span>
94	+ </div>
95	+ </fieldset>
96	+ </div>
97	+
98	+ <script type="text/javascript">
99	+ //<![CDATA[
100	+ $$('.option-control').each(showOption);
101	+ changeEntityType();
102	+
103	+
104	+ function showFeildMapping() {
105	+ var direction = $('profile_direction').options[$('profile_direction').options.selectedIndex].value;
106	+ var value = $('parse_fieldnames').options[$('parse_fieldnames').options.selectedIndex].value;
107	+ var map = $('map_only_specified').options[$('map_only_specified').options.selectedIndex].value;
108	+
109	+ if (direction == 'export') {
110	+ if (map) {
111	+ Element.show($('__fieldmapping'));
112	+ } else {
113	+ deleteAllAddedMappingFields();
114	+ Element.hide($('__fieldmapping'));
115	+ }
116	+ } else {
117	+ if (value) {
118	+ Element.hide($('__fieldmapping'));
119	+ deleteAllAddedMappingFields();
120	+ } else {
121	+ Element.show($('__fieldmapping'));
122	+ }
123	+ }
124	+
125	+ }
126	+
127	+ function deleteAllAddedMappingFields()
128	+ {
129	+ var type = $('profile_entity_type').options[$('profile_entity_type').options.selectedIndex].value;
130	+
131	+ var elems = $('map_container_'+type).childElements();
132	+ if (elems.length > 0) for (var idx in elems) {
133	+ if (elems[idx] != undefined && elems[idx].tagName != undefined) {
134	+ elems[idx].remove();
135	+ }
136	+ }
137	+ }
138	+ var direction = $('profile_direction').options[$('profile_direction').options.selectedIndex].value;
139	+ if (direction == 'import') {
140	+ //if ($('parse_fieldnames').options[$('parse_fieldnames').options.selectedIndex].value) {
141	+ // Element.hide($('__fieldmapping'));
142	+ // deleteAllAddedMappingFields();
143	+ // } else {
144	+ Element.show($('__fieldmapping'));
145	+ //}
146	+ } else {
147	+ var map = $('map_only_specified').options[$('map_only_specified').options.selectedIndex].value;
148	+ if (map) {
149	+ Element.show($('__fieldmapping'));
150	+ } else {
151	+ deleteAllAddedMappingFields();
152	+ Element.hide($('__fieldmapping'));
153	+ }
154	+ }
155	+ //]]>
156	+ </script>

app/design/adminhtml/default/default/template/oopsprofile/profiletemplate.phtml ADDED Viewed

	@@ -0,0 +1,127 @@


1	+ <?php
2	+ $delimiterTypes = Mage::helper('oopsprofile')->delimiterTypeArray();
3	+ $enclosureTypes = Mage::helper('oopsprofile')->enclosureTypeArray();
4	+ ?>
5	+
6	+ <div id="data-format-and-fields">
7	+ <div id="data-format-display-div">
8	+ <div class="entry-edit-head">
9	+ <h4 class="icon-head head-edit-form fieldset-legend"><?php echo $this->__("Data Format") ?></h4>
10	+ </div>
11	+ <fieldset>
12	+ <legend><?php echo $this->__("Data Format") ?></legend>
13	+ <span class="field-row" id="parse_type_row">
14	+ <label for="parse_type"><?php echo $this->__("Type:") ?></label>
15	+ <?php $formatTypes = Mage::helper('oopsprofile')->formatTypeArray()?>
16	+ <select id="parse_type" name="gui_data[parse][type]" onchange="showOption(this);" class="option-control" style="width:207px;">
17	+ <?php foreach($formatTypes as $key=>$value):?>
18	+ <option value="<?php echo $key?>" <?php echo $this->getSelected('gui_data/parse/type', $key) ?>><?php echo $value ?></option>
19	+ <?php endforeach;?>
20	+ </select>
21	+ </span>
22	+
23	+
24	+ <div class="parse_type_csv" id="parse_type_csv">
25	+ <span class="field-row">
26	+ <label for="parse_delimiter"><?php echo $this->__("Value Delimiter:") ?></label>
27	+ <select id="parse_delimiter" name="gui_data[parse][csv][delimiter]" onchange="showOption(this)" class="option-control" style="width:207px;">
28	+ <?php foreach($delimiterTypes as $key=>$value):?>
29	+ <option value="<?php echo $key?>" <?php echo $this->getSelected('gui_data/parse/csv/delimiter', $key) ?>><?php echo $value ?></option>
30	+ <?php endforeach;?>
31	+ </select>
32	+ </span>
33	+ <span class="field-row">
34	+ <label for="parse_enclose"><?php echo $this->__("Enclose Values In:") ?></label>
35	+ <select id="parse_enclose" name="gui_data[parse][csv][enclose]" onchange="showOption(this)" class="option-control" style="width:207px;">
36	+ <option value='"' <?php echo $this->getSelected('gui_data/parse/csv/enclose', '"') ?>><?php echo '"' ?></option>
37	+ <option value="'" <?php echo $this->getSelected('gui_data/parse/csv/enclose', "'") ?>><?php echo "'" ?></option>
38	+ </select>
39	+ </span>
40	+ </div>
41	+ <div class="parse_type_txt">
42	+ <span class="field-row">
43	+ <label for="parse_delimiter"><?php echo $this->__("Value Delimiter:") ?></label>
44	+ <select id="parse_delimiter" name="gui_data[parse][txt][delimiter]" onchange="showOption(this)" class="option-control" style="width:207px;">
45	+ <?php foreach($delimiterTypes as $key=>$value):?>
46	+ <option value="<?php echo $key?>" <?php echo $this->getSelected('gui_data/parse/txt/delimiter', $key) ?>><?php echo $value ?></option>
47	+ <?php endforeach;?>
48	+ </select>
49	+ </span>
50	+ <span class="field-row">
51	+ <label for="parse_enclose"><?php echo $this->__("Enclose Values In:") ?></label>
52	+ <select id="parse_enclose" name="gui_data[parse][txt][enclose]" onchange="showOption(this)" class="option-control" style="width:207px;">
53	+ <option value='"' <?php echo $this->getSelected('gui_data/parse/txt/enclose', '"') ?>><?php echo '"' ?></option>
54	+ <option value="'" <?php echo $this->getSelected('gui_data/parse/txt/enclose', "'") ?>><?php echo "'" ?></option>
55	+ </select>
56	+ </span>
57	+ </div>
58	+ <span class="field-row" id="first-row-display-select">
59	+ <label for="parse_fieldnames" id="first-row-display-row1"><?php echo $this->__("Original Magento attribute names in first row:") ?></label>
60	+ <span class="with-tip" id="first-row-display-row2">
61	+ <select id="parse_fieldnames" name="gui_data[parse][fieldnames]" onchange="showFeildMapping();showOption(this)" class="option-control" style="width:207px;">
62	+ <option value="" <?php echo $this->getSelected('gui_data/parse/fieldnames', false) ?>><?php echo $this->__("No") ?></option>
63	+ <option value="true" <?php echo $this->getSelected('gui_data/parse/fieldnames', true) ?>><?php echo $this->__("Yes") ?></option>
64	+ </select>
65	+ <small class="profile_direction_import">
66	+ <span class="parse_fieldnames_">
67	+ <?php echo $this->__("(When 'No', only mapped fields will be imported. When mapping, use 'column1', 'column2', etc.)") ?>
68	+ </span>
69	+ </small>
70	+ </span>
71	+ </span>
72	+ <div class="profile_direction_export" id="profile_direction_export_row">
73	+ <span class="field-row">
74	+ <label for="map_only_specified"><?php echo $this->__("Export:") ?></label>
75	+ <select id="map_only_specified" name="gui_data[map][only_specified]" onchange="showFeildMapping();showOption(this)">
76	+ <option value="" <?php echo $this->getSelected('gui_data/map/only_specified', false) ?>><?php echo $this->__("All fields") ?></option>
77	+ <option value="true" <?php echo $this->getSelected('gui_data/map/only_specified', true) ?>><?php echo $this->__("Only mapped fields") ?></option>
78	+ </select>
79	+ </span>
80	+ </div>
81	+ </fieldset>
82	+ </div>
83	+
84	+ <div id="__fieldmapping">
85	+ <div class="entry-edit-head">
86	+ <h4 class="icon-head head-edit-form fieldset-legend"><?php echo $this->__("Field Mapping") ?></h4>
87	+ </div>
88	+ <fieldset>
89	+ <legend><?php echo $this->__("Field Mapping") ?></legend>
90	+ <?php $oopsentityAttrTypes = Mage::helper('oopsprofile')->entityAttrTypeArray()?>
91	+ <?php foreach ($oopsentityAttrTypes as $_entityType): ?>
92	+ <div class="profile_entity_type_<?php echo $_entityType ?>">
93	+ <div id="map_template_<?php echo $_entityType ?>" style="display:none">
94	+ <span class="field-row">
95	+ <?php echo $this->__("In Database:") ?> <select name="gui_data[map][<?php echo $_entityType ?>][db][]" onchange="setMapFileField(this)">
96	+ <?php
97	+ $fieldMappingInDatabase = $this->getAttributes($_entityType);
98	+ asort($fieldMappingInDatabase);
99	+ foreach ($fieldMappingInDatabase as $_value=>$_label): ?>
100	+ <option value="<?php echo $_value ?>"><?php echo $_label ?></option>
101	+ <?php endforeach ?>
102	+ </select>
103	+ <-->
104	+ <?php echo $this->__("In File:") ?> <input class="input-text" name="gui_data[map][<?php echo $_entityType ?>][file][]"/>
105	+ <?php echo $this->getRemoveMapButtonHtml() ?>
106	+ </span>
107	+ </div>
108	+ <div id="map_container_<?php echo $_entityType ?>">
109	+ <?php foreach ($this->getMappings($_entityType) as $_i=>$_dbField): ?>
110	+ <span class="field-row">
111	+ <?php echo $this->__("In Database:") ?> <select name="gui_data[map][<?php echo $_entityType ?>][db][]">
112	+ <?php foreach ($this->getAttributes($_entityType) as $_value=>$_label): ?>
113	+ <option value="<?php echo $_value ?>" <?php echo $this->getSelected('gui_data/map/'.$_entityType.'/db/'.$_i, $_value) ?>><?php echo $_label ?></option>
114	+ <?php endforeach ?>
115	+ </select>
116	+ <-->
117	+ <?php echo $this->__("In File:") ?> <input class="input-text" name="gui_data[map][<?php echo $_entityType ?>][file][]" value="<?php echo $this->getValue('gui_data/map/'.$_entityType.'/file/'.$_i) ?>"/>
118	+ <?php echo $this->getRemoveMapButtonHtml() ?>
119	+ </span>
120	+ <?php endforeach ?>
121	+ </div>
122	+ </div>
123	+ <?php endforeach ?>
124	+ <?php echo $this->getAddMapButtonHtml() ?>
125	+ </fieldset>
126	+ </div>
127	+ </div>

app/design/adminhtml/default/default/template/oopsprofile/profileway.phtml ADDED Viewed

	@@ -0,0 +1,91 @@


1	+
2	+ <style type="text/css">
3	+ .full-width{
4	+ width:100% !important;
5	+ }
6	+ </style>
7	+
8	+ <?php
9	+ $profile = Mage::registry('current_convert_profile');
10	+ $oopsProfile = Mage::getModel('oopsprofile/oopsprofile')->loadByProfile($profile);
11	+ $isTokenAvailable = $oopsProfile->getIsTokenAvailable();
12	+ $authUrl = $oopsProfile->getOauthUrl();
13	+ ?>
14	+
15	+ <div class="entry-edit profile-generator oopsprofile-generator">
16	+ <div class="entry-edit-head">
17	+ <h4 class="icon-head head-edit-form fieldset-legend"><?php echo $this->__("File Information") ?></h4>
18	+ </div>
19	+ <fieldset>
20	+ <legend><?php echo $this->__("File Information") ?></legend>
21	+ <span class="field-row">
22	+ <label for="profile_data_transfer"><?php echo $this->__("Profile Way:") ?></label>
23	+ <?php $wayTypes = Mage::helper('oopsprofile')->wayTypeArray()?>
24	+ <select id="profile_data_transfer" name="data_transfer" onchange="showOption(this);updateRun(this)" class="option-control">
25	+ <?php foreach($wayTypes as $waykey=>$wayvalue):?>
26	+ <option value="<?php echo $waykey?>" <?php echo $this->getSelected('data_transfer', $waykey) ?>><?php echo $wayvalue ?></option>
27	+ <?php endforeach;?>
28	+ </select>
29	+ </span>
30	+
31	+
32	+ <?php
33	+ $id = $profile->getId();//Current Profile Id
34	+ $format = $this->getValue('gui_data/parse/type');
35	+ $entityType = $this->getValue('entity_type');
36	+ ?>
37	+
38	+ <?php $exportFile = Mage::getBaseDir().'/httpexport/export_'.$entityType.'_'.$id.'.'.$format;?>
39	+
40	+ <!--If profile way is Http-->
41	+ <div class="profile_data_transfer_http" style="display:none;">
42	+ <span class="field-row">
43	+ <label for="file_type"><?php echo $this->__("Export Data:") ?></label>
44	+ <?php if(glob($exportFile)):?>
45	+ <a target ="_blank" href="<?php echo Mage::getBaseUrl(Mage_Core_Model_Store::URL_TYPE_WEB).'httpexport/export_'.$entityType.'_'.$id.'.'.$format?>"><?php echo $this->__('Click to export')?></a>
46	+ <?php else:?>
47	+ <small>
48	+ <?php echo $this->__('(First you need to save and run the profile in order to export it)') ?>
49	+ </small>
50	+ <?php endif;?>
51	+ </span>
52	+ <span class="field-row">
53	+ <?php if(glob($exportFile)):?>
54	+ <small>
55	+ <?php echo $this->__('(First you need to save and run the profile in order to export new data)') ?>
56	+ </small>
57	+ <?php endif;?>
58	+ </span>
59	+ </div>
60	+
61	+
62	+ <!--File Type Local/FTP/SFTP-->
63	+ <div class="profile_data_transfer_file">
64	+ <span class="field-row">
65	+ <label for="file_type"><?php echo $this->__("Type:") ?></label>
66	+ <select id="file_type" name="gui_data[file][type]" onchange="showOption(this)" class="option-control">
67	+ <option value="file" <?php echo $this->getSelected('gui_data/file/type', 'file') ?>><?php echo $this->__("Local Server") ?></option>
68	+ <!--option value="ftp" <?php //echo $this->getSelected('gui_data/file/type', 'ftp') ?>><?php echo $this->__("Remote FTP") ?></option>
69	+ <option value="sftp" <?php //echo $this->getSelected('gui_data/file/type', 'sftp') ?>><?php echo $this->__("Remote SFTP") ?></option-->
70	+ </select>
71	+ </span>
72	+ <span class="field-row">
73	+ <label for="file_filename"><?php echo $this->__("File name:") ?></label>
74	+ <input class="input-text" id="file_filename" name="gui_data[file][filename]" value="<?php echo $this->getValue('gui_data/file/filename') ?>"/>
75	+ </span>
76	+ <span class="field-row">
77	+ <label for="file_path"><?php echo $this->__("Path:") ?></label>
78	+ <span class="with-tip">
79	+ <input class="input-text" id="file_path" name="gui_data[file][path]" value="<?php echo $this->getValue('gui_data/file/path') ?>"/>
80	+ <small class="file_type_file">
81	+ <?php echo $this->__('(For Type "Local Server" need to use relative path to Magento install var/export or var/import, e.g. var/export, var/import, var/export/some/dir, var/import/some/dir)') ?>
82	+ </small>
83	+ </span>
84	+ </span>
85	+
86	+
87	+
88	+ </div>
89	+
90	+ </fieldset>
91	+ </div>

app/design/adminhtml/default/default/template/oopsprofile/run.phtml ADDED Viewed

	@@ -0,0 +1,60 @@


1	+ <script type="text/javascript">
2	+ function runProfile(popup)
3	+ {
4	+ var url = "<?php echo $this->getUrl('//run', array('id'=>$this->getProfileId())) ?>";
5	+ if ($('profile_direction') != undefined
6	+ && $('profile_data_transfer') != undefined
7	+ && getDirection() == 'import' && getTransferType() == 'interactive') {
8	+ var file = getSelectedFiles();
9	+ if (file == '') {
10	+ alert('Please select imported files');
11	+ $('file_list').show();
12	+ return false;
13	+ }
14	+ url += 'files/' + file + '/';
15	+ }
16	+
17	+ if (!popup) {
18	+ $('run_iframe').style.display = 'block';
19	+ $('run_iframe').src = url;
20	+ } else {
21	+ window.open(url);
22	+ }
23	+ }
24	+
25	+ function getDirection()
26	+ {
27	+ return $('profile_direction').options[$('profile_direction').options.selectedIndex].value;
28	+ }
29	+
30	+ function getSelectedFiles()
31	+ {
32	+ return $('files').options[$('files').options.selectedIndex].value;
33	+ }
34	+
35	+ function getTransferType()
36	+ {
37	+ return $('profile_data_transfer').options[$('profile_data_transfer').options.selectedIndex].value;
38	+ }
39	+ </script>
40	+ <ul class="messages">
41	+ <li class="notice-msg">
42	+ <ul>
43	+ <li><?php echo $this->__('Please make sure that your changes were saved before running the profile.') ?></li>
44	+ </ul>
45	+ </li>
46	+ </ul>
47	+ <div id="file_list" style="display: none;">
48	+ <select id="files" name="files">
49	+ <option value="">Select a file</option>
50	+ <?php if ($files = $this->getImportedFiles()) :
51	+ foreach ($files as $file) : ?>
52	+ <option value=<?php echo $file ?>><?php echo $file ?></option>
53	+ <?php endforeach;
54	+ endif; ?>
55	+ </select>
56	+ <br />
57	+ </div>
58	+
59	+ <?php echo $this->getRunButtonHtml() ?><br/>
60	+ <iframe id="run_iframe" src="<?php echo $this->getJsUrl() ?>blank.html" frameborder=0 style="display:none; width:100%; height:400px;"></iframe>

app/etc/modules/PI_Oopsprofile.xml ADDED Viewed

	@@ -0,0 +1,9 @@


1	+ <?xml version='1.0'?>
2	+ <config>
3	+ <modules>
4	+ <PI_Oopsprofile>
5	+ <active>true</active>
6	+ <codePool>community</codePool>
7	+ </PI_Oopsprofile>
8	+ </modules>
9	+ </config>

package.xml ADDED Viewed

	@@ -0,0 +1,20 @@


1	+ <?xml version="1.0"?>
2	+ <package>
3	+ <name>PI_Oopsprofile</name>
4	+ <version>0.2.0</version>
5	+ <stability>stable</stability>
6	+ <license uri="http://opensource.org/licenses/osl-3.0.php">Open Software License (OSL</license>
7	+ <channel>community</channel>
8	+ <extends/>
9	+ <summary>This extension is used for import/export products and customers.</summary>
10	+ <description>You can import/export the product and customer, you can modify already created products and customers.
11	+
12	+ You can apply multiple filters on import/export.</description>
13	+ <notes>This is a stable version.</notes>
14	+ <authors><author><name>pureimagination</name><user>pureimagination</user><email>johncarter15oct@gmail.com</email></author></authors>
15	+ <date>2015-06-30</date>
16	+ <time>16:49:25</time>
17	+ <contents><target name="magecommunity"><dir name="PI"><dir name="Oopsprofile"><dir name="Block"><dir name="Adminhtml"><dir name="Oopsprofile"><dir name="Edit"><file name="Form.php" hash="534d9238c1c1169f171cefc143cd532c"/><dir name="Tab"><file name="General.php" hash="a1490439063558339421fed71ca163d8"/><file name="Profilefilter.php" hash="c9a9ebba4f6d4c536fe75b4e50f37aa0"/><file name="Profiletemplate.php" hash="0b7fd1d437c667b5550b6fc608021c15"/><file name="Profileway.php" hash="94661a0e5563310ffe00940bb347a37d"/><file name="Run.php" hash="9c381f19c551e4825dc7876e41f358b3"/></dir><file name="Tabs.php" hash="61acb9c7f53ad676064c652ecf67a600"/></dir><file name="Edit.php" hash="c0c72bdd839637dafcde6cc6255e60bd"/><file name="Grid.php" hash="3bd2003dbbb6f335a2f668e0ce0868f9"/></dir><file name="Oopsprofile.php" hash="d261d42999938b0bed5af86ddaa9d5a9"/><dir name="Renderer"><file name="Parsetype.php" hash="3e0ec2054c70150c865e72a81d4d54a8"/><file name="Way.php" hash="e9b03cdd37a1982c418f3fb5fa8a5ce2"/></dir><file name="Run.php" hash="8dc6268ca9f17c39aa54bd7378610288"/><dir name="System"><dir name="Config"><dir name="Cron"><file name="Schedule.php" hash="ee849230bf2a8d21b7baa6c76e535f73"/></dir></dir><dir name="Convert"><dir name="Gui"><file name="Grid.php" hash="1cd93532ba131ea2d72695857756ca4f"/></dir></dir></dir></dir><dir name="Rule"><file name="Conditions.php" hash="50a80dafc55faddd1f50702eba273d8f"/></dir></dir><dir name="Helper"><file name="Data.php" hash="47d64850728e40b32e421e7b9ad00075"/><file name="Mail.php" hash="930ec7a8d31dd295679260a1e983ad2b"/><file name="Table.php" hash="c4467fce95a28214bc257576f1ce1515"/></dir><dir name="Model"><dir name="Convert"><dir name="Adapter"><file name="Api.php" hash="20c81eae28079f6a9d32f5e7e98d12d7"/><file name="Http.php" hash="63f90085688f6efc703a9ce9ef9a467a"/><file name="Io.php" hash="1c521a8a9557e06b057f7c4a279b6165"/><file name="Mail.php" hash="1796baf8c8599ab15d92bd08c7c50645"/></dir><dir name="Parser"><file name="Csv.php" hash="f6c2094d2675fa6d0ce62be18592b4ea"/><file name="Txt.php" hash="efba02ca7438a4cdbbbf1f990352a65b"/></dir></dir><file name="Createapiobserver.php" hash="835f37d42809b38e18e414a44526caed"/><file name="CronObserver.php" hash="feeaf7562b492fd67762fcd27796b301"/><dir name="Customergroup"><dir name="Convert"><dir name="Adapter"><file name="Customergroup.php" hash="36dfc61af8bb5d684c7f56ea86191207"/></dir><dir name="Parser"><file name="Customergroup.php" hash="708f6e767a0b5166fd92e9b47453e811"/></dir></dir></dir><dir name="Dataflow"><dir name="Batch"><file name="Io.php" hash="5cd25bb53453a892b85163a16797ec55"/></dir><dir name="Convert"><dir name="Mapper"><file name="Column.php" hash="6762f0c5c9e8683bc374646d9e4ea1f4"/></dir></dir><dir name="Profile"><file name="History.php" hash="3637b0b9618bfdaf62f52f487ee407ee"/></dir><file name="Profile.php" hash="cb00b63b2246abd68d56c1e6a24b394d"/></dir><file name="Mail.php" hash="c54b158ac4fa37725561f272ce2a5abc"/><dir name="Mysql4"><dir name="Oopsprofile"><file name="Collection.php" hash="a1237c9b3c43dd479010db3e00e699f6"/></dir><file name="Oopsprofile.php" hash="f153b86e7299cbf680bd6870e2c1f757"/></dir><file name="Oopsprofile.php" hash="e95d66ebafedeb5235ff0687c151a2c4"/><file name="Oopsprofileapi.php" hash="fffd75599d5489ab091def50d586d5cb"/><dir name="Product"><dir name="Convert"><dir name="Adapter"><file name="Product.php" hash="06d71f01d5c9d5d744e6e227791fb902"/></dir><dir name="Parser"><file name="Product.php" hash="e15fc0158a0416a5872ed14eef7742c4"/></dir></dir></dir><dir name="Rule"><dir name="Condition"><file name="Combine.php" hash="57bb6de822f5b99838cd125cd296c24a"/><file name="Product.php" hash="a00b80416c8023540216ba6024b0db95"/></dir></dir><file name="Rule.php" hash="1d9ee949e5d40eb6b93233a9ea45e8d7"/><dir name="Varien"><dir name="Io"><file name="Sftp.php" hash="cc52ff838ee5b053db26ceeef31af2e1"/></dir></dir></dir><dir name="controllers"><dir name="Adminhtml"><file name="OopsprofileController.php" hash="9c7f1fce3d4629cff921798ca133047a"/></dir><file name="ApiController.php" hash="7bb98fe7ad90cf37112ba291a84f5174"/><file name="OopsprofileController.php" hash="ea9099c36c8f11cfe9a44c207c71832e"/></dir><dir name="etc"><file name="adminhtml.xml" hash="7b73ae59d4ede142d27b350a15629dd3"/><file name="config.xml" hash="9e9252241529e8a515e1d73f0e6b7572"/></dir><dir name="sql"><dir name="oopsprofile_setup"><file name="mysql4-install-0.1.0.php" hash="476db9cbc5d76bdc3c072e5c853b539c"/><file name="mysql4-upgrade-0.1.0-0.1.1.php" hash="9e452cf7dd0f468643593bddf3a9b763"/><file name="mysql4-upgrade-0.1.1-0.1.2.php" hash="3fb8f054e4ca4a866119a7e0ea7dfafc"/><file name="mysql4-upgrade-0.1.2-0.1.3.php" hash="d0a6719a71595a9608a3c3ab01b70864"/><file name="mysql4-upgrade-0.1.3-0.1.4.php" hash="bd64dd63493d3942ad8d2e0dd196ef35"/><file name="mysql4-upgrade-0.1.4-0.1.5.php" hash="e60deecbe99c6b6358fd5df3b3fbe4c4"/><file name="mysql4-upgrade-0.1.5-0.1.6.php" hash="fb2f0c979bd33031e1aa0e88d952a752"/><file name="mysql4-upgrade-0.1.6-0.1.7.php" hash="962bed7a1700bbc67450b701ada2a727"/><file name="mysql4-upgrade-0.1.7-0.1.8.php" hash="3109963b5b9f41ce7e504dc4e243aa48"/><file name="mysql4-upgrade-0.1.8-0.1.9.php" hash="fde1ca360448f9b59e51d55318dbce5d"/><file name="mysql4-upgrade-0.1.9-0.2.0.php" hash="1a95e7320b6bb2403d7df877b0b9eddb"/></dir></dir></dir></dir></target><target name="mageetc"><dir name="modules"><file name="PI_Oopsprofile.xml" hash="bad7e8d5c5ddd0ff923477c902ed45df"/></dir></target><target name="magedesign"><dir name="adminhtml"><dir name="default"><dir name="default"><dir name="layout"><file name="oopsprofile.xml" hash="1366038b071066dd8a84d49b0a9873d4"/></dir><dir name="template"><dir name="oopsprofile"><file name="general.phtml" hash="067de0749f31aa072d5e0feee4d3fb38"/><file name="process.phtml" hash="f7de91b086c11d8be57e263d545475d6"/><file name="profilefilter.phtml" hash="c00fd9c9267e6bcb748474fb0a57ce80"/><file name="profiletemplate.phtml" hash="20af0543349b3be20ca51018b03e68bb"/><file name="profileway.phtml" hash="5e23c614d141f993450a86a4ab67b947"/><file name="run.phtml" hash="8491131da271e47548965cd690177be2"/></dir></dir></dir></dir></dir></target><target name="mageskin"><dir name="adminhtml"><dir name="default"><dir name="default"><dir name="oopsprofile"><dir name="css"><file name="jquery-ui-1.8.12.custom.css" hash="f3ccac687d0596fdd2b49c095b77e3db"/><file name="jquery.checkboxtree.css" hash="6a1d1006d5a32d35428e0cfbaf68928b"/><file name="oopsprofile.css" hash="6bd27abb355a93489d220f2757798c6b"/></dir><dir name="images"><file name="ui-bg_flat_0_aaaaaa_40x100.png" hash="2a44fbdb7360c60122bcf6dcef0387d8"/><file name="ui-bg_flat_75_ffffff_40x100.png" hash="8692e6efddf882acbff144c38ea7dfdf"/><file name="ui-bg_glass_55_fbf9ee_1x400.png" hash="f8f4558e0b92ff2cd6136781533902ec"/><file name="ui-bg_glass_65_ffffff_1x400.png" hash="e5a8f32e28fd5c27bf0fed33c8a8b9b5"/><file name="ui-bg_glass_75_dadada_1x400.png" hash="c12c6510dad3ebfa64c8a30e959a2469"/><file name="ui-bg_glass_75_e6e6e6_1x400.png" hash="f4254356c2a8c9a383205ef2c4de22c4"/><file name="ui-bg_glass_95_fef1ec_1x400.png" hash="5a3be2d8fff8324d59aec3df7b0a0c83"/><file name="ui-bg_highlight-soft_75_cccccc_1x100.png" hash="72c593d16e998952cd8d798fee33c6f3"/><file name="ui-icons_222222_256x240.png" hash="ebe6b6902a408fbf9cac6379a1477525"/><file name="ui-icons_2e83ff_256x240.png" hash="2b99a5e48d3c3957d03027d36a25e8bb"/><file name="ui-icons_454545_256x240.png" hash="119dd0c2e94ad689de873ef39fd43e6e"/><file name="ui-icons_888888_256x240.png" hash="9c46d7cab43e22a14bad26d2d4806d80"/><file name="ui-icons_cd0a0a_256x240.png" hash="3e450c2a2c66328d9498e7001ad7197c"/></dir><dir name="js"><file name="jquery-1.4.4.js" hash="30c7c15a666b9f75a9f58478608fc7e4"/><file name="jquery-ui-1.8.12.custom.min.js" hash="8bd7da990811d5b776243a81cac3d848"/><file name="jquery.checkboxtree.js" hash="0dcb00d6af53617f9d9e0f69028228af"/></dir></dir></dir></dir></dir></target></contents>
18	+ <compatible/>
19	+ <dependencies><required><php><min>5.2.0</min><max>6.0.0</max></php></required></dependencies>
20	+ </package>

skin/adminhtml/default/default/oopsprofile/css/jquery-ui-1.8.12.custom.css ADDED Viewed

	@@ -0,0 +1,578 @@


1	+ /*
2	+ * jQuery UI CSS Framework 1.8.12
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI/Theming/API
9	+ */
10	+
11	+ /* Layout helpers
12	+ ----------------------------------*/
13	+ .ui-helper-hidden { display: none; }
14	+ .ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
15	+ .ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
16	+ .ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
17	+ .ui-helper-clearfix { display: inline-block; }
18	+ /* required comment for clearfix to work in Opera \*/
19	+ * html .ui-helper-clearfix { height:1%; }
20	+ .ui-helper-clearfix { display:block; }
21	+ /* end clearfix */
22	+ .ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
23	+
24	+
25	+ /* Interaction Cues
26	+ ----------------------------------*/
27	+ .ui-state-disabled { cursor: default !important; }
28	+
29	+
30	+ /* Icons
31	+ ----------------------------------*/
32	+
33	+ /* states and images */
34	+ .ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
35	+
36	+
37	+ /* Misc visuals
38	+ ----------------------------------*/
39	+
40	+ /* Overlays */
41	+ .ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
42	+
43	+
44	+ /*
45	+ * jQuery UI CSS Framework 1.8.12
46	+ *
47	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
48	+ * Dual licensed under the MIT or GPL Version 2 licenses.
49	+ * http://jquery.org/license
50	+ *
51	+ * http://docs.jquery.com/UI/Theming/API
52	+ *
53	+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
54	+ */
55	+
56	+
57	+ /* Component containers
58	+ ----------------------------------*/
59	+ .ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
60	+ .ui-widget .ui-widget { font-size: 1em; }
61	+ .ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
62	+ .ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(../images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
63	+ .ui-widget-content a { color: #222222; }
64	+ .ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(../images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
65	+ .ui-widget-header a { color: #222222; }
66	+
67	+ /* Interaction states
68	+ ----------------------------------*/
69	+ .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(../images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
70	+ .ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
71	+ .ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(../images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
72	+ .ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
73	+ .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(../images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
74	+ .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
75	+ .ui-widget :active { outline: none; }
76	+
77	+ /* Interaction Cues
78	+ ----------------------------------*/
79	+ .ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(../images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
80	+ .ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
81	+ .ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(../images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
82	+ .ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
83	+ .ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
84	+ .ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
85	+ .ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
86	+ .ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
87	+
88	+ /* Icons
89	+ ----------------------------------*/
90	+
91	+ /* states and images */
92	+ .ui-icon { width: 16px; height: 16px; background-image: url(../images/ui-icons_222222_256x240.png); }
93	+ .ui-widget-content .ui-icon {background-image: url(../images/ui-icons_222222_256x240.png); }
94	+ .ui-widget-header .ui-icon {background-image: url(../images/ui-icons_222222_256x240.png); }
95	+ .ui-state-default .ui-icon { background-image: url(../images/ui-icons_888888_256x240.png); }
96	+ .ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(../images/ui-icons_454545_256x240.png); }
97	+ .ui-state-active .ui-icon {background-image: url(../images/ui-icons_454545_256x240.png); }
98	+ .ui-state-highlight .ui-icon {background-image: url(../images/ui-icons_2e83ff_256x240.png); }
99	+ .ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(../images/ui-icons_cd0a0a_256x240.png); }
100	+
101	+ /* positioning */
102	+ .ui-icon-carat-1-n { background-position: 0 0; }
103	+ .ui-icon-carat-1-ne { background-position: -16px 0; }
104	+ .ui-icon-carat-1-e { background-position: -32px 0; }
105	+ .ui-icon-carat-1-se { background-position: -48px 0; }
106	+ .ui-icon-carat-1-s { background-position: -64px 0; }
107	+ .ui-icon-carat-1-sw { background-position: -80px 0; }
108	+ .ui-icon-carat-1-w { background-position: -96px 0; }
109	+ .ui-icon-carat-1-nw { background-position: -112px 0; }
110	+ .ui-icon-carat-2-n-s { background-position: -128px 0; }
111	+ .ui-icon-carat-2-e-w { background-position: -144px 0; }
112	+ .ui-icon-triangle-1-n { background-position: 0 -16px; }
113	+ .ui-icon-triangle-1-ne { background-position: -16px -16px; }
114	+ .ui-icon-triangle-1-e { background-position: -32px -16px; }
115	+ .ui-icon-triangle-1-se { background-position: -48px -16px; }
116	+ .ui-icon-triangle-1-s { background-position: -64px -16px; }
117	+ .ui-icon-triangle-1-sw { background-position: -80px -16px; }
118	+ .ui-icon-triangle-1-w { background-position: -96px -16px; }
119	+ .ui-icon-triangle-1-nw { background-position: -112px -16px; }
120	+ .ui-icon-triangle-2-n-s { background-position: -128px -16px; }
121	+ .ui-icon-triangle-2-e-w { background-position: -144px -16px; }
122	+ .ui-icon-arrow-1-n { background-position: 0 -32px; }
123	+ .ui-icon-arrow-1-ne { background-position: -16px -32px; }
124	+ .ui-icon-arrow-1-e { background-position: -32px -32px; }
125	+ .ui-icon-arrow-1-se { background-position: -48px -32px; }
126	+ .ui-icon-arrow-1-s { background-position: -64px -32px; }
127	+ .ui-icon-arrow-1-sw { background-position: -80px -32px; }
128	+ .ui-icon-arrow-1-w { background-position: -96px -32px; }
129	+ .ui-icon-arrow-1-nw { background-position: -112px -32px; }
130	+ .ui-icon-arrow-2-n-s { background-position: -128px -32px; }
131	+ .ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
132	+ .ui-icon-arrow-2-e-w { background-position: -160px -32px; }
133	+ .ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
134	+ .ui-icon-arrowstop-1-n { background-position: -192px -32px; }
135	+ .ui-icon-arrowstop-1-e { background-position: -208px -32px; }
136	+ .ui-icon-arrowstop-1-s { background-position: -224px -32px; }
137	+ .ui-icon-arrowstop-1-w { background-position: -240px -32px; }
138	+ .ui-icon-arrowthick-1-n { background-position: 0 -48px; }
139	+ .ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
140	+ .ui-icon-arrowthick-1-e { background-position: -32px -48px; }
141	+ .ui-icon-arrowthick-1-se { background-position: -48px -48px; }
142	+ .ui-icon-arrowthick-1-s { background-position: -64px -48px; }
143	+ .ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
144	+ .ui-icon-arrowthick-1-w { background-position: -96px -48px; }
145	+ .ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
146	+ .ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
147	+ .ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
148	+ .ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
149	+ .ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
150	+ .ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
151	+ .ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
152	+ .ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
153	+ .ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
154	+ .ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
155	+ .ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
156	+ .ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
157	+ .ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
158	+ .ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
159	+ .ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
160	+ .ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
161	+ .ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
162	+ .ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
163	+ .ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
164	+ .ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
165	+ .ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
166	+ .ui-icon-arrow-4 { background-position: 0 -80px; }
167	+ .ui-icon-arrow-4-diag { background-position: -16px -80px; }
168	+ .ui-icon-extlink { background-position: -32px -80px; }
169	+ .ui-icon-newwin { background-position: -48px -80px; }
170	+ .ui-icon-refresh { background-position: -64px -80px; }
171	+ .ui-icon-shuffle { background-position: -80px -80px; }
172	+ .ui-icon-transfer-e-w { background-position: -96px -80px; }
173	+ .ui-icon-transferthick-e-w { background-position: -112px -80px; }
174	+ .ui-icon-folder-collapsed { background-position: 0 -96px; }
175	+ .ui-icon-folder-open { background-position: -16px -96px; }
176	+ .ui-icon-document { background-position: -32px -96px; }
177	+ .ui-icon-document-b { background-position: -48px -96px; }
178	+ .ui-icon-note { background-position: -64px -96px; }
179	+ .ui-icon-mail-closed { background-position: -80px -96px; }
180	+ .ui-icon-mail-open { background-position: -96px -96px; }
181	+ .ui-icon-suitcase { background-position: -112px -96px; }
182	+ .ui-icon-comment { background-position: -128px -96px; }
183	+ .ui-icon-person { background-position: -144px -96px; }
184	+ .ui-icon-print { background-position: -160px -96px; }
185	+ .ui-icon-trash { background-position: -176px -96px; }
186	+ .ui-icon-locked { background-position: -192px -96px; }
187	+ .ui-icon-unlocked { background-position: -208px -96px; }
188	+ .ui-icon-bookmark { background-position: -224px -96px; }
189	+ .ui-icon-tag { background-position: -240px -96px; }
190	+ .ui-icon-home { background-position: 0 -112px; }
191	+ .ui-icon-flag { background-position: -16px -112px; }
192	+ .ui-icon-calendar { background-position: -32px -112px; }
193	+ .ui-icon-cart { background-position: -48px -112px; }
194	+ .ui-icon-pencil { background-position: -64px -112px; }
195	+ .ui-icon-clock { background-position: -80px -112px; }
196	+ .ui-icon-disk { background-position: -96px -112px; }
197	+ .ui-icon-calculator { background-position: -112px -112px; }
198	+ .ui-icon-zoomin { background-position: -128px -112px; }
199	+ .ui-icon-zoomout { background-position: -144px -112px; }
200	+ .ui-icon-search { background-position: -160px -112px; }
201	+ .ui-icon-wrench { background-position: -176px -112px; }
202	+ .ui-icon-gear { background-position: -192px -112px; }
203	+ .ui-icon-heart { background-position: -208px -112px; }
204	+ .ui-icon-star { background-position: -224px -112px; }
205	+ .ui-icon-link { background-position: -240px -112px; }
206	+ .ui-icon-cancel { background-position: 0 -128px; }
207	+ .ui-icon-plus { background-position: -16px -128px; }
208	+ .ui-icon-plusthick { background-position: -32px -128px; }
209	+ .ui-icon-minus { background-position: -48px -128px; }
210	+ .ui-icon-minusthick { background-position: -64px -128px; }
211	+ .ui-icon-close { background-position: -80px -128px; }
212	+ .ui-icon-closethick { background-position: -96px -128px; }
213	+ .ui-icon-key { background-position: -112px -128px; }
214	+ .ui-icon-lightbulb { background-position: -128px -128px; }
215	+ .ui-icon-scissors { background-position: -144px -128px; }
216	+ .ui-icon-clipboard { background-position: -160px -128px; }
217	+ .ui-icon-copy { background-position: -176px -128px; }
218	+ .ui-icon-contact { background-position: -192px -128px; }
219	+ .ui-icon-image { background-position: -208px -128px; }
220	+ .ui-icon-video { background-position: -224px -128px; }
221	+ .ui-icon-script { background-position: -240px -128px; }
222	+ .ui-icon-alert { background-position: 0 -144px; }
223	+ .ui-icon-info { background-position: -16px -144px; }
224	+ .ui-icon-notice { background-position: -32px -144px; }
225	+ .ui-icon-help { background-position: -48px -144px; }
226	+ .ui-icon-check { background-position: -64px -144px; }
227	+ .ui-icon-bullet { background-position: -80px -144px; }
228	+ .ui-icon-radio-off { background-position: -96px -144px; }
229	+ .ui-icon-radio-on { background-position: -112px -144px; }
230	+ .ui-icon-pin-w { background-position: -128px -144px; }
231	+ .ui-icon-pin-s { background-position: -144px -144px; }
232	+ .ui-icon-play { background-position: 0 -160px; }
233	+ .ui-icon-pause { background-position: -16px -160px; }
234	+ .ui-icon-seek-next { background-position: -32px -160px; }
235	+ .ui-icon-seek-prev { background-position: -48px -160px; }
236	+ .ui-icon-seek-end { background-position: -64px -160px; }
237	+ .ui-icon-seek-start { background-position: -80px -160px; }
238	+ /* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
239	+ .ui-icon-seek-first { background-position: -80px -160px; }
240	+ .ui-icon-stop { background-position: -96px -160px; }
241	+ .ui-icon-eject { background-position: -112px -160px; }
242	+ .ui-icon-volume-off { background-position: -128px -160px; }
243	+ .ui-icon-volume-on { background-position: -144px -160px; }
244	+ .ui-icon-power { background-position: 0 -176px; }
245	+ .ui-icon-signal-diag { background-position: -16px -176px; }
246	+ .ui-icon-signal { background-position: -32px -176px; }
247	+ .ui-icon-battery-0 { background-position: -48px -176px; }
248	+ .ui-icon-battery-1 { background-position: -64px -176px; }
249	+ .ui-icon-battery-2 { background-position: -80px -176px; }
250	+ .ui-icon-battery-3 { background-position: -96px -176px; }
251	+ .ui-icon-circle-plus { background-position: 0 -192px; }
252	+ .ui-icon-circle-minus { background-position: -16px -192px; }
253	+ .ui-icon-circle-close { background-position: -32px -192px; }
254	+ .ui-icon-circle-triangle-e { background-position: -48px -192px; }
255	+ .ui-icon-circle-triangle-s { background-position: -64px -192px; }
256	+ .ui-icon-circle-triangle-w { background-position: -80px -192px; }
257	+ .ui-icon-circle-triangle-n { background-position: -96px -192px; }
258	+ .ui-icon-circle-arrow-e { background-position: -112px -192px; }
259	+ .ui-icon-circle-arrow-s { background-position: -128px -192px; }
260	+ .ui-icon-circle-arrow-w { background-position: -144px -192px; }
261	+ .ui-icon-circle-arrow-n { background-position: -160px -192px; }
262	+ .ui-icon-circle-zoomin { background-position: -176px -192px; }
263	+ .ui-icon-circle-zoomout { background-position: -192px -192px; }
264	+ .ui-icon-circle-check { background-position: -208px -192px; }
265	+ .ui-icon-circlesmall-plus { background-position: 0 -208px; }
266	+ .ui-icon-circlesmall-minus { background-position: -16px -208px; }
267	+ .ui-icon-circlesmall-close { background-position: -32px -208px; }
268	+ .ui-icon-squaresmall-plus { background-position: -48px -208px; }
269	+ .ui-icon-squaresmall-minus { background-position: -64px -208px; }
270	+ .ui-icon-squaresmall-close { background-position: -80px -208px; }
271	+ .ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
272	+ .ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
273	+ .ui-icon-grip-solid-vertical { background-position: -32px -224px; }
274	+ .ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
275	+ .ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
276	+ .ui-icon-grip-diagonal-se { background-position: -80px -224px; }
277	+
278	+
279	+ /* Misc visuals
280	+ ----------------------------------*/
281	+
282	+ /* Corner radius */
283	+ .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
284	+ .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
285	+ .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
286	+ .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
287	+ .ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
288	+ .ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
289	+ .ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
290	+ .ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
291	+ .ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
292	+
293	+ /* Overlays */
294	+ .ui-widget-overlay { background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
295	+ .ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(../images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
296	+ * jQuery UI Resizable 1.8.12
297	+ *
298	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
299	+ * Dual licensed under the MIT or GPL Version 2 licenses.
300	+ * http://jquery.org/license
301	+ *
302	+ * http://docs.jquery.com/UI/Resizable#theming
303	+ */
304	+ .ui-resizable { position: relative;}
305	+ .ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;
306	+ /* http://bugs.jqueryui.com/ticket/7233
307	+ - Resizable: resizable handles fail to work in IE if transparent and content overlaps
308	+ */
309	+ background-image:url(data:);
310	+ }
311	+ .ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
312	+ .ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
313	+ .ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
314	+ .ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
315	+ .ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
316	+ .ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
317	+ .ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
318	+ .ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
319	+ .ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
320	+ * jQuery UI Selectable 1.8.12
321	+ *
322	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
323	+ * Dual licensed under the MIT or GPL Version 2 licenses.
324	+ * http://jquery.org/license
325	+ *
326	+ * http://docs.jquery.com/UI/Selectable#theming
327	+ */
328	+ .ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
329	+ /*
330	+ * jQuery UI Accordion 1.8.12
331	+ *
332	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
333	+ * Dual licensed under the MIT or GPL Version 2 licenses.
334	+ * http://jquery.org/license
335	+ *
336	+ * http://docs.jquery.com/UI/Accordion#theming
337	+ */
338	+ /* IE/Win - Fix animation bug - #4615 */
339	+ .ui-accordion { width: 100%; }
340	+ .ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
341	+ .ui-accordion .ui-accordion-li-fix { display: inline; }
342	+ .ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
343	+ .ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
344	+ .ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
345	+ .ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
346	+ .ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
347	+ .ui-accordion .ui-accordion-content-active { display: block; }
348	+ /*
349	+ * jQuery UI Autocomplete 1.8.12
350	+ *
351	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
352	+ * Dual licensed under the MIT or GPL Version 2 licenses.
353	+ * http://jquery.org/license
354	+ *
355	+ * http://docs.jquery.com/UI/Autocomplete#theming
356	+ */
357	+ .ui-autocomplete { position: absolute; cursor: default; }
358	+
359	+ /* workarounds */
360	+ * html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
361	+
362	+ /*
363	+ * jQuery UI Menu 1.8.12
364	+ *
365	+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
366	+ * Dual licensed under the MIT or GPL Version 2 licenses.
367	+ * http://jquery.org/license
368	+ *
369	+ * http://docs.jquery.com/UI/Menu#theming
370	+ */
371	+ .ui-menu {
372	+ list-style:none;
373	+ padding: 2px;
374	+ margin: 0;
375	+ display:block;
376	+ float: left;
377	+ }
378	+ .ui-menu .ui-menu {
379	+ margin-top: -3px;
380	+ }
381	+ .ui-menu .ui-menu-item {
382	+ margin:0;
383	+ padding: 0;
384	+ zoom: 1;
385	+ float: left;
386	+ clear: left;
387	+ width: 100%;
388	+ }
389	+ .ui-menu .ui-menu-item a {
390	+ text-decoration:none;
391	+ display:block;
392	+ padding:.2em .4em;
393	+ line-height:1.5;
394	+ zoom:1;
395	+ }
396	+ .ui-menu .ui-menu-item a.ui-state-hover,
397	+ .ui-menu .ui-menu-item a.ui-state-active {
398	+ font-weight: normal;
399	+ margin: -1px;
400	+ }
401	+ /*
402	+ * jQuery UI Button 1.8.12
403	+ *
404	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
405	+ * Dual licensed under the MIT or GPL Version 2 licenses.
406	+ * http://jquery.org/license
407	+ *
408	+ * http://docs.jquery.com/UI/Button#theming
409	+ */
410	+ .ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
411	+ .ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
412	+ button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
413	+ .ui-button-icons-only { width: 3.4em; }
414	+ button.ui-button-icons-only { width: 3.7em; }
415	+
416	+ /button text element /
417	+ .ui-button .ui-button-text { display: block; line-height: 1.4; }
418	+ .ui-button-text-only .ui-button-text { padding: .4em 1em; }
419	+ .ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
420	+ .ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
421	+ .ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
422	+ .ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
423	+ /* no icon support for input elements, provide padding by default */
424	+ input.ui-button { padding: .4em 1em; }
425	+
426	+ /button icon element(s) /
427	+ .ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
428	+ .ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
429	+ .ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
430	+ .ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
431	+ .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
432	+
433	+ /button sets/
434	+ .ui-buttonset { margin-right: 7px; }
435	+ .ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
436	+
437	+ /* workarounds */
438	+ button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
439	+ /*
440	+ * jQuery UI Dialog 1.8.12
441	+ *
442	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
443	+ * Dual licensed under the MIT or GPL Version 2 licenses.
444	+ * http://jquery.org/license
445	+ *
446	+ * http://docs.jquery.com/UI/Dialog#theming
447	+ */
448	+ .ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
449	+ .ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
450	+ .ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
451	+ .ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
452	+ .ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
453	+ .ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
454	+ .ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
455	+ .ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
456	+ .ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
457	+ .ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
458	+ .ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
459	+ .ui-draggable .ui-dialog-titlebar { cursor: move; }
460	+ /*
461	+ * jQuery UI Slider 1.8.12
462	+ *
463	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
464	+ * Dual licensed under the MIT or GPL Version 2 licenses.
465	+ * http://jquery.org/license
466	+ *
467	+ * http://docs.jquery.com/UI/Slider#theming
468	+ */
469	+ .ui-slider { position: relative; text-align: left; }
470	+ .ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
471	+ .ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
472	+
473	+ .ui-slider-horizontal { height: .8em; }
474	+ .ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
475	+ .ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
476	+ .ui-slider-horizontal .ui-slider-range-min { left: 0; }
477	+ .ui-slider-horizontal .ui-slider-range-max { right: 0; }
478	+
479	+ .ui-slider-vertical { width: .8em; height: 100px; }
480	+ .ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
481	+ .ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
482	+ .ui-slider-vertical .ui-slider-range-min { bottom: 0; }
483	+ .ui-slider-vertical .ui-slider-range-max { top: 0; }/*
484	+ * jQuery UI Tabs 1.8.12
485	+ *
486	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
487	+ * Dual licensed under the MIT or GPL Version 2 licenses.
488	+ * http://jquery.org/license
489	+ *
490	+ * http://docs.jquery.com/UI/Tabs#theming
491	+ */
492	+ .ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
493	+ .ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
494	+ .ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
495	+ .ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
496	+ .ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
497	+ .ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
498	+ .ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
499	+ .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
500	+ .ui-tabs .ui-tabs-hide { display: none !important; }
501	+ /*
502	+ * jQuery UI Datepicker 1.8.12
503	+ *
504	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
505	+ * Dual licensed under the MIT or GPL Version 2 licenses.
506	+ * http://jquery.org/license
507	+ *
508	+ * http://docs.jquery.com/UI/Datepicker#theming
509	+ */
510	+ .ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
511	+ .ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
512	+ .ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
513	+ .ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
514	+ .ui-datepicker .ui-datepicker-prev { left:2px; }
515	+ .ui-datepicker .ui-datepicker-next { right:2px; }
516	+ .ui-datepicker .ui-datepicker-prev-hover { left:1px; }
517	+ .ui-datepicker .ui-datepicker-next-hover { right:1px; }
518	+ .ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
519	+ .ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
520	+ .ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
521	+ .ui-datepicker select.ui-datepicker-month-year {width: 100%;}
522	+ .ui-datepicker select.ui-datepicker-month,
523	+ .ui-datepicker select.ui-datepicker-year { width: 49%;}
524	+ .ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
525	+ .ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
526	+ .ui-datepicker td { border: 0; padding: 1px; }
527	+ .ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
528	+ .ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
529	+ .ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
530	+ .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
531	+
532	+ /* with multiple calendars */
533	+ .ui-datepicker.ui-datepicker-multi { width:auto; }
534	+ .ui-datepicker-multi .ui-datepicker-group { float:left; }
535	+ .ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
536	+ .ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
537	+ .ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
538	+ .ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
539	+ .ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
540	+ .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
541	+ .ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
542	+ .ui-datepicker-row-break { clear:both; width:100%; }
543	+
544	+ /* RTL support */
545	+ .ui-datepicker-rtl { direction: rtl; }
546	+ .ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
547	+ .ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
548	+ .ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
549	+ .ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
550	+ .ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
551	+ .ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
552	+ .ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
553	+ .ui-datepicker-rtl .ui-datepicker-group { float:right; }
554	+ .ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
555	+ .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
556	+
557	+ /* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
558	+ .ui-datepicker-cover {
559	+ display: none; /sorry for IE5/
560	+ display/*/: block; /sorry for IE5*/
561	+ position: absolute; /must have/
562	+ z-index: -1; /must have/
563	+ filter: mask(); /must have/
564	+ top: -4px; /must have/
565	+ left: -4px; /must have/
566	+ width: 200px; /must have/
567	+ height: 200px; /must have/
568	+ }/*
569	+ * jQuery UI Progressbar 1.8.12
570	+ *
571	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
572	+ * Dual licensed under the MIT or GPL Version 2 licenses.
573	+ * http://jquery.org/license
574	+ *
575	+ * http://docs.jquery.com/UI/Progressbar#theming
576	+ */
577	+ .ui-progressbar { height:2em; text-align: left; }
578	+ .ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }

skin/adminhtml/default/default/oopsprofile/css/jquery.checkboxtree.css ADDED Viewed

	@@ -0,0 +1,12 @@


1	+ .ui-widget-daredevel-checkboxTree li {
2	+ list-style-type: none;
3	+ position: relative;
4	+ left:25px;
5	+ }
6	+
7	+ .ui-widget-daredevel-checkboxTree li span {
8	+ cursor: default;
9	+ position: absolute;
10	+ top: 1px;
11	+ left: -16px;
12	+ }

skin/adminhtml/default/default/oopsprofile/css/oopsprofile.css ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ /Oops profile/
2	+ .oopsprofile-generator select { width:207px; }
3	+ .oopsprofile-generator input.input-text { width:200px; }
4	+
5	+ .oopsprofile-generator .field-row button.delete {vertical-align:middle; }
6	+ .oopsprofile-generator fieldset button.add {display:inline; margin:0; }
7	+
8	+ /category Mapping/
9	+ .category-mapping.entry-edit .field-row label{width:240px;}
10	+ .category-mapping.entry-edit .field-row input.input-text{width:205px;}
11	+
12	+ .category-mapping.entry-edit ul.ui-widget{float:left;width:100%;}
13	+ .category-mapping.entry-edit ul.ui-widget li{float:left;width:95%;}
14	+ .category-mapping.entry-edit ul{float:left;width:100%;background:#f0f0f0;}
15	+ .category-mapping.entry-edit ul li{float:left;width:95%;margin:0;}
16	+ .category-mapping.entry-edit .category-mapping{float:left;width:95%;border:1px solid #cccccc;padding:2px;margin:1px 0;}
17	+ .category-mapping.entry-edit .category-name{float:left;width:20%;}
18	+ .category-mapping.entry-edit .category-map{float:left;width:80%;}
19	+
20	+ .category-mapping.entry-edit .category-map input{
21	+ float:left;
22	+ width: 350px;
23	+ border: 1px solid #DDDDDD;
24	+ background: #F6F6F6;
25	+ padding: 1px 3px 1px 3px;
26	+ color: #2f2f2f;
27	+ font-size: 12px;
28	+ }
29	+ .category-mapping.entry-edit .category-map input:focus,.category-mapping.entry-edit .category-map input:hover{
30	+ background: #fff;
31	+ border-color: #aaa #c8c8c8 #c8c8c8 #aaa;
32	+ }
33	+

skin/adminhtml/default/default/oopsprofile/images/ui-bg_flat_0_aaaaaa_40x100.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_flat_75_ffffff_40x100.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_55_fbf9ee_1x400.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_65_ffffff_1x400.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_75_dadada_1x400.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_75_e6e6e6_1x400.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_glass_95_fef1ec_1x400.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-bg_highlight-soft_75_cccccc_1x100.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-icons_222222_256x240.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-icons_2e83ff_256x240.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-icons_454545_256x240.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-icons_888888_256x240.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/images/ui-icons_cd0a0a_256x240.png ADDED Viewed

Binary file

skin/adminhtml/default/default/oopsprofile/js/jquery-1.4.4.js ADDED Viewed

	@@ -0,0 +1,7180 @@


1	+ /*!
2	+ * jQuery JavaScript Library v1.4.4
3	+ * http://jquery.com/
4	+ *
5	+ * Copyright 2010, John Resig
6	+ * Dual licensed under the MIT or GPL Version 2 licenses.
7	+ * http://jquery.org/license
8	+ *
9	+ * Includes Sizzle.js
10	+ * http://sizzlejs.com/
11	+ * Copyright 2010, The Dojo Foundation
12	+ * Released under the MIT, BSD, and GPL Licenses.
13	+ *
14	+ * Date: Thu Nov 11 19:04:53 2010 -0500
15	+ */
16	+ (function( window, undefined ) {
17	+
18	+ // Use the correct document accordingly with window argument (sandbox)
19	+ var document = window.document;
20	+ var jQuery = (function() {
21	+
22	+ // Define a local copy of jQuery
23	+ var jQuery = function( selector, context ) {
24	+ // The jQuery object is actually just the init constructor 'enhanced'
25	+ return new jQuery.fn.init( selector, context );
26	+ },
27	+
28	+ // Map over jQuery in case of overwrite
29	+ _jQuery = window.jQuery,
30	+
31	+ // Map over the $ in case of overwrite
32	+ _$ = window.$,
33	+
34	+ // A central reference to the root jQuery(document)
35	+ rootjQuery,
36	+
37	+ // A simple way to check for HTML strings or ID strings
38	+ // (both of which we optimize for)
39	+ quickExpr = /^(?:[^<](<[\w\W]+>)[^>]$\|#([\w\-]+)$)/,
40	+
41	+ // Is it a simple selector
42	+ isSimple = /^.[^:#\[\.,]*$/,
43	+
44	+ // Check if a string has a non-whitespace character in it
45	+ rnotwhite = /\S/,
46	+ rwhite = /\s/,
47	+
48	+ // Used for trimming whitespace
49	+ trimLeft = /^\s+/,
50	+ trimRight = /\s+$/,
51	+
52	+ // Check for non-word characters
53	+ rnonword = /\W/,
54	+
55	+ // Check for digits
56	+ rdigit = /\d/,
57	+
58	+ // Match a standalone tag
59	+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
60	+
61	+ // JSON RegExp
62	+ rvalidchars = /^[\],:{}\s]*$/,
63	+ rvalidescape = /\\(?:["\\\/bfnrt]\|u[0-9a-fA-F]{4})/g,
64	+ rvalidtokens = /"[^"\\\n\r]"\|true\|false\|null\|-?\d+(?:\.\d)?(?:[eE][+\-]?\d+)?/g,
65	+ rvalidbraces = /(?:^\|:\|,)(?:\s*\[)+/g,
66	+
67	+ // Useragent RegExp
68	+ rwebkit = /(webkit)[ \/]([\w.]+)/,
69	+ ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
70	+ rmsie = /(msie) ([\w.]+)/,
71	+ rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
72	+
73	+ // Keep a UserAgent string for use with jQuery.browser
74	+ userAgent = navigator.userAgent,
75	+
76	+ // For matching the engine and version of the browser
77	+ browserMatch,
78	+
79	+ // Has the ready events already been bound?
80	+ readyBound = false,
81	+
82	+ // The functions to execute on DOM ready
83	+ readyList = [],
84	+
85	+ // The ready event handler
86	+ DOMContentLoaded,
87	+
88	+ // Save a reference to some core methods
89	+ toString = Object.prototype.toString,
90	+ hasOwn = Object.prototype.hasOwnProperty,
91	+ push = Array.prototype.push,
92	+ slice = Array.prototype.slice,
93	+ trim = String.prototype.trim,
94	+ indexOf = Array.prototype.indexOf,
95	+
96	+ // [[Class]] -> type pairs
97	+ class2type = {};
98	+
99	+ jQuery.fn = jQuery.prototype = {
100	+ init: function( selector, context ) {
101	+ var match, elem, ret, doc;
102	+
103	+ // Handle $(""), $(null), or $(undefined)
104	+ if ( !selector ) {
105	+ return this;
106	+ }
107	+
108	+ // Handle $(DOMElement)
109	+ if ( selector.nodeType ) {
110	+ this.context = this[0] = selector;
111	+ this.length = 1;
112	+ return this;
113	+ }
114	+
115	+ // The body element only exists once, optimize finding it
116	+ if ( selector === "body" && !context && document.body ) {
117	+ this.context = document;
118	+ this[0] = document.body;
119	+ this.selector = "body";
120	+ this.length = 1;
121	+ return this;
122	+ }
123	+
124	+ // Handle HTML strings
125	+ if ( typeof selector === "string" ) {
126	+ // Are we dealing with HTML string or an ID?
127	+ match = quickExpr.exec( selector );
128	+
129	+ // Verify a match, and that no context was specified for #id
130	+ if ( match && (match[1] \|\| !context) ) {
131	+
132	+ // HANDLE: $(html) -> $(array)
133	+ if ( match[1] ) {
134	+ doc = (context ? context.ownerDocument \|\| context : document);
135	+
136	+ // If a single string is passed in and it's a single tag
137	+ // just do a createElement and skip the rest
138	+ ret = rsingleTag.exec( selector );
139	+
140	+ if ( ret ) {
141	+ if ( jQuery.isPlainObject( context ) ) {
142	+ selector = [ document.createElement( ret[1] ) ];
143	+ jQuery.fn.attr.call( selector, context, true );
144	+
145	+ } else {
146	+ selector = [ doc.createElement( ret[1] ) ];
147	+ }
148	+
149	+ } else {
150	+ ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
151	+ selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes;
152	+ }
153	+
154	+ return jQuery.merge( this, selector );
155	+
156	+ // HANDLE: $("#id")
157	+ } else {
158	+ elem = document.getElementById( match[2] );
159	+
160	+ // Check parentNode to catch when Blackberry 4.6 returns
161	+ // nodes that are no longer in the document #6963
162	+ if ( elem && elem.parentNode ) {
163	+ // Handle the case where IE and Opera return items
164	+ // by name instead of ID
165	+ if ( elem.id !== match[2] ) {
166	+ return rootjQuery.find( selector );
167	+ }
168	+
169	+ // Otherwise, we inject the element directly into the jQuery object
170	+ this.length = 1;
171	+ this[0] = elem;
172	+ }
173	+
174	+ this.context = document;
175	+ this.selector = selector;
176	+ return this;
177	+ }
178	+
179	+ // HANDLE: $("TAG")
180	+ } else if ( !context && !rnonword.test( selector ) ) {
181	+ this.selector = selector;
182	+ this.context = document;
183	+ selector = document.getElementsByTagName( selector );
184	+ return jQuery.merge( this, selector );
185	+
186	+ // HANDLE: $(expr, $(...))
187	+ } else if ( !context \|\| context.jquery ) {
188	+ return (context \|\| rootjQuery).find( selector );
189	+
190	+ // HANDLE: $(expr, context)
191	+ // (which is just equivalent to: $(context).find(expr)
192	+ } else {
193	+ return jQuery( context ).find( selector );
194	+ }
195	+
196	+ // HANDLE: $(function)
197	+ // Shortcut for document ready
198	+ } else if ( jQuery.isFunction( selector ) ) {
199	+ return rootjQuery.ready( selector );
200	+ }
201	+
202	+ if (selector.selector !== undefined) {
203	+ this.selector = selector.selector;
204	+ this.context = selector.context;
205	+ }
206	+
207	+ return jQuery.makeArray( selector, this );
208	+ },
209	+
210	+ // Start with an empty selector
211	+ selector: "",
212	+
213	+ // The current version of jQuery being used
214	+ jquery: "1.4.4",
215	+
216	+ // The default length of a jQuery object is 0
217	+ length: 0,
218	+
219	+ // The number of elements contained in the matched element set
220	+ size: function() {
221	+ return this.length;
222	+ },
223	+
224	+ toArray: function() {
225	+ return slice.call( this, 0 );
226	+ },
227	+
228	+ // Get the Nth element in the matched element set OR
229	+ // Get the whole matched element set as a clean array
230	+ get: function( num ) {
231	+ return num == null ?
232	+
233	+ // Return a 'clean' array
234	+ this.toArray() :
235	+
236	+ // Return just the object
237	+ ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] );
238	+ },
239	+
240	+ // Take an array of elements and push it onto the stack
241	+ // (returning the new matched element set)
242	+ pushStack: function( elems, name, selector ) {
243	+ // Build a new jQuery matched element set
244	+ var ret = jQuery();
245	+
246	+ if ( jQuery.isArray( elems ) ) {
247	+ push.apply( ret, elems );
248	+
249	+ } else {
250	+ jQuery.merge( ret, elems );
251	+ }
252	+
253	+ // Add the old object onto the stack (as a reference)
254	+ ret.prevObject = this;
255	+
256	+ ret.context = this.context;
257	+
258	+ if ( name === "find" ) {
259	+ ret.selector = this.selector + (this.selector ? " " : "") + selector;
260	+ } else if ( name ) {
261	+ ret.selector = this.selector + "." + name + "(" + selector + ")";
262	+ }
263	+
264	+ // Return the newly-formed element set
265	+ return ret;
266	+ },
267	+
268	+ // Execute a callback for every element in the matched set.
269	+ // (You can seed the arguments with an array of args, but this is
270	+ // only used internally.)
271	+ each: function( callback, args ) {
272	+ return jQuery.each( this, callback, args );
273	+ },
274	+
275	+ ready: function( fn ) {
276	+ // Attach the listeners
277	+ jQuery.bindReady();
278	+
279	+ // If the DOM is already ready
280	+ if ( jQuery.isReady ) {
281	+ // Execute the function immediately
282	+ fn.call( document, jQuery );
283	+
284	+ // Otherwise, remember the function for later
285	+ } else if ( readyList ) {
286	+ // Add the function to the wait list
287	+ readyList.push( fn );
288	+ }
289	+
290	+ return this;
291	+ },
292	+
293	+ eq: function( i ) {
294	+ return i === -1 ?
295	+ this.slice( i ) :
296	+ this.slice( i, +i + 1 );
297	+ },
298	+
299	+ first: function() {
300	+ return this.eq( 0 );
301	+ },
302	+
303	+ last: function() {
304	+ return this.eq( -1 );
305	+ },
306	+
307	+ slice: function() {
308	+ return this.pushStack( slice.apply( this, arguments ),
309	+ "slice", slice.call(arguments).join(",") );
310	+ },
311	+
312	+ map: function( callback ) {
313	+ return this.pushStack( jQuery.map(this, function( elem, i ) {
314	+ return callback.call( elem, i, elem );
315	+ }));
316	+ },
317	+
318	+ end: function() {
319	+ return this.prevObject \|\| jQuery(null);
320	+ },
321	+
322	+ // For internal use only.
323	+ // Behaves like an Array's method, not like a jQuery method.
324	+ push: push,
325	+ sort: [].sort,
326	+ splice: [].splice
327	+ };
328	+
329	+ // Give the init function the jQuery prototype for later instantiation
330	+ jQuery.fn.init.prototype = jQuery.fn;
331	+
332	+ jQuery.extend = jQuery.fn.extend = function() {
333	+ var options, name, src, copy, copyIsArray, clone,
334	+ target = arguments[0] \|\| {},
335	+ i = 1,
336	+ length = arguments.length,
337	+ deep = false;
338	+
339	+ // Handle a deep copy situation
340	+ if ( typeof target === "boolean" ) {
341	+ deep = target;
342	+ target = arguments[1] \|\| {};
343	+ // skip the boolean and the target
344	+ i = 2;
345	+ }
346	+
347	+ // Handle case when target is a string or something (possible in deep copy)
348	+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
349	+ target = {};
350	+ }
351	+
352	+ // extend jQuery itself if only one argument is passed
353	+ if ( length === i ) {
354	+ target = this;
355	+ --i;
356	+ }
357	+
358	+ for ( ; i < length; i++ ) {
359	+ // Only deal with non-null/undefined values
360	+ if ( (options = arguments[ i ]) != null ) {
361	+ // Extend the base object
362	+ for ( name in options ) {
363	+ src = target[ name ];
364	+ copy = options[ name ];
365	+
366	+ // Prevent never-ending loop
367	+ if ( target === copy ) {
368	+ continue;
369	+ }
370	+
371	+ // Recurse if we're merging plain objects or arrays
372	+ if ( deep && copy && ( jQuery.isPlainObject(copy) \|\| (copyIsArray = jQuery.isArray(copy)) ) ) {
373	+ if ( copyIsArray ) {
374	+ copyIsArray = false;
375	+ clone = src && jQuery.isArray(src) ? src : [];
376	+
377	+ } else {
378	+ clone = src && jQuery.isPlainObject(src) ? src : {};
379	+ }
380	+
381	+ // Never move original objects, clone them
382	+ target[ name ] = jQuery.extend( deep, clone, copy );
383	+
384	+ // Don't bring in undefined values
385	+ } else if ( copy !== undefined ) {
386	+ target[ name ] = copy;
387	+ }
388	+ }
389	+ }
390	+ }
391	+
392	+ // Return the modified object
393	+ return target;
394	+ };
395	+
396	+ jQuery.extend({
397	+ noConflict: function( deep ) {
398	+ window.$ = _$;
399	+
400	+ if ( deep ) {
401	+ window.jQuery = _jQuery;
402	+ }
403	+
404	+ return jQuery;
405	+ },
406	+
407	+ // Is the DOM ready to be used? Set to true once it occurs.
408	+ isReady: false,
409	+
410	+ // A counter to track how many items to wait for before
411	+ // the ready event fires. See #6781
412	+ readyWait: 1,
413	+
414	+ // Handle when the DOM is ready
415	+ ready: function( wait ) {
416	+ // A third-party is pushing the ready event forwards
417	+ if ( wait === true ) {
418	+ jQuery.readyWait--;
419	+ }
420	+
421	+ // Make sure that the DOM is not already loaded
422	+ if ( !jQuery.readyWait \|\| (wait !== true && !jQuery.isReady) ) {
423	+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
424	+ if ( !document.body ) {
425	+ return setTimeout( jQuery.ready, 1 );
426	+ }
427	+
428	+ // Remember that the DOM is ready
429	+ jQuery.isReady = true;
430	+
431	+ // If a normal DOM Ready event fired, decrement, and wait if need be
432	+ if ( wait !== true && --jQuery.readyWait > 0 ) {
433	+ return;
434	+ }
435	+
436	+ // If there are functions bound, to execute
437	+ if ( readyList ) {
438	+ // Execute all of them
439	+ var fn,
440	+ i = 0,
441	+ ready = readyList;
442	+
443	+ // Reset the list of functions
444	+ readyList = null;
445	+
446	+ while ( (fn = ready[ i++ ]) ) {
447	+ fn.call( document, jQuery );
448	+ }
449	+
450	+ // Trigger any bound ready events
451	+ if ( jQuery.fn.trigger ) {
452	+ jQuery( document ).trigger( "ready" ).unbind( "ready" );
453	+ }
454	+ }
455	+ }
456	+ },
457	+
458	+ bindReady: function() {
459	+ if ( readyBound ) {
460	+ return;
461	+ }
462	+
463	+ readyBound = true;
464	+
465	+ // Catch cases where $(document).ready() is called after the
466	+ // browser event has already occurred.
467	+ if ( document.readyState === "complete" ) {
468	+ // Handle it asynchronously to allow scripts the opportunity to delay ready
469	+ return setTimeout( jQuery.ready, 1 );
470	+ }
471	+
472	+ // Mozilla, Opera and webkit nightlies currently support this event
473	+ if ( document.addEventListener ) {
474	+ // Use the handy event callback
475	+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
476	+
477	+ // A fallback to window.onload, that will always work
478	+ window.addEventListener( "load", jQuery.ready, false );
479	+
480	+ // If IE event model is used
481	+ } else if ( document.attachEvent ) {
482	+ // ensure firing before onload,
483	+ // maybe late but safe also for iframes
484	+ document.attachEvent("onreadystatechange", DOMContentLoaded);
485	+
486	+ // A fallback to window.onload, that will always work
487	+ window.attachEvent( "onload", jQuery.ready );
488	+
489	+ // If IE and not a frame
490	+ // continually check to see if the document is ready
491	+ var toplevel = false;
492	+
493	+ try {
494	+ toplevel = window.frameElement == null;
495	+ } catch(e) {}
496	+
497	+ if ( document.documentElement.doScroll && toplevel ) {
498	+ doScrollCheck();
499	+ }
500	+ }
501	+ },
502	+
503	+ // See test/unit/core.js for details concerning isFunction.
504	+ // Since version 1.3, DOM methods and functions like alert
505	+ // aren't supported. They return false on IE (#2968).
506	+ isFunction: function( obj ) {
507	+ return jQuery.type(obj) === "function";
508	+ },
509	+
510	+ isArray: Array.isArray \|\| function( obj ) {
511	+ return jQuery.type(obj) === "array";
512	+ },
513	+
514	+ // A crude way of determining if an object is a window
515	+ isWindow: function( obj ) {
516	+ return obj && typeof obj === "object" && "setInterval" in obj;
517	+ },
518	+
519	+ isNaN: function( obj ) {
520	+ return obj == null \|\| !rdigit.test( obj ) \|\| isNaN( obj );
521	+ },
522	+
523	+ type: function( obj ) {
524	+ return obj == null ?
525	+ String( obj ) :
526	+ class2type[ toString.call(obj) ] \|\| "object";
527	+ },
528	+
529	+ isPlainObject: function( obj ) {
530	+ // Must be an Object.
531	+ // Because of IE, we also have to check the presence of the constructor property.
532	+ // Make sure that DOM nodes and window objects don't pass through, as well
533	+ if ( !obj \|\| jQuery.type(obj) !== "object" \|\| obj.nodeType \|\| jQuery.isWindow( obj ) ) {
534	+ return false;
535	+ }
536	+
537	+ // Not own constructor property must be Object
538	+ if ( obj.constructor &&
539	+ !hasOwn.call(obj, "constructor") &&
540	+ !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
541	+ return false;
542	+ }
543	+
544	+ // Own properties are enumerated firstly, so to speed up,
545	+ // if last one is own, then all properties are own.
546	+
547	+ var key;
548	+ for ( key in obj ) {}
549	+
550	+ return key === undefined \|\| hasOwn.call( obj, key );
551	+ },
552	+
553	+ isEmptyObject: function( obj ) {
554	+ for ( var name in obj ) {
555	+ return false;
556	+ }
557	+ return true;
558	+ },
559	+
560	+ error: function( msg ) {
561	+ throw msg;
562	+ },
563	+
564	+ parseJSON: function( data ) {
565	+ if ( typeof data !== "string" \|\| !data ) {
566	+ return null;
567	+ }
568	+
569	+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
570	+ data = jQuery.trim( data );
571	+
572	+ // Make sure the incoming data is actual JSON
573	+ // Logic borrowed from http://json.org/json2.js
574	+ if ( rvalidchars.test(data.replace(rvalidescape, "@")
575	+ .replace(rvalidtokens, "]")
576	+ .replace(rvalidbraces, "")) ) {
577	+
578	+ // Try to use the native JSON parser first
579	+ return window.JSON && window.JSON.parse ?
580	+ window.JSON.parse( data ) :
581	+ (new Function("return " + data))();
582	+
583	+ } else {
584	+ jQuery.error( "Invalid JSON: " + data );
585	+ }
586	+ },
587	+
588	+ noop: function() {},
589	+
590	+ // Evalulates a script in a global context
591	+ globalEval: function( data ) {
592	+ if ( data && rnotwhite.test(data) ) {
593	+ // Inspired by code by Andrea Giammarchi
594	+ // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
595	+ var head = document.getElementsByTagName("head")[0] \|\| document.documentElement,
596	+ script = document.createElement("script");
597	+
598	+ script.type = "text/javascript";
599	+
600	+ if ( jQuery.support.scriptEval ) {
601	+ script.appendChild( document.createTextNode( data ) );
602	+ } else {
603	+ script.text = data;
604	+ }
605	+
606	+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
607	+ // This arises when a base node is used (#2709).
608	+ head.insertBefore( script, head.firstChild );
609	+ head.removeChild( script );
610	+ }
611	+ },
612	+
613	+ nodeName: function( elem, name ) {
614	+ return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
615	+ },
616	+
617	+ // args is for internal usage only
618	+ each: function( object, callback, args ) {
619	+ var name, i = 0,
620	+ length = object.length,
621	+ isObj = length === undefined \|\| jQuery.isFunction(object);
622	+
623	+ if ( args ) {
624	+ if ( isObj ) {
625	+ for ( name in object ) {
626	+ if ( callback.apply( object[ name ], args ) === false ) {
627	+ break;
628	+ }
629	+ }
630	+ } else {
631	+ for ( ; i < length; ) {
632	+ if ( callback.apply( object[ i++ ], args ) === false ) {
633	+ break;
634	+ }
635	+ }
636	+ }
637	+
638	+ // A special, fast, case for the most common use of each
639	+ } else {
640	+ if ( isObj ) {
641	+ for ( name in object ) {
642	+ if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
643	+ break;
644	+ }
645	+ }
646	+ } else {
647	+ for ( var value = object[0];
648	+ i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
649	+ }
650	+ }
651	+
652	+ return object;
653	+ },
654	+
655	+ // Use native String.trim function wherever possible
656	+ trim: trim ?
657	+ function( text ) {
658	+ return text == null ?
659	+ "" :
660	+ trim.call( text );
661	+ } :
662	+
663	+ // Otherwise use our own trimming functionality
664	+ function( text ) {
665	+ return text == null ?
666	+ "" :
667	+ text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
668	+ },
669	+
670	+ // results is for internal usage only
671	+ makeArray: function( array, results ) {
672	+ var ret = results \|\| [];
673	+
674	+ if ( array != null ) {
675	+ // The window, strings (and functions) also have 'length'
676	+ // The extra typeof function check is to prevent crashes
677	+ // in Safari 2 (See: #3039)
678	+ // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
679	+ var type = jQuery.type(array);
680	+
681	+ if ( array.length == null \|\| type === "string" \|\| type === "function" \|\| type === "regexp" \|\| jQuery.isWindow( array ) ) {
682	+ push.call( ret, array );
683	+ } else {
684	+ jQuery.merge( ret, array );
685	+ }
686	+ }
687	+
688	+ return ret;
689	+ },
690	+
691	+ inArray: function( elem, array ) {
692	+ if ( array.indexOf ) {
693	+ return array.indexOf( elem );
694	+ }
695	+
696	+ for ( var i = 0, length = array.length; i < length; i++ ) {
697	+ if ( array[ i ] === elem ) {
698	+ return i;
699	+ }
700	+ }
701	+
702	+ return -1;
703	+ },
704	+
705	+ merge: function( first, second ) {
706	+ var i = first.length,
707	+ j = 0;
708	+
709	+ if ( typeof second.length === "number" ) {
710	+ for ( var l = second.length; j < l; j++ ) {
711	+ first[ i++ ] = second[ j ];
712	+ }
713	+
714	+ } else {
715	+ while ( second[j] !== undefined ) {
716	+ first[ i++ ] = second[ j++ ];
717	+ }
718	+ }
719	+
720	+ first.length = i;
721	+
722	+ return first;
723	+ },
724	+
725	+ grep: function( elems, callback, inv ) {
726	+ var ret = [], retVal;
727	+ inv = !!inv;
728	+
729	+ // Go through the array, only saving the items
730	+ // that pass the validator function
731	+ for ( var i = 0, length = elems.length; i < length; i++ ) {
732	+ retVal = !!callback( elems[ i ], i );
733	+ if ( inv !== retVal ) {
734	+ ret.push( elems[ i ] );
735	+ }
736	+ }
737	+
738	+ return ret;
739	+ },
740	+
741	+ // arg is for internal usage only
742	+ map: function( elems, callback, arg ) {
743	+ var ret = [], value;
744	+
745	+ // Go through the array, translating each of the items to their
746	+ // new value (or values).
747	+ for ( var i = 0, length = elems.length; i < length; i++ ) {
748	+ value = callback( elems[ i ], i, arg );
749	+
750	+ if ( value != null ) {
751	+ ret[ ret.length ] = value;
752	+ }
753	+ }
754	+
755	+ return ret.concat.apply( [], ret );
756	+ },
757	+
758	+ // A global GUID counter for objects
759	+ guid: 1,
760	+
761	+ proxy: function( fn, proxy, thisObject ) {
762	+ if ( arguments.length === 2 ) {
763	+ if ( typeof proxy === "string" ) {
764	+ thisObject = fn;
765	+ fn = thisObject[ proxy ];
766	+ proxy = undefined;
767	+
768	+ } else if ( proxy && !jQuery.isFunction( proxy ) ) {
769	+ thisObject = proxy;
770	+ proxy = undefined;
771	+ }
772	+ }
773	+
774	+ if ( !proxy && fn ) {
775	+ proxy = function() {
776	+ return fn.apply( thisObject \|\| this, arguments );
777	+ };
778	+ }
779	+
780	+ // Set the guid of unique handler to the same of original handler, so it can be removed
781	+ if ( fn ) {
782	+ proxy.guid = fn.guid = fn.guid \|\| proxy.guid \|\| jQuery.guid++;
783	+ }
784	+
785	+ // So proxy can be declared as an argument
786	+ return proxy;
787	+ },
788	+
789	+ // Mutifunctional method to get and set values to a collection
790	+ // The value/s can be optionally by executed if its a function
791	+ access: function( elems, key, value, exec, fn, pass ) {
792	+ var length = elems.length;
793	+
794	+ // Setting many attributes
795	+ if ( typeof key === "object" ) {
796	+ for ( var k in key ) {
797	+ jQuery.access( elems, k, key[k], exec, fn, value );
798	+ }
799	+ return elems;
800	+ }
801	+
802	+ // Setting one attribute
803	+ if ( value !== undefined ) {
804	+ // Optionally, function values get executed if exec is true
805	+ exec = !pass && exec && jQuery.isFunction(value);
806	+
807	+ for ( var i = 0; i < length; i++ ) {
808	+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
809	+ }
810	+
811	+ return elems;
812	+ }
813	+
814	+ // Getting an attribute
815	+ return length ? fn( elems[0], key ) : undefined;
816	+ },
817	+
818	+ now: function() {
819	+ return (new Date()).getTime();
820	+ },
821	+
822	+ // Use of jQuery.browser is frowned upon.
823	+ // More details: http://docs.jquery.com/Utilities/jQuery.browser
824	+ uaMatch: function( ua ) {
825	+ ua = ua.toLowerCase();
826	+
827	+ var match = rwebkit.exec( ua ) \|\|
828	+ ropera.exec( ua ) \|\|
829	+ rmsie.exec( ua ) \|\|
830	+ ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) \|\|
831	+ [];
832	+
833	+ return { browser: match[1] \|\| "", version: match[2] \|\| "0" };
834	+ },
835	+
836	+ browser: {}
837	+ });
838	+
839	+ // Populate the class2type map
840	+ jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
841	+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
842	+ });
843	+
844	+ browserMatch = jQuery.uaMatch( userAgent );
845	+ if ( browserMatch.browser ) {
846	+ jQuery.browser[ browserMatch.browser ] = true;
847	+ jQuery.browser.version = browserMatch.version;
848	+ }
849	+
850	+ // Deprecated, use jQuery.browser.webkit instead
851	+ if ( jQuery.browser.webkit ) {
852	+ jQuery.browser.safari = true;
853	+ }
854	+
855	+ if ( indexOf ) {
856	+ jQuery.inArray = function( elem, array ) {
857	+ return indexOf.call( array, elem );
858	+ };
859	+ }
860	+
861	+ // Verify that \s matches non-breaking spaces
862	+ // (IE fails on this test)
863	+ if ( !rwhite.test( "\xA0" ) ) {
864	+ trimLeft = /^[\s\xA0]+/;
865	+ trimRight = /[\s\xA0]+$/;
866	+ }
867	+
868	+ // All jQuery objects should point back to these
869	+ rootjQuery = jQuery(document);
870	+
871	+ // Cleanup functions for the document ready method
872	+ if ( document.addEventListener ) {
873	+ DOMContentLoaded = function() {
874	+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
875	+ jQuery.ready();
876	+ };
877	+
878	+ } else if ( document.attachEvent ) {
879	+ DOMContentLoaded = function() {
880	+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
881	+ if ( document.readyState === "complete" ) {
882	+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
883	+ jQuery.ready();
884	+ }
885	+ };
886	+ }
887	+
888	+ // The DOM ready check for Internet Explorer
889	+ function doScrollCheck() {
890	+ if ( jQuery.isReady ) {
891	+ return;
892	+ }
893	+
894	+ try {
895	+ // If IE is used, use the trick by Diego Perini
896	+ // http://javascript.nwbox.com/IEContentLoaded/
897	+ document.documentElement.doScroll("left");
898	+ } catch(e) {
899	+ setTimeout( doScrollCheck, 1 );
900	+ return;
901	+ }
902	+
903	+ // and execute any waiting functions
904	+ jQuery.ready();
905	+ }
906	+
907	+ // Expose jQuery to the global object
908	+ return (window.jQuery = window.$ = jQuery);
909	+
910	+ })();
911	+
912	+
913	+ (function() {
914	+
915	+ jQuery.support = {};
916	+
917	+ var root = document.documentElement,
918	+ script = document.createElement("script"),
919	+ div = document.createElement("div"),
920	+ id = "script" + jQuery.now();
921	+
922	+ div.style.display = "none";
923	+ div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
924	+
925	+ var all = div.getElementsByTagName("*"),
926	+ a = div.getElementsByTagName("a")[0],
927	+ select = document.createElement("select"),
928	+ opt = select.appendChild( document.createElement("option") );
929	+
930	+ // Can't get basic test support
931	+ if ( !all \|\| !all.length \|\| !a ) {
932	+ return;
933	+ }
934	+
935	+ jQuery.support = {
936	+ // IE strips leading whitespace when .innerHTML is used
937	+ leadingWhitespace: div.firstChild.nodeType === 3,
938	+
939	+ // Make sure that tbody elements aren't automatically inserted
940	+ // IE will insert them into empty tables
941	+ tbody: !div.getElementsByTagName("tbody").length,
942	+
943	+ // Make sure that link elements get serialized correctly by innerHTML
944	+ // This requires a wrapper element in IE
945	+ htmlSerialize: !!div.getElementsByTagName("link").length,
946	+
947	+ // Get the style information from getAttribute
948	+ // (IE uses .cssText insted)
949	+ style: /red/.test( a.getAttribute("style") ),
950	+
951	+ // Make sure that URLs aren't manipulated
952	+ // (IE normalizes it by default)
953	+ hrefNormalized: a.getAttribute("href") === "/a",
954	+
955	+ // Make sure that element opacity exists
956	+ // (IE uses filter instead)
957	+ // Use a regex to work around a WebKit issue. See #5145
958	+ opacity: /^0.55$/.test( a.style.opacity ),
959	+
960	+ // Verify style float existence
961	+ // (IE uses styleFloat instead of cssFloat)
962	+ cssFloat: !!a.style.cssFloat,
963	+
964	+ // Make sure that if no value is specified for a checkbox
965	+ // that it defaults to "on".
966	+ // (WebKit defaults to "" instead)
967	+ checkOn: div.getElementsByTagName("input")[0].value === "on",
968	+
969	+ // Make sure that a selected-by-default option has a working selected property.
970	+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
971	+ optSelected: opt.selected,
972	+
973	+ // Will be defined later
974	+ deleteExpando: true,
975	+ optDisabled: false,
976	+ checkClone: false,
977	+ scriptEval: false,
978	+ noCloneEvent: true,
979	+ boxModel: null,
980	+ inlineBlockNeedsLayout: false,
981	+ shrinkWrapBlocks: false,
982	+ reliableHiddenOffsets: true
983	+ };
984	+
985	+ // Make sure that the options inside disabled selects aren't marked as disabled
986	+ // (WebKit marks them as diabled)
987	+ select.disabled = true;
988	+ jQuery.support.optDisabled = !opt.disabled;
989	+
990	+ script.type = "text/javascript";
991	+ try {
992	+ script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
993	+ } catch(e) {}
994	+
995	+ root.insertBefore( script, root.firstChild );
996	+
997	+ // Make sure that the execution of code works by injecting a script
998	+ // tag with appendChild/createTextNode
999	+ // (IE doesn't support this, fails, and uses .text instead)
1000	+ if ( window[ id ] ) {
1001	+ jQuery.support.scriptEval = true;
1002	+ delete window[ id ];
1003	+ }
1004	+
1005	+ // Test to see if it's possible to delete an expando from an element
1006	+ // Fails in Internet Explorer
1007	+ try {
1008	+ delete script.test;
1009	+
1010	+ } catch(e) {
1011	+ jQuery.support.deleteExpando = false;
1012	+ }
1013	+
1014	+ root.removeChild( script );
1015	+
1016	+ if ( div.attachEvent && div.fireEvent ) {
1017	+ div.attachEvent("onclick", function click() {
1018	+ // Cloning a node shouldn't copy over any
1019	+ // bound event handlers (IE does this)
1020	+ jQuery.support.noCloneEvent = false;
1021	+ div.detachEvent("onclick", click);
1022	+ });
1023	+ div.cloneNode(true).fireEvent("onclick");
1024	+ }
1025	+
1026	+ div = document.createElement("div");
1027	+ div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
1028	+
1029	+ var fragment = document.createDocumentFragment();
1030	+ fragment.appendChild( div.firstChild );
1031	+
1032	+ // WebKit doesn't clone checked state correctly in fragments
1033	+ jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
1034	+
1035	+ // Figure out if the W3C box model works as expected
1036	+ // document.body must exist before we can do this
1037	+ jQuery(function() {
1038	+ var div = document.createElement("div");
1039	+ div.style.width = div.style.paddingLeft = "1px";
1040	+
1041	+ document.body.appendChild( div );
1042	+ jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
1043	+
1044	+ if ( "zoom" in div.style ) {
1045	+ // Check if natively block-level elements act like inline-block
1046	+ // elements when setting their display to 'inline' and giving
1047	+ // them layout
1048	+ // (IE < 8 does this)
1049	+ div.style.display = "inline";
1050	+ div.style.zoom = 1;
1051	+ jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2;
1052	+
1053	+ // Check if elements with layout shrink-wrap their children
1054	+ // (IE 6 does this)
1055	+ div.style.display = "";
1056	+ div.innerHTML = "<div style='width:4px;'></div>";
1057	+ jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2;
1058	+ }
1059	+
1060	+ div.innerHTML = "<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>";
1061	+ var tds = div.getElementsByTagName("td");
1062	+
1063	+ // Check if table cells still have offsetWidth/Height when they are set
1064	+ // to display:none and there are still other visible table cells in a
1065	+ // table row; if so, offsetWidth/Height are not reliable for use when
1066	+ // determining if an element has been hidden directly using
1067	+ // display:none (it is still safe to use offsets if a parent element is
1068	+ // hidden; don safety goggles and see bug #4512 for more information).
1069	+ // (only IE 8 fails this test)
1070	+ jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0;
1071	+
1072	+ tds[0].style.display = "";
1073	+ tds[1].style.display = "none";
1074	+
1075	+ // Check if empty table cells still have offsetWidth/Height
1076	+ // (IE < 8 fail this test)
1077	+ jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0;
1078	+ div.innerHTML = "";
1079	+
1080	+ document.body.removeChild( div ).style.display = "none";
1081	+ div = tds = null;
1082	+ });
1083	+
1084	+ // Technique from Juriy Zaytsev
1085	+ // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
1086	+ var eventSupported = function( eventName ) {
1087	+ var el = document.createElement("div");
1088	+ eventName = "on" + eventName;
1089	+
1090	+ var isSupported = (eventName in el);
1091	+ if ( !isSupported ) {
1092	+ el.setAttribute(eventName, "return;");
1093	+ isSupported = typeof el[eventName] === "function";
1094	+ }
1095	+ el = null;
1096	+
1097	+ return isSupported;
1098	+ };
1099	+
1100	+ jQuery.support.submitBubbles = eventSupported("submit");
1101	+ jQuery.support.changeBubbles = eventSupported("change");
1102	+
1103	+ // release memory in IE
1104	+ root = script = div = all = a = null;
1105	+ })();
1106	+
1107	+
1108	+
1109	+ var windowData = {},
1110	+ rbrace = /^(?:\{.\}\|\[.\])$/;
1111	+
1112	+ jQuery.extend({
1113	+ cache: {},
1114	+
1115	+ // Please use with caution
1116	+ uuid: 0,
1117	+
1118	+ // Unique for each copy of jQuery on the page
1119	+ expando: "jQuery" + jQuery.now(),
1120	+
1121	+ // The following elements throw uncatchable exceptions if you
1122	+ // attempt to add expando properties to them.
1123	+ noData: {
1124	+ "embed": true,
1125	+ // Ban all objects except for Flash (which handle expandos)
1126	+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
1127	+ "applet": true
1128	+ },
1129	+
1130	+ data: function( elem, name, data ) {
1131	+ if ( !jQuery.acceptData( elem ) ) {
1132	+ return;
1133	+ }
1134	+
1135	+ elem = elem == window ?
1136	+ windowData :
1137	+ elem;
1138	+
1139	+ var isNode = elem.nodeType,
1140	+ id = isNode ? elem[ jQuery.expando ] : null,
1141	+ cache = jQuery.cache, thisCache;
1142	+
1143	+ if ( isNode && !id && typeof name === "string" && data === undefined ) {
1144	+ return;
1145	+ }
1146	+
1147	+ // Get the data from the object directly
1148	+ if ( !isNode ) {
1149	+ cache = elem;
1150	+
1151	+ // Compute a unique ID for the element
1152	+ } else if ( !id ) {
1153	+ elem[ jQuery.expando ] = id = ++jQuery.uuid;
1154	+ }
1155	+
1156	+ // Avoid generating a new cache unless none exists and we
1157	+ // want to manipulate it.
1158	+ if ( typeof name === "object" ) {
1159	+ if ( isNode ) {
1160	+ cache[ id ] = jQuery.extend(cache[ id ], name);
1161	+
1162	+ } else {
1163	+ jQuery.extend( cache, name );
1164	+ }
1165	+
1166	+ } else if ( isNode && !cache[ id ] ) {
1167	+ cache[ id ] = {};
1168	+ }
1169	+
1170	+ thisCache = isNode ? cache[ id ] : cache;
1171	+
1172	+ // Prevent overriding the named cache with undefined values
1173	+ if ( data !== undefined ) {
1174	+ thisCache[ name ] = data;
1175	+ }
1176	+
1177	+ return typeof name === "string" ? thisCache[ name ] : thisCache;
1178	+ },
1179	+
1180	+ removeData: function( elem, name ) {
1181	+ if ( !jQuery.acceptData( elem ) ) {
1182	+ return;
1183	+ }
1184	+
1185	+ elem = elem == window ?
1186	+ windowData :
1187	+ elem;
1188	+
1189	+ var isNode = elem.nodeType,
1190	+ id = isNode ? elem[ jQuery.expando ] : elem,
1191	+ cache = jQuery.cache,
1192	+ thisCache = isNode ? cache[ id ] : id;
1193	+
1194	+ // If we want to remove a specific section of the element's data
1195	+ if ( name ) {
1196	+ if ( thisCache ) {
1197	+ // Remove the section of cache data
1198	+ delete thisCache[ name ];
1199	+
1200	+ // If we've removed all the data, remove the element's cache
1201	+ if ( isNode && jQuery.isEmptyObject(thisCache) ) {
1202	+ jQuery.removeData( elem );
1203	+ }
1204	+ }
1205	+
1206	+ // Otherwise, we want to remove all of the element's data
1207	+ } else {
1208	+ if ( isNode && jQuery.support.deleteExpando ) {
1209	+ delete elem[ jQuery.expando ];
1210	+
1211	+ } else if ( elem.removeAttribute ) {
1212	+ elem.removeAttribute( jQuery.expando );
1213	+
1214	+ // Completely remove the data cache
1215	+ } else if ( isNode ) {
1216	+ delete cache[ id ];
1217	+
1218	+ // Remove all fields from the object
1219	+ } else {
1220	+ for ( var n in elem ) {
1221	+ delete elem[ n ];
1222	+ }
1223	+ }
1224	+ }
1225	+ },
1226	+
1227	+ // A method for determining if a DOM node can handle the data expando
1228	+ acceptData: function( elem ) {
1229	+ if ( elem.nodeName ) {
1230	+ var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
1231	+
1232	+ if ( match ) {
1233	+ return !(match === true \|\| elem.getAttribute("classid") !== match);
1234	+ }
1235	+ }
1236	+
1237	+ return true;
1238	+ }
1239	+ });
1240	+
1241	+ jQuery.fn.extend({
1242	+ data: function( key, value ) {
1243	+ var data = null;
1244	+
1245	+ if ( typeof key === "undefined" ) {
1246	+ if ( this.length ) {
1247	+ var attr = this[0].attributes, name;
1248	+ data = jQuery.data( this[0] );
1249	+
1250	+ for ( var i = 0, l = attr.length; i < l; i++ ) {
1251	+ name = attr[i].name;
1252	+
1253	+ if ( name.indexOf( "data-" ) === 0 ) {
1254	+ name = name.substr( 5 );
1255	+ dataAttr( this[0], name, data[ name ] );
1256	+ }
1257	+ }
1258	+ }
1259	+
1260	+ return data;
1261	+
1262	+ } else if ( typeof key === "object" ) {
1263	+ return this.each(function() {
1264	+ jQuery.data( this, key );
1265	+ });
1266	+ }
1267	+
1268	+ var parts = key.split(".");
1269	+ parts[1] = parts[1] ? "." + parts[1] : "";
1270	+
1271	+ if ( value === undefined ) {
1272	+ data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
1273	+
1274	+ // Try to fetch any internally stored data first
1275	+ if ( data === undefined && this.length ) {
1276	+ data = jQuery.data( this[0], key );
1277	+ data = dataAttr( this[0], key, data );
1278	+ }
1279	+
1280	+ return data === undefined && parts[1] ?
1281	+ this.data( parts[0] ) :
1282	+ data;
1283	+
1284	+ } else {
1285	+ return this.each(function() {
1286	+ var $this = jQuery( this ),
1287	+ args = [ parts[0], value ];
1288	+
1289	+ $this.triggerHandler( "setData" + parts[1] + "!", args );
1290	+ jQuery.data( this, key, value );
1291	+ $this.triggerHandler( "changeData" + parts[1] + "!", args );
1292	+ });
1293	+ }
1294	+ },
1295	+
1296	+ removeData: function( key ) {
1297	+ return this.each(function() {
1298	+ jQuery.removeData( this, key );
1299	+ });
1300	+ }
1301	+ });
1302	+
1303	+ function dataAttr( elem, key, data ) {
1304	+ // If nothing was found internally, try to fetch any
1305	+ // data from the HTML5 data-* attribute
1306	+ if ( data === undefined && elem.nodeType === 1 ) {
1307	+ data = elem.getAttribute( "data-" + key );
1308	+
1309	+ if ( typeof data === "string" ) {
1310	+ try {
1311	+ data = data === "true" ? true :
1312	+ data === "false" ? false :
1313	+ data === "null" ? null :
1314	+ !jQuery.isNaN( data ) ? parseFloat( data ) :
1315	+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
1316	+ data;
1317	+ } catch( e ) {}
1318	+
1319	+ // Make sure we set the data so it isn't changed later
1320	+ jQuery.data( elem, key, data );
1321	+
1322	+ } else {
1323	+ data = undefined;
1324	+ }
1325	+ }
1326	+
1327	+ return data;
1328	+ }
1329	+
1330	+
1331	+
1332	+
1333	+ jQuery.extend({
1334	+ queue: function( elem, type, data ) {
1335	+ if ( !elem ) {
1336	+ return;
1337	+ }
1338	+
1339	+ type = (type \|\| "fx") + "queue";
1340	+ var q = jQuery.data( elem, type );
1341	+
1342	+ // Speed up dequeue by getting out quickly if this is just a lookup
1343	+ if ( !data ) {
1344	+ return q \|\| [];
1345	+ }
1346	+
1347	+ if ( !q \|\| jQuery.isArray(data) ) {
1348	+ q = jQuery.data( elem, type, jQuery.makeArray(data) );
1349	+
1350	+ } else {
1351	+ q.push( data );
1352	+ }
1353	+
1354	+ return q;
1355	+ },
1356	+
1357	+ dequeue: function( elem, type ) {
1358	+ type = type \|\| "fx";
1359	+
1360	+ var queue = jQuery.queue( elem, type ),
1361	+ fn = queue.shift();
1362	+
1363	+ // If the fx queue is dequeued, always remove the progress sentinel
1364	+ if ( fn === "inprogress" ) {
1365	+ fn = queue.shift();
1366	+ }
1367	+
1368	+ if ( fn ) {
1369	+ // Add a progress sentinel to prevent the fx queue from being
1370	+ // automatically dequeued
1371	+ if ( type === "fx" ) {
1372	+ queue.unshift("inprogress");
1373	+ }
1374	+
1375	+ fn.call(elem, function() {
1376	+ jQuery.dequeue(elem, type);
1377	+ });
1378	+ }
1379	+ }
1380	+ });
1381	+
1382	+ jQuery.fn.extend({
1383	+ queue: function( type, data ) {
1384	+ if ( typeof type !== "string" ) {
1385	+ data = type;
1386	+ type = "fx";
1387	+ }
1388	+
1389	+ if ( data === undefined ) {
1390	+ return jQuery.queue( this[0], type );
1391	+ }
1392	+ return this.each(function( i ) {
1393	+ var queue = jQuery.queue( this, type, data );
1394	+
1395	+ if ( type === "fx" && queue[0] !== "inprogress" ) {
1396	+ jQuery.dequeue( this, type );
1397	+ }
1398	+ });
1399	+ },
1400	+ dequeue: function( type ) {
1401	+ return this.each(function() {
1402	+ jQuery.dequeue( this, type );
1403	+ });
1404	+ },
1405	+
1406	+ // Based off of the plugin by Clint Helfers, with permission.
1407	+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
1408	+ delay: function( time, type ) {
1409	+ time = jQuery.fx ? jQuery.fx.speeds[time] \|\| time : time;
1410	+ type = type \|\| "fx";
1411	+
1412	+ return this.queue( type, function() {
1413	+ var elem = this;
1414	+ setTimeout(function() {
1415	+ jQuery.dequeue( elem, type );
1416	+ }, time );
1417	+ });
1418	+ },
1419	+
1420	+ clearQueue: function( type ) {
1421	+ return this.queue( type \|\| "fx", [] );
1422	+ }
1423	+ });
1424	+
1425	+
1426	+
1427	+
1428	+ var rclass = /[\n\t]/g,
1429	+ rspaces = /\s+/,
1430	+ rreturn = /\r/g,
1431	+ rspecialurl = /^(?:href\|src\|style)$/,
1432	+ rtype = /^(?:button\|input)$/i,
1433	+ rfocusable = /^(?:button\|input\|object\|select\|textarea)$/i,
1434	+ rclickable = /^a(?:rea)?$/i,
1435	+ rradiocheck = /^(?:radio\|checkbox)$/i;
1436	+
1437	+ jQuery.props = {
1438	+ "for": "htmlFor",
1439	+ "class": "className",
1440	+ readonly: "readOnly",
1441	+ maxlength: "maxLength",
1442	+ cellspacing: "cellSpacing",
1443	+ rowspan: "rowSpan",
1444	+ colspan: "colSpan",
1445	+ tabindex: "tabIndex",
1446	+ usemap: "useMap",
1447	+ frameborder: "frameBorder"
1448	+ };
1449	+
1450	+ jQuery.fn.extend({
1451	+ attr: function( name, value ) {
1452	+ return jQuery.access( this, name, value, true, jQuery.attr );
1453	+ },
1454	+
1455	+ removeAttr: function( name, fn ) {
1456	+ return this.each(function(){
1457	+ jQuery.attr( this, name, "" );
1458	+ if ( this.nodeType === 1 ) {
1459	+ this.removeAttribute( name );
1460	+ }
1461	+ });
1462	+ },
1463	+
1464	+ addClass: function( value ) {
1465	+ if ( jQuery.isFunction(value) ) {
1466	+ return this.each(function(i) {
1467	+ var self = jQuery(this);
1468	+ self.addClass( value.call(this, i, self.attr("class")) );
1469	+ });
1470	+ }
1471	+
1472	+ if ( value && typeof value === "string" ) {
1473	+ var classNames = (value \|\| "").split( rspaces );
1474	+
1475	+ for ( var i = 0, l = this.length; i < l; i++ ) {
1476	+ var elem = this[i];
1477	+
1478	+ if ( elem.nodeType === 1 ) {
1479	+ if ( !elem.className ) {
1480	+ elem.className = value;
1481	+
1482	+ } else {
1483	+ var className = " " + elem.className + " ",
1484	+ setClass = elem.className;
1485	+
1486	+ for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
1487	+ if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
1488	+ setClass += " " + classNames[c];
1489	+ }
1490	+ }
1491	+ elem.className = jQuery.trim( setClass );
1492	+ }
1493	+ }
1494	+ }
1495	+ }
1496	+
1497	+ return this;
1498	+ },
1499	+
1500	+ removeClass: function( value ) {
1501	+ if ( jQuery.isFunction(value) ) {
1502	+ return this.each(function(i) {
1503	+ var self = jQuery(this);
1504	+ self.removeClass( value.call(this, i, self.attr("class")) );
1505	+ });
1506	+ }
1507	+
1508	+ if ( (value && typeof value === "string") \|\| value === undefined ) {
1509	+ var classNames = (value \|\| "").split( rspaces );
1510	+
1511	+ for ( var i = 0, l = this.length; i < l; i++ ) {
1512	+ var elem = this[i];
1513	+
1514	+ if ( elem.nodeType === 1 && elem.className ) {
1515	+ if ( value ) {
1516	+ var className = (" " + elem.className + " ").replace(rclass, " ");
1517	+ for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
1518	+ className = className.replace(" " + classNames[c] + " ", " ");
1519	+ }
1520	+ elem.className = jQuery.trim( className );
1521	+
1522	+ } else {
1523	+ elem.className = "";
1524	+ }
1525	+ }
1526	+ }
1527	+ }
1528	+
1529	+ return this;
1530	+ },
1531	+
1532	+ toggleClass: function( value, stateVal ) {
1533	+ var type = typeof value,
1534	+ isBool = typeof stateVal === "boolean";
1535	+
1536	+ if ( jQuery.isFunction( value ) ) {
1537	+ return this.each(function(i) {
1538	+ var self = jQuery(this);
1539	+ self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
1540	+ });
1541	+ }
1542	+
1543	+ return this.each(function() {
1544	+ if ( type === "string" ) {
1545	+ // toggle individual class names
1546	+ var className,
1547	+ i = 0,
1548	+ self = jQuery( this ),
1549	+ state = stateVal,
1550	+ classNames = value.split( rspaces );
1551	+
1552	+ while ( (className = classNames[ i++ ]) ) {
1553	+ // check each className given, space seperated list
1554	+ state = isBool ? state : !self.hasClass( className );
1555	+ self[ state ? "addClass" : "removeClass" ]( className );
1556	+ }
1557	+
1558	+ } else if ( type === "undefined" \|\| type === "boolean" ) {
1559	+ if ( this.className ) {
1560	+ // store className if set
1561	+ jQuery.data( this, "__className__", this.className );
1562	+ }
1563	+
1564	+ // toggle whole className
1565	+ this.className = this.className \|\| value === false ? "" : jQuery.data( this, "__className__" ) \|\| "";
1566	+ }
1567	+ });
1568	+ },
1569	+
1570	+ hasClass: function( selector ) {
1571	+ var className = " " + selector + " ";
1572	+ for ( var i = 0, l = this.length; i < l; i++ ) {
1573	+ if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
1574	+ return true;
1575	+ }
1576	+ }
1577	+
1578	+ return false;
1579	+ },
1580	+
1581	+ val: function( value ) {
1582	+ if ( !arguments.length ) {
1583	+ var elem = this[0];
1584	+
1585	+ if ( elem ) {
1586	+ if ( jQuery.nodeName( elem, "option" ) ) {
1587	+ // attributes.value is undefined in Blackberry 4.7 but
1588	+ // uses .value. See #6932
1589	+ var val = elem.attributes.value;
1590	+ return !val \|\| val.specified ? elem.value : elem.text;
1591	+ }
1592	+
1593	+ // We need to handle select boxes special
1594	+ if ( jQuery.nodeName( elem, "select" ) ) {
1595	+ var index = elem.selectedIndex,
1596	+ values = [],
1597	+ options = elem.options,
1598	+ one = elem.type === "select-one";
1599	+
1600	+ // Nothing was selected
1601	+ if ( index < 0 ) {
1602	+ return null;
1603	+ }
1604	+
1605	+ // Loop through all the selected options
1606	+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
1607	+ var option = options[ i ];
1608	+
1609	+ // Don't return options that are disabled or in a disabled optgroup
1610	+ if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
1611	+ (!option.parentNode.disabled \|\| !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
1612	+
1613	+ // Get the specific value for the option
1614	+ value = jQuery(option).val();
1615	+
1616	+ // We don't need an array for one selects
1617	+ if ( one ) {
1618	+ return value;
1619	+ }
1620	+
1621	+ // Multi-Selects return an array
1622	+ values.push( value );
1623	+ }
1624	+ }
1625	+
1626	+ return values;
1627	+ }
1628	+
1629	+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
1630	+ if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
1631	+ return elem.getAttribute("value") === null ? "on" : elem.value;
1632	+ }
1633	+
1634	+
1635	+ // Everything else, we just grab the value
1636	+ return (elem.value \|\| "").replace(rreturn, "");
1637	+
1638	+ }
1639	+
1640	+ return undefined;
1641	+ }
1642	+
1643	+ var isFunction = jQuery.isFunction(value);
1644	+
1645	+ return this.each(function(i) {
1646	+ var self = jQuery(this), val = value;
1647	+
1648	+ if ( this.nodeType !== 1 ) {
1649	+ return;
1650	+ }
1651	+
1652	+ if ( isFunction ) {
1653	+ val = value.call(this, i, self.val());
1654	+ }
1655	+
1656	+ // Treat null/undefined as ""; convert numbers to string
1657	+ if ( val == null ) {
1658	+ val = "";
1659	+ } else if ( typeof val === "number" ) {
1660	+ val += "";
1661	+ } else if ( jQuery.isArray(val) ) {
1662	+ val = jQuery.map(val, function (value) {
1663	+ return value == null ? "" : value + "";
1664	+ });
1665	+ }
1666	+
1667	+ if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
1668	+ this.checked = jQuery.inArray( self.val(), val ) >= 0;
1669	+
1670	+ } else if ( jQuery.nodeName( this, "select" ) ) {
1671	+ var values = jQuery.makeArray(val);
1672	+
1673	+ jQuery( "option", this ).each(function() {
1674	+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
1675	+ });
1676	+
1677	+ if ( !values.length ) {
1678	+ this.selectedIndex = -1;
1679	+ }
1680	+
1681	+ } else {
1682	+ this.value = val;
1683	+ }
1684	+ });
1685	+ }
1686	+ });
1687	+
1688	+ jQuery.extend({
1689	+ attrFn: {
1690	+ val: true,
1691	+ css: true,
1692	+ html: true,
1693	+ text: true,
1694	+ data: true,
1695	+ width: true,
1696	+ height: true,
1697	+ offset: true
1698	+ },
1699	+
1700	+ attr: function( elem, name, value, pass ) {
1701	+ // don't set attributes on text and comment nodes
1702	+ if ( !elem \|\| elem.nodeType === 3 \|\| elem.nodeType === 8 ) {
1703	+ return undefined;
1704	+ }
1705	+
1706	+ if ( pass && name in jQuery.attrFn ) {
1707	+ return jQuery(elem)[name](value);
1708	+ }
1709	+
1710	+ var notxml = elem.nodeType !== 1 \|\| !jQuery.isXMLDoc( elem ),
1711	+ // Whether we are setting (or getting)
1712	+ set = value !== undefined;
1713	+
1714	+ // Try to normalize/fix the name
1715	+ name = notxml && jQuery.props[ name ] \|\| name;
1716	+
1717	+ // These attributes require special treatment
1718	+ var special = rspecialurl.test( name );
1719	+
1720	+ // Safari mis-reports the default selected property of an option
1721	+ // Accessing the parent's selectedIndex property fixes it
1722	+ if ( name === "selected" && !jQuery.support.optSelected ) {
1723	+ var parent = elem.parentNode;
1724	+ if ( parent ) {
1725	+ parent.selectedIndex;
1726	+
1727	+ // Make sure that it also works with optgroups, see #5701
1728	+ if ( parent.parentNode ) {
1729	+ parent.parentNode.selectedIndex;
1730	+ }
1731	+ }
1732	+ }
1733	+
1734	+ // If applicable, access the attribute via the DOM 0 way
1735	+ // 'in' checks fail in Blackberry 4.7 #6931
1736	+ if ( (name in elem \|\| elem[ name ] !== undefined) && notxml && !special ) {
1737	+ if ( set ) {
1738	+ // We can't allow the type property to be changed (since it causes problems in IE)
1739	+ if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
1740	+ jQuery.error( "type property can't be changed" );
1741	+ }
1742	+
1743	+ if ( value === null ) {
1744	+ if ( elem.nodeType === 1 ) {
1745	+ elem.removeAttribute( name );
1746	+ }
1747	+
1748	+ } else {
1749	+ elem[ name ] = value;
1750	+ }
1751	+ }
1752	+
1753	+ // browsers index elements by id/name on forms, give priority to attributes.
1754	+ if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
1755	+ return elem.getAttributeNode( name ).nodeValue;
1756	+ }
1757	+
1758	+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
1759	+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
1760	+ if ( name === "tabIndex" ) {
1761	+ var attributeNode = elem.getAttributeNode( "tabIndex" );
1762	+
1763	+ return attributeNode && attributeNode.specified ?
1764	+ attributeNode.value :
1765	+ rfocusable.test( elem.nodeName ) \|\| rclickable.test( elem.nodeName ) && elem.href ?
1766	+ 0 :
1767	+ undefined;
1768	+ }
1769	+
1770	+ return elem[ name ];
1771	+ }
1772	+
1773	+ if ( !jQuery.support.style && notxml && name === "style" ) {
1774	+ if ( set ) {
1775	+ elem.style.cssText = "" + value;
1776	+ }
1777	+
1778	+ return elem.style.cssText;
1779	+ }
1780	+
1781	+ if ( set ) {
1782	+ // convert the value to a string (all browsers do this but IE) see #1070
1783	+ elem.setAttribute( name, "" + value );
1784	+ }
1785	+
1786	+ // Ensure that missing attributes return undefined
1787	+ // Blackberry 4.7 returns "" from getAttribute #6938
1788	+ if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) {
1789	+ return undefined;
1790	+ }
1791	+
1792	+ var attr = !jQuery.support.hrefNormalized && notxml && special ?
1793	+ // Some attributes require a special call on IE
1794	+ elem.getAttribute( name, 2 ) :
1795	+ elem.getAttribute( name );
1796	+
1797	+ // Non-existent attributes return null, we normalize to undefined
1798	+ return attr === null ? undefined : attr;
1799	+ }
1800	+ });
1801	+
1802	+
1803	+
1804	+
1805	+ var rnamespaces = /\.(.*)$/,
1806	+ rformElems = /^(?:textarea\|input\|select)$/i,
1807	+ rperiod = /\./g,
1808	+ rspace = / /g,
1809	+ rescape = /[^\w\s.\|`]/g,
1810	+ fcleanup = function( nm ) {
1811	+ return nm.replace(rescape, "\\$&");
1812	+ },
1813	+ focusCounts = { focusin: 0, focusout: 0 };
1814	+
1815	+ /*
1816	+ * A number of helper functions used for managing events.
1817	+ * Many of the ideas behind this code originated from
1818	+ * Dean Edwards' addEvent library.
1819	+ */
1820	+ jQuery.event = {
1821	+
1822	+ // Bind an event to an element
1823	+ // Original by Dean Edwards
1824	+ add: function( elem, types, handler, data ) {
1825	+ if ( elem.nodeType === 3 \|\| elem.nodeType === 8 ) {
1826	+ return;
1827	+ }
1828	+
1829	+ // For whatever reason, IE has trouble passing the window object
1830	+ // around, causing it to be cloned in the process
1831	+ if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) {
1832	+ elem = window;
1833	+ }
1834	+
1835	+ if ( handler === false ) {
1836	+ handler = returnFalse;
1837	+ } else if ( !handler ) {
1838	+ // Fixes bug #7229. Fix recommended by jdalton
1839	+ return;
1840	+ }
1841	+
1842	+ var handleObjIn, handleObj;
1843	+
1844	+ if ( handler.handler ) {
1845	+ handleObjIn = handler;
1846	+ handler = handleObjIn.handler;
1847	+ }
1848	+
1849	+ // Make sure that the function being executed has a unique ID
1850	+ if ( !handler.guid ) {
1851	+ handler.guid = jQuery.guid++;
1852	+ }
1853	+
1854	+ // Init the element's event structure
1855	+ var elemData = jQuery.data( elem );
1856	+
1857	+ // If no elemData is found then we must be trying to bind to one of the
1858	+ // banned noData elements
1859	+ if ( !elemData ) {
1860	+ return;
1861	+ }
1862	+
1863	+ // Use a key less likely to result in collisions for plain JS objects.
1864	+ // Fixes bug #7150.
1865	+ var eventKey = elem.nodeType ? "events" : "__events__",
1866	+ events = elemData[ eventKey ],
1867	+ eventHandle = elemData.handle;
1868	+
1869	+ if ( typeof events === "function" ) {
1870	+ // On plain objects events is a fn that holds the the data
1871	+ // which prevents this data from being JSON serialized
1872	+ // the function does not need to be called, it just contains the data
1873	+ eventHandle = events.handle;
1874	+ events = events.events;
1875	+
1876	+ } else if ( !events ) {
1877	+ if ( !elem.nodeType ) {
1878	+ // On plain objects, create a fn that acts as the holder
1879	+ // of the values to avoid JSON serialization of event data
1880	+ elemData[ eventKey ] = elemData = function(){};
1881	+ }
1882	+
1883	+ elemData.events = events = {};
1884	+ }
1885	+
1886	+ if ( !eventHandle ) {
1887	+ elemData.handle = eventHandle = function() {
1888	+ // Handle the second event of a trigger and when
1889	+ // an event is called after a page has unloaded
1890	+ return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
1891	+ jQuery.event.handle.apply( eventHandle.elem, arguments ) :
1892	+ undefined;
1893	+ };
1894	+ }
1895	+
1896	+ // Add elem as a property of the handle function
1897	+ // This is to prevent a memory leak with non-native events in IE.
1898	+ eventHandle.elem = elem;
1899	+
1900	+ // Handle multiple events separated by a space
1901	+ // jQuery(...).bind("mouseover mouseout", fn);
1902	+ types = types.split(" ");
1903	+
1904	+ var type, i = 0, namespaces;
1905	+
1906	+ while ( (type = types[ i++ ]) ) {
1907	+ handleObj = handleObjIn ?
1908	+ jQuery.extend({}, handleObjIn) :
1909	+ { handler: handler, data: data };
1910	+
1911	+ // Namespaced event handlers
1912	+ if ( type.indexOf(".") > -1 ) {
1913	+ namespaces = type.split(".");
1914	+ type = namespaces.shift();
1915	+ handleObj.namespace = namespaces.slice(0).sort().join(".");
1916	+
1917	+ } else {
1918	+ namespaces = [];
1919	+ handleObj.namespace = "";
1920	+ }
1921	+
1922	+ handleObj.type = type;
1923	+ if ( !handleObj.guid ) {
1924	+ handleObj.guid = handler.guid;
1925	+ }
1926	+
1927	+ // Get the current list of functions bound to this event
1928	+ var handlers = events[ type ],
1929	+ special = jQuery.event.special[ type ] \|\| {};
1930	+
1931	+ // Init the event handler queue
1932	+ if ( !handlers ) {
1933	+ handlers = events[ type ] = [];
1934	+
1935	+ // Check for a special event handler
1936	+ // Only use addEventListener/attachEvent if the special
1937	+ // events handler returns false
1938	+ if ( !special.setup \|\| special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
1939	+ // Bind the global event handler to the element
1940	+ if ( elem.addEventListener ) {
1941	+ elem.addEventListener( type, eventHandle, false );
1942	+
1943	+ } else if ( elem.attachEvent ) {
1944	+ elem.attachEvent( "on" + type, eventHandle );
1945	+ }
1946	+ }
1947	+ }
1948	+
1949	+ if ( special.add ) {
1950	+ special.add.call( elem, handleObj );
1951	+
1952	+ if ( !handleObj.handler.guid ) {
1953	+ handleObj.handler.guid = handler.guid;
1954	+ }
1955	+ }
1956	+
1957	+ // Add the function to the element's handler list
1958	+ handlers.push( handleObj );
1959	+
1960	+ // Keep track of which events have been used, for global triggering
1961	+ jQuery.event.global[ type ] = true;
1962	+ }
1963	+
1964	+ // Nullify elem to prevent memory leaks in IE
1965	+ elem = null;
1966	+ },
1967	+
1968	+ global: {},
1969	+
1970	+ // Detach an event or set of events from an element
1971	+ remove: function( elem, types, handler, pos ) {
1972	+ // don't do events on text and comment nodes
1973	+ if ( elem.nodeType === 3 \|\| elem.nodeType === 8 ) {
1974	+ return;
1975	+ }
1976	+
1977	+ if ( handler === false ) {
1978	+ handler = returnFalse;
1979	+ }
1980	+
1981	+ var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
1982	+ eventKey = elem.nodeType ? "events" : "__events__",
1983	+ elemData = jQuery.data( elem ),
1984	+ events = elemData && elemData[ eventKey ];
1985	+
1986	+ if ( !elemData \|\| !events ) {
1987	+ return;
1988	+ }
1989	+
1990	+ if ( typeof events === "function" ) {
1991	+ elemData = events;
1992	+ events = events.events;
1993	+ }
1994	+
1995	+ // types is actually an event object here
1996	+ if ( types && types.type ) {
1997	+ handler = types.handler;
1998	+ types = types.type;
1999	+ }
2000	+
2001	+ // Unbind all events for the element
2002	+ if ( !types \|\| typeof types === "string" && types.charAt(0) === "." ) {
2003	+ types = types \|\| "";
2004	+
2005	+ for ( type in events ) {
2006	+ jQuery.event.remove( elem, type + types );
2007	+ }
2008	+
2009	+ return;
2010	+ }
2011	+
2012	+ // Handle multiple events separated by a space
2013	+ // jQuery(...).unbind("mouseover mouseout", fn);
2014	+ types = types.split(" ");
2015	+
2016	+ while ( (type = types[ i++ ]) ) {
2017	+ origType = type;
2018	+ handleObj = null;
2019	+ all = type.indexOf(".") < 0;
2020	+ namespaces = [];
2021	+
2022	+ if ( !all ) {
2023	+ // Namespaced event handlers
2024	+ namespaces = type.split(".");
2025	+ type = namespaces.shift();
2026	+
2027	+ namespace = new RegExp("(^\|\\.)" +
2028	+ jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.\|$)");
2029	+ }
2030	+
2031	+ eventType = events[ type ];
2032	+
2033	+ if ( !eventType ) {
2034	+ continue;
2035	+ }
2036	+
2037	+ if ( !handler ) {
2038	+ for ( j = 0; j < eventType.length; j++ ) {
2039	+ handleObj = eventType[ j ];
2040	+
2041	+ if ( all \|\| namespace.test( handleObj.namespace ) ) {
2042	+ jQuery.event.remove( elem, origType, handleObj.handler, j );
2043	+ eventType.splice( j--, 1 );
2044	+ }
2045	+ }
2046	+
2047	+ continue;
2048	+ }
2049	+
2050	+ special = jQuery.event.special[ type ] \|\| {};
2051	+
2052	+ for ( j = pos \|\| 0; j < eventType.length; j++ ) {
2053	+ handleObj = eventType[ j ];
2054	+
2055	+ if ( handler.guid === handleObj.guid ) {
2056	+ // remove the given handler for the given type
2057	+ if ( all \|\| namespace.test( handleObj.namespace ) ) {
2058	+ if ( pos == null ) {
2059	+ eventType.splice( j--, 1 );
2060	+ }
2061	+
2062	+ if ( special.remove ) {
2063	+ special.remove.call( elem, handleObj );
2064	+ }
2065	+ }
2066	+
2067	+ if ( pos != null ) {
2068	+ break;
2069	+ }
2070	+ }
2071	+ }
2072	+
2073	+ // remove generic event handler if no more handlers exist
2074	+ if ( eventType.length === 0 \|\| pos != null && eventType.length === 1 ) {
2075	+ if ( !special.teardown \|\| special.teardown.call( elem, namespaces ) === false ) {
2076	+ jQuery.removeEvent( elem, type, elemData.handle );
2077	+ }
2078	+
2079	+ ret = null;
2080	+ delete events[ type ];
2081	+ }
2082	+ }
2083	+
2084	+ // Remove the expando if it's no longer used
2085	+ if ( jQuery.isEmptyObject( events ) ) {
2086	+ var handle = elemData.handle;
2087	+ if ( handle ) {
2088	+ handle.elem = null;
2089	+ }
2090	+
2091	+ delete elemData.events;
2092	+ delete elemData.handle;
2093	+
2094	+ if ( typeof elemData === "function" ) {
2095	+ jQuery.removeData( elem, eventKey );
2096	+
2097	+ } else if ( jQuery.isEmptyObject( elemData ) ) {
2098	+ jQuery.removeData( elem );
2099	+ }
2100	+ }
2101	+ },
2102	+
2103	+ // bubbling is internal
2104	+ trigger: function( event, data, elem /, bubbling / ) {
2105	+ // Event object or event type
2106	+ var type = event.type \|\| event,
2107	+ bubbling = arguments[3];
2108	+
2109	+ if ( !bubbling ) {
2110	+ event = typeof event === "object" ?
2111	+ // jQuery.Event object
2112	+ event[ jQuery.expando ] ? event :
2113	+ // Object literal
2114	+ jQuery.extend( jQuery.Event(type), event ) :
2115	+ // Just the event type (string)
2116	+ jQuery.Event(type);
2117	+
2118	+ if ( type.indexOf("!") >= 0 ) {
2119	+ event.type = type = type.slice(0, -1);
2120	+ event.exclusive = true;
2121	+ }
2122	+
2123	+ // Handle a global trigger
2124	+ if ( !elem ) {
2125	+ // Don't bubble custom events when global (to avoid too much overhead)
2126	+ event.stopPropagation();
2127	+
2128	+ // Only trigger if we've ever bound an event for it
2129	+ if ( jQuery.event.global[ type ] ) {
2130	+ jQuery.each( jQuery.cache, function() {
2131	+ if ( this.events && this.events[type] ) {
2132	+ jQuery.event.trigger( event, data, this.handle.elem );
2133	+ }
2134	+ });
2135	+ }
2136	+ }
2137	+
2138	+ // Handle triggering a single element
2139	+
2140	+ // don't do events on text and comment nodes
2141	+ if ( !elem \|\| elem.nodeType === 3 \|\| elem.nodeType === 8 ) {
2142	+ return undefined;
2143	+ }
2144	+
2145	+ // Clean up in case it is reused
2146	+ event.result = undefined;
2147	+ event.target = elem;
2148	+
2149	+ // Clone the incoming data, if any
2150	+ data = jQuery.makeArray( data );
2151	+ data.unshift( event );
2152	+ }
2153	+
2154	+ event.currentTarget = elem;
2155	+
2156	+ // Trigger the event, it is assumed that "handle" is a function
2157	+ var handle = elem.nodeType ?
2158	+ jQuery.data( elem, "handle" ) :
2159	+ (jQuery.data( elem, "__events__" ) \|\| {}).handle;
2160	+
2161	+ if ( handle ) {
2162	+ handle.apply( elem, data );
2163	+ }
2164	+
2165	+ var parent = elem.parentNode \|\| elem.ownerDocument;
2166	+
2167	+ // Trigger an inline bound script
2168	+ try {
2169	+ if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
2170	+ if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
2171	+ event.result = false;
2172	+ event.preventDefault();
2173	+ }
2174	+ }
2175	+
2176	+ // prevent IE from throwing an error for some elements with some event types, see #3533
2177	+ } catch (inlineError) {}
2178	+
2179	+ if ( !event.isPropagationStopped() && parent ) {
2180	+ jQuery.event.trigger( event, data, parent, true );
2181	+
2182	+ } else if ( !event.isDefaultPrevented() ) {
2183	+ var old,
2184	+ target = event.target,
2185	+ targetType = type.replace( rnamespaces, "" ),
2186	+ isClick = jQuery.nodeName( target, "a" ) && targetType === "click",
2187	+ special = jQuery.event.special[ targetType ] \|\| {};
2188	+
2189	+ if ( (!special._default \|\| special._default.call( elem, event ) === false) &&
2190	+ !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
2191	+
2192	+ try {
2193	+ if ( target[ targetType ] ) {
2194	+ // Make sure that we don't accidentally re-trigger the onFOO events
2195	+ old = target[ "on" + targetType ];
2196	+
2197	+ if ( old ) {
2198	+ target[ "on" + targetType ] = null;
2199	+ }
2200	+
2201	+ jQuery.event.triggered = true;
2202	+ target[ targetType ]();
2203	+ }
2204	+
2205	+ // prevent IE from throwing an error for some elements with some event types, see #3533
2206	+ } catch (triggerError) {}
2207	+
2208	+ if ( old ) {
2209	+ target[ "on" + targetType ] = old;
2210	+ }
2211	+
2212	+ jQuery.event.triggered = false;
2213	+ }
2214	+ }
2215	+ },
2216	+
2217	+ handle: function( event ) {
2218	+ var all, handlers, namespaces, namespace_re, events,
2219	+ namespace_sort = [],
2220	+ args = jQuery.makeArray( arguments );
2221	+
2222	+ event = args[0] = jQuery.event.fix( event \|\| window.event );
2223	+ event.currentTarget = this;
2224	+
2225	+ // Namespaced event handlers
2226	+ all = event.type.indexOf(".") < 0 && !event.exclusive;
2227	+
2228	+ if ( !all ) {
2229	+ namespaces = event.type.split(".");
2230	+ event.type = namespaces.shift();
2231	+ namespace_sort = namespaces.slice(0).sort();
2232	+ namespace_re = new RegExp("(^\|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.\|$)");
2233	+ }
2234	+
2235	+ event.namespace = event.namespace \|\| namespace_sort.join(".");
2236	+
2237	+ events = jQuery.data(this, this.nodeType ? "events" : "__events__");
2238	+
2239	+ if ( typeof events === "function" ) {
2240	+ events = events.events;
2241	+ }
2242	+
2243	+ handlers = (events \|\| {})[ event.type ];
2244	+
2245	+ if ( events && handlers ) {
2246	+ // Clone the handlers to prevent manipulation
2247	+ handlers = handlers.slice(0);
2248	+
2249	+ for ( var j = 0, l = handlers.length; j < l; j++ ) {
2250	+ var handleObj = handlers[ j ];
2251	+
2252	+ // Filter the functions by class
2253	+ if ( all \|\| namespace_re.test( handleObj.namespace ) ) {
2254	+ // Pass in a reference to the handler function itself
2255	+ // So that we can later remove it
2256	+ event.handler = handleObj.handler;
2257	+ event.data = handleObj.data;
2258	+ event.handleObj = handleObj;
2259	+
2260	+ var ret = handleObj.handler.apply( this, args );
2261	+
2262	+ if ( ret !== undefined ) {
2263	+ event.result = ret;
2264	+ if ( ret === false ) {
2265	+ event.preventDefault();
2266	+ event.stopPropagation();
2267	+ }
2268	+ }
2269	+
2270	+ if ( event.isImmediatePropagationStopped() ) {
2271	+ break;
2272	+ }
2273	+ }
2274	+ }
2275	+ }
2276	+
2277	+ return event.result;
2278	+ },
2279	+
2280	+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
2281	+
2282	+ fix: function( event ) {
2283	+ if ( event[ jQuery.expando ] ) {
2284	+ return event;
2285	+ }
2286	+
2287	+ // store a copy of the original event object
2288	+ // and "clone" to set read-only properties
2289	+ var originalEvent = event;
2290	+ event = jQuery.Event( originalEvent );
2291	+
2292	+ for ( var i = this.props.length, prop; i; ) {
2293	+ prop = this.props[ --i ];
2294	+ event[ prop ] = originalEvent[ prop ];
2295	+ }
2296	+
2297	+ // Fix target property, if necessary
2298	+ if ( !event.target ) {
2299	+ // Fixes #1925 where srcElement might not be defined either
2300	+ event.target = event.srcElement \|\| document;
2301	+ }
2302	+
2303	+ // check if target is a textnode (safari)
2304	+ if ( event.target.nodeType === 3 ) {
2305	+ event.target = event.target.parentNode;
2306	+ }
2307	+
2308	+ // Add relatedTarget, if necessary
2309	+ if ( !event.relatedTarget && event.fromElement ) {
2310	+ event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
2311	+ }
2312	+
2313	+ // Calculate pageX/Y if missing and clientX/Y available
2314	+ if ( event.pageX == null && event.clientX != null ) {
2315	+ var doc = document.documentElement,
2316	+ body = document.body;
2317	+
2318	+ event.pageX = event.clientX + (doc && doc.scrollLeft \|\| body && body.scrollLeft \|\| 0) - (doc && doc.clientLeft \|\| body && body.clientLeft \|\| 0);
2319	+ event.pageY = event.clientY + (doc && doc.scrollTop \|\| body && body.scrollTop \|\| 0) - (doc && doc.clientTop \|\| body && body.clientTop \|\| 0);
2320	+ }
2321	+
2322	+ // Add which for key events
2323	+ if ( event.which == null && (event.charCode != null \|\| event.keyCode != null) ) {
2324	+ event.which = event.charCode != null ? event.charCode : event.keyCode;
2325	+ }
2326	+
2327	+ // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
2328	+ if ( !event.metaKey && event.ctrlKey ) {
2329	+ event.metaKey = event.ctrlKey;
2330	+ }
2331	+
2332	+ // Add which for click: 1 === left; 2 === middle; 3 === right
2333	+ // Note: button is not normalized, so don't use it
2334	+ if ( !event.which && event.button !== undefined ) {
2335	+ event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
2336	+ }
2337	+
2338	+ return event;
2339	+ },
2340	+
2341	+ // Deprecated, use jQuery.guid instead
2342	+ guid: 1E8,
2343	+
2344	+ // Deprecated, use jQuery.proxy instead
2345	+ proxy: jQuery.proxy,
2346	+
2347	+ special: {
2348	+ ready: {
2349	+ // Make sure the ready event is setup
2350	+ setup: jQuery.bindReady,
2351	+ teardown: jQuery.noop
2352	+ },
2353	+
2354	+ live: {
2355	+ add: function( handleObj ) {
2356	+ jQuery.event.add( this,
2357	+ liveConvert( handleObj.origType, handleObj.selector ),
2358	+ jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) );
2359	+ },
2360	+
2361	+ remove: function( handleObj ) {
2362	+ jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj );
2363	+ }
2364	+ },
2365	+
2366	+ beforeunload: {
2367	+ setup: function( data, namespaces, eventHandle ) {
2368	+ // We only want to do this special case on windows
2369	+ if ( jQuery.isWindow( this ) ) {
2370	+ this.onbeforeunload = eventHandle;
2371	+ }
2372	+ },
2373	+
2374	+ teardown: function( namespaces, eventHandle ) {
2375	+ if ( this.onbeforeunload === eventHandle ) {
2376	+ this.onbeforeunload = null;
2377	+ }
2378	+ }
2379	+ }
2380	+ }
2381	+ };
2382	+
2383	+ jQuery.removeEvent = document.removeEventListener ?
2384	+ function( elem, type, handle ) {
2385	+ if ( elem.removeEventListener ) {
2386	+ elem.removeEventListener( type, handle, false );
2387	+ }
2388	+ } :
2389	+ function( elem, type, handle ) {
2390	+ if ( elem.detachEvent ) {
2391	+ elem.detachEvent( "on" + type, handle );
2392	+ }
2393	+ };
2394	+
2395	+ jQuery.Event = function( src ) {
2396	+ // Allow instantiation without the 'new' keyword
2397	+ if ( !this.preventDefault ) {
2398	+ return new jQuery.Event( src );
2399	+ }
2400	+
2401	+ // Event object
2402	+ if ( src && src.type ) {
2403	+ this.originalEvent = src;
2404	+ this.type = src.type;
2405	+ // Event type
2406	+ } else {
2407	+ this.type = src;
2408	+ }
2409	+
2410	+ // timeStamp is buggy for some events on Firefox(#3843)
2411	+ // So we won't rely on the native value
2412	+ this.timeStamp = jQuery.now();
2413	+
2414	+ // Mark it as fixed
2415	+ this[ jQuery.expando ] = true;
2416	+ };
2417	+
2418	+ function returnFalse() {
2419	+ return false;
2420	+ }
2421	+ function returnTrue() {
2422	+ return true;
2423	+ }
2424	+
2425	+ // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
2426	+ // http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
2427	+ jQuery.Event.prototype = {
2428	+ preventDefault: function() {
2429	+ this.isDefaultPrevented = returnTrue;
2430	+
2431	+ var e = this.originalEvent;
2432	+ if ( !e ) {
2433	+ return;
2434	+ }
2435	+
2436	+ // if preventDefault exists run it on the original event
2437	+ if ( e.preventDefault ) {
2438	+ e.preventDefault();
2439	+
2440	+ // otherwise set the returnValue property of the original event to false (IE)
2441	+ } else {
2442	+ e.returnValue = false;
2443	+ }
2444	+ },
2445	+ stopPropagation: function() {
2446	+ this.isPropagationStopped = returnTrue;
2447	+
2448	+ var e = this.originalEvent;
2449	+ if ( !e ) {
2450	+ return;
2451	+ }
2452	+ // if stopPropagation exists run it on the original event
2453	+ if ( e.stopPropagation ) {
2454	+ e.stopPropagation();
2455	+ }
2456	+ // otherwise set the cancelBubble property of the original event to true (IE)
2457	+ e.cancelBubble = true;
2458	+ },
2459	+ stopImmediatePropagation: function() {
2460	+ this.isImmediatePropagationStopped = returnTrue;
2461	+ this.stopPropagation();
2462	+ },
2463	+ isDefaultPrevented: returnFalse,
2464	+ isPropagationStopped: returnFalse,
2465	+ isImmediatePropagationStopped: returnFalse
2466	+ };
2467	+
2468	+ // Checks if an event happened on an element within another element
2469	+ // Used in jQuery.event.special.mouseenter and mouseleave handlers
2470	+ var withinElement = function( event ) {
2471	+ // Check if mouse(over\|out) are still within the same parent element
2472	+ var parent = event.relatedTarget;
2473	+
2474	+ // Firefox sometimes assigns relatedTarget a XUL element
2475	+ // which we cannot access the parentNode property of
2476	+ try {
2477	+ // Traverse up the tree
2478	+ while ( parent && parent !== this ) {
2479	+ parent = parent.parentNode;
2480	+ }
2481	+
2482	+ if ( parent !== this ) {
2483	+ // set the correct event type
2484	+ event.type = event.data;
2485	+
2486	+ // handle event if we actually just moused on to a non sub-element
2487	+ jQuery.event.handle.apply( this, arguments );
2488	+ }
2489	+
2490	+ // assuming we've left the element since we most likely mousedover a xul element
2491	+ } catch(e) { }
2492	+ },
2493	+
2494	+ // In case of event delegation, we only need to rename the event.type,
2495	+ // liveHandler will take care of the rest.
2496	+ delegate = function( event ) {
2497	+ event.type = event.data;
2498	+ jQuery.event.handle.apply( this, arguments );
2499	+ };
2500	+
2501	+ // Create mouseenter and mouseleave events
2502	+ jQuery.each({
2503	+ mouseenter: "mouseover",
2504	+ mouseleave: "mouseout"
2505	+ }, function( orig, fix ) {
2506	+ jQuery.event.special[ orig ] = {
2507	+ setup: function( data ) {
2508	+ jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
2509	+ },
2510	+ teardown: function( data ) {
2511	+ jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
2512	+ }
2513	+ };
2514	+ });
2515	+
2516	+ // submit delegation
2517	+ if ( !jQuery.support.submitBubbles ) {
2518	+
2519	+ jQuery.event.special.submit = {
2520	+ setup: function( data, namespaces ) {
2521	+ if ( this.nodeName.toLowerCase() !== "form" ) {
2522	+ jQuery.event.add(this, "click.specialSubmit", function( e ) {
2523	+ var elem = e.target,
2524	+ type = elem.type;
2525	+
2526	+ if ( (type === "submit" \|\| type === "image") && jQuery( elem ).closest("form").length ) {
2527	+ e.liveFired = undefined;
2528	+ return trigger( "submit", this, arguments );
2529	+ }
2530	+ });
2531	+
2532	+ jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
2533	+ var elem = e.target,
2534	+ type = elem.type;
2535	+
2536	+ if ( (type === "text" \|\| type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
2537	+ e.liveFired = undefined;
2538	+ return trigger( "submit", this, arguments );
2539	+ }
2540	+ });
2541	+
2542	+ } else {
2543	+ return false;
2544	+ }
2545	+ },
2546	+
2547	+ teardown: function( namespaces ) {
2548	+ jQuery.event.remove( this, ".specialSubmit" );
2549	+ }
2550	+ };
2551	+
2552	+ }
2553	+
2554	+ // change delegation, happens here so we have bind.
2555	+ if ( !jQuery.support.changeBubbles ) {
2556	+
2557	+ var changeFilters,
2558	+
2559	+ getVal = function( elem ) {
2560	+ var type = elem.type, val = elem.value;
2561	+
2562	+ if ( type === "radio" \|\| type === "checkbox" ) {
2563	+ val = elem.checked;
2564	+
2565	+ } else if ( type === "select-multiple" ) {
2566	+ val = elem.selectedIndex > -1 ?
2567	+ jQuery.map( elem.options, function( elem ) {
2568	+ return elem.selected;
2569	+ }).join("-") :
2570	+ "";
2571	+
2572	+ } else if ( elem.nodeName.toLowerCase() === "select" ) {
2573	+ val = elem.selectedIndex;
2574	+ }
2575	+
2576	+ return val;
2577	+ },
2578	+
2579	+ testChange = function testChange( e ) {
2580	+ var elem = e.target, data, val;
2581	+
2582	+ if ( !rformElems.test( elem.nodeName ) \|\| elem.readOnly ) {
2583	+ return;
2584	+ }
2585	+
2586	+ data = jQuery.data( elem, "_change_data" );
2587	+ val = getVal(elem);
2588	+
2589	+ // the current data will be also retrieved by beforeactivate
2590	+ if ( e.type !== "focusout" \|\| elem.type !== "radio" ) {
2591	+ jQuery.data( elem, "_change_data", val );
2592	+ }
2593	+
2594	+ if ( data === undefined \|\| val === data ) {
2595	+ return;
2596	+ }
2597	+
2598	+ if ( data != null \|\| val ) {
2599	+ e.type = "change";
2600	+ e.liveFired = undefined;
2601	+ return jQuery.event.trigger( e, arguments[1], elem );
2602	+ }
2603	+ };
2604	+
2605	+ jQuery.event.special.change = {
2606	+ filters: {
2607	+ focusout: testChange,
2608	+
2609	+ beforedeactivate: testChange,
2610	+
2611	+ click: function( e ) {
2612	+ var elem = e.target, type = elem.type;
2613	+
2614	+ if ( type === "radio" \|\| type === "checkbox" \|\| elem.nodeName.toLowerCase() === "select" ) {
2615	+ return testChange.call( this, e );
2616	+ }
2617	+ },
2618	+
2619	+ // Change has to be called before submit
2620	+ // Keydown will be called before keypress, which is used in submit-event delegation
2621	+ keydown: function( e ) {
2622	+ var elem = e.target, type = elem.type;
2623	+
2624	+ if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") \|\|
2625	+ (e.keyCode === 32 && (type === "checkbox" \|\| type === "radio")) \|\|
2626	+ type === "select-multiple" ) {
2627	+ return testChange.call( this, e );
2628	+ }
2629	+ },
2630	+
2631	+ // Beforeactivate happens also before the previous element is blurred
2632	+ // with this event you can't trigger a change event, but you can store
2633	+ // information
2634	+ beforeactivate: function( e ) {
2635	+ var elem = e.target;
2636	+ jQuery.data( elem, "_change_data", getVal(elem) );
2637	+ }
2638	+ },
2639	+
2640	+ setup: function( data, namespaces ) {
2641	+ if ( this.type === "file" ) {
2642	+ return false;
2643	+ }
2644	+
2645	+ for ( var type in changeFilters ) {
2646	+ jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
2647	+ }
2648	+
2649	+ return rformElems.test( this.nodeName );
2650	+ },
2651	+
2652	+ teardown: function( namespaces ) {
2653	+ jQuery.event.remove( this, ".specialChange" );
2654	+
2655	+ return rformElems.test( this.nodeName );
2656	+ }
2657	+ };
2658	+
2659	+ changeFilters = jQuery.event.special.change.filters;
2660	+
2661	+ // Handle when the input is .focus()'d
2662	+ changeFilters.focus = changeFilters.beforeactivate;
2663	+ }
2664	+
2665	+ function trigger( type, elem, args ) {
2666	+ args[0].type = type;
2667	+ return jQuery.event.handle.apply( elem, args );
2668	+ }
2669	+
2670	+ // Create "bubbling" focus and blur events
2671	+ if ( document.addEventListener ) {
2672	+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
2673	+ jQuery.event.special[ fix ] = {
2674	+ setup: function() {
2675	+ if ( focusCounts[fix]++ === 0 ) {
2676	+ document.addEventListener( orig, handler, true );
2677	+ }
2678	+ },
2679	+ teardown: function() {
2680	+ if ( --focusCounts[fix] === 0 ) {
2681	+ document.removeEventListener( orig, handler, true );
2682	+ }
2683	+ }
2684	+ };
2685	+
2686	+ function handler( e ) {
2687	+ e = jQuery.event.fix( e );
2688	+ e.type = fix;
2689	+ return jQuery.event.trigger( e, null, e.target );
2690	+ }
2691	+ });
2692	+ }
2693	+
2694	+ jQuery.each(["bind", "one"], function( i, name ) {
2695	+ jQuery.fn[ name ] = function( type, data, fn ) {
2696	+ // Handle object literals
2697	+ if ( typeof type === "object" ) {
2698	+ for ( var key in type ) {
2699	+ this[ name ](key, data, type[key], fn);
2700	+ }
2701	+ return this;
2702	+ }
2703	+
2704	+ if ( jQuery.isFunction( data ) \|\| data === false ) {
2705	+ fn = data;
2706	+ data = undefined;
2707	+ }
2708	+
2709	+ var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
2710	+ jQuery( this ).unbind( event, handler );
2711	+ return fn.apply( this, arguments );
2712	+ }) : fn;
2713	+
2714	+ if ( type === "unload" && name !== "one" ) {
2715	+ this.one( type, data, fn );
2716	+
2717	+ } else {
2718	+ for ( var i = 0, l = this.length; i < l; i++ ) {
2719	+ jQuery.event.add( this[i], type, handler, data );
2720	+ }
2721	+ }
2722	+
2723	+ return this;
2724	+ };
2725	+ });
2726	+
2727	+ jQuery.fn.extend({
2728	+ unbind: function( type, fn ) {
2729	+ // Handle object literals
2730	+ if ( typeof type === "object" && !type.preventDefault ) {
2731	+ for ( var key in type ) {
2732	+ this.unbind(key, type[key]);
2733	+ }
2734	+
2735	+ } else {
2736	+ for ( var i = 0, l = this.length; i < l; i++ ) {
2737	+ jQuery.event.remove( this[i], type, fn );
2738	+ }
2739	+ }
2740	+
2741	+ return this;
2742	+ },
2743	+
2744	+ delegate: function( selector, types, data, fn ) {
2745	+ return this.live( types, data, fn, selector );
2746	+ },
2747	+
2748	+ undelegate: function( selector, types, fn ) {
2749	+ if ( arguments.length === 0 ) {
2750	+ return this.unbind( "live" );
2751	+
2752	+ } else {
2753	+ return this.die( types, null, fn, selector );
2754	+ }
2755	+ },
2756	+
2757	+ trigger: function( type, data ) {
2758	+ return this.each(function() {
2759	+ jQuery.event.trigger( type, data, this );
2760	+ });
2761	+ },
2762	+
2763	+ triggerHandler: function( type, data ) {
2764	+ if ( this[0] ) {
2765	+ var event = jQuery.Event( type );
2766	+ event.preventDefault();
2767	+ event.stopPropagation();
2768	+ jQuery.event.trigger( event, data, this[0] );
2769	+ return event.result;
2770	+ }
2771	+ },
2772	+
2773	+ toggle: function( fn ) {
2774	+ // Save reference to arguments for access in closure
2775	+ var args = arguments,
2776	+ i = 1;
2777	+
2778	+ // link all the functions, so any of them can unbind this click handler
2779	+ while ( i < args.length ) {
2780	+ jQuery.proxy( fn, args[ i++ ] );
2781	+ }
2782	+
2783	+ return this.click( jQuery.proxy( fn, function( event ) {
2784	+ // Figure out which function to execute
2785	+ var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) \|\| 0 ) % i;
2786	+ jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
2787	+
2788	+ // Make sure that clicks stop
2789	+ event.preventDefault();
2790	+
2791	+ // and execute the function
2792	+ return args[ lastToggle ].apply( this, arguments ) \|\| false;
2793	+ }));
2794	+ },
2795	+
2796	+ hover: function( fnOver, fnOut ) {
2797	+ return this.mouseenter( fnOver ).mouseleave( fnOut \|\| fnOver );
2798	+ }
2799	+ });
2800	+
2801	+ var liveMap = {
2802	+ focus: "focusin",
2803	+ blur: "focusout",
2804	+ mouseenter: "mouseover",
2805	+ mouseleave: "mouseout"
2806	+ };
2807	+
2808	+ jQuery.each(["live", "die"], function( i, name ) {
2809	+ jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
2810	+ var type, i = 0, match, namespaces, preType,
2811	+ selector = origSelector \|\| this.selector,
2812	+ context = origSelector ? this : jQuery( this.context );
2813	+
2814	+ if ( typeof types === "object" && !types.preventDefault ) {
2815	+ for ( var key in types ) {
2816	+ context[ name ]( key, data, types[key], selector );
2817	+ }
2818	+
2819	+ return this;
2820	+ }
2821	+
2822	+ if ( jQuery.isFunction( data ) ) {
2823	+ fn = data;
2824	+ data = undefined;
2825	+ }
2826	+
2827	+ types = (types \|\| "").split(" ");
2828	+
2829	+ while ( (type = types[ i++ ]) != null ) {
2830	+ match = rnamespaces.exec( type );
2831	+ namespaces = "";
2832	+
2833	+ if ( match ) {
2834	+ namespaces = match[0];
2835	+ type = type.replace( rnamespaces, "" );
2836	+ }
2837	+
2838	+ if ( type === "hover" ) {
2839	+ types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
2840	+ continue;
2841	+ }
2842	+
2843	+ preType = type;
2844	+
2845	+ if ( type === "focus" \|\| type === "blur" ) {
2846	+ types.push( liveMap[ type ] + namespaces );
2847	+ type = type + namespaces;
2848	+
2849	+ } else {
2850	+ type = (liveMap[ type ] \|\| type) + namespaces;
2851	+ }
2852	+
2853	+ if ( name === "live" ) {
2854	+ // bind live handler
2855	+ for ( var j = 0, l = context.length; j < l; j++ ) {
2856	+ jQuery.event.add( context[j], "live." + liveConvert( type, selector ),
2857	+ { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
2858	+ }
2859	+
2860	+ } else {
2861	+ // unbind live handler
2862	+ context.unbind( "live." + liveConvert( type, selector ), fn );
2863	+ }
2864	+ }
2865	+
2866	+ return this;
2867	+ };
2868	+ });
2869	+
2870	+ function liveHandler( event ) {
2871	+ var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret,
2872	+ elems = [],
2873	+ selectors = [],
2874	+ events = jQuery.data( this, this.nodeType ? "events" : "__events__" );
2875	+
2876	+ if ( typeof events === "function" ) {
2877	+ events = events.events;
2878	+ }
2879	+
2880	+ // Make sure we avoid non-left-click bubbling in Firefox (#3861)
2881	+ if ( event.liveFired === this \|\| !events \|\| !events.live \|\| event.button && event.type === "click" ) {
2882	+ return;
2883	+ }
2884	+
2885	+ if ( event.namespace ) {
2886	+ namespace = new RegExp("(^\|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.\|$)");
2887	+ }
2888	+
2889	+ event.liveFired = this;
2890	+
2891	+ var live = events.live.slice(0);
2892	+
2893	+ for ( j = 0; j < live.length; j++ ) {
2894	+ handleObj = live[j];
2895	+
2896	+ if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
2897	+ selectors.push( handleObj.selector );
2898	+
2899	+ } else {
2900	+ live.splice( j--, 1 );
2901	+ }
2902	+ }
2903	+
2904	+ match = jQuery( event.target ).closest( selectors, event.currentTarget );
2905	+
2906	+ for ( i = 0, l = match.length; i < l; i++ ) {
2907	+ close = match[i];
2908	+
2909	+ for ( j = 0; j < live.length; j++ ) {
2910	+ handleObj = live[j];
2911	+
2912	+ if ( close.selector === handleObj.selector && (!namespace \|\| namespace.test( handleObj.namespace )) ) {
2913	+ elem = close.elem;
2914	+ related = null;
2915	+
2916	+ // Those two events require additional checking
2917	+ if ( handleObj.preType === "mouseenter" \|\| handleObj.preType === "mouseleave" ) {
2918	+ event.type = handleObj.preType;
2919	+ related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
2920	+ }
2921	+
2922	+ if ( !related \|\| related !== elem ) {
2923	+ elems.push({ elem: elem, handleObj: handleObj, level: close.level });
2924	+ }
2925	+ }
2926	+ }
2927	+ }
2928	+
2929	+ for ( i = 0, l = elems.length; i < l; i++ ) {
2930	+ match = elems[i];
2931	+
2932	+ if ( maxLevel && match.level > maxLevel ) {
2933	+ break;
2934	+ }
2935	+
2936	+ event.currentTarget = match.elem;
2937	+ event.data = match.handleObj.data;
2938	+ event.handleObj = match.handleObj;
2939	+
2940	+ ret = match.handleObj.origHandler.apply( match.elem, arguments );
2941	+
2942	+ if ( ret === false \|\| event.isPropagationStopped() ) {
2943	+ maxLevel = match.level;
2944	+
2945	+ if ( ret === false ) {
2946	+ stop = false;
2947	+ }
2948	+ if ( event.isImmediatePropagationStopped() ) {
2949	+ break;
2950	+ }
2951	+ }
2952	+ }
2953	+
2954	+ return stop;
2955	+ }
2956	+
2957	+ function liveConvert( type, selector ) {
2958	+ return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&");
2959	+ }
2960	+
2961	+ jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
2962	+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
2963	+ "change select submit keydown keypress keyup error").split(" "), function( i, name ) {
2964	+
2965	+ // Handle event binding
2966	+ jQuery.fn[ name ] = function( data, fn ) {
2967	+ if ( fn == null ) {
2968	+ fn = data;
2969	+ data = null;
2970	+ }
2971	+
2972	+ return arguments.length > 0 ?
2973	+ this.bind( name, data, fn ) :
2974	+ this.trigger( name );
2975	+ };
2976	+
2977	+ if ( jQuery.attrFn ) {
2978	+ jQuery.attrFn[ name ] = true;
2979	+ }
2980	+ });
2981	+
2982	+ // Prevent memory leaks in IE
2983	+ // Window isn't included so as not to unbind existing unload events
2984	+ // More info:
2985	+ // - http://isaacschlueter.com/2006/10/msie-memory-leaks/
2986	+ if ( window.attachEvent && !window.addEventListener ) {
2987	+ jQuery(window).bind("unload", function() {
2988	+ for ( var id in jQuery.cache ) {
2989	+ if ( jQuery.cache[ id ].handle ) {
2990	+ // Try/Catch is to handle iframes being unloaded, see #4280
2991	+ try {
2992	+ jQuery.event.remove( jQuery.cache[ id ].handle.elem );
2993	+ } catch(e) {}
2994	+ }
2995	+ }
2996	+ });
2997	+ }
2998	+
2999	+
3000	+ /*!
3001	+ * Sizzle CSS Selector Engine - v1.0
3002	+ * Copyright 2009, The Dojo Foundation
3003	+ * Released under the MIT, BSD, and GPL Licenses.
3004	+ * More information: http://sizzlejs.com/
3005	+ */
3006	+ (function(){
3007	+
3008	+ var chunker = /((?:$(?:\([^()]+$\|[^()]+)+\)\|\[(?:\[[^\[\]]\]\|['"][^'"]['"]\|[^\[\]'"]+)+\]\|\\.\|[^ >+~,(\[\\]+)+\|[>+~])(\s,\s)?((?:.\|\r\|\n)*)/g,
3009	+ done = 0,
3010	+ toString = Object.prototype.toString,
3011	+ hasDuplicate = false,
3012	+ baseHasDuplicate = true;
3013	+
3014	+ // Here we check if the JavaScript engine is using some sort of
3015	+ // optimization where it does not always call our comparision
3016	+ // function. If that is the case, discard the hasDuplicate value.
3017	+ // Thus far that includes Google Chrome.
3018	+ [0, 0].sort(function() {
3019	+ baseHasDuplicate = false;
3020	+ return 0;
3021	+ });
3022	+
3023	+ var Sizzle = function( selector, context, results, seed ) {
3024	+ results = results \|\| [];
3025	+ context = context \|\| document;
3026	+
3027	+ var origContext = context;
3028	+
3029	+ if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
3030	+ return [];
3031	+ }
3032	+
3033	+ if ( !selector \|\| typeof selector !== "string" ) {
3034	+ return results;
3035	+ }
3036	+
3037	+ var m, set, checkSet, extra, ret, cur, pop, i,
3038	+ prune = true,
3039	+ contextXML = Sizzle.isXML( context ),
3040	+ parts = [],
3041	+ soFar = selector;
3042	+
3043	+ // Reset the position of the chunker regexp (start from head)
3044	+ do {
3045	+ chunker.exec( "" );
3046	+ m = chunker.exec( soFar );
3047	+
3048	+ if ( m ) {
3049	+ soFar = m[3];
3050	+
3051	+ parts.push( m[1] );
3052	+
3053	+ if ( m[2] ) {
3054	+ extra = m[3];
3055	+ break;
3056	+ }
3057	+ }
3058	+ } while ( m );
3059	+
3060	+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
3061	+
3062	+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
3063	+ set = posProcess( parts[0] + parts[1], context );
3064	+
3065	+ } else {
3066	+ set = Expr.relative[ parts[0] ] ?
3067	+ [ context ] :
3068	+ Sizzle( parts.shift(), context );
3069	+
3070	+ while ( parts.length ) {
3071	+ selector = parts.shift();
3072	+
3073	+ if ( Expr.relative[ selector ] ) {
3074	+ selector += parts.shift();
3075	+ }
3076	+
3077	+ set = posProcess( selector, set );
3078	+ }
3079	+ }
3080	+
3081	+ } else {
3082	+ // Take a shortcut and set the context if the root selector is an ID
3083	+ // (but not if it'll be faster if the inner selector is an ID)
3084	+ if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
3085	+ Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
3086	+
3087	+ ret = Sizzle.find( parts.shift(), context, contextXML );
3088	+ context = ret.expr ?
3089	+ Sizzle.filter( ret.expr, ret.set )[0] :
3090	+ ret.set[0];
3091	+ }
3092	+
3093	+ if ( context ) {
3094	+ ret = seed ?
3095	+ { expr: parts.pop(), set: makeArray(seed) } :
3096	+ Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" \|\| parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
3097	+
3098	+ set = ret.expr ?
3099	+ Sizzle.filter( ret.expr, ret.set ) :
3100	+ ret.set;
3101	+
3102	+ if ( parts.length > 0 ) {
3103	+ checkSet = makeArray( set );
3104	+
3105	+ } else {
3106	+ prune = false;
3107	+ }
3108	+
3109	+ while ( parts.length ) {
3110	+ cur = parts.pop();
3111	+ pop = cur;
3112	+
3113	+ if ( !Expr.relative[ cur ] ) {
3114	+ cur = "";
3115	+ } else {
3116	+ pop = parts.pop();
3117	+ }
3118	+
3119	+ if ( pop == null ) {
3120	+ pop = context;
3121	+ }
3122	+
3123	+ Expr.relative[ cur ]( checkSet, pop, contextXML );
3124	+ }
3125	+
3126	+ } else {
3127	+ checkSet = parts = [];
3128	+ }
3129	+ }
3130	+
3131	+ if ( !checkSet ) {
3132	+ checkSet = set;
3133	+ }
3134	+
3135	+ if ( !checkSet ) {
3136	+ Sizzle.error( cur \|\| selector );
3137	+ }
3138	+
3139	+ if ( toString.call(checkSet) === "[object Array]" ) {
3140	+ if ( !prune ) {
3141	+ results.push.apply( results, checkSet );
3142	+
3143	+ } else if ( context && context.nodeType === 1 ) {
3144	+ for ( i = 0; checkSet[i] != null; i++ ) {
3145	+ if ( checkSet[i] && (checkSet[i] === true \|\| checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
3146	+ results.push( set[i] );
3147	+ }
3148	+ }
3149	+
3150	+ } else {
3151	+ for ( i = 0; checkSet[i] != null; i++ ) {
3152	+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
3153	+ results.push( set[i] );
3154	+ }
3155	+ }
3156	+ }
3157	+
3158	+ } else {
3159	+ makeArray( checkSet, results );
3160	+ }
3161	+
3162	+ if ( extra ) {
3163	+ Sizzle( extra, origContext, results, seed );
3164	+ Sizzle.uniqueSort( results );
3165	+ }
3166	+
3167	+ return results;
3168	+ };
3169	+
3170	+ Sizzle.uniqueSort = function( results ) {
3171	+ if ( sortOrder ) {
3172	+ hasDuplicate = baseHasDuplicate;
3173	+ results.sort( sortOrder );
3174	+
3175	+ if ( hasDuplicate ) {
3176	+ for ( var i = 1; i < results.length; i++ ) {
3177	+ if ( results[i] === results[ i - 1 ] ) {
3178	+ results.splice( i--, 1 );
3179	+ }
3180	+ }
3181	+ }
3182	+ }
3183	+
3184	+ return results;
3185	+ };
3186	+
3187	+ Sizzle.matches = function( expr, set ) {
3188	+ return Sizzle( expr, null, null, set );
3189	+ };
3190	+
3191	+ Sizzle.matchesSelector = function( node, expr ) {
3192	+ return Sizzle( expr, null, null, [node] ).length > 0;
3193	+ };
3194	+
3195	+ Sizzle.find = function( expr, context, isXML ) {
3196	+ var set;
3197	+
3198	+ if ( !expr ) {
3199	+ return [];
3200	+ }
3201	+
3202	+ for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
3203	+ var match,
3204	+ type = Expr.order[i];
3205	+
3206	+ if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
3207	+ var left = match[1];
3208	+ match.splice( 1, 1 );
3209	+
3210	+ if ( left.substr( left.length - 1 ) !== "\\" ) {
3211	+ match[1] = (match[1] \|\| "").replace(/\\/g, "");
3212	+ set = Expr.find[ type ]( match, context, isXML );
3213	+
3214	+ if ( set != null ) {
3215	+ expr = expr.replace( Expr.match[ type ], "" );
3216	+ break;
3217	+ }
3218	+ }
3219	+ }
3220	+ }
3221	+
3222	+ if ( !set ) {
3223	+ set = context.getElementsByTagName( "*" );
3224	+ }
3225	+
3226	+ return { set: set, expr: expr };
3227	+ };
3228	+
3229	+ Sizzle.filter = function( expr, set, inplace, not ) {
3230	+ var match, anyFound,
3231	+ old = expr,
3232	+ result = [],
3233	+ curLoop = set,
3234	+ isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
3235	+
3236	+ while ( expr && set.length ) {
3237	+ for ( var type in Expr.filter ) {
3238	+ if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
3239	+ var found, item,
3240	+ filter = Expr.filter[ type ],
3241	+ left = match[1];
3242	+
3243	+ anyFound = false;
3244	+
3245	+ match.splice(1,1);
3246	+
3247	+ if ( left.substr( left.length - 1 ) === "\\" ) {
3248	+ continue;
3249	+ }
3250	+
3251	+ if ( curLoop === result ) {
3252	+ result = [];
3253	+ }
3254	+
3255	+ if ( Expr.preFilter[ type ] ) {
3256	+ match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
3257	+
3258	+ if ( !match ) {
3259	+ anyFound = found = true;
3260	+
3261	+ } else if ( match === true ) {
3262	+ continue;
3263	+ }
3264	+ }
3265	+
3266	+ if ( match ) {
3267	+ for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
3268	+ if ( item ) {
3269	+ found = filter( item, match, i, curLoop );
3270	+ var pass = not ^ !!found;
3271	+
3272	+ if ( inplace && found != null ) {
3273	+ if ( pass ) {
3274	+ anyFound = true;
3275	+
3276	+ } else {
3277	+ curLoop[i] = false;
3278	+ }
3279	+
3280	+ } else if ( pass ) {
3281	+ result.push( item );
3282	+ anyFound = true;
3283	+ }
3284	+ }
3285	+ }
3286	+ }
3287	+
3288	+ if ( found !== undefined ) {
3289	+ if ( !inplace ) {
3290	+ curLoop = result;
3291	+ }
3292	+
3293	+ expr = expr.replace( Expr.match[ type ], "" );
3294	+
3295	+ if ( !anyFound ) {
3296	+ return [];
3297	+ }
3298	+
3299	+ break;
3300	+ }
3301	+ }
3302	+ }
3303	+
3304	+ // Improper expression
3305	+ if ( expr === old ) {
3306	+ if ( anyFound == null ) {
3307	+ Sizzle.error( expr );
3308	+
3309	+ } else {
3310	+ break;
3311	+ }
3312	+ }
3313	+
3314	+ old = expr;
3315	+ }
3316	+
3317	+ return curLoop;
3318	+ };
3319	+
3320	+ Sizzle.error = function( msg ) {
3321	+ throw "Syntax error, unrecognized expression: " + msg;
3322	+ };
3323	+
3324	+ var Expr = Sizzle.selectors = {
3325	+ order: [ "ID", "NAME", "TAG" ],
3326	+
3327	+ match: {
3328	+ ID: /#((?:[\w\u00c0-\uFFFF\-]\|\\.)+)/,
3329	+ CLASS: /\.((?:[\w\u00c0-\uFFFF\-]\|\\.)+)/,
3330	+ NAME: /\[name=['"]((?:[\w\u00c0-\uFFFF\-]\|\\.)+)['"]\]/,
3331	+ ATTR: /\[\s((?:[\w\u00c0-\uFFFF\-]\|\\.)+)\s(?:(\S?=)\s(['"])(.?)\3\|)\s\]/,
3332	+ TAG: /^((?:[\w\u00c0-\uFFFF\*\-]\|\\.)+)/,
3333	+ CHILD: /:(only\|nth\|last\|first)-child(?:$(even\|odd\|[\dn+\-]*)$)?/,
3334	+ POS: /:(nth\|eq\|gt\|lt\|first\|last\|even\|odd)(?:$(\d*)$)?(?=[^\-]\|$)/,
3335	+ PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]\|\\.)+)(?:$(['"]?)((?:\([^$]+\)\|[^]*)+)\2\))?/
3336	+ },
3337	+
3338	+ leftMatch: {},
3339	+
3340	+ attrMap: {
3341	+ "class": "className",
3342	+ "for": "htmlFor"
3343	+ },
3344	+
3345	+ attrHandle: {
3346	+ href: function( elem ) {
3347	+ return elem.getAttribute( "href" );
3348	+ }
3349	+ },
3350	+
3351	+ relative: {
3352	+ "+": function(checkSet, part){
3353	+ var isPartStr = typeof part === "string",
3354	+ isTag = isPartStr && !/\W/.test( part ),
3355	+ isPartStrNotTag = isPartStr && !isTag;
3356	+
3357	+ if ( isTag ) {
3358	+ part = part.toLowerCase();
3359	+ }
3360	+
3361	+ for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
3362	+ if ( (elem = checkSet[i]) ) {
3363	+ while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
3364	+
3365	+ checkSet[i] = isPartStrNotTag \|\| elem && elem.nodeName.toLowerCase() === part ?
3366	+ elem \|\| false :
3367	+ elem === part;
3368	+ }
3369	+ }
3370	+
3371	+ if ( isPartStrNotTag ) {
3372	+ Sizzle.filter( part, checkSet, true );
3373	+ }
3374	+ },
3375	+
3376	+ ">": function( checkSet, part ) {
3377	+ var elem,
3378	+ isPartStr = typeof part === "string",
3379	+ i = 0,
3380	+ l = checkSet.length;
3381	+
3382	+ if ( isPartStr && !/\W/.test( part ) ) {
3383	+ part = part.toLowerCase();
3384	+
3385	+ for ( ; i < l; i++ ) {
3386	+ elem = checkSet[i];
3387	+
3388	+ if ( elem ) {
3389	+ var parent = elem.parentNode;
3390	+ checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
3391	+ }
3392	+ }
3393	+
3394	+ } else {
3395	+ for ( ; i < l; i++ ) {
3396	+ elem = checkSet[i];
3397	+
3398	+ if ( elem ) {
3399	+ checkSet[i] = isPartStr ?
3400	+ elem.parentNode :
3401	+ elem.parentNode === part;
3402	+ }
3403	+ }
3404	+
3405	+ if ( isPartStr ) {
3406	+ Sizzle.filter( part, checkSet, true );
3407	+ }
3408	+ }
3409	+ },
3410	+
3411	+ "": function(checkSet, part, isXML){
3412	+ var nodeCheck,
3413	+ doneName = done++,
3414	+ checkFn = dirCheck;
3415	+
3416	+ if ( typeof part === "string" && !/\W/.test(part) ) {
3417	+ part = part.toLowerCase();
3418	+ nodeCheck = part;
3419	+ checkFn = dirNodeCheck;
3420	+ }
3421	+
3422	+ checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
3423	+ },
3424	+
3425	+ "~": function( checkSet, part, isXML ) {
3426	+ var nodeCheck,
3427	+ doneName = done++,
3428	+ checkFn = dirCheck;
3429	+
3430	+ if ( typeof part === "string" && !/\W/.test( part ) ) {
3431	+ part = part.toLowerCase();
3432	+ nodeCheck = part;
3433	+ checkFn = dirNodeCheck;
3434	+ }
3435	+
3436	+ checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
3437	+ }
3438	+ },
3439	+
3440	+ find: {
3441	+ ID: function( match, context, isXML ) {
3442	+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
3443	+ var m = context.getElementById(match[1]);
3444	+ // Check parentNode to catch when Blackberry 4.6 returns
3445	+ // nodes that are no longer in the document #6963
3446	+ return m && m.parentNode ? [m] : [];
3447	+ }
3448	+ },
3449	+
3450	+ NAME: function( match, context ) {
3451	+ if ( typeof context.getElementsByName !== "undefined" ) {
3452	+ var ret = [],
3453	+ results = context.getElementsByName( match[1] );
3454	+
3455	+ for ( var i = 0, l = results.length; i < l; i++ ) {
3456	+ if ( results[i].getAttribute("name") === match[1] ) {
3457	+ ret.push( results[i] );
3458	+ }
3459	+ }
3460	+
3461	+ return ret.length === 0 ? null : ret;
3462	+ }
3463	+ },
3464	+
3465	+ TAG: function( match, context ) {
3466	+ return context.getElementsByTagName( match[1] );
3467	+ }
3468	+ },
3469	+ preFilter: {
3470	+ CLASS: function( match, curLoop, inplace, result, not, isXML ) {
3471	+ match = " " + match[1].replace(/\\/g, "") + " ";
3472	+
3473	+ if ( isXML ) {
3474	+ return match;
3475	+ }
3476	+
3477	+ for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
3478	+ if ( elem ) {
3479	+ if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) {
3480	+ if ( !inplace ) {
3481	+ result.push( elem );
3482	+ }
3483	+
3484	+ } else if ( inplace ) {
3485	+ curLoop[i] = false;
3486	+ }
3487	+ }
3488	+ }
3489	+
3490	+ return false;
3491	+ },
3492	+
3493	+ ID: function( match ) {
3494	+ return match[1].replace(/\\/g, "");
3495	+ },
3496	+
3497	+ TAG: function( match, curLoop ) {
3498	+ return match[1].toLowerCase();
3499	+ },
3500	+
3501	+ CHILD: function( match ) {
3502	+ if ( match[1] === "nth" ) {
3503	+ // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
3504	+ var test = /(-?)(\d)n((?:\+\|-)?\d)/.exec(
3505	+ match[2] === "even" && "2n" \|\| match[2] === "odd" && "2n+1" \|\|
3506	+ !/\D/.test( match[2] ) && "0n+" + match[2] \|\| match[2]);
3507	+
3508	+ // calculate the numbers (first)n+(last) including if they are negative
3509	+ match[2] = (test[1] + (test[2] \|\| 1)) - 0;
3510	+ match[3] = test[3] - 0;
3511	+ }
3512	+
3513	+ // TODO: Move to normal caching system
3514	+ match[0] = done++;
3515	+
3516	+ return match;
3517	+ },
3518	+
3519	+ ATTR: function( match, curLoop, inplace, result, not, isXML ) {
3520	+ var name = match[1].replace(/\\/g, "");
3521	+
3522	+ if ( !isXML && Expr.attrMap[name] ) {
3523	+ match[1] = Expr.attrMap[name];
3524	+ }
3525	+
3526	+ if ( match[2] === "~=" ) {
3527	+ match[4] = " " + match[4] + " ";
3528	+ }
3529	+
3530	+ return match;
3531	+ },
3532	+
3533	+ PSEUDO: function( match, curLoop, inplace, result, not ) {
3534	+ if ( match[1] === "not" ) {
3535	+ // If we're dealing with a complex expression, or a simple one
3536	+ if ( ( chunker.exec(match[3]) \|\| "" ).length > 1 \|\| /^\w/.test(match[3]) ) {
3537	+ match[3] = Sizzle(match[3], null, null, curLoop);
3538	+
3539	+ } else {
3540	+ var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
3541	+
3542	+ if ( !inplace ) {
3543	+ result.push.apply( result, ret );
3544	+ }
3545	+
3546	+ return false;
3547	+ }
3548	+
3549	+ } else if ( Expr.match.POS.test( match[0] ) \|\| Expr.match.CHILD.test( match[0] ) ) {
3550	+ return true;
3551	+ }
3552	+
3553	+ return match;
3554	+ },
3555	+
3556	+ POS: function( match ) {
3557	+ match.unshift( true );
3558	+
3559	+ return match;
3560	+ }
3561	+ },
3562	+
3563	+ filters: {
3564	+ enabled: function( elem ) {
3565	+ return elem.disabled === false && elem.type !== "hidden";
3566	+ },
3567	+
3568	+ disabled: function( elem ) {
3569	+ return elem.disabled === true;
3570	+ },
3571	+
3572	+ checked: function( elem ) {
3573	+ return elem.checked === true;
3574	+ },
3575	+
3576	+ selected: function( elem ) {
3577	+ // Accessing this property makes selected-by-default
3578	+ // options in Safari work properly
3579	+ elem.parentNode.selectedIndex;
3580	+
3581	+ return elem.selected === true;
3582	+ },
3583	+
3584	+ parent: function( elem ) {
3585	+ return !!elem.firstChild;
3586	+ },
3587	+
3588	+ empty: function( elem ) {
3589	+ return !elem.firstChild;
3590	+ },
3591	+
3592	+ has: function( elem, i, match ) {
3593	+ return !!Sizzle( match[3], elem ).length;
3594	+ },
3595	+
3596	+ header: function( elem ) {
3597	+ return (/h\d/i).test( elem.nodeName );
3598	+ },
3599	+
3600	+ text: function( elem ) {
3601	+ return "text" === elem.type;
3602	+ },
3603	+ radio: function( elem ) {
3604	+ return "radio" === elem.type;
3605	+ },
3606	+
3607	+ checkbox: function( elem ) {
3608	+ return "checkbox" === elem.type;
3609	+ },
3610	+
3611	+ file: function( elem ) {
3612	+ return "file" === elem.type;
3613	+ },
3614	+ password: function( elem ) {
3615	+ return "password" === elem.type;
3616	+ },
3617	+
3618	+ submit: function( elem ) {
3619	+ return "submit" === elem.type;
3620	+ },
3621	+
3622	+ image: function( elem ) {
3623	+ return "image" === elem.type;
3624	+ },
3625	+
3626	+ reset: function( elem ) {
3627	+ return "reset" === elem.type;
3628	+ },
3629	+
3630	+ button: function( elem ) {
3631	+ return "button" === elem.type \|\| elem.nodeName.toLowerCase() === "button";
3632	+ },
3633	+
3634	+ input: function( elem ) {
3635	+ return (/input\|select\|textarea\|button/i).test( elem.nodeName );
3636	+ }
3637	+ },
3638	+ setFilters: {
3639	+ first: function( elem, i ) {
3640	+ return i === 0;
3641	+ },
3642	+
3643	+ last: function( elem, i, match, array ) {
3644	+ return i === array.length - 1;
3645	+ },
3646	+
3647	+ even: function( elem, i ) {
3648	+ return i % 2 === 0;
3649	+ },
3650	+
3651	+ odd: function( elem, i ) {
3652	+ return i % 2 === 1;
3653	+ },
3654	+
3655	+ lt: function( elem, i, match ) {
3656	+ return i < match[3] - 0;
3657	+ },
3658	+
3659	+ gt: function( elem, i, match ) {
3660	+ return i > match[3] - 0;
3661	+ },
3662	+
3663	+ nth: function( elem, i, match ) {
3664	+ return match[3] - 0 === i;
3665	+ },
3666	+
3667	+ eq: function( elem, i, match ) {
3668	+ return match[3] - 0 === i;
3669	+ }
3670	+ },
3671	+ filter: {
3672	+ PSEUDO: function( elem, match, i, array ) {
3673	+ var name = match[1],
3674	+ filter = Expr.filters[ name ];
3675	+
3676	+ if ( filter ) {
3677	+ return filter( elem, i, match, array );
3678	+
3679	+ } else if ( name === "contains" ) {
3680	+ return (elem.textContent \|\| elem.innerText \|\| Sizzle.getText([ elem ]) \|\| "").indexOf(match[3]) >= 0;
3681	+
3682	+ } else if ( name === "not" ) {
3683	+ var not = match[3];
3684	+
3685	+ for ( var j = 0, l = not.length; j < l; j++ ) {
3686	+ if ( not[j] === elem ) {
3687	+ return false;
3688	+ }
3689	+ }
3690	+
3691	+ return true;
3692	+
3693	+ } else {
3694	+ Sizzle.error( "Syntax error, unrecognized expression: " + name );
3695	+ }
3696	+ },
3697	+
3698	+ CHILD: function( elem, match ) {
3699	+ var type = match[1],
3700	+ node = elem;
3701	+
3702	+ switch ( type ) {
3703	+ case "only":
3704	+ case "first":
3705	+ while ( (node = node.previousSibling) ) {
3706	+ if ( node.nodeType === 1 ) {
3707	+ return false;
3708	+ }
3709	+ }
3710	+
3711	+ if ( type === "first" ) {
3712	+ return true;
3713	+ }
3714	+
3715	+ node = elem;
3716	+
3717	+ case "last":
3718	+ while ( (node = node.nextSibling) ) {
3719	+ if ( node.nodeType === 1 ) {
3720	+ return false;
3721	+ }
3722	+ }
3723	+
3724	+ return true;
3725	+
3726	+ case "nth":
3727	+ var first = match[2],
3728	+ last = match[3];
3729	+
3730	+ if ( first === 1 && last === 0 ) {
3731	+ return true;
3732	+ }
3733	+
3734	+ var doneName = match[0],
3735	+ parent = elem.parentNode;
3736	+
3737	+ if ( parent && (parent.sizcache !== doneName \|\| !elem.nodeIndex) ) {
3738	+ var count = 0;
3739	+
3740	+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
3741	+ if ( node.nodeType === 1 ) {
3742	+ node.nodeIndex = ++count;
3743	+ }
3744	+ }
3745	+
3746	+ parent.sizcache = doneName;
3747	+ }
3748	+
3749	+ var diff = elem.nodeIndex - last;
3750	+
3751	+ if ( first === 0 ) {
3752	+ return diff === 0;
3753	+
3754	+ } else {
3755	+ return ( diff % first === 0 && diff / first >= 0 );
3756	+ }
3757	+ }
3758	+ },
3759	+
3760	+ ID: function( elem, match ) {
3761	+ return elem.nodeType === 1 && elem.getAttribute("id") === match;
3762	+ },
3763	+
3764	+ TAG: function( elem, match ) {
3765	+ return (match === "*" && elem.nodeType === 1) \|\| elem.nodeName.toLowerCase() === match;
3766	+ },
3767	+
3768	+ CLASS: function( elem, match ) {
3769	+ return (" " + (elem.className \|\| elem.getAttribute("class")) + " ")
3770	+ .indexOf( match ) > -1;
3771	+ },
3772	+
3773	+ ATTR: function( elem, match ) {
3774	+ var name = match[1],
3775	+ result = Expr.attrHandle[ name ] ?
3776	+ Expr.attrHandle[ name ]( elem ) :
3777	+ elem[ name ] != null ?
3778	+ elem[ name ] :
3779	+ elem.getAttribute( name ),
3780	+ value = result + "",
3781	+ type = match[2],
3782	+ check = match[4];
3783	+
3784	+ return result == null ?
3785	+ type === "!=" :
3786	+ type === "=" ?
3787	+ value === check :
3788	+ type === "*=" ?
3789	+ value.indexOf(check) >= 0 :
3790	+ type === "~=" ?
3791	+ (" " + value + " ").indexOf(check) >= 0 :
3792	+ !check ?
3793	+ value && result !== false :
3794	+ type === "!=" ?
3795	+ value !== check :
3796	+ type === "^=" ?
3797	+ value.indexOf(check) === 0 :
3798	+ type === "$=" ?
3799	+ value.substr(value.length - check.length) === check :
3800	+ type === "\|=" ?
3801	+ value === check \|\| value.substr(0, check.length + 1) === check + "-" :
3802	+ false;
3803	+ },
3804	+
3805	+ POS: function( elem, match, i, array ) {
3806	+ var name = match[2],
3807	+ filter = Expr.setFilters[ name ];
3808	+
3809	+ if ( filter ) {
3810	+ return filter( elem, i, match, array );
3811	+ }
3812	+ }
3813	+ }
3814	+ };
3815	+
3816	+ var origPOS = Expr.match.POS,
3817	+ fescape = function(all, num){
3818	+ return "\\" + (num - 0 + 1);
3819	+ };
3820	+
3821	+ for ( var type in Expr.match ) {
3822	+ Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]\])(?![^$]$)/.source) );
3823	+ Expr.leftMatch[ type ] = new RegExp( /(^(?:.\|\r\|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
3824	+ }
3825	+
3826	+ var makeArray = function( array, results ) {
3827	+ array = Array.prototype.slice.call( array, 0 );
3828	+
3829	+ if ( results ) {
3830	+ results.push.apply( results, array );
3831	+ return results;
3832	+ }
3833	+
3834	+ return array;
3835	+ };
3836	+
3837	+ // Perform a simple check to determine if the browser is capable of
3838	+ // converting a NodeList to an array using builtin methods.
3839	+ // Also verifies that the returned array holds DOM nodes
3840	+ // (which is not the case in the Blackberry browser)
3841	+ try {
3842	+ Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
3843	+
3844	+ // Provide a fallback method if it does not work
3845	+ } catch( e ) {
3846	+ makeArray = function( array, results ) {
3847	+ var i = 0,
3848	+ ret = results \|\| [];
3849	+
3850	+ if ( toString.call(array) === "[object Array]" ) {
3851	+ Array.prototype.push.apply( ret, array );
3852	+
3853	+ } else {
3854	+ if ( typeof array.length === "number" ) {
3855	+ for ( var l = array.length; i < l; i++ ) {
3856	+ ret.push( array[i] );
3857	+ }
3858	+
3859	+ } else {
3860	+ for ( ; array[i]; i++ ) {
3861	+ ret.push( array[i] );
3862	+ }
3863	+ }
3864	+ }
3865	+
3866	+ return ret;
3867	+ };
3868	+ }
3869	+
3870	+ var sortOrder, siblingCheck;
3871	+
3872	+ if ( document.documentElement.compareDocumentPosition ) {
3873	+ sortOrder = function( a, b ) {
3874	+ if ( a === b ) {
3875	+ hasDuplicate = true;
3876	+ return 0;
3877	+ }
3878	+
3879	+ if ( !a.compareDocumentPosition \|\| !b.compareDocumentPosition ) {
3880	+ return a.compareDocumentPosition ? -1 : 1;
3881	+ }
3882	+
3883	+ return a.compareDocumentPosition(b) & 4 ? -1 : 1;
3884	+ };
3885	+
3886	+ } else {
3887	+ sortOrder = function( a, b ) {
3888	+ var al, bl,
3889	+ ap = [],
3890	+ bp = [],
3891	+ aup = a.parentNode,
3892	+ bup = b.parentNode,
3893	+ cur = aup;
3894	+
3895	+ // The nodes are identical, we can exit early
3896	+ if ( a === b ) {
3897	+ hasDuplicate = true;
3898	+ return 0;
3899	+
3900	+ // If the nodes are siblings (or identical) we can do a quick check
3901	+ } else if ( aup === bup ) {
3902	+ return siblingCheck( a, b );
3903	+
3904	+ // If no parents were found then the nodes are disconnected
3905	+ } else if ( !aup ) {
3906	+ return -1;
3907	+
3908	+ } else if ( !bup ) {
3909	+ return 1;
3910	+ }
3911	+
3912	+ // Otherwise they're somewhere else in the tree so we need
3913	+ // to build up a full list of the parentNodes for comparison
3914	+ while ( cur ) {
3915	+ ap.unshift( cur );
3916	+ cur = cur.parentNode;
3917	+ }
3918	+
3919	+ cur = bup;
3920	+
3921	+ while ( cur ) {
3922	+ bp.unshift( cur );
3923	+ cur = cur.parentNode;
3924	+ }
3925	+
3926	+ al = ap.length;
3927	+ bl = bp.length;
3928	+
3929	+ // Start walking down the tree looking for a discrepancy
3930	+ for ( var i = 0; i < al && i < bl; i++ ) {
3931	+ if ( ap[i] !== bp[i] ) {
3932	+ return siblingCheck( ap[i], bp[i] );
3933	+ }
3934	+ }
3935	+
3936	+ // We ended someplace up the tree so do a sibling check
3937	+ return i === al ?
3938	+ siblingCheck( a, bp[i], -1 ) :
3939	+ siblingCheck( ap[i], b, 1 );
3940	+ };
3941	+
3942	+ siblingCheck = function( a, b, ret ) {
3943	+ if ( a === b ) {
3944	+ return ret;
3945	+ }
3946	+
3947	+ var cur = a.nextSibling;
3948	+
3949	+ while ( cur ) {
3950	+ if ( cur === b ) {
3951	+ return -1;
3952	+ }
3953	+
3954	+ cur = cur.nextSibling;
3955	+ }
3956	+
3957	+ return 1;
3958	+ };
3959	+ }
3960	+
3961	+ // Utility function for retreiving the text value of an array of DOM nodes
3962	+ Sizzle.getText = function( elems ) {
3963	+ var ret = "", elem;
3964	+
3965	+ for ( var i = 0; elems[i]; i++ ) {
3966	+ elem = elems[i];
3967	+
3968	+ // Get the text from text nodes and CDATA nodes
3969	+ if ( elem.nodeType === 3 \|\| elem.nodeType === 4 ) {
3970	+ ret += elem.nodeValue;
3971	+
3972	+ // Traverse everything else, except comment nodes
3973	+ } else if ( elem.nodeType !== 8 ) {
3974	+ ret += Sizzle.getText( elem.childNodes );
3975	+ }
3976	+ }
3977	+
3978	+ return ret;
3979	+ };
3980	+
3981	+ // Check to see if the browser returns elements by name when
3982	+ // querying by getElementById (and provide a workaround)
3983	+ (function(){
3984	+ // We're going to inject a fake input element with a specified name
3985	+ var form = document.createElement("div"),
3986	+ id = "script" + (new Date()).getTime(),
3987	+ root = document.documentElement;
3988	+
3989	+ form.innerHTML = "<a name='" + id + "'/>";
3990	+
3991	+ // Inject it into the root element, check its status, and remove it quickly
3992	+ root.insertBefore( form, root.firstChild );
3993	+
3994	+ // The workaround has to do additional checks after a getElementById
3995	+ // Which slows things down for other browsers (hence the branching)
3996	+ if ( document.getElementById( id ) ) {
3997	+ Expr.find.ID = function( match, context, isXML ) {
3998	+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
3999	+ var m = context.getElementById(match[1]);
4000	+
4001	+ return m ?
4002	+ m.id === match[1] \|\| typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
4003	+ [m] :
4004	+ undefined :
4005	+ [];
4006	+ }
4007	+ };
4008	+
4009	+ Expr.filter.ID = function( elem, match ) {
4010	+ var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
4011	+
4012	+ return elem.nodeType === 1 && node && node.nodeValue === match;
4013	+ };
4014	+ }
4015	+
4016	+ root.removeChild( form );
4017	+
4018	+ // release memory in IE
4019	+ root = form = null;
4020	+ })();
4021	+
4022	+ (function(){
4023	+ // Check to see if the browser returns only elements
4024	+ // when doing getElementsByTagName("*")
4025	+
4026	+ // Create a fake element
4027	+ var div = document.createElement("div");
4028	+ div.appendChild( document.createComment("") );
4029	+
4030	+ // Make sure no comments are found
4031	+ if ( div.getElementsByTagName("*").length > 0 ) {
4032	+ Expr.find.TAG = function( match, context ) {
4033	+ var results = context.getElementsByTagName( match[1] );
4034	+
4035	+ // Filter out possible comments
4036	+ if ( match[1] === "*" ) {
4037	+ var tmp = [];
4038	+
4039	+ for ( var i = 0; results[i]; i++ ) {
4040	+ if ( results[i].nodeType === 1 ) {
4041	+ tmp.push( results[i] );
4042	+ }
4043	+ }
4044	+
4045	+ results = tmp;
4046	+ }
4047	+
4048	+ return results;
4049	+ };
4050	+ }
4051	+
4052	+ // Check to see if an attribute returns normalized href attributes
4053	+ div.innerHTML = "<a href='#'></a>";
4054	+
4055	+ if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
4056	+ div.firstChild.getAttribute("href") !== "#" ) {
4057	+
4058	+ Expr.attrHandle.href = function( elem ) {
4059	+ return elem.getAttribute( "href", 2 );
4060	+ };
4061	+ }
4062	+
4063	+ // release memory in IE
4064	+ div = null;
4065	+ })();
4066	+
4067	+ if ( document.querySelectorAll ) {
4068	+ (function(){
4069	+ var oldSizzle = Sizzle,
4070	+ div = document.createElement("div"),
4071	+ id = "__sizzle__";
4072	+
4073	+ div.innerHTML = "<p class='TEST'></p>";
4074	+
4075	+ // Safari can't handle uppercase or unicode characters when
4076	+ // in quirks mode.
4077	+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
4078	+ return;
4079	+ }
4080	+
4081	+ Sizzle = function( query, context, extra, seed ) {
4082	+ context = context \|\| document;
4083	+
4084	+ // Make sure that attribute selectors are quoted
4085	+ query = query.replace(/\=\s([^'"\]])\s*\]/g, "='$1']");
4086	+
4087	+ // Only use querySelectorAll on non-XML documents
4088	+ // (ID selectors don't work in non-HTML documents)
4089	+ if ( !seed && !Sizzle.isXML(context) ) {
4090	+ if ( context.nodeType === 9 ) {
4091	+ try {
4092	+ return makeArray( context.querySelectorAll(query), extra );
4093	+ } catch(qsaError) {}
4094	+
4095	+ // qSA works strangely on Element-rooted queries
4096	+ // We can work around this by specifying an extra ID on the root
4097	+ // and working up from there (Thanks to Andrew Dupont for the technique)
4098	+ // IE 8 doesn't work on object elements
4099	+ } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
4100	+ var old = context.getAttribute( "id" ),
4101	+ nid = old \|\| id;
4102	+
4103	+ if ( !old ) {
4104	+ context.setAttribute( "id", nid );
4105	+ }
4106	+
4107	+ try {
4108	+ return makeArray( context.querySelectorAll( "#" + nid + " " + query ), extra );
4109	+
4110	+ } catch(pseudoError) {
4111	+ } finally {
4112	+ if ( !old ) {
4113	+ context.removeAttribute( "id" );
4114	+ }
4115	+ }
4116	+ }
4117	+ }
4118	+
4119	+ return oldSizzle(query, context, extra, seed);
4120	+ };
4121	+
4122	+ for ( var prop in oldSizzle ) {
4123	+ Sizzle[ prop ] = oldSizzle[ prop ];
4124	+ }
4125	+
4126	+ // release memory in IE
4127	+ div = null;
4128	+ })();
4129	+ }
4130	+
4131	+ (function(){
4132	+ var html = document.documentElement,
4133	+ matches = html.matchesSelector \|\| html.mozMatchesSelector \|\| html.webkitMatchesSelector \|\| html.msMatchesSelector,
4134	+ pseudoWorks = false;
4135	+
4136	+ try {
4137	+ // This should fail with an exception
4138	+ // Gecko does not error, returns false instead
4139	+ matches.call( document.documentElement, "[test!='']:sizzle" );
4140	+
4141	+ } catch( pseudoError ) {
4142	+ pseudoWorks = true;
4143	+ }
4144	+
4145	+ if ( matches ) {
4146	+ Sizzle.matchesSelector = function( node, expr ) {
4147	+ // Make sure that attribute selectors are quoted
4148	+ expr = expr.replace(/\=\s([^'"\]])\s*\]/g, "='$1']");
4149	+
4150	+ if ( !Sizzle.isXML( node ) ) {
4151	+ try {
4152	+ if ( pseudoWorks \|\| !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
4153	+ return matches.call( node, expr );
4154	+ }
4155	+ } catch(e) {}
4156	+ }
4157	+
4158	+ return Sizzle(expr, null, null, [node]).length > 0;
4159	+ };
4160	+ }
4161	+ })();
4162	+
4163	+ (function(){
4164	+ var div = document.createElement("div");
4165	+
4166	+ div.innerHTML = "<div class='test e'></div><div class='test'></div>";
4167	+
4168	+ // Opera can't find a second classname (in 9.6)
4169	+ // Also, make sure that getElementsByClassName actually exists
4170	+ if ( !div.getElementsByClassName \|\| div.getElementsByClassName("e").length === 0 ) {
4171	+ return;
4172	+ }
4173	+
4174	+ // Safari caches class attributes, doesn't catch changes (in 3.2)
4175	+ div.lastChild.className = "e";
4176	+
4177	+ if ( div.getElementsByClassName("e").length === 1 ) {
4178	+ return;
4179	+ }
4180	+
4181	+ Expr.order.splice(1, 0, "CLASS");
4182	+ Expr.find.CLASS = function( match, context, isXML ) {
4183	+ if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
4184	+ return context.getElementsByClassName(match[1]);
4185	+ }
4186	+ };
4187	+
4188	+ // release memory in IE
4189	+ div = null;
4190	+ })();
4191	+
4192	+ function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
4193	+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
4194	+ var elem = checkSet[i];
4195	+
4196	+ if ( elem ) {
4197	+ var match = false;
4198	+
4199	+ elem = elem[dir];
4200	+
4201	+ while ( elem ) {
4202	+ if ( elem.sizcache === doneName ) {
4203	+ match = checkSet[elem.sizset];
4204	+ break;
4205	+ }
4206	+
4207	+ if ( elem.nodeType === 1 && !isXML ){
4208	+ elem.sizcache = doneName;
4209	+ elem.sizset = i;
4210	+ }
4211	+
4212	+ if ( elem.nodeName.toLowerCase() === cur ) {
4213	+ match = elem;
4214	+ break;
4215	+ }
4216	+
4217	+ elem = elem[dir];
4218	+ }
4219	+
4220	+ checkSet[i] = match;
4221	+ }
4222	+ }
4223	+ }
4224	+
4225	+ function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
4226	+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
4227	+ var elem = checkSet[i];
4228	+
4229	+ if ( elem ) {
4230	+ var match = false;
4231	+
4232	+ elem = elem[dir];
4233	+
4234	+ while ( elem ) {
4235	+ if ( elem.sizcache === doneName ) {
4236	+ match = checkSet[elem.sizset];
4237	+ break;
4238	+ }
4239	+
4240	+ if ( elem.nodeType === 1 ) {
4241	+ if ( !isXML ) {
4242	+ elem.sizcache = doneName;
4243	+ elem.sizset = i;
4244	+ }
4245	+
4246	+ if ( typeof cur !== "string" ) {
4247	+ if ( elem === cur ) {
4248	+ match = true;
4249	+ break;
4250	+ }
4251	+
4252	+ } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
4253	+ match = elem;
4254	+ break;
4255	+ }
4256	+ }
4257	+
4258	+ elem = elem[dir];
4259	+ }
4260	+
4261	+ checkSet[i] = match;
4262	+ }
4263	+ }
4264	+ }
4265	+
4266	+ if ( document.documentElement.contains ) {
4267	+ Sizzle.contains = function( a, b ) {
4268	+ return a !== b && (a.contains ? a.contains(b) : true);
4269	+ };
4270	+
4271	+ } else if ( document.documentElement.compareDocumentPosition ) {
4272	+ Sizzle.contains = function( a, b ) {
4273	+ return !!(a.compareDocumentPosition(b) & 16);
4274	+ };
4275	+
4276	+ } else {
4277	+ Sizzle.contains = function() {
4278	+ return false;
4279	+ };
4280	+ }
4281	+
4282	+ Sizzle.isXML = function( elem ) {
4283	+ // documentElement is verified for cases where it doesn't yet exist
4284	+ // (such as loading iframes in IE - #4833)
4285	+ var documentElement = (elem ? elem.ownerDocument \|\| elem : 0).documentElement;
4286	+
4287	+ return documentElement ? documentElement.nodeName !== "HTML" : false;
4288	+ };
4289	+
4290	+ var posProcess = function( selector, context ) {
4291	+ var match,
4292	+ tmpSet = [],
4293	+ later = "",
4294	+ root = context.nodeType ? [context] : context;
4295	+
4296	+ // Position selectors must be done after the filter
4297	+ // And so must :not(positional) so we move all PSEUDOs to the end
4298	+ while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
4299	+ later += match[0];
4300	+ selector = selector.replace( Expr.match.PSEUDO, "" );
4301	+ }
4302	+
4303	+ selector = Expr.relative[selector] ? selector + "*" : selector;
4304	+
4305	+ for ( var i = 0, l = root.length; i < l; i++ ) {
4306	+ Sizzle( selector, root[i], tmpSet );
4307	+ }
4308	+
4309	+ return Sizzle.filter( later, tmpSet );
4310	+ };
4311	+
4312	+ // EXPOSE
4313	+ jQuery.find = Sizzle;
4314	+ jQuery.expr = Sizzle.selectors;
4315	+ jQuery.expr[":"] = jQuery.expr.filters;
4316	+ jQuery.unique = Sizzle.uniqueSort;
4317	+ jQuery.text = Sizzle.getText;
4318	+ jQuery.isXMLDoc = Sizzle.isXML;
4319	+ jQuery.contains = Sizzle.contains;
4320	+
4321	+
4322	+ })();
4323	+
4324	+
4325	+ var runtil = /Until$/,
4326	+ rparentsprev = /^(?:parents\|prevUntil\|prevAll)/,
4327	+ // Note: This RegExp should be improved, or likely pulled from Sizzle
4328	+ rmultiselector = /,/,
4329	+ isSimple = /^.[^:#\[\.,]*$/,
4330	+ slice = Array.prototype.slice,
4331	+ POS = jQuery.expr.match.POS;
4332	+
4333	+ jQuery.fn.extend({
4334	+ find: function( selector ) {
4335	+ var ret = this.pushStack( "", "find", selector ),
4336	+ length = 0;
4337	+
4338	+ for ( var i = 0, l = this.length; i < l; i++ ) {
4339	+ length = ret.length;
4340	+ jQuery.find( selector, this[i], ret );
4341	+
4342	+ if ( i > 0 ) {
4343	+ // Make sure that the results are unique
4344	+ for ( var n = length; n < ret.length; n++ ) {
4345	+ for ( var r = 0; r < length; r++ ) {
4346	+ if ( ret[r] === ret[n] ) {
4347	+ ret.splice(n--, 1);
4348	+ break;
4349	+ }
4350	+ }
4351	+ }
4352	+ }
4353	+ }
4354	+
4355	+ return ret;
4356	+ },
4357	+
4358	+ has: function( target ) {
4359	+ var targets = jQuery( target );
4360	+ return this.filter(function() {
4361	+ for ( var i = 0, l = targets.length; i < l; i++ ) {
4362	+ if ( jQuery.contains( this, targets[i] ) ) {
4363	+ return true;
4364	+ }
4365	+ }
4366	+ });
4367	+ },
4368	+
4369	+ not: function( selector ) {
4370	+ return this.pushStack( winnow(this, selector, false), "not", selector);
4371	+ },
4372	+
4373	+ filter: function( selector ) {
4374	+ return this.pushStack( winnow(this, selector, true), "filter", selector );
4375	+ },
4376	+
4377	+ is: function( selector ) {
4378	+ return !!selector && jQuery.filter( selector, this ).length > 0;
4379	+ },
4380	+
4381	+ closest: function( selectors, context ) {
4382	+ var ret = [], i, l, cur = this[0];
4383	+
4384	+ if ( jQuery.isArray( selectors ) ) {
4385	+ var match, selector,
4386	+ matches = {},
4387	+ level = 1;
4388	+
4389	+ if ( cur && selectors.length ) {
4390	+ for ( i = 0, l = selectors.length; i < l; i++ ) {
4391	+ selector = selectors[i];
4392	+
4393	+ if ( !matches[selector] ) {
4394	+ matches[selector] = jQuery.expr.match.POS.test( selector ) ?
4395	+ jQuery( selector, context \|\| this.context ) :
4396	+ selector;
4397	+ }
4398	+ }
4399	+
4400	+ while ( cur && cur.ownerDocument && cur !== context ) {
4401	+ for ( selector in matches ) {
4402	+ match = matches[selector];
4403	+
4404	+ if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
4405	+ ret.push({ selector: selector, elem: cur, level: level });
4406	+ }
4407	+ }
4408	+
4409	+ cur = cur.parentNode;
4410	+ level++;
4411	+ }
4412	+ }
4413	+
4414	+ return ret;
4415	+ }
4416	+
4417	+ var pos = POS.test( selectors ) ?
4418	+ jQuery( selectors, context \|\| this.context ) : null;
4419	+
4420	+ for ( i = 0, l = this.length; i < l; i++ ) {
4421	+ cur = this[i];
4422	+
4423	+ while ( cur ) {
4424	+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
4425	+ ret.push( cur );
4426	+ break;
4427	+
4428	+ } else {
4429	+ cur = cur.parentNode;
4430	+ if ( !cur \|\| !cur.ownerDocument \|\| cur === context ) {
4431	+ break;
4432	+ }
4433	+ }
4434	+ }
4435	+ }
4436	+
4437	+ ret = ret.length > 1 ? jQuery.unique(ret) : ret;
4438	+
4439	+ return this.pushStack( ret, "closest", selectors );
4440	+ },
4441	+
4442	+ // Determine the position of an element within
4443	+ // the matched set of elements
4444	+ index: function( elem ) {
4445	+ if ( !elem \|\| typeof elem === "string" ) {
4446	+ return jQuery.inArray( this[0],
4447	+ // If it receives a string, the selector is used
4448	+ // If it receives nothing, the siblings are used
4449	+ elem ? jQuery( elem ) : this.parent().children() );
4450	+ }
4451	+ // Locate the position of the desired element
4452	+ return jQuery.inArray(
4453	+ // If it receives a jQuery object, the first element is used
4454	+ elem.jquery ? elem[0] : elem, this );
4455	+ },
4456	+
4457	+ add: function( selector, context ) {
4458	+ var set = typeof selector === "string" ?
4459	+ jQuery( selector, context \|\| this.context ) :
4460	+ jQuery.makeArray( selector ),
4461	+ all = jQuery.merge( this.get(), set );
4462	+
4463	+ return this.pushStack( isDisconnected( set[0] ) \|\| isDisconnected( all[0] ) ?
4464	+ all :
4465	+ jQuery.unique( all ) );
4466	+ },
4467	+
4468	+ andSelf: function() {
4469	+ return this.add( this.prevObject );
4470	+ }
4471	+ });
4472	+
4473	+ // A painfully simple check to see if an element is disconnected
4474	+ // from a document (should be improved, where feasible).
4475	+ function isDisconnected( node ) {
4476	+ return !node \|\| !node.parentNode \|\| node.parentNode.nodeType === 11;
4477	+ }
4478	+
4479	+ jQuery.each({
4480	+ parent: function( elem ) {
4481	+ var parent = elem.parentNode;
4482	+ return parent && parent.nodeType !== 11 ? parent : null;
4483	+ },
4484	+ parents: function( elem ) {
4485	+ return jQuery.dir( elem, "parentNode" );
4486	+ },
4487	+ parentsUntil: function( elem, i, until ) {
4488	+ return jQuery.dir( elem, "parentNode", until );
4489	+ },
4490	+ next: function( elem ) {
4491	+ return jQuery.nth( elem, 2, "nextSibling" );
4492	+ },
4493	+ prev: function( elem ) {
4494	+ return jQuery.nth( elem, 2, "previousSibling" );
4495	+ },
4496	+ nextAll: function( elem ) {
4497	+ return jQuery.dir( elem, "nextSibling" );
4498	+ },
4499	+ prevAll: function( elem ) {
4500	+ return jQuery.dir( elem, "previousSibling" );
4501	+ },
4502	+ nextUntil: function( elem, i, until ) {
4503	+ return jQuery.dir( elem, "nextSibling", until );
4504	+ },
4505	+ prevUntil: function( elem, i, until ) {
4506	+ return jQuery.dir( elem, "previousSibling", until );
4507	+ },
4508	+ siblings: function( elem ) {
4509	+ return jQuery.sibling( elem.parentNode.firstChild, elem );
4510	+ },
4511	+ children: function( elem ) {
4512	+ return jQuery.sibling( elem.firstChild );
4513	+ },
4514	+ contents: function( elem ) {
4515	+ return jQuery.nodeName( elem, "iframe" ) ?
4516	+ elem.contentDocument \|\| elem.contentWindow.document :
4517	+ jQuery.makeArray( elem.childNodes );
4518	+ }
4519	+ }, function( name, fn ) {
4520	+ jQuery.fn[ name ] = function( until, selector ) {
4521	+ var ret = jQuery.map( this, fn, until );
4522	+
4523	+ if ( !runtil.test( name ) ) {
4524	+ selector = until;
4525	+ }
4526	+
4527	+ if ( selector && typeof selector === "string" ) {
4528	+ ret = jQuery.filter( selector, ret );
4529	+ }
4530	+
4531	+ ret = this.length > 1 ? jQuery.unique( ret ) : ret;
4532	+
4533	+ if ( (this.length > 1 \|\| rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
4534	+ ret = ret.reverse();
4535	+ }
4536	+
4537	+ return this.pushStack( ret, name, slice.call(arguments).join(",") );
4538	+ };
4539	+ });
4540	+
4541	+ jQuery.extend({
4542	+ filter: function( expr, elems, not ) {
4543	+ if ( not ) {
4544	+ expr = ":not(" + expr + ")";
4545	+ }
4546	+
4547	+ return elems.length === 1 ?
4548	+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
4549	+ jQuery.find.matches(expr, elems);
4550	+ },
4551	+
4552	+ dir: function( elem, dir, until ) {
4553	+ var matched = [],
4554	+ cur = elem[ dir ];
4555	+
4556	+ while ( cur && cur.nodeType !== 9 && (until === undefined \|\| cur.nodeType !== 1 \|\| !jQuery( cur ).is( until )) ) {
4557	+ if ( cur.nodeType === 1 ) {
4558	+ matched.push( cur );
4559	+ }
4560	+ cur = cur[dir];
4561	+ }
4562	+ return matched;
4563	+ },
4564	+
4565	+ nth: function( cur, result, dir, elem ) {
4566	+ result = result \|\| 1;
4567	+ var num = 0;
4568	+
4569	+ for ( ; cur; cur = cur[dir] ) {
4570	+ if ( cur.nodeType === 1 && ++num === result ) {
4571	+ break;
4572	+ }
4573	+ }
4574	+
4575	+ return cur;
4576	+ },
4577	+
4578	+ sibling: function( n, elem ) {
4579	+ var r = [];
4580	+
4581	+ for ( ; n; n = n.nextSibling ) {
4582	+ if ( n.nodeType === 1 && n !== elem ) {
4583	+ r.push( n );
4584	+ }
4585	+ }
4586	+
4587	+ return r;
4588	+ }
4589	+ });
4590	+
4591	+ // Implement the identical functionality for filter and not
4592	+ function winnow( elements, qualifier, keep ) {
4593	+ if ( jQuery.isFunction( qualifier ) ) {
4594	+ return jQuery.grep(elements, function( elem, i ) {
4595	+ var retVal = !!qualifier.call( elem, i, elem );
4596	+ return retVal === keep;
4597	+ });
4598	+
4599	+ } else if ( qualifier.nodeType ) {
4600	+ return jQuery.grep(elements, function( elem, i ) {
4601	+ return (elem === qualifier) === keep;
4602	+ });
4603	+
4604	+ } else if ( typeof qualifier === "string" ) {
4605	+ var filtered = jQuery.grep(elements, function( elem ) {
4606	+ return elem.nodeType === 1;
4607	+ });
4608	+
4609	+ if ( isSimple.test( qualifier ) ) {
4610	+ return jQuery.filter(qualifier, filtered, !keep);
4611	+ } else {
4612	+ qualifier = jQuery.filter( qualifier, filtered );
4613	+ }
4614	+ }
4615	+
4616	+ return jQuery.grep(elements, function( elem, i ) {
4617	+ return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
4618	+ });
4619	+ }
4620	+
4621	+
4622	+
4623	+
4624	+ var rinlinejQuery = / jQuery\d+="(?:\d+\|null)"/g,
4625	+ rleadingWhitespace = /^\s+/,
4626	+ rxhtmlTag = /<(?!area\|br\|col\|embed\|hr\|img\|input\|link\|meta\|param)(([\w:]+)[^>]*)\/>/ig,
4627	+ rtagName = /<([\w:]+)/,
4628	+ rtbody = /<tbody/i,
4629	+ rhtml = /<\|&#?\w+;/,
4630	+ rnocache = /<(?:script\|object\|embed\|option\|style)/i,
4631	+ // checked="checked" or checked (html5)
4632	+ rchecked = /checked\s(?:[^=]\|=\s.checked.)/i,
4633	+ raction = /\=([^="'>\s]+\/)>/g,
4634	+ wrapMap = {
4635	+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
4636	+ legend: [ 1, "<fieldset>", "</fieldset>" ],
4637	+ thead: [ 1, "<table>", "</table>" ],
4638	+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
4639	+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
4640	+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
4641	+ area: [ 1, "<map>", "</map>" ],
4642	+ _default: [ 0, "", "" ]
4643	+ };
4644	+
4645	+ wrapMap.optgroup = wrapMap.option;
4646	+ wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
4647	+ wrapMap.th = wrapMap.td;
4648	+
4649	+ // IE can't serialize <link> and <script> tags normally
4650	+ if ( !jQuery.support.htmlSerialize ) {
4651	+ wrapMap._default = [ 1, "div<div>", "</div>" ];
4652	+ }
4653	+
4654	+ jQuery.fn.extend({
4655	+ text: function( text ) {
4656	+ if ( jQuery.isFunction(text) ) {
4657	+ return this.each(function(i) {
4658	+ var self = jQuery( this );
4659	+
4660	+ self.text( text.call(this, i, self.text()) );
4661	+ });
4662	+ }
4663	+
4664	+ if ( typeof text !== "object" && text !== undefined ) {
4665	+ return this.empty().append( (this[0] && this[0].ownerDocument \|\| document).createTextNode( text ) );
4666	+ }
4667	+
4668	+ return jQuery.text( this );
4669	+ },
4670	+
4671	+ wrapAll: function( html ) {
4672	+ if ( jQuery.isFunction( html ) ) {
4673	+ return this.each(function(i) {
4674	+ jQuery(this).wrapAll( html.call(this, i) );
4675	+ });
4676	+ }
4677	+
4678	+ if ( this[0] ) {
4679	+ // The elements to wrap the target around
4680	+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
4681	+
4682	+ if ( this[0].parentNode ) {
4683	+ wrap.insertBefore( this[0] );
4684	+ }
4685	+
4686	+ wrap.map(function() {
4687	+ var elem = this;
4688	+
4689	+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
4690	+ elem = elem.firstChild;
4691	+ }
4692	+
4693	+ return elem;
4694	+ }).append(this);
4695	+ }
4696	+
4697	+ return this;
4698	+ },
4699	+
4700	+ wrapInner: function( html ) {
4701	+ if ( jQuery.isFunction( html ) ) {
4702	+ return this.each(function(i) {
4703	+ jQuery(this).wrapInner( html.call(this, i) );
4704	+ });
4705	+ }
4706	+
4707	+ return this.each(function() {
4708	+ var self = jQuery( this ),
4709	+ contents = self.contents();
4710	+
4711	+ if ( contents.length ) {
4712	+ contents.wrapAll( html );
4713	+
4714	+ } else {
4715	+ self.append( html );
4716	+ }
4717	+ });
4718	+ },
4719	+
4720	+ wrap: function( html ) {
4721	+ return this.each(function() {
4722	+ jQuery( this ).wrapAll( html );
4723	+ });
4724	+ },
4725	+
4726	+ unwrap: function() {
4727	+ return this.parent().each(function() {
4728	+ if ( !jQuery.nodeName( this, "body" ) ) {
4729	+ jQuery( this ).replaceWith( this.childNodes );
4730	+ }
4731	+ }).end();
4732	+ },
4733	+
4734	+ append: function() {
4735	+ return this.domManip(arguments, true, function( elem ) {
4736	+ if ( this.nodeType === 1 ) {
4737	+ this.appendChild( elem );
4738	+ }
4739	+ });
4740	+ },
4741	+
4742	+ prepend: function() {
4743	+ return this.domManip(arguments, true, function( elem ) {
4744	+ if ( this.nodeType === 1 ) {
4745	+ this.insertBefore( elem, this.firstChild );
4746	+ }
4747	+ });
4748	+ },
4749	+
4750	+ before: function() {
4751	+ if ( this[0] && this[0].parentNode ) {
4752	+ return this.domManip(arguments, false, function( elem ) {
4753	+ this.parentNode.insertBefore( elem, this );
4754	+ });
4755	+ } else if ( arguments.length ) {
4756	+ var set = jQuery(arguments[0]);
4757	+ set.push.apply( set, this.toArray() );
4758	+ return this.pushStack( set, "before", arguments );
4759	+ }
4760	+ },
4761	+
4762	+ after: function() {
4763	+ if ( this[0] && this[0].parentNode ) {
4764	+ return this.domManip(arguments, false, function( elem ) {
4765	+ this.parentNode.insertBefore( elem, this.nextSibling );
4766	+ });
4767	+ } else if ( arguments.length ) {
4768	+ var set = this.pushStack( this, "after", arguments );
4769	+ set.push.apply( set, jQuery(arguments[0]).toArray() );
4770	+ return set;
4771	+ }
4772	+ },
4773	+
4774	+ // keepData is for internal use only--do not document
4775	+ remove: function( selector, keepData ) {
4776	+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
4777	+ if ( !selector \|\| jQuery.filter( selector, [ elem ] ).length ) {
4778	+ if ( !keepData && elem.nodeType === 1 ) {
4779	+ jQuery.cleanData( elem.getElementsByTagName("*") );
4780	+ jQuery.cleanData( [ elem ] );
4781	+ }
4782	+
4783	+ if ( elem.parentNode ) {
4784	+ elem.parentNode.removeChild( elem );
4785	+ }
4786	+ }
4787	+ }
4788	+
4789	+ return this;
4790	+ },
4791	+
4792	+ empty: function() {
4793	+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
4794	+ // Remove element nodes and prevent memory leaks
4795	+ if ( elem.nodeType === 1 ) {
4796	+ jQuery.cleanData( elem.getElementsByTagName("*") );
4797	+ }
4798	+
4799	+ // Remove any remaining nodes
4800	+ while ( elem.firstChild ) {
4801	+ elem.removeChild( elem.firstChild );
4802	+ }
4803	+ }
4804	+
4805	+ return this;
4806	+ },
4807	+
4808	+ clone: function( events ) {
4809	+ // Do the clone
4810	+ var ret = this.map(function() {
4811	+ if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
4812	+ // IE copies events bound via attachEvent when
4813	+ // using cloneNode. Calling detachEvent on the
4814	+ // clone will also remove the events from the orignal
4815	+ // In order to get around this, we use innerHTML.
4816	+ // Unfortunately, this means some modifications to
4817	+ // attributes in IE that are actually only stored
4818	+ // as properties will not be copied (such as the
4819	+ // the name attribute on an input).
4820	+ var html = this.outerHTML,
4821	+ ownerDocument = this.ownerDocument;
4822	+
4823	+ if ( !html ) {
4824	+ var div = ownerDocument.createElement("div");
4825	+ div.appendChild( this.cloneNode(true) );
4826	+ html = div.innerHTML;
4827	+ }
4828	+
4829	+ return jQuery.clean([html.replace(rinlinejQuery, "")
4830	+ // Handle the case in IE 8 where action=/test/> self-closes a tag
4831	+ .replace(raction, '="$1">')
4832	+ .replace(rleadingWhitespace, "")], ownerDocument)[0];
4833	+ } else {
4834	+ return this.cloneNode(true);
4835	+ }
4836	+ });
4837	+
4838	+ // Copy the events from the original to the clone
4839	+ if ( events === true ) {
4840	+ cloneCopyEvent( this, ret );
4841	+ cloneCopyEvent( this.find(""), ret.find("") );
4842	+ }
4843	+
4844	+ // Return the cloned set
4845	+ return ret;
4846	+ },
4847	+
4848	+ html: function( value ) {
4849	+ if ( value === undefined ) {
4850	+ return this[0] && this[0].nodeType === 1 ?
4851	+ this[0].innerHTML.replace(rinlinejQuery, "") :
4852	+ null;
4853	+
4854	+ // See if we can take a shortcut and just use innerHTML
4855	+ } else if ( typeof value === "string" && !rnocache.test( value ) &&
4856	+ (jQuery.support.leadingWhitespace \|\| !rleadingWhitespace.test( value )) &&
4857	+ !wrapMap[ (rtagName.exec( value ) \|\| ["", ""])[1].toLowerCase() ] ) {
4858	+
4859	+ value = value.replace(rxhtmlTag, "<$1></$2>");
4860	+
4861	+ try {
4862	+ for ( var i = 0, l = this.length; i < l; i++ ) {
4863	+ // Remove element nodes and prevent memory leaks
4864	+ if ( this[i].nodeType === 1 ) {
4865	+ jQuery.cleanData( this[i].getElementsByTagName("*") );
4866	+ this[i].innerHTML = value;
4867	+ }
4868	+ }
4869	+
4870	+ // If using innerHTML throws an exception, use the fallback method
4871	+ } catch(e) {
4872	+ this.empty().append( value );
4873	+ }
4874	+
4875	+ } else if ( jQuery.isFunction( value ) ) {
4876	+ this.each(function(i){
4877	+ var self = jQuery( this );
4878	+
4879	+ self.html( value.call(this, i, self.html()) );
4880	+ });
4881	+
4882	+ } else {
4883	+ this.empty().append( value );
4884	+ }
4885	+
4886	+ return this;
4887	+ },
4888	+
4889	+ replaceWith: function( value ) {
4890	+ if ( this[0] && this[0].parentNode ) {
4891	+ // Make sure that the elements are removed from the DOM before they are inserted
4892	+ // this can help fix replacing a parent with child elements
4893	+ if ( jQuery.isFunction( value ) ) {
4894	+ return this.each(function(i) {
4895	+ var self = jQuery(this), old = self.html();
4896	+ self.replaceWith( value.call( this, i, old ) );
4897	+ });
4898	+ }
4899	+
4900	+ if ( typeof value !== "string" ) {
4901	+ value = jQuery( value ).detach();
4902	+ }
4903	+
4904	+ return this.each(function() {
4905	+ var next = this.nextSibling,
4906	+ parent = this.parentNode;
4907	+
4908	+ jQuery( this ).remove();
4909	+
4910	+ if ( next ) {
4911	+ jQuery(next).before( value );
4912	+ } else {
4913	+ jQuery(parent).append( value );
4914	+ }
4915	+ });
4916	+ } else {
4917	+ return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
4918	+ }
4919	+ },
4920	+
4921	+ detach: function( selector ) {
4922	+ return this.remove( selector, true );
4923	+ },
4924	+
4925	+ domManip: function( args, table, callback ) {
4926	+ var results, first, fragment, parent,
4927	+ value = args[0],
4928	+ scripts = [];
4929	+
4930	+ // We can't cloneNode fragments that contain checked, in WebKit
4931	+ if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
4932	+ return this.each(function() {
4933	+ jQuery(this).domManip( args, table, callback, true );
4934	+ });
4935	+ }
4936	+
4937	+ if ( jQuery.isFunction(value) ) {
4938	+ return this.each(function(i) {
4939	+ var self = jQuery(this);
4940	+ args[0] = value.call(this, i, table ? self.html() : undefined);
4941	+ self.domManip( args, table, callback );
4942	+ });
4943	+ }
4944	+
4945	+ if ( this[0] ) {
4946	+ parent = value && value.parentNode;
4947	+
4948	+ // If we're in a fragment, just use that instead of building a new one
4949	+ if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
4950	+ results = { fragment: parent };
4951	+
4952	+ } else {
4953	+ results = jQuery.buildFragment( args, this, scripts );
4954	+ }
4955	+
4956	+ fragment = results.fragment;
4957	+
4958	+ if ( fragment.childNodes.length === 1 ) {
4959	+ first = fragment = fragment.firstChild;
4960	+ } else {
4961	+ first = fragment.firstChild;
4962	+ }
4963	+
4964	+ if ( first ) {
4965	+ table = table && jQuery.nodeName( first, "tr" );
4966	+
4967	+ for ( var i = 0, l = this.length; i < l; i++ ) {
4968	+ callback.call(
4969	+ table ?
4970	+ root(this[i], first) :
4971	+ this[i],
4972	+ i > 0 \|\| results.cacheable \|\| this.length > 1 ?
4973	+ fragment.cloneNode(true) :
4974	+ fragment
4975	+ );
4976	+ }
4977	+ }
4978	+
4979	+ if ( scripts.length ) {
4980	+ jQuery.each( scripts, evalScript );
4981	+ }
4982	+ }
4983	+
4984	+ return this;
4985	+ }
4986	+ });
4987	+
4988	+ function root( elem, cur ) {
4989	+ return jQuery.nodeName(elem, "table") ?
4990	+ (elem.getElementsByTagName("tbody")[0] \|\|
4991	+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
4992	+ elem;
4993	+ }
4994	+
4995	+ function cloneCopyEvent(orig, ret) {
4996	+ var i = 0;
4997	+
4998	+ ret.each(function() {
4999	+ if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) {
5000	+ return;
5001	+ }
5002	+
5003	+ var oldData = jQuery.data( orig[i++] ),
5004	+ curData = jQuery.data( this, oldData ),
5005	+ events = oldData && oldData.events;
5006	+
5007	+ if ( events ) {
5008	+ delete curData.handle;
5009	+ curData.events = {};
5010	+
5011	+ for ( var type in events ) {
5012	+ for ( var handler in events[ type ] ) {
5013	+ jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
5014	+ }
5015	+ }
5016	+ }
5017	+ });
5018	+ }
5019	+
5020	+ jQuery.buildFragment = function( args, nodes, scripts ) {
5021	+ var fragment, cacheable, cacheresults,
5022	+ doc = (nodes && nodes[0] ? nodes[0].ownerDocument \|\| nodes[0] : document);
5023	+
5024	+ // Only cache "small" (1/2 KB) strings that are associated with the main document
5025	+ // Cloning options loses the selected state, so don't cache them
5026	+ // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
5027	+ // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
5028	+ if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
5029	+ !rnocache.test( args[0] ) && (jQuery.support.checkClone \|\| !rchecked.test( args[0] )) ) {
5030	+
5031	+ cacheable = true;
5032	+ cacheresults = jQuery.fragments[ args[0] ];
5033	+ if ( cacheresults ) {
5034	+ if ( cacheresults !== 1 ) {
5035	+ fragment = cacheresults;
5036	+ }
5037	+ }
5038	+ }
5039	+
5040	+ if ( !fragment ) {
5041	+ fragment = doc.createDocumentFragment();
5042	+ jQuery.clean( args, doc, fragment, scripts );
5043	+ }
5044	+
5045	+ if ( cacheable ) {
5046	+ jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
5047	+ }
5048	+
5049	+ return { fragment: fragment, cacheable: cacheable };
5050	+ };
5051	+
5052	+ jQuery.fragments = {};
5053	+
5054	+ jQuery.each({
5055	+ appendTo: "append",
5056	+ prependTo: "prepend",
5057	+ insertBefore: "before",
5058	+ insertAfter: "after",
5059	+ replaceAll: "replaceWith"
5060	+ }, function( name, original ) {
5061	+ jQuery.fn[ name ] = function( selector ) {
5062	+ var ret = [],
5063	+ insert = jQuery( selector ),
5064	+ parent = this.length === 1 && this[0].parentNode;
5065	+
5066	+ if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
5067	+ insert[ original ]( this[0] );
5068	+ return this;
5069	+
5070	+ } else {
5071	+ for ( var i = 0, l = insert.length; i < l; i++ ) {
5072	+ var elems = (i > 0 ? this.clone(true) : this).get();
5073	+ jQuery( insert[i] )[ original ]( elems );
5074	+ ret = ret.concat( elems );
5075	+ }
5076	+
5077	+ return this.pushStack( ret, name, insert.selector );
5078	+ }
5079	+ };
5080	+ });
5081	+
5082	+ jQuery.extend({
5083	+ clean: function( elems, context, fragment, scripts ) {
5084	+ context = context \|\| document;
5085	+
5086	+ // !context.createElement fails in IE with an error but returns typeof 'object'
5087	+ if ( typeof context.createElement === "undefined" ) {
5088	+ context = context.ownerDocument \|\| context[0] && context[0].ownerDocument \|\| document;
5089	+ }
5090	+
5091	+ var ret = [];
5092	+
5093	+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
5094	+ if ( typeof elem === "number" ) {
5095	+ elem += "";
5096	+ }
5097	+
5098	+ if ( !elem ) {
5099	+ continue;
5100	+ }
5101	+
5102	+ // Convert html string into DOM nodes
5103	+ if ( typeof elem === "string" && !rhtml.test( elem ) ) {
5104	+ elem = context.createTextNode( elem );
5105	+
5106	+ } else if ( typeof elem === "string" ) {
5107	+ // Fix "XHTML"-style tags in all browsers
5108	+ elem = elem.replace(rxhtmlTag, "<$1></$2>");
5109	+
5110	+ // Trim whitespace, otherwise indexOf won't work as expected
5111	+ var tag = (rtagName.exec( elem ) \|\| ["", ""])[1].toLowerCase(),
5112	+ wrap = wrapMap[ tag ] \|\| wrapMap._default,
5113	+ depth = wrap[0],
5114	+ div = context.createElement("div");
5115	+
5116	+ // Go to html and back, then peel off extra wrappers
5117	+ div.innerHTML = wrap[1] + elem + wrap[2];
5118	+
5119	+ // Move to the right depth
5120	+ while ( depth-- ) {
5121	+ div = div.lastChild;
5122	+ }
5123	+
5124	+ // Remove IE's autoinserted <tbody> from table fragments
5125	+ if ( !jQuery.support.tbody ) {
5126	+
5127	+ // String was a <table>, may have spurious <tbody>
5128	+ var hasBody = rtbody.test(elem),
5129	+ tbody = tag === "table" && !hasBody ?
5130	+ div.firstChild && div.firstChild.childNodes :
5131	+
5132	+ // String was a bare <thead> or <tfoot>
5133	+ wrap[1] === "<table>" && !hasBody ?
5134	+ div.childNodes :
5135	+ [];
5136	+
5137	+ for ( var j = tbody.length - 1; j >= 0 ; --j ) {
5138	+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
5139	+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
5140	+ }
5141	+ }
5142	+
5143	+ }
5144	+
5145	+ // IE completely kills leading whitespace when innerHTML is used
5146	+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
5147	+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
5148	+ }
5149	+
5150	+ elem = div.childNodes;
5151	+ }
5152	+
5153	+ if ( elem.nodeType ) {
5154	+ ret.push( elem );
5155	+ } else {
5156	+ ret = jQuery.merge( ret, elem );
5157	+ }
5158	+ }
5159	+
5160	+ if ( fragment ) {
5161	+ for ( i = 0; ret[i]; i++ ) {
5162	+ if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type \|\| ret[i].type.toLowerCase() === "text/javascript") ) {
5163	+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
5164	+
5165	+ } else {
5166	+ if ( ret[i].nodeType === 1 ) {
5167	+ ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
5168	+ }
5169	+ fragment.appendChild( ret[i] );
5170	+ }
5171	+ }
5172	+ }
5173	+
5174	+ return ret;
5175	+ },
5176	+
5177	+ cleanData: function( elems ) {
5178	+ var data, id, cache = jQuery.cache,
5179	+ special = jQuery.event.special,
5180	+ deleteExpando = jQuery.support.deleteExpando;
5181	+
5182	+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
5183	+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
5184	+ continue;
5185	+ }
5186	+
5187	+ id = elem[ jQuery.expando ];
5188	+
5189	+ if ( id ) {
5190	+ data = cache[ id ];
5191	+
5192	+ if ( data && data.events ) {
5193	+ for ( var type in data.events ) {
5194	+ if ( special[ type ] ) {
5195	+ jQuery.event.remove( elem, type );
5196	+
5197	+ } else {
5198	+ jQuery.removeEvent( elem, type, data.handle );
5199	+ }
5200	+ }
5201	+ }
5202	+
5203	+ if ( deleteExpando ) {
5204	+ delete elem[ jQuery.expando ];
5205	+
5206	+ } else if ( elem.removeAttribute ) {
5207	+ elem.removeAttribute( jQuery.expando );
5208	+ }
5209	+
5210	+ delete cache[ id ];
5211	+ }
5212	+ }
5213	+ }
5214	+ });
5215	+
5216	+ function evalScript( i, elem ) {
5217	+ if ( elem.src ) {
5218	+ jQuery.ajax({
5219	+ url: elem.src,
5220	+ async: false,
5221	+ dataType: "script"
5222	+ });
5223	+ } else {
5224	+ jQuery.globalEval( elem.text \|\| elem.textContent \|\| elem.innerHTML \|\| "" );
5225	+ }
5226	+
5227	+ if ( elem.parentNode ) {
5228	+ elem.parentNode.removeChild( elem );
5229	+ }
5230	+ }
5231	+
5232	+
5233	+
5234	+
5235	+ var ralpha = /alpha$[^)]*$/i,
5236	+ ropacity = /opacity=([^)]*)/,
5237	+ rdashAlpha = /-([a-z])/ig,
5238	+ rupper = /([A-Z])/g,
5239	+ rnumpx = /^-?\d+(?:px)?$/i,
5240	+ rnum = /^-?\d/,
5241	+
5242	+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
5243	+ cssWidth = [ "Left", "Right" ],
5244	+ cssHeight = [ "Top", "Bottom" ],
5245	+ curCSS,
5246	+
5247	+ getComputedStyle,
5248	+ currentStyle,
5249	+
5250	+ fcamelCase = function( all, letter ) {
5251	+ return letter.toUpperCase();
5252	+ };
5253	+
5254	+ jQuery.fn.css = function( name, value ) {
5255	+ // Setting 'undefined' is a no-op
5256	+ if ( arguments.length === 2 && value === undefined ) {
5257	+ return this;
5258	+ }
5259	+
5260	+ return jQuery.access( this, name, value, true, function( elem, name, value ) {
5261	+ return value !== undefined ?
5262	+ jQuery.style( elem, name, value ) :
5263	+ jQuery.css( elem, name );
5264	+ });
5265	+ };
5266	+
5267	+ jQuery.extend({
5268	+ // Add in style property hooks for overriding the default
5269	+ // behavior of getting and setting a style property
5270	+ cssHooks: {
5271	+ opacity: {
5272	+ get: function( elem, computed ) {
5273	+ if ( computed ) {
5274	+ // We should always get a number back from opacity
5275	+ var ret = curCSS( elem, "opacity", "opacity" );
5276	+ return ret === "" ? "1" : ret;
5277	+
5278	+ } else {
5279	+ return elem.style.opacity;
5280	+ }
5281	+ }
5282	+ }
5283	+ },
5284	+
5285	+ // Exclude the following css properties to add px
5286	+ cssNumber: {
5287	+ "zIndex": true,
5288	+ "fontWeight": true,
5289	+ "opacity": true,
5290	+ "zoom": true,
5291	+ "lineHeight": true
5292	+ },
5293	+
5294	+ // Add in properties whose names you wish to fix before
5295	+ // setting or getting the value
5296	+ cssProps: {
5297	+ // normalize float css property
5298	+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
5299	+ },
5300	+
5301	+ // Get and set the style property on a DOM Node
5302	+ style: function( elem, name, value, extra ) {
5303	+ // Don't set styles on text and comment nodes
5304	+ if ( !elem \|\| elem.nodeType === 3 \|\| elem.nodeType === 8 \|\| !elem.style ) {
5305	+ return;
5306	+ }
5307	+
5308	+ // Make sure that we're working with the right name
5309	+ var ret, origName = jQuery.camelCase( name ),
5310	+ style = elem.style, hooks = jQuery.cssHooks[ origName ];
5311	+
5312	+ name = jQuery.cssProps[ origName ] \|\| origName;
5313	+
5314	+ // Check if we're setting a value
5315	+ if ( value !== undefined ) {
5316	+ // Make sure that NaN and null values aren't set. See: #7116
5317	+ if ( typeof value === "number" && isNaN( value ) \|\| value == null ) {
5318	+ return;
5319	+ }
5320	+
5321	+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
5322	+ if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) {
5323	+ value += "px";
5324	+ }
5325	+
5326	+ // If a hook was provided, use that value, otherwise just set the specified value
5327	+ if ( !hooks \|\| !("set" in hooks) \|\| (value = hooks.set( elem, value )) !== undefined ) {
5328	+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
5329	+ // Fixes bug #5509
5330	+ try {
5331	+ style[ name ] = value;
5332	+ } catch(e) {}
5333	+ }
5334	+
5335	+ } else {
5336	+ // If a hook was provided get the non-computed value from there
5337	+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
5338	+ return ret;
5339	+ }
5340	+
5341	+ // Otherwise just get the value from the style object
5342	+ return style[ name ];
5343	+ }
5344	+ },
5345	+
5346	+ css: function( elem, name, extra ) {
5347	+ // Make sure that we're working with the right name
5348	+ var ret, origName = jQuery.camelCase( name ),
5349	+ hooks = jQuery.cssHooks[ origName ];
5350	+
5351	+ name = jQuery.cssProps[ origName ] \|\| origName;
5352	+
5353	+ // If a hook was provided get the computed value from there
5354	+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
5355	+ return ret;
5356	+
5357	+ // Otherwise, if a way to get the computed value exists, use that
5358	+ } else if ( curCSS ) {
5359	+ return curCSS( elem, name, origName );
5360	+ }
5361	+ },
5362	+
5363	+ // A method for quickly swapping in/out CSS properties to get correct calculations
5364	+ swap: function( elem, options, callback ) {
5365	+ var old = {};
5366	+
5367	+ // Remember the old values, and insert the new ones
5368	+ for ( var name in options ) {
5369	+ old[ name ] = elem.style[ name ];
5370	+ elem.style[ name ] = options[ name ];
5371	+ }
5372	+
5373	+ callback.call( elem );
5374	+
5375	+ // Revert the old values
5376	+ for ( name in options ) {
5377	+ elem.style[ name ] = old[ name ];
5378	+ }
5379	+ },
5380	+
5381	+ camelCase: function( string ) {
5382	+ return string.replace( rdashAlpha, fcamelCase );
5383	+ }
5384	+ });
5385	+
5386	+ // DEPRECATED, Use jQuery.css() instead
5387	+ jQuery.curCSS = jQuery.css;
5388	+
5389	+ jQuery.each(["height", "width"], function( i, name ) {
5390	+ jQuery.cssHooks[ name ] = {
5391	+ get: function( elem, computed, extra ) {
5392	+ var val;
5393	+
5394	+ if ( computed ) {
5395	+ if ( elem.offsetWidth !== 0 ) {
5396	+ val = getWH( elem, name, extra );
5397	+
5398	+ } else {
5399	+ jQuery.swap( elem, cssShow, function() {
5400	+ val = getWH( elem, name, extra );
5401	+ });
5402	+ }
5403	+
5404	+ if ( val <= 0 ) {
5405	+ val = curCSS( elem, name, name );
5406	+
5407	+ if ( val === "0px" && currentStyle ) {
5408	+ val = currentStyle( elem, name, name );
5409	+ }
5410	+
5411	+ if ( val != null ) {
5412	+ // Should return "auto" instead of 0, use 0 for
5413	+ // temporary backwards-compat
5414	+ return val === "" \|\| val === "auto" ? "0px" : val;
5415	+ }
5416	+ }
5417	+
5418	+ if ( val < 0 \|\| val == null ) {
5419	+ val = elem.style[ name ];
5420	+
5421	+ // Should return "auto" instead of 0, use 0 for
5422	+ // temporary backwards-compat
5423	+ return val === "" \|\| val === "auto" ? "0px" : val;
5424	+ }
5425	+
5426	+ return typeof val === "string" ? val : val + "px";
5427	+ }
5428	+ },
5429	+
5430	+ set: function( elem, value ) {
5431	+ if ( rnumpx.test( value ) ) {
5432	+ // ignore negative width and height values #1599
5433	+ value = parseFloat(value);
5434	+
5435	+ if ( value >= 0 ) {
5436	+ return value + "px";
5437	+ }
5438	+
5439	+ } else {
5440	+ return value;
5441	+ }
5442	+ }
5443	+ };
5444	+ });
5445	+
5446	+ if ( !jQuery.support.opacity ) {
5447	+ jQuery.cssHooks.opacity = {
5448	+ get: function( elem, computed ) {
5449	+ // IE uses filters for opacity
5450	+ return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) \|\| "") ?
5451	+ (parseFloat(RegExp.$1) / 100) + "" :
5452	+ computed ? "1" : "";
5453	+ },
5454	+
5455	+ set: function( elem, value ) {
5456	+ var style = elem.style;
5457	+
5458	+ // IE has trouble with opacity if it does not have layout
5459	+ // Force it by setting the zoom level
5460	+ style.zoom = 1;
5461	+
5462	+ // Set the alpha filter to set the opacity
5463	+ var opacity = jQuery.isNaN(value) ?
5464	+ "" :
5465	+ "alpha(opacity=" + value * 100 + ")",
5466	+ filter = style.filter \|\| "";
5467	+
5468	+ style.filter = ralpha.test(filter) ?
5469	+ filter.replace(ralpha, opacity) :
5470	+ style.filter + ' ' + opacity;
5471	+ }
5472	+ };
5473	+ }
5474	+
5475	+ if ( document.defaultView && document.defaultView.getComputedStyle ) {
5476	+ getComputedStyle = function( elem, newName, name ) {
5477	+ var ret, defaultView, computedStyle;
5478	+
5479	+ name = name.replace( rupper, "-$1" ).toLowerCase();
5480	+
5481	+ if ( !(defaultView = elem.ownerDocument.defaultView) ) {
5482	+ return undefined;
5483	+ }
5484	+
5485	+ if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
5486	+ ret = computedStyle.getPropertyValue( name );
5487	+ if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
5488	+ ret = jQuery.style( elem, name );
5489	+ }
5490	+ }
5491	+
5492	+ return ret;
5493	+ };
5494	+ }
5495	+
5496	+ if ( document.documentElement.currentStyle ) {
5497	+ currentStyle = function( elem, name ) {
5498	+ var left, rsLeft,
5499	+ ret = elem.currentStyle && elem.currentStyle[ name ],
5500	+ style = elem.style;
5501	+
5502	+ // From the awesome hack by Dean Edwards
5503	+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
5504	+
5505	+ // If we're not dealing with a regular pixel number
5506	+ // but a number that has a weird ending, we need to convert it to pixels
5507	+ if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
5508	+ // Remember the original values
5509	+ left = style.left;
5510	+ rsLeft = elem.runtimeStyle.left;
5511	+
5512	+ // Put in the new values to get a computed value out
5513	+ elem.runtimeStyle.left = elem.currentStyle.left;
5514	+ style.left = name === "fontSize" ? "1em" : (ret \|\| 0);
5515	+ ret = style.pixelLeft + "px";
5516	+
5517	+ // Revert the changed values
5518	+ style.left = left;
5519	+ elem.runtimeStyle.left = rsLeft;
5520	+ }
5521	+
5522	+ return ret === "" ? "auto" : ret;
5523	+ };
5524	+ }
5525	+
5526	+ curCSS = getComputedStyle \|\| currentStyle;
5527	+
5528	+ function getWH( elem, name, extra ) {
5529	+ var which = name === "width" ? cssWidth : cssHeight,
5530	+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
5531	+
5532	+ if ( extra === "border" ) {
5533	+ return val;
5534	+ }
5535	+
5536	+ jQuery.each( which, function() {
5537	+ if ( !extra ) {
5538	+ val -= parseFloat(jQuery.css( elem, "padding" + this )) \|\| 0;
5539	+ }
5540	+
5541	+ if ( extra === "margin" ) {
5542	+ val += parseFloat(jQuery.css( elem, "margin" + this )) \|\| 0;
5543	+
5544	+ } else {
5545	+ val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) \|\| 0;
5546	+ }
5547	+ });
5548	+
5549	+ return val;
5550	+ }
5551	+
5552	+ if ( jQuery.expr && jQuery.expr.filters ) {
5553	+ jQuery.expr.filters.hidden = function( elem ) {
5554	+ var width = elem.offsetWidth,
5555	+ height = elem.offsetHeight;
5556	+
5557	+ return (width === 0 && height === 0) \|\| (!jQuery.support.reliableHiddenOffsets && (elem.style.display \|\| jQuery.css( elem, "display" )) === "none");
5558	+ };
5559	+
5560	+ jQuery.expr.filters.visible = function( elem ) {
5561	+ return !jQuery.expr.filters.hidden( elem );
5562	+ };
5563	+ }
5564	+
5565	+
5566	+
5567	+
5568	+ var jsc = jQuery.now(),
5569	+ rscript = /<script\b[^<](?:(?!<\/script>)<[^<])*<\/script>/gi,
5570	+ rselectTextarea = /^(?:select\|textarea)/i,
5571	+ rinput = /^(?:color\|date\|datetime\|email\|hidden\|month\|number\|password\|range\|search\|tel\|text\|time\|url\|week)$/i,
5572	+ rnoContent = /^(?:GET\|HEAD)$/,
5573	+ rbracket = /\[\]$/,
5574	+ jsre = /\=\?(&\|$)/,
5575	+ rquery = /\?/,
5576	+ rts = /([?&])_=[^&]*/,
5577	+ rurl = /^(\w+:)?\/\/([^\/?#]+)/,
5578	+ r20 = /%20/g,
5579	+ rhash = /#.*$/,
5580	+
5581	+ // Keep a copy of the old load method
5582	+ _load = jQuery.fn.load;
5583	+
5584	+ jQuery.fn.extend({
5585	+ load: function( url, params, callback ) {
5586	+ if ( typeof url !== "string" && _load ) {
5587	+ return _load.apply( this, arguments );
5588	+
5589	+ // Don't do a request if no elements are being requested
5590	+ } else if ( !this.length ) {
5591	+ return this;
5592	+ }
5593	+
5594	+ var off = url.indexOf(" ");
5595	+ if ( off >= 0 ) {
5596	+ var selector = url.slice(off, url.length);
5597	+ url = url.slice(0, off);
5598	+ }
5599	+
5600	+ // Default to a GET request
5601	+ var type = "GET";
5602	+
5603	+ // If the second parameter was provided
5604	+ if ( params ) {
5605	+ // If it's a function
5606	+ if ( jQuery.isFunction( params ) ) {
5607	+ // We assume that it's the callback
5608	+ callback = params;
5609	+ params = null;
5610	+
5611	+ // Otherwise, build a param string
5612	+ } else if ( typeof params === "object" ) {
5613	+ params = jQuery.param( params, jQuery.ajaxSettings.traditional );
5614	+ type = "POST";
5615	+ }
5616	+ }
5617	+
5618	+ var self = this;
5619	+
5620	+ // Request the remote document
5621	+ jQuery.ajax({
5622	+ url: url,
5623	+ type: type,
5624	+ dataType: "html",
5625	+ data: params,
5626	+ complete: function( res, status ) {
5627	+ // If successful, inject the HTML into all the matched elements
5628	+ if ( status === "success" \|\| status === "notmodified" ) {
5629	+ // See if a selector was specified
5630	+ self.html( selector ?
5631	+ // Create a dummy div to hold the results
5632	+ jQuery("<div>")
5633	+ // inject the contents of the document in, removing the scripts
5634	+ // to avoid any 'Permission Denied' errors in IE
5635	+ .append(res.responseText.replace(rscript, ""))
5636	+
5637	+ // Locate the specified elements
5638	+ .find(selector) :
5639	+
5640	+ // If not, just inject the full result
5641	+ res.responseText );
5642	+ }
5643	+
5644	+ if ( callback ) {
5645	+ self.each( callback, [res.responseText, status, res] );
5646	+ }
5647	+ }
5648	+ });
5649	+
5650	+ return this;
5651	+ },
5652	+
5653	+ serialize: function() {
5654	+ return jQuery.param(this.serializeArray());
5655	+ },
5656	+
5657	+ serializeArray: function() {
5658	+ return this.map(function() {
5659	+ return this.elements ? jQuery.makeArray(this.elements) : this;
5660	+ })
5661	+ .filter(function() {
5662	+ return this.name && !this.disabled &&
5663	+ (this.checked \|\| rselectTextarea.test(this.nodeName) \|\|
5664	+ rinput.test(this.type));
5665	+ })
5666	+ .map(function( i, elem ) {
5667	+ var val = jQuery(this).val();
5668	+
5669	+ return val == null ?
5670	+ null :
5671	+ jQuery.isArray(val) ?
5672	+ jQuery.map( val, function( val, i ) {
5673	+ return { name: elem.name, value: val };
5674	+ }) :
5675	+ { name: elem.name, value: val };
5676	+ }).get();
5677	+ }
5678	+ });
5679	+
5680	+ // Attach a bunch of functions for handling common AJAX events
5681	+ jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) {
5682	+ jQuery.fn[o] = function( f ) {
5683	+ return this.bind(o, f);
5684	+ };
5685	+ });
5686	+
5687	+ jQuery.extend({
5688	+ get: function( url, data, callback, type ) {
5689	+ // shift arguments if data argument was omited
5690	+ if ( jQuery.isFunction( data ) ) {
5691	+ type = type \|\| callback;
5692	+ callback = data;
5693	+ data = null;
5694	+ }
5695	+
5696	+ return jQuery.ajax({
5697	+ type: "GET",
5698	+ url: url,
5699	+ data: data,
5700	+ success: callback,
5701	+ dataType: type
5702	+ });
5703	+ },
5704	+
5705	+ getScript: function( url, callback ) {
5706	+ return jQuery.get(url, null, callback, "script");
5707	+ },
5708	+
5709	+ getJSON: function( url, data, callback ) {
5710	+ return jQuery.get(url, data, callback, "json");
5711	+ },
5712	+
5713	+ post: function( url, data, callback, type ) {
5714	+ // shift arguments if data argument was omited
5715	+ if ( jQuery.isFunction( data ) ) {
5716	+ type = type \|\| callback;
5717	+ callback = data;
5718	+ data = {};
5719	+ }
5720	+
5721	+ return jQuery.ajax({
5722	+ type: "POST",
5723	+ url: url,
5724	+ data: data,
5725	+ success: callback,
5726	+ dataType: type
5727	+ });
5728	+ },
5729	+
5730	+ ajaxSetup: function( settings ) {
5731	+ jQuery.extend( jQuery.ajaxSettings, settings );
5732	+ },
5733	+
5734	+ ajaxSettings: {
5735	+ url: location.href,
5736	+ global: true,
5737	+ type: "GET",
5738	+ contentType: "application/x-www-form-urlencoded",
5739	+ processData: true,
5740	+ async: true,
5741	+ /*
5742	+ timeout: 0,
5743	+ data: null,
5744	+ username: null,
5745	+ password: null,
5746	+ traditional: false,
5747	+ */
5748	+ // This function can be overriden by calling jQuery.ajaxSetup
5749	+ xhr: function() {
5750	+ return new window.XMLHttpRequest();
5751	+ },
5752	+ accepts: {
5753	+ xml: "application/xml, text/xml",
5754	+ html: "text/html",
5755	+ script: "text/javascript, application/javascript",
5756	+ json: "application/json, text/javascript",
5757	+ text: "text/plain",
5758	+ _default: "/"
5759	+ }
5760	+ },
5761	+
5762	+ ajax: function( origSettings ) {
5763	+ var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings),
5764	+ jsonp, status, data, type = s.type.toUpperCase(), noContent = rnoContent.test(type);
5765	+
5766	+ s.url = s.url.replace( rhash, "" );
5767	+
5768	+ // Use original (not extended) context object if it was provided
5769	+ s.context = origSettings && origSettings.context != null ? origSettings.context : s;
5770	+
5771	+ // convert data if not already a string
5772	+ if ( s.data && s.processData && typeof s.data !== "string" ) {
5773	+ s.data = jQuery.param( s.data, s.traditional );
5774	+ }
5775	+
5776	+ // Handle JSONP Parameter Callbacks
5777	+ if ( s.dataType === "jsonp" ) {
5778	+ if ( type === "GET" ) {
5779	+ if ( !jsre.test( s.url ) ) {
5780	+ s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp \|\| "callback") + "=?";
5781	+ }
5782	+ } else if ( !s.data \|\| !jsre.test(s.data) ) {
5783	+ s.data = (s.data ? s.data + "&" : "") + (s.jsonp \|\| "callback") + "=?";
5784	+ }
5785	+ s.dataType = "json";
5786	+ }
5787	+
5788	+ // Build temporary JSONP function
5789	+ if ( s.dataType === "json" && (s.data && jsre.test(s.data) \|\| jsre.test(s.url)) ) {
5790	+ jsonp = s.jsonpCallback \|\| ("jsonp" + jsc++);
5791	+
5792	+ // Replace the =? sequence both in the query string and the data
5793	+ if ( s.data ) {
5794	+ s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
5795	+ }
5796	+
5797	+ s.url = s.url.replace(jsre, "=" + jsonp + "$1");
5798	+
5799	+ // We need to make sure
5800	+ // that a JSONP style response is executed properly
5801	+ s.dataType = "script";
5802	+
5803	+ // Handle JSONP-style loading
5804	+ var customJsonp = window[ jsonp ];
5805	+
5806	+ window[ jsonp ] = function( tmp ) {
5807	+ if ( jQuery.isFunction( customJsonp ) ) {
5808	+ customJsonp( tmp );
5809	+
5810	+ } else {
5811	+ // Garbage collect
5812	+ window[ jsonp ] = undefined;
5813	+
5814	+ try {
5815	+ delete window[ jsonp ];
5816	+ } catch( jsonpError ) {}
5817	+ }
5818	+
5819	+ data = tmp;
5820	+ jQuery.handleSuccess( s, xhr, status, data );
5821	+ jQuery.handleComplete( s, xhr, status, data );
5822	+
5823	+ if ( head ) {
5824	+ head.removeChild( script );
5825	+ }
5826	+ };
5827	+ }
5828	+
5829	+ if ( s.dataType === "script" && s.cache === null ) {
5830	+ s.cache = false;
5831	+ }
5832	+
5833	+ if ( s.cache === false && noContent ) {
5834	+ var ts = jQuery.now();
5835	+
5836	+ // try replacing _= if it is there
5837	+ var ret = s.url.replace(rts, "$1_=" + ts);
5838	+
5839	+ // if nothing was replaced, add timestamp to the end
5840	+ s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : "");
5841	+ }
5842	+
5843	+ // If data is available, append data to url for GET/HEAD requests
5844	+ if ( s.data && noContent ) {
5845	+ s.url += (rquery.test(s.url) ? "&" : "?") + s.data;
5846	+ }
5847	+
5848	+ // Watch for a new set of requests
5849	+ if ( s.global && jQuery.active++ === 0 ) {
5850	+ jQuery.event.trigger( "ajaxStart" );
5851	+ }
5852	+
5853	+ // Matches an absolute URL, and saves the domain
5854	+ var parts = rurl.exec( s.url ),
5855	+ remote = parts && (parts[1] && parts[1].toLowerCase() !== location.protocol \|\| parts[2].toLowerCase() !== location.host);
5856	+
5857	+ // If we're requesting a remote document
5858	+ // and trying to load JSON or Script with a GET
5859	+ if ( s.dataType === "script" && type === "GET" && remote ) {
5860	+ var head = document.getElementsByTagName("head")[0] \|\| document.documentElement;
5861	+ var script = document.createElement("script");
5862	+ if ( s.scriptCharset ) {
5863	+ script.charset = s.scriptCharset;
5864	+ }
5865	+ script.src = s.url;
5866	+
5867	+ // Handle Script loading
5868	+ if ( !jsonp ) {
5869	+ var done = false;
5870	+
5871	+ // Attach handlers for all browsers
5872	+ script.onload = script.onreadystatechange = function() {
5873	+ if ( !done && (!this.readyState \|\|
5874	+ this.readyState === "loaded" \|\| this.readyState === "complete") ) {
5875	+ done = true;
5876	+ jQuery.handleSuccess( s, xhr, status, data );
5877	+ jQuery.handleComplete( s, xhr, status, data );
5878	+
5879	+ // Handle memory leak in IE
5880	+ script.onload = script.onreadystatechange = null;
5881	+ if ( head && script.parentNode ) {
5882	+ head.removeChild( script );
5883	+ }
5884	+ }
5885	+ };
5886	+ }
5887	+
5888	+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
5889	+ // This arises when a base node is used (#2709 and #4378).
5890	+ head.insertBefore( script, head.firstChild );
5891	+
5892	+ // We handle everything using the script element injection
5893	+ return undefined;
5894	+ }
5895	+
5896	+ var requestDone = false;
5897	+
5898	+ // Create the request object
5899	+ var xhr = s.xhr();
5900	+
5901	+ if ( !xhr ) {
5902	+ return;
5903	+ }
5904	+
5905	+ // Open the socket
5906	+ // Passing null username, generates a login popup on Opera (#2865)
5907	+ if ( s.username ) {
5908	+ xhr.open(type, s.url, s.async, s.username, s.password);
5909	+ } else {
5910	+ xhr.open(type, s.url, s.async);
5911	+ }
5912	+
5913	+ // Need an extra try/catch for cross domain requests in Firefox 3
5914	+ try {
5915	+ // Set content-type if data specified and content-body is valid for this type
5916	+ if ( (s.data != null && !noContent) \|\| (origSettings && origSettings.contentType) ) {
5917	+ xhr.setRequestHeader("Content-Type", s.contentType);
5918	+ }
5919	+
5920	+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
5921	+ if ( s.ifModified ) {
5922	+ if ( jQuery.lastModified[s.url] ) {
5923	+ xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]);
5924	+ }
5925	+
5926	+ if ( jQuery.etag[s.url] ) {
5927	+ xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]);
5928	+ }
5929	+ }
5930	+
5931	+ // Set header so the called script knows that it's an XMLHttpRequest
5932	+ // Only send the header if it's not a remote XHR
5933	+ if ( !remote ) {
5934	+ xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
5935	+ }
5936	+
5937	+ // Set the Accepts header for the server, depending on the dataType
5938	+ xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
5939	+ s.accepts[ s.dataType ] + ", /; q=0.01" :
5940	+ s.accepts._default );
5941	+ } catch( headerError ) {}
5942	+
5943	+ // Allow custom headers/mimetypes and early abort
5944	+ if ( s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false ) {
5945	+ // Handle the global AJAX counter
5946	+ if ( s.global && jQuery.active-- === 1 ) {
5947	+ jQuery.event.trigger( "ajaxStop" );
5948	+ }
5949	+
5950	+ // close opended socket
5951	+ xhr.abort();
5952	+ return false;
5953	+ }
5954	+
5955	+ if ( s.global ) {
5956	+ jQuery.triggerGlobal( s, "ajaxSend", [xhr, s] );
5957	+ }
5958	+
5959	+ // Wait for a response to come back
5960	+ var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) {
5961	+ // The request was aborted
5962	+ if ( !xhr \|\| xhr.readyState === 0 \|\| isTimeout === "abort" ) {
5963	+ // Opera doesn't call onreadystatechange before this point
5964	+ // so we simulate the call
5965	+ if ( !requestDone ) {
5966	+ jQuery.handleComplete( s, xhr, status, data );
5967	+ }
5968	+
5969	+ requestDone = true;
5970	+ if ( xhr ) {
5971	+ xhr.onreadystatechange = jQuery.noop;
5972	+ }
5973	+
5974	+ // The transfer is complete and the data is available, or the request timed out
5975	+ } else if ( !requestDone && xhr && (xhr.readyState === 4 \|\| isTimeout === "timeout") ) {
5976	+ requestDone = true;
5977	+ xhr.onreadystatechange = jQuery.noop;
5978	+
5979	+ status = isTimeout === "timeout" ?
5980	+ "timeout" :
5981	+ !jQuery.httpSuccess( xhr ) ?
5982	+ "error" :
5983	+ s.ifModified && jQuery.httpNotModified( xhr, s.url ) ?
5984	+ "notmodified" :
5985	+ "success";
5986	+
5987	+ var errMsg;
5988	+
5989	+ if ( status === "success" ) {
5990	+ // Watch for, and catch, XML document parse errors
5991	+ try {
5992	+ // process the data (runs the xml through httpData regardless of callback)
5993	+ data = jQuery.httpData( xhr, s.dataType, s );
5994	+ } catch( parserError ) {
5995	+ status = "parsererror";
5996	+ errMsg = parserError;
5997	+ }
5998	+ }
5999	+
6000	+ // Make sure that the request was successful or notmodified
6001	+ if ( status === "success" \|\| status === "notmodified" ) {
6002	+ // JSONP handles its own success callback
6003	+ if ( !jsonp ) {
6004	+ jQuery.handleSuccess( s, xhr, status, data );
6005	+ }
6006	+ } else {
6007	+ jQuery.handleError( s, xhr, status, errMsg );
6008	+ }
6009	+
6010	+ // Fire the complete handlers
6011	+ if ( !jsonp ) {
6012	+ jQuery.handleComplete( s, xhr, status, data );
6013	+ }
6014	+
6015	+ if ( isTimeout === "timeout" ) {
6016	+ xhr.abort();
6017	+ }
6018	+
6019	+ // Stop memory leaks
6020	+ if ( s.async ) {
6021	+ xhr = null;
6022	+ }
6023	+ }
6024	+ };
6025	+
6026	+ // Override the abort handler, if we can (IE 6 doesn't allow it, but that's OK)
6027	+ // Opera doesn't fire onreadystatechange at all on abort
6028	+ try {
6029	+ var oldAbort = xhr.abort;
6030	+ xhr.abort = function() {
6031	+ if ( xhr ) {
6032	+ // oldAbort has no call property in IE7 so
6033	+ // just do it this way, which works in all
6034	+ // browsers
6035	+ Function.prototype.call.call( oldAbort, xhr );
6036	+ }
6037	+
6038	+ onreadystatechange( "abort" );
6039	+ };
6040	+ } catch( abortError ) {}
6041	+
6042	+ // Timeout checker
6043	+ if ( s.async && s.timeout > 0 ) {
6044	+ setTimeout(function() {
6045	+ // Check to see if the request is still happening
6046	+ if ( xhr && !requestDone ) {
6047	+ onreadystatechange( "timeout" );
6048	+ }
6049	+ }, s.timeout);
6050	+ }
6051	+
6052	+ // Send the data
6053	+ try {
6054	+ xhr.send( noContent \|\| s.data == null ? null : s.data );
6055	+
6056	+ } catch( sendError ) {
6057	+ jQuery.handleError( s, xhr, null, sendError );
6058	+
6059	+ // Fire the complete handlers
6060	+ jQuery.handleComplete( s, xhr, status, data );
6061	+ }
6062	+
6063	+ // firefox 1.5 doesn't fire statechange for sync requests
6064	+ if ( !s.async ) {
6065	+ onreadystatechange();
6066	+ }
6067	+
6068	+ // return XMLHttpRequest to allow aborting the request etc.
6069	+ return xhr;
6070	+ },
6071	+
6072	+ // Serialize an array of form elements or a set of
6073	+ // key/values into a query string
6074	+ param: function( a, traditional ) {
6075	+ var s = [],
6076	+ add = function( key, value ) {
6077	+ // If value is a function, invoke it and return its value
6078	+ value = jQuery.isFunction(value) ? value() : value;
6079	+ s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
6080	+ };
6081	+
6082	+ // Set traditional to true for jQuery <= 1.3.2 behavior.
6083	+ if ( traditional === undefined ) {
6084	+ traditional = jQuery.ajaxSettings.traditional;
6085	+ }
6086	+
6087	+ // If an array was passed in, assume that it is an array of form elements.
6088	+ if ( jQuery.isArray(a) \|\| a.jquery ) {
6089	+ // Serialize the form elements
6090	+ jQuery.each( a, function() {
6091	+ add( this.name, this.value );
6092	+ });
6093	+
6094	+ } else {
6095	+ // If traditional, encode the "old" way (the way 1.3.2 or older
6096	+ // did it), otherwise encode params recursively.
6097	+ for ( var prefix in a ) {
6098	+ buildParams( prefix, a[prefix], traditional, add );
6099	+ }
6100	+ }
6101	+
6102	+ // Return the resulting serialization
6103	+ return s.join("&").replace(r20, "+");
6104	+ }
6105	+ });
6106	+
6107	+ function buildParams( prefix, obj, traditional, add ) {
6108	+ if ( jQuery.isArray(obj) && obj.length ) {
6109	+ // Serialize array item.
6110	+ jQuery.each( obj, function( i, v ) {
6111	+ if ( traditional \|\| rbracket.test( prefix ) ) {
6112	+ // Treat each array item as a scalar.
6113	+ add( prefix, v );
6114	+
6115	+ } else {
6116	+ // If array item is non-scalar (array or object), encode its
6117	+ // numeric index to resolve deserialization ambiguity issues.
6118	+ // Note that rack (as of 1.0.0) can't currently deserialize
6119	+ // nested arrays properly, and attempting to do so may cause
6120	+ // a server error. Possible fixes are to modify rack's
6121	+ // deserialization algorithm or to provide an option or flag
6122	+ // to force array serialization to be shallow.
6123	+ buildParams( prefix + "[" + ( typeof v === "object" \|\| jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
6124	+ }
6125	+ });
6126	+
6127	+ } else if ( !traditional && obj != null && typeof obj === "object" ) {
6128	+ if ( jQuery.isEmptyObject( obj ) ) {
6129	+ add( prefix, "" );
6130	+
6131	+ // Serialize object item.
6132	+ } else {
6133	+ jQuery.each( obj, function( k, v ) {
6134	+ buildParams( prefix + "[" + k + "]", v, traditional, add );
6135	+ });
6136	+ }
6137	+
6138	+ } else {
6139	+ // Serialize scalar item.
6140	+ add( prefix, obj );
6141	+ }
6142	+ }
6143	+
6144	+ // This is still on the jQuery object... for now
6145	+ // Want to move this to jQuery.ajax some day
6146	+ jQuery.extend({
6147	+
6148	+ // Counter for holding the number of active queries
6149	+ active: 0,
6150	+
6151	+ // Last-Modified header cache for next request
6152	+ lastModified: {},
6153	+ etag: {},
6154	+
6155	+ handleError: function( s, xhr, status, e ) {
6156	+ // If a local callback was specified, fire it
6157	+ if ( s.error ) {
6158	+ s.error.call( s.context, xhr, status, e );
6159	+ }
6160	+
6161	+ // Fire the global callback
6162	+ if ( s.global ) {
6163	+ jQuery.triggerGlobal( s, "ajaxError", [xhr, s, e] );
6164	+ }
6165	+ },
6166	+
6167	+ handleSuccess: function( s, xhr, status, data ) {
6168	+ // If a local callback was specified, fire it and pass it the data
6169	+ if ( s.success ) {
6170	+ s.success.call( s.context, data, status, xhr );
6171	+ }
6172	+
6173	+ // Fire the global callback
6174	+ if ( s.global ) {
6175	+ jQuery.triggerGlobal( s, "ajaxSuccess", [xhr, s] );
6176	+ }
6177	+ },
6178	+
6179	+ handleComplete: function( s, xhr, status ) {
6180	+ // Process result
6181	+ if ( s.complete ) {
6182	+ s.complete.call( s.context, xhr, status );
6183	+ }
6184	+
6185	+ // The request was completed
6186	+ if ( s.global ) {
6187	+ jQuery.triggerGlobal( s, "ajaxComplete", [xhr, s] );
6188	+ }
6189	+
6190	+ // Handle the global AJAX counter
6191	+ if ( s.global && jQuery.active-- === 1 ) {
6192	+ jQuery.event.trigger( "ajaxStop" );
6193	+ }
6194	+ },
6195	+
6196	+ triggerGlobal: function( s, type, args ) {
6197	+ (s.context && s.context.url == null ? jQuery(s.context) : jQuery.event).trigger(type, args);
6198	+ },
6199	+
6200	+ // Determines if an XMLHttpRequest was successful or not
6201	+ httpSuccess: function( xhr ) {
6202	+ try {
6203	+ // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
6204	+ return !xhr.status && location.protocol === "file:" \|\|
6205	+ xhr.status >= 200 && xhr.status < 300 \|\|
6206	+ xhr.status === 304 \|\| xhr.status === 1223;
6207	+ } catch(e) {}
6208	+
6209	+ return false;
6210	+ },
6211	+
6212	+ // Determines if an XMLHttpRequest returns NotModified
6213	+ httpNotModified: function( xhr, url ) {
6214	+ var lastModified = xhr.getResponseHeader("Last-Modified"),
6215	+ etag = xhr.getResponseHeader("Etag");
6216	+
6217	+ if ( lastModified ) {
6218	+ jQuery.lastModified[url] = lastModified;
6219	+ }
6220	+
6221	+ if ( etag ) {
6222	+ jQuery.etag[url] = etag;
6223	+ }
6224	+
6225	+ return xhr.status === 304;
6226	+ },
6227	+
6228	+ httpData: function( xhr, type, s ) {
6229	+ var ct = xhr.getResponseHeader("content-type") \|\| "",
6230	+ xml = type === "xml" \|\| !type && ct.indexOf("xml") >= 0,
6231	+ data = xml ? xhr.responseXML : xhr.responseText;
6232	+
6233	+ if ( xml && data.documentElement.nodeName === "parsererror" ) {
6234	+ jQuery.error( "parsererror" );
6235	+ }
6236	+
6237	+ // Allow a pre-filtering function to sanitize the response
6238	+ // s is checked to keep backwards compatibility
6239	+ if ( s && s.dataFilter ) {
6240	+ data = s.dataFilter( data, type );
6241	+ }
6242	+
6243	+ // The filter can actually parse the response
6244	+ if ( typeof data === "string" ) {
6245	+ // Get the JavaScript object, if JSON is used.
6246	+ if ( type === "json" \|\| !type && ct.indexOf("json") >= 0 ) {
6247	+ data = jQuery.parseJSON( data );
6248	+
6249	+ // If the type is "script", eval it in global context
6250	+ } else if ( type === "script" \|\| !type && ct.indexOf("javascript") >= 0 ) {
6251	+ jQuery.globalEval( data );
6252	+ }
6253	+ }
6254	+
6255	+ return data;
6256	+ }
6257	+
6258	+ });
6259	+
6260	+ /*
6261	+ * Create the request object; Microsoft failed to properly
6262	+ * implement the XMLHttpRequest in IE7 (can't request local files),
6263	+ * so we use the ActiveXObject when it is available
6264	+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
6265	+ * we need a fallback.
6266	+ */
6267	+ if ( window.ActiveXObject ) {
6268	+ jQuery.ajaxSettings.xhr = function() {
6269	+ if ( window.location.protocol !== "file:" ) {
6270	+ try {
6271	+ return new window.XMLHttpRequest();
6272	+ } catch(xhrError) {}
6273	+ }
6274	+
6275	+ try {
6276	+ return new window.ActiveXObject("Microsoft.XMLHTTP");
6277	+ } catch(activeError) {}
6278	+ };
6279	+ }
6280	+
6281	+ // Does this browser support XHR requests?
6282	+ jQuery.support.ajax = !!jQuery.ajaxSettings.xhr();
6283	+
6284	+
6285	+
6286	+
6287	+ var elemdisplay = {},
6288	+ rfxtypes = /^(?:toggle\|show\|hide)$/,
6289	+ rfxnum = /^([+\-]=)?([\d+.\-]+)(.*)$/,
6290	+ timerId,
6291	+ fxAttrs = [
6292	+ // height animations
6293	+ [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
6294	+ // width animations
6295	+ [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
6296	+ // opacity animations
6297	+ [ "opacity" ]
6298	+ ];
6299	+
6300	+ jQuery.fn.extend({
6301	+ show: function( speed, easing, callback ) {
6302	+ var elem, display;
6303	+
6304	+ if ( speed \|\| speed === 0 ) {
6305	+ return this.animate( genFx("show", 3), speed, easing, callback);
6306	+
6307	+ } else {
6308	+ for ( var i = 0, j = this.length; i < j; i++ ) {
6309	+ elem = this[i];
6310	+ display = elem.style.display;
6311	+
6312	+ // Reset the inline display of this element to learn if it is
6313	+ // being hidden by cascaded rules or not
6314	+ if ( !jQuery.data(elem, "olddisplay") && display === "none" ) {
6315	+ display = elem.style.display = "";
6316	+ }
6317	+
6318	+ // Set elements which have been overridden with display: none
6319	+ // in a stylesheet to whatever the default browser style is
6320	+ // for such an element
6321	+ if ( display === "" && jQuery.css( elem, "display" ) === "none" ) {
6322	+ jQuery.data(elem, "olddisplay", defaultDisplay(elem.nodeName));
6323	+ }
6324	+ }
6325	+
6326	+ // Set the display of most of the elements in a second loop
6327	+ // to avoid the constant reflow
6328	+ for ( i = 0; i < j; i++ ) {
6329	+ elem = this[i];
6330	+ display = elem.style.display;
6331	+
6332	+ if ( display === "" \|\| display === "none" ) {
6333	+ elem.style.display = jQuery.data(elem, "olddisplay") \|\| "";
6334	+ }
6335	+ }
6336	+
6337	+ return this;
6338	+ }
6339	+ },
6340	+
6341	+ hide: function( speed, easing, callback ) {
6342	+ if ( speed \|\| speed === 0 ) {
6343	+ return this.animate( genFx("hide", 3), speed, easing, callback);
6344	+
6345	+ } else {
6346	+ for ( var i = 0, j = this.length; i < j; i++ ) {
6347	+ var display = jQuery.css( this[i], "display" );
6348	+
6349	+ if ( display !== "none" ) {
6350	+ jQuery.data( this[i], "olddisplay", display );
6351	+ }
6352	+ }
6353	+
6354	+ // Set the display of the elements in a second loop
6355	+ // to avoid the constant reflow
6356	+ for ( i = 0; i < j; i++ ) {
6357	+ this[i].style.display = "none";
6358	+ }
6359	+
6360	+ return this;
6361	+ }
6362	+ },
6363	+
6364	+ // Save the old toggle function
6365	+ _toggle: jQuery.fn.toggle,
6366	+
6367	+ toggle: function( fn, fn2, callback ) {
6368	+ var bool = typeof fn === "boolean";
6369	+
6370	+ if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
6371	+ this._toggle.apply( this, arguments );
6372	+
6373	+ } else if ( fn == null \|\| bool ) {
6374	+ this.each(function() {
6375	+ var state = bool ? fn : jQuery(this).is(":hidden");
6376	+ jQuery(this)[ state ? "show" : "hide" ]();
6377	+ });
6378	+
6379	+ } else {
6380	+ this.animate(genFx("toggle", 3), fn, fn2, callback);
6381	+ }
6382	+
6383	+ return this;
6384	+ },
6385	+
6386	+ fadeTo: function( speed, to, easing, callback ) {
6387	+ return this.filter(":hidden").css("opacity", 0).show().end()
6388	+ .animate({opacity: to}, speed, easing, callback);
6389	+ },
6390	+
6391	+ animate: function( prop, speed, easing, callback ) {
6392	+ var optall = jQuery.speed(speed, easing, callback);
6393	+
6394	+ if ( jQuery.isEmptyObject( prop ) ) {
6395	+ return this.each( optall.complete );
6396	+ }
6397	+
6398	+ return this[ optall.queue === false ? "each" : "queue" ](function() {
6399	+ // XXX 'this' does not always have a nodeName when running the
6400	+ // test suite
6401	+
6402	+ var opt = jQuery.extend({}, optall), p,
6403	+ isElement = this.nodeType === 1,
6404	+ hidden = isElement && jQuery(this).is(":hidden"),
6405	+ self = this;
6406	+
6407	+ for ( p in prop ) {
6408	+ var name = jQuery.camelCase( p );
6409	+
6410	+ if ( p !== name ) {
6411	+ prop[ name ] = prop[ p ];
6412	+ delete prop[ p ];
6413	+ p = name;
6414	+ }
6415	+
6416	+ if ( prop[p] === "hide" && hidden \|\| prop[p] === "show" && !hidden ) {
6417	+ return opt.complete.call(this);
6418	+ }
6419	+
6420	+ if ( isElement && ( p === "height" \|\| p === "width" ) ) {
6421	+ // Make sure that nothing sneaks out
6422	+ // Record all 3 overflow attributes because IE does not
6423	+ // change the overflow attribute when overflowX and
6424	+ // overflowY are set to the same value
6425	+ opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
6426	+
6427	+ // Set display property to inline-block for height/width
6428	+ // animations on inline elements that are having width/height
6429	+ // animated
6430	+ if ( jQuery.css( this, "display" ) === "inline" &&
6431	+ jQuery.css( this, "float" ) === "none" ) {
6432	+ if ( !jQuery.support.inlineBlockNeedsLayout ) {
6433	+ this.style.display = "inline-block";
6434	+
6435	+ } else {
6436	+ var display = defaultDisplay(this.nodeName);
6437	+
6438	+ // inline-level elements accept inline-block;
6439	+ // block-level elements need to be inline with layout
6440	+ if ( display === "inline" ) {
6441	+ this.style.display = "inline-block";
6442	+
6443	+ } else {
6444	+ this.style.display = "inline";
6445	+ this.style.zoom = 1;
6446	+ }
6447	+ }
6448	+ }
6449	+ }
6450	+
6451	+ if ( jQuery.isArray( prop[p] ) ) {
6452	+ // Create (if needed) and add to specialEasing
6453	+ (opt.specialEasing = opt.specialEasing \|\| {})[p] = prop[p][1];
6454	+ prop[p] = prop[p][0];
6455	+ }
6456	+ }
6457	+
6458	+ if ( opt.overflow != null ) {
6459	+ this.style.overflow = "hidden";
6460	+ }
6461	+
6462	+ opt.curAnim = jQuery.extend({}, prop);
6463	+
6464	+ jQuery.each( prop, function( name, val ) {
6465	+ var e = new jQuery.fx( self, opt, name );
6466	+
6467	+ if ( rfxtypes.test(val) ) {
6468	+ e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
6469	+
6470	+ } else {
6471	+ var parts = rfxnum.exec(val),
6472	+ start = e.cur() \|\| 0;
6473	+
6474	+ if ( parts ) {
6475	+ var end = parseFloat( parts[2] ),
6476	+ unit = parts[3] \|\| "px";
6477	+
6478	+ // We need to compute starting value
6479	+ if ( unit !== "px" ) {
6480	+ jQuery.style( self, name, (end \|\| 1) + unit);
6481	+ start = ((end \|\| 1) / e.cur()) * start;
6482	+ jQuery.style( self, name, start + unit);
6483	+ }
6484	+
6485	+ // If a +=/-= token was provided, we're doing a relative animation
6486	+ if ( parts[1] ) {
6487	+ end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
6488	+ }
6489	+
6490	+ e.custom( start, end, unit );
6491	+
6492	+ } else {
6493	+ e.custom( start, val, "" );
6494	+ }
6495	+ }
6496	+ });
6497	+
6498	+ // For JS strict compliance
6499	+ return true;
6500	+ });
6501	+ },
6502	+
6503	+ stop: function( clearQueue, gotoEnd ) {
6504	+ var timers = jQuery.timers;
6505	+
6506	+ if ( clearQueue ) {
6507	+ this.queue([]);
6508	+ }
6509	+
6510	+ this.each(function() {
6511	+ // go in reverse order so anything added to the queue during the loop is ignored
6512	+ for ( var i = timers.length - 1; i >= 0; i-- ) {
6513	+ if ( timers[i].elem === this ) {
6514	+ if (gotoEnd) {
6515	+ // force the next step to be the last
6516	+ timers[i](true);
6517	+ }
6518	+
6519	+ timers.splice(i, 1);
6520	+ }
6521	+ }
6522	+ });
6523	+
6524	+ // start the next in the queue if the last step wasn't forced
6525	+ if ( !gotoEnd ) {
6526	+ this.dequeue();
6527	+ }
6528	+
6529	+ return this;
6530	+ }
6531	+
6532	+ });
6533	+
6534	+ function genFx( type, num ) {
6535	+ var obj = {};
6536	+
6537	+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
6538	+ obj[ this ] = type;
6539	+ });
6540	+
6541	+ return obj;
6542	+ }
6543	+
6544	+ // Generate shortcuts for custom animations
6545	+ jQuery.each({
6546	+ slideDown: genFx("show", 1),
6547	+ slideUp: genFx("hide", 1),
6548	+ slideToggle: genFx("toggle", 1),
6549	+ fadeIn: { opacity: "show" },
6550	+ fadeOut: { opacity: "hide" },
6551	+ fadeToggle: { opacity: "toggle" }
6552	+ }, function( name, props ) {
6553	+ jQuery.fn[ name ] = function( speed, easing, callback ) {
6554	+ return this.animate( props, speed, easing, callback );
6555	+ };
6556	+ });
6557	+
6558	+ jQuery.extend({
6559	+ speed: function( speed, easing, fn ) {
6560	+ var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
6561	+ complete: fn \|\| !fn && easing \|\|
6562	+ jQuery.isFunction( speed ) && speed,
6563	+ duration: speed,
6564	+ easing: fn && easing \|\| easing && !jQuery.isFunction(easing) && easing
6565	+ };
6566	+
6567	+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
6568	+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
6569	+
6570	+ // Queueing
6571	+ opt.old = opt.complete;
6572	+ opt.complete = function() {
6573	+ if ( opt.queue !== false ) {
6574	+ jQuery(this).dequeue();
6575	+ }
6576	+ if ( jQuery.isFunction( opt.old ) ) {
6577	+ opt.old.call( this );
6578	+ }
6579	+ };
6580	+
6581	+ return opt;
6582	+ },
6583	+
6584	+ easing: {
6585	+ linear: function( p, n, firstNum, diff ) {
6586	+ return firstNum + diff * p;
6587	+ },
6588	+ swing: function( p, n, firstNum, diff ) {
6589	+ return ((-Math.cos(pMath.PI)/2) + 0.5) diff + firstNum;
6590	+ }
6591	+ },
6592	+
6593	+ timers: [],
6594	+
6595	+ fx: function( elem, options, prop ) {
6596	+ this.options = options;
6597	+ this.elem = elem;
6598	+ this.prop = prop;
6599	+
6600	+ if ( !options.orig ) {
6601	+ options.orig = {};
6602	+ }
6603	+ }
6604	+
6605	+ });
6606	+
6607	+ jQuery.fx.prototype = {
6608	+ // Simple function for setting a style value
6609	+ update: function() {
6610	+ if ( this.options.step ) {
6611	+ this.options.step.call( this.elem, this.now, this );
6612	+ }
6613	+
6614	+ (jQuery.fx.step[this.prop] \|\| jQuery.fx.step._default)( this );
6615	+ },
6616	+
6617	+ // Get the current size
6618	+ cur: function() {
6619	+ if ( this.elem[this.prop] != null && (!this.elem.style \|\| this.elem.style[this.prop] == null) ) {
6620	+ return this.elem[ this.prop ];
6621	+ }
6622	+
6623	+ var r = parseFloat( jQuery.css( this.elem, this.prop ) );
6624	+ return r && r > -10000 ? r : 0;
6625	+ },
6626	+
6627	+ // Start an animation from one number to another
6628	+ custom: function( from, to, unit ) {
6629	+ var self = this,
6630	+ fx = jQuery.fx;
6631	+
6632	+ this.startTime = jQuery.now();
6633	+ this.start = from;
6634	+ this.end = to;
6635	+ this.unit = unit \|\| this.unit \|\| "px";
6636	+ this.now = this.start;
6637	+ this.pos = this.state = 0;
6638	+
6639	+ function t( gotoEnd ) {
6640	+ return self.step(gotoEnd);
6641	+ }
6642	+
6643	+ t.elem = this.elem;
6644	+
6645	+ if ( t() && jQuery.timers.push(t) && !timerId ) {
6646	+ timerId = setInterval(fx.tick, fx.interval);
6647	+ }
6648	+ },
6649	+
6650	+ // Simple 'show' function
6651	+ show: function() {
6652	+ // Remember where we started, so that we can go back to it later
6653	+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
6654	+ this.options.show = true;
6655	+
6656	+ // Begin the animation
6657	+ // Make sure that we start at a small width/height to avoid any
6658	+ // flash of content
6659	+ this.custom(this.prop === "width" \|\| this.prop === "height" ? 1 : 0, this.cur());
6660	+
6661	+ // Start by showing the element
6662	+ jQuery( this.elem ).show();
6663	+ },
6664	+
6665	+ // Simple 'hide' function
6666	+ hide: function() {
6667	+ // Remember where we started, so that we can go back to it later
6668	+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
6669	+ this.options.hide = true;
6670	+
6671	+ // Begin the animation
6672	+ this.custom(this.cur(), 0);
6673	+ },
6674	+
6675	+ // Each step of an animation
6676	+ step: function( gotoEnd ) {
6677	+ var t = jQuery.now(), done = true;
6678	+
6679	+ if ( gotoEnd \|\| t >= this.options.duration + this.startTime ) {
6680	+ this.now = this.end;
6681	+ this.pos = this.state = 1;
6682	+ this.update();
6683	+
6684	+ this.options.curAnim[ this.prop ] = true;
6685	+
6686	+ for ( var i in this.options.curAnim ) {
6687	+ if ( this.options.curAnim[i] !== true ) {
6688	+ done = false;
6689	+ }
6690	+ }
6691	+
6692	+ if ( done ) {
6693	+ // Reset the overflow
6694	+ if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
6695	+ var elem = this.elem,
6696	+ options = this.options;
6697	+
6698	+ jQuery.each( [ "", "X", "Y" ], function (index, value) {
6699	+ elem.style[ "overflow" + value ] = options.overflow[index];
6700	+ } );
6701	+ }
6702	+
6703	+ // Hide the element if the "hide" operation was done
6704	+ if ( this.options.hide ) {
6705	+ jQuery(this.elem).hide();
6706	+ }
6707	+
6708	+ // Reset the properties, if the item has been hidden or shown
6709	+ if ( this.options.hide \|\| this.options.show ) {
6710	+ for ( var p in this.options.curAnim ) {
6711	+ jQuery.style( this.elem, p, this.options.orig[p] );
6712	+ }
6713	+ }
6714	+
6715	+ // Execute the complete function
6716	+ this.options.complete.call( this.elem );
6717	+ }
6718	+
6719	+ return false;
6720	+
6721	+ } else {
6722	+ var n = t - this.startTime;
6723	+ this.state = n / this.options.duration;
6724	+
6725	+ // Perform the easing function, defaults to swing
6726	+ var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
6727	+ var defaultEasing = this.options.easing \|\| (jQuery.easing.swing ? "swing" : "linear");
6728	+ this.pos = jQuery.easing[specialEasing \|\| defaultEasing](this.state, n, 0, 1, this.options.duration);
6729	+ this.now = this.start + ((this.end - this.start) * this.pos);
6730	+
6731	+ // Perform the next step of the animation
6732	+ this.update();
6733	+ }
6734	+
6735	+ return true;
6736	+ }
6737	+ };
6738	+
6739	+ jQuery.extend( jQuery.fx, {
6740	+ tick: function() {
6741	+ var timers = jQuery.timers;
6742	+
6743	+ for ( var i = 0; i < timers.length; i++ ) {
6744	+ if ( !timers[i]() ) {
6745	+ timers.splice(i--, 1);
6746	+ }
6747	+ }
6748	+
6749	+ if ( !timers.length ) {
6750	+ jQuery.fx.stop();
6751	+ }
6752	+ },
6753	+
6754	+ interval: 13,
6755	+
6756	+ stop: function() {
6757	+ clearInterval( timerId );
6758	+ timerId = null;
6759	+ },
6760	+
6761	+ speeds: {
6762	+ slow: 600,
6763	+ fast: 200,
6764	+ // Default speed
6765	+ _default: 400
6766	+ },
6767	+
6768	+ step: {
6769	+ opacity: function( fx ) {
6770	+ jQuery.style( fx.elem, "opacity", fx.now );
6771	+ },
6772	+
6773	+ _default: function( fx ) {
6774	+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
6775	+ fx.elem.style[ fx.prop ] = (fx.prop === "width" \|\| fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
6776	+ } else {
6777	+ fx.elem[ fx.prop ] = fx.now;
6778	+ }
6779	+ }
6780	+ }
6781	+ });
6782	+
6783	+ if ( jQuery.expr && jQuery.expr.filters ) {
6784	+ jQuery.expr.filters.animated = function( elem ) {
6785	+ return jQuery.grep(jQuery.timers, function( fn ) {
6786	+ return elem === fn.elem;
6787	+ }).length;
6788	+ };
6789	+ }
6790	+
6791	+ function defaultDisplay( nodeName ) {
6792	+ if ( !elemdisplay[ nodeName ] ) {
6793	+ var elem = jQuery("<" + nodeName + ">").appendTo("body"),
6794	+ display = elem.css("display");
6795	+
6796	+ elem.remove();
6797	+
6798	+ if ( display === "none" \|\| display === "" ) {
6799	+ display = "block";
6800	+ }
6801	+
6802	+ elemdisplay[ nodeName ] = display;
6803	+ }
6804	+
6805	+ return elemdisplay[ nodeName ];
6806	+ }
6807	+
6808	+
6809	+
6810	+
6811	+ var rtable = /^t(?:able\|d\|h)$/i,
6812	+ rroot = /^(?:body\|html)$/i;
6813	+
6814	+ if ( "getBoundingClientRect" in document.documentElement ) {
6815	+ jQuery.fn.offset = function( options ) {
6816	+ var elem = this[0], box;
6817	+
6818	+ if ( options ) {
6819	+ return this.each(function( i ) {
6820	+ jQuery.offset.setOffset( this, options, i );
6821	+ });
6822	+ }
6823	+
6824	+ if ( !elem \|\| !elem.ownerDocument ) {
6825	+ return null;
6826	+ }
6827	+
6828	+ if ( elem === elem.ownerDocument.body ) {
6829	+ return jQuery.offset.bodyOffset( elem );
6830	+ }
6831	+
6832	+ try {
6833	+ box = elem.getBoundingClientRect();
6834	+ } catch(e) {}
6835	+
6836	+ var doc = elem.ownerDocument,
6837	+ docElem = doc.documentElement;
6838	+
6839	+ // Make sure we're not dealing with a disconnected DOM node
6840	+ if ( !box \|\| !jQuery.contains( docElem, elem ) ) {
6841	+ return box \|\| { top: 0, left: 0 };
6842	+ }
6843	+
6844	+ var body = doc.body,
6845	+ win = getWindow(doc),
6846	+ clientTop = docElem.clientTop \|\| body.clientTop \|\| 0,
6847	+ clientLeft = docElem.clientLeft \|\| body.clientLeft \|\| 0,
6848	+ scrollTop = (win.pageYOffset \|\| jQuery.support.boxModel && docElem.scrollTop \|\| body.scrollTop ),
6849	+ scrollLeft = (win.pageXOffset \|\| jQuery.support.boxModel && docElem.scrollLeft \|\| body.scrollLeft),
6850	+ top = box.top + scrollTop - clientTop,
6851	+ left = box.left + scrollLeft - clientLeft;
6852	+
6853	+ return { top: top, left: left };
6854	+ };
6855	+
6856	+ } else {
6857	+ jQuery.fn.offset = function( options ) {
6858	+ var elem = this[0];
6859	+
6860	+ if ( options ) {
6861	+ return this.each(function( i ) {
6862	+ jQuery.offset.setOffset( this, options, i );
6863	+ });
6864	+ }
6865	+
6866	+ if ( !elem \|\| !elem.ownerDocument ) {
6867	+ return null;
6868	+ }
6869	+
6870	+ if ( elem === elem.ownerDocument.body ) {
6871	+ return jQuery.offset.bodyOffset( elem );
6872	+ }
6873	+
6874	+ jQuery.offset.initialize();
6875	+
6876	+ var computedStyle,
6877	+ offsetParent = elem.offsetParent,
6878	+ prevOffsetParent = elem,
6879	+ doc = elem.ownerDocument,
6880	+ docElem = doc.documentElement,
6881	+ body = doc.body,
6882	+ defaultView = doc.defaultView,
6883	+ prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
6884	+ top = elem.offsetTop,
6885	+ left = elem.offsetLeft;
6886	+
6887	+ while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
6888	+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
6889	+ break;
6890	+ }
6891	+
6892	+ computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
6893	+ top -= elem.scrollTop;
6894	+ left -= elem.scrollLeft;
6895	+
6896	+ if ( elem === offsetParent ) {
6897	+ top += elem.offsetTop;
6898	+ left += elem.offsetLeft;
6899	+
6900	+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
6901	+ top += parseFloat( computedStyle.borderTopWidth ) \|\| 0;
6902	+ left += parseFloat( computedStyle.borderLeftWidth ) \|\| 0;
6903	+ }
6904	+
6905	+ prevOffsetParent = offsetParent;
6906	+ offsetParent = elem.offsetParent;
6907	+ }
6908	+
6909	+ if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
6910	+ top += parseFloat( computedStyle.borderTopWidth ) \|\| 0;
6911	+ left += parseFloat( computedStyle.borderLeftWidth ) \|\| 0;
6912	+ }
6913	+
6914	+ prevComputedStyle = computedStyle;
6915	+ }
6916	+
6917	+ if ( prevComputedStyle.position === "relative" \|\| prevComputedStyle.position === "static" ) {
6918	+ top += body.offsetTop;
6919	+ left += body.offsetLeft;
6920	+ }
6921	+
6922	+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
6923	+ top += Math.max( docElem.scrollTop, body.scrollTop );
6924	+ left += Math.max( docElem.scrollLeft, body.scrollLeft );
6925	+ }
6926	+
6927	+ return { top: top, left: left };
6928	+ };
6929	+ }
6930	+
6931	+ jQuery.offset = {
6932	+ initialize: function() {
6933	+ var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) \|\| 0,
6934	+ html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
6935	+
6936	+ jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
6937	+
6938	+ container.innerHTML = html;
6939	+ body.insertBefore( container, body.firstChild );
6940	+ innerDiv = container.firstChild;
6941	+ checkDiv = innerDiv.firstChild;
6942	+ td = innerDiv.nextSibling.firstChild.firstChild;
6943	+
6944	+ this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
6945	+ this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
6946	+
6947	+ checkDiv.style.position = "fixed";
6948	+ checkDiv.style.top = "20px";
6949	+
6950	+ // safari subtracts parent border width here which is 5px
6951	+ this.supportsFixedPosition = (checkDiv.offsetTop === 20 \|\| checkDiv.offsetTop === 15);
6952	+ checkDiv.style.position = checkDiv.style.top = "";
6953	+
6954	+ innerDiv.style.overflow = "hidden";
6955	+ innerDiv.style.position = "relative";
6956	+
6957	+ this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
6958	+
6959	+ this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
6960	+
6961	+ body.removeChild( container );
6962	+ body = container = innerDiv = checkDiv = table = td = null;
6963	+ jQuery.offset.initialize = jQuery.noop;
6964	+ },
6965	+
6966	+ bodyOffset: function( body ) {
6967	+ var top = body.offsetTop,
6968	+ left = body.offsetLeft;
6969	+
6970	+ jQuery.offset.initialize();
6971	+
6972	+ if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
6973	+ top += parseFloat( jQuery.css(body, "marginTop") ) \|\| 0;
6974	+ left += parseFloat( jQuery.css(body, "marginLeft") ) \|\| 0;
6975	+ }
6976	+
6977	+ return { top: top, left: left };
6978	+ },
6979	+
6980	+ setOffset: function( elem, options, i ) {
6981	+ var position = jQuery.css( elem, "position" );
6982	+
6983	+ // set position first, in-case top/left are set even on static elem
6984	+ if ( position === "static" ) {
6985	+ elem.style.position = "relative";
6986	+ }
6987	+
6988	+ var curElem = jQuery( elem ),
6989	+ curOffset = curElem.offset(),
6990	+ curCSSTop = jQuery.css( elem, "top" ),
6991	+ curCSSLeft = jQuery.css( elem, "left" ),
6992	+ calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1),
6993	+ props = {}, curPosition = {}, curTop, curLeft;
6994	+
6995	+ // need to be able to calculate position if either top or left is auto and position is absolute
6996	+ if ( calculatePosition ) {
6997	+ curPosition = curElem.position();
6998	+ }
6999	+
7000	+ curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) \|\| 0;
7001	+ curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) \|\| 0;
7002	+
7003	+ if ( jQuery.isFunction( options ) ) {
7004	+ options = options.call( elem, i, curOffset );
7005	+ }
7006	+
7007	+ if (options.top != null) {
7008	+ props.top = (options.top - curOffset.top) + curTop;
7009	+ }
7010	+ if (options.left != null) {
7011	+ props.left = (options.left - curOffset.left) + curLeft;
7012	+ }
7013	+
7014	+ if ( "using" in options ) {
7015	+ options.using.call( elem, props );
7016	+ } else {
7017	+ curElem.css( props );
7018	+ }
7019	+ }
7020	+ };
7021	+
7022	+
7023	+ jQuery.fn.extend({
7024	+ position: function() {
7025	+ if ( !this[0] ) {
7026	+ return null;
7027	+ }
7028	+
7029	+ var elem = this[0],
7030	+
7031	+ // Get real offsetParent
7032	+ offsetParent = this.offsetParent(),
7033	+
7034	+ // Get correct offsets
7035	+ offset = this.offset(),
7036	+ parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
7037	+
7038	+ // Subtract element margins
7039	+ // note: when an element has margin: auto the offsetLeft and marginLeft
7040	+ // are the same in Safari causing offset.left to incorrectly be 0
7041	+ offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) \|\| 0;
7042	+ offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) \|\| 0;
7043	+
7044	+ // Add offsetParent borders
7045	+ parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) \|\| 0;
7046	+ parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) \|\| 0;
7047	+
7048	+ // Subtract the two offsets
7049	+ return {
7050	+ top: offset.top - parentOffset.top,
7051	+ left: offset.left - parentOffset.left
7052	+ };
7053	+ },
7054	+
7055	+ offsetParent: function() {
7056	+ return this.map(function() {
7057	+ var offsetParent = this.offsetParent \|\| document.body;
7058	+ while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
7059	+ offsetParent = offsetParent.offsetParent;
7060	+ }
7061	+ return offsetParent;
7062	+ });
7063	+ }
7064	+ });
7065	+
7066	+
7067	+ // Create scrollLeft and scrollTop methods
7068	+ jQuery.each( ["Left", "Top"], function( i, name ) {
7069	+ var method = "scroll" + name;
7070	+
7071	+ jQuery.fn[ method ] = function(val) {
7072	+ var elem = this[0], win;
7073	+
7074	+ if ( !elem ) {
7075	+ return null;
7076	+ }
7077	+
7078	+ if ( val !== undefined ) {
7079	+ // Set the scroll offset
7080	+ return this.each(function() {
7081	+ win = getWindow( this );
7082	+
7083	+ if ( win ) {
7084	+ win.scrollTo(
7085	+ !i ? val : jQuery(win).scrollLeft(),
7086	+ i ? val : jQuery(win).scrollTop()
7087	+ );
7088	+
7089	+ } else {
7090	+ this[ method ] = val;
7091	+ }
7092	+ });
7093	+ } else {
7094	+ win = getWindow( elem );
7095	+
7096	+ // Return the scroll offset
7097	+ return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
7098	+ jQuery.support.boxModel && win.document.documentElement[ method ] \|\|
7099	+ win.document.body[ method ] :
7100	+ elem[ method ];
7101	+ }
7102	+ };
7103	+ });
7104	+
7105	+ function getWindow( elem ) {
7106	+ return jQuery.isWindow( elem ) ?
7107	+ elem :
7108	+ elem.nodeType === 9 ?
7109	+ elem.defaultView \|\| elem.parentWindow :
7110	+ false;
7111	+ }
7112	+
7113	+
7114	+
7115	+
7116	+ // Create innerHeight, innerWidth, outerHeight and outerWidth methods
7117	+ jQuery.each([ "Height", "Width" ], function( i, name ) {
7118	+
7119	+ var type = name.toLowerCase();
7120	+
7121	+ // innerHeight and innerWidth
7122	+ jQuery.fn["inner" + name] = function() {
7123	+ return this[0] ?
7124	+ parseFloat( jQuery.css( this[0], type, "padding" ) ) :
7125	+ null;
7126	+ };
7127	+
7128	+ // outerHeight and outerWidth
7129	+ jQuery.fn["outer" + name] = function( margin ) {
7130	+ return this[0] ?
7131	+ parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) :
7132	+ null;
7133	+ };
7134	+
7135	+ jQuery.fn[ type ] = function( size ) {
7136	+ // Get window width or height
7137	+ var elem = this[0];
7138	+ if ( !elem ) {
7139	+ return size == null ? null : this;
7140	+ }
7141	+
7142	+ if ( jQuery.isFunction( size ) ) {
7143	+ return this.each(function( i ) {
7144	+ var self = jQuery( this );
7145	+ self[ type ]( size.call( this, i, self[ type ]() ) );
7146	+ });
7147	+ }
7148	+
7149	+ if ( jQuery.isWindow( elem ) ) {
7150	+ // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
7151	+ return elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] \|\|
7152	+ elem.document.body[ "client" + name ];
7153	+
7154	+ // Get document width or height
7155	+ } else if ( elem.nodeType === 9 ) {
7156	+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
7157	+ return Math.max(
7158	+ elem.documentElement["client" + name],
7159	+ elem.body["scroll" + name], elem.documentElement["scroll" + name],
7160	+ elem.body["offset" + name], elem.documentElement["offset" + name]
7161	+ );
7162	+
7163	+ // Get or set width or height on the element
7164	+ } else if ( size === undefined ) {
7165	+ var orig = jQuery.css( elem, type ),
7166	+ ret = parseFloat( orig );
7167	+
7168	+ return jQuery.isNaN( ret ) ? orig : ret;
7169	+
7170	+ // Set the width or height on the element (default to pixels if value is unitless)
7171	+ } else {
7172	+ return this.css( type, typeof size === "string" ? size : size + "px" );
7173	+ }
7174	+ };
7175	+
7176	+ });
7177	+
7178	+
7179	+ })(window);
7180	+ jQuery.noConflict();

skin/adminhtml/default/default/oopsprofile/js/jquery-ui-1.8.12.custom.min.js ADDED Viewed

	@@ -0,0 +1,783 @@


1	+ /*!
2	+ * jQuery UI 1.8.12
3	+ *
4	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
5	+ * Dual licensed under the MIT or GPL Version 2 licenses.
6	+ * http://jquery.org/license
7	+ *
8	+ * http://docs.jquery.com/UI
9	+ */
10	+ (function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"\|\|c.expr.filters.hidden(this)}).length}c.ui=c.ui\|\|{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
11	+ NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static\|relative)/.test(this.css("position"))\|\|/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative\|absolute\|fixed)/.test(c.curCSS(this,
12	+ "position",1))&&/(auto\|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto\|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))\|\|!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
13	+ if(b==="absolute"\|\|b==="relative"\|\|b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))\|\|0;if(l)g-=parseFloat(c.curCSS(f,
14	+ "border"+this+"Width",true))\|\|0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))\|\|0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
15	+ d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href\|\|!d\|\|b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input\|select\|textarea\|button\|object/.test(b)?!a.disabled:"a"==b?a.href\|\|!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)\|\|b>=0)&&c(a).is(":focusable")}});
16	+ c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]\|\|[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
17	+ b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
18	+ ;/*!
19	+ * jQuery UI Widget 1.8.12
20	+ *
21	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
22	+ * Dual licensed under the MIT or GPL Version 2 licenses.
23	+ * http://jquery.org/license
24	+ *
25	+ * http://docs.jquery.com/UI/Widget
26	+ */
27	+ (function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a\|\|b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
28	+ a)};b[e]=b[e]\|\|{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix\|\|a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
29	+ e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d\|\|{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
30	+ this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
31	+ widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
32	+ enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d\|\|{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false\|\|c.isDefaultPrevented())}}})(jQuery);
33	+ ;/*!
34	+ * jQuery UI Mouse 1.8.12
35	+ *
36	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
37	+ * Dual licensed under the MIT or GPL Version 2 licenses.
38	+ * http://jquery.org/license
39	+ *
40	+ * http://docs.jquery.com/UI/Mouse
41	+ *
42	+ * Depends:
43	+ * jquery.ui.widget.js
44	+ */
45	+ (function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
46	+ a.originalEvent\|\|{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,e=a.which==1,f=typeof this.options.cancel=="string"?b(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e\|\|f\|\|!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
47	+ this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(d){return c._mouseMove(d)};this._mouseUpDelegate=function(d){return c._mouseUp(d)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=
48	+ true}},_mouseMove:function(a){if(b.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);
49	+ if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
50	+ ;/*
51	+ * jQuery UI Position 1.8.12
52	+ *
53	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
54	+ * Dual licensed under the MIT or GPL Version 2 licenses.
55	+ * http://jquery.org/license
56	+ *
57	+ * http://docs.jquery.com/UI/Position
58	+ */
59	+ (function(c){c.ui=c.ui\|\|{};var n=/left\|center\|right/,o=/top\|center\|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b\|\|!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision\|\|"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
60	+ left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]\|\|"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)\|\|0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)\|\|0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
61	+ k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))\|\|0,q=parseInt(c.curCSS(this,"marginTop",true))\|\|0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))\|\|0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))\|\|0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
62	+ m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
63	+ d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
64	+ a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
65	+ g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)\|\|0,h=parseInt(c.curCSS(b,"left",true),10)\|\|0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a\|\|!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
66	+ ;/*
67	+ * jQuery UI Draggable 1.8.12
68	+ *
69	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
70	+ * Dual licensed under the MIT or GPL Version 2 licenses.
71	+ * http://jquery.org/license
72	+ *
73	+ * http://docs.jquery.com/UI/Draggables
74	+ *
75	+ * Depends:
76	+ * jquery.ui.core.js
77	+ * jquery.ui.mouse.js
78	+ * jquery.ui.widget.js
79	+ */
80	+ (function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
81	+ "original"&&!/^(?:r\|a\|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
82	+ this.options;if(this.helper\|\|b.disabled\|\|d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
83	+ this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
84	+ d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis\|\|this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis\|\|
85	+ this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]\|\|!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b\|\|this.options.revert=="valid"&&b\|\|this.options.revert===true\|\|d.isFunction(this.options.revert)&&
86	+ this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle\|\|!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
87	+ a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length\|\|a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed\|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]\|\|
88	+ 0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
89	+ this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body\|\|this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)\|\|0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)\|\|0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
90	+ (parseInt(this.helper.css("top"),10)\|\|0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)\|\|0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)\|\|0,top:parseInt(this.element.css("marginTop"),10)\|\|0,right:parseInt(this.element.css("marginRight"),10)\|\|0,bottom:parseInt(this.element.css("marginBottom"),10)\|\|0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),
91	+ height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"\|\|a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?
92	+ document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()\|\|document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document\|window\|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),
93	+ 10)\|\|0)+(parseInt(d(b).css("paddingLeft"),10)\|\|0),a.top+(parseInt(d(b).css("borderTopWidth"),10)\|\|0)+(parseInt(d(b).css("paddingTop"),10)\|\|0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)\|\|0)-(parseInt(d(b).css("paddingRight"),10)\|\|0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)\|\|0)-(parseInt(d(b).css("paddingBottom"),
94	+ 10)\|\|0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html\|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.topa+this.offset.parent.topa-(d.browser.safari&&
95	+ d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())a),left:b.left+this.offset.relative.lefta+this.offset.parent.lefta-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
96	+ this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html\|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=
97	+ this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]\|\|g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]\|\|e-this.offset.click.left>this.containment[2])?
98	+ e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
99	+ f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c\|\|this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,
100	+ offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.12"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g.refreshPositions();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},
101	+ b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=
102	+ d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};
103	+ a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&
104	+ this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",
105	+ {start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+
106	+ "px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",
107	+ a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis\|\|c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+
108	+ c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis\|\|c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis\|\|c.axis!="x")if(a.pageY-d(document).scrollTop()<
109	+ c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis\|\|c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+
110	+ c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items\|\|":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),
111	+ f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e\|\|i-e<g&&g<k+e&&j-e<o&&o<l+e\|\|i-e<n&&n<k+e&&j-e<m&&m<l+e\|\|i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=
112	+ c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p\|\|q\|\|r\|\|s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=
113	+ c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p\|\|q\|\|r\|\|s\|\|t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),
114	+ {snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p\|\|q\|\|r\|\|s\|\|t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)\|\|0)-(parseInt(d(f).css("zIndex"),10)\|\|0)});if(a.length){var b=
115	+ parseInt(a[0].style.zIndex)\|\|0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
116	+ ;/*
117	+ * jQuery UI Droppable 1.8.12
118	+ *
119	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
120	+ * Dual licensed under the MIT or GPL Version 2 licenses.
121	+ * http://jquery.org/license
122	+ *
123	+ * http://docs.jquery.com/UI/Droppables
124	+ *
125	+ * Depends:
126	+ * jquery.ui.core.js
127	+ * jquery.ui.widget.js
128	+ * jquery.ui.mouse.js
129	+ * jquery.ui.draggable.js
130	+ */
131	+ (function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]\|\|[];d.ui.ddmanager.droppables[a.scope].push(this);
132	+ a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
133	+ this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b\|\|(b.currentItem\|\|b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem\|\|b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
134	+ this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b\|\|(b.currentItem\|\|b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem\|\|b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b\|\|d.ui.ddmanager.current;if(!c\|\|(c.currentItem\|\|c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
135	+ d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem\|\|c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem\|\|c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
136	+ a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem\|\|a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.12"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs\|\|a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs\|\|a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
137	+ switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs\|\|a.position.absolute).top+(a.clickOffset\|\|a.offset.click).top,(a.positionAbs\|\|a.position.absolute).left+(a.clickOffset\|\|a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l\|\|h>=j&&h<=l\|\|f<j&&h>l)&&(e>=
138	+ i&&e<=k\|\|g>=i&&g<=k\|\|e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]\|\|[],e=b?b.type:null,g=(a.currentItem\|\|a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled\|\|a&&!c[f].accept.call(c[f].element[0],a.currentItem\|\|a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
139	+ "none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]\|\|[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c\|\|this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem\|\|
140	+ a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]\|\|[],function(){if(!(this.options.disabled\|\|this.greedyChild\|\|!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
141	+ d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
142	+ ;/*
143	+ * jQuery UI Resizable 1.8.12
144	+ *
145	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
146	+ * Dual licensed under the MIT or GPL Version 2 licenses.
147	+ * http://jquery.org/license
148	+ *
149	+ * http://docs.jquery.com/UI/Resizables
150	+ *
151	+ * Depends:
152	+ * jquery.ui.core.js
153	+ * jquery.ui.mouse.js
154	+ * jquery.ui.widget.js
155	+ */
156	+ (function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
157	+ _proportionallyResizeElements:[],_helper:a.helper\|\|a.ghost\|\|a.animate?a.helper\|\|"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas\|textarea\|input\|select\|button\|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
158	+ top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
159	+ this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles\|\|(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
160	+ nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw\|se\|ne\|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h\|\|this.element;for(var i in this.handles){if(this.handles[i].constructor==
161	+ String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea\|input\|select\|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw\|ne\|nw\|se\|n\|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne\|nw\|n/.test(i)?"Top":/se\|sw\|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
162	+ this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se\|sw\|ne\|nw\|n\|e\|s\|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
163	+ if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
164	+ d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")\|\|/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()\|\|0;f+=e(a.containment).scrollTop()\|\|0}this.offset=
165	+ this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
166	+ this.originalSize.width/this.originalSize.height\|\|1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left\|\|0,b.pageY-c.top\|\|0]);if(this._aspectRatio\|\|b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
167	+ b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
168	+ f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)\|\|null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)\|\|null;a.animate\|\|this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
169	+ this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
170	+ null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
171	+ this.size.height,k=/sw\|nw\|w/.test(c);c=/nw\|ne\|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper\|\|this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=
172	+ [c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)\|\|0;h=parseInt(f[h],10)\|\|0;return g+h})}e.browser.msie&&(e(b).is(":hidden")\|\|e(b).parents(":hidden").length)\|\|c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]\|\|0,width:b.width()-this.borderDif[1]-this.borderDif[3]\|\|0})}},_renderProxy:function(){var b=
173	+ this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper\|\|e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
174	+ a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
175	+ c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
176	+ originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.12"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
177	+ b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height\|\|0,width:c.size.width-d.width\|\|0,top:c.position.top-f.top\|\|0,left:c.position.left-f.left\|\|0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
178	+ "height","top","left"];e.each(r,function(n,o){if((n=(q[o]\|\|0)+(g[o]\|\|0))&&n>=0)p[o]=n\|\|null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
179	+ if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
180	+ g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)\|\|null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)\|\|null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
181	+ height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)\|\|c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()\|\|document.body.parentNode.scrollHeight}}else{var d=
182	+ e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
183	+ d=a.containerOffset,f=a.position;b=a._aspectRatio\|\|b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
184	+ d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative\|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
185	+ a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
186	+ /static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
187	+ b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]\|\|1))*(a.grid[0]\|\|1);a=Math.round((c.height-d.height)/
188	+ (a.grid[1]\|\|1))*(a.grid[1]\|\|1);if(/^(se\|s\|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)\|\|0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
189	+ ;/*
190	+ * jQuery UI Selectable 1.8.12
191	+ *
192	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
193	+ * Dual licensed under the MIT or GPL Version 2 licenses.
194	+ * http://jquery.org/license
195	+ *
196	+ * http://docs.jquery.com/UI/Selectables
197	+ *
198	+ * Depends:
199	+ * jquery.ui.core.js
200	+ * jquery.ui.mouse.js
201	+ * jquery.ui.widget.js
202	+ */
203	+ (function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
204	+ selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
205	+ c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
206	+ c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey\|\|!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
207	+ this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a\|\|a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h\|\|a.right<b\|\|a.top>i\|\|a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
208	+ a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
209	+ !a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
210	+ e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.12"})})(jQuery);
211	+ ;/*
212	+ * jQuery UI Sortable 1.8.12
213	+ *
214	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
215	+ * Dual licensed under the MIT or GPL Version 2 licenses.
216	+ * http://jquery.org/license
217	+ *
218	+ * http://docs.jquery.com/UI/Sortables
219	+ *
220	+ * Depends:
221	+ * jquery.ui.core.js
222	+ * jquery.ui.mouse.js
223	+ * jquery.ui.widget.js
224	+ */
225	+ (function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
226	+ this.refresh();this.floating=this.items.length?/left\|right/.test(this.items[0].item.css("float"))\|\|/inline\|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=
227	+ b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled\|\|this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;
228	+ d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-
229	+ this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
230	+ this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
231	+ document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions\|\|this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
232	+ return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
233	+ b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
234	+ b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
235	+ a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis\|\|this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis\|\|this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
236	+ e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"\|\|this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
237	+ c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)\|\|500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
238	+ this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
239	+ dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a\|\|{};d(b).each(function(){var e=(d(a.item\|\|this).attr(a.attribute\|\|"id")\|\|"").match(a.expression\|\|/(.+)[-=_](.+)/);if(e)c.push((a.key\|\|e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
240	+ toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a\|\|{};b.each(function(){c.push(d(a.item\|\|this).attr(a.attribute\|\|"id")\|\|"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"\|\|this.options.forcePointerForContainers\|\|
241	+ this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
242	+ var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"\|\|a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a\|\|e=="left"&&!a:c&&(c=="down"&&b\|\|c=="up"&&!b)},
243	+ _getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
244	+ if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
245	+ this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
246	+ this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
247	+ this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
248	+ this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a\|\|this,c=b.options;if(!c.placeholder\|\|c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
249	+ d(document.createElement(b.currentItem[0].nodeName)).addClass(e\|\|b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()\|\|g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")\|\|0,10)-parseInt(b.currentItem.css("paddingBottom")\|\|0,10));g.width()\|\|g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")\|\|0,10)-parseInt(b.currentItem.css("paddingRight")\|\|
250	+ 0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
251	+ a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
252	+ f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e\|\|this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=
253	+ this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length\|\|d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==
254	+ ""\|\|b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""\|\|b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]\|\|0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=
255	+ this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body\|\|this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a=
256	+ {top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)\|\|0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)\|\|0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)\|\|0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)\|\|0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),
257	+ 10)\|\|0,top:parseInt(this.currentItem.css("marginTop"),10)\|\|0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"\|\|a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?
258	+ document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()\|\|document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document\|window\|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)\|\|0)+(parseInt(d(b).css("paddingLeft"),10)\|\|0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
259	+ 10)\|\|0)+(parseInt(d(b).css("paddingTop"),10)\|\|0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)\|\|0)-(parseInt(d(b).css("paddingRight"),10)\|\|0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)\|\|0)-(parseInt(d(b).css("paddingBottom"),10)\|\|0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=
260	+ this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html\|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.topa+this.offset.parent.topa-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())a),left:b.left+this.offset.relative.lefta+this.offset.parent.left*a-(d.browser.safari&&
261	+ this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html\|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();
262	+ var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
263	+ this.originalPageY)/b.grid[1])b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]\|\|g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]\|\|f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-
264	+ this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],
265	+ this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"\|\|this._storedCSS[e]=="static")this._storedCSS[e]=
266	+ "";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside\|\|this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]\|\|this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b\|\|c.push(function(f){this._trigger("remove",
267	+ f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b\|\|c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
268	+ this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
269	+ a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b\|\|this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},
270	+ _uiHash:function(a){var b=a\|\|this;return{helper:b.helper,placeholder:b.placeholder\|\|d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.12"})})(jQuery);
271	+ ;/*
272	+ * jQuery UI Accordion 1.8.12
273	+ *
274	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
275	+ * Dual licensed under the MIT or GPL Version 2 licenses.
276	+ * http://jquery.org/license
277	+ *
278	+ * http://docs.jquery.com/UI/Accordion
279	+ *
280	+ * Depends:
281	+ * jquery.ui.core.js
282	+ * jquery.ui.widget.js
283	+ */
284	+ (function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
285	+ a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled\|\|c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled\|\|c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled\|\|c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled\|\|c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
286	+ if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active\|\|b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
287	+ function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active\|\|"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari\|\|a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
288	+ this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
289	+ this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight\|\|a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
290	+ b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled\|\|a.altKey\|\|a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
291	+ a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
292	+ c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
293	+ if(!d.disabled)if(a.target){a=c(a.currentTarget\|\|b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running\|\|!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
294	+ if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
295	+ e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight\|\|e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight\|\|
296	+ e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]\|\|(h[k]=function(l){this.slide(l,{easing:k,duration:i\|\|700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
297	+ "aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.12",
298	+ animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)\|\|0)-(parseInt(b.css("borderRightWidth"),10)\|\|0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
299	+ f[i]={value:j[1],unit:j[2]\|\|"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight\|\|a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
300	+ paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
301	+ ;/*
302	+ * jQuery UI Autocomplete 1.8.12
303	+ *
304	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
305	+ * Dual licensed under the MIT or GPL Version 2 licenses.
306	+ * http://jquery.org/license
307	+ *
308	+ * http://docs.jquery.com/UI/Autocomplete
309	+ *
310	+ * Depends:
311	+ * jquery.ui.core.js
312	+ * jquery.ui.widget.js
313	+ * jquery.ui.position.js
314	+ */
315	+ (function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled\|\|a.element.attr("readonly"))){g=
316	+ false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
317	+ a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
318	+ this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo\|\|"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length\|\|setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
319	+ a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
320	+ d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b\|\|"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
321	+ b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
322	+ this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
323	+ this.pending--;this.pending\|\|this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label\|\|
324	+ b.value,value:b.value\|\|b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
325	+ d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)\|\|this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$\|#\s]/g,
326	+ "\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label\|\|c.value\|\|c)})}})})(jQuery);
327	+ (function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
328	+ -1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
329	+ deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
330	+ e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active\|\|this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length\|\|(g=this.element.children(".ui-menu-item:last"));this.activate(e,
331	+ g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active\|\|this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active\|\|this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length\|\|(result=this.element.children(".ui-menu-item:first"));
332	+ this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active\|\|this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
333	+ ;/*
334	+ * jQuery UI Button 1.8.12
335	+ *
336	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
337	+ * Dual licensed under the MIT or GPL Version 2 licenses.
338	+ * http://jquery.org/license
339	+ *
340	+ * http://docs.jquery.com/UI/Button
341	+ *
342	+ * Depends:
343	+ * jquery.ui.core.js
344	+ * jquery.ui.widget.js
345	+ */
346	+ (function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
347	+ i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"\|\|this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
348	+ function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled\|\|a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
349	+ b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
350	+ g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE\|\|e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
351	+ c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"\|\|this.type==="radio"){var b=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=b.find(c);if(!this.buttonElement.length){b=b.length?b.siblings():this.element.siblings();this.buttonElement=b.filter(c);if(!this.buttonElement.length)this.buttonElement=b.find(c)}this.element.addClass("ui-helper-hidden-accessible");
352	+ (b=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
353	+ this.hasTitle\|\|this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
354	+ true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
355	+ c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary\|\|d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only":
356	+ "ui-button-icon-only");this.hasTitle\|\|b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
357	+ destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
358	+ ;/*
359	+ * jQuery UI Dialog 1.8.12
360	+ *
361	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
362	+ * Dual licensed under the MIT or GPL Version 2 licenses.
363	+ * http://jquery.org/license
364	+ *
365	+ * http://docs.jquery.com/UI/Dialog
366	+ *
367	+ * Depends:
368	+ * jquery.ui.core.js
369	+ * jquery.ui.widget.js
370	+ * jquery.ui.button.js
371	+ * jquery.ui.draggable.js
372	+ * jquery.ui.mouse.js
373	+ * jquery.ui.position.js
374	+ * jquery.ui.resizable.js
375	+ */
376	+ (function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn\|\|{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
377	+ position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title\|\|this.originalTitle;var a=this,b=a.options,d=b.title\|\|" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
378	+ b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
379	+ h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
380	+ e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
381	+ a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
382	+ b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)\|\|(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a\|\|!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=
383	+ 1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
384	+ f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
385	+ function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
386	+ handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
387	+ originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
388	+ f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"\|\|typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
389	+ [a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))\|\|this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e\|\|this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
390	+ if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
391	+ e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b\|\|" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
392	+ this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e\|\|this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
393	+ b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.12",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
394	+ create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()\|\|c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
395	+ height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
396	+ b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
397	+ function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
398	+ ;/*
399	+ * jQuery UI Slider 1.8.12
400	+ *
401	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
402	+ * Dual licensed under the MIT or GPL Version 2 licenses.
403	+ * http://jquery.org/license
404	+ *
405	+ * http://docs.jquery.com/UI/Slider
406	+ *
407	+ * Depends:
408	+ * jquery.ui.core.js
409	+ * jquery.ui.mouse.js
410	+ * jquery.ui.widget.js
411	+ */
412	+ (function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
413	+ this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"\|\|a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
414	+ if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled\|\|d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
415	+ else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
416	+ false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
417	+ b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
418	+ this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b,
419	+ g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)\|\|0)-(parseInt(f.css("borderBottomWidth"),10)\|\|0)+(parseInt(f.css("marginTop"),10)\|\|0)};this.handles.hasClass("ui-state-hover")\|\|this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},
420	+ _mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
421	+ if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
422	+ this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e\|\|a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
423	+ value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
424	+ this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):
425	+ this.value();else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
426	+ this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
427	+ return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
428	+ _refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);
429	+ if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
430	+ 1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.12"})})(jQuery);
431	+ ;/*
432	+ * jQuery UI Tabs 1.8.12
433	+ *
434	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
435	+ * Dual licensed under the MIT or GPL Version 2 licenses.
436	+ * http://jquery.org/license
437	+ *
438	+ * http://docs.jquery.com/UI/Tabs
439	+ *
440	+ * Depends:
441	+ * jquery.ui.core.js
442	+ * jquery.ui.widget.js
443	+ */
444	+ (function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
445	+ e==this.options.selected\|\|this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")\|\|this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie\|\|(this.cookie=this.options.cookie.name\|\|"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
446	+ d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]\|\|
447	+ (q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]\|\|a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
448	+ this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
449	+ this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected\|\|(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]\|\|c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
450	+ if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
451	+ this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
452	+ g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration\|\|"normal",
453	+ function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration\|\|"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
454	+ this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible\|\|f.hasClass("ui-state-disabled")\|\|f.hasClass("ui-state-processing")\|\|a.panels.filter(":animated").length\|\|a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
455	+ -1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
456	+ d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
457	+ d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
458	+ e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length\|\|(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
459	+ j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
460	+ if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
461	+ this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
462	+ load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h\|\|this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
463	+ "cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
464	+ url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.12"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate\|\|(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate\|\|(a._unrotate=!e?function(j){j.clientX&&
465	+ a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
466	+ ;/*
467	+ * jQuery UI Datepicker 1.8.12
468	+ *
469	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
470	+ * Dual licensed under the MIT or GPL Version 2 licenses.
471	+ * http://jquery.org/license
472	+ *
473	+ * http://docs.jquery.com/UI/Datepicker
474	+ *
475	+ * Depends:
476	+ * jquery.ui.core.js
477	+ */
478	+ (function(d,A){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
479	+ "ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
480	+ "Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
481	+ minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function F(a,b){d.extend(a,b);for(var c in b)if(b[c]==
482	+ null\|\|b[c]==A)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.12"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){F(this._defaults,a\|\|{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c\|\|{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();
483	+ f=e=="div"\|\|e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b\|\|{},c\|\|{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
484	+ _connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
485	+ b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"\|\|c=="both")a.focus(this._showDatepicker);if(c=="button"\|\|c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
486	+ ""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
487	+ c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
488	+ true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}F(a.settings,e\|\|{});
489	+ b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft\|\|document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop\|\|document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);
490	+ this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",
491	+ this._doKeyUp)}else if(e=="div"\|\|e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"\|\|e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,
492	+ function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"\|\|e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:
493	+ f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},
494	+ e.settings):this._get(e,b):null;var f=b\|\|{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,"max");F(e.settings,f);if(i!==null&&f.dateFormat!==A&&f.minDate===A)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==A&&f.maxDate===A)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},
495	+ _changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");
496	+ b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),
497	+ "M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey\|\|a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey\|\|a.metaKey;break;case 36:if(a.ctrlKey\|\|a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey\|\|a.metaKey;break;case 37:if(a.ctrlKey\|\|a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey\|\|a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?
498	+ -d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey\|\|a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey\|\|a.metaKey;break;case 39:if(a.ctrlKey\|\|a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey\|\|a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey\|\|a.metaKey)d.datepicker._adjustDate(a.target,
499	+ +7,"D");c=a.ctrlKey\|\|a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==A?a.keyCode:a.charCode);return a.ctrlKey\|\|a.metaKey\|\|c<" "\|\|!b\|\|b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);
500	+ if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target\|\|a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)\|\|d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);
501	+ d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");F(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e\|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=
502	+ document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");
503	+ var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c\|\|"show"](c?f:null,h);if(!c\|\|!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=
504	+ b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");
505	+ this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+
506	+ this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1\|\|c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&
507	+ a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]\|\|c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():
508	+ 0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),
509	+ "isRTL");a&&(a.type=="hidden"\|\|a.nodeType!=1\|\|d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b\|\|a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?
510	+ "fadeOut":"hide"](a?c:null,e);a\|\|e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=
511	+ d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=
512	+ d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c==
513	+ "M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)\|\|this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=
514	+ b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();
515	+ this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")\|\|this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()\|\|7));var b=a.getTime();a.setMonth(0);
516	+ a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null\|\|b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)\|\|this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)\|\|this._defaults.dayNamesShort,h=(c?c.dayNames:null)\|\|this._defaults.dayNames,i=(c?c.monthNamesShort:null)\|\|this._defaults.monthNamesShort,g=(c?
517	+ c.monthNames:null)\|\|this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+
518	+ s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+
519	+ 1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c\|\|w.getMonth()+1!=j\|\|w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",
520	+ RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))2460601E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)\|\|this._defaults.dayNamesShort,f=(c?c.dayNames:null)\|\|this._defaults.dayNames,h=(c?c.monthNamesShort:null)\|\|this._defaults.monthNamesShort;c=(c?c.monthNames:null)\|\|this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&
521	+ a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",
522	+ b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
523	+ "0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==A?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)\|\|h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
524	+ f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
525	+ (h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)\|\|new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s(d\|D\|w\|W\|m\|M\|y\|Y)?/g,k=u.exec(h);k;){switch(k[2]\|\|"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
526	+ l,g)};if(b=(b=b==null\|\|b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
527	+ a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth\|\|h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear\|\|a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
528	+ b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1\|\|i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
529	+ this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
530	+ (c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
531	+ (c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,
532	+ "closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=
533	+ this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",D=0;D<i[0];D++){for(var M="",E=0;E<i[1];E++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(E){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-
534	+ 1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all\|left/.test(t)&&D==0?c?f:n:"")+(/all\|right/.test(t)&&D==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,D>0\|\|E>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var B=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=
535	+ (t+h)%7;B+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=B+"</tr></thead><tbody>";B=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,B);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;B=l?6:Math.ceil((t+B)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<B;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var G=
536	+ p?p.apply(a.input?a.input[0]:null,[q]):[true,""],C=q.getMonth()!=g,J=C&&!H\|\|!G[0]\|\|k&&q<k\|\|o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(C?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent\|\|L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(C&&!v?"":" "+G[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":
537	+ ""))+'"'+((!C\|\|v)&&G[2]?' title="'+G[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(C&&!v?" ":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(C?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=
538	+ P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&E==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',
539	+ o="";if(h\|\|!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i\|\|n>=e.getMonth())&&(!m\|\|n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u\|\|(k+=o+(h\|\|!(j&&
540	+ l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h\|\|!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-]./)?c+parseInt(s.substring(1),10):s.match(/[+-]./)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]\|\|""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+
541	+ a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}}k+=this._get(a,"yearSuffix");if(u)k+=(h\|\|!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=
542	+ a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"\|\|c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
543	+ "onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
544	+ c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c\|\|b.getTime()>=c.getTime())&&(!a\|\|b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
545	+ "dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
546	+ function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"\|\|a=="getDate"\|\|a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,
547	+ [this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.12";window["DP_jQuery_"+y]=d})(jQuery);
548	+ ;/*
549	+ * jQuery UI Progressbar 1.8.12
550	+ *
551	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
552	+ * Dual licensed under the MIT or GPL Version 2 licenses.
553	+ * http://jquery.org/license
554	+ *
555	+ * http://docs.jquery.com/UI/Progressbar
556	+ *
557	+ * Depends:
558	+ * jquery.ui.core.js
559	+ * jquery.ui.widget.js
560	+ */
561	+ (function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
562	+ this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
563	+ this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.12"})})(jQuery);
564	+ ;/*
565	+ * jQuery UI Effects 1.8.12
566	+ *
567	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
568	+ * Dual licensed under the MIT or GPL Version 2 licenses.
569	+ * http://jquery.org/license
570	+ *
571	+ * http://docs.jquery.com/UI/Effects/
572	+ */
573	+ jQuery.effects\|\|function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb$\s([0-9]{1,3})\s,\s([0-9]{1,3})\s,\s([0-9]{1,3})\s$/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb$\s([0-9]+(?:\.[0-9]+)?)\%\s,\s([0-9]+(?:\.[0-9]+)?)\%\s,\s([0-9]+(?:\.[0-9]+)?)\%\s$/.exec(c))return[parseFloat(a[1])2.55,parseFloat(a[2])2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
574	+ 16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba$0, 0, 0, 0$/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"\|\|f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
575	+ a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null\|\|f.isFunction(b)\|\|a in t\|\|/scrollbar/.test(a)\|\|!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
576	+ a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"\|\|f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a\|\|{};b=b\|\|a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d\|\|a.complete;return[c,a,b,d]}function m(c){if(!c\|\|typeof c==="number"\|\|f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
577	+ "borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
578	+ 0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
579	+ 211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
580	+ d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")\|\|" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0];
581	+ h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"\|\|a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,
582	+ a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.12",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,
583	+ a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
584	+ border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
585	+ return c},setTransition:function(c,a,b,d){d=d\|\|{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off\|\|!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
586	+ else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)\|\|typeof c==="boolean"\|\|f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
587	+ b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d(a/=e)a+b},easeOutQuad:function(c,a,b,d,e){return-d(a/=e)(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2aa+b;return-d/2(--a(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d(a/=e)a*a+b},easeOutCubic:function(c,
588	+ a,b,d,e){return d((a=a/e-1)aa+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2aaa+b;return d/2((a-=2)aa+2)+b},easeInQuart:function(c,a,b,d,e){return d(a/=e)aaa+b},easeOutQuart:function(c,a,b,d,e){return-d((a=a/e-1)aaa-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2aaaa+b;return-d/2((a-=2)aaa-2)+b},easeInQuint:function(c,a,b,d,e){return d(a/=e)aaaa+b},easeOutQuint:function(c,a,b,d,e){return d((a=a/e-1)aaa*a+1)+b},easeInOutQuint:function(c,
589	+ a,b,d,e){if((a/=e/2)<1)return d/2aaaaa+b;return d/2((a-=2)aaaa+2)+b},easeInSine:function(c,a,b,d,e){return-dMath.cos(a/e(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return dMath.sin(a/e(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2(Math.cos(Math.PIa/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:dMath.pow(2,10(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d(-Math.pow(2,-10a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
590	+ e)return b+d;if((a/=e/2)<1)return d/2Math.pow(2,10(a-1))+b;return d/2(-Math.pow(2,-10--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d(Math.sqrt(1-(a/=e)a)-1)+b},easeOutCirc:function(c,a,b,d,e){return dMath.sqrt(1-(a=a/e-1)a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2(Math.sqrt(1-aa)-1)+b;return d/2(Math.sqrt(1-(a-=2)a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g\|\|(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=
591	+ g/(2Math.PI)Math.asin(d/h);return-(hMath.pow(2,10(a-=1))Math.sin((ae-c)2Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g\|\|(g=e0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2Math.PI)Math.asin(d/h);return hMath.pow(2,-10a)Math.sin((ae-c)2Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g\|\|(g=e0.31.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2Math.PI)*Math.asin(d/
592	+ h);if(a<1)return-0.5hMath.pow(2,10(a-=1))Math.sin((ae-c)2Math.PI/g)+b;return hMath.pow(2,-10(a-=1))Math.sin((ae-c)2Math.PI/g)0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d(a/=e)a((g+1)a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d((a=a/e-1)a((g+1)a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2aa(((g=1.525)+1)a-g)+b;return d/2((a-=2)a(((g=1.525)+1)a+g)+2)+b},easeInBounce:function(c,
593	+ a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d7.5625aa+b:a<2/2.75?d(7.5625(a-=1.5/2.75)a+0.75)+b:a<2.5/2.75?d(7.5625(a-=2.25/2.75)a+0.9375)+b:d(7.5625(a-=2.625/2.75)a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a2,0,d,e)0.5+b;return f.easing.easeOutBounce(c,a2-e,0,d,e)0.5+d*0.5+b}})}(jQuery);
594	+ ;/*
595	+ * jQuery UI Effects Blind 1.8.12
596	+ *
597	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
598	+ * Dual licensed under the MIT or GPL Version 2 licenses.
599	+ * http://jquery.org/license
600	+ *
601	+ * http://docs.jquery.com/UI/Effects/Blind
602	+ *
603	+ * Depends:
604	+ * jquery.effects.core.js
605	+ */
606	+ (function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode\|\|"hide"),d=c.options.direction\|\|"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
607	+ g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
608	+ ;/*
609	+ * jQuery UI Effects Bounce 1.8.12
610	+ *
611	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
612	+ * Dual licensed under the MIT or GPL Version 2 licenses.
613	+ * http://jquery.org/license
614	+ *
615	+ * http://docs.jquery.com/UI/Effects/Bounce
616	+ *
617	+ * Depends:
618	+ * jquery.effects.core.js
619	+ */
620	+ (function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode\|\|"effect"),d=b.options.direction\|\|"up",c=b.options.distance\|\|20,m=b.options.times\|\|5,i=b.duration\|\|250;/show\|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"\|\|d=="down"?"top":"left";d=d=="up"\|\|d=="left"?"pos":"neg";c=b.options.distance\|\|(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
621	+ 3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
622	+ b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
623	+ ;/*
624	+ * jQuery UI Effects Clip 1.8.12
625	+ *
626	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
627	+ * Dual licensed under the MIT or GPL Version 2 licenses.
628	+ * http://jquery.org/license
629	+ *
630	+ * http://docs.jquery.com/UI/Effects/Clip
631	+ *
632	+ * Depends:
633	+ * jquery.effects.core.js
634	+ */
635	+ (function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode\|\|"hide"),c=e.options.direction\|\|"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
636	+ c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
637	+ ;/*
638	+ * jQuery UI Effects Drop 1.8.12
639	+ *
640	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
641	+ * Dual licensed under the MIT or GPL Version 2 licenses.
642	+ * http://jquery.org/license
643	+ *
644	+ * http://docs.jquery.com/UI/Effects/Drop
645	+ *
646	+ * Depends:
647	+ * jquery.effects.core.js
648	+ */
649	+ (function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode\|\|"hide"),b=d.options.direction\|\|"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"\|\|b=="down"?"top":"left";b=b=="up"\|\|b=="left"?"pos":"neg";var g=d.options.distance\|\|(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
650	+ "show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
651	+ ;/*
652	+ * jQuery UI Effects Explode 1.8.12
653	+ *
654	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
655	+ * Dual licensed under the MIT or GPL Version 2 licenses.
656	+ * http://jquery.org/license
657	+ *
658	+ * http://docs.jquery.com/UI/Effects/Explode
659	+ *
660	+ * Depends:
661	+ * jquery.effects.core.js
662	+ */
663	+ (function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)\|\|0;g.left-=parseInt(b.css("marginLeft"),10)\|\|0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
664	+ 0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f(h/d),top:-e(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))(h/d):0),top:g.top+e(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))(h/d)),top:g.top+
665	+ e(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))(i/c)),opacity:a.options.mode=="show"?1:0},a.duration\|\|500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration\|\|500)})}})(jQuery);
666	+ ;/*
667	+ * jQuery UI Effects Fade 1.8.12
668	+ *
669	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
670	+ * Dual licensed under the MIT or GPL Version 2 licenses.
671	+ * http://jquery.org/license
672	+ *
673	+ * http://docs.jquery.com/UI/Effects/Fade
674	+ *
675	+ * Depends:
676	+ * jquery.effects.core.js
677	+ */
678	+ (function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode\|\|"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
679	+ ;/*
680	+ * jQuery UI Effects Fold 1.8.12
681	+ *
682	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
683	+ * Dual licensed under the MIT or GPL Version 2 licenses.
684	+ * http://jquery.org/license
685	+ *
686	+ * http://docs.jquery.com/UI/Effects/Fold
687	+ *
688	+ * Depends:
689	+ * jquery.effects.core.js
690	+ */
691	+ (function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode\|\|"hide"),g=a.options.size\|\|15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
692	+ 10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
693	+ ;/*
694	+ * jQuery UI Effects Highlight 1.8.12
695	+ *
696	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
697	+ * Dual licensed under the MIT or GPL Version 2 licenses.
698	+ * http://jquery.org/license
699	+ *
700	+ * http://docs.jquery.com/UI/Effects/Highlight
701	+ *
702	+ * Depends:
703	+ * jquery.effects.core.js
704	+ */
705	+ (function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode\|\|"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color\|\|"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
706	+ this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
707	+ ;/*
708	+ * jQuery UI Effects Pulsate 1.8.12
709	+ *
710	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
711	+ * Dual licensed under the MIT or GPL Version 2 licenses.
712	+ * http://jquery.org/license
713	+ *
714	+ * http://docs.jquery.com/UI/Effects/Pulsate
715	+ *
716	+ * Depends:
717	+ * jquery.effects.core.js
718	+ */
719	+ (function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode\|\|"show");times=(a.options.times\|\|5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible\|\|c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
720	+ a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
721	+ ;/*
722	+ * jQuery UI Effects Scale 1.8.12
723	+ *
724	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
725	+ * Dual licensed under the MIT or GPL Version 2 licenses.
726	+ * http://jquery.org/license
727	+ *
728	+ * http://docs.jquery.com/UI/Effects/Scale
729	+ *
730	+ * Depends:
731	+ * jquery.effects.core.js
732	+ */
733	+ (function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode\|\|"hide"),g=parseInt(b.options.percent,10)\|\|150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.heighth,width:i.widthh}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
734	+ b.options.mode\|\|"effect"),h=parseInt(b.options.percent,10)\|\|(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction\|\|"both",f=b.options.origin;if(g!="effect"){e.origin=f\|\|["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from\|\|(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.heighth.y,width:f.widthh.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
735	+ 1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
736	+ p=c.effects.setMode(a,b.options.mode\|\|"effect"),n=b.options.restore\|\|false,m=b.options.scale\|\|"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from\|\|j;a.to=b.options.to\|\|j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)l.y;a.from.left=(j.width-a.from.width)l.x;a.to.top=(j.height-a.to.height)l.y;a.to.left=(j.width-a.to.width)l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
737	+ if(m=="box"\|\|m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"\|\|m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
738	+ a.css("overflow","hidden").css(a.from);if(m=="content"\|\|m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.heightd.from.y,width:o.widthd.from.x};child.to={height:o.heightd.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
739	+ child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
740	+ n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
741	+ ;/*
742	+ * jQuery UI Effects Shake 1.8.12
743	+ *
744	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
745	+ * Dual licensed under the MIT or GPL Version 2 licenses.
746	+ * http://jquery.org/license
747	+ *
748	+ * http://docs.jquery.com/UI/Effects/Shake
749	+ *
750	+ * Depends:
751	+ * jquery.effects.core.js
752	+ */
753	+ (function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode\|\|"effect");var c=a.options.direction\|\|"left",e=a.options.distance\|\|20,l=a.options.times\|\|3,f=a.duration\|\|a.options.duration\|\|140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"\|\|c=="down"?"top":"left",h=c=="up"\|\|c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
754	+ (h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
755	+ ;/*
756	+ * jQuery UI Effects Slide 1.8.12
757	+ *
758	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
759	+ * Dual licensed under the MIT or GPL Version 2 licenses.
760	+ * http://jquery.org/license
761	+ *
762	+ * http://docs.jquery.com/UI/Effects/Slide
763	+ *
764	+ * Depends:
765	+ * jquery.effects.core.js
766	+ */
767	+ (function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode\|\|"show"),b=d.options.direction\|\|"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"\|\|b=="down"?"top":"left";b=b=="up"\|\|b=="left"?"pos":"neg";var e=d.options.distance\|\|(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
768	+ var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
769	+ ;/*
770	+ * jQuery UI Effects Transfer 1.8.12
771	+ *
772	+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
773	+ * Dual licensed under the MIT or GPL Version 2 licenses.
774	+ * http://jquery.org/license
775	+ *
776	+ * http://docs.jquery.com/UI/Effects/Transfer
777	+ *
778	+ * Depends:
779	+ * jquery.effects.core.js
780	+ */
781	+ (function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
782	+ b.dequeue()})})}})(jQuery);
783	+ ;

skin/adminhtml/default/default/oopsprofile/js/jquery.checkboxtree.js ADDED Viewed

	@@ -0,0 +1,628 @@


1	+ /*!
2	+ * jQuery CheckboxTree
3	+ *
4	+ * @author Valerio Galano <v.galano@daredevel.it>
5	+ *
6	+ * @see http://checkboxtree.daredevel.it
7	+ *
8	+ * @version 0.5.2
9	+ */
10	+ jQuery.noConflict();
11	+ jQuery.widget("daredevel.checkboxTree", {
12	+
13	+ /**
14	+ * Check if all descendant of passed node are checked
15	+ *
16	+ * @private
17	+ *
18	+ * @param li node
19	+ *
20	+ * @return true if all descendant checked
21	+ */
22	+ _allDescendantChecked: function(li) {
23	+ return (li.find('li input:checkbox:not(:checked)').length == 0);
24	+ },
25	+
26	+ /**
27	+ * Initialize plugin
28	+ *
29	+ * @private
30	+ */
31	+ _create: function() {
32	+
33	+ var t = this;
34	+
35	+ // setup collapse engine tree
36	+ if (this.options.collapsable) {
37	+
38	+ // build collapse engine's anchors
39	+ this.options.collapseAnchor = (this.options.collapseImage.length > 0) ? '<img src="' + this.options.collapseImage + '" />' : '';
40	+ this.options.expandAnchor = (this.options.expandImage.length > 0) ? '<img src="' + this.options.expandImage + '" />' : '';
41	+ this.options.leafAnchor = (this.options.leafImage.length > 0) ? '<img src="' + this.options.leafImage + '" />' : '';
42	+
43	+ // initialize leafs
44	+ this.element.find("li:not(:has(ul))").each(function() {
45	+ jQuery(this).prepend(jQuery('<span />'));
46	+ t._markAsLeaf(jQuery(this));
47	+ });
48	+
49	+ // initialize checked nodes
50	+ this.element.find("li:has(ul):has(input:checkbox:checked)").each(function() {
51	+ jQuery(this).prepend(jQuery('<span />'));
52	+ t.options.initializeChecked == 'collapsed' ? t.collapse(jQuery(this)) : t.expand(jQuery(this));
53	+ });
54	+
55	+ // initialize unchecked nodes
56	+ this.element.find("li:has(ul):not(:has(input:checkbox:checked))").each(function() {
57	+ jQuery(this).prepend(jQuery('<span />'));
58	+ t.options.initializeUnchecked == 'collapsed' ? t.collapse(jQuery(this)) : t.expand(jQuery(this));
59	+ });
60	+
61	+ // bind collapse/expand event
62	+ this.element.find('li span').live("click", function() {
63	+ var li = jQuery(this).parents("li:first");
64	+
65	+ if (li.hasClass('collapsed')) {
66	+ t.expand(li);
67	+ } else
68	+
69	+ if (li.hasClass('expanded')) {
70	+ t.collapse(li);
71	+ }
72	+ });
73	+
74	+ // bind collapse all element event
75	+ jQuery(this.options.collapseAllElement).bind("click", function() {
76	+ t.collapseAll();
77	+ });
78	+
79	+ // bind expand all element event
80	+ jQuery(this.options.expandAllElement).bind("click", function() {
81	+ t.expandAll();
82	+ });
83	+
84	+ // bind collapse on uncheck event
85	+ if (this.options.onUncheck.node == 'collapse') {
86	+ this.element.find('input:checkbox:not(:checked)').live("click", function() {
87	+ t.collapse(jQuery(this).parents("li:first"));
88	+ });
89	+ } else
90	+
91	+ // bind expand on uncheck event
92	+ if (this.options.onUncheck.node == 'expand') {
93	+ this.element.find('input:checkbox:not(:checked)').live("click", function() {
94	+ t.expand(jQuery(this).parents("li:first"));
95	+ });
96	+ }
97	+
98	+ // bind collapse on check event
99	+ if (this.options.onCheck.node == 'collapse') {
100	+ this.element.find('input:checkbox:checked').live("click", function() {
101	+ t.collapse(jQuery(this).parents("li:first"));
102	+ });
103	+ } else
104	+
105	+ // bind expand on check event
106	+ if (this.options.onCheck.node == 'expand') {
107	+ this.element.find('input:checkbox:checked').live("click", function() {
108	+ t.expand(jQuery(this).parents("li:first"));
109	+ });
110	+ }
111	+ }
112	+
113	+ // bind node uncheck event
114	+ this.element.find('input:checkbox:not(:checked)').live('click', function() {
115	+ var li = jQuery(this).parents('li:first');
116	+ t.uncheck(li);
117	+ });
118	+
119	+ // bind node check event
120	+ this.element.find('input:checkbox:checked').live('click', function() {
121	+ var li = jQuery(this).parents('li:first');
122	+ t.check(li);
123	+ });
124	+
125	+ // add essential css class
126	+ this.element.addClass('ui-widget-daredevel-checkboxTree');
127	+
128	+ // add jQueryUI css widget class
129	+ this.element.addClass('ui-widget ui-widget-content');
130	+
131	+ },
132	+
133	+ /**
134	+ * Check ancestors on passed node
135	+ *
136	+ * Don't use check() method because we won't trigger onCheck events
137	+ *
138	+ * @private
139	+ *
140	+ * @param li node
141	+ */
142	+ _checkAncestors: function(li) {
143	+ li.parentsUntil(".ui-widget").filter('li').find('input:checkbox:first:not(:checked)').attr('checked', true).change();
144	+ },
145	+
146	+ /**
147	+ * Check descendants on passed node
148	+ *
149	+ * Don't use check() method because we won't trigger onCheck events
150	+ *
151	+ * @private
152	+ *
153	+ * @param li node
154	+ */
155	+ _checkDescendants: function(li) {
156	+ li.find('li input:checkbox:not(:checked)').attr('checked', true).change();
157	+ },
158	+
159	+ /**
160	+ * Check nodes that are neither ancestors or descendants of passed node
161	+ *
162	+ * Don't use check() method because we won't trigger onCheck events
163	+ *
164	+ * @private
165	+ *
166	+ * @param li node
167	+ */
168	+ _checkOthers: function(li) {
169	+ li.addClass('exclude');
170	+ li.parents('li').addClass('exclude');
171	+ li.find('li').addClass('exclude');
172	+ jQuery(this.element).find('li').each(function() {
173	+ if (!jQuery(this).hasClass('exclude')) {
174	+ jQuery(this).find('input:checkbox:first:not(:checked)').attr('checked', true).change();
175	+ }
176	+ });
177	+ jQuery(this.element).find('li').removeClass('exclude');
178	+ },
179	+
180	+ /**
181	+ * Destroy plugin
182	+ *
183	+ * @private
184	+ */
185	+ _destroy: function() {
186	+ this.element.removeClass(this.options.cssClass);
187	+
188	+ jQuery.Widget.prototype.destroy.call(this);
189	+ },
190	+
191	+ /**
192	+ * Check if passed node is a root
193	+ *
194	+ * @private
195	+ *
196	+ * @param li node to check
197	+ */
198	+ _isRoot: function(li) {
199	+ var parents = li.parentsUntil('.ui-widget-daredevel-checkboxTree');
200	+ return 0 == parents.length;
201	+ },
202	+
203	+ /**
204	+ * Mark node as collapsed
205	+ *
206	+ * @private
207	+ *
208	+ * @param li node to mark
209	+ */
210	+ _markAsCollapsed: function(li) {
211	+ if (this.options.expandAnchor.length > 0) {
212	+ li.children("span").html(this.options.expandAnchor);
213	+ } else
214	+ if (this.options.collapseUiIcon.length > 0) {
215	+ li.children("span").removeClass(this.options.expandUiIcon).addClass('ui-icon ' + this.options.collapseUiIcon);
216	+ }
217	+ li.removeClass("expanded").addClass("collapsed");
218	+ },
219	+
220	+ /**
221	+ * Mark node as expanded
222	+ *
223	+ * @private
224	+ *
225	+ * @param li node to mark
226	+ */
227	+ _markAsExpanded: function(li) {
228	+ if (this.options.collapseAnchor.length > 0) {
229	+ li.children("span").html(this.options.collapseAnchor);
230	+ } else
231	+ if (this.options.expandUiIcon.length > 0) {
232	+ li.children("span").removeClass(this.options.collapseUiIcon).addClass('ui-icon ' + this.options.expandUiIcon);
233	+ }
234	+ li.removeClass("collapsed").addClass("expanded");
235	+ },
236	+
237	+ /**
238	+ * Mark node as leaf
239	+ *
240	+ * @private
241	+ *
242	+ * @param li node to mark
243	+ */
244	+ _markAsLeaf: function(li) {
245	+ if (this.options.leafAnchor.length > 0) {
246	+ li.children("span").html(this.options.leafAnchor);
247	+ } else
248	+ if (this.options.leafUiIcon.length > 0) {
249	+ li.children("span").addClass('ui-icon ' + this.options.leafUiIcon);
250	+ }
251	+ li.addClass("leaf");
252	+ },
253	+
254	+ /**
255	+ * Return parent li of the passed li
256	+ *
257	+ * @private
258	+ *
259	+ * @param li node
260	+ *
261	+ * @return parent li
262	+ */
263	+ _parentNode: function(li) {
264	+ return li.parents('li:first');
265	+ },
266	+
267	+ /**
268	+ * Uncheck ancestors of passed node
269	+ *
270	+ * Don't use uncheck() method because we won't trigger onUncheck events
271	+ *
272	+ * @private
273	+ *
274	+ * @param li node
275	+ */
276	+ _uncheckAncestors: function(li) {
277	+ li.parentsUntil(".ui-widget").filter('li').find('input:checkbox:first:checked').attr('checked', false).change();
278	+ },
279	+
280	+ /**
281	+ * Uncheck descendants of passed node
282	+ *
283	+ * Don't use uncheck() method because we won't trigger onUncheck events
284	+ *
285	+ * @private
286	+ *
287	+ * @param li node
288	+ */
289	+ _uncheckDescendants: function(li) {
290	+ li.find('li input:checkbox:checked').attr('checked', false).change();
291	+ },
292	+
293	+ /**
294	+ * Uncheck nodes that are neither ancestors or descendants of passed node
295	+ *
296	+ * Don't use uncheck() method because we won't trigger onUncheck events
297	+ *
298	+ * @private
299	+ *
300	+ * @param li node
301	+ */
302	+ _uncheckOthers: function(li) {
303	+ li.addClass('exclude');
304	+ li.parents('li').addClass('exclude');
305	+ li.find('li').addClass('exclude');
306	+ jQuery(this.element).find('li').each(function() {
307	+ if (!jQuery(this).hasClass('exclude')) {
308	+ jQuery(this).find('input:checkbox:first:checked').attr('checked', false).change();
309	+ }
310	+ });
311	+ jQuery(this.element).find('li').removeClass('exclude');
312	+ },
313	+
314	+ /**
315	+ * Check node
316	+ *
317	+ * @public
318	+ *
319	+ * @param li node to check
320	+ */
321	+ check: function(li) {
322	+
323	+ li.find('input:checkbox:first:not(:checked)').attr('checked', true).change();
324	+
325	+ // handle others
326	+ if (this.options.onCheck.others == 'check') {
327	+ this._checkOthers(li);
328	+ } else
329	+
330	+ if (this.options.onCheck.others == 'uncheck') {
331	+ this._uncheckOthers(li);
332	+ }
333	+
334	+ // handle descendants
335	+ if (this.options.onCheck.descendants == 'check') {
336	+ this._checkDescendants(li);
337	+ } else
338	+
339	+ if (this.options.onCheck.descendants == 'uncheck') {
340	+ this._uncheckDescendants(li);
341	+ }
342	+
343	+ // handle ancestors
344	+ if (this.options.onCheck.ancestors == 'check') {
345	+ this._checkAncestors(li);
346	+ } else
347	+
348	+ if (this.options.onCheck.ancestors == 'uncheck') {
349	+ this._uncheckAncestors(li);
350	+ } else
351	+
352	+ if (this.options.onCheck.ancestors == 'checkIfFull') {
353	+ if (!this._isRoot(li) && this._allDescendantChecked(this._parentNode(li))) {
354	+ this.check(this._parentNode(li));
355	+ }
356	+ }
357	+ },
358	+
359	+ /**
360	+ * Check all tree elements
361	+ *
362	+ * Don't use check() method so it won't trigger onCheck events
363	+ *
364	+ * @public
365	+ */
366	+ checkAll: function() {
367	+ jQuery(this.element).find('input:checkbox:not(:checked)').attr('checked', true).change();
368	+ },
369	+
370	+ /**
371	+ * Collapse node
372	+ *
373	+ * @public
374	+ *
375	+ * @param li node to collapse
376	+ */
377	+ collapse: function(li) {
378	+ if (li.hasClass('collapsed') \|\| (li.hasClass('leaf'))) {
379	+ return;
380	+ }
381	+
382	+ var t = this;
383	+
384	+ li.children("ul").hide(this.options.collapseEffect, {}, this.options.collapseDuration);
385	+
386	+ setTimeout(function() {
387	+ t._markAsCollapsed(li, t.options);
388	+ }, t.options.collapseDuration);
389	+
390	+ t._trigger('collapse', li);
391	+ },
392	+
393	+ /**
394	+ * Collapse all nodes of the tree
395	+ *
396	+ * @private
397	+ */
398	+ collapseAll: function() {
399	+ var t = this;
400	+ jQuery(this.element).find('li.expanded').each(function() {
401	+ t.collapse(jQuery(this));
402	+ });
403	+ },
404	+
405	+ /**
406	+ * Expand node
407	+ *
408	+ * @public
409	+ *
410	+ * @param li node to expand
411	+ */
412	+ expand: function(li) {
413	+ if (li.hasClass('expanded') \|\| (li.hasClass('leaf'))) {
414	+ return;
415	+ }
416	+
417	+ var t = this;
418	+
419	+ li.children("ul").show(t.options.expandEffect, {}, t.options.expandDuration);
420	+
421	+ setTimeout(function() {
422	+ t._markAsExpanded(li, t.options);
423	+ }, t.options.expandDuration);
424	+
425	+ t._trigger('expand', li);
426	+ },
427	+
428	+ /**
429	+ * Expand all nodes of the tree
430	+ *
431	+ * @public
432	+ */
433	+ expandAll: function() {
434	+ var t = this;
435	+ jQuery(this.element).find('li.collapsed').each(function() {
436	+ t.expand(jQuery(this));
437	+ });
438	+ },
439	+
440	+ /**
441	+ * Uncheck node
442	+ *
443	+ * @public
444	+ *
445	+ * @param li node to uncheck
446	+ */
447	+ uncheck: function(li) {
448	+
449	+ li.find('input:checkbox:first:checked').attr('checked', false).change();
450	+
451	+ // handle others
452	+ if (this.options.onUncheck.others == 'check') {
453	+ this._checkOthers(li);
454	+ } else
455	+
456	+ if (this.options.onUncheck.others == 'uncheck') {
457	+ this._uncheckOthers(li);
458	+ }
459	+
460	+ // handle descendants
461	+ if (this.options.onUncheck.descendants == 'check') {
462	+ this._checkDescendants(li);
463	+ } else
464	+
465	+ if (this.options.onUncheck.descendants == 'uncheck') {
466	+ // this._uncheckDescendants(li);
467	+ }
468	+
469	+ // handle ancestors
470	+ if (this.options.onUncheck.ancestors == 'check') {
471	+ this._checkAncestors(li);
472	+ } else
473	+
474	+ if (this.options.onUncheck.ancestors == 'uncheck') {
475	+ this._uncheckAncestors(li);
476	+ }
477	+
478	+ },
479	+
480	+ /**
481	+ * Uncheck all tree elements
482	+ *
483	+ * Don't use uncheck() method so it won't trigger onUncheck events
484	+ *
485	+ * @public
486	+ */
487	+ uncheckAll: function() {
488	+ jQuery(this.element).find('input:checkbox:checked').attr('checked', false).change();
489	+ },
490	+
491	+ /**
492	+ * Default options values
493	+ */
494	+ options: {
495	+ /**
496	+ * Defines if tree has collapse capability.
497	+ */
498	+ collapsable: true,
499	+ /**
500	+ * Defines an element of DOM that, if clicked, trigger collapseAll() method.
501	+ * Value can be either a jQuery object or a selector string.
502	+ * @deprecated will be removed in jquery 0.6.
503	+ */
504	+ collapseAllElement: '',
505	+ /**
506	+ * Defines duration of collapse effect in ms.
507	+ * Works only if collapseEffect is not null.
508	+ */
509	+ collapseDuration: 500,
510	+ /**
511	+ * Defines the effect used for collapse node.
512	+ */
513	+ collapseEffect: 'blind',
514	+ /**
515	+ * Defines URL of image used for collapse anchor.
516	+ * @deprecated will be removed in jquery 0.6.
517	+ */
518	+ collapseImage: '',
519	+ /**
520	+ * Defines jQueryUI icon class used for collapse anchor.
521	+ */
522	+ collapseUiIcon: 'ui-icon-triangle-1-e',
523	+ // dataSourceType: '',
524	+ // dataSourceUrl: '',
525	+ /**
526	+ * Defines an element of DOM that, if clicked, trigger expandAll() method.
527	+ * Value can be either a jQuery object or a selector string.
528	+ * @deprecated will be removed in jquery 0.6.
529	+ */
530	+ expandAllElement: '',
531	+ /**
532	+ * Defines duration of expand effect in ms.
533	+ * Works only if expandEffect is not null.
534	+ */
535	+ expandDuration: 500,
536	+ /**
537	+ * Defines the effect used for expand node.
538	+ */
539	+ expandEffect: 'blind',
540	+ /**
541	+ * Defines URL of image used for expand anchor.
542	+ * @deprecated will be removed in jquery 0.6.
543	+ */
544	+ expandImage: '',
545	+ /**
546	+ * Defines jQueryUI icon class used for expand anchor.
547	+ */
548	+ expandUiIcon: 'ui-icon-triangle-1-se',
549	+ /**
550	+ * Defines if checked node are collapsed or not at tree initializing.
551	+ */
552	+ initializeChecked: 'expanded', // or 'collapsed'
553	+ /**
554	+ * Defines if unchecked node are collapsed or not at tree initializing.
555	+ */
556	+ initializeUnchecked: 'expanded', // or 'collapsed'
557	+ /**
558	+ * Defines URL of image used for leaf anchor.
559	+ * @deprecated will be removed in jquery 0.6.
560	+ */
561	+ leafImage: '',
562	+ /**
563	+ * Defines jQueryUI icon class used for leaf anchor.
564	+ */
565	+ leafUiIcon: '',
566	+ /**
567	+ * Defines which actions trigger when a node is checked.
568	+ * Actions are triggered in the following order:
569	+ * 1) node
570	+ * 2) others
571	+ * 3) descendants
572	+ * 4) ancestors
573	+ */
574	+ onCheck: {
575	+ /**
576	+ * Defines action to perform on ancestors of the checked node.
577	+ * Available values: null, 'check', 'uncheck', 'checkIfFull'.
578	+ */
579	+ ancestors: 'check',
580	+ /**
581	+ * Defines action to perform on descendants of the checked node.
582	+ * Available values: null, 'check', 'uncheck'.
583	+ */
584	+ descendants: 'check',
585	+ /**
586	+ * Defines action to perform on checked node.
587	+ * Available values: null, 'collapse', 'expand'.
588	+ */
589	+ node: '',
590	+ /**
591	+ * Defines action to perform on each other node (checked one excluded).
592	+ * Available values: null, 'check', 'uncheck'.
593	+ */
594	+ others: ''
595	+ },
596	+ /**
597	+ * Defines which actions trigger when a node is unchecked.
598	+ * Actions are triggered in the following order:
599	+ * 1) node
600	+ * 2) others
601	+ * 3) descendants
602	+ * 4) ancestors
603	+ */
604	+ onUncheck: {
605	+ /**
606	+ * Defines action to perform on ancestors of the unchecked node.
607	+ * Available values: null, 'check', 'uncheck'.
608	+ */
609	+ ancestors: '',
610	+ /**
611	+ * Defines action to perform on descendants of the unchecked node.
612	+ * Available values: null, 'check', 'uncheck'.
613	+ */
614	+ descendants: 'uncheck',
615	+ /**
616	+ * Defines action to perform on unchecked node.
617	+ * Available values: null, 'collapse', 'expand'.
618	+ */
619	+ node: '',
620	+ /**
621	+ * Defines action to perform on each other node (unchecked one excluded).
622	+ * Available values: null, 'check', 'uncheck'.
623	+ */
624	+ others: ''
625	+ }
626	+ }
627	+
628	+ });