Advanced Custom Fields: Font Awesome Field

Version Description

Initial Release.

Release Info

Developer	mattkeys
Plugin	Advanced Custom Fields: Font Awesome Field
Version	1.0.0
Comparing to
See all releases

Version 1.0.0

Files changed (58) hide show

acf-font-awesome.php +55 -0
css/fontawesome.css +1340 -0
css/input.css +4 -0
css/select2.css +615 -0
font-awesome-v4.php +756 -0
font/FontAwesome.otf +0 -0
font/fontawesome-webfont.eot +0 -0
font/fontawesome-webfont.svg +414 -0
font/fontawesome-webfont.ttf +0 -0
font/fontawesome-webfont.woff +0 -0
images/select2-spinner.gif +0 -0
images/select2.png +0 -0
images/select2x2.png +0 -0
js/input.js +51 -0
js/select2/select2.min.js +22 -0
js/select2/select2_locale_ar.js +17 -0
js/select2/select2_locale_bg.js +17 -0
js/select2/select2_locale_ca.js +17 -0
js/select2/select2_locale_cs.js +49 -0
js/select2/select2_locale_da.js +17 -0
js/select2/select2_locale_de.js +15 -0
js/select2/select2_locale_el.js +17 -0
js/select2/select2_locale_en.js.template +17 -0
js/select2/select2_locale_es.js +15 -0
js/select2/select2_locale_et.js +17 -0
js/select2/select2_locale_eu.js +43 -0
js/select2/select2_locale_fa.js +17 -0
js/select2/select2_locale_fi.js +28 -0
js/select2/select2_locale_fr.js +15 -0
js/select2/select2_locale_gl.js +43 -0
js/select2/select2_locale_he.js +17 -0
js/select2/select2_locale_hr.js +42 -0
js/select2/select2_locale_hu.js +15 -0
js/select2/select2_locale_id.js +17 -0
js/select2/select2_locale_is.js +16 -0
js/select2/select2_locale_it.js +15 -0
js/select2/select2_locale_ja.js +15 -0
js/select2/select2_locale_ko.js +17 -0
js/select2/select2_locale_lt.js +29 -0
js/select2/select2_locale_lv.js +16 -0
js/select2/select2_locale_mk.js +17 -0
js/select2/select2_locale_ms.js +17 -0
js/select2/select2_locale_nl.js +15 -0
js/select2/select2_locale_no.js +18 -0
js/select2/select2_locale_pl.js +37 -0
js/select2/select2_locale_pt-BR.js +15 -0
js/select2/select2_locale_pt-PT.js +15 -0
js/select2/select2_locale_ro.js +15 -0
js/select2/select2_locale_ru.js +15 -0
js/select2/select2_locale_sk.js +48 -0
js/select2/select2_locale_sv.js +17 -0
js/select2/select2_locale_th.js +17 -0
js/select2/select2_locale_tr.js +17 -0
js/select2/select2_locale_ua.js +17 -0
js/select2/select2_locale_vi.js +18 -0
js/select2/select2_locale_zh-CN.js +14 -0
js/select2/select2_locale_zh-TW.js +14 -0
readme.txt +55 -0

acf-font-awesome.php ADDED Viewed

	@@ -0,0 +1,55 @@


1	+ <?php
2	+ /*
3	+ Plugin Name: Advanced Custom Fields: Font Awesome
4	+ Description: Add a Font Awesome field type to Advanced Custom Fields
5	+ Version: 1.0.0
6	+ Author: Matt Keys
7	+ Author URI: http://mattkeys.me/
8	+ License: GPLv2 or later
9	+ License URI: http://www.gnu.org/licenses/gpl-2.0.html
10	+ */
11	+
12	+
13	+ class acf_field_font_awesome_plugin
14	+ {
15	+ /*
16	+ * Construct
17	+ *
18	+ * @description:
19	+ * @since: 3.6
20	+ * @created: 1/04/13
21	+ */
22	+
23	+ function __construct()
24	+ {
25	+ // set text domain
26	+ /*
27	+ $domain = 'acf-font-awesome';
28	+ $mofile = trailingslashit(dirname(__File__)) . 'lang/' . $domain . '-' . get_locale() . '.mo';
29	+ load_textdomain( $domain, $mofile );
30	+ */
31	+
32	+
33	+ // version 4+
34	+ add_action('acf/register_fields', array($this, 'register_fields'));
35	+
36	+ }
37	+
38	+ /*
39	+ * register_fields
40	+ *
41	+ * @description:
42	+ * @since: 3.6
43	+ * @created: 1/04/13
44	+ */
45	+
46	+ function register_fields()
47	+ {
48	+ include_once('font-awesome-v4.php');
49	+ }
50	+
51	+ }
52	+
53	+ new acf_field_font_awesome_plugin();
54	+
55	+ ?>

css/fontawesome.css ADDED Viewed

	@@ -0,0 +1,1340 @@


1	+ .fa-live-preview {
2	+ font-size: 50px;
3	+ padding: 10px;
4	+ }
5	+
6	+ @font-face {
7	+ font-family: 'FontAwesome';
8	+ src: url('../font/fontawesome-webfont.eot?v=4.0.3');
9	+ src: url('../font/fontawesome-webfont.eot?#iefix&v=4.0.3') format('embedded-opentype'),
10	+ url('../font/fontawesome-webfont.woff?v=4.0.3') format('woff'),
11	+ url('../font/fontawesome-webfont.ttf?v=4.0.3') format('truetype'),
12	+ url('../font/fontawesome-webfont.svg?v=4.0.3#fontawesomeregular') format('svg');
13	+ font-weight: normal;
14	+ font-style: normal;
15	+ }
16	+ .fa {
17	+ display: inline-block;
18	+ font-family: FontAwesome;
19	+ font-style: normal;
20	+ font-weight: normal;
21	+ line-height: 1;
22	+ -webkit-font-smoothing: antialiased;
23	+ -moz-osx-font-smoothing: grayscale;
24	+ }
25	+ /* makes the font 33% larger relative to the icon container */
26	+ .fa-lg {
27	+ font-size: 1.3333333333333333em;
28	+ line-height: 0.75em;
29	+ vertical-align: -15%;
30	+ }
31	+ .fa-2x {
32	+ font-size: 2em;
33	+ }
34	+ .fa-3x {
35	+ font-size: 3em;
36	+ }
37	+ .fa-4x {
38	+ font-size: 4em;
39	+ }
40	+ .fa-5x {
41	+ font-size: 5em;
42	+ }
43	+ .fa-fw {
44	+ width: 1.2857142857142858em;
45	+ text-align: center;
46	+ }
47	+ .fa-ul {
48	+ padding-left: 0;
49	+ margin-left: 2.142857142857143em;
50	+ list-style-type: none;
51	+ }
52	+ .fa-ul > li {
53	+ position: relative;
54	+ }
55	+ .fa-li {
56	+ position: absolute;
57	+ left: -2.142857142857143em;
58	+ width: 2.142857142857143em;
59	+ top: 0.14285714285714285em;
60	+ text-align: center;
61	+ }
62	+ .fa-li.fa-lg {
63	+ left: -1.8571428571428572em;
64	+ }
65	+ .fa-border {
66	+ padding: .2em .25em .15em;
67	+ border: solid 0.08em #eeeeee;
68	+ border-radius: .1em;
69	+ }
70	+ .pull-right {
71	+ float: right;
72	+ }
73	+ .pull-left {
74	+ float: left;
75	+ }
76	+ .fa.pull-left {
77	+ margin-right: .3em;
78	+ }
79	+ .fa.pull-right {
80	+ margin-left: .3em;
81	+ }
82	+ .fa-spin {
83	+ -webkit-animation: spin 2s infinite linear;
84	+ -moz-animation: spin 2s infinite linear;
85	+ -o-animation: spin 2s infinite linear;
86	+ animation: spin 2s infinite linear;
87	+ }
88	+ @-moz-keyframes spin {
89	+ 0% {
90	+ -moz-transform: rotate(0deg);
91	+ }
92	+ 100% {
93	+ -moz-transform: rotate(359deg);
94	+ }
95	+ }
96	+ @-webkit-keyframes spin {
97	+ 0% {
98	+ -webkit-transform: rotate(0deg);
99	+ }
100	+ 100% {
101	+ -webkit-transform: rotate(359deg);
102	+ }
103	+ }
104	+ @-o-keyframes spin {
105	+ 0% {
106	+ -o-transform: rotate(0deg);
107	+ }
108	+ 100% {
109	+ -o-transform: rotate(359deg);
110	+ }
111	+ }
112	+ @-ms-keyframes spin {
113	+ 0% {
114	+ -ms-transform: rotate(0deg);
115	+ }
116	+ 100% {
117	+ -ms-transform: rotate(359deg);
118	+ }
119	+ }
120	+ @keyframes spin {
121	+ 0% {
122	+ transform: rotate(0deg);
123	+ }
124	+ 100% {
125	+ transform: rotate(359deg);
126	+ }
127	+ }
128	+ .fa-rotate-90 {
129	+ filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=1);
130	+ -webkit-transform: rotate(90deg);
131	+ -moz-transform: rotate(90deg);
132	+ -ms-transform: rotate(90deg);
133	+ -o-transform: rotate(90deg);
134	+ transform: rotate(90deg);
135	+ }
136	+ .fa-rotate-180 {
137	+ filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2);
138	+ -webkit-transform: rotate(180deg);
139	+ -moz-transform: rotate(180deg);
140	+ -ms-transform: rotate(180deg);
141	+ -o-transform: rotate(180deg);
142	+ transform: rotate(180deg);
143	+ }
144	+ .fa-rotate-270 {
145	+ filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=3);
146	+ -webkit-transform: rotate(270deg);
147	+ -moz-transform: rotate(270deg);
148	+ -ms-transform: rotate(270deg);
149	+ -o-transform: rotate(270deg);
150	+ transform: rotate(270deg);
151	+ }
152	+ .fa-flip-horizontal {
153	+ filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1);
154	+ -webkit-transform: scale(-1, 1);
155	+ -moz-transform: scale(-1, 1);
156	+ -ms-transform: scale(-1, 1);
157	+ -o-transform: scale(-1, 1);
158	+ transform: scale(-1, 1);
159	+ }
160	+ .fa-flip-vertical {
161	+ filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1);
162	+ -webkit-transform: scale(1, -1);
163	+ -moz-transform: scale(1, -1);
164	+ -ms-transform: scale(1, -1);
165	+ -o-transform: scale(1, -1);
166	+ transform: scale(1, -1);
167	+ }
168	+ .fa-stack {
169	+ position: relative;
170	+ display: inline-block;
171	+ width: 2em;
172	+ height: 2em;
173	+ line-height: 2em;
174	+ vertical-align: middle;
175	+ }
176	+ .fa-stack-1x,
177	+ .fa-stack-2x {
178	+ position: absolute;
179	+ left: 0;
180	+ width: 100%;
181	+ text-align: center;
182	+ }
183	+ .fa-stack-1x {
184	+ line-height: inherit;
185	+ }
186	+ .fa-stack-2x {
187	+ font-size: 2em;
188	+ }
189	+ .fa-inverse {
190	+ color: #ffffff;
191	+ }
192	+ /* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
193	+ readers do not read off random characters that represent icons */
194	+ .fa-glass:before {
195	+ content: "\f000";
196	+ }
197	+ .fa-music:before {
198	+ content: "\f001";
199	+ }
200	+ .fa-search:before {
201	+ content: "\f002";
202	+ }
203	+ .fa-envelope-o:before {
204	+ content: "\f003";
205	+ }
206	+ .fa-heart:before {
207	+ content: "\f004";
208	+ }
209	+ .fa-star:before {
210	+ content: "\f005";
211	+ }
212	+ .fa-star-o:before {
213	+ content: "\f006";
214	+ }
215	+ .fa-user:before {
216	+ content: "\f007";
217	+ }
218	+ .fa-film:before {
219	+ content: "\f008";
220	+ }
221	+ .fa-th-large:before {
222	+ content: "\f009";
223	+ }
224	+ .fa-th:before {
225	+ content: "\f00a";
226	+ }
227	+ .fa-th-list:before {
228	+ content: "\f00b";
229	+ }
230	+ .fa-check:before {
231	+ content: "\f00c";
232	+ }
233	+ .fa-times:before {
234	+ content: "\f00d";
235	+ }
236	+ .fa-search-plus:before {
237	+ content: "\f00e";
238	+ }
239	+ .fa-search-minus:before {
240	+ content: "\f010";
241	+ }
242	+ .fa-power-off:before {
243	+ content: "\f011";
244	+ }
245	+ .fa-signal:before {
246	+ content: "\f012";
247	+ }
248	+ .fa-gear:before,
249	+ .fa-cog:before {
250	+ content: "\f013";
251	+ }
252	+ .fa-trash-o:before {
253	+ content: "\f014";
254	+ }
255	+ .fa-home:before {
256	+ content: "\f015";
257	+ }
258	+ .fa-file-o:before {
259	+ content: "\f016";
260	+ }
261	+ .fa-clock-o:before {
262	+ content: "\f017";
263	+ }
264	+ .fa-road:before {
265	+ content: "\f018";
266	+ }
267	+ .fa-download:before {
268	+ content: "\f019";
269	+ }
270	+ .fa-arrow-circle-o-down:before {
271	+ content: "\f01a";
272	+ }
273	+ .fa-arrow-circle-o-up:before {
274	+ content: "\f01b";
275	+ }
276	+ .fa-inbox:before {
277	+ content: "\f01c";
278	+ }
279	+ .fa-play-circle-o:before {
280	+ content: "\f01d";
281	+ }
282	+ .fa-rotate-right:before,
283	+ .fa-repeat:before {
284	+ content: "\f01e";
285	+ }
286	+ .fa-refresh:before {
287	+ content: "\f021";
288	+ }
289	+ .fa-list-alt:before {
290	+ content: "\f022";
291	+ }
292	+ .fa-lock:before {
293	+ content: "\f023";
294	+ }
295	+ .fa-flag:before {
296	+ content: "\f024";
297	+ }
298	+ .fa-headphones:before {
299	+ content: "\f025";
300	+ }
301	+ .fa-volume-off:before {
302	+ content: "\f026";
303	+ }
304	+ .fa-volume-down:before {
305	+ content: "\f027";
306	+ }
307	+ .fa-volume-up:before {
308	+ content: "\f028";
309	+ }
310	+ .fa-qrcode:before {
311	+ content: "\f029";
312	+ }
313	+ .fa-barcode:before {
314	+ content: "\f02a";
315	+ }
316	+ .fa-tag:before {
317	+ content: "\f02b";
318	+ }
319	+ .fa-tags:before {
320	+ content: "\f02c";
321	+ }
322	+ .fa-book:before {
323	+ content: "\f02d";
324	+ }
325	+ .fa-bookmark:before {
326	+ content: "\f02e";
327	+ }
328	+ .fa-print:before {
329	+ content: "\f02f";
330	+ }
331	+ .fa-camera:before {
332	+ content: "\f030";
333	+ }
334	+ .fa-font:before {
335	+ content: "\f031";
336	+ }
337	+ .fa-bold:before {
338	+ content: "\f032";
339	+ }
340	+ .fa-italic:before {
341	+ content: "\f033";
342	+ }
343	+ .fa-text-height:before {
344	+ content: "\f034";
345	+ }
346	+ .fa-text-width:before {
347	+ content: "\f035";
348	+ }
349	+ .fa-align-left:before {
350	+ content: "\f036";
351	+ }
352	+ .fa-align-center:before {
353	+ content: "\f037";
354	+ }
355	+ .fa-align-right:before {
356	+ content: "\f038";
357	+ }
358	+ .fa-align-justify:before {
359	+ content: "\f039";
360	+ }
361	+ .fa-list:before {
362	+ content: "\f03a";
363	+ }
364	+ .fa-dedent:before,
365	+ .fa-outdent:before {
366	+ content: "\f03b";
367	+ }
368	+ .fa-indent:before {
369	+ content: "\f03c";
370	+ }
371	+ .fa-video-camera:before {
372	+ content: "\f03d";
373	+ }
374	+ .fa-picture-o:before {
375	+ content: "\f03e";
376	+ }
377	+ .fa-pencil:before {
378	+ content: "\f040";
379	+ }
380	+ .fa-map-marker:before {
381	+ content: "\f041";
382	+ }
383	+ .fa-adjust:before {
384	+ content: "\f042";
385	+ }
386	+ .fa-tint:before {
387	+ content: "\f043";
388	+ }
389	+ .fa-edit:before,
390	+ .fa-pencil-square-o:before {
391	+ content: "\f044";
392	+ }
393	+ .fa-share-square-o:before {
394	+ content: "\f045";
395	+ }
396	+ .fa-check-square-o:before {
397	+ content: "\f046";
398	+ }
399	+ .fa-arrows:before {
400	+ content: "\f047";
401	+ }
402	+ .fa-step-backward:before {
403	+ content: "\f048";
404	+ }
405	+ .fa-fast-backward:before {
406	+ content: "\f049";
407	+ }
408	+ .fa-backward:before {
409	+ content: "\f04a";
410	+ }
411	+ .fa-play:before {
412	+ content: "\f04b";
413	+ }
414	+ .fa-pause:before {
415	+ content: "\f04c";
416	+ }
417	+ .fa-stop:before {
418	+ content: "\f04d";
419	+ }
420	+ .fa-forward:before {
421	+ content: "\f04e";
422	+ }
423	+ .fa-fast-forward:before {
424	+ content: "\f050";
425	+ }
426	+ .fa-step-forward:before {
427	+ content: "\f051";
428	+ }
429	+ .fa-eject:before {
430	+ content: "\f052";
431	+ }
432	+ .fa-chevron-left:before {
433	+ content: "\f053";
434	+ }
435	+ .fa-chevron-right:before {
436	+ content: "\f054";
437	+ }
438	+ .fa-plus-circle:before {
439	+ content: "\f055";
440	+ }
441	+ .fa-minus-circle:before {
442	+ content: "\f056";
443	+ }
444	+ .fa-times-circle:before {
445	+ content: "\f057";
446	+ }
447	+ .fa-check-circle:before {
448	+ content: "\f058";
449	+ }
450	+ .fa-question-circle:before {
451	+ content: "\f059";
452	+ }
453	+ .fa-info-circle:before {
454	+ content: "\f05a";
455	+ }
456	+ .fa-crosshairs:before {
457	+ content: "\f05b";
458	+ }
459	+ .fa-times-circle-o:before {
460	+ content: "\f05c";
461	+ }
462	+ .fa-check-circle-o:before {
463	+ content: "\f05d";
464	+ }
465	+ .fa-ban:before {
466	+ content: "\f05e";
467	+ }
468	+ .fa-arrow-left:before {
469	+ content: "\f060";
470	+ }
471	+ .fa-arrow-right:before {
472	+ content: "\f061";
473	+ }
474	+ .fa-arrow-up:before {
475	+ content: "\f062";
476	+ }
477	+ .fa-arrow-down:before {
478	+ content: "\f063";
479	+ }
480	+ .fa-mail-forward:before,
481	+ .fa-share:before {
482	+ content: "\f064";
483	+ }
484	+ .fa-expand:before {
485	+ content: "\f065";
486	+ }
487	+ .fa-compress:before {
488	+ content: "\f066";
489	+ }
490	+ .fa-plus:before {
491	+ content: "\f067";
492	+ }
493	+ .fa-minus:before {
494	+ content: "\f068";
495	+ }
496	+ .fa-asterisk:before {
497	+ content: "\f069";
498	+ }
499	+ .fa-exclamation-circle:before {
500	+ content: "\f06a";
501	+ }
502	+ .fa-gift:before {
503	+ content: "\f06b";
504	+ }
505	+ .fa-leaf:before {
506	+ content: "\f06c";
507	+ }
508	+ .fa-fire:before {
509	+ content: "\f06d";
510	+ }
511	+ .fa-eye:before {
512	+ content: "\f06e";
513	+ }
514	+ .fa-eye-slash:before {
515	+ content: "\f070";
516	+ }
517	+ .fa-warning:before,
518	+ .fa-exclamation-triangle:before {
519	+ content: "\f071";
520	+ }
521	+ .fa-plane:before {
522	+ content: "\f072";
523	+ }
524	+ .fa-calendar:before {
525	+ content: "\f073";
526	+ }
527	+ .fa-random:before {
528	+ content: "\f074";
529	+ }
530	+ .fa-comment:before {
531	+ content: "\f075";
532	+ }
533	+ .fa-magnet:before {
534	+ content: "\f076";
535	+ }
536	+ .fa-chevron-up:before {
537	+ content: "\f077";
538	+ }
539	+ .fa-chevron-down:before {
540	+ content: "\f078";
541	+ }
542	+ .fa-retweet:before {
543	+ content: "\f079";
544	+ }
545	+ .fa-shopping-cart:before {
546	+ content: "\f07a";
547	+ }
548	+ .fa-folder:before {
549	+ content: "\f07b";
550	+ }
551	+ .fa-folder-open:before {
552	+ content: "\f07c";
553	+ }
554	+ .fa-arrows-v:before {
555	+ content: "\f07d";
556	+ }
557	+ .fa-arrows-h:before {
558	+ content: "\f07e";
559	+ }
560	+ .fa-bar-chart-o:before {
561	+ content: "\f080";
562	+ }
563	+ .fa-twitter-square:before {
564	+ content: "\f081";
565	+ }
566	+ .fa-facebook-square:before {
567	+ content: "\f082";
568	+ }
569	+ .fa-camera-retro:before {
570	+ content: "\f083";
571	+ }
572	+ .fa-key:before {
573	+ content: "\f084";
574	+ }
575	+ .fa-gears:before,
576	+ .fa-cogs:before {
577	+ content: "\f085";
578	+ }
579	+ .fa-comments:before {
580	+ content: "\f086";
581	+ }
582	+ .fa-thumbs-o-up:before {
583	+ content: "\f087";
584	+ }
585	+ .fa-thumbs-o-down:before {
586	+ content: "\f088";
587	+ }
588	+ .fa-star-half:before {
589	+ content: "\f089";
590	+ }
591	+ .fa-heart-o:before {
592	+ content: "\f08a";
593	+ }
594	+ .fa-sign-out:before {
595	+ content: "\f08b";
596	+ }
597	+ .fa-linkedin-square:before {
598	+ content: "\f08c";
599	+ }
600	+ .fa-thumb-tack:before {
601	+ content: "\f08d";
602	+ }
603	+ .fa-external-link:before {
604	+ content: "\f08e";
605	+ }
606	+ .fa-sign-in:before {
607	+ content: "\f090";
608	+ }
609	+ .fa-trophy:before {
610	+ content: "\f091";
611	+ }
612	+ .fa-github-square:before {
613	+ content: "\f092";
614	+ }
615	+ .fa-upload:before {
616	+ content: "\f093";
617	+ }
618	+ .fa-lemon-o:before {
619	+ content: "\f094";
620	+ }
621	+ .fa-phone:before {
622	+ content: "\f095";
623	+ }
624	+ .fa-square-o:before {
625	+ content: "\f096";
626	+ }
627	+ .fa-bookmark-o:before {
628	+ content: "\f097";
629	+ }
630	+ .fa-phone-square:before {
631	+ content: "\f098";
632	+ }
633	+ .fa-twitter:before {
634	+ content: "\f099";
635	+ }
636	+ .fa-facebook:before {
637	+ content: "\f09a";
638	+ }
639	+ .fa-github:before {
640	+ content: "\f09b";
641	+ }
642	+ .fa-unlock:before {
643	+ content: "\f09c";
644	+ }
645	+ .fa-credit-card:before {
646	+ content: "\f09d";
647	+ }
648	+ .fa-rss:before {
649	+ content: "\f09e";
650	+ }
651	+ .fa-hdd-o:before {
652	+ content: "\f0a0";
653	+ }
654	+ .fa-bullhorn:before {
655	+ content: "\f0a1";
656	+ }
657	+ .fa-bell:before {
658	+ content: "\f0f3";
659	+ }
660	+ .fa-certificate:before {
661	+ content: "\f0a3";
662	+ }
663	+ .fa-hand-o-right:before {
664	+ content: "\f0a4";
665	+ }
666	+ .fa-hand-o-left:before {
667	+ content: "\f0a5";
668	+ }
669	+ .fa-hand-o-up:before {
670	+ content: "\f0a6";
671	+ }
672	+ .fa-hand-o-down:before {
673	+ content: "\f0a7";
674	+ }
675	+ .fa-arrow-circle-left:before {
676	+ content: "\f0a8";
677	+ }
678	+ .fa-arrow-circle-right:before {
679	+ content: "\f0a9";
680	+ }
681	+ .fa-arrow-circle-up:before {
682	+ content: "\f0aa";
683	+ }
684	+ .fa-arrow-circle-down:before {
685	+ content: "\f0ab";
686	+ }
687	+ .fa-globe:before {
688	+ content: "\f0ac";
689	+ }
690	+ .fa-wrench:before {
691	+ content: "\f0ad";
692	+ }
693	+ .fa-tasks:before {
694	+ content: "\f0ae";
695	+ }
696	+ .fa-filter:before {
697	+ content: "\f0b0";
698	+ }
699	+ .fa-briefcase:before {
700	+ content: "\f0b1";
701	+ }
702	+ .fa-arrows-alt:before {
703	+ content: "\f0b2";
704	+ }
705	+ .fa-group:before,
706	+ .fa-users:before {
707	+ content: "\f0c0";
708	+ }
709	+ .fa-chain:before,
710	+ .fa-link:before {
711	+ content: "\f0c1";
712	+ }
713	+ .fa-cloud:before {
714	+ content: "\f0c2";
715	+ }
716	+ .fa-flask:before {
717	+ content: "\f0c3";
718	+ }
719	+ .fa-cut:before,
720	+ .fa-scissors:before {
721	+ content: "\f0c4";
722	+ }
723	+ .fa-copy:before,
724	+ .fa-files-o:before {
725	+ content: "\f0c5";
726	+ }
727	+ .fa-paperclip:before {
728	+ content: "\f0c6";
729	+ }
730	+ .fa-save:before,
731	+ .fa-floppy-o:before {
732	+ content: "\f0c7";
733	+ }
734	+ .fa-square:before {
735	+ content: "\f0c8";
736	+ }
737	+ .fa-bars:before {
738	+ content: "\f0c9";
739	+ }
740	+ .fa-list-ul:before {
741	+ content: "\f0ca";
742	+ }
743	+ .fa-list-ol:before {
744	+ content: "\f0cb";
745	+ }
746	+ .fa-strikethrough:before {
747	+ content: "\f0cc";
748	+ }
749	+ .fa-underline:before {
750	+ content: "\f0cd";
751	+ }
752	+ .fa-table:before {
753	+ content: "\f0ce";
754	+ }
755	+ .fa-magic:before {
756	+ content: "\f0d0";
757	+ }
758	+ .fa-truck:before {
759	+ content: "\f0d1";
760	+ }
761	+ .fa-pinterest:before {
762	+ content: "\f0d2";
763	+ }
764	+ .fa-pinterest-square:before {
765	+ content: "\f0d3";
766	+ }
767	+ .fa-google-plus-square:before {
768	+ content: "\f0d4";
769	+ }
770	+ .fa-google-plus:before {
771	+ content: "\f0d5";
772	+ }
773	+ .fa-money:before {
774	+ content: "\f0d6";
775	+ }
776	+ .fa-caret-down:before {
777	+ content: "\f0d7";
778	+ }
779	+ .fa-caret-up:before {
780	+ content: "\f0d8";
781	+ }
782	+ .fa-caret-left:before {
783	+ content: "\f0d9";
784	+ }
785	+ .fa-caret-right:before {
786	+ content: "\f0da";
787	+ }
788	+ .fa-columns:before {
789	+ content: "\f0db";
790	+ }
791	+ .fa-unsorted:before,
792	+ .fa-sort:before {
793	+ content: "\f0dc";
794	+ }
795	+ .fa-sort-down:before,
796	+ .fa-sort-asc:before {
797	+ content: "\f0dd";
798	+ }
799	+ .fa-sort-up:before,
800	+ .fa-sort-desc:before {
801	+ content: "\f0de";
802	+ }
803	+ .fa-envelope:before {
804	+ content: "\f0e0";
805	+ }
806	+ .fa-linkedin:before {
807	+ content: "\f0e1";
808	+ }
809	+ .fa-rotate-left:before,
810	+ .fa-undo:before {
811	+ content: "\f0e2";
812	+ }
813	+ .fa-legal:before,
814	+ .fa-gavel:before {
815	+ content: "\f0e3";
816	+ }
817	+ .fa-dashboard:before,
818	+ .fa-tachometer:before {
819	+ content: "\f0e4";
820	+ }
821	+ .fa-comment-o:before {
822	+ content: "\f0e5";
823	+ }
824	+ .fa-comments-o:before {
825	+ content: "\f0e6";
826	+ }
827	+ .fa-flash:before,
828	+ .fa-bolt:before {
829	+ content: "\f0e7";
830	+ }
831	+ .fa-sitemap:before {
832	+ content: "\f0e8";
833	+ }
834	+ .fa-umbrella:before {
835	+ content: "\f0e9";
836	+ }
837	+ .fa-paste:before,
838	+ .fa-clipboard:before {
839	+ content: "\f0ea";
840	+ }
841	+ .fa-lightbulb-o:before {
842	+ content: "\f0eb";
843	+ }
844	+ .fa-exchange:before {
845	+ content: "\f0ec";
846	+ }
847	+ .fa-cloud-download:before {
848	+ content: "\f0ed";
849	+ }
850	+ .fa-cloud-upload:before {
851	+ content: "\f0ee";
852	+ }
853	+ .fa-user-md:before {
854	+ content: "\f0f0";
855	+ }
856	+ .fa-stethoscope:before {
857	+ content: "\f0f1";
858	+ }
859	+ .fa-suitcase:before {
860	+ content: "\f0f2";
861	+ }
862	+ .fa-bell-o:before {
863	+ content: "\f0a2";
864	+ }
865	+ .fa-coffee:before {
866	+ content: "\f0f4";
867	+ }
868	+ .fa-cutlery:before {
869	+ content: "\f0f5";
870	+ }
871	+ .fa-file-text-o:before {
872	+ content: "\f0f6";
873	+ }
874	+ .fa-building-o:before {
875	+ content: "\f0f7";
876	+ }
877	+ .fa-hospital-o:before {
878	+ content: "\f0f8";
879	+ }
880	+ .fa-ambulance:before {
881	+ content: "\f0f9";
882	+ }
883	+ .fa-medkit:before {
884	+ content: "\f0fa";
885	+ }
886	+ .fa-fighter-jet:before {
887	+ content: "\f0fb";
888	+ }
889	+ .fa-beer:before {
890	+ content: "\f0fc";
891	+ }
892	+ .fa-h-square:before {
893	+ content: "\f0fd";
894	+ }
895	+ .fa-plus-square:before {
896	+ content: "\f0fe";
897	+ }
898	+ .fa-angle-double-left:before {
899	+ content: "\f100";
900	+ }
901	+ .fa-angle-double-right:before {
902	+ content: "\f101";
903	+ }
904	+ .fa-angle-double-up:before {
905	+ content: "\f102";
906	+ }
907	+ .fa-angle-double-down:before {
908	+ content: "\f103";
909	+ }
910	+ .fa-angle-left:before {
911	+ content: "\f104";
912	+ }
913	+ .fa-angle-right:before {
914	+ content: "\f105";
915	+ }
916	+ .fa-angle-up:before {
917	+ content: "\f106";
918	+ }
919	+ .fa-angle-down:before {
920	+ content: "\f107";
921	+ }
922	+ .fa-desktop:before {
923	+ content: "\f108";
924	+ }
925	+ .fa-laptop:before {
926	+ content: "\f109";
927	+ }
928	+ .fa-tablet:before {
929	+ content: "\f10a";
930	+ }
931	+ .fa-mobile-phone:before,
932	+ .fa-mobile:before {
933	+ content: "\f10b";
934	+ }
935	+ .fa-circle-o:before {
936	+ content: "\f10c";
937	+ }
938	+ .fa-quote-left:before {
939	+ content: "\f10d";
940	+ }
941	+ .fa-quote-right:before {
942	+ content: "\f10e";
943	+ }
944	+ .fa-spinner:before {
945	+ content: "\f110";
946	+ }
947	+ .fa-circle:before {
948	+ content: "\f111";
949	+ }
950	+ .fa-mail-reply:before,
951	+ .fa-reply:before {
952	+ content: "\f112";
953	+ }
954	+ .fa-github-alt:before {
955	+ content: "\f113";
956	+ }
957	+ .fa-folder-o:before {
958	+ content: "\f114";
959	+ }
960	+ .fa-folder-open-o:before {
961	+ content: "\f115";
962	+ }
963	+ .fa-smile-o:before {
964	+ content: "\f118";
965	+ }
966	+ .fa-frown-o:before {
967	+ content: "\f119";
968	+ }
969	+ .fa-meh-o:before {
970	+ content: "\f11a";
971	+ }
972	+ .fa-gamepad:before {
973	+ content: "\f11b";
974	+ }
975	+ .fa-keyboard-o:before {
976	+ content: "\f11c";
977	+ }
978	+ .fa-flag-o:before {
979	+ content: "\f11d";
980	+ }
981	+ .fa-flag-checkered:before {
982	+ content: "\f11e";
983	+ }
984	+ .fa-terminal:before {
985	+ content: "\f120";
986	+ }
987	+ .fa-code:before {
988	+ content: "\f121";
989	+ }
990	+ .fa-reply-all:before {
991	+ content: "\f122";
992	+ }
993	+ .fa-mail-reply-all:before {
994	+ content: "\f122";
995	+ }
996	+ .fa-star-half-empty:before,
997	+ .fa-star-half-full:before,
998	+ .fa-star-half-o:before {
999	+ content: "\f123";
1000	+ }
1001	+ .fa-location-arrow:before {
1002	+ content: "\f124";
1003	+ }
1004	+ .fa-crop:before {
1005	+ content: "\f125";
1006	+ }
1007	+ .fa-code-fork:before {
1008	+ content: "\f126";
1009	+ }
1010	+ .fa-unlink:before,
1011	+ .fa-chain-broken:before {
1012	+ content: "\f127";
1013	+ }
1014	+ .fa-question:before {
1015	+ content: "\f128";
1016	+ }
1017	+ .fa-info:before {
1018	+ content: "\f129";
1019	+ }
1020	+ .fa-exclamation:before {
1021	+ content: "\f12a";
1022	+ }
1023	+ .fa-superscript:before {
1024	+ content: "\f12b";
1025	+ }
1026	+ .fa-subscript:before {
1027	+ content: "\f12c";
1028	+ }
1029	+ .fa-eraser:before {
1030	+ content: "\f12d";
1031	+ }
1032	+ .fa-puzzle-piece:before {
1033	+ content: "\f12e";
1034	+ }
1035	+ .fa-microphone:before {
1036	+ content: "\f130";
1037	+ }
1038	+ .fa-microphone-slash:before {
1039	+ content: "\f131";
1040	+ }
1041	+ .fa-shield:before {
1042	+ content: "\f132";
1043	+ }
1044	+ .fa-calendar-o:before {
1045	+ content: "\f133";
1046	+ }
1047	+ .fa-fire-extinguisher:before {
1048	+ content: "\f134";
1049	+ }
1050	+ .fa-rocket:before {
1051	+ content: "\f135";
1052	+ }
1053	+ .fa-maxcdn:before {
1054	+ content: "\f136";
1055	+ }
1056	+ .fa-chevron-circle-left:before {
1057	+ content: "\f137";
1058	+ }
1059	+ .fa-chevron-circle-right:before {
1060	+ content: "\f138";
1061	+ }
1062	+ .fa-chevron-circle-up:before {
1063	+ content: "\f139";
1064	+ }
1065	+ .fa-chevron-circle-down:before {
1066	+ content: "\f13a";
1067	+ }
1068	+ .fa-html5:before {
1069	+ content: "\f13b";
1070	+ }
1071	+ .fa-css3:before {
1072	+ content: "\f13c";
1073	+ }
1074	+ .fa-anchor:before {
1075	+ content: "\f13d";
1076	+ }
1077	+ .fa-unlock-alt:before {
1078	+ content: "\f13e";
1079	+ }
1080	+ .fa-bullseye:before {
1081	+ content: "\f140";
1082	+ }
1083	+ .fa-ellipsis-h:before {
1084	+ content: "\f141";
1085	+ }
1086	+ .fa-ellipsis-v:before {
1087	+ content: "\f142";
1088	+ }
1089	+ .fa-rss-square:before {
1090	+ content: "\f143";
1091	+ }
1092	+ .fa-play-circle:before {
1093	+ content: "\f144";
1094	+ }
1095	+ .fa-ticket:before {
1096	+ content: "\f145";
1097	+ }
1098	+ .fa-minus-square:before {
1099	+ content: "\f146";
1100	+ }
1101	+ .fa-minus-square-o:before {
1102	+ content: "\f147";
1103	+ }
1104	+ .fa-level-up:before {
1105	+ content: "\f148";
1106	+ }
1107	+ .fa-level-down:before {
1108	+ content: "\f149";
1109	+ }
1110	+ .fa-check-square:before {
1111	+ content: "\f14a";
1112	+ }
1113	+ .fa-pencil-square:before {
1114	+ content: "\f14b";
1115	+ }
1116	+ .fa-external-link-square:before {
1117	+ content: "\f14c";
1118	+ }
1119	+ .fa-share-square:before {
1120	+ content: "\f14d";
1121	+ }
1122	+ .fa-compass:before {
1123	+ content: "\f14e";
1124	+ }
1125	+ .fa-toggle-down:before,
1126	+ .fa-caret-square-o-down:before {
1127	+ content: "\f150";
1128	+ }
1129	+ .fa-toggle-up:before,
1130	+ .fa-caret-square-o-up:before {
1131	+ content: "\f151";
1132	+ }
1133	+ .fa-toggle-right:before,
1134	+ .fa-caret-square-o-right:before {
1135	+ content: "\f152";
1136	+ }
1137	+ .fa-euro:before,
1138	+ .fa-eur:before {
1139	+ content: "\f153";
1140	+ }
1141	+ .fa-gbp:before {
1142	+ content: "\f154";
1143	+ }
1144	+ .fa-dollar:before,
1145	+ .fa-usd:before {
1146	+ content: "\f155";
1147	+ }
1148	+ .fa-rupee:before,
1149	+ .fa-inr:before {
1150	+ content: "\f156";
1151	+ }
1152	+ .fa-cny:before,
1153	+ .fa-rmb:before,
1154	+ .fa-yen:before,
1155	+ .fa-jpy:before {
1156	+ content: "\f157";
1157	+ }
1158	+ .fa-ruble:before,
1159	+ .fa-rouble:before,
1160	+ .fa-rub:before {
1161	+ content: "\f158";
1162	+ }
1163	+ .fa-won:before,
1164	+ .fa-krw:before {
1165	+ content: "\f159";
1166	+ }
1167	+ .fa-bitcoin:before,
1168	+ .fa-btc:before {
1169	+ content: "\f15a";
1170	+ }
1171	+ .fa-file:before {
1172	+ content: "\f15b";
1173	+ }
1174	+ .fa-file-text:before {
1175	+ content: "\f15c";
1176	+ }
1177	+ .fa-sort-alpha-asc:before {
1178	+ content: "\f15d";
1179	+ }
1180	+ .fa-sort-alpha-desc:before {
1181	+ content: "\f15e";
1182	+ }
1183	+ .fa-sort-amount-asc:before {
1184	+ content: "\f160";
1185	+ }
1186	+ .fa-sort-amount-desc:before {
1187	+ content: "\f161";
1188	+ }
1189	+ .fa-sort-numeric-asc:before {
1190	+ content: "\f162";
1191	+ }
1192	+ .fa-sort-numeric-desc:before {
1193	+ content: "\f163";
1194	+ }
1195	+ .fa-thumbs-up:before {
1196	+ content: "\f164";
1197	+ }
1198	+ .fa-thumbs-down:before {
1199	+ content: "\f165";
1200	+ }
1201	+ .fa-youtube-square:before {
1202	+ content: "\f166";
1203	+ }
1204	+ .fa-youtube:before {
1205	+ content: "\f167";
1206	+ }
1207	+ .fa-xing:before {
1208	+ content: "\f168";
1209	+ }
1210	+ .fa-xing-square:before {
1211	+ content: "\f169";
1212	+ }
1213	+ .fa-youtube-play:before {
1214	+ content: "\f16a";
1215	+ }
1216	+ .fa-dropbox:before {
1217	+ content: "\f16b";
1218	+ }
1219	+ .fa-stack-overflow:before {
1220	+ content: "\f16c";
1221	+ }
1222	+ .fa-instagram:before {
1223	+ content: "\f16d";
1224	+ }
1225	+ .fa-flickr:before {
1226	+ content: "\f16e";
1227	+ }
1228	+ .fa-adn:before {
1229	+ content: "\f170";
1230	+ }
1231	+ .fa-bitbucket:before {
1232	+ content: "\f171";
1233	+ }
1234	+ .fa-bitbucket-square:before {
1235	+ content: "\f172";
1236	+ }
1237	+ .fa-tumblr:before {
1238	+ content: "\f173";
1239	+ }
1240	+ .fa-tumblr-square:before {
1241	+ content: "\f174";
1242	+ }
1243	+ .fa-long-arrow-down:before {
1244	+ content: "\f175";
1245	+ }
1246	+ .fa-long-arrow-up:before {
1247	+ content: "\f176";
1248	+ }
1249	+ .fa-long-arrow-left:before {
1250	+ content: "\f177";
1251	+ }
1252	+ .fa-long-arrow-right:before {
1253	+ content: "\f178";
1254	+ }
1255	+ .fa-apple:before {
1256	+ content: "\f179";
1257	+ }
1258	+ .fa-windows:before {
1259	+ content: "\f17a";
1260	+ }
1261	+ .fa-android:before {
1262	+ content: "\f17b";
1263	+ }
1264	+ .fa-linux:before {
1265	+ content: "\f17c";
1266	+ }
1267	+ .fa-dribbble:before {
1268	+ content: "\f17d";
1269	+ }
1270	+ .fa-skype:before {
1271	+ content: "\f17e";
1272	+ }
1273	+ .fa-foursquare:before {
1274	+ content: "\f180";
1275	+ }
1276	+ .fa-trello:before {
1277	+ content: "\f181";
1278	+ }
1279	+ .fa-female:before {
1280	+ content: "\f182";
1281	+ }
1282	+ .fa-male:before {
1283	+ content: "\f183";
1284	+ }
1285	+ .fa-gittip:before {
1286	+ content: "\f184";
1287	+ }
1288	+ .fa-sun-o:before {
1289	+ content: "\f185";
1290	+ }
1291	+ .fa-moon-o:before {
1292	+ content: "\f186";
1293	+ }
1294	+ .fa-archive:before {
1295	+ content: "\f187";
1296	+ }
1297	+ .fa-bug:before {
1298	+ content: "\f188";
1299	+ }
1300	+ .fa-vk:before {
1301	+ content: "\f189";
1302	+ }
1303	+ .fa-weibo:before {
1304	+ content: "\f18a";
1305	+ }
1306	+ .fa-renren:before {
1307	+ content: "\f18b";
1308	+ }
1309	+ .fa-pagelines:before {
1310	+ content: "\f18c";
1311	+ }
1312	+ .fa-stack-exchange:before {
1313	+ content: "\f18d";
1314	+ }
1315	+ .fa-arrow-circle-o-right:before {
1316	+ content: "\f18e";
1317	+ }
1318	+ .fa-arrow-circle-o-left:before {
1319	+ content: "\f190";
1320	+ }
1321	+ .fa-toggle-left:before,
1322	+ .fa-caret-square-o-left:before {
1323	+ content: "\f191";
1324	+ }
1325	+ .fa-dot-circle-o:before {
1326	+ content: "\f192";
1327	+ }
1328	+ .fa-wheelchair:before {
1329	+ content: "\f193";
1330	+ }
1331	+ .fa-vimeo-square:before {
1332	+ content: "\f194";
1333	+ }
1334	+ .fa-turkish-lira:before,
1335	+ .fa-try:before {
1336	+ content: "\f195";
1337	+ }
1338	+ .fa-plus-square-o:before {
1339	+ content: "\f196";
1340	+ }

css/input.css ADDED Viewed

	@@ -0,0 +1,4 @@


1	+ .select2-drop,
2	+ .select2-chosen {
3	+ font-family: 'FontAwesome', 'Open Sans', sans-serif;
4	+ }

css/select2.css ADDED Viewed

	@@ -0,0 +1,615 @@


1	+ /*
2	+ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
3	+ */
4	+ .select2-container {
5	+ margin: 0;
6	+ position: relative;
7	+ display: inline-block;
8	+ /* inline-block for ie7 */
9	+ zoom: 1;
10	+ *display: inline;
11	+ vertical-align: middle;
12	+ }
13	+
14	+ .select2-container,
15	+ .select2-drop,
16	+ .select2-search,
17	+ .select2-search input {
18	+ /*
19	+ Force border-box so that % widths fit the parent
20	+ container without overlap because of margin/padding.
21	+
22	+ More Info : http://www.quirksmode.org/css/box.html
23	+ */
24	+ -webkit-box-sizing: border-box; /* webkit */
25	+ -moz-box-sizing: border-box; /* firefox */
26	+ box-sizing: border-box; /* css3 */
27	+ }
28	+
29	+ .select2-container .select2-choice {
30	+ display: block;
31	+ height: 26px;
32	+ padding: 0 0 0 8px;
33	+ overflow: hidden;
34	+ position: relative;
35	+
36	+ border: 1px solid #aaa;
37	+ white-space: nowrap;
38	+ line-height: 26px;
39	+ color: #444;
40	+ text-decoration: none;
41	+
42	+ border-radius: 4px;
43	+
44	+ background-clip: padding-box;
45	+
46	+ -webkit-touch-callout: none;
47	+ -webkit-user-select: none;
48	+ -moz-user-select: none;
49	+ -ms-user-select: none;
50	+ user-select: none;
51	+
52	+ background-color: #fff;
53	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
54	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
55	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
56	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
57	+ background-image: linear-gradient(top, #fff 0%, #eee 50%);
58	+ }
59	+
60	+ .select2-container.select2-drop-above .select2-choice {
61	+ border-bottom-color: #aaa;
62	+
63	+ border-radius: 0 0 4px 4px;
64	+
65	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
66	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
67	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
68	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
69	+ background-image: linear-gradient(top, #eee 0%, #fff 90%);
70	+ }
71	+
72	+ .select2-container.select2-allowclear .select2-choice .select2-chosen {
73	+ margin-right: 42px;
74	+ }
75	+
76	+ .select2-container .select2-choice > .select2-chosen {
77	+ margin-right: 26px;
78	+ display: block;
79	+ overflow: hidden;
80	+
81	+ white-space: nowrap;
82	+
83	+ text-overflow: ellipsis;
84	+ }
85	+
86	+ .select2-container .select2-choice abbr {
87	+ display: none;
88	+ width: 12px;
89	+ height: 12px;
90	+ position: absolute;
91	+ right: 24px;
92	+ top: 8px;
93	+
94	+ font-size: 1px;
95	+ text-decoration: none;
96	+
97	+ border: 0;
98	+ background: url('../images/select2.png') right top no-repeat;
99	+ cursor: pointer;
100	+ outline: 0;
101	+ }
102	+
103	+ .select2-container.select2-allowclear .select2-choice abbr {
104	+ display: inline-block;
105	+ }
106	+
107	+ .select2-container .select2-choice abbr:hover {
108	+ background-position: right -11px;
109	+ cursor: pointer;
110	+ }
111	+
112	+ .select2-drop-mask {
113	+ border: 0;
114	+ margin: 0;
115	+ padding: 0;
116	+ position: fixed;
117	+ left: 0;
118	+ top: 0;
119	+ min-height: 100%;
120	+ min-width: 100%;
121	+ height: auto;
122	+ width: auto;
123	+ opacity: 0;
124	+ z-index: 9998;
125	+ /* styles required for IE to work */
126	+ background-color: #fff;
127	+ filter: alpha(opacity=0);
128	+ }
129	+
130	+ .select2-drop {
131	+ width: 100%;
132	+ margin-top: -1px;
133	+ position: absolute;
134	+ z-index: 9999;
135	+ top: 100%;
136	+
137	+ background: #fff;
138	+ color: #000;
139	+ border: 1px solid #aaa;
140	+ border-top: 0;
141	+
142	+ border-radius: 0 0 4px 4px;
143	+
144	+ -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
145	+ box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
146	+ }
147	+
148	+ .select2-drop-auto-width {
149	+ border-top: 1px solid #aaa;
150	+ width: auto;
151	+ }
152	+
153	+ .select2-drop-auto-width .select2-search {
154	+ padding-top: 4px;
155	+ }
156	+
157	+ .select2-drop.select2-drop-above {
158	+ margin-top: 1px;
159	+ border-top: 1px solid #aaa;
160	+ border-bottom: 0;
161	+
162	+ border-radius: 4px 4px 0 0;
163	+
164	+ -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
165	+ box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
166	+ }
167	+
168	+ .select2-drop-active {
169	+ border: 1px solid #5897fb;
170	+ border-top: none;
171	+ }
172	+
173	+ .select2-drop.select2-drop-above.select2-drop-active {
174	+ border-top: 1px solid #5897fb;
175	+ }
176	+
177	+ .select2-container .select2-choice .select2-arrow {
178	+ display: inline-block;
179	+ width: 18px;
180	+ height: 100%;
181	+ position: absolute;
182	+ right: 0;
183	+ top: 0;
184	+
185	+ border-left: 1px solid #aaa;
186	+ border-radius: 0 4px 4px 0;
187	+
188	+ background-clip: padding-box;
189	+
190	+ background: #ccc;
191	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
192	+ background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
193	+ background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
194	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
195	+ background-image: linear-gradient(top, #ccc 0%, #eee 60%);
196	+ }
197	+
198	+ .select2-container .select2-choice .select2-arrow b {
199	+ display: block;
200	+ width: 100%;
201	+ height: 100%;
202	+ background: url('../images/select2.png') no-repeat 0 1px;
203	+ }
204	+
205	+ .select2-search {
206	+ display: inline-block;
207	+ width: 100%;
208	+ min-height: 26px;
209	+ margin: 0;
210	+ padding-left: 4px;
211	+ padding-right: 4px;
212	+
213	+ position: relative;
214	+ z-index: 10000;
215	+
216	+ white-space: nowrap;
217	+ }
218	+
219	+ .select2-search input {
220	+ width: 100%;
221	+ height: auto !important;
222	+ min-height: 26px;
223	+ padding: 4px 20px 4px 5px;
224	+ margin: 0;
225	+
226	+ outline: 0;
227	+ font-family: sans-serif;
228	+ font-size: 1em;
229	+
230	+ border: 1px solid #aaa;
231	+ border-radius: 0;
232	+
233	+ -webkit-box-shadow: none;
234	+ box-shadow: none;
235	+
236	+ background: #fff url('../images/select2.png') no-repeat 100% -22px;
237	+ background: url('../images/select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
238	+ background: url('../images/select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
239	+ background: url('../images/select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
240	+ background: url('../images/select2.png') no-repeat 100% -22px, linear-gradient(top, #fff 85%, #eee 99%);
241	+ }
242	+
243	+ .select2-drop.select2-drop-above .select2-search input {
244	+ margin-top: 4px;
245	+ }
246	+
247	+ .select2-search input.select2-active {
248	+ background: #fff url('../images/select2-spinner.gif') no-repeat 100%;
249	+ background: url('../images/select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
250	+ background: url('../images/select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
251	+ background: url('../images/select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
252	+ background: url('../images/select2-spinner.gif') no-repeat 100%, linear-gradient(top, #fff 85%, #eee 99%);
253	+ }
254	+
255	+ .select2-container-active .select2-choice,
256	+ .select2-container-active .select2-choices {
257	+ border: 1px solid #5897fb;
258	+ outline: none;
259	+
260	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
261	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
262	+ }
263	+
264	+ .select2-dropdown-open .select2-choice {
265	+ border-bottom-color: transparent;
266	+ -webkit-box-shadow: 0 1px 0 #fff inset;
267	+ box-shadow: 0 1px 0 #fff inset;
268	+
269	+ border-bottom-left-radius: 0;
270	+ border-bottom-right-radius: 0;
271	+
272	+ background-color: #eee;
273	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
274	+ background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
275	+ background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
276	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
277	+ background-image: linear-gradient(top, #fff 0%, #eee 50%);
278	+ }
279	+
280	+ .select2-dropdown-open.select2-drop-above .select2-choice,
281	+ .select2-dropdown-open.select2-drop-above .select2-choices {
282	+ border: 1px solid #5897fb;
283	+ border-top-color: transparent;
284	+
285	+ background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
286	+ background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
287	+ background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
288	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
289	+ background-image: linear-gradient(bottom, #fff 0%, #eee 50%);
290	+ }
291	+
292	+ .select2-dropdown-open .select2-choice .select2-arrow {
293	+ background: transparent;
294	+ border-left: none;
295	+ filter: none;
296	+ }
297	+ .select2-dropdown-open .select2-choice .select2-arrow b {
298	+ background-position: -18px 1px;
299	+ }
300	+
301	+ /* results */
302	+ .select2-results {
303	+ max-height: 200px;
304	+ padding: 0 0 0 4px;
305	+ margin: 4px 4px 4px 0;
306	+ position: relative;
307	+ overflow-x: hidden;
308	+ overflow-y: auto;
309	+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
310	+ }
311	+
312	+ .select2-results ul.select2-result-sub {
313	+ margin: 0;
314	+ padding-left: 0;
315	+ }
316	+
317	+ .select2-results ul.select2-result-sub > li .select2-result-label { padding-left: 20px }
318	+ .select2-results ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 40px }
319	+ .select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 60px }
320	+ .select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 80px }
321	+ .select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 100px }
322	+ .select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 110px }
323	+ .select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub > li .select2-result-label { padding-left: 120px }
324	+
325	+ .select2-results li {
326	+ list-style: none;
327	+ display: list-item;
328	+ background-image: none;
329	+ }
330	+
331	+ .select2-results li.select2-result-with-children > .select2-result-label {
332	+ font-weight: bold;
333	+ }
334	+
335	+ .select2-results .select2-result-label {
336	+ padding: 3px 7px 4px;
337	+ margin: 0;
338	+ cursor: pointer;
339	+
340	+ min-height: 1em;
341	+
342	+ -webkit-touch-callout: none;
343	+ -webkit-user-select: none;
344	+ -moz-user-select: none;
345	+ -ms-user-select: none;
346	+ user-select: none;
347	+ }
348	+
349	+ .select2-results .select2-highlighted {
350	+ background: #3875d7;
351	+ color: #fff;
352	+ }
353	+
354	+ .select2-results li em {
355	+ background: #feffde;
356	+ font-style: normal;
357	+ }
358	+
359	+ .select2-results .select2-highlighted em {
360	+ background: transparent;
361	+ }
362	+
363	+ .select2-results .select2-highlighted ul {
364	+ background: #fff;
365	+ color: #000;
366	+ }
367	+
368	+
369	+ .select2-results .select2-no-results,
370	+ .select2-results .select2-searching,
371	+ .select2-results .select2-selection-limit {
372	+ background: #f4f4f4;
373	+ display: list-item;
374	+ }
375	+
376	+ /*
377	+ disabled look for disabled choices in the results dropdown
378	+ */
379	+ .select2-results .select2-disabled.select2-highlighted {
380	+ color: #666;
381	+ background: #f4f4f4;
382	+ display: list-item;
383	+ cursor: default;
384	+ }
385	+ .select2-results .select2-disabled {
386	+ background: #f4f4f4;
387	+ display: list-item;
388	+ cursor: default;
389	+ }
390	+
391	+ .select2-results .select2-selected {
392	+ display: none;
393	+ }
394	+
395	+ .select2-more-results.select2-active {
396	+ background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
397	+ }
398	+
399	+ .select2-more-results {
400	+ background: #f4f4f4;
401	+ display: list-item;
402	+ }
403	+
404	+ /* disabled styles */
405	+
406	+ .select2-container.select2-container-disabled .select2-choice {
407	+ background-color: #f4f4f4;
408	+ background-image: none;
409	+ border: 1px solid #ddd;
410	+ cursor: default;
411	+ }
412	+
413	+ .select2-container.select2-container-disabled .select2-choice .select2-arrow {
414	+ background-color: #f4f4f4;
415	+ background-image: none;
416	+ border-left: 0;
417	+ }
418	+
419	+ .select2-container.select2-container-disabled .select2-choice abbr {
420	+ display: none;
421	+ }
422	+
423	+
424	+ /* multiselect */
425	+
426	+ .select2-container-multi .select2-choices {
427	+ height: auto !important;
428	+ height: 1%;
429	+ margin: 0;
430	+ padding: 0;
431	+ position: relative;
432	+
433	+ border: 1px solid #aaa;
434	+ cursor: text;
435	+ overflow: hidden;
436	+
437	+ background-color: #fff;
438	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
439	+ background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
440	+ background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
441	+ background-image: linear-gradient(top, #eee 1%, #fff 15%);
442	+ }
443	+
444	+ .select2-locked {
445	+ padding: 3px 5px 3px 5px !important;
446	+ }
447	+
448	+ .select2-container-multi .select2-choices {
449	+ min-height: 26px;
450	+ }
451	+
452	+ .select2-container-multi.select2-container-active .select2-choices {
453	+ border: 1px solid #5897fb;
454	+ outline: none;
455	+
456	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
457	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
458	+ }
459	+ .select2-container-multi .select2-choices li {
460	+ float: left;
461	+ list-style: none;
462	+ }
463	+ .select2-container-multi .select2-choices .select2-search-field {
464	+ margin: 0;
465	+ padding: 0;
466	+ white-space: nowrap;
467	+ }
468	+
469	+ .select2-container-multi .select2-choices .select2-search-field input {
470	+ padding: 5px;
471	+ margin: 1px 0;
472	+
473	+ font-family: sans-serif;
474	+ font-size: 100%;
475	+ color: #666;
476	+ outline: 0;
477	+ border: 0;
478	+ -webkit-box-shadow: none;
479	+ box-shadow: none;
480	+ background: transparent !important;
481	+ }
482	+
483	+ .select2-container-multi .select2-choices .select2-search-field input.select2-active {
484	+ background: #fff url('select2-spinner.gif') no-repeat 100% !important;
485	+ }
486	+
487	+ .select2-default {
488	+ color: #999 !important;
489	+ }
490	+
491	+ .select2-container-multi .select2-choices .select2-search-choice {
492	+ padding: 3px 5px 3px 18px;
493	+ margin: 3px 0 3px 5px;
494	+ position: relative;
495	+
496	+ line-height: 13px;
497	+ color: #333;
498	+ cursor: default;
499	+ border: 1px solid #aaaaaa;
500	+
501	+ border-radius: 3px;
502	+
503	+ -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
504	+ box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
505	+
506	+ background-clip: padding-box;
507	+
508	+ -webkit-touch-callout: none;
509	+ -webkit-user-select: none;
510	+ -moz-user-select: none;
511	+ -ms-user-select: none;
512	+ user-select: none;
513	+
514	+ background-color: #e4e4e4;
515	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
516	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
517	+ background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
518	+ background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
519	+ background-image: linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
520	+ }
521	+ .select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
522	+ cursor: default;
523	+ }
524	+ .select2-container-multi .select2-choices .select2-search-choice-focus {
525	+ background: #d4d4d4;
526	+ }
527	+
528	+ .select2-search-choice-close {
529	+ display: block;
530	+ width: 12px;
531	+ height: 13px;
532	+ position: absolute;
533	+ right: 3px;
534	+ top: 4px;
535	+
536	+ font-size: 1px;
537	+ outline: none;
538	+ background: url('../images/select2.png') right top no-repeat;
539	+ }
540	+
541	+ .select2-container-multi .select2-search-choice-close {
542	+ left: 3px;
543	+ }
544	+
545	+ .select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
546	+ background-position: right -11px;
547	+ }
548	+ .select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
549	+ background-position: right -11px;
550	+ }
551	+
552	+ /* disabled styles */
553	+ .select2-container-multi.select2-container-disabled .select2-choices {
554	+ background-color: #f4f4f4;
555	+ background-image: none;
556	+ border: 1px solid #ddd;
557	+ cursor: default;
558	+ }
559	+
560	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
561	+ padding: 3px 5px 3px 5px;
562	+ border: 1px solid #ddd;
563	+ background-image: none;
564	+ background-color: #f4f4f4;
565	+ }
566	+
567	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
568	+ background: none;
569	+ }
570	+ /* end multiselect */
571	+
572	+
573	+ .select2-result-selectable .select2-match,
574	+ .select2-result-unselectable .select2-match {
575	+ text-decoration: underline;
576	+ }
577	+
578	+ .select2-offscreen, .select2-offscreen:focus {
579	+ clip: rect(0 0 0 0) !important;
580	+ width: 1px !important;
581	+ height: 1px !important;
582	+ border: 0 !important;
583	+ margin: 0 !important;
584	+ padding: 0 !important;
585	+ overflow: hidden !important;
586	+ position: absolute !important;
587	+ outline: 0 !important;
588	+ left: 0px !important;
589	+ top: 0px !important;
590	+ }
591	+
592	+ .select2-display-none {
593	+ display: none;
594	+ }
595	+
596	+ .select2-measure-scrollbar {
597	+ position: absolute;
598	+ top: -10000px;
599	+ left: -10000px;
600	+ width: 100px;
601	+ height: 100px;
602	+ overflow: scroll;
603	+ }
604	+ /* Retina-ize icons */
605	+
606	+ @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 144dpi) {
607	+ .select2-search input, .select2-search-choice-close, .select2-container .select2-choice abbr, .select2-container .select2-choice .select2-arrow b {
608	+ background-image: url('select2x2.png') !important;
609	+ background-repeat: no-repeat !important;
610	+ background-size: 60px 40px !important;
611	+ }
612	+ .select2-search input {
613	+ background-position: 100% -21px !important;
614	+ }
615	+ }

font-awesome-v4.php ADDED Viewed

	@@ -0,0 +1,756 @@


1	+ <?php
2	+
3	+ class acf_field_font_awesome extends acf_field
4	+ {
5	+ // vars
6	+ var $settings, // will hold info such as dir / path
7	+ $defaults; // will hold default field options
8	+
9	+ /*
10	+ * __construct
11	+ *
12	+ * Set name / label needed for actions / filters
13	+ *
14	+ * @since 3.6
15	+ * @date 23/01/13
16	+ */
17	+
18	+ function __construct()
19	+ {
20	+ // vars
21	+ $this->name = 'font-awesome';
22	+ $this->label = __('Font Awesome Icon');
23	+ $this->category = __("Content",'acf'); // Basic, Content, Choice, etc
24	+ $this->defaults = array(
25	+ 'enqueue_fa' => 0,
26	+ 'allow_null' => 0,
27	+ 'save_format' => 'element',
28	+ 'default_value' => '',
29	+ 'choices' => array(
30	+ 'fa-glass' => __(' fa-glass'),
31	+ 'fa-music' => __(' fa-music'),
32	+ 'fa-search' => __(' fa-search'),
33	+ 'fa-envelope-o' => __(' fa-envelope-o'),
34	+ 'fa-heart' => __(' fa-heart'),
35	+ 'fa-star' => __(' fa-star'),
36	+ 'fa-star-o' => __(' fa-star-o'),
37	+ 'fa-user' => __(' fa-user'),
38	+ 'fa-film' => __(' fa-film'),
39	+ 'fa-th-large' => __(' fa-th-large'),
40	+ 'fa-th' => __(' fa-th'),
41	+ 'fa-th-list' => __(' fa-th-list'),
42	+ 'fa-check' => __(' fa-check'),
43	+ 'fa-times' => __(' fa-times'),
44	+ 'fa-search-plus' => __(' fa-search-plus'),
45	+ 'fa-search-minus' => __(' fa-search-minus'),
46	+ 'fa-power-off' => __(' fa-power-off'),
47	+ 'fa-signal' => __(' fa-signal'),
48	+ 'fa-cog' => __(' fa-cog'),
49	+ 'fa-trash-o' => __(' fa-trash-o'),
50	+ 'fa-home' => __(' fa-home'),
51	+ 'fa-file-o' => __(' fa-file-o'),
52	+ 'fa-clock-o' => __(' fa-clock-o'),
53	+ 'fa-road' => __(' fa-road'),
54	+ 'fa-download' => __(' fa-download'),
55	+ 'fa-arrow-circle-o-down' => __(' fa-arrow-circle-o-down'),
56	+ 'fa-arrow-circle-o-up' => __(' fa-arrow-circle-o-up'),
57	+ 'fa-inbox' => __(' fa-inbox'),
58	+ 'fa-play-circle-o' => __(' fa-play-circle-o'),
59	+ 'fa-repeat' => __(' fa-repeat'),
60	+ 'fa-refresh' => __(' fa-refresh'),
61	+ 'fa-list-alt' => __(' fa-list-alt'),
62	+ 'fa-lock' => __(' fa-lock'),
63	+ 'fa-flag' => __(' fa-flag'),
64	+ 'fa-headphones' => __(' fa-headphones'),
65	+ 'fa-volume-off' => __(' fa-volume-off'),
66	+ 'fa-volume-down' => __(' fa-volume-down'),
67	+ 'fa-volume-up' => __(' fa-volume-up'),
68	+ 'fa-qrcode' => __(' fa-qrcode'),
69	+ 'fa-barcode' => __(' fa-barcode'),
70	+ 'fa-tag' => __(' fa-tag'),
71	+ 'fa-tags' => __(' fa-tags'),
72	+ 'fa-book' => __(' fa-book'),
73	+ 'fa-bookmark' => __(' fa-bookmark'),
74	+ 'fa-print' => __(' fa-print'),
75	+ 'fa-camera' => __(' fa-camera'),
76	+ 'fa-font' => __(' fa-font'),
77	+ 'fa-bold' => __(' fa-bold'),
78	+ 'fa-italic' => __(' fa-italic'),
79	+ 'fa-text-height' => __(' fa-text-height'),
80	+ 'fa-text-width' => __(' fa-text-width'),
81	+ 'fa-align-left' => __(' fa-align-left'),
82	+ 'fa-align-center' => __(' fa-align-center'),
83	+ 'fa-align-right' => __(' fa-align-right'),
84	+ 'fa-align-justify' => __(' fa-align-justify'),
85	+ 'fa-list' => __(' fa-list'),
86	+ 'fa-outdent' => __(' fa-outdent'),
87	+ 'fa-indent' => __(' fa-indent'),
88	+ 'fa-video-camera' => __(' fa-video-camera'),
89	+ 'fa-picture-o' => __(' fa-picture-o'),
90	+ 'fa-pencil' => __(' fa-pencil'),
91	+ 'fa-map-marker' => __(' fa-map-marker'),
92	+ 'fa-adjust' => __(' fa-adjust'),
93	+ 'fa-tint' => __(' fa-tint'),
94	+ 'fa-pencil-square-o' => __(' fa-pencil-square-o'),
95	+ 'fa-share-square-o' => __(' fa-share-square-o'),
96	+ 'fa-check-square-o' => __(' fa-check-square-o'),
97	+ 'fa-arrows' => __(' fa-arrows'),
98	+ 'fa-step-backward' => __(' fa-step-backward'),
99	+ 'fa-fast-backward' => __(' fa-fast-backward'),
100	+ 'fa-backward' => __(' fa-backward'),
101	+ 'fa-play' => __(' fa-play'),
102	+ 'fa-pause' => __(' fa-pause'),
103	+ 'fa-stop' => __(' fa-stop'),
104	+ 'fa-forward' => __(' fa-forward'),
105	+ 'fa-fast-forward' => __(' fa-fast-forward'),
106	+ 'fa-step-forward' => __(' fa-step-forward'),
107	+ 'fa-eject' => __(' fa-eject'),
108	+ 'fa-chevron-left' => __(' fa-chevron-left'),
109	+ 'fa-chevron-right' => __(' fa-chevron-right'),
110	+ 'fa-plus-circle' => __(' fa-plus-circle'),
111	+ 'fa-minus-circle' => __(' fa-minus-circle'),
112	+ 'fa-times-circle' => __(' fa-times-circle'),
113	+ 'fa-check-circle' => __(' fa-check-circle'),
114	+ 'fa-question-circle' => __(' fa-question-circle'),
115	+ 'fa-info-circle' => __(' fa-info-circle'),
116	+ 'fa-crosshairs' => __(' fa-crosshairs'),
117	+ 'fa-times-circle-o' => __(' fa-times-circle-o'),
118	+ 'fa-check-circle-o' => __(' fa-check-circle-o'),
119	+ 'fa-ban' => __(' fa-ban'),
120	+ 'fa-arrow-left' => __(' fa-arrow-left'),
121	+ 'fa-arrow-right' => __(' fa-arrow-right'),
122	+ 'fa-arrow-up' => __(' fa-arrow-up'),
123	+ 'fa-arrow-down' => __(' fa-arrow-down'),
124	+ 'fa-share' => __(' fa-share'),
125	+ 'fa-expand' => __(' fa-expand'),
126	+ 'fa-compress' => __(' fa-compress'),
127	+ 'fa-plus' => __(' fa-plus'),
128	+ 'fa-minus' => __(' fa-minus'),
129	+ 'fa-asterisk' => __(' fa-asterisk'),
130	+ 'fa-exclamation-circle' => __(' fa-exclamation-circle'),
131	+ 'fa-gift' => __(' fa-gift'),
132	+ 'fa-leaf' => __(' fa-leaf'),
133	+ 'fa-fire' => __(' fa-fire'),
134	+ 'fa-eye' => __(' fa-eye'),
135	+ 'fa-eye-slash' => __(' fa-eye-slash'),
136	+ 'fa-exclamation-triangle' => __(' fa-exclamation-triangle'),
137	+ 'fa-plane' => __(' fa-plane'),
138	+ 'fa-calendar' => __(' fa-calendar'),
139	+ 'fa-random' => __(' fa-random'),
140	+ 'fa-comment' => __(' fa-comment'),
141	+ 'fa-magnet' => __(' fa-magnet'),
142	+ 'fa-chevron-up' => __(' fa-chevron-up'),
143	+ 'fa-chevron-down' => __(' fa-chevron-down'),
144	+ 'fa-retweet' => __(' fa-retweet'),
145	+ 'fa-shopping-cart' => __(' fa-shopping-cart'),
146	+ 'fa-folder' => __(' fa-folder'),
147	+ 'fa-folder-open' => __(' fa-folder-open'),
148	+ 'fa-arrows-v' => __(' fa-arrows-v'),
149	+ 'fa-arrows-h' => __(' fa-arrows-h'),
150	+ 'fa-bar-chart-o' => __(' fa-bar-chart-o'),
151	+ 'fa-twitter-square' => __(' fa-twitter-square'),
152	+ 'fa-facebook-square' => __(' fa-facebook-square'),
153	+ 'fa-camera-retro' => __(' fa-camera-retro'),
154	+ 'fa-key' => __(' fa-key'),
155	+ 'fa-cogs' => __(' fa-cogs'),
156	+ 'fa-comments' => __(' fa-comments'),
157	+ 'fa-thumbs-o-up' => __(' fa-thumbs-o-up'),
158	+ 'fa-thumbs-o-down' => __(' fa-thumbs-o-down'),
159	+ 'fa-star-half' => __(' fa-star-half'),
160	+ 'fa-heart-o' => __(' fa-heart-o'),
161	+ 'fa-sign-out' => __(' fa-sign-out'),
162	+ 'fa-linkedin-square' => __(' fa-linkedin-square'),
163	+ 'fa-thumb-tack' => __(' fa-thumb-tack'),
164	+ 'fa-external-link' => __(' fa-external-link'),
165	+ 'fa-sign-in' => __(' fa-sign-in'),
166	+ 'fa-trophy' => __(' fa-trophy'),
167	+ 'fa-github-square' => __(' fa-github-square'),
168	+ 'fa-upload' => __(' fa-upload'),
169	+ 'fa-lemon-o' => __(' fa-lemon-o'),
170	+ 'fa-phone' => __(' fa-phone'),
171	+ 'fa-square-o' => __(' fa-square-o'),
172	+ 'fa-bookmark-o' => __(' fa-bookmark-o'),
173	+ 'fa-phone-square' => __(' fa-phone-square'),
174	+ 'fa-twitter' => __(' fa-twitter'),
175	+ 'fa-facebook' => __(' fa-facebook'),
176	+ 'fa-github' => __(' fa-github'),
177	+ 'fa-unlock' => __(' fa-unlock'),
178	+ 'fa-credit-card' => __(' fa-credit-card'),
179	+ 'fa-rss' => __(' fa-rss'),
180	+ 'fa-hdd-o' => __(' fa-hdd-o'),
181	+ 'fa-bullhorn' => __(' fa-bullhorn'),
182	+ 'fa-bell' => __(' fa-bell'),
183	+ 'fa-certificate' => __(' fa-certificate'),
184	+ 'fa-hand-o-right' => __(' fa-hand-o-right'),
185	+ 'fa-hand-o-left' => __(' fa-hand-o-left'),
186	+ 'fa-hand-o-up' => __(' fa-hand-o-up'),
187	+ 'fa-hand-o-down' => __(' fa-hand-o-down'),
188	+ 'fa-arrow-circle-left' => __(' fa-arrow-circle-left'),
189	+ 'fa-arrow-circle-right' => __(' fa-arrow-circle-right'),
190	+ 'fa-arrow-circle-up' => __(' fa-arrow-circle-up'),
191	+ 'fa-arrow-circle-down' => __(' fa-arrow-circle-down'),
192	+ 'fa-globe' => __(' fa-globe'),
193	+ 'fa-wrench' => __(' fa-wrench'),
194	+ 'fa-tasks' => __(' fa-tasks'),
195	+ 'fa-filter' => __(' fa-filter'),
196	+ 'fa-briefcase' => __(' fa-briefcase'),
197	+ 'fa-arrows-alt' => __(' fa-arrows-alt'),
198	+ 'fa-users' => __(' fa-users'),
199	+ 'fa-link' => __(' fa-link'),
200	+ 'fa-cloud' => __(' fa-cloud'),
201	+ 'fa-flask' => __(' fa-flask'),
202	+ 'fa-scissors' => __(' fa-scissors'),
203	+ 'fa-files-o' => __(' fa-files-o'),
204	+ 'fa-paperclip' => __(' fa-paperclip'),
205	+ 'fa-floppy-o' => __(' fa-floppy-o'),
206	+ 'fa-square' => __(' fa-square'),
207	+ 'fa-bars' => __(' fa-bars'),
208	+ 'fa-list-ul' => __(' fa-list-ul'),
209	+ 'fa-list-ol' => __(' fa-list-ol'),
210	+ 'fa-strikethrough' => __(' fa-strikethrough'),
211	+ 'fa-underline' => __(' fa-underline'),
212	+ 'fa-table' => __(' fa-table'),
213	+ 'fa-magic' => __(' fa-magic'),
214	+ 'fa-truck' => __(' fa-truck'),
215	+ 'fa-pinterest' => __(' fa-pinterest'),
216	+ 'fa-pinterest-square' => __(' fa-pinterest-square'),
217	+ 'fa-google-plus-square' => __(' fa-google-plus-square'),
218	+ 'fa-google-plus' => __(' fa-google-plus'),
219	+ 'fa-money' => __(' fa-money'),
220	+ 'fa-caret-down' => __(' fa-caret-down'),
221	+ 'fa-caret-up' => __(' fa-caret-up'),
222	+ 'fa-caret-left' => __(' fa-caret-left'),
223	+ 'fa-caret-right' => __(' fa-caret-right'),
224	+ 'fa-columns' => __(' fa-columns'),
225	+ 'fa-sort' => __(' fa-sort'),
226	+ 'fa-sort-asc' => __(' fa-sort-asc'),
227	+ 'fa-sort-desc' => __(' fa-sort-desc'),
228	+ 'fa-envelope' => __(' fa-envelope'),
229	+ 'fa-linkedin' => __(' fa-linkedin'),
230	+ 'fa-undo' => __(' fa-undo'),
231	+ 'fa-gavel' => __(' fa-gavel'),
232	+ 'fa-tachometer' => __(' fa-tachometer'),
233	+ 'fa-comment-o' => __(' fa-comment-o'),
234	+ 'fa-comments-o' => __(' fa-comments-o'),
235	+ 'fa-bolt' => __(' fa-bolt'),
236	+ 'fa-sitemap' => __(' fa-sitemap'),
237	+ 'fa-umbrella' => __(' fa-umbrella'),
238	+ 'fa-clipboard' => __(' fa-clipboard'),
239	+ 'fa-lightbulb-o' => __(' fa-lightbulb-o'),
240	+ 'fa-exchange' => __(' fa-exchange'),
241	+ 'fa-cloud-download' => __(' fa-cloud-download'),
242	+ 'fa-cloud-upload' => __(' fa-cloud-upload'),
243	+ 'fa-user-md' => __(' fa-user-md'),
244	+ 'fa-stethoscope' => __(' fa-stethoscope'),
245	+ 'fa-suitcase' => __(' fa-suitcase'),
246	+ 'fa-bell-o' => __(' fa-bell-o'),
247	+ 'fa-coffee' => __(' fa-coffee'),
248	+ 'fa-cutlery' => __(' fa-cutlery'),
249	+ 'fa-file-text-o' => __(' fa-file-text-o'),
250	+ 'fa-building-o' => __(' fa-building-o'),
251	+ 'fa-hospital-o' => __(' fa-hospital-o'),
252	+ 'fa-ambulance' => __(' fa-ambulance'),
253	+ 'fa-medkit' => __(' fa-medkit'),
254	+ 'fa-fighter-jet' => __(' fa-fighter-jet'),
255	+ 'fa-beer' => __(' fa-beer'),
256	+ 'fa-h-square' => __(' fa-h-square'),
257	+ 'fa-plus-square' => __(' fa-plus-square'),
258	+ 'fa-angle-double-left' => __(' fa-angle-double-left'),
259	+ 'fa-angle-double-right' => __(' fa-angle-double-right'),
260	+ 'fa-angle-double-up' => __(' fa-angle-double-up'),
261	+ 'fa-angle-double-down' => __(' fa-angle-double-down'),
262	+ 'fa-angle-left' => __(' fa-angle-left'),
263	+ 'fa-angle-right' => __(' fa-angle-right'),
264	+ 'fa-angle-up' => __(' fa-angle-up'),
265	+ 'fa-angle-down' => __(' fa-angle-down'),
266	+ 'fa-desktop' => __(' fa-desktop'),
267	+ 'fa-laptop' => __(' fa-laptop'),
268	+ 'fa-tablet' => __(' fa-tablet'),
269	+ 'fa-mobile' => __(' fa-mobile'),
270	+ 'fa-circle-o' => __(' fa-circle-o'),
271	+ 'fa-quote-left' => __(' fa-quote-left'),
272	+ 'fa-quote-right' => __(' fa-quote-right'),
273	+ 'fa-spinner' => __(' fa-spinner'),
274	+ 'fa-circle' => __(' fa-circle'),
275	+ 'fa-reply' => __(' fa-reply'),
276	+ 'fa-github-alt' => __(' fa-github-alt'),
277	+ 'fa-folder-o' => __(' fa-folder-o'),
278	+ 'fa-folder-open-o' => __(' fa-folder-open-o'),
279	+ 'fa-smile-o' => __(' fa-smile-o'),
280	+ 'fa-frown-o' => __(' fa-frown-o'),
281	+ 'fa-meh-o' => __(' fa-meh-o'),
282	+ 'fa-gamepad' => __(' fa-gamepad'),
283	+ 'fa-keyboard-o' => __(' fa-keyboard-o'),
284	+ 'fa-flag-o' => __(' fa-flag-o'),
285	+ 'fa-flag-checkered' => __(' fa-flag-checkered'),
286	+ 'fa-terminal' => __(' fa-terminal'),
287	+ 'fa-code' => __(' fa-code'),
288	+ 'fa-reply-all' => __(' fa-reply-all'),
289	+ 'fa-mail-reply-all' => __(' fa-mail-reply-all'),
290	+ 'fa-star-half-o' => __(' fa-star-half-o'),
291	+ 'fa-location-arrow' => __(' fa-location-arrow'),
292	+ 'fa-crop' => __(' fa-crop'),
293	+ 'fa-code-fork' => __(' fa-code-fork'),
294	+ 'fa-chain-broken' => __(' fa-chain-broken'),
295	+ 'fa-question' => __(' fa-question'),
296	+ 'fa-info' => __(' fa-info'),
297	+ 'fa-exclamation' => __(' fa-exclamation'),
298	+ 'fa-superscript' => __(' fa-superscript'),
299	+ 'fa-subscript' => __(' fa-subscript'),
300	+ 'fa-eraser' => __(' fa-eraser'),
301	+ 'fa-puzzle-piece' => __(' fa-puzzle-piece'),
302	+ 'fa-microphone' => __(' fa-microphone'),
303	+ 'fa-microphone-slash' => __(' fa-microphone-slash'),
304	+ 'fa-shield' => __(' fa-shield'),
305	+ 'fa-calendar-o' => __(' fa-calendar-o'),
306	+ 'fa-fire-extinguisher' => __(' fa-fire-extinguisher'),
307	+ 'fa-rocket' => __(' fa-rocket'),
308	+ 'fa-maxcdn' => __(' fa-maxcdn'),
309	+ 'fa-chevron-circle-left' => __(' fa-chevron-circle-left'),
310	+ 'fa-chevron-circle-right' => __(' fa-chevron-circle-right'),
311	+ 'fa-chevron-circle-up' => __(' fa-chevron-circle-up'),
312	+ 'fa-chevron-circle-down' => __(' fa-chevron-circle-down'),
313	+ 'fa-html5' => __(' fa-html5'),
314	+ 'fa-css3' => __(' fa-css3'),
315	+ 'fa-anchor' => __(' fa-anchor'),
316	+ 'fa-unlock-alt' => __(' fa-unlock-alt'),
317	+ 'fa-bullseye' => __(' fa-bullseye'),
318	+ 'fa-ellipsis-h' => __(' fa-ellipsis-h'),
319	+ 'fa-ellipsis-v' => __(' fa-ellipsis-v'),
320	+ 'fa-rss-square' => __(' fa-rss-square'),
321	+ 'fa-play-circle' => __(' fa-play-circle'),
322	+ 'fa-ticket' => __(' fa-ticket'),
323	+ 'fa-minus-square' => __(' fa-minus-square'),
324	+ 'fa-minus-square-o' => __(' fa-minus-square-o'),
325	+ 'fa-level-up' => __(' fa-level-up'),
326	+ 'fa-level-down' => __(' fa-level-down'),
327	+ 'fa-check-square' => __(' fa-check-square'),
328	+ 'fa-pencil-square' => __(' fa-pencil-square'),
329	+ 'fa-external-link-square' => __(' fa-external-link-square'),
330	+ 'fa-share-square' => __(' fa-share-square'),
331	+ 'fa-compass' => __(' fa-compass'),
332	+ 'fa-caret-square-o-down' => __(' fa-caret-square-o-down'),
333	+ 'fa-caret-square-o-up' => __(' fa-caret-square-o-up'),
334	+ 'fa-caret-square-o-right' => __(' fa-caret-square-o-right'),
335	+ 'fa-eur' => __(' fa-eur'),
336	+ 'fa-gbp' => __(' fa-gbp'),
337	+ 'fa-usd' => __(' fa-usd'),
338	+ 'fa-inr' => __(' fa-inr'),
339	+ 'fa-jpy' => __(' fa-jpy'),
340	+ 'fa-rub' => __(' fa-rub'),
341	+ 'fa-krw' => __(' fa-krw'),
342	+ 'fa-btc' => __(' fa-btc'),
343	+ 'fa-file' => __(' fa-file'),
344	+ 'fa-file-text' => __(' fa-file-text'),
345	+ 'fa-sort-alpha-asc' => __(' fa-sort-alpha-asc'),
346	+ 'fa-sort-alpha-desc' => __(' fa-sort-alpha-desc'),
347	+ 'fa-sort-amount-asc' => __(' fa-sort-amount-asc'),
348	+ 'fa-sort-amount-desc' => __(' fa-sort-amount-desc'),
349	+ 'fa-sort-numeric-asc' => __(' fa-sort-numeric-asc'),
350	+ 'fa-sort-numeric-desc' => __(' fa-sort-numeric-desc'),
351	+ 'fa-thumbs-up' => __(' fa-thumbs-up'),
352	+ 'fa-thumbs-down' => __(' fa-thumbs-down'),
353	+ 'fa-youtube-square' => __(' fa-youtube-square'),
354	+ 'fa-youtube' => __(' fa-youtube'),
355	+ 'fa-xing' => __(' fa-xing'),
356	+ 'fa-xing-square' => __(' fa-xing-square'),
357	+ 'fa-youtube-play' => __(' fa-youtube-play'),
358	+ 'fa-dropbox' => __(' fa-dropbox'),
359	+ 'fa-stack-overflow' => __(' fa-stack-overflow'),
360	+ 'fa-instagram' => __(' fa-instagram'),
361	+ 'fa-flickr' => __(' fa-flickr'),
362	+ 'fa-adn' => __(' fa-adn'),
363	+ 'fa-bitbucket' => __(' fa-bitbucket'),
364	+ 'fa-bitbucket-square' => __(' fa-bitbucket-square'),
365	+ 'fa-tumblr' => __(' fa-tumblr'),
366	+ 'fa-tumblr-square' => __(' fa-tumblr-square'),
367	+ 'fa-long-arrow-down' => __(' fa-long-arrow-down'),
368	+ 'fa-long-arrow-up' => __(' fa-long-arrow-up'),
369	+ 'fa-long-arrow-left' => __(' fa-long-arrow-left'),
370	+ 'fa-long-arrow-right' => __(' fa-long-arrow-right'),
371	+ 'fa-apple' => __(' fa-apple'),
372	+ 'fa-windows' => __(' fa-windows'),
373	+ 'fa-android' => __(' fa-android'),
374	+ 'fa-linux' => __(' fa-linux'),
375	+ 'fa-dribbble' => __(' fa-dribbble'),
376	+ 'fa-skype' => __(' fa-skype'),
377	+ 'fa-foursquare' => __(' fa-foursquare'),
378	+ 'fa-trello' => __(' fa-trello'),
379	+ 'fa-female' => __(' fa-female'),
380	+ 'fa-male' => __(' fa-male'),
381	+ 'fa-gittip' => __(' fa-gittip'),
382	+ 'fa-sun-o' => __(' fa-sun-o'),
383	+ 'fa-moon-o' => __(' fa-moon-o'),
384	+ 'fa-archive' => __(' fa-archive'),
385	+ 'fa-bug' => __(' fa-bug'),
386	+ 'fa-vk' => __(' fa-vk'),
387	+ 'fa-weibo' => __(' fa-weibo'),
388	+ 'fa-renren' => __(' fa-renren'),
389	+ 'fa-pagelines' => __(' fa-pagelines'),
390	+ 'fa-stack-exchange' => __(' fa-stack-exchange'),
391	+ 'fa-arrow-circle-o-right' => __(' fa-arrow-circle-o-right'),
392	+ 'fa-arrow-circle-o-left' => __(' fa-arrow-circle-o-left'),
393	+ 'fa-caret-square-o-left' => __(' fa-caret-square-o-left'),
394	+ 'fa-dot-circle-o' => __(' fa-dot-circle-o'),
395	+ 'fa-wheelchair' => __(' fa-wheelchair'),
396	+ 'fa-vimeo-square' => __(' fa-vimeo-square'),
397	+ 'fa-try' => __(' fa-try'),
398	+ 'fa-plus-square-o' => __(' fa-plus-square-o')
399	+ )
400	+ );
401	+
402	+ // do not delete!
403	+ parent::__construct();
404	+
405	+ // settings
406	+ $this->settings = array(
407	+ 'path' => apply_filters('acf/helpers/get_path', __FILE__),
408	+ 'dir' => apply_filters('acf/helpers/get_dir', __FILE__),
409	+ 'version' => '1.0.0'
410	+ );
411	+
412	+ add_filter('acf/load_field', array( $this, 'maybe_enqueue_font_awesome' ) );
413	+ }
414	+
415	+ function maybe_enqueue_font_awesome( $field )
416	+ {
417	+ if( 'font-awesome' == $field['type'] && $field['enqueue_fa'] ) {
418	+ add_action( 'wp_footer', array( $this, 'frontend_enqueue_scripts' ) );
419	+ }
420	+
421	+ return $field;
422	+ }
423	+
424	+ /*
425	+ * create_options()
426	+ *
427	+ * Create extra options for your field. This is rendered when editing a field.
428	+ * The value of $field['name'] can be used (like bellow) to save extra data to the $field
429	+ *
430	+ * @type action
431	+ * @since 3.6
432	+ * @date 23/01/13
433	+ *
434	+ * @param $field - an array holding all the field's data
435	+ */
436	+
437	+ function create_options($field)
438	+ {
439	+ // defaults?
440	+ $field = array_merge($this->defaults, $field);
441	+
442	+ // key is needed in the field names to correctly save the data
443	+ $key = $field['name'];
444	+
445	+
446	+ // Create Field Options HTML
447	+ ?>
448	+ <tr class="field_option field_option_<?php echo $this->name; ?>">
449	+ <td class="label">
450	+ <label><?php _e("Default Icon", 'acf'); ?></label>
451	+ </td>
452	+ <td>
453	+ <?php
454	+
455	+ do_action('acf/create_field', array(
456	+ 'type' => 'select',
457	+ 'name' => 'fields[' . $key . '][default_value]',
458	+ 'value' => $field['default_value'],
459	+ 'class' => 'fontawesome',
460	+ 'choices' => array_merge( array( 'null' => __("Select",'acf') ), $field['choices'] )
461	+ ));
462	+
463	+ ?>
464	+ </td>
465	+ </tr>
466	+ <tr class="field_option field_option_<?php echo $this->name; ?>">
467	+ <td class="label">
468	+ <label><?php _e("Return Value",'acf'); ?></label>
469	+ <p class="description"><?php _e("Specify the returned value on front end", 'acf'); ?></p>
470	+ </td>
471	+ <td>
472	+ <?php
473	+ do_action('acf/create_field', array(
474	+ 'type' => 'radio',
475	+ 'name' => 'fields['.$key.'][save_format]',
476	+ 'value' => $field['save_format'],
477	+ 'choices' => array(
478	+ 'element' => __("Icon Element",'acf'),
479	+ 'object' => __("Icon Object",'acf'),
480	+ 'class' => __("Icon Class",'acf'),
481	+ ),
482	+ 'layout' => 'horizontal',
483	+ ));
484	+ ?>
485	+ </td>
486	+ </tr>
487	+
488	+ <tr class="field_option field_option_<?php echo $this->name; ?>">
489	+ <td class="label">
490	+ <label><?php _e("Allow Null?",'acf'); ?></label>
491	+ </td>
492	+ <td>
493	+ <?php
494	+ do_action('acf/create_field', array(
495	+ 'type' => 'radio',
496	+ 'name' => 'fields['.$key.'][allow_null]',
497	+ 'value' => $field['allow_null'],
498	+ 'choices' => array(
499	+ 1 => __("Yes",'acf'),
500	+ 0 => __("No",'acf'),
501	+ ),
502	+ 'layout' => 'horizontal',
503	+ ));
504	+ ?>
505	+ </td>
506	+ </tr>
507	+
508	+ <tr class="field_option field_option_<?php echo $this->name; ?>">
509	+ <td class="label">
510	+ <label><?php _e("Enqueue FontAwesome?",'acf'); ?></label>
511	+ <p class="description"><?php _e("Set to 'No' if you have already enqueued FA manually. Set to 'Yes' to enqueue FA in the footer on any pages using this field.", 'acf'); ?></p>
512	+ </td>
513	+ <td>
514	+ <?php
515	+ do_action('acf/create_field', array(
516	+ 'type' => 'radio',
517	+ 'name' => 'fields['.$key.'][enqueue_fa]',
518	+ 'value' => $field['enqueue_fa'],
519	+ 'choices' => array(
520	+ 1 => __("Yes",'acf'),
521	+ 0 => __("No",'acf'),
522	+ ),
523	+ 'layout' => 'horizontal',
524	+ ));
525	+ ?>
526	+ </td>
527	+ </tr>
528	+
529	+ <script type="text/javascript">
530	+ jQuery(".fontawesome").select2({
531	+ width : 'resolve'
532	+ });
533	+ </script>
534	+
535	+ <?php
536	+
537	+ }
538	+
539	+ /*
540	+ * create_field()
541	+ *
542	+ * Create the HTML interface for your field
543	+ *
544	+ * @param $field - an array holding all the field's data
545	+ *
546	+ * @type action
547	+ * @since 3.6
548	+ * @date 23/01/13
549	+ */
550	+
551	+ function create_field( $field )
552	+ {
553	+ if( 'object' == $field['save_format'] )
554	+ $field['value'] = array( $field['value']->class );
555	+
556	+ // value must be array
557	+ if( !is_array($field['value']) )
558	+ {
559	+ // perhaps this is a default value with new lines in it?
560	+ if( strpos($field['value'], "\n") !== false )
561	+ {
562	+ // found multiple lines, explode it
563	+ $field['value'] = explode("\n", $field['value']);
564	+ }
565	+ else
566	+ {
567	+ $field['value'] = array( $field['value'] );
568	+ }
569	+ }
570	+
571	+ // trim value
572	+ $field['value'] = array_map('trim', $field['value']);
573	+
574	+ // html
575	+ echo '<div class="fa-live-preview"></div>';
576	+ echo '<select id="' . $field['id'] . '" class="' . $field['class'] . ' fa-select2-field" name="' . $field['name'] . '" >';
577	+
578	+ // null
579	+ if( $field['allow_null'] )
580	+ {
581	+ echo '<option value="null">- ' . __("Select",'acf') . ' -</option>';
582	+ }
583	+
584	+ // loop through values and add them as options
585	+ if( is_array($field['choices']) )
586	+ {
587	+ foreach( $field['choices'] as $key => $value )
588	+ {
589	+ $selected = $this->find_selected( $key, $field['value'], $field['save_format'], $field['choices'] );
590	+ echo '<option value="'.$key.'" '.$selected.'>'.$value.'</option>';
591	+ }
592	+ }
593	+
594	+ echo '</select>';
595	+ }
596	+
597	+ function find_selected( $needle, $haystack, $type, $choices )
598	+ {
599	+ switch( $type )
600	+ {
601	+ case 'object':
602	+ case 'element':
603	+ $search = array( '<i class="fa ', '"></i>' );
604	+ $string = str_replace( $search, '', $haystack[0] );
605	+ break;
606	+
607	+ case 'class':
608	+ $string = $haystack[0];
609	+ break;
610	+ }
611	+
612	+ if( $string == $needle )
613	+ return 'selected="selected"';
614	+
615	+ return '';
616	+ }
617	+
618	+ /*
619	+ * input_admin_enqueue_scripts()
620	+ *
621	+ * This action is called in the admin_enqueue_scripts action on the edit screen where your field is created.
622	+ * Use this action to add css + javascript to assist your create_field() action.
623	+ *
624	+ * $info http://codex.wordpress.org/Plugin_API/Action_Reference/admin_enqueue_scripts
625	+ * @type action
626	+ * @since 3.6
627	+ * @date 23/01/13
628	+ */
629	+
630	+ function input_admin_enqueue_scripts()
631	+ {
632	+ // register acf scripts
633	+ wp_register_script('acf-input-font-awesome-select2', $this->settings['dir'] . 'js/select2/select2.min.js', array('acf-input'), $this->settings['version']);
634	+ wp_register_script('acf-input-font-awesome', $this->settings['dir'] . 'js/input.js', array('acf-input'), $this->settings['version']);
635	+ wp_register_style('acf-input-font-awesome-input', $this->settings['dir'] . 'css/input.css', array('acf-input'), $this->settings['version']);
636	+ wp_register_style('acf-input-font-awesome-fa', $this->settings['dir'] . 'css/fontawesome.css', array('acf-input'), $this->settings['version']);
637	+ wp_register_style('acf-input-font-awesome-select2', $this->settings['dir'] . 'css/select2.css', array('acf-input'), $this->settings['version']);
638	+
639	+
640	+ // scripts
641	+ wp_enqueue_script(array(
642	+ 'acf-input-font-awesome',
643	+ 'acf-input-font-awesome-select2'
644	+ ));
645	+
646	+ // styles
647	+ wp_enqueue_style(array(
648	+ 'acf-input-font-awesome-input',
649	+ 'acf-input-font-awesome-fa',
650	+ 'acf-input-font-awesome-select2'
651	+ ));
652	+ }
653	+
654	+ /*
655	+ * field_group_admin_enqueue_scripts()
656	+ *
657	+ * This action is called in the admin_enqueue_scripts action on the edit screen where your field is edited.
658	+ * Use this action to add css + javascript to assist your create_field_options() action.
659	+ *
660	+ * $info http://codex.wordpress.org/Plugin_API/Action_Reference/admin_enqueue_scripts
661	+ * @type action
662	+ * @since 3.6
663	+ * @date 23/01/13
664	+ */
665	+
666	+ function field_group_admin_enqueue_scripts()
667	+ {
668	+ // register acf scripts
669	+ wp_register_script('acf-input-font-awesome-select2', $this->settings['dir'] . 'js/select2/select2.min.js', array('acf-input'), $this->settings['version']);
670	+ wp_register_script('acf-input-font-awesome-select2', $this->settings['dir'] . 'js/select2/select2.min.js', array('acf-input'), $this->settings['version']);
671	+ wp_register_style('acf-input-font-awesome-input', $this->settings['dir'] . 'css/input.css', array('acf-input'), $this->settings['version']);
672	+ wp_register_style('acf-input-font-awesome-fa', $this->settings['dir'] . 'css/fontawesome.css', array('acf-input'), $this->settings['version']);
673	+ wp_register_style('acf-input-font-awesome-select2', $this->settings['dir'] . 'css/select2.css', array('acf-input'), $this->settings['version']);
674	+
675	+
676	+ // scripts
677	+ wp_enqueue_script(array(
678	+ 'acf-input-font-awesome-select2'
679	+ ));
680	+
681	+ // styles
682	+ wp_enqueue_style(array(
683	+ 'acf-input-font-awesome-input',
684	+ 'acf-input-font-awesome-fa',
685	+ 'acf-input-font-awesome-select2'
686	+ ));
687	+ }
688	+
689	+ /*
690	+ * frontend_enqueue_scripts()
691	+ *
692	+ * This action is called in the wp_enqueue_scripts action on the front end.
693	+ *
694	+ * $info http://codex.wordpress.org/Plugin_API/Action_Reference/wp_enqueue_scripts
695	+ * @type action
696	+ */
697	+
698	+ function frontend_enqueue_scripts()
699	+ {
700	+ wp_register_style('font-awesome', $this->settings['dir'] . 'css/fontawesome.css', array(), $this->settings['version']);
701	+
702	+ wp_enqueue_style(array(
703	+ 'font-awesome'
704	+ ));
705	+ }
706	+
707	+ /*
708	+ * load_value()
709	+ *
710	+ * This filter is appied to the $value after it is loaded from the db
711	+ *
712	+ * @type filter
713	+ * @since 3.6
714	+ * @date 23/01/13
715	+ *
716	+ * @param $value - the value found in the database
717	+ * @param $post_id - the $post_id from which the value was loaded from
718	+ * @param $field - the field array holding all the field options
719	+ *
720	+ * @return $value - the value to be saved in te database
721	+ */
722	+
723	+ function load_value($value, $post_id, $field)
724	+ {
725	+ // Note: This function can be removed if not used
726	+ switch( $field['save_format'] )
727	+ {
728	+ case 'object':
729	+ $icon_array = explode( ' ', $this->defaults['choices'][ $value ] );
730	+ $value = (object) array(
731	+ 'unicode' => $icon_array[0],
732	+ 'class' => $icon_array[1],
733	+ 'element' => '<i class="fa ' . $icon_array[1] . '"></i>'
734	+ );
735	+ break;
736	+
737	+ case 'unicode':
738	+ $icon_array = explode( ' ', $this->defaults['choices'][ $value ] );
739	+ $value = $icon_array[0];
740	+ break;
741	+
742	+ case 'element':
743	+ $value = '<i class="fa ' . $value . '"></i>';
744	+ break;
745	+ }
746	+
747	+ return $value;
748	+ }
749	+
750	+ }
751	+
752	+
753	+ // create field
754	+ new acf_field_font_awesome();
755	+
756	+ ?>

font/FontAwesome.otf ADDED Viewed

Binary file

font/fontawesome-webfont.eot ADDED Viewed

Binary file

font/fontawesome-webfont.svg ADDED Viewed

	@@ -0,0 +1,414 @@


1	+ <?xml version="1.0" standalone="no"?>
2	+ <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
3	+ <svg xmlns="http://www.w3.org/2000/svg">
4	+ <metadata></metadata>
5	+ <defs>
6	+ <font id="fontawesomeregular" horiz-adv-x="1536" >
7	+ <font-face units-per-em="1792" ascent="1536" descent="-256" />
8	+ <missing-glyph horiz-adv-x="448" />
9	+ <glyph unicode=" " horiz-adv-x="448" />
10	+ <glyph unicode=" " horiz-adv-x="448" />
11	+ <glyph unicode=" " horiz-adv-x="448" />
12	+ <glyph unicode="¨" horiz-adv-x="1792" />
13	+ <glyph unicode="©" horiz-adv-x="1792" />
14	+ <glyph unicode="®" horiz-adv-x="1792" />
15	+ <glyph unicode="´" horiz-adv-x="1792" />
16	+ <glyph unicode="Æ" horiz-adv-x="1792" />
17	+ <glyph unicode=" " horiz-adv-x="768" />
18	+ <glyph unicode=" " />
19	+ <glyph unicode=" " horiz-adv-x="768" />
20	+ <glyph unicode=" " />
21	+ <glyph unicode=" " horiz-adv-x="512" />
22	+ <glyph unicode=" " horiz-adv-x="384" />
23	+ <glyph unicode=" " horiz-adv-x="256" />
24	+ <glyph unicode=" " horiz-adv-x="256" />
25	+ <glyph unicode=" " horiz-adv-x="192" />
26	+ <glyph unicode=" " horiz-adv-x="307" />
27	+ <glyph unicode=" " horiz-adv-x="85" />
28	+ <glyph unicode=" " horiz-adv-x="307" />
29	+ <glyph unicode=" " horiz-adv-x="384" />
30	+ <glyph unicode="™" horiz-adv-x="1792" />
31	+ <glyph unicode="∞" horiz-adv-x="1792" />
32	+ <glyph unicode="≠" horiz-adv-x="1792" />
33	+ <glyph unicode="" horiz-adv-x="500" d="M0 0z" />
34	+ <glyph unicode="" horiz-adv-x="1792" d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
35	+ <glyph unicode="" d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
36	+ <glyph unicode="" horiz-adv-x="1664" d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
37	+ <glyph unicode="" horiz-adv-x="1792" d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
38	+ <glyph unicode="" horiz-adv-x="1792" d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 q-18 -18 -44 -18z" />
39	+ <glyph unicode="" horiz-adv-x="1664" d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 l502 -73q56 -9 56 -46z" />
40	+ <glyph unicode="" horiz-adv-x="1664" d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
41	+ <glyph unicode="" horiz-adv-x="1408" d="M1408 131q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q9 0 42 -21.5t74.5 -48t108 -48t133.5 -21.5t133.5 21.5t108 48t74.5 48t42 21.5q61 0 111.5 -20t85.5 -53.5t62 -81 t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
42	+ <glyph unicode="" horiz-adv-x="1920" d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
43	+ <glyph unicode="" horiz-adv-x="1664" d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
44	+ <glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
45	+ <glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
46	+ <glyph unicode="" horiz-adv-x="1792" d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
47	+ <glyph unicode="" horiz-adv-x="1408" d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
48	+ <glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
49	+ <glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z " />
50	+ <glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
51	+ <glyph unicode="" horiz-adv-x="1792" d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
52	+ <glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
53	+ <glyph unicode="" horiz-adv-x="1408" d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
54	+ <glyph unicode="" horiz-adv-x="1664" d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
55	+ <glyph unicode="" horiz-adv-x="1280" d="M128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280zM768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z " />
56	+ <glyph unicode="" d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
57	+ <glyph unicode="" horiz-adv-x="1920" d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
58	+ <glyph unicode="" horiz-adv-x="1664" d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
59	+ <glyph unicode="" d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
60	+ <glyph unicode="" d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
61	+ <glyph unicode="" d="M1023 576h316q-1 3 -2.5 8t-2.5 8l-212 496h-708l-212 -496q-1 -2 -2.5 -8t-2.5 -8h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 q25 -61 25 -123z" />
62	+ <glyph unicode="" d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
63	+ <glyph unicode="" d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q14 0 25 -9 l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
64	+ <glyph unicode="" d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
65	+ <glyph unicode="" horiz-adv-x="1792" d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 t47 -113z" />
66	+ <glyph unicode="" horiz-adv-x="1152" d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
67	+ <glyph unicode="" horiz-adv-x="1792" d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
68	+ <glyph unicode="" horiz-adv-x="1664" d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
69	+ <glyph unicode="" horiz-adv-x="768" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
70	+ <glyph unicode="" horiz-adv-x="1152" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
71	+ <glyph unicode="" horiz-adv-x="1664" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
72	+ <glyph unicode="" horiz-adv-x="1408" d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
73	+ <glyph unicode="" horiz-adv-x="1792" d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
74	+ <glyph unicode="" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91z" />
75	+ <glyph unicode="" horiz-adv-x="1920" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
76	+ <glyph unicode="" horiz-adv-x="1664" d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
77	+ <glyph unicode="" horiz-adv-x="1280" d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
78	+ <glyph unicode="" horiz-adv-x="1664" d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
79	+ <glyph unicode="" horiz-adv-x="1920" d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
80	+ <glyph unicode="" horiz-adv-x="1664" d="M725 977l-170 -450q73 -1 153.5 -2t119 -1.5t52.5 -0.5l29 2q-32 95 -92 241q-53 132 -92 211zM21 -128h-21l2 79q22 7 80 18q89 16 110 31q20 16 48 68l237 616l280 724h75h53l11 -21l205 -480q103 -242 124 -297q39 -102 96 -235q26 -58 65 -164q24 -67 65 -149 q22 -49 35 -57q22 -19 69 -23q47 -6 103 -27q6 -39 6 -57q0 -14 -1 -26q-80 0 -192 8q-93 8 -189 8q-79 0 -135 -2l-200 -11l-58 -2q0 45 4 78l131 28q56 13 68 23q12 12 12 27t-6 32l-47 114l-92 228l-450 2q-29 -65 -104 -274q-23 -64 -23 -84q0 -31 17 -43 q26 -21 103 -32q3 0 13.5 -2t30 -5t40.5 -6q1 -28 1 -58q0 -17 -2 -27q-66 0 -349 20l-48 -8q-81 -14 -167 -14z" />
81	+ <glyph unicode="" horiz-adv-x="1408" d="M555 15q76 -32 140 -32q131 0 216 41t122 113q38 70 38 181q0 114 -41 180q-58 94 -141 126q-80 32 -247 32q-74 0 -101 -10v-144l-1 -173l3 -270q0 -15 12 -44zM541 761q43 -7 109 -7q175 0 264 65t89 224q0 112 -85 187q-84 75 -255 75q-52 0 -130 -13q0 -44 2 -77 q7 -122 6 -279l-1 -98q0 -43 1 -77zM0 -128l2 94q45 9 68 12q77 12 123 31q17 27 21 51q9 66 9 194l-2 497q-5 256 -9 404q-1 87 -11 109q-1 4 -12 12q-18 12 -69 15q-30 2 -114 13l-4 83l260 6l380 13l45 1q5 0 14 0.5t14 0.5q1 0 21.5 -0.5t40.5 -0.5h74q88 0 191 -27 q43 -13 96 -39q57 -29 102 -76q44 -47 65 -104t21 -122q0 -70 -32 -128t-95 -105q-26 -20 -150 -77q177 -41 267 -146q92 -106 92 -236q0 -76 -29 -161q-21 -62 -71 -117q-66 -72 -140 -108q-73 -36 -203 -60q-82 -15 -198 -11l-197 4q-84 2 -298 -11q-33 -3 -272 -11z" />
82	+ <glyph unicode="" horiz-adv-x="1024" d="M0 -126l17 85q4 1 77 20q76 19 116 39q29 37 41 101l27 139l56 268l12 64q8 44 17 84.5t16 67t12.5 46.5t9 30.5t3.5 11.5l29 157l16 63l22 135l8 50v38q-41 22 -144 28q-28 2 -38 4l19 103l317 -14q39 -2 73 -2q66 0 214 9q33 2 68 4.5t36 2.5q-2 -19 -6 -38 q-7 -29 -13 -51q-55 -19 -109 -31q-64 -16 -101 -31q-12 -31 -24 -88q-9 -44 -13 -82q-44 -199 -66 -306l-61 -311l-38 -158l-43 -235l-12 -45q-2 -7 1 -27q64 -15 119 -21q36 -5 66 -10q-1 -29 -7 -58q-7 -31 -9 -41q-18 0 -23 -1q-24 -2 -42 -2q-9 0 -28 3q-19 4 -145 17 l-198 2q-41 1 -174 -11q-74 -7 -98 -9z" />
83	+ <glyph unicode="" horiz-adv-x="1792" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l215 -1h293l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -42.5 2t-103.5 -1t-111 -1 q-34 0 -67 -5q-10 -97 -8 -136l1 -152v-332l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-88 0 -233 -14q-48 -4 -70 -4q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q8 192 6 433l-5 428q-1 62 -0.5 118.5t0.5 102.5t-2 57t-6 15q-6 5 -14 6q-38 6 -148 6q-43 0 -100 -13.5t-73 -24.5q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1744 128q33 0 42 -18.5t-11 -44.5 l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80z" />
84	+ <glyph unicode="" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l446 -1h318l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -58.5 2t-138.5 -1t-128 -1 q-94 0 -127 -5q-10 -97 -8 -136l1 -152v52l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-82 0 -233 -13q-45 -5 -70 -5q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q6 137 6 433l-5 44q0 265 -2 278q-2 11 -6 15q-6 5 -14 6q-38 6 -148 6q-50 0 -168.5 -14t-132.5 -24q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1505 113q26 -20 26 -49t-26 -49l-162 -126 q-26 -20 -44.5 -11t-18.5 42v80h-1024v-80q0 -33 -18.5 -42t-44.5 11l-162 126q-26 20 -26 49t26 49l162 126q26 20 44.5 11t18.5 -42v-80h1024v80q0 33 18.5 42t44.5 -11z" />
85	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
86	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
87	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
88	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
89	+ <glyph unicode="" horiz-adv-x="1792" d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
90	+ <glyph unicode="" horiz-adv-x="1792" d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
91	+ <glyph unicode="" horiz-adv-x="1792" d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
92	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 q39 -17 39 -59z" />
93	+ <glyph unicode="" horiz-adv-x="1920" d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
94	+ <glyph unicode="" d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 q53 0 91 -38l235 -234q37 -39 37 -91z" />
95	+ <glyph unicode="" horiz-adv-x="1024" d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
96	+ <glyph unicode="" d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
97	+ <glyph unicode="" horiz-adv-x="1024" d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
98	+ <glyph unicode="" horiz-adv-x="1792" d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
99	+ <glyph unicode="" horiz-adv-x="1664" d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
100	+ <glyph unicode="" horiz-adv-x="1664" d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 q24 -24 24 -57t-24 -57z" />
101	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
102	+ <glyph unicode="" horiz-adv-x="1024" d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19z" />
103	+ <glyph unicode="" horiz-adv-x="1792" d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19l710 710 q19 19 32 13t13 -32v-710q4 11 13 19z" />
104	+ <glyph unicode="" horiz-adv-x="1664" d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-8 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q5 11 13 19z" />
105	+ <glyph unicode="" horiz-adv-x="1408" d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
106	+ <glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
107	+ <glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
108	+ <glyph unicode="" horiz-adv-x="1664" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
109	+ <glyph unicode="" horiz-adv-x="1792" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19l-710 -710 q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
110	+ <glyph unicode="" horiz-adv-x="1024" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19z" />
111	+ <glyph unicode="" horiz-adv-x="1538" d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
112	+ <glyph unicode="" horiz-adv-x="1152" d="M742 -37l-652 651q-37 37 -37 90.5t37 90.5l652 651q37 37 90.5 37t90.5 -37l75 -75q37 -37 37 -90.5t-37 -90.5l-486 -486l486 -485q37 -38 37 -91t-37 -90l-75 -75q-37 -37 -90.5 -37t-90.5 37z" />
113	+ <glyph unicode="" horiz-adv-x="1152" d="M1099 704q0 -52 -37 -91l-652 -651q-37 -37 -90 -37t-90 37l-76 75q-37 39 -37 91q0 53 37 90l486 486l-486 485q-37 39 -37 91q0 53 37 90l76 75q36 38 90 38t90 -38l652 -651q37 -37 37 -90z" />
114	+ <glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
115	+ <glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" />
116	+ <glyph unicode="" d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
117	+ <glyph unicode="" d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
118	+ <glyph unicode="" d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
119	+ <glyph unicode="" d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
120	+ <glyph unicode="" d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
121	+ <glyph unicode="" d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
122	+ <glyph unicode="" d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
123	+ <glyph unicode="" d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
124	+ <glyph unicode="" d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 t32.5 -90.5z" />
125	+ <glyph unicode="" d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
126	+ <glyph unicode="" horiz-adv-x="1664" d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 q37 -39 37 -91z" />
127	+ <glyph unicode="" horiz-adv-x="1664" d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
128	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
129	+ <glyph unicode="" d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
130	+ <glyph unicode="" d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
131	+ <glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
132	+ <glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
133	+ <glyph unicode="" horiz-adv-x="1664" d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
134	+ <glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
135	+ <glyph unicode="" d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
136	+ <glyph unicode="" horiz-adv-x="1792" d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-30 0 -51 11t-31 24t-27 42q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
137	+ <glyph unicode="" horiz-adv-x="1408" d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
138	+ <glyph unicode="" horiz-adv-x="1792" d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
139	+ <glyph unicode="" horiz-adv-x="1792" d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 q-105 -188 -315 -566t-316 -567l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z " />
140	+ <glyph unicode="" horiz-adv-x="1792" d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
141	+ <glyph unicode="" horiz-adv-x="1408" d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
142	+ <glyph unicode="" horiz-adv-x="1664" d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
143	+ <glyph unicode="" horiz-adv-x="1792" d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
144	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
145	+ <glyph unicode="" d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
146	+ <glyph unicode="" horiz-adv-x="1664" d="M1611 320q0 -53 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-486 485l-486 -485q-36 -38 -90 -38t-90 38l-75 75q-38 36 -38 90q0 53 38 91l651 651q37 37 90 37q52 0 91 -37l650 -651q38 -38 38 -91z" />
147	+ <glyph unicode="" horiz-adv-x="1664" d="M1611 832q0 -53 -37 -90l-651 -651q-38 -38 -91 -38q-54 0 -90 38l-651 651q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l486 -486l486 486q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
148	+ <glyph unicode="" horiz-adv-x="1920" d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -11 7 -21 zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z " />
149	+ <glyph unicode="" horiz-adv-x="1664" d="M640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5 l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5 t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
150	+ <glyph unicode="" horiz-adv-x="1664" d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
151	+ <glyph unicode="" horiz-adv-x="1920" d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
152	+ <glyph unicode="" horiz-adv-x="768" d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
153	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
154	+ <glyph unicode="" horiz-adv-x="1920" d="M512 512v-384h-256v384h256zM896 1024v-896h-256v896h256zM1280 768v-640h-256v640h256zM1664 1152v-1024h-256v1024h256zM1792 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5z M1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
155	+ <glyph unicode="" d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
156	+ <glyph unicode="" d="M1307 618l23 219h-198v109q0 49 15.5 68.5t71.5 19.5h110v219h-175q-152 0 -218 -72t-66 -213v-131h-131v-219h131v-635h262v635h175zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 q119 0 203.5 -84.5t84.5 -203.5z" />
157	+ <glyph unicode="" horiz-adv-x="1792" d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
158	+ <glyph unicode="" horiz-adv-x="1792" d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
159	+ <glyph unicode="" horiz-adv-x="1920" d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -10 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -9 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
160	+ <glyph unicode="" horiz-adv-x="1792" d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
161	+ <glyph unicode="" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
162	+ <glyph unicode="" d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 32 18 69t-17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -74 49 -163z" />
163	+ <glyph unicode="" horiz-adv-x="896" d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
164	+ <glyph unicode="" horiz-adv-x="1792" d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 q224 0 351 -124t127 -344z" />
165	+ <glyph unicode="" horiz-adv-x="1664" d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
166	+ <glyph unicode="" d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
167	+ <glyph unicode="" horiz-adv-x="1152" d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
168	+ <glyph unicode="" horiz-adv-x="1792" d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
169	+ <glyph unicode="" d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
170	+ <glyph unicode="" horiz-adv-x="1664" d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
171	+ <glyph unicode="" d="M394 184q-8 -9 -20 3q-13 11 -4 19q8 9 20 -3q12 -11 4 -19zM352 245q9 -12 0 -19q-8 -6 -17 7t0 18q9 7 17 -6zM291 305q-5 -7 -13 -2q-10 5 -7 12q3 5 13 2q10 -5 7 -12zM322 271q-6 -7 -16 3q-9 11 -2 16q6 6 16 -3q9 -11 2 -16zM451 159q-4 -12 -19 -6q-17 4 -13 15 t19 7q16 -5 13 -16zM514 154q0 -11 -16 -11q-17 -2 -17 11q0 11 16 11q17 2 17 -11zM572 164q2 -10 -14 -14t-18 8t14 15q16 2 18 -9zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-224q-16 0 -24.5 1t-19.5 5t-16 14.5t-5 27.5v239q0 97 -52 142q57 6 102.5 18t94 39 t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103 q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -103t0.5 -68q0 -22 -11 -33.5t-22 -13t-33 -1.5 h-224q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
172	+ <glyph unicode="" horiz-adv-x="1664" d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
173	+ <glyph unicode="" d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -10 1 -18.5t3 -17t4 -13.5t6.5 -16t6.5 -17q16 -40 25 -118.5t9 -136.5z" />
174	+ <glyph unicode="" horiz-adv-x="1408" d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -52.5 3.5t-57.5 12.5t-47.5 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-128 79 -264.5 215.5t-215.5 264.5q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47.5t-12.5 57.5t-3.5 52.5 q0 92 51 186q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174 q2 -1 19 -11.5t24 -14t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
175	+ <glyph unicode="" horiz-adv-x="1408" d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q119 0 203.5 -84.5t84.5 -203.5z" />
176	+ <glyph unicode="" horiz-adv-x="1280" d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
177	+ <glyph unicode="" d="M1280 343q0 11 -2 16q-3 8 -38.5 29.5t-88.5 49.5l-53 29q-5 3 -19 13t-25 15t-21 5q-18 0 -47 -32.5t-57 -65.5t-44 -33q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170.5 126.5t-126.5 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5t-3.5 16.5q0 13 20.5 33.5t45 38.5 t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5t320.5 -216.5q6 -2 30 -11t33 -12.5 t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
178	+ <glyph unicode="" horiz-adv-x="1664" d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
179	+ <glyph unicode="" horiz-adv-x="768" d="M511 980h257l-30 -284h-227v-824h-341v824h-170v284h170v171q0 182 86 275.5t283 93.5h227v-284h-142q-39 0 -62.5 -6.5t-34 -23.5t-13.5 -34.5t-3 -49.5v-142z" />
180	+ <glyph unicode="" d="M1536 640q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -39.5 7t-12.5 30v211q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5 q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23 q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -89t0.5 -54q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
181	+ <glyph unicode="" horiz-adv-x="1664" d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 t316.5 -131.5t131.5 -316.5z" />
182	+ <glyph unicode="" horiz-adv-x="1920" d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
183	+ <glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 q187 -186 294 -425.5t120 -501.5z" />
184	+ <glyph unicode="" d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
185	+ <glyph unicode="" horiz-adv-x="1792" d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
186	+ <glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM183 128h1298q-164 181 -246.5 411.5t-82.5 484.5q0 256 -320 256t-320 -256q0 -254 -82.5 -484.5t-246.5 -411.5zM1664 128q0 -52 -38 -90t-90 -38 h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
187	+ <glyph unicode="" d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
188	+ <glyph unicode="" horiz-adv-x="1792" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
189	+ <glyph unicode="" horiz-adv-x="1792" d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-2 3 -3.5 4.5t-4 4.5t-4.5 5q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576 q-50 0 -89 -38.5t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45 t45 -19t45 19t19 45zM1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128 q0 122 81.5 189t206.5 67q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
190	+ <glyph unicode="" d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
191	+ <glyph unicode="" d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
192	+ <glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
193	+ <glyph unicode="" d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
194	+ <glyph unicode="" d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
195	+ <glyph unicode="" d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
196	+ <glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 10.5t-9.5 10.5q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-5 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10t17 -20q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q7 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
197	+ <glyph unicode="" horiz-adv-x="1664" d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
198	+ <glyph unicode="" horiz-adv-x="1792" d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
199	+ <glyph unicode="" horiz-adv-x="1408" d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
200	+ <glyph unicode="" horiz-adv-x="1792" d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
201	+ <glyph unicode="" d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z " />
202	+ <glyph unicode="" horiz-adv-x="1920" d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
203	+ <glyph unicode="" horiz-adv-x="1664" d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
204	+ <glyph unicode="" horiz-adv-x="1920" d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z " />
205	+ <glyph unicode="" horiz-adv-x="1664" d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
206	+ <glyph unicode="" horiz-adv-x="1792" d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
207	+ <glyph unicode="" horiz-adv-x="1792" d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
208	+ <glyph unicode="" horiz-adv-x="1408" d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 z" />
209	+ <glyph unicode="" d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
210	+ <glyph unicode="" d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
211	+ <glyph unicode="" d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
212	+ <glyph unicode="" horiz-adv-x="1792" d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
213	+ <glyph unicode="" horiz-adv-x="1792" d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 122t0.5 121v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5 t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
214	+ <glyph unicode="" horiz-adv-x="1792" d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 97 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -55 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
215	+ <glyph unicode="" d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
216	+ <glyph unicode="" horiz-adv-x="1664" d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 z" />
217	+ <glyph unicode="" horiz-adv-x="1664" d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
218	+ <glyph unicode="" horiz-adv-x="1792" d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
219	+ <glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
220	+ <glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
221	+ <glyph unicode="" d="M678 -57q0 -38 -10 -71h-380q-95 0 -171.5 56.5t-103.5 147.5q24 45 69 77.5t100 49.5t107 24t107 7q32 0 49 -2q6 -4 30.5 -21t33 -23t31 -23t32 -25.5t27.5 -25.5t26.5 -29.5t21 -30.5t17.5 -34.5t9.5 -36t4.5 -40.5zM385 294q-234 -7 -385 -85v433q103 -118 273 -118 q32 0 70 5q-21 -61 -21 -86q0 -67 63 -149zM558 805q0 -100 -43.5 -160.5t-140.5 -60.5q-51 0 -97 26t-78 67.5t-56 93.5t-35.5 104t-11.5 99q0 96 51.5 165t144.5 69q66 0 119 -41t84 -104t47 -130t16 -128zM1536 896v-736q0 -119 -84.5 -203.5t-203.5 -84.5h-468 q39 73 39 157q0 66 -22 122.5t-55.5 93t-72 71t-72 59.5t-55.5 54.5t-22 59.5q0 36 23 68t56 61.5t65.5 64.5t55.5 93t23 131t-26.5 145.5t-75.5 118.5q-6 6 -14 11t-12.5 7.5t-10 9.5t-10.5 17h135l135 64h-437q-138 0 -244.5 -38.5t-182.5 -133.5q0 126 81 213t207 87h960 q119 0 203.5 -84.5t84.5 -203.5v-96h-256v256h-128v-256h-256v-128h256v-256h128v256h256z" />
222	+ <glyph unicode="" horiz-adv-x="1664" d="M876 71q0 21 -4.5 40.5t-9.5 36t-17.5 34.5t-21 30.5t-26.5 29.5t-27.5 25.5t-32 25.5t-31 23t-33 23t-30.5 21q-17 2 -50 2q-54 0 -106 -7t-108 -25t-98 -46t-69 -75t-27 -107q0 -68 35.5 -121.5t93 -84t120.5 -45.5t127 -15q59 0 112.5 12.5t100.5 39t74.5 73.5 t27.5 110zM756 933q0 60 -16.5 127.5t-47 130.5t-84 104t-119.5 41q-93 0 -144 -69t-51 -165q0 -47 11.5 -99t35.5 -104t56 -93.5t78 -67.5t97 -26q97 0 140.5 60.5t43.5 160.5zM625 1408h437l-135 -79h-135q71 -45 110 -126t39 -169q0 -74 -23 -131.5t-56 -92.5t-66 -64.5 t-56 -61t-23 -67.5q0 -26 16.5 -51t43 -48t58.5 -48t64 -55.5t58.5 -66t43 -85t16.5 -106.5q0 -160 -140 -282q-152 -131 -420 -131q-59 0 -119.5 10t-122 33.5t-108.5 58t-77 89t-30 121.5q0 61 37 135q32 64 96 110.5t145 71t155 36t150 13.5q-64 83 -64 149q0 12 2 23.5 t5 19.5t8 21.5t7 21.5q-40 -5 -70 -5q-149 0 -255.5 98t-106.5 246q0 140 95 250.5t234 141.5q94 20 187 20zM1664 1152v-128h-256v-256h-128v256h-256v128h256v256h128v-256h256z" />
223	+ <glyph unicode="" horiz-adv-x="1920" d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
224	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
225	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
226	+ <glyph unicode="" horiz-adv-x="640" d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
227	+ <glyph unicode="" horiz-adv-x="640" d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
228	+ <glyph unicode="" horiz-adv-x="1664" d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
229	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
230	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
231	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
232	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
233	+ <glyph unicode="" d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
234	+ <glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
235	+ <glyph unicode="" horiz-adv-x="1792" d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
236	+ <glyph unicode="" horiz-adv-x="1792" d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
237	+ <glyph unicode="" horiz-adv-x="1792" d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
238	+ <glyph unicode="" horiz-adv-x="1792" d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
239	+ <glyph unicode="" horiz-adv-x="896" d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
240	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 z" />
241	+ <glyph unicode="" horiz-adv-x="1664" d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
242	+ <glyph unicode="" horiz-adv-x="1792" d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
243	+ <glyph unicode="" horiz-adv-x="1024" d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
244	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
245	+ <glyph unicode="" horiz-adv-x="1920" d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
246	+ <glyph unicode="" horiz-adv-x="1920" d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
247	+ <glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" />
248	+ <glyph unicode="" horiz-adv-x="1408" d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
249	+ <glyph unicode="" horiz-adv-x="1792" d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 t66 -158z" />
250	+ <glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1664 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5 q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
251	+ <glyph unicode="" horiz-adv-x="1920" d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
252	+ <glyph unicode="" horiz-adv-x="1408" d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
253	+ <glyph unicode="" horiz-adv-x="1280" d="M1024 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1024 608v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280z M768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z" />
254	+ <glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
255	+ <glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
256	+ <glyph unicode="" horiz-adv-x="1920" d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
257	+ <glyph unicode="" horiz-adv-x="1792" d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
258	+ <glyph unicode="" horiz-adv-x="1920" d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q261 -58 287 -93z" />
259	+ <glyph unicode="" horiz-adv-x="1664" d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
260	+ <glyph unicode="" d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
261	+ <glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
262	+ <glyph unicode="" horiz-adv-x="1024" d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
263	+ <glyph unicode="" horiz-adv-x="1024" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
264	+ <glyph unicode="" horiz-adv-x="1152" d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
265	+ <glyph unicode="" horiz-adv-x="1152" d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
266	+ <glyph unicode="" horiz-adv-x="640" d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
267	+ <glyph unicode="" horiz-adv-x="640" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
268	+ <glyph unicode="" horiz-adv-x="1152" d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
269	+ <glyph unicode="" horiz-adv-x="1152" d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
270	+ <glyph unicode="" horiz-adv-x="1920" d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
271	+ <glyph unicode="" horiz-adv-x="1920" d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
272	+ <glyph unicode="" horiz-adv-x="1152" d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
273	+ <glyph unicode="" horiz-adv-x="768" d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
274	+ <glyph unicode="" d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 t279.5 -279.5t103 -385.5z" />
275	+ <glyph unicode="" horiz-adv-x="1664" d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
276	+ <glyph unicode="" horiz-adv-x="1664" d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
277	+ <glyph unicode="" horiz-adv-x="1568" d="M496 192q0 -60 -42.5 -102t-101.5 -42q-60 0 -102 42t-42 102t42 102t102 42q59 0 101.5 -42t42.5 -102zM928 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -66 -47 -113t-113 -47t-113 47t-47 113 t47 113t113 47t113 -47t47 -113zM1360 192q0 -46 -33 -79t-79 -33t-79 33t-33 79t33 79t79 33t79 -33t33 -79zM528 1088q0 -73 -51.5 -124.5t-124.5 -51.5t-124.5 51.5t-51.5 124.5t51.5 124.5t124.5 51.5t124.5 -51.5t51.5 -124.5zM992 1280q0 -80 -56 -136t-136 -56 t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1536 640q0 -40 -28 -68t-68 -28t-68 28t-28 68t28 68t68 28t68 -28t28 -68zM1328 1088q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5z" />
278	+ <glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
279	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
280	+ <glyph unicode="" horiz-adv-x="1664" d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 q0 -87 -27 -168q136 -160 136 -398z" />
281	+ <glyph unicode="" horiz-adv-x="1664" d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
282	+ <glyph unicode="" horiz-adv-x="1920" d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z " />
283	+ <glyph unicode="" horiz-adv-x="1792" />
284	+ <glyph unicode="" horiz-adv-x="1792" />
285	+ <glyph unicode="" d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
286	+ <glyph unicode="" d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
287	+ <glyph unicode="" d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
288	+ <glyph unicode="" horiz-adv-x="1920" d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
289	+ <glyph unicode="" horiz-adv-x="1920" d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
290	+ <glyph unicode="" horiz-adv-x="1792" d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
291	+ <glyph unicode="" horiz-adv-x="1792" d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
292	+ <glyph unicode="" horiz-adv-x="1664" d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 t9 -23z" />
293	+ <glyph unicode="" horiz-adv-x="1920" d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
294	+ <glyph unicode="" horiz-adv-x="1792" d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
295	+ <glyph unicode="" horiz-adv-x="1664" d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
296	+ <glyph unicode="" horiz-adv-x="1408" d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
297	+ <glyph unicode="" horiz-adv-x="1664" d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
298	+ <glyph unicode="" horiz-adv-x="1024" d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 q-2 -287 -226 -414q-68 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
299	+ <glyph unicode="" horiz-adv-x="1664" d="M439 265l-256 -256q-10 -9 -23 -9q-12 0 -23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
300	+ <glyph unicode="" horiz-adv-x="1024" d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
301	+ <glyph unicode="" horiz-adv-x="640" d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
302	+ <glyph unicode="" horiz-adv-x="640" d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
303	+ <glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1534 846v-206h-514l-3 27 q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5t-65.5 -51.5t-30.5 -63h232v80 h126z" />
304	+ <glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1536 -50v-206h-514l-4 27 q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73h232v80h126z" />
305	+ <glyph unicode="" horiz-adv-x="1920" d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
306	+ <glyph unicode="" horiz-adv-x="1664" d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
307	+ <glyph unicode="" horiz-adv-x="1152" d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
308	+ <glyph unicode="" horiz-adv-x="1408" d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
309	+ <glyph unicode="" horiz-adv-x="1280" d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
310	+ <glyph unicode="" horiz-adv-x="1664" d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
311	+ <glyph unicode="" horiz-adv-x="1408" d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
312	+ <glyph unicode="" horiz-adv-x="1664" d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
313	+ <glyph unicode="" horiz-adv-x="1792" d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" />
314	+ <glyph unicode="" d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
315	+ <glyph unicode="" d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
316	+ <glyph unicode="" d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
317	+ <glyph unicode="" d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
318	+ <glyph unicode="" horiz-adv-x="1408" d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
319	+ <glyph unicode="" horiz-adv-x="1792" d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
320	+ <glyph unicode="" horiz-adv-x="1792" d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-13 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
321	+ <glyph unicode="" horiz-adv-x="1152" d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 v-320h736z" />
322	+ <glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
323	+ <glyph unicode="" horiz-adv-x="1408" d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
324	+ <glyph unicode="" horiz-adv-x="384" d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
325	+ <glyph unicode="" d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 232 -177 396t-396 177q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128q13 0 23 10 t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
326	+ <glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 q16 -8 32 -8q17 0 32 9z" />
327	+ <glyph unicode="" horiz-adv-x="1792" d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
328	+ <glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" />
329	+ <glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
330	+ <glyph unicode="" horiz-adv-x="1024" d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
331	+ <glyph unicode="" horiz-adv-x="1024" d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
332	+ <glyph unicode="" d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
333	+ <glyph unicode="" d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
334	+ <glyph unicode="" d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
335	+ <glyph unicode="" d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q10 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
336	+ <glyph unicode="" d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
337	+ <glyph unicode="" d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
338	+ <glyph unicode="" d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
339	+ <glyph unicode="" d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
340	+ <glyph unicode="" horiz-adv-x="1024" d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
341	+ <glyph unicode="" horiz-adv-x="1024" d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
342	+ <glyph unicode="" horiz-adv-x="1024" d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 t53 -63.5t31.5 -76.5t13 -94z" />
343	+ <glyph unicode="" horiz-adv-x="898" d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
344	+ <glyph unicode="" horiz-adv-x="1027" d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
345	+ <glyph unicode="" horiz-adv-x="1280" d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128 q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" />
346	+ <glyph unicode="" horiz-adv-x="1792" d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
347	+ <glyph unicode="" horiz-adv-x="1280" d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
348	+ <glyph unicode="" horiz-adv-x="1280" d="M1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
349	+ <glyph unicode="" horiz-adv-x="1280" d="M1024 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1024 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28 t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
350	+ <glyph unicode="" horiz-adv-x="1664" d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 l230 -662h70z" />
351	+ <glyph unicode="" horiz-adv-x="1664" d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 v119h121z" />
352	+ <glyph unicode="" horiz-adv-x="1792" d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
353	+ <glyph unicode="" horiz-adv-x="1792" d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
354	+ <glyph unicode="" d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
355	+ <glyph unicode="" d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
356	+ <glyph unicode="" horiz-adv-x="1664" d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
357	+ <glyph unicode="" horiz-adv-x="1664" d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
358	+ <glyph unicode="" d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 16 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 q21 -28 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78l24 -69t23 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38q-51 0 -78 -38 q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
359	+ <glyph unicode="" d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-37 -51 -106 -51q-67 0 -105 51 q-28 38 -28 118v175q0 80 28 117q38 51 105 51q69 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
360	+ <glyph unicode="" horiz-adv-x="1408" d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 q25 45 64 45h241q22 0 31 -15z" />
361	+ <glyph unicode="" d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
362	+ <glyph unicode="" horiz-adv-x="1792" d="M1280 640q0 37 -30 54l-512 320q-31 20 -65 2q-33 -18 -33 -56v-640q0 -38 33 -56q16 -8 31 -8q20 0 34 10l512 320q30 17 30 54zM1792 640q0 -96 -1 -150t-8.5 -136.5t-22.5 -147.5q-16 -73 -69 -123t-124 -58q-222 -25 -671 -25t-671 25q-71 8 -124.5 58t-69.5 123 q-14 65 -21.5 147.5t-8.5 136.5t-1 150t1 150t8.5 136.5t22.5 147.5q16 73 69 123t124 58q222 25 671 25t671 -25q71 -8 124.5 -58t69.5 -123q14 -65 21.5 -147.5t8.5 -136.5t1 -150z" />
363	+ <glyph unicode="" horiz-adv-x="1792" d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
364	+ <glyph unicode="" horiz-adv-x="1408" d="M928 135v-151l-707 -1v151zM1169 481v-701l-1 -35v-1h-1132l-35 1h-1v736h121v-618h928v618h120zM241 393l704 -65l-13 -150l-705 65zM309 709l683 -183l-39 -146l-683 183zM472 1058l609 -360l-77 -130l-609 360zM832 1389l398 -585l-124 -85l-399 584zM1285 1536 l121 -697l-149 -26l-121 697z" />
365	+ <glyph unicode="" d="M1362 110v648h-135q20 -63 20 -131q0 -126 -64 -232.5t-174 -168.5t-240 -62q-197 0 -337 135.5t-140 327.5q0 68 20 131h-141v-648q0 -26 17.5 -43.5t43.5 -17.5h1069q25 0 43 17.5t18 43.5zM1078 643q0 124 -90.5 211.5t-218.5 87.5q-127 0 -217.5 -87.5t-90.5 -211.5 t90.5 -211.5t217.5 -87.5q128 0 218.5 87.5t90.5 211.5zM1362 1003v165q0 28 -20 48.5t-49 20.5h-174q-29 0 -49 -20.5t-20 -48.5v-165q0 -29 20 -49t49 -20h174q29 0 49 20t20 49zM1536 1211v-1142q0 -81 -58 -139t-139 -58h-1142q-81 0 -139 58t-58 139v1142q0 81 58 139 t139 58h1142q81 0 139 -58t58 -139z" />
366	+ <glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
367	+ <glyph unicode="" d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
368	+ <glyph unicode="" horiz-adv-x="1408" d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
369	+ <glyph unicode="" d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
370	+ <glyph unicode="" horiz-adv-x="1024" d="M390 1408h219v-388h364v-241h-364v-394q0 -136 14 -172q13 -37 52 -60q50 -31 117 -31q117 0 232 76v-242q-102 -48 -178 -65q-77 -19 -173 -19q-105 0 -186 27q-78 25 -138 75q-58 51 -79 105q-22 54 -22 161v539h-170v217q91 30 155 84q64 55 103 132q39 78 54 196z " />
371	+ <glyph unicode="" d="M1123 127v181q-88 -56 -174 -56q-51 0 -88 23q-29 17 -39 45q-11 30 -11 129v295h274v181h-274v291h-164q-11 -90 -40 -147t-78 -99q-48 -40 -116 -63v-163h127v-404q0 -78 17 -121q17 -42 59 -78q43 -37 104 -57q62 -20 140 -20q67 0 129 14q57 13 134 49zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
372	+ <glyph unicode="" horiz-adv-x="768" d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
373	+ <glyph unicode="" horiz-adv-x="768" d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
374	+ <glyph unicode="" horiz-adv-x="1792" d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
375	+ <glyph unicode="" horiz-adv-x="1792" d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
376	+ <glyph unicode="" horiz-adv-x="1408" d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q112 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
377	+ <glyph unicode="" horiz-adv-x="1664" d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
378	+ <glyph unicode="" horiz-adv-x="1408" d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
379	+ <glyph unicode="" d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-7 -10 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18l-4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-14 -1 -7 -7l4 -2 q14 -4 18 -31q0 -3 8 2zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5t-30 -18.5 t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43q-19 4 -51 9.5 t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49t-14 -48 q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54q110 143 124 195 q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5t-40.5 -33.5t-61 -14 q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5t15.5 47.5q1 -31 8 -56.5 t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
380	+ <glyph unicode="" d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -6 6.5 -17.5t7.5 -16.5q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
381	+ <glyph unicode="" d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
382	+ <glyph unicode="" horiz-adv-x="1664" d="M1483 512l-587 -587q-52 -53 -127.5 -53t-128.5 53l-587 587q-53 53 -53 128t53 128l587 587q53 53 128 53t128 -53l265 -265l-398 -399l-188 188q-42 42 -99 42q-59 0 -100 -41l-120 -121q-42 -40 -42 -99q0 -58 42 -100l406 -408q30 -28 67 -37l6 -4h28q60 0 99 41 l619 619l2 -3q53 -53 53 -128t-53 -128zM1406 1138l120 -120q14 -15 14 -36t-14 -36l-730 -730q-17 -15 -37 -15v0q-4 0 -6 1q-18 2 -30 14l-407 408q-14 15 -14 36t14 35l121 120q13 15 35 15t36 -15l252 -252l574 575q15 15 36 15t36 -15z" />
383	+ <glyph unicode="" d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
384	+ <glyph unicode="" horiz-adv-x="1280" d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
385	+ <glyph unicode="" horiz-adv-x="1024" d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
386	+ <glyph unicode="" d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
387	+ <glyph unicode="" horiz-adv-x="1792" d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
388	+ <glyph unicode="" d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
389	+ <glyph unicode="" horiz-adv-x="1792" d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
390	+ <glyph unicode="" horiz-adv-x="1664" d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
391	+ <glyph unicode="" horiz-adv-x="1920" d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-78 -100 -90 -131q-17 -41 14 -81q17 -21 81 -82h1l1 -1l1 -1l2 -2q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q17 19 38 30q53 26 239 24 q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 q39 5 64 -2.5t31 -16.5z" />
392	+ <glyph unicode="" horiz-adv-x="1792" d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
393	+ <glyph unicode="" d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495 q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" />
394	+ <glyph unicode="" horiz-adv-x="1408" d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5 t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56 t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -5 1 -50.5t-1 -71.5q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5 t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" />
395	+ <glyph unicode="" horiz-adv-x="1280" d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z " />
396	+ <glyph unicode="" d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
397	+ <glyph unicode="" d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
398	+ <glyph unicode="" d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
399	+ <glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5 t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
400	+ <glyph unicode="" horiz-adv-x="1664" d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128 q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 16 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" />
401	+ <glyph unicode="" d="M1254 899q16 85 -21 132q-52 65 -187 45q-17 -3 -41 -12.5t-57.5 -30.5t-64.5 -48.5t-59.5 -70t-44.5 -91.5q80 7 113.5 -16t26.5 -99q-5 -52 -52 -143q-43 -78 -71 -99q-44 -32 -87 14q-23 24 -37.5 64.5t-19 73t-10 84t-8.5 71.5q-23 129 -34 164q-12 37 -35.5 69 t-50.5 40q-57 16 -127 -25q-54 -32 -136.5 -106t-122.5 -102v-7q16 -8 25.5 -26t21.5 -20q21 -3 54.5 8.5t58 10.5t41.5 -30q11 -18 18.5 -38.5t15 -48t12.5 -40.5q17 -46 53 -187q36 -146 57 -197q42 -99 103 -125q43 -12 85 -1.5t76 31.5q131 77 250 237 q104 139 172.5 292.5t82.5 226.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
402	+ <glyph unicode="" horiz-adv-x="1152" d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160 q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
403	+ <glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832 q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
404	+ <glyph unicode="" horiz-adv-x="1792" />
405	+ <glyph unicode="" horiz-adv-x="1792" />
406	+ <glyph unicode="" horiz-adv-x="1792" />
407	+ <glyph unicode="" horiz-adv-x="1792" />
408	+ <glyph unicode="" horiz-adv-x="1792" />
409	+ <glyph unicode="" horiz-adv-x="1792" />
410	+ <glyph unicode="" horiz-adv-x="1792" />
411	+ <glyph unicode="" horiz-adv-x="1792" />
412	+ <glyph unicode="" horiz-adv-x="1792" />
413	+ </font>
414	+ </defs></svg>

font/fontawesome-webfont.ttf ADDED Viewed

Binary file

font/fontawesome-webfont.woff ADDED Viewed

Binary file

images/select2-spinner.gif ADDED Viewed

Binary file

images/select2.png ADDED Viewed

Binary file

images/select2x2.png ADDED Viewed

Binary file

js/input.js ADDED Viewed

	@@ -0,0 +1,51 @@


1	+ (function($){
2	+
3	+
4	+ /*
5	+ * acf/setup_fields
6	+ *
7	+ * This event is triggered when ACF adds any new elements to the DOM.
8	+ *
9	+ * @type function
10	+ * @since 1.0.0
11	+ * @date 01/01/12
12	+ *
13	+ * @param event e: an event object. This can be ignored
14	+ * @param Element postbox: An element which contains the new HTML
15	+ *
16	+ * @return N/A
17	+ */
18	+
19	+ $(document).live('acf/setup_fields', function(e, postbox){
20	+
21	+ $(postbox).find('.font-awesome').each(function(){
22	+
23	+ $(".fa-select2-field").select2({
24	+ width : 'resolve'
25	+ });
26	+
27	+ $('.fa-select2-field').on( 'select2-selecting', function( object ) {
28	+ update_preview( this, object.val );
29	+ });
30	+
31	+ $('.fa-select2-field').each(function(index, el) {
32	+ update_preview( this, $(this).val() );
33	+ });
34	+
35	+ $('.fa-select2-field').on( 'select2-highlight', function( object ) {
36	+ update_preview( this, object.val );
37	+ });
38	+
39	+ $('.fa-select2-field').on( 'select2-close', function( object ) {
40	+ update_preview( this, $(this).val() );
41	+ });
42	+
43	+ function update_preview( element, selected ) {
44	+ $(element).prevAll('.fa-live-preview').html( '<i class="fa ' + selected + '"></i>' );
45	+ }
46	+
47	+ });
48	+
49	+ });
50	+
51	+ })(jQuery);

js/select2/select2.min.js ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ /*
2	+ Copyright 2012 Igor Vaynberg
3	+
4	+ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
5	+
6	+ This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
7	+ General Public License version 2 (the "GPL License"). You may choose either license to govern your
8	+ use of this software only upon the condition that you accept all of the terms of either the Apache
9	+ License or the GPL License.
10	+
11	+ You may obtain a copy of the Apache License and the GPL License at:
12	+
13	+ http://www.apache.org/licenses/LICENSE-2.0
14	+ http://www.gnu.org/licenses/gpl-2.0.html
15	+
16	+ Unless required by applicable law or agreed to in writing, software distributed under the Apache License
17	+ or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
18	+ either express or implied. See the Apache License and the GPL License for the specific language governing
19	+ permissions and limitations under the Apache License and the GPL License.
20	+ */
21	+ !function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(a){var b,c,d,e;if(!a\|\|a.length<1)return a;for(b="",c=0,d=a.length;d>c;c++)e=a.charAt(c),b+=m[e]\|\|e;return b}function o(a,b){for(var c=0,d=b.length;d>c;c+=1)if(q(a,b[c]))return c;return-1}function p(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function q(a,c){return a===c?!0:a===b\|\|c===b?!1:null===a\|\|null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function r(b,c){var d,e,f;if(null===b\|\|b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function s(a){return a.outerWidth(!1)-a.width()}function t(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function u(c){c.on("mousemove",function(c){var d=i;(d===b\|\|d.x!==c.pageX\|\|d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function v(a,c,d){d=d\|\|b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function w(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function x(a,b){var c=v(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){o(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle\|\|window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=n(a.toUpperCase()).indexOf(n(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis\|\|100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport\|\|a.fn.select2.ajaxDefaults.transport,k={type:c.type\|\|"GET",cache:c.cache\|\|!1,jsonpCallback:c.jsonpCallback\|\|b,dataType:c.dataType\|\|"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)\|\|(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length\|\|b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f\|\|e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw new Error(c+" must be a function or a falsy value")}function K(b){return a.isFunction(b)?b():b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice\|\|!e.tokenSeparators\|\|e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(q(e.id(h),e.id(c[j]))){g=!0;break}g\|\|d(h)}}return f!==a?a:void 0}function N(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=N(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")\|\|"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]=>\\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=w(function(){return c.element.closest("body")}),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),u(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),t(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k\|\|p(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.nextSearchTerm=b},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus\|\|!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:q(a.attr("locked"),"locked")\|\|q(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,i=this.opts.id;g=function(d,e,j){var k,l,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),k=0,l=d.length;l>k;k+=1)m=d[k],o=m.disabled===!0,n=!o&&i(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+j),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("select2-result-sub"),g(m.children,s,j+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c\|\|("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0&&(c.ajax.url=g),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(r(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return q(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,d,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var c=a.prop("disabled");c===b&&(c=!1),this.enable(!c);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass))}),a.on("propertychange.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),d=window.MutationObserver\|\|window.WebKitMutationObserver\|\|window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b\|\|{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=this.body().scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(t=this.body().offset(),m-=t.top,n-=t.left),r\|\|(n=c.left+e-q),w={left:n,width:e},u?(w.bottom=i-c.top,w.top="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1\|\|this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){var f,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close({focus:!0}),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),f=e.offset().top+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=e.offset().top-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled, .select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?o(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.ensureHighlightVisible(),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(e.opts.formatLoadMore(d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown()}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0\|\|!k\|\|!q(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0\|\|this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+f.formatSelectionTooBig(o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;
22	+ if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return q(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")\|\|this.opts.element.attr("data-placeholder")\|\|this.opts.element.data("placeholder")\|\|this.opts.placeholder\|\|((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a\|\|"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width\|\|"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px\|em\|ex\|%\|in\|cm\|mm\|pt\|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>"," </div>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e)),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(a){this.opened()&&(this.parent.close.apply(this,arguments),a=a\|\|{focus:!0},this.focusser.removeAttr("disabled"),a.focus&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var b,d=this.container,e=this.dropdown;this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP\|\|a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN\|\|a.which==c.UP\|\|a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE\|\|a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),t(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(b)})),e.on("mousedown",this.bind(function(){this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()\|\|(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()?(a=this.getPlaceholderOption())!==b&&a.prop("selected")\|\|""===this.opts.element.val()\|\|this.opts.element.val()===b\|\|null===this.opts.element.val():!1},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=q(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return q(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus\|\|this.focusser.focus(),q(c,this.id(a))\|\|this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=r(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return q(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(q(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]\|\|(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()\|\|this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT\|\|a.which==c.RIGHT\|\|a.which==c.BACKSPACE\|\|a.which==c.DELETE\|\|a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?(this.unselect(b.first()),this.search.width(10),h=e.length?e:f):a.which==c.DELETE?(this.unselect(b.first()),this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length\|\|this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns\|\|a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return}this.open(),(a.which===c.PAGE_UP\|\|a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()\|\|this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0\|\|(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select\|\|""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){o(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select\|\|!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus\|\|this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),A(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){for(;(e=o(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();var f=a.Event("select2-removing");f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented()\|\|(b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}))}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));o(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")\|\|0!==b.find(".select2-result-selectable:not(.select2-selected)").length\|\|b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a\|\|a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-s(this.search)},resizeSearch:function(){var a,b,c,d,e,f=s(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),r(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){o(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)q(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length\|\|(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b\|\|(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],l=["opened","isFocused","container","dropdown"],m=["val","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length\|\|"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple\|\|!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(o(c[0],k)<0)throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),o(c[0],l)>=0\|\|o(c[0],m)&&1==c.length)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return n(""+b).toUpperCase().indexOf(n(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:v,markMatch:E,escapeMarkup:F,stripDiacritics:n},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);

js/select2/select2_locale_ar.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Arabic translation.
3	+ *
4	+ * Author: Your Name <amedhat3@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "لا توجد نتائج"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "من فضلك أدخل " + n + " حروف أكثر"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "من فضلك أحذف " + n + " حروف"; },
13	+ formatSelectionTooBig: function (limit) { return "يمكنك ان تختار " + limit + " أختيارات فقط"; },
14	+ formatLoadMore: function (pageNumber) { return "تحمل المذيد من النتائج ..."; },
15	+ formatSearching: function () { return "جاري البحث ..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_bg.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <Language> translation.
3	+ *
4	+ * Author: Lubomir Vikev <lubomirvikev@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Няма намерени съвпадения"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n == 1 ? "" : "а"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n == 1? "" : "а"); },
13	+ formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit == 1 ? " избор" : " избора"); },
14	+ formatLoadMore: function (pageNumber) { return "Зареждат се още..."; },
15	+ formatSearching: function () { return "Търсене..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_ca.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Catalan translation.
3	+ *
4	+ * Author: David Planella <david.planella@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
13	+ formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
14	+ formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats..."; },
15	+ formatSearching: function () { return "S'està cercant..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_cs.js ADDED Viewed

	@@ -0,0 +1,49 @@


1	+ /**
2	+ * Select2 Czech translation.
3	+ *
4	+ * Author: Michal Marek <ahoj@michal-marek.cz>
5	+ * Author - sklonovani: David Vallner <david@vallner.net>
6	+ */
7	+ (function ($) {
8	+ "use strict";
9	+ // use text for the numbers 2 through 4
10	+ var smallNumbers = {
11	+ 2: function(masc) { return (masc ? "dva" : "dvě"); },
12	+ 3: function() { return "tři"; },
13	+ 4: function() { return "čtyři"; }
14	+ }
15	+ $.extend($.fn.select2.defaults, {
16	+ formatNoMatches: function () { return "Nenalezeny žádné položky"; },
17	+ formatInputTooShort: function (input, min) {
18	+ var n = min - input.length;
19	+ if (n == 1) {
20	+ return "Prosím zadejte ještě jeden znak";
21	+ } else if (n <= 4) {
22	+ return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
23	+ } else {
24	+ return "Prosím zadejte ještě dalších "+n+" znaků";
25	+ }
26	+ },
27	+ formatInputTooLong: function (input, max) {
28	+ var n = input.length - max;
29	+ if (n == 1) {
30	+ return "Prosím zadejte o jeden znak méně";
31	+ } else if (n <= 4) {
32	+ return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
33	+ } else {
34	+ return "Prosím zadejte o "+n+" znaků méně";
35	+ }
36	+ },
37	+ formatSelectionTooBig: function (limit) {
38	+ if (limit == 1) {
39	+ return "Můžete zvolit jen jednu položku";
40	+ } else if (limit <= 4) {
41	+ return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
42	+ } else {
43	+ return "Můžete zvolit maximálně "+limit+" položek";
44	+ }
45	+ },
46	+ formatLoadMore: function (pageNumber) { return "Načítají se další výsledky..."; },
47	+ formatSearching: function () { return "Vyhledávání..."; }
48	+ });
49	+ })(jQuery);

js/select2/select2_locale_da.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Danish translation.
3	+ *
4	+ * Author: Anders Jenbo <anders@jenbo.dk>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Ingen resultater fundet"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
13	+ formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
14	+ formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
15	+ formatSearching: function () { return "Søger…"; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_de.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 German translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
11	+ formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
12	+ formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse..."; },
13	+ formatSearching: function () { return "Suche..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_el.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <Language> translation.
3	+ *
4	+ * Author: Your Name <your@email>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n == 1 ? "" : "υς") + " χαρακτήρ" + (n == 1 ? "α" : "ες"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n == 1 ? "α" : "ες"); },
13	+ formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit == 1 ? "ο" : "α"); },
14	+ formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων..."; },
15	+ formatSearching: function () { return "Αναζήτηση..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_en.js.template ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <Language> translation.
3	+ *
4	+ * Author: Your Name <your@email>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "No matches found"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1 ? "" : "s"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
13	+ formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
14	+ formatLoadMore: function (pageNumber) { return "Loading more results..."; },
15	+ formatSearching: function () { return "Searching..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_es.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Spanish translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "No se encontraron resultados"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "á" : "a") + "cter" + (n == 1? "" : "es"); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "á" : "a") + "cter" + (n == 1? "" : "es"); },
11	+ formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
12	+ formatLoadMore: function (pageNumber) { return "Cargando más resultados..."; },
13	+ formatSearching: function () { return "Buscando..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_et.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Estonian translation.
3	+ *
4	+ * Author: Kuldar Kalvik <kuldar@kalvik.ee>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Tulemused puuduvad"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
13	+ formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
14	+ formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
15	+ formatSearching: function () { return "Otsin.."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_eu.js ADDED Viewed

	@@ -0,0 +1,43 @@


1	+ /**
2	+ * Select2 Basque translation.
3	+ *
4	+ * Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () {
11	+ return "Ez da bat datorrenik aurkitu";
12	+ },
13	+ formatInputTooShort: function (input, min) {
14	+ var n = min - input.length;
15	+ if (n === 1) {
16	+ return "Idatzi karaktere bat gehiago";
17	+ } else {
18	+ return "Idatzi " + n + " karaktere gehiago";
19	+ }
20	+ },
21	+ formatInputTooLong: function (input, max) {
22	+ var n = input.length - max;
23	+ if (n === 1) {
24	+ return "Idatzi karaktere bat gutxiago";
25	+ } else {
26	+ return "Idatzi " + n + " karaktere gutxiago";
27	+ }
28	+ },
29	+ formatSelectionTooBig: function (limit) {
30	+ if (limit === 1 ) {
31	+ return "Elementu bakarra hauta dezakezu";
32	+ } else {
33	+ return limit + " elementu hauta ditzakezu soilik";
34	+ }
35	+ },
36	+ formatLoadMore: function (pageNumber) {
37	+ return "Emaitza gehiago kargatzen...";
38	+ },
39	+ formatSearching: function () {
40	+ return "Bilatzen...";
41	+ }
42	+ });
43	+ })(jQuery);

js/select2/select2_locale_fa.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <fa> translation.
3	+ *
4	+ * Author: Ali Choopan <choopan@arsh.co>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "نتیجه‌ای یافت نشد."; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return " لطفا بیش از"+n+"کاراکتر وارد نمایید "; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return " لطفا" + n + " کاراکتر را حذف کنید."; },
13	+ formatSelectionTooBig: function (limit) { return "شما فقط می‌توانید " + limit + " مورد را انتخاب کنید"; },
14	+ formatLoadMore: function (pageNumber) { return "در حال بارگذاری موارد بیشتر ..."; },
15	+ formatSearching: function () { return "در حال جستجو"; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_fi.js ADDED Viewed

	@@ -0,0 +1,28 @@


1	+ /**
2	+ * Select2 Finnish translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+ $.extend($.fn.select2.defaults, {
7	+ formatNoMatches: function () {
8	+ return "Ei tuloksia";
9	+ },
10	+ formatInputTooShort: function (input, min) {
11	+ var n = min - input.length;
12	+ return "Ole hyvä ja anna " + n + " merkkiä lisää";
13	+ },
14	+ formatInputTooLong: function (input, max) {
15	+ var n = input.length - max;
16	+ return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
17	+ },
18	+ formatSelectionTooBig: function (limit) {
19	+ return "Voit valita ainoastaan " + limit + " kpl";
20	+ },
21	+ formatLoadMore: function (pageNumber) {
22	+ return "Ladataan lisää tuloksia...";
23	+ },
24	+ formatSearching: function () {
25	+ return "Etsitään...";
26	+ }
27	+ });
28	+ })(jQuery);

js/select2/select2_locale_fr.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 French translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Aucun résultat trouvé"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Merci de saisir " + n + " caractère" + (n == 1? "" : "s") + " de plus"; },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Merci de supprimer " + n + " caractère" + (n == 1? "" : "s"); },
11	+ formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
12	+ formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires..."; },
13	+ formatSearching: function () { return "Recherche en cours..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_gl.js ADDED Viewed

	@@ -0,0 +1,43 @@


1	+ /**
2	+ * Select2 Galician translation
3	+ *
4	+ * Author: Leandro Regueiro <leandro.regueiro@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () {
11	+ return "Non se atoparon resultados";
12	+ },
13	+ formatInputTooShort: function (input, min) {
14	+ var n = min - input.length;
15	+ if (n === 1) {
16	+ return "Engada un carácter";
17	+ } else {
18	+ return "Engada " + n + " caracteres";
19	+ }
20	+ },
21	+ formatInputTooLong: function (input, max) {
22	+ var n = input.length - max;
23	+ if (n === 1) {
24	+ return "Elimine un carácter";
25	+ } else {
26	+ return "Elimine " + n + " caracteres";
27	+ }
28	+ },
29	+ formatSelectionTooBig: function (limit) {
30	+ if (limit === 1 ) {
31	+ return "Só pode seleccionar un elemento";
32	+ } else {
33	+ return "Só pode seleccionar " + limit + " elementos";
34	+ }
35	+ },
36	+ formatLoadMore: function (pageNumber) {
37	+ return "Cargando máis resultados...";
38	+ },
39	+ formatSearching: function () {
40	+ return "Buscando...";
41	+ }
42	+ });
43	+ })(jQuery);

js/select2/select2_locale_he.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Hebrew translation.
3	+ *
4	+ * Author: Yakir Sitbon <http://www.yakirs.net/>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "לא נמצאו התאמות"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
13	+ formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
14	+ formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות..."; },
15	+ formatSearching: function () { return "מחפש..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_hr.js ADDED Viewed

	@@ -0,0 +1,42 @@


1	+ /**
2	+ * Select2 Croatian translation.
3	+ *
4	+ * Author: Edi Modrić <edi.modric@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ var specialNumbers = {
10	+ 1: function(n) { return (n % 100 != 11 ? "znak" : "znakova"); },
11	+ 2: function(n) { return (n % 100 != 12 ? "znaka" : "znakova"); },
12	+ 3: function(n) { return (n % 100 != 13 ? "znaka" : "znakova"); },
13	+ 4: function(n) { return (n % 100 != 14 ? "znaka" : "znakova"); }
14	+ };
15	+
16	+ $.extend($.fn.select2.defaults, {
17	+ formatNoMatches: function () { return "Nema rezultata"; },
18	+ formatInputTooShort: function (input, min) {
19	+ var n = min - input.length;
20	+ var nMod10 = n % 10;
21	+
22	+ if (nMod10 > 0 && nMod10 < 5) {
23	+ return "Unesite još " + n + " " + specialNumbers[nMod10](n);
24	+ }
25	+
26	+ return "Unesite još " + n + " znakova";
27	+ },
28	+ formatInputTooLong: function (input, max) {
29	+ var n = input.length - max;
30	+ var nMod10 = n % 10;
31	+
32	+ if (nMod10 > 0 && nMod10 < 5) {
33	+ return "Unesite " + n + " " + specialNumbers[nMod10](n) + " manje";
34	+ }
35	+
36	+ return "Unesite " + n + " znakova manje";
37	+ },
38	+ formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
39	+ formatLoadMore: function (pageNumber) { return "Učitavanje rezultata..."; },
40	+ formatSearching: function () { return "Pretraga..."; }
41	+ });
42	+ })(jQuery);

js/select2/select2_locale_hu.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Hungarian translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Nincs találat."; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " kerekterrel több mint kellene."; },
11	+ formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
12	+ formatLoadMore: function (pageNumber) { return "Töltés..."; },
13	+ formatSearching: function () { return "Keresés..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_id.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Indonesian translation.
3	+ *
4	+ * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
13	+ formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
14	+ formatLoadMore: function (pageNumber) { return "Mengambil data..."; },
15	+ formatSearching: function () { return "Mencari..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_is.js ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ /**
2	+ * Select2 Icelandic translation.
3	+ *
4	+ */
5	+ (function ($) {
6	+ "use strict";
7	+
8	+ $.extend($.fn.select2.defaults, {
9	+ formatNoMatches: function () { return "Ekkert fannst"; },
10	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n == 1 ? "" : "i") + " í viðbót"; },
11	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n == 1 ? "" : "i"); },
12	+ formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
13	+ formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður..."; },
14	+ formatSearching: function () { return "Leita..."; }
15	+ });
16	+ })(jQuery);

js/select2/select2_locale_it.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Italian translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
11	+ formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
12	+ formatLoadMore: function (pageNumber) { return "Caricamento in corso..."; },
13	+ formatSearching: function () { return "Ricerca..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_ja.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Japanese translation.
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "該当なし"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
11	+ formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
12	+ formatLoadMore: function (pageNumber) { return "読込中･･･"; },
13	+ formatSearching: function () { return "検索中･･･"; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_ko.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <Language> translation.
3	+ *
4	+ * Author: Swen Mun <longfinfunnel@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "결과 없음"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
13	+ formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
14	+ formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
15	+ formatSearching: function () { return "검색 중…"; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_lt.js ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ /**
2	+ * Select2 lithuanian translation.
3	+ *
4	+ * Author: CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Atitikmenų nerasta"; },
11	+ formatInputTooShort: function (input, min) {
12	+ var n = min - input.length,
13	+ suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) \|\| (n % 100 >= 20))) ? 'ius' : 'ių');
14	+ return "Įrašykite dar " + n + " simbol" + suffix;
15	+ },
16	+ formatInputTooLong: function (input, max) {
17	+ var n = input.length - max,
18	+ suffix = (n % 10 == 1) && (n % 100 != 11) ? 'į' : (((n % 10 >= 2) && ((n % 100 < 10) \|\| (n % 100 >= 20))) ? 'ius' : 'ių');
19	+ return "Pašalinkite " + n + " simbol" + suffix;
20	+ },
21	+ formatSelectionTooBig: function (limit) {
22	+ var n = limit,
23	+ suffix = (n % 10 == 1) && (n % 100 != 11) ? 'ą' : (((n % 10 >= 2) && ((n % 100 < 10) \|\| (n % 100 >= 20))) ? 'us' : 'ų');
24	+ return "Jūs galite pasirinkti tik " + limit + " element" + suffix;
25	+ },
26	+ formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų..."; },
27	+ formatSearching: function () { return "Ieškoma..."; }
28	+ });
29	+ })(jQuery);

js/select2/select2_locale_lv.js ADDED Viewed

	@@ -0,0 +1,16 @@


1	+ /**
2	+ * Select2 Latvian translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Sakritību nav"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : (/^\d*[1]$/im.test(n)? "u" : "us")); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : (/^\d*[1]$/im.test(n)? "u" : "iem")) + " mazāk"; },
11	+ formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : (/^\d*[1]$/im.test(limit)? "u" : "us")); },
12	+ formatLoadMore: function (pageNumber) { return "Datu ielāde..."; },
13	+ formatSearching: function () { return "Meklēšana..."; }
14	+ });
15	+
16	+ })(jQuery);

js/select2/select2_locale_mk.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Macedonian translation.
3	+ *
4	+ * Author: Marko Aleksic <psybaron@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
13	+ formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
14	+ formatLoadMore: function (pageNumber) { return "Вчитување резултати..."; },
15	+ formatSearching: function () { return "Пребарување..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_ms.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Malay translation.
3	+ *
4	+ * Author: Kepoweran <kepoweran@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
13	+ formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
14	+ formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan..."; },
15	+ formatSearching: function () { return "Mencari..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_nl.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Dutch translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Geen resultaten gevonden"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " meer in"; },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " minder in"; },
11	+ formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
12	+ formatLoadMore: function (pageNumber) { return "Meer resultaten laden..."; },
13	+ formatSearching: function () { return "Zoeken..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_no.js ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ /**
2	+ * Select2 Norwegian translation.
3	+ *
4	+ * Author: Torgeir Veimo <torgeir.veimo@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Ingen treff"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
13	+ formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
14	+ formatLoadMore: function (pageNumber) { return "Laster flere resultater..."; },
15	+ formatSearching: function () { return "Søker..."; }
16	+ });
17	+ })(jQuery);
18	+

js/select2/select2_locale_pl.js ADDED Viewed

	@@ -0,0 +1,37 @@


1	+ /**
2	+ * Select2 Polish translation.
3	+ *
4	+ * Author: Jan Kondratowicz <jan@kondratowicz.pl>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ var pl_suffix = function(n) {
10	+ if(n == 1) return "";
11	+ if((n%100 > 1 && n%100 < 5) \|\| (n%100 > 20 && n%10 > 1 && n%10 < 5)) return "i";
12	+ return "ów";
13	+ };
14	+
15	+ $.extend($.fn.select2.defaults, {
16	+ formatNoMatches: function () {
17	+ return "Brak wyników.";
18	+ },
19	+ formatInputTooShort: function (input, min) {
20	+ var n = min - input.length;
21	+ return "Wpisz jeszcze " + n + " znak" + pl_suffix(n) + ".";
22	+ },
23	+ formatInputTooLong: function (input, max) {
24	+ var n = input.length - max;
25	+ return "Wpisana fraza jest za długa o " + n + " znak" + pl_suffix(n) + ".";
26	+ },
27	+ formatSelectionTooBig: function (limit) {
28	+ return "Możesz zaznaczyć najwyżej " + limit + " element" + pl_suffix(limit) + ".";
29	+ },
30	+ formatLoadMore: function (pageNumber) {
31	+ return "Ładowanie wyników...";
32	+ },
33	+ formatSearching: function () {
34	+ return "Szukanie...";
35	+ }
36	+ });
37	+ })(jQuery);

js/select2/select2_locale_pt-BR.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Brazilian Portuguese translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Nenhum resultado encontrado"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Informe " + n + " caractere" + (n == 1? "" : "s"); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caractere" + (n == 1? "" : "s"); },
11	+ formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
12	+ formatLoadMore: function (pageNumber) { return "Carregando mais resultados..."; },
13	+ formatSearching: function () { return "Buscando..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_pt-PT.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Portuguese (Portugal) translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Nenhum resultado encontrado"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
11	+ formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
12	+ formatLoadMore: function (pageNumber) { return "A carregar mais resultados..."; },
13	+ formatSearching: function () { return "A pesquisar..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_ro.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Romanian translation.
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Nu a fost găsit nimic"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
11	+ formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
12	+ formatLoadMore: function (pageNumber) { return "Se încarcă..."; },
13	+ formatSearching: function () { return "Căutare..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_ru.js ADDED Viewed

	@@ -0,0 +1,15 @@


1	+ /**
2	+ * Select2 Russian translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+
7	+ $.extend($.fn.select2.defaults, {
8	+ formatNoMatches: function () { return "Совпадений не найдено"; },
9	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Пожалуйста, введите еще " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5) ? "а" : "ов")); },
10	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Пожалуйста, введите на " + n + " символ" + (n == 1 ? "" : ((n > 1)&&(n < 5)? "а" : "ов")) + " меньше"; },
11	+ formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit == 1 ? "а" : "ов"); },
12	+ formatLoadMore: function (pageNumber) { return "Загрузка данных..."; },
13	+ formatSearching: function () { return "Поиск..."; }
14	+ });
15	+ })(jQuery);

js/select2/select2_locale_sk.js ADDED Viewed

	@@ -0,0 +1,48 @@


1	+ /**
2	+ * Select2 Slovak translation.
3	+ *
4	+ * Author: David Vallner <david@vallner.net>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+ // use text for the numbers 2 through 4
9	+ var smallNumbers = {
10	+ 2: function(masc) { return (masc ? "dva" : "dve"); },
11	+ 3: function() { return "tri"; },
12	+ 4: function() { return "štyri"; }
13	+ }
14	+ $.extend($.fn.select2.defaults, {
15	+ formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
16	+ formatInputTooShort: function (input, min) {
17	+ var n = min - input.length;
18	+ if (n == 1) {
19	+ return "Prosím zadajte ešte jeden znak";
20	+ } else if (n <= 4) {
21	+ return "Prosím zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
22	+ } else {
23	+ return "Prosím zadajte ešte ďalších "+n+" znakov";
24	+ }
25	+ },
26	+ formatInputTooLong: function (input, max) {
27	+ var n = input.length - max;
28	+ if (n == 1) {
29	+ return "Prosím zadajte o jeden znak menej";
30	+ } else if (n <= 4) {
31	+ return "Prosím zadajte o "+smallNumbers[n](true)+" znaky menej";
32	+ } else {
33	+ return "Prosím zadajte o "+n+" znakov menej";
34	+ }
35	+ },
36	+ formatSelectionTooBig: function (limit) {
37	+ if (limit == 1) {
38	+ return "Môžete zvoliť len jednu položku";
39	+ } else if (limit <= 4) {
40	+ return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
41	+ } else {
42	+ return "Môžete zvoliť najviac "+limit+" položiek";
43	+ }
44	+ },
45	+ formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky..."; },
46	+ formatSearching: function () { return "Vyhľadávanie..."; }
47	+ });
48	+ })(jQuery);

js/select2/select2_locale_sv.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Swedish translation.
3	+ *
4	+ * Author: Jens Rantil <jens.rantil@telavox.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Inga träffar"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
13	+ formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
14	+ formatLoadMore: function (pageNumber) { return "Laddar fler resultat..."; },
15	+ formatSearching: function () { return "Söker..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_th.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Thai translation.
3	+ *
4	+ * Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "ไม่พบข้อมูล"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
13	+ formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
14	+ formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม..."; },
15	+ formatSearching: function () { return "กำลังค้นข้อมูล..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_tr.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 Turkish translation.
3	+ *
4	+ * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Sonuç bulunamadı"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
13	+ formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
14	+ formatLoadMore: function (pageNumber) { return "Daha fazla..."; },
15	+ formatSearching: function () { return "Aranıyor..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_ua.js ADDED Viewed

	@@ -0,0 +1,17 @@


1	+ /**
2	+ * Select2 <Language> translation.
3	+ *
4	+ * Author: bigmihail <bigmihail@bigmir.net>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Нічого не знайдено"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка ще " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ]; },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max, s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Введіть буль ласка на " + n + " символ" + s[ (n%100>4 && n%100<=20)? 2 : p[Math.min(n%10, 5)] ] + " менше"; },
13	+ formatSelectionTooBig: function (limit) {var s = ["", "и", "ів"], p = [2,0,1,1,1,2]; return "Ви можете вибрати лише " + limit + " елемент" + s[ (limit%100>4 && limit%100<=20)? 2 : p[Math.min(limit%10, 5)] ]; },
14	+ formatLoadMore: function (pageNumber) { return "Завантаження даних..."; },
15	+ formatSearching: function () { return "Пошук..."; }
16	+ });
17	+ })(jQuery);

js/select2/select2_locale_vi.js ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ /**
2	+ * Select2 Vietnamese translation.
3	+ *
4	+ * Author: Long Nguyen <olragon@gmail.com>
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.extend($.fn.select2.defaults, {
10	+ formatNoMatches: function () { return "Không tìm thấy kết quả"; },
11	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
12	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
13	+ formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
14	+ formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả..."; },
15	+ formatSearching: function () { return "Đang tìm..."; }
16	+ });
17	+ })(jQuery);
18	+

js/select2/select2_locale_zh-CN.js ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ /**
2	+ * Select2 Chinese translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+ $.extend($.fn.select2.defaults, {
7	+ formatNoMatches: function () { return "没有找到匹配项"; },
8	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
9	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
10	+ formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
11	+ formatLoadMore: function (pageNumber) { return "加载结果中..."; },
12	+ formatSearching: function () { return "搜索中..."; }
13	+ });
14	+ })(jQuery);

js/select2/select2_locale_zh-TW.js ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ /**
2	+ * Select2 Traditional Chinese translation
3	+ */
4	+ (function ($) {
5	+ "use strict";
6	+ $.extend($.fn.select2.defaults, {
7	+ formatNoMatches: function () { return "沒有找到相符的項目"; },
8	+ formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
9	+ formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
10	+ formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
11	+ formatLoadMore: function (pageNumber) { return "載入中..."; },
12	+ formatSearching: function () { return "搜尋中..."; }
13	+ });
14	+ })(jQuery);

readme.txt ADDED Viewed

	@@ -0,0 +1,55 @@


1	+ === Advanced Custom Fields: Font Awesome ===
2	+ Contributors: mattkeys
3	+ Tags: Advanced Custom Fields, ACF, Font Awesome, FontAwesome
4	+ Requires at least: 3.5
5	+ Tested up to: 3.8.1
6	+ Stable tag: trunk
7	+ License: GPLv2 or later
8	+ License URI: http://www.gnu.org/licenses/gpl-2.0.html
9	+
10	+ Adds a new 'Font Awesome Icon' field to the popular Advanced Custom Fields plugin.
11	+
12	+ == Description ==
13	+
14	+ Add a [Font Awesome](http://fontawesome.io/) icon field type to Advanced Custom Fields.
15	+
16	+ * Optionally set a default icon
17	+ * Returns Icon Element, or Icon Class, or Object include class, element, and unicode value
18	+ * Optionally enqueues Font Awesome in footer
19	+
20	+ = Compatibility =
21	+
22	+ This add-on will work with:
23	+
24	+ * version 4 and up
25	+
26	+ == Installation ==
27	+
28	+ This add-on can be treated as both a WP plugin and a theme include.
29	+
30	+ = Plugin =
31	+ 1. Copy the 'acf-font-awesome' folder into your plugins folder
32	+ 2. Activate the plugin via the Plugins admin page
33	+
34	+ = Include =
35	+ 1. Copy the 'acf-font-awesome' folder into your theme folder (can use sub folders). You can place the folder anywhere inside the 'wp-content' directory
36	+ 2. Edit your functions.php file and add the code below (Make sure the path is correct to include the acf-font-awesome.php file)
37	+
38	+ `
39	+ add_action('acf/register_fields', 'my_register_fields');
40	+
41	+ function my_register_fields()
42	+ {
43	+ include_once('acf-font-awesome/acf-font-awesome.php');
44	+ }
45	+ `
46	+
47	+ == Screenshots ==
48	+
49	+ 1. Set a default icon, and choose how you want icon data to be returned.
50	+ 2. Searchable list of all icons, including large live preview
51	+
52	+ == Changelog ==
53	+
54	+ = 1.0.0 =
55	+ * Initial Release.

Advanced Custom Fields: Font Awesome Field - Version 1.0.0

Version Description

Release Info

Version 1.0.0