Version Description
( August 23, 2015 ) = * Improved: Adding rows in form layout. * Added: Conditional groups. * Added: New helper classes for form processors. * Fixed: Issue where forms with a file field, without a file uploaded, would break mailer validation. * Added: Date range settings for date picker fields. * Improved: Colors in form editor. * Improved: Inline docs in Caldera_Forms class. * Added: 2 new form templates. * Fixed: Issue with field scripts being double loaded. * Fixed: Issue affecting color pickers as conditional fields. * Update Translations: German (de_DE), Spanish (es_ES), French (fr_FR), Japanese (ja), Portuguese (pt_PT), Turkish (tr_TR).
Download this release
Release Info
| Developer | Shelob9 |
| Plugin |  Caldera Forms – More Than Contact Forms |
| Version | 1.3.0 |
| Comparing to | |
| See all releases | |
Code changes from version 1.2.2 to 1.3.0
- LICENSE +339 -0
- README.md +12 -0
- assets/css/admin.css +45 -6
- assets/css/editor-grid.css +31 -4
- assets/css/processors-edit.css +44 -3
- assets/js/conditionals.js +2 -2
- assets/js/conditionals.min.js +1 -1
- assets/js/edit.js +39 -19
- assets/js/edit.min.js +2 -2
- assets/js/frontend-script-init.js +12 -2
- assets/js/frontend-script-init.min.js +1 -1
- assets/js/wp-baldrick-full.js +43 -38
- caldera-core.php +7 -2
- classes/Caldera_Forms_Save_Final.php +391 -0
- classes/admin.php +170 -55
- classes/core.php +527 -388
- composer.json +15 -0
- fields/button/field.php +7 -1
- fields/calculation/field.php +11 -2
- fields/date_picker/datepicker.php +15 -3
- fields/date_picker/setup.php +18 -4
- fields/file/config_template.php +7 -0
- fields/file/field.php +9 -2
- fields/gravatar/field.php +5 -0
- fields/html/field.php +14 -2
- fields/range_slider/field.php +23 -16
- fields/recaptcha/field.php +9 -1
- fields/select2/css/ccselect2-spinner.gif +0 -0
- fields/select2/css/ccselect2.png +0 -0
- fields/select2/css/ccselect2x2.png +0 -0
- fields/select2/css/select2.css +706 -0
- fields/select2/field/config.php +55 -0
- fields/select2/field/field.php +139 -0
- fields/select2/field/preview.php +12 -0
- fields/select2/js/select2.min.js +24 -0
- fields/select2/select2.php +27 -0
- fields/star-rate/field.php +5 -1
- fields/states/field.php +1 -1
- fields/toggle_switch/field.php +7 -2
- includes/field_processors.php +47 -11
- includes/templates/registration-form-example.php +308 -0
- includes/templates/starter-contact-form.php +219 -0
- includes/templates/variable-price-example.php +311 -0
- languages/caldera-forms-de_DE.mo +0 -0
- languages/caldera-forms-de_DE.po +350 -241
- languages/caldera-forms-es_ES.mo +0 -0
- languages/caldera-forms-es_ES.po +349 -240
- languages/caldera-forms-fr_FR.mo +0 -0
- languages/caldera-forms-fr_FR.po +629 -507
- languages/caldera-forms-ja.mo +0 -0
- languages/caldera-forms-ja.po +346 -243
- languages/caldera-forms-pt_PT.mo +0 -0
- languages/caldera-forms-pt_PT.po +1761 -0
- languages/caldera-forms-tr_TR.mo +0 -0
- languages/caldera-forms-tr_TR.po +1753 -0
- languages/caldera-forms.pot +334 -237
- processors/classes/get_data.php +231 -0
- processors/classes/load.php +209 -0
- processors/classes/ui.php +275 -0
- readme.txt +51 -5
- ui/admin.php +30 -0
- ui/admin_templates.php +1 -1
- ui/community.php +1 -1
- ui/edit.php +65 -26
- ui/extend.php +8 -2
- ui/news_templates.php +2 -2
- ui/panels/conditions.php +366 -0
- ui/panels/emailer.php +7 -2
- ui/panels/layout.php +1 -0
- ui/panels/layout_toolbar.php +62 -0
- ui/panels/processors.php +2 -2
LICENSE
ADDED
|
@@ -0,0 +1,339 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
GNU GENERAL PUBLIC LICENSE
|
| 2 |
+
Version 2, June 1991
|
| 3 |
+
|
| 4 |
+
Copyright (C) 1989, 1991 Free Software Foundation, Inc., <http://fsf.org/>
|
| 5 |
+
51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
|
| 6 |
+
Everyone is permitted to copy and distribute verbatim copies
|
| 7 |
+
of this license document, but changing it is not allowed.
|
| 8 |
+
|
| 9 |
+
Preamble
|
| 10 |
+
|
| 11 |
+
The licenses for most software are designed to take away your
|
| 12 |
+
freedom to share and change it. By contrast, the GNU General Public
|
| 13 |
+
License is intended to guarantee your freedom to share and change free
|
| 14 |
+
software--to make sure the software is free for all its users. This
|
| 15 |
+
General Public License applies to most of the Free Software
|
| 16 |
+
Foundation's software and to any other program whose authors commit to
|
| 17 |
+
using it. (Some other Free Software Foundation software is covered by
|
| 18 |
+
the GNU Lesser General Public License instead.) You can apply it to
|
| 19 |
+
your programs, too.
|
| 20 |
+
|
| 21 |
+
When we speak of free software, we are referring to freedom, not
|
| 22 |
+
price. Our General Public Licenses are designed to make sure that you
|
| 23 |
+
have the freedom to distribute copies of free software (and charge for
|
| 24 |
+
this service if you wish), that you receive source code or can get it
|
| 25 |
+
if you want it, that you can change the software or use pieces of it
|
| 26 |
+
in new free programs; and that you know you can do these things.
|
| 27 |
+
|
| 28 |
+
To protect your rights, we need to make restrictions that forbid
|
| 29 |
+
anyone to deny you these rights or to ask you to surrender the rights.
|
| 30 |
+
These restrictions translate to certain responsibilities for you if you
|
| 31 |
+
distribute copies of the software, or if you modify it.
|
| 32 |
+
|
| 33 |
+
For example, if you distribute copies of such a program, whether
|
| 34 |
+
gratis or for a fee, you must give the recipients all the rights that
|
| 35 |
+
you have. You must make sure that they, too, receive or can get the
|
| 36 |
+
source code. And you must show them these terms so they know their
|
| 37 |
+
rights.
|
| 38 |
+
|
| 39 |
+
We protect your rights with two steps: (1) copyright the software, and
|
| 40 |
+
(2) offer you this license which gives you legal permission to copy,
|
| 41 |
+
distribute and/or modify the software.
|
| 42 |
+
|
| 43 |
+
Also, for each author's protection and ours, we want to make certain
|
| 44 |
+
that everyone understands that there is no warranty for this free
|
| 45 |
+
software. If the software is modified by someone else and passed on, we
|
| 46 |
+
want its recipients to know that what they have is not the original, so
|
| 47 |
+
that any problems introduced by others will not reflect on the original
|
| 48 |
+
authors' reputations.
|
| 49 |
+
|
| 50 |
+
Finally, any free program is threatened constantly by software
|
| 51 |
+
patents. We wish to avoid the danger that redistributors of a free
|
| 52 |
+
program will individually obtain patent licenses, in effect making the
|
| 53 |
+
program proprietary. To prevent this, we have made it clear that any
|
| 54 |
+
patent must be licensed for everyone's free use or not licensed at all.
|
| 55 |
+
|
| 56 |
+
The precise terms and conditions for copying, distribution and
|
| 57 |
+
modification follow.
|
| 58 |
+
|
| 59 |
+
GNU GENERAL PUBLIC LICENSE
|
| 60 |
+
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
|
| 61 |
+
|
| 62 |
+
0. This License applies to any program or other work which contains
|
| 63 |
+
a notice placed by the copyright holder saying it may be distributed
|
| 64 |
+
under the terms of this General Public License. The "Program", below,
|
| 65 |
+
refers to any such program or work, and a "work based on the Program"
|
| 66 |
+
means either the Program or any derivative work under copyright law:
|
| 67 |
+
that is to say, a work containing the Program or a portion of it,
|
| 68 |
+
either verbatim or with modifications and/or translated into another
|
| 69 |
+
language. (Hereinafter, translation is included without limitation in
|
| 70 |
+
the term "modification".) Each licensee is addressed as "you".
|
| 71 |
+
|
| 72 |
+
Activities other than copying, distribution and modification are not
|
| 73 |
+
covered by this License; they are outside its scope. The act of
|
| 74 |
+
running the Program is not restricted, and the output from the Program
|
| 75 |
+
is covered only if its contents constitute a work based on the
|
| 76 |
+
Program (independent of having been made by running the Program).
|
| 77 |
+
Whether that is true depends on what the Program does.
|
| 78 |
+
|
| 79 |
+
1. You may copy and distribute verbatim copies of the Program's
|
| 80 |
+
source code as you receive it, in any medium, provided that you
|
| 81 |
+
conspicuously and appropriately publish on each copy an appropriate
|
| 82 |
+
copyright notice and disclaimer of warranty; keep intact all the
|
| 83 |
+
notices that refer to this License and to the absence of any warranty;
|
| 84 |
+
and give any other recipients of the Program a copy of this License
|
| 85 |
+
along with the Program.
|
| 86 |
+
|
| 87 |
+
You may charge a fee for the physical act of transferring a copy, and
|
| 88 |
+
you may at your option offer warranty protection in exchange for a fee.
|
| 89 |
+
|
| 90 |
+
2. You may modify your copy or copies of the Program or any portion
|
| 91 |
+
of it, thus forming a work based on the Program, and copy and
|
| 92 |
+
distribute such modifications or work under the terms of Section 1
|
| 93 |
+
above, provided that you also meet all of these conditions:
|
| 94 |
+
|
| 95 |
+
a) You must cause the modified files to carry prominent notices
|
| 96 |
+
stating that you changed the files and the date of any change.
|
| 97 |
+
|
| 98 |
+
b) You must cause any work that you distribute or publish, that in
|
| 99 |
+
whole or in part contains or is derived from the Program or any
|
| 100 |
+
part thereof, to be licensed as a whole at no charge to all third
|
| 101 |
+
parties under the terms of this License.
|
| 102 |
+
|
| 103 |
+
c) If the modified program normally reads commands interactively
|
| 104 |
+
when run, you must cause it, when started running for such
|
| 105 |
+
interactive use in the most ordinary way, to print or display an
|
| 106 |
+
announcement including an appropriate copyright notice and a
|
| 107 |
+
notice that there is no warranty (or else, saying that you provide
|
| 108 |
+
a warranty) and that users may redistribute the program under
|
| 109 |
+
these conditions, and telling the user how to view a copy of this
|
| 110 |
+
License. (Exception: if the Program itself is interactive but
|
| 111 |
+
does not normally print such an announcement, your work based on
|
| 112 |
+
the Program is not required to print an announcement.)
|
| 113 |
+
|
| 114 |
+
These requirements apply to the modified work as a whole. If
|
| 115 |
+
identifiable sections of that work are not derived from the Program,
|
| 116 |
+
and can be reasonably considered independent and separate works in
|
| 117 |
+
themselves, then this License, and its terms, do not apply to those
|
| 118 |
+
sections when you distribute them as separate works. But when you
|
| 119 |
+
distribute the same sections as part of a whole which is a work based
|
| 120 |
+
on the Program, the distribution of the whole must be on the terms of
|
| 121 |
+
this License, whose permissions for other licensees extend to the
|
| 122 |
+
entire whole, and thus to each and every part regardless of who wrote it.
|
| 123 |
+
|
| 124 |
+
Thus, it is not the intent of this section to claim rights or contest
|
| 125 |
+
your rights to work written entirely by you; rather, the intent is to
|
| 126 |
+
exercise the right to control the distribution of derivative or
|
| 127 |
+
collective works based on the Program.
|
| 128 |
+
|
| 129 |
+
In addition, mere aggregation of another work not based on the Program
|
| 130 |
+
with the Program (or with a work based on the Program) on a volume of
|
| 131 |
+
a storage or distribution medium does not bring the other work under
|
| 132 |
+
the scope of this License.
|
| 133 |
+
|
| 134 |
+
3. You may copy and distribute the Program (or a work based on it,
|
| 135 |
+
under Section 2) in object code or executable form under the terms of
|
| 136 |
+
Sections 1 and 2 above provided that you also do one of the following:
|
| 137 |
+
|
| 138 |
+
a) Accompany it with the complete corresponding machine-readable
|
| 139 |
+
source code, which must be distributed under the terms of Sections
|
| 140 |
+
1 and 2 above on a medium customarily used for software interchange; or,
|
| 141 |
+
|
| 142 |
+
b) Accompany it with a written offer, valid for at least three
|
| 143 |
+
years, to give any third party, for a charge no more than your
|
| 144 |
+
cost of physically performing source distribution, a complete
|
| 145 |
+
machine-readable copy of the corresponding source code, to be
|
| 146 |
+
distributed under the terms of Sections 1 and 2 above on a medium
|
| 147 |
+
customarily used for software interchange; or,
|
| 148 |
+
|
| 149 |
+
c) Accompany it with the information you received as to the offer
|
| 150 |
+
to distribute corresponding source code. (This alternative is
|
| 151 |
+
allowed only for noncommercial distribution and only if you
|
| 152 |
+
received the program in object code or executable form with such
|
| 153 |
+
an offer, in accord with Subsection b above.)
|
| 154 |
+
|
| 155 |
+
The source code for a work means the preferred form of the work for
|
| 156 |
+
making modifications to it. For an executable work, complete source
|
| 157 |
+
code means all the source code for all modules it contains, plus any
|
| 158 |
+
associated interface definition files, plus the scripts used to
|
| 159 |
+
control compilation and installation of the executable. However, as a
|
| 160 |
+
special exception, the source code distributed need not include
|
| 161 |
+
anything that is normally distributed (in either source or binary
|
| 162 |
+
form) with the major components (compiler, kernel, and so on) of the
|
| 163 |
+
operating system on which the executable runs, unless that component
|
| 164 |
+
itself accompanies the executable.
|
| 165 |
+
|
| 166 |
+
If distribution of executable or object code is made by offering
|
| 167 |
+
access to copy from a designated place, then offering equivalent
|
| 168 |
+
access to copy the source code from the same place counts as
|
| 169 |
+
distribution of the source code, even though third parties are not
|
| 170 |
+
compelled to copy the source along with the object code.
|
| 171 |
+
|
| 172 |
+
4. You may not copy, modify, sublicense, or distribute the Program
|
| 173 |
+
except as expressly provided under this License. Any attempt
|
| 174 |
+
otherwise to copy, modify, sublicense or distribute the Program is
|
| 175 |
+
void, and will automatically terminate your rights under this License.
|
| 176 |
+
However, parties who have received copies, or rights, from you under
|
| 177 |
+
this License will not have their licenses terminated so long as such
|
| 178 |
+
parties remain in full compliance.
|
| 179 |
+
|
| 180 |
+
5. You are not required to accept this License, since you have not
|
| 181 |
+
signed it. However, nothing else grants you permission to modify or
|
| 182 |
+
distribute the Program or its derivative works. These actions are
|
| 183 |
+
prohibited by law if you do not accept this License. Therefore, by
|
| 184 |
+
modifying or distributing the Program (or any work based on the
|
| 185 |
+
Program), you indicate your acceptance of this License to do so, and
|
| 186 |
+
all its terms and conditions for copying, distributing or modifying
|
| 187 |
+
the Program or works based on it.
|
| 188 |
+
|
| 189 |
+
6. Each time you redistribute the Program (or any work based on the
|
| 190 |
+
Program), the recipient automatically receives a license from the
|
| 191 |
+
original licensor to copy, distribute or modify the Program subject to
|
| 192 |
+
these terms and conditions. You may not impose any further
|
| 193 |
+
restrictions on the recipients' exercise of the rights granted herein.
|
| 194 |
+
You are not responsible for enforcing compliance by third parties to
|
| 195 |
+
this License.
|
| 196 |
+
|
| 197 |
+
7. If, as a consequence of a court judgment or allegation of patent
|
| 198 |
+
infringement or for any other reason (not limited to patent issues),
|
| 199 |
+
conditions are imposed on you (whether by court order, agreement or
|
| 200 |
+
otherwise) that contradict the conditions of this License, they do not
|
| 201 |
+
excuse you from the conditions of this License. If you cannot
|
| 202 |
+
distribute so as to satisfy simultaneously your obligations under this
|
| 203 |
+
License and any other pertinent obligations, then as a consequence you
|
| 204 |
+
may not distribute the Program at all. For example, if a patent
|
| 205 |
+
license would not permit royalty-free redistribution of the Program by
|
| 206 |
+
all those who receive copies directly or indirectly through you, then
|
| 207 |
+
the only way you could satisfy both it and this License would be to
|
| 208 |
+
refrain entirely from distribution of the Program.
|
| 209 |
+
|
| 210 |
+
If any portion of this section is held invalid or unenforceable under
|
| 211 |
+
any particular circumstance, the balance of the section is intended to
|
| 212 |
+
apply and the section as a whole is intended to apply in other
|
| 213 |
+
circumstances.
|
| 214 |
+
|
| 215 |
+
It is not the purpose of this section to induce you to infringe any
|
| 216 |
+
patents or other property right claims or to contest validity of any
|
| 217 |
+
such claims; this section has the sole purpose of protecting the
|
| 218 |
+
integrity of the free software distribution system, which is
|
| 219 |
+
implemented by public license practices. Many people have made
|
| 220 |
+
generous contributions to the wide range of software distributed
|
| 221 |
+
through that system in reliance on consistent application of that
|
| 222 |
+
system; it is up to the author/donor to decide if he or she is willing
|
| 223 |
+
to distribute software through any other system and a licensee cannot
|
| 224 |
+
impose that choice.
|
| 225 |
+
|
| 226 |
+
This section is intended to make thoroughly clear what is believed to
|
| 227 |
+
be a consequence of the rest of this License.
|
| 228 |
+
|
| 229 |
+
8. If the distribution and/or use of the Program is restricted in
|
| 230 |
+
certain countries either by patents or by copyrighted interfaces, the
|
| 231 |
+
original copyright holder who places the Program under this License
|
| 232 |
+
may add an explicit geographical distribution limitation excluding
|
| 233 |
+
those countries, so that distribution is permitted only in or among
|
| 234 |
+
countries not thus excluded. In such case, this License incorporates
|
| 235 |
+
the limitation as if written in the body of this License.
|
| 236 |
+
|
| 237 |
+
9. The Free Software Foundation may publish revised and/or new versions
|
| 238 |
+
of the General Public License from time to time. Such new versions will
|
| 239 |
+
be similar in spirit to the present version, but may differ in detail to
|
| 240 |
+
address new problems or concerns.
|
| 241 |
+
|
| 242 |
+
Each version is given a distinguishing version number. If the Program
|
| 243 |
+
specifies a version number of this License which applies to it and "any
|
| 244 |
+
later version", you have the option of following the terms and conditions
|
| 245 |
+
either of that version or of any later version published by the Free
|
| 246 |
+
Software Foundation. If the Program does not specify a version number of
|
| 247 |
+
this License, you may choose any version ever published by the Free Software
|
| 248 |
+
Foundation.
|
| 249 |
+
|
| 250 |
+
10. If you wish to incorporate parts of the Program into other free
|
| 251 |
+
programs whose distribution conditions are different, write to the author
|
| 252 |
+
to ask for permission. For software which is copyrighted by the Free
|
| 253 |
+
Software Foundation, write to the Free Software Foundation; we sometimes
|
| 254 |
+
make exceptions for this. Our decision will be guided by the two goals
|
| 255 |
+
of preserving the free status of all derivatives of our free software and
|
| 256 |
+
of promoting the sharing and reuse of software generally.
|
| 257 |
+
|
| 258 |
+
NO WARRANTY
|
| 259 |
+
|
| 260 |
+
11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
|
| 261 |
+
FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
|
| 262 |
+
OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
|
| 263 |
+
PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
|
| 264 |
+
OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
| 265 |
+
MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
|
| 266 |
+
TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
|
| 267 |
+
PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
|
| 268 |
+
REPAIR OR CORRECTION.
|
| 269 |
+
|
| 270 |
+
12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
|
| 271 |
+
WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
|
| 272 |
+
REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
|
| 273 |
+
INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
|
| 274 |
+
OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
|
| 275 |
+
TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
|
| 276 |
+
YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
|
| 277 |
+
PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
|
| 278 |
+
POSSIBILITY OF SUCH DAMAGES.
|
| 279 |
+
|
| 280 |
+
END OF TERMS AND CONDITIONS
|
| 281 |
+
|
| 282 |
+
How to Apply These Terms to Your New Programs
|
| 283 |
+
|
| 284 |
+
If you develop a new program, and you want it to be of the greatest
|
| 285 |
+
possible use to the public, the best way to achieve this is to make it
|
| 286 |
+
free software which everyone can redistribute and change under these terms.
|
| 287 |
+
|
| 288 |
+
To do so, attach the following notices to the program. It is safest
|
| 289 |
+
to attach them to the start of each source file to most effectively
|
| 290 |
+
convey the exclusion of warranty; and each file should have at least
|
| 291 |
+
the "copyright" line and a pointer to where the full notice is found.
|
| 292 |
+
|
| 293 |
+
{description}
|
| 294 |
+
Copyright (C) {year} {fullname}
|
| 295 |
+
|
| 296 |
+
This program is free software; you can redistribute it and/or modify
|
| 297 |
+
it under the terms of the GNU General Public License as published by
|
| 298 |
+
the Free Software Foundation; either version 2 of the License, or
|
| 299 |
+
(at your option) any later version.
|
| 300 |
+
|
| 301 |
+
This program is distributed in the hope that it will be useful,
|
| 302 |
+
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
| 303 |
+
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
| 304 |
+
GNU General Public License for more details.
|
| 305 |
+
|
| 306 |
+
You should have received a copy of the GNU General Public License along
|
| 307 |
+
with this program; if not, write to the Free Software Foundation, Inc.,
|
| 308 |
+
51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
|
| 309 |
+
|
| 310 |
+
Also add information on how to contact you by electronic and paper mail.
|
| 311 |
+
|
| 312 |
+
If the program is interactive, make it output a short notice like this
|
| 313 |
+
when it starts in an interactive mode:
|
| 314 |
+
|
| 315 |
+
Gnomovision version 69, Copyright (C) year name of author
|
| 316 |
+
Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
|
| 317 |
+
This is free software, and you are welcome to redistribute it
|
| 318 |
+
under certain conditions; type `show c' for details.
|
| 319 |
+
|
| 320 |
+
The hypothetical commands `show w' and `show c' should show the appropriate
|
| 321 |
+
parts of the General Public License. Of course, the commands you use may
|
| 322 |
+
be called something other than `show w' and `show c'; they could even be
|
| 323 |
+
mouse-clicks or menu items--whatever suits your program.
|
| 324 |
+
|
| 325 |
+
You should also get your employer (if you work as a programmer) or your
|
| 326 |
+
school, if any, to sign a "copyright disclaimer" for the program, if
|
| 327 |
+
necessary. Here is a sample; alter the names:
|
| 328 |
+
|
| 329 |
+
Yoyodyne, Inc., hereby disclaims all copyright interest in the program
|
| 330 |
+
`Gnomovision' (which makes passes at compilers) written by James Hacker.
|
| 331 |
+
|
| 332 |
+
{signature of Ty Coon}, 1 April 1989
|
| 333 |
+
Ty Coon, President of Vice
|
| 334 |
+
|
| 335 |
+
This General Public License does not permit incorporating your program into
|
| 336 |
+
proprietary programs. If your program is a subroutine library, you may
|
| 337 |
+
consider it more useful to permit linking proprietary applications with the
|
| 338 |
+
library. If this is what you want to do, use the GNU Lesser General
|
| 339 |
+
Public License instead of this License.
|
README.md
ADDED
|
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Caldera-Forms
|
| 2 |
+
=============
|
| 3 |
+
<img src="https://calderawp.com/wp-content/uploads/2015/02/CalderaWP_Logo_SQ-150x150.png" >
|
| 4 |
+
|
| 5 |
+
# Drag & Drop Responsive Form Builder
|
| 6 |
+
|
| 7 |
+
#### By <a href="https://CalderaWP.com" title="CalderaWP: Transform Your WordPress Experience">CalderaWP</a>
|
| 8 |
+
|
| 9 |
+
### Docs, Add-ons & More Information:
|
| 10 |
+
* [Premium Add-ons](https://calderawp.com/caldera-forms-add-ons/)
|
| 11 |
+
* [More Information](https://calderawp.com/free-plugin/caldera-forms/)
|
| 12 |
+
* [Documentation](http://docs.calderaforms.com/)
|
assets/css/admin.css
CHANGED
|
@@ -277,8 +277,8 @@ select.caldera-type-selector {
|
|
| 277 |
z-index: 100;
|
| 278 |
}
|
| 279 |
.caldera-editor-header.caldera-editor-subnav {
|
| 280 |
-
background-color: #
|
| 281 |
-
top:
|
| 282 |
}
|
| 283 |
.caldera-editor-header .button.caldera-header-save-button,
|
| 284 |
.caldera-editor-header .button.caldera-header-preview-button {
|
|
@@ -317,9 +317,11 @@ li.caldera-editor-logo {
|
|
| 317 |
display: inline-block;
|
| 318 |
padding: 12px 12px;
|
| 319 |
text-decoration: none;
|
|
|
|
| 320 |
}
|
| 321 |
.caldera-editor-header-nav > li.active a {
|
| 322 |
-
background: none repeat scroll 0 0 #
|
|
|
|
| 323 |
}
|
| 324 |
.caldera-editor-header-nav > li.caldera-forms-toolbar-item {
|
| 325 |
padding: 6px 6px 6px 12px;
|
|
@@ -697,6 +699,7 @@ a span.error-tag {
|
|
| 697 |
float: left;
|
| 698 |
margin-left: -430px;
|
| 699 |
width: 430px;
|
|
|
|
| 700 |
}
|
| 701 |
.form-entries-wrap {
|
| 702 |
padding: 0 30px;
|
|
@@ -825,8 +828,8 @@ a span.error-tag {
|
|
| 825 |
top: 0;
|
| 826 |
width: 150px;
|
| 827 |
}
|
| 828 |
-
.
|
| 829 |
-
.
|
| 830 |
float: left;
|
| 831 |
}
|
| 832 |
.modal-side-bar .modal-side-tabs {
|
|
@@ -1628,4 +1631,40 @@ tr.form_entry_row.loading {
|
|
| 1628 |
.caldera-table-nav .tablenav-pages .current-page{
|
| 1629 |
width: 45px;
|
| 1630 |
}
|
| 1631 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 277 |
z-index: 100;
|
| 278 |
}
|
| 279 |
.caldera-editor-header.caldera-editor-subnav {
|
| 280 |
+
background-color: #f0f0f0;
|
| 281 |
+
top: 84px;
|
| 282 |
}
|
| 283 |
.caldera-editor-header .button.caldera-header-save-button,
|
| 284 |
.caldera-editor-header .button.caldera-header-preview-button {
|
| 317 |
display: inline-block;
|
| 318 |
padding: 12px 12px;
|
| 319 |
text-decoration: none;
|
| 320 |
+
color: #839e3f;
|
| 321 |
}
|
| 322 |
.caldera-editor-header-nav > li.active a {
|
| 323 |
+
background: none repeat scroll 0 0 #a3be5f;
|
| 324 |
+
color: #fff;
|
| 325 |
}
|
| 326 |
.caldera-editor-header-nav > li.caldera-forms-toolbar-item {
|
| 327 |
padding: 6px 6px 6px 12px;
|
| 699 |
float: left;
|
| 700 |
margin-left: -430px;
|
| 701 |
width: 430px;
|
| 702 |
+
position: relative;
|
| 703 |
}
|
| 704 |
.form-entries-wrap {
|
| 705 |
padding: 0 30px;
|
| 828 |
top: 0;
|
| 829 |
width: 150px;
|
| 830 |
}
|
| 831 |
+
.user-avatar,
|
| 832 |
+
.user-avatar img {
|
| 833 |
float: left;
|
| 834 |
}
|
| 835 |
.modal-side-bar .modal-side-tabs {
|
| 1631 |
.caldera-table-nav .tablenav-pages .current-page{
|
| 1632 |
width: 45px;
|
| 1633 |
}
|
| 1634 |
+
.cf-notification-external {
|
| 1635 |
+
left: 0;
|
| 1636 |
+
padding: 0 1px 0 0;
|
| 1637 |
+
position: absolute;
|
| 1638 |
+
right: 0;
|
| 1639 |
+
top: -45px;
|
| 1640 |
+
}
|
| 1641 |
+
.cf-notification {
|
| 1642 |
+
background: #fff none repeat scroll 0 0;
|
| 1643 |
+
border: 1px solid #dfdfdf;
|
| 1644 |
+
border-radius: 1px;
|
| 1645 |
+
box-shadow: 0 2px 4px rgba(0, 0, 0, 0.08);
|
| 1646 |
+
left: 0;
|
| 1647 |
+
padding: 0;
|
| 1648 |
+
position: absolute;
|
| 1649 |
+
right: 0;
|
| 1650 |
+
top: -45px;
|
| 1651 |
+
}
|
| 1652 |
+
.cf-notification-notice {
|
| 1653 |
+
height: 20px;
|
| 1654 |
+
overflow: hidden;
|
| 1655 |
+
padding: 8px;
|
| 1656 |
+
text-overflow: ellipsis;
|
| 1657 |
+
white-space: nowrap;
|
| 1658 |
+
}
|
| 1659 |
+
.cf-notification div.error {
|
| 1660 |
+
margin: 1px 0 0 !important;
|
| 1661 |
+
}
|
| 1662 |
+
.cf-notification .dashicons.dashicons-warning{
|
| 1663 |
+
color: #dd3d36;
|
| 1664 |
+
}
|
| 1665 |
+
.cf-notification .dashicons.dashicons-arrow-up,
|
| 1666 |
+
.cf-notification .dashicons.dashicons-arrow-down {
|
| 1667 |
+
cursor: pointer;
|
| 1668 |
+
float: right;
|
| 1669 |
+
padding: 8px;
|
| 1670 |
+
}
|
assets/css/editor-grid.css
CHANGED
|
@@ -57,6 +57,25 @@
|
|
| 57 |
content: "\e601";
|
| 58 |
}
|
| 59 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 60 |
|
| 61 |
|
| 62 |
.column-tools i {
|
|
@@ -80,9 +99,20 @@
|
|
| 80 |
text-align: center;
|
| 81 |
}
|
| 82 |
.column-sort.column-tools {
|
| 83 |
-
width:
|
| 84 |
right: 0;
|
| 85 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 86 |
.column-sort .icon-edit {
|
| 87 |
margin-right: 15px;
|
| 88 |
}
|
|
@@ -389,9 +419,6 @@ textarea.magic-tag-enabled {
|
|
| 389 |
z-index: 101;
|
| 390 |
}
|
| 391 |
|
| 392 |
-
.layout-grid-panel{
|
| 393 |
-
min-height: 100px;
|
| 394 |
-
}
|
| 395 |
|
| 396 |
.template-element.ui-draggable-dragging{
|
| 397 |
z-index: 1000;
|
| 57 |
content: "\e601";
|
| 58 |
}
|
| 59 |
|
| 60 |
+
.add-new-item {
|
| 61 |
+
cursor: pointer;
|
| 62 |
+
text-align: center;
|
| 63 |
+
border: 3px dashed #cfcfcf;
|
| 64 |
+
height: 50px;
|
| 65 |
+
margin: 20px 4px;
|
| 66 |
+
}
|
| 67 |
+
.add-new-item:hover {
|
| 68 |
+
background-color: #e7e7e7;
|
| 69 |
+
border: 3px dashed #a3a3a3;
|
| 70 |
+
}
|
| 71 |
+
.add-new-item .dashicons.dashicons-plus {
|
| 72 |
+
color: #cfcfcf;
|
| 73 |
+
font-size: 28px;
|
| 74 |
+
line-height: 54px;
|
| 75 |
+
}
|
| 76 |
+
.add-new-item:hover .dashicons.dashicons-plus {
|
| 77 |
+
color: #a3a3a3;
|
| 78 |
+
}
|
| 79 |
|
| 80 |
|
| 81 |
.column-tools i {
|
| 99 |
text-align: center;
|
| 100 |
}
|
| 101 |
.column-sort.column-tools {
|
| 102 |
+
width: 25px;
|
| 103 |
right: 0;
|
| 104 |
}
|
| 105 |
+
.column-config.column-tools {
|
| 106 |
+
left: -20px;
|
| 107 |
+
position: absolute;
|
| 108 |
+
top: 29%;
|
| 109 |
+
}
|
| 110 |
+
.column-config.column-tools i {
|
| 111 |
+
border: 2px solid #CFCFCF;
|
| 112 |
+
height: 23px;
|
| 113 |
+
padding: 3px;
|
| 114 |
+
width: 23px;
|
| 115 |
+
}
|
| 116 |
.column-sort .icon-edit {
|
| 117 |
margin-right: 15px;
|
| 118 |
}
|
| 419 |
z-index: 101;
|
| 420 |
}
|
| 421 |
|
|
|
|
|
|
|
|
|
|
| 422 |
|
| 423 |
.template-element.ui-draggable-dragging{
|
| 424 |
z-index: 1000;
|
assets/css/processors-edit.css
CHANGED
|
@@ -4,8 +4,10 @@
|
|
| 4 |
width: 250px;
|
| 5 |
}
|
| 6 |
.caldera-editor-processors-panel li{
|
| 7 |
-
border
|
| 8 |
-
|
|
|
|
|
|
|
| 9 |
}
|
| 10 |
.caldera-editor-processors-panel a{
|
| 11 |
color: #6F6F6F;
|
|
@@ -15,7 +17,7 @@
|
|
| 15 |
}
|
| 16 |
.caldera-editor-processors-panel li.active a,
|
| 17 |
.caldera-editor-processors-panel a:hover{
|
| 18 |
-
background: none repeat scroll 0 0 #
|
| 19 |
}
|
| 20 |
.caldera-editor-processor-config {
|
| 21 |
float: left;
|
|
@@ -57,3 +59,42 @@ button.button.info-button {
|
|
| 57 |
margin-right: 9px;
|
| 58 |
width: 45px;
|
| 59 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
width: 250px;
|
| 5 |
}
|
| 6 |
.caldera-editor-processors-panel li{
|
| 7 |
+
border: 1px solid #dfdfdf;
|
| 8 |
+
border-radius: 3px;
|
| 9 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.06);
|
| 10 |
+
margin: 0 0 6px;
|
| 11 |
}
|
| 12 |
.caldera-editor-processors-panel a{
|
| 13 |
color: #6F6F6F;
|
| 17 |
}
|
| 18 |
.caldera-editor-processors-panel li.active a,
|
| 19 |
.caldera-editor-processors-panel a:hover{
|
| 20 |
+
background: none repeat scroll 0 0 #FFF;
|
| 21 |
}
|
| 22 |
.caldera-editor-processor-config {
|
| 23 |
float: left;
|
| 59 |
margin-right: 9px;
|
| 60 |
width: 45px;
|
| 61 |
}
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
.caldera-editor-conditions-panel {
|
| 65 |
+
float: left;
|
| 66 |
+
margin-right: 20px;
|
| 67 |
+
width: 250px;
|
| 68 |
+
}
|
| 69 |
+
.caldera-editor-conditions-panel li {
|
| 70 |
+
border: 1px solid #dfdfdf;
|
| 71 |
+
border-radius: 3px;
|
| 72 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.06);
|
| 73 |
+
margin: 0 0 6px;
|
| 74 |
+
}
|
| 75 |
+
.caldera-editor-conditions-panel a{
|
| 76 |
+
color: #6F6F6F;
|
| 77 |
+
display: block;
|
| 78 |
+
padding: 6px;
|
| 79 |
+
text-decoration: none;
|
| 80 |
+
}
|
| 81 |
+
.caldera-editor-conditions-panel li.active a,
|
| 82 |
+
.caldera-editor-conditions-panel a:hover{
|
| 83 |
+
background: none repeat scroll 0 0 #FFF;
|
| 84 |
+
}
|
| 85 |
+
.caldera-editor-condition-config {
|
| 86 |
+
float: left;
|
| 87 |
+
width: auto;
|
| 88 |
+
}
|
| 89 |
+
.caldera-editor-condition-config-wrapper {
|
| 90 |
+
width: 550px;
|
| 91 |
+
}
|
| 92 |
+
h3.caldera-editor-condition-title {
|
| 93 |
+
border-bottom: 1px solid #CFCFCF;
|
| 94 |
+
color: #3F3F3F;
|
| 95 |
+
font-size: 18px;
|
| 96 |
+
font-weight: 400;
|
| 97 |
+
margin: 0 0 6px;
|
| 98 |
+
padding: 5px 0 12px;
|
| 99 |
+
}
|
| 100 |
+
|
assets/js/conditionals.js
CHANGED
|
@@ -170,15 +170,15 @@
|
|
| 170 |
}else{
|
| 171 |
target_field.prop('disabled', false);
|
| 172 |
}
|
|
|
|
| 173 |
}else if (action === 'disable'){
|
| 174 |
if(!target.html().length){
|
| 175 |
target.html(template).trigger('cf.add');
|
| 176 |
-
jQuery(document).trigger('cf.add');
|
| 177 |
jQuery('[data-field="' + field + '"]').prop('disabled', 'disabled');
|
| 178 |
}else{
|
| 179 |
target_field.prop('disabled', 'disabled');
|
| 180 |
-
jQuery(document).trigger('cf.disable');
|
| 181 |
}
|
|
|
|
| 182 |
}
|
| 183 |
|
| 184 |
}
|
| 170 |
}else{
|
| 171 |
target_field.prop('disabled', false);
|
| 172 |
}
|
| 173 |
+
jQuery(document).trigger('cf.enable');
|
| 174 |
}else if (action === 'disable'){
|
| 175 |
if(!target.html().length){
|
| 176 |
target.html(template).trigger('cf.add');
|
|
|
|
| 177 |
jQuery('[data-field="' + field + '"]').prop('disabled', 'disabled');
|
| 178 |
}else{
|
| 179 |
target_field.prop('disabled', 'disabled');
|
|
|
|
| 180 |
}
|
| 181 |
+
jQuery(document).trigger('cf.disable');
|
| 182 |
}
|
| 183 |
|
| 184 |
}
|
assets/js/conditionals.min.js
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
!function(a){function b(a){if("undefined"!=typeof caldera_conditionals[a])for(var b in caldera_conditionals[a]){var c=jQuery("#conditional_"+b);if(c.length){var d=caldera_conditionals[a][b].type,e=caldera_conditionals[a][b].group,f=[];for(var g in e){var h={},i=e[g];for(var j in i){var k=jQuery('[data-field="'+i[j].field+"_"+i[j].instance+'"]'),l=[],m="function"==typeof i[j].value?i[j].value():i[j].value;if(h[j]=!1,k.is(":radio,:checkbox")?k=k.filter(":checked"):k.is("div")&&(k=jQuery("<input>").val(k.html())),k.length)for(var n=0;n<k.length;n++)l.push(k[n].value);else l.push(i[j].field);switch(i[j].compare){case"is":l.length&&l.indexOf(m.toString())>=0&&(h[j]=!0);break;case"isnot":l.length&&l.indexOf(m)<0&&(h[j]=!0);break;case">":parseFloat(l.reduce(function(a,b){return a+b}))>parseFloat(m)&&(h[j]=!0);break;case"<":parseFloat(l.reduce(function(a,b){return a+b}))<parseFloat(m)&&(h[j]=!0);break;case"startswith":for(var n=0;n<l.length;n++)l[n].toLowerCase().substr(0,m.toLowerCase().length)===m.toLowerCase()&&(h[j]=!0);break;case"endswith":for(var n=0;n<l.length;n++)l[n].toLowerCase().substr(l[n].toLowerCase().length-m.toLowerCase().length)===m.toLowerCase()&&(h[j]=!0);break;case"contains":for(var n=0;n<l.length;n++)l[n].toLowerCase().indexOf(m)>=0&&(h[j]=!0)}}istrue=!0;for(var o in h)if(h[o]===!1){istrue=!1;break}f.push(istrue)}var s,p=jQuery("#conditional-"+b+"-tmpl").html(),q=jQuery("#conditional_"+b),r=jQuery('[data-field="'+b+'"]');f.length&&f.indexOf(!0)>=0?"show"===d?s="show":"hide"===d?s="hide":"disable"===d&&(s="disable"):s="show"===d?"hide":"disable"===d?"enable":"show","show"===s?q.html().length||(q.html(p).trigger("cf.add"),jQuery(document).trigger("cf.add")):"hide"===s?q.html().length&&(r.val("").empty().prop("checked",!1),q.empty().trigger("cf.remove"),jQuery(document).trigger("cf.remove")):"enable"===s?q.html().length?r.prop("disabled",!1):(q.html(p).trigger("cf.add"),jQuery(document).trigger("cf.add")):"disable"===s&&(q.html().length?
|
| 1 |
+
!function(a){function b(a){if("undefined"!=typeof caldera_conditionals[a])for(var b in caldera_conditionals[a]){var c=jQuery("#conditional_"+b);if(c.length){var d=caldera_conditionals[a][b].type,e=caldera_conditionals[a][b].group,f=[];for(var g in e){var h={},i=e[g];for(var j in i){var k=jQuery('[data-field="'+i[j].field+"_"+i[j].instance+'"]'),l=[],m="function"==typeof i[j].value?i[j].value():i[j].value;if(h[j]=!1,k.is(":radio,:checkbox")?k=k.filter(":checked"):k.is("div")&&(k=jQuery("<input>").val(k.html())),k.length)for(var n=0;n<k.length;n++)l.push(k[n].value);else l.push(i[j].field);switch(i[j].compare){case"is":l.length&&l.indexOf(m.toString())>=0&&(h[j]=!0);break;case"isnot":l.length&&l.indexOf(m)<0&&(h[j]=!0);break;case">":parseFloat(l.reduce(function(a,b){return a+b}))>parseFloat(m)&&(h[j]=!0);break;case"<":parseFloat(l.reduce(function(a,b){return a+b}))<parseFloat(m)&&(h[j]=!0);break;case"startswith":for(var n=0;n<l.length;n++)l[n].toLowerCase().substr(0,m.toLowerCase().length)===m.toLowerCase()&&(h[j]=!0);break;case"endswith":for(var n=0;n<l.length;n++)l[n].toLowerCase().substr(l[n].toLowerCase().length-m.toLowerCase().length)===m.toLowerCase()&&(h[j]=!0);break;case"contains":for(var n=0;n<l.length;n++)l[n].toLowerCase().indexOf(m)>=0&&(h[j]=!0)}}istrue=!0;for(var o in h)if(h[o]===!1){istrue=!1;break}f.push(istrue)}var s,p=jQuery("#conditional-"+b+"-tmpl").html(),q=jQuery("#conditional_"+b),r=jQuery('[data-field="'+b+'"]');f.length&&f.indexOf(!0)>=0?"show"===d?s="show":"hide"===d?s="hide":"disable"===d&&(s="disable"):s="show"===d?"hide":"disable"===d?"enable":"show","show"===s?q.html().length||(q.html(p).trigger("cf.add"),jQuery(document).trigger("cf.add")):"hide"===s?q.html().length&&(r.val("").empty().prop("checked",!1),q.empty().trigger("cf.remove"),jQuery(document).trigger("cf.remove")):"enable"===s?(q.html().length?r.prop("disabled",!1):(q.html(p).trigger("cf.add"),jQuery(document).trigger("cf.add")),jQuery(document).trigger("cf.enable")):"disable"===s&&(q.html().length?r.prop("disabled","disabled"):(q.html(p).trigger("cf.add"),jQuery('[data-field="'+b+'"]').prop("disabled","disabled")),jQuery(document).trigger("cf.disable"))}}}Array.prototype.indexOf||(Array.prototype.indexOf=function(a){var b=this.length>>>0,c=Number(arguments[1])||0;for(c=0>c?Math.ceil(c):Math.floor(c),0>c&&(c+=b);b>c;c++)if(c in this&&this[c]===a)return c;return-1}),"undefined"!=typeof caldera_conditionals&&(jQuery(".caldera_forms_form").on("change keyup","[data-field]",function(){var d=a(this).closest(".caldera_forms_form").prop("id");b(d)}),a(".caldera_forms_form").each(function(){b(a(this).closest(".caldera_forms_form").prop("id"))}))}(jQuery);
|
assets/js/edit.js
CHANGED
|
@@ -853,7 +853,7 @@ jQuery(document).ready(function($){
|
|
| 853 |
|
| 854 |
var select = $(this);
|
| 855 |
|
| 856 |
-
if(this.value
|
| 857 |
$('#' + select.data('id') + '_condition_group_add').show();
|
| 858 |
$('#' + select.data('id') + '_conditional_wrap').show();
|
| 859 |
}else{
|
|
@@ -1184,25 +1184,26 @@ init_magic_tags = function(){
|
|
| 1184 |
currentwrapper.show();
|
| 1185 |
}
|
| 1186 |
return;
|
| 1187 |
-
}
|
| 1188 |
-
|
| 1189 |
-
|
| 1190 |
|
| 1191 |
-
|
| 1192 |
-
|
| 1193 |
-
|
| 1194 |
|
| 1195 |
-
|
| 1196 |
-
|
| 1197 |
-
|
| 1198 |
|
| 1199 |
-
|
| 1200 |
-
|
| 1201 |
-
|
| 1202 |
-
|
| 1203 |
-
|
| 1204 |
-
|
| 1205 |
-
|
|
|
|
| 1206 |
}
|
| 1207 |
});
|
| 1208 |
|
|
@@ -1837,7 +1838,10 @@ jQuery(document).ready(function($) {
|
|
| 1837 |
$('.caldera-add-page').trigger('click');
|
| 1838 |
return;
|
| 1839 |
}
|
| 1840 |
-
$('
|
|
|
|
|
|
|
|
|
|
| 1841 |
buildSortables();
|
| 1842 |
buildLayoutString();
|
| 1843 |
});
|
|
@@ -1981,7 +1985,8 @@ jQuery(document).ready(function($) {
|
|
| 1981 |
}
|
| 1982 |
|
| 1983 |
$(document).trigger('show.' + panel.data('config'));
|
| 1984 |
-
|
|
|
|
| 1985 |
if( type === 'radio' || type === 'checkbox' || type === 'dropdown' || type === 'toggle_switch' ){
|
| 1986 |
$('#' + panel.data('config') + '_auto').trigger('change');
|
| 1987 |
}
|
|
@@ -2373,6 +2378,21 @@ jQuery(document).ready(function($){
|
|
| 2373 |
|
| 2374 |
rebuild_field_binding();
|
| 2375 |
baldrickTriggers();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2376 |
}
|
| 2377 |
|
| 2378 |
// build configs on load:
|
| 853 |
|
| 854 |
var select = $(this);
|
| 855 |
|
| 856 |
+
if( this.value === 'show' || this.value === 'hide' || this.value === 'disable' || this.value === 'use' || this.value === 'not' ){
|
| 857 |
$('#' + select.data('id') + '_condition_group_add').show();
|
| 858 |
$('#' + select.data('id') + '_conditional_wrap').show();
|
| 859 |
}else{
|
| 1184 |
currentwrapper.show();
|
| 1185 |
}
|
| 1186 |
return;
|
| 1187 |
+
}else{
|
| 1188 |
+
var magictag = jQuery('<span class="icn-code magic-tag-init"></span>'),
|
| 1189 |
+
wrapper = jQuery('<span style="position:relative;display:inline-block; width:100%;"></span>');
|
| 1190 |
|
| 1191 |
+
if(input.is('input')){
|
| 1192 |
+
magictag.css('borderBottom', 'none');
|
| 1193 |
+
}
|
| 1194 |
|
| 1195 |
+
if(input.hasClass('caldera-conditional-value-field')){
|
| 1196 |
+
wrapper.width('auto');
|
| 1197 |
+
}
|
| 1198 |
|
| 1199 |
+
input.wrap(wrapper);
|
| 1200 |
+
magictag.insertAfter(input);
|
| 1201 |
+
input.addClass('magic-tag-init-bound');
|
| 1202 |
+
if(!input.is(':visible')){
|
| 1203 |
+
magictag.hide();
|
| 1204 |
+
}else{
|
| 1205 |
+
magictag.show();
|
| 1206 |
+
}
|
| 1207 |
}
|
| 1208 |
});
|
| 1209 |
|
| 1838 |
$('.caldera-add-page').trigger('click');
|
| 1839 |
return;
|
| 1840 |
}
|
| 1841 |
+
var new_row = $( '<div style="display:none;" class="first-row-level row"><div class="col-xs-12"><div class="layout-column column-container"></div></div></div>' );
|
| 1842 |
+
|
| 1843 |
+
$('.page-active').append( new_row );
|
| 1844 |
+
new_row.slideDown( 200 );
|
| 1845 |
buildSortables();
|
| 1846 |
buildLayoutString();
|
| 1847 |
});
|
| 1985 |
}
|
| 1986 |
|
| 1987 |
$(document).trigger('show.' + panel.data('config'));
|
| 1988 |
+
$(document).trigger('show.fieldedit');
|
| 1989 |
+
|
| 1990 |
if( type === 'radio' || type === 'checkbox' || type === 'dropdown' || type === 'toggle_switch' ){
|
| 1991 |
$('#' + panel.data('config') + '_auto').trigger('change');
|
| 1992 |
}
|
| 2378 |
|
| 2379 |
rebuild_field_binding();
|
| 2380 |
baldrickTriggers();
|
| 2381 |
+
|
| 2382 |
+
// initialise baldrick triggers
|
| 2383 |
+
$('.wp-baldrick').baldrick({
|
| 2384 |
+
request : ajaxurl,
|
| 2385 |
+
method : 'POST',
|
| 2386 |
+
before : function(el){
|
| 2387 |
+
|
| 2388 |
+
var tr = $(el);
|
| 2389 |
+
|
| 2390 |
+
if( tr.data('addNode') && !tr.data('request') ){
|
| 2391 |
+
tr.data('request', 'cf_get_default_setting');
|
| 2392 |
+
}
|
| 2393 |
+
}
|
| 2394 |
+
});
|
| 2395 |
+
|
| 2396 |
}
|
| 2397 |
|
| 2398 |
// build configs on load:
|
assets/js/edit.min.js
CHANGED
|
@@ -1,2 +1,2 @@
|
|
| 1 |
-
function new_conditional_group(a){var b=a.trigger.data("id"),c="cl"+Math.round(18746582734*Math.random()),d="rw"+Math.round(98347598345*Math.random()),e=[{id:d,type:a.trigger.data("type"),lines:[{id:c}]}];return{group:e,id:b}}function new_conditional_line(a){var b=a.trigger.data("id"),c=a.trigger.data("group"),d=a.trigger.data("type"),e="cl"+Math.round(18746582734*Math.random()),f={id:b,type:d,lineid:e,rowid:c,name:"config["+d+"]["+b+"][conditions][group]["+c+"]["+e+"]"};return f}function build_conditions_config(a){var b=JSON.parse(a.trigger.val());return b.id=a.trigger.data("id"),b}function setup_field_type(a){return{id:a.trigger.prop("id")}}function check_required_bindings(a){var b,d=(jQuery(".caldera-header-save-button"),jQuery(".layout-form-field")),e=jQuery(".caldera-processor-nav"),f=!0;b=a?jQuery(a):jQuery(".caldera-config-field .required"),b.removeClass("has-error"),d.removeClass("has-error"),e.removeClass("has-error"),jQuery(".error-tag").remove(),required_errors={},b.each(function(a,b){var c=jQuery(b),d=c.closest(".caldera-config-editor-panel");if(b.value.length){if(c.hasClass("field-slug"))for(var h=jQuery(".field-slug").not(c),i=0;i<h.length;i++)if(h[i].value===b.value){var c=jQuery(h[i]);required_errors[d.prop("id")]||(required_errors[d.prop("id")]=0);var e=c.closest(".caldera-editor-field-config-wrapper"),g=c.closest(".caldera-editor-processor-config-wrapper");e.length&&jQuery('.layout-form-field[data-config="'+e.prop("id")+'"]').addClass("has-error"),g.length&&jQuery("."+g.prop("id")).addClass("has-error"),required_errors[d.prop("id")]+=1,c.addClass("has-error");break}}else{required_errors[d.prop("id")]||(required_errors[d.prop("id")]=0);var e=c.closest(".caldera-editor-field-config-wrapper"),g=c.closest(".caldera-editor-processor-config-wrapper");e.length&&jQuery('.layout-form-field[data-config="'+e.prop("id")+'"]').addClass("has-error"),g.length&&jQuery("."+g.prop("id")).addClass("has-error"),required_errors[d.prop("id")]+=1,c.addClass("has-error"),f=!1}});for(var g in required_errors)jQuery(".caldera-forms-options-form").find('a[href="#'+g+'"]').append('<span class="error-tag">'+required_errors[g]+"</span>");return jQuery(".preview-caldera-config-group button:submit").length?(jQuery(".mailer-errors").hide(),jQuery(".mailer-control-panel").show()):(jQuery(".mailer-errors").show(),jQuery(".mailer-control-panel").hide()),jQuery(".caldera-conditional-field-set").trigger("change"),f}jQuery(document).ready(function(a){function b(b){var d=a(b),e=d.closest(".caldera-editor-field-config-wrapper"),f=e.find(".caldera-config-field-setup"),g=compiled_templates[d.val()+"_tmpl"]?compiled_templates[d.val()+"_tmpl"]:compiled_templates.noconfig_field_templ,h=e.find(".field_config_string").val(),i=d.data("type");if(e.find(".caldera-config-group").show(),d.addClass("field-initialized"),h=h.length&&i===d.val()?JSON.parse(h):fieldtype_defaults[d.val()+"_cfg"],h||(h={}),h._id=d.data("field"),h._name="config[fields]["+d.data("field")+"][config]",g=a("<div>").html(g(h)),f.html(g.html()),"function"==typeof window[d.val()+"_init"]&&window[d.val()+"_init"](d.data("field"),f),fieldtype_defaults[d.val()+"_nosupport"]&&(fieldtype_defaults[d.val()+"_nosupport"].indexOf("hide_label")>=0&&e.find(".hide-label-field").hide().find(".field-config").prop("checked",!1),fieldtype_defaults[d.val()+"_nosupport"].indexOf("caption")>=0&&e.find(".caption-field").hide().find(".field-config").val(""),fieldtype_defaults[d.val()+"_nosupport"].indexOf("required")>=0&&e.find(".required-field").hide().find(".field-config").prop("checked",!1),fieldtype_defaults[d.val()+"_nosupport"].indexOf("custom_class")>=0&&e.find(".customclass-field").hide().find(".field-config").val(""),fieldtype_defaults[d.val()+"_nosupport"].indexOf("entry_list")>=0&&e.find(".entrylist-field").hide().find(".field-config").prop("checked",!1)),e.find(".toggle_show_values").trigger("change"),!a(".caldera-select-field-type").not(".field-initialized").length){if(core_form.hasClass("builder-loaded"))c(d.data("field"));else{for(var j=a(".caldera-select-field-type.field-initialized"),k=0;k<j.length;k++)c(a(j[k]).data("field"));core_form.addClass("builder-loaded")}rebuild_field_binding(),baldrickTriggers()}}function c(b){var c=a("#"+b),d=c.find(".caldera-select-field-type"),e=a('.layout-form-field[data-config="'+b+'"]'),f=e.find(".field_preview"),h=(a("#preview-"+d.val()+"_tmpl").html(),compiled_templates["preview-"+d.val()+"_tmpl"]),i={id:b},j=c.find(".field-config");j.each(function(c,d){for(var e=a(d),f=e.prop("name").split("["+b+"]")[1].substr(1),g=f.substr(0,f.length-1).split("]["),h=e.is(":checkbox,:radio")?e.filter(":checked").val():e.val(),j={},k=g.length-1;k>=0;k--)if(k===g.length-1)j[g[k]]=h;else{var l=j;j={},j[g[k]]=l}a.extend(!0,i,j)}),f.html(h(i)),e.removeClass("button"),a(".preview-field-config").prop("disabled",!0)}function d(b){var t,c=a(".caldera-editor-fields-panel"),e=(a(".caldera-editor-groups-panel"),a(".caldera-group-nav")),f=a('[data-group="'+b+'"]'),g=f.find(".caldera-config-group-name"),h=f.find(".caldera-config-group-slug"),i=f.find(".caldera-config-group-desc"),j=f.find(".caldera-config-group-admin"),k=a(".active-group-name"),l=a(".active-group-slug"),m=a(".active-group-desc"),n=a(".active-group-admin"),o=a(".caldera-editor-fields-list ul"),p=f.find(".caldera-config-group-repeat"),q=a(".repeat-config-button"),s=(a(".caldera-editor-group-settings"),a(".caldera-config-group-remove"));a(".new-group-input").remove(),a(".new-field-input").remove(),e.removeClass("active"),c.show(),o.hide(),o.removeClass("active").find("li.active").removeClass("active"),o.hide(),f.addClass("active"),t=a(".caldera-editor-fields-list ul.active li"),t.length?s.hide():s.show(),a(".caldera-editor-field-config-wrapper").hide(),f.show(),k.val(g.val()),l.val(h.val()),m.val(i.val()),"1"===j.val()?n.prop("checked",!0):n.prop("checked",!1),"1"===p.val()?q.addClass("field-edit-open"):q.removeClass("field-edit-open")}a(".caldera-header-save-button").baldrick({method:"POST",request:"admin.php?page=caldera-forms",before:function(b,c){if(c.preventDefault(),!check_required_bindings())return!1;a("#save_indicator").addClass("loading"),"undefined"!=typeof tinyMCE&&tinyMCE.triggerSave();var d=a(".caldera-forms-options-form").formJSON();return a(b).data("cf_edit_nonce",d.cf_edit_nonce),a(b).data("_wp_http_referer",d._wp_http_referer),a(b).data("sender","ajax"),a(b).data("config",JSON.stringify(d.config)),!0},callback:function(b){if(!1===b.data){var c=a(".updated_notice_box");c.stop().animate({top:0},200,function(){setTimeout(function(){c.stop().animate({top:-75},200)},2e3)})}},complete:function(){a(".wrapper-instance-pane .field-config").prop("disabled",!1)}}),a("body").on("click",".toggle_option_tab > a",function(b){b.preventDefault();var c=a(this),d=a(c.attr("href")),e=c.parent().find("a"),f=c.closest(".caldera-editor-config-wrapper").find(".wrapper-instance-pane");e.removeClass("button-primary"),f.hide(),d.show(),c.addClass("button-primary"),a(".caldera-conditionals-usetype").trigger("change")}),a(".caldera-editor-body").on("change",".caldera-select-field-type",function(){b(this)}),a(".caldera-editor-body").on("click",".caldera-group-nav a",function(b){b.preventDefault(),d(a(this).attr("href").substr(1))}),a(".caldera-editor-body").on("click",".caldera-editor-fields-list a",function(b){b.preventDefault();var c=a(this),d=a(c.attr("href"));a(".new-group-input").remove(),a(".new-field-input").remove(),a(".caldera-editor-fields-list li.active").removeClass("active"),c.parent().addClass("active"),a(".caldera-editor-field-config-wrapper").hide(),d.show()}),a(".caldera-editor-body").on("click",".group-config-button",function(){var c=a(this),d=a(".caldera-editor-group-settings"),e=c.closest(".caldera-editor-fields-panel"),f=a(".caldera-config-group-remove");e.find(".caldera-field-line").length?f.hide():f.show(),c.hasClass("field-edit-open")?(d.slideUp(100),c.removeClass("field-edit-open")):(d.slideDown(100),c.addClass("field-edit-open"))}),a(".caldera-editor-body").on("keydown",".field-config",function(b){a(this).is("textarea")||13===b.which&&b.preventDefault()}),a(".caldera-editor-body").on("change",".field-label",function(b){var c=a(this).closest(".caldera-editor-field-config-wrapper").prop("id");field_line=a('[data-field="'+c+'"]'),field_title=a("#"+c+" .caldera-editor-field-title, .layout-form-field.field-edit-open .layout_field_name"),slug=a("#"+c+" .field-slug"),field_line.find("a").html('<i class="icn-field"></i> '+this.value),field_title.text(this.value),"change"===b.type&&slug.trigger("change"),rebuild_field_binding()}),a(".caldera-editor-body").on("change",".active-group-name",function(b){b.preventDefault();var c=a(".caldera-group-nav.active"),e=(c.data("group"),c.find(".caldera-config-group-name")),f=c.find("span");"focusout"!==b.type||this.value.length||(this.value="Group "+(parseInt(c.index())+1)),e.val(this.value),f.text(this.value)}),a(".caldera-editor-body").on("change",".active-group-slug",function(b){b.preventDefault();var c=a(".caldera-group-nav.active"),e=(c.data("group"),c.find(".caldera-config-group-name").val()),f=c.find(".caldera-config-group-slug"),h=(c.find("span"),this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase());"focusout"!==b.type||this.value.length||(h=e.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase()),f.val(h),this.value=h}),a(".caldera-editor-body").on("change",".active-group-desc",function(b){b.preventDefault();var c=a(".caldera-group-nav.active"),e=(c.data("group"),c.find(".caldera-config-group-desc"));e.val(this.value)}),a(".caldera-editor-body").on("change",".active-group-admin",function(b){b.preventDefault();var c=a(".caldera-group-nav.active"),f=(c.data("group"),c.find(".caldera-config-group-name").val(),c.find(".caldera-config-group-admin"));c.find("span"),this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),a(this).prop("checked")?(f.val(1),c.addClass("is-admin")):(f.val(0),c.removeClass("is-admin"))}),a(".caldera-editor-body").on("click",".repeat-config-button",function(b){b.preventDefault();var c=a(".caldera-group-nav.active"),e=(c.data("group"),c.find("a .group-type")),f=c.find(".caldera-config-group-repeat"),g=a(this);g.hasClass("field-edit-open")?(f.val("0"),e.removeClass("icn-repeat").addClass("icn-folder"),g.removeClass("field-edit-open")):(f.val("1"),e.addClass("icn-repeat").removeClass("icn-folder"),g.addClass("field-edit-open"))}),a(".caldera-editor-body").on("click",".delete-field",function(){var b=a(this),c=b.closest(".caldera-editor-field-config-wrapper").prop("id");confirm(b.data("confirm"))&&(a("#"+c).remove(),a('option[value="'+c+'"]').remove(),a('[data-bind="'+c+'"]').remove(),delete current_form_fields[c],a('[data-config="'+c+'"]').slideUp(200,function(){var b=a(this);b.remove(),rebuild_field_binding(),a(document).trigger("field.removed")}))}),a(".caldera-editor-body").on("click",".add-new-group,.add-field",function(){var b=a(this);if(a(".new-group-input").remove(),a(".new-field-input").remove(),b.hasClass("add-field")){var c=a('<input type="text" class="new-field-input block-input">');c.appendTo(a(".caldera-editor-fields-list ul.active")).focus()}else{var d=a('<input type="text" class="new-group-input block-input">');d.appendTo(a(".caldera-editor-groups-panel")).focus()}}),a(".caldera-editor-body").on("change keypress",".new-group-input",function(b){if("keypress"===b.type){if(13!==b.which)return;b.preventDefault()}var h,i,c=this.value,e=a(this),f=a(".caldera-editor-groups-panel ul"),g=a(".caldera-editor-fields-list");if(c.length){h=Handlebars.compile(a("#caldera_group_line_templ").html()),i={id:c.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),name:c},f.append(h(i));var j=a('<ul data-group="'+i.id+'">').hide();j.appendTo(g),e.remove(),d(i.id)}else e.remove()}),a(".caldera-editor-body").on("change keypress",".new-field-input",function(b){if("keypress"===b.type){if(13!==b.which)return;b.preventDefault()}var g,h,i,c=this.value,d=a(this),e=d.parent(),f=a(".caldera-editor-field-config"),j=a(".caldera-config-group-remove");if(c.length){j.hide(),g=Handlebars.compile(a("#caldera_field_line_templ").html()),h=Handlebars.compile(a("#caldera_field_config_wrapper_templ").html()),i={id:c.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),label:c,slug:c.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),group:a(".caldera-group-nav.active").data("group")};var k=a(g(i));k.appendTo(e),f.append(h(i)),k.find("a").trigger("click"),d.remove()}else d.remove()}),a(".caldera-editor-body").on("change",".field-slug",function(b){this.value.length?this.value=this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase():"change"===b.type&&(this.value=a(this).closest(".caldera-editor-field-config-wrapper").find(".field-label").val().split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase())}),a(".caldera-editor-body").on("click",".caldera-add-group",function(){var c=a(this),d=c.data("group"),e=a("#"+d+"_panel_tmpl").html();c.parent().parent().append(e)}),a(".caldera-editor-body").on("click",".caldera-config-group-remove",function(){var c=a(".active-group-slug").val();a('[data-group="'+c+'"]').hide(0,function(){a(this).remove();var b=a(".caldera-group-nav");b.length?b.first().find("a").trigger("click"):a(".caldera-editor-fields-panel").hide()})}),a("body").on("click",".set-current-field",function(b){b.preventDefault();var c=a(this);a("#"+c.data("field")+"_type").val(c.data("type")).trigger("change"),a("#"+c.data("field")+"_lable").focus(),a("#field_setup_baldrickModalCloser").trigger("click")}),a(".caldera-editor-body").on("change",".field-config",function(){var d=a(this),e=d.closest(".caldera-editor-field-config-wrapper");current_form_fields&&(d.prop("id")===e.prop("id")+"_lable"&&(current_form_fields[e.prop("id")].label=this.value),d.prop("id")===e.prop("id")+"_slug"&&(current_form_fields[e.prop("id")].slug=this.value),d.prop("id")===e.prop("id")+"_type"&&(current_form_fields[e.prop("id")].type=this.value),e.length&&c(e.prop("id")))}),a(".caldera-editor-body").on("focus",".caldera-field-bind",function(b){var c=a(this),d=this.value;return console.log(b.type),b.type&&"focusin"===b.type?(c.removeClass("bound_field").addClass("reload-binding"),rebind_field_bindings(),this.value=d,void 0):void 0}),a(".caldera-editor-body").on("change",".caldera-conditional-field-set",function(){var k,l,c=a(this),d=c.parent().find(".compare-type"),e=c.data("condition"),f=c.data("id"),g="config["+e+"]["+f+"][conditions][group]["+c.data("row")+"]["+c.data("line")+"]",h=c.data("line"),i=a("#"+h+"_value"),j=i.find(".caldera-conditional-value-field").first(),m=[],n=this.value;if("{"!==n.substr(0,1)&&(k=a("#"+n),l=k.find(".field-button-type"),m=k.find(".caldera-config-group-toggle-options")),c.hasClass(".bind_init")&&c.addClass("bound_triggered"),j.length&&j.val().length&&i.data("value",j.val()),d.show(),m.length){var o=m.find(".toggle_option_row"),p='<select name="'+g+'[value]" class="caldera-processor-value-bind caldera-conditional-value-field" data-field="'+n+'" style="max-width: 220px; width: 220px;">';p+='<option value=""></option>',o.each(function(b,c){var d=a(c).find(".toggle_label_field"),e=d.data("option"),f="";i.data("value")&&(i.data("value").toString()===e||i.data("value").toString()===a(c).find(".toggle_value_field").val())&&(f=' selected="selected"'),p+='<option value="'+e+'"'+f+">"+d.val()+"</option>"}),p+="</select>"}else l&&"button"==l.val()?(d.val("is").hide(),p='<select name="'+g+'[value]" class="caldera-processor-value-bind caldera-conditional-value-field" data-field="'+n+'" style="max-width: 220px; width: 220px;">',p+='<option value="click" '+("click"===i.data("value")?'selected="selected"':"")+">Click</option>",p+='<option value="dblclick" '+("dblclick"===i.data("value")?'selected="selected"':"")+">Double Click</option>",p+="</select>"):p='<input name="'+g+'[value]" type="text" class="caldera-conditional-value-field magic-tag-enabled" value="'+(i.data("value")?i.data("value"):"")+'" style="max-width: 205px;">';i.html(p),init_magic_tags()}),a(".caldera-editor-body").on("change",".caldera-conditionals-usetype",function(){var c=a(this);""!==this.value?(a("#"+c.data("id")+"_condition_group_add").show(),a("#"+c.data("id")+"_conditional_wrap").show()):(a("#"+c.data("id")+"_condition_group_add").hide(),a("#"+c.data("id")+"_conditional_wrap").hide())}),a(".caldera-editor-body").on("click",".remove-conditional-line",function(b){b.preventDefault();var c=a(this),d=c.closest(".caldera-condition-line"),e=c.closest(".caldera-condition-group");d.remove(),e.find(".caldera-condition-line").length||e.remove()}),a(".caldera-group-nav").first().find("a").trigger("click"),a(".caldera-editor-body").on("change",".toggle_show_values",function(){var c=a(this),d=c.closest(".caldera-config-group-toggle-options");values=d.find(".toggle_value_field"),lables=d.find(".toggle_label_field"),field_lables=d.find(".caldera-config-group-option-labels"),c.prop("checked")?(values.show().parent().show(),values.show().parent().parent().show(),lables.css("width",""),field_lables.show()):(values.hide().parent().hide(),lables.css("width",245),field_lables.hide()),lables.trigger("toggle.values"),init_magic_tags()}),a(".caldera-editor-body").on("change",".auto-populate-type",function(){a(this).closest(".wrapper-instance-pane").find(".auto-populate-options").trigger("change")}),a(".caldera-editor-body").on("change",".auto-populate-options",function(){var b=a(this),c=b.closest(".wrapper-instance-pane"),d=c.find(".caldera-config-group-toggle-options"),e=c.find(".caldera-config-group-auto-options"),f=e.find(".auto-populate-type");e.find(".auto-populate-type-panel").hide(),b.prop("checked")?(d.hide(),e.show()):(d.show(),e.hide()),e.find(".caldera-config-group-auto-"+f.val()).show()}),a("body").on("change",".pin-toggle-roles",function(){var b=a(this),c=a("#caldera-pin-rules");"1"===b.val()?c.show():c.hide()}),a("body").on("click",".magic-tag-init",function(){var c=a(this),d=c.prev();d.focus().trigger("init.magic")}),a("body").on("keyup blur focus select click init.magic",".magic-tag-enabled",function(b){init_magic_tags();var c=a(this),d=c.parent(),e=d.closest(".wrapper-instance-pane").find(".caldera-select-field-type").val()?d.closest(".wrapper-instance-pane").find(".caldera-select-field-type").val():"hidden",f=d.find(".magic-tags-autocomplete"),g=f.find("ul"),h=this.value,j=[],k="",l=this.selectionStart,m=this.selectionEnd;if(f.length&&f.data("focus"))return b.preventDefault(),void 0;if(c.data("tag",""),this.selectionEnd>this.selectionStart)k=this.value.substr(this.selectionStart,this.selectionEnd-this.selectionStart);else if(("select"===b.type||"keyup"===b.type)&&40!==b.which&&38!==b.which&&39!==b.which&&37!==b.which){for(l=this.selectionStart;l>0;l--){var n=h.substr(l-1,1);if(" "===n||"\n"===n||("%"===n||"}"===n)&&this.selectionStart===l)break}for(m=this.selectionStart;m<h.length;m++){var n=h.substr(m,1);if(" "===n||"\n"===n||("%"===n||"{"===n)&&this.selectionStart===m)break}k=h.substr(l,m-l)}if("focusout"!==b.type){if("init"!==b.type&&k.length<3)return f.length&&f.remove(),void 0;f.length||(f=a('<div class="magic-tags-autocomplete"></div>'),g=a("<ul></ul>"),g.appendTo(f),f.insertAfter(c),f.on("mouseenter",function(){a(this).data("focus",!0)}),f.on("mouseleave",function(){a(this).data("focus",!1),c.is(":focus")||c.trigger("focusout")})),g.empty();var o="system",p=!1;"hidden"===e||"dropdown"===e||"radio"===e||"toggle_switch"===e||"checkbox"===e?(p=!0,e="text",o="all"):("paragraph"===e||"html"===e)&&(e="text"),c.data("type")&&(e=c.data("type")),e=e.split(","),e.push("vars");for(var q=0;q<e.length;q++)for(var r in system_values)if("undefined"!=typeof system_values[r].tags[e[q]]){if(j=[r],"system"!==r&&"variable"!==r&&"field"!==r){var s=jQuery(".processor-"+r),t=c.closest(".caldera-editor-processor-config-wrapper"),u=t.prop("id");j=[];for(var v=0;v<s.length;v++)if(t.length||p!==!0){if(u===s[v].id)continue;jQuery("li."+s[v].id).index()<jQuery("li."+u).index()&&j.push(s[v].id)}else j.push(s[v].id)}for(var w=0;w<j.length;w++)if("all"===o||o===r||"variable"===r){var x=a('<li class="header">'+system_values[r].type+(w>0?" ["+(w+1)+"]":"")+"</li>"),y=0;x.appendTo(g);for(var z=0;z<system_values[r].tags[e[q]].length;z++)if(!c.data("parent")||"variable:"+c.data("parent")!==system_values[r].tags[e[q]][z]){var A=system_values[r].wrap[0]+system_values[r].tags[e[q]][z]+system_values[r].wrap[1];if(j[w]!==r&&j.length>1&&(A=system_values[r].wrap[0]+system_values[r].tags[e[q]][z]+":"+j[w]+system_values[r].wrap[1]),A.indexOf(k)>=0||"init"===b.type){y+=1;var B=A.replace(k,"<strong>"+k+"</strong>"),C=a('<li class="tag" data-tag="'+A+'">'+B+"</li>");C.on("click",function(){var b=a(this).data("tag");c.val(h.substr(0,l)+b+h.substr(m)).trigger("change").focus(),c[0].selectionStart=l+b.length-(b.indexOf("*")>0?2:0),c[0].selectionEnd=l+b.length-(b.indexOf("*")>0?1:0)}),C.appendTo(g)}}0===y&&x.remove()}}}g.children().length||f.remove(),"focusout"===b.type&&setTimeout(function(){f.remove()},200)});for(var e=a(".cf-editor-template"),f=0;f<e.length;f++)compiled_templates[e[f].id]=Handlebars.compile(e[f].innerHTML);a(".caldera-select-field-type").not(".field-initialized").each(function(a,c){b(c)})});var rebuild_field_binding,rebind_field_bindings,current_form_fields={},required_errors={},add_new_grid_page,add_page_grid,init_magic_tags,core_form,compiled_templates={};init_magic_tags=function(){var a=jQuery(".magic-tag-enabled");a.each(function(a,b){var c=jQuery(b);if(c.hasClass("magic-tag-init-bound")){var d=c.parent().find(".magic-tag-init");return c.is(":visible")?d.show():d.hide(),void 0}var e=jQuery('<span class="icn-code magic-tag-init"></span>'),f=jQuery('<span style="position:relative;display:inline-block; width:100%;"></span>');c.is("input")&&e.css("borderBottom","none"),c.hasClass("caldera-conditional-value-field")&&f.width("auto"),c.wrap(f),e.insertAfter(c),c.addClass("magic-tag-init-bound"),c.is(":visible")?e.show():e.hide()})},rebuild_field_binding=function(){if(core_form||(core_form=jQuery(".caldera-forms-options-form")),core_form.hasClass("builder-loaded")){var a=jQuery(".caldera-editor-field-config-wrapper");system_values.field={tags:{text:[]},type:"Fields",wrap:["%","%"]};for(var b=0;b<a.length;b++){var c=a[b].id,d=jQuery("#"+c+"_lable").val(),e=jQuery("#"+c+"_slug").val(),f=jQuery("#"+c+"_type").val();"undefined"==typeof system_values.field.tags[f]&&(system_values.field.tags[f]=[]),system_values.field.tags[f].push(e),"text"!==f&&system_values.field.tags.text.push(e),current_form_fields[c]={label:d,slug:e,type:f},jQuery("option.bound-field").trigger("change").each(function(a,b){var c=jQuery(b);0!==c.prop("value").indexOf("{")?c.text(jQuery("#"+c.prop("value")+"_lable").val()+" ["+jQuery("#"+c.prop("value")+"_lable").val()+"]"):c.text(c.prop("value").replace("{","").replace("}",""))}).removeClass("bound-field")}}},rebind_field_bindings=function(){var b,c,a=jQuery(".caldera-field-bind").not(".bound_field");if(a.length){a.addClass("bound_field");for(var d=0;d<a.length;d++){var e=jQuery(a[d]),f=e.val(),g=e.data("default"),h=e.data("exclude"),i=0,j=e.closest(".caldera-editor-processor-config-wrapper"),k=j.prop("id"),l="";if(g&&!e.hasClass("reload-binding")&&(f=g),e.is("select")){e.empty();var m=jQuery('<optgroup label="Fields">');for(var n in current_form_fields)e.data("type")&&e.data("type").split(",").indexOf(current_form_fields[n].type)<0||(e.data("id")!==n&&m.append('<option value="'+n+'"'+(f===n?'selected="selected"':"")+">"+current_form_fields[n].label+" ["+current_form_fields[n].slug+"]</option>"),i+=1);m.appendTo(e),0===i&&e.empty();for(var o in system_values)if(b=[],!(h&&h.split(",").indexOf(o)>=0)){if("system"!==o&&"variable"!==o)for(var p=jQuery(".processor-"+o),q=0;q<p.length;q++)k!==p[q].id&&(b.push(p[q].id),p.length>1&&(c=jQuery("li."+p[q].id+" .processor-line-number"))&&c.html("["+(q+1)+"]"));else b.push("__system__");var r=[];e.data("type")?(r=e.data("type").split(","),r.push("vars")):r=["text","vars"];for(var s=0;s<r.length;s++)if(system_values[o].tags[r[s]])for(var t=0;t<b.length;t++){jQuery("li."+b[t]).index()>jQuery("li."+k).index()&&"__system__"!==b[t]?e.closest(".caldera-editor-processors-panel-wrap").length&&(l=' disabled="disabled"'):l="";for(var m=jQuery('<optgroup label="'+system_values[o].type+("__system__"!==b[t]?" "+jQuery("li."+b[t]).find(".processor-line-number").html():"")+'"'+l+">"),u=0;u<system_values[o].tags[r[s]].length;u++){var v=system_values[o].tags[r[s]][u];"__system__"!==b[t]&&(v=v.replace(o,b[t])),m.append('<option value="{'+v+'}"'+(f==="{"+v+"}"?'selected="selected"':"")+l+">"+system_values[o].tags[r[s]][u]+"</option>"),i+=1}m.children().length&&m.appendTo(e)}}if(0===i){if(e.empty(),e.data("type")){e.append('<option value="">No '+e.data("type").split(",").join(" or ")+" in form</option>");var w=!0}}else e.prop("disabled",!1);e.hasClass("required")||"undefined"!=typeof w||e.prepend('<option value=""></option>'),e.val(f)}}init_magic_tags(),jQuery(document).trigger("bound.fields"),jQuery(".caldera-header-save-button").prop("disabled",!1)}},jQuery(document).ready(function(a){function b(){var b=a(".layout-grid-panel"),c=0;b.each(function(b,d){var e=a(d),f=e.find(".layout-structure"),g=e.find(".row"),h=[];g.each(function(b,d){var e=a(d),f=e.children().not(".column-merge"),g=[];c+=1,f.each(function(b,d){span=a(d).attr("class").split("-"),g.push(span[2]);var e=a(d).find(".field-location");e.length&&e.each(function(d,e){var f=a(e);f.val(c+":"+(b+1)).removeAttr("disabled")})}),h.push(g.join(":"))}),f.val(h.join("|"))})}function c(b,c,e){var i,j,f="fld_"+Math.round(1e7*Math.random()),g=f,h=a("#field_config_panels");if(e){var k=a("#"+e).clone().wrap("<div>").parent().html().replace(new RegExp(e,"g"),"{{id}}");i=Handlebars.compile(k)}else i=Handlebars.compile(a("#caldera_field_config_wrapper_templ").html());j={id:g,label:"",slug:""},h.append(i(j)),b.removeClass("button-small").removeClass("button").removeClass("button-primary").removeClass("ui-draggable").removeClass("layout-new-form-field").addClass("layout-form-field").attr("data-config",f),b.find(".layout_field_name").remove(),b.find(".field-location").prop("name","config[layout_grid][fields]["+f+"]"),b.find(".settings-panel").show(),b.appendTo(c),d(),b.find(".icon-edit").trigger("click"),a("#"+f+"_lable").focus().select(),e&&(h.find(".field_config_string").val(""),h.find(".field-label").trigger("change")),rebuild_field_binding(),baldrickTriggers(),a("#"+f).trigger("field.drop"),a(document).trigger("field.added")}function d(){a(".toggle-options").sortable({handle:".dashicons-sort"}),a("#grid-pages-panel").sortable({placeholder:"row-drop-helper",handle:".sort-handle",items:".first-row-level",axis:"y",stop:function(){b()}}),a(".layout-column").sortable({connectWith:".layout-column",appendTo:"#grid-pages-panel",helper:"clone",items:".layout-form-field",handle:".drag-handle",cursor:"move",opacity:.7,cursorAt:{left:100,top:15},start:function(a,b){b.helper.css({width:"200px",height:"35px",paddingTop:"20px"})},stop:function(a,c){c.item.removeAttr("style"),b()}}),a("h3 .layout-new-form-field").draggable({helper:"clone",appendTo:"body"}),a(".page-toggle.button").droppable({accept:".layout-form-field",over:function(){a(this).trigger("click"),a(".layout-column").sortable("refresh")}}),a(".layout-column").droppable({greedy:!0,activeClass:"ui-state-dropper",hoverClass:"ui-state-hoverable",accept:".layout-new-form-field",drop:function(b,d){var e=d.draggable.clone(),f=a(this);c(e,f)}}),b()}add_new_grid_page=function(){return{page_no:"pg_"+Math.round(1e7*Math.random())}},add_page_grid=function(b){var c=a(".page-toggle").length+1,e=a('<button type="button" data-name="Page '+c+'" data-page="'+b.rawData.page_no+'" class="page-toggle button">'+b.params.trigger.data("addtitle")+" "+c+"</button> "),f=a("#page-toggles");e.appendTo(f),f.show(),d(),e.trigger("click"),1===c&&f.hide(),a(document).trigger("add.page")},a(document).on("remove.page add.page load.page",function(){var c=a(".page-toggle").length,d=a("#tab_pages");1>=c?d.hide():d.show()}),d(),a("#grid-pages-panel").on("click",".column-fieldinsert .dashicons-plus-alt",function(){var d=a(this).closest(".column-container"),e=a("#newfield-tool").clone();c(e,d)}),a("#grid-pages-panel").on("click",".column-fieldinsert .dashicons-admin-generic",function(){}),a("#grid-pages-panel").on("click",".column-split",function(){var c=a(this).parent().parent(),e=c.attr("class").split("-"),f=a("<div>").insertAfter(c),g=Math.ceil(e[2]/2),h=Math.floor(e[2]/2);e[2]=g,c.attr("class",e.join("-")),e[2]=h,f.addClass(e.join("-")).append('<div class="layout-column column-container">'),a(this).remove(),d(),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),a("#grid-pages-panel").on("click",".column-remove",function(){var d=a(this).closest(".row"),e=d.find(".layout-form-field"),f=d.closest(".layout-grid-panel");if(e.length){if(!confirm(a("#row-remove-fields-message").text()))return;e.each(function(b,c){var d=a(c).data("config");a("#"+d).remove(),a('option[value="'+d+'"]').remove(),a('[data-bind="'+d+'"]').remove(),delete current_form_fields[d]})}d.slideUp(200,function(){if(a(this).remove(),b(),rebuild_field_binding(),!f.find(".row").length){f.remove();var c=a("#page-toggles .button-primary"),d=c.prev(),e=c.next();c.remove(),d.length?d.trigger("click"):e.trigger("click")}a(document).trigger("remove.page")}),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),a(".caldera-config-editor-main-panel").on("click",".caldera-add-row",function(c){c.preventDefault();var e=a(".page-active");return e.length?(a(".page-active").append('<div class="first-row-level row"><div class="col-xs-12"><div class="layout-column column-container"></div></div></div>'),d(),b(),void 0):(a(".caldera-add-page").trigger("click"),void 0)}),a("#grid-pages-panel").on("click",".column-join",function(){var d=a(this).parent().parent().parent(),e=d.prev(),f=e.attr("class").split("-"),g=d.attr("class").split("-");f[2]=parseFloat(f[2])+parseFloat(g[2]),d.find(".layout-column").contents().appendTo(e.find(".layout-column")),e.attr("class",f.join("-")),d.remove(),b(),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),a("#grid-pages-panel").on("mouseenter",".row",function(){var d=jQuery(this);jQuery(".column-tools,.column-merge").remove(),d.children().children().first().append('<div class="column-remove column-tools"><i class="icon-remove"></i></div>'),d.children().children().last().append('<div class="column-sort column-tools" style="text-align:right;"><i class="dashicons dashicons-menu drag-handle sort-handle"></i></div>'),d.children().children().not(":first").prepend('<div class="column-merge"><div class="column-join column-tools"><i class="icon-join"></i></div></div>');var e=d.parent().parent().parent().width()/12-1;d.children().children().each(function(b,c){var d=a(c),e=d.width()/2-5;d.prepend('<div class="column-fieldinsert column-tools"><i class="dashicons dashicons-plus-alt"></i></div>'),d.parent().hasClass("col-xs-1")||(d.prepend('<div class="column-split column-tools"><i class="dashicons dashicons-leftright"></i></div>'),d.find(".column-split").css("left",e))}),jQuery(".column-merge").draggable({axis:"x",helper:"clone",appendTo:d,grid:[e,0],drag:function(c,d){a(this).addClass("dragging"),a(".column-tools").remove(),a(".column-split").remove();var e=a(this).parent().parent(),f=d.helper,g=d.originalPosition.left>f.position().left?"left":"right",i=e.prev(),j=Math.round(e.parent().width()/12-10),k=Math.abs(d.originalPosition.left-f.position().left);if(e.parent().addClass("sizing"),k>=j){var l=i.attr("class").split("-"),m=e.attr("class").split("-");l[2]=parseFloat(l[2]),m[2]=parseFloat(m[2]),"left"===g?(l[2]--,m[2]++,l[2]>0&&l[2]<l[2]+m[2]?(i.attr("class",l.join("-")),e.attr("class",m.join("-")),d.originalPosition.left=f.position().left):a(this).draggable("option","disabled",!0)):(l[2]++,m[2]--,m[2]>0&&m[2]<m[2]+m[2]?(i.attr("class",l.join("-")),e.attr("class",m.join("-")),d.originalPosition.left=f.position().left):a(this).draggable("option","disabled",!0)),b()
|
| 2 |
-
}},stop:function(){
|
| 1 |
+
function new_conditional_group(e){var a=e.trigger.data("id"),i="cl"+Math.round(18746582734*Math.random()),t="rw"+Math.round(98347598345*Math.random()),r=[{id:t,type:e.trigger.data("type"),lines:[{id:i}]}];return{group:r,id:a}}function new_conditional_line(e){var a=e.trigger.data("id"),i=e.trigger.data("group"),t=e.trigger.data("type"),r="cl"+Math.round(18746582734*Math.random()),o={id:a,type:t,lineid:r,rowid:i,name:"config["+t+"]["+a+"][conditions][group]["+i+"]["+r+"]"};return o}function build_conditions_config(e){var a=JSON.parse(e.trigger.val());return a.id=e.trigger.data("id"),a}function setup_field_type(e){return{id:e.trigger.prop("id")}}function check_required_bindings(e){var a,i=(jQuery(".caldera-header-save-button"),jQuery(".layout-form-field")),t=jQuery(".caldera-processor-nav"),r=!0;a=e?jQuery(e):jQuery(".caldera-config-field .required"),a.removeClass("has-error"),i.removeClass("has-error"),t.removeClass("has-error"),jQuery(".error-tag").remove(),required_errors={},a.each(function(e,a){var i=jQuery(a),t=i.closest(".caldera-config-editor-panel");if(a.value.length){if(i.hasClass("field-slug"))for(var o=jQuery(".field-slug").not(i),l=0;l<o.length;l++)if(o[l].value===a.value){var i=jQuery(o[l]);required_errors[t.prop("id")]||(required_errors[t.prop("id")]=0);var n=i.closest(".caldera-editor-field-config-wrapper"),d=i.closest(".caldera-editor-processor-config-wrapper");n.length&&jQuery('.layout-form-field[data-config="'+n.prop("id")+'"]').addClass("has-error"),d.length&&jQuery("."+d.prop("id")).addClass("has-error"),required_errors[t.prop("id")]+=1,i.addClass("has-error");break}}else{required_errors[t.prop("id")]||(required_errors[t.prop("id")]=0);var n=i.closest(".caldera-editor-field-config-wrapper"),d=i.closest(".caldera-editor-processor-config-wrapper");n.length&&jQuery('.layout-form-field[data-config="'+n.prop("id")+'"]').addClass("has-error"),d.length&&jQuery("."+d.prop("id")).addClass("has-error"),required_errors[t.prop("id")]+=1,i.addClass("has-error"),r=!1}});for(var o in required_errors)jQuery(".caldera-forms-options-form").find('a[href="#'+o+'"]').append('<span class="error-tag">'+required_errors[o]+"</span>");return jQuery(".preview-caldera-config-group button:submit").length?(jQuery(".mailer-errors").hide(),jQuery(".mailer-control-panel").show()):(jQuery(".mailer-errors").show(),jQuery(".mailer-control-panel").hide()),jQuery(".caldera-conditional-field-set").trigger("change"),r}jQuery(document).ready(function(e){function a(a){var t=e(a),r=t.closest(".caldera-editor-field-config-wrapper"),o=r.find(".caldera-config-field-setup"),l=compiled_templates[t.val()+"_tmpl"]?compiled_templates[t.val()+"_tmpl"]:compiled_templates.noconfig_field_templ,n=r.find(".field_config_string").val(),d=t.data("type");if(r.find(".caldera-config-group").show(),t.addClass("field-initialized"),n=n.length&&d===t.val()?JSON.parse(n):fieldtype_defaults[t.val()+"_cfg"],n||(n={}),n._id=t.data("field"),n._name="config[fields]["+t.data("field")+"][config]",l=e("<div>").html(l(n)),o.html(l.html()),"function"==typeof window[t.val()+"_init"]&&window[t.val()+"_init"](t.data("field"),o),fieldtype_defaults[t.val()+"_nosupport"]&&(fieldtype_defaults[t.val()+"_nosupport"].indexOf("hide_label")>=0&&r.find(".hide-label-field").hide().find(".field-config").prop("checked",!1),fieldtype_defaults[t.val()+"_nosupport"].indexOf("caption")>=0&&r.find(".caption-field").hide().find(".field-config").val(""),fieldtype_defaults[t.val()+"_nosupport"].indexOf("required")>=0&&r.find(".required-field").hide().find(".field-config").prop("checked",!1),fieldtype_defaults[t.val()+"_nosupport"].indexOf("custom_class")>=0&&r.find(".customclass-field").hide().find(".field-config").val(""),fieldtype_defaults[t.val()+"_nosupport"].indexOf("entry_list")>=0&&r.find(".entrylist-field").hide().find(".field-config").prop("checked",!1)),r.find(".toggle_show_values").trigger("change"),!e(".caldera-select-field-type").not(".field-initialized").length){if(core_form.hasClass("builder-loaded"))i(t.data("field"));else{for(var s=e(".caldera-select-field-type.field-initialized"),c=0;c<s.length;c++)i(e(s[c]).data("field"));core_form.addClass("builder-loaded")}rebuild_field_binding(),baldrickTriggers()}}function i(a){var i=e("#"+a),t=i.find(".caldera-select-field-type"),r=e('.layout-form-field[data-config="'+a+'"]'),o=r.find(".field_preview"),l=(e("#preview-"+t.val()+"_tmpl").html(),compiled_templates["preview-"+t.val()+"_tmpl"]),n={id:a},d=i.find(".field-config");d.each(function(i,t){for(var r=e(t),o=r.prop("name").split("["+a+"]")[1].substr(1),l=o.substr(0,o.length-1).split("]["),d=r.is(":checkbox,:radio")?r.filter(":checked").val():r.val(),s={},c=l.length-1;c>=0;c--)if(c===l.length-1)s[l[c]]=d;else{var p=s;s={},s[l[c]]=p}e.extend(!0,n,s)}),o.html(l(n)),r.removeClass("button"),e(".preview-field-config").prop("disabled",!0)}function t(a){var i,t=e(".caldera-editor-fields-panel"),r=(e(".caldera-editor-groups-panel"),e(".caldera-group-nav")),o=e('[data-group="'+a+'"]'),l=o.find(".caldera-config-group-name"),n=o.find(".caldera-config-group-slug"),d=o.find(".caldera-config-group-desc"),s=o.find(".caldera-config-group-admin"),c=e(".active-group-name"),p=e(".active-group-slug"),u=e(".active-group-desc"),f=e(".active-group-admin"),g=e(".caldera-editor-fields-list ul"),v=o.find(".caldera-config-group-repeat"),h=e(".repeat-config-button"),m=(e(".caldera-editor-group-settings"),e(".caldera-config-group-remove"));e(".new-group-input").remove(),e(".new-field-input").remove(),r.removeClass("active"),t.show(),g.hide(),g.removeClass("active").find("li.active").removeClass("active"),g.hide(),o.addClass("active"),i=e(".caldera-editor-fields-list ul.active li"),i.length?m.hide():m.show(),e(".caldera-editor-field-config-wrapper").hide(),o.show(),c.val(l.val()),p.val(n.val()),u.val(d.val()),"1"===s.val()?f.prop("checked",!0):f.prop("checked",!1),"1"===v.val()?h.addClass("field-edit-open"):h.removeClass("field-edit-open")}e(".caldera-header-save-button").baldrick({method:"POST",request:"admin.php?page=caldera-forms",before:function(a,i){if(i.preventDefault(),!check_required_bindings())return!1;e("#save_indicator").addClass("loading"),"undefined"!=typeof tinyMCE&&tinyMCE.triggerSave();var t=e(".caldera-forms-options-form").formJSON();return e(a).data("cf_edit_nonce",t.cf_edit_nonce),e(a).data("_wp_http_referer",t._wp_http_referer),e(a).data("sender","ajax"),e(a).data("config",JSON.stringify(t.config)),!0},callback:function(a){if(!1===a.data){var i=e(".updated_notice_box");i.stop().animate({top:0},200,function(){setTimeout(function(){i.stop().animate({top:-75},200)},2e3)})}},complete:function(a){e(".wrapper-instance-pane .field-config").prop("disabled",!1)}}),e("body").on("click",".toggle_option_tab > a",function(a){a.preventDefault();var i=e(this),t=e(i.attr("href")),r=i.parent().find("a"),o=i.closest(".caldera-editor-config-wrapper").find(".wrapper-instance-pane");r.removeClass("button-primary"),o.hide(),t.show(),i.addClass("button-primary"),e(".caldera-conditionals-usetype").trigger("change")}),e(".caldera-editor-body").on("change",".caldera-select-field-type",function(e){a(this)}),e(".caldera-editor-body").on("click",".caldera-group-nav a",function(a){a.preventDefault(),t(e(this).attr("href").substr(1))}),e(".caldera-editor-body").on("click",".caldera-editor-fields-list a",function(a){a.preventDefault();var i=e(this),t=e(i.attr("href"));e(".new-group-input").remove(),e(".new-field-input").remove(),e(".caldera-editor-fields-list li.active").removeClass("active"),i.parent().addClass("active"),e(".caldera-editor-field-config-wrapper").hide(),t.show()}),e(".caldera-editor-body").on("click",".group-config-button",function(a){var i=e(this),t=e(".caldera-editor-group-settings"),r=i.closest(".caldera-editor-fields-panel"),o=e(".caldera-config-group-remove");r.find(".caldera-field-line").length?o.hide():o.show(),i.hasClass("field-edit-open")?(t.slideUp(100),i.removeClass("field-edit-open")):(t.slideDown(100),i.addClass("field-edit-open"))}),e(".caldera-editor-body").on("keydown",".field-config",function(a){e(this).is("textarea")||13===a.which&&a.preventDefault()}),e(".caldera-editor-body").on("change",".field-label",function(a){var i=e(this).closest(".caldera-editor-field-config-wrapper").prop("id");field_line=e('[data-field="'+i+'"]'),field_title=e("#"+i+" .caldera-editor-field-title, .layout-form-field.field-edit-open .layout_field_name"),slug=e("#"+i+" .field-slug"),field_line.find("a").html('<i class="icn-field"></i> '+this.value),field_title.text(this.value),"change"===a.type&&slug.trigger("change"),rebuild_field_binding()}),e(".caldera-editor-body").on("change",".active-group-name",function(a){a.preventDefault();var i=e(".caldera-group-nav.active"),t=(i.data("group"),i.find(".caldera-config-group-name")),r=i.find("span");"focusout"!==a.type||this.value.length||(this.value="Group "+(parseInt(i.index())+1)),t.val(this.value),r.text(this.value)}),e(".caldera-editor-body").on("change",".active-group-slug",function(a){a.preventDefault();var i=e(".caldera-group-nav.active"),t=(i.data("group"),i.find(".caldera-config-group-name").val()),r=i.find(".caldera-config-group-slug"),o=(i.find("span"),this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase());"focusout"!==a.type||this.value.length||(o=t.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase()),r.val(o),this.value=o}),e(".caldera-editor-body").on("change",".active-group-desc",function(a){a.preventDefault();var i=e(".caldera-group-nav.active"),t=(i.data("group"),i.find(".caldera-config-group-desc"));t.val(this.value)}),e(".caldera-editor-body").on("change",".active-group-admin",function(a){a.preventDefault();var i=e(".caldera-group-nav.active"),t=(i.data("group"),i.find(".caldera-config-group-name").val(),i.find(".caldera-config-group-admin"));i.find("span"),this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase();e(this).prop("checked")?(t.val(1),i.addClass("is-admin")):(t.val(0),i.removeClass("is-admin"))}),e(".caldera-editor-body").on("click",".repeat-config-button",function(a){a.preventDefault();var i=e(".caldera-group-nav.active"),t=(i.data("group"),i.find("a .group-type")),r=i.find(".caldera-config-group-repeat"),o=e(this);o.hasClass("field-edit-open")?(r.val("0"),t.removeClass("icn-repeat").addClass("icn-folder"),o.removeClass("field-edit-open")):(r.val("1"),t.addClass("icn-repeat").removeClass("icn-folder"),o.addClass("field-edit-open"))}),e(".caldera-editor-body").on("click",".delete-field",function(){var a=e(this),i=a.closest(".caldera-editor-field-config-wrapper").prop("id");confirm(a.data("confirm"))&&(e("#"+i).remove(),e('option[value="'+i+'"]').remove(),e('[data-bind="'+i+'"]').remove(),delete current_form_fields[i],e('[data-config="'+i+'"]').slideUp(200,function(){var a=e(this);a.remove(),rebuild_field_binding(),e(document).trigger("field.removed")}))}),e(".caldera-editor-body").on("click",".add-new-group,.add-field",function(){var a=e(this);if(e(".new-group-input").remove(),e(".new-field-input").remove(),a.hasClass("add-field")){var i=e('<input type="text" class="new-field-input block-input">');i.appendTo(e(".caldera-editor-fields-list ul.active")).focus()}else{var t=e('<input type="text" class="new-group-input block-input">');t.appendTo(e(".caldera-editor-groups-panel")).focus()}}),e(".caldera-editor-body").on("change keypress",".new-group-input",function(a){if("keypress"===a.type){if(13!==a.which)return;a.preventDefault()}var i,r,o=this.value,l=e(this),n=e(".caldera-editor-groups-panel ul"),d=e(".caldera-editor-fields-list");if(o.length){i=Handlebars.compile(e("#caldera_group_line_templ").html()),r={id:o.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),name:o},n.append(i(r));var s=e('<ul data-group="'+r.id+'">').hide();s.appendTo(d),l.remove(),t(r.id)}else l.remove()}),e(".caldera-editor-body").on("change keypress",".new-field-input",function(a){if("keypress"===a.type){if(13!==a.which)return;a.preventDefault()}var i,t,r,o=this.value,l=e(this),n=l.parent(),d=e(".caldera-editor-field-config"),s=e(".caldera-config-group-remove");if(o.length){s.hide(),i=Handlebars.compile(e("#caldera_field_line_templ").html()),t=Handlebars.compile(e("#caldera_field_config_wrapper_templ").html()),r={id:o.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),label:o,slug:o.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase(),group:e(".caldera-group-nav.active").data("group")};var c=e(i(r));c.appendTo(n),d.append(t(r)),c.find("a").trigger("click"),l.remove()}else l.remove()}),e(".caldera-editor-body").on("change",".field-slug",function(a){this.value.length?this.value=this.value.split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase():"change"===a.type&&(this.value=e(this).closest(".caldera-editor-field-config-wrapper").find(".field-label").val().split(" ").join("_").split("-").join("_").replace(/[^a-z0-9_]/gi,"").toLowerCase())}),e(".caldera-editor-body").on("click",".caldera-add-group",function(a){var i=e(this),t=i.data("group"),r=e("#"+t+"_panel_tmpl").html();i.parent().parent().append(r)}),e(".caldera-editor-body").on("click",".caldera-config-group-remove",function(a){var i=e(".active-group-slug").val();e('[data-group="'+i+'"]').hide(0,function(){e(this).remove();var a=e(".caldera-group-nav");a.length?a.first().find("a").trigger("click"):e(".caldera-editor-fields-panel").hide()})}),e("body").on("click",".set-current-field",function(a){a.preventDefault();var i=e(this);e("#"+i.data("field")+"_type").val(i.data("type")).trigger("change"),e("#"+i.data("field")+"_lable").focus(),e("#field_setup_baldrickModalCloser").trigger("click")}),e(".caldera-editor-body").on("change",".field-config",function(a){var t=e(this),r=t.closest(".caldera-editor-field-config-wrapper");current_form_fields&&(t.prop("id")===r.prop("id")+"_lable"&&(current_form_fields[r.prop("id")].label=this.value),t.prop("id")===r.prop("id")+"_slug"&&(current_form_fields[r.prop("id")].slug=this.value),t.prop("id")===r.prop("id")+"_type"&&(current_form_fields[r.prop("id")].type=this.value),r.length&&i(r.prop("id")))}),e(".caldera-editor-body").on("focus",".caldera-field-bind",function(a){var i=e(this),t=this.value;return console.log(a.type),a.type&&"focusin"===a.type?(i.removeClass("bound_field").addClass("reload-binding"),rebind_field_bindings(),void(this.value=t)):void 0}),e(".caldera-editor-body").on("change",".caldera-conditional-field-set",function(a){var i,t,r=e(this),o=r.parent().find(".compare-type"),l=r.data("condition"),n=r.data("id"),d="config["+l+"]["+n+"][conditions][group]["+r.data("row")+"]["+r.data("line")+"]",s=r.data("line"),c=e("#"+s+"_value"),p=c.find(".caldera-conditional-value-field").first(),u=[],f=this.value;if("{"!==f.substr(0,1)&&(i=e("#"+f),t=i.find(".field-button-type"),u=i.find(".caldera-config-group-toggle-options")),r.hasClass(".bind_init")&&r.addClass("bound_triggered"),p.length&&p.val().length&&c.data("value",p.val()),o.show(),u.length){var g=u.find(".toggle_option_row"),v='<select name="'+d+'[value]" class="caldera-processor-value-bind caldera-conditional-value-field" data-field="'+f+'" style="max-width: 220px; width: 220px;">';v+='<option value=""></option>',g.each(function(a,i){var t=e(i).find(".toggle_label_field"),r=t.data("option"),o="";c.data("value")&&(c.data("value").toString()===r||c.data("value").toString()===e(i).find(".toggle_value_field").val())&&(o=' selected="selected"'),v+='<option value="'+r+'"'+o+">"+t.val()+"</option>"}),v+="</select>"}else t&&"button"==t.val()?(o.val("is").hide(),v='<select name="'+d+'[value]" class="caldera-processor-value-bind caldera-conditional-value-field" data-field="'+f+'" style="max-width: 220px; width: 220px;">',v+='<option value="click" '+("click"===c.data("value")?'selected="selected"':"")+">Click</option>",v+='<option value="dblclick" '+("dblclick"===c.data("value")?'selected="selected"':"")+">Double Click</option>",v+="</select>"):v='<input name="'+d+'[value]" type="text" class="caldera-conditional-value-field magic-tag-enabled" value="'+(c.data("value")?c.data("value"):"")+'" style="max-width: 205px;">';c.html(v),init_magic_tags()}),e(".caldera-editor-body").on("change",".caldera-conditionals-usetype",function(a){var i=e(this);"show"===this.value||"hide"===this.value||"disable"===this.value||"use"===this.value||"not"===this.value?(e("#"+i.data("id")+"_condition_group_add").show(),e("#"+i.data("id")+"_conditional_wrap").show()):(e("#"+i.data("id")+"_condition_group_add").hide(),e("#"+i.data("id")+"_conditional_wrap").hide())}),e(".caldera-editor-body").on("click",".remove-conditional-line",function(a){a.preventDefault();var i=e(this),t=i.closest(".caldera-condition-line"),r=i.closest(".caldera-condition-group");t.remove(),r.find(".caldera-condition-line").length||r.remove()}),e(".caldera-group-nav").first().find("a").trigger("click"),e(".caldera-editor-body").on("change",".toggle_show_values",function(a){var i=e(this),t=i.closest(".caldera-config-group-toggle-options");values=t.find(".toggle_value_field"),lables=t.find(".toggle_label_field"),field_lables=t.find(".caldera-config-group-option-labels"),i.prop("checked")?(values.show().parent().show(),values.show().parent().parent().show(),lables.css("width",""),field_lables.show()):(values.hide().parent().hide(),lables.css("width",245),field_lables.hide()),lables.trigger("toggle.values"),init_magic_tags()}),e(".caldera-editor-body").on("change",".auto-populate-type",function(){e(this).closest(".wrapper-instance-pane").find(".auto-populate-options").trigger("change")}),e(".caldera-editor-body").on("change",".auto-populate-options",function(){var a=e(this),i=a.closest(".wrapper-instance-pane"),t=i.find(".caldera-config-group-toggle-options"),r=i.find(".caldera-config-group-auto-options"),o=r.find(".auto-populate-type");r.find(".auto-populate-type-panel").hide(),a.prop("checked")?(t.hide(),r.show()):(t.show(),r.hide()),r.find(".caldera-config-group-auto-"+o.val()).show()}),e("body").on("change",".pin-toggle-roles",function(){var a=e(this),i=e("#caldera-pin-rules");"1"===a.val()?i.show():i.hide()}),e("body").on("click",".magic-tag-init",function(a){var i=e(this),t=i.prev();t.focus().trigger("init.magic")}),e("body").on("keyup blur focus select click init.magic",".magic-tag-enabled",function(a){init_magic_tags();var i=e(this),t=i.parent(),r=t.closest(".wrapper-instance-pane").find(".caldera-select-field-type").val()?t.closest(".wrapper-instance-pane").find(".caldera-select-field-type").val():"hidden",o=t.find(".magic-tags-autocomplete"),l=o.find("ul"),n=this.value,d=[],s="",c=this.selectionStart,p=this.selectionEnd;if(o.length&&o.data("focus"))return void a.preventDefault();if(i.data("tag",""),this.selectionEnd>this.selectionStart)s=this.value.substr(this.selectionStart,this.selectionEnd-this.selectionStart);else if(("select"===a.type||"keyup"===a.type)&&40!==a.which&&38!==a.which&&39!==a.which&&37!==a.which){for(c=this.selectionStart;c>0;c--){var u=n.substr(c-1,1);if(" "===u||"\n"===u||("%"===u||"}"===u)&&this.selectionStart===c)break}for(p=this.selectionStart;p<n.length;p++){var u=n.substr(p,1);if(" "===u||"\n"===u||("%"===u||"{"===u)&&this.selectionStart===p)break}s=n.substr(c,p-c)}if("focusout"!==a.type){if("init"!==a.type&&s.length<3)return void(o.length&&o.remove());o.length||(o=e('<div class="magic-tags-autocomplete"></div>'),l=e("<ul></ul>"),l.appendTo(o),o.insertAfter(i),o.on("mouseenter",function(){e(this).data("focus",!0)}),o.on("mouseleave",function(){e(this).data("focus",!1),i.is(":focus")||i.trigger("focusout")})),l.empty();var f="system",g=!1;"hidden"===r||"dropdown"===r||"radio"===r||"toggle_switch"===r||"checkbox"===r?(g=!0,r="text",f="all"):("paragraph"===r||"html"===r)&&(r="text"),i.data("type")&&(r=i.data("type")),r=r.split(","),r.push("vars");for(var v=0;v<r.length;v++)for(var h in system_values)if("undefined"!=typeof system_values[h].tags[r[v]]){if(d=[h],"system"!==h&&"variable"!==h&&"field"!==h){var m=jQuery(".processor-"+h),_=i.closest(".caldera-editor-processor-config-wrapper"),y=_.prop("id");d=[];for(var b=0;b<m.length;b++)if(_.length||g!==!0){if(y===m[b].id)continue;jQuery("li."+m[b].id).index()<jQuery("li."+y).index()&&d.push(m[b].id)}else d.push(m[b].id)}for(var w=0;w<d.length;w++)if("all"===f||f===h||"variable"===h){var k=e('<li class="header">'+system_values[h].type+(w>0?" ["+(w+1)+"]":"")+"</li>"),j=0;k.appendTo(l);for(var C=0;C<system_values[h].tags[r[v]].length;C++)if(!i.data("parent")||"variable:"+i.data("parent")!==system_values[h].tags[r[v]][C]){var x=system_values[h].wrap[0]+system_values[h].tags[r[v]][C]+system_values[h].wrap[1];if(d[w]!==h&&d.length>1&&(x=system_values[h].wrap[0]+system_values[h].tags[r[v]][C]+":"+d[w]+system_values[h].wrap[1]),x.indexOf(s)>=0||"init"===a.type){j+=1;var Q=x.replace(s,"<strong>"+s+"</strong>"),q=e('<li class="tag" data-tag="'+x+'">'+Q+"</li>");q.on("click",function(){var a=e(this).data("tag");i.val(n.substr(0,c)+a+n.substr(p)).trigger("change").focus(),i[0].selectionStart=c+a.length-(a.indexOf("*")>0?2:0),i[0].selectionEnd=c+a.length-(a.indexOf("*")>0?1:0)}),q.appendTo(l)}}0===j&&k.remove()}}}l.children().length||o.remove(),"focusout"===a.type&&setTimeout(function(){o.remove()},200)});for(var r=e(".cf-editor-template"),o=0;o<r.length;o++)compiled_templates[r[o].id]=Handlebars.compile(r[o].innerHTML);e(".caldera-select-field-type").not(".field-initialized").each(function(e,i){a(i)})});var rebuild_field_binding,rebind_field_bindings,current_form_fields={},required_errors={},add_new_grid_page,add_page_grid,init_magic_tags,core_form,compiled_templates={};init_magic_tags=function(){var e=jQuery(".magic-tag-enabled");e.each(function(e,a){var i=jQuery(a);if(i.hasClass("magic-tag-init-bound")){var t=i.parent().find(".magic-tag-init");return void(i.is(":visible")?t.show():t.hide())}var r=jQuery('<span class="icn-code magic-tag-init"></span>'),o=jQuery('<span style="position:relative;display:inline-block; width:100%;"></span>');i.is("input")&&r.css("borderBottom","none"),i.hasClass("caldera-conditional-value-field")&&o.width("auto"),i.wrap(o),r.insertAfter(i),i.addClass("magic-tag-init-bound"),i.is(":visible")?r.show():r.hide()})},rebuild_field_binding=function(){if(core_form||(core_form=jQuery(".caldera-forms-options-form")),core_form.hasClass("builder-loaded")){var e=jQuery(".caldera-editor-field-config-wrapper");system_values.field={tags:{text:[]},type:"Fields",wrap:["%","%"]};for(var a=0;a<e.length;a++){var i=e[a].id,t=jQuery("#"+i+"_lable").val(),r=jQuery("#"+i+"_slug").val(),o=jQuery("#"+i+"_type").val();"undefined"==typeof system_values.field.tags[o]&&(system_values.field.tags[o]=[]),system_values.field.tags[o].push(r),"text"!==o&&system_values.field.tags.text.push(r),current_form_fields[i]={label:t,slug:r,type:o},jQuery("option.bound-field").trigger("change").each(function(e,a){var i=jQuery(a);0!==i.prop("value").indexOf("{")?i.text(jQuery("#"+i.prop("value")+"_lable").val()+" ["+jQuery("#"+i.prop("value")+"_lable").val()+"]"):i.text(i.prop("value").replace("{","").replace("}",""))}).removeClass("bound-field")}}},rebind_field_bindings=function(){var e,a,i=jQuery(".caldera-field-bind").not(".bound_field");if(i.length){i.addClass("bound_field");for(var t=0;t<i.length;t++){var r=jQuery(i[t]),o=r.val(),l=r.data("default"),n=r.data("exclude"),d=0,s=r.closest(".caldera-editor-processor-config-wrapper"),c=s.prop("id"),p="";if(l&&!r.hasClass("reload-binding")&&(o=l),r.is("select")){r.empty();var u=jQuery('<optgroup label="Fields">');for(var f in current_form_fields)r.data("type")&&r.data("type").split(",").indexOf(current_form_fields[f].type)<0||(r.data("id")!==f&&u.append('<option value="'+f+'"'+(o===f?'selected="selected"':"")+">"+current_form_fields[f].label+" ["+current_form_fields[f].slug+"]</option>"),d+=1);u.appendTo(r),0===d&&r.empty();for(var g in system_values)if(e=[],!(n&&n.split(",").indexOf(g)>=0)){if("system"!==g&&"variable"!==g)for(var v=jQuery(".processor-"+g),h=0;h<v.length;h++)c!==v[h].id&&(e.push(v[h].id),v.length>1&&(a=jQuery("li."+v[h].id+" .processor-line-number"))&&a.html("["+(h+1)+"]"));else e.push("__system__");var m=[];r.data("type")?(m=r.data("type").split(","),m.push("vars")):m=["text","vars"];for(var _=0;_<m.length;_++)if(system_values[g].tags[m[_]])for(var y=0;y<e.length;y++){jQuery("li."+e[y]).index()>jQuery("li."+c).index()&&"__system__"!==e[y]?r.closest(".caldera-editor-processors-panel-wrap").length&&(p=' disabled="disabled"'):p="";for(var u=jQuery('<optgroup label="'+system_values[g].type+("__system__"!==e[y]?" "+jQuery("li."+e[y]).find(".processor-line-number").html():"")+'"'+p+">"),b=0;b<system_values[g].tags[m[_]].length;b++){var w=system_values[g].tags[m[_]][b];"__system__"!==e[y]&&(w=w.replace(g,e[y])),u.append('<option value="{'+w+'}"'+(o==="{"+w+"}"?'selected="selected"':"")+p+">"+system_values[g].tags[m[_]][b]+"</option>"),d+=1}u.children().length&&u.appendTo(r)}}if(0===d){if(r.empty(),r.data("type")){r.append('<option value="">No '+r.data("type").split(",").join(" or ")+" in form</option>");var k=!0}}else r.prop("disabled",!1);r.hasClass("required")||"undefined"!=typeof k||r.prepend('<option value=""></option>'),r.val(o)}}init_magic_tags(),jQuery(document).trigger("bound.fields"),jQuery(".caldera-header-save-button").prop("disabled",!1)}},jQuery(document).ready(function(e){function a(){var a=e(".layout-grid-panel"),i=0;a.each(function(a,t){var r=e(t),o=r.find(".layout-structure"),l=r.find(".row"),n=[];l.each(function(a,t){var r=e(t),o=r.children().not(".column-merge"),l=[];i+=1,o.each(function(a,t){span=e(t).attr("class").split("-"),l.push(span[2]);var r=e(t).find(".field-location");r.length&&r.each(function(t,r){var o=e(r);o.val(i+":"+(a+1)).removeAttr("disabled")})}),n.push(l.join(":"))}),o.val(n.join("|"))})}function i(a,i,r){var o,l,n="fld_"+Math.round(1e7*Math.random()),d=n,s=e("#field_config_panels");if(r){var c=e("#"+r).clone().wrap("<div>").parent().html().replace(new RegExp(r,"g"),"{{id}}");o=Handlebars.compile(c)}else o=Handlebars.compile(e("#caldera_field_config_wrapper_templ").html());l={id:d,label:"",slug:""},s.append(o(l)),a.removeClass("button-small").removeClass("button").removeClass("button-primary").removeClass("ui-draggable").removeClass("layout-new-form-field").addClass("layout-form-field").attr("data-config",n),a.find(".layout_field_name").remove(),a.find(".field-location").prop("name","config[layout_grid][fields]["+n+"]"),a.find(".settings-panel").show(),a.appendTo(i),t(),a.find(".icon-edit").trigger("click"),e("#"+n+"_lable").focus().select(),r&&(s.find(".field_config_string").val(""),s.find(".field-label").trigger("change")),rebuild_field_binding(),baldrickTriggers(),e("#"+n).trigger("field.drop"),e(document).trigger("field.added")}function t(){e(".toggle-options").sortable({handle:".dashicons-sort"}),e("#grid-pages-panel").sortable({placeholder:"row-drop-helper",handle:".sort-handle",items:".first-row-level",axis:"y",stop:function(){a()}}),e(".layout-column").sortable({connectWith:".layout-column",appendTo:"#grid-pages-panel",helper:"clone",items:".layout-form-field",handle:".drag-handle",cursor:"move",opacity:.7,cursorAt:{left:100,top:15},start:function(e,a){a.helper.css({width:"200px",height:"35px",paddingTop:"20px"})},stop:function(e,i){i.item.removeAttr("style"),a()}}),e("h3 .layout-new-form-field").draggable({helper:"clone",appendTo:"body"}),e(".page-toggle.button").droppable({accept:".layout-form-field",over:function(a,i){e(this).trigger("click"),e(".layout-column").sortable("refresh")}}),e(".layout-column").droppable({greedy:!0,activeClass:"ui-state-dropper",hoverClass:"ui-state-hoverable",accept:".layout-new-form-field",drop:function(a,t){var r=t.draggable.clone(),o=e(this);i(r,o)}}),a()}add_new_grid_page=function(e){return{page_no:"pg_"+Math.round(1e7*Math.random())}},add_page_grid=function(a){var i=e(".page-toggle").length+1,r=e('<button type="button" data-name="Page '+i+'" data-page="'+a.rawData.page_no+'" class="page-toggle button">'+a.params.trigger.data("addtitle")+" "+i+"</button> "),o=e("#page-toggles");r.appendTo(o),o.show(),t(),r.trigger("click"),1===i&&o.hide(),e(document).trigger("add.page")},e(document).on("remove.page add.page load.page",function(a){var i=e(".page-toggle").length,t=e("#tab_pages");1>=i?t.hide():t.show()}),t(),e("#grid-pages-panel").on("click",".column-fieldinsert .dashicons-plus-alt",function(a){var t=e(this).closest(".column-container"),r=e("#newfield-tool").clone();i(r,t)}),e("#grid-pages-panel").on("click",".column-fieldinsert .dashicons-admin-generic",function(e){}),e("#grid-pages-panel").on("click",".column-split",function(a){var i=e(this).parent().parent(),r=i.attr("class").split("-"),o=e("<div>").insertAfter(i),l=Math.ceil(r[2]/2),n=Math.floor(r[2]/2);r[2]=l,i.attr("class",r.join("-")),r[2]=n,o.addClass(r.join("-")).append('<div class="layout-column column-container">'),e(this).remove(),t(),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),e("#grid-pages-panel").on("click",".column-remove",function(i){var t=e(this).closest(".row"),r=t.find(".layout-form-field"),o=t.closest(".layout-grid-panel");if(r.length){if(!confirm(e("#row-remove-fields-message").text()))return;r.each(function(a,i){var t=e(i).data("config");e("#"+t).remove(),e('option[value="'+t+'"]').remove(),e('[data-bind="'+t+'"]').remove(),delete current_form_fields[t]})}t.slideUp(200,function(){if(e(this).remove(),a(),rebuild_field_binding(),!o.find(".row").length){o.remove();var i=e("#page-toggles .button-primary"),t=i.prev(),r=i.next();i.remove(),t.length?t.trigger("click"):r.trigger("click")}e(document).trigger("remove.page")}),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),e(".caldera-config-editor-main-panel").on("click",".caldera-add-row",function(i){i.preventDefault();var r=e(".page-active");if(!r.length)return void e(".caldera-add-page").trigger("click");var o=e('<div style="display:none;" class="first-row-level row"><div class="col-xs-12"><div class="layout-column column-container"></div></div></div>');e(".page-active").append(o),o.slideDown(200),t(),a()}),e("#grid-pages-panel").on("click",".column-join",function(i){var t=e(this).parent().parent().parent(),r=t.prev(),o=r.attr("class").split("-"),l=t.attr("class").split("-");o[2]=parseFloat(o[2])+parseFloat(l[2]),t.find(".layout-column").contents().appendTo(r.find(".layout-column")),r.attr("class",o.join("-")),t.remove(),a(),jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),e("#grid-pages-panel").on("mouseenter",".row",function(i){var t=jQuery(this);jQuery(".column-tools,.column-merge").remove(),t.children().children().first().append('<div class="column-remove column-tools"><i class="icon-remove"></i></div>'),t.children().children().last().append('<div class="column-sort column-tools" style="text-align:right;"><i class="dashicons dashicons-menu drag-handle sort-handle"></i></div>'),t.children().children().not(":first").prepend('<div class="column-merge"><div class="column-join column-tools"><i class="icon-join"></i></div></div>');var r=t.parent().parent().parent().width()/12-1;t.children().children().each(function(a,i){var t=e(i),r=t.width()/2-5;t.prepend('<div class="column-fieldinsert column-tools"><i class="dashicons dashicons-plus-alt"></i></div>'),t.parent().hasClass("col-xs-1")||(t.prepend('<div class="column-split column-tools"><i class="dashicons dashicons-leftright"></i></div>'),t.find(".column-split").css("left",r))}),jQuery(".column-merge").draggable({axis:"x",helper:"clone",appendTo:t,grid:[r,0],drag:function(i,t){e(this).addClass("dragging"),e(".column-tools").remove(),e(".column-split").remove();var r=e(this).parent().parent(),o=t.helper,l=t.originalPosition.left>o.position().left?"left":"right",n=r.prev(),d=Math.round(r.parent().width()/12-10),s=Math.abs(t.originalPosition.left-o.position().left);if(r.parent().addClass("sizing"),s>=d){var c=n.attr("class").split("-"),p=r.attr("class").split("-");
|
| 2 |
+
c[2]=parseFloat(c[2]),p[2]=parseFloat(p[2]),"left"===l?(c[2]--,p[2]++,c[2]>0&&c[2]<c[2]+p[2]?(n.attr("class",c.join("-")),r.attr("class",p.join("-")),t.originalPosition.left=o.position().left):e(this).draggable("option","disabled",!0)):(c[2]++,p[2]--,p[2]>0&&p[2]<p[2]+p[2]?(n.attr("class",c.join("-")),r.attr("class",p.join("-")),t.originalPosition.left=o.position().left):e(this).draggable("option","disabled",!0)),a()}},stop:function(){e(this).removeClass("dragging").parent().parent().parent().removeClass("sizing")}})}),e("#grid-pages-panel").on("mouseleave",".row",function(e){jQuery(".column-tools").remove(),jQuery(".column-merge").remove()}),e("#grid-pages-panel").on("click",".layout-form-field .icon-remove",function(){var a=e(this),i=a.parent(),t=e("#"+i.data("config"));i.slideUp(100,function(){e(this).remove()}),t.slideUp(100,function(){e(this).remove()})}),e("#grid-pages-panel").on("click",".layout-form-field .icon-edit",function(){var a=e(this),i=a.parent(),t=e("#"+i.data("config")+"_type").val();e(".caldera-editor-field-config-wrapper").hide(),i.hasClass("field-edit-open")?i.removeClass("field-edit-open"):(e(".layout-form-field").removeClass("field-edit-open"),i.addClass("field-edit-open"),e("#"+i.data("config")).show()),e(document).trigger("show."+i.data("config")),e(document).trigger("show.fieldedit"),("radio"===t||"checkbox"===t||"dropdown"===t||"toggle_switch"===t)&&e("#"+i.data("config")+"_auto").trigger("change")}),e("body").on("click",".layout-modal-edit-closer,.layout-modal-save-action",function(a){a.preventDefault();var i=e(this),t=e(".layout-form-field.edit-open"),r=i.closest(".layout-modal-container");settings=r.find(".settings-panel").first(),e(".edit-open").removeClass("edit-open"),settings.appendTo(t.find(".settings-wrapper")).hide(),r.hide()}),e(".layout-editor-body").on("change",".layout-core-pod-query",function(){e(this).parent().find(".settings-panel-row").remove(),e(".edit-open").find(".drag-handle .set-pod").html(" - "+e(this).val())}),e(".layout-editor-body").on("click",".remove-where",function(){e(this).closest(".settings-panel-row").remove()}),e(".layout-editor-body").on("click",".use-pod-container",function(){var a=e(this),i=a.prev(),t=i.val();if(t.length){e(".edit-open").find(".drag-handle .set-pod").html(" - "+i.val()),a.parent().parent().find(".spinner").css("display","inline-block");var r={action:"pq_loadpod",pod_reference:{pod:t}};e.post(ajaxurl,r,function(i){a.parent().find(".spinner").css("display","none");var t=e("#where-line-tmpl").html(),r="",o=a.closest(".settings-panel").data("container");for(var l in i)r+='<option value="'+i[l]+'">'+i[l]+"</option>";t=t.replace(/{{fields}}/g,r).replace(/{{container_id}}/g,o),a.parent().append(t)})}}),e(".caldera-editor-header").on("click",".column-sort .icon-edit",function(e){}),e(".layout-editor-body").on("tray_loaded",".layout-template-tray",function(){t()}),e(".caldera-editor-header").on("click",".caldera-editor-header-nav a",function(a){a.preventDefault();var i=e(this);e(".caldera-editor-header-nav li").removeClass("active"),e(".caldera-editor-body").hide(),e(i.attr("href")).show(),i.parent().addClass("active"),rebind_field_bindings()}),e("body").on("change",".required",function(){check_required_bindings(this)}),e("body").on("submit",".caldera-forms-options-form",function(a){var i=e(".required.has-error");i.length&&a.preventDefault()}),e(".caldera-editor-body").on("click",".add-toggle-option",function(a){var i=e(this);if(i.data("bulk"))return e(i.data("bulk")).toggle(),void e(i.data("bulk")).find("textarea").focus();var t=i.closest(".caldera-editor-field-config-wrapper"),r=t.find(".toggle-options"),o=e("#field-option-row-tmpl").html(),l=Handlebars.compile(o),n="opt"+parseInt(1048576*(Math.random()+1)),d={_name:"config[fields]["+t.prop("id")+"][config]",option:{}};if(i.data("options")){for(var s=e(i.data("options")),c=s.val().split("\n"),p=0;p<c.length;p++)d.option["opt"+parseInt(1048576*(Math.random()+p))]={value:c[p],label:c[p],"default":!1};e(i.data("options")).parent().hide(),s.val(""),r.empty()}else d.option[n]={value:"",label:"","default":!1};r.append(l(d)),t.find(".toggle_show_values").trigger("change"),e(".toggle-options").sortable({handle:".dashicons-sort"}),c||r.find(".toggle_label_field").last().focus()}),e(".caldera-editor-body").on("click",".toggle-remove-option",function(a){var i=e(this).closest(".caldera-editor-field-config-wrapper").find(".field-config").first();e(this).parent().remove(),i.trigger("change")}),e(".caldera-editor-body").on("click",".page-toggle",function(a){var i=e(this),t=i.parent(),r=t.find(".button");r.removeClass("button-primary"),e(".layout-grid-panel").hide().removeClass("page-active"),e("#"+i.data("page")).show().addClass("page-active"),i.addClass("button-primary"),r.each(function(a,i){e(i).html(t.data("title")+" "+(a+1))}),1===r.length&&t.hide()}),e(".caldera-editor-body").on("blur toggle.values",".toggle_label_field",function(a){var i=e(this),t=i.prev();t.val().length||t.val(i.val())}),rebuild_field_binding(),e(document).trigger("load.page")}),Handlebars.registerHelper("_options_config",function(){}),jQuery(document).ready(function(e){function a(){e(".caldera-editor-processors-panel ul").sortable({update:function(){rebuild_field_binding()}})}function i(a){var i=e(a),t=e("#"+i.val()+"-tmpl").length?e("#"+i.val()+"-tmpl").html():"",r=i.closest(".caldera-editor-processor-config-wrapper"),o=r.find(".caldera-config-processor-setup"),l=Handlebars.compile(t),n=r.find(".processor_config_string").val(),d=i.data("type");n=n.length&&d===i.val()?JSON.parse(n):processor_defaults[i.val()+"_cfg"],n||(n={}),n._id=r.prop("id"),n._name="config[processors]["+r.prop("id")+"][config]",l=e("<div>").html(l(n)),o.html(l.html()),"function"==typeof window[i.val()+"_init"]&&window[i.val()+"_init"](r.prop("id"),o),r.find(".no-conditions").length&&r.find(".toggle_option_tab").remove(),rebuild_field_binding(),baldrickTriggers(),e(".wp-baldrick").baldrick({request:ajaxurl,method:"POST",before:function(a){var i=e(a);i.data("addNode")&&!i.data("request")&&i.data("request","cf_get_default_setting")}})}e("body").on("click",".caldera-processor-nav a",function(a){a.preventDefault();var i=e(this);e(".caldera-processor-nav").removeClass("active"),e(".caldera-editor-processor-config-wrapper").hide(),e(i.attr("href")).show(),i.parent().addClass("active")}),e("body").on("click",".add-new-processor",function(i){var t=e(this),r=Handlebars.compile(e("#processor-wrapper-tmpl").html());wrap=e(".active-processors-list"),process_conf=e(".caldera-editor-processor-config"),processid=Math.round(1e8*Math.random()),new_templ=Handlebars.compile(e("#processor-line-tmpl").html()),new_proc={id:"fp_"+processid,type:t.data("type")},wrap.append(new_templ(new_proc)),process_conf.append(r(new_proc)),e("#form_processor_baldrickModalCloser").trigger("click"),e(".caldera-processor-nav a").last().trigger("click"),e("#fp_"+processid+"_type").val(t.data("type")).trigger("change"),a(),baldrickTriggers()}),e("body").on("click",".delete-processor",function(a){var i=e(this),t=i.closest(".caldera-editor-processor-config-wrapper");t.data("type");confirm(i.data("confirm"))&&(e("."+t.prop("id")).remove(),t.remove(),e(".caldera-processor-nav a").first().trigger("click"),rebuild_field_binding())}),e("body").on("change",".caldera-select-processor-type",function(a){var t=e(this),r=t.closest(".caldera-editor-processor-config-wrapper"),o=t.find('option[value="'+t.val()+'"]').text(),l=r.find(".caldera-editor-processor-title"),n=e(".caldera-processor-nav.active a");""===o&&(o=l.data("title")),l.html(o),n.html(o+' <span class="processor-line-number"></span>').parent().addClass("processor_type_"+t.val()),i(this),rebuild_field_binding()}),rebuild_field_binding(),e(".caldera-select-processor-type").each(function(e,a){i(a)}),a()}),Handlebars.registerHelper("_field",function(e){var a=this,i="",t="",r="",o=this[e.hash.slug]?' data-default="'+this[e.hash.slug]+'"':"";e.hash.required&&(i=" required"),e.hash.exclude&&(r='data-exclude="'+e.hash.exclude+'"'),e.hash.array&&(t="[]","true"!==e.hash.array&&(o='value="'+e.hash.array+'"')),out="<select "+(e.hash.type?'data-type="'+e.hash.type+'"':"")+o+" "+r+' name="'+this._name+"["+e.hash.slug+"]"+t+'" id="'+this._id+"_"+e.hash.slug+'" class="block-input field-config caldera-field-bind'+i+'">',this[e.hash.slug]?out+='<option class="bound-field" value="'+this[e.hash.slug]+'" class="bound-field"></option>':e.hash.required||(out+='<option value=""></option>');for(var l in current_form_fields){var n="";e.hash.type&¤t_form_fields[l].type!==e.hash.type||(a[e.hash.slug]&&a[e.hash.slug]===l&&(n=' selected="selected"'),out+='<option value="'+l+'"'+n+">"+current_form_fields[l].label+" ["+current_form_fields[l].slug+"]</option>")}return out+="</select>",e.hash.required&&(out+='<input class="field-config" name="'+this._name+'[_required_bounds][]" type="hidden" value="'+e.hash.slug+'">'),out}),Handlebars.registerHelper("console",function(e,a){console.log(this)});
|
assets/js/frontend-script-init.js
CHANGED
|
@@ -1,12 +1,19 @@
|
|
|
|
|
| 1 |
(function($){
|
| 2 |
-
|
| 3 |
-
|
|
|
|
| 4 |
jQuery('.init_field_type[data-type]').each(function(k,v){
|
| 5 |
var ftype = jQuery(v);
|
| 6 |
if( typeof window[ftype.data('type') + '_init'] === 'function' ){
|
| 7 |
window[ftype.data('type') + '_init'](ftype.prop('id'), ftype[0]);
|
| 8 |
}
|
| 9 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 10 |
});
|
| 11 |
// modals activation
|
| 12 |
jQuery(document).on('click', '.cf_modal_button', function(e){
|
|
@@ -19,6 +26,9 @@
|
|
| 19 |
var clicked = jQuery(this);
|
| 20 |
clicked.closest('.caldera-front-modal-container').hide();
|
| 21 |
});
|
|
|
|
|
|
|
|
|
|
| 22 |
// Page navigation
|
| 23 |
jQuery(document).on('click', '[data-page]', function(e){
|
| 24 |
|
| 1 |
+
var cf_jsfields_init;
|
| 2 |
(function($){
|
| 3 |
+
|
| 4 |
+
// make init function
|
| 5 |
+
cf_jsfields_init = function(){
|
| 6 |
jQuery('.init_field_type[data-type]').each(function(k,v){
|
| 7 |
var ftype = jQuery(v);
|
| 8 |
if( typeof window[ftype.data('type') + '_init'] === 'function' ){
|
| 9 |
window[ftype.data('type') + '_init'](ftype.prop('id'), ftype[0]);
|
| 10 |
}
|
| 11 |
});
|
| 12 |
+
};
|
| 13 |
+
|
| 14 |
+
jQuery('document').ready(function(){
|
| 15 |
+
// check for init function
|
| 16 |
+
cf_jsfields_init();
|
| 17 |
});
|
| 18 |
// modals activation
|
| 19 |
jQuery(document).on('click', '.cf_modal_button', function(e){
|
| 26 |
var clicked = jQuery(this);
|
| 27 |
clicked.closest('.caldera-front-modal-container').hide();
|
| 28 |
});
|
| 29 |
+
// stuff trigger
|
| 30 |
+
jQuery(document).on('cf.add cf.enable cf.disable cf.pagenav', cf_jsfields_init );
|
| 31 |
+
|
| 32 |
// Page navigation
|
| 33 |
jQuery(document).on('click', '[data-page]', function(e){
|
| 34 |
|
assets/js/frontend-script-init.min.js
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
|
| 1 |
+
var cf_jsfields_init;!function(a){cf_jsfields_init=function(){jQuery(".init_field_type[data-type]").each(function(a,e){var r=jQuery(e);"function"==typeof window[r.data("type")+"_init"]&&window[r.data("type")+"_init"](r.prop("id"),r[0])})},jQuery("document").ready(function(){cf_jsfields_init()}),jQuery(document).on("click",".cf_modal_button",function(a){a.preventDefault();var e=jQuery(this);jQuery(e.attr("href")).show()}),jQuery(document).on("click",".caldera-front-modal-closer",function(a){a.preventDefault();var e=jQuery(this);e.closest(".caldera-front-modal-container").hide()}),jQuery(document).on("cf.add cf.enable cf.disable cf.pagenav",cf_jsfields_init),jQuery(document).on("click","[data-page]",function(e){var r,t,d,i=jQuery(this),n=i.closest(".caldera-form-page"),f=i.closest(".caldera-grid"),o=n.data("formpage"),c=jQuery('.breadcrumb[data-form="'+f.prop("id")+'"]'),l={};if(f.length){i.data("pagenav")?(d=jQuery("#"+i.data("pagenav")+" .caldera-form-page").find("[data-field]"),f=i.closest(".caldera_forms_form")):d=f.find(".caldera-form-page:visible").find("[data-field]");for(var u=0;u<d.length;u++)if(jQuery(d[u]).is(":radio,:checkbox")){if(!a(d[u]).hasClass("option-required"))continue;l[a(d[u]).data("field")]||(l[a(d[u]).data("field")]=[]),l[a(d[u]).data("field")].push(a(d[u]).prop("checked"))}else if(jQuery(d[u]).prop("required")){if(!d[u].value.length)return e.preventDefault(),void f.find('[type="submit"]').trigger("click");if("email"===d[u].type&&(d[u].value.indexOf("@")<0||d[u].value.length<=d[u].value.indexOf("@")+1))return e.preventDefault(),void f.find('[type="submit"]').trigger("click")}for(var p in l){if(l[p].indexOf(!0)<0)return a('[for="'+p+'"]').parent().addClass("has-error"),!1;a('[for="'+p+'"]').parent().removeClass("has-error")}"next"===i.data("page")?(c&&c.find("li.active").removeClass("active"),r=f.find('.caldera-form-page[data-formpage="'+(o+1)+'"]'),r.length&&(n.hide(),r.show(),c&&c.find('a[data-page="'+(o+1)+'"]').parent().addClass("active"))):"prev"===i.data("page")?(c&&c.find("li.active").removeClass("active"),t=f.find('.caldera-form-page[data-formpage="'+(o-1)+'"]'),t.length&&(n.hide(),t.show(),c&&c.find('a[data-page="'+(o-1)+'"]').parent().addClass("active"))):i.data("pagenav")&&(e.preventDefault(),i.closest(".breadcrumb").find("li.active").removeClass("active"),jQuery("#"+i.data("pagenav")+" .caldera-form-page").hide(),jQuery("#"+i.data("pagenav")+' .caldera-form-page[data-formpage="'+i.data("page")+'"]').show(),i.parent().addClass("active")),jQuery("html, body").animate({scrollTop:f.offset().top-100},200),jQuery(document).trigger("cf.pagenav")}});var e;jQuery(".caldera-grid .breadcrumb").each(function(a,r){jQuery(r).find("a[data-pagenav]").each(function(a,r){var t=jQuery(r),d=t.data("pagenav"),i=jQuery("#"+d+' .caldera-form-page[data-formpage="'+t.data("page")+'"]');i.find(".has-error").length&&(t.parent().addClass("error"),"undefined"==typeof e&&(t.trigger("click"),e=!0))})})}(jQuery);
|
assets/js/wp-baldrick-full.js
CHANGED
|
@@ -3830,32 +3830,23 @@ var __module0__ = (function(__dependency1__, __dependency2__, __dependency3__, _
|
|
| 3830 |
}
|
| 3831 |
|
| 3832 |
$.fn.formJSON = function(){
|
| 3833 |
-
|
| 3834 |
var form = $(this);
|
| 3835 |
-
if( !form.is('form') ){
|
| 3836 |
-
form = $('<form>').append( form.clone() );
|
| 3837 |
-
}
|
| 3838 |
|
| 3839 |
-
var fields = form.
|
| 3840 |
json = {},
|
| 3841 |
arraynames = {};
|
| 3842 |
for( var v = 0; v < fields.length; v++){
|
| 3843 |
-
var field = fields[v],
|
| 3844 |
-
|
| 3845 |
-
|
| 3846 |
-
value = field.value,
|
| 3847 |
lineconf = {};
|
| 3848 |
|
| 3849 |
-
|
| 3850 |
-
|
| 3851 |
-
|
| 3852 |
-
field_el.removeClass('invalid');
|
| 3853 |
-
}else{
|
| 3854 |
-
field_el.focus().addClass('invalid');
|
| 3855 |
-
return false;
|
| 3856 |
}
|
| 3857 |
-
}
|
| 3858 |
-
|
| 3859 |
for(var i = name.length-1; i >= 0; i--){
|
| 3860 |
var nestname = name[i];
|
| 3861 |
if(nestname.length === 0){
|
|
@@ -3868,18 +3859,20 @@ var __module0__ = (function(__dependency1__, __dependency2__, __dependency3__, _
|
|
| 3868 |
nestname = arraynames[name[i-1]];
|
| 3869 |
}
|
| 3870 |
if(i === name.length-1){
|
| 3871 |
-
if( value
|
| 3872 |
-
value
|
| 3873 |
-
|
| 3874 |
-
value
|
| 3875 |
-
|
| 3876 |
-
value
|
| 3877 |
-
|
| 3878 |
-
|
| 3879 |
-
|
| 3880 |
-
|
| 3881 |
-
|
| 3882 |
-
|
|
|
|
|
|
|
| 3883 |
}
|
| 3884 |
}
|
| 3885 |
lineconf[nestname] = value;
|
|
@@ -4638,6 +4631,15 @@ var handlebarsVariables = {};
|
|
| 4638 |
title = modal.find('.baldrick-modal-title'),
|
| 4639 |
current_size = '';
|
| 4640 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4641 |
if( windowWidth <= 700 && windowWidth > 600 ){
|
| 4642 |
modalHeight = windowHeight - 30;
|
| 4643 |
modalWidth = windowWidth - 30;
|
|
@@ -4666,11 +4668,11 @@ var handlebarsVariables = {};
|
|
| 4666 |
// inject tabs
|
| 4667 |
var navtabs = obj.params.target.find('[data-tab]'),
|
| 4668 |
avatar = obj.params.target.find('.user-avatar');
|
| 4669 |
-
|
| 4670 |
if( navtabs.length ){
|
| 4671 |
var tabs = $('<ul>', { "class" : "navtabs" } ),
|
| 4672 |
hasSelection = false;
|
| 4673 |
-
|
| 4674 |
navtabs.each( function(k,v){
|
| 4675 |
var tab = $(this),
|
| 4676 |
element = $('<li>'),
|
|
@@ -4703,18 +4705,22 @@ var handlebarsVariables = {};
|
|
| 4703 |
}
|
| 4704 |
|
| 4705 |
tabs.css('top', obj.params.target.parent().find('.baldrick-modal-title').outerHeight() );
|
| 4706 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4707 |
|
| 4708 |
obj.params.target.before( tabs ).addClass('has-tabs');
|
| 4709 |
-
|
| 4710 |
if( avatar.length ){
|
| 4711 |
tabs.before( avatar );
|
| 4712 |
tabs.css('top', obj.params.target.parent().find('.baldrick-modal-title').outerHeight() + 149 );
|
| 4713 |
tabs.css('padding-top', 0 );
|
| 4714 |
}
|
| 4715 |
|
| 4716 |
-
}
|
| 4717 |
-
|
| 4718 |
},
|
| 4719 |
event : function(el, obj){
|
| 4720 |
var trigger = $(el), modal_id = 'wm';
|
|
@@ -4726,8 +4732,7 @@ var handlebarsVariables = {};
|
|
| 4726 |
$('.baldrick-modal-wrap').css('zIndex' , '100099');
|
| 4727 |
//wm_hasModal = true;
|
| 4728 |
// write out a template wrapper.
|
| 4729 |
-
var
|
| 4730 |
-
modal = $('<' + modal_element + '>', {
|
| 4731 |
id : modal_id + '_baldrickModal',
|
| 4732 |
tabIndex : -1,
|
| 4733 |
"ariaLabelled-by" : modal_id + '_baldrickModalLable',
|
| 3830 |
}
|
| 3831 |
|
| 3832 |
$.fn.formJSON = function(){
|
|
|
|
| 3833 |
var form = $(this);
|
|
|
|
|
|
|
|
|
|
| 3834 |
|
| 3835 |
+
var fields = form.find('[name]'),
|
| 3836 |
json = {},
|
| 3837 |
arraynames = {};
|
| 3838 |
for( var v = 0; v < fields.length; v++){
|
| 3839 |
+
var field = $( fields[v] ),
|
| 3840 |
+
name = field.prop('name').replace(/\]/gi,'').split('['),
|
| 3841 |
+
value = field.val(),
|
|
|
|
| 3842 |
lineconf = {};
|
| 3843 |
|
| 3844 |
+
if( field.is(':radio') || field.is(':checkbox') ){
|
| 3845 |
+
if( !field.is(':checked') ){
|
| 3846 |
+
continue;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3847 |
}
|
| 3848 |
+
}
|
| 3849 |
+
|
| 3850 |
for(var i = name.length-1; i >= 0; i--){
|
| 3851 |
var nestname = name[i];
|
| 3852 |
if(nestname.length === 0){
|
| 3859 |
nestname = arraynames[name[i-1]];
|
| 3860 |
}
|
| 3861 |
if(i === name.length-1){
|
| 3862 |
+
if( value ){
|
| 3863 |
+
if( value === 'true' ){
|
| 3864 |
+
value = true;
|
| 3865 |
+
}else if( value === 'false' ){
|
| 3866 |
+
value = false;
|
| 3867 |
+
}else if( !isNaN( parseFloat( value ) ) && parseFloat( value ).toString() === value ){
|
| 3868 |
+
value = parseFloat( value );
|
| 3869 |
+
}else if( value.substr(0,1) === '{' || value.substr(0,1) === '[' ){
|
| 3870 |
+
try {
|
| 3871 |
+
value = JSON.parse( value );
|
| 3872 |
+
|
| 3873 |
+
} catch (e) {
|
| 3874 |
+
//console.log( e );
|
| 3875 |
+
}
|
| 3876 |
}
|
| 3877 |
}
|
| 3878 |
lineconf[nestname] = value;
|
| 4631 |
title = modal.find('.baldrick-modal-title'),
|
| 4632 |
current_size = '';
|
| 4633 |
|
| 4634 |
+
if( modalHeight === 'auto' ){
|
| 4635 |
+
body.css( 'position', 'initial' );
|
| 4636 |
+
modalHeight = body.outerHeight() + footer.outerHeight() + title.outerHeight();
|
| 4637 |
+
body.css( 'position', '' );
|
| 4638 |
+
}
|
| 4639 |
+
if( modalWidth === 'auto' ){
|
| 4640 |
+
modalWidth = 450;
|
| 4641 |
+
}
|
| 4642 |
+
|
| 4643 |
if( windowWidth <= 700 && windowWidth > 600 ){
|
| 4644 |
modalHeight = windowHeight - 30;
|
| 4645 |
modalWidth = windowWidth - 30;
|
| 4668 |
// inject tabs
|
| 4669 |
var navtabs = obj.params.target.find('[data-tab]'),
|
| 4670 |
avatar = obj.params.target.find('.user-avatar');
|
| 4671 |
+
|
| 4672 |
if( navtabs.length ){
|
| 4673 |
var tabs = $('<ul>', { "class" : "navtabs" } ),
|
| 4674 |
hasSelection = false;
|
| 4675 |
+
|
| 4676 |
navtabs.each( function(k,v){
|
| 4677 |
var tab = $(this),
|
| 4678 |
element = $('<li>'),
|
| 4705 |
}
|
| 4706 |
|
| 4707 |
tabs.css('top', obj.params.target.parent().find('.baldrick-modal-title').outerHeight() );
|
| 4708 |
+
if( obj.params.trigger.data('modalButtons' ) ){
|
| 4709 |
+
tabs.css('bottom', obj.params.target.parent().find('.baldrick-modal-footer').outerHeight() );
|
| 4710 |
+
}else{
|
| 4711 |
+
tabs.css('bottom', 0 );
|
| 4712 |
+
}
|
| 4713 |
+
|
| 4714 |
|
| 4715 |
obj.params.target.before( tabs ).addClass('has-tabs');
|
| 4716 |
+
|
| 4717 |
if( avatar.length ){
|
| 4718 |
tabs.before( avatar );
|
| 4719 |
tabs.css('top', obj.params.target.parent().find('.baldrick-modal-title').outerHeight() + 149 );
|
| 4720 |
tabs.css('padding-top', 0 );
|
| 4721 |
}
|
| 4722 |
|
| 4723 |
+
}
|
|
|
|
| 4724 |
},
|
| 4725 |
event : function(el, obj){
|
| 4726 |
var trigger = $(el), modal_id = 'wm';
|
| 4732 |
$('.baldrick-modal-wrap').css('zIndex' , '100099');
|
| 4733 |
//wm_hasModal = true;
|
| 4734 |
// write out a template wrapper.
|
| 4735 |
+
var modal = $('<' + ( trigger.data('modalElement') ? trigger.data('modalElement') : 'form' ) + '>', {
|
|
|
|
| 4736 |
id : modal_id + '_baldrickModal',
|
| 4737 |
tabIndex : -1,
|
| 4738 |
"ariaLabelled-by" : modal_id + '_baldrickModalLable',
|
caldera-core.php
CHANGED
|
@@ -4,7 +4,7 @@
|
|
| 4 |
Plugin URI: http://digilab.co.za
|
| 5 |
Description: Easy to use, grid based responsive form builder for creating simple to complex forms.
|
| 6 |
Author: David Cramer
|
| 7 |
-
Version: 1.
|
| 8 |
Author URI: http://digilab.co.za
|
| 9 |
*/
|
| 10 |
|
|
@@ -17,7 +17,7 @@ if ( ! defined( 'WPINC' ) ) {
|
|
| 17 |
|
| 18 |
define('CFCORE_PATH', plugin_dir_path(__FILE__));
|
| 19 |
define('CFCORE_URL', plugin_dir_url(__FILE__));
|
| 20 |
-
define('CFCORE_VER', '1.
|
| 21 |
define('CFCORE_EXTEND_URL', 'https://api.calderaforms.com/1.0/');
|
| 22 |
|
| 23 |
include_once CFCORE_PATH . 'classes/core.php';
|
|
@@ -29,6 +29,8 @@ include_once CFCORE_PATH . 'includes/cf-ajax/plugin.php';
|
|
| 29 |
include_once CFCORE_PATH . 'includes/field_processors.php';
|
| 30 |
include_once CFCORE_PATH . 'includes/custom_field_class.php';
|
| 31 |
include_once CFCORE_PATH . 'includes/filter_addon_plugins.php';
|
|
|
|
|
|
|
| 32 |
|
| 33 |
// table builder
|
| 34 |
register_activation_hook( __FILE__, array( 'Caldera_Forms', 'activate_caldera_forms' ) );
|
|
@@ -43,3 +45,6 @@ if ( is_admin() || defined( 'DOING_AJAX' ) ) {
|
|
| 43 |
|
| 44 |
}
|
| 45 |
|
|
|
|
|
|
|
|
|
| 4 |
Plugin URI: http://digilab.co.za
|
| 5 |
Description: Easy to use, grid based responsive form builder for creating simple to complex forms.
|
| 6 |
Author: David Cramer
|
| 7 |
+
Version: 1.3.0
|
| 8 |
Author URI: http://digilab.co.za
|
| 9 |
*/
|
| 10 |
|
| 17 |
|
| 18 |
define('CFCORE_PATH', plugin_dir_path(__FILE__));
|
| 19 |
define('CFCORE_URL', plugin_dir_url(__FILE__));
|
| 20 |
+
define('CFCORE_VER', '1.3.0');
|
| 21 |
define('CFCORE_EXTEND_URL', 'https://api.calderaforms.com/1.0/');
|
| 22 |
|
| 23 |
include_once CFCORE_PATH . 'classes/core.php';
|
| 29 |
include_once CFCORE_PATH . 'includes/field_processors.php';
|
| 30 |
include_once CFCORE_PATH . 'includes/custom_field_class.php';
|
| 31 |
include_once CFCORE_PATH . 'includes/filter_addon_plugins.php';
|
| 32 |
+
include_once CFCORE_PATH . 'processors/classes/load.php';
|
| 33 |
+
include_once CFCORE_PATH . 'processors/classes/get_data.php';
|
| 34 |
|
| 35 |
// table builder
|
| 36 |
register_activation_hook( __FILE__, array( 'Caldera_Forms', 'activate_caldera_forms' ) );
|
| 45 |
|
| 46 |
}
|
| 47 |
|
| 48 |
+
if ( is_admin() ) {
|
| 49 |
+
require_once( CFCORE_PATH . 'processors/classes/ui.php' );
|
| 50 |
+
}
|
classes/Caldera_Forms_Save_Final.php
ADDED
|
@@ -0,0 +1,391 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Handles final saving of the form.
|
| 4 |
+
*
|
| 5 |
+
* @package Caldera_Forms
|
| 6 |
+
* @author Josh Pollock <Josh@CalderaWP.com>
|
| 7 |
+
* @license GPL-2.0+
|
| 8 |
+
* @link
|
| 9 |
+
* @copyright 2015 CalderaWP LLC
|
| 10 |
+
*/
|
| 11 |
+
class Caldera_Forms_Save_Final {
|
| 12 |
+
|
| 13 |
+
public static function determine_type( $form, $_cf_frm_edt ) {
|
| 14 |
+
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* Save form in database
|
| 19 |
+
*
|
| 20 |
+
* @since 1.2.3
|
| 21 |
+
*
|
| 22 |
+
* @param array $form Form config
|
| 23 |
+
* @param int|null $entryid Optional. ID of entry to send. If not provided, will be determined from current POST data '_entry_id' key.
|
| 24 |
+
*/
|
| 25 |
+
public static function save_in_db( $form, $entryid = null ) {
|
| 26 |
+
global $wpdb, $processed_meta;
|
| 27 |
+
if(!empty($form['db_support'])){
|
| 28 |
+
|
| 29 |
+
// new entry or update
|
| 30 |
+
if(empty($entryid)){
|
| 31 |
+
|
| 32 |
+
$entryid = Caldera_Forms::get_field_data( '_entry_id', $form );
|
| 33 |
+
|
| 34 |
+
foreach($form['fields'] as $field_id=>$field){
|
| 35 |
+
// add new and update
|
| 36 |
+
Caldera_Forms::save_field_data($field, $entryid, $form);
|
| 37 |
+
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
// save form meta if any
|
| 41 |
+
if(isset($processed_meta[$form['ID']])){
|
| 42 |
+
foreach($processed_meta[$form['ID']] as $process_id=>$meta_data){
|
| 43 |
+
|
| 44 |
+
foreach($meta_data as $meta_key=>$meta_value){
|
| 45 |
+
if(is_array($meta_value)){
|
| 46 |
+
foreach ($meta_value as &$check_value) {
|
| 47 |
+
if(is_array($check_value)){
|
| 48 |
+
foreach($check_value as &$sub_check_value){
|
| 49 |
+
if(!is_array($sub_check_value)){
|
| 50 |
+
$sub_check_value = Caldera_Forms::do_magic_tags( $sub_check_value );
|
| 51 |
+
}
|
| 52 |
+
}
|
| 53 |
+
}else{
|
| 54 |
+
$check_value = Caldera_Forms::do_magic_tags( $check_value );
|
| 55 |
+
}
|
| 56 |
+
}
|
| 57 |
+
}else{
|
| 58 |
+
$meta_value = Caldera_Forms::do_magic_tags( $meta_value );
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
if(count($meta_value) > 1){
|
| 63 |
+
$meta_value = json_encode($meta_value);
|
| 64 |
+
}else{
|
| 65 |
+
$meta_value = $meta_value[0];
|
| 66 |
+
if(is_array($meta_value) || is_object($meta_value)){
|
| 67 |
+
$meta_value = json_encode($meta_value);
|
| 68 |
+
}
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
$meta_entry = array(
|
| 72 |
+
'entry_id' => $entryid,
|
| 73 |
+
'process_id' => $process_id,
|
| 74 |
+
'meta_key' => $meta_key,
|
| 75 |
+
'meta_value' => $meta_value
|
| 76 |
+
);
|
| 77 |
+
|
| 78 |
+
$wpdb->insert($wpdb->prefix . 'cf_form_entry_meta', $meta_entry);
|
| 79 |
+
|
| 80 |
+
}
|
| 81 |
+
|
| 82 |
+
}
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
// update status
|
| 86 |
+
$wpdb->update($wpdb->prefix . 'cf_form_entries', array('status' => 'active'), array( 'id' => $entryid ) );
|
| 87 |
+
|
| 88 |
+
}else{
|
| 89 |
+
|
| 90 |
+
// do update
|
| 91 |
+
foreach($form['fields'] as $field_id=>$field){
|
| 92 |
+
// add new and update
|
| 93 |
+
Caldera_Forms::update_field_data($field, $entryid, $form);
|
| 94 |
+
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
if(isset($processed_meta[$form['ID']])){
|
| 98 |
+
foreach($processed_meta[$form['ID']] as $process_id=>$meta_data){
|
| 99 |
+
|
| 100 |
+
foreach($meta_data as $meta_key=>$meta_value){
|
| 101 |
+
|
| 102 |
+
if(count($meta_value) > 1){
|
| 103 |
+
$meta_value = json_encode($meta_value);
|
| 104 |
+
}else{
|
| 105 |
+
$meta_value = $meta_value[0];
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
$meta_entry = array(
|
| 109 |
+
'entry_id' => $entryid,
|
| 110 |
+
'process_id' => $process_id,
|
| 111 |
+
'meta_key' => $meta_key,
|
| 112 |
+
'meta_value' => $meta_value
|
| 113 |
+
);
|
| 114 |
+
$wpdb->insert($wpdb->prefix . 'cf_form_entry_meta', $meta_entry);
|
| 115 |
+
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
}
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
// return
|
| 122 |
+
return;
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
/**
|
| 130 |
+
* Process mailer
|
| 131 |
+
*
|
| 132 |
+
* @since 1.2.3
|
| 133 |
+
*
|
| 134 |
+
* @param array $form Form config
|
| 135 |
+
* @param int|null $entryid Optional. ID of entry to send. If not provided, will be deteremined based on global $transdata
|
| 136 |
+
* @param array|null $data Optional. Data to use for sending. If not provided, will be retrieved by form ID.
|
| 137 |
+
*/
|
| 138 |
+
public static function do_mailer( $form, $entryid = null, $data = null ) {
|
| 139 |
+
global $transdata;
|
| 140 |
+
|
| 141 |
+
if ( ! $data ) {
|
| 142 |
+
$data = Caldera_Forms::get_submission_data($form);
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
// add entry ID to transient data
|
| 146 |
+
if( ! isset( $entryid ) ){
|
| 147 |
+
$entryid = null;
|
| 148 |
+
}
|
| 149 |
+
$transdata['entry_id'] = $entryid;
|
| 150 |
+
|
| 151 |
+
// do mailer!
|
| 152 |
+
$sendername = __('Caldera Forms Notification', 'caldera-forms');
|
| 153 |
+
if(!empty($form['mailer']['sender_name'])){
|
| 154 |
+
$sendername = $form['mailer']['sender_name'];
|
| 155 |
+
if( false !== strpos($sendername, '%')){
|
| 156 |
+
$isname = Caldera_Forms::get_slug_data( trim($sendername, '%'), $form);
|
| 157 |
+
if(!empty( $isname )){
|
| 158 |
+
$sendername = $isname;
|
| 159 |
+
}
|
| 160 |
+
}
|
| 161 |
+
}
|
| 162 |
+
if(empty($form['mailer']['sender_email'])){
|
| 163 |
+
$sendermail = get_option( 'admin_email' );
|
| 164 |
+
}else{
|
| 165 |
+
$sendermail = $form['mailer']['sender_email'];
|
| 166 |
+
if( false !== strpos($sendermail, '%')){
|
| 167 |
+
$ismail = Caldera_Forms::get_slug_data( trim($sendermail, '%'), $form);
|
| 168 |
+
if(is_email( $ismail )){
|
| 169 |
+
$sendermail = $ismail;
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
}
|
| 173 |
+
// use summary
|
| 174 |
+
if(empty($form['mailer']['email_message'])){
|
| 175 |
+
$form['mailer']['email_message'] = "{summary}";
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
$mail = array(
|
| 179 |
+
'recipients' => array(),
|
| 180 |
+
'subject' => Caldera_Forms::do_magic_tags($form['mailer']['email_subject']),
|
| 181 |
+
'message' => stripslashes( $form['mailer']['email_message'] ) ."\r\n",
|
| 182 |
+
'headers' => array(
|
| 183 |
+
Caldera_Forms::do_magic_tags( 'From: ' . $sendername . ' <' . $sendermail . '>' ),
|
| 184 |
+
),
|
| 185 |
+
'attachments' => array()
|
| 186 |
+
);
|
| 187 |
+
|
| 188 |
+
// if added a bcc
|
| 189 |
+
$bcc_to = trim( $form['mailer']['bcc_to'] );
|
| 190 |
+
if( !empty( $bcc_to ) ){
|
| 191 |
+
$mail['headers'][] = Caldera_Forms::do_magic_tags( 'Bcc: ' . $bcc_to );
|
| 192 |
+
}
|
| 193 |
+
|
| 194 |
+
// if added a replyto
|
| 195 |
+
$reply_to = trim( $form['mailer']['reply_to'] );
|
| 196 |
+
if( !empty( $reply_to ) ){
|
| 197 |
+
$mail['headers'][] = Caldera_Forms::do_magic_tags( 'Reply-To: <' . $reply_to . '>' );
|
| 198 |
+
}
|
| 199 |
+
|
| 200 |
+
// Filter Mailer first as not to have user input be filtered
|
| 201 |
+
$mail['message'] = Caldera_Forms::do_magic_tags($mail['message']);
|
| 202 |
+
|
| 203 |
+
if($form['mailer']['email_type'] == 'html'){
|
| 204 |
+
$mail['headers'][] = "Content-type: text/html";
|
| 205 |
+
$mail['message'] = wpautop( $mail['message'] );
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
// get tags
|
| 209 |
+
preg_match_all("/%(.+?)%/", $mail['message'], $hastags);
|
| 210 |
+
if(!empty($hastags[1])){
|
| 211 |
+
foreach($hastags[1] as $tag_key=>$tag){
|
| 212 |
+
$tagval = Caldera_Forms::get_slug_data($tag, $form);
|
| 213 |
+
if(is_array($tagval)){
|
| 214 |
+
$tagval = implode(', ', $tagval);
|
| 215 |
+
}
|
| 216 |
+
$mail['message'] = str_replace($hastags[0][$tag_key], $tagval, $mail['message']);
|
| 217 |
+
}
|
| 218 |
+
}
|
| 219 |
+
|
| 220 |
+
//$mail['message']
|
| 221 |
+
|
| 222 |
+
// ifs
|
| 223 |
+
preg_match_all("/\[if (.+?)?\](?:(.+?)?\[\/if\])?/", $mail['message'], $hasifs);
|
| 224 |
+
if(!empty($hasifs[1])){
|
| 225 |
+
// process ifs
|
| 226 |
+
foreach($hasifs[0] as $if_key=>$if_tag){
|
| 227 |
+
|
| 228 |
+
$content = explode('[else]', $hasifs[2][$if_key]);
|
| 229 |
+
if(empty($content[1])){
|
| 230 |
+
$content[1] = '';
|
| 231 |
+
}
|
| 232 |
+
$vars = shortcode_parse_atts( $hasifs[1][$if_key]);
|
| 233 |
+
foreach($vars as $varkey=>$varval){
|
| 234 |
+
if(is_string($varkey)){
|
| 235 |
+
$var = Caldera_Forms::get_slug_data($varkey, $form);
|
| 236 |
+
if( in_array($varval, (array) $var) ){
|
| 237 |
+
// yes show code
|
| 238 |
+
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[0], $mail['message']);
|
| 239 |
+
}else{
|
| 240 |
+
// nope- no code
|
| 241 |
+
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[1], $mail['message']);
|
| 242 |
+
}
|
| 243 |
+
}else{
|
| 244 |
+
$var = Caldera_Forms::get_slug_data($varval, $form);
|
| 245 |
+
if(!empty($var)){
|
| 246 |
+
// show code
|
| 247 |
+
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[0], $mail['message']);
|
| 248 |
+
}else{
|
| 249 |
+
// no code
|
| 250 |
+
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[1], $mail['message']);
|
| 251 |
+
}
|
| 252 |
+
}
|
| 253 |
+
}
|
| 254 |
+
}
|
| 255 |
+
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
if(!empty($form['mailer']['recipients'])){
|
| 260 |
+
$mail['recipients'] = explode(',', Caldera_Forms::do_magic_tags( $form['mailer']['recipients']) );
|
| 261 |
+
}else{
|
| 262 |
+
$mail['recipients'][] = get_option( 'admin_email' );
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
$submission = array();
|
| 266 |
+
foreach ($data as $field_id=>$row) {
|
| 267 |
+
if($row === null || !isset($form['fields'][$field_id]) ){
|
| 268 |
+
continue;
|
| 269 |
+
}
|
| 270 |
+
|
| 271 |
+
$key = $form['fields'][$field_id]['slug'];
|
| 272 |
+
if(is_array($row)){
|
| 273 |
+
if(!empty($row)){
|
| 274 |
+
$keys = array_keys($row);
|
| 275 |
+
if(is_int($keys[0])){
|
| 276 |
+
$row = implode(', ', $row);
|
| 277 |
+
}else{
|
| 278 |
+
$tmp = array();
|
| 279 |
+
foreach($row as $linekey=>$item){
|
| 280 |
+
if(is_array($item)){
|
| 281 |
+
$item = '( ' . implode(', ', $item).' )';
|
| 282 |
+
}
|
| 283 |
+
$tmp[] = $linekey.': '.$item;
|
| 284 |
+
}
|
| 285 |
+
$row = implode(', ', $tmp);
|
| 286 |
+
}
|
| 287 |
+
}else{
|
| 288 |
+
$row = null;
|
| 289 |
+
}
|
| 290 |
+
}
|
| 291 |
+
$mail['message'] = str_replace('%'.$key.'%', $row, $mail['message']);
|
| 292 |
+
$mail['subject'] = str_replace('%'.$key.'%', $row, $mail['subject']);
|
| 293 |
+
|
| 294 |
+
$submission[] = $row;
|
| 295 |
+
$labels[] = $form['fields'][$field_id]['label'];
|
| 296 |
+
}
|
| 297 |
+
|
| 298 |
+
// final magic
|
| 299 |
+
$mail['message'] = Caldera_Forms::do_magic_tags( $mail['message'] );
|
| 300 |
+
$mail['subject'] = Caldera_Forms::do_magic_tags( $mail['subject'] );
|
| 301 |
+
|
| 302 |
+
// CSV
|
| 303 |
+
if(!empty($form['mailer']['csv_data'])){
|
| 304 |
+
ob_start();
|
| 305 |
+
$df = fopen("php://output", 'w');
|
| 306 |
+
fputcsv($df, $labels);
|
| 307 |
+
fputcsv($df, $submission);
|
| 308 |
+
fclose($df);
|
| 309 |
+
$csv = ob_get_clean();
|
| 310 |
+
$csvfile = wp_upload_bits( uniqid().'.csv', null, $csv );
|
| 311 |
+
if( isset( $csvfile['file'] ) && false == $csvfile['error'] && file_exists( $csvfile['file'] ) ){
|
| 312 |
+
$mail['attachments'][] = $csvfile['file'];
|
| 313 |
+
}
|
| 314 |
+
}
|
| 315 |
+
|
| 316 |
+
if(empty($mail)){
|
| 317 |
+
return;
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
/**
|
| 321 |
+
* Filter email data before sending
|
| 322 |
+
*
|
| 323 |
+
* @since 1.2.3 in this location.
|
| 324 |
+
* @since unknown in original location (Caldera_Forms::save_final_form)
|
| 325 |
+
*
|
| 326 |
+
* @param array $mail Email data
|
| 327 |
+
* @param array $data Form entry data
|
| 328 |
+
* @param array $form The form config
|
| 329 |
+
*/
|
| 330 |
+
$mail = apply_filters( 'caldera_forms_mailer', $mail, $data, $form);
|
| 331 |
+
|
| 332 |
+
|
| 333 |
+
$headers = implode("\r\n", $mail['headers']);
|
| 334 |
+
|
| 335 |
+
/**
|
| 336 |
+
* Runs before mail is sent, but after data is prepared
|
| 337 |
+
*
|
| 338 |
+
* @since 1.2.3 in this location.
|
| 339 |
+
* @since unknown in original location (Caldera_Forms::save_final_form)
|
| 340 |
+
*
|
| 341 |
+
* @param array $mail Email data
|
| 342 |
+
* @param array $data Form entry data
|
| 343 |
+
* @param array $form The form config
|
| 344 |
+
*/
|
| 345 |
+
do_action( 'caldera_forms_do_mailer', $mail, $data, $form);
|
| 346 |
+
|
| 347 |
+
// force message to string.
|
| 348 |
+
if( is_array( $mail['message'] ) ){
|
| 349 |
+
$mail['message'] = implode( "\n", $mail['message'] );
|
| 350 |
+
}
|
| 351 |
+
|
| 352 |
+
if( ! empty( $mail ) ){
|
| 353 |
+
|
| 354 |
+
// is send debug enabled?
|
| 355 |
+
if( !empty( $form['debug_mailer'] ) ){
|
| 356 |
+
add_action( 'phpmailer_init', array( 'Caldera_Forms', 'debug_mail_send' ), 1000 );
|
| 357 |
+
}
|
| 358 |
+
|
| 359 |
+
if( wp_mail( (array) $mail['recipients'], $mail['subject'], stripslashes( $mail['message'] ), $headers, $mail['attachments'] )){
|
| 360 |
+
|
| 361 |
+
// kill attachment.
|
| 362 |
+
if(!empty($csvfile['file'])){
|
| 363 |
+
if(file_exists($csvfile['file'])){
|
| 364 |
+
unlink($csvfile['file']);
|
| 365 |
+
}
|
| 366 |
+
}
|
| 367 |
+
}else{
|
| 368 |
+
/**
|
| 369 |
+
* Fires main mailer fails
|
| 370 |
+
*
|
| 371 |
+
* @since 1.2.3
|
| 372 |
+
*
|
| 373 |
+
* @param array $mail Email data
|
| 374 |
+
* @param array $data Form entry data
|
| 375 |
+
* @param array $form The form config
|
| 376 |
+
*/
|
| 377 |
+
do_action( 'caldera_forms_mailer_failed', $mail, $data, $form );
|
| 378 |
+
|
| 379 |
+
}
|
| 380 |
+
}else{
|
| 381 |
+
if(!empty($csvfile['file'])){
|
| 382 |
+
if(file_exists($csvfile['file'])){
|
| 383 |
+
unlink($csvfile['file']);
|
| 384 |
+
}
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
}
|
| 388 |
+
|
| 389 |
+
}
|
| 390 |
+
|
| 391 |
+
}
|
classes/admin.php
CHANGED
|
@@ -26,22 +26,36 @@ class Caldera_Forms_Admin {
|
|
| 26 |
* @var string
|
| 27 |
*/
|
| 28 |
protected $plugin_slug = 'caldera-forms';
|
|
|
|
| 29 |
/**
|
| 30 |
* @var string
|
| 31 |
*/
|
| 32 |
protected $screen_prefix = array();
|
|
|
|
| 33 |
/**
|
| 34 |
* @var string
|
| 35 |
*/
|
| 36 |
protected $sub_prefix = null;
|
|
|
|
| 37 |
/**
|
| 38 |
* @var string
|
| 39 |
*/
|
| 40 |
protected $addons = array();
|
|
|
|
| 41 |
/**
|
| 42 |
* @var object
|
| 43 |
*/
|
| 44 |
protected static $instance = null;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 45 |
/**
|
| 46 |
* Initialize the plugin by setting localization, filters, and administration functions.
|
| 47 |
*
|
|
@@ -96,6 +110,8 @@ class Caldera_Forms_Admin {
|
|
| 96 |
add_action('admin_footer-post.php', array( $this, 'render_editor_template')); // Fired on post edit page
|
| 97 |
add_action('admin_footer-post-new.php', array( $this, 'render_editor_template')); // Fired on add new post page
|
| 98 |
|
|
|
|
|
|
|
| 99 |
}
|
| 100 |
|
| 101 |
public function render_editor_template(){
|
|
@@ -112,7 +128,67 @@ class Caldera_Forms_Admin {
|
|
| 112 |
<?php
|
| 113 |
|
| 114 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 115 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 116 |
|
| 117 |
public function get_form_preview(){
|
| 118 |
global $post;
|
|
@@ -167,8 +243,10 @@ class Caldera_Forms_Admin {
|
|
| 167 |
if(empty($_POST['do'])){
|
| 168 |
die;
|
| 169 |
}
|
|
|
|
|
|
|
| 170 |
|
| 171 |
-
switch ($
|
| 172 |
case 'active':
|
| 173 |
case 'trash':
|
| 174 |
case 'delete':
|
|
@@ -182,7 +260,7 @@ class Caldera_Forms_Admin {
|
|
| 182 |
$selectors[] = '#entry_row_' . (int) $item_id;
|
| 183 |
}
|
| 184 |
|
| 185 |
-
switch ($
|
| 186 |
case 'delete':
|
| 187 |
if( current_user_can( 'delete_others_posts' ) ){
|
| 188 |
$result = $wpdb->query( "DELETE FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `id` IN (".implode(',', $items).");" );
|
|
@@ -195,16 +273,16 @@ class Caldera_Forms_Admin {
|
|
| 195 |
|
| 196 |
default:
|
| 197 |
if( current_user_can( 'edit_others_posts' ) ){
|
| 198 |
-
$result = $wpdb->query( $wpdb->prepare( "UPDATE `" . $wpdb->prefix . "cf_form_entries` SET `status` = %s WHERE `id` IN (".implode(',', $items).");", $
|
| 199 |
}
|
| 200 |
break;
|
| 201 |
}
|
| 202 |
|
| 203 |
if( $result ){
|
| 204 |
|
| 205 |
-
$out['status'] = $
|
| 206 |
-
$out['undo'] = ( $
|
| 207 |
-
$out['undo_text'] = ( $
|
| 208 |
|
| 209 |
$out['entries'] = implode(',',$selectors);
|
| 210 |
$out['total'] = $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s && `status` = 'active';", $_POST['form']));
|
|
@@ -263,7 +341,7 @@ class Caldera_Forms_Admin {
|
|
| 263 |
}
|
| 264 |
public static function get_admin_meta_templates(){
|
| 265 |
|
| 266 |
-
$processors =
|
| 267 |
if(!empty($processors)){
|
| 268 |
foreach($processors as $processor_type=>$processor_config){
|
| 269 |
if( isset( $processor_config['meta_template'] ) && file_exists( $processor_config['meta_template'] ) ){
|
|
@@ -430,7 +508,7 @@ class Caldera_Forms_Admin {
|
|
| 430 |
/**
|
| 431 |
* Get entries from a form
|
| 432 |
*
|
| 433 |
-
* @since 1.
|
| 434 |
*
|
| 435 |
* @param string|array $form Form ID or form config.
|
| 436 |
* @param int $page Optional. Page of entries to get per page. Default is 1.
|
|
@@ -489,17 +567,11 @@ class Caldera_Forms_Admin {
|
|
| 489 |
|
| 490 |
$filter = null;
|
| 491 |
|
| 492 |
-
// status
|
| 493 |
-
if(!empty($status)){
|
| 494 |
-
$status = $wpdb->prepare("%s", $status );
|
| 495 |
-
}
|
| 496 |
-
|
| 497 |
$data['trash'] = (int) $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s AND `status` = 'trash';", $form_id ) );
|
| 498 |
$data['active'] = (int) $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s AND `status` = 'active';", $form_id ) );
|
| 499 |
|
| 500 |
-
|
| 501 |
// set current total
|
| 502 |
-
if(!empty( $status ) && isset($data[ $status ])){
|
| 503 |
$data['total'] = $data[ $status ];
|
| 504 |
}else{
|
| 505 |
$data['total'] = $data['active'];
|
|
@@ -533,7 +605,7 @@ class Caldera_Forms_Admin {
|
|
| 533 |
`form_id`
|
| 534 |
FROM `" . $wpdb->prefix ."cf_form_entries`
|
| 535 |
|
| 536 |
-
WHERE `form_id` = %s AND `status` =
|
| 537 |
|
| 538 |
if(!empty($rawdata)){
|
| 539 |
|
|
@@ -816,7 +888,7 @@ class Caldera_Forms_Admin {
|
|
| 816 |
$panel_extensions = apply_filters( 'caldera_forms_get_panel_extensions', array() );
|
| 817 |
|
| 818 |
// load processors
|
| 819 |
-
$form_processors =
|
| 820 |
|
| 821 |
// merge a list
|
| 822 |
$merged_types = array_merge($field_types, $panel_extensions, $form_processors);
|
|
@@ -1184,40 +1256,7 @@ class Caldera_Forms_Admin {
|
|
| 1184 |
}
|
| 1185 |
//dump($data);
|
| 1186 |
}
|
| 1187 |
-
|
| 1188 |
-
foreach( $rawdata as $entry){
|
| 1189 |
-
// build structure
|
| 1190 |
-
if(!isset($data[$entry->_entryid])){
|
| 1191 |
-
$data[$entry->_entryid] = $structure;
|
| 1192 |
-
}
|
| 1193 |
-
// check for json
|
| 1194 |
-
if(substr($entry->value, 0,2) === '{"' && substr($entry->value, strlen($entry->value)-2 ) === '"}'){
|
| 1195 |
-
$row = json_decode($entry->value, true);
|
| 1196 |
-
if(!empty($row)){
|
| 1197 |
-
$keys = array_keys($row);
|
| 1198 |
-
if(is_int($keys[0])){
|
| 1199 |
-
$row = implode(', ', $row);
|
| 1200 |
-
}else{
|
| 1201 |
-
$tmp = array();
|
| 1202 |
-
foreach($row as $key=>$item){
|
| 1203 |
-
if(is_array($item)){
|
| 1204 |
-
$item = '( ' . implode(', ', $item).' )';
|
| 1205 |
-
}
|
| 1206 |
-
$tmp[] = $key.': '.$item;
|
| 1207 |
-
}
|
| 1208 |
-
$row = implode(', ', $tmp);
|
| 1209 |
-
}
|
| 1210 |
-
$entry->value = $row;
|
| 1211 |
-
}
|
| 1212 |
-
}
|
| 1213 |
-
$data[$entry->_entryid][$entry->slug] = $entry->value;
|
| 1214 |
-
$label = $entry->slug;
|
| 1215 |
-
if(isset($labels[$entry->slug])){
|
| 1216 |
-
$label = $labels[$entry->slug];
|
| 1217 |
-
}
|
| 1218 |
-
$headers[$entry->slug] = $label;
|
| 1219 |
-
}*/
|
| 1220 |
-
|
| 1221 |
header("Pragma: public");
|
| 1222 |
header("Expires: 0");
|
| 1223 |
header("Cache-Control: must-revalidate, post-check=0, pre-check=0");
|
|
@@ -1299,6 +1338,9 @@ class Caldera_Forms_Admin {
|
|
| 1299 |
if(isset($forms[$data['ID']]['settings'])){
|
| 1300 |
unset($forms[$data['ID']]['settings']);
|
| 1301 |
}
|
|
|
|
|
|
|
|
|
|
| 1302 |
|
| 1303 |
foreach($forms as $form_id=>$form_config){
|
| 1304 |
if(empty($form_config)){
|
|
@@ -1307,7 +1349,14 @@ class Caldera_Forms_Admin {
|
|
| 1307 |
}
|
| 1308 |
// combine structure pages
|
| 1309 |
$data['layout_grid']['structure'] = implode('#', $data['layout_grid']['structure']);
|
| 1310 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1311 |
// add from to list
|
| 1312 |
update_option($data['ID'], $data);
|
| 1313 |
do_action('caldera_forms_save_form', $data);
|
|
@@ -1331,6 +1380,9 @@ class Caldera_Forms_Admin {
|
|
| 1331 |
|
| 1332 |
parse_str( $_POST['data'], $newform );
|
| 1333 |
|
|
|
|
|
|
|
|
|
|
| 1334 |
// get form registry
|
| 1335 |
$forms = Caldera_Forms::get_forms( true );
|
| 1336 |
if(empty($forms)){
|
|
@@ -1339,15 +1391,25 @@ class Caldera_Forms_Admin {
|
|
| 1339 |
if(!empty($newform['clone'])){
|
| 1340 |
$clone = $newform['clone'];
|
| 1341 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1342 |
$newform = array(
|
| 1343 |
"ID" => uniqid('CF'),
|
| 1344 |
"name" => $newform['name'],
|
| 1345 |
"description" => $newform['description'],
|
| 1346 |
"success" => __('Form has been successfully submitted. Thank you.', 'caldera-forms'),
|
| 1347 |
"form_ajax" => 1,
|
| 1348 |
-
"hide_form" => 1
|
|
|
|
| 1349 |
);
|
| 1350 |
-
|
|
|
|
|
|
|
|
|
|
| 1351 |
// add from to list
|
| 1352 |
$newform = apply_filters( 'caldera_forms_create_form', $newform);
|
| 1353 |
|
|
@@ -1360,6 +1422,8 @@ class Caldera_Forms_Admin {
|
|
| 1360 |
$newform = array_merge($clone_form, $newform);
|
| 1361 |
}
|
| 1362 |
}
|
|
|
|
|
|
|
| 1363 |
|
| 1364 |
// add form to db
|
| 1365 |
update_option($newform['ID'], $newform);
|
|
@@ -1401,7 +1465,7 @@ class Caldera_Forms_Admin {
|
|
| 1401 |
"label" => __("Layout Builder", 'caldera-forms'),
|
| 1402 |
"active" => true,
|
| 1403 |
"actions" => array(
|
| 1404 |
-
$path . "
|
| 1405 |
),
|
| 1406 |
"repeat" => 0,
|
| 1407 |
"canvas" => $path . "layout.php",
|
|
@@ -1413,6 +1477,12 @@ class Caldera_Forms_Admin {
|
|
| 1413 |
"label" => __("Form Pages", 'caldera-forms'),
|
| 1414 |
"canvas" => $path . "pages.php",
|
| 1415 |
),
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1416 |
"processors" => array(
|
| 1417 |
"name" => __("Processors", 'caldera-forms'),
|
| 1418 |
"location" => "lower",
|
|
@@ -1543,6 +1613,51 @@ class Caldera_Forms_Admin {
|
|
| 1543 |
|
| 1544 |
}
|
| 1545 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1546 |
}
|
| 1547 |
|
| 1548 |
|
| 26 |
* @var string
|
| 27 |
*/
|
| 28 |
protected $plugin_slug = 'caldera-forms';
|
| 29 |
+
|
| 30 |
/**
|
| 31 |
* @var string
|
| 32 |
*/
|
| 33 |
protected $screen_prefix = array();
|
| 34 |
+
|
| 35 |
/**
|
| 36 |
* @var string
|
| 37 |
*/
|
| 38 |
protected $sub_prefix = null;
|
| 39 |
+
|
| 40 |
/**
|
| 41 |
* @var string
|
| 42 |
*/
|
| 43 |
protected $addons = array();
|
| 44 |
+
|
| 45 |
/**
|
| 46 |
* @var object
|
| 47 |
*/
|
| 48 |
protected static $instance = null;
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Holds admin notices
|
| 52 |
+
*
|
| 53 |
+
* @since 1.3.0
|
| 54 |
+
*
|
| 55 |
+
* @var array
|
| 56 |
+
*/
|
| 57 |
+
private static $admin_notices;
|
| 58 |
+
|
| 59 |
/**
|
| 60 |
* Initialize the plugin by setting localization, filters, and administration functions.
|
| 61 |
*
|
| 110 |
add_action('admin_footer-post.php', array( $this, 'render_editor_template')); // Fired on post edit page
|
| 111 |
add_action('admin_footer-post-new.php', array( $this, 'render_editor_template')); // Fired on add new post page
|
| 112 |
|
| 113 |
+
add_action( 'caldera_forms_new_form_template_end', array( $this, 'load_new_form_templates') );
|
| 114 |
+
|
| 115 |
}
|
| 116 |
|
| 117 |
public function render_editor_template(){
|
| 128 |
<?php
|
| 129 |
|
| 130 |
}
|
| 131 |
+
|
| 132 |
+
/**
|
| 133 |
+
* Returns the array of form templates.
|
| 134 |
+
*
|
| 135 |
+
* @since 1.2.3
|
| 136 |
+
*
|
| 137 |
+
* @return array The form templates
|
| 138 |
+
*/
|
| 139 |
+
public static function internal_form_templates(){
|
| 140 |
+
|
| 141 |
+
$internal_templates = array(
|
| 142 |
+
'starter_contact_form' => array(
|
| 143 |
+
'name' => __( 'Starter Contact Form', 'caldera-forms' ),
|
| 144 |
+
'template' => include CFCORE_PATH . 'includes/templates/starter-contact-form.php'
|
| 145 |
+
),
|
| 146 |
+
'variable_price_example' => array(
|
| 147 |
+
'name' => __( 'Variable Pricing Form, with add-on products.', 'caldera-forms' ),
|
| 148 |
+
'template' => include CFCORE_PATH . 'includes/templates/variable-price-example.php'
|
| 149 |
+
),
|
| 150 |
+
'registration' => array(
|
| 151 |
+
'name' => __( 'Registration Form, with optional additional participants.', 'caldera-forms' ),
|
| 152 |
+
'template' => include CFCORE_PATH . 'includes/templates/registration-form-example.php'
|
| 153 |
+
),
|
| 154 |
+
|
| 155 |
+
);
|
| 156 |
+
|
| 157 |
+
/**
|
| 158 |
+
* Filter form templates
|
| 159 |
+
*
|
| 160 |
+
* @since 1.2.3
|
| 161 |
+
*
|
| 162 |
+
* @param array $internal_templates Form templates
|
| 163 |
+
*/
|
| 164 |
+
return apply_filters( 'caldera_forms_get_form_templates', $internal_templates );
|
| 165 |
+
|
| 166 |
+
}
|
| 167 |
|
| 168 |
+
public function load_new_form_templates(){
|
| 169 |
+
|
| 170 |
+
$form_templates = self::internal_form_templates();
|
| 171 |
+
|
| 172 |
+
?>
|
| 173 |
+
<div class="caldera-config-group">
|
| 174 |
+
<label for=""><?php echo __('Form Template', 'caldera-forms'); ?></label>
|
| 175 |
+
<div class="caldera-config-field">
|
| 176 |
+
<select class="new-form-template block-input field-config" name="template" value="">
|
| 177 |
+
<option value="0"><?php echo __('no template - blank form', 'caldera-forms'); ?></option>
|
| 178 |
+
<?php
|
| 179 |
+
|
| 180 |
+
foreach( $form_templates as $template_slug => $template ){
|
| 181 |
+
if( !empty( $template['template'] ) && !empty( $template['name'] ) ){
|
| 182 |
+
echo '<option value="' . $template_slug . '">' . $template['name'] . '</option>';
|
| 183 |
+
}
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
?>
|
| 187 |
+
</select>
|
| 188 |
+
</div>
|
| 189 |
+
</div>
|
| 190 |
+
<?php
|
| 191 |
+
}
|
| 192 |
|
| 193 |
public function get_form_preview(){
|
| 194 |
global $post;
|
| 243 |
if(empty($_POST['do'])){
|
| 244 |
die;
|
| 245 |
}
|
| 246 |
+
|
| 247 |
+
$do_action = strtolower( $_POST['do'] );
|
| 248 |
|
| 249 |
+
switch ( $do_action ) {
|
| 250 |
case 'active':
|
| 251 |
case 'trash':
|
| 252 |
case 'delete':
|
| 260 |
$selectors[] = '#entry_row_' . (int) $item_id;
|
| 261 |
}
|
| 262 |
|
| 263 |
+
switch ($do_action) {
|
| 264 |
case 'delete':
|
| 265 |
if( current_user_can( 'delete_others_posts' ) ){
|
| 266 |
$result = $wpdb->query( "DELETE FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `id` IN (".implode(',', $items).");" );
|
| 273 |
|
| 274 |
default:
|
| 275 |
if( current_user_can( 'edit_others_posts' ) ){
|
| 276 |
+
$result = $wpdb->query( $wpdb->prepare( "UPDATE `" . $wpdb->prefix . "cf_form_entries` SET `status` = %s WHERE `id` IN (".implode(',', $items).");", $do_action ) );
|
| 277 |
}
|
| 278 |
break;
|
| 279 |
}
|
| 280 |
|
| 281 |
if( $result ){
|
| 282 |
|
| 283 |
+
$out['status'] = $do_action;
|
| 284 |
+
$out['undo'] = ( $do_action === 'trash' ? 'active' : __('Trash') );
|
| 285 |
+
$out['undo_text'] = ( $do_action === 'trash' ? __('Restore', 'caldera-forms') : __('Trash') );
|
| 286 |
|
| 287 |
$out['entries'] = implode(',',$selectors);
|
| 288 |
$out['total'] = $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s && `status` = 'active';", $_POST['form']));
|
| 341 |
}
|
| 342 |
public static function get_admin_meta_templates(){
|
| 343 |
|
| 344 |
+
$processors = $processors = Caldera_Forms_Processor_Load::get_instance()->get_processors();
|
| 345 |
if(!empty($processors)){
|
| 346 |
foreach($processors as $processor_type=>$processor_config){
|
| 347 |
if( isset( $processor_config['meta_template'] ) && file_exists( $processor_config['meta_template'] ) ){
|
| 508 |
/**
|
| 509 |
* Get entries from a form
|
| 510 |
*
|
| 511 |
+
* @since 1.2.1
|
| 512 |
*
|
| 513 |
* @param string|array $form Form ID or form config.
|
| 514 |
* @param int $page Optional. Page of entries to get per page. Default is 1.
|
| 567 |
|
| 568 |
$filter = null;
|
| 569 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 570 |
$data['trash'] = (int) $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s AND `status` = 'trash';", $form_id ) );
|
| 571 |
$data['active'] = (int) $wpdb->get_var($wpdb->prepare("SELECT COUNT(`id`) AS `total` FROM `" . $wpdb->prefix . "cf_form_entries` WHERE `form_id` = %s AND `status` = 'active';", $form_id ) );
|
| 572 |
|
|
|
|
| 573 |
// set current total
|
| 574 |
+
if(!empty( $status ) && isset( $data[ $status ] ) ){
|
| 575 |
$data['total'] = $data[ $status ];
|
| 576 |
}else{
|
| 577 |
$data['total'] = $data['active'];
|
| 605 |
`form_id`
|
| 606 |
FROM `" . $wpdb->prefix ."cf_form_entries`
|
| 607 |
|
| 608 |
+
WHERE `form_id` = %s AND `status` = %s ORDER BY `datestamp` DESC LIMIT " . $limit . ";", $form_id, $status ) );
|
| 609 |
|
| 610 |
if(!empty($rawdata)){
|
| 611 |
|
| 888 |
$panel_extensions = apply_filters( 'caldera_forms_get_panel_extensions', array() );
|
| 889 |
|
| 890 |
// load processors
|
| 891 |
+
$form_processors = $processors = Caldera_Forms_Processor_Load::get_instance()->get_processors();
|
| 892 |
|
| 893 |
// merge a list
|
| 894 |
$merged_types = array_merge($field_types, $panel_extensions, $form_processors);
|
| 1256 |
}
|
| 1257 |
//dump($data);
|
| 1258 |
}
|
| 1259 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1260 |
header("Pragma: public");
|
| 1261 |
header("Expires: 0");
|
| 1262 |
header("Cache-Control: must-revalidate, post-check=0, pre-check=0");
|
| 1338 |
if(isset($forms[$data['ID']]['settings'])){
|
| 1339 |
unset($forms[$data['ID']]['settings']);
|
| 1340 |
}
|
| 1341 |
+
if(isset($forms[$data['ID']]['conditional_groups'])){
|
| 1342 |
+
unset($forms[$data['ID']]['conditional_groups']);
|
| 1343 |
+
}
|
| 1344 |
|
| 1345 |
foreach($forms as $form_id=>$form_config){
|
| 1346 |
if(empty($form_config)){
|
| 1349 |
}
|
| 1350 |
// combine structure pages
|
| 1351 |
$data['layout_grid']['structure'] = implode('#', $data['layout_grid']['structure']);
|
| 1352 |
+
// remove fields from conditions
|
| 1353 |
+
if( !empty( $data['conditional_groups']['fields'] ) ){
|
| 1354 |
+
unset( $data['conditional_groups']['fields'] );
|
| 1355 |
+
}
|
| 1356 |
+
// remove magics ( yes, not used yet.)
|
| 1357 |
+
if( !empty( $data['conditional_groups']['magic'] ) ){
|
| 1358 |
+
unset( $data['conditional_groups']['magic'] );
|
| 1359 |
+
}
|
| 1360 |
// add from to list
|
| 1361 |
update_option($data['ID'], $data);
|
| 1362 |
do_action('caldera_forms_save_form', $data);
|
| 1380 |
|
| 1381 |
parse_str( $_POST['data'], $newform );
|
| 1382 |
|
| 1383 |
+
// get form templates
|
| 1384 |
+
$form_templates = self::internal_form_templates();
|
| 1385 |
+
|
| 1386 |
// get form registry
|
| 1387 |
$forms = Caldera_Forms::get_forms( true );
|
| 1388 |
if(empty($forms)){
|
| 1391 |
if(!empty($newform['clone'])){
|
| 1392 |
$clone = $newform['clone'];
|
| 1393 |
}
|
| 1394 |
+
// load template if any
|
| 1395 |
+
if( !empty( $newform['template'] ) ){
|
| 1396 |
+
if( isset( $form_templates[ $newform['template'] ] ) && !empty( $form_templates[ $newform['template'] ]['template'] ) ){
|
| 1397 |
+
$form_template = $form_templates[ $newform['template'] ]['template'];
|
| 1398 |
+
}
|
| 1399 |
+
}
|
| 1400 |
$newform = array(
|
| 1401 |
"ID" => uniqid('CF'),
|
| 1402 |
"name" => $newform['name'],
|
| 1403 |
"description" => $newform['description'],
|
| 1404 |
"success" => __('Form has been successfully submitted. Thank you.', 'caldera-forms'),
|
| 1405 |
"form_ajax" => 1,
|
| 1406 |
+
"hide_form" => 1,
|
| 1407 |
+
"check_honey" => 1,
|
| 1408 |
);
|
| 1409 |
+
// is template?
|
| 1410 |
+
if( !empty( $form_template ) && is_array( $form_template ) ){
|
| 1411 |
+
$newform = array_merge( $form_template, $newform );
|
| 1412 |
+
}
|
| 1413 |
// add from to list
|
| 1414 |
$newform = apply_filters( 'caldera_forms_create_form', $newform);
|
| 1415 |
|
| 1422 |
$newform = array_merge($clone_form, $newform);
|
| 1423 |
}
|
| 1424 |
}
|
| 1425 |
+
|
| 1426 |
+
|
| 1427 |
|
| 1428 |
// add form to db
|
| 1429 |
update_option($newform['ID'], $newform);
|
| 1465 |
"label" => __("Layout Builder", 'caldera-forms'),
|
| 1466 |
"active" => true,
|
| 1467 |
"actions" => array(
|
| 1468 |
+
$path . "layout_toolbar.php"
|
| 1469 |
),
|
| 1470 |
"repeat" => 0,
|
| 1471 |
"canvas" => $path . "layout.php",
|
| 1477 |
"label" => __("Form Pages", 'caldera-forms'),
|
| 1478 |
"canvas" => $path . "pages.php",
|
| 1479 |
),
|
| 1480 |
+
"conditions" => array(
|
| 1481 |
+
"name" => __("Conditions", 'caldera-forms'),
|
| 1482 |
+
"location" => "lower",
|
| 1483 |
+
"label" => __("Conditions", 'caldera-forms'),
|
| 1484 |
+
"canvas" => $path . "conditions.php",
|
| 1485 |
+
),
|
| 1486 |
"processors" => array(
|
| 1487 |
"name" => __("Processors", 'caldera-forms'),
|
| 1488 |
"location" => "lower",
|
| 1613 |
|
| 1614 |
}
|
| 1615 |
|
| 1616 |
+
/**
|
| 1617 |
+
* Add to the admin notices
|
| 1618 |
+
*
|
| 1619 |
+
* @since 1.3.0
|
| 1620 |
+
*
|
| 1621 |
+
* @param string|array $notice The notice or array of notices to add.
|
| 1622 |
+
*/
|
| 1623 |
+
public static function add_admin_notice( $notice ) {
|
| 1624 |
+
if ( is_string( $notice ) ) {
|
| 1625 |
+
self::$admin_notices[] = $notice;
|
| 1626 |
+
}
|
| 1627 |
+
|
| 1628 |
+
if ( is_array( $notice ) ) {
|
| 1629 |
+
foreach( $notice as $n) {
|
| 1630 |
+
self::add_admin_notice( $n );
|
| 1631 |
+
}
|
| 1632 |
+
|
| 1633 |
+
}
|
| 1634 |
+
|
| 1635 |
+
}
|
| 1636 |
+
|
| 1637 |
+
/**
|
| 1638 |
+
* Get the admin messages
|
| 1639 |
+
*
|
| 1640 |
+
* @since 1.3
|
| 1641 |
+
*
|
| 1642 |
+
* @param bool $as_string Optional. To return as string, the default, or as an array
|
| 1643 |
+
* @param string $seperator Optional. What to break notices with, when returning as string. Default is "\n"
|
| 1644 |
+
*
|
| 1645 |
+
* @return string|array|void
|
| 1646 |
+
*/
|
| 1647 |
+
public static function get_admin_notices( $as_string = true, $seperator = "\n" ) {
|
| 1648 |
+
if ( ! empty( self::$admin_notices ) ) {
|
| 1649 |
+
if ( $as_string ) {
|
| 1650 |
+
return implode( $seperator, self::$admin_notices );
|
| 1651 |
+
|
| 1652 |
+
}else{
|
| 1653 |
+
return self::$admin_notices;
|
| 1654 |
+
|
| 1655 |
+
}
|
| 1656 |
+
|
| 1657 |
+
}
|
| 1658 |
+
|
| 1659 |
+
}
|
| 1660 |
+
|
| 1661 |
}
|
| 1662 |
|
| 1663 |
|
classes/core.php
CHANGED
|
@@ -50,6 +50,7 @@ class Caldera_Forms {
|
|
| 50 |
add_filter('caldera_forms_submit_redirect_complete', array( $this, 'do_redirect'),10, 4);
|
| 51 |
add_action('caldera_forms_edit_end', array($this, 'calculations_templates') );
|
| 52 |
add_filter('caldera_forms_render_get_field', array( $this, 'auto_populate_options_field' ), 10, 2);
|
|
|
|
| 53 |
//add_filter('caldera_forms_render_get_field_type-radio', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 54 |
//add_filter('caldera_forms_render_get_field_type-checkbox', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 55 |
//add_filter('caldera_forms_render_get_field_type-dropdown', array( $this, 'auto_populate_options_field' ), 10, 2);
|
|
@@ -67,7 +68,8 @@ class Caldera_Forms {
|
|
| 67 |
|
| 68 |
add_action("wp_ajax_get_entry", array( $this, 'get_entry') );
|
| 69 |
// find if profile is loaded
|
| 70 |
-
add_action('
|
|
|
|
| 71 |
|
| 72 |
// render shortcode
|
| 73 |
add_shortcode( 'caldera_form', array( $this, 'render_form') );
|
|
@@ -86,7 +88,13 @@ class Caldera_Forms {
|
|
| 86 |
|
| 87 |
}
|
| 88 |
|
| 89 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 90 |
public static function get_form( $id_name ){
|
| 91 |
|
| 92 |
$id_name = sanitize_text_field( $id_name );
|
|
@@ -122,7 +130,13 @@ class Caldera_Forms {
|
|
| 122 |
|
| 123 |
}
|
| 124 |
|
| 125 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 126 |
public static function get_forms( $internal = false ){
|
| 127 |
|
| 128 |
$base_forms = get_option( '_caldera_forms', array() );
|
|
@@ -161,7 +175,9 @@ class Caldera_Forms {
|
|
| 161 |
load_plugin_textdomain( $this->plugin_slug, FALSE, basename( CFCORE_PATH ) . '/languages');
|
| 162 |
}
|
| 163 |
|
| 164 |
-
|
|
|
|
|
|
|
| 165 |
public static function activate_caldera_forms(){
|
| 166 |
global $wpdb;
|
| 167 |
|
|
@@ -280,7 +296,15 @@ class Caldera_Forms {
|
|
| 280 |
|
| 281 |
}
|
| 282 |
|
| 283 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 284 |
public static function star_rating_viewer($value, $field, $form){
|
| 285 |
if(!is_admin()){
|
| 286 |
// only for the front
|
|
@@ -302,15 +326,33 @@ class Caldera_Forms {
|
|
| 302 |
return $out;
|
| 303 |
}
|
| 304 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 305 |
public static function handle_file_view($value, $field, $form){
|
| 306 |
-
|
| 307 |
-
|
|
|
|
| 308 |
}
|
|
|
|
|
|
|
| 309 |
|
| 310 |
-
return '<a href="' . $value .'" target="_blank">' . basename($value) .'</a>';
|
| 311 |
|
| 312 |
-
|
| 313 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 314 |
public static function mail_attachment_check($mail, $data, $form){
|
| 315 |
|
| 316 |
// check for
|
|
@@ -319,7 +361,7 @@ class Caldera_Forms {
|
|
| 319 |
|
| 320 |
$dir = wp_upload_dir();
|
| 321 |
$file = str_replace($dir['baseurl'], $dir['basedir'], self::get_field_data($field_id, $form));
|
| 322 |
-
if(file_exists($file)){
|
| 323 |
$mail['attachments'][] = $file;
|
| 324 |
}
|
| 325 |
|
|
@@ -328,7 +370,15 @@ class Caldera_Forms {
|
|
| 328 |
return $mail;
|
| 329 |
}
|
| 330 |
|
| 331 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 332 |
public static function captcha_check($value, $field, $form){
|
| 333 |
|
| 334 |
if( !isset( $_POST['g-recaptcha-response'] ) || empty( $_POST['g-recaptcha-response'] )){
|
|
@@ -350,6 +400,13 @@ class Caldera_Forms {
|
|
| 350 |
|
| 351 |
}
|
| 352 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 353 |
public static function update_field_data($field, $entry_id, $form){
|
| 354 |
global $wpdb, $form;
|
| 355 |
|
|
@@ -394,7 +451,13 @@ class Caldera_Forms {
|
|
| 394 |
|
| 395 |
}
|
| 396 |
|
| 397 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 398 |
public static function save_field_data($field, $entry_id, $form){
|
| 399 |
global $wpdb, $form;
|
| 400 |
|
|
@@ -452,15 +515,21 @@ class Caldera_Forms {
|
|
| 452 |
|
| 453 |
}
|
| 454 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 455 |
public static function save_final_form($form){
|
| 456 |
-
|
| 457 |
-
|
| 458 |
// check submit type (new or update)
|
| 459 |
if(isset($_POST['_cf_frm_edt'])){
|
| 460 |
// is edit
|
| 461 |
//check user can edit this item.
|
| 462 |
$user_id = get_current_user_id();
|
| 463 |
-
$details =
|
| 464 |
|
| 465 |
// check token
|
| 466 |
if(isset($_POST['_cf_frm_edt_tkn'])){
|
|
@@ -481,7 +550,7 @@ class Caldera_Forms {
|
|
| 481 |
|
| 482 |
}else{
|
| 483 |
|
| 484 |
-
if(!empty($user_id)){
|
| 485 |
if(!empty($details)){
|
| 486 |
// check user can edit
|
| 487 |
if( current_user_can( 'edit_posts' ) || $details['user_id'] === $user_id ){
|
|
@@ -496,330 +565,27 @@ class Caldera_Forms {
|
|
| 496 |
|
| 497 |
}
|
| 498 |
|
|
|
|
|
|
|
| 499 |
|
| 500 |
-
if(!empty($form['db_support'])){
|
| 501 |
-
|
| 502 |
-
if(empty($entryid)){
|
| 503 |
-
|
| 504 |
-
$entryid = self::get_field_data( '_entry_id', $form );
|
| 505 |
-
|
| 506 |
-
foreach($form['fields'] as $field_id=>$field){
|
| 507 |
-
// add new and update
|
| 508 |
-
self::save_field_data($field, $entryid, $form);
|
| 509 |
-
|
| 510 |
-
}
|
| 511 |
-
// save form meta if any
|
| 512 |
-
if(isset($processed_meta[$form['ID']])){
|
| 513 |
-
foreach($processed_meta[$form['ID']] as $process_id=>$meta_data){
|
| 514 |
-
|
| 515 |
-
foreach($meta_data as $meta_key=>$meta_value){
|
| 516 |
-
if(is_array($meta_value)){
|
| 517 |
-
foreach ($meta_value as &$check_value) {
|
| 518 |
-
if(is_array($check_value)){
|
| 519 |
-
foreach($check_value as &$sub_check_value){
|
| 520 |
-
if(!is_array($sub_check_value)){
|
| 521 |
-
$sub_check_value = self::do_magic_tags( $sub_check_value );
|
| 522 |
-
}
|
| 523 |
-
}
|
| 524 |
-
}else{
|
| 525 |
-
$check_value = self::do_magic_tags( $check_value );
|
| 526 |
-
}
|
| 527 |
-
}
|
| 528 |
-
}else{
|
| 529 |
-
$meta_value = self::do_magic_tags( $meta_value );
|
| 530 |
-
}
|
| 531 |
-
|
| 532 |
-
|
| 533 |
-
if(count($meta_value) > 1){
|
| 534 |
-
$meta_value = json_encode($meta_value);
|
| 535 |
-
}else{
|
| 536 |
-
$meta_value = $meta_value[0];
|
| 537 |
-
if(is_array($meta_value) || is_object($meta_value)){
|
| 538 |
-
$meta_value = json_encode($meta_value);
|
| 539 |
-
}
|
| 540 |
-
}
|
| 541 |
-
|
| 542 |
-
$meta_entry = array(
|
| 543 |
-
'entry_id' => $entryid,
|
| 544 |
-
'process_id' => $process_id,
|
| 545 |
-
'meta_key' => $meta_key,
|
| 546 |
-
'meta_value' => $meta_value
|
| 547 |
-
);
|
| 548 |
-
|
| 549 |
-
$wpdb->insert($wpdb->prefix . 'cf_form_entry_meta', $meta_entry);
|
| 550 |
-
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
}
|
| 554 |
-
}
|
| 555 |
-
|
| 556 |
-
// update status
|
| 557 |
-
$wpdb->update($wpdb->prefix . 'cf_form_entries', array('status' => 'active'), array( 'id' => $entryid ) );
|
| 558 |
-
|
| 559 |
-
}else{
|
| 560 |
-
|
| 561 |
-
// do update
|
| 562 |
-
foreach($form['fields'] as $field_id=>$field){
|
| 563 |
-
// add new and update
|
| 564 |
-
self::update_field_data($field, $entryid, $form);
|
| 565 |
-
|
| 566 |
-
}
|
| 567 |
-
if(isset($processed_meta[$form['ID']])){
|
| 568 |
-
foreach($processed_meta[$form['ID']] as $process_id=>$meta_data){
|
| 569 |
-
|
| 570 |
-
foreach($meta_data as $meta_key=>$meta_value){
|
| 571 |
-
|
| 572 |
-
if(count($meta_value) > 1){
|
| 573 |
-
$meta_value = json_encode($meta_value);
|
| 574 |
-
}else{
|
| 575 |
-
$meta_value = $meta_value[0];
|
| 576 |
-
}
|
| 577 |
-
|
| 578 |
-
$meta_entry = array(
|
| 579 |
-
'entry_id' => $entryid,
|
| 580 |
-
'process_id' => $process_id,
|
| 581 |
-
'meta_key' => $meta_key,
|
| 582 |
-
'meta_value' => $meta_value
|
| 583 |
-
);
|
| 584 |
-
$wpdb->insert($wpdb->prefix . 'cf_form_entry_meta', $meta_entry);
|
| 585 |
-
|
| 586 |
-
}
|
| 587 |
-
|
| 588 |
-
}
|
| 589 |
-
}
|
| 590 |
-
// return
|
| 591 |
-
return;
|
| 592 |
-
}
|
| 593 |
-
|
| 594 |
}
|
| 595 |
|
| 596 |
if(empty($form['mailer']['enable_mailer'])){
|
| 597 |
return;
|
| 598 |
-
}
|
| 599 |
-
|
| 600 |
-
// add entry ID to transient data
|
| 601 |
-
if( !isset( $entryid ) ){
|
| 602 |
-
$entryid = null;
|
| 603 |
-
}
|
| 604 |
-
$transdata['entry_id'] = $entryid;
|
| 605 |
-
|
| 606 |
-
// do mailer!
|
| 607 |
-
$sendername = __('Caldera Forms Notification', 'caldera-forms');
|
| 608 |
-
if(!empty($form['mailer']['sender_name'])){
|
| 609 |
-
$sendername = $form['mailer']['sender_name'];
|
| 610 |
-
if( false !== strpos($sendername, '%')){
|
| 611 |
-
$isname = self::get_slug_data( trim($sendername, '%'), $form);
|
| 612 |
-
if(!empty( $isname )){
|
| 613 |
-
$sendername = $isname;
|
| 614 |
-
}
|
| 615 |
-
}
|
| 616 |
-
}
|
| 617 |
-
if(empty($form['mailer']['sender_email'])){
|
| 618 |
-
$sendermail = get_option( 'admin_email' );
|
| 619 |
}else{
|
| 620 |
-
$
|
| 621 |
-
if( false !== strpos($sendermail, '%')){
|
| 622 |
-
$ismail = self::get_slug_data( trim($sendermail, '%'), $form);
|
| 623 |
-
if(is_email( $ismail )){
|
| 624 |
-
$sendermail = $ismail;
|
| 625 |
-
}
|
| 626 |
-
}
|
| 627 |
}
|
| 628 |
-
// use summary
|
| 629 |
-
if(empty($form['mailer']['email_message'])){
|
| 630 |
-
$form['mailer']['email_message'] = "{summary}";
|
| 631 |
-
}
|
| 632 |
-
|
| 633 |
-
$mail = array(
|
| 634 |
-
'recipients' => array(),
|
| 635 |
-
'subject' => self::do_magic_tags($form['mailer']['email_subject']),
|
| 636 |
-
'message' => stripslashes( $form['mailer']['email_message'] ) ."\r\n",
|
| 637 |
-
'headers' => array(
|
| 638 |
-
self::do_magic_tags( 'From: ' . $sendername . ' <' . $sendermail . '>' ),
|
| 639 |
-
),
|
| 640 |
-
'attachments' => array()
|
| 641 |
-
);
|
| 642 |
|
| 643 |
-
// if added a bcc
|
| 644 |
-
$bcc_to = trim( $form['mailer']['bcc_to'] );
|
| 645 |
-
if( !empty( $bcc_to ) ){
|
| 646 |
-
$mail['headers'][] = self::do_magic_tags( 'Bcc: ' . $bcc_to );
|
| 647 |
-
}
|
| 648 |
|
| 649 |
-
// if added a replyto
|
| 650 |
-
$reply_to = trim( $form['mailer']['reply_to'] );
|
| 651 |
-
if( !empty( $reply_to ) ){
|
| 652 |
-
$mail['headers'][] = self::do_magic_tags( 'Reply-To: <' . $reply_to . '>' );
|
| 653 |
-
}
|
| 654 |
-
|
| 655 |
-
// Filter Mailer first as not to have user input be filtered
|
| 656 |
-
$mail['message'] = self::do_magic_tags($mail['message']);
|
| 657 |
-
|
| 658 |
-
if($form['mailer']['email_type'] == 'html'){
|
| 659 |
-
$mail['headers'][] = "Content-type: text/html";
|
| 660 |
-
$mail['message'] = wpautop( $mail['message'] );
|
| 661 |
-
}
|
| 662 |
-
|
| 663 |
-
// get tags
|
| 664 |
-
preg_match_all("/%(.+?)%/", $mail['message'], $hastags);
|
| 665 |
-
if(!empty($hastags[1])){
|
| 666 |
-
foreach($hastags[1] as $tag_key=>$tag){
|
| 667 |
-
$tagval = self::get_slug_data($tag, $form);
|
| 668 |
-
if(is_array($tagval)){
|
| 669 |
-
$tagval = implode(', ', $tagval);
|
| 670 |
-
}
|
| 671 |
-
$mail['message'] = str_replace($hastags[0][$tag_key], $tagval, $mail['message']);
|
| 672 |
-
}
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
//$mail['message']
|
| 676 |
-
|
| 677 |
-
// ifs
|
| 678 |
-
preg_match_all("/\[if (.+?)?\](?:(.+?)?\[\/if\])?/", $mail['message'], $hasifs);
|
| 679 |
-
if(!empty($hasifs[1])){
|
| 680 |
-
// process ifs
|
| 681 |
-
foreach($hasifs[0] as $if_key=>$if_tag){
|
| 682 |
-
|
| 683 |
-
$content = explode('[else]', $hasifs[2][$if_key]);
|
| 684 |
-
if(empty($content[1])){
|
| 685 |
-
$content[1] = '';
|
| 686 |
-
}
|
| 687 |
-
$vars = shortcode_parse_atts( $hasifs[1][$if_key]);
|
| 688 |
-
foreach($vars as $varkey=>$varval){
|
| 689 |
-
if(is_string($varkey)){
|
| 690 |
-
$var = self::get_slug_data($varkey, $form);
|
| 691 |
-
if( in_array($varval, (array) $var) ){
|
| 692 |
-
// yes show code
|
| 693 |
-
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[0], $mail['message']);
|
| 694 |
-
}else{
|
| 695 |
-
// nope- no code
|
| 696 |
-
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[1], $mail['message']);
|
| 697 |
-
}
|
| 698 |
-
}else{
|
| 699 |
-
$var = self::get_slug_data($varval, $form);
|
| 700 |
-
if(!empty($var)){
|
| 701 |
-
// show code
|
| 702 |
-
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[0], $mail['message']);
|
| 703 |
-
}else{
|
| 704 |
-
// no code
|
| 705 |
-
$mail['message'] = str_replace( $hasifs[0][$if_key], $content[1], $mail['message']);
|
| 706 |
-
}
|
| 707 |
-
}
|
| 708 |
-
}
|
| 709 |
-
}
|
| 710 |
-
|
| 711 |
-
}
|
| 712 |
-
|
| 713 |
-
|
| 714 |
-
if(!empty($form['mailer']['recipients'])){
|
| 715 |
-
$mail['recipients'] = explode(',', self::do_magic_tags( $form['mailer']['recipients']) );
|
| 716 |
-
}else{
|
| 717 |
-
$mail['recipients'][] = get_option( 'admin_email' );
|
| 718 |
-
}
|
| 719 |
-
|
| 720 |
-
$data = self::get_submission_data($form);
|
| 721 |
-
|
| 722 |
-
$submission = array();
|
| 723 |
-
foreach ($data as $field_id=>$row) {
|
| 724 |
-
if($row === null || !isset($form['fields'][$field_id]) ){
|
| 725 |
-
continue;
|
| 726 |
-
}
|
| 727 |
-
|
| 728 |
-
$key = $form['fields'][$field_id]['slug'];
|
| 729 |
-
if(is_array($row)){
|
| 730 |
-
if(!empty($row)){
|
| 731 |
-
$keys = array_keys($row);
|
| 732 |
-
if(is_int($keys[0])){
|
| 733 |
-
$row = implode(', ', $row);
|
| 734 |
-
}else{
|
| 735 |
-
$tmp = array();
|
| 736 |
-
foreach($row as $linekey=>$item){
|
| 737 |
-
if(is_array($item)){
|
| 738 |
-
$item = '( ' . implode(', ', $item).' )';
|
| 739 |
-
}
|
| 740 |
-
$tmp[] = $linekey.': '.$item;
|
| 741 |
-
}
|
| 742 |
-
$row = implode(', ', $tmp);
|
| 743 |
-
}
|
| 744 |
-
}else{
|
| 745 |
-
$row = null;
|
| 746 |
-
}
|
| 747 |
-
}
|
| 748 |
-
$mail['message'] = str_replace('%'.$key.'%', $row, $mail['message']);
|
| 749 |
-
$mail['subject'] = str_replace('%'.$key.'%', $row, $mail['subject']);
|
| 750 |
-
|
| 751 |
-
$submission[] = $row;
|
| 752 |
-
$labels[] = $form['fields'][$field_id]['label'];
|
| 753 |
-
}
|
| 754 |
-
|
| 755 |
-
// final magic
|
| 756 |
-
$mail['message'] = self::do_magic_tags( $mail['message'] );
|
| 757 |
-
$mail['subject'] = self::do_magic_tags( $mail['subject'] );
|
| 758 |
-
|
| 759 |
-
// CSV
|
| 760 |
-
if(!empty($form['mailer']['csv_data'])){
|
| 761 |
-
ob_start();
|
| 762 |
-
$df = fopen("php://output", 'w');
|
| 763 |
-
fputcsv($df, $labels);
|
| 764 |
-
fputcsv($df, $submission);
|
| 765 |
-
fclose($df);
|
| 766 |
-
$csv = ob_get_clean();
|
| 767 |
-
$csvfile = wp_upload_bits( uniqid().'.csv', null, $csv );
|
| 768 |
-
if( isset( $csvfile['file'] ) && false == $csvfile['error'] && file_exists( $csvfile['file'] ) ){
|
| 769 |
-
$mail['attachments'][] = $csvfile['file'];
|
| 770 |
-
}
|
| 771 |
-
}
|
| 772 |
-
|
| 773 |
-
if(empty($mail)){
|
| 774 |
-
return;
|
| 775 |
-
}
|
| 776 |
-
|
| 777 |
-
$mail = apply_filters( 'caldera_forms_mailer', $mail, $data, $form);
|
| 778 |
-
|
| 779 |
-
/*// recipients
|
| 780 |
-
foreach($mail['recipients'] as &$recipient){
|
| 781 |
-
// trim spaces
|
| 782 |
-
$recipient = trim($recipient);
|
| 783 |
-
}
|
| 784 |
-
$recipients = implode(',', $mail['recipients']);
|
| 785 |
-
*/
|
| 786 |
-
$headers = implode("\r\n", $mail['headers']);
|
| 787 |
-
|
| 788 |
-
do_action( 'caldera_forms_do_mailer', $mail, $data, $form);
|
| 789 |
-
|
| 790 |
-
// force message to string.
|
| 791 |
-
if( is_array( $mail['message'] ) ){
|
| 792 |
-
$mail['message'] = implode( "\n", $mail['message'] );
|
| 793 |
-
}
|
| 794 |
-
|
| 795 |
-
if( ! empty( $mail ) ){
|
| 796 |
-
|
| 797 |
-
// is send debug enabled?
|
| 798 |
-
if( !empty( $form['debug_mailer'] ) ){
|
| 799 |
-
add_action( 'phpmailer_init', array( 'Caldera_Forms', 'debug_mail_send' ), 1000 );
|
| 800 |
-
}
|
| 801 |
-
|
| 802 |
-
if( wp_mail( (array) $mail['recipients'], $mail['subject'], stripslashes( $mail['message'] ), $headers, $mail['attachments'] )){
|
| 803 |
-
|
| 804 |
-
// kill attachment.
|
| 805 |
-
if(!empty($csvfile['file'])){
|
| 806 |
-
if(file_exists($csvfile['file'])){
|
| 807 |
-
unlink($csvfile['file']);
|
| 808 |
-
}
|
| 809 |
-
}
|
| 810 |
-
}
|
| 811 |
-
}else{
|
| 812 |
-
if(!empty($csvfile['file'])){
|
| 813 |
-
if(file_exists($csvfile['file'])){
|
| 814 |
-
unlink($csvfile['file']);
|
| 815 |
-
}
|
| 816 |
-
}
|
| 817 |
-
}
|
| 818 |
|
| 819 |
}
|
|
|
|
| 820 |
/**
|
| 821 |
-
*
|
| 822 |
*
|
|
|
|
| 823 |
*/
|
| 824 |
public static function debug_mail_send( $phpmailer ) {
|
| 825 |
global $transdata, $wpdb;
|
|
@@ -865,6 +631,14 @@ class Caldera_Forms {
|
|
| 865 |
return self::$instance;
|
| 866 |
}
|
| 867 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 868 |
public static function override_redirect_notice($notices, $form){
|
| 869 |
|
| 870 |
if(isset($form['processors'])){
|
|
@@ -878,6 +652,15 @@ class Caldera_Forms {
|
|
| 878 |
return $notices;
|
| 879 |
}
|
| 880 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 881 |
public static function do_redirect($referrer, $form, $processid){
|
| 882 |
if(isset($form['processors'])){
|
| 883 |
foreach($form['processors'] as $processor){
|
|
@@ -924,6 +707,12 @@ class Caldera_Forms {
|
|
| 924 |
return $referrer;
|
| 925 |
}
|
| 926 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 927 |
public static function send_auto_response($config, $form){
|
| 928 |
global $form;
|
| 929 |
|
|
@@ -961,12 +750,37 @@ class Caldera_Forms {
|
|
| 961 |
do_action( 'caldera_forms_do_autoresponse', $config, $form);
|
| 962 |
|
| 963 |
// send mail
|
| 964 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 965 |
|
| 966 |
}
|
| 967 |
|
| 968 |
|
| 969 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 970 |
public function get_form_processors($processors){
|
| 971 |
$internal_processors = array(
|
| 972 |
'auto_responder' => array(
|
|
@@ -1012,7 +826,14 @@ class Caldera_Forms {
|
|
| 1012 |
|
| 1013 |
}
|
| 1014 |
|
| 1015 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1016 |
public function increment_value( $config, $form ){
|
| 1017 |
|
| 1018 |
// get increment value;
|
|
@@ -1029,6 +850,14 @@ class Caldera_Forms {
|
|
| 1029 |
}
|
| 1030 |
|
| 1031 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1032 |
static public function akismet_scanner($config, $form){
|
| 1033 |
global $post;
|
| 1034 |
|
|
@@ -1101,7 +930,15 @@ class Caldera_Forms {
|
|
| 1101 |
|
| 1102 |
}
|
| 1103 |
|
| 1104 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1105 |
static public function run_calculation($value, $field, $form){
|
| 1106 |
|
| 1107 |
$formula = $field['config']['formular'];
|
|
@@ -1146,16 +983,32 @@ class Caldera_Forms {
|
|
| 1146 |
|
| 1147 |
$total = create_function(null, 'return '.$formula.';');
|
| 1148 |
if(isset($field['config']['fixed'])){
|
| 1149 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1150 |
}
|
| 1151 |
return $total();
|
| 1152 |
}
|
| 1153 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1154 |
static public function calculations_templates(){
|
| 1155 |
include CFCORE_PATH . "fields/calculation/line-templates.php";
|
| 1156 |
}
|
| 1157 |
|
| 1158 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1159 |
public function get_internal_field_types($fields){
|
| 1160 |
|
| 1161 |
|
|
@@ -1259,7 +1112,7 @@ class Caldera_Forms {
|
|
| 1259 |
"field" => __('Phone Number', 'caldera-forms'),
|
| 1260 |
"description" => __('Phone number with masking', 'caldera-forms'),
|
| 1261 |
"file" => CFCORE_PATH . "fields/phone/field.php",
|
| 1262 |
-
"category" => __("Text Fields", "caldera-forms").', '.__("
|
| 1263 |
"setup" => array(
|
| 1264 |
"template" => CFCORE_PATH . "fields/phone/config.php",
|
| 1265 |
"preview" => CFCORE_PATH . "fields/phone/preview.php",
|
|
@@ -1549,7 +1402,7 @@ class Caldera_Forms {
|
|
| 1549 |
"field" => __("State/ Province Select", "caldera-forms"),
|
| 1550 |
"description" => __('Dropdown select for US states and Canadian provinces.', 'caldera-forms'),
|
| 1551 |
"file" => CFCORE_PATH . "fields/states/field.php",
|
| 1552 |
-
"category" => __("Select Options", "caldera-forms")
|
| 1553 |
"placeholder" => false,
|
| 1554 |
//"viewer" => array($this, 'filter_options_calculator'),
|
| 1555 |
"setup" => array(
|
|
@@ -1560,14 +1413,41 @@ class Caldera_Forms {
|
|
| 1560 |
),
|
| 1561 |
)
|
| 1562 |
),
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1563 |
);
|
| 1564 |
|
| 1565 |
return array_merge( $fields, $internal_fields );
|
| 1566 |
|
| 1567 |
-
}
|
| 1568 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1569 |
function filter_options_calculator($value,$field,$form){
|
| 1570 |
-
//
|
| 1571 |
if(!empty($form)){
|
| 1572 |
foreach($form['fields'] as $field_id => $field_conf){
|
| 1573 |
if($field_conf['type'] !== 'calculation'){
|
|
@@ -1600,6 +1480,32 @@ class Caldera_Forms {
|
|
| 1600 |
return $value;
|
| 1601 |
}
|
| 1602 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1603 |
public function auto_populate_options_field($field, $form){
|
| 1604 |
|
| 1605 |
if(!empty($field['config']['auto'])){
|
|
@@ -1607,7 +1513,11 @@ class Caldera_Forms {
|
|
| 1607 |
switch($field['config']['auto_type']){
|
| 1608 |
case 'post_type':
|
| 1609 |
$posts = get_posts( array('post_type' => $field['config']['post_type'], 'post_status' => 'publish', 'posts_per_page' => -1) );
|
| 1610 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1611 |
/**
|
| 1612 |
* Filter which field is used for the VALUE when getting autopopulate option values when autopopulating options from post types
|
| 1613 |
*
|
|
@@ -1620,7 +1530,7 @@ class Caldera_Forms {
|
|
| 1620 |
* @param array $form Config for the form.
|
| 1621 |
* @param array $posts Current post collection.
|
| 1622 |
*/
|
| 1623 |
-
$field_for_value = apply_filters( 'caldera_forms_autopopulate_options_post_value_field', '
|
| 1624 |
$field[ 'config' ][ 'value_field' ] = $field_for_value;
|
| 1625 |
|
| 1626 |
/**
|
|
@@ -1658,7 +1568,7 @@ class Caldera_Forms {
|
|
| 1658 |
* @param array $form Config for the form.
|
| 1659 |
* @param array $posts Current term collection.
|
| 1660 |
*/
|
| 1661 |
-
$field_for_value = apply_filters( 'caldera_forms_autopopulate_options_taxonomy_value_field', '
|
| 1662 |
$field[ 'config' ][ 'value_field' ] = $field_for_value;
|
| 1663 |
|
| 1664 |
/**
|
|
@@ -1708,6 +1618,15 @@ class Caldera_Forms {
|
|
| 1708 |
|
| 1709 |
}
|
| 1710 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1711 |
static public function check_condition($conditions, $form, $entry_id=null){
|
| 1712 |
|
| 1713 |
$trues = array();
|
|
@@ -1846,6 +1765,14 @@ class Caldera_Forms {
|
|
| 1846 |
}
|
| 1847 |
|
| 1848 |
// FRONT END STUFFF
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1849 |
static public function form_redirect($type, $url, $form, $processid){
|
| 1850 |
|
| 1851 |
$url = apply_filters( 'caldera_forms_redirect_url', $url, $form, $processid);
|
|
@@ -1858,10 +1785,16 @@ class Caldera_Forms {
|
|
| 1858 |
wp_redirect( $url );
|
| 1859 |
exit;
|
| 1860 |
}
|
|
|
|
| 1861 |
}
|
| 1862 |
-
// magic tags
|
| 1863 |
|
| 1864 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1865 |
public function set_magic_tags($tags){
|
| 1866 |
|
| 1867 |
// get internal tags
|
|
@@ -1893,7 +1826,11 @@ class Caldera_Forms {
|
|
| 1893 |
'date_picker'
|
| 1894 |
),
|
| 1895 |
'date:Y/m/d',
|
| 1896 |
-
'date:Y/d/m'
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1897 |
|
| 1898 |
);
|
| 1899 |
|
|
@@ -1902,8 +1839,9 @@ class Caldera_Forms {
|
|
| 1902 |
'tags' => $system_tags,
|
| 1903 |
'wrap' => array('{','}')
|
| 1904 |
);
|
|
|
|
| 1905 |
// get processor tags
|
| 1906 |
-
$processors =
|
| 1907 |
if(!empty($processors)){
|
| 1908 |
foreach($processors as $processor_key=>$processor){
|
| 1909 |
if(isset($processor['magic_tags'])){
|
|
@@ -1942,7 +1880,16 @@ class Caldera_Forms {
|
|
| 1942 |
return $tags;
|
| 1943 |
}
|
| 1944 |
|
| 1945 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1946 |
|
| 1947 |
global $processed_meta, $form, $referrer;
|
| 1948 |
/// get meta entry for magic tags defined.
|
|
@@ -2083,7 +2030,6 @@ class Caldera_Forms {
|
|
| 2083 |
$magic_tag = null;
|
| 2084 |
}
|
| 2085 |
break;
|
| 2086 |
-
|
| 2087 |
}
|
| 2088 |
}else{
|
| 2089 |
switch ($magic_tag) {
|
|
@@ -2167,6 +2113,20 @@ class Caldera_Forms {
|
|
| 2167 |
}
|
| 2168 |
}
|
| 2169 |
break;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2170 |
}
|
| 2171 |
}
|
| 2172 |
|
|
@@ -2272,7 +2232,11 @@ class Caldera_Forms {
|
|
| 2272 |
return $value;
|
| 2273 |
}
|
| 2274 |
|
| 2275 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2276 |
static public function get_field_types(){
|
| 2277 |
//global $field_types;
|
| 2278 |
//if(!empty($field_types)){
|
|
@@ -2292,8 +2256,17 @@ class Caldera_Forms {
|
|
| 2292 |
}
|
| 2293 |
|
| 2294 |
return $field_types;
|
|
|
|
| 2295 |
}
|
| 2296 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2297 |
static public function get_processor_by_type($type, $form){
|
| 2298 |
if(is_string($form)){
|
| 2299 |
$form_cfg = self::get_form( $form );
|
|
@@ -2320,6 +2293,16 @@ class Caldera_Forms {
|
|
| 2320 |
return false;
|
| 2321 |
}
|
| 2322 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2323 |
static public function set_submission_meta($key, $value, $form, $processor_id='meta'){
|
| 2324 |
global $processed_meta;
|
| 2325 |
|
|
@@ -2339,6 +2322,16 @@ class Caldera_Forms {
|
|
| 2339 |
}
|
| 2340 |
}
|
| 2341 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2342 |
static public function set_field_data($field_id, $data, $form, $entry_id = false){
|
| 2343 |
global $processed_data;
|
| 2344 |
|
|
@@ -2369,6 +2362,15 @@ class Caldera_Forms {
|
|
| 2369 |
return true;
|
| 2370 |
}
|
| 2371 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2372 |
static public function get_field_data($field_id, $form, $entry_id = false){
|
| 2373 |
global $processed_data;
|
| 2374 |
|
|
@@ -2529,6 +2531,15 @@ class Caldera_Forms {
|
|
| 2529 |
|
| 2530 |
return null;
|
| 2531 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2532 |
static public function get_field_by_slug($slug, $form){
|
| 2533 |
|
| 2534 |
foreach($form['fields'] as $field_id=>$field){
|
|
@@ -2542,7 +2553,17 @@ class Caldera_Forms {
|
|
| 2542 |
|
| 2543 |
return false;
|
| 2544 |
|
| 2545 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2546 |
static public function get_slug_data($slug, $form, $entry_id = false){
|
| 2547 |
|
| 2548 |
|
|
@@ -2563,7 +2584,16 @@ class Caldera_Forms {
|
|
| 2563 |
}
|
| 2564 |
}
|
| 2565 |
|
| 2566 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2567 |
static public function get_entry_detail($entry_id, $form = null){
|
| 2568 |
global $wpdb, $form;
|
| 2569 |
|
|
@@ -2585,6 +2615,15 @@ class Caldera_Forms {
|
|
| 2585 |
return $entry;
|
| 2586 |
}
|
| 2587 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2588 |
static public function get_entry_meta($entry_id, $form, $type = null){
|
| 2589 |
global $wpdb;
|
| 2590 |
|
|
@@ -2696,6 +2735,13 @@ class Caldera_Forms {
|
|
| 2696 |
return $entry_meta;
|
| 2697 |
}
|
| 2698 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2699 |
static public function get_submission_data($form, $entry_id = false){
|
| 2700 |
global $processed_data;
|
| 2701 |
|
|
@@ -2734,6 +2780,9 @@ class Caldera_Forms {
|
|
| 2734 |
return $processed_data[$indexkey];
|
| 2735 |
}
|
| 2736 |
|
|
|
|
|
|
|
|
|
|
| 2737 |
static public function process_submission(){
|
| 2738 |
global $post;
|
| 2739 |
global $front_templates;
|
|
@@ -3323,37 +3372,14 @@ class Caldera_Forms {
|
|
| 3323 |
return self::form_redirect('complete', $referrer, $form, $process_id );
|
| 3324 |
}
|
| 3325 |
|
| 3326 |
-
static public function cf_init_system(){
|
| 3327 |
-
|
| 3328 |
-
global $post, $front_templates, $wp_query, $process_id, $form;
|
| 3329 |
|
| 3330 |
-
|
| 3331 |
-
|
| 3332 |
-
|
| 3333 |
-
|
| 3334 |
-
|
| 3335 |
-
if($form['ID'] === $wp_query->query_vars['cf_api']){
|
| 3336 |
-
// got it!
|
| 3337 |
-
// need entry?
|
| 3338 |
-
if(!empty($wp_query->query_vars['cf_entry'])){
|
| 3339 |
-
$entry = Caldera_Forms::get_entry($wp_query->query_vars['cf_entry'], $form);
|
| 3340 |
-
wp_send_json( $entry );
|
| 3341 |
-
}
|
| 3342 |
-
// is a post?
|
| 3343 |
-
if( $_SERVER['REQUEST_METHOD'] === 'POST' ){
|
| 3344 |
-
|
| 3345 |
-
$_POST['_wp_http_referer_true'] = 'api';
|
| 3346 |
-
$_POST['_cf_frm_id'] = $_POST['cfajax'] = $wp_query->query_vars['cf_api'];
|
| 3347 |
-
|
| 3348 |
-
$submission = Caldera_Forms::process_submission();
|
| 3349 |
-
|
| 3350 |
-
}
|
| 3351 |
|
| 3352 |
-
|
| 3353 |
-
die;
|
| 3354 |
-
}
|
| 3355 |
-
}
|
| 3356 |
-
}
|
| 3357 |
|
| 3358 |
if(!empty($_GET['cf_preview'])){
|
| 3359 |
$form = self::get_form( $_GET['cf_preview'] );
|
|
@@ -3392,6 +3418,41 @@ class Caldera_Forms {
|
|
| 3392 |
|
| 3393 |
}
|
| 3394 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3395 |
|
| 3396 |
// catch a transient process
|
| 3397 |
if(!empty($_GET['cf_tp'])){
|
|
@@ -3407,7 +3468,7 @@ class Caldera_Forms {
|
|
| 3407 |
}
|
| 3408 |
|
| 3409 |
|
| 3410 |
-
// hook into
|
| 3411 |
if(isset($_POST['_cf_verify']) && isset( $_POST['_cf_frm_id'] )){
|
| 3412 |
if(wp_verify_nonce( $_POST['_cf_verify'], 'caldera_forms_front' )){
|
| 3413 |
|
|
@@ -3564,7 +3625,15 @@ class Caldera_Forms {
|
|
| 3564 |
}
|
| 3565 |
}
|
| 3566 |
|
| 3567 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3568 |
static function search_array_fields($needle, $haystack, $found = array()){
|
| 3569 |
|
| 3570 |
if(is_array($needle)){
|
|
@@ -3578,7 +3647,15 @@ class Caldera_Forms {
|
|
| 3578 |
}
|
| 3579 |
return $found;
|
| 3580 |
}
|
| 3581 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3582 |
static public function get_entry($entry_id = null, $form = null){
|
| 3583 |
|
| 3584 |
if(empty($entry_id)){
|
|
@@ -3634,9 +3711,33 @@ class Caldera_Forms {
|
|
| 3634 |
//not_supported
|
| 3635 |
|
| 3636 |
$field = $form['fields'][$field_id];
|
| 3637 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3638 |
$field = apply_filters( 'caldera_forms_render_get_field', $field, $form);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3639 |
$field = apply_filters( 'caldera_forms_render_get_field_type-' . $field['type'], $field, $form);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3640 |
$field = apply_filters( 'caldera_forms_render_get_field_slug-' . $field['slug'], $field, $form);
|
| 3641 |
|
| 3642 |
if( is_string( $field_value ) ){
|
|
@@ -3712,6 +3813,14 @@ class Caldera_Forms {
|
|
| 3712 |
return $data;
|
| 3713 |
}
|
| 3714 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3715 |
static public function render_modal_form($atts, $content){
|
| 3716 |
global $footer_modals;
|
| 3717 |
|
|
@@ -3775,12 +3884,25 @@ class Caldera_Forms {
|
|
| 3775 |
$footer_modals .= ob_get_clean();
|
| 3776 |
return $out;
|
| 3777 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3778 |
static public function render_footer_modals(){
|
| 3779 |
global $footer_modals;
|
| 3780 |
if(!empty($footer_modals)){
|
| 3781 |
echo $footer_modals;
|
| 3782 |
}
|
| 3783 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3784 |
static public function render_form($atts, $entry_id = null, $shortcode = null){
|
| 3785 |
|
| 3786 |
global $current_form_count, $form, $post;
|
|
@@ -3835,9 +3957,27 @@ class Caldera_Forms {
|
|
| 3835 |
if(!empty($atts['entry'])){
|
| 3836 |
$entry_id = self::do_magic_tags( $atts['entry'] );
|
| 3837 |
}
|
| 3838 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3839 |
$form = apply_filters( 'caldera_forms_render_get_form', $form );
|
| 3840 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3841 |
if(empty($form)){
|
| 3842 |
return;
|
| 3843 |
}
|
|
@@ -4417,8 +4557,7 @@ class Caldera_Forms {
|
|
| 4417 |
|
| 4418 |
wp_enqueue_script( 'cf-frontend-script-init', CFCORE_URL . 'assets/js/frontend-script-init.min.js', array('jquery'), self::VERSION, true);
|
| 4419 |
wp_enqueue_script( 'cf-frontend-fields', CFCORE_URL . 'assets/js/fields.min.js', array('jquery'), self::VERSION );
|
| 4420 |
-
|
| 4421 |
-
|
| 4422 |
return apply_filters( 'caldera_forms_render_form', $out, $form);
|
| 4423 |
|
| 4424 |
}
|
| 50 |
add_filter('caldera_forms_submit_redirect_complete', array( $this, 'do_redirect'),10, 4);
|
| 51 |
add_action('caldera_forms_edit_end', array($this, 'calculations_templates') );
|
| 52 |
add_filter('caldera_forms_render_get_field', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 53 |
+
add_filter('caldera_forms_render_get_field', array( $this, 'apply_conditional_groups' ), 10, 2);
|
| 54 |
//add_filter('caldera_forms_render_get_field_type-radio', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 55 |
//add_filter('caldera_forms_render_get_field_type-checkbox', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 56 |
//add_filter('caldera_forms_render_get_field_type-dropdown', array( $this, 'auto_populate_options_field' ), 10, 2);
|
| 68 |
|
| 69 |
add_action("wp_ajax_get_entry", array( $this, 'get_entry') );
|
| 70 |
// find if profile is loaded
|
| 71 |
+
add_action('init', array( $this, 'cf_init_system'));
|
| 72 |
+
add_action('wp', array( $this, 'cf_init_preview'));
|
| 73 |
|
| 74 |
// render shortcode
|
| 75 |
add_shortcode( 'caldera_form', array( $this, 'render_form') );
|
| 88 |
|
| 89 |
}
|
| 90 |
|
| 91 |
+
/**
|
| 92 |
+
* Load a form by ID or name
|
| 93 |
+
*
|
| 94 |
+
* @param string $id_name ID or name of form.
|
| 95 |
+
*
|
| 96 |
+
* @return array|null Form config array if found. If not null.
|
| 97 |
+
*/
|
| 98 |
public static function get_form( $id_name ){
|
| 99 |
|
| 100 |
$id_name = sanitize_text_field( $id_name );
|
| 130 |
|
| 131 |
}
|
| 132 |
|
| 133 |
+
/**
|
| 134 |
+
* Load all forms
|
| 135 |
+
*
|
| 136 |
+
* @param bool $internal Optional. If false, the default, all forms are returned. If true, only those saved in DB are returned.
|
| 137 |
+
*
|
| 138 |
+
* @return mixed|void
|
| 139 |
+
*/
|
| 140 |
public static function get_forms( $internal = false ){
|
| 141 |
|
| 142 |
$base_forms = get_option( '_caldera_forms', array() );
|
| 175 |
load_plugin_textdomain( $this->plugin_slug, FALSE, basename( CFCORE_PATH ) . '/languages');
|
| 176 |
}
|
| 177 |
|
| 178 |
+
/**
|
| 179 |
+
* Activate and setip plugin
|
| 180 |
+
*/
|
| 181 |
public static function activate_caldera_forms(){
|
| 182 |
global $wpdb;
|
| 183 |
|
| 296 |
|
| 297 |
}
|
| 298 |
|
| 299 |
+
/**
|
| 300 |
+
* View a star rating form value
|
| 301 |
+
*
|
| 302 |
+
* @param int $value Value for star ratring
|
| 303 |
+
* @param array $field Field config
|
| 304 |
+
* @param array $form Form config
|
| 305 |
+
*
|
| 306 |
+
* @return string HTML markup
|
| 307 |
+
*/
|
| 308 |
public static function star_rating_viewer($value, $field, $form){
|
| 309 |
if(!is_admin()){
|
| 310 |
// only for the front
|
| 326 |
return $out;
|
| 327 |
}
|
| 328 |
|
| 329 |
+
/**
|
| 330 |
+
* Output markup for file fields
|
| 331 |
+
*
|
| 332 |
+
* @param array $value Saved file paths
|
| 333 |
+
* @param array $field Field config
|
| 334 |
+
* @param array $form Form config
|
| 335 |
+
*
|
| 336 |
+
* @return string
|
| 337 |
+
*/
|
| 338 |
public static function handle_file_view($value, $field, $form){
|
| 339 |
+
$out = array();
|
| 340 |
+
foreach( (array) $value as $file_url ){
|
| 341 |
+
$out[] = '<a href="' . $file_url .'" target="_blank">' . basename($file_url) .'</a>';
|
| 342 |
}
|
| 343 |
+
return implode(', ', $out );
|
| 344 |
+
}
|
| 345 |
|
|
|
|
| 346 |
|
| 347 |
+
/**
|
| 348 |
+
* Prepare email attachments
|
| 349 |
+
*
|
| 350 |
+
* @param array $mail Email data
|
| 351 |
+
* @param array $data ?
|
| 352 |
+
* @param array $form For config
|
| 353 |
+
*
|
| 354 |
+
* @return array
|
| 355 |
+
*/
|
| 356 |
public static function mail_attachment_check($mail, $data, $form){
|
| 357 |
|
| 358 |
// check for
|
| 361 |
|
| 362 |
$dir = wp_upload_dir();
|
| 363 |
$file = str_replace($dir['baseurl'], $dir['basedir'], self::get_field_data($field_id, $form));
|
| 364 |
+
if( is_String( $file ) && file_exists($file)){
|
| 365 |
$mail['attachments'][] = $file;
|
| 366 |
}
|
| 367 |
|
| 370 |
return $mail;
|
| 371 |
}
|
| 372 |
|
| 373 |
+
/**
|
| 374 |
+
* Check a captcha
|
| 375 |
+
*
|
| 376 |
+
* @param string $value Attempted captcha value
|
| 377 |
+
* @param array $field Field config
|
| 378 |
+
* @param array $form Form config
|
| 379 |
+
*
|
| 380 |
+
* @return bool|\WP_Error True if valid, WP_Error if not
|
| 381 |
+
*/
|
| 382 |
public static function captcha_check($value, $field, $form){
|
| 383 |
|
| 384 |
if( !isset( $_POST['g-recaptcha-response'] ) || empty( $_POST['g-recaptcha-response'] )){
|
| 400 |
|
| 401 |
}
|
| 402 |
|
| 403 |
+
/**
|
| 404 |
+
* Update saved entry data for a field.
|
| 405 |
+
*
|
| 406 |
+
* @param array $field Field config
|
| 407 |
+
* @param int $entry_id The entry ID
|
| 408 |
+
* @param array $form Form config
|
| 409 |
+
*/
|
| 410 |
public static function update_field_data($field, $entry_id, $form){
|
| 411 |
global $wpdb, $form;
|
| 412 |
|
| 451 |
|
| 452 |
}
|
| 453 |
|
| 454 |
+
/**
|
| 455 |
+
* Save entry data for a field.
|
| 456 |
+
*
|
| 457 |
+
* @param array $field Field config
|
| 458 |
+
* @param int $entry_id The entry ID
|
| 459 |
+
* @param array $form Form config
|
| 460 |
+
*/
|
| 461 |
public static function save_field_data($field, $entry_id, $form){
|
| 462 |
global $wpdb, $form;
|
| 463 |
|
| 515 |
|
| 516 |
}
|
| 517 |
|
| 518 |
+
/**
|
| 519 |
+
* Save final form data
|
| 520 |
+
*
|
| 521 |
+
* @param array $form Form config
|
| 522 |
+
*
|
| 523 |
+
* @return void|\WP_Error
|
| 524 |
+
*/
|
| 525 |
public static function save_final_form($form){
|
| 526 |
+
$entryid = null;
|
|
|
|
| 527 |
// check submit type (new or update)
|
| 528 |
if(isset($_POST['_cf_frm_edt'])){
|
| 529 |
// is edit
|
| 530 |
//check user can edit this item.
|
| 531 |
$user_id = get_current_user_id();
|
| 532 |
+
$details = Caldera_Forms::get_entry_detail($_POST['_cf_frm_edt'], $form);
|
| 533 |
|
| 534 |
// check token
|
| 535 |
if(isset($_POST['_cf_frm_edt_tkn'])){
|
| 550 |
|
| 551 |
}else{
|
| 552 |
|
| 553 |
+
if(!empty($user_id)){
|
| 554 |
if(!empty($details)){
|
| 555 |
// check user can edit
|
| 556 |
if( current_user_can( 'edit_posts' ) || $details['user_id'] === $user_id ){
|
| 565 |
|
| 566 |
}
|
| 567 |
|
| 568 |
+
// pull in the class
|
| 569 |
+
include_once CFCORE_PATH . 'classes/Caldera_Forms_Save_Final.php';
|
| 570 |
|
| 571 |
+
if(! empty( $form[ 'db_support' ] ) ) {
|
| 572 |
+
Caldera_Forms_Save_Final::save_in_db( $form, $entryid );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 573 |
}
|
| 574 |
|
| 575 |
if(empty($form['mailer']['enable_mailer'])){
|
| 576 |
return;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 577 |
}else{
|
| 578 |
+
Caldera_Forms_Save_Final::do_mailer( $form, $entryid );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 579 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 580 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 581 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 582 |
|
| 583 |
}
|
| 584 |
+
|
| 585 |
/**
|
| 586 |
+
* Creates a send log to debug mailer problems
|
| 587 |
*
|
| 588 |
+
* @param object $phpmailer The phpmailer object
|
| 589 |
*/
|
| 590 |
public static function debug_mail_send( $phpmailer ) {
|
| 591 |
global $transdata, $wpdb;
|
| 631 |
return self::$instance;
|
| 632 |
}
|
| 633 |
|
| 634 |
+
/**
|
| 635 |
+
* Change redirect notices using magic tags.
|
| 636 |
+
*
|
| 637 |
+
* @param array $notices Current notices
|
| 638 |
+
* @param array $form Form config
|
| 639 |
+
*
|
| 640 |
+
* @return array
|
| 641 |
+
*/
|
| 642 |
public static function override_redirect_notice($notices, $form){
|
| 643 |
|
| 644 |
if(isset($form['processors'])){
|
| 652 |
return $notices;
|
| 653 |
}
|
| 654 |
|
| 655 |
+
/**
|
| 656 |
+
* Do the redirect
|
| 657 |
+
*
|
| 658 |
+
* @param string $referrer Reffering URL
|
| 659 |
+
* @param array $form Form config
|
| 660 |
+
* @param $processid
|
| 661 |
+
*
|
| 662 |
+
* @return string URL to redirect to.
|
| 663 |
+
*/
|
| 664 |
public static function do_redirect($referrer, $form, $processid){
|
| 665 |
if(isset($form['processors'])){
|
| 666 |
foreach($form['processors'] as $processor){
|
| 707 |
return $referrer;
|
| 708 |
}
|
| 709 |
|
| 710 |
+
/**
|
| 711 |
+
* Send an autoresponse email.
|
| 712 |
+
*
|
| 713 |
+
* @param array $config Processor config
|
| 714 |
+
* @param array $form Form config
|
| 715 |
+
*/
|
| 716 |
public static function send_auto_response($config, $form){
|
| 717 |
global $form;
|
| 718 |
|
| 750 |
do_action( 'caldera_forms_do_autoresponse', $config, $form);
|
| 751 |
|
| 752 |
// send mail
|
| 753 |
+
$sent = wp_mail(
|
| 754 |
+
$email_message['recipients'],
|
| 755 |
+
$email_message['subject'],
|
| 756 |
+
implode( "\r\n", (array) $email_message['message'] ),
|
| 757 |
+
implode("\r\n", (array) $email_message['headers']),
|
| 758 |
+
$email_message['attachments']
|
| 759 |
+
);
|
| 760 |
+
|
| 761 |
+
if ( ! $sent ) {
|
| 762 |
+
/**
|
| 763 |
+
* Fires if wp_mail returns false in autoresponder
|
| 764 |
+
*
|
| 765 |
+
* @since 1.2.3
|
| 766 |
+
*
|
| 767 |
+
* @param array $email_message Email data
|
| 768 |
+
* @param array $config Auto responder settings
|
| 769 |
+
* @param array $form The form config
|
| 770 |
+
*/
|
| 771 |
+
do_action( 'caldera_forms_autoresponder_failed', $email_message, $config, $form );
|
| 772 |
+
}
|
| 773 |
|
| 774 |
}
|
| 775 |
|
| 776 |
|
| 777 |
+
/**
|
| 778 |
+
* Load built-in form processors
|
| 779 |
+
*
|
| 780 |
+
* @param array $processors
|
| 781 |
+
*
|
| 782 |
+
* @return array
|
| 783 |
+
*/
|
| 784 |
public function get_form_processors($processors){
|
| 785 |
$internal_processors = array(
|
| 786 |
'auto_responder' => array(
|
| 826 |
|
| 827 |
}
|
| 828 |
|
| 829 |
+
/**
|
| 830 |
+
* Increment an internal value
|
| 831 |
+
*
|
| 832 |
+
* @param array $config Processor config
|
| 833 |
+
* @param array $form Form config
|
| 834 |
+
*
|
| 835 |
+
* @return array Key is new value.
|
| 836 |
+
*/
|
| 837 |
public function increment_value( $config, $form ){
|
| 838 |
|
| 839 |
// get increment value;
|
| 850 |
}
|
| 851 |
|
| 852 |
|
| 853 |
+
/**
|
| 854 |
+
* Apply Akismets
|
| 855 |
+
*
|
| 856 |
+
* @param array $config Processor config
|
| 857 |
+
* @param array $form Form config
|
| 858 |
+
*
|
| 859 |
+
* @return array
|
| 860 |
+
*/
|
| 861 |
static public function akismet_scanner($config, $form){
|
| 862 |
global $post;
|
| 863 |
|
| 930 |
|
| 931 |
}
|
| 932 |
|
| 933 |
+
/**
|
| 934 |
+
* Process a calculation field.
|
| 935 |
+
*
|
| 936 |
+
* @param string $value The calculation to run
|
| 937 |
+
* @param array $field Field config
|
| 938 |
+
* @param array $form Form config
|
| 939 |
+
*
|
| 940 |
+
* @return int|string
|
| 941 |
+
*/
|
| 942 |
static public function run_calculation($value, $field, $form){
|
| 943 |
|
| 944 |
$formula = $field['config']['formular'];
|
| 983 |
|
| 984 |
$total = create_function(null, 'return '.$formula.';');
|
| 985 |
if(isset($field['config']['fixed'])){
|
| 986 |
+
if( function_exists( 'money_format' ) ){
|
| 987 |
+
return money_format('%i', $total() );
|
| 988 |
+
}else{
|
| 989 |
+
return sprintf('%01.2f', $total() );
|
| 990 |
+
}
|
| 991 |
+
|
| 992 |
}
|
| 993 |
return $total();
|
| 994 |
}
|
| 995 |
|
| 996 |
+
/**
|
| 997 |
+
* Include the template for a calculation field
|
| 998 |
+
*
|
| 999 |
+
* @return string HTML for field.
|
| 1000 |
+
*/
|
| 1001 |
static public function calculations_templates(){
|
| 1002 |
include CFCORE_PATH . "fields/calculation/line-templates.php";
|
| 1003 |
}
|
| 1004 |
|
| 1005 |
+
/**
|
| 1006 |
+
* Load built-in fields
|
| 1007 |
+
*
|
| 1008 |
+
* @param array $fields
|
| 1009 |
+
*
|
| 1010 |
+
* @return array
|
| 1011 |
+
*/
|
| 1012 |
public function get_internal_field_types($fields){
|
| 1013 |
|
| 1014 |
|
| 1112 |
"field" => __('Phone Number', 'caldera-forms'),
|
| 1113 |
"description" => __('Phone number with masking', 'caldera-forms'),
|
| 1114 |
"file" => CFCORE_PATH . "fields/phone/field.php",
|
| 1115 |
+
"category" => __("Text Fields", "caldera-forms").', '.__("User", "caldera-forms"),
|
| 1116 |
"setup" => array(
|
| 1117 |
"template" => CFCORE_PATH . "fields/phone/config.php",
|
| 1118 |
"preview" => CFCORE_PATH . "fields/phone/preview.php",
|
| 1402 |
"field" => __("State/ Province Select", "caldera-forms"),
|
| 1403 |
"description" => __('Dropdown select for US states and Canadian provinces.', 'caldera-forms'),
|
| 1404 |
"file" => CFCORE_PATH . "fields/states/field.php",
|
| 1405 |
+
"category" => __("Select Options", "caldera-forms"),
|
| 1406 |
"placeholder" => false,
|
| 1407 |
//"viewer" => array($this, 'filter_options_calculator'),
|
| 1408 |
"setup" => array(
|
| 1413 |
),
|
| 1414 |
)
|
| 1415 |
),
|
| 1416 |
+
'filtered_select2' => array(
|
| 1417 |
+
"field" => __( 'Autocomplete', 'caldera-forms' ),
|
| 1418 |
+
"file" => CFCORE_PATH . "fields/select2/field/field.php",
|
| 1419 |
+
"category" => __("Pickers,Select Options", "caldera-forms"),
|
| 1420 |
+
"description" => 'Select2 dropdown',
|
| 1421 |
+
"options" => "multiple",
|
| 1422 |
+
"static" => true,
|
| 1423 |
+
"setup" => array(
|
| 1424 |
+
"template" => CFCORE_PATH . "fields/select2/field/config.php",
|
| 1425 |
+
"preview" => CFCORE_PATH . "fields/select2/field/preview.php",
|
| 1426 |
+
),
|
| 1427 |
+
"scripts" => array(
|
| 1428 |
+
CFCORE_URL . "fields/select2/js/select2.min.js",
|
| 1429 |
+
),
|
| 1430 |
+
"styles" => array(
|
| 1431 |
+
CFCORE_URL . "fields/select2/css/select2.css",
|
| 1432 |
+
)
|
| 1433 |
+
)
|
| 1434 |
);
|
| 1435 |
|
| 1436 |
return array_merge( $fields, $internal_fields );
|
| 1437 |
|
| 1438 |
+
}
|
| 1439 |
+
|
| 1440 |
+
/**
|
| 1441 |
+
* Check to see if the field is used in a calculation (use to display the label)
|
| 1442 |
+
*
|
| 1443 |
+
* @param string $value Value to filter.
|
| 1444 |
+
* @param array $field Field config.
|
| 1445 |
+
* @param array $form Form congig.
|
| 1446 |
+
*
|
| 1447 |
+
* @return array|string
|
| 1448 |
+
*/
|
| 1449 |
function filter_options_calculator($value,$field,$form){
|
| 1450 |
+
//
|
| 1451 |
if(!empty($form)){
|
| 1452 |
foreach($form['fields'] as $field_id => $field_conf){
|
| 1453 |
if($field_conf['type'] !== 'calculation'){
|
| 1480 |
return $value;
|
| 1481 |
}
|
| 1482 |
|
| 1483 |
+
/**
|
| 1484 |
+
* Applies the inline rules for fields conditionals
|
| 1485 |
+
*
|
| 1486 |
+
* @param array $field Field config
|
| 1487 |
+
* @param array $form Form config
|
| 1488 |
+
*
|
| 1489 |
+
* @return array Options for field
|
| 1490 |
+
*/
|
| 1491 |
+
public function apply_conditional_groups($field, $form){
|
| 1492 |
+
|
| 1493 |
+
if( !empty( $form['conditional_groups']['conditions'][ $field['conditions']['type'] ] ) ){
|
| 1494 |
+
$group = $form['conditional_groups']['conditions'][ $field['conditions']['type'] ];
|
| 1495 |
+
$field['conditions']['type'] = $group['type'];
|
| 1496 |
+
$field['conditions']['group'] = $group['group'];
|
| 1497 |
+
}
|
| 1498 |
+
|
| 1499 |
+
return $field;
|
| 1500 |
+
}
|
| 1501 |
+
/**
|
| 1502 |
+
* Default callback for auto populating select fields
|
| 1503 |
+
*
|
| 1504 |
+
* @param array $field Field config
|
| 1505 |
+
* @param array $form Form config
|
| 1506 |
+
*
|
| 1507 |
+
* @return array Options for field
|
| 1508 |
+
*/
|
| 1509 |
public function auto_populate_options_field($field, $form){
|
| 1510 |
|
| 1511 |
if(!empty($field['config']['auto'])){
|
| 1513 |
switch($field['config']['auto_type']){
|
| 1514 |
case 'post_type':
|
| 1515 |
$posts = get_posts( array('post_type' => $field['config']['post_type'], 'post_status' => 'publish', 'posts_per_page' => -1) );
|
| 1516 |
+
if( $field[ 'config' ][ 'value_field' ] === 'id' ){
|
| 1517 |
+
$field[ 'config' ][ 'value_field' ] = 'ID';
|
| 1518 |
+
}elseif( $field[ 'config' ][ 'value_field' ] === 'name' ){
|
| 1519 |
+
$field[ 'config' ][ 'value_field' ] = 'post_name';
|
| 1520 |
+
}
|
| 1521 |
/**
|
| 1522 |
* Filter which field is used for the VALUE when getting autopopulate option values when autopopulating options from post types
|
| 1523 |
*
|
| 1530 |
* @param array $form Config for the form.
|
| 1531 |
* @param array $posts Current post collection.
|
| 1532 |
*/
|
| 1533 |
+
$field_for_value = apply_filters( 'caldera_forms_autopopulate_options_post_value_field', $field[ 'config' ][ 'value_field' ], $field, $form, $posts );
|
| 1534 |
$field[ 'config' ][ 'value_field' ] = $field_for_value;
|
| 1535 |
|
| 1536 |
/**
|
| 1568 |
* @param array $form Config for the form.
|
| 1569 |
* @param array $posts Current term collection.
|
| 1570 |
*/
|
| 1571 |
+
$field_for_value = apply_filters( 'caldera_forms_autopopulate_options_taxonomy_value_field', $field[ 'config' ][ 'value_field' ], $field, $form, $terms );
|
| 1572 |
$field[ 'config' ][ 'value_field' ] = $field_for_value;
|
| 1573 |
|
| 1574 |
/**
|
| 1618 |
|
| 1619 |
}
|
| 1620 |
|
| 1621 |
+
/**
|
| 1622 |
+
* Evaluate a conditional.
|
| 1623 |
+
*
|
| 1624 |
+
* @param array $conditions Conditions.
|
| 1625 |
+
* @param array $form Form config.
|
| 1626 |
+
* @param null|int $entry_id Optional. Entry ID to test by.
|
| 1627 |
+
*
|
| 1628 |
+
* @return bool
|
| 1629 |
+
*/
|
| 1630 |
static public function check_condition($conditions, $form, $entry_id=null){
|
| 1631 |
|
| 1632 |
$trues = array();
|
| 1765 |
}
|
| 1766 |
|
| 1767 |
// FRONT END STUFFF
|
| 1768 |
+
/**
|
| 1769 |
+
* Perform redirect
|
| 1770 |
+
*
|
| 1771 |
+
* @param string $type Type of redirect being performed.
|
| 1772 |
+
* @param string $url URL to redirect to.
|
| 1773 |
+
* @param array $form Form config.
|
| 1774 |
+
* @param string $processid Process ID for process calling the redirect.
|
| 1775 |
+
*/
|
| 1776 |
static public function form_redirect($type, $url, $form, $processid){
|
| 1777 |
|
| 1778 |
$url = apply_filters( 'caldera_forms_redirect_url', $url, $form, $processid);
|
| 1785 |
wp_redirect( $url );
|
| 1786 |
exit;
|
| 1787 |
}
|
| 1788 |
+
|
| 1789 |
}
|
|
|
|
| 1790 |
|
| 1791 |
+
/**
|
| 1792 |
+
* Add default magic tags
|
| 1793 |
+
*
|
| 1794 |
+
* @param array $tags
|
| 1795 |
+
*
|
| 1796 |
+
* @return array
|
| 1797 |
+
*/
|
| 1798 |
public function set_magic_tags($tags){
|
| 1799 |
|
| 1800 |
// get internal tags
|
| 1826 |
'date_picker'
|
| 1827 |
),
|
| 1828 |
'date:Y/m/d',
|
| 1829 |
+
'date:Y/d/m',
|
| 1830 |
+
'login_url',
|
| 1831 |
+
'logout_url',
|
| 1832 |
+
'register_url',
|
| 1833 |
+
'lostpassword_url'
|
| 1834 |
|
| 1835 |
);
|
| 1836 |
|
| 1839 |
'tags' => $system_tags,
|
| 1840 |
'wrap' => array('{','}')
|
| 1841 |
);
|
| 1842 |
+
|
| 1843 |
// get processor tags
|
| 1844 |
+
$processors = Caldera_Forms_Processor_Load::get_instance()->get_processors();
|
| 1845 |
if(!empty($processors)){
|
| 1846 |
foreach($processors as $processor_key=>$processor){
|
| 1847 |
if(isset($processor['magic_tags'])){
|
| 1880 |
return $tags;
|
| 1881 |
}
|
| 1882 |
|
| 1883 |
+
/**
|
| 1884 |
+
* Parse magic tags
|
| 1885 |
+
*
|
| 1886 |
+
* @param string $value
|
| 1887 |
+
* @param null|int $entry_id Optional. Entry ID to test by.
|
| 1888 |
+
* @param array $magic_caller The form/processorr/entry to evaluate against. May also be a powerful wizard.
|
| 1889 |
+
*
|
| 1890 |
+
* @return mixed
|
| 1891 |
+
*/
|
| 1892 |
+
static public function do_magic_tags($value, $entry_id = null, $magic_caller = array() ){
|
| 1893 |
|
| 1894 |
global $processed_meta, $form, $referrer;
|
| 1895 |
/// get meta entry for magic tags defined.
|
| 2030 |
$magic_tag = null;
|
| 2031 |
}
|
| 2032 |
break;
|
|
|
|
| 2033 |
}
|
| 2034 |
}else{
|
| 2035 |
switch ($magic_tag) {
|
| 2113 |
}
|
| 2114 |
}
|
| 2115 |
break;
|
| 2116 |
+
case 'login_url' :
|
| 2117 |
+
$magic_tag = wp_login_url();
|
| 2118 |
+
break;
|
| 2119 |
+
case 'logout_url' :
|
| 2120 |
+
$magic_tag = wp_logout_url();
|
| 2121 |
+
break;
|
| 2122 |
+
case 'register_url' :
|
| 2123 |
+
$magic_tag = wp_registration_url();
|
| 2124 |
+
break;
|
| 2125 |
+
case 'lostpassword_url' :
|
| 2126 |
+
$magic_tag = wp_lostpassword_url();
|
| 2127 |
+
break;
|
| 2128 |
+
|
| 2129 |
+
|
| 2130 |
}
|
| 2131 |
}
|
| 2132 |
|
| 2232 |
return $value;
|
| 2233 |
}
|
| 2234 |
|
| 2235 |
+
/**
|
| 2236 |
+
* Get all types of fields currently available.
|
| 2237 |
+
*
|
| 2238 |
+
* @return array Array of field types.
|
| 2239 |
+
*/
|
| 2240 |
static public function get_field_types(){
|
| 2241 |
//global $field_types;
|
| 2242 |
//if(!empty($field_types)){
|
| 2256 |
}
|
| 2257 |
|
| 2258 |
return $field_types;
|
| 2259 |
+
|
| 2260 |
}
|
| 2261 |
+
|
| 2262 |
+
/**
|
| 2263 |
+
* Get all processors, in a form, of a specific type
|
| 2264 |
+
*
|
| 2265 |
+
* @param string $type Processor type.
|
| 2266 |
+
* @param array $form Form config
|
| 2267 |
+
*
|
| 2268 |
+
* @return array|bool Processor config if found. False if not.
|
| 2269 |
+
*/
|
| 2270 |
static public function get_processor_by_type($type, $form){
|
| 2271 |
if(is_string($form)){
|
| 2272 |
$form_cfg = self::get_form( $form );
|
| 2293 |
return false;
|
| 2294 |
}
|
| 2295 |
|
| 2296 |
+
/**
|
| 2297 |
+
* Set a specific meta key from form meta.
|
| 2298 |
+
*
|
| 2299 |
+
* @param string $key Name of key.
|
| 2300 |
+
* @param mixed $value Value to save.
|
| 2301 |
+
* @param string|array form Form config array or ID of form.
|
| 2302 |
+
* @param string $processor_id Optional. ID of processor. Default is "meta"
|
| 2303 |
+
*
|
| 2304 |
+
* @return bool
|
| 2305 |
+
*/
|
| 2306 |
static public function set_submission_meta($key, $value, $form, $processor_id='meta'){
|
| 2307 |
global $processed_meta;
|
| 2308 |
|
| 2322 |
}
|
| 2323 |
}
|
| 2324 |
|
| 2325 |
+
/**
|
| 2326 |
+
* Set a field's data to be saved form a form entry.
|
| 2327 |
+
*
|
| 2328 |
+
* @param string $field_id ID of field.
|
| 2329 |
+
* @param mixed $data Data to save.
|
| 2330 |
+
* @param string|array form Form config array or ID of form.
|
| 2331 |
+
* @param bool|false $entry_id Optional. Entry ID to save in.
|
| 2332 |
+
*
|
| 2333 |
+
* @return bool
|
| 2334 |
+
*/
|
| 2335 |
static public function set_field_data($field_id, $data, $form, $entry_id = false){
|
| 2336 |
global $processed_data;
|
| 2337 |
|
| 2362 |
return true;
|
| 2363 |
}
|
| 2364 |
|
| 2365 |
+
/**
|
| 2366 |
+
* Get a field's data.
|
| 2367 |
+
*
|
| 2368 |
+
* @param string $field_id ID of field.
|
| 2369 |
+
* @param string|array $form Form config array or ID of form.
|
| 2370 |
+
* @param bool|false $entry_id Optional. Entry ID to save in.
|
| 2371 |
+
*
|
| 2372 |
+
* @return bool
|
| 2373 |
+
*/
|
| 2374 |
static public function get_field_data($field_id, $form, $entry_id = false){
|
| 2375 |
global $processed_data;
|
| 2376 |
|
| 2531 |
|
| 2532 |
return null;
|
| 2533 |
}
|
| 2534 |
+
|
| 2535 |
+
/**
|
| 2536 |
+
* Get the configuration for a field.
|
| 2537 |
+
*
|
| 2538 |
+
* @param string $slug Slug of field to get config for.
|
| 2539 |
+
* @param array $form Form config array.
|
| 2540 |
+
*
|
| 2541 |
+
* @return bool|mixed|void
|
| 2542 |
+
*/
|
| 2543 |
static public function get_field_by_slug($slug, $form){
|
| 2544 |
|
| 2545 |
foreach($form['fields'] as $field_id=>$field){
|
| 2553 |
|
| 2554 |
return false;
|
| 2555 |
|
| 2556 |
+
}
|
| 2557 |
+
|
| 2558 |
+
/**
|
| 2559 |
+
* Get field data, by slug, and by entry.
|
| 2560 |
+
*
|
| 2561 |
+
* @param string $slug Slug of field to get config for.
|
| 2562 |
+
* @param array $form Form config array.
|
| 2563 |
+
* @param bool|false $entry_id Optional. The entry ID.
|
| 2564 |
+
*
|
| 2565 |
+
* @return bool|array
|
| 2566 |
+
*/
|
| 2567 |
static public function get_slug_data($slug, $form, $entry_id = false){
|
| 2568 |
|
| 2569 |
|
| 2584 |
}
|
| 2585 |
}
|
| 2586 |
|
| 2587 |
+
}
|
| 2588 |
+
|
| 2589 |
+
/**
|
| 2590 |
+
* Get saved data for a form entry
|
| 2591 |
+
*
|
| 2592 |
+
* @param int $entry_id Entry ID
|
| 2593 |
+
* @param null|array $form Optional. Form config.
|
| 2594 |
+
*
|
| 2595 |
+
* @return array|null|void
|
| 2596 |
+
*/
|
| 2597 |
static public function get_entry_detail($entry_id, $form = null){
|
| 2598 |
global $wpdb, $form;
|
| 2599 |
|
| 2615 |
return $entry;
|
| 2616 |
}
|
| 2617 |
|
| 2618 |
+
/**
|
| 2619 |
+
* Get all meta for an entry.
|
| 2620 |
+
*
|
| 2621 |
+
* @param int $entry_id Entry ID
|
| 2622 |
+
* @param array $form Form config.
|
| 2623 |
+
* @param null|string $type Optional. Type of meta to get. If null, the default, all meta is returned.
|
| 2624 |
+
*
|
| 2625 |
+
* @return array
|
| 2626 |
+
*/
|
| 2627 |
static public function get_entry_meta($entry_id, $form, $type = null){
|
| 2628 |
global $wpdb;
|
| 2629 |
|
| 2735 |
return $entry_meta;
|
| 2736 |
}
|
| 2737 |
|
| 2738 |
+
/**
|
| 2739 |
+
* Get submission data from a form being submitted or a saved entry
|
| 2740 |
+
* @param array $form Form Config.
|
| 2741 |
+
* @param bool|false $entry_id Optional. Entry ID to get data for, or if false, the default, get form current submission.
|
| 2742 |
+
*
|
| 2743 |
+
* @return array|\WP_Error
|
| 2744 |
+
*/
|
| 2745 |
static public function get_submission_data($form, $entry_id = false){
|
| 2746 |
global $processed_data;
|
| 2747 |
|
| 2780 |
return $processed_data[$indexkey];
|
| 2781 |
}
|
| 2782 |
|
| 2783 |
+
/**
|
| 2784 |
+
* Process current POST data as form submission.
|
| 2785 |
+
*/
|
| 2786 |
static public function process_submission(){
|
| 2787 |
global $post;
|
| 2788 |
global $front_templates;
|
| 3372 |
return self::form_redirect('complete', $referrer, $form, $process_id );
|
| 3373 |
}
|
| 3374 |
|
|
|
|
|
|
|
|
|
|
| 3375 |
|
| 3376 |
+
|
| 3377 |
+
/**
|
| 3378 |
+
* Makes Caldera Forms load the preview
|
| 3379 |
+
*/
|
| 3380 |
+
static public function cf_init_preview(){
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3381 |
|
| 3382 |
+
global $post, $form;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3383 |
|
| 3384 |
if(!empty($_GET['cf_preview'])){
|
| 3385 |
$form = self::get_form( $_GET['cf_preview'] );
|
| 3418 |
|
| 3419 |
}
|
| 3420 |
}
|
| 3421 |
+
}
|
| 3422 |
+
/**
|
| 3423 |
+
* Makes Caldera Forms go in front-end!
|
| 3424 |
+
*/
|
| 3425 |
+
static public function cf_init_system(){
|
| 3426 |
+
|
| 3427 |
+
global $post, $front_templates, $wp_query, $process_id, $form;
|
| 3428 |
+
|
| 3429 |
+
// check for API
|
| 3430 |
+
if(!empty($wp_query->query_vars['cf_api'])){
|
| 3431 |
+
// check if form exists
|
| 3432 |
+
$form = self::get_form( $wp_query->query_vars['cf_api'] );
|
| 3433 |
+
if(!empty($form['ID'])){
|
| 3434 |
+
if($form['ID'] === $wp_query->query_vars['cf_api']){
|
| 3435 |
+
// got it!
|
| 3436 |
+
// need entry?
|
| 3437 |
+
if(!empty($wp_query->query_vars['cf_entry'])){
|
| 3438 |
+
$entry = Caldera_Forms::get_entry($wp_query->query_vars['cf_entry'], $form);
|
| 3439 |
+
wp_send_json( $entry );
|
| 3440 |
+
}
|
| 3441 |
+
// is a post?
|
| 3442 |
+
if( $_SERVER['REQUEST_METHOD'] === 'POST' ){
|
| 3443 |
+
|
| 3444 |
+
$_POST['_wp_http_referer_true'] = 'api';
|
| 3445 |
+
$_POST['_cf_frm_id'] = $_POST['cfajax'] = $wp_query->query_vars['cf_api'];
|
| 3446 |
+
|
| 3447 |
+
$submission = Caldera_Forms::process_submission();
|
| 3448 |
+
|
| 3449 |
+
}
|
| 3450 |
+
|
| 3451 |
+
wp_send_json( $wp_query );
|
| 3452 |
+
die;
|
| 3453 |
+
}
|
| 3454 |
+
}
|
| 3455 |
+
}
|
| 3456 |
|
| 3457 |
// catch a transient process
|
| 3458 |
if(!empty($_GET['cf_tp'])){
|
| 3468 |
}
|
| 3469 |
|
| 3470 |
|
| 3471 |
+
// hook into submission
|
| 3472 |
if(isset($_POST['_cf_verify']) && isset( $_POST['_cf_frm_id'] )){
|
| 3473 |
if(wp_verify_nonce( $_POST['_cf_verify'], 'caldera_forms_front' )){
|
| 3474 |
|
| 3625 |
}
|
| 3626 |
}
|
| 3627 |
|
| 3628 |
+
/**
|
| 3629 |
+
* Recursive array search.
|
| 3630 |
+
*
|
| 3631 |
+
* @param string|array $needle Value to search for.
|
| 3632 |
+
* @param array $haystack Array to search in
|
| 3633 |
+
* @param array $found Optional. Array to add found items to. Default is an empty array.
|
| 3634 |
+
*
|
| 3635 |
+
* @return array Array of found needles.
|
| 3636 |
+
*/
|
| 3637 |
static function search_array_fields($needle, $haystack, $found = array()){
|
| 3638 |
|
| 3639 |
if(is_array($needle)){
|
| 3647 |
}
|
| 3648 |
return $found;
|
| 3649 |
}
|
| 3650 |
+
|
| 3651 |
+
/**
|
| 3652 |
+
* Load a saved entry.
|
| 3653 |
+
*
|
| 3654 |
+
* @param null|int $entry_id Entry ID
|
| 3655 |
+
* @param null|string|array $form Optional. Config array, or ID of form.
|
| 3656 |
+
*
|
| 3657 |
+
* @return array
|
| 3658 |
+
*/
|
| 3659 |
static public function get_entry($entry_id = null, $form = null){
|
| 3660 |
|
| 3661 |
if(empty($entry_id)){
|
| 3711 |
//not_supported
|
| 3712 |
|
| 3713 |
$field = $form['fields'][$field_id];
|
| 3714 |
+
|
| 3715 |
+
/**
|
| 3716 |
+
* Filter field config.
|
| 3717 |
+
*
|
| 3718 |
+
* @param array $field The field config.
|
| 3719 |
+
* @param array $form The form config.
|
| 3720 |
+
*/
|
| 3721 |
$field = apply_filters( 'caldera_forms_render_get_field', $field, $form);
|
| 3722 |
+
|
| 3723 |
+
/**
|
| 3724 |
+
* Filter field config for fields of a given type.
|
| 3725 |
+
*
|
| 3726 |
+
* Filter name is dynamic, based on field type. For example "caldera_forms_render_get_field_type-hidden" or "caldera_forms_render_get_field_type-radio"
|
| 3727 |
+
*
|
| 3728 |
+
* @param array $field The field config.
|
| 3729 |
+
* @param array $form The form config.
|
| 3730 |
+
*/
|
| 3731 |
$field = apply_filters( 'caldera_forms_render_get_field_type-' . $field['type'], $field, $form);
|
| 3732 |
+
|
| 3733 |
+
/**
|
| 3734 |
+
* Filter field config for fields with a given slug
|
| 3735 |
+
*
|
| 3736 |
+
* Filter name is dynamic, based on field type. For example "caldera_forms_render_get_field_slug-salsa" or "caldera_forms_render_get_field_slug-chips"
|
| 3737 |
+
*
|
| 3738 |
+
* @param array $field The field config.
|
| 3739 |
+
* @param array $form The form config.
|
| 3740 |
+
*/
|
| 3741 |
$field = apply_filters( 'caldera_forms_render_get_field_slug-' . $field['slug'], $field, $form);
|
| 3742 |
|
| 3743 |
if( is_string( $field_value ) ){
|
| 3813 |
return $data;
|
| 3814 |
}
|
| 3815 |
|
| 3816 |
+
/**
|
| 3817 |
+
* Load a Caldera Form in a modal.
|
| 3818 |
+
*
|
| 3819 |
+
* @param string|array $atts Shortcode atts or form ID
|
| 3820 |
+
* @param string $content Content to use in trigger link.
|
| 3821 |
+
*
|
| 3822 |
+
* @return string
|
| 3823 |
+
*/
|
| 3824 |
static public function render_modal_form($atts, $content){
|
| 3825 |
global $footer_modals;
|
| 3826 |
|
| 3884 |
$footer_modals .= ob_get_clean();
|
| 3885 |
return $out;
|
| 3886 |
}
|
| 3887 |
+
|
| 3888 |
+
/**
|
| 3889 |
+
* Print modal content in footer.
|
| 3890 |
+
*/
|
| 3891 |
static public function render_footer_modals(){
|
| 3892 |
global $footer_modals;
|
| 3893 |
if(!empty($footer_modals)){
|
| 3894 |
echo $footer_modals;
|
| 3895 |
}
|
| 3896 |
}
|
| 3897 |
+
|
| 3898 |
+
/**
|
| 3899 |
+
* Create HTML markup for a form.
|
| 3900 |
+
* @param array|string $atts Form ID or shortcode atts or form config array
|
| 3901 |
+
* @param null|int $entry_id Optional. Entry ID to load data from. Null, the default, loads form for creating a new entry.
|
| 3902 |
+
* @param null $shortcode No longer used.
|
| 3903 |
+
*
|
| 3904 |
+
* @return void|string HTML for form, if it was able to be laoded
|
| 3905 |
+
*/
|
| 3906 |
static public function render_form($atts, $entry_id = null, $shortcode = null){
|
| 3907 |
|
| 3908 |
global $current_form_count, $form, $post;
|
| 3957 |
if(!empty($atts['entry'])){
|
| 3958 |
$entry_id = self::do_magic_tags( $atts['entry'] );
|
| 3959 |
}
|
| 3960 |
+
|
| 3961 |
+
/**
|
| 3962 |
+
* Filter form settings, before rendering form.
|
| 3963 |
+
*
|
| 3964 |
+
* @since unknown
|
| 3965 |
+
*
|
| 3966 |
+
* @param int $entry_id The entry ID.
|
| 3967 |
+
* @param array $form Form config.
|
| 3968 |
+
*/
|
| 3969 |
$form = apply_filters( 'caldera_forms_render_get_form', $form );
|
| 3970 |
|
| 3971 |
+
/**
|
| 3972 |
+
* Set entry ID when loading form
|
| 3973 |
+
*
|
| 3974 |
+
* @since 1.2.3
|
| 3975 |
+
*
|
| 3976 |
+
* @param int $entry_id The entry ID.
|
| 3977 |
+
* @param array $form Form config.
|
| 3978 |
+
*/
|
| 3979 |
+
$entry_id = apply_filters( 'caldera_forms_render_entry_id', $entry_id, $form );
|
| 3980 |
+
|
| 3981 |
if(empty($form)){
|
| 3982 |
return;
|
| 3983 |
}
|
| 4557 |
|
| 4558 |
wp_enqueue_script( 'cf-frontend-script-init', CFCORE_URL . 'assets/js/frontend-script-init.min.js', array('jquery'), self::VERSION, true);
|
| 4559 |
wp_enqueue_script( 'cf-frontend-fields', CFCORE_URL . 'assets/js/fields.min.js', array('jquery'), self::VERSION );
|
| 4560 |
+
|
|
|
|
| 4561 |
return apply_filters( 'caldera_forms_render_form', $out, $form);
|
| 4562 |
|
| 4563 |
}
|
composer.json
ADDED
|
@@ -0,0 +1,15 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"name" : "Desertsnowman/caldera-forms",
|
| 3 |
+
"description" : "Create complex grid based, responsive forms easily with an easy to use drag and drop layout builder",
|
| 4 |
+
"type" : "wordpress-plugin",
|
| 5 |
+
"keywords" : [ "wordpress", "forms", "caldera" ],
|
| 6 |
+
"license" : "GPL-2.0+",
|
| 7 |
+
"authors" : [
|
| 8 |
+
{
|
| 9 |
+
"name" : "David Cramer",
|
| 10 |
+
"homepage": "http://cramer.co.za",
|
| 11 |
+
"role" : "Lead Developer"
|
| 12 |
+
}
|
| 13 |
+
],
|
| 14 |
+
"homepage" : "http://calderaforms.com"
|
| 15 |
+
}
|
fields/button/field.php
CHANGED
|
@@ -10,6 +10,9 @@ if($field['config']['type'] == 'next' || $field['config']['type'] == 'prev'){
|
|
| 10 |
|
| 11 |
?><?php echo $wrapper_before; ?><?php echo $field_before; ?><input data-field="<?php echo $field_base_id; ?>_btn" <?php echo $btn_action; ?> class="<?php echo $field['config']['class']; ?>" type="<?php echo $btnType; ?>" name="<?php echo $field_name; ?>_btn" value="<?php echo esc_attr( $field['label'] ); ?>" id="<?php echo $field_id; ?>"><?php echo $field_after; ?><?php echo $wrapper_after; ?>
|
| 12 |
<input class="button_trigger_<?php echo $current_form_count; ?>" type="hidden" data-field="<?php echo $field_base_id; ?>" id="<?php echo $field_id; ?>_btn" name="<?php echo $field_name; ?>" value="<?php echo esc_attr( $field_value ); ?>" autocomplete="off">
|
|
|
|
|
|
|
|
|
|
| 13 |
<script>
|
| 14 |
jQuery( function($){
|
| 15 |
|
|
@@ -18,4 +21,7 @@ if($field['config']['type'] == 'next' || $field['config']['type'] == 'prev'){
|
|
| 18 |
});
|
| 19 |
|
| 20 |
});
|
| 21 |
-
</script>
|
|
|
|
|
|
|
|
|
| 10 |
|
| 11 |
?><?php echo $wrapper_before; ?><?php echo $field_before; ?><input data-field="<?php echo $field_base_id; ?>_btn" <?php echo $btn_action; ?> class="<?php echo $field['config']['class']; ?>" type="<?php echo $btnType; ?>" name="<?php echo $field_name; ?>_btn" value="<?php echo esc_attr( $field['label'] ); ?>" id="<?php echo $field_id; ?>"><?php echo $field_after; ?><?php echo $wrapper_after; ?>
|
| 12 |
<input class="button_trigger_<?php echo $current_form_count; ?>" type="hidden" data-field="<?php echo $field_base_id; ?>" id="<?php echo $field_id; ?>_btn" name="<?php echo $field_name; ?>" value="<?php echo esc_attr( $field_value ); ?>" autocomplete="off">
|
| 13 |
+
<?php
|
| 14 |
+
ob_start();
|
| 15 |
+
?>
|
| 16 |
<script>
|
| 17 |
jQuery( function($){
|
| 18 |
|
| 21 |
});
|
| 22 |
|
| 23 |
});
|
| 24 |
+
</script>
|
| 25 |
+
<?php
|
| 26 |
+
$script_template = ob_get_clean();
|
| 27 |
+
$grid->append( $script_template, $location );
|
fields/calculation/field.php
CHANGED
|
@@ -70,6 +70,7 @@ foreach($form['fields'] as $fid=>$cfg){
|
|
| 70 |
if(!empty($binds)){
|
| 71 |
$bindtriggers = array_merge($binds, $binds_wrap);
|
| 72 |
|
|
|
|
| 73 |
?>
|
| 74 |
<script type="text/javascript">
|
| 75 |
jQuery(function($){
|
|
@@ -108,11 +109,19 @@ if(!empty($binds)){
|
|
| 108 |
$('[data-field="<?php echo $field_base_id; ?>"]').val( total ).trigger('change');
|
| 109 |
|
| 110 |
}
|
| 111 |
-
$('body').on('change keyup
|
| 112 |
docalc_<?php echo $field_base_id; ?>();
|
| 113 |
});
|
|
|
|
|
|
|
|
|
|
| 114 |
docalc_<?php echo $field_base_id; ?>();
|
| 115 |
});
|
| 116 |
|
| 117 |
</script>
|
| 118 |
-
<?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 70 |
if(!empty($binds)){
|
| 71 |
$bindtriggers = array_merge($binds, $binds_wrap);
|
| 72 |
|
| 73 |
+
ob_start();
|
| 74 |
?>
|
| 75 |
<script type="text/javascript">
|
| 76 |
jQuery(function($){
|
| 109 |
$('[data-field="<?php echo $field_base_id; ?>"]').val( total ).trigger('change');
|
| 110 |
|
| 111 |
}
|
| 112 |
+
$('body').on('change keyup', '<?php echo implode(',', $bindtriggers); ?>', function(e){
|
| 113 |
docalc_<?php echo $field_base_id; ?>();
|
| 114 |
});
|
| 115 |
+
$( document ).on('cf.remove cf.add', function( e ){
|
| 116 |
+
docalc_<?php echo $field_base_id; ?>();
|
| 117 |
+
})
|
| 118 |
docalc_<?php echo $field_base_id; ?>();
|
| 119 |
});
|
| 120 |
|
| 121 |
</script>
|
| 122 |
+
<?php
|
| 123 |
+
|
| 124 |
+
$script_template = ob_get_clean();
|
| 125 |
+
$grid->append( $script_template, $location );
|
| 126 |
+
|
| 127 |
+
} ?>
|
fields/date_picker/datepicker.php
CHANGED
|
@@ -1,6 +1,18 @@
|
|
| 1 |
<?php
|
| 2 |
-
|
| 3 |
$has_lang = '';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
if( !empty( $field['config']['language'] ) ){
|
| 5 |
if( file_exists( CFCORE_PATH . 'fields/date_picker/js/locales/bootstrap-datepicker.' . $field['config']['language'] . '.js' ) ){
|
| 6 |
$has_lang = 'data-date-language="' . $field['config']['language'] . '"';
|
|
@@ -18,7 +30,7 @@ if( !empty( $field['config']['autoclose'] ) ){
|
|
| 18 |
<?php echo $wrapper_before; ?>
|
| 19 |
<?php echo $field_label; ?>
|
| 20 |
<?php echo $field_before; ?>
|
| 21 |
-
<input <?php echo $field_placeholder; ?> type="text" data-provide="cfdatepicker" data-field="<?php echo $field_base_id; ?>" class="<?php echo $field_class; ?> is-cfdatepicker" id="<?php echo $field_id; ?>" <?php echo $has_lang; ?> data-date-format="<?php echo $field['config']['format']; ?>"
|
| 22 |
<?php echo $field_caption; ?>
|
| 23 |
<?php echo $field_after; ?>
|
| 24 |
-
<?php echo $wrapper_after; ?>
|
| 1 |
<?php
|
|
|
|
| 2 |
$has_lang = '';
|
| 3 |
+
|
| 4 |
+
// prevent errors for fields of previous version
|
| 5 |
+
$start_end_atts = '';
|
| 6 |
+
if( !empty( $field['config']['start_view'] ) ){
|
| 7 |
+
$start_end_atts .= ' data-date-start-view="' . esc_attr( $field['config']['start_view'] ) . '"';
|
| 8 |
+
}
|
| 9 |
+
if( !empty( $field['config']['start_date'] ) ){
|
| 10 |
+
$start_end_atts .= ' data-date-start-date="' . esc_attr( $field['config']['start_date'] ) . '"';
|
| 11 |
+
}
|
| 12 |
+
if( !empty( $field['config']['end_date'] ) ){
|
| 13 |
+
$start_end_atts .= ' data-date-end-date="' . esc_attr( $field['config']['end_date'] ) . '"';
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
if( !empty( $field['config']['language'] ) ){
|
| 17 |
if( file_exists( CFCORE_PATH . 'fields/date_picker/js/locales/bootstrap-datepicker.' . $field['config']['language'] . '.js' ) ){
|
| 18 |
$has_lang = 'data-date-language="' . $field['config']['language'] . '"';
|
| 30 |
<?php echo $wrapper_before; ?>
|
| 31 |
<?php echo $field_label; ?>
|
| 32 |
<?php echo $field_before; ?>
|
| 33 |
+
<input <?php echo $field_placeholder; ?> type="text" data-provide="cfdatepicker" data-field="<?php echo $field_base_id; ?>" class="<?php echo $field_class; ?> is-cfdatepicker" id="<?php echo $field_id; ?>" <?php echo $has_lang; ?> data-date-format="<?php echo $field['config']['format']; ?>" <?php echo $start_end_atts; ?> <?php echo $is_autoclose; ?> name="<?php echo $field_name; ?>" value="<?php echo $field_value; ?>" <?php echo $field_required; ?>>
|
| 34 |
<?php echo $field_caption; ?>
|
| 35 |
<?php echo $field_after; ?>
|
| 36 |
+
<?php echo $wrapper_after; ?>
|
fields/date_picker/setup.php
CHANGED
|
@@ -20,14 +20,28 @@
|
|
| 20 |
<div class="caldera-config-group">
|
| 21 |
<label><?php _e('Start View', 'caldera-forms'); ?></label>
|
| 22 |
<div class="caldera-config-field">
|
| 23 |
-
<select class="block-input field-config" name="{{_name}}[
|
| 24 |
-
<option value="month" {{#is
|
| 25 |
-
<option value="year" {{#is
|
| 26 |
-
<option value="decade" {{#is
|
| 27 |
</select>
|
| 28 |
<p class="description"><?php _e('The starting view of the date picker (month, year, decade)', 'caldera-forms'); ?></p>
|
| 29 |
</div>
|
| 30 |
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 31 |
<div class="caldera-config-group">
|
| 32 |
<label><?php _e('language', 'caldera-forms'); ?></label>
|
| 33 |
<div class="caldera-config-field">
|
| 20 |
<div class="caldera-config-group">
|
| 21 |
<label><?php _e('Start View', 'caldera-forms'); ?></label>
|
| 22 |
<div class="caldera-config-field">
|
| 23 |
+
<select class="block-input field-config" name="{{_name}}[start_view]">
|
| 24 |
+
<option value="month" {{#is start_view value="month"}}selected="selected"{{/is}}><?php _e('Month (Default)', 'caldera-forms'); ?></option>
|
| 25 |
+
<option value="year" {{#is start_view value="year"}}selected="selected"{{/is}}><?php _e('Year', 'caldera-forms'); ?></option>
|
| 26 |
+
<option value="decade" {{#is start_view value="decade"}}selected="selected"{{/is}}><?php _e('Decade', 'caldera-forms'); ?></option>
|
| 27 |
</select>
|
| 28 |
<p class="description"><?php _e('The starting view of the date picker (month, year, decade)', 'caldera-forms'); ?></p>
|
| 29 |
</div>
|
| 30 |
</div>
|
| 31 |
+
<div class="caldera-config-group">
|
| 32 |
+
<label><?php _e('Start Date', 'caldera-forms'); ?></label>
|
| 33 |
+
<div class="caldera-config-field">
|
| 34 |
+
<input type="text" class="cfdatepicker-set-format block-input field-config" name="{{_name}}[start_date]" value="{{start_date}}">
|
| 35 |
+
<p class="description"><?php _e('The starting date of the date picker like +1d, -2y, +4m. 0d for today ', 'caldera-forms'); ?></p>
|
| 36 |
+
</div>
|
| 37 |
+
</div>
|
| 38 |
+
<div class="caldera-config-group">
|
| 39 |
+
<label><?php _e('End Date', 'caldera-forms'); ?></label>
|
| 40 |
+
<div class="caldera-config-field">
|
| 41 |
+
<input type="text" class="cfdatepicker-set-format block-input field-config" name="{{_name}}[end_date]" value="{{end_date}}">
|
| 42 |
+
<p class="description"><?php _e('The ending date of the date picker like +1d, -2y, +4m. 0d for today ', 'caldera-forms'); ?></p>
|
| 43 |
+
</div>
|
| 44 |
+
</div>
|
| 45 |
<div class="caldera-config-group">
|
| 46 |
<label><?php _e('language', 'caldera-forms'); ?></label>
|
| 47 |
<div class="caldera-config-field">
|
fields/file/config_template.php
CHANGED
|
@@ -5,6 +5,13 @@
|
|
| 5 |
</div>
|
| 6 |
</div>
|
| 7 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 8 |
<div class="caldera-config-group">
|
| 9 |
<label for="{{_id}}_allowed"><?php echo __('Allowed Types', 'caldera-forms'); ?></label>
|
| 10 |
<div class="caldera-config-field">
|
| 5 |
</div>
|
| 6 |
</div>
|
| 7 |
|
| 8 |
+
<div class="caldera-config-group">
|
| 9 |
+
<label for="{{_id}}_allow_multiple"><?php echo __('Allow Multiple', 'caldera-forms'); ?></label>
|
| 10 |
+
<div class="caldera-config-field">
|
| 11 |
+
<input id="{{_id}}_allow_multiple" type="checkbox" class="field-config" name="{{_name}}[multi_upload]" value="1" {{#if multi_upload}}checked="checked"{{/if}}>
|
| 12 |
+
</div>
|
| 13 |
+
</div>
|
| 14 |
+
|
| 15 |
<div class="caldera-config-group">
|
| 16 |
<label for="{{_id}}_allowed"><?php echo __('Allowed Types', 'caldera-forms'); ?></label>
|
| 17 |
<div class="caldera-config-field">
|
fields/file/field.php
CHANGED
|
@@ -1,7 +1,14 @@
|
|
| 1 |
-
<?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
<?php echo $field_label; ?>
|
| 3 |
<?php echo $field_before; ?>
|
| 4 |
-
<input <?php echo $field_placeholder; ?> type="file" data-field="<?php echo $field_base_id; ?>" id="<?php echo $field_id; ?>" name="<?php echo $field_name; ?>" <?php echo $field_required; ?>>
|
| 5 |
<input type="hidden" name="<?php echo $field_name; ?>" value="true">
|
| 6 |
<?php echo $field_caption; ?>
|
| 7 |
<?php echo $field_after; ?>
|
| 1 |
+
<?php
|
| 2 |
+
$is_multiple = null;
|
| 3 |
+
if( !empty( $field['config']['multi_upload'] ) ){
|
| 4 |
+
$is_multiple = 'multiple="multiple"';
|
| 5 |
+
$field_name .= '[]';
|
| 6 |
+
}
|
| 7 |
+
|
| 8 |
+
?><?php echo $wrapper_before; ?>
|
| 9 |
<?php echo $field_label; ?>
|
| 10 |
<?php echo $field_before; ?>
|
| 11 |
+
<input <?php echo $field_placeholder; ?> <?php echo $is_multiple; ?> type="file" data-field="<?php echo $field_base_id; ?>" id="<?php echo $field_id; ?>" name="<?php echo $field_name; ?>" <?php echo $field_required; ?>>
|
| 12 |
<input type="hidden" name="<?php echo $field_name; ?>" value="true">
|
| 13 |
<?php echo $field_caption; ?>
|
| 14 |
<?php echo $field_after; ?>
|
fields/gravatar/field.php
CHANGED
|
@@ -26,6 +26,8 @@ if(!empty($field['config']['email'])){
|
|
| 26 |
if(empty($field['config']['email'])){
|
| 27 |
return;
|
| 28 |
}
|
|
|
|
|
|
|
| 29 |
?>
|
| 30 |
<script type="text/javascript">
|
| 31 |
|
|
@@ -83,3 +85,6 @@ jQuery(function($){
|
|
| 83 |
})
|
| 84 |
|
| 85 |
</script>
|
|
|
|
|
|
|
|
|
| 26 |
if(empty($field['config']['email'])){
|
| 27 |
return;
|
| 28 |
}
|
| 29 |
+
|
| 30 |
+
ob_start();
|
| 31 |
?>
|
| 32 |
<script type="text/javascript">
|
| 33 |
|
| 85 |
})
|
| 86 |
|
| 87 |
</script>
|
| 88 |
+
<?php
|
| 89 |
+
$script_template = ob_get_clean();
|
| 90 |
+
$grid->append( $script_template, $location );
|
fields/html/field.php
CHANGED
|
@@ -1,4 +1,7 @@
|
|
| 1 |
<?php
|
|
|
|
|
|
|
|
|
|
| 2 |
// magics!
|
| 3 |
preg_match_all("/%(.+?)%/", $field['config']['default'], $hastags);
|
| 4 |
if(!empty($hastags[1])){
|
|
@@ -15,9 +18,13 @@ if(!empty($hastags[1])){
|
|
| 15 |
}
|
| 16 |
}
|
| 17 |
echo '<div id="html-content-'.$field_id.'" data-field="'.$field_id.'" class="' . $field['config']['custom_class'] . '"></div>';
|
|
|
|
|
|
|
|
|
|
| 18 |
echo '<script type="text/html" id="html-content-'.$field_id.'-tmpl">';
|
| 19 |
echo do_shortcode( self::do_magic_tags( $field['config']['default'] ) );
|
| 20 |
echo '</script>';
|
|
|
|
| 21 |
?>
|
| 22 |
<script type="text/javascript">
|
| 23 |
jQuery(function($){
|
|
@@ -42,7 +49,9 @@ if(!empty($hastags[1])){
|
|
| 42 |
var file_parts = field[f].value.split('\\');
|
| 43 |
value.push( file_parts[file_parts.length-1] );
|
| 44 |
}else{
|
| 45 |
-
|
|
|
|
|
|
|
| 46 |
}
|
| 47 |
}
|
| 48 |
|
|
@@ -51,13 +60,16 @@ if(!empty($hastags[1])){
|
|
| 51 |
target.html(template).trigger('change');
|
| 52 |
|
| 53 |
}
|
| 54 |
-
$('body').on('change', '<?php echo implode(',', $binds); ?>', htmltemplate<?php echo $field_id; ?>);
|
| 55 |
|
| 56 |
htmltemplate<?php echo $field_id; ?>();
|
| 57 |
|
| 58 |
})
|
| 59 |
</script>
|
| 60 |
<?php
|
|
|
|
|
|
|
|
|
|
| 61 |
}else{
|
| 62 |
echo '<div class="' . $field['config']['custom_class'] . '">' . do_shortcode( self::do_magic_tags( $field['config']['default'] ) ) . '</div>';
|
| 63 |
}
|
| 1 |
<?php
|
| 2 |
+
|
| 3 |
+
|
| 4 |
+
|
| 5 |
// magics!
|
| 6 |
preg_match_all("/%(.+?)%/", $field['config']['default'], $hastags);
|
| 7 |
if(!empty($hastags[1])){
|
| 18 |
}
|
| 19 |
}
|
| 20 |
echo '<div id="html-content-'.$field_id.'" data-field="'.$field_id.'" class="' . $field['config']['custom_class'] . '"></div>';
|
| 21 |
+
|
| 22 |
+
// create template block
|
| 23 |
+
ob_start();
|
| 24 |
echo '<script type="text/html" id="html-content-'.$field_id.'-tmpl">';
|
| 25 |
echo do_shortcode( self::do_magic_tags( $field['config']['default'] ) );
|
| 26 |
echo '</script>';
|
| 27 |
+
|
| 28 |
?>
|
| 29 |
<script type="text/javascript">
|
| 30 |
jQuery(function($){
|
| 49 |
var file_parts = field[f].value.split('\\');
|
| 50 |
value.push( file_parts[file_parts.length-1] );
|
| 51 |
}else{
|
| 52 |
+
if( field[f].value ){
|
| 53 |
+
value.push( field[f].value );
|
| 54 |
+
}
|
| 55 |
}
|
| 56 |
}
|
| 57 |
|
| 60 |
target.html(template).trigger('change');
|
| 61 |
|
| 62 |
}
|
| 63 |
+
$('body').on('change keyup', '<?php echo implode(',', $binds); ?>', htmltemplate<?php echo $field_id; ?>);
|
| 64 |
|
| 65 |
htmltemplate<?php echo $field_id; ?>();
|
| 66 |
|
| 67 |
})
|
| 68 |
</script>
|
| 69 |
<?php
|
| 70 |
+
$script_template = ob_get_clean();
|
| 71 |
+
$grid->append( $script_template, $location );
|
| 72 |
+
|
| 73 |
}else{
|
| 74 |
echo '<div class="' . $field['config']['custom_class'] . '">' . do_shortcode( self::do_magic_tags( $field['config']['default'] ) ) . '</div>';
|
| 75 |
}
|
fields/range_slider/field.php
CHANGED
|
@@ -30,6 +30,7 @@ if ( is_array( $field_value ) ) {
|
|
| 30 |
<?php echo $field_caption; ?>
|
| 31 |
<?php echo $field_after; ?>
|
| 32 |
<?php echo $wrapper_after; ?>
|
|
|
|
| 33 |
<script type="text/javascript">
|
| 34 |
jQuery(function($){
|
| 35 |
|
|
@@ -38,21 +39,23 @@ if ( is_array( $field_value ) ) {
|
|
| 38 |
rangeslider;
|
| 39 |
<?php if(empty($field['config']['pollyfill'])){ ?>
|
| 40 |
if (el.is(':visible')) {
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
|
|
|
|
|
|
| 56 |
}else{
|
| 57 |
el.rangeslider('destroy');
|
| 58 |
}
|
|
@@ -65,7 +68,7 @@ if ( is_array( $field_value ) ) {
|
|
| 65 |
}
|
| 66 |
<?php if(empty($field['config']['pollyfill'])){ ?>
|
| 67 |
// setup tabs
|
| 68 |
-
$(document).on('cf.pagenav', function(){
|
| 69 |
init_rangeslider();
|
| 70 |
});
|
| 71 |
<?php } ?>
|
|
@@ -74,3 +77,7 @@ if ( is_array( $field_value ) ) {
|
|
| 74 |
|
| 75 |
});
|
| 76 |
</script>
|
|
|
|
|
|
|
|
|
|
|
|
| 30 |
<?php echo $field_caption; ?>
|
| 31 |
<?php echo $field_after; ?>
|
| 32 |
<?php echo $wrapper_after; ?>
|
| 33 |
+
<?php ob_start(); ?>
|
| 34 |
<script type="text/javascript">
|
| 35 |
jQuery(function($){
|
| 36 |
|
| 39 |
rangeslider;
|
| 40 |
<?php if(empty($field['config']['pollyfill'])){ ?>
|
| 41 |
if (el.is(':visible')) {
|
| 42 |
+
if( !el.data( 'plugin_rangeslider' ) ){
|
| 43 |
+
rangeslider = el.rangeslider({
|
| 44 |
+
onSlide: function(position, value) {
|
| 45 |
+
<?php
|
| 46 |
+
if( false !== strpos( $field['config']['step'], '.' ) ){
|
| 47 |
+
$part = explode('.', $field['config']['step'] );
|
| 48 |
+
?>
|
| 49 |
+
value = value.toFixed( <?php echo strlen( $part[1] ); ?> );
|
| 50 |
+
<?php } ?>
|
| 51 |
+
$('#<?php echo $field_id; ?>_value').html(value);
|
| 52 |
+
},
|
| 53 |
+
polyfill: <?php echo $polyfill; ?>
|
| 54 |
+
});
|
| 55 |
+
rangeslider.parent().find('.rangeslider').css('backgroundColor', rangeslider.data('trackcolor'));
|
| 56 |
+
rangeslider.parent().find('.rangeslider__fill').css('backgroundColor', rangeslider.data('color'));
|
| 57 |
+
rangeslider.parent().find('.rangeslider__handle').css('backgroundColor', rangeslider.data('handle')).css('borderColor', rangeslider.data('handleborder'));
|
| 58 |
+
}
|
| 59 |
}else{
|
| 60 |
el.rangeslider('destroy');
|
| 61 |
}
|
| 68 |
}
|
| 69 |
<?php if(empty($field['config']['pollyfill'])){ ?>
|
| 70 |
// setup tabs
|
| 71 |
+
$(document).on('cf.pagenav cf.add cf.disable', function(){
|
| 72 |
init_rangeslider();
|
| 73 |
});
|
| 74 |
<?php } ?>
|
| 77 |
|
| 78 |
});
|
| 79 |
</script>
|
| 80 |
+
<?php
|
| 81 |
+
$script_template = ob_get_clean();
|
| 82 |
+
$grid->append( $script_template, $location );
|
| 83 |
+
?>
|
fields/recaptcha/field.php
CHANGED
|
@@ -12,6 +12,9 @@ if( empty( $field['config']['public_key'] ) ){
|
|
| 12 |
<?php echo $field_before; ?>
|
| 13 |
<input type="hidden" name="<?php echo $field_name; ?>" value="<?php echo $field_id; ?>" data-field="<?php echo $field_base_id; ?>">
|
| 14 |
<div id="cap<?php echo $field_id; ?>" class="g-recaptcha" data-theme="<?php echo $field['config']['theme']; ?>" data-sitekey="<?php echo $field['config']['public_key']; ?>"></div>
|
|
|
|
|
|
|
|
|
|
| 15 |
<script>
|
| 16 |
jQuery( function($){
|
| 17 |
function init_recaptcha(){
|
|
@@ -27,6 +30,11 @@ jQuery( function($){
|
|
| 27 |
init_recaptcha();
|
| 28 |
}, 1000);
|
| 29 |
});
|
| 30 |
-
</script><?php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 31 |
<?php echo $field_after; ?>
|
| 32 |
<?php echo $wrapper_after; ?>
|
| 12 |
<?php echo $field_before; ?>
|
| 13 |
<input type="hidden" name="<?php echo $field_name; ?>" value="<?php echo $field_id; ?>" data-field="<?php echo $field_base_id; ?>">
|
| 14 |
<div id="cap<?php echo $field_id; ?>" class="g-recaptcha" data-theme="<?php echo $field['config']['theme']; ?>" data-sitekey="<?php echo $field['config']['public_key']; ?>"></div>
|
| 15 |
+
<?php
|
| 16 |
+
ob_start();
|
| 17 |
+
?>
|
| 18 |
<script>
|
| 19 |
jQuery( function($){
|
| 20 |
function init_recaptcha(){
|
| 30 |
init_recaptcha();
|
| 31 |
}, 1000);
|
| 32 |
});
|
| 33 |
+
</script><?php
|
| 34 |
+
|
| 35 |
+
$script_template = ob_get_clean();
|
| 36 |
+
$grid->append( $script_template, $location );
|
| 37 |
+
|
| 38 |
+
echo $field_caption; ?>
|
| 39 |
<?php echo $field_after; ?>
|
| 40 |
<?php echo $wrapper_after; ?>
|
fields/select2/css/ccselect2-spinner.gif
ADDED
|
Binary file
|
fields/select2/css/ccselect2.png
ADDED
|
Binary file
|
fields/select2/css/ccselect2x2.png
ADDED
|
Binary file
|
fields/select2/css/select2.css
ADDED
|
@@ -0,0 +1,706 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
+
*/
|
| 4 |
+
.ccselect2-container {
|
| 5 |
+
margin: 0;
|
| 6 |
+
position: relative;
|
| 7 |
+
display: inline-block;
|
| 8 |
+
/* inline-block for ie7 */
|
| 9 |
+
zoom: 1;
|
| 10 |
+
*display: inline;
|
| 11 |
+
vertical-align: middle;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.ccselect2-container,
|
| 15 |
+
.ccselect2-drop,
|
| 16 |
+
.ccselect2-search,
|
| 17 |
+
.ccselect2-search input {
|
| 18 |
+
/*
|
| 19 |
+
Force border-box so that % widths fit the parent
|
| 20 |
+
container without overlap because of margin/padding.
|
| 21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
+
*/
|
| 23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
+
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
+
box-sizing: border-box; /* css3 */
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.ccselect2-container .ccselect2-choice {
|
| 29 |
+
display: block;
|
| 30 |
+
height: 26px;
|
| 31 |
+
padding: 0 0 0 8px;
|
| 32 |
+
overflow: hidden;
|
| 33 |
+
position: relative;
|
| 34 |
+
border: 1px solid #aaa !important;
|
| 35 |
+
white-space: nowrap;
|
| 36 |
+
line-height: 26px;
|
| 37 |
+
color: #444;
|
| 38 |
+
text-decoration: none;
|
| 39 |
+
|
| 40 |
+
border-radius: 4px;
|
| 41 |
+
|
| 42 |
+
background-clip: padding-box;
|
| 43 |
+
|
| 44 |
+
-webkit-touch-callout: none;
|
| 45 |
+
-webkit-user-select: none;
|
| 46 |
+
-moz-user-select: none;
|
| 47 |
+
-ms-user-select: none;
|
| 48 |
+
user-select: none;
|
| 49 |
+
|
| 50 |
+
background-color: #fff;
|
| 51 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 52 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 53 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 55 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
html[dir="rtl"] .ccselect2-container .ccselect2-choice {
|
| 59 |
+
padding: 0 8px 0 0;
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
.ccselect2-container.ccselect2-drop-above .ccselect2-choice {
|
| 63 |
+
border-bottom-color: #aaa;
|
| 64 |
+
|
| 65 |
+
border-radius: 0 0 4px 4px;
|
| 66 |
+
|
| 67 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 68 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 69 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 71 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
.ccselect2-container.ccselect2-allowclear .ccselect2-choice .ccselect2-chosen {
|
| 75 |
+
margin-right: 42px;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
.ccselect2-container .ccselect2-choice > .ccselect2-chosen {
|
| 79 |
+
margin-right: 26px;
|
| 80 |
+
display: block;
|
| 81 |
+
overflow: hidden;
|
| 82 |
+
|
| 83 |
+
white-space: nowrap;
|
| 84 |
+
|
| 85 |
+
text-overflow: ellipsis;
|
| 86 |
+
float: none;
|
| 87 |
+
width: auto;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
html[dir="rtl"] .ccselect2-container .ccselect2-choice > .ccselect2-chosen {
|
| 91 |
+
margin-left: 26px;
|
| 92 |
+
margin-right: 0;
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
.ccselect2-container .ccselect2-choice abbr {
|
| 96 |
+
display: none;
|
| 97 |
+
width: 12px;
|
| 98 |
+
height: 12px;
|
| 99 |
+
position: absolute;
|
| 100 |
+
right: 24px;
|
| 101 |
+
top: 8px;
|
| 102 |
+
|
| 103 |
+
font-size: 1px;
|
| 104 |
+
text-decoration: none;
|
| 105 |
+
|
| 106 |
+
border: 0;
|
| 107 |
+
background: url('ccselect2.png') right top no-repeat;
|
| 108 |
+
cursor: pointer;
|
| 109 |
+
outline: 0;
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
.ccselect2-container.ccselect2-allowclear .ccselect2-choice abbr {
|
| 113 |
+
display: inline-block;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
.ccselect2-container .ccselect2-choice abbr:hover {
|
| 117 |
+
background-position: right -11px;
|
| 118 |
+
cursor: pointer;
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
.ccselect2-drop-mask {
|
| 122 |
+
border: 0;
|
| 123 |
+
margin: 0;
|
| 124 |
+
padding: 0;
|
| 125 |
+
position: fixed;
|
| 126 |
+
left: 0;
|
| 127 |
+
top: 0;
|
| 128 |
+
min-height: 100%;
|
| 129 |
+
min-width: 100%;
|
| 130 |
+
height: auto;
|
| 131 |
+
width: auto;
|
| 132 |
+
opacity: 0;
|
| 133 |
+
z-index: 9998;
|
| 134 |
+
/* styles required for IE to work */
|
| 135 |
+
background-color: #fff;
|
| 136 |
+
filter: alpha(opacity=0);
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
.ccselect2-drop {
|
| 140 |
+
width: 100%;
|
| 141 |
+
margin-top: -1px;
|
| 142 |
+
position: absolute;
|
| 143 |
+
z-index: 9999;
|
| 144 |
+
top: 100%;
|
| 145 |
+
|
| 146 |
+
background: #fff;
|
| 147 |
+
color: #000;
|
| 148 |
+
border: 1px solid #aaa;
|
| 149 |
+
border-top: 0;
|
| 150 |
+
|
| 151 |
+
border-radius: 0 0 4px 4px;
|
| 152 |
+
|
| 153 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 154 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
.ccselect2-drop.ccselect2-drop-above {
|
| 158 |
+
margin-top: 1px;
|
| 159 |
+
border-top: 1px solid #aaa;
|
| 160 |
+
border-bottom: 0;
|
| 161 |
+
|
| 162 |
+
border-radius: 4px 4px 0 0;
|
| 163 |
+
|
| 164 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 165 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
.ccselect2-drop-active {
|
| 169 |
+
border: 1px solid #5b9dd9;
|
| 170 |
+
border-top: none;
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
.ccselect2-drop.ccselect2-drop-above.ccselect2-drop-active {
|
| 174 |
+
border-top: 1px solid #5b9dd9;
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
.ccselect2-drop-auto-width {
|
| 178 |
+
border-top: 1px solid #aaa;
|
| 179 |
+
width: auto;
|
| 180 |
+
}
|
| 181 |
+
|
| 182 |
+
.ccselect2-drop-auto-width .ccselect2-search {
|
| 183 |
+
padding-top: 4px;
|
| 184 |
+
}
|
| 185 |
+
|
| 186 |
+
.ccselect2-container .ccselect2-choice .ccselect2-arrow {
|
| 187 |
+
display: inline-block;
|
| 188 |
+
width: 18px;
|
| 189 |
+
height: 100%;
|
| 190 |
+
position: absolute;
|
| 191 |
+
right: 0;
|
| 192 |
+
top: 0;
|
| 193 |
+
|
| 194 |
+
border-left: 1px solid #aaa;
|
| 195 |
+
border-radius: 0 4px 4px 0;
|
| 196 |
+
|
| 197 |
+
background-clip: padding-box;
|
| 198 |
+
|
| 199 |
+
background: #ccc;
|
| 200 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 201 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 202 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 204 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
html[dir="rtl"] .ccselect2-container .ccselect2-choice .ccselect2-arrow {
|
| 208 |
+
left: 0;
|
| 209 |
+
right: auto;
|
| 210 |
+
|
| 211 |
+
border-left: none;
|
| 212 |
+
border-right: 1px solid #aaa;
|
| 213 |
+
border-radius: 4px 0 0 4px;
|
| 214 |
+
}
|
| 215 |
+
|
| 216 |
+
.ccselect2-container .ccselect2-choice .ccselect2-arrow b {
|
| 217 |
+
display: block;
|
| 218 |
+
width: 100%;
|
| 219 |
+
height: 100%;
|
| 220 |
+
background: url('ccselect2.png') no-repeat 0 1px;
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
html[dir="rtl"] .ccselect2-container .ccselect2-choice .ccselect2-arrow b {
|
| 224 |
+
background-position: 2px 1px;
|
| 225 |
+
}
|
| 226 |
+
|
| 227 |
+
.ccselect2-search {
|
| 228 |
+
display: inline-block;
|
| 229 |
+
width: 100%;
|
| 230 |
+
min-height: 26px;
|
| 231 |
+
margin: 0;
|
| 232 |
+
padding-left: 4px;
|
| 233 |
+
padding-right: 4px;
|
| 234 |
+
|
| 235 |
+
position: relative;
|
| 236 |
+
z-index: 10000;
|
| 237 |
+
|
| 238 |
+
white-space: nowrap;
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
.ccselect2-search input {
|
| 242 |
+
width: 100%;
|
| 243 |
+
height: auto !important;
|
| 244 |
+
min-height: 26px;
|
| 245 |
+
padding: 4px 20px 4px 5px;
|
| 246 |
+
margin: 0;
|
| 247 |
+
|
| 248 |
+
outline: 0;
|
| 249 |
+
font-family: sans-serif;
|
| 250 |
+
font-size: 1em;
|
| 251 |
+
|
| 252 |
+
border: 1px solid #aaa;
|
| 253 |
+
border-radius: 0;
|
| 254 |
+
|
| 255 |
+
-webkit-box-shadow: none;
|
| 256 |
+
box-shadow: none;
|
| 257 |
+
|
| 258 |
+
background: #fff url('ccselect2.png') no-repeat 100% -22px;
|
| 259 |
+
background: url('ccselect2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 260 |
+
background: url('ccselect2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 261 |
+
background: url('ccselect2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
+
background: url('ccselect2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
html[dir="rtl"] .ccselect2-search input {
|
| 266 |
+
padding: 4px 5px 4px 20px;
|
| 267 |
+
|
| 268 |
+
background: #fff url('ccselect2.png') no-repeat -37px -22px;
|
| 269 |
+
background: url('ccselect2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 270 |
+
background: url('ccselect2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 271 |
+
background: url('ccselect2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
+
background: url('ccselect2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
+
.ccselect2-drop.ccselect2-drop-above .ccselect2-search input {
|
| 276 |
+
margin-top: 4px;
|
| 277 |
+
}
|
| 278 |
+
|
| 279 |
+
.ccselect2-search input.ccselect2-active {
|
| 280 |
+
background: #fff url('ccselect2-spinner.gif') no-repeat 100%;
|
| 281 |
+
background: url('ccselect2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 282 |
+
background: url('ccselect2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 283 |
+
background: url('ccselect2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
+
background: url('ccselect2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
+
.ccselect2-container-active .ccselect2-choice,
|
| 288 |
+
.ccselect2-container-active .ccselect2-choices {
|
| 289 |
+
border: 1px solid #5b9dd9;
|
| 290 |
+
outline: none;
|
| 291 |
+
|
| 292 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 293 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
+
}
|
| 295 |
+
|
| 296 |
+
.ccselect2-dropdown-open .ccselect2-choice {
|
| 297 |
+
border-bottom-color: transparent;
|
| 298 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 299 |
+
box-shadow: 0 1px 0 #fff inset;
|
| 300 |
+
|
| 301 |
+
border-bottom-left-radius: 0;
|
| 302 |
+
border-bottom-right-radius: 0;
|
| 303 |
+
|
| 304 |
+
background-color: #eee;
|
| 305 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 306 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 307 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 309 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 310 |
+
}
|
| 311 |
+
|
| 312 |
+
.ccselect2-dropdown-open.ccselect2-drop-above .ccselect2-choice,
|
| 313 |
+
.ccselect2-dropdown-open.ccselect2-drop-above .ccselect2-choices {
|
| 314 |
+
border: 1px solid #5b9dd9;
|
| 315 |
+
border-top-color: transparent;
|
| 316 |
+
|
| 317 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 318 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 319 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 321 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
.ccselect2-dropdown-open .ccselect2-choice .ccselect2-arrow {
|
| 325 |
+
background: transparent;
|
| 326 |
+
border-left: none;
|
| 327 |
+
filter: none;
|
| 328 |
+
}
|
| 329 |
+
html[dir="rtl"] .ccselect2-dropdown-open .ccselect2-choice .ccselect2-arrow {
|
| 330 |
+
border-right: none;
|
| 331 |
+
}
|
| 332 |
+
|
| 333 |
+
.ccselect2-dropdown-open .ccselect2-choice .ccselect2-arrow b {
|
| 334 |
+
background-position: -18px 1px;
|
| 335 |
+
}
|
| 336 |
+
|
| 337 |
+
html[dir="rtl"] .ccselect2-dropdown-open .ccselect2-choice .ccselect2-arrow b {
|
| 338 |
+
background-position: -16px 1px;
|
| 339 |
+
}
|
| 340 |
+
|
| 341 |
+
.ccselect2-hidden-accessible {
|
| 342 |
+
border: 0;
|
| 343 |
+
clip: rect(0 0 0 0);
|
| 344 |
+
height: 1px;
|
| 345 |
+
margin: -1px;
|
| 346 |
+
overflow: hidden;
|
| 347 |
+
padding: 0;
|
| 348 |
+
position: absolute;
|
| 349 |
+
width: 1px;
|
| 350 |
+
}
|
| 351 |
+
|
| 352 |
+
/* results */
|
| 353 |
+
.ccselect2-results {
|
| 354 |
+
max-height: 200px;
|
| 355 |
+
padding: 0 0 0 4px;
|
| 356 |
+
margin: 4px 4px 4px 0;
|
| 357 |
+
position: relative;
|
| 358 |
+
overflow-x: hidden;
|
| 359 |
+
overflow-y: auto;
|
| 360 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 361 |
+
}
|
| 362 |
+
|
| 363 |
+
html[dir="rtl"] .ccselect2-results {
|
| 364 |
+
padding: 0 4px 0 0;
|
| 365 |
+
margin: 4px 0 4px 4px;
|
| 366 |
+
}
|
| 367 |
+
|
| 368 |
+
.ccselect2-results ul.ccselect2-result-sub {
|
| 369 |
+
margin: 0;
|
| 370 |
+
padding-left: 0;
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
+
.ccselect2-results li {
|
| 374 |
+
list-style: none;
|
| 375 |
+
display: list-item;
|
| 376 |
+
background-image: none;
|
| 377 |
+
}
|
| 378 |
+
|
| 379 |
+
.ccselect2-results li.ccselect2-result-with-children > .ccselect2-result-label {
|
| 380 |
+
font-weight: bold;
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
.ccselect2-results .ccselect2-result-label {
|
| 384 |
+
padding: 3px 7px 4px;
|
| 385 |
+
margin: 0;
|
| 386 |
+
cursor: pointer;
|
| 387 |
+
|
| 388 |
+
min-height: 1em;
|
| 389 |
+
|
| 390 |
+
-webkit-touch-callout: none;
|
| 391 |
+
-webkit-user-select: none;
|
| 392 |
+
-moz-user-select: none;
|
| 393 |
+
-ms-user-select: none;
|
| 394 |
+
user-select: none;
|
| 395 |
+
}
|
| 396 |
+
|
| 397 |
+
.ccselect2-results-dept-1 .ccselect2-result-label { padding-left: 20px }
|
| 398 |
+
.ccselect2-results-dept-2 .ccselect2-result-label { padding-left: 40px }
|
| 399 |
+
.ccselect2-results-dept-3 .ccselect2-result-label { padding-left: 60px }
|
| 400 |
+
.ccselect2-results-dept-4 .ccselect2-result-label { padding-left: 80px }
|
| 401 |
+
.ccselect2-results-dept-5 .ccselect2-result-label { padding-left: 100px }
|
| 402 |
+
.ccselect2-results-dept-6 .ccselect2-result-label { padding-left: 110px }
|
| 403 |
+
.ccselect2-results-dept-7 .ccselect2-result-label { padding-left: 120px }
|
| 404 |
+
|
| 405 |
+
.ccselect2-results .ccselect2-highlighted {
|
| 406 |
+
background: #5b9dd9;
|
| 407 |
+
color: #fff;
|
| 408 |
+
}
|
| 409 |
+
|
| 410 |
+
.ccselect2-results li em {
|
| 411 |
+
background: #feffde;
|
| 412 |
+
font-style: normal;
|
| 413 |
+
}
|
| 414 |
+
|
| 415 |
+
.ccselect2-results .ccselect2-highlighted em {
|
| 416 |
+
background: transparent;
|
| 417 |
+
}
|
| 418 |
+
|
| 419 |
+
.ccselect2-results .ccselect2-highlighted ul {
|
| 420 |
+
background: #fff;
|
| 421 |
+
color: #000;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
.ccselect2-results .ccselect2-no-results,
|
| 425 |
+
.ccselect2-results .ccselect2-searching,
|
| 426 |
+
.ccselect2-results .ccselect2-ajax-error,
|
| 427 |
+
.ccselect2-results .ccselect2-selection-limit {
|
| 428 |
+
background: #f4f4f4;
|
| 429 |
+
display: list-item;
|
| 430 |
+
padding-left: 5px;
|
| 431 |
+
}
|
| 432 |
+
|
| 433 |
+
/*
|
| 434 |
+
disabled look for disabled choices in the results dropdown
|
| 435 |
+
*/
|
| 436 |
+
.ccselect2-results .ccselect2-disabled.ccselect2-highlighted {
|
| 437 |
+
color: #666;
|
| 438 |
+
background: #f4f4f4;
|
| 439 |
+
display: list-item;
|
| 440 |
+
cursor: default;
|
| 441 |
+
}
|
| 442 |
+
.ccselect2-results .ccselect2-disabled {
|
| 443 |
+
background: #f4f4f4;
|
| 444 |
+
display: list-item;
|
| 445 |
+
cursor: default;
|
| 446 |
+
}
|
| 447 |
+
|
| 448 |
+
.ccselect2-results .ccselect2-selected {
|
| 449 |
+
display: none;
|
| 450 |
+
}
|
| 451 |
+
|
| 452 |
+
.ccselect2-more-results.ccselect2-active {
|
| 453 |
+
background: #f4f4f4 url('ccselect2-spinner.gif') no-repeat 100%;
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
.ccselect2-results .ccselect2-ajax-error {
|
| 457 |
+
background: rgba(255, 50, 50, .2);
|
| 458 |
+
}
|
| 459 |
+
|
| 460 |
+
.ccselect2-more-results {
|
| 461 |
+
background: #f4f4f4;
|
| 462 |
+
display: list-item;
|
| 463 |
+
}
|
| 464 |
+
|
| 465 |
+
/* disabled styles */
|
| 466 |
+
|
| 467 |
+
.ccselect2-container.ccselect2-container-disabled .ccselect2-choice {
|
| 468 |
+
background-color: #f4f4f4;
|
| 469 |
+
background-image: none;
|
| 470 |
+
border: 1px solid #ddd;
|
| 471 |
+
cursor: default;
|
| 472 |
+
}
|
| 473 |
+
|
| 474 |
+
.ccselect2-container.ccselect2-container-disabled .ccselect2-choice .ccselect2-arrow {
|
| 475 |
+
background-color: #f4f4f4;
|
| 476 |
+
background-image: none;
|
| 477 |
+
border-left: 0;
|
| 478 |
+
}
|
| 479 |
+
|
| 480 |
+
.ccselect2-container.ccselect2-container-disabled .ccselect2-choice abbr {
|
| 481 |
+
display: none;
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
|
| 485 |
+
/* multiselect */
|
| 486 |
+
|
| 487 |
+
.ccselect2-container-multi .ccselect2-choices {
|
| 488 |
+
height: auto !important;
|
| 489 |
+
height: 1%;
|
| 490 |
+
margin: 0;
|
| 491 |
+
padding: 0 5px 0 0;
|
| 492 |
+
position: relative;
|
| 493 |
+
|
| 494 |
+
border: 1px solid #ddd;
|
| 495 |
+
cursor: text;
|
| 496 |
+
overflow: hidden;
|
| 497 |
+
|
| 498 |
+
background-color: #fff;
|
| 499 |
+
}
|
| 500 |
+
|
| 501 |
+
html[dir="rtl"] .ccselect2-container-multi .ccselect2-choices {
|
| 502 |
+
padding: 0 0 0 5px;
|
| 503 |
+
}
|
| 504 |
+
|
| 505 |
+
.ccselect2-locked {
|
| 506 |
+
padding: 3px 5px 3px 5px !important;
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
.ccselect2-container-multi .ccselect2-choices {
|
| 510 |
+
min-height: 26px;
|
| 511 |
+
}
|
| 512 |
+
|
| 513 |
+
.ccselect2-container-multi.ccselect2-container-active .ccselect2-choices {
|
| 514 |
+
border: 1px solid #5b9dd9;
|
| 515 |
+
outline: none;
|
| 516 |
+
|
| 517 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 518 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 519 |
+
}
|
| 520 |
+
.ccselect2-container-multi .ccselect2-choices li {
|
| 521 |
+
float: left;
|
| 522 |
+
list-style: none;
|
| 523 |
+
}
|
| 524 |
+
html[dir="rtl"] .ccselect2-container-multi .ccselect2-choices li
|
| 525 |
+
{
|
| 526 |
+
float: right;
|
| 527 |
+
}
|
| 528 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-field {
|
| 529 |
+
margin: 0;
|
| 530 |
+
padding: 0;
|
| 531 |
+
white-space: nowrap;
|
| 532 |
+
}
|
| 533 |
+
|
| 534 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-field input {
|
| 535 |
+
padding: 5px;
|
| 536 |
+
margin: 1px 0;
|
| 537 |
+
|
| 538 |
+
font-family: sans-serif;
|
| 539 |
+
font-size: 100%;
|
| 540 |
+
color: #666;
|
| 541 |
+
outline: 0;
|
| 542 |
+
border: 0;
|
| 543 |
+
-webkit-box-shadow: none;
|
| 544 |
+
box-shadow: none;
|
| 545 |
+
background: transparent !important;
|
| 546 |
+
}
|
| 547 |
+
|
| 548 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-field input.ccselect2-active {
|
| 549 |
+
background: #fff url('ccselect2-spinner.gif') no-repeat 100% !important;
|
| 550 |
+
}
|
| 551 |
+
|
| 552 |
+
.ccselect2-default {
|
| 553 |
+
color: #999 !important;
|
| 554 |
+
}
|
| 555 |
+
|
| 556 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice {
|
| 557 |
+
padding: 3px 5px 3px 18px;
|
| 558 |
+
margin: 3px 0 3px 5px;
|
| 559 |
+
position: relative;
|
| 560 |
+
|
| 561 |
+
line-height: 13px;
|
| 562 |
+
color: #333;
|
| 563 |
+
cursor: default;
|
| 564 |
+
border: 1px solid #bababa;
|
| 565 |
+
|
| 566 |
+
border-radius: 3px;
|
| 567 |
+
|
| 568 |
+
background-clip: padding-box;
|
| 569 |
+
|
| 570 |
+
-webkit-touch-callout: none;
|
| 571 |
+
-webkit-user-select: none;
|
| 572 |
+
-moz-user-select: none;
|
| 573 |
+
-ms-user-select: none;
|
| 574 |
+
user-select: none;
|
| 575 |
+
|
| 576 |
+
background-color: #ededed;
|
| 577 |
+
|
| 578 |
+
}
|
| 579 |
+
html[dir="rtl"] .ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice
|
| 580 |
+
{
|
| 581 |
+
margin: 3px 5px 3px 0;
|
| 582 |
+
padding: 3px 18px 3px 5px;
|
| 583 |
+
}
|
| 584 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice .ccselect2-chosen {
|
| 585 |
+
cursor: default;
|
| 586 |
+
}
|
| 587 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice-focus {
|
| 588 |
+
background: #5b9dd9;
|
| 589 |
+
color: #fff;
|
| 590 |
+
border-color: #4b8dc9;
|
| 591 |
+
}
|
| 592 |
+
|
| 593 |
+
.ccselect2-search-choice-close {
|
| 594 |
+
display: block;
|
| 595 |
+
width: 12px;
|
| 596 |
+
height: 13px;
|
| 597 |
+
position: absolute;
|
| 598 |
+
right: 3px;
|
| 599 |
+
top: 4px;
|
| 600 |
+
|
| 601 |
+
font-size: 1px;
|
| 602 |
+
outline: none;
|
| 603 |
+
}
|
| 604 |
+
html[dir="rtl"] .ccselect2-search-choice-close {
|
| 605 |
+
right: auto;
|
| 606 |
+
left: 3px;
|
| 607 |
+
}
|
| 608 |
+
|
| 609 |
+
.ccselect2-container-multi .ccselect2-search-choice-close {
|
| 610 |
+
left: 3px;
|
| 611 |
+
font-size: 12px;
|
| 612 |
+
color: #333;
|
| 613 |
+
}
|
| 614 |
+
|
| 615 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice-focus .ccselect2-search-choice-close{
|
| 616 |
+
color: #fff;
|
| 617 |
+
}
|
| 618 |
+
|
| 619 |
+
html[dir="rtl"] .ccselect2-container-multi .ccselect2-search-choice-close {
|
| 620 |
+
left: auto;
|
| 621 |
+
right: 2px;
|
| 622 |
+
}
|
| 623 |
+
|
| 624 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice .ccselect2-search-choice-close:hover {
|
| 625 |
+
background-position: right -11px;
|
| 626 |
+
}
|
| 627 |
+
.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice-focus .ccselect2-search-choice-close {
|
| 628 |
+
background-position: right -11px;
|
| 629 |
+
}
|
| 630 |
+
|
| 631 |
+
/* disabled styles */
|
| 632 |
+
.ccselect2-container-multi.ccselect2-container-disabled .ccselect2-choices {
|
| 633 |
+
background-color: #f4f4f4;
|
| 634 |
+
background-image: none;
|
| 635 |
+
border: 1px solid #ddd;
|
| 636 |
+
cursor: default;
|
| 637 |
+
}
|
| 638 |
+
|
| 639 |
+
.ccselect2-container-multi.ccselect2-container-disabled .ccselect2-choices .ccselect2-search-choice {
|
| 640 |
+
padding: 3px 5px 3px 5px;
|
| 641 |
+
border: 1px solid #ddd;
|
| 642 |
+
background-image: none;
|
| 643 |
+
background-color: #f4f4f4;
|
| 644 |
+
}
|
| 645 |
+
|
| 646 |
+
.ccselect2-container-multi.ccselect2-container-disabled .ccselect2-choices .ccselect2-search-choice .ccselect2-search-choice-close { display: none;
|
| 647 |
+
background: none;
|
| 648 |
+
}
|
| 649 |
+
/* end multiselect */
|
| 650 |
+
|
| 651 |
+
|
| 652 |
+
.ccselect2-result-selectable .ccselect2-match,
|
| 653 |
+
.ccselect2-result-unselectable .ccselect2-match {
|
| 654 |
+
text-decoration: underline;
|
| 655 |
+
}
|
| 656 |
+
|
| 657 |
+
.ccselect2-offscreen, .ccselect2-offscreen:focus {
|
| 658 |
+
clip: rect(0 0 0 0) !important;
|
| 659 |
+
width: 1px !important;
|
| 660 |
+
height: 1px !important;
|
| 661 |
+
border: 0 !important;
|
| 662 |
+
margin: 0 !important;
|
| 663 |
+
padding: 0 !important;
|
| 664 |
+
overflow: hidden !important;
|
| 665 |
+
position: absolute !important;
|
| 666 |
+
outline: 0 !important;
|
| 667 |
+
left: 0px !important;
|
| 668 |
+
top: 0px !important;
|
| 669 |
+
}
|
| 670 |
+
|
| 671 |
+
.ccselect2-display-none {
|
| 672 |
+
display: none;
|
| 673 |
+
}
|
| 674 |
+
|
| 675 |
+
.ccselect2-measure-scrollbar {
|
| 676 |
+
position: absolute;
|
| 677 |
+
top: -10000px;
|
| 678 |
+
left: -10000px;
|
| 679 |
+
width: 100px;
|
| 680 |
+
height: 100px;
|
| 681 |
+
overflow: scroll;
|
| 682 |
+
}
|
| 683 |
+
|
| 684 |
+
/* Retina-ize icons */
|
| 685 |
+
|
| 686 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 687 |
+
.ccselect2-search input,
|
| 688 |
+
.ccselect2-search-choice-close,
|
| 689 |
+
.ccselect2-container .ccselect2-choice abbr,
|
| 690 |
+
.ccselect2-container .ccselect2-choice .ccselect2-arrow b {
|
| 691 |
+
background-image: url('ccselect2x2.png') !important;
|
| 692 |
+
background-repeat: no-repeat !important;
|
| 693 |
+
background-size: 60px 40px !important;
|
| 694 |
+
}
|
| 695 |
+
|
| 696 |
+
.ccselect2-search input {
|
| 697 |
+
background-position: 100% -21px !important;
|
| 698 |
+
}
|
| 699 |
+
}
|
| 700 |
+
|
| 701 |
+
.caldera-grid .ccselect2-container.form-control:hover,
|
| 702 |
+
.caldera-grid .ccselect2-container.form-control {
|
| 703 |
+
border: 0 none;
|
| 704 |
+
height: auto;
|
| 705 |
+
padding: 0;
|
| 706 |
+
}
|
fields/select2/field/config.php
ADDED
|
@@ -0,0 +1,55 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="caldera-config-group">
|
| 2 |
+
<label>
|
| 3 |
+
<?php _e( 'Placeholder', 'caldera-forms' ); ?>
|
| 4 |
+
</label>
|
| 5 |
+
<div class="caldera-config-field">
|
| 6 |
+
<input type="text" id="{{_id}}_placeholder" class="block-input field-config" name="{{_name}}[placeholder]" value="{{placeholder}}">
|
| 7 |
+
</div>
|
| 8 |
+
</div>
|
| 9 |
+
<div class="caldera-config-group">
|
| 10 |
+
<label>
|
| 11 |
+
<?php _e( 'Multiple', 'caldera-forms'); ?>
|
| 12 |
+
</label>
|
| 13 |
+
<div class="caldera-config-field">
|
| 14 |
+
<label>
|
| 15 |
+
<input type="checkbox" id="{{_id}}_is_multi" class="field-config" name="{{_name}}[multi]" value="1" {{#if multi}}checked="checked"{{/if}}> <?php _e( 'Enable multiple selections', 'caldera-forms'); ?></label>
|
| 16 |
+
</div>
|
| 17 |
+
</div>
|
| 18 |
+
<div class="caldera-config-group">
|
| 19 |
+
<label for="{{_id}}_color">
|
| 20 |
+
<?php _e('Highlight', 'caldera-forms'); ?>
|
| 21 |
+
</label>
|
| 22 |
+
<div class="caldera-config-field">
|
| 23 |
+
<input id="{{_id}}_color" style="width: 120px;" type="text" class="minicolor-picker field-config" name="{{_name}}[color]" value="{{#if color}}{{color}}{{else}}#5b9dd9{{/if}}">
|
| 24 |
+
<span id="{{_id}}_color_preview" class="preview-color-selector" style="margin-left: -27px; padding-bottom: 4px; padding-top: 4px; background-color: {{#if color}}{{color}}{{else}}#5b9dd9{{/if}};"></span>
|
| 25 |
+
</div>
|
| 26 |
+
</div>
|
| 27 |
+
<div class="caldera-config-group">
|
| 28 |
+
<label for="{{_id}}_border">
|
| 29 |
+
<?php _e( 'Border', 'caldera-forms' ); ?>
|
| 30 |
+
</label>
|
| 31 |
+
<div class="caldera-config-field">
|
| 32 |
+
<input id="{{_id}}_border" style="width: 120px;" type="text" class="minicolor-picker field-config" name="{{_name}}[border]" value="{{#if border}}{{border}}{{else}}#4b8dc9{{/if}}">
|
| 33 |
+
<span id="{{_id}}_border_preview" class="preview-color-selector" style="margin-left: -27px; padding-bottom: 4px; padding-top: 4px; background-color: {{#if border}}{{border}}{{else}}#4b8dc9{{/if}};"></span>
|
| 34 |
+
</div>
|
| 35 |
+
</div>
|
| 36 |
+
|
| 37 |
+
{{#script}}
|
| 38 |
+
jQuery(function($){
|
| 39 |
+
jQuery('#{{_id}}_color').miniColors({
|
| 40 |
+
change: function(hex, opacity) {
|
| 41 |
+
jQuery('#{{_id}}_color_preview').css('background-color', hex);
|
| 42 |
+
}
|
| 43 |
+
});
|
| 44 |
+
jQuery('#{{_id}}_border').miniColors({
|
| 45 |
+
change: function(hex, opacity) {
|
| 46 |
+
jQuery('#{{_id}}_border_preview').css('background-color', hex);
|
| 47 |
+
}
|
| 48 |
+
});
|
| 49 |
+
});
|
| 50 |
+
{{/script}}
|
| 51 |
+
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
|
fields/select2/field/field.php
ADDED
|
@@ -0,0 +1,139 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
$bound = null;
|
| 4 |
+
if( !empty( $field['config']['advanced_populate']['filter'] ) ){
|
| 5 |
+
preg_match_all("/%(.+?)%/", $field['config']['advanced_populate']['filter'], $hastags);
|
| 6 |
+
if(!empty($hastags[1])){
|
| 7 |
+
|
| 8 |
+
foreach($hastags[1] as $tag_key=>$tag){
|
| 9 |
+
foreach($form['fields'] as $key_id=>$fcfg){
|
| 10 |
+
if($fcfg['slug'] === $tag){
|
| 11 |
+
$bound = '[data-field="'.$key_id.'_'.$current_form_count.'"]';
|
| 12 |
+
}
|
| 13 |
+
}
|
| 14 |
+
}
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
echo $wrapper_before;
|
| 21 |
+
if ( isset( $field[ 'slug' ] ) && isset( $_GET[ $field[ 'slug' ] ] ) ) {
|
| 22 |
+
$field_value = Caldera_Forms_Sanitize::sanitize( $_GET[ $field[ 'slug' ] ] );
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
$multi = '';
|
| 26 |
+
if( !empty( $field['config']['multi'] ) ){
|
| 27 |
+
$multi = 'multiple="multiple"';
|
| 28 |
+
$field_name .= '[]';
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
$placeholder = '';
|
| 32 |
+
if( !empty( $field['config']['placeholder'] ) ){
|
| 33 |
+
$placeholder = 'data-placeholder="' . esc_attr( $field['config']['placeholder'] ) . '"';
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
?>
|
| 37 |
+
<?php echo $field_label; ?>
|
| 38 |
+
<?php echo $field_before; ?>
|
| 39 |
+
<?php if( empty( $bound ) ){ ?>
|
| 40 |
+
<select <?php echo $field_placeholder; ?> id="<?php echo $field_id; ?>" <?php echo $multi; ?> data-select-two="true" data-field="<?php echo $field_base_id; ?>" class="<?php echo $field_class; ?>" name="<?php echo $field_name; ?>" <?php echo $field_required; ?> <?php echo $placeholder; ?>>
|
| 41 |
+
<?php
|
| 42 |
+
if(isset( $field['config'] ) && isset($field['config']['default']) && isset($field['config']['option'][$field['config']['default']])){
|
| 43 |
+
//if( $field['config']['option'][$field['config']['default']]['value'] )
|
| 44 |
+
if( $field['config']['default'] === $field_value ){
|
| 45 |
+
$field_value = $field['config']['option'][$field['config']['default']]['value'];
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
|
| 52 |
+
if(!empty($field['config']['option'])){
|
| 53 |
+
if(!empty($field['config']['default'])){
|
| 54 |
+
if(!isset($field['config']['option'][$field['config']['default']])){
|
| 55 |
+
echo "<option value=\"\"></option>\r\n";
|
| 56 |
+
}
|
| 57 |
+
}elseif( !empty( $field['config']['placeholder'] ) ){
|
| 58 |
+
echo '<option value=""></option>';
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
foreach($field['config']['option'] as $option_key=>$option){
|
| 62 |
+
if(!isset($option['value'])){
|
| 63 |
+
$option['value'] = htmlspecialchars( $option['label'] );
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
?>
|
| 67 |
+
<option value="<?php echo $option['value']; ?>" <?php if( in_array( $option['value'] , (array) $field_value ) ){ ?>selected="selected"<?php } ?>><?php echo $option['label']; ?></option>
|
| 68 |
+
<?php
|
| 69 |
+
}
|
| 70 |
+
} ?>
|
| 71 |
+
</select>
|
| 72 |
+
<?php }else{ ?>
|
| 73 |
+
<input type="text" data-select-two="true" id="<?php echo $field_id; ?>" data-field="<?php echo $field_base_id; ?>" name="<?php echo $field_name; ?>[]" multiple="multiple" value="<?php echo htmlentities( $field_value ); ?>">
|
| 74 |
+
<?php } ?>
|
| 75 |
+
<?php echo $field_caption; ?>
|
| 76 |
+
<?php echo $field_after; ?>
|
| 77 |
+
<?php echo $wrapper_after; ?>
|
| 78 |
+
|
| 79 |
+
<?php
|
| 80 |
+
ob_start();
|
| 81 |
+
?>
|
| 82 |
+
<style>
|
| 83 |
+
.ccselect2-drop-active,.ccselect2-drop.ccselect2-drop-above.ccselect2-drop-active,.ccselect2-container-active .ccselect2-choice,.ccselect2-container-active .ccselect2-choices,.ccselect2-dropdown-open.ccselect2-drop-above .ccselect2-choice,.ccselect2-dropdown-open.ccselect2-drop-above .ccselect2-choices,.ccselect2-container-multi.ccselect2-container-active .ccselect2-choices,.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice-focus{
|
| 84 |
+
border-color: <?php echo $field['config']['border']; ?>;
|
| 85 |
+
}.ccselect2-results .ccselect2-highlighted,.ccselect2-container-multi .ccselect2-choices .ccselect2-search-choice-focus{
|
| 86 |
+
background: <?php echo $field['config']['color']; ?>;
|
| 87 |
+
}
|
| 88 |
+
</style>
|
| 89 |
+
<script>
|
| 90 |
+
jQuery( function($){
|
| 91 |
+
<?php if( !empty( $bound ) ){ ?>
|
| 92 |
+
var opts = {
|
| 93 |
+
ajax: {
|
| 94 |
+
url: ajaxurl,
|
| 95 |
+
dataType: 'json',
|
| 96 |
+
quietMillis: 250,
|
| 97 |
+
data: function (term, page) {
|
| 98 |
+
return {
|
| 99 |
+
action : 'cf_filter_populate',
|
| 100 |
+
q: $('<?php echo $bound; ?>').val(), // search term
|
| 101 |
+
<?php if( !empty( $field['config']['easy_pod'] ) ){?>easy_pod : '<?php echo $field['config']['easy_pod']; ?>'<?php } ?>
|
| 102 |
+
};
|
| 103 |
+
},
|
| 104 |
+
results: function (data, page) {
|
| 105 |
+
console.log( data );
|
| 106 |
+
return { results: data };
|
| 107 |
+
},
|
| 108 |
+
cache: true
|
| 109 |
+
}
|
| 110 |
+
};
|
| 111 |
+
<?php }else{ ?>
|
| 112 |
+
var opts = {};
|
| 113 |
+
<?php } ?>
|
| 114 |
+
|
| 115 |
+
$(document).on('cf.add', function(){
|
| 116 |
+
$('#<?php echo $field_id; ?>').select2( opts );
|
| 117 |
+
}).trigger('cf.add');
|
| 118 |
+
});
|
| 119 |
+
</script>
|
| 120 |
+
<?php
|
| 121 |
+
$script_template = ob_get_clean();
|
| 122 |
+
$grid->append( $script_template, $location );
|
| 123 |
+
|
| 124 |
+
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
|
| 130 |
+
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
|
| 134 |
+
|
| 135 |
+
|
| 136 |
+
|
| 137 |
+
|
| 138 |
+
|
| 139 |
+
|
fields/select2/field/preview.php
ADDED
|
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="preview-caldera-config-group">
|
| 2 |
+
{{#unless hide_label}}<lable class="control-label">{{label}}{{#if required}} <span style="color:#ff0000;">*</span>{{/if}}</lable>{{/unless}}
|
| 3 |
+
<div class="preview-caldera-config-field">
|
| 4 |
+
<select class="preview-field-config" {{#if hide_label}}placeholder="{{label}}"{{/if}}>
|
| 5 |
+
<option value=""></option>
|
| 6 |
+
{{#each config/option}}
|
| 7 |
+
<option {{#is ../config/default value="@key"}}selected="selected"{{/is}}>{{label}}</option>
|
| 8 |
+
{{/each}}
|
| 9 |
+
</select>
|
| 10 |
+
<span class="help-block">{{caption}}</span>
|
| 11 |
+
</div>
|
| 12 |
+
</div>
|
fields/select2/js/select2.min.js
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2014 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
+
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","ccselect2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("ccselect2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("ccselect2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='ccselect2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='ccselect2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".ccselect2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".ccselect2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("ccselect2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".ccselect2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.ccselect2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".ccselect2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".ccselect2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("ccselect2-focused")}),e.on("blur",function(){e.removeClass("ccselect2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".ccselect2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("ccselect2-results-dept-"+l),s.addClass("ccselect2-result"),s.addClass(p?"ccselect2-result-selectable":"ccselect2-result-unselectable"),q&&s.addClass("ccselect2-disabled"),r&&s.addClass("ccselect2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("ccselect2-result-label"),t.attr("id","ccselect2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("ccselect2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("ccselect2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-ccselect2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("ccselect2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("ccselect2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("ccselect2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("ccselect2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("ccselect2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("ccselect2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("ccselect2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".ccselect2-results",b)[0],b.addClass("ccselect2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("ccselect2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("ccselect2-drop-above"),b.addClass("ccselect2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("ccselect2-drop-above"),b.removeClass("ccselect2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("ccselect2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("ccselect2-drop-above"),this.dropdown.removeClass("ccselect2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("ccselect2-dropdown-open").addClass("ccselect2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#ccselect2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","ccselect2-drop-mask").attr("class","ccselect2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#ccselect2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#ccselect2-drop").removeAttr("id"),this.dropdown.attr("id","ccselect2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("ccselect2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#ccselect2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("ccselect2-dropdown-open").removeClass("ccselect2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("ccselect2-active"),this.opts.element.trigger(a.Event("ccselect2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".ccselect2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.ccselect2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".ccselect2-result-selectable:not(.ccselect2-disabled):not(.ccselect2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
+
var e=a(c[d]);if(e.hasClass("ccselect2-result-selectable")&&!e.hasClass("ccselect2-disabled")&&!e.hasClass("ccselect2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".ccselect2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("ccselect2-highlighted"),this.search.attr("aria-activedescendant",d.find(".ccselect2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("ccselect2-data"),e&&this.opts.element.trigger({type:"ccselect2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".ccselect2-highlighted").removeClass("ccselect2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".ccselect2-result-selectable");if(c.length>0&&!c.is(".ccselect2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.ccselect2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("ccselect2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"ccselect2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("ccselect2-active"),h.positionDropdown(),e.find(".ccselect2-no-results,.ccselect2-selection-limit,.ccselect2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.ccselect2-result-selectable:not(".ccselect2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"ccselect2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"ccselect2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='ccselect2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='ccselect2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='ccselect2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='ccselect2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("ccselect2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("ccselect2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='ccselect2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='ccselect2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='ccselect2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"ccselect2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("ccselect2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".ccselect2-search-choice-focus").removeClass("ccselect2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".ccselect2-highlighted"),d=c.closest(".ccselect2-result").data("ccselect2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"ccselect2-container"}).html(["<a href='javascript:void(0)' class='ccselect2-choice' tabindex='-1'>"," <span class='ccselect2-chosen'> </span><abbr class='ccselect2-search-choice-close dashicons dashicons-no-alt'></abbr>"," <span class='ccselect2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='ccselect2-offscreen'></label>","<input class='ccselect2-focusser ccselect2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='ccselect2-drop ccselect2-display-none'>"," <div class='ccselect2-search'>"," <label for='' class='ccselect2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='ccselect2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='ccselect2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("ccselect2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("ccselect2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".ccselect2-choice"),this.focusser=c.find(".ccselect2-focusser"),b.find(".ccselect2-chosen").attr("id","ccselect2-chosen-"+e),this.focusser.attr("aria-labelledby","ccselect2-chosen-"+e),this.results.attr("id","ccselect2-results-"+e),this.search.attr("aria-owns","ccselect2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("ccselect2-container-active")||this.opts.element.trigger(a.Event("ccselect2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("ccselect2-container-active")||this.opts.element.trigger(a.Event("ccselect2-focus")),this.container.addClass("ccselect2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("ccselect2-container-active"),this.opts.element.trigger(a.Event("ccselect2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("ccselect2-container-active")||this.opts.element.trigger(a.Event("ccselect2-focus")),this.container.addClass("ccselect2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("ccselect2-data");if(c){var d=a.Event("ccselect2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".ccselect2-chosen").empty(),this.selection.removeData("ccselect2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"ccselect2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".ccselect2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("ccselect2-default"),this.container.removeClass("ccselect2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("ccselect2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".ccselect2-search").toggleClass("ccselect2-search-hidden",!b),this.dropdown.find(".ccselect2-search").toggleClass("ccselect2-offscreen",!b),a(this.dropdown,this.container).toggleClass("ccselect2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"ccselect2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".ccselect2-chosen");this.selection.data("ccselect2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("ccselect2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("ccselect2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("ccselect2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"ccselect2-container ccselect2-container-multi"}).html(["<ul class='ccselect2-choices'>"," <li class='ccselect2-search-field'>"," <label for='' class='ccselect2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='ccselect2-input'>"," </li>","</ul>","<div class='ccselect2-drop ccselect2-drop-multi ccselect2-display-none'>"," <ul class='ccselect2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".ccselect2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("ccselect2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("ccselect2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".ccselect2-choices";this.searchContainer=this.container.find(".ccselect2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".ccselect2-container:not(.ccselect2-container-disabled) .ccselect2-search-choice:not(.ccselect2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".ccselect2-search-choice-focus"),d=b.prev(".ccselect2-search-choice:not(.ccselect2-locked)"),e=b.next(".ccselect2-search-choice:not(.ccselect2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".ccselect2-search-choice:not(.ccselect2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("ccselect2-container-active"),this.search.removeClass("ccselect2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("ccselect2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".ccselect2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("ccselect2-container-active")||this.opts.element.trigger(a.Event("ccselect2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("ccselect2-container-active")||this.opts.element.trigger(a.Event("ccselect2-focus")),this.container.addClass("ccselect2-container-active"),this.dropdown.addClass("ccselect2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("ccselect2-focused")===!1?(this.search.val(a).addClass("ccselect2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("ccselect2-default")&&this.search.val("").removeClass("ccselect2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("ccselect2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("ccselect2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".ccselect2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='ccselect2-search-choice'> <div></div> <a href='#' class='ccselect2-search-choice-close dashicons dashicons-no-alt' tabindex='-1'></a></li>"),f=a("<li class='ccselect2-search-choice ccselect2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".ccselect2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".ccselect2-search-choice-focus").removeClass("ccselect2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("ccselect2-container-active"),this.dropdown.addClass("ccselect2-drop-active"))})),g.data("ccselect2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".ccselect2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .ccselect2-search-choice";if(d=b.data("ccselect2-data")){var f=a.Event("ccselect2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"ccselect2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".ccselect2-result"),f=this.results.find(".ccselect2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("ccselect2-data"));p(c,d)>=0&&(b.addClass("ccselect2-selected"),b.find(".ccselect2-result-selectable").addClass("ccselect2-selected"))}),f.each2(function(a,b){b.is(".ccselect2-result-selectable")||0!==b.find(".ccselect2-result-selectable:not(.ccselect2-selected)").length||b.addClass("ccselect2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".ccselect2-result:not(.ccselect2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".ccselect2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='ccselect2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".ccselect2-search-choice").each(function(){b.push(c.opts.id(a(this).data("ccselect2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".ccselect2-search-choice").map(function(){return a(this).data("ccselect2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
+
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
| 24 |
+
|
fields/select2/select2.php
ADDED
|
@@ -0,0 +1,27 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
add_filter( 'caldera_forms_process_field_filtered_select2', 'caldera_forms_select2_populate_array' );
|
| 3 |
+
/**
|
| 4 |
+
* Populate entry options for select2 field
|
| 5 |
+
*
|
| 6 |
+
* @since @todo
|
| 7 |
+
*
|
| 8 |
+
* @uses caldera_forms_process_field_filtered_select2
|
| 9 |
+
*
|
| 10 |
+
* @param array $entry
|
| 11 |
+
*
|
| 12 |
+
* @return array
|
| 13 |
+
*/
|
| 14 |
+
function caldera_forms_select2_populate_array( $entry ){
|
| 15 |
+
|
| 16 |
+
if( !is_array( $entry ) ){
|
| 17 |
+
return $entry;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
$new_entry = array();
|
| 21 |
+
foreach( $entry as $value ){
|
| 22 |
+
$new_entry[$value] = $value;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
return $new_entry;
|
| 26 |
+
|
| 27 |
+
}
|
fields/star-rate/field.php
CHANGED
|
@@ -15,6 +15,7 @@ if(!isset($field['config']['type'])){
|
|
| 15 |
<?php echo $field_caption; ?>
|
| 16 |
<?php echo $field_after; ?>
|
| 17 |
<?php echo $wrapper_after; ?>
|
|
|
|
| 18 |
<script type="text/javascript">
|
| 19 |
jQuery(function($){
|
| 20 |
$('#<?php echo $field_id; ?>_stars').raty({
|
|
@@ -36,4 +37,7 @@ if(!isset($field['config']['type'])){
|
|
| 36 |
<?php if(!empty($field['config']['single'])){ echo ",single: true"; }; ?>
|
| 37 |
});
|
| 38 |
});
|
| 39 |
-
</script>
|
|
|
|
|
|
|
|
|
| 15 |
<?php echo $field_caption; ?>
|
| 16 |
<?php echo $field_after; ?>
|
| 17 |
<?php echo $wrapper_after; ?>
|
| 18 |
+
<?php ob_start(); ?>
|
| 19 |
<script type="text/javascript">
|
| 20 |
jQuery(function($){
|
| 21 |
$('#<?php echo $field_id; ?>_stars').raty({
|
| 37 |
<?php if(!empty($field['config']['single'])){ echo ",single: true"; }; ?>
|
| 38 |
});
|
| 39 |
});
|
| 40 |
+
</script>
|
| 41 |
+
<?php
|
| 42 |
+
$script_template = ob_get_clean();
|
| 43 |
+
$grid->append( $script_template, $location );
|
fields/states/field.php
CHANGED
|
@@ -4,7 +4,7 @@ echo $wrapper_before; ?>
|
|
| 4 |
<?php echo $field_before; ?>
|
| 5 |
<?php ob_start(); ?>
|
| 6 |
<select <?php echo $field_placeholder; ?> id="<?php echo $field_id; ?>" data-field="<?php echo $field_base_id; ?>" class="<?php echo $field_class; ?>" name="<?php echo $field_name; ?>" <?php echo $field_required; ?>>
|
| 7 |
-
<option> - Select Province/State - </option>
|
| 8 |
<option value="AB">Alberta</option>
|
| 9 |
<option value="BC">British Columbia</option>
|
| 10 |
<option value="MB">Manitoba</option>
|
| 4 |
<?php echo $field_before; ?>
|
| 5 |
<?php ob_start(); ?>
|
| 6 |
<select <?php echo $field_placeholder; ?> id="<?php echo $field_id; ?>" data-field="<?php echo $field_base_id; ?>" class="<?php echo $field_class; ?>" name="<?php echo $field_name; ?>" <?php echo $field_required; ?>>
|
| 7 |
+
<option value=""> - Select Province/State - </option>
|
| 8 |
<option value="AB">Alberta</option>
|
| 9 |
<option value="BC">British Columbia</option>
|
| 10 |
<option value="MB">Manitoba</option>
|
fields/toggle_switch/field.php
CHANGED
|
@@ -73,7 +73,9 @@ if(!empty($field['config']['orientation']) && $field['config']['orientation'] ==
|
|
| 73 |
</div>
|
| 74 |
<?php echo $field_after; ?>
|
| 75 |
<?php echo $wrapper_after; ?>
|
| 76 |
-
|
|
|
|
|
|
|
| 77 |
<script>
|
| 78 |
jQuery( function( $ ){
|
| 79 |
$(document).on('reset', '.<?php echo $form['ID']; ?>', function(e){
|
|
@@ -81,4 +83,7 @@ jQuery( function( $ ){
|
|
| 81 |
$('input[data-field="<?php echo $field_base_id; ?>"]').prop('checked','');
|
| 82 |
});
|
| 83 |
});
|
| 84 |
-
</script>
|
|
|
|
|
|
|
|
|
| 73 |
</div>
|
| 74 |
<?php echo $field_after; ?>
|
| 75 |
<?php echo $wrapper_after; ?>
|
| 76 |
+
<?php
|
| 77 |
+
ob_start();
|
| 78 |
+
?>
|
| 79 |
<script>
|
| 80 |
jQuery( function( $ ){
|
| 81 |
$(document).on('reset', '.<?php echo $form['ID']; ?>', function(e){
|
| 83 |
$('input[data-field="<?php echo $field_base_id; ?>"]').prop('checked','');
|
| 84 |
});
|
| 85 |
});
|
| 86 |
+
</script>
|
| 87 |
+
<?php
|
| 88 |
+
$script_template = ob_get_clean();
|
| 89 |
+
$grid->append( $script_template, $location );
|
includes/field_processors.php
CHANGED
|
@@ -1,6 +1,25 @@
|
|
| 1 |
<?php
|
| 2 |
|
| 3 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
|
| 5 |
|
| 6 |
add_filter('caldera_forms_process_field_file', 'cf_handle_file_upload', 10, 3);
|
|
@@ -16,24 +35,41 @@ function cf_handle_file_upload($entry, $field, $form){
|
|
| 16 |
foreach($types as &$type){
|
| 17 |
$type=trim($type);
|
| 18 |
}
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
}
|
| 26 |
}
|
| 27 |
|
| 28 |
}
|
| 29 |
if ( ! function_exists( 'wp_handle_upload' ) ) require_once( ABSPATH . 'wp-admin/includes/file.php' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 30 |
|
| 31 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
|
| 33 |
-
if(
|
| 34 |
-
return $
|
| 35 |
-
}else{
|
| 36 |
-
return new WP_Error( 'fail', $upload['error'] );
|
| 37 |
}
|
|
|
|
| 38 |
}
|
| 39 |
}
|
| 1 |
<?php
|
| 2 |
|
| 3 |
|
| 4 |
+
add_filter('caldera_forms_view_field_checkbox', 'cf_handle_multi_view', 10, 3);
|
| 5 |
+
function cf_handle_multi_view( $data, $field ){
|
| 6 |
+
|
| 7 |
+
if( empty( $data ) || !is_array( $data ) ){
|
| 8 |
+
return $data;
|
| 9 |
+
}
|
| 10 |
+
// can put in the value as well.
|
| 11 |
+
$viewer = array();
|
| 12 |
+
foreach( $data as $key=>$value ){
|
| 13 |
+
if( isset( $field['config']['option'][ $key ]['value'] ) ){
|
| 14 |
+
$viewer[] = $field['config']['option'][ $key ]['label'] . ' (' . $field['config']['option'][ $key ]['value'] . ')';
|
| 15 |
+
}else{
|
| 16 |
+
$viewer[] = $value;
|
| 17 |
+
}
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
return implode( ', ', $viewer );
|
| 21 |
+
|
| 22 |
+
}
|
| 23 |
|
| 24 |
|
| 25 |
add_filter('caldera_forms_process_field_file', 'cf_handle_file_upload', 10, 3);
|
| 35 |
foreach($types as &$type){
|
| 36 |
$type=trim($type);
|
| 37 |
}
|
| 38 |
+
foreach( (array) $_FILES[$field['ID']]['name'] as $file_name ){
|
| 39 |
+
if( empty( $file_name ) ){
|
| 40 |
+
return $entry;
|
| 41 |
+
}
|
| 42 |
+
$check = pathinfo( $file_name );
|
| 43 |
+
if(!in_array( $check['extension'], $types)){
|
| 44 |
+
if(count($types) > 1){
|
| 45 |
+
return new WP_Error( 'fail', __('File type not allowed. Allowed types are: ', 'caldera-forms') . ' '. implode(', ', $types) );
|
| 46 |
+
}else{
|
| 47 |
+
return new WP_Error( 'fail', __('File type needs to be', 'caldera-forms') . ' .' . $types[0] );
|
| 48 |
+
}
|
| 49 |
}
|
| 50 |
}
|
| 51 |
|
| 52 |
}
|
| 53 |
if ( ! function_exists( 'wp_handle_upload' ) ) require_once( ABSPATH . 'wp-admin/includes/file.php' );
|
| 54 |
+
|
| 55 |
+
$files = array();
|
| 56 |
+
foreach( (array) $_FILES[$field['ID']] as $file_key=>$file_parts ){
|
| 57 |
+
foreach( (array) $file_parts as $part_index=>$part_value ){
|
| 58 |
+
$files[ $part_index ][ $file_key ] = $part_value;
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
foreach( $files as $file ){
|
| 62 |
+
$upload = wp_handle_upload($file, array( 'test_form' => false ), date('Y/m') );
|
| 63 |
|
| 64 |
+
if( !empty( $upload['error'] ) ){
|
| 65 |
+
return new WP_Error( 'fail', $upload['error'] );
|
| 66 |
+
}
|
| 67 |
+
$uploads[] = $upload['url'];
|
| 68 |
+
}
|
| 69 |
|
| 70 |
+
if( count( $uploads ) > 1 ){
|
| 71 |
+
return $uploads;
|
|
|
|
|
|
|
| 72 |
}
|
| 73 |
+
return $uploads[0];
|
| 74 |
}
|
| 75 |
}
|
includes/templates/registration-form-example.php
ADDED
|
@@ -0,0 +1,308 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Caldera Forms - Registration form example.
|
| 4 |
+
*
|
| 5 |
+
* @since 1.3.0
|
| 6 |
+
*
|
| 7 |
+
* @package Caldera_Forms
|
| 8 |
+
* @author Josh Pollock <josh@calderawp.com>
|
| 9 |
+
* @license GPL-2.0+
|
| 10 |
+
* @link
|
| 11 |
+
* @copyright 2015 Josh Pollock for CalderaWP LLC
|
| 12 |
+
*/
|
| 13 |
+
return array (
|
| 14 |
+
'_last_updated' => 'Fri, 21 Aug 2015 20:42:39 +0000',
|
| 15 |
+
'ID' => 'CF55d78d3e3624f',
|
| 16 |
+
'name' => 'Registration Form',
|
| 17 |
+
'description' => '',
|
| 18 |
+
'db_support' => 1,
|
| 19 |
+
'pinned' => 0,
|
| 20 |
+
'hide_form' => 1,
|
| 21 |
+
'check_honey' => 1,
|
| 22 |
+
'success' => 'Form has been successfully submitted. Thank you.',
|
| 23 |
+
'avatar_field' => '',
|
| 24 |
+
'form_ajax' => 1,
|
| 25 |
+
'custom_callback' => '',
|
| 26 |
+
'layout_grid' =>
|
| 27 |
+
array (
|
| 28 |
+
'fields' =>
|
| 29 |
+
array (
|
| 30 |
+
'fld_1327818' => '1:1',
|
| 31 |
+
'fld_1812913' => '2:1',
|
| 32 |
+
'fld_7290902' => '2:2',
|
| 33 |
+
'fld_6900741' => '3:1',
|
| 34 |
+
'fld_1561974' => '3:2',
|
| 35 |
+
'fld_6241168' => '4:1',
|
| 36 |
+
'fld_2458053' => '4:2',
|
| 37 |
+
'fld_2668148' => '5:1',
|
| 38 |
+
),
|
| 39 |
+
'structure' => '12|6:6|6:6|6:6|6:6',
|
| 40 |
+
),
|
| 41 |
+
'fields' =>
|
| 42 |
+
array (
|
| 43 |
+
'fld_1327818' =>
|
| 44 |
+
array (
|
| 45 |
+
'ID' => 'fld_1327818',
|
| 46 |
+
'type' => 'toggle_switch',
|
| 47 |
+
'label' => 'Number of People',
|
| 48 |
+
'slug' => 'number_of_people',
|
| 49 |
+
'conditions' =>
|
| 50 |
+
array (
|
| 51 |
+
'type' => '',
|
| 52 |
+
),
|
| 53 |
+
'caption' => '',
|
| 54 |
+
'config' =>
|
| 55 |
+
array (
|
| 56 |
+
'custom_class' => '',
|
| 57 |
+
'orientation' => 'horizontal',
|
| 58 |
+
'selected_class' => 'btn-success',
|
| 59 |
+
'default_class' => 'btn-default',
|
| 60 |
+
'auto_type' => '',
|
| 61 |
+
'taxonomy' => 'category',
|
| 62 |
+
'post_type' => 'post',
|
| 63 |
+
'value_field' => 'name',
|
| 64 |
+
'default' => 'opt1186018',
|
| 65 |
+
'option' =>
|
| 66 |
+
array (
|
| 67 |
+
'opt1186018' =>
|
| 68 |
+
array (
|
| 69 |
+
'value' => '',
|
| 70 |
+
'label' => 'One',
|
| 71 |
+
),
|
| 72 |
+
'opt1400463' =>
|
| 73 |
+
array (
|
| 74 |
+
'value' => '',
|
| 75 |
+
'label' => 'Two',
|
| 76 |
+
),
|
| 77 |
+
'opt1453751' =>
|
| 78 |
+
array (
|
| 79 |
+
'value' => '',
|
| 80 |
+
'label' => 'Three',
|
| 81 |
+
),
|
| 82 |
+
),
|
| 83 |
+
),
|
| 84 |
+
),
|
| 85 |
+
'fld_1812913' =>
|
| 86 |
+
array (
|
| 87 |
+
'ID' => 'fld_1812913',
|
| 88 |
+
'type' => 'text',
|
| 89 |
+
'label' => 'Person One Name',
|
| 90 |
+
'slug' => 'person_one_name',
|
| 91 |
+
'conditions' =>
|
| 92 |
+
array (
|
| 93 |
+
'type' => '',
|
| 94 |
+
),
|
| 95 |
+
'required' => 1,
|
| 96 |
+
'caption' => '',
|
| 97 |
+
'config' =>
|
| 98 |
+
array (
|
| 99 |
+
'custom_class' => '',
|
| 100 |
+
'placeholder' => '',
|
| 101 |
+
'default' => '',
|
| 102 |
+
'mask' => '',
|
| 103 |
+
),
|
| 104 |
+
),
|
| 105 |
+
'fld_7290902' =>
|
| 106 |
+
array (
|
| 107 |
+
'ID' => 'fld_7290902',
|
| 108 |
+
'type' => 'email',
|
| 109 |
+
'label' => 'Person One Email',
|
| 110 |
+
'slug' => 'person_one_email',
|
| 111 |
+
'conditions' =>
|
| 112 |
+
array (
|
| 113 |
+
'type' => '',
|
| 114 |
+
),
|
| 115 |
+
'required' => 1,
|
| 116 |
+
'caption' => '',
|
| 117 |
+
'config' =>
|
| 118 |
+
array (
|
| 119 |
+
'custom_class' => '',
|
| 120 |
+
'placeholder' => '',
|
| 121 |
+
'default' => '',
|
| 122 |
+
),
|
| 123 |
+
),
|
| 124 |
+
'fld_6900741' =>
|
| 125 |
+
array (
|
| 126 |
+
'ID' => 'fld_6900741',
|
| 127 |
+
'type' => 'text',
|
| 128 |
+
'label' => 'Person Two Name',
|
| 129 |
+
'slug' => 'person_two_name',
|
| 130 |
+
'conditions' =>
|
| 131 |
+
array (
|
| 132 |
+
'type' => 'con_9457156563497745',
|
| 133 |
+
),
|
| 134 |
+
'required' => 1,
|
| 135 |
+
'caption' => '',
|
| 136 |
+
'config' =>
|
| 137 |
+
array (
|
| 138 |
+
'custom_class' => '',
|
| 139 |
+
'placeholder' => '',
|
| 140 |
+
'default' => '',
|
| 141 |
+
'mask' => '',
|
| 142 |
+
),
|
| 143 |
+
),
|
| 144 |
+
'fld_1561974' =>
|
| 145 |
+
array (
|
| 146 |
+
'ID' => 'fld_1561974',
|
| 147 |
+
'type' => 'email',
|
| 148 |
+
'label' => 'Person Two Email',
|
| 149 |
+
'slug' => 'person_two_email',
|
| 150 |
+
'conditions' =>
|
| 151 |
+
array (
|
| 152 |
+
'type' => 'con_9457156563497745',
|
| 153 |
+
),
|
| 154 |
+
'required' => 1,
|
| 155 |
+
'caption' => '',
|
| 156 |
+
'config' =>
|
| 157 |
+
array (
|
| 158 |
+
'custom_class' => '',
|
| 159 |
+
'placeholder' => '',
|
| 160 |
+
'default' => '',
|
| 161 |
+
),
|
| 162 |
+
),
|
| 163 |
+
'fld_2458053' =>
|
| 164 |
+
array (
|
| 165 |
+
'ID' => 'fld_2458053',
|
| 166 |
+
'type' => 'email',
|
| 167 |
+
'label' => 'Person Three Email',
|
| 168 |
+
'slug' => 'person_three_email',
|
| 169 |
+
'conditions' =>
|
| 170 |
+
array (
|
| 171 |
+
'type' => 'con_4812944559945067',
|
| 172 |
+
),
|
| 173 |
+
'required' => 1,
|
| 174 |
+
'caption' => '',
|
| 175 |
+
'config' =>
|
| 176 |
+
array (
|
| 177 |
+
'custom_class' => '',
|
| 178 |
+
'placeholder' => '',
|
| 179 |
+
'default' => '',
|
| 180 |
+
),
|
| 181 |
+
),
|
| 182 |
+
'fld_6241168' =>
|
| 183 |
+
array (
|
| 184 |
+
'ID' => 'fld_6241168',
|
| 185 |
+
'type' => 'text',
|
| 186 |
+
'label' => 'Person Three Name',
|
| 187 |
+
'slug' => 'person_three_name',
|
| 188 |
+
'conditions' =>
|
| 189 |
+
array (
|
| 190 |
+
'type' => 'con_4812944559945067',
|
| 191 |
+
),
|
| 192 |
+
'required' => 1,
|
| 193 |
+
'caption' => '',
|
| 194 |
+
'config' =>
|
| 195 |
+
array (
|
| 196 |
+
'custom_class' => '',
|
| 197 |
+
'placeholder' => '',
|
| 198 |
+
'default' => '',
|
| 199 |
+
'mask' => '',
|
| 200 |
+
),
|
| 201 |
+
),
|
| 202 |
+
'fld_2668148' =>
|
| 203 |
+
array (
|
| 204 |
+
'ID' => 'fld_2668148',
|
| 205 |
+
'type' => 'button',
|
| 206 |
+
'label' => 'Submit',
|
| 207 |
+
'slug' => 'submit',
|
| 208 |
+
'conditions' =>
|
| 209 |
+
array (
|
| 210 |
+
'type' => '',
|
| 211 |
+
),
|
| 212 |
+
'caption' => '',
|
| 213 |
+
'config' =>
|
| 214 |
+
array (
|
| 215 |
+
'custom_class' => '',
|
| 216 |
+
'type' => 'submit',
|
| 217 |
+
'class' => 'btn btn-default',
|
| 218 |
+
),
|
| 219 |
+
),
|
| 220 |
+
),
|
| 221 |
+
'page_names' =>
|
| 222 |
+
array (
|
| 223 |
+
0 => 'Page 1',
|
| 224 |
+
),
|
| 225 |
+
'conditional_groups' =>
|
| 226 |
+
array (
|
| 227 |
+
'_open_condition' => 'con_4812944559945067',
|
| 228 |
+
'conditions' =>
|
| 229 |
+
array (
|
| 230 |
+
'con_9457156563497745' =>
|
| 231 |
+
array (
|
| 232 |
+
'id' => 'con_9457156563497745',
|
| 233 |
+
'name' => 'Two People',
|
| 234 |
+
'type' => 'show',
|
| 235 |
+
'fields' =>
|
| 236 |
+
array (
|
| 237 |
+
'cl8962595065547459' => 'fld_1327818',
|
| 238 |
+
'cl4510708085080191' => 'fld_1327818',
|
| 239 |
+
),
|
| 240 |
+
'group' =>
|
| 241 |
+
array (
|
| 242 |
+
'rw872285474363952' =>
|
| 243 |
+
array (
|
| 244 |
+
'cl8962595065547459' =>
|
| 245 |
+
array (
|
| 246 |
+
'parent' => 'rw872285474363952',
|
| 247 |
+
'field' => 'fld_1327818',
|
| 248 |
+
'compare' => 'is',
|
| 249 |
+
'value' => 'opt1400463',
|
| 250 |
+
),
|
| 251 |
+
),
|
| 252 |
+
'rw6265972925354504' =>
|
| 253 |
+
array (
|
| 254 |
+
'cl4510708085080191' =>
|
| 255 |
+
array (
|
| 256 |
+
'parent' => 'rw6265972925354504',
|
| 257 |
+
'field' => 'fld_1327818',
|
| 258 |
+
'compare' => 'is',
|
| 259 |
+
'value' => 'opt1453751',
|
| 260 |
+
),
|
| 261 |
+
),
|
| 262 |
+
),
|
| 263 |
+
),
|
| 264 |
+
'con_4812944559945067' =>
|
| 265 |
+
array (
|
| 266 |
+
'id' => 'con_4812944559945067',
|
| 267 |
+
'name' => 'Three People',
|
| 268 |
+
'type' => 'show',
|
| 269 |
+
'group' =>
|
| 270 |
+
array (
|
| 271 |
+
'rw1885912614213066' =>
|
| 272 |
+
array (
|
| 273 |
+
'cl5077669325217868' =>
|
| 274 |
+
array (
|
| 275 |
+
'parent' => 'rw1885912614213066',
|
| 276 |
+
'field' => 'fld_1327818',
|
| 277 |
+
'compare' => 'is',
|
| 278 |
+
'value' => 'opt1453751',
|
| 279 |
+
),
|
| 280 |
+
),
|
| 281 |
+
),
|
| 282 |
+
'fields' =>
|
| 283 |
+
array (
|
| 284 |
+
'cl5077669325217868' => 'fld_1327818',
|
| 285 |
+
),
|
| 286 |
+
),
|
| 287 |
+
),
|
| 288 |
+
),
|
| 289 |
+
'settings' =>
|
| 290 |
+
array (
|
| 291 |
+
'responsive' =>
|
| 292 |
+
array (
|
| 293 |
+
'break_point' => 'sm',
|
| 294 |
+
),
|
| 295 |
+
),
|
| 296 |
+
'mailer' =>
|
| 297 |
+
array (
|
| 298 |
+
'enable_mailer' => 1,
|
| 299 |
+
'sender_name' => 'Caldera Forms Notification',
|
| 300 |
+
'sender_email' => 'admin@local.dev',
|
| 301 |
+
'reply_to' => '',
|
| 302 |
+
'email_type' => 'html',
|
| 303 |
+
'recipients' => '',
|
| 304 |
+
'bcc_to' => '',
|
| 305 |
+
'email_subject' => 'Registration',
|
| 306 |
+
'email_message' => '{summary}',
|
| 307 |
+
),
|
| 308 |
+
);
|
includes/templates/starter-contact-form.php
ADDED
|
@@ -0,0 +1,219 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Caldera Forms - starter template
|
| 4 |
+
*
|
| 5 |
+
* @package Caldera_Forms
|
| 6 |
+
* @author David <david@digilab.co.za>
|
| 7 |
+
* @license GPL-2.0+
|
| 8 |
+
* @link
|
| 9 |
+
* @copyright 2014 David Cramer
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
return array (
|
| 13 |
+
'name' => 'Contact Form',
|
| 14 |
+
'description' => 'Basic starter contact form with auto-responder processor.',
|
| 15 |
+
'db_support' => '1',
|
| 16 |
+
'hide_form' => '1',
|
| 17 |
+
'success' => 'Thank you, your message has been sent.',
|
| 18 |
+
'avatar_field' => 'fld_6009157',
|
| 19 |
+
'form_ajax' => '1',
|
| 20 |
+
'layout_grid' =>
|
| 21 |
+
array (
|
| 22 |
+
'fields' =>
|
| 23 |
+
array (
|
| 24 |
+
'fld_29462' => '1:1',
|
| 25 |
+
'fld_8768091' => '2:1',
|
| 26 |
+
'fld_9970286' => '2:2',
|
| 27 |
+
'fld_6009157' => '2:3',
|
| 28 |
+
'fld_2758980' => '3:1',
|
| 29 |
+
'fld_7683514' => '4:1',
|
| 30 |
+
'fld_7908577' => '5:1',
|
| 31 |
+
),
|
| 32 |
+
'structure' => '12|4:4:4|12|12|12',
|
| 33 |
+
),
|
| 34 |
+
'fields' =>
|
| 35 |
+
array (
|
| 36 |
+
'fld_29462' =>
|
| 37 |
+
array (
|
| 38 |
+
'ID' => 'fld_29462',
|
| 39 |
+
'type' => 'html',
|
| 40 |
+
'label' => 'header',
|
| 41 |
+
'slug' => 'header',
|
| 42 |
+
'caption' => '',
|
| 43 |
+
'config' =>
|
| 44 |
+
array (
|
| 45 |
+
'custom_class' => '',
|
| 46 |
+
'default' => '<h2>Your Details</h2>
|
| 47 |
+
<p>Let us know how to get back to you.</p>
|
| 48 |
+
<hr>',
|
| 49 |
+
),
|
| 50 |
+
'conditions' =>
|
| 51 |
+
array (
|
| 52 |
+
'type' => '',
|
| 53 |
+
),
|
| 54 |
+
),
|
| 55 |
+
'fld_8768091' =>
|
| 56 |
+
array (
|
| 57 |
+
'ID' => 'fld_8768091',
|
| 58 |
+
'type' => 'text',
|
| 59 |
+
'label' => 'First name',
|
| 60 |
+
'slug' => 'first_name',
|
| 61 |
+
'required' => '1',
|
| 62 |
+
'caption' => '',
|
| 63 |
+
'config' =>
|
| 64 |
+
array (
|
| 65 |
+
'custom_class' => '',
|
| 66 |
+
'placeholder' => '',
|
| 67 |
+
'default' => '',
|
| 68 |
+
'mask' => '',
|
| 69 |
+
),
|
| 70 |
+
'conditions' =>
|
| 71 |
+
array (
|
| 72 |
+
'type' => '',
|
| 73 |
+
),
|
| 74 |
+
),
|
| 75 |
+
'fld_9970286' =>
|
| 76 |
+
array (
|
| 77 |
+
'ID' => 'fld_9970286',
|
| 78 |
+
'type' => 'text',
|
| 79 |
+
'label' => 'Last name',
|
| 80 |
+
'slug' => 'last_name',
|
| 81 |
+
'required' => '1',
|
| 82 |
+
'caption' => '',
|
| 83 |
+
'config' =>
|
| 84 |
+
array (
|
| 85 |
+
'custom_class' => '',
|
| 86 |
+
'placeholder' => '',
|
| 87 |
+
'default' => '',
|
| 88 |
+
'mask' => '',
|
| 89 |
+
),
|
| 90 |
+
'conditions' =>
|
| 91 |
+
array (
|
| 92 |
+
'type' => '',
|
| 93 |
+
),
|
| 94 |
+
),
|
| 95 |
+
'fld_6009157' =>
|
| 96 |
+
array (
|
| 97 |
+
'ID' => 'fld_6009157',
|
| 98 |
+
'type' => 'email',
|
| 99 |
+
'label' => 'Email Address',
|
| 100 |
+
'slug' => 'email_address',
|
| 101 |
+
'required' => '1',
|
| 102 |
+
'caption' => '',
|
| 103 |
+
'config' =>
|
| 104 |
+
array (
|
| 105 |
+
'custom_class' => '',
|
| 106 |
+
'placeholder' => '',
|
| 107 |
+
'default' => '',
|
| 108 |
+
),
|
| 109 |
+
'conditions' =>
|
| 110 |
+
array (
|
| 111 |
+
'type' => '',
|
| 112 |
+
),
|
| 113 |
+
),
|
| 114 |
+
'fld_2758980' =>
|
| 115 |
+
array (
|
| 116 |
+
'ID' => 'fld_2758980',
|
| 117 |
+
'type' => 'html',
|
| 118 |
+
'label' => 'message',
|
| 119 |
+
'slug' => 'message',
|
| 120 |
+
'caption' => '',
|
| 121 |
+
'config' =>
|
| 122 |
+
array (
|
| 123 |
+
'custom_class' => '',
|
| 124 |
+
'default' => '<h2>How can we help?</h2>
|
| 125 |
+
<p>Feel free to ask a question or simply leave a comment.</p>
|
| 126 |
+
<hr>',
|
| 127 |
+
),
|
| 128 |
+
'conditions' =>
|
| 129 |
+
array (
|
| 130 |
+
'type' => '',
|
| 131 |
+
),
|
| 132 |
+
),
|
| 133 |
+
'fld_7683514' =>
|
| 134 |
+
array (
|
| 135 |
+
'ID' => 'fld_7683514',
|
| 136 |
+
'type' => 'paragraph',
|
| 137 |
+
'label' => 'Comments / Questions',
|
| 138 |
+
'slug' => 'comments_questions',
|
| 139 |
+
'required' => '1',
|
| 140 |
+
'caption' => '',
|
| 141 |
+
'config' =>
|
| 142 |
+
array (
|
| 143 |
+
'custom_class' => '',
|
| 144 |
+
'placeholder' => '',
|
| 145 |
+
'rows' => '7',
|
| 146 |
+
'default' => '',
|
| 147 |
+
),
|
| 148 |
+
'conditions' =>
|
| 149 |
+
array (
|
| 150 |
+
'type' => '',
|
| 151 |
+
),
|
| 152 |
+
),
|
| 153 |
+
'fld_7908577' =>
|
| 154 |
+
array (
|
| 155 |
+
'ID' => 'fld_7908577',
|
| 156 |
+
'type' => 'button',
|
| 157 |
+
'label' => 'Send Form',
|
| 158 |
+
'slug' => 'send_form',
|
| 159 |
+
'caption' => '',
|
| 160 |
+
'config' =>
|
| 161 |
+
array (
|
| 162 |
+
'custom_class' => '',
|
| 163 |
+
'type' => 'submit',
|
| 164 |
+
'class' => 'btn btn-default',
|
| 165 |
+
),
|
| 166 |
+
'conditions' =>
|
| 167 |
+
array (
|
| 168 |
+
'type' => '',
|
| 169 |
+
),
|
| 170 |
+
),
|
| 171 |
+
),
|
| 172 |
+
'page_names' =>
|
| 173 |
+
array (
|
| 174 |
+
0 => 'Page 1',
|
| 175 |
+
),
|
| 176 |
+
'processors' =>
|
| 177 |
+
array (
|
| 178 |
+
'fp_17689566' =>
|
| 179 |
+
array (
|
| 180 |
+
'ID' => 'fp_17689566',
|
| 181 |
+
'type' => 'auto_responder',
|
| 182 |
+
'config' =>
|
| 183 |
+
array (
|
| 184 |
+
'sender_name' => 'Site Admin',
|
| 185 |
+
'sender_email' => 'admin@localhost',
|
| 186 |
+
'subject' => 'Contact auto-response',
|
| 187 |
+
'recipient_name' => '%first_name% %last_name%',
|
| 188 |
+
'recipient_email' => '%email_address%',
|
| 189 |
+
'message' => 'Hi %recipient_name%.
|
| 190 |
+
Thanks for your email.
|
| 191 |
+
We\'ll get get back to you as soon as possible!
|
| 192 |
+
Here\'s a summary of your message:
|
| 193 |
+
------------------------
|
| 194 |
+
{summary}',
|
| 195 |
+
),
|
| 196 |
+
'conditions' =>
|
| 197 |
+
array (
|
| 198 |
+
'type' => '',
|
| 199 |
+
),
|
| 200 |
+
),
|
| 201 |
+
),
|
| 202 |
+
'settings' =>
|
| 203 |
+
array (
|
| 204 |
+
'responsive' =>
|
| 205 |
+
array (
|
| 206 |
+
'break_point' => 'sm',
|
| 207 |
+
),
|
| 208 |
+
),
|
| 209 |
+
'mailer' =>
|
| 210 |
+
array (
|
| 211 |
+
'enable_mailer' => '1',
|
| 212 |
+
'sender_name' => 'Caldera Forms Notification',
|
| 213 |
+
'sender_email' => '',
|
| 214 |
+
'email_type' => 'html',
|
| 215 |
+
'recipients' => '',
|
| 216 |
+
'email_subject' => 'Contact Form',
|
| 217 |
+
'email_message' => '{summary}',
|
| 218 |
+
),
|
| 219 |
+
);
|
includes/templates/variable-price-example.php
ADDED
|
@@ -0,0 +1,311 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Caldera Forms - Variable pricing example
|
| 4 |
+
*
|
| 5 |
+
* @since 1.3.0
|
| 6 |
+
*
|
| 7 |
+
* @package Caldera_Forms
|
| 8 |
+
* @author Josh Pollock <josh@calderawp.com>
|
| 9 |
+
* @license GPL-2.0+
|
| 10 |
+
* @link
|
| 11 |
+
* @copyright 2015 Josh Pollock for CalderaWP LLC
|
| 12 |
+
*/
|
| 13 |
+
|
| 14 |
+
return array (
|
| 15 |
+
'_last_updated' => 'Fri, 21 Aug 2015 00:33:50 +0000',
|
| 16 |
+
'ID' => 'CF55d671ee14e40',
|
| 17 |
+
'name' => 'Variable Price Example',
|
| 18 |
+
'description' => '',
|
| 19 |
+
'db_support' => 1,
|
| 20 |
+
'pinned' => 0,
|
| 21 |
+
'hide_form' => 1,
|
| 22 |
+
'check_honey' => 1,
|
| 23 |
+
'success' => 'Form has been successfully submitted. Thank you.',
|
| 24 |
+
'avatar_field' => '',
|
| 25 |
+
'form_ajax' => 1,
|
| 26 |
+
'custom_callback' => '',
|
| 27 |
+
'layout_grid' =>
|
| 28 |
+
array (
|
| 29 |
+
'fields' =>
|
| 30 |
+
array (
|
| 31 |
+
'fld_4338248' => '1:1',
|
| 32 |
+
'fld_1316929' => '1:1',
|
| 33 |
+
'fld_6796077' => '1:1',
|
| 34 |
+
'fld_5987102' => '1:1',
|
| 35 |
+
'fld_3993413' => '2:1',
|
| 36 |
+
'fld_5161425' => '2:2',
|
| 37 |
+
'fld_8997460' => '3:1',
|
| 38 |
+
'fld_1338703' => '3:2',
|
| 39 |
+
),
|
| 40 |
+
'structure' => '12|6:6|6:6',
|
| 41 |
+
),
|
| 42 |
+
'fields' =>
|
| 43 |
+
array (
|
| 44 |
+
'fld_1316929' =>
|
| 45 |
+
array (
|
| 46 |
+
'ID' => 'fld_1316929',
|
| 47 |
+
'type' => 'hidden',
|
| 48 |
+
'label' => 'Two Big',
|
| 49 |
+
'slug' => 'two_big',
|
| 50 |
+
'caption' => '',
|
| 51 |
+
'config' =>
|
| 52 |
+
array (
|
| 53 |
+
'custom_class' => '',
|
| 54 |
+
'default' => 5,
|
| 55 |
+
),
|
| 56 |
+
'conditions' =>
|
| 57 |
+
array (
|
| 58 |
+
'type' => 'hide',
|
| 59 |
+
'group' =>
|
| 60 |
+
array (
|
| 61 |
+
'rw19946608611' =>
|
| 62 |
+
array (
|
| 63 |
+
'cl3564295763' =>
|
| 64 |
+
array (
|
| 65 |
+
'field' => 'fld_5161425',
|
| 66 |
+
'compare' => 'isnot',
|
| 67 |
+
'value' => 'opt1533135',
|
| 68 |
+
),
|
| 69 |
+
),
|
| 70 |
+
),
|
| 71 |
+
),
|
| 72 |
+
),
|
| 73 |
+
'fld_4338248' =>
|
| 74 |
+
array (
|
| 75 |
+
'ID' => 'fld_4338248',
|
| 76 |
+
'type' => 'hidden',
|
| 77 |
+
'label' => 'One',
|
| 78 |
+
'slug' => 'one',
|
| 79 |
+
'caption' => '',
|
| 80 |
+
'config' =>
|
| 81 |
+
array (
|
| 82 |
+
'custom_class' => '',
|
| 83 |
+
'default' => 10,
|
| 84 |
+
),
|
| 85 |
+
'conditions' =>
|
| 86 |
+
array (
|
| 87 |
+
'type' => 'hide',
|
| 88 |
+
'group' =>
|
| 89 |
+
array (
|
| 90 |
+
'rw47185924125' =>
|
| 91 |
+
array (
|
| 92 |
+
'cl5675243200' =>
|
| 93 |
+
array (
|
| 94 |
+
'field' => 'fld_3993413',
|
| 95 |
+
'compare' => 'isnot',
|
| 96 |
+
'value' => 'opt1697235',
|
| 97 |
+
),
|
| 98 |
+
),
|
| 99 |
+
),
|
| 100 |
+
),
|
| 101 |
+
),
|
| 102 |
+
'fld_5987102' =>
|
| 103 |
+
array (
|
| 104 |
+
'ID' => 'fld_5987102',
|
| 105 |
+
'type' => 'hidden',
|
| 106 |
+
'label' => 'Base',
|
| 107 |
+
'slug' => 'base',
|
| 108 |
+
'caption' => '',
|
| 109 |
+
'config' =>
|
| 110 |
+
array (
|
| 111 |
+
'custom_class' => '',
|
| 112 |
+
'default' => 25,
|
| 113 |
+
),
|
| 114 |
+
'conditions' =>
|
| 115 |
+
array (
|
| 116 |
+
'type' => '',
|
| 117 |
+
),
|
| 118 |
+
),
|
| 119 |
+
'fld_3993413' =>
|
| 120 |
+
array (
|
| 121 |
+
'ID' => 'fld_3993413',
|
| 122 |
+
'type' => 'checkbox',
|
| 123 |
+
'label' => 'Want Option 1?',
|
| 124 |
+
'slug' => 'option_1',
|
| 125 |
+
'caption' => '',
|
| 126 |
+
'config' =>
|
| 127 |
+
array (
|
| 128 |
+
'custom_class' => '',
|
| 129 |
+
'inline' => 1,
|
| 130 |
+
'auto_type' => '',
|
| 131 |
+
'taxonomy' => 'category',
|
| 132 |
+
'post_type' => 'post',
|
| 133 |
+
'value_field' => 'name',
|
| 134 |
+
'default' => '',
|
| 135 |
+
'option' =>
|
| 136 |
+
array (
|
| 137 |
+
'opt1697235' =>
|
| 138 |
+
array (
|
| 139 |
+
'value' => '',
|
| 140 |
+
'label' => 'Yes',
|
| 141 |
+
),
|
| 142 |
+
),
|
| 143 |
+
),
|
| 144 |
+
'conditions' =>
|
| 145 |
+
array (
|
| 146 |
+
'type' => '',
|
| 147 |
+
),
|
| 148 |
+
),
|
| 149 |
+
'fld_5161425' =>
|
| 150 |
+
array (
|
| 151 |
+
'ID' => 'fld_5161425',
|
| 152 |
+
'type' => 'dropdown',
|
| 153 |
+
'label' => 'Option 2 Type',
|
| 154 |
+
'slug' => 'option_2',
|
| 155 |
+
'caption' => '',
|
| 156 |
+
'config' =>
|
| 157 |
+
array (
|
| 158 |
+
'custom_class' => '',
|
| 159 |
+
'placeholder' => '',
|
| 160 |
+
'auto_type' => '',
|
| 161 |
+
'taxonomy' => 'category',
|
| 162 |
+
'post_type' => 'post',
|
| 163 |
+
'value_field' => 'name',
|
| 164 |
+
'default' => '',
|
| 165 |
+
'option' =>
|
| 166 |
+
array (
|
| 167 |
+
'opt1533135' =>
|
| 168 |
+
array (
|
| 169 |
+
'value' => '',
|
| 170 |
+
'label' => 'Big',
|
| 171 |
+
),
|
| 172 |
+
'opt1786217' =>
|
| 173 |
+
array (
|
| 174 |
+
'value' => '',
|
| 175 |
+
'label' => 'Small',
|
| 176 |
+
),
|
| 177 |
+
),
|
| 178 |
+
),
|
| 179 |
+
'conditions' =>
|
| 180 |
+
array (
|
| 181 |
+
'type' => '',
|
| 182 |
+
),
|
| 183 |
+
),
|
| 184 |
+
'fld_8997460' =>
|
| 185 |
+
array (
|
| 186 |
+
'ID' => 'fld_8997460',
|
| 187 |
+
'type' => 'calculation',
|
| 188 |
+
'label' => 'Total',
|
| 189 |
+
'slug' => 'total',
|
| 190 |
+
'caption' => '',
|
| 191 |
+
'config' =>
|
| 192 |
+
array (
|
| 193 |
+
'custom_class' => '',
|
| 194 |
+
'element' => 'h3',
|
| 195 |
+
'classes' => 'total-line',
|
| 196 |
+
'before' => 'Total:',
|
| 197 |
+
'after' => '',
|
| 198 |
+
'fixed' => 1,
|
| 199 |
+
'thousand_separator' => ',',
|
| 200 |
+
'formular' => ' ( fld_5987102+fld_4338248+fld_6796077+fld_1316929 ) ',
|
| 201 |
+
'config' =>
|
| 202 |
+
array (
|
| 203 |
+
'group' =>
|
| 204 |
+
array (
|
| 205 |
+
0 =>
|
| 206 |
+
array (
|
| 207 |
+
'lines' =>
|
| 208 |
+
array (
|
| 209 |
+
0 =>
|
| 210 |
+
array (
|
| 211 |
+
'operator' => '+',
|
| 212 |
+
'field' => 'fld_5987102',
|
| 213 |
+
),
|
| 214 |
+
1 =>
|
| 215 |
+
array (
|
| 216 |
+
'operator' => '+',
|
| 217 |
+
'field' => 'fld_4338248',
|
| 218 |
+
),
|
| 219 |
+
2 =>
|
| 220 |
+
array (
|
| 221 |
+
'operator' => '+',
|
| 222 |
+
'field' => 'fld_6796077',
|
| 223 |
+
),
|
| 224 |
+
3 =>
|
| 225 |
+
array (
|
| 226 |
+
'operator' => '+',
|
| 227 |
+
'field' => 'fld_1316929',
|
| 228 |
+
),
|
| 229 |
+
),
|
| 230 |
+
),
|
| 231 |
+
),
|
| 232 |
+
),
|
| 233 |
+
'manual_formula' => '',
|
| 234 |
+
),
|
| 235 |
+
'conditions' =>
|
| 236 |
+
array (
|
| 237 |
+
'type' => '',
|
| 238 |
+
),
|
| 239 |
+
),
|
| 240 |
+
'fld_1338703' =>
|
| 241 |
+
array (
|
| 242 |
+
'ID' => 'fld_1338703',
|
| 243 |
+
'type' => 'button',
|
| 244 |
+
'label' => 'Pay',
|
| 245 |
+
'slug' => 'pay',
|
| 246 |
+
'caption' => '',
|
| 247 |
+
'config' =>
|
| 248 |
+
array (
|
| 249 |
+
'custom_class' => '',
|
| 250 |
+
'type' => 'submit',
|
| 251 |
+
'class' => 'btn btn-default',
|
| 252 |
+
),
|
| 253 |
+
'conditions' =>
|
| 254 |
+
array (
|
| 255 |
+
'type' => '',
|
| 256 |
+
),
|
| 257 |
+
),
|
| 258 |
+
'fld_6796077' =>
|
| 259 |
+
array (
|
| 260 |
+
'ID' => 'fld_6796077',
|
| 261 |
+
'type' => 'hidden',
|
| 262 |
+
'label' => 'Two Small',
|
| 263 |
+
'slug' => 'two_small',
|
| 264 |
+
'caption' => '',
|
| 265 |
+
'config' =>
|
| 266 |
+
array (
|
| 267 |
+
'custom_class' => '',
|
| 268 |
+
'default' => 1,
|
| 269 |
+
),
|
| 270 |
+
'conditions' =>
|
| 271 |
+
array (
|
| 272 |
+
'type' => 'hide',
|
| 273 |
+
'group' =>
|
| 274 |
+
array (
|
| 275 |
+
'rw74415141932' =>
|
| 276 |
+
array (
|
| 277 |
+
'cl7168988428' =>
|
| 278 |
+
array (
|
| 279 |
+
'field' => 'fld_5161425',
|
| 280 |
+
'compare' => 'isnot',
|
| 281 |
+
'value' => 'opt1786217',
|
| 282 |
+
),
|
| 283 |
+
),
|
| 284 |
+
),
|
| 285 |
+
),
|
| 286 |
+
),
|
| 287 |
+
),
|
| 288 |
+
'page_names' =>
|
| 289 |
+
array (
|
| 290 |
+
0 => 'Page 1',
|
| 291 |
+
),
|
| 292 |
+
'settings' =>
|
| 293 |
+
array (
|
| 294 |
+
'responsive' =>
|
| 295 |
+
array (
|
| 296 |
+
'break_point' => 'sm',
|
| 297 |
+
),
|
| 298 |
+
),
|
| 299 |
+
'mailer' =>
|
| 300 |
+
array (
|
| 301 |
+
'enable_mailer' => 1,
|
| 302 |
+
'sender_name' => 'Caldera Forms Notification',
|
| 303 |
+
'sender_email' => 'admin@local.dev',
|
| 304 |
+
'reply_to' => '',
|
| 305 |
+
'email_type' => 'html',
|
| 306 |
+
'recipients' => '',
|
| 307 |
+
'bcc_to' => '',
|
| 308 |
+
'email_subject' => 'MultiPrice',
|
| 309 |
+
'email_message' => '{summary}',
|
| 310 |
+
),
|
| 311 |
+
);
|
languages/caldera-forms-de_DE.mo
CHANGED
|
Binary file
|
languages/caldera-forms-de_DE.po
CHANGED
|
@@ -2,172 +2,202 @@ msgid ""
|
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: 2015-
|
| 6 |
-
"PO-Revision-Date: 2015-
|
| 7 |
"Last-Translator: Detlef <d.beyer@crash.de>\n"
|
| 8 |
"Language-Team: Tricodia Systems <david@digilab.co.za>\n"
|
| 9 |
"Language: de\n"
|
| 10 |
"MIME-Version: 1.0\n"
|
| 11 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"X-Generator: Poedit 1.
|
| 14 |
"X-Poedit-Basepath: .\n"
|
| 15 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 16 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 17 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 18 |
"X-Poedit-SearchPath-0: ..\n"
|
| 19 |
|
| 20 |
-
#: ../classes/
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
msgid "Invalid Form."
|
| 22 |
msgstr "Ungültiges Formular."
|
| 23 |
|
| 24 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
#: ../ui/entries_toolbar.php:27
|
| 26 |
msgid "Trash"
|
| 27 |
msgstr "Papierkorb"
|
| 28 |
|
| 29 |
-
#: ../classes/admin.php:
|
| 30 |
#: ../ui/admin_templates.php:9
|
| 31 |
msgid "Restore"
|
| 32 |
msgstr "Zurücksetzen"
|
| 33 |
|
| 34 |
-
#: ../classes/admin.php:
|
| 35 |
msgid "Entry"
|
| 36 |
msgstr "Eingabe"
|
| 37 |
|
| 38 |
-
#: ../classes/admin.php:
|
| 39 |
msgid "View"
|
| 40 |
msgstr "Anzeige"
|
| 41 |
|
| 42 |
-
#: ../classes/admin.php:
|
| 43 |
msgid "Add Form to Page"
|
| 44 |
msgstr "Formular zur Seite hinzufügen"
|
| 45 |
|
| 46 |
-
#: ../classes/admin.php:
|
| 47 |
msgid "Insert Form Shortcode"
|
| 48 |
msgstr "Formular Shortcode einfügen"
|
| 49 |
|
| 50 |
-
#: ../classes/admin.php:
|
| 51 |
#, fuzzy
|
| 52 |
msgid "Caldera Form"
|
| 53 |
msgstr "Ein Caldera Formular hinzufügen"
|
| 54 |
|
| 55 |
-
#: ../classes/admin.php:
|
| 56 |
#, fuzzy
|
| 57 |
msgid "Deactivate"
|
| 58 |
msgstr "Aktiv"
|
| 59 |
|
| 60 |
-
#: ../classes/admin.php:
|
| 61 |
#, fuzzy
|
| 62 |
msgid "Activate"
|
| 63 |
msgstr "Aktiv"
|
| 64 |
|
| 65 |
-
#: ../classes/admin.php:
|
| 66 |
-
#: ../classes/admin.php:
|
| 67 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 68 |
-
#: ../ui/community.php:5 ../ui/edit.php:
|
| 69 |
msgid "Caldera Forms"
|
| 70 |
msgstr "Caldera Formulare"
|
| 71 |
|
| 72 |
-
#: ../classes/admin.php:
|
| 73 |
msgid "Caldera Forms Admin"
|
| 74 |
msgstr "Caldera Formular Admin"
|
| 75 |
|
| 76 |
-
#: ../classes/admin.php:
|
| 77 |
msgid "Forms"
|
| 78 |
msgstr "Formulare"
|
| 79 |
|
| 80 |
-
#: ../classes/admin.php:
|
| 81 |
msgid "Community"
|
| 82 |
msgstr "Community"
|
| 83 |
|
| 84 |
-
#: ../classes/admin.php:
|
| 85 |
msgid "Extend"
|
| 86 |
msgstr "Erweitern"
|
| 87 |
|
| 88 |
-
#: ../classes/admin.php:
|
| 89 |
msgid "Sorry, please try again"
|
| 90 |
msgstr "Sorry, bitte noch einmal versuchen"
|
| 91 |
|
| 92 |
-
#: ../classes/admin.php:
|
| 93 |
msgid "Form Delete Error"
|
| 94 |
msgstr "Fehler beim Löschen des Formulars"
|
| 95 |
|
| 96 |
-
#: ../classes/admin.php:
|
| 97 |
msgid "Sorry, File is not valid."
|
| 98 |
msgstr "Sorry, die Datei ist nicht gültig"
|
| 99 |
|
| 100 |
-
#: ../classes/admin.php:
|
| 101 |
-
#: ../classes/admin.php:
|
| 102 |
msgid "Form Import Error"
|
| 103 |
msgstr "Fehler beim Import des Fomulars"
|
| 104 |
|
| 105 |
-
#: ../classes/admin.php:
|
| 106 |
msgid "Sorry, File not uploaded."
|
| 107 |
msgstr "Sorry, die Datei wurde nicht geladen"
|
| 108 |
|
| 109 |
-
#: ../classes/admin.php:
|
| 110 |
msgid "Form does not exist."
|
| 111 |
msgstr "Das Formular existiert nicht"
|
| 112 |
|
| 113 |
-
#: ../classes/admin.php:
|
| 114 |
msgid "Export selection has expired"
|
| 115 |
msgstr "Export-Auswahl ist abgelaufen"
|
| 116 |
|
| 117 |
-
#: ../classes/admin.php:
|
| 118 |
msgid "Export Expired"
|
| 119 |
msgstr "Export ist abgelaufen"
|
| 120 |
|
| 121 |
-
#: ../classes/admin.php:
|
| 122 |
#, fuzzy
|
| 123 |
msgid "Form has been successfully submitted. Thank you."
|
| 124 |
msgstr "Das Formular wurde abgeschickt. Vielen Dank."
|
| 125 |
|
| 126 |
-
#: ../classes/admin.php:
|
| 127 |
#, fuzzy
|
| 128 |
msgid "Layout"
|
| 129 |
msgstr "Layout"
|
| 130 |
|
| 131 |
-
#: ../classes/admin.php:
|
| 132 |
#, fuzzy
|
| 133 |
msgid "Layout Builder"
|
| 134 |
msgstr "Bildschirm-Layout"
|
| 135 |
|
| 136 |
-
#: ../classes/admin.php:
|
| 137 |
msgid "Pages"
|
| 138 |
msgstr "Seiten"
|
| 139 |
|
| 140 |
-
#: ../classes/admin.php:
|
| 141 |
msgid "Form Pages"
|
| 142 |
msgstr "Formularseiten"
|
| 143 |
|
| 144 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 145 |
msgid "Processors"
|
| 146 |
msgstr "Prozessoren"
|
| 147 |
|
| 148 |
-
#: ../classes/admin.php:
|
| 149 |
msgid "Form Processors"
|
| 150 |
msgstr "Formular Prozessoren"
|
| 151 |
|
| 152 |
-
#: ../classes/admin.php:
|
| 153 |
#: ../ui/panels/variables.php:83
|
| 154 |
msgid "Variables"
|
| 155 |
msgstr "Variable"
|
| 156 |
|
| 157 |
-
#: ../classes/admin.php:
|
| 158 |
#, fuzzy
|
| 159 |
msgid "Responsive"
|
| 160 |
msgstr "Responsive"
|
| 161 |
|
| 162 |
-
#: ../classes/admin.php:
|
| 163 |
msgid "Resposive Settings"
|
| 164 |
msgstr "Responsive Einstellungen"
|
| 165 |
|
| 166 |
-
#: ../classes/admin.php:
|
| 167 |
msgid "Grid Collapse"
|
| 168 |
msgstr "Raster einklappen"
|
| 169 |
|
| 170 |
-
#: ../classes/admin.php:
|
| 171 |
msgid ""
|
| 172 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 173 |
"Bootstrap 3.0)"
|
|
@@ -175,275 +205,281 @@ msgstr ""
|
|
| 175 |
"Die Bildschirmbreite ab der das Raster zusammenklappt (basierend auf "
|
| 176 |
"Bootstrap 3.0)"
|
| 177 |
|
| 178 |
-
#: ../classes/admin.php:
|
| 179 |
msgid "Maintain grid always"
|
| 180 |
msgstr "Raster immer erhalten"
|
| 181 |
|
| 182 |
-
#: ../classes/admin.php:
|
| 183 |
#, fuzzy
|
| 184 |
msgid "Mailer"
|
| 185 |
msgstr "An den Mailer anhängen"
|
| 186 |
|
| 187 |
-
#: ../classes/admin.php:
|
| 188 |
msgid "Email Notification Settings"
|
| 189 |
msgstr "Email Benachrichtigungseinstellungen"
|
| 190 |
|
| 191 |
-
#: ../classes/core.php:
|
| 192 |
msgid "The wasn't entered correct."
|
| 193 |
msgstr "Das wurde nicht richtig eingetragen"
|
| 194 |
|
| 195 |
-
#: ../classes/core.php:
|
| 196 |
msgid "Reset"
|
| 197 |
msgstr "Zurücksetzen"
|
| 198 |
|
| 199 |
-
#: ../classes/core.php:
|
| 200 |
msgid "Permission denied."
|
| 201 |
msgstr "Zugriff verweigert"
|
| 202 |
|
| 203 |
-
#: ../classes/core.php:
|
| 204 |
-
msgid "Caldera Forms Notification"
|
| 205 |
-
msgstr "Benachrichtigung von Caldera Forms"
|
| 206 |
-
|
| 207 |
-
#: ../classes/core.php:973
|
| 208 |
msgid "Auto Responder"
|
| 209 |
msgstr "Auto Antwort"
|
| 210 |
|
| 211 |
-
#: ../classes/core.php:
|
| 212 |
msgid "Sends out an auto response e-mail"
|
| 213 |
msgstr "Sendet eine automatische Benachrichtigung"
|
| 214 |
|
| 215 |
-
#: ../classes/core.php:
|
| 216 |
msgid "Thank you for contacting us"
|
| 217 |
msgstr "Danke für Ihre Anfrage"
|
| 218 |
|
| 219 |
-
#: ../classes/core.php:
|
| 220 |
msgid "Redirect"
|
| 221 |
msgstr "Umleiten"
|
| 222 |
|
| 223 |
-
#: ../classes/core.php:
|
| 224 |
msgid "Redirects user to URL on successful submit"
|
| 225 |
msgstr "Leitet den Nutzer nach erfolgreicher Eingabe auf eine andere Seite um"
|
| 226 |
|
| 227 |
-
#: ../classes/core.php:
|
| 228 |
msgid "Increment Value"
|
| 229 |
msgstr ""
|
| 230 |
|
| 231 |
-
#: ../classes/core.php:
|
| 232 |
msgid "Increment a value per entry."
|
| 233 |
msgstr ""
|
| 234 |
|
| 235 |
-
#: ../classes/core.php:
|
| 236 |
#, fuzzy
|
| 237 |
msgid "Akismet"
|
| 238 |
msgstr "Akismet"
|
| 239 |
|
| 240 |
-
#: ../classes/core.php:
|
| 241 |
#, fuzzy
|
| 242 |
msgid "Anti-spam filtering"
|
| 243 |
msgstr "reCAPTCHA anti-spam Feld"
|
| 244 |
|
| 245 |
-
#: ../classes/core.php:
|
| 246 |
msgid "Akismet not setup."
|
| 247 |
msgstr "Akismet wurde nicht eingerichtet."
|
| 248 |
|
| 249 |
-
#: ../classes/core.php:
|
| 250 |
msgid "Calculation"
|
| 251 |
msgstr "Berechnung"
|
| 252 |
|
| 253 |
-
#: ../classes/core.php:
|
| 254 |
-
#: ../classes/core.php:
|
| 255 |
msgid "Special"
|
| 256 |
msgstr "Spezial"
|
| 257 |
|
| 258 |
-
#: ../classes/core.php:
|
| 259 |
msgid "Math"
|
| 260 |
msgstr "Mathe"
|
| 261 |
|
| 262 |
-
#: ../classes/core.php:
|
| 263 |
msgid "Calculate values"
|
| 264 |
msgstr "Werte berechnen"
|
| 265 |
|
| 266 |
-
#: ../classes/core.php:
|
| 267 |
msgid "Total"
|
| 268 |
msgstr "Summe"
|
| 269 |
|
| 270 |
-
#: ../classes/core.php:
|
| 271 |
msgid "Range Slider"
|
| 272 |
msgstr "Schieberegler"
|
| 273 |
|
| 274 |
-
#: ../classes/core.php:
|
| 275 |
msgid "Range Slider input field"
|
| 276 |
msgstr "Schieberegler Eingabefeld"
|
| 277 |
|
| 278 |
-
#: ../classes/core.php:
|
| 279 |
msgid "Star Rating"
|
| 280 |
msgstr "Sterne-Bewertung"
|
| 281 |
|
| 282 |
-
#: ../classes/core.php:
|
| 283 |
#, fuzzy
|
| 284 |
msgid "Feedback"
|
| 285 |
msgstr "Feedback"
|
| 286 |
|
| 287 |
-
#: ../classes/core.php:
|
| 288 |
msgid "Star rating input for feedback"
|
| 289 |
msgstr "Sterne-Bewertung für ein Feedback"
|
| 290 |
|
| 291 |
-
#: ../classes/core.php:
|
| 292 |
msgid "Phone Number"
|
| 293 |
msgstr "Telefonnummer"
|
| 294 |
|
| 295 |
-
#: ../classes/core.php:
|
| 296 |
msgid "Phone number with masking"
|
| 297 |
msgstr "Maskierte Telefonnummer"
|
| 298 |
|
| 299 |
-
#: ../classes/core.php:
|
| 300 |
-
#: ../classes/core.php:
|
| 301 |
-
#: ../classes/core.php:
|
| 302 |
msgid "Text Fields"
|
| 303 |
msgstr "Textfelder"
|
| 304 |
|
| 305 |
-
#: ../classes/core.php:
|
| 306 |
-
#: ../classes/core.php:1353 ../classes/core.php:1369 ../classes/core.php:1390
|
| 307 |
-
#: ../classes/core.php:1400 ../classes/core.php:1441 ../classes/core.php:1460
|
| 308 |
-
#: ../classes/core.php:1479 ../classes/core.php:1552 ../ui/edit.php:170
|
| 309 |
-
#, fuzzy
|
| 310 |
-
msgid "Basic"
|
| 311 |
-
msgstr "Grundlegende Einstellungen"
|
| 312 |
-
|
| 313 |
-
#: ../classes/core.php:1262
|
| 314 |
#, fuzzy
|
| 315 |
msgid "User"
|
| 316 |
msgstr "Benutzer"
|
| 317 |
|
| 318 |
-
#: ../classes/core.php:
|
| 319 |
msgid "Single Line Text"
|
| 320 |
msgstr "Einzelne Textzeile"
|
| 321 |
|
| 322 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 323 |
msgid "File"
|
| 324 |
msgstr "Datei"
|
| 325 |
|
| 326 |
-
#: ../classes/core.php:
|
| 327 |
msgid "File Uploader"
|
| 328 |
msgstr "Datei Uploader"
|
| 329 |
|
| 330 |
-
#: ../classes/core.php:
|
| 331 |
msgid "reCAPTCHA"
|
| 332 |
msgstr ""
|
| 333 |
|
| 334 |
-
#: ../classes/core.php:
|
| 335 |
msgid "reCAPTCHA anti-spam field"
|
| 336 |
msgstr "reCAPTCHA anti-spam Feld"
|
| 337 |
|
| 338 |
-
#: ../classes/core.php:
|
| 339 |
#, fuzzy
|
| 340 |
msgid "HTML"
|
| 341 |
msgstr "HTML"
|
| 342 |
|
| 343 |
-
#: ../classes/core.php:
|
| 344 |
msgid "Add text/html content"
|
| 345 |
msgstr "text/html hinzufügen"
|
| 346 |
|
| 347 |
-
#: ../classes/core.php:
|
| 348 |
#: ../processors/akismet/config.php:20
|
| 349 |
msgid "Content"
|
| 350 |
msgstr "Inhalt"
|
| 351 |
|
| 352 |
-
#: ../classes/core.php:
|
| 353 |
msgid "Hidden"
|
| 354 |
msgstr "Versteckt"
|
| 355 |
|
| 356 |
-
#: ../classes/core.php:
|
| 357 |
msgid "Button"
|
| 358 |
msgstr ""
|
| 359 |
|
| 360 |
-
#: ../classes/core.php:
|
| 361 |
msgid "Button, Submit and Reset types"
|
| 362 |
msgstr "Button, Submit und Reset Typen"
|
| 363 |
|
| 364 |
-
#: ../classes/core.php:
|
| 365 |
msgid "Buttons"
|
| 366 |
msgstr ""
|
| 367 |
|
| 368 |
-
#: ../classes/core.php:
|
| 369 |
msgid "Email Address"
|
| 370 |
msgstr "Email Adresse"
|
| 371 |
|
| 372 |
-
#: ../classes/core.php:
|
| 373 |
msgid "Paragraph Textarea"
|
| 374 |
msgstr "Textarea (Abschnitt)"
|
| 375 |
|
| 376 |
-
#: ../classes/core.php:
|
| 377 |
msgid "Toggle Switch"
|
| 378 |
msgstr "Umschalter"
|
| 379 |
|
| 380 |
-
#: ../classes/core.php:
|
| 381 |
-
#: ../classes/core.php:
|
| 382 |
msgid "Select Options"
|
| 383 |
msgstr "Auswahl Optionen"
|
| 384 |
|
| 385 |
-
#: ../classes/core.php:
|
| 386 |
msgid "Dropdown Select"
|
| 387 |
msgstr "Dropdown Auswahl"
|
| 388 |
|
| 389 |
-
#: ../classes/core.php:
|
| 390 |
msgid "Checkbox"
|
| 391 |
msgstr ""
|
| 392 |
|
| 393 |
-
#: ../classes/core.php:
|
| 394 |
msgid "Radio"
|
| 395 |
msgstr "Radio Button"
|
| 396 |
|
| 397 |
-
#: ../classes/core.php:
|
| 398 |
msgid "Date Picker"
|
| 399 |
msgstr "Datums Picker"
|
| 400 |
|
| 401 |
-
#: ../classes/core.php:
|
| 402 |
msgid "Pickers"
|
| 403 |
msgstr ""
|
| 404 |
|
| 405 |
-
#: ../classes/core.php:
|
| 406 |
msgid "Color Picker"
|
| 407 |
msgstr "Farb Picker"
|
| 408 |
|
| 409 |
-
#: ../classes/core.php:
|
| 410 |
#, fuzzy
|
| 411 |
msgid "State/ Province Select"
|
| 412 |
msgstr "Verzeichnis auswählen"
|
| 413 |
|
| 414 |
-
#: ../classes/core.php:
|
| 415 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 416 |
msgstr ""
|
| 417 |
|
| 418 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 419 |
#, fuzzy
|
| 420 |
msgid "System Tags"
|
| 421 |
msgstr "Schlagwörter hinzufügen"
|
| 422 |
|
| 423 |
-
#: ../classes/core.php:
|
| 424 |
#, fuzzy
|
| 425 |
msgid "Mailer Debug"
|
| 426 |
msgstr "An den Mailer anhängen"
|
| 427 |
|
| 428 |
-
#: ../classes/core.php:
|
| 429 |
msgid "Invalid form ID"
|
| 430 |
msgstr "Ungültige Formular ID"
|
| 431 |
|
| 432 |
-
#: ../classes/core.php:
|
| 433 |
-
#: ../classes/core.php:
|
| 434 |
-
#: ../classes/core.php:
|
| 435 |
msgid "Permission denied or entry does not exist."
|
| 436 |
msgstr "Zugriff verweigert oder der Eintrag existiert nicht"
|
| 437 |
|
| 438 |
-
#: ../classes/core.php:
|
| 439 |
msgid "is required"
|
| 440 |
msgstr "wird benötigt"
|
| 441 |
|
| 442 |
-
#: ../classes/core.php:
|
| 443 |
msgid "Form is currently not active."
|
| 444 |
msgstr ""
|
| 445 |
|
| 446 |
-
#: ../classes/core.php:
|
| 447 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 448 |
msgstr ""
|
| 449 |
|
|
@@ -451,7 +487,7 @@ msgstr ""
|
|
| 451 |
msgid "Title"
|
| 452 |
msgstr "Titel"
|
| 453 |
|
| 454 |
-
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:
|
| 455 |
msgid "Form"
|
| 456 |
msgstr "Formular"
|
| 457 |
|
|
@@ -575,16 +611,32 @@ msgid "The starting view of the date picker (month, year, decade)"
|
|
| 575 |
msgstr ""
|
| 576 |
|
| 577 |
#: ../fields/date_picker/setup.php:32
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 578 |
msgid "language"
|
| 579 |
msgstr "Sprache"
|
| 580 |
|
| 581 |
-
#: ../fields/date_picker/setup.php:
|
| 582 |
msgid "Language to use. e.g. pt-BR"
|
| 583 |
msgstr "Zu nutzende Sprache z.B. pt-BR"
|
| 584 |
|
| 585 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 586 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 587 |
-
#: ../fields/text/config.php:2
|
| 588 |
msgid "Placeholder"
|
| 589 |
msgstr "Platzhalter"
|
| 590 |
|
|
@@ -593,10 +645,14 @@ msgid "Attach to mailer"
|
|
| 593 |
msgstr "An den Mailer anhängen"
|
| 594 |
|
| 595 |
#: ../fields/file/config_template.php:9
|
|
|
|
|
|
|
|
|
|
|
|
|
| 596 |
msgid "Allowed Types"
|
| 597 |
msgstr "Erlaubte Typen"
|
| 598 |
|
| 599 |
-
#: ../fields/file/config_template.php:
|
| 600 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 601 |
msgstr "Durch ein Komma getrennt z.B.: jpg, pdf, txt"
|
| 602 |
|
|
@@ -654,7 +710,7 @@ msgstr "Rand-Größe"
|
|
| 654 |
msgid "Border Radius"
|
| 655 |
msgstr "Rand-Radius"
|
| 656 |
|
| 657 |
-
#: ../fields/hidden/setup.php:2 ../ui/edit.php:
|
| 658 |
#: ../ui/panels/variables.php:12
|
| 659 |
msgid "Value"
|
| 660 |
msgstr "Wert"
|
|
@@ -689,7 +745,7 @@ msgstr "Nutzen Sie die Ziffer 9 um eine Zahl anzugeben"
|
|
| 689 |
msgid "Track"
|
| 690 |
msgstr "Track Farbe"
|
| 691 |
|
| 692 |
-
#: ../fields/range_slider/config.php:23
|
| 693 |
msgid "Highlight"
|
| 694 |
msgstr ""
|
| 695 |
|
|
@@ -697,7 +753,7 @@ msgstr ""
|
|
| 697 |
msgid "Handle"
|
| 698 |
msgstr ""
|
| 699 |
|
| 700 |
-
#: ../fields/range_slider/config.php:35
|
| 701 |
msgid "Border"
|
| 702 |
msgstr "Bordure"
|
| 703 |
|
|
@@ -766,6 +822,14 @@ msgstr "Kein geheimer Schlüssel hinzugefügt"
|
|
| 766 |
msgid "No Site Key Added"
|
| 767 |
msgstr "Kein Site-Schlüssel hinzugefügt"
|
| 768 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 769 |
#: ../fields/star-rate/config.php:2
|
| 770 |
msgid "Number of Stars"
|
| 771 |
msgstr "Anzahl der Sterne"
|
|
@@ -887,8 +951,8 @@ msgstr "Aktiviert <span class=\"count\">(%s)</span>"
|
|
| 887 |
msgid "Inactive Class"
|
| 888 |
msgstr "Inaktiv <span class=\"count\">(%s)</span>"
|
| 889 |
|
| 890 |
-
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:
|
| 891 |
-
#: ../ui/edit.php:
|
| 892 |
msgid "Enable"
|
| 893 |
msgstr "Aktivieren"
|
| 894 |
|
|
@@ -947,16 +1011,16 @@ msgstr "Sie werden weitergeleitet"
|
|
| 947 |
msgid "Custom Class"
|
| 948 |
msgstr "Eigene CSS-Klasse."
|
| 949 |
|
| 950 |
-
#: ../includes/field_processors.php:
|
| 951 |
msgid "File type not allowed. Allowed types are: "
|
| 952 |
msgstr "Dateityp ist nicht erlaubt. Erlaubte Typen sind: "
|
| 953 |
|
| 954 |
-
#: ../includes/field_processors.php:
|
| 955 |
msgid "File type needs to be"
|
| 956 |
msgstr "Der Dateityp muss sein:"
|
| 957 |
|
| 958 |
-
#: ../processors/akismet/config.php:2 ../ui/edit.php:
|
| 959 |
-
#: ../ui/panels/variables.php:10
|
| 960 |
msgid "Name"
|
| 961 |
msgstr "Name"
|
| 962 |
|
|
@@ -1001,6 +1065,11 @@ msgstr "Empfänger-Email"
|
|
| 1001 |
msgid "Message"
|
| 1002 |
msgstr "Nachricht"
|
| 1003 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1004 |
#: ../processors/increment/config.php:2
|
| 1005 |
msgid "Increment Start"
|
| 1006 |
msgstr ""
|
|
@@ -1078,52 +1147,52 @@ msgstr ""
|
|
| 1078 |
msgid "Grid"
|
| 1079 |
msgstr "Raster (Grid)"
|
| 1080 |
|
| 1081 |
-
#: ../ui/admin.php:
|
| 1082 |
msgid "Entries"
|
| 1083 |
msgstr "Einträge"
|
| 1084 |
|
| 1085 |
-
#: ../ui/admin.php:
|
| 1086 |
#: ../ui/panels/emailer.php:35
|
| 1087 |
msgid "Disabled"
|
| 1088 |
msgstr "Deaktiviert"
|
| 1089 |
|
| 1090 |
-
#: ../ui/admin.php:
|
| 1091 |
msgid "Mailer Debug enabled."
|
| 1092 |
msgstr ""
|
| 1093 |
|
| 1094 |
-
#: ../ui/admin.php:
|
| 1095 |
msgid "Edit"
|
| 1096 |
msgstr "Bearbeiten"
|
| 1097 |
|
| 1098 |
-
#: ../ui/admin.php:
|
| 1099 |
msgid "Export"
|
| 1100 |
msgstr "Exportieren"
|
| 1101 |
|
| 1102 |
-
#: ../ui/admin.php:
|
| 1103 |
msgid "Clone Form"
|
| 1104 |
msgstr "Formular duplizieren"
|
| 1105 |
|
| 1106 |
-
#: ../ui/admin.php:
|
| 1107 |
msgid "Clone"
|
| 1108 |
msgstr "Duplizieren"
|
| 1109 |
|
| 1110 |
-
#: ../ui/admin.php:
|
| 1111 |
msgid "This will delete this form permanently. Continue?"
|
| 1112 |
msgstr "Dies löscht das Formular dauerhaft. Fortfahren?"
|
| 1113 |
|
| 1114 |
-
#: ../ui/admin.php:
|
| 1115 |
msgid "Delete"
|
| 1116 |
msgstr "Löschen"
|
| 1117 |
|
| 1118 |
-
#: ../ui/admin.php:
|
| 1119 |
msgid "You don't have any forms."
|
| 1120 |
msgstr "Sie haben keine Formulare."
|
| 1121 |
|
| 1122 |
-
#: ../ui/admin.php:
|
| 1123 |
msgid "An form name is required"
|
| 1124 |
msgstr "Ein Name für das Formular wird benötigt"
|
| 1125 |
|
| 1126 |
-
#: ../ui/admin.php:
|
| 1127 |
msgid ""
|
| 1128 |
"Looks like something is not working. Please try again a little later or post "
|
| 1129 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
|
@@ -1150,8 +1219,7 @@ msgstr "In den Papierkorb bewegen"
|
|
| 1150 |
msgid "Delete Permanently"
|
| 1151 |
msgstr "Endgültig löschen"
|
| 1152 |
|
| 1153 |
-
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48
|
| 1154 |
-
#: ../ui/edit.php:468
|
| 1155 |
msgid "Form Name"
|
| 1156 |
msgstr "Formularname"
|
| 1157 |
|
|
@@ -1159,11 +1227,11 @@ msgstr "Formularname"
|
|
| 1159 |
msgid "Form File"
|
| 1160 |
msgstr "Formular-Datei"
|
| 1161 |
|
| 1162 |
-
#: ../ui/admin_templates.php:54 ../ui/edit.php:
|
| 1163 |
msgid "Description"
|
| 1164 |
msgstr "Beschreibung"
|
| 1165 |
|
| 1166 |
-
#: ../ui/admin_templates.php:72 ../ui/edit.php:
|
| 1167 |
#, fuzzy
|
| 1168 |
msgid "ID"
|
| 1169 |
msgstr "ID"
|
|
@@ -1185,248 +1253,232 @@ msgstr "Keine Einträge"
|
|
| 1185 |
msgid "Form has successfully been submitted. Thank you."
|
| 1186 |
msgstr "Das Formular wurde übermittelt. Danke."
|
| 1187 |
|
| 1188 |
-
#: ../ui/edit.php:
|
| 1189 |
#, fuzzy
|
| 1190 |
msgid "Auto Populate"
|
| 1191 |
msgstr "Automatisch gespeicherter Entwurf"
|
| 1192 |
|
| 1193 |
-
#: ../ui/edit.php:
|
| 1194 |
#, fuzzy
|
| 1195 |
msgid "Auto Type"
|
| 1196 |
msgstr "Verbindungstyp"
|
| 1197 |
|
| 1198 |
-
#: ../ui/edit.php:
|
| 1199 |
msgid "Select a source"
|
| 1200 |
msgstr "Wählen Sie eine Quelle"
|
| 1201 |
|
| 1202 |
-
#: ../ui/edit.php:
|
| 1203 |
#, fuzzy
|
| 1204 |
msgid "Post Type"
|
| 1205 |
msgstr "Ungültiger Artikeltyp"
|
| 1206 |
|
| 1207 |
-
#: ../ui/edit.php:
|
| 1208 |
#, fuzzy
|
| 1209 |
msgid "Taxonomy"
|
| 1210 |
msgstr "Taxonomie"
|
| 1211 |
|
| 1212 |
-
#: ../ui/edit.php:
|
| 1213 |
msgid "Add Option"
|
| 1214 |
msgstr "Option hinzufügen"
|
| 1215 |
|
| 1216 |
-
#: ../ui/edit.php:
|
| 1217 |
msgid "Bulk Insert"
|
| 1218 |
msgstr "Bild einfügen"
|
| 1219 |
|
| 1220 |
-
#: ../ui/edit.php:
|
| 1221 |
msgid "Single option per line. These replace the current list."
|
| 1222 |
msgstr "Eine Option je Zeile. Dies ersetzt die aktuelle Liste."
|
| 1223 |
|
| 1224 |
-
#: ../ui/edit.php:
|
| 1225 |
msgid "Insert Options"
|
| 1226 |
msgstr "Optionen einfügen"
|
| 1227 |
|
| 1228 |
-
#: ../ui/edit.php:
|
| 1229 |
msgid "No Default"
|
| 1230 |
msgstr "Kein Standard"
|
| 1231 |
|
| 1232 |
-
#: ../ui/edit.php:
|
| 1233 |
msgid "Show Values"
|
| 1234 |
msgstr "Werte anzeigen"
|
| 1235 |
|
| 1236 |
-
#: ../ui/edit.php:
|
| 1237 |
msgid "Label"
|
| 1238 |
msgstr "Label"
|
| 1239 |
|
| 1240 |
-
#: ../ui/edit.php:
|
| 1241 |
msgid "Elements"
|
| 1242 |
msgstr "Elemente"
|
| 1243 |
|
| 1244 |
-
#: ../ui/edit.php:
|
| 1245 |
-
msgid "Settings"
|
| 1246 |
-
msgstr "Einstellungen"
|
| 1247 |
-
|
| 1248 |
-
#: ../ui/edit.php:306
|
| 1249 |
-
msgid "Conditions"
|
| 1250 |
-
msgstr "Bedingungen"
|
| 1251 |
-
|
| 1252 |
-
#: ../ui/edit.php:313
|
| 1253 |
msgid "Element Type"
|
| 1254 |
msgstr "Elementtyp"
|
| 1255 |
|
| 1256 |
-
#: ../ui/edit.php:
|
| 1257 |
msgid "Hide Label"
|
| 1258 |
msgstr "Label verstecken"
|
| 1259 |
|
| 1260 |
-
#: ../ui/edit.php:
|
| 1261 |
#, fuzzy
|
| 1262 |
msgid "Slug"
|
| 1263 |
msgstr "Titelform"
|
| 1264 |
|
| 1265 |
-
#: ../ui/edit.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1266 |
msgid "Required"
|
| 1267 |
msgstr "Pflichtfeld"
|
| 1268 |
|
| 1269 |
-
#: ../ui/edit.php:
|
| 1270 |
msgid "Show in Entry List"
|
| 1271 |
msgstr "In der Eingabeliste zeigen"
|
| 1272 |
|
| 1273 |
-
#: ../ui/edit.php:
|
| 1274 |
msgid ""
|
| 1275 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1276 |
msgstr "Sind Sie sicher, dass dieses Feld entfernt werden soll?"
|
| 1277 |
|
| 1278 |
-
#: ../ui/edit.php:
|
| 1279 |
msgid "Delete Element"
|
| 1280 |
msgstr "Element löschen"
|
| 1281 |
|
| 1282 |
-
#: ../ui/edit.php:
|
| 1283 |
-
msgid "Show"
|
| 1284 |
-
msgstr "Anzeigen"
|
| 1285 |
-
|
| 1286 |
-
#: ../ui/edit.php:381
|
| 1287 |
-
msgid "Hide"
|
| 1288 |
-
msgstr "Verstecken"
|
| 1289 |
-
|
| 1290 |
-
#: ../ui/edit.php:382
|
| 1291 |
-
msgid "Disable"
|
| 1292 |
-
msgstr "Deaktivieren"
|
| 1293 |
-
|
| 1294 |
-
#: ../ui/edit.php:384 ../ui/panels/processors.php:126
|
| 1295 |
-
#, fuzzy
|
| 1296 |
-
msgid "Add Conditional Group"
|
| 1297 |
-
msgstr "Operator Gruppe hinzufügen"
|
| 1298 |
-
|
| 1299 |
-
#: ../ui/edit.php:454 ../ui/edit.php:466
|
| 1300 |
msgid "General Settings"
|
| 1301 |
msgstr "Grundeinstellungen"
|
| 1302 |
|
| 1303 |
-
#: ../ui/edit.php:
|
| 1304 |
msgid "Updated Successfully"
|
| 1305 |
msgstr ""
|
| 1306 |
|
| 1307 |
-
#: ../ui/edit.php:
|
| 1308 |
msgid "Update Form"
|
| 1309 |
msgstr "Änderungen speichern"
|
| 1310 |
|
| 1311 |
-
#: ../ui/edit.php:
|
| 1312 |
msgid "Preview Form"
|
| 1313 |
msgstr "Vorschau des Formulars"
|
| 1314 |
|
| 1315 |
-
#: ../ui/edit.php:
|
| 1316 |
msgid "Form Description"
|
| 1317 |
msgstr "Beschreibung des Formulars"
|
| 1318 |
|
| 1319 |
-
#: ../ui/edit.php:
|
| 1320 |
#, fuzzy
|
| 1321 |
msgid "State"
|
| 1322 |
msgstr "Statisch"
|
| 1323 |
|
| 1324 |
-
#: ../ui/edit.php:
|
| 1325 |
msgid "Deactivate / Draft"
|
| 1326 |
msgstr ""
|
| 1327 |
|
| 1328 |
-
#: ../ui/edit.php:
|
| 1329 |
msgid "Capture Entries"
|
| 1330 |
msgstr "Einträge sichern"
|
| 1331 |
|
| 1332 |
-
#: ../ui/edit.php:
|
| 1333 |
msgid "Pin to Menu"
|
| 1334 |
msgstr "An das Menü anhängen"
|
| 1335 |
|
| 1336 |
-
#: ../ui/edit.php:
|
| 1337 |
msgid "View Entries"
|
| 1338 |
msgstr "Einträge anzeigen"
|
| 1339 |
|
| 1340 |
-
#: ../ui/edit.php:
|
| 1341 |
msgid "All"
|
| 1342 |
msgstr "Alle"
|
| 1343 |
|
| 1344 |
-
#: ../ui/edit.php:
|
| 1345 |
msgid "Hide Form"
|
| 1346 |
msgstr "Formular ausblenden"
|
| 1347 |
|
| 1348 |
-
#: ../ui/edit.php:
|
| 1349 |
msgid "Hide form after successful submission"
|
| 1350 |
msgstr "Formular nach dem erfolgreichen Abschicken ausblenden"
|
| 1351 |
|
| 1352 |
-
#: ../ui/edit.php:
|
| 1353 |
msgid "Honeypot"
|
| 1354 |
msgstr "Honigtopf"
|
| 1355 |
|
| 1356 |
-
#: ../ui/edit.php:
|
| 1357 |
msgid "Place an invisible field to trick spambots"
|
| 1358 |
msgstr "Fügen Sie ein unsichtbares Feld ein, um damit SPAM-Bots auszutricksen"
|
| 1359 |
|
| 1360 |
-
#: ../ui/edit.php:
|
| 1361 |
msgid "Success Message"
|
| 1362 |
msgstr "Erfolgsmeldung"
|
| 1363 |
|
| 1364 |
-
#: ../ui/edit.php:
|
| 1365 |
msgid "Gravatar Field"
|
| 1366 |
msgstr "Gravatar Feld"
|
| 1367 |
|
| 1368 |
-
#: ../ui/edit.php:
|
| 1369 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1370 |
msgstr ""
|
| 1371 |
"Genutzt, wenn ein Eintrag eines nicht-angemeldeten Benutzers gezeigt wird"
|
| 1372 |
|
| 1373 |
-
#: ../ui/edit.php:
|
| 1374 |
msgid "Add New"
|
| 1375 |
msgstr "Neu hinzufügen"
|
| 1376 |
|
| 1377 |
-
#: ../ui/edit.php:
|
| 1378 |
msgid "Remove"
|
| 1379 |
msgstr "Entfernen"
|
| 1380 |
|
| 1381 |
-
#: ../ui/edit.php:
|
| 1382 |
msgid "Set Element"
|
| 1383 |
msgstr "Element setzen"
|
| 1384 |
|
| 1385 |
-
#: ../ui/edit.php:
|
| 1386 |
msgid "No description given"
|
| 1387 |
msgstr "Keine Beschreibung"
|
| 1388 |
|
| 1389 |
-
#: ../ui/edit.php:
|
| 1390 |
msgid "or"
|
| 1391 |
msgstr "oder"
|
| 1392 |
|
| 1393 |
-
#: ../ui/edit.php:
|
| 1394 |
msgid "is"
|
| 1395 |
msgstr "ist"
|
| 1396 |
|
| 1397 |
-
#: ../ui/edit.php:
|
| 1398 |
msgid "is not"
|
| 1399 |
msgstr "ist nicht"
|
| 1400 |
|
| 1401 |
-
#: ../ui/edit.php:
|
| 1402 |
msgid "is greater than"
|
| 1403 |
msgstr "ist größer als"
|
| 1404 |
|
| 1405 |
-
#: ../ui/edit.php:
|
| 1406 |
msgid "is less than"
|
| 1407 |
msgstr "ist kleiner als"
|
| 1408 |
|
| 1409 |
-
#: ../ui/edit.php:
|
| 1410 |
msgid "starts with"
|
| 1411 |
msgstr "startet mit"
|
| 1412 |
|
| 1413 |
-
#: ../ui/edit.php:
|
| 1414 |
msgid "ends with"
|
| 1415 |
msgstr "endet mit"
|
| 1416 |
|
| 1417 |
-
#: ../ui/edit.php:
|
| 1418 |
msgid "contains"
|
| 1419 |
msgstr "beinhaltet"
|
| 1420 |
|
| 1421 |
-
#: ../ui/edit.php:
|
| 1422 |
msgid "Select field first"
|
| 1423 |
msgstr "Wählen Sie zuerst ein Feld"
|
| 1424 |
|
| 1425 |
-
#: ../ui/edit.php:
|
|
|
|
| 1426 |
msgid "Add Condition"
|
| 1427 |
msgstr "Bedingung hinzufügen"
|
| 1428 |
|
| 1429 |
-
#: ../ui/edit.php:
|
| 1430 |
msgid "and"
|
| 1431 |
msgstr "und"
|
| 1432 |
|
|
@@ -1453,10 +1505,17 @@ msgid "items"
|
|
| 1453 |
msgstr "Einträge"
|
| 1454 |
|
| 1455 |
#: ../ui/extend.php:23
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1456 |
msgid "No licensed addons installed."
|
| 1457 |
msgstr "keine lizensierten Erweiterungen (Addons) installiert"
|
| 1458 |
|
| 1459 |
-
#: ../ui/extend.php:
|
| 1460 |
msgid "Already Installed"
|
| 1461 |
msgstr "Bereits installiert"
|
| 1462 |
|
|
@@ -1480,6 +1539,38 @@ msgstr "Schließen"
|
|
| 1480 |
msgid "Unable to connect or no extensions available."
|
| 1481 |
msgstr "Keine Verbindung oder keine Erweiterungen verfügbar"
|
| 1482 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1483 |
#: ../ui/panels/emailer.php:36
|
| 1484 |
msgid "Enabled"
|
| 1485 |
msgstr "aktiv"
|
|
@@ -1522,14 +1613,18 @@ msgstr "Eine CSV Version des Formulars anhängen"
|
|
| 1522 |
msgid "Recipients"
|
| 1523 |
msgstr "Empfänger"
|
| 1524 |
|
| 1525 |
-
#: ../ui/panels/emailer.php:84
|
| 1526 |
-
msgid "Comma separated list of email addresses."
|
| 1527 |
-
msgstr "
|
| 1528 |
|
| 1529 |
#: ../ui/panels/emailer.php:89
|
| 1530 |
msgid "BCC"
|
| 1531 |
msgstr ""
|
| 1532 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1533 |
#: ../ui/panels/emailer.php:100
|
| 1534 |
msgid "Use %field_slug% to use a value from the form"
|
| 1535 |
msgstr "Nutzen Sie %field_slug% um den Wert im Formular zu nutzen"
|
|
@@ -1566,7 +1661,11 @@ msgid ""
|
|
| 1566 |
"tracking."
|
| 1567 |
msgstr ""
|
| 1568 |
|
| 1569 |
-
#: ../ui/panels/emailer.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1570 |
msgid ""
|
| 1571 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1572 |
"the form submittable."
|
|
@@ -1579,24 +1678,20 @@ msgid "This will remove all the fields in this row. Are you sure?"
|
|
| 1579 |
msgstr "Sie entfernen alle Felder dieser Reihe. Sind Sie sicher?"
|
| 1580 |
|
| 1581 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1582 |
-
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:
|
| 1583 |
-
#: ../ui/panels/
|
| 1584 |
msgid "Page"
|
| 1585 |
msgstr "Seite"
|
| 1586 |
|
| 1587 |
-
#: ../ui/panels/
|
| 1588 |
-
msgid "Add Row"
|
| 1589 |
-
msgstr "Zeile hinzufügen"
|
| 1590 |
-
|
| 1591 |
-
#: ../ui/panels/layout_add_row.php:11
|
| 1592 |
msgid "Add Page"
|
| 1593 |
msgstr "Seite hinzufügen"
|
| 1594 |
|
| 1595 |
-
#: ../ui/panels/
|
| 1596 |
msgid "Drag onto the form grid below"
|
| 1597 |
msgstr "Auf das Formularraster unten ziehen"
|
| 1598 |
|
| 1599 |
-
#: ../ui/panels/
|
| 1600 |
msgid "Add Element"
|
| 1601 |
msgstr "Element hinzufügen"
|
| 1602 |
|
|
@@ -1639,6 +1734,11 @@ msgstr "Nutzen"
|
|
| 1639 |
msgid "Don't Use"
|
| 1640 |
msgstr "Nicht nutzen"
|
| 1641 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1642 |
#: ../ui/panels/processors.php:171
|
| 1643 |
msgid "Add Processor"
|
| 1644 |
msgstr "Prozessor hinzufügen"
|
|
@@ -1680,6 +1780,15 @@ msgstr "Rückgabe"
|
|
| 1680 |
msgid "Entry List"
|
| 1681 |
msgstr "In der Eingabeliste zeigen"
|
| 1682 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1683 |
#, fuzzy
|
| 1684 |
#~ msgid ""
|
| 1685 |
#~ "Comma separated list of email addresses. Use %field_slug% to use a value "
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2015-08-24 12:16+0200\n"
|
| 6 |
+
"PO-Revision-Date: 2015-08-24 12:16+0200\n"
|
| 7 |
"Last-Translator: Detlef <d.beyer@crash.de>\n"
|
| 8 |
"Language-Team: Tricodia Systems <david@digilab.co.za>\n"
|
| 9 |
"Language: de\n"
|
| 10 |
"MIME-Version: 1.0\n"
|
| 11 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 14 |
"X-Poedit-Basepath: .\n"
|
| 15 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 16 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 17 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 18 |
"X-Poedit-SearchPath-0: ..\n"
|
| 19 |
|
| 20 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 21 |
+
msgid "Caldera Forms Notification"
|
| 22 |
+
msgstr "Benachrichtigung von Caldera Forms"
|
| 23 |
+
|
| 24 |
+
#: ../classes/admin.php:124
|
| 25 |
msgid "Invalid Form."
|
| 26 |
msgstr "Ungültiges Formular."
|
| 27 |
|
| 28 |
+
#: ../classes/admin.php:143
|
| 29 |
+
#, fuzzy
|
| 30 |
+
msgid "Starter Contact Form"
|
| 31 |
+
msgstr "Farbe des Sterns"
|
| 32 |
+
|
| 33 |
+
#: ../classes/admin.php:147
|
| 34 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 35 |
+
msgstr ""
|
| 36 |
+
|
| 37 |
+
#: ../classes/admin.php:151
|
| 38 |
+
msgid "Registration Form, with optional additional participants."
|
| 39 |
+
msgstr ""
|
| 40 |
+
|
| 41 |
+
#: ../classes/admin.php:174
|
| 42 |
+
#, fuzzy
|
| 43 |
+
msgid "Form Template"
|
| 44 |
+
msgstr "Formularname"
|
| 45 |
+
|
| 46 |
+
#: ../classes/admin.php:177
|
| 47 |
+
msgid "no template - blank form"
|
| 48 |
+
msgstr ""
|
| 49 |
+
|
| 50 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 51 |
#: ../ui/entries_toolbar.php:27
|
| 52 |
msgid "Trash"
|
| 53 |
msgstr "Papierkorb"
|
| 54 |
|
| 55 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 56 |
#: ../ui/admin_templates.php:9
|
| 57 |
msgid "Restore"
|
| 58 |
msgstr "Zurücksetzen"
|
| 59 |
|
| 60 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 61 |
msgid "Entry"
|
| 62 |
msgstr "Eingabe"
|
| 63 |
|
| 64 |
+
#: ../classes/admin.php:385
|
| 65 |
msgid "View"
|
| 66 |
msgstr "Anzeige"
|
| 67 |
|
| 68 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 69 |
msgid "Add Form to Page"
|
| 70 |
msgstr "Formular zur Seite hinzufügen"
|
| 71 |
|
| 72 |
+
#: ../classes/admin.php:428
|
| 73 |
msgid "Insert Form Shortcode"
|
| 74 |
msgstr "Formular Shortcode einfügen"
|
| 75 |
|
| 76 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 77 |
#, fuzzy
|
| 78 |
msgid "Caldera Form"
|
| 79 |
msgstr "Ein Caldera Formular hinzufügen"
|
| 80 |
|
| 81 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 82 |
#, fuzzy
|
| 83 |
msgid "Deactivate"
|
| 84 |
msgstr "Aktiv"
|
| 85 |
|
| 86 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 87 |
#, fuzzy
|
| 88 |
msgid "Activate"
|
| 89 |
msgstr "Aktiv"
|
| 90 |
|
| 91 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 92 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 93 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 94 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 95 |
msgid "Caldera Forms"
|
| 96 |
msgstr "Caldera Formulare"
|
| 97 |
|
| 98 |
+
#: ../classes/admin.php:746
|
| 99 |
msgid "Caldera Forms Admin"
|
| 100 |
msgstr "Caldera Formular Admin"
|
| 101 |
|
| 102 |
+
#: ../classes/admin.php:746
|
| 103 |
msgid "Forms"
|
| 104 |
msgstr "Formulare"
|
| 105 |
|
| 106 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 107 |
msgid "Community"
|
| 108 |
msgstr "Community"
|
| 109 |
|
| 110 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 111 |
msgid "Extend"
|
| 112 |
msgstr "Erweitern"
|
| 113 |
|
| 114 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 115 |
msgid "Sorry, please try again"
|
| 116 |
msgstr "Sorry, bitte noch einmal versuchen"
|
| 117 |
|
| 118 |
+
#: ../classes/admin.php:1017
|
| 119 |
msgid "Form Delete Error"
|
| 120 |
msgstr "Fehler beim Löschen des Formulars"
|
| 121 |
|
| 122 |
+
#: ../classes/admin.php:1170
|
| 123 |
msgid "Sorry, File is not valid."
|
| 124 |
msgstr "Sorry, die Datei ist nicht gültig"
|
| 125 |
|
| 126 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 127 |
+
#: ../classes/admin.php:1179
|
| 128 |
msgid "Form Import Error"
|
| 129 |
msgstr "Fehler beim Import des Fomulars"
|
| 130 |
|
| 131 |
+
#: ../classes/admin.php:1174
|
| 132 |
msgid "Sorry, File not uploaded."
|
| 133 |
msgstr "Sorry, die Datei wurde nicht geladen"
|
| 134 |
|
| 135 |
+
#: ../classes/admin.php:1188
|
| 136 |
msgid "Form does not exist."
|
| 137 |
msgstr "Das Formular existiert nicht"
|
| 138 |
|
| 139 |
+
#: ../classes/admin.php:1229
|
| 140 |
msgid "Export selection has expired"
|
| 141 |
msgstr "Export-Auswahl ist abgelaufen"
|
| 142 |
|
| 143 |
+
#: ../classes/admin.php:1229
|
| 144 |
msgid "Export Expired"
|
| 145 |
msgstr "Export ist abgelaufen"
|
| 146 |
|
| 147 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 148 |
#, fuzzy
|
| 149 |
msgid "Form has been successfully submitted. Thank you."
|
| 150 |
msgstr "Das Formular wurde abgeschickt. Vielen Dank."
|
| 151 |
|
| 152 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 153 |
#, fuzzy
|
| 154 |
msgid "Layout"
|
| 155 |
msgstr "Layout"
|
| 156 |
|
| 157 |
+
#: ../classes/admin.php:1465
|
| 158 |
#, fuzzy
|
| 159 |
msgid "Layout Builder"
|
| 160 |
msgstr "Bildschirm-Layout"
|
| 161 |
|
| 162 |
+
#: ../classes/admin.php:1475
|
| 163 |
msgid "Pages"
|
| 164 |
msgstr "Seiten"
|
| 165 |
|
| 166 |
+
#: ../classes/admin.php:1477
|
| 167 |
msgid "Form Pages"
|
| 168 |
msgstr "Formularseiten"
|
| 169 |
|
| 170 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 171 |
+
msgid "Conditions"
|
| 172 |
+
msgstr "Bedingungen"
|
| 173 |
+
|
| 174 |
+
#: ../classes/admin.php:1487
|
| 175 |
msgid "Processors"
|
| 176 |
msgstr "Prozessoren"
|
| 177 |
|
| 178 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 179 |
msgid "Form Processors"
|
| 180 |
msgstr "Formular Prozessoren"
|
| 181 |
|
| 182 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 183 |
#: ../ui/panels/variables.php:83
|
| 184 |
msgid "Variables"
|
| 185 |
msgstr "Variable"
|
| 186 |
|
| 187 |
+
#: ../classes/admin.php:1502
|
| 188 |
#, fuzzy
|
| 189 |
msgid "Responsive"
|
| 190 |
msgstr "Responsive"
|
| 191 |
|
| 192 |
+
#: ../classes/admin.php:1504
|
| 193 |
msgid "Resposive Settings"
|
| 194 |
msgstr "Responsive Einstellungen"
|
| 195 |
|
| 196 |
+
#: ../classes/admin.php:1508
|
| 197 |
msgid "Grid Collapse"
|
| 198 |
msgstr "Raster einklappen"
|
| 199 |
|
| 200 |
+
#: ../classes/admin.php:1510
|
| 201 |
msgid ""
|
| 202 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 203 |
"Bootstrap 3.0)"
|
| 205 |
"Die Bildschirmbreite ab der das Raster zusammenklappt (basierend auf "
|
| 206 |
"Bootstrap 3.0)"
|
| 207 |
|
| 208 |
+
#: ../classes/admin.php:1517
|
| 209 |
msgid "Maintain grid always"
|
| 210 |
msgstr "Raster immer erhalten"
|
| 211 |
|
| 212 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 213 |
#, fuzzy
|
| 214 |
msgid "Mailer"
|
| 215 |
msgstr "An den Mailer anhängen"
|
| 216 |
|
| 217 |
+
#: ../classes/admin.php:1539
|
| 218 |
msgid "Email Notification Settings"
|
| 219 |
msgstr "Email Benachrichtigungseinstellungen"
|
| 220 |
|
| 221 |
+
#: ../classes/core.php:396
|
| 222 |
msgid "The wasn't entered correct."
|
| 223 |
msgstr "Das wurde nicht richtig eingetragen"
|
| 224 |
|
| 225 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 226 |
msgid "Reset"
|
| 227 |
msgstr "Zurücksetzen"
|
| 228 |
|
| 229 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 230 |
msgid "Permission denied."
|
| 231 |
msgstr "Zugriff verweigert"
|
| 232 |
|
| 233 |
+
#: ../classes/core.php:787
|
|
|
|
|
|
|
|
|
|
|
|
|
| 234 |
msgid "Auto Responder"
|
| 235 |
msgstr "Auto Antwort"
|
| 236 |
|
| 237 |
+
#: ../classes/core.php:788
|
| 238 |
msgid "Sends out an auto response e-mail"
|
| 239 |
msgstr "Sendet eine automatische Benachrichtigung"
|
| 240 |
|
| 241 |
+
#: ../classes/core.php:792
|
| 242 |
msgid "Thank you for contacting us"
|
| 243 |
msgstr "Danke für Ihre Anfrage"
|
| 244 |
|
| 245 |
+
#: ../classes/core.php:796
|
| 246 |
msgid "Redirect"
|
| 247 |
msgstr "Umleiten"
|
| 248 |
|
| 249 |
+
#: ../classes/core.php:797
|
| 250 |
msgid "Redirects user to URL on successful submit"
|
| 251 |
msgstr "Leitet den Nutzer nach erfolgreicher Eingabe auf eine andere Seite um"
|
| 252 |
|
| 253 |
+
#: ../classes/core.php:802
|
| 254 |
msgid "Increment Value"
|
| 255 |
msgstr ""
|
| 256 |
|
| 257 |
+
#: ../classes/core.php:803
|
| 258 |
msgid "Increment a value per entry."
|
| 259 |
msgstr ""
|
| 260 |
|
| 261 |
+
#: ../classes/core.php:817
|
| 262 |
#, fuzzy
|
| 263 |
msgid "Akismet"
|
| 264 |
msgstr "Akismet"
|
| 265 |
|
| 266 |
+
#: ../classes/core.php:818
|
| 267 |
#, fuzzy
|
| 268 |
msgid "Anti-spam filtering"
|
| 269 |
msgstr "reCAPTCHA anti-spam Feld"
|
| 270 |
|
| 271 |
+
#: ../classes/core.php:866
|
| 272 |
msgid "Akismet not setup."
|
| 273 |
msgstr "Akismet wurde nicht eingerichtet."
|
| 274 |
|
| 275 |
+
#: ../classes/core.php:1017
|
| 276 |
msgid "Calculation"
|
| 277 |
msgstr "Berechnung"
|
| 278 |
|
| 279 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 280 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 281 |
msgid "Special"
|
| 282 |
msgstr "Spezial"
|
| 283 |
|
| 284 |
+
#: ../classes/core.php:1020
|
| 285 |
msgid "Math"
|
| 286 |
msgstr "Mathe"
|
| 287 |
|
| 288 |
+
#: ../classes/core.php:1021
|
| 289 |
msgid "Calculate values"
|
| 290 |
msgstr "Werte berechnen"
|
| 291 |
|
| 292 |
+
#: ../classes/core.php:1028
|
| 293 |
msgid "Total"
|
| 294 |
msgstr "Summe"
|
| 295 |
|
| 296 |
+
#: ../classes/core.php:1040
|
| 297 |
msgid "Range Slider"
|
| 298 |
msgstr "Schieberegler"
|
| 299 |
|
| 300 |
+
#: ../classes/core.php:1043
|
| 301 |
msgid "Range Slider input field"
|
| 302 |
msgstr "Schieberegler Eingabefeld"
|
| 303 |
|
| 304 |
+
#: ../classes/core.php:1077
|
| 305 |
msgid "Star Rating"
|
| 306 |
msgstr "Sterne-Bewertung"
|
| 307 |
|
| 308 |
+
#: ../classes/core.php:1079
|
| 309 |
#, fuzzy
|
| 310 |
msgid "Feedback"
|
| 311 |
msgstr "Feedback"
|
| 312 |
|
| 313 |
+
#: ../classes/core.php:1080
|
| 314 |
msgid "Star rating input for feedback"
|
| 315 |
msgstr "Sterne-Bewertung für ein Feedback"
|
| 316 |
|
| 317 |
+
#: ../classes/core.php:1112
|
| 318 |
msgid "Phone Number"
|
| 319 |
msgstr "Telefonnummer"
|
| 320 |
|
| 321 |
+
#: ../classes/core.php:1113
|
| 322 |
msgid "Phone number with masking"
|
| 323 |
msgstr "Maskierte Telefonnummer"
|
| 324 |
|
| 325 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 326 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 327 |
+
#: ../classes/core.php:1376
|
| 328 |
msgid "Text Fields"
|
| 329 |
msgstr "Textfelder"
|
| 330 |
|
| 331 |
+
#: ../classes/core.php:1115
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 332 |
#, fuzzy
|
| 333 |
msgid "User"
|
| 334 |
msgstr "Benutzer"
|
| 335 |
|
| 336 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 337 |
msgid "Single Line Text"
|
| 338 |
msgstr "Einzelne Textzeile"
|
| 339 |
|
| 340 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 341 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 342 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 343 |
+
#: ../ui/edit.php:215
|
| 344 |
+
#, fuzzy
|
| 345 |
+
msgid "Basic"
|
| 346 |
+
msgstr "Grundlegende Einstellungen"
|
| 347 |
+
|
| 348 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 349 |
msgid "File"
|
| 350 |
msgstr "Datei"
|
| 351 |
|
| 352 |
+
#: ../classes/core.php:1149
|
| 353 |
msgid "File Uploader"
|
| 354 |
msgstr "Datei Uploader"
|
| 355 |
|
| 356 |
+
#: ../classes/core.php:1159
|
| 357 |
msgid "reCAPTCHA"
|
| 358 |
msgstr ""
|
| 359 |
|
| 360 |
+
#: ../classes/core.php:1160
|
| 361 |
msgid "reCAPTCHA anti-spam field"
|
| 362 |
msgstr "reCAPTCHA anti-spam Feld"
|
| 363 |
|
| 364 |
+
#: ../classes/core.php:1185
|
| 365 |
#, fuzzy
|
| 366 |
msgid "HTML"
|
| 367 |
msgstr "HTML"
|
| 368 |
|
| 369 |
+
#: ../classes/core.php:1186
|
| 370 |
msgid "Add text/html content"
|
| 371 |
msgstr "text/html hinzufügen"
|
| 372 |
|
| 373 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 374 |
#: ../processors/akismet/config.php:20
|
| 375 |
msgid "Content"
|
| 376 |
msgstr "Inhalt"
|
| 377 |
|
| 378 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 379 |
msgid "Hidden"
|
| 380 |
msgstr "Versteckt"
|
| 381 |
|
| 382 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 383 |
msgid "Button"
|
| 384 |
msgstr ""
|
| 385 |
|
| 386 |
+
#: ../classes/core.php:1220
|
| 387 |
msgid "Button, Submit and Reset types"
|
| 388 |
msgstr "Button, Submit und Reset Typen"
|
| 389 |
|
| 390 |
+
#: ../classes/core.php:1222
|
| 391 |
msgid "Buttons"
|
| 392 |
msgstr ""
|
| 393 |
|
| 394 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 395 |
msgid "Email Address"
|
| 396 |
msgstr "Email Adresse"
|
| 397 |
|
| 398 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 399 |
msgid "Paragraph Textarea"
|
| 400 |
msgstr "Textarea (Abschnitt)"
|
| 401 |
|
| 402 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 403 |
msgid "Toggle Switch"
|
| 404 |
msgstr "Umschalter"
|
| 405 |
|
| 406 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 407 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 408 |
msgid "Select Options"
|
| 409 |
msgstr "Auswahl Optionen"
|
| 410 |
|
| 411 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 412 |
msgid "Dropdown Select"
|
| 413 |
msgstr "Dropdown Auswahl"
|
| 414 |
|
| 415 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 416 |
msgid "Checkbox"
|
| 417 |
msgstr ""
|
| 418 |
|
| 419 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 420 |
msgid "Radio"
|
| 421 |
msgstr "Radio Button"
|
| 422 |
|
| 423 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 424 |
msgid "Date Picker"
|
| 425 |
msgstr "Datums Picker"
|
| 426 |
|
| 427 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 428 |
msgid "Pickers"
|
| 429 |
msgstr ""
|
| 430 |
|
| 431 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 432 |
msgid "Color Picker"
|
| 433 |
msgstr "Farb Picker"
|
| 434 |
|
| 435 |
+
#: ../classes/core.php:1402
|
| 436 |
#, fuzzy
|
| 437 |
msgid "State/ Province Select"
|
| 438 |
msgstr "Verzeichnis auswählen"
|
| 439 |
|
| 440 |
+
#: ../classes/core.php:1403
|
| 441 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 442 |
msgstr ""
|
| 443 |
|
| 444 |
+
#: ../classes/core.php:1417
|
| 445 |
+
#, fuzzy
|
| 446 |
+
msgid "Autocomplete"
|
| 447 |
+
msgstr "Automatisch gespeicherter Entwurf"
|
| 448 |
+
|
| 449 |
+
#: ../classes/core.php:1419
|
| 450 |
+
#, fuzzy
|
| 451 |
+
msgid "Pickers,Select Options"
|
| 452 |
+
msgstr "Auswahl Optionen"
|
| 453 |
+
|
| 454 |
+
#: ../classes/core.php:1838
|
| 455 |
#, fuzzy
|
| 456 |
msgid "System Tags"
|
| 457 |
msgstr "Schlagwörter hinzufügen"
|
| 458 |
|
| 459 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 460 |
#, fuzzy
|
| 461 |
msgid "Mailer Debug"
|
| 462 |
msgstr "An den Mailer anhängen"
|
| 463 |
|
| 464 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 465 |
msgid "Invalid form ID"
|
| 466 |
msgstr "Ungültige Formular ID"
|
| 467 |
|
| 468 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 469 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 470 |
+
#: ../classes/core.php:4111
|
| 471 |
msgid "Permission denied or entry does not exist."
|
| 472 |
msgstr "Zugriff verweigert oder der Eintrag existiert nicht"
|
| 473 |
|
| 474 |
+
#: ../classes/core.php:3053
|
| 475 |
msgid "is required"
|
| 476 |
msgstr "wird benötigt"
|
| 477 |
|
| 478 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 479 |
msgid "Form is currently not active."
|
| 480 |
msgstr ""
|
| 481 |
|
| 482 |
+
#: ../classes/core.php:4393
|
| 483 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 484 |
msgstr ""
|
| 485 |
|
| 487 |
msgid "Title"
|
| 488 |
msgstr "Titel"
|
| 489 |
|
| 490 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 491 |
msgid "Form"
|
| 492 |
msgstr "Formular"
|
| 493 |
|
| 611 |
msgstr ""
|
| 612 |
|
| 613 |
#: ../fields/date_picker/setup.php:32
|
| 614 |
+
msgid "Start Date"
|
| 615 |
+
msgstr ""
|
| 616 |
+
|
| 617 |
+
#: ../fields/date_picker/setup.php:35
|
| 618 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 619 |
+
msgstr ""
|
| 620 |
+
|
| 621 |
+
#: ../fields/date_picker/setup.php:39
|
| 622 |
+
msgid "End Date"
|
| 623 |
+
msgstr ""
|
| 624 |
+
|
| 625 |
+
#: ../fields/date_picker/setup.php:42
|
| 626 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 627 |
+
msgstr ""
|
| 628 |
+
|
| 629 |
+
#: ../fields/date_picker/setup.php:46
|
| 630 |
msgid "language"
|
| 631 |
msgstr "Sprache"
|
| 632 |
|
| 633 |
+
#: ../fields/date_picker/setup.php:114
|
| 634 |
msgid "Language to use. e.g. pt-BR"
|
| 635 |
msgstr "Zu nutzende Sprache z.B. pt-BR"
|
| 636 |
|
| 637 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 638 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 639 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 640 |
msgid "Placeholder"
|
| 641 |
msgstr "Platzhalter"
|
| 642 |
|
| 645 |
msgstr "An den Mailer anhängen"
|
| 646 |
|
| 647 |
#: ../fields/file/config_template.php:9
|
| 648 |
+
msgid "Allow Multiple"
|
| 649 |
+
msgstr ""
|
| 650 |
+
|
| 651 |
+
#: ../fields/file/config_template.php:16
|
| 652 |
msgid "Allowed Types"
|
| 653 |
msgstr "Erlaubte Typen"
|
| 654 |
|
| 655 |
+
#: ../fields/file/config_template.php:19
|
| 656 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 657 |
msgstr "Durch ein Komma getrennt z.B.: jpg, pdf, txt"
|
| 658 |
|
| 710 |
msgid "Border Radius"
|
| 711 |
msgstr "Rand-Radius"
|
| 712 |
|
| 713 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 714 |
#: ../ui/panels/variables.php:12
|
| 715 |
msgid "Value"
|
| 716 |
msgstr "Wert"
|
| 745 |
msgid "Track"
|
| 746 |
msgstr "Track Farbe"
|
| 747 |
|
| 748 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 749 |
msgid "Highlight"
|
| 750 |
msgstr ""
|
| 751 |
|
| 753 |
msgid "Handle"
|
| 754 |
msgstr ""
|
| 755 |
|
| 756 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 757 |
msgid "Border"
|
| 758 |
msgstr "Bordure"
|
| 759 |
|
| 822 |
msgid "No Site Key Added"
|
| 823 |
msgstr "Kein Site-Schlüssel hinzugefügt"
|
| 824 |
|
| 825 |
+
#: ../fields/select2/field/config.php:11
|
| 826 |
+
msgid "Multiple"
|
| 827 |
+
msgstr ""
|
| 828 |
+
|
| 829 |
+
#: ../fields/select2/field/config.php:15
|
| 830 |
+
msgid "Enable multiple selections"
|
| 831 |
+
msgstr ""
|
| 832 |
+
|
| 833 |
#: ../fields/star-rate/config.php:2
|
| 834 |
msgid "Number of Stars"
|
| 835 |
msgstr "Anzahl der Sterne"
|
| 951 |
msgid "Inactive Class"
|
| 952 |
msgstr "Inaktiv <span class=\"count\">(%s)</span>"
|
| 953 |
|
| 954 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 955 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 956 |
msgid "Enable"
|
| 957 |
msgstr "Aktivieren"
|
| 958 |
|
| 1011 |
msgid "Custom Class"
|
| 1012 |
msgstr "Eigene CSS-Klasse."
|
| 1013 |
|
| 1014 |
+
#: ../includes/field_processors.php:45
|
| 1015 |
msgid "File type not allowed. Allowed types are: "
|
| 1016 |
msgstr "Dateityp ist nicht erlaubt. Erlaubte Typen sind: "
|
| 1017 |
|
| 1018 |
+
#: ../includes/field_processors.php:47
|
| 1019 |
msgid "File type needs to be"
|
| 1020 |
msgstr "Der Dateityp muss sein:"
|
| 1021 |
|
| 1022 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 1023 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 1024 |
msgid "Name"
|
| 1025 |
msgstr "Name"
|
| 1026 |
|
| 1065 |
msgid "Message"
|
| 1066 |
msgstr "Nachricht"
|
| 1067 |
|
| 1068 |
+
#: ../processors/classes/get_data.php:76
|
| 1069 |
+
#, php-format
|
| 1070 |
+
msgid "%s is required"
|
| 1071 |
+
msgstr ""
|
| 1072 |
+
|
| 1073 |
#: ../processors/increment/config.php:2
|
| 1074 |
msgid "Increment Start"
|
| 1075 |
msgstr ""
|
| 1147 |
msgid "Grid"
|
| 1148 |
msgstr "Raster (Grid)"
|
| 1149 |
|
| 1150 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1151 |
msgid "Entries"
|
| 1152 |
msgstr "Einträge"
|
| 1153 |
|
| 1154 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1155 |
#: ../ui/panels/emailer.php:35
|
| 1156 |
msgid "Disabled"
|
| 1157 |
msgstr "Deaktiviert"
|
| 1158 |
|
| 1159 |
+
#: ../ui/admin.php:112
|
| 1160 |
msgid "Mailer Debug enabled."
|
| 1161 |
msgstr ""
|
| 1162 |
|
| 1163 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1164 |
msgid "Edit"
|
| 1165 |
msgstr "Bearbeiten"
|
| 1166 |
|
| 1167 |
+
#: ../ui/admin.php:141
|
| 1168 |
msgid "Export"
|
| 1169 |
msgstr "Exportieren"
|
| 1170 |
|
| 1171 |
+
#: ../ui/admin.php:142
|
| 1172 |
msgid "Clone Form"
|
| 1173 |
msgstr "Formular duplizieren"
|
| 1174 |
|
| 1175 |
+
#: ../ui/admin.php:142
|
| 1176 |
msgid "Clone"
|
| 1177 |
msgstr "Duplizieren"
|
| 1178 |
|
| 1179 |
+
#: ../ui/admin.php:143
|
| 1180 |
msgid "This will delete this form permanently. Continue?"
|
| 1181 |
msgstr "Dies löscht das Formular dauerhaft. Fortfahren?"
|
| 1182 |
|
| 1183 |
+
#: ../ui/admin.php:143
|
| 1184 |
msgid "Delete"
|
| 1185 |
msgstr "Löschen"
|
| 1186 |
|
| 1187 |
+
#: ../ui/admin.php:163
|
| 1188 |
msgid "You don't have any forms."
|
| 1189 |
msgstr "Sie haben keine Formulare."
|
| 1190 |
|
| 1191 |
+
#: ../ui/admin.php:204
|
| 1192 |
msgid "An form name is required"
|
| 1193 |
msgstr "Ein Name für das Formular wird benötigt"
|
| 1194 |
|
| 1195 |
+
#: ../ui/admin.php:231
|
| 1196 |
msgid ""
|
| 1197 |
"Looks like something is not working. Please try again a little later or post "
|
| 1198 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1219 |
msgid "Delete Permanently"
|
| 1220 |
msgstr "Endgültig löschen"
|
| 1221 |
|
| 1222 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
|
|
|
| 1223 |
msgid "Form Name"
|
| 1224 |
msgstr "Formularname"
|
| 1225 |
|
| 1227 |
msgid "Form File"
|
| 1228 |
msgstr "Formular-Datei"
|
| 1229 |
|
| 1230 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1231 |
msgid "Description"
|
| 1232 |
msgstr "Beschreibung"
|
| 1233 |
|
| 1234 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1235 |
#, fuzzy
|
| 1236 |
msgid "ID"
|
| 1237 |
msgstr "ID"
|
| 1253 |
msgid "Form has successfully been submitted. Thank you."
|
| 1254 |
msgstr "Das Formular wurde übermittelt. Danke."
|
| 1255 |
|
| 1256 |
+
#: ../ui/edit.php:99
|
| 1257 |
#, fuzzy
|
| 1258 |
msgid "Auto Populate"
|
| 1259 |
msgstr "Automatisch gespeicherter Entwurf"
|
| 1260 |
|
| 1261 |
+
#: ../ui/edit.php:105
|
| 1262 |
#, fuzzy
|
| 1263 |
msgid "Auto Type"
|
| 1264 |
msgstr "Verbindungstyp"
|
| 1265 |
|
| 1266 |
+
#: ../ui/edit.php:108
|
| 1267 |
msgid "Select a source"
|
| 1268 |
msgstr "Wählen Sie eine Quelle"
|
| 1269 |
|
| 1270 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1271 |
#, fuzzy
|
| 1272 |
msgid "Post Type"
|
| 1273 |
msgstr "Ungültiger Artikeltyp"
|
| 1274 |
|
| 1275 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1276 |
#, fuzzy
|
| 1277 |
msgid "Taxonomy"
|
| 1278 |
msgstr "Taxonomie"
|
| 1279 |
|
| 1280 |
+
#: ../ui/edit.php:167
|
| 1281 |
msgid "Add Option"
|
| 1282 |
msgstr "Option hinzufügen"
|
| 1283 |
|
| 1284 |
+
#: ../ui/edit.php:168
|
| 1285 |
msgid "Bulk Insert"
|
| 1286 |
msgstr "Bild einfügen"
|
| 1287 |
|
| 1288 |
+
#: ../ui/edit.php:171
|
| 1289 |
msgid "Single option per line. These replace the current list."
|
| 1290 |
msgstr "Eine Option je Zeile. Dies ersetzt die aktuelle Liste."
|
| 1291 |
|
| 1292 |
+
#: ../ui/edit.php:172
|
| 1293 |
msgid "Insert Options"
|
| 1294 |
msgstr "Optionen einfügen"
|
| 1295 |
|
| 1296 |
+
#: ../ui/edit.php:176
|
| 1297 |
msgid "No Default"
|
| 1298 |
msgstr "Kein Standard"
|
| 1299 |
|
| 1300 |
+
#: ../ui/edit.php:177
|
| 1301 |
msgid "Show Values"
|
| 1302 |
msgstr "Werte anzeigen"
|
| 1303 |
|
| 1304 |
+
#: ../ui/edit.php:181
|
| 1305 |
msgid "Label"
|
| 1306 |
msgstr "Label"
|
| 1307 |
|
| 1308 |
+
#: ../ui/edit.php:342
|
| 1309 |
msgid "Elements"
|
| 1310 |
msgstr "Elemente"
|
| 1311 |
|
| 1312 |
+
#: ../ui/edit.php:354
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1313 |
msgid "Element Type"
|
| 1314 |
msgstr "Elementtyp"
|
| 1315 |
|
| 1316 |
+
#: ../ui/edit.php:379
|
| 1317 |
msgid "Hide Label"
|
| 1318 |
msgstr "Label verstecken"
|
| 1319 |
|
| 1320 |
+
#: ../ui/edit.php:386
|
| 1321 |
#, fuzzy
|
| 1322 |
msgid "Slug"
|
| 1323 |
msgstr "Titelform"
|
| 1324 |
|
| 1325 |
+
#: ../ui/edit.php:392
|
| 1326 |
+
msgid "Condition"
|
| 1327 |
+
msgstr ""
|
| 1328 |
+
|
| 1329 |
+
#: ../ui/edit.php:397
|
| 1330 |
+
msgid "Disable"
|
| 1331 |
+
msgstr "Deaktivieren"
|
| 1332 |
+
|
| 1333 |
+
#: ../ui/edit.php:403
|
| 1334 |
msgid "Required"
|
| 1335 |
msgstr "Pflichtfeld"
|
| 1336 |
|
| 1337 |
+
#: ../ui/edit.php:417
|
| 1338 |
msgid "Show in Entry List"
|
| 1339 |
msgstr "In der Eingabeliste zeigen"
|
| 1340 |
|
| 1341 |
+
#: ../ui/edit.php:427
|
| 1342 |
msgid ""
|
| 1343 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1344 |
msgstr "Sind Sie sicher, dass dieses Feld entfernt werden soll?"
|
| 1345 |
|
| 1346 |
+
#: ../ui/edit.php:427
|
| 1347 |
msgid "Delete Element"
|
| 1348 |
msgstr "Element löschen"
|
| 1349 |
|
| 1350 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1351 |
msgid "General Settings"
|
| 1352 |
msgstr "Grundeinstellungen"
|
| 1353 |
|
| 1354 |
+
#: ../ui/edit.php:498
|
| 1355 |
msgid "Updated Successfully"
|
| 1356 |
msgstr ""
|
| 1357 |
|
| 1358 |
+
#: ../ui/edit.php:500
|
| 1359 |
msgid "Update Form"
|
| 1360 |
msgstr "Änderungen speichern"
|
| 1361 |
|
| 1362 |
+
#: ../ui/edit.php:501
|
| 1363 |
msgid "Preview Form"
|
| 1364 |
msgstr "Vorschau des Formulars"
|
| 1365 |
|
| 1366 |
+
#: ../ui/edit.php:514
|
| 1367 |
msgid "Form Description"
|
| 1368 |
msgstr "Beschreibung des Formulars"
|
| 1369 |
|
| 1370 |
+
#: ../ui/edit.php:521
|
| 1371 |
#, fuzzy
|
| 1372 |
msgid "State"
|
| 1373 |
msgstr "Statisch"
|
| 1374 |
|
| 1375 |
+
#: ../ui/edit.php:523
|
| 1376 |
msgid "Deactivate / Draft"
|
| 1377 |
msgstr ""
|
| 1378 |
|
| 1379 |
+
#: ../ui/edit.php:528
|
| 1380 |
msgid "Capture Entries"
|
| 1381 |
msgstr "Einträge sichern"
|
| 1382 |
|
| 1383 |
+
#: ../ui/edit.php:536
|
| 1384 |
msgid "Pin to Menu"
|
| 1385 |
msgstr "An das Menü anhängen"
|
| 1386 |
|
| 1387 |
+
#: ../ui/edit.php:545
|
| 1388 |
msgid "View Entries"
|
| 1389 |
msgstr "Einträge anzeigen"
|
| 1390 |
|
| 1391 |
+
#: ../ui/edit.php:547
|
| 1392 |
msgid "All"
|
| 1393 |
msgstr "Alle"
|
| 1394 |
|
| 1395 |
+
#: ../ui/edit.php:569
|
| 1396 |
msgid "Hide Form"
|
| 1397 |
msgstr "Formular ausblenden"
|
| 1398 |
|
| 1399 |
+
#: ../ui/edit.php:571
|
| 1400 |
msgid "Hide form after successful submission"
|
| 1401 |
msgstr "Formular nach dem erfolgreichen Abschicken ausblenden"
|
| 1402 |
|
| 1403 |
+
#: ../ui/edit.php:576
|
| 1404 |
msgid "Honeypot"
|
| 1405 |
msgstr "Honigtopf"
|
| 1406 |
|
| 1407 |
+
#: ../ui/edit.php:578
|
| 1408 |
msgid "Place an invisible field to trick spambots"
|
| 1409 |
msgstr "Fügen Sie ein unsichtbares Feld ein, um damit SPAM-Bots auszutricksen"
|
| 1410 |
|
| 1411 |
+
#: ../ui/edit.php:583
|
| 1412 |
msgid "Success Message"
|
| 1413 |
msgstr "Erfolgsmeldung"
|
| 1414 |
|
| 1415 |
+
#: ../ui/edit.php:589
|
| 1416 |
msgid "Gravatar Field"
|
| 1417 |
msgstr "Gravatar Feld"
|
| 1418 |
|
| 1419 |
+
#: ../ui/edit.php:596
|
| 1420 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1421 |
msgstr ""
|
| 1422 |
"Genutzt, wenn ein Eintrag eines nicht-angemeldeten Benutzers gezeigt wird"
|
| 1423 |
|
| 1424 |
+
#: ../ui/edit.php:670
|
| 1425 |
msgid "Add New"
|
| 1426 |
msgstr "Neu hinzufügen"
|
| 1427 |
|
| 1428 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1429 |
msgid "Remove"
|
| 1430 |
msgstr "Entfernen"
|
| 1431 |
|
| 1432 |
+
#: ../ui/edit.php:825
|
| 1433 |
msgid "Set Element"
|
| 1434 |
msgstr "Element setzen"
|
| 1435 |
|
| 1436 |
+
#: ../ui/edit.php:828
|
| 1437 |
msgid "No description given"
|
| 1438 |
msgstr "Keine Beschreibung"
|
| 1439 |
|
| 1440 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1441 |
msgid "or"
|
| 1442 |
msgstr "oder"
|
| 1443 |
|
| 1444 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1445 |
msgid "is"
|
| 1446 |
msgstr "ist"
|
| 1447 |
|
| 1448 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1449 |
msgid "is not"
|
| 1450 |
msgstr "ist nicht"
|
| 1451 |
|
| 1452 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1453 |
msgid "is greater than"
|
| 1454 |
msgstr "ist größer als"
|
| 1455 |
|
| 1456 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1457 |
msgid "is less than"
|
| 1458 |
msgstr "ist kleiner als"
|
| 1459 |
|
| 1460 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1461 |
msgid "starts with"
|
| 1462 |
msgstr "startet mit"
|
| 1463 |
|
| 1464 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1465 |
msgid "ends with"
|
| 1466 |
msgstr "endet mit"
|
| 1467 |
|
| 1468 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1469 |
msgid "contains"
|
| 1470 |
msgstr "beinhaltet"
|
| 1471 |
|
| 1472 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1473 |
msgid "Select field first"
|
| 1474 |
msgstr "Wählen Sie zuerst ein Feld"
|
| 1475 |
|
| 1476 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1477 |
+
#: ../ui/panels/conditions.php:129
|
| 1478 |
msgid "Add Condition"
|
| 1479 |
msgstr "Bedingung hinzufügen"
|
| 1480 |
|
| 1481 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1482 |
msgid "and"
|
| 1483 |
msgstr "und"
|
| 1484 |
|
| 1505 |
msgstr "Einträge"
|
| 1506 |
|
| 1507 |
#: ../ui/extend.php:23
|
| 1508 |
+
msgid ""
|
| 1509 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1510 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1511 |
+
"Forms."
|
| 1512 |
+
msgstr ""
|
| 1513 |
+
|
| 1514 |
+
#: ../ui/extend.php:29
|
| 1515 |
msgid "No licensed addons installed."
|
| 1516 |
msgstr "keine lizensierten Erweiterungen (Addons) installiert"
|
| 1517 |
|
| 1518 |
+
#: ../ui/extend.php:54
|
| 1519 |
msgid "Already Installed"
|
| 1520 |
msgstr "Bereits installiert"
|
| 1521 |
|
| 1539 |
msgid "Unable to connect or no extensions available."
|
| 1540 |
msgstr "Keine Verbindung oder keine Erweiterungen verfügbar"
|
| 1541 |
|
| 1542 |
+
#: ../ui/panels/conditions.php:65
|
| 1543 |
+
msgid "Show"
|
| 1544 |
+
msgstr "Anzeigen"
|
| 1545 |
+
|
| 1546 |
+
#: ../ui/panels/conditions.php:66
|
| 1547 |
+
msgid "Hide"
|
| 1548 |
+
msgstr "Verstecken"
|
| 1549 |
+
|
| 1550 |
+
#: ../ui/panels/conditions.php:69
|
| 1551 |
+
msgid "Add Conditional Line"
|
| 1552 |
+
msgstr ""
|
| 1553 |
+
|
| 1554 |
+
#: ../ui/panels/conditions.php:83
|
| 1555 |
+
msgid "if"
|
| 1556 |
+
msgstr ""
|
| 1557 |
+
|
| 1558 |
+
#: ../ui/panels/conditions.php:133
|
| 1559 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1560 |
+
msgstr ""
|
| 1561 |
+
|
| 1562 |
+
#: ../ui/panels/conditions.php:133
|
| 1563 |
+
msgid "Remove Condition"
|
| 1564 |
+
msgstr ""
|
| 1565 |
+
|
| 1566 |
+
#: ../ui/panels/conditions.php:137
|
| 1567 |
+
msgid "Applied Fields"
|
| 1568 |
+
msgstr ""
|
| 1569 |
+
|
| 1570 |
+
#: ../ui/panels/conditions.php:138
|
| 1571 |
+
msgid "Select the fields to apply this condition to."
|
| 1572 |
+
msgstr ""
|
| 1573 |
+
|
| 1574 |
#: ../ui/panels/emailer.php:36
|
| 1575 |
msgid "Enabled"
|
| 1576 |
msgstr "aktiv"
|
| 1613 |
msgid "Recipients"
|
| 1614 |
msgstr "Empfänger"
|
| 1615 |
|
| 1616 |
+
#: ../ui/panels/emailer.php:84
|
| 1617 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1618 |
+
msgstr ""
|
| 1619 |
|
| 1620 |
#: ../ui/panels/emailer.php:89
|
| 1621 |
msgid "BCC"
|
| 1622 |
msgstr ""
|
| 1623 |
|
| 1624 |
+
#: ../ui/panels/emailer.php:92
|
| 1625 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1626 |
+
msgstr ""
|
| 1627 |
+
|
| 1628 |
#: ../ui/panels/emailer.php:100
|
| 1629 |
msgid "Use %field_slug% to use a value from the form"
|
| 1630 |
msgstr "Nutzen Sie %field_slug% um den Wert im Formular zu nutzen"
|
| 1661 |
"tracking."
|
| 1662 |
msgstr ""
|
| 1663 |
|
| 1664 |
+
#: ../ui/panels/emailer.php:118
|
| 1665 |
+
msgid "Learn more here"
|
| 1666 |
+
msgstr ""
|
| 1667 |
+
|
| 1668 |
+
#: ../ui/panels/emailer.php:130
|
| 1669 |
msgid ""
|
| 1670 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1671 |
"the form submittable."
|
| 1678 |
msgstr "Sie entfernen alle Felder dieser Reihe. Sind Sie sicher?"
|
| 1679 |
|
| 1680 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1681 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1682 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1683 |
msgid "Page"
|
| 1684 |
msgstr "Seite"
|
| 1685 |
|
| 1686 |
+
#: ../ui/panels/layout_toolbar.php:11
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1687 |
msgid "Add Page"
|
| 1688 |
msgstr "Seite hinzufügen"
|
| 1689 |
|
| 1690 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1691 |
msgid "Drag onto the form grid below"
|
| 1692 |
msgstr "Auf das Formularraster unten ziehen"
|
| 1693 |
|
| 1694 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1695 |
msgid "Add Element"
|
| 1696 |
msgstr "Element hinzufügen"
|
| 1697 |
|
| 1734 |
msgid "Don't Use"
|
| 1735 |
msgstr "Nicht nutzen"
|
| 1736 |
|
| 1737 |
+
#: ../ui/panels/processors.php:126
|
| 1738 |
+
#, fuzzy
|
| 1739 |
+
msgid "Add Conditional Group"
|
| 1740 |
+
msgstr "Operator Gruppe hinzufügen"
|
| 1741 |
+
|
| 1742 |
#: ../ui/panels/processors.php:171
|
| 1743 |
msgid "Add Processor"
|
| 1744 |
msgstr "Prozessor hinzufügen"
|
| 1780 |
msgid "Entry List"
|
| 1781 |
msgstr "In der Eingabeliste zeigen"
|
| 1782 |
|
| 1783 |
+
#~ msgid "Settings"
|
| 1784 |
+
#~ msgstr "Einstellungen"
|
| 1785 |
+
|
| 1786 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1787 |
+
#~ msgstr "Komma-separierte Liste der Email-Adressen"
|
| 1788 |
+
|
| 1789 |
+
#~ msgid "Add Row"
|
| 1790 |
+
#~ msgstr "Zeile hinzufügen"
|
| 1791 |
+
|
| 1792 |
#, fuzzy
|
| 1793 |
#~ msgid ""
|
| 1794 |
#~ "Comma separated list of email addresses. Use %field_slug% to use a value "
|
languages/caldera-forms-es_ES.mo
CHANGED
|
Binary file
|
languages/caldera-forms-es_ES.po
CHANGED
|
@@ -1,165 +1,195 @@
|
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
-
"POT-Creation-Date: 2015-
|
| 5 |
-
"PO-Revision-Date: 2015-
|
| 6 |
"Last-Translator: \n"
|
| 7 |
"Language-Team: Notecopies <hola@notecopies.es>\n"
|
|
|
|
| 8 |
"MIME-Version: 1.0\n"
|
| 9 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
-
"X-Generator: Poedit 1.8.
|
| 12 |
"X-Poedit-Basepath: .\n"
|
| 13 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 14 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
-
"Language: es_ES\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
-
#: ../classes/
|
|
|
|
|
|
|
|
|
|
|
|
|
| 20 |
msgid "Invalid Form."
|
| 21 |
msgstr "Formulario Incorrecto"
|
| 22 |
|
| 23 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 24 |
#: ../ui/entries_toolbar.php:27
|
| 25 |
msgid "Trash"
|
| 26 |
msgstr "Papelera"
|
| 27 |
|
| 28 |
-
#: ../classes/admin.php:
|
| 29 |
#: ../ui/admin_templates.php:9
|
| 30 |
msgid "Restore"
|
| 31 |
msgstr "Restaurar"
|
| 32 |
|
| 33 |
-
#: ../classes/admin.php:
|
| 34 |
msgid "Entry"
|
| 35 |
msgstr "Entrada"
|
| 36 |
|
| 37 |
-
#: ../classes/admin.php:
|
| 38 |
msgid "View"
|
| 39 |
msgstr "Vista"
|
| 40 |
|
| 41 |
-
#: ../classes/admin.php:
|
| 42 |
msgid "Add Form to Page"
|
| 43 |
msgstr "Añadir Formulario a Página"
|
| 44 |
|
| 45 |
-
#: ../classes/admin.php:
|
| 46 |
msgid "Insert Form Shortcode"
|
| 47 |
msgstr "Insertar Desde Shortcode"
|
| 48 |
|
| 49 |
-
#: ../classes/admin.php:
|
| 50 |
msgid "Caldera Form"
|
| 51 |
msgstr "Formulario Caldera"
|
| 52 |
|
| 53 |
-
#: ../classes/admin.php:
|
| 54 |
msgid "Deactivate"
|
| 55 |
msgstr "Desactivar"
|
| 56 |
|
| 57 |
-
#: ../classes/admin.php:
|
| 58 |
msgid "Activate"
|
| 59 |
msgstr "Activar"
|
| 60 |
|
| 61 |
-
#: ../classes/admin.php:
|
| 62 |
-
#: ../classes/admin.php:
|
| 63 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 64 |
-
#: ../ui/community.php:5 ../ui/edit.php:
|
| 65 |
msgid "Caldera Forms"
|
| 66 |
msgstr "Caldera Forms"
|
| 67 |
|
| 68 |
-
#: ../classes/admin.php:
|
| 69 |
msgid "Caldera Forms Admin"
|
| 70 |
msgstr "Administrar Caldera Forms"
|
| 71 |
|
| 72 |
-
#: ../classes/admin.php:
|
| 73 |
msgid "Forms"
|
| 74 |
msgstr "Formularios"
|
| 75 |
|
| 76 |
-
#: ../classes/admin.php:
|
| 77 |
msgid "Community"
|
| 78 |
msgstr "Comunidad"
|
| 79 |
|
| 80 |
-
#: ../classes/admin.php:
|
| 81 |
msgid "Extend"
|
| 82 |
msgstr "Mejoras"
|
| 83 |
|
| 84 |
-
#: ../classes/admin.php:
|
| 85 |
msgid "Sorry, please try again"
|
| 86 |
msgstr "Lo sentimos, inténtalo de nuevo por favor"
|
| 87 |
|
| 88 |
-
#: ../classes/admin.php:
|
| 89 |
msgid "Form Delete Error"
|
| 90 |
msgstr "Error al eliminar"
|
| 91 |
|
| 92 |
-
#: ../classes/admin.php:
|
| 93 |
msgid "Sorry, File is not valid."
|
| 94 |
msgstr "Lo sentimos, archivo no válido"
|
| 95 |
|
| 96 |
-
#: ../classes/admin.php:
|
| 97 |
-
#: ../classes/admin.php:
|
| 98 |
msgid "Form Import Error"
|
| 99 |
msgstr "Error al importar"
|
| 100 |
|
| 101 |
-
#: ../classes/admin.php:
|
| 102 |
msgid "Sorry, File not uploaded."
|
| 103 |
msgstr "Lo sentimos, el archivo no se ha subido"
|
| 104 |
|
| 105 |
-
#: ../classes/admin.php:
|
| 106 |
msgid "Form does not exist."
|
| 107 |
msgstr "El formulario no existe"
|
| 108 |
|
| 109 |
-
#: ../classes/admin.php:
|
| 110 |
msgid "Export selection has expired"
|
| 111 |
msgstr "La exportación ha caducado"
|
| 112 |
|
| 113 |
-
#: ../classes/admin.php:
|
| 114 |
msgid "Export Expired"
|
| 115 |
msgstr "Exportación caducada"
|
| 116 |
|
| 117 |
-
#: ../classes/admin.php:
|
| 118 |
msgid "Form has been successfully submitted. Thank you."
|
| 119 |
msgstr "El formulario ha sido correctamente enviado. Gracias."
|
| 120 |
|
| 121 |
-
#: ../classes/admin.php:
|
| 122 |
msgid "Layout"
|
| 123 |
msgstr "Diseño"
|
| 124 |
|
| 125 |
-
#: ../classes/admin.php:
|
| 126 |
msgid "Layout Builder"
|
| 127 |
msgstr "Diseñador"
|
| 128 |
|
| 129 |
-
#: ../classes/admin.php:
|
| 130 |
msgid "Pages"
|
| 131 |
msgstr "Páginas"
|
| 132 |
|
| 133 |
-
#: ../classes/admin.php:
|
| 134 |
msgid "Form Pages"
|
| 135 |
msgstr "Páginas de formulario"
|
| 136 |
|
| 137 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 138 |
msgid "Processors"
|
| 139 |
msgstr "Procesadores"
|
| 140 |
|
| 141 |
-
#: ../classes/admin.php:
|
| 142 |
msgid "Form Processors"
|
| 143 |
msgstr "Procesadores de formulario"
|
| 144 |
|
| 145 |
-
#: ../classes/admin.php:
|
| 146 |
#: ../ui/panels/variables.php:83
|
| 147 |
msgid "Variables"
|
| 148 |
msgstr "Variables"
|
| 149 |
|
| 150 |
-
#: ../classes/admin.php:
|
| 151 |
msgid "Responsive"
|
| 152 |
msgstr "Adaptabilidad"
|
| 153 |
|
| 154 |
-
#: ../classes/admin.php:
|
| 155 |
msgid "Resposive Settings"
|
| 156 |
msgstr "Opciones de adaptabilidad"
|
| 157 |
|
| 158 |
-
#: ../classes/admin.php:
|
| 159 |
msgid "Grid Collapse"
|
| 160 |
msgstr "División modular"
|
| 161 |
|
| 162 |
-
#: ../classes/admin.php:
|
| 163 |
msgid ""
|
| 164 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 165 |
"Bootstrap 3.0)"
|
|
@@ -167,265 +197,271 @@ msgstr ""
|
|
| 167 |
"Pon el tamaño de pantalla mínimo necesario para que la estructura modular "
|
| 168 |
"del diseño se divida y se adapte. (basado en Bootstrap 3.0)"
|
| 169 |
|
| 170 |
-
#: ../classes/admin.php:
|
| 171 |
msgid "Maintain grid always"
|
| 172 |
msgstr "Mantener la estructura siempre"
|
| 173 |
|
| 174 |
-
#: ../classes/admin.php:
|
| 175 |
msgid "Mailer"
|
| 176 |
msgstr "Envío"
|
| 177 |
|
| 178 |
-
#: ../classes/admin.php:
|
| 179 |
msgid "Email Notification Settings"
|
| 180 |
msgstr "Opciones de notificación"
|
| 181 |
|
| 182 |
-
#: ../classes/core.php:
|
| 183 |
msgid "The wasn't entered correct."
|
| 184 |
msgstr "Eso no se ha introducido correctamente."
|
| 185 |
|
| 186 |
-
#: ../classes/core.php:
|
| 187 |
msgid "Reset"
|
| 188 |
msgstr "Restaurar valores"
|
| 189 |
|
| 190 |
-
#: ../classes/core.php:
|
| 191 |
msgid "Permission denied."
|
| 192 |
msgstr "Permiso denegado."
|
| 193 |
|
| 194 |
-
#: ../classes/core.php:
|
| 195 |
-
msgid "Caldera Forms Notification"
|
| 196 |
-
msgstr "Notificación Caldera Forms"
|
| 197 |
-
|
| 198 |
-
#: ../classes/core.php:973
|
| 199 |
msgid "Auto Responder"
|
| 200 |
msgstr "Auto-respuesta"
|
| 201 |
|
| 202 |
-
#: ../classes/core.php:
|
| 203 |
msgid "Sends out an auto response e-mail"
|
| 204 |
msgstr "Envía un mensaje de auto-respuesta"
|
| 205 |
|
| 206 |
-
#: ../classes/core.php:
|
| 207 |
msgid "Thank you for contacting us"
|
| 208 |
msgstr "Gracias por contactar con nosotros"
|
| 209 |
|
| 210 |
-
#: ../classes/core.php:
|
| 211 |
msgid "Redirect"
|
| 212 |
msgstr "Redireccionar"
|
| 213 |
|
| 214 |
-
#: ../classes/core.php:
|
| 215 |
msgid "Redirects user to URL on successful submit"
|
| 216 |
msgstr "Redirecciona a una URL tras un envio con éxito"
|
| 217 |
|
| 218 |
-
#: ../classes/core.php:
|
| 219 |
msgid "Increment Value"
|
| 220 |
msgstr "Incrementar valor"
|
| 221 |
|
| 222 |
-
#: ../classes/core.php:
|
| 223 |
msgid "Increment a value per entry."
|
| 224 |
msgstr "Incrementar valor por entrada"
|
| 225 |
|
| 226 |
-
#: ../classes/core.php:
|
| 227 |
msgid "Akismet"
|
| 228 |
msgstr "Akismet"
|
| 229 |
|
| 230 |
-
#: ../classes/core.php:
|
| 231 |
msgid "Anti-spam filtering"
|
| 232 |
msgstr "Filtro anti-spam"
|
| 233 |
|
| 234 |
-
#: ../classes/core.php:
|
| 235 |
msgid "Akismet not setup."
|
| 236 |
msgstr "Akismet no está configurado"
|
| 237 |
|
| 238 |
-
#: ../classes/core.php:
|
| 239 |
msgid "Calculation"
|
| 240 |
msgstr "Operaciones"
|
| 241 |
|
| 242 |
-
#: ../classes/core.php:
|
| 243 |
-
#: ../classes/core.php:
|
| 244 |
msgid "Special"
|
| 245 |
msgstr "Especial"
|
| 246 |
|
| 247 |
-
#: ../classes/core.php:
|
| 248 |
msgid "Math"
|
| 249 |
msgstr "Cálculo"
|
| 250 |
|
| 251 |
-
#: ../classes/core.php:
|
| 252 |
msgid "Calculate values"
|
| 253 |
msgstr "Calcular valores"
|
| 254 |
|
| 255 |
-
#: ../classes/core.php:
|
| 256 |
msgid "Total"
|
| 257 |
msgstr "Total"
|
| 258 |
|
| 259 |
-
#: ../classes/core.php:
|
| 260 |
msgid "Range Slider"
|
| 261 |
msgstr "Rango deslizable"
|
| 262 |
|
| 263 |
-
#: ../classes/core.php:
|
| 264 |
msgid "Range Slider input field"
|
| 265 |
msgstr "Campo de rango deslizable"
|
| 266 |
|
| 267 |
-
#: ../classes/core.php:
|
| 268 |
msgid "Star Rating"
|
| 269 |
msgstr "Valoración con estrellas"
|
| 270 |
|
| 271 |
-
#: ../classes/core.php:
|
| 272 |
msgid "Feedback"
|
| 273 |
msgstr "Reacciones"
|
| 274 |
|
| 275 |
-
#: ../classes/core.php:
|
| 276 |
msgid "Star rating input for feedback"
|
| 277 |
msgstr "Campo de valoración para recoger opiniones"
|
| 278 |
|
| 279 |
-
#: ../classes/core.php:
|
| 280 |
msgid "Phone Number"
|
| 281 |
msgstr "Número de teléfono"
|
| 282 |
|
| 283 |
-
#: ../classes/core.php:
|
| 284 |
msgid "Phone number with masking"
|
| 285 |
msgstr "Número de teléfono con máscara"
|
| 286 |
|
| 287 |
-
#: ../classes/core.php:
|
| 288 |
-
#: ../classes/core.php:
|
| 289 |
-
#: ../classes/core.php:
|
| 290 |
msgid "Text Fields"
|
| 291 |
msgstr "Campos de texto"
|
| 292 |
|
| 293 |
-
#: ../classes/core.php:
|
| 294 |
-
#: ../classes/core.php:1353 ../classes/core.php:1369 ../classes/core.php:1390
|
| 295 |
-
#: ../classes/core.php:1400 ../classes/core.php:1441 ../classes/core.php:1460
|
| 296 |
-
#: ../classes/core.php:1479 ../classes/core.php:1552 ../ui/edit.php:170
|
| 297 |
-
msgid "Basic"
|
| 298 |
-
msgstr "Básico"
|
| 299 |
-
|
| 300 |
-
#: ../classes/core.php:1262
|
| 301 |
msgid "User"
|
| 302 |
msgstr "Usuario"
|
| 303 |
|
| 304 |
-
#: ../classes/core.php:
|
| 305 |
msgid "Single Line Text"
|
| 306 |
msgstr "Campo de texto"
|
| 307 |
|
| 308 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 309 |
msgid "File"
|
| 310 |
msgstr "Fichero"
|
| 311 |
|
| 312 |
-
#: ../classes/core.php:
|
| 313 |
msgid "File Uploader"
|
| 314 |
msgstr "Cargador de archivos"
|
| 315 |
|
| 316 |
-
#: ../classes/core.php:
|
| 317 |
msgid "reCAPTCHA"
|
| 318 |
msgstr "reCAPTCHA"
|
| 319 |
|
| 320 |
-
#: ../classes/core.php:
|
| 321 |
msgid "reCAPTCHA anti-spam field"
|
| 322 |
msgstr "Campo anti-spam reCAPTCHA"
|
| 323 |
|
| 324 |
-
#: ../classes/core.php:
|
| 325 |
msgid "HTML"
|
| 326 |
msgstr "HTML"
|
| 327 |
|
| 328 |
-
#: ../classes/core.php:
|
| 329 |
msgid "Add text/html content"
|
| 330 |
msgstr "Añadir contenido html/texto"
|
| 331 |
|
| 332 |
-
#: ../classes/core.php:
|
| 333 |
#: ../processors/akismet/config.php:20
|
| 334 |
msgid "Content"
|
| 335 |
msgstr "Contenido"
|
| 336 |
|
| 337 |
-
#: ../classes/core.php:
|
| 338 |
msgid "Hidden"
|
| 339 |
msgstr "Oculto"
|
| 340 |
|
| 341 |
-
#: ../classes/core.php:
|
| 342 |
msgid "Button"
|
| 343 |
msgstr "Botón"
|
| 344 |
|
| 345 |
-
#: ../classes/core.php:
|
| 346 |
msgid "Button, Submit and Reset types"
|
| 347 |
msgstr "Tipos botón, enviar y reestablecer"
|
| 348 |
|
| 349 |
-
#: ../classes/core.php:
|
| 350 |
msgid "Buttons"
|
| 351 |
msgstr "Botones"
|
| 352 |
|
| 353 |
-
#: ../classes/core.php:
|
| 354 |
msgid "Email Address"
|
| 355 |
msgstr "Dirección email"
|
| 356 |
|
| 357 |
-
#: ../classes/core.php:
|
| 358 |
msgid "Paragraph Textarea"
|
| 359 |
msgstr "Área de texto"
|
| 360 |
|
| 361 |
-
#: ../classes/core.php:
|
| 362 |
msgid "Toggle Switch"
|
| 363 |
msgstr "Pestañas seleccionables"
|
| 364 |
|
| 365 |
-
#: ../classes/core.php:
|
| 366 |
-
#: ../classes/core.php:
|
| 367 |
msgid "Select Options"
|
| 368 |
msgstr "Opciones desplegables"
|
| 369 |
|
| 370 |
-
#: ../classes/core.php:
|
| 371 |
msgid "Dropdown Select"
|
| 372 |
msgstr "Lista desplegable"
|
| 373 |
|
| 374 |
-
#: ../classes/core.php:
|
| 375 |
msgid "Checkbox"
|
| 376 |
msgstr "Casillas seleccionables"
|
| 377 |
|
| 378 |
-
#: ../classes/core.php:
|
| 379 |
msgid "Radio"
|
| 380 |
msgstr "Lista de opciones"
|
| 381 |
|
| 382 |
-
#: ../classes/core.php:
|
| 383 |
msgid "Date Picker"
|
| 384 |
msgstr "Selección de fecha"
|
| 385 |
|
| 386 |
-
#: ../classes/core.php:
|
| 387 |
msgid "Pickers"
|
| 388 |
msgstr "Selectores"
|
| 389 |
|
| 390 |
-
#: ../classes/core.php:
|
| 391 |
msgid "Color Picker"
|
| 392 |
msgstr "Selección de color"
|
| 393 |
|
| 394 |
-
#: ../classes/core.php:
|
| 395 |
msgid "State/ Province Select"
|
| 396 |
msgstr "Lista de Estados/Provincias"
|
| 397 |
|
| 398 |
-
#: ../classes/core.php:
|
| 399 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 400 |
msgstr "Lista desplegable para los estados de EEUU y las provincias de Canadá"
|
| 401 |
|
| 402 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 403 |
msgid "System Tags"
|
| 404 |
msgstr "Etiquetas de sistema"
|
| 405 |
|
| 406 |
-
#: ../classes/core.php:
|
| 407 |
msgid "Mailer Debug"
|
| 408 |
msgstr "Depurador de correo"
|
| 409 |
|
| 410 |
-
#: ../classes/core.php:
|
| 411 |
msgid "Invalid form ID"
|
| 412 |
msgstr "ID de formulario inválida"
|
| 413 |
|
| 414 |
-
#: ../classes/core.php:
|
| 415 |
-
#: ../classes/core.php:
|
| 416 |
-
#: ../classes/core.php:
|
| 417 |
msgid "Permission denied or entry does not exist."
|
| 418 |
msgstr "Permiso denegado o la entrada no existe"
|
| 419 |
|
| 420 |
-
#: ../classes/core.php:
|
| 421 |
msgid "is required"
|
| 422 |
msgstr "es obligatorio"
|
| 423 |
|
| 424 |
-
#: ../classes/core.php:
|
| 425 |
msgid "Form is currently not active."
|
| 426 |
msgstr "El formulario no está activo actualmente."
|
| 427 |
|
| 428 |
-
#: ../classes/core.php:
|
| 429 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 430 |
msgstr ""
|
| 431 |
"AVISO: El formulario está en modo Depurador de correo. Desactívelo antes de "
|
|
@@ -435,7 +471,7 @@ msgstr ""
|
|
| 435 |
msgid "Title"
|
| 436 |
msgstr "Título"
|
| 437 |
|
| 438 |
-
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:
|
| 439 |
msgid "Form"
|
| 440 |
msgstr "Formulario"
|
| 441 |
|
|
@@ -558,16 +594,32 @@ msgid "The starting view of the date picker (month, year, decade)"
|
|
| 558 |
msgstr "La visualización inicial del selector de fecha (mes, año, década)"
|
| 559 |
|
| 560 |
#: ../fields/date_picker/setup.php:32
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 561 |
msgid "language"
|
| 562 |
msgstr "lenguaje"
|
| 563 |
|
| 564 |
-
#: ../fields/date_picker/setup.php:
|
| 565 |
msgid "Language to use. e.g. pt-BR"
|
| 566 |
msgstr "El lenguaje a utilizar. Ejemplo: es-ES"
|
| 567 |
|
| 568 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 569 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 570 |
-
#: ../fields/text/config.php:2
|
| 571 |
msgid "Placeholder"
|
| 572 |
msgstr "Texto interior"
|
| 573 |
|
|
@@ -576,10 +628,14 @@ msgid "Attach to mailer"
|
|
| 576 |
msgstr "Adjuntar al envío de correo"
|
| 577 |
|
| 578 |
#: ../fields/file/config_template.php:9
|
|
|
|
|
|
|
|
|
|
|
|
|
| 579 |
msgid "Allowed Types"
|
| 580 |
msgstr "Tipos permitidos"
|
| 581 |
|
| 582 |
-
#: ../fields/file/config_template.php:
|
| 583 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 584 |
msgstr "Separado por comas. Ejemplo: jpg,pdf,txt"
|
| 585 |
|
|
@@ -635,7 +691,7 @@ msgstr "Tamaño de Borde"
|
|
| 635 |
msgid "Border Radius"
|
| 636 |
msgstr "Bordes Redondeados"
|
| 637 |
|
| 638 |
-
#: ../fields/hidden/setup.php:2 ../ui/edit.php:
|
| 639 |
#: ../ui/panels/variables.php:12
|
| 640 |
msgid "Value"
|
| 641 |
msgstr "Valor"
|
|
@@ -668,7 +724,7 @@ msgstr "Usa el dígito 9 para indicar números"
|
|
| 668 |
msgid "Track"
|
| 669 |
msgstr "Rastro"
|
| 670 |
|
| 671 |
-
#: ../fields/range_slider/config.php:23
|
| 672 |
msgid "Highlight"
|
| 673 |
msgstr "Resaltado"
|
| 674 |
|
|
@@ -676,7 +732,7 @@ msgstr "Resaltado"
|
|
| 676 |
msgid "Handle"
|
| 677 |
msgstr "Manejo"
|
| 678 |
|
| 679 |
-
#: ../fields/range_slider/config.php:35
|
| 680 |
msgid "Border"
|
| 681 |
msgstr "Borde"
|
| 682 |
|
|
@@ -744,6 +800,14 @@ msgstr "No se ha añadido la clave secreta"
|
|
| 744 |
msgid "No Site Key Added"
|
| 745 |
msgstr "No se ha añadido clave del sistio"
|
| 746 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 747 |
#: ../fields/star-rate/config.php:2
|
| 748 |
msgid "Number of Stars"
|
| 749 |
msgstr "Número de estrellas"
|
|
@@ -860,8 +924,8 @@ msgstr "Clase Activa"
|
|
| 860 |
msgid "Inactive Class"
|
| 861 |
msgstr "Clase Inactiva"
|
| 862 |
|
| 863 |
-
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:
|
| 864 |
-
#: ../ui/edit.php:
|
| 865 |
msgid "Enable"
|
| 866 |
msgstr "Activar"
|
| 867 |
|
|
@@ -922,16 +986,16 @@ msgstr "Redirección"
|
|
| 922 |
msgid "Custom Class"
|
| 923 |
msgstr "Clase personalizada"
|
| 924 |
|
| 925 |
-
#: ../includes/field_processors.php:
|
| 926 |
msgid "File type not allowed. Allowed types are: "
|
| 927 |
msgstr "Tipo de archivo no permitido. Los archivos permitidos son:"
|
| 928 |
|
| 929 |
-
#: ../includes/field_processors.php:
|
| 930 |
msgid "File type needs to be"
|
| 931 |
msgstr "El tipo de archivo ha de ser"
|
| 932 |
|
| 933 |
-
#: ../processors/akismet/config.php:2 ../ui/edit.php:
|
| 934 |
-
#: ../ui/panels/variables.php:10
|
| 935 |
msgid "Name"
|
| 936 |
msgstr "Nombre"
|
| 937 |
|
|
@@ -976,6 +1040,11 @@ msgstr "Email destinatario"
|
|
| 976 |
msgid "Message"
|
| 977 |
msgstr "Mensaje"
|
| 978 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 979 |
#: ../processors/increment/config.php:2
|
| 980 |
msgid "Increment Start"
|
| 981 |
msgstr "Incremento de inicio"
|
|
@@ -1060,52 +1129,52 @@ msgstr ""
|
|
| 1060 |
msgid "Grid"
|
| 1061 |
msgstr "Bloques"
|
| 1062 |
|
| 1063 |
-
#: ../ui/admin.php:
|
| 1064 |
msgid "Entries"
|
| 1065 |
msgstr "Entradas"
|
| 1066 |
|
| 1067 |
-
#: ../ui/admin.php:
|
| 1068 |
#: ../ui/panels/emailer.php:35
|
| 1069 |
msgid "Disabled"
|
| 1070 |
msgstr "Desactivado"
|
| 1071 |
|
| 1072 |
-
#: ../ui/admin.php:
|
| 1073 |
msgid "Mailer Debug enabled."
|
| 1074 |
msgstr "Depuración de correo activada."
|
| 1075 |
|
| 1076 |
-
#: ../ui/admin.php:
|
| 1077 |
msgid "Edit"
|
| 1078 |
msgstr "Editar"
|
| 1079 |
|
| 1080 |
-
#: ../ui/admin.php:
|
| 1081 |
msgid "Export"
|
| 1082 |
msgstr "Exportar"
|
| 1083 |
|
| 1084 |
-
#: ../ui/admin.php:
|
| 1085 |
msgid "Clone Form"
|
| 1086 |
msgstr "Clonar Formulario"
|
| 1087 |
|
| 1088 |
-
#: ../ui/admin.php:
|
| 1089 |
msgid "Clone"
|
| 1090 |
msgstr "Clonar"
|
| 1091 |
|
| 1092 |
-
#: ../ui/admin.php:
|
| 1093 |
msgid "This will delete this form permanently. Continue?"
|
| 1094 |
msgstr "Esta acción eliminará el formulario definitivamente. ¿Continuar?"
|
| 1095 |
|
| 1096 |
-
#: ../ui/admin.php:
|
| 1097 |
msgid "Delete"
|
| 1098 |
msgstr "Eliminar"
|
| 1099 |
|
| 1100 |
-
#: ../ui/admin.php:
|
| 1101 |
msgid "You don't have any forms."
|
| 1102 |
msgstr "No hay ningún formulario."
|
| 1103 |
|
| 1104 |
-
#: ../ui/admin.php:
|
| 1105 |
msgid "An form name is required"
|
| 1106 |
msgstr "Es necesario un nombre para el formulario"
|
| 1107 |
|
| 1108 |
-
#: ../ui/admin.php:
|
| 1109 |
msgid ""
|
| 1110 |
"Looks like something is not working. Please try again a little later or post "
|
| 1111 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
|
@@ -1131,8 +1200,7 @@ msgstr "Mover a papelera"
|
|
| 1131 |
msgid "Delete Permanently"
|
| 1132 |
msgstr "Borrar permanentemente"
|
| 1133 |
|
| 1134 |
-
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48
|
| 1135 |
-
#: ../ui/edit.php:468
|
| 1136 |
msgid "Form Name"
|
| 1137 |
msgstr "Nombre de Formulario"
|
| 1138 |
|
|
@@ -1140,11 +1208,11 @@ msgstr "Nombre de Formulario"
|
|
| 1140 |
msgid "Form File"
|
| 1141 |
msgstr "Fichero de Formulario"
|
| 1142 |
|
| 1143 |
-
#: ../ui/admin_templates.php:54 ../ui/edit.php:
|
| 1144 |
msgid "Description"
|
| 1145 |
msgstr "Descripción"
|
| 1146 |
|
| 1147 |
-
#: ../ui/admin_templates.php:72 ../ui/edit.php:
|
| 1148 |
msgid "ID"
|
| 1149 |
msgstr "ID"
|
| 1150 |
|
|
@@ -1164,242 +1232,227 @@ msgstr "No hay entradas aún."
|
|
| 1164 |
msgid "Form has successfully been submitted. Thank you."
|
| 1165 |
msgstr "El formulario ha sido correctamente enviado. Gracias."
|
| 1166 |
|
| 1167 |
-
#: ../ui/edit.php:
|
| 1168 |
msgid "Auto Populate"
|
| 1169 |
msgstr "Auto-rellenar."
|
| 1170 |
|
| 1171 |
-
#: ../ui/edit.php:
|
| 1172 |
msgid "Auto Type"
|
| 1173 |
msgstr "Auto-introducir."
|
| 1174 |
|
| 1175 |
-
#: ../ui/edit.php:
|
| 1176 |
msgid "Select a source"
|
| 1177 |
msgstr "Selecciona una fuente"
|
| 1178 |
|
| 1179 |
-
#: ../ui/edit.php:
|
| 1180 |
msgid "Post Type"
|
| 1181 |
msgstr "Tipo de Post"
|
| 1182 |
|
| 1183 |
-
#: ../ui/edit.php:
|
| 1184 |
msgid "Taxonomy"
|
| 1185 |
msgstr "Clasificación"
|
| 1186 |
|
| 1187 |
-
#: ../ui/edit.php:
|
| 1188 |
msgid "Add Option"
|
| 1189 |
msgstr "Añadir Opción"
|
| 1190 |
|
| 1191 |
-
#: ../ui/edit.php:
|
| 1192 |
msgid "Bulk Insert"
|
| 1193 |
msgstr "Insetar en lote"
|
| 1194 |
|
| 1195 |
-
#: ../ui/edit.php:
|
| 1196 |
msgid "Single option per line. These replace the current list."
|
| 1197 |
msgstr "Una sola opción por línea. Esto reemplazará la lista actual."
|
| 1198 |
|
| 1199 |
-
#: ../ui/edit.php:
|
| 1200 |
msgid "Insert Options"
|
| 1201 |
msgstr "Opciónes de inserción"
|
| 1202 |
|
| 1203 |
-
#: ../ui/edit.php:
|
| 1204 |
msgid "No Default"
|
| 1205 |
msgstr "No (Predeterminado)"
|
| 1206 |
|
| 1207 |
-
#: ../ui/edit.php:
|
| 1208 |
msgid "Show Values"
|
| 1209 |
msgstr "Mostrar valores"
|
| 1210 |
|
| 1211 |
-
#: ../ui/edit.php:
|
| 1212 |
msgid "Label"
|
| 1213 |
msgstr "Etiqueta"
|
| 1214 |
|
| 1215 |
-
#: ../ui/edit.php:
|
| 1216 |
msgid "Elements"
|
| 1217 |
msgstr "Elementos"
|
| 1218 |
|
| 1219 |
-
#: ../ui/edit.php:
|
| 1220 |
-
msgid "Settings"
|
| 1221 |
-
msgstr "Configuración"
|
| 1222 |
-
|
| 1223 |
-
#: ../ui/edit.php:306
|
| 1224 |
-
msgid "Conditions"
|
| 1225 |
-
msgstr "Condicionales"
|
| 1226 |
-
|
| 1227 |
-
#: ../ui/edit.php:313
|
| 1228 |
msgid "Element Type"
|
| 1229 |
msgstr "Tipo de elemento"
|
| 1230 |
|
| 1231 |
-
#: ../ui/edit.php:
|
| 1232 |
msgid "Hide Label"
|
| 1233 |
msgstr "Ocultar etiqueta"
|
| 1234 |
|
| 1235 |
-
#: ../ui/edit.php:
|
| 1236 |
msgid "Slug"
|
| 1237 |
msgstr "Slug"
|
| 1238 |
|
| 1239 |
-
#: ../ui/edit.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1240 |
msgid "Required"
|
| 1241 |
msgstr "Requerido"
|
| 1242 |
|
| 1243 |
-
#: ../ui/edit.php:
|
| 1244 |
msgid "Show in Entry List"
|
| 1245 |
msgstr "Mostrar en listado de entradas"
|
| 1246 |
|
| 1247 |
-
#: ../ui/edit.php:
|
| 1248 |
msgid ""
|
| 1249 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1250 |
msgstr ""
|
| 1251 |
"¿Estás seguro de querer eliminar este campo? Pulsa 'Cancelar' si no. 'OK' "
|
| 1252 |
"para eliminar"
|
| 1253 |
|
| 1254 |
-
#: ../ui/edit.php:
|
| 1255 |
msgid "Delete Element"
|
| 1256 |
msgstr "Eliminar elemento"
|
| 1257 |
|
| 1258 |
-
#: ../ui/edit.php:
|
| 1259 |
-
msgid "Show"
|
| 1260 |
-
msgstr "Mostrar"
|
| 1261 |
-
|
| 1262 |
-
#: ../ui/edit.php:381
|
| 1263 |
-
msgid "Hide"
|
| 1264 |
-
msgstr "Ocultar"
|
| 1265 |
-
|
| 1266 |
-
#: ../ui/edit.php:382
|
| 1267 |
-
msgid "Disable"
|
| 1268 |
-
msgstr "Desactivar"
|
| 1269 |
-
|
| 1270 |
-
#: ../ui/edit.php:384 ../ui/panels/processors.php:126
|
| 1271 |
-
msgid "Add Conditional Group"
|
| 1272 |
-
msgstr "Añadir grupo condicional"
|
| 1273 |
-
|
| 1274 |
-
#: ../ui/edit.php:454 ../ui/edit.php:466
|
| 1275 |
msgid "General Settings"
|
| 1276 |
msgstr "Configuración General"
|
| 1277 |
|
| 1278 |
-
#: ../ui/edit.php:
|
| 1279 |
msgid "Updated Successfully"
|
| 1280 |
msgstr "Actualizado Correctamente"
|
| 1281 |
|
| 1282 |
-
#: ../ui/edit.php:
|
| 1283 |
msgid "Update Form"
|
| 1284 |
msgstr "Actualizar Formulario"
|
| 1285 |
|
| 1286 |
-
#: ../ui/edit.php:
|
| 1287 |
msgid "Preview Form"
|
| 1288 |
msgstr "Previsualizar"
|
| 1289 |
|
| 1290 |
-
#: ../ui/edit.php:
|
| 1291 |
msgid "Form Description"
|
| 1292 |
msgstr "Descripción del formulario"
|
| 1293 |
|
| 1294 |
-
#: ../ui/edit.php:
|
| 1295 |
msgid "State"
|
| 1296 |
msgstr "Estado"
|
| 1297 |
|
| 1298 |
-
#: ../ui/edit.php:
|
| 1299 |
msgid "Deactivate / Draft"
|
| 1300 |
msgstr "Desactivar / Borrador"
|
| 1301 |
|
| 1302 |
-
#: ../ui/edit.php:
|
| 1303 |
msgid "Capture Entries"
|
| 1304 |
msgstr "Capturar Entradas"
|
| 1305 |
|
| 1306 |
-
#: ../ui/edit.php:
|
| 1307 |
msgid "Pin to Menu"
|
| 1308 |
msgstr "Agregar al Menú"
|
| 1309 |
|
| 1310 |
-
#: ../ui/edit.php:
|
| 1311 |
msgid "View Entries"
|
| 1312 |
msgstr "Ver Entradas"
|
| 1313 |
|
| 1314 |
-
#: ../ui/edit.php:
|
| 1315 |
msgid "All"
|
| 1316 |
msgstr "Todo"
|
| 1317 |
|
| 1318 |
-
#: ../ui/edit.php:
|
| 1319 |
msgid "Hide Form"
|
| 1320 |
msgstr "Ocultar Formulario"
|
| 1321 |
|
| 1322 |
-
#: ../ui/edit.php:
|
| 1323 |
msgid "Hide form after successful submission"
|
| 1324 |
msgstr "Ocultar formulario tras envío con éxito"
|
| 1325 |
|
| 1326 |
-
#: ../ui/edit.php:
|
| 1327 |
msgid "Honeypot"
|
| 1328 |
msgstr "Bote de Miel"
|
| 1329 |
|
| 1330 |
-
#: ../ui/edit.php:
|
| 1331 |
msgid "Place an invisible field to trick spambots"
|
| 1332 |
msgstr "Coloca un campo invisible para engañar a los programas de Spam"
|
| 1333 |
|
| 1334 |
-
#: ../ui/edit.php:
|
| 1335 |
msgid "Success Message"
|
| 1336 |
msgstr "Mensaje de Envío con éxito"
|
| 1337 |
|
| 1338 |
-
#: ../ui/edit.php:
|
| 1339 |
msgid "Gravatar Field"
|
| 1340 |
msgstr "Campo Gavatar"
|
| 1341 |
|
| 1342 |
-
#: ../ui/edit.php:
|
| 1343 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1344 |
msgstr "Usado al ver una entrada de un usuario no autenticado."
|
| 1345 |
|
| 1346 |
-
#: ../ui/edit.php:
|
| 1347 |
msgid "Add New"
|
| 1348 |
msgstr "Añadir Nuevo"
|
| 1349 |
|
| 1350 |
-
#: ../ui/edit.php:
|
| 1351 |
msgid "Remove"
|
| 1352 |
msgstr "Borrar"
|
| 1353 |
|
| 1354 |
-
#: ../ui/edit.php:
|
| 1355 |
msgid "Set Element"
|
| 1356 |
msgstr "Añadir Elemento"
|
| 1357 |
|
| 1358 |
-
#: ../ui/edit.php:
|
| 1359 |
msgid "No description given"
|
| 1360 |
msgstr "No tiene descripción"
|
| 1361 |
|
| 1362 |
-
#: ../ui/edit.php:
|
| 1363 |
msgid "or"
|
| 1364 |
msgstr "o"
|
| 1365 |
|
| 1366 |
-
#: ../ui/edit.php:
|
| 1367 |
msgid "is"
|
| 1368 |
msgstr "es"
|
| 1369 |
|
| 1370 |
-
#: ../ui/edit.php:
|
| 1371 |
msgid "is not"
|
| 1372 |
msgstr "no es"
|
| 1373 |
|
| 1374 |
-
#: ../ui/edit.php:
|
| 1375 |
msgid "is greater than"
|
| 1376 |
msgstr "es mayor que"
|
| 1377 |
|
| 1378 |
-
#: ../ui/edit.php:
|
| 1379 |
msgid "is less than"
|
| 1380 |
msgstr "es menor que"
|
| 1381 |
|
| 1382 |
-
#: ../ui/edit.php:
|
| 1383 |
msgid "starts with"
|
| 1384 |
msgstr "empieza por"
|
| 1385 |
|
| 1386 |
-
#: ../ui/edit.php:
|
| 1387 |
msgid "ends with"
|
| 1388 |
msgstr "termina en"
|
| 1389 |
|
| 1390 |
-
#: ../ui/edit.php:
|
| 1391 |
msgid "contains"
|
| 1392 |
msgstr "contiene"
|
| 1393 |
|
| 1394 |
-
#: ../ui/edit.php:
|
| 1395 |
msgid "Select field first"
|
| 1396 |
msgstr "Selecciona el campo primero"
|
| 1397 |
|
| 1398 |
-
#: ../ui/edit.php:
|
|
|
|
| 1399 |
msgid "Add Condition"
|
| 1400 |
msgstr "Añadir Condición"
|
| 1401 |
|
| 1402 |
-
#: ../ui/edit.php:
|
| 1403 |
msgid "and"
|
| 1404 |
msgstr "y"
|
| 1405 |
|
|
@@ -1424,10 +1477,17 @@ msgid "items"
|
|
| 1424 |
msgstr "elementos"
|
| 1425 |
|
| 1426 |
#: ../ui/extend.php:23
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1427 |
msgid "No licensed addons installed."
|
| 1428 |
msgstr "No hay extensiones Premium instaladas."
|
| 1429 |
|
| 1430 |
-
#: ../ui/extend.php:
|
| 1431 |
msgid "Already Installed"
|
| 1432 |
msgstr "Ya está instalado"
|
| 1433 |
|
|
@@ -1451,6 +1511,38 @@ msgstr "Cerrar"
|
|
| 1451 |
msgid "Unable to connect or no extensions available."
|
| 1452 |
msgstr "Incapaz de conectar o no hay extensiones disponibles."
|
| 1453 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1454 |
#: ../ui/panels/emailer.php:36
|
| 1455 |
msgid "Enabled"
|
| 1456 |
msgstr "Activado"
|
|
@@ -1497,14 +1589,18 @@ msgstr "Adjuntar una versión CSV de los datos enviados"
|
|
| 1497 |
msgid "Recipients"
|
| 1498 |
msgstr "Destinatarios"
|
| 1499 |
|
| 1500 |
-
#: ../ui/panels/emailer.php:84
|
| 1501 |
-
msgid "Comma separated list of email addresses."
|
| 1502 |
-
msgstr "
|
| 1503 |
|
| 1504 |
#: ../ui/panels/emailer.php:89
|
| 1505 |
msgid "BCC"
|
| 1506 |
msgstr "CCO"
|
| 1507 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1508 |
#: ../ui/panels/emailer.php:100
|
| 1509 |
msgid "Use %field_slug% to use a value from the form"
|
| 1510 |
msgstr "Usa %slug_del_campo% para referirte a un campo del formulario"
|
|
@@ -1542,7 +1638,11 @@ msgstr ""
|
|
| 1542 |
"Correo\" para ver el log de la transacción. No lo mantengas activado en "
|
| 1543 |
"producción ya que esto envía dos emails de seguimiento."
|
| 1544 |
|
| 1545 |
-
#: ../ui/panels/emailer.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1546 |
msgid ""
|
| 1547 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1548 |
"the form submittable."
|
|
@@ -1555,24 +1655,20 @@ msgid "This will remove all the fields in this row. Are you sure?"
|
|
| 1555 |
msgstr "Esto eliminará todos los campos en esta fila. ¿Estás seguro?"
|
| 1556 |
|
| 1557 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1558 |
-
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:
|
| 1559 |
-
#: ../ui/panels/
|
| 1560 |
msgid "Page"
|
| 1561 |
msgstr "Página"
|
| 1562 |
|
| 1563 |
-
#: ../ui/panels/
|
| 1564 |
-
msgid "Add Row"
|
| 1565 |
-
msgstr "Añadir Fila"
|
| 1566 |
-
|
| 1567 |
-
#: ../ui/panels/layout_add_row.php:11
|
| 1568 |
msgid "Add Page"
|
| 1569 |
msgstr "Añadir Página"
|
| 1570 |
|
| 1571 |
-
#: ../ui/panels/
|
| 1572 |
msgid "Drag onto the form grid below"
|
| 1573 |
msgstr "Arrastrar dentro de los módulos de abajo"
|
| 1574 |
|
| 1575 |
-
#: ../ui/panels/
|
| 1576 |
msgid "Add Element"
|
| 1577 |
msgstr "Añadir Elemento"
|
| 1578 |
|
|
@@ -1615,6 +1711,10 @@ msgstr "Usar"
|
|
| 1615 |
msgid "Don't Use"
|
| 1616 |
msgstr "No usar"
|
| 1617 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1618 |
#: ../ui/panels/processors.php:171
|
| 1619 |
msgid "Add Processor"
|
| 1620 |
msgstr "Añadir Procesador"
|
|
@@ -1654,3 +1754,12 @@ msgstr "Transferencias"
|
|
| 1654 |
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
| 1655 |
msgid "Entry List"
|
| 1656 |
msgstr "Lista de Entradas"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
+
"POT-Creation-Date: 2015-08-24 12:16+0200\n"
|
| 5 |
+
"PO-Revision-Date: 2015-08-24 12:17+0200\n"
|
| 6 |
"Last-Translator: \n"
|
| 7 |
"Language-Team: Notecopies <hola@notecopies.es>\n"
|
| 8 |
+
"Language: es_ES\n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 15 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
"X-Poedit-KeywordsList: __;_e\n"
|
|
|
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 20 |
+
msgid "Caldera Forms Notification"
|
| 21 |
+
msgstr "Notificación Caldera Forms"
|
| 22 |
+
|
| 23 |
+
#: ../classes/admin.php:124
|
| 24 |
msgid "Invalid Form."
|
| 25 |
msgstr "Formulario Incorrecto"
|
| 26 |
|
| 27 |
+
#: ../classes/admin.php:143
|
| 28 |
+
#, fuzzy
|
| 29 |
+
msgid "Starter Contact Form"
|
| 30 |
+
msgstr "Color de estrellas"
|
| 31 |
+
|
| 32 |
+
#: ../classes/admin.php:147
|
| 33 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 34 |
+
msgstr ""
|
| 35 |
+
|
| 36 |
+
#: ../classes/admin.php:151
|
| 37 |
+
msgid "Registration Form, with optional additional participants."
|
| 38 |
+
msgstr ""
|
| 39 |
+
|
| 40 |
+
#: ../classes/admin.php:174
|
| 41 |
+
#, fuzzy
|
| 42 |
+
msgid "Form Template"
|
| 43 |
+
msgstr "Nombre de Formulario"
|
| 44 |
+
|
| 45 |
+
#: ../classes/admin.php:177
|
| 46 |
+
msgid "no template - blank form"
|
| 47 |
+
msgstr ""
|
| 48 |
+
|
| 49 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 50 |
#: ../ui/entries_toolbar.php:27
|
| 51 |
msgid "Trash"
|
| 52 |
msgstr "Papelera"
|
| 53 |
|
| 54 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 55 |
#: ../ui/admin_templates.php:9
|
| 56 |
msgid "Restore"
|
| 57 |
msgstr "Restaurar"
|
| 58 |
|
| 59 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 60 |
msgid "Entry"
|
| 61 |
msgstr "Entrada"
|
| 62 |
|
| 63 |
+
#: ../classes/admin.php:385
|
| 64 |
msgid "View"
|
| 65 |
msgstr "Vista"
|
| 66 |
|
| 67 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 68 |
msgid "Add Form to Page"
|
| 69 |
msgstr "Añadir Formulario a Página"
|
| 70 |
|
| 71 |
+
#: ../classes/admin.php:428
|
| 72 |
msgid "Insert Form Shortcode"
|
| 73 |
msgstr "Insertar Desde Shortcode"
|
| 74 |
|
| 75 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 76 |
msgid "Caldera Form"
|
| 77 |
msgstr "Formulario Caldera"
|
| 78 |
|
| 79 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 80 |
msgid "Deactivate"
|
| 81 |
msgstr "Desactivar"
|
| 82 |
|
| 83 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 84 |
msgid "Activate"
|
| 85 |
msgstr "Activar"
|
| 86 |
|
| 87 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 88 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 89 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 90 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 91 |
msgid "Caldera Forms"
|
| 92 |
msgstr "Caldera Forms"
|
| 93 |
|
| 94 |
+
#: ../classes/admin.php:746
|
| 95 |
msgid "Caldera Forms Admin"
|
| 96 |
msgstr "Administrar Caldera Forms"
|
| 97 |
|
| 98 |
+
#: ../classes/admin.php:746
|
| 99 |
msgid "Forms"
|
| 100 |
msgstr "Formularios"
|
| 101 |
|
| 102 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 103 |
msgid "Community"
|
| 104 |
msgstr "Comunidad"
|
| 105 |
|
| 106 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 107 |
msgid "Extend"
|
| 108 |
msgstr "Mejoras"
|
| 109 |
|
| 110 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 111 |
msgid "Sorry, please try again"
|
| 112 |
msgstr "Lo sentimos, inténtalo de nuevo por favor"
|
| 113 |
|
| 114 |
+
#: ../classes/admin.php:1017
|
| 115 |
msgid "Form Delete Error"
|
| 116 |
msgstr "Error al eliminar"
|
| 117 |
|
| 118 |
+
#: ../classes/admin.php:1170
|
| 119 |
msgid "Sorry, File is not valid."
|
| 120 |
msgstr "Lo sentimos, archivo no válido"
|
| 121 |
|
| 122 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 123 |
+
#: ../classes/admin.php:1179
|
| 124 |
msgid "Form Import Error"
|
| 125 |
msgstr "Error al importar"
|
| 126 |
|
| 127 |
+
#: ../classes/admin.php:1174
|
| 128 |
msgid "Sorry, File not uploaded."
|
| 129 |
msgstr "Lo sentimos, el archivo no se ha subido"
|
| 130 |
|
| 131 |
+
#: ../classes/admin.php:1188
|
| 132 |
msgid "Form does not exist."
|
| 133 |
msgstr "El formulario no existe"
|
| 134 |
|
| 135 |
+
#: ../classes/admin.php:1229
|
| 136 |
msgid "Export selection has expired"
|
| 137 |
msgstr "La exportación ha caducado"
|
| 138 |
|
| 139 |
+
#: ../classes/admin.php:1229
|
| 140 |
msgid "Export Expired"
|
| 141 |
msgstr "Exportación caducada"
|
| 142 |
|
| 143 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 144 |
msgid "Form has been successfully submitted. Thank you."
|
| 145 |
msgstr "El formulario ha sido correctamente enviado. Gracias."
|
| 146 |
|
| 147 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 148 |
msgid "Layout"
|
| 149 |
msgstr "Diseño"
|
| 150 |
|
| 151 |
+
#: ../classes/admin.php:1465
|
| 152 |
msgid "Layout Builder"
|
| 153 |
msgstr "Diseñador"
|
| 154 |
|
| 155 |
+
#: ../classes/admin.php:1475
|
| 156 |
msgid "Pages"
|
| 157 |
msgstr "Páginas"
|
| 158 |
|
| 159 |
+
#: ../classes/admin.php:1477
|
| 160 |
msgid "Form Pages"
|
| 161 |
msgstr "Páginas de formulario"
|
| 162 |
|
| 163 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 164 |
+
msgid "Conditions"
|
| 165 |
+
msgstr "Condicionales"
|
| 166 |
+
|
| 167 |
+
#: ../classes/admin.php:1487
|
| 168 |
msgid "Processors"
|
| 169 |
msgstr "Procesadores"
|
| 170 |
|
| 171 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 172 |
msgid "Form Processors"
|
| 173 |
msgstr "Procesadores de formulario"
|
| 174 |
|
| 175 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 176 |
#: ../ui/panels/variables.php:83
|
| 177 |
msgid "Variables"
|
| 178 |
msgstr "Variables"
|
| 179 |
|
| 180 |
+
#: ../classes/admin.php:1502
|
| 181 |
msgid "Responsive"
|
| 182 |
msgstr "Adaptabilidad"
|
| 183 |
|
| 184 |
+
#: ../classes/admin.php:1504
|
| 185 |
msgid "Resposive Settings"
|
| 186 |
msgstr "Opciones de adaptabilidad"
|
| 187 |
|
| 188 |
+
#: ../classes/admin.php:1508
|
| 189 |
msgid "Grid Collapse"
|
| 190 |
msgstr "División modular"
|
| 191 |
|
| 192 |
+
#: ../classes/admin.php:1510
|
| 193 |
msgid ""
|
| 194 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 195 |
"Bootstrap 3.0)"
|
| 197 |
"Pon el tamaño de pantalla mínimo necesario para que la estructura modular "
|
| 198 |
"del diseño se divida y se adapte. (basado en Bootstrap 3.0)"
|
| 199 |
|
| 200 |
+
#: ../classes/admin.php:1517
|
| 201 |
msgid "Maintain grid always"
|
| 202 |
msgstr "Mantener la estructura siempre"
|
| 203 |
|
| 204 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 205 |
msgid "Mailer"
|
| 206 |
msgstr "Envío"
|
| 207 |
|
| 208 |
+
#: ../classes/admin.php:1539
|
| 209 |
msgid "Email Notification Settings"
|
| 210 |
msgstr "Opciones de notificación"
|
| 211 |
|
| 212 |
+
#: ../classes/core.php:396
|
| 213 |
msgid "The wasn't entered correct."
|
| 214 |
msgstr "Eso no se ha introducido correctamente."
|
| 215 |
|
| 216 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 217 |
msgid "Reset"
|
| 218 |
msgstr "Restaurar valores"
|
| 219 |
|
| 220 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 221 |
msgid "Permission denied."
|
| 222 |
msgstr "Permiso denegado."
|
| 223 |
|
| 224 |
+
#: ../classes/core.php:787
|
|
|
|
|
|
|
|
|
|
|
|
|
| 225 |
msgid "Auto Responder"
|
| 226 |
msgstr "Auto-respuesta"
|
| 227 |
|
| 228 |
+
#: ../classes/core.php:788
|
| 229 |
msgid "Sends out an auto response e-mail"
|
| 230 |
msgstr "Envía un mensaje de auto-respuesta"
|
| 231 |
|
| 232 |
+
#: ../classes/core.php:792
|
| 233 |
msgid "Thank you for contacting us"
|
| 234 |
msgstr "Gracias por contactar con nosotros"
|
| 235 |
|
| 236 |
+
#: ../classes/core.php:796
|
| 237 |
msgid "Redirect"
|
| 238 |
msgstr "Redireccionar"
|
| 239 |
|
| 240 |
+
#: ../classes/core.php:797
|
| 241 |
msgid "Redirects user to URL on successful submit"
|
| 242 |
msgstr "Redirecciona a una URL tras un envio con éxito"
|
| 243 |
|
| 244 |
+
#: ../classes/core.php:802
|
| 245 |
msgid "Increment Value"
|
| 246 |
msgstr "Incrementar valor"
|
| 247 |
|
| 248 |
+
#: ../classes/core.php:803
|
| 249 |
msgid "Increment a value per entry."
|
| 250 |
msgstr "Incrementar valor por entrada"
|
| 251 |
|
| 252 |
+
#: ../classes/core.php:817
|
| 253 |
msgid "Akismet"
|
| 254 |
msgstr "Akismet"
|
| 255 |
|
| 256 |
+
#: ../classes/core.php:818
|
| 257 |
msgid "Anti-spam filtering"
|
| 258 |
msgstr "Filtro anti-spam"
|
| 259 |
|
| 260 |
+
#: ../classes/core.php:866
|
| 261 |
msgid "Akismet not setup."
|
| 262 |
msgstr "Akismet no está configurado"
|
| 263 |
|
| 264 |
+
#: ../classes/core.php:1017
|
| 265 |
msgid "Calculation"
|
| 266 |
msgstr "Operaciones"
|
| 267 |
|
| 268 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 269 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 270 |
msgid "Special"
|
| 271 |
msgstr "Especial"
|
| 272 |
|
| 273 |
+
#: ../classes/core.php:1020
|
| 274 |
msgid "Math"
|
| 275 |
msgstr "Cálculo"
|
| 276 |
|
| 277 |
+
#: ../classes/core.php:1021
|
| 278 |
msgid "Calculate values"
|
| 279 |
msgstr "Calcular valores"
|
| 280 |
|
| 281 |
+
#: ../classes/core.php:1028
|
| 282 |
msgid "Total"
|
| 283 |
msgstr "Total"
|
| 284 |
|
| 285 |
+
#: ../classes/core.php:1040
|
| 286 |
msgid "Range Slider"
|
| 287 |
msgstr "Rango deslizable"
|
| 288 |
|
| 289 |
+
#: ../classes/core.php:1043
|
| 290 |
msgid "Range Slider input field"
|
| 291 |
msgstr "Campo de rango deslizable"
|
| 292 |
|
| 293 |
+
#: ../classes/core.php:1077
|
| 294 |
msgid "Star Rating"
|
| 295 |
msgstr "Valoración con estrellas"
|
| 296 |
|
| 297 |
+
#: ../classes/core.php:1079
|
| 298 |
msgid "Feedback"
|
| 299 |
msgstr "Reacciones"
|
| 300 |
|
| 301 |
+
#: ../classes/core.php:1080
|
| 302 |
msgid "Star rating input for feedback"
|
| 303 |
msgstr "Campo de valoración para recoger opiniones"
|
| 304 |
|
| 305 |
+
#: ../classes/core.php:1112
|
| 306 |
msgid "Phone Number"
|
| 307 |
msgstr "Número de teléfono"
|
| 308 |
|
| 309 |
+
#: ../classes/core.php:1113
|
| 310 |
msgid "Phone number with masking"
|
| 311 |
msgstr "Número de teléfono con máscara"
|
| 312 |
|
| 313 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 314 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 315 |
+
#: ../classes/core.php:1376
|
| 316 |
msgid "Text Fields"
|
| 317 |
msgstr "Campos de texto"
|
| 318 |
|
| 319 |
+
#: ../classes/core.php:1115
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 320 |
msgid "User"
|
| 321 |
msgstr "Usuario"
|
| 322 |
|
| 323 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 324 |
msgid "Single Line Text"
|
| 325 |
msgstr "Campo de texto"
|
| 326 |
|
| 327 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 328 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 329 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 330 |
+
#: ../ui/edit.php:215
|
| 331 |
+
msgid "Basic"
|
| 332 |
+
msgstr "Básico"
|
| 333 |
+
|
| 334 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 335 |
msgid "File"
|
| 336 |
msgstr "Fichero"
|
| 337 |
|
| 338 |
+
#: ../classes/core.php:1149
|
| 339 |
msgid "File Uploader"
|
| 340 |
msgstr "Cargador de archivos"
|
| 341 |
|
| 342 |
+
#: ../classes/core.php:1159
|
| 343 |
msgid "reCAPTCHA"
|
| 344 |
msgstr "reCAPTCHA"
|
| 345 |
|
| 346 |
+
#: ../classes/core.php:1160
|
| 347 |
msgid "reCAPTCHA anti-spam field"
|
| 348 |
msgstr "Campo anti-spam reCAPTCHA"
|
| 349 |
|
| 350 |
+
#: ../classes/core.php:1185
|
| 351 |
msgid "HTML"
|
| 352 |
msgstr "HTML"
|
| 353 |
|
| 354 |
+
#: ../classes/core.php:1186
|
| 355 |
msgid "Add text/html content"
|
| 356 |
msgstr "Añadir contenido html/texto"
|
| 357 |
|
| 358 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 359 |
#: ../processors/akismet/config.php:20
|
| 360 |
msgid "Content"
|
| 361 |
msgstr "Contenido"
|
| 362 |
|
| 363 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 364 |
msgid "Hidden"
|
| 365 |
msgstr "Oculto"
|
| 366 |
|
| 367 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 368 |
msgid "Button"
|
| 369 |
msgstr "Botón"
|
| 370 |
|
| 371 |
+
#: ../classes/core.php:1220
|
| 372 |
msgid "Button, Submit and Reset types"
|
| 373 |
msgstr "Tipos botón, enviar y reestablecer"
|
| 374 |
|
| 375 |
+
#: ../classes/core.php:1222
|
| 376 |
msgid "Buttons"
|
| 377 |
msgstr "Botones"
|
| 378 |
|
| 379 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 380 |
msgid "Email Address"
|
| 381 |
msgstr "Dirección email"
|
| 382 |
|
| 383 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 384 |
msgid "Paragraph Textarea"
|
| 385 |
msgstr "Área de texto"
|
| 386 |
|
| 387 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 388 |
msgid "Toggle Switch"
|
| 389 |
msgstr "Pestañas seleccionables"
|
| 390 |
|
| 391 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 392 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 393 |
msgid "Select Options"
|
| 394 |
msgstr "Opciones desplegables"
|
| 395 |
|
| 396 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 397 |
msgid "Dropdown Select"
|
| 398 |
msgstr "Lista desplegable"
|
| 399 |
|
| 400 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 401 |
msgid "Checkbox"
|
| 402 |
msgstr "Casillas seleccionables"
|
| 403 |
|
| 404 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 405 |
msgid "Radio"
|
| 406 |
msgstr "Lista de opciones"
|
| 407 |
|
| 408 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 409 |
msgid "Date Picker"
|
| 410 |
msgstr "Selección de fecha"
|
| 411 |
|
| 412 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 413 |
msgid "Pickers"
|
| 414 |
msgstr "Selectores"
|
| 415 |
|
| 416 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 417 |
msgid "Color Picker"
|
| 418 |
msgstr "Selección de color"
|
| 419 |
|
| 420 |
+
#: ../classes/core.php:1402
|
| 421 |
msgid "State/ Province Select"
|
| 422 |
msgstr "Lista de Estados/Provincias"
|
| 423 |
|
| 424 |
+
#: ../classes/core.php:1403
|
| 425 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 426 |
msgstr "Lista desplegable para los estados de EEUU y las provincias de Canadá"
|
| 427 |
|
| 428 |
+
#: ../classes/core.php:1417
|
| 429 |
+
#, fuzzy
|
| 430 |
+
msgid "Autocomplete"
|
| 431 |
+
msgstr "Auto-rellenar."
|
| 432 |
+
|
| 433 |
+
#: ../classes/core.php:1419
|
| 434 |
+
#, fuzzy
|
| 435 |
+
msgid "Pickers,Select Options"
|
| 436 |
+
msgstr "Opciones desplegables"
|
| 437 |
+
|
| 438 |
+
#: ../classes/core.php:1838
|
| 439 |
msgid "System Tags"
|
| 440 |
msgstr "Etiquetas de sistema"
|
| 441 |
|
| 442 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 443 |
msgid "Mailer Debug"
|
| 444 |
msgstr "Depurador de correo"
|
| 445 |
|
| 446 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 447 |
msgid "Invalid form ID"
|
| 448 |
msgstr "ID de formulario inválida"
|
| 449 |
|
| 450 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 451 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 452 |
+
#: ../classes/core.php:4111
|
| 453 |
msgid "Permission denied or entry does not exist."
|
| 454 |
msgstr "Permiso denegado o la entrada no existe"
|
| 455 |
|
| 456 |
+
#: ../classes/core.php:3053
|
| 457 |
msgid "is required"
|
| 458 |
msgstr "es obligatorio"
|
| 459 |
|
| 460 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 461 |
msgid "Form is currently not active."
|
| 462 |
msgstr "El formulario no está activo actualmente."
|
| 463 |
|
| 464 |
+
#: ../classes/core.php:4393
|
| 465 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 466 |
msgstr ""
|
| 467 |
"AVISO: El formulario está en modo Depurador de correo. Desactívelo antes de "
|
| 471 |
msgid "Title"
|
| 472 |
msgstr "Título"
|
| 473 |
|
| 474 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 475 |
msgid "Form"
|
| 476 |
msgstr "Formulario"
|
| 477 |
|
| 594 |
msgstr "La visualización inicial del selector de fecha (mes, año, década)"
|
| 595 |
|
| 596 |
#: ../fields/date_picker/setup.php:32
|
| 597 |
+
msgid "Start Date"
|
| 598 |
+
msgstr ""
|
| 599 |
+
|
| 600 |
+
#: ../fields/date_picker/setup.php:35
|
| 601 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 602 |
+
msgstr ""
|
| 603 |
+
|
| 604 |
+
#: ../fields/date_picker/setup.php:39
|
| 605 |
+
msgid "End Date"
|
| 606 |
+
msgstr ""
|
| 607 |
+
|
| 608 |
+
#: ../fields/date_picker/setup.php:42
|
| 609 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 610 |
+
msgstr ""
|
| 611 |
+
|
| 612 |
+
#: ../fields/date_picker/setup.php:46
|
| 613 |
msgid "language"
|
| 614 |
msgstr "lenguaje"
|
| 615 |
|
| 616 |
+
#: ../fields/date_picker/setup.php:114
|
| 617 |
msgid "Language to use. e.g. pt-BR"
|
| 618 |
msgstr "El lenguaje a utilizar. Ejemplo: es-ES"
|
| 619 |
|
| 620 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 621 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 622 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 623 |
msgid "Placeholder"
|
| 624 |
msgstr "Texto interior"
|
| 625 |
|
| 628 |
msgstr "Adjuntar al envío de correo"
|
| 629 |
|
| 630 |
#: ../fields/file/config_template.php:9
|
| 631 |
+
msgid "Allow Multiple"
|
| 632 |
+
msgstr ""
|
| 633 |
+
|
| 634 |
+
#: ../fields/file/config_template.php:16
|
| 635 |
msgid "Allowed Types"
|
| 636 |
msgstr "Tipos permitidos"
|
| 637 |
|
| 638 |
+
#: ../fields/file/config_template.php:19
|
| 639 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 640 |
msgstr "Separado por comas. Ejemplo: jpg,pdf,txt"
|
| 641 |
|
| 691 |
msgid "Border Radius"
|
| 692 |
msgstr "Bordes Redondeados"
|
| 693 |
|
| 694 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 695 |
#: ../ui/panels/variables.php:12
|
| 696 |
msgid "Value"
|
| 697 |
msgstr "Valor"
|
| 724 |
msgid "Track"
|
| 725 |
msgstr "Rastro"
|
| 726 |
|
| 727 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 728 |
msgid "Highlight"
|
| 729 |
msgstr "Resaltado"
|
| 730 |
|
| 732 |
msgid "Handle"
|
| 733 |
msgstr "Manejo"
|
| 734 |
|
| 735 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 736 |
msgid "Border"
|
| 737 |
msgstr "Borde"
|
| 738 |
|
| 800 |
msgid "No Site Key Added"
|
| 801 |
msgstr "No se ha añadido clave del sistio"
|
| 802 |
|
| 803 |
+
#: ../fields/select2/field/config.php:11
|
| 804 |
+
msgid "Multiple"
|
| 805 |
+
msgstr ""
|
| 806 |
+
|
| 807 |
+
#: ../fields/select2/field/config.php:15
|
| 808 |
+
msgid "Enable multiple selections"
|
| 809 |
+
msgstr ""
|
| 810 |
+
|
| 811 |
#: ../fields/star-rate/config.php:2
|
| 812 |
msgid "Number of Stars"
|
| 813 |
msgstr "Número de estrellas"
|
| 924 |
msgid "Inactive Class"
|
| 925 |
msgstr "Clase Inactiva"
|
| 926 |
|
| 927 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 928 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 929 |
msgid "Enable"
|
| 930 |
msgstr "Activar"
|
| 931 |
|
| 986 |
msgid "Custom Class"
|
| 987 |
msgstr "Clase personalizada"
|
| 988 |
|
| 989 |
+
#: ../includes/field_processors.php:45
|
| 990 |
msgid "File type not allowed. Allowed types are: "
|
| 991 |
msgstr "Tipo de archivo no permitido. Los archivos permitidos son:"
|
| 992 |
|
| 993 |
+
#: ../includes/field_processors.php:47
|
| 994 |
msgid "File type needs to be"
|
| 995 |
msgstr "El tipo de archivo ha de ser"
|
| 996 |
|
| 997 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 998 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 999 |
msgid "Name"
|
| 1000 |
msgstr "Nombre"
|
| 1001 |
|
| 1040 |
msgid "Message"
|
| 1041 |
msgstr "Mensaje"
|
| 1042 |
|
| 1043 |
+
#: ../processors/classes/get_data.php:76
|
| 1044 |
+
#, php-format
|
| 1045 |
+
msgid "%s is required"
|
| 1046 |
+
msgstr ""
|
| 1047 |
+
|
| 1048 |
#: ../processors/increment/config.php:2
|
| 1049 |
msgid "Increment Start"
|
| 1050 |
msgstr "Incremento de inicio"
|
| 1129 |
msgid "Grid"
|
| 1130 |
msgstr "Bloques"
|
| 1131 |
|
| 1132 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1133 |
msgid "Entries"
|
| 1134 |
msgstr "Entradas"
|
| 1135 |
|
| 1136 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1137 |
#: ../ui/panels/emailer.php:35
|
| 1138 |
msgid "Disabled"
|
| 1139 |
msgstr "Desactivado"
|
| 1140 |
|
| 1141 |
+
#: ../ui/admin.php:112
|
| 1142 |
msgid "Mailer Debug enabled."
|
| 1143 |
msgstr "Depuración de correo activada."
|
| 1144 |
|
| 1145 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1146 |
msgid "Edit"
|
| 1147 |
msgstr "Editar"
|
| 1148 |
|
| 1149 |
+
#: ../ui/admin.php:141
|
| 1150 |
msgid "Export"
|
| 1151 |
msgstr "Exportar"
|
| 1152 |
|
| 1153 |
+
#: ../ui/admin.php:142
|
| 1154 |
msgid "Clone Form"
|
| 1155 |
msgstr "Clonar Formulario"
|
| 1156 |
|
| 1157 |
+
#: ../ui/admin.php:142
|
| 1158 |
msgid "Clone"
|
| 1159 |
msgstr "Clonar"
|
| 1160 |
|
| 1161 |
+
#: ../ui/admin.php:143
|
| 1162 |
msgid "This will delete this form permanently. Continue?"
|
| 1163 |
msgstr "Esta acción eliminará el formulario definitivamente. ¿Continuar?"
|
| 1164 |
|
| 1165 |
+
#: ../ui/admin.php:143
|
| 1166 |
msgid "Delete"
|
| 1167 |
msgstr "Eliminar"
|
| 1168 |
|
| 1169 |
+
#: ../ui/admin.php:163
|
| 1170 |
msgid "You don't have any forms."
|
| 1171 |
msgstr "No hay ningún formulario."
|
| 1172 |
|
| 1173 |
+
#: ../ui/admin.php:204
|
| 1174 |
msgid "An form name is required"
|
| 1175 |
msgstr "Es necesario un nombre para el formulario"
|
| 1176 |
|
| 1177 |
+
#: ../ui/admin.php:231
|
| 1178 |
msgid ""
|
| 1179 |
"Looks like something is not working. Please try again a little later or post "
|
| 1180 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1200 |
msgid "Delete Permanently"
|
| 1201 |
msgstr "Borrar permanentemente"
|
| 1202 |
|
| 1203 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
|
|
|
| 1204 |
msgid "Form Name"
|
| 1205 |
msgstr "Nombre de Formulario"
|
| 1206 |
|
| 1208 |
msgid "Form File"
|
| 1209 |
msgstr "Fichero de Formulario"
|
| 1210 |
|
| 1211 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1212 |
msgid "Description"
|
| 1213 |
msgstr "Descripción"
|
| 1214 |
|
| 1215 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1216 |
msgid "ID"
|
| 1217 |
msgstr "ID"
|
| 1218 |
|
| 1232 |
msgid "Form has successfully been submitted. Thank you."
|
| 1233 |
msgstr "El formulario ha sido correctamente enviado. Gracias."
|
| 1234 |
|
| 1235 |
+
#: ../ui/edit.php:99
|
| 1236 |
msgid "Auto Populate"
|
| 1237 |
msgstr "Auto-rellenar."
|
| 1238 |
|
| 1239 |
+
#: ../ui/edit.php:105
|
| 1240 |
msgid "Auto Type"
|
| 1241 |
msgstr "Auto-introducir."
|
| 1242 |
|
| 1243 |
+
#: ../ui/edit.php:108
|
| 1244 |
msgid "Select a source"
|
| 1245 |
msgstr "Selecciona una fuente"
|
| 1246 |
|
| 1247 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1248 |
msgid "Post Type"
|
| 1249 |
msgstr "Tipo de Post"
|
| 1250 |
|
| 1251 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1252 |
msgid "Taxonomy"
|
| 1253 |
msgstr "Clasificación"
|
| 1254 |
|
| 1255 |
+
#: ../ui/edit.php:167
|
| 1256 |
msgid "Add Option"
|
| 1257 |
msgstr "Añadir Opción"
|
| 1258 |
|
| 1259 |
+
#: ../ui/edit.php:168
|
| 1260 |
msgid "Bulk Insert"
|
| 1261 |
msgstr "Insetar en lote"
|
| 1262 |
|
| 1263 |
+
#: ../ui/edit.php:171
|
| 1264 |
msgid "Single option per line. These replace the current list."
|
| 1265 |
msgstr "Una sola opción por línea. Esto reemplazará la lista actual."
|
| 1266 |
|
| 1267 |
+
#: ../ui/edit.php:172
|
| 1268 |
msgid "Insert Options"
|
| 1269 |
msgstr "Opciónes de inserción"
|
| 1270 |
|
| 1271 |
+
#: ../ui/edit.php:176
|
| 1272 |
msgid "No Default"
|
| 1273 |
msgstr "No (Predeterminado)"
|
| 1274 |
|
| 1275 |
+
#: ../ui/edit.php:177
|
| 1276 |
msgid "Show Values"
|
| 1277 |
msgstr "Mostrar valores"
|
| 1278 |
|
| 1279 |
+
#: ../ui/edit.php:181
|
| 1280 |
msgid "Label"
|
| 1281 |
msgstr "Etiqueta"
|
| 1282 |
|
| 1283 |
+
#: ../ui/edit.php:342
|
| 1284 |
msgid "Elements"
|
| 1285 |
msgstr "Elementos"
|
| 1286 |
|
| 1287 |
+
#: ../ui/edit.php:354
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1288 |
msgid "Element Type"
|
| 1289 |
msgstr "Tipo de elemento"
|
| 1290 |
|
| 1291 |
+
#: ../ui/edit.php:379
|
| 1292 |
msgid "Hide Label"
|
| 1293 |
msgstr "Ocultar etiqueta"
|
| 1294 |
|
| 1295 |
+
#: ../ui/edit.php:386
|
| 1296 |
msgid "Slug"
|
| 1297 |
msgstr "Slug"
|
| 1298 |
|
| 1299 |
+
#: ../ui/edit.php:392
|
| 1300 |
+
msgid "Condition"
|
| 1301 |
+
msgstr ""
|
| 1302 |
+
|
| 1303 |
+
#: ../ui/edit.php:397
|
| 1304 |
+
msgid "Disable"
|
| 1305 |
+
msgstr "Desactivar"
|
| 1306 |
+
|
| 1307 |
+
#: ../ui/edit.php:403
|
| 1308 |
msgid "Required"
|
| 1309 |
msgstr "Requerido"
|
| 1310 |
|
| 1311 |
+
#: ../ui/edit.php:417
|
| 1312 |
msgid "Show in Entry List"
|
| 1313 |
msgstr "Mostrar en listado de entradas"
|
| 1314 |
|
| 1315 |
+
#: ../ui/edit.php:427
|
| 1316 |
msgid ""
|
| 1317 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1318 |
msgstr ""
|
| 1319 |
"¿Estás seguro de querer eliminar este campo? Pulsa 'Cancelar' si no. 'OK' "
|
| 1320 |
"para eliminar"
|
| 1321 |
|
| 1322 |
+
#: ../ui/edit.php:427
|
| 1323 |
msgid "Delete Element"
|
| 1324 |
msgstr "Eliminar elemento"
|
| 1325 |
|
| 1326 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1327 |
msgid "General Settings"
|
| 1328 |
msgstr "Configuración General"
|
| 1329 |
|
| 1330 |
+
#: ../ui/edit.php:498
|
| 1331 |
msgid "Updated Successfully"
|
| 1332 |
msgstr "Actualizado Correctamente"
|
| 1333 |
|
| 1334 |
+
#: ../ui/edit.php:500
|
| 1335 |
msgid "Update Form"
|
| 1336 |
msgstr "Actualizar Formulario"
|
| 1337 |
|
| 1338 |
+
#: ../ui/edit.php:501
|
| 1339 |
msgid "Preview Form"
|
| 1340 |
msgstr "Previsualizar"
|
| 1341 |
|
| 1342 |
+
#: ../ui/edit.php:514
|
| 1343 |
msgid "Form Description"
|
| 1344 |
msgstr "Descripción del formulario"
|
| 1345 |
|
| 1346 |
+
#: ../ui/edit.php:521
|
| 1347 |
msgid "State"
|
| 1348 |
msgstr "Estado"
|
| 1349 |
|
| 1350 |
+
#: ../ui/edit.php:523
|
| 1351 |
msgid "Deactivate / Draft"
|
| 1352 |
msgstr "Desactivar / Borrador"
|
| 1353 |
|
| 1354 |
+
#: ../ui/edit.php:528
|
| 1355 |
msgid "Capture Entries"
|
| 1356 |
msgstr "Capturar Entradas"
|
| 1357 |
|
| 1358 |
+
#: ../ui/edit.php:536
|
| 1359 |
msgid "Pin to Menu"
|
| 1360 |
msgstr "Agregar al Menú"
|
| 1361 |
|
| 1362 |
+
#: ../ui/edit.php:545
|
| 1363 |
msgid "View Entries"
|
| 1364 |
msgstr "Ver Entradas"
|
| 1365 |
|
| 1366 |
+
#: ../ui/edit.php:547
|
| 1367 |
msgid "All"
|
| 1368 |
msgstr "Todo"
|
| 1369 |
|
| 1370 |
+
#: ../ui/edit.php:569
|
| 1371 |
msgid "Hide Form"
|
| 1372 |
msgstr "Ocultar Formulario"
|
| 1373 |
|
| 1374 |
+
#: ../ui/edit.php:571
|
| 1375 |
msgid "Hide form after successful submission"
|
| 1376 |
msgstr "Ocultar formulario tras envío con éxito"
|
| 1377 |
|
| 1378 |
+
#: ../ui/edit.php:576
|
| 1379 |
msgid "Honeypot"
|
| 1380 |
msgstr "Bote de Miel"
|
| 1381 |
|
| 1382 |
+
#: ../ui/edit.php:578
|
| 1383 |
msgid "Place an invisible field to trick spambots"
|
| 1384 |
msgstr "Coloca un campo invisible para engañar a los programas de Spam"
|
| 1385 |
|
| 1386 |
+
#: ../ui/edit.php:583
|
| 1387 |
msgid "Success Message"
|
| 1388 |
msgstr "Mensaje de Envío con éxito"
|
| 1389 |
|
| 1390 |
+
#: ../ui/edit.php:589
|
| 1391 |
msgid "Gravatar Field"
|
| 1392 |
msgstr "Campo Gavatar"
|
| 1393 |
|
| 1394 |
+
#: ../ui/edit.php:596
|
| 1395 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1396 |
msgstr "Usado al ver una entrada de un usuario no autenticado."
|
| 1397 |
|
| 1398 |
+
#: ../ui/edit.php:670
|
| 1399 |
msgid "Add New"
|
| 1400 |
msgstr "Añadir Nuevo"
|
| 1401 |
|
| 1402 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1403 |
msgid "Remove"
|
| 1404 |
msgstr "Borrar"
|
| 1405 |
|
| 1406 |
+
#: ../ui/edit.php:825
|
| 1407 |
msgid "Set Element"
|
| 1408 |
msgstr "Añadir Elemento"
|
| 1409 |
|
| 1410 |
+
#: ../ui/edit.php:828
|
| 1411 |
msgid "No description given"
|
| 1412 |
msgstr "No tiene descripción"
|
| 1413 |
|
| 1414 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1415 |
msgid "or"
|
| 1416 |
msgstr "o"
|
| 1417 |
|
| 1418 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1419 |
msgid "is"
|
| 1420 |
msgstr "es"
|
| 1421 |
|
| 1422 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1423 |
msgid "is not"
|
| 1424 |
msgstr "no es"
|
| 1425 |
|
| 1426 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1427 |
msgid "is greater than"
|
| 1428 |
msgstr "es mayor que"
|
| 1429 |
|
| 1430 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1431 |
msgid "is less than"
|
| 1432 |
msgstr "es menor que"
|
| 1433 |
|
| 1434 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1435 |
msgid "starts with"
|
| 1436 |
msgstr "empieza por"
|
| 1437 |
|
| 1438 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1439 |
msgid "ends with"
|
| 1440 |
msgstr "termina en"
|
| 1441 |
|
| 1442 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1443 |
msgid "contains"
|
| 1444 |
msgstr "contiene"
|
| 1445 |
|
| 1446 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1447 |
msgid "Select field first"
|
| 1448 |
msgstr "Selecciona el campo primero"
|
| 1449 |
|
| 1450 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1451 |
+
#: ../ui/panels/conditions.php:129
|
| 1452 |
msgid "Add Condition"
|
| 1453 |
msgstr "Añadir Condición"
|
| 1454 |
|
| 1455 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1456 |
msgid "and"
|
| 1457 |
msgstr "y"
|
| 1458 |
|
| 1477 |
msgstr "elementos"
|
| 1478 |
|
| 1479 |
#: ../ui/extend.php:23
|
| 1480 |
+
msgid ""
|
| 1481 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1482 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1483 |
+
"Forms."
|
| 1484 |
+
msgstr ""
|
| 1485 |
+
|
| 1486 |
+
#: ../ui/extend.php:29
|
| 1487 |
msgid "No licensed addons installed."
|
| 1488 |
msgstr "No hay extensiones Premium instaladas."
|
| 1489 |
|
| 1490 |
+
#: ../ui/extend.php:54
|
| 1491 |
msgid "Already Installed"
|
| 1492 |
msgstr "Ya está instalado"
|
| 1493 |
|
| 1511 |
msgid "Unable to connect or no extensions available."
|
| 1512 |
msgstr "Incapaz de conectar o no hay extensiones disponibles."
|
| 1513 |
|
| 1514 |
+
#: ../ui/panels/conditions.php:65
|
| 1515 |
+
msgid "Show"
|
| 1516 |
+
msgstr "Mostrar"
|
| 1517 |
+
|
| 1518 |
+
#: ../ui/panels/conditions.php:66
|
| 1519 |
+
msgid "Hide"
|
| 1520 |
+
msgstr "Ocultar"
|
| 1521 |
+
|
| 1522 |
+
#: ../ui/panels/conditions.php:69
|
| 1523 |
+
msgid "Add Conditional Line"
|
| 1524 |
+
msgstr ""
|
| 1525 |
+
|
| 1526 |
+
#: ../ui/panels/conditions.php:83
|
| 1527 |
+
msgid "if"
|
| 1528 |
+
msgstr ""
|
| 1529 |
+
|
| 1530 |
+
#: ../ui/panels/conditions.php:133
|
| 1531 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1532 |
+
msgstr ""
|
| 1533 |
+
|
| 1534 |
+
#: ../ui/panels/conditions.php:133
|
| 1535 |
+
msgid "Remove Condition"
|
| 1536 |
+
msgstr ""
|
| 1537 |
+
|
| 1538 |
+
#: ../ui/panels/conditions.php:137
|
| 1539 |
+
msgid "Applied Fields"
|
| 1540 |
+
msgstr ""
|
| 1541 |
+
|
| 1542 |
+
#: ../ui/panels/conditions.php:138
|
| 1543 |
+
msgid "Select the fields to apply this condition to."
|
| 1544 |
+
msgstr ""
|
| 1545 |
+
|
| 1546 |
#: ../ui/panels/emailer.php:36
|
| 1547 |
msgid "Enabled"
|
| 1548 |
msgstr "Activado"
|
| 1589 |
msgid "Recipients"
|
| 1590 |
msgstr "Destinatarios"
|
| 1591 |
|
| 1592 |
+
#: ../ui/panels/emailer.php:84
|
| 1593 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1594 |
+
msgstr ""
|
| 1595 |
|
| 1596 |
#: ../ui/panels/emailer.php:89
|
| 1597 |
msgid "BCC"
|
| 1598 |
msgstr "CCO"
|
| 1599 |
|
| 1600 |
+
#: ../ui/panels/emailer.php:92
|
| 1601 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1602 |
+
msgstr ""
|
| 1603 |
+
|
| 1604 |
#: ../ui/panels/emailer.php:100
|
| 1605 |
msgid "Use %field_slug% to use a value from the form"
|
| 1606 |
msgstr "Usa %slug_del_campo% para referirte a un campo del formulario"
|
| 1638 |
"Correo\" para ver el log de la transacción. No lo mantengas activado en "
|
| 1639 |
"producción ya que esto envía dos emails de seguimiento."
|
| 1640 |
|
| 1641 |
+
#: ../ui/panels/emailer.php:118
|
| 1642 |
+
msgid "Learn more here"
|
| 1643 |
+
msgstr ""
|
| 1644 |
+
|
| 1645 |
+
#: ../ui/panels/emailer.php:130
|
| 1646 |
msgid ""
|
| 1647 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1648 |
"the form submittable."
|
| 1655 |
msgstr "Esto eliminará todos los campos en esta fila. ¿Estás seguro?"
|
| 1656 |
|
| 1657 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1658 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1659 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1660 |
msgid "Page"
|
| 1661 |
msgstr "Página"
|
| 1662 |
|
| 1663 |
+
#: ../ui/panels/layout_toolbar.php:11
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1664 |
msgid "Add Page"
|
| 1665 |
msgstr "Añadir Página"
|
| 1666 |
|
| 1667 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1668 |
msgid "Drag onto the form grid below"
|
| 1669 |
msgstr "Arrastrar dentro de los módulos de abajo"
|
| 1670 |
|
| 1671 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1672 |
msgid "Add Element"
|
| 1673 |
msgstr "Añadir Elemento"
|
| 1674 |
|
| 1711 |
msgid "Don't Use"
|
| 1712 |
msgstr "No usar"
|
| 1713 |
|
| 1714 |
+
#: ../ui/panels/processors.php:126
|
| 1715 |
+
msgid "Add Conditional Group"
|
| 1716 |
+
msgstr "Añadir grupo condicional"
|
| 1717 |
+
|
| 1718 |
#: ../ui/panels/processors.php:171
|
| 1719 |
msgid "Add Processor"
|
| 1720 |
msgstr "Añadir Procesador"
|
| 1754 |
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
| 1755 |
msgid "Entry List"
|
| 1756 |
msgstr "Lista de Entradas"
|
| 1757 |
+
|
| 1758 |
+
#~ msgid "Settings"
|
| 1759 |
+
#~ msgstr "Configuración"
|
| 1760 |
+
|
| 1761 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1762 |
+
#~ msgstr "Lista de direcciones email separadas por coma."
|
| 1763 |
+
|
| 1764 |
+
#~ msgid "Add Row"
|
| 1765 |
+
#~ msgstr "Añadir Fila"
|
languages/caldera-forms-fr_FR.mo
CHANGED
|
Binary file
|
languages/caldera-forms-fr_FR.po
CHANGED
|
@@ -1,446 +1,479 @@
|
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
-
"POT-Creation-Date: 2015-
|
| 5 |
-
"PO-Revision-Date: 2015-
|
| 6 |
"Last-Translator: David Cramer <david@caldera.co.za>\n"
|
| 7 |
"Language-Team: Tricodia Systems <david@digilab.co.za>\n"
|
| 8 |
"Language: fr\n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
-
"X-Generator: Poedit 1.
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
-
#: ../classes/
|
| 20 |
-
|
|
|
|
|
|
|
|
|
|
| 21 |
msgid "Invalid Form."
|
| 22 |
-
msgstr "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 23 |
|
| 24 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
#: ../ui/entries_toolbar.php:27
|
| 26 |
msgid "Trash"
|
| 27 |
msgstr "Corbeille"
|
| 28 |
|
| 29 |
-
#: ../classes/admin.php:
|
| 30 |
#: ../ui/admin_templates.php:9
|
| 31 |
msgid "Restore"
|
| 32 |
-
msgstr "
|
| 33 |
|
| 34 |
-
#: ../classes/admin.php:
|
| 35 |
msgid "Entry"
|
| 36 |
msgstr "Donnée"
|
| 37 |
|
| 38 |
-
#: ../classes/admin.php:
|
| 39 |
msgid "View"
|
| 40 |
msgstr "Voir"
|
| 41 |
|
| 42 |
-
#: ../classes/admin.php:
|
| 43 |
msgid "Add Form to Page"
|
| 44 |
msgstr "Ajouter le formulaire à la page"
|
| 45 |
|
| 46 |
-
#: ../classes/admin.php:
|
| 47 |
msgid "Insert Form Shortcode"
|
| 48 |
-
msgstr "Insérer
|
| 49 |
|
| 50 |
-
#: ../classes/admin.php:
|
| 51 |
msgid "Caldera Form"
|
| 52 |
-
msgstr ""
|
| 53 |
|
| 54 |
-
#: ../classes/admin.php:
|
| 55 |
msgid "Deactivate"
|
| 56 |
-
msgstr ""
|
| 57 |
|
| 58 |
-
#: ../classes/admin.php:
|
| 59 |
msgid "Activate"
|
| 60 |
-
msgstr ""
|
| 61 |
|
| 62 |
-
#: ../classes/admin.php:
|
| 63 |
-
#: ../classes/admin.php:
|
| 64 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 65 |
-
#: ../ui/community.php:5 ../ui/edit.php:
|
| 66 |
msgid "Caldera Forms"
|
| 67 |
-
msgstr ""
|
| 68 |
|
| 69 |
-
#: ../classes/admin.php:
|
| 70 |
msgid "Caldera Forms Admin"
|
| 71 |
msgstr "Notification de Caldera Forms"
|
| 72 |
|
| 73 |
-
#: ../classes/admin.php:
|
| 74 |
msgid "Forms"
|
| 75 |
-
msgstr "
|
| 76 |
|
| 77 |
-
#: ../classes/admin.php:
|
| 78 |
msgid "Community"
|
| 79 |
msgstr "Communauté"
|
| 80 |
|
| 81 |
-
#: ../classes/admin.php:
|
| 82 |
msgid "Extend"
|
| 83 |
-
msgstr "
|
| 84 |
|
| 85 |
-
#: ../classes/admin.php:
|
| 86 |
msgid "Sorry, please try again"
|
| 87 |
-
msgstr "Désolé, essayer plus tard"
|
| 88 |
|
| 89 |
-
#: ../classes/admin.php:
|
| 90 |
msgid "Form Delete Error"
|
| 91 |
msgstr "Erreur lors de la suppression du formulaire"
|
| 92 |
|
| 93 |
-
#: ../classes/admin.php:
|
| 94 |
msgid "Sorry, File is not valid."
|
| 95 |
msgstr "Désolé, le fichier n'est pas valide."
|
| 96 |
|
| 97 |
-
#: ../classes/admin.php:
|
| 98 |
-
#: ../classes/admin.php:
|
| 99 |
msgid "Form Import Error"
|
| 100 |
msgstr "Erreur lors de l'importation du formulaire"
|
| 101 |
|
| 102 |
-
#: ../classes/admin.php:
|
| 103 |
msgid "Sorry, File not uploaded."
|
| 104 |
msgstr "Désolé, le fichier n'a pas été envoyé."
|
| 105 |
|
| 106 |
-
#: ../classes/admin.php:
|
| 107 |
msgid "Form does not exist."
|
| 108 |
msgstr "Le formulaire n'existe pas."
|
| 109 |
|
| 110 |
-
#: ../classes/admin.php:
|
| 111 |
msgid "Export selection has expired"
|
| 112 |
-
msgstr ""
|
| 113 |
|
| 114 |
-
#: ../classes/admin.php:
|
| 115 |
msgid "Export Expired"
|
| 116 |
-
msgstr ""
|
| 117 |
|
| 118 |
-
#: ../classes/admin.php:
|
| 119 |
-
#, fuzzy
|
| 120 |
msgid "Form has been successfully submitted. Thank you."
|
| 121 |
-
msgstr "Le formulaire a été envoyé."
|
| 122 |
|
| 123 |
-
#: ../classes/admin.php:
|
| 124 |
msgid "Layout"
|
| 125 |
msgstr "Disposition"
|
| 126 |
|
| 127 |
-
#: ../classes/admin.php:
|
| 128 |
msgid "Layout Builder"
|
| 129 |
-
msgstr ""
|
| 130 |
|
| 131 |
-
#: ../classes/admin.php:
|
| 132 |
msgid "Pages"
|
| 133 |
msgstr "Pages"
|
| 134 |
|
| 135 |
-
#: ../classes/admin.php:
|
| 136 |
msgid "Form Pages"
|
| 137 |
msgstr "Pages de formulaire"
|
| 138 |
|
| 139 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 140 |
msgid "Processors"
|
| 141 |
-
msgstr ""
|
| 142 |
|
| 143 |
-
#: ../classes/admin.php:
|
| 144 |
msgid "Form Processors"
|
| 145 |
-
msgstr ""
|
| 146 |
|
| 147 |
-
#: ../classes/admin.php:
|
| 148 |
#: ../ui/panels/variables.php:83
|
| 149 |
msgid "Variables"
|
| 150 |
msgstr "Variables"
|
| 151 |
|
| 152 |
-
#: ../classes/admin.php:
|
| 153 |
msgid "Responsive"
|
| 154 |
msgstr "Responsive"
|
| 155 |
|
| 156 |
-
#: ../classes/admin.php:
|
| 157 |
msgid "Resposive Settings"
|
| 158 |
msgstr "Réglage du \"Responsive\""
|
| 159 |
|
| 160 |
-
#: ../classes/admin.php:
|
| 161 |
msgid "Grid Collapse"
|
| 162 |
msgstr "Redimensionnement des grilles"
|
| 163 |
|
| 164 |
-
#: ../classes/admin.php:
|
| 165 |
msgid ""
|
| 166 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 167 |
"Bootstrap 3.0)"
|
| 168 |
msgstr ""
|
|
|
|
|
|
|
| 169 |
|
| 170 |
-
#: ../classes/admin.php:
|
| 171 |
msgid "Maintain grid always"
|
| 172 |
msgstr "Ne pas redimmensionner les grilles"
|
| 173 |
|
| 174 |
-
#: ../classes/admin.php:
|
| 175 |
msgid "Mailer"
|
| 176 |
-
msgstr ""
|
| 177 |
|
| 178 |
-
#: ../classes/admin.php:
|
| 179 |
msgid "Email Notification Settings"
|
| 180 |
-
msgstr "
|
| 181 |
|
| 182 |
-
#: ../classes/core.php:
|
| 183 |
-
#, fuzzy
|
| 184 |
msgid "The wasn't entered correct."
|
| 185 |
msgstr "Le reCAPTCHA est incorrect."
|
| 186 |
|
| 187 |
-
#: ../classes/core.php:
|
| 188 |
msgid "Reset"
|
| 189 |
-
msgstr ""
|
| 190 |
|
| 191 |
-
#: ../classes/core.php:
|
| 192 |
msgid "Permission denied."
|
| 193 |
-
msgstr "Autorisation
|
| 194 |
|
| 195 |
-
#: ../classes/core.php:
|
| 196 |
-
msgid "Caldera Forms Notification"
|
| 197 |
-
msgstr "Notification de Caldera Forms"
|
| 198 |
-
|
| 199 |
-
#: ../classes/core.php:973
|
| 200 |
msgid "Auto Responder"
|
| 201 |
-
msgstr "
|
| 202 |
|
| 203 |
-
#: ../classes/core.php:
|
| 204 |
msgid "Sends out an auto response e-mail"
|
| 205 |
-
msgstr "Envoie une réponse automatique"
|
| 206 |
|
| 207 |
-
#: ../classes/core.php:
|
| 208 |
msgid "Thank you for contacting us"
|
| 209 |
-
msgstr "Merci de nous avoir
|
| 210 |
|
| 211 |
-
#: ../classes/core.php:
|
| 212 |
msgid "Redirect"
|
| 213 |
msgstr "Redirection"
|
| 214 |
|
| 215 |
-
#: ../classes/core.php:
|
| 216 |
msgid "Redirects user to URL on successful submit"
|
| 217 |
-
msgstr "Redirige l'utilisateur vers l'URL après
|
| 218 |
|
| 219 |
-
#: ../classes/core.php:
|
| 220 |
msgid "Increment Value"
|
| 221 |
-
msgstr ""
|
| 222 |
|
| 223 |
-
#: ../classes/core.php:
|
| 224 |
msgid "Increment a value per entry."
|
| 225 |
-
msgstr ""
|
| 226 |
|
| 227 |
-
#: ../classes/core.php:
|
| 228 |
msgid "Akismet"
|
| 229 |
-
msgstr ""
|
| 230 |
|
| 231 |
-
#: ../classes/core.php:
|
| 232 |
msgid "Anti-spam filtering"
|
| 233 |
-
msgstr ""
|
| 234 |
|
| 235 |
-
#: ../classes/core.php:
|
| 236 |
msgid "Akismet not setup."
|
| 237 |
-
msgstr ""
|
| 238 |
|
| 239 |
-
#: ../classes/core.php:
|
| 240 |
msgid "Calculation"
|
| 241 |
msgstr "Calcul"
|
| 242 |
|
| 243 |
-
#: ../classes/core.php:
|
| 244 |
-
#: ../classes/core.php:
|
| 245 |
msgid "Special"
|
| 246 |
msgstr "Spécial"
|
| 247 |
|
| 248 |
-
#: ../classes/core.php:
|
| 249 |
msgid "Math"
|
| 250 |
-
msgstr ""
|
| 251 |
|
| 252 |
-
#: ../classes/core.php:
|
| 253 |
msgid "Calculate values"
|
| 254 |
msgstr "Calculer les valeurs"
|
| 255 |
|
| 256 |
-
#: ../classes/core.php:
|
| 257 |
msgid "Total"
|
| 258 |
msgstr "Total"
|
| 259 |
|
| 260 |
-
#: ../classes/core.php:
|
| 261 |
msgid "Range Slider"
|
| 262 |
-
msgstr ""
|
| 263 |
|
| 264 |
-
#: ../classes/core.php:
|
| 265 |
msgid "Range Slider input field"
|
| 266 |
-
msgstr ""
|
| 267 |
|
| 268 |
-
#: ../classes/core.php:
|
| 269 |
msgid "Star Rating"
|
| 270 |
-
msgstr ""
|
| 271 |
|
| 272 |
-
#: ../classes/core.php:
|
| 273 |
msgid "Feedback"
|
| 274 |
-
msgstr ""
|
| 275 |
|
| 276 |
-
#: ../classes/core.php:
|
| 277 |
msgid "Star rating input for feedback"
|
| 278 |
-
msgstr ""
|
| 279 |
|
| 280 |
-
#: ../classes/core.php:
|
| 281 |
msgid "Phone Number"
|
| 282 |
msgstr "Numéro de téléphone"
|
| 283 |
|
| 284 |
-
#: ../classes/core.php:
|
| 285 |
msgid "Phone number with masking"
|
| 286 |
-
msgstr "Numéro de téléphone (avec
|
| 287 |
|
| 288 |
-
#: ../classes/core.php:
|
| 289 |
-
#: ../classes/core.php:
|
| 290 |
-
#: ../classes/core.php:
|
| 291 |
msgid "Text Fields"
|
| 292 |
-
msgstr "Champ"
|
| 293 |
-
|
| 294 |
-
#: ../classes/core.php:1262 ../classes/core.php:1284 ../classes/core.php:1299
|
| 295 |
-
#: ../classes/core.php:1353 ../classes/core.php:1369 ../classes/core.php:1390
|
| 296 |
-
#: ../classes/core.php:1400 ../classes/core.php:1441 ../classes/core.php:1460
|
| 297 |
-
#: ../classes/core.php:1479 ../classes/core.php:1552 ../ui/edit.php:170
|
| 298 |
-
msgid "Basic"
|
| 299 |
-
msgstr ""
|
| 300 |
|
| 301 |
-
#: ../classes/core.php:
|
| 302 |
msgid "User"
|
| 303 |
-
msgstr ""
|
| 304 |
|
| 305 |
-
#: ../classes/core.php:
|
| 306 |
msgid "Single Line Text"
|
| 307 |
-
msgstr "
|
| 308 |
|
| 309 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 310 |
msgid "File"
|
| 311 |
-
msgstr ""
|
| 312 |
|
| 313 |
-
#: ../classes/core.php:
|
| 314 |
msgid "File Uploader"
|
| 315 |
-
msgstr ""
|
| 316 |
|
| 317 |
-
#: ../classes/core.php:
|
| 318 |
msgid "reCAPTCHA"
|
| 319 |
-
msgstr ""
|
| 320 |
|
| 321 |
-
#: ../classes/core.php:
|
| 322 |
msgid "reCAPTCHA anti-spam field"
|
| 323 |
-
msgstr ""
|
| 324 |
|
| 325 |
-
#: ../classes/core.php:
|
| 326 |
msgid "HTML"
|
| 327 |
-
msgstr ""
|
| 328 |
|
| 329 |
-
#: ../classes/core.php:
|
| 330 |
msgid "Add text/html content"
|
| 331 |
msgstr "Ajouter un contenu text/html"
|
| 332 |
|
| 333 |
-
#: ../classes/core.php:
|
| 334 |
#: ../processors/akismet/config.php:20
|
| 335 |
msgid "Content"
|
| 336 |
msgstr "Contenu"
|
| 337 |
|
| 338 |
-
#: ../classes/core.php:
|
| 339 |
msgid "Hidden"
|
| 340 |
msgstr "Caché"
|
| 341 |
|
| 342 |
-
#: ../classes/core.php:
|
| 343 |
msgid "Button"
|
| 344 |
-
msgstr ""
|
| 345 |
|
| 346 |
-
#: ../classes/core.php:
|
| 347 |
msgid "Button, Submit and Reset types"
|
| 348 |
-
msgstr ""
|
| 349 |
|
| 350 |
-
#: ../classes/core.php:
|
| 351 |
msgid "Buttons"
|
| 352 |
-
msgstr ""
|
| 353 |
|
| 354 |
-
#: ../classes/core.php:
|
| 355 |
msgid "Email Address"
|
| 356 |
-
msgstr "Adresse
|
| 357 |
|
| 358 |
-
#: ../classes/core.php:
|
| 359 |
msgid "Paragraph Textarea"
|
| 360 |
msgstr "Zone de texte"
|
| 361 |
|
| 362 |
-
#: ../classes/core.php:
|
| 363 |
msgid "Toggle Switch"
|
| 364 |
-
msgstr ""
|
| 365 |
|
| 366 |
-
#: ../classes/core.php:
|
| 367 |
-
#: ../classes/core.php:
|
| 368 |
msgid "Select Options"
|
| 369 |
-
msgstr ""
|
| 370 |
|
| 371 |
-
#: ../classes/core.php:
|
| 372 |
msgid "Dropdown Select"
|
| 373 |
-
msgstr ""
|
| 374 |
|
| 375 |
-
#: ../classes/core.php:
|
| 376 |
msgid "Checkbox"
|
| 377 |
-
msgstr ""
|
| 378 |
|
| 379 |
-
#: ../classes/core.php:
|
| 380 |
msgid "Radio"
|
| 381 |
-
msgstr ""
|
| 382 |
|
| 383 |
-
#: ../classes/core.php:
|
| 384 |
msgid "Date Picker"
|
| 385 |
-
msgstr ""
|
| 386 |
|
| 387 |
-
#: ../classes/core.php:
|
| 388 |
msgid "Pickers"
|
| 389 |
-
msgstr ""
|
| 390 |
|
| 391 |
-
#: ../classes/core.php:
|
| 392 |
msgid "Color Picker"
|
| 393 |
-
msgstr ""
|
| 394 |
|
| 395 |
-
#: ../classes/core.php:
|
| 396 |
msgid "State/ Province Select"
|
| 397 |
-
msgstr ""
|
| 398 |
|
| 399 |
-
#: ../classes/core.php:
|
| 400 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 401 |
-
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
| 402 |
|
| 403 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 404 |
msgid "System Tags"
|
| 405 |
-
msgstr ""
|
| 406 |
|
| 407 |
-
#: ../classes/core.php:
|
| 408 |
msgid "Mailer Debug"
|
| 409 |
-
msgstr ""
|
| 410 |
|
| 411 |
-
#: ../classes/core.php:
|
| 412 |
msgid "Invalid form ID"
|
| 413 |
-
msgstr ""
|
| 414 |
|
| 415 |
-
#: ../classes/core.php:
|
| 416 |
-
#: ../classes/core.php:
|
| 417 |
-
#: ../classes/core.php:
|
| 418 |
msgid "Permission denied or entry does not exist."
|
| 419 |
msgstr "Accés refusé ou donnée inexistante."
|
| 420 |
|
| 421 |
-
#: ../classes/core.php:
|
| 422 |
msgid "is required"
|
| 423 |
msgstr "est requis"
|
| 424 |
|
| 425 |
-
#: ../classes/core.php:
|
| 426 |
msgid "Form is currently not active."
|
| 427 |
-
msgstr ""
|
| 428 |
|
| 429 |
-
#: ../classes/core.php:
|
| 430 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 431 |
msgstr ""
|
|
|
|
|
|
|
| 432 |
|
| 433 |
#: ../classes/widget.php:43
|
| 434 |
msgid "Title"
|
| 435 |
msgstr "Titre"
|
| 436 |
|
| 437 |
-
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:
|
| 438 |
msgid "Form"
|
| 439 |
msgstr "Formulaire"
|
| 440 |
|
| 441 |
#: ../fields/button/config_template.php:2
|
| 442 |
msgid "Type"
|
| 443 |
-
msgstr ""
|
| 444 |
|
| 445 |
#: ../fields/button/config_template.php:5
|
| 446 |
msgid "Submit"
|
|
@@ -448,15 +481,15 @@ msgstr "Date d'envoi"
|
|
| 448 |
|
| 449 |
#: ../fields/button/config_template.php:7
|
| 450 |
msgid "Next Page"
|
| 451 |
-
msgstr "Page"
|
| 452 |
|
| 453 |
#: ../fields/button/config_template.php:8
|
| 454 |
msgid "Previous Page"
|
| 455 |
-
msgstr ""
|
| 456 |
|
| 457 |
#: ../fields/button/config_template.php:14
|
| 458 |
msgid "Class"
|
| 459 |
-
msgstr "
|
| 460 |
|
| 461 |
#: ../fields/calculation/config.php:2
|
| 462 |
msgid "Element"
|
|
@@ -480,29 +513,28 @@ msgstr "Format monétaire"
|
|
| 480 |
|
| 481 |
#: ../fields/calculation/config.php:32
|
| 482 |
msgid "Separator"
|
| 483 |
-
msgstr ""
|
| 484 |
|
| 485 |
#: ../fields/calculation/config.php:35
|
| 486 |
msgid "Setup a custom thousand separator. e.g 10,000.00 or 10.000.00"
|
| 487 |
-
msgstr ""
|
| 488 |
|
| 489 |
#: ../fields/calculation/config.php:41
|
| 490 |
msgid "Manual Formula"
|
| 491 |
-
msgstr ""
|
| 492 |
|
| 493 |
#: ../fields/calculation/config.php:54
|
| 494 |
msgid "Add Operator Group"
|
| 495 |
-
msgstr ""
|
| 496 |
|
| 497 |
#: ../fields/calculation/config.php:63
|
| 498 |
-
#, fuzzy
|
| 499 |
msgid "Use %field_slug% as field value variables"
|
| 500 |
-
msgstr "Utiliser %field_slug%
|
| 501 |
|
| 502 |
#: ../fields/checkbox/config_template.php:3
|
| 503 |
#: ../fields/radio/config_template.php:4
|
| 504 |
msgid "Inline"
|
| 505 |
-
msgstr ""
|
| 506 |
|
| 507 |
#: ../fields/color_picker/setup.php:2 ../fields/date_picker/setup.php:2
|
| 508 |
#: ../fields/email/config.php:8 ../fields/paragraph/config_template.php:14
|
|
@@ -513,177 +545,194 @@ msgstr "Défaut"
|
|
| 513 |
|
| 514 |
#: ../fields/color_picker/setup.php:2
|
| 515 |
msgid "Color"
|
| 516 |
-
msgstr ""
|
| 517 |
|
| 518 |
#: ../fields/date_picker/setup.php:8
|
| 519 |
msgid "Format"
|
| 520 |
-
msgstr "
|
| 521 |
|
| 522 |
#: ../fields/date_picker/setup.php:14
|
| 523 |
msgid "Autoclose"
|
| 524 |
-
msgstr ""
|
| 525 |
|
| 526 |
#: ../fields/date_picker/setup.php:16
|
| 527 |
msgid "Enable autoclose"
|
| 528 |
-
msgstr ""
|
| 529 |
|
| 530 |
#: ../fields/date_picker/setup.php:17
|
| 531 |
msgid ""
|
| 532 |
"If enabled, the date picker will automatically close after selecting the "
|
| 533 |
"final input"
|
| 534 |
msgstr ""
|
|
|
|
|
|
|
| 535 |
|
| 536 |
#: ../fields/date_picker/setup.php:21
|
| 537 |
msgid "Start View"
|
| 538 |
-
msgstr ""
|
| 539 |
|
| 540 |
#: ../fields/date_picker/setup.php:24
|
| 541 |
-
#, fuzzy
|
| 542 |
msgid "Month (Default)"
|
| 543 |
-
msgstr "
|
| 544 |
|
| 545 |
#: ../fields/date_picker/setup.php:25
|
| 546 |
msgid "Year"
|
| 547 |
-
msgstr ""
|
| 548 |
|
| 549 |
#: ../fields/date_picker/setup.php:26
|
| 550 |
msgid "Decade"
|
| 551 |
-
msgstr ""
|
| 552 |
|
| 553 |
#: ../fields/date_picker/setup.php:28
|
| 554 |
msgid "The starting view of the date picker (month, year, decade)"
|
| 555 |
-
msgstr ""
|
| 556 |
|
| 557 |
#: ../fields/date_picker/setup.php:32
|
| 558 |
-
msgid "
|
| 559 |
msgstr ""
|
| 560 |
|
| 561 |
-
#: ../fields/date_picker/setup.php:
|
| 562 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 563 |
msgstr ""
|
| 564 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 565 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 566 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 567 |
-
#: ../fields/text/config.php:2
|
| 568 |
msgid "Placeholder"
|
| 569 |
-
msgstr ""
|
| 570 |
|
| 571 |
#: ../fields/file/config_template.php:2
|
| 572 |
msgid "Attach to mailer"
|
| 573 |
-
msgstr ""
|
| 574 |
|
| 575 |
#: ../fields/file/config_template.php:9
|
|
|
|
|
|
|
|
|
|
|
|
|
| 576 |
msgid "Allowed Types"
|
| 577 |
-
msgstr "
|
| 578 |
|
| 579 |
-
#: ../fields/file/config_template.php:
|
| 580 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 581 |
-
msgstr "Séparés par des virgules,
|
| 582 |
|
| 583 |
#: ../fields/gravatar/config.php:2
|
| 584 |
-
#, fuzzy
|
| 585 |
msgid "Email Field"
|
| 586 |
-
msgstr "
|
| 587 |
|
| 588 |
#: ../fields/gravatar/config.php:10
|
| 589 |
msgid "Mystery Man"
|
| 590 |
-
msgstr ""
|
| 591 |
|
| 592 |
#: ../fields/gravatar/config.php:11
|
| 593 |
msgid "Blank"
|
| 594 |
-
msgstr ""
|
| 595 |
|
| 596 |
#: ../fields/gravatar/config.php:12
|
| 597 |
msgid "Gravatar Logo"
|
| 598 |
-
msgstr ""
|
| 599 |
|
| 600 |
#: ../fields/gravatar/config.php:13
|
| 601 |
msgid "Identicon (Generated)"
|
| 602 |
-
msgstr ""
|
| 603 |
|
| 604 |
#: ../fields/gravatar/config.php:14
|
| 605 |
msgid "Wavatar (Generated)"
|
| 606 |
-
msgstr ""
|
| 607 |
|
| 608 |
#: ../fields/gravatar/config.php:15
|
| 609 |
msgid "MonsterID (Generated)"
|
| 610 |
-
msgstr ""
|
| 611 |
|
| 612 |
#: ../fields/gravatar/config.php:16
|
| 613 |
msgid "Retro (Generated)"
|
| 614 |
-
msgstr ""
|
| 615 |
|
| 616 |
#: ../fields/gravatar/config.php:21
|
| 617 |
msgid "Fallback"
|
| 618 |
-
msgstr ""
|
| 619 |
|
| 620 |
#: ../fields/gravatar/config.php:35
|
| 621 |
msgid "Size"
|
| 622 |
-
msgstr ""
|
| 623 |
|
| 624 |
#: ../fields/gravatar/config.php:42
|
| 625 |
-
#, fuzzy
|
| 626 |
msgid "Border Color"
|
| 627 |
-
msgstr "
|
| 628 |
|
| 629 |
#: ../fields/gravatar/config.php:49
|
| 630 |
-
#, fuzzy
|
| 631 |
msgid "Border Size"
|
| 632 |
-
msgstr "
|
| 633 |
|
| 634 |
#: ../fields/gravatar/config.php:56
|
| 635 |
-
#, fuzzy
|
| 636 |
msgid "Border Radius"
|
| 637 |
-
msgstr "
|
| 638 |
|
| 639 |
-
#: ../fields/hidden/setup.php:2 ../ui/edit.php:
|
| 640 |
#: ../ui/panels/variables.php:12
|
| 641 |
msgid "Value"
|
| 642 |
msgstr "Valeur"
|
| 643 |
|
| 644 |
#: ../fields/paragraph/config_template.php:8
|
| 645 |
msgid "Rows"
|
| 646 |
-
msgstr ""
|
| 647 |
|
| 648 |
#: ../fields/phone/config.php:14
|
| 649 |
msgid "Style"
|
| 650 |
-
msgstr ""
|
| 651 |
|
| 652 |
#: ../fields/phone/config.php:16
|
| 653 |
msgid "Local"
|
| 654 |
-
msgstr ""
|
| 655 |
|
| 656 |
#: ../fields/phone/config.php:18
|
| 657 |
msgid "International"
|
| 658 |
-
msgstr ""
|
| 659 |
|
| 660 |
#: ../fields/phone/config.php:20
|
| 661 |
msgid "Custom"
|
| 662 |
-
msgstr ""
|
| 663 |
|
| 664 |
#: ../fields/phone/config.php:22
|
| 665 |
msgid "Use the digit 9 to indicate a number"
|
| 666 |
-
msgstr ""
|
| 667 |
|
| 668 |
#: ../fields/range_slider/config.php:17
|
| 669 |
msgid "Track"
|
| 670 |
-
msgstr ""
|
| 671 |
|
| 672 |
-
#: ../fields/range_slider/config.php:23
|
| 673 |
msgid "Highlight"
|
| 674 |
-
msgstr ""
|
| 675 |
|
| 676 |
#: ../fields/range_slider/config.php:29
|
| 677 |
msgid "Handle"
|
| 678 |
-
msgstr ""
|
| 679 |
|
| 680 |
-
#: ../fields/range_slider/config.php:35
|
| 681 |
msgid "Border"
|
| 682 |
msgstr "Bordure"
|
| 683 |
|
| 684 |
#: ../fields/range_slider/config.php:42
|
| 685 |
msgid "Steps"
|
| 686 |
-
msgstr ""
|
| 687 |
|
| 688 |
#: ../fields/range_slider/config.php:48
|
| 689 |
msgid "Minimum"
|
|
@@ -707,16 +756,15 @@ msgstr "Suffixe"
|
|
| 707 |
|
| 708 |
#: ../fields/recaptcha/config.php:1
|
| 709 |
msgid "reCaptcha required keys from Google."
|
| 710 |
-
msgstr ""
|
| 711 |
|
| 712 |
#: ../fields/recaptcha/config.php:3
|
| 713 |
-
#, fuzzy
|
| 714 |
msgid "Site Key"
|
| 715 |
-
msgstr "Clé
|
| 716 |
|
| 717 |
#: ../fields/recaptcha/config.php:9
|
| 718 |
msgid "Secret Key"
|
| 719 |
-
msgstr ""
|
| 720 |
|
| 721 |
#: ../fields/recaptcha/config.php:15
|
| 722 |
msgid "Theme"
|
|
@@ -724,189 +772,203 @@ msgstr "Thème"
|
|
| 724 |
|
| 725 |
#: ../fields/recaptcha/config.php:18
|
| 726 |
msgid "Light"
|
| 727 |
-
msgstr ""
|
| 728 |
|
| 729 |
#: ../fields/recaptcha/config.php:19
|
| 730 |
msgid "Dark"
|
| 731 |
-
msgstr ""
|
| 732 |
|
| 733 |
#: ../fields/recaptcha/config.php:21
|
| 734 |
msgid ""
|
| 735 |
"Theme changes not available in preview. Update form and reload to see new "
|
| 736 |
"theme."
|
| 737 |
msgstr ""
|
|
|
|
|
|
|
| 738 |
|
| 739 |
#: ../fields/recaptcha/preview.php:20
|
| 740 |
msgid "No Secret Key Added"
|
| 741 |
-
msgstr ""
|
| 742 |
|
| 743 |
#: ../fields/recaptcha/preview.php:23
|
| 744 |
msgid "No Site Key Added"
|
| 745 |
-
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 746 |
|
| 747 |
#: ../fields/star-rate/config.php:2
|
| 748 |
msgid "Number of Stars"
|
| 749 |
-
msgstr ""
|
| 750 |
|
| 751 |
#: ../fields/star-rate/config.php:8
|
| 752 |
msgid "Star Type"
|
| 753 |
-
msgstr ""
|
| 754 |
|
| 755 |
#: ../fields/star-rate/config.php:11
|
| 756 |
msgid "Star"
|
| 757 |
-
msgstr ""
|
| 758 |
|
| 759 |
#: ../fields/star-rate/config.php:12
|
| 760 |
msgid "Heart"
|
| 761 |
-
msgstr ""
|
| 762 |
|
| 763 |
#: ../fields/star-rate/config.php:13
|
| 764 |
msgid "Face"
|
| 765 |
-
msgstr ""
|
| 766 |
|
| 767 |
#: ../fields/star-rate/config.php:14
|
| 768 |
msgid "Dot"
|
| 769 |
-
msgstr ""
|
| 770 |
|
| 771 |
#: ../fields/star-rate/config.php:19
|
| 772 |
msgid "Star Size"
|
| 773 |
-
msgstr ""
|
| 774 |
|
| 775 |
#: ../fields/star-rate/config.php:25
|
| 776 |
msgid "Star Spacing"
|
| 777 |
-
msgstr ""
|
| 778 |
|
| 779 |
#: ../fields/star-rate/config.php:31
|
| 780 |
msgid "Single Select"
|
| 781 |
-
msgstr ""
|
| 782 |
|
| 783 |
#: ../fields/star-rate/config.php:38
|
| 784 |
msgid "Star Color"
|
| 785 |
-
msgstr ""
|
| 786 |
|
| 787 |
#: ../fields/star-rate/config.php:44
|
| 788 |
msgid "Track Color"
|
| 789 |
-
msgstr ""
|
| 790 |
|
| 791 |
#: ../fields/star-rate/config.php:50
|
| 792 |
msgid "Include Cancel"
|
| 793 |
-
msgstr ""
|
| 794 |
|
| 795 |
#: ../fields/text/config.php:15
|
| 796 |
msgid "Masked Input"
|
| 797 |
-
msgstr ""
|
| 798 |
|
| 799 |
#: ../fields/text/config.php:17
|
| 800 |
msgid "Enable input mask"
|
| 801 |
-
msgstr ""
|
| 802 |
|
| 803 |
#: ../fields/text/config.php:22
|
| 804 |
msgid "Mask"
|
| 805 |
-
msgstr ""
|
| 806 |
|
| 807 |
#: ../fields/text/config.php:30
|
| 808 |
msgid "numeric"
|
| 809 |
-
msgstr ""
|
| 810 |
|
| 811 |
#: ../fields/text/config.php:31
|
| 812 |
msgid "alphabetical"
|
| 813 |
-
msgstr ""
|
| 814 |
|
| 815 |
#: ../fields/text/config.php:32
|
| 816 |
msgid "alphanumeric"
|
| 817 |
-
msgstr ""
|
| 818 |
|
| 819 |
#: ../fields/text/config.php:33
|
| 820 |
msgid "optional"
|
| 821 |
-
msgstr ""
|
| 822 |
|
| 823 |
#: ../fields/text/config.php:34
|
| 824 |
msgid "length"
|
| 825 |
-
msgstr ""
|
| 826 |
|
| 827 |
#: ../fields/text/config.php:36
|
| 828 |
msgid "Any length character only"
|
| 829 |
-
msgstr ""
|
| 830 |
|
| 831 |
#: ../fields/text/config.php:37
|
| 832 |
msgid "Any length number only"
|
| 833 |
-
msgstr ""
|
| 834 |
|
| 835 |
#: ../fields/text/config.php:38
|
| 836 |
msgid "email"
|
| 837 |
-
msgstr ""
|
| 838 |
|
| 839 |
#: ../fields/toggle_switch/config_template.php:2
|
| 840 |
msgid "Orientation"
|
| 841 |
-
msgstr ""
|
| 842 |
|
| 843 |
#: ../fields/toggle_switch/config_template.php:5
|
| 844 |
msgid "Horizontal"
|
| 845 |
-
msgstr ""
|
| 846 |
|
| 847 |
#: ../fields/toggle_switch/config_template.php:6
|
| 848 |
msgid "Justified"
|
| 849 |
-
msgstr ""
|
| 850 |
|
| 851 |
#: ../fields/toggle_switch/config_template.php:7
|
| 852 |
msgid "Vertical"
|
| 853 |
-
msgstr ""
|
| 854 |
|
| 855 |
#: ../fields/toggle_switch/config_template.php:13
|
| 856 |
msgid "Active Class"
|
| 857 |
-
msgstr ""
|
| 858 |
|
| 859 |
#: ../fields/toggle_switch/config_template.php:20
|
| 860 |
msgid "Inactive Class"
|
| 861 |
-
msgstr ""
|
| 862 |
|
| 863 |
-
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:
|
| 864 |
-
#: ../ui/edit.php:
|
| 865 |
msgid "Enable"
|
| 866 |
msgstr "Activé"
|
| 867 |
|
| 868 |
#: ../includes/cf-ajax/plugin.php:38
|
| 869 |
msgid "Ajax Submissions"
|
| 870 |
-
msgstr ""
|
| 871 |
|
| 872 |
#: ../includes/cf-ajax/plugin.php:40
|
| 873 |
msgid "Enable Ajax Submissions. (No page reloads)"
|
| 874 |
-
msgstr ""
|
| 875 |
|
| 876 |
#: ../includes/cf-ajax/plugin.php:46
|
| 877 |
msgid "Custom Callback"
|
| 878 |
-
msgstr ""
|
| 879 |
|
| 880 |
#: ../includes/cf-ajax/plugin.php:48
|
| 881 |
msgid "Add a custom Javascript callback handlers on submission."
|
| 882 |
msgstr ""
|
|
|
|
| 883 |
|
| 884 |
#: ../includes/cf-ajax/plugin.php:55
|
| 885 |
msgid "Inhibit Notices"
|
| 886 |
-
msgstr ""
|
| 887 |
|
| 888 |
#: ../includes/cf-ajax/plugin.php:57
|
| 889 |
msgid "Don't show default alerts (success etc.)"
|
| 890 |
-
msgstr ""
|
| 891 |
|
| 892 |
#: ../includes/cf-ajax/plugin.php:63
|
| 893 |
-
#, fuzzy
|
| 894 |
msgid "Callback Function"
|
| 895 |
-
msgstr "
|
| 896 |
|
| 897 |
#: ../includes/cf-ajax/plugin.php:66
|
| 898 |
msgid ""
|
| 899 |
"Javascript function to call on submission. Passed an object containing form "
|
| 900 |
"submission result."
|
| 901 |
msgstr ""
|
|
|
|
|
|
|
| 902 |
|
| 903 |
#: ../includes/cf-ajax/plugin.php:91
|
| 904 |
msgid "Multiple Ajax Submissions"
|
| 905 |
-
msgstr ""
|
| 906 |
|
| 907 |
#: ../includes/cf-ajax/plugin.php:93
|
| 908 |
msgid "If set, form can be submitted multiple times with out a new page load."
|
| 909 |
msgstr ""
|
|
|
|
|
|
|
| 910 |
|
| 911 |
#: ../includes/cf-ajax/plugin.php:147 ../includes/cf-ajax/plugin.php:158
|
| 912 |
#: ../processors/redirect/config.php:10
|
|
@@ -915,23 +977,22 @@ msgstr "Redirection"
|
|
| 915 |
|
| 916 |
#: ../includes/custom_field_class.php:21
|
| 917 |
msgid "Custom Class"
|
| 918 |
-
msgstr ""
|
| 919 |
|
| 920 |
-
#: ../includes/field_processors.php:
|
| 921 |
msgid "File type not allowed. Allowed types are: "
|
| 922 |
msgstr "Type de fichier non autorisé. Les types autorisés sont :"
|
| 923 |
|
| 924 |
-
#: ../includes/field_processors.php:
|
| 925 |
msgid "File type needs to be"
|
| 926 |
msgstr "Les types de fichier doivent être"
|
| 927 |
|
| 928 |
-
#: ../processors/akismet/config.php:2 ../ui/edit.php:
|
| 929 |
-
#: ../ui/panels/variables.php:10
|
| 930 |
msgid "Name"
|
| 931 |
msgstr "Nom"
|
| 932 |
|
| 933 |
#: ../processors/akismet/config.php:8
|
| 934 |
-
#, fuzzy
|
| 935 |
msgid "Email"
|
| 936 |
msgstr "De"
|
| 937 |
|
|
@@ -940,13 +1001,12 @@ msgid "URL"
|
|
| 940 |
msgstr "URL"
|
| 941 |
|
| 942 |
#: ../processors/akismet/config.php:27
|
| 943 |
-
#, fuzzy
|
| 944 |
msgid "Error Message"
|
| 945 |
-
msgstr "Message"
|
| 946 |
|
| 947 |
#: ../processors/akismet/config.php:29
|
| 948 |
msgid "Sorry, that looked very spammy, try rephrasing things"
|
| 949 |
-
msgstr ""
|
| 950 |
|
| 951 |
#: ../processors/auto_responder/config.php:2 ../ui/panels/emailer.php:42
|
| 952 |
msgid "From Name"
|
|
@@ -962,49 +1022,56 @@ msgstr "Sujet"
|
|
| 962 |
|
| 963 |
#: ../processors/auto_responder/config.php:20
|
| 964 |
msgid "Recipient Name"
|
| 965 |
-
msgstr ""
|
| 966 |
|
| 967 |
#: ../processors/auto_responder/config.php:26
|
| 968 |
msgid "Recipient Email"
|
| 969 |
-
msgstr ""
|
| 970 |
|
| 971 |
#: ../processors/auto_responder/config.php:32
|
| 972 |
msgid "Message"
|
| 973 |
msgstr "Message"
|
| 974 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 975 |
#: ../processors/increment/config.php:2
|
| 976 |
msgid "Increment Start"
|
| 977 |
-
msgstr ""
|
| 978 |
|
| 979 |
#: ../processors/increment/config.php:6
|
| 980 |
msgid "Number to start incrementing."
|
| 981 |
-
msgstr ""
|
| 982 |
|
| 983 |
#: ../processors/increment/config.php:8
|
| 984 |
msgid ""
|
| 985 |
"Incremenets started at {{start}}. to reset, delete this and insert a new "
|
| 986 |
"increment processor."
|
| 987 |
msgstr ""
|
|
|
|
|
|
|
| 988 |
|
| 989 |
#: ../processors/increment/config.php:14
|
| 990 |
-
#, fuzzy
|
| 991 |
msgid "Increment Field"
|
| 992 |
-
msgstr "Champ"
|
| 993 |
|
| 994 |
#: ../processors/increment/config.php:17
|
| 995 |
msgid ""
|
| 996 |
"If you want to show the value in the entries, Select a Hidden field in form "
|
| 997 |
"to capture the value to."
|
| 998 |
msgstr ""
|
|
|
|
|
|
|
| 999 |
|
| 1000 |
#: ../processors/redirect/config.php:8
|
| 1001 |
-
#, fuzzy
|
| 1002 |
msgid "Redirect Message"
|
| 1003 |
-
msgstr "Redirection"
|
| 1004 |
|
| 1005 |
#: ../processors/redirect/config.php:11
|
| 1006 |
msgid "Message text shown when redirecting in Ajax mode."
|
| 1007 |
-
msgstr ""
|
| 1008 |
|
| 1009 |
#: ../ui/admin.php:26
|
| 1010 |
msgid "Create Form"
|
|
@@ -1012,7 +1079,7 @@ msgstr "Créer un formulaire"
|
|
| 1012 |
|
| 1013 |
#: ../ui/admin.php:38
|
| 1014 |
msgid "Create New Form"
|
| 1015 |
-
msgstr "
|
| 1016 |
|
| 1017 |
#: ../ui/admin.php:38
|
| 1018 |
msgid "New Form"
|
|
@@ -1020,7 +1087,7 @@ msgstr "Nouveau formulaire"
|
|
| 1020 |
|
| 1021 |
#: ../ui/admin.php:41 ../ui/admin_templates.php:33
|
| 1022 |
msgid "Import Form"
|
| 1023 |
-
msgstr "Importer un
|
| 1024 |
|
| 1025 |
#: ../ui/admin.php:41
|
| 1026 |
msgid "Import"
|
|
@@ -1028,93 +1095,97 @@ msgstr "Importer"
|
|
| 1028 |
|
| 1029 |
#: ../ui/admin.php:47
|
| 1030 |
msgid "Front-end Style Includes"
|
| 1031 |
-
msgstr ""
|
| 1032 |
|
| 1033 |
#: ../ui/admin.php:51
|
| 1034 |
msgid "Includes Bootstrap 3 styles on the frontend for form alert notices"
|
| 1035 |
msgstr ""
|
|
|
|
|
|
|
| 1036 |
|
| 1037 |
#: ../ui/admin.php:51
|
| 1038 |
msgid "Alert"
|
| 1039 |
-
msgstr "
|
| 1040 |
|
| 1041 |
#: ../ui/admin.php:52
|
| 1042 |
msgid "Includes Bootstrap 3 styles on the frontend for form fields and buttons"
|
| 1043 |
msgstr ""
|
|
|
|
|
|
|
| 1044 |
|
| 1045 |
#: ../ui/admin.php:53
|
| 1046 |
msgid "Includes Bootstrap 3 styles on the frontend for form grid layouts"
|
| 1047 |
msgstr ""
|
|
|
|
|
|
|
| 1048 |
|
| 1049 |
#: ../ui/admin.php:53
|
| 1050 |
msgid "Grid"
|
| 1051 |
msgstr "Grille"
|
| 1052 |
|
| 1053 |
-
#: ../ui/admin.php:
|
| 1054 |
msgid "Entries"
|
| 1055 |
msgstr "données"
|
| 1056 |
|
| 1057 |
-
#: ../ui/admin.php:
|
| 1058 |
#: ../ui/panels/emailer.php:35
|
| 1059 |
msgid "Disabled"
|
| 1060 |
-
msgstr "
|
| 1061 |
|
| 1062 |
-
#: ../ui/admin.php:
|
| 1063 |
msgid "Mailer Debug enabled."
|
| 1064 |
-
msgstr ""
|
| 1065 |
|
| 1066 |
-
#: ../ui/admin.php:
|
| 1067 |
msgid "Edit"
|
| 1068 |
msgstr "Modifier"
|
| 1069 |
|
| 1070 |
-
#: ../ui/admin.php:
|
| 1071 |
-
#, fuzzy
|
| 1072 |
msgid "Export"
|
| 1073 |
-
msgstr "Exporter
|
| 1074 |
|
| 1075 |
-
#: ../ui/admin.php:
|
| 1076 |
-
#, fuzzy
|
| 1077 |
msgid "Clone Form"
|
| 1078 |
-
msgstr "
|
| 1079 |
|
| 1080 |
-
#: ../ui/admin.php:
|
| 1081 |
msgid "Clone"
|
| 1082 |
-
msgstr ""
|
| 1083 |
|
| 1084 |
-
#: ../ui/admin.php:
|
| 1085 |
msgid "This will delete this form permanently. Continue?"
|
| 1086 |
msgstr ""
|
| 1087 |
-
"Cela va supprimer le formulaire
|
| 1088 |
|
| 1089 |
-
#: ../ui/admin.php:
|
| 1090 |
msgid "Delete"
|
| 1091 |
msgstr "Supprimer"
|
| 1092 |
|
| 1093 |
-
#: ../ui/admin.php:
|
| 1094 |
msgid "You don't have any forms."
|
| 1095 |
-
msgstr "Vous n'avez aucun formulaire"
|
| 1096 |
|
| 1097 |
-
#: ../ui/admin.php:
|
| 1098 |
msgid "An form name is required"
|
| 1099 |
msgstr "Un nom de formulaire est requis"
|
| 1100 |
|
| 1101 |
-
#: ../ui/admin.php:
|
| 1102 |
msgid ""
|
| 1103 |
"Looks like something is not working. Please try again a little later or post "
|
| 1104 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1105 |
"\"_blank\">support forum</a>."
|
| 1106 |
msgstr ""
|
| 1107 |
-
"Il semblerait que quelque chose ne fonctionne pas.
|
| 1108 |
"<a href=\"http://wordpress.org/support/plugin/caldera-forms\" target=\"_blank"
|
| 1109 |
"\">support</a>."
|
| 1110 |
|
| 1111 |
#: ../ui/admin_templates.php:2 ../ui/admin_templates.php:7
|
| 1112 |
msgid "Bulk Actions"
|
| 1113 |
-
msgstr ""
|
| 1114 |
|
| 1115 |
#: ../ui/admin_templates.php:3 ../ui/admin_templates.php:8
|
| 1116 |
msgid "Export Selected"
|
| 1117 |
-
msgstr ""
|
| 1118 |
|
| 1119 |
#: ../ui/admin_templates.php:4
|
| 1120 |
msgid "Move to Trash"
|
|
@@ -1124,23 +1195,21 @@ msgstr "Déplacer dans la corbeille"
|
|
| 1124 |
msgid "Delete Permanently"
|
| 1125 |
msgstr "Supprimer définitivement"
|
| 1126 |
|
| 1127 |
-
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48
|
| 1128 |
-
#: ../ui/edit.php:468
|
| 1129 |
msgid "Form Name"
|
| 1130 |
msgstr "Nom du formulaire"
|
| 1131 |
|
| 1132 |
#: ../ui/admin_templates.php:25
|
| 1133 |
-
#, fuzzy
|
| 1134 |
msgid "Form File"
|
| 1135 |
-
msgstr "
|
| 1136 |
|
| 1137 |
-
#: ../ui/admin_templates.php:54 ../ui/edit.php:
|
| 1138 |
msgid "Description"
|
| 1139 |
msgstr "Description"
|
| 1140 |
|
| 1141 |
-
#: ../ui/admin_templates.php:72 ../ui/edit.php:
|
| 1142 |
msgid "ID"
|
| 1143 |
-
msgstr ""
|
| 1144 |
|
| 1145 |
#: ../ui/admin_templates.php:73 ../ui/admin_templates.php:111
|
| 1146 |
msgid "Submitted"
|
|
@@ -1152,255 +1221,239 @@ msgstr "Aucune donnée trouvée"
|
|
| 1152 |
|
| 1153 |
#: ../ui/admin_templates.php:100
|
| 1154 |
msgid "No entries yet."
|
| 1155 |
-
msgstr "Il n'y a pas encore de
|
| 1156 |
|
| 1157 |
#: ../ui/edit.php:13
|
| 1158 |
-
#, fuzzy
|
| 1159 |
msgid "Form has successfully been submitted. Thank you."
|
| 1160 |
-
msgstr "Le formulaire a été envoyé."
|
| 1161 |
|
| 1162 |
-
#: ../ui/edit.php:
|
| 1163 |
msgid "Auto Populate"
|
| 1164 |
-
msgstr ""
|
| 1165 |
|
| 1166 |
-
#: ../ui/edit.php:
|
| 1167 |
msgid "Auto Type"
|
| 1168 |
-
msgstr ""
|
| 1169 |
|
| 1170 |
-
#: ../ui/edit.php:
|
| 1171 |
msgid "Select a source"
|
| 1172 |
msgstr "Choisir une source"
|
| 1173 |
|
| 1174 |
-
#: ../ui/edit.php:
|
| 1175 |
msgid "Post Type"
|
| 1176 |
-
msgstr ""
|
| 1177 |
|
| 1178 |
-
#: ../ui/edit.php:
|
| 1179 |
msgid "Taxonomy"
|
| 1180 |
-
msgstr ""
|
| 1181 |
|
| 1182 |
-
#: ../ui/edit.php:
|
| 1183 |
msgid "Add Option"
|
| 1184 |
msgstr "Ajouter une option"
|
| 1185 |
|
| 1186 |
-
#: ../ui/edit.php:
|
| 1187 |
msgid "Bulk Insert"
|
| 1188 |
-
msgstr ""
|
| 1189 |
|
| 1190 |
-
#: ../ui/edit.php:
|
| 1191 |
msgid "Single option per line. These replace the current list."
|
| 1192 |
-
msgstr ""
|
| 1193 |
|
| 1194 |
-
#: ../ui/edit.php:
|
| 1195 |
msgid "Insert Options"
|
| 1196 |
-
msgstr ""
|
| 1197 |
|
| 1198 |
-
#: ../ui/edit.php:
|
| 1199 |
msgid "No Default"
|
| 1200 |
-
msgstr ""
|
| 1201 |
|
| 1202 |
-
#: ../ui/edit.php:
|
| 1203 |
msgid "Show Values"
|
| 1204 |
msgstr "Montrer les valeurs"
|
| 1205 |
|
| 1206 |
-
#: ../ui/edit.php:
|
| 1207 |
msgid "Label"
|
| 1208 |
-
msgstr "
|
| 1209 |
|
| 1210 |
-
#: ../ui/edit.php:
|
| 1211 |
msgid "Elements"
|
| 1212 |
msgstr "Éléments"
|
| 1213 |
|
| 1214 |
-
#: ../ui/edit.php:
|
| 1215 |
-
msgid "Settings"
|
| 1216 |
-
msgstr "Paramètres généraux"
|
| 1217 |
-
|
| 1218 |
-
#: ../ui/edit.php:306
|
| 1219 |
-
msgid "Conditions"
|
| 1220 |
-
msgstr ""
|
| 1221 |
-
|
| 1222 |
-
#: ../ui/edit.php:313
|
| 1223 |
msgid "Element Type"
|
| 1224 |
-
msgstr ""
|
| 1225 |
|
| 1226 |
-
#: ../ui/edit.php:
|
| 1227 |
msgid "Hide Label"
|
| 1228 |
-
msgstr "Masquer le
|
| 1229 |
|
| 1230 |
-
#: ../ui/edit.php:
|
| 1231 |
msgid "Slug"
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1232 |
msgstr ""
|
| 1233 |
|
| 1234 |
-
#: ../ui/edit.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1235 |
msgid "Required"
|
| 1236 |
msgstr "Requis"
|
| 1237 |
|
| 1238 |
-
#: ../ui/edit.php:
|
| 1239 |
msgid "Show in Entry List"
|
| 1240 |
-
msgstr ""
|
| 1241 |
|
| 1242 |
-
#: ../ui/edit.php:
|
| 1243 |
msgid ""
|
| 1244 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1245 |
msgstr ""
|
|
|
|
|
|
|
| 1246 |
|
| 1247 |
-
#: ../ui/edit.php:
|
| 1248 |
msgid "Delete Element"
|
| 1249 |
msgstr "Supprimer un élément"
|
| 1250 |
|
| 1251 |
-
#: ../ui/edit.php:
|
| 1252 |
-
msgid "Show"
|
| 1253 |
-
msgstr "Afficher"
|
| 1254 |
-
|
| 1255 |
-
#: ../ui/edit.php:381
|
| 1256 |
-
msgid "Hide"
|
| 1257 |
-
msgstr "Masquer"
|
| 1258 |
-
|
| 1259 |
-
#: ../ui/edit.php:382
|
| 1260 |
-
#, fuzzy
|
| 1261 |
-
msgid "Disable"
|
| 1262 |
-
msgstr "Désactiver"
|
| 1263 |
-
|
| 1264 |
-
#: ../ui/edit.php:384 ../ui/panels/processors.php:126
|
| 1265 |
-
msgid "Add Conditional Group"
|
| 1266 |
-
msgstr ""
|
| 1267 |
-
|
| 1268 |
-
#: ../ui/edit.php:454 ../ui/edit.php:466
|
| 1269 |
msgid "General Settings"
|
| 1270 |
msgstr "Paramètres généraux"
|
| 1271 |
|
| 1272 |
-
#: ../ui/edit.php:
|
| 1273 |
msgid "Updated Successfully"
|
| 1274 |
-
msgstr ""
|
| 1275 |
|
| 1276 |
-
#: ../ui/edit.php:
|
| 1277 |
msgid "Update Form"
|
| 1278 |
msgstr "Mettre à jour le formulaire"
|
| 1279 |
|
| 1280 |
-
#: ../ui/edit.php:
|
| 1281 |
msgid "Preview Form"
|
| 1282 |
msgstr "Prévisualiser le formulaire"
|
| 1283 |
|
| 1284 |
-
#: ../ui/edit.php:
|
| 1285 |
msgid "Form Description"
|
| 1286 |
msgstr "Description du formulaire"
|
| 1287 |
|
| 1288 |
-
#: ../ui/edit.php:
|
| 1289 |
msgid "State"
|
| 1290 |
-
msgstr ""
|
| 1291 |
|
| 1292 |
-
#: ../ui/edit.php:
|
| 1293 |
msgid "Deactivate / Draft"
|
| 1294 |
-
msgstr ""
|
| 1295 |
|
| 1296 |
-
#: ../ui/edit.php:
|
| 1297 |
msgid "Capture Entries"
|
| 1298 |
msgstr "Sauvegarder les données"
|
| 1299 |
|
| 1300 |
-
#: ../ui/edit.php:
|
| 1301 |
msgid "Pin to Menu"
|
| 1302 |
msgstr "Attacher au menu"
|
| 1303 |
|
| 1304 |
-
#: ../ui/edit.php:
|
| 1305 |
msgid "View Entries"
|
| 1306 |
msgstr "Voir les données"
|
| 1307 |
|
| 1308 |
-
#: ../ui/edit.php:
|
| 1309 |
msgid "All"
|
| 1310 |
-
msgstr ""
|
| 1311 |
|
| 1312 |
-
#: ../ui/edit.php:
|
| 1313 |
msgid "Hide Form"
|
| 1314 |
-
msgstr "
|
| 1315 |
|
| 1316 |
-
#: ../ui/edit.php:
|
| 1317 |
msgid "Hide form after successful submission"
|
| 1318 |
-
msgstr "
|
| 1319 |
|
| 1320 |
-
#: ../ui/edit.php:
|
| 1321 |
-
#, fuzzy
|
| 1322 |
msgid "Honeypot"
|
| 1323 |
-
msgstr "
|
| 1324 |
|
| 1325 |
-
#: ../ui/edit.php:
|
| 1326 |
msgid "Place an invisible field to trick spambots"
|
| 1327 |
-
msgstr ""
|
| 1328 |
|
| 1329 |
-
#: ../ui/edit.php:
|
| 1330 |
msgid "Success Message"
|
| 1331 |
-
msgstr ""
|
| 1332 |
|
| 1333 |
-
#: ../ui/edit.php:
|
| 1334 |
msgid "Gravatar Field"
|
| 1335 |
-
msgstr ""
|
| 1336 |
|
| 1337 |
-
#: ../ui/edit.php:
|
| 1338 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1339 |
-
msgstr ""
|
| 1340 |
|
| 1341 |
-
#: ../ui/edit.php:
|
| 1342 |
msgid "Add New"
|
| 1343 |
msgstr "Ajouter"
|
| 1344 |
|
| 1345 |
-
#: ../ui/edit.php:
|
| 1346 |
msgid "Remove"
|
| 1347 |
msgstr "Supprimer"
|
| 1348 |
|
| 1349 |
-
#: ../ui/edit.php:
|
| 1350 |
msgid "Set Element"
|
| 1351 |
-
msgstr ""
|
| 1352 |
|
| 1353 |
-
#: ../ui/edit.php:
|
| 1354 |
msgid "No description given"
|
| 1355 |
msgstr "Pas de description"
|
| 1356 |
|
| 1357 |
-
#: ../ui/edit.php:
|
| 1358 |
msgid "or"
|
| 1359 |
msgstr "ou"
|
| 1360 |
|
| 1361 |
-
#: ../ui/edit.php:
|
| 1362 |
msgid "is"
|
| 1363 |
msgstr "est"
|
| 1364 |
|
| 1365 |
-
#: ../ui/edit.php:
|
| 1366 |
msgid "is not"
|
| 1367 |
msgstr "n'est pas"
|
| 1368 |
|
| 1369 |
-
#: ../ui/edit.php:
|
| 1370 |
msgid "is greater than"
|
| 1371 |
msgstr "est plus grand que"
|
| 1372 |
|
| 1373 |
-
#: ../ui/edit.php:
|
| 1374 |
msgid "is less than"
|
| 1375 |
msgstr "est plus petit que"
|
| 1376 |
|
| 1377 |
-
#: ../ui/edit.php:
|
| 1378 |
msgid "starts with"
|
| 1379 |
-
msgstr "commence
|
| 1380 |
|
| 1381 |
-
#: ../ui/edit.php:
|
| 1382 |
msgid "ends with"
|
| 1383 |
-
msgstr "se termine
|
| 1384 |
|
| 1385 |
-
#: ../ui/edit.php:
|
| 1386 |
msgid "contains"
|
| 1387 |
msgstr "contient"
|
| 1388 |
|
| 1389 |
-
#: ../ui/edit.php:
|
| 1390 |
msgid "Select field first"
|
| 1391 |
msgstr "Sélectionner le champ en premier"
|
| 1392 |
|
| 1393 |
-
#: ../ui/edit.php:
|
|
|
|
| 1394 |
msgid "Add Condition"
|
| 1395 |
-
msgstr ""
|
| 1396 |
|
| 1397 |
-
#: ../ui/edit.php:
|
| 1398 |
msgid "and"
|
| 1399 |
msgstr "et"
|
| 1400 |
|
| 1401 |
#: ../ui/entries_toolbar.php:15
|
| 1402 |
msgid "Active"
|
| 1403 |
-
msgstr ""
|
| 1404 |
|
| 1405 |
#: ../ui/entries_toolbar.php:31
|
| 1406 |
msgid "Export Entries"
|
|
@@ -1412,27 +1465,37 @@ msgstr "Appliquer"
|
|
| 1412 |
|
| 1413 |
#: ../ui/entry_navigation.php:23
|
| 1414 |
msgid "item"
|
| 1415 |
-
msgstr ""
|
| 1416 |
|
| 1417 |
#: ../ui/entry_navigation.php:23
|
| 1418 |
msgid "items"
|
| 1419 |
-
msgstr ""
|
| 1420 |
|
| 1421 |
#: ../ui/extend.php:23
|
| 1422 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
| 1423 |
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1424 |
|
| 1425 |
-
#: ../ui/extend.php:
|
| 1426 |
msgid "Already Installed"
|
| 1427 |
msgstr "Déjà installé"
|
| 1428 |
|
| 1429 |
#: ../ui/insert_shortcode.php:5
|
| 1430 |
msgid "Insert Caldera Form"
|
| 1431 |
-
msgstr ""
|
| 1432 |
|
| 1433 |
#: ../ui/insert_shortcode.php:24
|
| 1434 |
msgid "You don't have any forms to insert."
|
| 1435 |
-
msgstr "Vous n'avez aucun formulaire a
|
| 1436 |
|
| 1437 |
#: ../ui/insert_shortcode.php:32
|
| 1438 |
msgid "Insert Form"
|
|
@@ -1446,13 +1509,45 @@ msgstr "Fermer"
|
|
| 1446 |
msgid "Unable to connect or no extensions available."
|
| 1447 |
msgstr "Connexion impossible ou aucune extension disponible."
|
| 1448 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1449 |
#: ../ui/panels/emailer.php:36
|
| 1450 |
msgid "Enabled"
|
| 1451 |
msgstr "Activé"
|
| 1452 |
|
| 1453 |
#: ../ui/panels/emailer.php:45
|
| 1454 |
msgid "Name from which the email comes"
|
| 1455 |
-
msgstr ""
|
| 1456 |
|
| 1457 |
#: ../ui/panels/emailer.php:52
|
| 1458 |
msgid ""
|
|
@@ -1460,39 +1555,49 @@ msgid ""
|
|
| 1460 |
"form. Rather use your own email and use a form field in the \"Reply To Email"
|
| 1461 |
"\" below."
|
| 1462 |
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1463 |
|
| 1464 |
#: ../ui/panels/emailer.php:56
|
| 1465 |
msgid "Reply To Email"
|
| 1466 |
-
msgstr ""
|
| 1467 |
|
| 1468 |
#: ../ui/panels/emailer.php:59
|
| 1469 |
msgid ""
|
| 1470 |
"The email address of the person filling in the form. This will allow the "
|
| 1471 |
"email to be replied directly to the sender."
|
| 1472 |
msgstr ""
|
|
|
|
|
|
|
| 1473 |
|
| 1474 |
#: ../ui/panels/emailer.php:64
|
| 1475 |
msgid "Email Type"
|
| 1476 |
-
msgstr "Type
|
| 1477 |
|
| 1478 |
#: ../ui/panels/emailer.php:73
|
| 1479 |
msgid "CSV Include"
|
| 1480 |
-
msgstr "Inclure
|
| 1481 |
|
| 1482 |
#: ../ui/panels/emailer.php:75
|
| 1483 |
msgid "Attach a CSV version of the submission"
|
| 1484 |
-
msgstr "
|
| 1485 |
|
| 1486 |
#: ../ui/panels/emailer.php:81
|
| 1487 |
msgid "Recipients"
|
| 1488 |
-
msgstr ""
|
| 1489 |
|
| 1490 |
-
#: ../ui/panels/emailer.php:84
|
| 1491 |
-
msgid "Comma separated list of email addresses."
|
| 1492 |
-
msgstr "
|
| 1493 |
|
| 1494 |
#: ../ui/panels/emailer.php:89
|
| 1495 |
msgid "BCC"
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1496 |
msgstr ""
|
| 1497 |
|
| 1498 |
#: ../ui/panels/emailer.php:100
|
|
@@ -1501,26 +1606,25 @@ msgstr "Utiliser %field_slug% pour afficher une valeur du formulaire"
|
|
| 1501 |
|
| 1502 |
#: ../ui/panels/emailer.php:104
|
| 1503 |
msgid "Email Message"
|
| 1504 |
-
msgstr ""
|
| 1505 |
|
| 1506 |
#: ../ui/panels/emailer.php:107
|
| 1507 |
-
#, fuzzy
|
| 1508 |
msgid ""
|
| 1509 |
"Magic tags, %field_slug% are replaced with submitted data. Use {summary} to "
|
| 1510 |
"build an automatic mail based on form content. Leaving the mailer blank, "
|
| 1511 |
"will create and automatic summary."
|
| 1512 |
msgstr ""
|
| 1513 |
-
"
|
| 1514 |
-
"formulaire. Utiliser {summary} pour générer les données automatiquement
|
| 1515 |
-
"Laisser vide correspond à {summary}
|
| 1516 |
|
| 1517 |
#: ../ui/panels/emailer.php:113
|
| 1518 |
msgid "Debug Mailer"
|
| 1519 |
-
msgstr ""
|
| 1520 |
|
| 1521 |
#: ../ui/panels/emailer.php:115
|
| 1522 |
msgid "Enable email send transation log"
|
| 1523 |
-
msgstr ""
|
| 1524 |
|
| 1525 |
#: ../ui/panels/emailer.php:116
|
| 1526 |
msgid ""
|
|
@@ -1528,85 +1632,95 @@ msgid ""
|
|
| 1528 |
"log. Do not keep this enabled on production as it sends two emails for "
|
| 1529 |
"tracking."
|
| 1530 |
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1531 |
|
| 1532 |
-
#: ../ui/panels/emailer.php:
|
| 1533 |
msgid ""
|
| 1534 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1535 |
"the form submittable."
|
| 1536 |
-
msgstr "
|
|
|
|
|
|
|
| 1537 |
|
| 1538 |
#: ../ui/panels/layout.php:13
|
| 1539 |
msgid "This will remove all the fields in this row. Are you sure?"
|
| 1540 |
msgstr ""
|
| 1541 |
-
"Cela supprimera tous les champs de la ligne.
|
| 1542 |
-
"ça ?"
|
| 1543 |
|
| 1544 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1545 |
-
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:
|
| 1546 |
-
#: ../ui/panels/
|
| 1547 |
msgid "Page"
|
| 1548 |
msgstr "Page"
|
| 1549 |
|
| 1550 |
-
#: ../ui/panels/
|
| 1551 |
-
msgid "Add Row"
|
| 1552 |
-
msgstr "Ajouter une ligne"
|
| 1553 |
-
|
| 1554 |
-
#: ../ui/panels/layout_add_row.php:11
|
| 1555 |
msgid "Add Page"
|
| 1556 |
msgstr "Ajouter une page"
|
| 1557 |
|
| 1558 |
-
#: ../ui/panels/
|
| 1559 |
msgid "Drag onto the form grid below"
|
| 1560 |
-
msgstr ""
|
| 1561 |
|
| 1562 |
-
#: ../ui/panels/
|
| 1563 |
msgid "Add Element"
|
| 1564 |
msgstr "Ajouter un élément"
|
| 1565 |
|
| 1566 |
#: ../ui/panels/pages.php:2
|
| 1567 |
msgid "Progress Bar"
|
| 1568 |
-
msgstr ""
|
| 1569 |
|
| 1570 |
#: ../ui/panels/pages.php:4
|
| 1571 |
msgid "Show Breadcrumbs"
|
| 1572 |
-
msgstr ""
|
| 1573 |
|
| 1574 |
#: ../ui/panels/pages.php:5
|
| 1575 |
msgid "ProTip: Use an HTML element to build a custom progress per page"
|
| 1576 |
msgstr ""
|
|
|
|
|
|
|
| 1577 |
|
| 1578 |
#: ../ui/panels/processors.php:22 ../ui/panels/processors.php:47
|
| 1579 |
#: ../ui/panels/processors.php:100
|
| 1580 |
msgid "New Form Processor"
|
| 1581 |
-
msgstr ""
|
| 1582 |
|
| 1583 |
#: ../ui/panels/processors.php:103
|
| 1584 |
msgid "Processor Type"
|
| 1585 |
-
msgstr ""
|
| 1586 |
|
| 1587 |
#: ../ui/panels/processors.php:117
|
| 1588 |
msgid "Are you sure you want to remove this processor?"
|
| 1589 |
-
msgstr ""
|
| 1590 |
|
| 1591 |
#: ../ui/panels/processors.php:117
|
| 1592 |
msgid "Remove Processor"
|
| 1593 |
-
msgstr ""
|
| 1594 |
|
| 1595 |
#: ../ui/panels/processors.php:123
|
| 1596 |
msgid "Use"
|
| 1597 |
-
msgstr ""
|
| 1598 |
|
| 1599 |
#: ../ui/panels/processors.php:124
|
| 1600 |
msgid "Don't Use"
|
| 1601 |
-
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1602 |
|
| 1603 |
#: ../ui/panels/processors.php:171
|
| 1604 |
msgid "Add Processor"
|
| 1605 |
-
msgstr ""
|
| 1606 |
|
| 1607 |
#: ../ui/panels/processors.php:221
|
| 1608 |
msgid "Use Processor"
|
| 1609 |
-
msgstr ""
|
| 1610 |
|
| 1611 |
#: ../ui/panels/processors.php:226
|
| 1612 |
msgid "by"
|
|
@@ -1614,7 +1728,7 @@ msgstr "par"
|
|
| 1614 |
|
| 1615 |
#: ../ui/panels/processors.php:284
|
| 1616 |
msgid "This processor has no configurable options."
|
| 1617 |
-
msgstr ""
|
| 1618 |
|
| 1619 |
#: ../ui/panels/variable_add.php:1
|
| 1620 |
msgid "Add Variable"
|
|
@@ -1622,7 +1736,7 @@ msgstr "Ajouter une variable"
|
|
| 1622 |
|
| 1623 |
#: ../ui/panels/variables.php:14
|
| 1624 |
msgid "Behaviour"
|
| 1625 |
-
msgstr ""
|
| 1626 |
|
| 1627 |
#: ../ui/panels/variables.php:16
|
| 1628 |
msgid "No variables defined"
|
|
@@ -1630,16 +1744,24 @@ msgstr "Aucune variable définie"
|
|
| 1630 |
|
| 1631 |
#: ../ui/panels/variables.php:29 ../ui/panels/variables.php:49
|
| 1632 |
msgid "Static"
|
| 1633 |
-
msgstr ""
|
| 1634 |
|
| 1635 |
#: ../ui/panels/variables.php:30 ../ui/panels/variables.php:50
|
| 1636 |
msgid "Passback"
|
| 1637 |
-
msgstr ""
|
| 1638 |
|
| 1639 |
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
| 1640 |
-
#, fuzzy
|
| 1641 |
msgid "Entry List"
|
| 1642 |
-
msgstr "données"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1643 |
|
| 1644 |
#, fuzzy
|
| 1645 |
#~ msgid ""
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
+
"POT-Creation-Date: 2015-08-24 12:17+0200\n"
|
| 5 |
+
"PO-Revision-Date: 2015-08-24 12:17+0200\n"
|
| 6 |
"Last-Translator: David Cramer <david@caldera.co.za>\n"
|
| 7 |
"Language-Team: Tricodia Systems <david@digilab.co.za>\n"
|
| 8 |
"Language: fr\n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 20 |
+
msgid "Caldera Forms Notification"
|
| 21 |
+
msgstr "Notification de Caldera Forms"
|
| 22 |
+
|
| 23 |
+
#: ../classes/admin.php:124
|
| 24 |
msgid "Invalid Form."
|
| 25 |
+
msgstr "Formulaire invalide."
|
| 26 |
+
|
| 27 |
+
#: ../classes/admin.php:143
|
| 28 |
+
msgid "Starter Contact Form"
|
| 29 |
+
msgstr "Formulaire de contact basic"
|
| 30 |
+
|
| 31 |
+
#: ../classes/admin.php:147
|
| 32 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 33 |
+
msgstr ""
|
| 34 |
+
|
| 35 |
+
#: ../classes/admin.php:151
|
| 36 |
+
msgid "Registration Form, with optional additional participants."
|
| 37 |
+
msgstr ""
|
| 38 |
+
|
| 39 |
+
#: ../classes/admin.php:174
|
| 40 |
+
msgid "Form Template"
|
| 41 |
+
msgstr "Modèle de formulaire"
|
| 42 |
|
| 43 |
+
#: ../classes/admin.php:177
|
| 44 |
+
msgid "no template - blank form"
|
| 45 |
+
msgstr "Aucun modèle - formulaire vide"
|
| 46 |
+
|
| 47 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 48 |
#: ../ui/entries_toolbar.php:27
|
| 49 |
msgid "Trash"
|
| 50 |
msgstr "Corbeille"
|
| 51 |
|
| 52 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 53 |
#: ../ui/admin_templates.php:9
|
| 54 |
msgid "Restore"
|
| 55 |
+
msgstr "Rétablir"
|
| 56 |
|
| 57 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 58 |
msgid "Entry"
|
| 59 |
msgstr "Donnée"
|
| 60 |
|
| 61 |
+
#: ../classes/admin.php:385
|
| 62 |
msgid "View"
|
| 63 |
msgstr "Voir"
|
| 64 |
|
| 65 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 66 |
msgid "Add Form to Page"
|
| 67 |
msgstr "Ajouter le formulaire à la page"
|
| 68 |
|
| 69 |
+
#: ../classes/admin.php:428
|
| 70 |
msgid "Insert Form Shortcode"
|
| 71 |
+
msgstr "Insérer le shortcode"
|
| 72 |
|
| 73 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 74 |
msgid "Caldera Form"
|
| 75 |
+
msgstr "Caldera Form"
|
| 76 |
|
| 77 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 78 |
msgid "Deactivate"
|
| 79 |
+
msgstr "Désactiver"
|
| 80 |
|
| 81 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 82 |
msgid "Activate"
|
| 83 |
+
msgstr "Activer"
|
| 84 |
|
| 85 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 86 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 87 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 88 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 89 |
msgid "Caldera Forms"
|
| 90 |
+
msgstr "Caldera Forms"
|
| 91 |
|
| 92 |
+
#: ../classes/admin.php:746
|
| 93 |
msgid "Caldera Forms Admin"
|
| 94 |
msgstr "Notification de Caldera Forms"
|
| 95 |
|
| 96 |
+
#: ../classes/admin.php:746
|
| 97 |
msgid "Forms"
|
| 98 |
+
msgstr "Formulaires"
|
| 99 |
|
| 100 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 101 |
msgid "Community"
|
| 102 |
msgstr "Communauté"
|
| 103 |
|
| 104 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 105 |
msgid "Extend"
|
| 106 |
+
msgstr "Étendre"
|
| 107 |
|
| 108 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 109 |
msgid "Sorry, please try again"
|
| 110 |
+
msgstr "Désolé, veuillez essayer plus tard"
|
| 111 |
|
| 112 |
+
#: ../classes/admin.php:1017
|
| 113 |
msgid "Form Delete Error"
|
| 114 |
msgstr "Erreur lors de la suppression du formulaire"
|
| 115 |
|
| 116 |
+
#: ../classes/admin.php:1170
|
| 117 |
msgid "Sorry, File is not valid."
|
| 118 |
msgstr "Désolé, le fichier n'est pas valide."
|
| 119 |
|
| 120 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 121 |
+
#: ../classes/admin.php:1179
|
| 122 |
msgid "Form Import Error"
|
| 123 |
msgstr "Erreur lors de l'importation du formulaire"
|
| 124 |
|
| 125 |
+
#: ../classes/admin.php:1174
|
| 126 |
msgid "Sorry, File not uploaded."
|
| 127 |
msgstr "Désolé, le fichier n'a pas été envoyé."
|
| 128 |
|
| 129 |
+
#: ../classes/admin.php:1188
|
| 130 |
msgid "Form does not exist."
|
| 131 |
msgstr "Le formulaire n'existe pas."
|
| 132 |
|
| 133 |
+
#: ../classes/admin.php:1229
|
| 134 |
msgid "Export selection has expired"
|
| 135 |
+
msgstr "L'exportation de la sélection a pris fin"
|
| 136 |
|
| 137 |
+
#: ../classes/admin.php:1229
|
| 138 |
msgid "Export Expired"
|
| 139 |
+
msgstr "Exportation achevée"
|
| 140 |
|
| 141 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
|
|
|
| 142 |
msgid "Form has been successfully submitted. Thank you."
|
| 143 |
+
msgstr "Le formulaire a été envoyé. Merci pour votre contribution."
|
| 144 |
|
| 145 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 146 |
msgid "Layout"
|
| 147 |
msgstr "Disposition"
|
| 148 |
|
| 149 |
+
#: ../classes/admin.php:1465
|
| 150 |
msgid "Layout Builder"
|
| 151 |
+
msgstr "Disposition des éléments"
|
| 152 |
|
| 153 |
+
#: ../classes/admin.php:1475
|
| 154 |
msgid "Pages"
|
| 155 |
msgstr "Pages"
|
| 156 |
|
| 157 |
+
#: ../classes/admin.php:1477
|
| 158 |
msgid "Form Pages"
|
| 159 |
msgstr "Pages de formulaire"
|
| 160 |
|
| 161 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 162 |
+
msgid "Conditions"
|
| 163 |
+
msgstr "Conditions"
|
| 164 |
+
|
| 165 |
+
#: ../classes/admin.php:1487
|
| 166 |
msgid "Processors"
|
| 167 |
+
msgstr "Traitements"
|
| 168 |
|
| 169 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 170 |
msgid "Form Processors"
|
| 171 |
+
msgstr "Traitements du formulaire"
|
| 172 |
|
| 173 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 174 |
#: ../ui/panels/variables.php:83
|
| 175 |
msgid "Variables"
|
| 176 |
msgstr "Variables"
|
| 177 |
|
| 178 |
+
#: ../classes/admin.php:1502
|
| 179 |
msgid "Responsive"
|
| 180 |
msgstr "Responsive"
|
| 181 |
|
| 182 |
+
#: ../classes/admin.php:1504
|
| 183 |
msgid "Resposive Settings"
|
| 184 |
msgstr "Réglage du \"Responsive\""
|
| 185 |
|
| 186 |
+
#: ../classes/admin.php:1508
|
| 187 |
msgid "Grid Collapse"
|
| 188 |
msgstr "Redimensionnement des grilles"
|
| 189 |
|
| 190 |
+
#: ../classes/admin.php:1510
|
| 191 |
msgid ""
|
| 192 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 193 |
"Bootstrap 3.0)"
|
| 194 |
msgstr ""
|
| 195 |
+
"Définir la plus petite taille d'écran pour laquelle la grille sera modifiée "
|
| 196 |
+
"(basé sur Bootstrap 3.0)."
|
| 197 |
|
| 198 |
+
#: ../classes/admin.php:1517
|
| 199 |
msgid "Maintain grid always"
|
| 200 |
msgstr "Ne pas redimmensionner les grilles"
|
| 201 |
|
| 202 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 203 |
msgid "Mailer"
|
| 204 |
+
msgstr "Courrielleur"
|
| 205 |
|
| 206 |
+
#: ../classes/admin.php:1539
|
| 207 |
msgid "Email Notification Settings"
|
| 208 |
+
msgstr "Réglage des notifications par courriel"
|
| 209 |
|
| 210 |
+
#: ../classes/core.php:396
|
|
|
|
| 211 |
msgid "The wasn't entered correct."
|
| 212 |
msgstr "Le reCAPTCHA est incorrect."
|
| 213 |
|
| 214 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 215 |
msgid "Reset"
|
| 216 |
+
msgstr "Réinitialiser"
|
| 217 |
|
| 218 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 219 |
msgid "Permission denied."
|
| 220 |
+
msgstr "Autorisation refusée."
|
| 221 |
|
| 222 |
+
#: ../classes/core.php:787
|
|
|
|
|
|
|
|
|
|
|
|
|
| 223 |
msgid "Auto Responder"
|
| 224 |
+
msgstr "Réponse automatique"
|
| 225 |
|
| 226 |
+
#: ../classes/core.php:788
|
| 227 |
msgid "Sends out an auto response e-mail"
|
| 228 |
+
msgstr "Envoie une réponse automatique par courriel"
|
| 229 |
|
| 230 |
+
#: ../classes/core.php:792
|
| 231 |
msgid "Thank you for contacting us"
|
| 232 |
+
msgstr "Merci de nous avoir contacté"
|
| 233 |
|
| 234 |
+
#: ../classes/core.php:796
|
| 235 |
msgid "Redirect"
|
| 236 |
msgstr "Redirection"
|
| 237 |
|
| 238 |
+
#: ../classes/core.php:797
|
| 239 |
msgid "Redirects user to URL on successful submit"
|
| 240 |
+
msgstr "Redirige l'utilisateur vers l'URL après envoi du formulaire"
|
| 241 |
|
| 242 |
+
#: ../classes/core.php:802
|
| 243 |
msgid "Increment Value"
|
| 244 |
+
msgstr "Valeur d'incrémentation"
|
| 245 |
|
| 246 |
+
#: ../classes/core.php:803
|
| 247 |
msgid "Increment a value per entry."
|
| 248 |
+
msgstr "Incrémenter une valeur par donnée."
|
| 249 |
|
| 250 |
+
#: ../classes/core.php:817
|
| 251 |
msgid "Akismet"
|
| 252 |
+
msgstr "Akismet"
|
| 253 |
|
| 254 |
+
#: ../classes/core.php:818
|
| 255 |
msgid "Anti-spam filtering"
|
| 256 |
+
msgstr "Filtrage anti-spam"
|
| 257 |
|
| 258 |
+
#: ../classes/core.php:866
|
| 259 |
msgid "Akismet not setup."
|
| 260 |
+
msgstr "Akismet non paramétré."
|
| 261 |
|
| 262 |
+
#: ../classes/core.php:1017
|
| 263 |
msgid "Calculation"
|
| 264 |
msgstr "Calcul"
|
| 265 |
|
| 266 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 267 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 268 |
msgid "Special"
|
| 269 |
msgstr "Spécial"
|
| 270 |
|
| 271 |
+
#: ../classes/core.php:1020
|
| 272 |
msgid "Math"
|
| 273 |
+
msgstr "Math"
|
| 274 |
|
| 275 |
+
#: ../classes/core.php:1021
|
| 276 |
msgid "Calculate values"
|
| 277 |
msgstr "Calculer les valeurs"
|
| 278 |
|
| 279 |
+
#: ../classes/core.php:1028
|
| 280 |
msgid "Total"
|
| 281 |
msgstr "Total"
|
| 282 |
|
| 283 |
+
#: ../classes/core.php:1040
|
| 284 |
msgid "Range Slider"
|
| 285 |
+
msgstr "Curseur de plage"
|
| 286 |
|
| 287 |
+
#: ../classes/core.php:1043
|
| 288 |
msgid "Range Slider input field"
|
| 289 |
+
msgstr "Champ de curseur de plage"
|
| 290 |
|
| 291 |
+
#: ../classes/core.php:1077
|
| 292 |
msgid "Star Rating"
|
| 293 |
+
msgstr "Vote par étoiles"
|
| 294 |
|
| 295 |
+
#: ../classes/core.php:1079
|
| 296 |
msgid "Feedback"
|
| 297 |
+
msgstr "Retour d'expérience"
|
| 298 |
|
| 299 |
+
#: ../classes/core.php:1080
|
| 300 |
msgid "Star rating input for feedback"
|
| 301 |
+
msgstr "Vote par étoiles pour réagir"
|
| 302 |
|
| 303 |
+
#: ../classes/core.php:1112
|
| 304 |
msgid "Phone Number"
|
| 305 |
msgstr "Numéro de téléphone"
|
| 306 |
|
| 307 |
+
#: ../classes/core.php:1113
|
| 308 |
msgid "Phone number with masking"
|
| 309 |
+
msgstr "Numéro de téléphone (avec masque)"
|
| 310 |
|
| 311 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 312 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 313 |
+
#: ../classes/core.php:1376
|
| 314 |
msgid "Text Fields"
|
| 315 |
+
msgstr "Champ de texte"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 316 |
|
| 317 |
+
#: ../classes/core.php:1115
|
| 318 |
msgid "User"
|
| 319 |
+
msgstr "Utilisateur"
|
| 320 |
|
| 321 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 322 |
msgid "Single Line Text"
|
| 323 |
+
msgstr "Texte sur une ligne"
|
| 324 |
|
| 325 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 326 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 327 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 328 |
+
#: ../ui/edit.php:215
|
| 329 |
+
msgid "Basic"
|
| 330 |
+
msgstr "Basic"
|
| 331 |
+
|
| 332 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 333 |
msgid "File"
|
| 334 |
+
msgstr "Fichier"
|
| 335 |
|
| 336 |
+
#: ../classes/core.php:1149
|
| 337 |
msgid "File Uploader"
|
| 338 |
+
msgstr "Envoi de fichier"
|
| 339 |
|
| 340 |
+
#: ../classes/core.php:1159
|
| 341 |
msgid "reCAPTCHA"
|
| 342 |
+
msgstr "reCAPTCHA"
|
| 343 |
|
| 344 |
+
#: ../classes/core.php:1160
|
| 345 |
msgid "reCAPTCHA anti-spam field"
|
| 346 |
+
msgstr "Champ anti-spam reCAPTCHA"
|
| 347 |
|
| 348 |
+
#: ../classes/core.php:1185
|
| 349 |
msgid "HTML"
|
| 350 |
+
msgstr "HTML"
|
| 351 |
|
| 352 |
+
#: ../classes/core.php:1186
|
| 353 |
msgid "Add text/html content"
|
| 354 |
msgstr "Ajouter un contenu text/html"
|
| 355 |
|
| 356 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 357 |
#: ../processors/akismet/config.php:20
|
| 358 |
msgid "Content"
|
| 359 |
msgstr "Contenu"
|
| 360 |
|
| 361 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 362 |
msgid "Hidden"
|
| 363 |
msgstr "Caché"
|
| 364 |
|
| 365 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 366 |
msgid "Button"
|
| 367 |
+
msgstr "Bouton"
|
| 368 |
|
| 369 |
+
#: ../classes/core.php:1220
|
| 370 |
msgid "Button, Submit and Reset types"
|
| 371 |
+
msgstr "Types button, submit et reset"
|
| 372 |
|
| 373 |
+
#: ../classes/core.php:1222
|
| 374 |
msgid "Buttons"
|
| 375 |
+
msgstr "Boutons"
|
| 376 |
|
| 377 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 378 |
msgid "Email Address"
|
| 379 |
+
msgstr "Adresse électronique"
|
| 380 |
|
| 381 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 382 |
msgid "Paragraph Textarea"
|
| 383 |
msgstr "Zone de texte"
|
| 384 |
|
| 385 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 386 |
msgid "Toggle Switch"
|
| 387 |
+
msgstr "Basculement"
|
| 388 |
|
| 389 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 390 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 391 |
msgid "Select Options"
|
| 392 |
+
msgstr "Options de sélection"
|
| 393 |
|
| 394 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 395 |
msgid "Dropdown Select"
|
| 396 |
+
msgstr "Menu déroulant"
|
| 397 |
|
| 398 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 399 |
msgid "Checkbox"
|
| 400 |
+
msgstr "Case à cocher"
|
| 401 |
|
| 402 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 403 |
msgid "Radio"
|
| 404 |
+
msgstr "Bouton radio"
|
| 405 |
|
| 406 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 407 |
msgid "Date Picker"
|
| 408 |
+
msgstr "Sélecteur de date"
|
| 409 |
|
| 410 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 411 |
msgid "Pickers"
|
| 412 |
+
msgstr "Sélecteurs"
|
| 413 |
|
| 414 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 415 |
msgid "Color Picker"
|
| 416 |
+
msgstr "Sélecteur de couleur"
|
| 417 |
|
| 418 |
+
#: ../classes/core.php:1402
|
| 419 |
msgid "State/ Province Select"
|
| 420 |
+
msgstr "Sélection État/Province"
|
| 421 |
|
| 422 |
+
#: ../classes/core.php:1403
|
| 423 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 424 |
+
msgstr "Menu déroulant pour les USA et les provinces canadiennes."
|
| 425 |
+
|
| 426 |
+
#: ../classes/core.php:1417
|
| 427 |
+
msgid "Autocomplete"
|
| 428 |
+
msgstr "Remplir automatiquement"
|
| 429 |
|
| 430 |
+
#: ../classes/core.php:1419
|
| 431 |
+
msgid "Pickers,Select Options"
|
| 432 |
+
msgstr "Sélecteurs, options de sélection"
|
| 433 |
+
|
| 434 |
+
#: ../classes/core.php:1838
|
| 435 |
msgid "System Tags"
|
| 436 |
+
msgstr "Balises système"
|
| 437 |
|
| 438 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 439 |
msgid "Mailer Debug"
|
| 440 |
+
msgstr "Débogage du courielleur"
|
| 441 |
|
| 442 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 443 |
msgid "Invalid form ID"
|
| 444 |
+
msgstr "ID de formulaire invalide"
|
| 445 |
|
| 446 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 447 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 448 |
+
#: ../classes/core.php:4111
|
| 449 |
msgid "Permission denied or entry does not exist."
|
| 450 |
msgstr "Accés refusé ou donnée inexistante."
|
| 451 |
|
| 452 |
+
#: ../classes/core.php:3053
|
| 453 |
msgid "is required"
|
| 454 |
msgstr "est requis"
|
| 455 |
|
| 456 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 457 |
msgid "Form is currently not active."
|
| 458 |
+
msgstr "Le formulaire n'est pas activé actuellement."
|
| 459 |
|
| 460 |
+
#: ../classes/core.php:4393
|
| 461 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 462 |
msgstr ""
|
| 463 |
+
"ATTENTION : le courrielleur est en mode débogage. Veuillez désactiver ce "
|
| 464 |
+
"mode avant d'aller en ligne."
|
| 465 |
|
| 466 |
#: ../classes/widget.php:43
|
| 467 |
msgid "Title"
|
| 468 |
msgstr "Titre"
|
| 469 |
|
| 470 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 471 |
msgid "Form"
|
| 472 |
msgstr "Formulaire"
|
| 473 |
|
| 474 |
#: ../fields/button/config_template.php:2
|
| 475 |
msgid "Type"
|
| 476 |
+
msgstr "Type"
|
| 477 |
|
| 478 |
#: ../fields/button/config_template.php:5
|
| 479 |
msgid "Submit"
|
| 481 |
|
| 482 |
#: ../fields/button/config_template.php:7
|
| 483 |
msgid "Next Page"
|
| 484 |
+
msgstr "Page suivante"
|
| 485 |
|
| 486 |
#: ../fields/button/config_template.php:8
|
| 487 |
msgid "Previous Page"
|
| 488 |
+
msgstr "Page précédente"
|
| 489 |
|
| 490 |
#: ../fields/button/config_template.php:14
|
| 491 |
msgid "Class"
|
| 492 |
+
msgstr "Class"
|
| 493 |
|
| 494 |
#: ../fields/calculation/config.php:2
|
| 495 |
msgid "Element"
|
| 513 |
|
| 514 |
#: ../fields/calculation/config.php:32
|
| 515 |
msgid "Separator"
|
| 516 |
+
msgstr "Séparateur"
|
| 517 |
|
| 518 |
#: ../fields/calculation/config.php:35
|
| 519 |
msgid "Setup a custom thousand separator. e.g 10,000.00 or 10.000.00"
|
| 520 |
+
msgstr "Définir un séparateur des milliers. Ex. : 10 000.00 ou 10.000.00"
|
| 521 |
|
| 522 |
#: ../fields/calculation/config.php:41
|
| 523 |
msgid "Manual Formula"
|
| 524 |
+
msgstr "Formule manuelle"
|
| 525 |
|
| 526 |
#: ../fields/calculation/config.php:54
|
| 527 |
msgid "Add Operator Group"
|
| 528 |
+
msgstr "Ajouter un groupe d'opérateur"
|
| 529 |
|
| 530 |
#: ../fields/calculation/config.php:63
|
|
|
|
| 531 |
msgid "Use %field_slug% as field value variables"
|
| 532 |
+
msgstr "Utiliser %field_slug% comme variable de valeur de champ"
|
| 533 |
|
| 534 |
#: ../fields/checkbox/config_template.php:3
|
| 535 |
#: ../fields/radio/config_template.php:4
|
| 536 |
msgid "Inline"
|
| 537 |
+
msgstr "En ligne"
|
| 538 |
|
| 539 |
#: ../fields/color_picker/setup.php:2 ../fields/date_picker/setup.php:2
|
| 540 |
#: ../fields/email/config.php:8 ../fields/paragraph/config_template.php:14
|
| 545 |
|
| 546 |
#: ../fields/color_picker/setup.php:2
|
| 547 |
msgid "Color"
|
| 548 |
+
msgstr "Couleur"
|
| 549 |
|
| 550 |
#: ../fields/date_picker/setup.php:8
|
| 551 |
msgid "Format"
|
| 552 |
+
msgstr "Format"
|
| 553 |
|
| 554 |
#: ../fields/date_picker/setup.php:14
|
| 555 |
msgid "Autoclose"
|
| 556 |
+
msgstr "Fermer automatiquement"
|
| 557 |
|
| 558 |
#: ../fields/date_picker/setup.php:16
|
| 559 |
msgid "Enable autoclose"
|
| 560 |
+
msgstr "Activer la fermeture automatique"
|
| 561 |
|
| 562 |
#: ../fields/date_picker/setup.php:17
|
| 563 |
msgid ""
|
| 564 |
"If enabled, the date picker will automatically close after selecting the "
|
| 565 |
"final input"
|
| 566 |
msgstr ""
|
| 567 |
+
"Si activé, le sélecteur de date se fermera automatiquement après sélection "
|
| 568 |
+
"du dernier champ"
|
| 569 |
|
| 570 |
#: ../fields/date_picker/setup.php:21
|
| 571 |
msgid "Start View"
|
| 572 |
+
msgstr "Affichage de départ"
|
| 573 |
|
| 574 |
#: ../fields/date_picker/setup.php:24
|
|
|
|
| 575 |
msgid "Month (Default)"
|
| 576 |
+
msgstr "Mois (défaut)"
|
| 577 |
|
| 578 |
#: ../fields/date_picker/setup.php:25
|
| 579 |
msgid "Year"
|
| 580 |
+
msgstr "Année"
|
| 581 |
|
| 582 |
#: ../fields/date_picker/setup.php:26
|
| 583 |
msgid "Decade"
|
| 584 |
+
msgstr "Décennie"
|
| 585 |
|
| 586 |
#: ../fields/date_picker/setup.php:28
|
| 587 |
msgid "The starting view of the date picker (month, year, decade)"
|
| 588 |
+
msgstr "L'affichage initial du sélecteur de date (mois, année, décennie)"
|
| 589 |
|
| 590 |
#: ../fields/date_picker/setup.php:32
|
| 591 |
+
msgid "Start Date"
|
| 592 |
msgstr ""
|
| 593 |
|
| 594 |
+
#: ../fields/date_picker/setup.php:35
|
| 595 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 596 |
+
msgstr ""
|
| 597 |
+
|
| 598 |
+
#: ../fields/date_picker/setup.php:39
|
| 599 |
+
msgid "End Date"
|
| 600 |
+
msgstr ""
|
| 601 |
+
|
| 602 |
+
#: ../fields/date_picker/setup.php:42
|
| 603 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 604 |
msgstr ""
|
| 605 |
|
| 606 |
+
#: ../fields/date_picker/setup.php:46
|
| 607 |
+
msgid "language"
|
| 608 |
+
msgstr "langue"
|
| 609 |
+
|
| 610 |
+
#: ../fields/date_picker/setup.php:114
|
| 611 |
+
msgid "Language to use. e.g. pt-BR"
|
| 612 |
+
msgstr "Langue à utiliser. Ex. : fr-FR"
|
| 613 |
+
|
| 614 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 615 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 616 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 617 |
msgid "Placeholder"
|
| 618 |
+
msgstr "Remplaçant fictif"
|
| 619 |
|
| 620 |
#: ../fields/file/config_template.php:2
|
| 621 |
msgid "Attach to mailer"
|
| 622 |
+
msgstr "Attacher au courrielleur"
|
| 623 |
|
| 624 |
#: ../fields/file/config_template.php:9
|
| 625 |
+
msgid "Allow Multiple"
|
| 626 |
+
msgstr "Multiple autorisé"
|
| 627 |
+
|
| 628 |
+
#: ../fields/file/config_template.php:16
|
| 629 |
msgid "Allowed Types"
|
| 630 |
+
msgstr "Types autorisés"
|
| 631 |
|
| 632 |
+
#: ../fields/file/config_template.php:19
|
| 633 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 634 |
+
msgstr "Séparés par des virgules, ex; : jpg, pdf, txt"
|
| 635 |
|
| 636 |
#: ../fields/gravatar/config.php:2
|
|
|
|
| 637 |
msgid "Email Field"
|
| 638 |
+
msgstr "Champ courriel"
|
| 639 |
|
| 640 |
#: ../fields/gravatar/config.php:10
|
| 641 |
msgid "Mystery Man"
|
| 642 |
+
msgstr "L'homme mystérieux"
|
| 643 |
|
| 644 |
#: ../fields/gravatar/config.php:11
|
| 645 |
msgid "Blank"
|
| 646 |
+
msgstr "Vide"
|
| 647 |
|
| 648 |
#: ../fields/gravatar/config.php:12
|
| 649 |
msgid "Gravatar Logo"
|
| 650 |
+
msgstr "Logo Gravatar"
|
| 651 |
|
| 652 |
#: ../fields/gravatar/config.php:13
|
| 653 |
msgid "Identicon (Generated)"
|
| 654 |
+
msgstr "Identicon (Généré)"
|
| 655 |
|
| 656 |
#: ../fields/gravatar/config.php:14
|
| 657 |
msgid "Wavatar (Generated)"
|
| 658 |
+
msgstr "Wavatar (Généré)"
|
| 659 |
|
| 660 |
#: ../fields/gravatar/config.php:15
|
| 661 |
msgid "MonsterID (Generated)"
|
| 662 |
+
msgstr "MonsterID (Généré)"
|
| 663 |
|
| 664 |
#: ../fields/gravatar/config.php:16
|
| 665 |
msgid "Retro (Generated)"
|
| 666 |
+
msgstr "Retro (Généré)"
|
| 667 |
|
| 668 |
#: ../fields/gravatar/config.php:21
|
| 669 |
msgid "Fallback"
|
| 670 |
+
msgstr "Fallback"
|
| 671 |
|
| 672 |
#: ../fields/gravatar/config.php:35
|
| 673 |
msgid "Size"
|
| 674 |
+
msgstr "Taille"
|
| 675 |
|
| 676 |
#: ../fields/gravatar/config.php:42
|
|
|
|
| 677 |
msgid "Border Color"
|
| 678 |
+
msgstr "Couleur de bordure"
|
| 679 |
|
| 680 |
#: ../fields/gravatar/config.php:49
|
|
|
|
| 681 |
msgid "Border Size"
|
| 682 |
+
msgstr "Taille de bordure"
|
| 683 |
|
| 684 |
#: ../fields/gravatar/config.php:56
|
|
|
|
| 685 |
msgid "Border Radius"
|
| 686 |
+
msgstr "Arrondis de bordure"
|
| 687 |
|
| 688 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 689 |
#: ../ui/panels/variables.php:12
|
| 690 |
msgid "Value"
|
| 691 |
msgstr "Valeur"
|
| 692 |
|
| 693 |
#: ../fields/paragraph/config_template.php:8
|
| 694 |
msgid "Rows"
|
| 695 |
+
msgstr "Lignes"
|
| 696 |
|
| 697 |
#: ../fields/phone/config.php:14
|
| 698 |
msgid "Style"
|
| 699 |
+
msgstr "Style"
|
| 700 |
|
| 701 |
#: ../fields/phone/config.php:16
|
| 702 |
msgid "Local"
|
| 703 |
+
msgstr "Local"
|
| 704 |
|
| 705 |
#: ../fields/phone/config.php:18
|
| 706 |
msgid "International"
|
| 707 |
+
msgstr "International"
|
| 708 |
|
| 709 |
#: ../fields/phone/config.php:20
|
| 710 |
msgid "Custom"
|
| 711 |
+
msgstr "Personnalisé"
|
| 712 |
|
| 713 |
#: ../fields/phone/config.php:22
|
| 714 |
msgid "Use the digit 9 to indicate a number"
|
| 715 |
+
msgstr "Utiliser le 9 pour indiquer un nombre"
|
| 716 |
|
| 717 |
#: ../fields/range_slider/config.php:17
|
| 718 |
msgid "Track"
|
| 719 |
+
msgstr "Pister"
|
| 720 |
|
| 721 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 722 |
msgid "Highlight"
|
| 723 |
+
msgstr "Mettre en évidence"
|
| 724 |
|
| 725 |
#: ../fields/range_slider/config.php:29
|
| 726 |
msgid "Handle"
|
| 727 |
+
msgstr "Traiter"
|
| 728 |
|
| 729 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 730 |
msgid "Border"
|
| 731 |
msgstr "Bordure"
|
| 732 |
|
| 733 |
#: ../fields/range_slider/config.php:42
|
| 734 |
msgid "Steps"
|
| 735 |
+
msgstr "Étapes"
|
| 736 |
|
| 737 |
#: ../fields/range_slider/config.php:48
|
| 738 |
msgid "Minimum"
|
| 756 |
|
| 757 |
#: ../fields/recaptcha/config.php:1
|
| 758 |
msgid "reCaptcha required keys from Google."
|
| 759 |
+
msgstr "Le reCaptcha nécessite les clés de Google."
|
| 760 |
|
| 761 |
#: ../fields/recaptcha/config.php:3
|
|
|
|
| 762 |
msgid "Site Key"
|
| 763 |
+
msgstr "Clé de site"
|
| 764 |
|
| 765 |
#: ../fields/recaptcha/config.php:9
|
| 766 |
msgid "Secret Key"
|
| 767 |
+
msgstr "Clé secrète"
|
| 768 |
|
| 769 |
#: ../fields/recaptcha/config.php:15
|
| 770 |
msgid "Theme"
|
| 772 |
|
| 773 |
#: ../fields/recaptcha/config.php:18
|
| 774 |
msgid "Light"
|
| 775 |
+
msgstr "Clair"
|
| 776 |
|
| 777 |
#: ../fields/recaptcha/config.php:19
|
| 778 |
msgid "Dark"
|
| 779 |
+
msgstr "Sombre"
|
| 780 |
|
| 781 |
#: ../fields/recaptcha/config.php:21
|
| 782 |
msgid ""
|
| 783 |
"Theme changes not available in preview. Update form and reload to see new "
|
| 784 |
"theme."
|
| 785 |
msgstr ""
|
| 786 |
+
"Modification de thème non disponible dans l'aperçu. Mettez à jour le "
|
| 787 |
+
"formulaire et rechargez-le pour voir le nouveau thème."
|
| 788 |
|
| 789 |
#: ../fields/recaptcha/preview.php:20
|
| 790 |
msgid "No Secret Key Added"
|
| 791 |
+
msgstr "Aucune clé secrète ajoutée"
|
| 792 |
|
| 793 |
#: ../fields/recaptcha/preview.php:23
|
| 794 |
msgid "No Site Key Added"
|
| 795 |
+
msgstr "Aucune clé de site ajoutée"
|
| 796 |
+
|
| 797 |
+
#: ../fields/select2/field/config.php:11
|
| 798 |
+
msgid "Multiple"
|
| 799 |
+
msgstr "Multiple"
|
| 800 |
+
|
| 801 |
+
#: ../fields/select2/field/config.php:15
|
| 802 |
+
msgid "Enable multiple selections"
|
| 803 |
+
msgstr "Autoriser la sélection multiple"
|
| 804 |
|
| 805 |
#: ../fields/star-rate/config.php:2
|
| 806 |
msgid "Number of Stars"
|
| 807 |
+
msgstr "Nombre d'étoiles"
|
| 808 |
|
| 809 |
#: ../fields/star-rate/config.php:8
|
| 810 |
msgid "Star Type"
|
| 811 |
+
msgstr "Type d'étoiles"
|
| 812 |
|
| 813 |
#: ../fields/star-rate/config.php:11
|
| 814 |
msgid "Star"
|
| 815 |
+
msgstr "Étoile"
|
| 816 |
|
| 817 |
#: ../fields/star-rate/config.php:12
|
| 818 |
msgid "Heart"
|
| 819 |
+
msgstr "Coeur"
|
| 820 |
|
| 821 |
#: ../fields/star-rate/config.php:13
|
| 822 |
msgid "Face"
|
| 823 |
+
msgstr "Visage"
|
| 824 |
|
| 825 |
#: ../fields/star-rate/config.php:14
|
| 826 |
msgid "Dot"
|
| 827 |
+
msgstr "Point"
|
| 828 |
|
| 829 |
#: ../fields/star-rate/config.php:19
|
| 830 |
msgid "Star Size"
|
| 831 |
+
msgstr "Taille d'étoile"
|
| 832 |
|
| 833 |
#: ../fields/star-rate/config.php:25
|
| 834 |
msgid "Star Spacing"
|
| 835 |
+
msgstr "Espacement entre étoiles"
|
| 836 |
|
| 837 |
#: ../fields/star-rate/config.php:31
|
| 838 |
msgid "Single Select"
|
| 839 |
+
msgstr "Sélection unique"
|
| 840 |
|
| 841 |
#: ../fields/star-rate/config.php:38
|
| 842 |
msgid "Star Color"
|
| 843 |
+
msgstr "Couleur d'étoile"
|
| 844 |
|
| 845 |
#: ../fields/star-rate/config.php:44
|
| 846 |
msgid "Track Color"
|
| 847 |
+
msgstr "Couleur de piste"
|
| 848 |
|
| 849 |
#: ../fields/star-rate/config.php:50
|
| 850 |
msgid "Include Cancel"
|
| 851 |
+
msgstr "Inclure \"Annuler\""
|
| 852 |
|
| 853 |
#: ../fields/text/config.php:15
|
| 854 |
msgid "Masked Input"
|
| 855 |
+
msgstr "Champ masqué"
|
| 856 |
|
| 857 |
#: ../fields/text/config.php:17
|
| 858 |
msgid "Enable input mask"
|
| 859 |
+
msgstr "Activer le champ masqué"
|
| 860 |
|
| 861 |
#: ../fields/text/config.php:22
|
| 862 |
msgid "Mask"
|
| 863 |
+
msgstr "masque"
|
| 864 |
|
| 865 |
#: ../fields/text/config.php:30
|
| 866 |
msgid "numeric"
|
| 867 |
+
msgstr "numérique"
|
| 868 |
|
| 869 |
#: ../fields/text/config.php:31
|
| 870 |
msgid "alphabetical"
|
| 871 |
+
msgstr "alphabétique"
|
| 872 |
|
| 873 |
#: ../fields/text/config.php:32
|
| 874 |
msgid "alphanumeric"
|
| 875 |
+
msgstr "alphanumérique"
|
| 876 |
|
| 877 |
#: ../fields/text/config.php:33
|
| 878 |
msgid "optional"
|
| 879 |
+
msgstr "facultatif"
|
| 880 |
|
| 881 |
#: ../fields/text/config.php:34
|
| 882 |
msgid "length"
|
| 883 |
+
msgstr "longueur"
|
| 884 |
|
| 885 |
#: ../fields/text/config.php:36
|
| 886 |
msgid "Any length character only"
|
| 887 |
+
msgstr "Toute longueur de caractères uniquement"
|
| 888 |
|
| 889 |
#: ../fields/text/config.php:37
|
| 890 |
msgid "Any length number only"
|
| 891 |
+
msgstr "Toute longueur de chiffres uniquement"
|
| 892 |
|
| 893 |
#: ../fields/text/config.php:38
|
| 894 |
msgid "email"
|
| 895 |
+
msgstr "courriel"
|
| 896 |
|
| 897 |
#: ../fields/toggle_switch/config_template.php:2
|
| 898 |
msgid "Orientation"
|
| 899 |
+
msgstr "Orientation"
|
| 900 |
|
| 901 |
#: ../fields/toggle_switch/config_template.php:5
|
| 902 |
msgid "Horizontal"
|
| 903 |
+
msgstr "Horizontal"
|
| 904 |
|
| 905 |
#: ../fields/toggle_switch/config_template.php:6
|
| 906 |
msgid "Justified"
|
| 907 |
+
msgstr "Justifié"
|
| 908 |
|
| 909 |
#: ../fields/toggle_switch/config_template.php:7
|
| 910 |
msgid "Vertical"
|
| 911 |
+
msgstr "Vertical"
|
| 912 |
|
| 913 |
#: ../fields/toggle_switch/config_template.php:13
|
| 914 |
msgid "Active Class"
|
| 915 |
+
msgstr "Class active"
|
| 916 |
|
| 917 |
#: ../fields/toggle_switch/config_template.php:20
|
| 918 |
msgid "Inactive Class"
|
| 919 |
+
msgstr "Class inactive"
|
| 920 |
|
| 921 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 922 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 923 |
msgid "Enable"
|
| 924 |
msgstr "Activé"
|
| 925 |
|
| 926 |
#: ../includes/cf-ajax/plugin.php:38
|
| 927 |
msgid "Ajax Submissions"
|
| 928 |
+
msgstr "Envoi Ajax"
|
| 929 |
|
| 930 |
#: ../includes/cf-ajax/plugin.php:40
|
| 931 |
msgid "Enable Ajax Submissions. (No page reloads)"
|
| 932 |
+
msgstr "Activer l'envoi par Ajax (pas de rechargement de page)."
|
| 933 |
|
| 934 |
#: ../includes/cf-ajax/plugin.php:46
|
| 935 |
msgid "Custom Callback"
|
| 936 |
+
msgstr "Callback personnalisé"
|
| 937 |
|
| 938 |
#: ../includes/cf-ajax/plugin.php:48
|
| 939 |
msgid "Add a custom Javascript callback handlers on submission."
|
| 940 |
msgstr ""
|
| 941 |
+
"Ajouter un traitement par callback JavaScript personnalisé après soumission."
|
| 942 |
|
| 943 |
#: ../includes/cf-ajax/plugin.php:55
|
| 944 |
msgid "Inhibit Notices"
|
| 945 |
+
msgstr "Ignorer les notifications"
|
| 946 |
|
| 947 |
#: ../includes/cf-ajax/plugin.php:57
|
| 948 |
msgid "Don't show default alerts (success etc.)"
|
| 949 |
+
msgstr "Ne pas afficher les avertissements par défaut (success, etc...)"
|
| 950 |
|
| 951 |
#: ../includes/cf-ajax/plugin.php:63
|
|
|
|
| 952 |
msgid "Callback Function"
|
| 953 |
+
msgstr "Fonction de callback"
|
| 954 |
|
| 955 |
#: ../includes/cf-ajax/plugin.php:66
|
| 956 |
msgid ""
|
| 957 |
"Javascript function to call on submission. Passed an object containing form "
|
| 958 |
"submission result."
|
| 959 |
msgstr ""
|
| 960 |
+
"Fonction JavaScript à appeler lors de la soumission. Passe un objet "
|
| 961 |
+
"contenant le résultat de l'envoi du formulaire."
|
| 962 |
|
| 963 |
#: ../includes/cf-ajax/plugin.php:91
|
| 964 |
msgid "Multiple Ajax Submissions"
|
| 965 |
+
msgstr "Soumissions Ajax multiples"
|
| 966 |
|
| 967 |
#: ../includes/cf-ajax/plugin.php:93
|
| 968 |
msgid "If set, form can be submitted multiple times with out a new page load."
|
| 969 |
msgstr ""
|
| 970 |
+
"Si défini, le formulaire peut être envoyé plusieurs fois sans recharger la "
|
| 971 |
+
"page."
|
| 972 |
|
| 973 |
#: ../includes/cf-ajax/plugin.php:147 ../includes/cf-ajax/plugin.php:158
|
| 974 |
#: ../processors/redirect/config.php:10
|
| 977 |
|
| 978 |
#: ../includes/custom_field_class.php:21
|
| 979 |
msgid "Custom Class"
|
| 980 |
+
msgstr "Class personnalisée"
|
| 981 |
|
| 982 |
+
#: ../includes/field_processors.php:45
|
| 983 |
msgid "File type not allowed. Allowed types are: "
|
| 984 |
msgstr "Type de fichier non autorisé. Les types autorisés sont :"
|
| 985 |
|
| 986 |
+
#: ../includes/field_processors.php:47
|
| 987 |
msgid "File type needs to be"
|
| 988 |
msgstr "Les types de fichier doivent être"
|
| 989 |
|
| 990 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 991 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 992 |
msgid "Name"
|
| 993 |
msgstr "Nom"
|
| 994 |
|
| 995 |
#: ../processors/akismet/config.php:8
|
|
|
|
| 996 |
msgid "Email"
|
| 997 |
msgstr "De"
|
| 998 |
|
| 1001 |
msgstr "URL"
|
| 1002 |
|
| 1003 |
#: ../processors/akismet/config.php:27
|
|
|
|
| 1004 |
msgid "Error Message"
|
| 1005 |
+
msgstr "Message d'erreur"
|
| 1006 |
|
| 1007 |
#: ../processors/akismet/config.php:29
|
| 1008 |
msgid "Sorry, that looked very spammy, try rephrasing things"
|
| 1009 |
+
msgstr "Désolé, cela ressemblait à du spam, veuillez reformuelr les choses"
|
| 1010 |
|
| 1011 |
#: ../processors/auto_responder/config.php:2 ../ui/panels/emailer.php:42
|
| 1012 |
msgid "From Name"
|
| 1022 |
|
| 1023 |
#: ../processors/auto_responder/config.php:20
|
| 1024 |
msgid "Recipient Name"
|
| 1025 |
+
msgstr "Nom du destinataire"
|
| 1026 |
|
| 1027 |
#: ../processors/auto_responder/config.php:26
|
| 1028 |
msgid "Recipient Email"
|
| 1029 |
+
msgstr "Courriel du destinataire"
|
| 1030 |
|
| 1031 |
#: ../processors/auto_responder/config.php:32
|
| 1032 |
msgid "Message"
|
| 1033 |
msgstr "Message"
|
| 1034 |
|
| 1035 |
+
#: ../processors/classes/get_data.php:76
|
| 1036 |
+
#, php-format
|
| 1037 |
+
msgid "%s is required"
|
| 1038 |
+
msgstr ""
|
| 1039 |
+
|
| 1040 |
#: ../processors/increment/config.php:2
|
| 1041 |
msgid "Increment Start"
|
| 1042 |
+
msgstr "Début d'incrémentation"
|
| 1043 |
|
| 1044 |
#: ../processors/increment/config.php:6
|
| 1045 |
msgid "Number to start incrementing."
|
| 1046 |
+
msgstr "Nombre où l'incrémentation commence."
|
| 1047 |
|
| 1048 |
#: ../processors/increment/config.php:8
|
| 1049 |
msgid ""
|
| 1050 |
"Incremenets started at {{start}}. to reset, delete this and insert a new "
|
| 1051 |
"increment processor."
|
| 1052 |
msgstr ""
|
| 1053 |
+
"Incrémentation débutée à {{start}}. Pour réinitialiser, supprimez cela et "
|
| 1054 |
+
"insérez un nouveau traitement d'incrémentation."
|
| 1055 |
|
| 1056 |
#: ../processors/increment/config.php:14
|
|
|
|
| 1057 |
msgid "Increment Field"
|
| 1058 |
+
msgstr "Champ d'incrémentation"
|
| 1059 |
|
| 1060 |
#: ../processors/increment/config.php:17
|
| 1061 |
msgid ""
|
| 1062 |
"If you want to show the value in the entries, Select a Hidden field in form "
|
| 1063 |
"to capture the value to."
|
| 1064 |
msgstr ""
|
| 1065 |
+
"Si vous souhaitez afficher la valeur dans les données, sélectionnez un champ "
|
| 1066 |
+
"masqué du formulaire dans lequel capturer la valeur."
|
| 1067 |
|
| 1068 |
#: ../processors/redirect/config.php:8
|
|
|
|
| 1069 |
msgid "Redirect Message"
|
| 1070 |
+
msgstr "Redirection de message"
|
| 1071 |
|
| 1072 |
#: ../processors/redirect/config.php:11
|
| 1073 |
msgid "Message text shown when redirecting in Ajax mode."
|
| 1074 |
+
msgstr "Texte du message affiché lors de la redirection Ajax."
|
| 1075 |
|
| 1076 |
#: ../ui/admin.php:26
|
| 1077 |
msgid "Create Form"
|
| 1079 |
|
| 1080 |
#: ../ui/admin.php:38
|
| 1081 |
msgid "Create New Form"
|
| 1082 |
+
msgstr "Créer un nouveau formulaire"
|
| 1083 |
|
| 1084 |
#: ../ui/admin.php:38
|
| 1085 |
msgid "New Form"
|
| 1087 |
|
| 1088 |
#: ../ui/admin.php:41 ../ui/admin_templates.php:33
|
| 1089 |
msgid "Import Form"
|
| 1090 |
+
msgstr "Importer un formulaire"
|
| 1091 |
|
| 1092 |
#: ../ui/admin.php:41
|
| 1093 |
msgid "Import"
|
| 1095 |
|
| 1096 |
#: ../ui/admin.php:47
|
| 1097 |
msgid "Front-end Style Includes"
|
| 1098 |
+
msgstr "Inclusions de style en frontend"
|
| 1099 |
|
| 1100 |
#: ../ui/admin.php:51
|
| 1101 |
msgid "Includes Bootstrap 3 styles on the frontend for form alert notices"
|
| 1102 |
msgstr ""
|
| 1103 |
+
"Inclut les styles Bootstrap 3 dans le frontend pour les notifications du "
|
| 1104 |
+
"formulaire"
|
| 1105 |
|
| 1106 |
#: ../ui/admin.php:51
|
| 1107 |
msgid "Alert"
|
| 1108 |
+
msgstr "Notification"
|
| 1109 |
|
| 1110 |
#: ../ui/admin.php:52
|
| 1111 |
msgid "Includes Bootstrap 3 styles on the frontend for form fields and buttons"
|
| 1112 |
msgstr ""
|
| 1113 |
+
"Inclut les styles Bootstrap 3 dans le frontend pour les champs et boutons du "
|
| 1114 |
+
"formulaire"
|
| 1115 |
|
| 1116 |
#: ../ui/admin.php:53
|
| 1117 |
msgid "Includes Bootstrap 3 styles on the frontend for form grid layouts"
|
| 1118 |
msgstr ""
|
| 1119 |
+
"Inclut les styles Bootstrap 3 dans le frontend pour les dispositions de "
|
| 1120 |
+
"grille"
|
| 1121 |
|
| 1122 |
#: ../ui/admin.php:53
|
| 1123 |
msgid "Grid"
|
| 1124 |
msgstr "Grille"
|
| 1125 |
|
| 1126 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1127 |
msgid "Entries"
|
| 1128 |
msgstr "données"
|
| 1129 |
|
| 1130 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1131 |
#: ../ui/panels/emailer.php:35
|
| 1132 |
msgid "Disabled"
|
| 1133 |
+
msgstr "Désactivé"
|
| 1134 |
|
| 1135 |
+
#: ../ui/admin.php:112
|
| 1136 |
msgid "Mailer Debug enabled."
|
| 1137 |
+
msgstr "Débogage courielleur activé."
|
| 1138 |
|
| 1139 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1140 |
msgid "Edit"
|
| 1141 |
msgstr "Modifier"
|
| 1142 |
|
| 1143 |
+
#: ../ui/admin.php:141
|
|
|
|
| 1144 |
msgid "Export"
|
| 1145 |
+
msgstr "Exporter"
|
| 1146 |
|
| 1147 |
+
#: ../ui/admin.php:142
|
|
|
|
| 1148 |
msgid "Clone Form"
|
| 1149 |
+
msgstr "Cloner le formulaire"
|
| 1150 |
|
| 1151 |
+
#: ../ui/admin.php:142
|
| 1152 |
msgid "Clone"
|
| 1153 |
+
msgstr "Cloner"
|
| 1154 |
|
| 1155 |
+
#: ../ui/admin.php:143
|
| 1156 |
msgid "This will delete this form permanently. Continue?"
|
| 1157 |
msgstr ""
|
| 1158 |
+
"Cela va supprimer le formulaire définitivement. Voulez-vous continuer ?"
|
| 1159 |
|
| 1160 |
+
#: ../ui/admin.php:143
|
| 1161 |
msgid "Delete"
|
| 1162 |
msgstr "Supprimer"
|
| 1163 |
|
| 1164 |
+
#: ../ui/admin.php:163
|
| 1165 |
msgid "You don't have any forms."
|
| 1166 |
+
msgstr "Vous n'avez aucun formulaire."
|
| 1167 |
|
| 1168 |
+
#: ../ui/admin.php:204
|
| 1169 |
msgid "An form name is required"
|
| 1170 |
msgstr "Un nom de formulaire est requis"
|
| 1171 |
|
| 1172 |
+
#: ../ui/admin.php:231
|
| 1173 |
msgid ""
|
| 1174 |
"Looks like something is not working. Please try again a little later or post "
|
| 1175 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1176 |
"\"_blank\">support forum</a>."
|
| 1177 |
msgstr ""
|
| 1178 |
+
"Il semblerait que quelque chose ne fonctionne pas. Réessayez ou contactez le "
|
| 1179 |
"<a href=\"http://wordpress.org/support/plugin/caldera-forms\" target=\"_blank"
|
| 1180 |
"\">support</a>."
|
| 1181 |
|
| 1182 |
#: ../ui/admin_templates.php:2 ../ui/admin_templates.php:7
|
| 1183 |
msgid "Bulk Actions"
|
| 1184 |
+
msgstr "Actions groupées"
|
| 1185 |
|
| 1186 |
#: ../ui/admin_templates.php:3 ../ui/admin_templates.php:8
|
| 1187 |
msgid "Export Selected"
|
| 1188 |
+
msgstr "Exporter la sélection"
|
| 1189 |
|
| 1190 |
#: ../ui/admin_templates.php:4
|
| 1191 |
msgid "Move to Trash"
|
| 1195 |
msgid "Delete Permanently"
|
| 1196 |
msgstr "Supprimer définitivement"
|
| 1197 |
|
| 1198 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
|
|
|
| 1199 |
msgid "Form Name"
|
| 1200 |
msgstr "Nom du formulaire"
|
| 1201 |
|
| 1202 |
#: ../ui/admin_templates.php:25
|
|
|
|
| 1203 |
msgid "Form File"
|
| 1204 |
+
msgstr "Fichier du formulaire"
|
| 1205 |
|
| 1206 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1207 |
msgid "Description"
|
| 1208 |
msgstr "Description"
|
| 1209 |
|
| 1210 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1211 |
msgid "ID"
|
| 1212 |
+
msgstr "ID"
|
| 1213 |
|
| 1214 |
#: ../ui/admin_templates.php:73 ../ui/admin_templates.php:111
|
| 1215 |
msgid "Submitted"
|
| 1221 |
|
| 1222 |
#: ../ui/admin_templates.php:100
|
| 1223 |
msgid "No entries yet."
|
| 1224 |
+
msgstr "Il n'y a pas encore de données."
|
| 1225 |
|
| 1226 |
#: ../ui/edit.php:13
|
|
|
|
| 1227 |
msgid "Form has successfully been submitted. Thank you."
|
| 1228 |
+
msgstr "Le formulaire a été envoyé. Merci pour votre contribution."
|
| 1229 |
|
| 1230 |
+
#: ../ui/edit.php:99
|
| 1231 |
msgid "Auto Populate"
|
| 1232 |
+
msgstr "Remplir automatiquement"
|
| 1233 |
|
| 1234 |
+
#: ../ui/edit.php:105
|
| 1235 |
msgid "Auto Type"
|
| 1236 |
+
msgstr "Saisie automatique"
|
| 1237 |
|
| 1238 |
+
#: ../ui/edit.php:108
|
| 1239 |
msgid "Select a source"
|
| 1240 |
msgstr "Choisir une source"
|
| 1241 |
|
| 1242 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1243 |
msgid "Post Type"
|
| 1244 |
+
msgstr "Type de ressource"
|
| 1245 |
|
| 1246 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1247 |
msgid "Taxonomy"
|
| 1248 |
+
msgstr "Taxonomie"
|
| 1249 |
|
| 1250 |
+
#: ../ui/edit.php:167
|
| 1251 |
msgid "Add Option"
|
| 1252 |
msgstr "Ajouter une option"
|
| 1253 |
|
| 1254 |
+
#: ../ui/edit.php:168
|
| 1255 |
msgid "Bulk Insert"
|
| 1256 |
+
msgstr "Insertion groupée"
|
| 1257 |
|
| 1258 |
+
#: ../ui/edit.php:171
|
| 1259 |
msgid "Single option per line. These replace the current list."
|
| 1260 |
+
msgstr "Une option par ligne. Ceci remplace la liste actuelle."
|
| 1261 |
|
| 1262 |
+
#: ../ui/edit.php:172
|
| 1263 |
msgid "Insert Options"
|
| 1264 |
+
msgstr "Insérer les options"
|
| 1265 |
|
| 1266 |
+
#: ../ui/edit.php:176
|
| 1267 |
msgid "No Default"
|
| 1268 |
+
msgstr "Pas de valeur par défaut"
|
| 1269 |
|
| 1270 |
+
#: ../ui/edit.php:177
|
| 1271 |
msgid "Show Values"
|
| 1272 |
msgstr "Montrer les valeurs"
|
| 1273 |
|
| 1274 |
+
#: ../ui/edit.php:181
|
| 1275 |
msgid "Label"
|
| 1276 |
+
msgstr "Titre"
|
| 1277 |
|
| 1278 |
+
#: ../ui/edit.php:342
|
| 1279 |
msgid "Elements"
|
| 1280 |
msgstr "Éléments"
|
| 1281 |
|
| 1282 |
+
#: ../ui/edit.php:354
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1283 |
msgid "Element Type"
|
| 1284 |
+
msgstr "Type d'élément"
|
| 1285 |
|
| 1286 |
+
#: ../ui/edit.php:379
|
| 1287 |
msgid "Hide Label"
|
| 1288 |
+
msgstr "Masquer le titre"
|
| 1289 |
|
| 1290 |
+
#: ../ui/edit.php:386
|
| 1291 |
msgid "Slug"
|
| 1292 |
+
msgstr "Slug"
|
| 1293 |
+
|
| 1294 |
+
#: ../ui/edit.php:392
|
| 1295 |
+
msgid "Condition"
|
| 1296 |
msgstr ""
|
| 1297 |
|
| 1298 |
+
#: ../ui/edit.php:397
|
| 1299 |
+
msgid "Disable"
|
| 1300 |
+
msgstr "Désactiver"
|
| 1301 |
+
|
| 1302 |
+
#: ../ui/edit.php:403
|
| 1303 |
msgid "Required"
|
| 1304 |
msgstr "Requis"
|
| 1305 |
|
| 1306 |
+
#: ../ui/edit.php:417
|
| 1307 |
msgid "Show in Entry List"
|
| 1308 |
+
msgstr "Afficher dans la liste des données"
|
| 1309 |
|
| 1310 |
+
#: ../ui/edit.php:427
|
| 1311 |
msgid ""
|
| 1312 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1313 |
msgstr ""
|
| 1314 |
+
"Souhaitez-vous vraiment supprimer ce champ ? \"Annuler\" pour abandonner. "
|
| 1315 |
+
"\"OK\" pour supprimer."
|
| 1316 |
|
| 1317 |
+
#: ../ui/edit.php:427
|
| 1318 |
msgid "Delete Element"
|
| 1319 |
msgstr "Supprimer un élément"
|
| 1320 |
|
| 1321 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1322 |
msgid "General Settings"
|
| 1323 |
msgstr "Paramètres généraux"
|
| 1324 |
|
| 1325 |
+
#: ../ui/edit.php:498
|
| 1326 |
msgid "Updated Successfully"
|
| 1327 |
+
msgstr "Mis à jour avec succès !"
|
| 1328 |
|
| 1329 |
+
#: ../ui/edit.php:500
|
| 1330 |
msgid "Update Form"
|
| 1331 |
msgstr "Mettre à jour le formulaire"
|
| 1332 |
|
| 1333 |
+
#: ../ui/edit.php:501
|
| 1334 |
msgid "Preview Form"
|
| 1335 |
msgstr "Prévisualiser le formulaire"
|
| 1336 |
|
| 1337 |
+
#: ../ui/edit.php:514
|
| 1338 |
msgid "Form Description"
|
| 1339 |
msgstr "Description du formulaire"
|
| 1340 |
|
| 1341 |
+
#: ../ui/edit.php:521
|
| 1342 |
msgid "State"
|
| 1343 |
+
msgstr "État"
|
| 1344 |
|
| 1345 |
+
#: ../ui/edit.php:523
|
| 1346 |
msgid "Deactivate / Draft"
|
| 1347 |
+
msgstr "Désactiver / brouillon"
|
| 1348 |
|
| 1349 |
+
#: ../ui/edit.php:528
|
| 1350 |
msgid "Capture Entries"
|
| 1351 |
msgstr "Sauvegarder les données"
|
| 1352 |
|
| 1353 |
+
#: ../ui/edit.php:536
|
| 1354 |
msgid "Pin to Menu"
|
| 1355 |
msgstr "Attacher au menu"
|
| 1356 |
|
| 1357 |
+
#: ../ui/edit.php:545
|
| 1358 |
msgid "View Entries"
|
| 1359 |
msgstr "Voir les données"
|
| 1360 |
|
| 1361 |
+
#: ../ui/edit.php:547
|
| 1362 |
msgid "All"
|
| 1363 |
+
msgstr "Tout"
|
| 1364 |
|
| 1365 |
+
#: ../ui/edit.php:569
|
| 1366 |
msgid "Hide Form"
|
| 1367 |
+
msgstr "Masquer le formulaire"
|
| 1368 |
|
| 1369 |
+
#: ../ui/edit.php:571
|
| 1370 |
msgid "Hide form after successful submission"
|
| 1371 |
+
msgstr "Masquer le formulaire après son envoi"
|
| 1372 |
|
| 1373 |
+
#: ../ui/edit.php:576
|
|
|
|
| 1374 |
msgid "Honeypot"
|
| 1375 |
+
msgstr "Piège à pirates"
|
| 1376 |
|
| 1377 |
+
#: ../ui/edit.php:578
|
| 1378 |
msgid "Place an invisible field to trick spambots"
|
| 1379 |
+
msgstr "Placer un champ invisible pour leurrer les robots de spam."
|
| 1380 |
|
| 1381 |
+
#: ../ui/edit.php:583
|
| 1382 |
msgid "Success Message"
|
| 1383 |
+
msgstr "Message en cas de succès"
|
| 1384 |
|
| 1385 |
+
#: ../ui/edit.php:589
|
| 1386 |
msgid "Gravatar Field"
|
| 1387 |
+
msgstr "Champ Gravatar"
|
| 1388 |
|
| 1389 |
+
#: ../ui/edit.php:596
|
| 1390 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1391 |
+
msgstr "Utilisé lorsqu'on voit une donnée d'un utilisateur non authentifié."
|
| 1392 |
|
| 1393 |
+
#: ../ui/edit.php:670
|
| 1394 |
msgid "Add New"
|
| 1395 |
msgstr "Ajouter"
|
| 1396 |
|
| 1397 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1398 |
msgid "Remove"
|
| 1399 |
msgstr "Supprimer"
|
| 1400 |
|
| 1401 |
+
#: ../ui/edit.php:825
|
| 1402 |
msgid "Set Element"
|
| 1403 |
+
msgstr "Définir l'élément"
|
| 1404 |
|
| 1405 |
+
#: ../ui/edit.php:828
|
| 1406 |
msgid "No description given"
|
| 1407 |
msgstr "Pas de description"
|
| 1408 |
|
| 1409 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1410 |
msgid "or"
|
| 1411 |
msgstr "ou"
|
| 1412 |
|
| 1413 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1414 |
msgid "is"
|
| 1415 |
msgstr "est"
|
| 1416 |
|
| 1417 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1418 |
msgid "is not"
|
| 1419 |
msgstr "n'est pas"
|
| 1420 |
|
| 1421 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1422 |
msgid "is greater than"
|
| 1423 |
msgstr "est plus grand que"
|
| 1424 |
|
| 1425 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1426 |
msgid "is less than"
|
| 1427 |
msgstr "est plus petit que"
|
| 1428 |
|
| 1429 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1430 |
msgid "starts with"
|
| 1431 |
+
msgstr "commence par"
|
| 1432 |
|
| 1433 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1434 |
msgid "ends with"
|
| 1435 |
+
msgstr "se termine par"
|
| 1436 |
|
| 1437 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1438 |
msgid "contains"
|
| 1439 |
msgstr "contient"
|
| 1440 |
|
| 1441 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1442 |
msgid "Select field first"
|
| 1443 |
msgstr "Sélectionner le champ en premier"
|
| 1444 |
|
| 1445 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1446 |
+
#: ../ui/panels/conditions.php:129
|
| 1447 |
msgid "Add Condition"
|
| 1448 |
+
msgstr "Ajouter une condition"
|
| 1449 |
|
| 1450 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1451 |
msgid "and"
|
| 1452 |
msgstr "et"
|
| 1453 |
|
| 1454 |
#: ../ui/entries_toolbar.php:15
|
| 1455 |
msgid "Active"
|
| 1456 |
+
msgstr "Actif"
|
| 1457 |
|
| 1458 |
#: ../ui/entries_toolbar.php:31
|
| 1459 |
msgid "Export Entries"
|
| 1465 |
|
| 1466 |
#: ../ui/entry_navigation.php:23
|
| 1467 |
msgid "item"
|
| 1468 |
+
msgstr "élément"
|
| 1469 |
|
| 1470 |
#: ../ui/entry_navigation.php:23
|
| 1471 |
msgid "items"
|
| 1472 |
+
msgstr "éléments"
|
| 1473 |
|
| 1474 |
#: ../ui/extend.php:23
|
| 1475 |
+
msgid ""
|
| 1476 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1477 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1478 |
+
"Forms."
|
| 1479 |
msgstr ""
|
| 1480 |
+
"REMARQUE : Nous déplaçons actuellement les licences de Caldera Forms vers le "
|
| 1481 |
+
"gestionnaire de licence CalderaWP. Ce panneau sera supprimé dans une version "
|
| 1482 |
+
"ultérieure de Caldera Forms."
|
| 1483 |
+
|
| 1484 |
+
#: ../ui/extend.php:29
|
| 1485 |
+
msgid "No licensed addons installed."
|
| 1486 |
+
msgstr "Aucune extension avec licence installée."
|
| 1487 |
|
| 1488 |
+
#: ../ui/extend.php:54
|
| 1489 |
msgid "Already Installed"
|
| 1490 |
msgstr "Déjà installé"
|
| 1491 |
|
| 1492 |
#: ../ui/insert_shortcode.php:5
|
| 1493 |
msgid "Insert Caldera Form"
|
| 1494 |
+
msgstr "Insérer un formulaire"
|
| 1495 |
|
| 1496 |
#: ../ui/insert_shortcode.php:24
|
| 1497 |
msgid "You don't have any forms to insert."
|
| 1498 |
+
msgstr "Vous n'avez aucun formulaire a insérer."
|
| 1499 |
|
| 1500 |
#: ../ui/insert_shortcode.php:32
|
| 1501 |
msgid "Insert Form"
|
| 1509 |
msgid "Unable to connect or no extensions available."
|
| 1510 |
msgstr "Connexion impossible ou aucune extension disponible."
|
| 1511 |
|
| 1512 |
+
#: ../ui/panels/conditions.php:65
|
| 1513 |
+
msgid "Show"
|
| 1514 |
+
msgstr "Afficher"
|
| 1515 |
+
|
| 1516 |
+
#: ../ui/panels/conditions.php:66
|
| 1517 |
+
msgid "Hide"
|
| 1518 |
+
msgstr "Masquer"
|
| 1519 |
+
|
| 1520 |
+
#: ../ui/panels/conditions.php:69
|
| 1521 |
+
msgid "Add Conditional Line"
|
| 1522 |
+
msgstr ""
|
| 1523 |
+
|
| 1524 |
+
#: ../ui/panels/conditions.php:83
|
| 1525 |
+
msgid "if"
|
| 1526 |
+
msgstr ""
|
| 1527 |
+
|
| 1528 |
+
#: ../ui/panels/conditions.php:133
|
| 1529 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1530 |
+
msgstr ""
|
| 1531 |
+
|
| 1532 |
+
#: ../ui/panels/conditions.php:133
|
| 1533 |
+
msgid "Remove Condition"
|
| 1534 |
+
msgstr ""
|
| 1535 |
+
|
| 1536 |
+
#: ../ui/panels/conditions.php:137
|
| 1537 |
+
msgid "Applied Fields"
|
| 1538 |
+
msgstr ""
|
| 1539 |
+
|
| 1540 |
+
#: ../ui/panels/conditions.php:138
|
| 1541 |
+
msgid "Select the fields to apply this condition to."
|
| 1542 |
+
msgstr ""
|
| 1543 |
+
|
| 1544 |
#: ../ui/panels/emailer.php:36
|
| 1545 |
msgid "Enabled"
|
| 1546 |
msgstr "Activé"
|
| 1547 |
|
| 1548 |
#: ../ui/panels/emailer.php:45
|
| 1549 |
msgid "Name from which the email comes"
|
| 1550 |
+
msgstr "Nom de l'expéditeur du courriel"
|
| 1551 |
|
| 1552 |
#: ../ui/panels/emailer.php:52
|
| 1553 |
msgid ""
|
| 1555 |
"form. Rather use your own email and use a form field in the \"Reply To Email"
|
| 1556 |
"\" below."
|
| 1557 |
msgstr ""
|
| 1558 |
+
"Adresse électronique de l'expéditeur du message. Essayez de ne pas utiliser "
|
| 1559 |
+
"une valeur d'un champ du formulaire. Utilisez plutôt votre propre adresse et "
|
| 1560 |
+
"insérez la valeur d'un champ dans la ligne \"Courriel de réponse\" ci-"
|
| 1561 |
+
"dessous."
|
| 1562 |
|
| 1563 |
#: ../ui/panels/emailer.php:56
|
| 1564 |
msgid "Reply To Email"
|
| 1565 |
+
msgstr "Courriel de réponse"
|
| 1566 |
|
| 1567 |
#: ../ui/panels/emailer.php:59
|
| 1568 |
msgid ""
|
| 1569 |
"The email address of the person filling in the form. This will allow the "
|
| 1570 |
"email to be replied directly to the sender."
|
| 1571 |
msgstr ""
|
| 1572 |
+
"L'adresse électronique de la personne remplissant le formulaire. Cela "
|
| 1573 |
+
"permettra de répondre directement à l'expéditeur."
|
| 1574 |
|
| 1575 |
#: ../ui/panels/emailer.php:64
|
| 1576 |
msgid "Email Type"
|
| 1577 |
+
msgstr "Type de courriel"
|
| 1578 |
|
| 1579 |
#: ../ui/panels/emailer.php:73
|
| 1580 |
msgid "CSV Include"
|
| 1581 |
+
msgstr "Inclure le CSV"
|
| 1582 |
|
| 1583 |
#: ../ui/panels/emailer.php:75
|
| 1584 |
msgid "Attach a CSV version of the submission"
|
| 1585 |
+
msgstr "Joindre une version CSV des données du formulaire"
|
| 1586 |
|
| 1587 |
#: ../ui/panels/emailer.php:81
|
| 1588 |
msgid "Recipients"
|
| 1589 |
+
msgstr "Destinataires"
|
| 1590 |
|
| 1591 |
+
#: ../ui/panels/emailer.php:84
|
| 1592 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1593 |
+
msgstr ""
|
| 1594 |
|
| 1595 |
#: ../ui/panels/emailer.php:89
|
| 1596 |
msgid "BCC"
|
| 1597 |
+
msgstr "Copie cachée"
|
| 1598 |
+
|
| 1599 |
+
#: ../ui/panels/emailer.php:92
|
| 1600 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1601 |
msgstr ""
|
| 1602 |
|
| 1603 |
#: ../ui/panels/emailer.php:100
|
| 1606 |
|
| 1607 |
#: ../ui/panels/emailer.php:104
|
| 1608 |
msgid "Email Message"
|
| 1609 |
+
msgstr "Message"
|
| 1610 |
|
| 1611 |
#: ../ui/panels/emailer.php:107
|
|
|
|
| 1612 |
msgid ""
|
| 1613 |
"Magic tags, %field_slug% are replaced with submitted data. Use {summary} to "
|
| 1614 |
"build an automatic mail based on form content. Leaving the mailer blank, "
|
| 1615 |
"will create and automatic summary."
|
| 1616 |
msgstr ""
|
| 1617 |
+
"Balises magiques, %field_slug% sera remplacé par la donnée correspondante du "
|
| 1618 |
+
"formulaire. Utiliser {summary} pour générer les données automatiquement "
|
| 1619 |
+
"basées sur le contenu du formulaire. Laisser vide correspond à {summary}."
|
| 1620 |
|
| 1621 |
#: ../ui/panels/emailer.php:113
|
| 1622 |
msgid "Debug Mailer"
|
| 1623 |
+
msgstr "Débogage courrielleur"
|
| 1624 |
|
| 1625 |
#: ../ui/panels/emailer.php:115
|
| 1626 |
msgid "Enable email send transation log"
|
| 1627 |
+
msgstr "Activer le journal des transactions d'envoi"
|
| 1628 |
|
| 1629 |
#: ../ui/panels/emailer.php:116
|
| 1630 |
msgid ""
|
| 1632 |
"log. Do not keep this enabled on production as it sends two emails for "
|
| 1633 |
"tracking."
|
| 1634 |
msgstr ""
|
| 1635 |
+
"Si défini, les données seront affublées d'un onglet de débogage pour voir le "
|
| 1636 |
+
"journal des tansactions. Ne laissez pas cette option activée en production "
|
| 1637 |
+
"puisque deux courriels sont envoyés pour le pistage."
|
| 1638 |
+
|
| 1639 |
+
#: ../ui/panels/emailer.php:118
|
| 1640 |
+
msgid "Learn more here"
|
| 1641 |
+
msgstr ""
|
| 1642 |
|
| 1643 |
+
#: ../ui/panels/emailer.php:130
|
| 1644 |
msgid ""
|
| 1645 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1646 |
"the form submittable."
|
| 1647 |
+
msgstr ""
|
| 1648 |
+
"Ajouter un boutton \"Submit\" pour que les valeurs du formulaire puissent "
|
| 1649 |
+
"être envoyées."
|
| 1650 |
|
| 1651 |
#: ../ui/panels/layout.php:13
|
| 1652 |
msgid "This will remove all the fields in this row. Are you sure?"
|
| 1653 |
msgstr ""
|
| 1654 |
+
"Cela supprimera tous les champs de la ligne. Souhaitez-vous vraiment cela ?"
|
|
|
|
| 1655 |
|
| 1656 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1657 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1658 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1659 |
msgid "Page"
|
| 1660 |
msgstr "Page"
|
| 1661 |
|
| 1662 |
+
#: ../ui/panels/layout_toolbar.php:11
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1663 |
msgid "Add Page"
|
| 1664 |
msgstr "Ajouter une page"
|
| 1665 |
|
| 1666 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1667 |
msgid "Drag onto the form grid below"
|
| 1668 |
+
msgstr "Glissez vers la grille de formulaire ci-dessous"
|
| 1669 |
|
| 1670 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1671 |
msgid "Add Element"
|
| 1672 |
msgstr "Ajouter un élément"
|
| 1673 |
|
| 1674 |
#: ../ui/panels/pages.php:2
|
| 1675 |
msgid "Progress Bar"
|
| 1676 |
+
msgstr "Barre de progression"
|
| 1677 |
|
| 1678 |
#: ../ui/panels/pages.php:4
|
| 1679 |
msgid "Show Breadcrumbs"
|
| 1680 |
+
msgstr "Afficher les pistes"
|
| 1681 |
|
| 1682 |
#: ../ui/panels/pages.php:5
|
| 1683 |
msgid "ProTip: Use an HTML element to build a custom progress per page"
|
| 1684 |
msgstr ""
|
| 1685 |
+
"Astuce de pro : utilisez un élément HTML pour créer une progression "
|
| 1686 |
+
"personnalisée par page"
|
| 1687 |
|
| 1688 |
#: ../ui/panels/processors.php:22 ../ui/panels/processors.php:47
|
| 1689 |
#: ../ui/panels/processors.php:100
|
| 1690 |
msgid "New Form Processor"
|
| 1691 |
+
msgstr "Nouveau traitement de formulaire"
|
| 1692 |
|
| 1693 |
#: ../ui/panels/processors.php:103
|
| 1694 |
msgid "Processor Type"
|
| 1695 |
+
msgstr "Type de traitement"
|
| 1696 |
|
| 1697 |
#: ../ui/panels/processors.php:117
|
| 1698 |
msgid "Are you sure you want to remove this processor?"
|
| 1699 |
+
msgstr "Souhaitez-vous vraiment supprimer ce traitement ?"
|
| 1700 |
|
| 1701 |
#: ../ui/panels/processors.php:117
|
| 1702 |
msgid "Remove Processor"
|
| 1703 |
+
msgstr "Supprimer le traitement"
|
| 1704 |
|
| 1705 |
#: ../ui/panels/processors.php:123
|
| 1706 |
msgid "Use"
|
| 1707 |
+
msgstr "Utiliser"
|
| 1708 |
|
| 1709 |
#: ../ui/panels/processors.php:124
|
| 1710 |
msgid "Don't Use"
|
| 1711 |
+
msgstr "Ne pas utiliser"
|
| 1712 |
+
|
| 1713 |
+
#: ../ui/panels/processors.php:126
|
| 1714 |
+
msgid "Add Conditional Group"
|
| 1715 |
+
msgstr "Ajouter un groupe conditionnel"
|
| 1716 |
|
| 1717 |
#: ../ui/panels/processors.php:171
|
| 1718 |
msgid "Add Processor"
|
| 1719 |
+
msgstr "Ajouter un traitement"
|
| 1720 |
|
| 1721 |
#: ../ui/panels/processors.php:221
|
| 1722 |
msgid "Use Processor"
|
| 1723 |
+
msgstr "Utiliser le traitement"
|
| 1724 |
|
| 1725 |
#: ../ui/panels/processors.php:226
|
| 1726 |
msgid "by"
|
| 1728 |
|
| 1729 |
#: ../ui/panels/processors.php:284
|
| 1730 |
msgid "This processor has no configurable options."
|
| 1731 |
+
msgstr "Ce traitement n'a pas d'options configurables."
|
| 1732 |
|
| 1733 |
#: ../ui/panels/variable_add.php:1
|
| 1734 |
msgid "Add Variable"
|
| 1736 |
|
| 1737 |
#: ../ui/panels/variables.php:14
|
| 1738 |
msgid "Behaviour"
|
| 1739 |
+
msgstr "Comportement"
|
| 1740 |
|
| 1741 |
#: ../ui/panels/variables.php:16
|
| 1742 |
msgid "No variables defined"
|
| 1744 |
|
| 1745 |
#: ../ui/panels/variables.php:29 ../ui/panels/variables.php:49
|
| 1746 |
msgid "Static"
|
| 1747 |
+
msgstr "Statique"
|
| 1748 |
|
| 1749 |
#: ../ui/panels/variables.php:30 ../ui/panels/variables.php:50
|
| 1750 |
msgid "Passback"
|
| 1751 |
+
msgstr "Retour"
|
| 1752 |
|
| 1753 |
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
|
|
|
| 1754 |
msgid "Entry List"
|
| 1755 |
+
msgstr "Liste des données"
|
| 1756 |
+
|
| 1757 |
+
#~ msgid "Settings"
|
| 1758 |
+
#~ msgstr "Paramètres"
|
| 1759 |
+
|
| 1760 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1761 |
+
#~ msgstr "Adresses séparées par des virgules"
|
| 1762 |
+
|
| 1763 |
+
#~ msgid "Add Row"
|
| 1764 |
+
#~ msgstr "Ajouter une ligne"
|
| 1765 |
|
| 1766 |
#, fuzzy
|
| 1767 |
#~ msgid ""
|
languages/caldera-forms-ja.mo
CHANGED
|
Binary file
|
languages/caldera-forms-ja.po
CHANGED
|
@@ -1,434 +1,470 @@
|
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
-
"POT-Creation-Date: 2015-
|
| 5 |
-
"PO-Revision-Date: 2015-
|
| 6 |
"Last-Translator: David Cramer <david@caldera.co.za>\n"
|
| 7 |
"Language-Team: Kiho Shin\n"
|
| 8 |
"Language: ja\n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
-
"X-Generator: Poedit 1.
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=1; plural=0;\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
-
#: ../classes/
|
|
|
|
|
|
|
|
|
|
|
|
|
| 20 |
#, fuzzy
|
| 21 |
msgid "Invalid Form."
|
| 22 |
msgstr "無効なフォームID "
|
| 23 |
|
| 24 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
#: ../ui/entries_toolbar.php:27
|
| 26 |
msgid "Trash"
|
| 27 |
msgstr "ゴミ箱"
|
| 28 |
|
| 29 |
-
#: ../classes/admin.php:
|
| 30 |
#: ../ui/admin_templates.php:9
|
| 31 |
msgid "Restore"
|
| 32 |
msgstr "復元"
|
| 33 |
|
| 34 |
-
#: ../classes/admin.php:
|
| 35 |
msgid "Entry"
|
| 36 |
msgstr "エントリー"
|
| 37 |
|
| 38 |
-
#: ../classes/admin.php:
|
| 39 |
msgid "View"
|
| 40 |
msgstr "表示"
|
| 41 |
|
| 42 |
-
#: ../classes/admin.php:
|
| 43 |
msgid "Add Form to Page"
|
| 44 |
msgstr "ページにフォームを追加"
|
| 45 |
|
| 46 |
-
#: ../classes/admin.php:
|
| 47 |
msgid "Insert Form Shortcode"
|
| 48 |
msgstr "フォームのショートコードを挿入"
|
| 49 |
|
| 50 |
-
#: ../classes/admin.php:
|
| 51 |
msgid "Caldera Form"
|
| 52 |
msgstr "Caldera フォーム"
|
| 53 |
|
| 54 |
-
#: ../classes/admin.php:
|
| 55 |
msgid "Deactivate"
|
| 56 |
msgstr ""
|
| 57 |
|
| 58 |
-
#: ../classes/admin.php:
|
| 59 |
msgid "Activate"
|
| 60 |
msgstr ""
|
| 61 |
|
| 62 |
-
#: ../classes/admin.php:
|
| 63 |
-
#: ../classes/admin.php:
|
| 64 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 65 |
-
#: ../ui/community.php:5 ../ui/edit.php:
|
| 66 |
msgid "Caldera Forms"
|
| 67 |
msgstr "Caldera フォーム"
|
| 68 |
|
| 69 |
-
#: ../classes/admin.php:
|
| 70 |
msgid "Caldera Forms Admin"
|
| 71 |
msgstr ""
|
| 72 |
|
| 73 |
-
#: ../classes/admin.php:
|
| 74 |
msgid "Forms"
|
| 75 |
msgstr "フォーム"
|
| 76 |
|
| 77 |
-
#: ../classes/admin.php:
|
| 78 |
msgid "Community"
|
| 79 |
msgstr "コミュニティ"
|
| 80 |
|
| 81 |
-
#: ../classes/admin.php:
|
| 82 |
msgid "Extend"
|
| 83 |
msgstr "拡張する"
|
| 84 |
|
| 85 |
-
#: ../classes/admin.php:
|
| 86 |
msgid "Sorry, please try again"
|
| 87 |
msgstr "もう一度試してください"
|
| 88 |
|
| 89 |
-
#: ../classes/admin.php:
|
| 90 |
msgid "Form Delete Error"
|
| 91 |
msgstr "フォーム削除エラー"
|
| 92 |
|
| 93 |
-
#: ../classes/admin.php:
|
| 94 |
msgid "Sorry, File is not valid."
|
| 95 |
msgstr "ファイルに対応していません。"
|
| 96 |
|
| 97 |
-
#: ../classes/admin.php:
|
| 98 |
-
#: ../classes/admin.php:
|
| 99 |
msgid "Form Import Error"
|
| 100 |
msgstr "フォームのインポート エラー"
|
| 101 |
|
| 102 |
-
#: ../classes/admin.php:
|
| 103 |
msgid "Sorry, File not uploaded."
|
| 104 |
msgstr "ファイルのアップロードに失敗しました。"
|
| 105 |
|
| 106 |
-
#: ../classes/admin.php:
|
| 107 |
msgid "Form does not exist."
|
| 108 |
msgstr "フォームが見つかりません。"
|
| 109 |
|
| 110 |
-
#: ../classes/admin.php:
|
| 111 |
msgid "Export selection has expired"
|
| 112 |
msgstr "エクスポートの設定"
|
| 113 |
|
| 114 |
-
#: ../classes/admin.php:
|
| 115 |
msgid "Export Expired"
|
| 116 |
msgstr ""
|
| 117 |
|
| 118 |
-
#: ../classes/admin.php:
|
| 119 |
#, fuzzy
|
| 120 |
msgid "Form has been successfully submitted. Thank you."
|
| 121 |
msgstr "送信されました。有難うございます。"
|
| 122 |
|
| 123 |
-
#: ../classes/admin.php:
|
| 124 |
msgid "Layout"
|
| 125 |
msgstr "レイアウト"
|
| 126 |
|
| 127 |
-
#: ../classes/admin.php:
|
| 128 |
msgid "Layout Builder"
|
| 129 |
msgstr "レイアウト ビルダー"
|
| 130 |
|
| 131 |
-
#: ../classes/admin.php:
|
| 132 |
msgid "Pages"
|
| 133 |
msgstr "ページ"
|
| 134 |
|
| 135 |
-
#: ../classes/admin.php:
|
| 136 |
msgid "Form Pages"
|
| 137 |
msgstr ""
|
| 138 |
|
| 139 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 140 |
msgid "Processors"
|
| 141 |
msgstr "処理"
|
| 142 |
|
| 143 |
-
#: ../classes/admin.php:
|
| 144 |
msgid "Form Processors"
|
| 145 |
msgstr "フォーム処理"
|
| 146 |
|
| 147 |
-
#: ../classes/admin.php:
|
| 148 |
#: ../ui/panels/variables.php:83
|
| 149 |
msgid "Variables"
|
| 150 |
msgstr "変数"
|
| 151 |
|
| 152 |
-
#: ../classes/admin.php:
|
| 153 |
msgid "Responsive"
|
| 154 |
msgstr "レスポンシブ"
|
| 155 |
|
| 156 |
-
#: ../classes/admin.php:
|
| 157 |
msgid "Resposive Settings"
|
| 158 |
msgstr "レスポンシブ設定"
|
| 159 |
|
| 160 |
-
#: ../classes/admin.php:
|
| 161 |
msgid "Grid Collapse"
|
| 162 |
msgstr "グリッドを縮小表示"
|
| 163 |
|
| 164 |
-
#: ../classes/admin.php:
|
| 165 |
msgid ""
|
| 166 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 167 |
"Bootstrap 3.0)"
|
| 168 |
msgstr "縮小表示次の最小表示サイズを設定 (Bootstrap 3.0 に基づく)"
|
| 169 |
|
| 170 |
-
#: ../classes/admin.php:
|
| 171 |
msgid "Maintain grid always"
|
| 172 |
msgstr "常にグリッド設定を保持する"
|
| 173 |
|
| 174 |
-
#: ../classes/admin.php:
|
| 175 |
msgid "Mailer"
|
| 176 |
msgstr "メーラー"
|
| 177 |
|
| 178 |
-
#: ../classes/admin.php:
|
| 179 |
msgid "Email Notification Settings"
|
| 180 |
msgstr "メール通知設定"
|
| 181 |
|
| 182 |
-
#: ../classes/core.php:
|
| 183 |
#, fuzzy
|
| 184 |
msgid "The wasn't entered correct."
|
| 185 |
msgstr "reCAPTCHA が間違っています。"
|
| 186 |
|
| 187 |
-
#: ../classes/core.php:
|
| 188 |
msgid "Reset"
|
| 189 |
msgstr ""
|
| 190 |
|
| 191 |
-
#: ../classes/core.php:
|
| 192 |
msgid "Permission denied."
|
| 193 |
msgstr "権限がありません。"
|
| 194 |
|
| 195 |
-
#: ../classes/core.php:
|
| 196 |
-
msgid "Caldera Forms Notification"
|
| 197 |
-
msgstr "Caldera フォームの通知"
|
| 198 |
-
|
| 199 |
-
#: ../classes/core.php:973
|
| 200 |
msgid "Auto Responder"
|
| 201 |
msgstr "自動返信メール"
|
| 202 |
|
| 203 |
-
#: ../classes/core.php:
|
| 204 |
msgid "Sends out an auto response e-mail"
|
| 205 |
msgstr "自動返信メールを送る"
|
| 206 |
|
| 207 |
-
#: ../classes/core.php:
|
| 208 |
msgid "Thank you for contacting us"
|
| 209 |
msgstr "お問い合わせ有難うございます。"
|
| 210 |
|
| 211 |
-
#: ../classes/core.php:
|
| 212 |
msgid "Redirect"
|
| 213 |
msgstr "転送"
|
| 214 |
|
| 215 |
-
#: ../classes/core.php:
|
| 216 |
msgid "Redirects user to URL on successful submit"
|
| 217 |
msgstr "送信成功後転送するURL"
|
| 218 |
|
| 219 |
-
#: ../classes/core.php:
|
| 220 |
msgid "Increment Value"
|
| 221 |
msgstr ""
|
| 222 |
|
| 223 |
-
#: ../classes/core.php:
|
| 224 |
msgid "Increment a value per entry."
|
| 225 |
msgstr ""
|
| 226 |
|
| 227 |
-
#: ../classes/core.php:
|
| 228 |
msgid "Akismet"
|
| 229 |
msgstr ""
|
| 230 |
|
| 231 |
-
#: ../classes/core.php:
|
| 232 |
msgid "Anti-spam filtering"
|
| 233 |
msgstr ""
|
| 234 |
|
| 235 |
-
#: ../classes/core.php:
|
| 236 |
msgid "Akismet not setup."
|
| 237 |
msgstr ""
|
| 238 |
|
| 239 |
-
#: ../classes/core.php:
|
| 240 |
msgid "Calculation"
|
| 241 |
msgstr "計算"
|
| 242 |
|
| 243 |
-
#: ../classes/core.php:
|
| 244 |
-
#: ../classes/core.php:
|
| 245 |
msgid "Special"
|
| 246 |
msgstr "スペシャル"
|
| 247 |
|
| 248 |
-
#: ../classes/core.php:
|
| 249 |
msgid "Math"
|
| 250 |
msgstr ""
|
| 251 |
|
| 252 |
-
#: ../classes/core.php:
|
| 253 |
msgid "Calculate values"
|
| 254 |
msgstr "計算値"
|
| 255 |
|
| 256 |
-
#: ../classes/core.php:
|
| 257 |
msgid "Total"
|
| 258 |
msgstr "合計"
|
| 259 |
|
| 260 |
-
#: ../classes/core.php:
|
| 261 |
msgid "Range Slider"
|
| 262 |
msgstr "レンジ スライダー"
|
| 263 |
|
| 264 |
-
#: ../classes/core.php:
|
| 265 |
msgid "Range Slider input field"
|
| 266 |
msgstr "レンジ スライダー入力フィールド"
|
| 267 |
|
| 268 |
-
#: ../classes/core.php:
|
| 269 |
msgid "Star Rating"
|
| 270 |
msgstr "スター評価"
|
| 271 |
|
| 272 |
-
#: ../classes/core.php:
|
| 273 |
msgid "Feedback"
|
| 274 |
msgstr ""
|
| 275 |
|
| 276 |
-
#: ../classes/core.php:
|
| 277 |
msgid "Star rating input for feedback"
|
| 278 |
msgstr "フィードバックのスター評価"
|
| 279 |
|
| 280 |
-
#: ../classes/core.php:
|
| 281 |
msgid "Phone Number"
|
| 282 |
msgstr "電話番号"
|
| 283 |
|
| 284 |
-
#: ../classes/core.php:
|
| 285 |
msgid "Phone number with masking"
|
| 286 |
msgstr "フォーマット化された電話番号"
|
| 287 |
|
| 288 |
-
#: ../classes/core.php:
|
| 289 |
-
#: ../classes/core.php:
|
| 290 |
-
#: ../classes/core.php:
|
| 291 |
msgid "Text Fields"
|
| 292 |
msgstr "テキスト入力"
|
| 293 |
|
| 294 |
-
#: ../classes/core.php:
|
| 295 |
-
#: ../classes/core.php:1353 ../classes/core.php:1369 ../classes/core.php:1390
|
| 296 |
-
#: ../classes/core.php:1400 ../classes/core.php:1441 ../classes/core.php:1460
|
| 297 |
-
#: ../classes/core.php:1479 ../classes/core.php:1552 ../ui/edit.php:170
|
| 298 |
-
msgid "Basic"
|
| 299 |
-
msgstr "ベーシック"
|
| 300 |
-
|
| 301 |
-
#: ../classes/core.php:1262
|
| 302 |
msgid "User"
|
| 303 |
msgstr ""
|
| 304 |
|
| 305 |
-
#: ../classes/core.php:
|
| 306 |
msgid "Single Line Text"
|
| 307 |
msgstr "一行のテキスト入力"
|
| 308 |
|
| 309 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 310 |
msgid "File"
|
| 311 |
msgstr ""
|
| 312 |
|
| 313 |
-
#: ../classes/core.php:
|
| 314 |
msgid "File Uploader"
|
| 315 |
msgstr "ファイル アップローダ"
|
| 316 |
|
| 317 |
-
#: ../classes/core.php:
|
| 318 |
msgid "reCAPTCHA"
|
| 319 |
msgstr ""
|
| 320 |
|
| 321 |
-
#: ../classes/core.php:
|
| 322 |
msgid "reCAPTCHA anti-spam field"
|
| 323 |
msgstr "reCAPTCHA アンチスパム フィールド"
|
| 324 |
|
| 325 |
-
#: ../classes/core.php:
|
| 326 |
msgid "HTML"
|
| 327 |
msgstr ""
|
| 328 |
|
| 329 |
-
#: ../classes/core.php:
|
| 330 |
msgid "Add text/html content"
|
| 331 |
msgstr "text/html コンテンツの追加"
|
| 332 |
|
| 333 |
-
#: ../classes/core.php:
|
| 334 |
#: ../processors/akismet/config.php:20
|
| 335 |
msgid "Content"
|
| 336 |
msgstr "コンテンツ"
|
| 337 |
|
| 338 |
-
#: ../classes/core.php:
|
| 339 |
msgid "Hidden"
|
| 340 |
msgstr "非表示"
|
| 341 |
|
| 342 |
-
#: ../classes/core.php:
|
| 343 |
msgid "Button"
|
| 344 |
msgstr ""
|
| 345 |
|
| 346 |
-
#: ../classes/core.php:
|
| 347 |
msgid "Button, Submit and Reset types"
|
| 348 |
msgstr "ボタン、送信、リセット"
|
| 349 |
|
| 350 |
-
#: ../classes/core.php:
|
| 351 |
msgid "Buttons"
|
| 352 |
msgstr ""
|
| 353 |
|
| 354 |
-
#: ../classes/core.php:
|
| 355 |
msgid "Email Address"
|
| 356 |
msgstr "メールアドレス"
|
| 357 |
|
| 358 |
-
#: ../classes/core.php:
|
| 359 |
msgid "Paragraph Textarea"
|
| 360 |
msgstr "テキスト エリア入力"
|
| 361 |
|
| 362 |
-
#: ../classes/core.php:
|
| 363 |
msgid "Toggle Switch"
|
| 364 |
msgstr "トグル スイッチ"
|
| 365 |
|
| 366 |
-
#: ../classes/core.php:
|
| 367 |
-
#: ../classes/core.php:
|
| 368 |
msgid "Select Options"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
-
#: ../classes/core.php:
|
| 372 |
msgid "Dropdown Select"
|
| 373 |
msgstr "ドロップダウンリスト"
|
| 374 |
|
| 375 |
-
#: ../classes/core.php:
|
| 376 |
msgid "Checkbox"
|
| 377 |
msgstr "チェックボックス"
|
| 378 |
|
| 379 |
-
#: ../classes/core.php:
|
| 380 |
msgid "Radio"
|
| 381 |
msgstr "ラジオボタン"
|
| 382 |
|
| 383 |
-
#: ../classes/core.php:
|
| 384 |
msgid "Date Picker"
|
| 385 |
msgstr "日付ピッカー"
|
| 386 |
|
| 387 |
-
#: ../classes/core.php:
|
| 388 |
msgid "Pickers"
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
-
#: ../classes/core.php:
|
| 392 |
msgid "Color Picker"
|
| 393 |
msgstr "カラーピッカー"
|
| 394 |
|
| 395 |
-
#: ../classes/core.php:
|
| 396 |
#, fuzzy
|
| 397 |
msgid "State/ Province Select"
|
| 398 |
msgstr "1つ選択"
|
| 399 |
|
| 400 |
-
#: ../classes/core.php:
|
| 401 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 402 |
msgstr ""
|
| 403 |
|
| 404 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 405 |
msgid "System Tags"
|
| 406 |
msgstr "システムタグ"
|
| 407 |
|
| 408 |
-
#: ../classes/core.php:
|
| 409 |
#, fuzzy
|
| 410 |
msgid "Mailer Debug"
|
| 411 |
msgstr "メーラー"
|
| 412 |
|
| 413 |
-
#: ../classes/core.php:
|
| 414 |
msgid "Invalid form ID"
|
| 415 |
msgstr "無効なフォームID "
|
| 416 |
|
| 417 |
-
#: ../classes/core.php:
|
| 418 |
-
#: ../classes/core.php:
|
| 419 |
-
#: ../classes/core.php:
|
| 420 |
msgid "Permission denied or entry does not exist."
|
| 421 |
msgstr "アクセス権限が無いかエントリーが存在しません。"
|
| 422 |
|
| 423 |
-
#: ../classes/core.php:
|
| 424 |
msgid "is required"
|
| 425 |
msgstr "は必須項目"
|
| 426 |
|
| 427 |
-
#: ../classes/core.php:
|
| 428 |
msgid "Form is currently not active."
|
| 429 |
msgstr ""
|
| 430 |
|
| 431 |
-
#: ../classes/core.php:
|
| 432 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 433 |
msgstr ""
|
| 434 |
|
|
@@ -436,7 +472,7 @@ msgstr ""
|
|
| 436 |
msgid "Title"
|
| 437 |
msgstr "タイトル"
|
| 438 |
|
| 439 |
-
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:
|
| 440 |
msgid "Form"
|
| 441 |
msgstr "フォーム"
|
| 442 |
|
|
@@ -558,16 +594,32 @@ msgid "The starting view of the date picker (month, year, decade)"
|
|
| 558 |
msgstr ""
|
| 559 |
|
| 560 |
#: ../fields/date_picker/setup.php:32
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 561 |
msgid "language"
|
| 562 |
msgstr ""
|
| 563 |
|
| 564 |
-
#: ../fields/date_picker/setup.php:
|
| 565 |
msgid "Language to use. e.g. pt-BR"
|
| 566 |
msgstr ""
|
| 567 |
|
| 568 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 569 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 570 |
-
#: ../fields/text/config.php:2
|
| 571 |
msgid "Placeholder"
|
| 572 |
msgstr ""
|
| 573 |
|
|
@@ -576,10 +628,14 @@ msgid "Attach to mailer"
|
|
| 576 |
msgstr "メーラーに添付"
|
| 577 |
|
| 578 |
#: ../fields/file/config_template.php:9
|
|
|
|
|
|
|
|
|
|
|
|
|
| 579 |
msgid "Allowed Types"
|
| 580 |
msgstr "使用可能なタイプ"
|
| 581 |
|
| 582 |
-
#: ../fields/file/config_template.php:
|
| 583 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 584 |
msgstr "コンマ区切り、jpg, pdf, txt"
|
| 585 |
|
|
@@ -641,7 +697,7 @@ msgstr "ボーダー"
|
|
| 641 |
msgid "Border Radius"
|
| 642 |
msgstr "ボーダー"
|
| 643 |
|
| 644 |
-
#: ../fields/hidden/setup.php:2 ../ui/edit.php:
|
| 645 |
#: ../ui/panels/variables.php:12
|
| 646 |
msgid "Value"
|
| 647 |
msgstr "入力値"
|
|
@@ -674,7 +730,7 @@ msgstr "\"9\" を数値識別子として使用する"
|
|
| 674 |
msgid "Track"
|
| 675 |
msgstr "追跡"
|
| 676 |
|
| 677 |
-
#: ../fields/range_slider/config.php:23
|
| 678 |
msgid "Highlight"
|
| 679 |
msgstr "ハイライト"
|
| 680 |
|
|
@@ -682,7 +738,7 @@ msgstr "ハイライト"
|
|
| 682 |
msgid "Handle"
|
| 683 |
msgstr "ハンドル"
|
| 684 |
|
| 685 |
-
#: ../fields/range_slider/config.php:35
|
| 686 |
msgid "Border"
|
| 687 |
msgstr "ボーダー"
|
| 688 |
|
|
@@ -749,6 +805,14 @@ msgstr ""
|
|
| 749 |
msgid "No Site Key Added"
|
| 750 |
msgstr ""
|
| 751 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 752 |
#: ../fields/star-rate/config.php:2
|
| 753 |
msgid "Number of Stars"
|
| 754 |
msgstr "スターの数"
|
|
@@ -865,8 +929,8 @@ msgstr ""
|
|
| 865 |
msgid "Inactive Class"
|
| 866 |
msgstr ""
|
| 867 |
|
| 868 |
-
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:
|
| 869 |
-
#: ../ui/edit.php:
|
| 870 |
msgid "Enable"
|
| 871 |
msgstr "有効化"
|
| 872 |
|
|
@@ -924,16 +988,16 @@ msgstr "リダイレクト中"
|
|
| 924 |
msgid "Custom Class"
|
| 925 |
msgstr "カスタム クラス"
|
| 926 |
|
| 927 |
-
#: ../includes/field_processors.php:
|
| 928 |
msgid "File type not allowed. Allowed types are: "
|
| 929 |
msgstr "ファイルの種類に対応していません、使用可能なファイルの種類: "
|
| 930 |
|
| 931 |
-
#: ../includes/field_processors.php:
|
| 932 |
msgid "File type needs to be"
|
| 933 |
msgstr "対応しているファイルの種類は"
|
| 934 |
|
| 935 |
-
#: ../processors/akismet/config.php:2 ../ui/edit.php:
|
| 936 |
-
#: ../ui/panels/variables.php:10
|
| 937 |
msgid "Name"
|
| 938 |
msgstr "名称"
|
| 939 |
|
|
@@ -979,6 +1043,11 @@ msgstr "受信者メールアドレス"
|
|
| 979 |
msgid "Message"
|
| 980 |
msgstr "メッセージ"
|
| 981 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 982 |
#: ../processors/increment/config.php:2
|
| 983 |
msgid "Increment Start"
|
| 984 |
msgstr ""
|
|
@@ -1058,54 +1127,54 @@ msgstr "フロントエンドのフォーム グリッドでBootstrap 3スタイ
|
|
| 1058 |
msgid "Grid"
|
| 1059 |
msgstr "グリッド"
|
| 1060 |
|
| 1061 |
-
#: ../ui/admin.php:
|
| 1062 |
msgid "Entries"
|
| 1063 |
msgstr "エントリー"
|
| 1064 |
|
| 1065 |
-
#: ../ui/admin.php:
|
| 1066 |
#: ../ui/panels/emailer.php:35
|
| 1067 |
msgid "Disabled"
|
| 1068 |
msgstr "無効"
|
| 1069 |
|
| 1070 |
-
#: ../ui/admin.php:
|
| 1071 |
msgid "Mailer Debug enabled."
|
| 1072 |
msgstr ""
|
| 1073 |
|
| 1074 |
-
#: ../ui/admin.php:
|
| 1075 |
msgid "Edit"
|
| 1076 |
msgstr ""
|
| 1077 |
|
| 1078 |
-
#: ../ui/admin.php:
|
| 1079 |
#, fuzzy
|
| 1080 |
msgid "Export"
|
| 1081 |
msgstr "インポート"
|
| 1082 |
|
| 1083 |
-
#: ../ui/admin.php:
|
| 1084 |
#, fuzzy
|
| 1085 |
msgid "Clone Form"
|
| 1086 |
msgstr "Caldera フォーム"
|
| 1087 |
|
| 1088 |
-
#: ../ui/admin.php:
|
| 1089 |
msgid "Clone"
|
| 1090 |
msgstr ""
|
| 1091 |
|
| 1092 |
-
#: ../ui/admin.php:
|
| 1093 |
msgid "This will delete this form permanently. Continue?"
|
| 1094 |
msgstr "継続してこのフォームを完全に削除しますか？"
|
| 1095 |
|
| 1096 |
-
#: ../ui/admin.php:
|
| 1097 |
msgid "Delete"
|
| 1098 |
msgstr ""
|
| 1099 |
|
| 1100 |
-
#: ../ui/admin.php:
|
| 1101 |
msgid "You don't have any forms."
|
| 1102 |
msgstr "フォームはありません,"
|
| 1103 |
|
| 1104 |
-
#: ../ui/admin.php:
|
| 1105 |
msgid "An form name is required"
|
| 1106 |
msgstr "フォーム名が必要です"
|
| 1107 |
|
| 1108 |
-
#: ../ui/admin.php:
|
| 1109 |
msgid ""
|
| 1110 |
"Looks like something is not working. Please try again a little later or post "
|
| 1111 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
|
@@ -1131,8 +1200,7 @@ msgstr "ゴミ箱に移動"
|
|
| 1131 |
msgid "Delete Permanently"
|
| 1132 |
msgstr ""
|
| 1133 |
|
| 1134 |
-
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48
|
| 1135 |
-
#: ../ui/edit.php:468
|
| 1136 |
msgid "Form Name"
|
| 1137 |
msgstr "フォーム名"
|
| 1138 |
|
|
@@ -1141,11 +1209,11 @@ msgstr "フォーム名"
|
|
| 1141 |
msgid "Form File"
|
| 1142 |
msgstr "フォーム名"
|
| 1143 |
|
| 1144 |
-
#: ../ui/admin_templates.php:54 ../ui/edit.php:
|
| 1145 |
msgid "Description"
|
| 1146 |
msgstr "詳細"
|
| 1147 |
|
| 1148 |
-
#: ../ui/admin_templates.php:72 ../ui/edit.php:
|
| 1149 |
msgid "ID"
|
| 1150 |
msgstr "ID"
|
| 1151 |
|
|
@@ -1166,244 +1234,229 @@ msgstr "えんとりーはありません。"
|
|
| 1166 |
msgid "Form has successfully been submitted. Thank you."
|
| 1167 |
msgstr "フォームは送信いたしました。"
|
| 1168 |
|
| 1169 |
-
#: ../ui/edit.php:
|
| 1170 |
msgid "Auto Populate"
|
| 1171 |
msgstr "オートポピュレート"
|
| 1172 |
|
| 1173 |
-
#: ../ui/edit.php:
|
| 1174 |
msgid "Auto Type"
|
| 1175 |
msgstr ""
|
| 1176 |
|
| 1177 |
-
#: ../ui/edit.php:
|
| 1178 |
msgid "Select a source"
|
| 1179 |
msgstr ""
|
| 1180 |
|
| 1181 |
-
#: ../ui/edit.php:
|
| 1182 |
msgid "Post Type"
|
| 1183 |
msgstr ""
|
| 1184 |
|
| 1185 |
-
#: ../ui/edit.php:
|
| 1186 |
msgid "Taxonomy"
|
| 1187 |
msgstr "タクソノミー"
|
| 1188 |
|
| 1189 |
-
#: ../ui/edit.php:
|
| 1190 |
msgid "Add Option"
|
| 1191 |
msgstr "オプションの追加"
|
| 1192 |
|
| 1193 |
-
#: ../ui/edit.php:
|
| 1194 |
msgid "Bulk Insert"
|
| 1195 |
msgstr "バルク挿入"
|
| 1196 |
|
| 1197 |
-
#: ../ui/edit.php:
|
| 1198 |
msgid "Single option per line. These replace the current list."
|
| 1199 |
msgstr "1行につき1つ選択可能です。既存のリストと換地します。"
|
| 1200 |
|
| 1201 |
-
#: ../ui/edit.php:
|
| 1202 |
msgid "Insert Options"
|
| 1203 |
msgstr ""
|
| 1204 |
|
| 1205 |
-
#: ../ui/edit.php:
|
| 1206 |
msgid "No Default"
|
| 1207 |
msgstr "ディフォルト設定無し"
|
| 1208 |
|
| 1209 |
-
#: ../ui/edit.php:
|
| 1210 |
msgid "Show Values"
|
| 1211 |
msgstr ""
|
| 1212 |
|
| 1213 |
-
#: ../ui/edit.php:
|
| 1214 |
msgid "Label"
|
| 1215 |
msgstr ""
|
| 1216 |
|
| 1217 |
-
#: ../ui/edit.php:
|
| 1218 |
msgid "Elements"
|
| 1219 |
msgstr "構成要素"
|
| 1220 |
|
| 1221 |
-
#: ../ui/edit.php:
|
| 1222 |
-
msgid "Settings"
|
| 1223 |
-
msgstr ""
|
| 1224 |
-
|
| 1225 |
-
#: ../ui/edit.php:306
|
| 1226 |
-
msgid "Conditions"
|
| 1227 |
-
msgstr ""
|
| 1228 |
-
|
| 1229 |
-
#: ../ui/edit.php:313
|
| 1230 |
msgid "Element Type"
|
| 1231 |
msgstr "構成要素の種類"
|
| 1232 |
|
| 1233 |
-
#: ../ui/edit.php:
|
| 1234 |
msgid "Hide Label"
|
| 1235 |
msgstr "ラベルを隠す"
|
| 1236 |
|
| 1237 |
-
#: ../ui/edit.php:
|
| 1238 |
msgid "Slug"
|
| 1239 |
msgstr "スラグ"
|
| 1240 |
|
| 1241 |
-
#: ../ui/edit.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1242 |
msgid "Required"
|
| 1243 |
msgstr "必須"
|
| 1244 |
|
| 1245 |
-
#: ../ui/edit.php:
|
| 1246 |
msgid "Show in Entry List"
|
| 1247 |
msgstr "エントリーに含む"
|
| 1248 |
|
| 1249 |
-
#: ../ui/edit.php:
|
| 1250 |
msgid ""
|
| 1251 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1252 |
msgstr ""
|
| 1253 |
"このフィールドを削除しますか？「キャンセル」を選択し中断するか、「OK」を選択"
|
| 1254 |
"し削除する。"
|
| 1255 |
|
| 1256 |
-
#: ../ui/edit.php:
|
| 1257 |
msgid "Delete Element"
|
| 1258 |
msgstr "構成要素を削除"
|
| 1259 |
|
| 1260 |
-
#: ../ui/edit.php:
|
| 1261 |
-
msgid "Show"
|
| 1262 |
-
msgstr "表示"
|
| 1263 |
-
|
| 1264 |
-
#: ../ui/edit.php:381
|
| 1265 |
-
msgid "Hide"
|
| 1266 |
-
msgstr "隠す"
|
| 1267 |
-
|
| 1268 |
-
#: ../ui/edit.php:382
|
| 1269 |
-
#, fuzzy
|
| 1270 |
-
msgid "Disable"
|
| 1271 |
-
msgstr "無効"
|
| 1272 |
-
|
| 1273 |
-
#: ../ui/edit.php:384 ../ui/panels/processors.php:126
|
| 1274 |
-
msgid "Add Conditional Group"
|
| 1275 |
-
msgstr "条件グループを追加"
|
| 1276 |
-
|
| 1277 |
-
#: ../ui/edit.php:454 ../ui/edit.php:466
|
| 1278 |
msgid "General Settings"
|
| 1279 |
msgstr "イパン設定"
|
| 1280 |
|
| 1281 |
-
#: ../ui/edit.php:
|
| 1282 |
msgid "Updated Successfully"
|
| 1283 |
msgstr ""
|
| 1284 |
|
| 1285 |
-
#: ../ui/edit.php:
|
| 1286 |
msgid "Update Form"
|
| 1287 |
msgstr "フォームを更新"
|
| 1288 |
|
| 1289 |
-
#: ../ui/edit.php:
|
| 1290 |
msgid "Preview Form"
|
| 1291 |
msgstr ""
|
| 1292 |
|
| 1293 |
-
#: ../ui/edit.php:
|
| 1294 |
msgid "Form Description"
|
| 1295 |
msgstr "フォームの詳細"
|
| 1296 |
|
| 1297 |
-
#: ../ui/edit.php:
|
| 1298 |
#, fuzzy
|
| 1299 |
msgid "State"
|
| 1300 |
msgstr "スタティック"
|
| 1301 |
|
| 1302 |
-
#: ../ui/edit.php:
|
| 1303 |
msgid "Deactivate / Draft"
|
| 1304 |
msgstr ""
|
| 1305 |
|
| 1306 |
-
#: ../ui/edit.php:
|
| 1307 |
msgid "Capture Entries"
|
| 1308 |
msgstr ""
|
| 1309 |
|
| 1310 |
-
#: ../ui/edit.php:
|
| 1311 |
msgid "Pin to Menu"
|
| 1312 |
msgstr "メニューにピン止めする"
|
| 1313 |
|
| 1314 |
-
#: ../ui/edit.php:
|
| 1315 |
msgid "View Entries"
|
| 1316 |
msgstr "エントリーを表示"
|
| 1317 |
|
| 1318 |
-
#: ../ui/edit.php:
|
| 1319 |
msgid "All"
|
| 1320 |
msgstr ""
|
| 1321 |
|
| 1322 |
-
#: ../ui/edit.php:
|
| 1323 |
msgid "Hide Form"
|
| 1324 |
msgstr ""
|
| 1325 |
|
| 1326 |
-
#: ../ui/edit.php:
|
| 1327 |
msgid "Hide form after successful submission"
|
| 1328 |
msgstr "送信の性交後フォームを非表示にする"
|
| 1329 |
|
| 1330 |
-
#: ../ui/edit.php:
|
| 1331 |
msgid "Honeypot"
|
| 1332 |
msgstr ""
|
| 1333 |
|
| 1334 |
-
#: ../ui/edit.php:
|
| 1335 |
msgid "Place an invisible field to trick spambots"
|
| 1336 |
msgstr ""
|
| 1337 |
|
| 1338 |
-
#: ../ui/edit.php:
|
| 1339 |
msgid "Success Message"
|
| 1340 |
msgstr "成功時のメッセージ"
|
| 1341 |
|
| 1342 |
-
#: ../ui/edit.php:
|
| 1343 |
msgid "Gravatar Field"
|
| 1344 |
msgstr "Gravatar 用フィールド"
|
| 1345 |
|
| 1346 |
-
#: ../ui/edit.php:
|
| 1347 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1348 |
msgstr "ログインしていないユーザーのエントリーの表示に使用"
|
| 1349 |
|
| 1350 |
-
#: ../ui/edit.php:
|
| 1351 |
msgid "Add New"
|
| 1352 |
msgstr "新規追加"
|
| 1353 |
|
| 1354 |
-
#: ../ui/edit.php:
|
| 1355 |
msgid "Remove"
|
| 1356 |
msgstr "削除"
|
| 1357 |
|
| 1358 |
-
#: ../ui/edit.php:
|
| 1359 |
msgid "Set Element"
|
| 1360 |
msgstr "構成要素を確定"
|
| 1361 |
|
| 1362 |
-
#: ../ui/edit.php:
|
| 1363 |
msgid "No description given"
|
| 1364 |
msgstr "詳細無し"
|
| 1365 |
|
| 1366 |
-
#: ../ui/edit.php:
|
| 1367 |
msgid "or"
|
| 1368 |
msgstr "あるいは"
|
| 1369 |
|
| 1370 |
-
#: ../ui/edit.php:
|
| 1371 |
msgid "is"
|
| 1372 |
msgstr "が"
|
| 1373 |
|
| 1374 |
-
#: ../ui/edit.php:
|
| 1375 |
msgid "is not"
|
| 1376 |
msgstr "一致しない"
|
| 1377 |
|
| 1378 |
-
#: ../ui/edit.php:
|
| 1379 |
msgid "is greater than"
|
| 1380 |
msgstr "より大きいい"
|
| 1381 |
|
| 1382 |
-
#: ../ui/edit.php:
|
| 1383 |
msgid "is less than"
|
| 1384 |
msgstr "以下"
|
| 1385 |
|
| 1386 |
-
#: ../ui/edit.php:
|
| 1387 |
msgid "starts with"
|
| 1388 |
msgstr "接頭文字列"
|
| 1389 |
|
| 1390 |
-
#: ../ui/edit.php:
|
| 1391 |
msgid "ends with"
|
| 1392 |
msgstr "末尾文字列"
|
| 1393 |
|
| 1394 |
-
#: ../ui/edit.php:
|
| 1395 |
msgid "contains"
|
| 1396 |
msgstr "を含む"
|
| 1397 |
|
| 1398 |
-
#: ../ui/edit.php:
|
| 1399 |
msgid "Select field first"
|
| 1400 |
msgstr "フィールドを先に選択してください"
|
| 1401 |
|
| 1402 |
-
#: ../ui/edit.php:
|
|
|
|
| 1403 |
msgid "Add Condition"
|
| 1404 |
msgstr "条件を追加"
|
| 1405 |
|
| 1406 |
-
#: ../ui/edit.php:
|
| 1407 |
msgid "and"
|
| 1408 |
msgstr "および"
|
| 1409 |
|
|
@@ -1428,10 +1481,17 @@ msgid "items"
|
|
| 1428 |
msgstr ""
|
| 1429 |
|
| 1430 |
#: ../ui/extend.php:23
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1431 |
msgid "No licensed addons installed."
|
| 1432 |
msgstr "ライセンスされたアドオンはありません。"
|
| 1433 |
|
| 1434 |
-
#: ../ui/extend.php:
|
| 1435 |
msgid "Already Installed"
|
| 1436 |
msgstr "既にインストール済み"
|
| 1437 |
|
|
@@ -1455,6 +1515,38 @@ msgstr "閉じる"
|
|
| 1455 |
msgid "Unable to connect or no extensions available."
|
| 1456 |
msgstr "接続に問題があるか、エクステンションがありません。"
|
| 1457 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1458 |
#: ../ui/panels/emailer.php:36
|
| 1459 |
msgid "Enabled"
|
| 1460 |
msgstr "有効"
|
|
@@ -1497,14 +1589,18 @@ msgstr "CSV バージョンを添付する"
|
|
| 1497 |
msgid "Recipients"
|
| 1498 |
msgstr "受信者"
|
| 1499 |
|
| 1500 |
-
#: ../ui/panels/emailer.php:84
|
| 1501 |
-
msgid "Comma separated list of email addresses."
|
| 1502 |
-
msgstr "
|
| 1503 |
|
| 1504 |
#: ../ui/panels/emailer.php:89
|
| 1505 |
msgid "BCC"
|
| 1506 |
msgstr ""
|
| 1507 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1508 |
#: ../ui/panels/emailer.php:100
|
| 1509 |
msgid "Use %field_slug% to use a value from the form"
|
| 1510 |
msgstr "フォームからの値を使用するために %field_slug% を使う"
|
|
@@ -1540,7 +1636,11 @@ msgid ""
|
|
| 1540 |
"tracking."
|
| 1541 |
msgstr ""
|
| 1542 |
|
| 1543 |
-
#: ../ui/panels/emailer.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1544 |
msgid ""
|
| 1545 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1546 |
"the form submittable."
|
|
@@ -1551,24 +1651,20 @@ msgid "This will remove all the fields in this row. Are you sure?"
|
|
| 1551 |
msgstr "指定した列にあるすべてのフィールドが削除されます。よろしいですか？"
|
| 1552 |
|
| 1553 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1554 |
-
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:
|
| 1555 |
-
#: ../ui/panels/
|
| 1556 |
msgid "Page"
|
| 1557 |
msgstr "ページ"
|
| 1558 |
|
| 1559 |
-
#: ../ui/panels/
|
| 1560 |
-
msgid "Add Row"
|
| 1561 |
-
msgstr "行を追加"
|
| 1562 |
-
|
| 1563 |
-
#: ../ui/panels/layout_add_row.php:11
|
| 1564 |
msgid "Add Page"
|
| 1565 |
msgstr ""
|
| 1566 |
|
| 1567 |
-
#: ../ui/panels/
|
| 1568 |
msgid "Drag onto the form grid below"
|
| 1569 |
msgstr "フォームのグリッド上にどドラッグしてください"
|
| 1570 |
|
| 1571 |
-
#: ../ui/panels/
|
| 1572 |
msgid "Add Element"
|
| 1573 |
msgstr "項目を追加"
|
| 1574 |
|
|
@@ -1610,6 +1706,10 @@ msgstr "使用する"
|
|
| 1610 |
msgid "Don't Use"
|
| 1611 |
msgstr "使用しない"
|
| 1612 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1613 |
#: ../ui/panels/processors.php:171
|
| 1614 |
msgid "Add Processor"
|
| 1615 |
msgstr "プロセッサーを追加"
|
|
@@ -1651,6 +1751,12 @@ msgstr "パスバック"
|
|
| 1651 |
msgid "Entry List"
|
| 1652 |
msgstr "エントリーに含む"
|
| 1653 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1654 |
#, fuzzy
|
| 1655 |
#~ msgid ""
|
| 1656 |
#~ "Comma separated list of email addresses. Use %field_slug% to use a value "
|
|
@@ -1741,9 +1847,6 @@ msgstr "エントリーに含む"
|
|
| 1741 |
#~ msgid "Basic,File"
|
| 1742 |
#~ msgstr "ベーシック ファイル"
|
| 1743 |
|
| 1744 |
-
#~ msgid "Select Options,Special"
|
| 1745 |
-
#~ msgstr "選択オプション、スペシャル"
|
| 1746 |
-
|
| 1747 |
#~ msgid "Text Fields,Pickers"
|
| 1748 |
#~ msgstr "テキスト入力、ピッカー"
|
| 1749 |
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
+
"POT-Creation-Date: 2015-08-24 12:17+0200\n"
|
| 5 |
+
"PO-Revision-Date: 2015-08-24 12:17+0200\n"
|
| 6 |
"Last-Translator: David Cramer <david@caldera.co.za>\n"
|
| 7 |
"Language-Team: Kiho Shin\n"
|
| 8 |
"Language: ja\n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=1; plural=0;\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 20 |
+
msgid "Caldera Forms Notification"
|
| 21 |
+
msgstr "Caldera フォームの通知"
|
| 22 |
+
|
| 23 |
+
#: ../classes/admin.php:124
|
| 24 |
#, fuzzy
|
| 25 |
msgid "Invalid Form."
|
| 26 |
msgstr "無効なフォームID "
|
| 27 |
|
| 28 |
+
#: ../classes/admin.php:143
|
| 29 |
+
#, fuzzy
|
| 30 |
+
msgid "Starter Contact Form"
|
| 31 |
+
msgstr "スターの色"
|
| 32 |
+
|
| 33 |
+
#: ../classes/admin.php:147
|
| 34 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 35 |
+
msgstr ""
|
| 36 |
+
|
| 37 |
+
#: ../classes/admin.php:151
|
| 38 |
+
msgid "Registration Form, with optional additional participants."
|
| 39 |
+
msgstr ""
|
| 40 |
+
|
| 41 |
+
#: ../classes/admin.php:174
|
| 42 |
+
#, fuzzy
|
| 43 |
+
msgid "Form Template"
|
| 44 |
+
msgstr "フォーム名"
|
| 45 |
+
|
| 46 |
+
#: ../classes/admin.php:177
|
| 47 |
+
msgid "no template - blank form"
|
| 48 |
+
msgstr ""
|
| 49 |
+
|
| 50 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 51 |
#: ../ui/entries_toolbar.php:27
|
| 52 |
msgid "Trash"
|
| 53 |
msgstr "ゴミ箱"
|
| 54 |
|
| 55 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 56 |
#: ../ui/admin_templates.php:9
|
| 57 |
msgid "Restore"
|
| 58 |
msgstr "復元"
|
| 59 |
|
| 60 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 61 |
msgid "Entry"
|
| 62 |
msgstr "エントリー"
|
| 63 |
|
| 64 |
+
#: ../classes/admin.php:385
|
| 65 |
msgid "View"
|
| 66 |
msgstr "表示"
|
| 67 |
|
| 68 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 69 |
msgid "Add Form to Page"
|
| 70 |
msgstr "ページにフォームを追加"
|
| 71 |
|
| 72 |
+
#: ../classes/admin.php:428
|
| 73 |
msgid "Insert Form Shortcode"
|
| 74 |
msgstr "フォームのショートコードを挿入"
|
| 75 |
|
| 76 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 77 |
msgid "Caldera Form"
|
| 78 |
msgstr "Caldera フォーム"
|
| 79 |
|
| 80 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 81 |
msgid "Deactivate"
|
| 82 |
msgstr ""
|
| 83 |
|
| 84 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 85 |
msgid "Activate"
|
| 86 |
msgstr ""
|
| 87 |
|
| 88 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 89 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 90 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 91 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 92 |
msgid "Caldera Forms"
|
| 93 |
msgstr "Caldera フォーム"
|
| 94 |
|
| 95 |
+
#: ../classes/admin.php:746
|
| 96 |
msgid "Caldera Forms Admin"
|
| 97 |
msgstr ""
|
| 98 |
|
| 99 |
+
#: ../classes/admin.php:746
|
| 100 |
msgid "Forms"
|
| 101 |
msgstr "フォーム"
|
| 102 |
|
| 103 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 104 |
msgid "Community"
|
| 105 |
msgstr "コミュニティ"
|
| 106 |
|
| 107 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 108 |
msgid "Extend"
|
| 109 |
msgstr "拡張する"
|
| 110 |
|
| 111 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 112 |
msgid "Sorry, please try again"
|
| 113 |
msgstr "もう一度試してください"
|
| 114 |
|
| 115 |
+
#: ../classes/admin.php:1017
|
| 116 |
msgid "Form Delete Error"
|
| 117 |
msgstr "フォーム削除エラー"
|
| 118 |
|
| 119 |
+
#: ../classes/admin.php:1170
|
| 120 |
msgid "Sorry, File is not valid."
|
| 121 |
msgstr "ファイルに対応していません。"
|
| 122 |
|
| 123 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 124 |
+
#: ../classes/admin.php:1179
|
| 125 |
msgid "Form Import Error"
|
| 126 |
msgstr "フォームのインポート エラー"
|
| 127 |
|
| 128 |
+
#: ../classes/admin.php:1174
|
| 129 |
msgid "Sorry, File not uploaded."
|
| 130 |
msgstr "ファイルのアップロードに失敗しました。"
|
| 131 |
|
| 132 |
+
#: ../classes/admin.php:1188
|
| 133 |
msgid "Form does not exist."
|
| 134 |
msgstr "フォームが見つかりません。"
|
| 135 |
|
| 136 |
+
#: ../classes/admin.php:1229
|
| 137 |
msgid "Export selection has expired"
|
| 138 |
msgstr "エクスポートの設定"
|
| 139 |
|
| 140 |
+
#: ../classes/admin.php:1229
|
| 141 |
msgid "Export Expired"
|
| 142 |
msgstr ""
|
| 143 |
|
| 144 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 145 |
#, fuzzy
|
| 146 |
msgid "Form has been successfully submitted. Thank you."
|
| 147 |
msgstr "送信されました。有難うございます。"
|
| 148 |
|
| 149 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 150 |
msgid "Layout"
|
| 151 |
msgstr "レイアウト"
|
| 152 |
|
| 153 |
+
#: ../classes/admin.php:1465
|
| 154 |
msgid "Layout Builder"
|
| 155 |
msgstr "レイアウト ビルダー"
|
| 156 |
|
| 157 |
+
#: ../classes/admin.php:1475
|
| 158 |
msgid "Pages"
|
| 159 |
msgstr "ページ"
|
| 160 |
|
| 161 |
+
#: ../classes/admin.php:1477
|
| 162 |
msgid "Form Pages"
|
| 163 |
msgstr ""
|
| 164 |
|
| 165 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 166 |
+
msgid "Conditions"
|
| 167 |
+
msgstr ""
|
| 168 |
+
|
| 169 |
+
#: ../classes/admin.php:1487
|
| 170 |
msgid "Processors"
|
| 171 |
msgstr "処理"
|
| 172 |
|
| 173 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 174 |
msgid "Form Processors"
|
| 175 |
msgstr "フォーム処理"
|
| 176 |
|
| 177 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 178 |
#: ../ui/panels/variables.php:83
|
| 179 |
msgid "Variables"
|
| 180 |
msgstr "変数"
|
| 181 |
|
| 182 |
+
#: ../classes/admin.php:1502
|
| 183 |
msgid "Responsive"
|
| 184 |
msgstr "レスポンシブ"
|
| 185 |
|
| 186 |
+
#: ../classes/admin.php:1504
|
| 187 |
msgid "Resposive Settings"
|
| 188 |
msgstr "レスポンシブ設定"
|
| 189 |
|
| 190 |
+
#: ../classes/admin.php:1508
|
| 191 |
msgid "Grid Collapse"
|
| 192 |
msgstr "グリッドを縮小表示"
|
| 193 |
|
| 194 |
+
#: ../classes/admin.php:1510
|
| 195 |
msgid ""
|
| 196 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 197 |
"Bootstrap 3.0)"
|
| 198 |
msgstr "縮小表示次の最小表示サイズを設定 (Bootstrap 3.0 に基づく)"
|
| 199 |
|
| 200 |
+
#: ../classes/admin.php:1517
|
| 201 |
msgid "Maintain grid always"
|
| 202 |
msgstr "常にグリッド設定を保持する"
|
| 203 |
|
| 204 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 205 |
msgid "Mailer"
|
| 206 |
msgstr "メーラー"
|
| 207 |
|
| 208 |
+
#: ../classes/admin.php:1539
|
| 209 |
msgid "Email Notification Settings"
|
| 210 |
msgstr "メール通知設定"
|
| 211 |
|
| 212 |
+
#: ../classes/core.php:396
|
| 213 |
#, fuzzy
|
| 214 |
msgid "The wasn't entered correct."
|
| 215 |
msgstr "reCAPTCHA が間違っています。"
|
| 216 |
|
| 217 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 218 |
msgid "Reset"
|
| 219 |
msgstr ""
|
| 220 |
|
| 221 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 222 |
msgid "Permission denied."
|
| 223 |
msgstr "権限がありません。"
|
| 224 |
|
| 225 |
+
#: ../classes/core.php:787
|
|
|
|
|
|
|
|
|
|
|
|
|
| 226 |
msgid "Auto Responder"
|
| 227 |
msgstr "自動返信メール"
|
| 228 |
|
| 229 |
+
#: ../classes/core.php:788
|
| 230 |
msgid "Sends out an auto response e-mail"
|
| 231 |
msgstr "自動返信メールを送る"
|
| 232 |
|
| 233 |
+
#: ../classes/core.php:792
|
| 234 |
msgid "Thank you for contacting us"
|
| 235 |
msgstr "お問い合わせ有難うございます。"
|
| 236 |
|
| 237 |
+
#: ../classes/core.php:796
|
| 238 |
msgid "Redirect"
|
| 239 |
msgstr "転送"
|
| 240 |
|
| 241 |
+
#: ../classes/core.php:797
|
| 242 |
msgid "Redirects user to URL on successful submit"
|
| 243 |
msgstr "送信成功後転送するURL"
|
| 244 |
|
| 245 |
+
#: ../classes/core.php:802
|
| 246 |
msgid "Increment Value"
|
| 247 |
msgstr ""
|
| 248 |
|
| 249 |
+
#: ../classes/core.php:803
|
| 250 |
msgid "Increment a value per entry."
|
| 251 |
msgstr ""
|
| 252 |
|
| 253 |
+
#: ../classes/core.php:817
|
| 254 |
msgid "Akismet"
|
| 255 |
msgstr ""
|
| 256 |
|
| 257 |
+
#: ../classes/core.php:818
|
| 258 |
msgid "Anti-spam filtering"
|
| 259 |
msgstr ""
|
| 260 |
|
| 261 |
+
#: ../classes/core.php:866
|
| 262 |
msgid "Akismet not setup."
|
| 263 |
msgstr ""
|
| 264 |
|
| 265 |
+
#: ../classes/core.php:1017
|
| 266 |
msgid "Calculation"
|
| 267 |
msgstr "計算"
|
| 268 |
|
| 269 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 270 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 271 |
msgid "Special"
|
| 272 |
msgstr "スペシャル"
|
| 273 |
|
| 274 |
+
#: ../classes/core.php:1020
|
| 275 |
msgid "Math"
|
| 276 |
msgstr ""
|
| 277 |
|
| 278 |
+
#: ../classes/core.php:1021
|
| 279 |
msgid "Calculate values"
|
| 280 |
msgstr "計算値"
|
| 281 |
|
| 282 |
+
#: ../classes/core.php:1028
|
| 283 |
msgid "Total"
|
| 284 |
msgstr "合計"
|
| 285 |
|
| 286 |
+
#: ../classes/core.php:1040
|
| 287 |
msgid "Range Slider"
|
| 288 |
msgstr "レンジ スライダー"
|
| 289 |
|
| 290 |
+
#: ../classes/core.php:1043
|
| 291 |
msgid "Range Slider input field"
|
| 292 |
msgstr "レンジ スライダー入力フィールド"
|
| 293 |
|
| 294 |
+
#: ../classes/core.php:1077
|
| 295 |
msgid "Star Rating"
|
| 296 |
msgstr "スター評価"
|
| 297 |
|
| 298 |
+
#: ../classes/core.php:1079
|
| 299 |
msgid "Feedback"
|
| 300 |
msgstr ""
|
| 301 |
|
| 302 |
+
#: ../classes/core.php:1080
|
| 303 |
msgid "Star rating input for feedback"
|
| 304 |
msgstr "フィードバックのスター評価"
|
| 305 |
|
| 306 |
+
#: ../classes/core.php:1112
|
| 307 |
msgid "Phone Number"
|
| 308 |
msgstr "電話番号"
|
| 309 |
|
| 310 |
+
#: ../classes/core.php:1113
|
| 311 |
msgid "Phone number with masking"
|
| 312 |
msgstr "フォーマット化された電話番号"
|
| 313 |
|
| 314 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 315 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 316 |
+
#: ../classes/core.php:1376
|
| 317 |
msgid "Text Fields"
|
| 318 |
msgstr "テキスト入力"
|
| 319 |
|
| 320 |
+
#: ../classes/core.php:1115
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 321 |
msgid "User"
|
| 322 |
msgstr ""
|
| 323 |
|
| 324 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 325 |
msgid "Single Line Text"
|
| 326 |
msgstr "一行のテキスト入力"
|
| 327 |
|
| 328 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 329 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 330 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 331 |
+
#: ../ui/edit.php:215
|
| 332 |
+
msgid "Basic"
|
| 333 |
+
msgstr "ベーシック"
|
| 334 |
+
|
| 335 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 336 |
msgid "File"
|
| 337 |
msgstr ""
|
| 338 |
|
| 339 |
+
#: ../classes/core.php:1149
|
| 340 |
msgid "File Uploader"
|
| 341 |
msgstr "ファイル アップローダ"
|
| 342 |
|
| 343 |
+
#: ../classes/core.php:1159
|
| 344 |
msgid "reCAPTCHA"
|
| 345 |
msgstr ""
|
| 346 |
|
| 347 |
+
#: ../classes/core.php:1160
|
| 348 |
msgid "reCAPTCHA anti-spam field"
|
| 349 |
msgstr "reCAPTCHA アンチスパム フィールド"
|
| 350 |
|
| 351 |
+
#: ../classes/core.php:1185
|
| 352 |
msgid "HTML"
|
| 353 |
msgstr ""
|
| 354 |
|
| 355 |
+
#: ../classes/core.php:1186
|
| 356 |
msgid "Add text/html content"
|
| 357 |
msgstr "text/html コンテンツの追加"
|
| 358 |
|
| 359 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 360 |
#: ../processors/akismet/config.php:20
|
| 361 |
msgid "Content"
|
| 362 |
msgstr "コンテンツ"
|
| 363 |
|
| 364 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 365 |
msgid "Hidden"
|
| 366 |
msgstr "非表示"
|
| 367 |
|
| 368 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 369 |
msgid "Button"
|
| 370 |
msgstr ""
|
| 371 |
|
| 372 |
+
#: ../classes/core.php:1220
|
| 373 |
msgid "Button, Submit and Reset types"
|
| 374 |
msgstr "ボタン、送信、リセット"
|
| 375 |
|
| 376 |
+
#: ../classes/core.php:1222
|
| 377 |
msgid "Buttons"
|
| 378 |
msgstr ""
|
| 379 |
|
| 380 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 381 |
msgid "Email Address"
|
| 382 |
msgstr "メールアドレス"
|
| 383 |
|
| 384 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 385 |
msgid "Paragraph Textarea"
|
| 386 |
msgstr "テキスト エリア入力"
|
| 387 |
|
| 388 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 389 |
msgid "Toggle Switch"
|
| 390 |
msgstr "トグル スイッチ"
|
| 391 |
|
| 392 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 393 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 394 |
msgid "Select Options"
|
| 395 |
msgstr ""
|
| 396 |
|
| 397 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 398 |
msgid "Dropdown Select"
|
| 399 |
msgstr "ドロップダウンリスト"
|
| 400 |
|
| 401 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 402 |
msgid "Checkbox"
|
| 403 |
msgstr "チェックボックス"
|
| 404 |
|
| 405 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 406 |
msgid "Radio"
|
| 407 |
msgstr "ラジオボタン"
|
| 408 |
|
| 409 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 410 |
msgid "Date Picker"
|
| 411 |
msgstr "日付ピッカー"
|
| 412 |
|
| 413 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 414 |
msgid "Pickers"
|
| 415 |
msgstr ""
|
| 416 |
|
| 417 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 418 |
msgid "Color Picker"
|
| 419 |
msgstr "カラーピッカー"
|
| 420 |
|
| 421 |
+
#: ../classes/core.php:1402
|
| 422 |
#, fuzzy
|
| 423 |
msgid "State/ Province Select"
|
| 424 |
msgstr "1つ選択"
|
| 425 |
|
| 426 |
+
#: ../classes/core.php:1403
|
| 427 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 428 |
msgstr ""
|
| 429 |
|
| 430 |
+
#: ../classes/core.php:1417
|
| 431 |
+
#, fuzzy
|
| 432 |
+
msgid "Autocomplete"
|
| 433 |
+
msgstr "オートポピュレート"
|
| 434 |
+
|
| 435 |
+
#: ../classes/core.php:1419
|
| 436 |
+
#, fuzzy
|
| 437 |
+
msgid "Pickers,Select Options"
|
| 438 |
+
msgstr "選択オプション、スペシャル"
|
| 439 |
+
|
| 440 |
+
#: ../classes/core.php:1838
|
| 441 |
msgid "System Tags"
|
| 442 |
msgstr "システムタグ"
|
| 443 |
|
| 444 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 445 |
#, fuzzy
|
| 446 |
msgid "Mailer Debug"
|
| 447 |
msgstr "メーラー"
|
| 448 |
|
| 449 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 450 |
msgid "Invalid form ID"
|
| 451 |
msgstr "無効なフォームID "
|
| 452 |
|
| 453 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 454 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 455 |
+
#: ../classes/core.php:4111
|
| 456 |
msgid "Permission denied or entry does not exist."
|
| 457 |
msgstr "アクセス権限が無いかエントリーが存在しません。"
|
| 458 |
|
| 459 |
+
#: ../classes/core.php:3053
|
| 460 |
msgid "is required"
|
| 461 |
msgstr "は必須項目"
|
| 462 |
|
| 463 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 464 |
msgid "Form is currently not active."
|
| 465 |
msgstr ""
|
| 466 |
|
| 467 |
+
#: ../classes/core.php:4393
|
| 468 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 469 |
msgstr ""
|
| 470 |
|
| 472 |
msgid "Title"
|
| 473 |
msgstr "タイトル"
|
| 474 |
|
| 475 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 476 |
msgid "Form"
|
| 477 |
msgstr "フォーム"
|
| 478 |
|
| 594 |
msgstr ""
|
| 595 |
|
| 596 |
#: ../fields/date_picker/setup.php:32
|
| 597 |
+
msgid "Start Date"
|
| 598 |
+
msgstr ""
|
| 599 |
+
|
| 600 |
+
#: ../fields/date_picker/setup.php:35
|
| 601 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 602 |
+
msgstr ""
|
| 603 |
+
|
| 604 |
+
#: ../fields/date_picker/setup.php:39
|
| 605 |
+
msgid "End Date"
|
| 606 |
+
msgstr ""
|
| 607 |
+
|
| 608 |
+
#: ../fields/date_picker/setup.php:42
|
| 609 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 610 |
+
msgstr ""
|
| 611 |
+
|
| 612 |
+
#: ../fields/date_picker/setup.php:46
|
| 613 |
msgid "language"
|
| 614 |
msgstr ""
|
| 615 |
|
| 616 |
+
#: ../fields/date_picker/setup.php:114
|
| 617 |
msgid "Language to use. e.g. pt-BR"
|
| 618 |
msgstr ""
|
| 619 |
|
| 620 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 621 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 622 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 623 |
msgid "Placeholder"
|
| 624 |
msgstr ""
|
| 625 |
|
| 628 |
msgstr "メーラーに添付"
|
| 629 |
|
| 630 |
#: ../fields/file/config_template.php:9
|
| 631 |
+
msgid "Allow Multiple"
|
| 632 |
+
msgstr ""
|
| 633 |
+
|
| 634 |
+
#: ../fields/file/config_template.php:16
|
| 635 |
msgid "Allowed Types"
|
| 636 |
msgstr "使用可能なタイプ"
|
| 637 |
|
| 638 |
+
#: ../fields/file/config_template.php:19
|
| 639 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 640 |
msgstr "コンマ区切り、jpg, pdf, txt"
|
| 641 |
|
| 697 |
msgid "Border Radius"
|
| 698 |
msgstr "ボーダー"
|
| 699 |
|
| 700 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 701 |
#: ../ui/panels/variables.php:12
|
| 702 |
msgid "Value"
|
| 703 |
msgstr "入力値"
|
| 730 |
msgid "Track"
|
| 731 |
msgstr "追跡"
|
| 732 |
|
| 733 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 734 |
msgid "Highlight"
|
| 735 |
msgstr "ハイライト"
|
| 736 |
|
| 738 |
msgid "Handle"
|
| 739 |
msgstr "ハンドル"
|
| 740 |
|
| 741 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 742 |
msgid "Border"
|
| 743 |
msgstr "ボーダー"
|
| 744 |
|
| 805 |
msgid "No Site Key Added"
|
| 806 |
msgstr ""
|
| 807 |
|
| 808 |
+
#: ../fields/select2/field/config.php:11
|
| 809 |
+
msgid "Multiple"
|
| 810 |
+
msgstr ""
|
| 811 |
+
|
| 812 |
+
#: ../fields/select2/field/config.php:15
|
| 813 |
+
msgid "Enable multiple selections"
|
| 814 |
+
msgstr ""
|
| 815 |
+
|
| 816 |
#: ../fields/star-rate/config.php:2
|
| 817 |
msgid "Number of Stars"
|
| 818 |
msgstr "スターの数"
|
| 929 |
msgid "Inactive Class"
|
| 930 |
msgstr ""
|
| 931 |
|
| 932 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 933 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 934 |
msgid "Enable"
|
| 935 |
msgstr "有効化"
|
| 936 |
|
| 988 |
msgid "Custom Class"
|
| 989 |
msgstr "カスタム クラス"
|
| 990 |
|
| 991 |
+
#: ../includes/field_processors.php:45
|
| 992 |
msgid "File type not allowed. Allowed types are: "
|
| 993 |
msgstr "ファイルの種類に対応していません、使用可能なファイルの種類: "
|
| 994 |
|
| 995 |
+
#: ../includes/field_processors.php:47
|
| 996 |
msgid "File type needs to be"
|
| 997 |
msgstr "対応しているファイルの種類は"
|
| 998 |
|
| 999 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 1000 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 1001 |
msgid "Name"
|
| 1002 |
msgstr "名称"
|
| 1003 |
|
| 1043 |
msgid "Message"
|
| 1044 |
msgstr "メッセージ"
|
| 1045 |
|
| 1046 |
+
#: ../processors/classes/get_data.php:76
|
| 1047 |
+
#, php-format
|
| 1048 |
+
msgid "%s is required"
|
| 1049 |
+
msgstr ""
|
| 1050 |
+
|
| 1051 |
#: ../processors/increment/config.php:2
|
| 1052 |
msgid "Increment Start"
|
| 1053 |
msgstr ""
|
| 1127 |
msgid "Grid"
|
| 1128 |
msgstr "グリッド"
|
| 1129 |
|
| 1130 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1131 |
msgid "Entries"
|
| 1132 |
msgstr "エントリー"
|
| 1133 |
|
| 1134 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1135 |
#: ../ui/panels/emailer.php:35
|
| 1136 |
msgid "Disabled"
|
| 1137 |
msgstr "無効"
|
| 1138 |
|
| 1139 |
+
#: ../ui/admin.php:112
|
| 1140 |
msgid "Mailer Debug enabled."
|
| 1141 |
msgstr ""
|
| 1142 |
|
| 1143 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1144 |
msgid "Edit"
|
| 1145 |
msgstr ""
|
| 1146 |
|
| 1147 |
+
#: ../ui/admin.php:141
|
| 1148 |
#, fuzzy
|
| 1149 |
msgid "Export"
|
| 1150 |
msgstr "インポート"
|
| 1151 |
|
| 1152 |
+
#: ../ui/admin.php:142
|
| 1153 |
#, fuzzy
|
| 1154 |
msgid "Clone Form"
|
| 1155 |
msgstr "Caldera フォーム"
|
| 1156 |
|
| 1157 |
+
#: ../ui/admin.php:142
|
| 1158 |
msgid "Clone"
|
| 1159 |
msgstr ""
|
| 1160 |
|
| 1161 |
+
#: ../ui/admin.php:143
|
| 1162 |
msgid "This will delete this form permanently. Continue?"
|
| 1163 |
msgstr "継続してこのフォームを完全に削除しますか？"
|
| 1164 |
|
| 1165 |
+
#: ../ui/admin.php:143
|
| 1166 |
msgid "Delete"
|
| 1167 |
msgstr ""
|
| 1168 |
|
| 1169 |
+
#: ../ui/admin.php:163
|
| 1170 |
msgid "You don't have any forms."
|
| 1171 |
msgstr "フォームはありません,"
|
| 1172 |
|
| 1173 |
+
#: ../ui/admin.php:204
|
| 1174 |
msgid "An form name is required"
|
| 1175 |
msgstr "フォーム名が必要です"
|
| 1176 |
|
| 1177 |
+
#: ../ui/admin.php:231
|
| 1178 |
msgid ""
|
| 1179 |
"Looks like something is not working. Please try again a little later or post "
|
| 1180 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1200 |
msgid "Delete Permanently"
|
| 1201 |
msgstr ""
|
| 1202 |
|
| 1203 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
|
|
|
| 1204 |
msgid "Form Name"
|
| 1205 |
msgstr "フォーム名"
|
| 1206 |
|
| 1209 |
msgid "Form File"
|
| 1210 |
msgstr "フォーム名"
|
| 1211 |
|
| 1212 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1213 |
msgid "Description"
|
| 1214 |
msgstr "詳細"
|
| 1215 |
|
| 1216 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1217 |
msgid "ID"
|
| 1218 |
msgstr "ID"
|
| 1219 |
|
| 1234 |
msgid "Form has successfully been submitted. Thank you."
|
| 1235 |
msgstr "フォームは送信いたしました。"
|
| 1236 |
|
| 1237 |
+
#: ../ui/edit.php:99
|
| 1238 |
msgid "Auto Populate"
|
| 1239 |
msgstr "オートポピュレート"
|
| 1240 |
|
| 1241 |
+
#: ../ui/edit.php:105
|
| 1242 |
msgid "Auto Type"
|
| 1243 |
msgstr ""
|
| 1244 |
|
| 1245 |
+
#: ../ui/edit.php:108
|
| 1246 |
msgid "Select a source"
|
| 1247 |
msgstr ""
|
| 1248 |
|
| 1249 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1250 |
msgid "Post Type"
|
| 1251 |
msgstr ""
|
| 1252 |
|
| 1253 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1254 |
msgid "Taxonomy"
|
| 1255 |
msgstr "タクソノミー"
|
| 1256 |
|
| 1257 |
+
#: ../ui/edit.php:167
|
| 1258 |
msgid "Add Option"
|
| 1259 |
msgstr "オプションの追加"
|
| 1260 |
|
| 1261 |
+
#: ../ui/edit.php:168
|
| 1262 |
msgid "Bulk Insert"
|
| 1263 |
msgstr "バルク挿入"
|
| 1264 |
|
| 1265 |
+
#: ../ui/edit.php:171
|
| 1266 |
msgid "Single option per line. These replace the current list."
|
| 1267 |
msgstr "1行につき1つ選択可能です。既存のリストと換地します。"
|
| 1268 |
|
| 1269 |
+
#: ../ui/edit.php:172
|
| 1270 |
msgid "Insert Options"
|
| 1271 |
msgstr ""
|
| 1272 |
|
| 1273 |
+
#: ../ui/edit.php:176
|
| 1274 |
msgid "No Default"
|
| 1275 |
msgstr "ディフォルト設定無し"
|
| 1276 |
|
| 1277 |
+
#: ../ui/edit.php:177
|
| 1278 |
msgid "Show Values"
|
| 1279 |
msgstr ""
|
| 1280 |
|
| 1281 |
+
#: ../ui/edit.php:181
|
| 1282 |
msgid "Label"
|
| 1283 |
msgstr ""
|
| 1284 |
|
| 1285 |
+
#: ../ui/edit.php:342
|
| 1286 |
msgid "Elements"
|
| 1287 |
msgstr "構成要素"
|
| 1288 |
|
| 1289 |
+
#: ../ui/edit.php:354
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1290 |
msgid "Element Type"
|
| 1291 |
msgstr "構成要素の種類"
|
| 1292 |
|
| 1293 |
+
#: ../ui/edit.php:379
|
| 1294 |
msgid "Hide Label"
|
| 1295 |
msgstr "ラベルを隠す"
|
| 1296 |
|
| 1297 |
+
#: ../ui/edit.php:386
|
| 1298 |
msgid "Slug"
|
| 1299 |
msgstr "スラグ"
|
| 1300 |
|
| 1301 |
+
#: ../ui/edit.php:392
|
| 1302 |
+
msgid "Condition"
|
| 1303 |
+
msgstr ""
|
| 1304 |
+
|
| 1305 |
+
#: ../ui/edit.php:397
|
| 1306 |
+
#, fuzzy
|
| 1307 |
+
msgid "Disable"
|
| 1308 |
+
msgstr "無効"
|
| 1309 |
+
|
| 1310 |
+
#: ../ui/edit.php:403
|
| 1311 |
msgid "Required"
|
| 1312 |
msgstr "必須"
|
| 1313 |
|
| 1314 |
+
#: ../ui/edit.php:417
|
| 1315 |
msgid "Show in Entry List"
|
| 1316 |
msgstr "エントリーに含む"
|
| 1317 |
|
| 1318 |
+
#: ../ui/edit.php:427
|
| 1319 |
msgid ""
|
| 1320 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1321 |
msgstr ""
|
| 1322 |
"このフィールドを削除しますか？「キャンセル」を選択し中断するか、「OK」を選択"
|
| 1323 |
"し削除する。"
|
| 1324 |
|
| 1325 |
+
#: ../ui/edit.php:427
|
| 1326 |
msgid "Delete Element"
|
| 1327 |
msgstr "構成要素を削除"
|
| 1328 |
|
| 1329 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1330 |
msgid "General Settings"
|
| 1331 |
msgstr "イパン設定"
|
| 1332 |
|
| 1333 |
+
#: ../ui/edit.php:498
|
| 1334 |
msgid "Updated Successfully"
|
| 1335 |
msgstr ""
|
| 1336 |
|
| 1337 |
+
#: ../ui/edit.php:500
|
| 1338 |
msgid "Update Form"
|
| 1339 |
msgstr "フォームを更新"
|
| 1340 |
|
| 1341 |
+
#: ../ui/edit.php:501
|
| 1342 |
msgid "Preview Form"
|
| 1343 |
msgstr ""
|
| 1344 |
|
| 1345 |
+
#: ../ui/edit.php:514
|
| 1346 |
msgid "Form Description"
|
| 1347 |
msgstr "フォームの詳細"
|
| 1348 |
|
| 1349 |
+
#: ../ui/edit.php:521
|
| 1350 |
#, fuzzy
|
| 1351 |
msgid "State"
|
| 1352 |
msgstr "スタティック"
|
| 1353 |
|
| 1354 |
+
#: ../ui/edit.php:523
|
| 1355 |
msgid "Deactivate / Draft"
|
| 1356 |
msgstr ""
|
| 1357 |
|
| 1358 |
+
#: ../ui/edit.php:528
|
| 1359 |
msgid "Capture Entries"
|
| 1360 |
msgstr ""
|
| 1361 |
|
| 1362 |
+
#: ../ui/edit.php:536
|
| 1363 |
msgid "Pin to Menu"
|
| 1364 |
msgstr "メニューにピン止めする"
|
| 1365 |
|
| 1366 |
+
#: ../ui/edit.php:545
|
| 1367 |
msgid "View Entries"
|
| 1368 |
msgstr "エントリーを表示"
|
| 1369 |
|
| 1370 |
+
#: ../ui/edit.php:547
|
| 1371 |
msgid "All"
|
| 1372 |
msgstr ""
|
| 1373 |
|
| 1374 |
+
#: ../ui/edit.php:569
|
| 1375 |
msgid "Hide Form"
|
| 1376 |
msgstr ""
|
| 1377 |
|
| 1378 |
+
#: ../ui/edit.php:571
|
| 1379 |
msgid "Hide form after successful submission"
|
| 1380 |
msgstr "送信の性交後フォームを非表示にする"
|
| 1381 |
|
| 1382 |
+
#: ../ui/edit.php:576
|
| 1383 |
msgid "Honeypot"
|
| 1384 |
msgstr ""
|
| 1385 |
|
| 1386 |
+
#: ../ui/edit.php:578
|
| 1387 |
msgid "Place an invisible field to trick spambots"
|
| 1388 |
msgstr ""
|
| 1389 |
|
| 1390 |
+
#: ../ui/edit.php:583
|
| 1391 |
msgid "Success Message"
|
| 1392 |
msgstr "成功時のメッセージ"
|
| 1393 |
|
| 1394 |
+
#: ../ui/edit.php:589
|
| 1395 |
msgid "Gravatar Field"
|
| 1396 |
msgstr "Gravatar 用フィールド"
|
| 1397 |
|
| 1398 |
+
#: ../ui/edit.php:596
|
| 1399 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1400 |
msgstr "ログインしていないユーザーのエントリーの表示に使用"
|
| 1401 |
|
| 1402 |
+
#: ../ui/edit.php:670
|
| 1403 |
msgid "Add New"
|
| 1404 |
msgstr "新規追加"
|
| 1405 |
|
| 1406 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1407 |
msgid "Remove"
|
| 1408 |
msgstr "削除"
|
| 1409 |
|
| 1410 |
+
#: ../ui/edit.php:825
|
| 1411 |
msgid "Set Element"
|
| 1412 |
msgstr "構成要素を確定"
|
| 1413 |
|
| 1414 |
+
#: ../ui/edit.php:828
|
| 1415 |
msgid "No description given"
|
| 1416 |
msgstr "詳細無し"
|
| 1417 |
|
| 1418 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1419 |
msgid "or"
|
| 1420 |
msgstr "あるいは"
|
| 1421 |
|
| 1422 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1423 |
msgid "is"
|
| 1424 |
msgstr "が"
|
| 1425 |
|
| 1426 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1427 |
msgid "is not"
|
| 1428 |
msgstr "一致しない"
|
| 1429 |
|
| 1430 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1431 |
msgid "is greater than"
|
| 1432 |
msgstr "より大きいい"
|
| 1433 |
|
| 1434 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1435 |
msgid "is less than"
|
| 1436 |
msgstr "以下"
|
| 1437 |
|
| 1438 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1439 |
msgid "starts with"
|
| 1440 |
msgstr "接頭文字列"
|
| 1441 |
|
| 1442 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1443 |
msgid "ends with"
|
| 1444 |
msgstr "末尾文字列"
|
| 1445 |
|
| 1446 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1447 |
msgid "contains"
|
| 1448 |
msgstr "を含む"
|
| 1449 |
|
| 1450 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1451 |
msgid "Select field first"
|
| 1452 |
msgstr "フィールドを先に選択してください"
|
| 1453 |
|
| 1454 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1455 |
+
#: ../ui/panels/conditions.php:129
|
| 1456 |
msgid "Add Condition"
|
| 1457 |
msgstr "条件を追加"
|
| 1458 |
|
| 1459 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1460 |
msgid "and"
|
| 1461 |
msgstr "および"
|
| 1462 |
|
| 1481 |
msgstr ""
|
| 1482 |
|
| 1483 |
#: ../ui/extend.php:23
|
| 1484 |
+
msgid ""
|
| 1485 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1486 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1487 |
+
"Forms."
|
| 1488 |
+
msgstr ""
|
| 1489 |
+
|
| 1490 |
+
#: ../ui/extend.php:29
|
| 1491 |
msgid "No licensed addons installed."
|
| 1492 |
msgstr "ライセンスされたアドオンはありません。"
|
| 1493 |
|
| 1494 |
+
#: ../ui/extend.php:54
|
| 1495 |
msgid "Already Installed"
|
| 1496 |
msgstr "既にインストール済み"
|
| 1497 |
|
| 1515 |
msgid "Unable to connect or no extensions available."
|
| 1516 |
msgstr "接続に問題があるか、エクステンションがありません。"
|
| 1517 |
|
| 1518 |
+
#: ../ui/panels/conditions.php:65
|
| 1519 |
+
msgid "Show"
|
| 1520 |
+
msgstr "表示"
|
| 1521 |
+
|
| 1522 |
+
#: ../ui/panels/conditions.php:66
|
| 1523 |
+
msgid "Hide"
|
| 1524 |
+
msgstr "隠す"
|
| 1525 |
+
|
| 1526 |
+
#: ../ui/panels/conditions.php:69
|
| 1527 |
+
msgid "Add Conditional Line"
|
| 1528 |
+
msgstr ""
|
| 1529 |
+
|
| 1530 |
+
#: ../ui/panels/conditions.php:83
|
| 1531 |
+
msgid "if"
|
| 1532 |
+
msgstr ""
|
| 1533 |
+
|
| 1534 |
+
#: ../ui/panels/conditions.php:133
|
| 1535 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1536 |
+
msgstr ""
|
| 1537 |
+
|
| 1538 |
+
#: ../ui/panels/conditions.php:133
|
| 1539 |
+
msgid "Remove Condition"
|
| 1540 |
+
msgstr ""
|
| 1541 |
+
|
| 1542 |
+
#: ../ui/panels/conditions.php:137
|
| 1543 |
+
msgid "Applied Fields"
|
| 1544 |
+
msgstr ""
|
| 1545 |
+
|
| 1546 |
+
#: ../ui/panels/conditions.php:138
|
| 1547 |
+
msgid "Select the fields to apply this condition to."
|
| 1548 |
+
msgstr ""
|
| 1549 |
+
|
| 1550 |
#: ../ui/panels/emailer.php:36
|
| 1551 |
msgid "Enabled"
|
| 1552 |
msgstr "有効"
|
| 1589 |
msgid "Recipients"
|
| 1590 |
msgstr "受信者"
|
| 1591 |
|
| 1592 |
+
#: ../ui/panels/emailer.php:84
|
| 1593 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1594 |
+
msgstr ""
|
| 1595 |
|
| 1596 |
#: ../ui/panels/emailer.php:89
|
| 1597 |
msgid "BCC"
|
| 1598 |
msgstr ""
|
| 1599 |
|
| 1600 |
+
#: ../ui/panels/emailer.php:92
|
| 1601 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1602 |
+
msgstr ""
|
| 1603 |
+
|
| 1604 |
#: ../ui/panels/emailer.php:100
|
| 1605 |
msgid "Use %field_slug% to use a value from the form"
|
| 1606 |
msgstr "フォームからの値を使用するために %field_slug% を使う"
|
| 1636 |
"tracking."
|
| 1637 |
msgstr ""
|
| 1638 |
|
| 1639 |
+
#: ../ui/panels/emailer.php:118
|
| 1640 |
+
msgid "Learn more here"
|
| 1641 |
+
msgstr ""
|
| 1642 |
+
|
| 1643 |
+
#: ../ui/panels/emailer.php:130
|
| 1644 |
msgid ""
|
| 1645 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1646 |
"the form submittable."
|
| 1651 |
msgstr "指定した列にあるすべてのフィールドが削除されます。よろしいですか？"
|
| 1652 |
|
| 1653 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1654 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1655 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1656 |
msgid "Page"
|
| 1657 |
msgstr "ページ"
|
| 1658 |
|
| 1659 |
+
#: ../ui/panels/layout_toolbar.php:11
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1660 |
msgid "Add Page"
|
| 1661 |
msgstr ""
|
| 1662 |
|
| 1663 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1664 |
msgid "Drag onto the form grid below"
|
| 1665 |
msgstr "フォームのグリッド上にどドラッグしてください"
|
| 1666 |
|
| 1667 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1668 |
msgid "Add Element"
|
| 1669 |
msgstr "項目を追加"
|
| 1670 |
|
| 1706 |
msgid "Don't Use"
|
| 1707 |
msgstr "使用しない"
|
| 1708 |
|
| 1709 |
+
#: ../ui/panels/processors.php:126
|
| 1710 |
+
msgid "Add Conditional Group"
|
| 1711 |
+
msgstr "条件グループを追加"
|
| 1712 |
+
|
| 1713 |
#: ../ui/panels/processors.php:171
|
| 1714 |
msgid "Add Processor"
|
| 1715 |
msgstr "プロセッサーを追加"
|
| 1751 |
msgid "Entry List"
|
| 1752 |
msgstr "エントリーに含む"
|
| 1753 |
|
| 1754 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1755 |
+
#~ msgstr "コンマ区切りのメールアドレスのリスト"
|
| 1756 |
+
|
| 1757 |
+
#~ msgid "Add Row"
|
| 1758 |
+
#~ msgstr "行を追加"
|
| 1759 |
+
|
| 1760 |
#, fuzzy
|
| 1761 |
#~ msgid ""
|
| 1762 |
#~ "Comma separated list of email addresses. Use %field_slug% to use a value "
|
| 1847 |
#~ msgid "Basic,File"
|
| 1848 |
#~ msgstr "ベーシック ファイル"
|
| 1849 |
|
|
|
|
|
|
|
|
|
|
| 1850 |
#~ msgid "Text Fields,Pickers"
|
| 1851 |
#~ msgstr "テキスト入力、ピッカー"
|
| 1852 |
|
languages/caldera-forms-pt_PT.mo
ADDED
|
Binary file
|
languages/caldera-forms-pt_PT.po
ADDED
|
@@ -0,0 +1,1761 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
+
"POT-Creation-Date: 2015-08-24 12:17+0200\n"
|
| 5 |
+
"PO-Revision-Date: 2015-08-24 12:17+0200\n"
|
| 6 |
+
"Last-Translator: Luis Martins <luis.martins@multiweb.pt>\n"
|
| 7 |
+
"Language-Team: \n"
|
| 8 |
+
"Language: pt_PT\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
+
"X-Poedit-Basepath: .\n"
|
| 14 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 15 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 17 |
+
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
+
|
| 19 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 20 |
+
msgid "Caldera Forms Notification"
|
| 21 |
+
msgstr "Notificação de Caldera Forms"
|
| 22 |
+
|
| 23 |
+
#: ../classes/admin.php:124
|
| 24 |
+
msgid "Invalid Form."
|
| 25 |
+
msgstr "Formulário inválido"
|
| 26 |
+
|
| 27 |
+
#: ../classes/admin.php:143
|
| 28 |
+
msgid "Starter Contact Form"
|
| 29 |
+
msgstr "Formulário de Contacto Inicial"
|
| 30 |
+
|
| 31 |
+
#: ../classes/admin.php:147
|
| 32 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 33 |
+
msgstr ""
|
| 34 |
+
|
| 35 |
+
#: ../classes/admin.php:151
|
| 36 |
+
msgid "Registration Form, with optional additional participants."
|
| 37 |
+
msgstr ""
|
| 38 |
+
|
| 39 |
+
#: ../classes/admin.php:174
|
| 40 |
+
msgid "Form Template"
|
| 41 |
+
msgstr "Modelo de Formulário"
|
| 42 |
+
|
| 43 |
+
#: ../classes/admin.php:177
|
| 44 |
+
msgid "no template - blank form"
|
| 45 |
+
msgstr "Nenhum modelo - formulário em branco"
|
| 46 |
+
|
| 47 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 48 |
+
#: ../ui/entries_toolbar.php:27
|
| 49 |
+
msgid "Trash"
|
| 50 |
+
msgstr "Lixo"
|
| 51 |
+
|
| 52 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 53 |
+
#: ../ui/admin_templates.php:9
|
| 54 |
+
msgid "Restore"
|
| 55 |
+
msgstr "Repor"
|
| 56 |
+
|
| 57 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 58 |
+
msgid "Entry"
|
| 59 |
+
msgstr "Entrada"
|
| 60 |
+
|
| 61 |
+
#: ../classes/admin.php:385
|
| 62 |
+
msgid "View"
|
| 63 |
+
msgstr "Ver"
|
| 64 |
+
|
| 65 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 66 |
+
msgid "Add Form to Page"
|
| 67 |
+
msgstr "Adicionar Formulário à Página"
|
| 68 |
+
|
| 69 |
+
#: ../classes/admin.php:428
|
| 70 |
+
msgid "Insert Form Shortcode"
|
| 71 |
+
msgstr "Inserir Shortcode do Formulário"
|
| 72 |
+
|
| 73 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 74 |
+
msgid "Caldera Form"
|
| 75 |
+
msgstr "Caldera Form"
|
| 76 |
+
|
| 77 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 78 |
+
msgid "Deactivate"
|
| 79 |
+
msgstr "Desactivar"
|
| 80 |
+
|
| 81 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 82 |
+
msgid "Activate"
|
| 83 |
+
msgstr "Activar"
|
| 84 |
+
|
| 85 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 86 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 87 |
+
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 88 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 89 |
+
msgid "Caldera Forms"
|
| 90 |
+
msgstr "Caldera Forms"
|
| 91 |
+
|
| 92 |
+
#: ../classes/admin.php:746
|
| 93 |
+
msgid "Caldera Forms Admin"
|
| 94 |
+
msgstr "Administração do Caldera Forms"
|
| 95 |
+
|
| 96 |
+
#: ../classes/admin.php:746
|
| 97 |
+
msgid "Forms"
|
| 98 |
+
msgstr "Formulários"
|
| 99 |
+
|
| 100 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 101 |
+
msgid "Community"
|
| 102 |
+
msgstr "Comunidade"
|
| 103 |
+
|
| 104 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 105 |
+
msgid "Extend"
|
| 106 |
+
msgstr "Estender"
|
| 107 |
+
|
| 108 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 109 |
+
msgid "Sorry, please try again"
|
| 110 |
+
msgstr "Pedimos desculpa, por favor tente novamente"
|
| 111 |
+
|
| 112 |
+
#: ../classes/admin.php:1017
|
| 113 |
+
msgid "Form Delete Error"
|
| 114 |
+
msgstr "Erro ao eliminar formulário"
|
| 115 |
+
|
| 116 |
+
#: ../classes/admin.php:1170
|
| 117 |
+
msgid "Sorry, File is not valid."
|
| 118 |
+
msgstr "Desculpe, o ficheiro não é válido"
|
| 119 |
+
|
| 120 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 121 |
+
#: ../classes/admin.php:1179
|
| 122 |
+
msgid "Form Import Error"
|
| 123 |
+
msgstr "Erro de importação de formulário"
|
| 124 |
+
|
| 125 |
+
#: ../classes/admin.php:1174
|
| 126 |
+
msgid "Sorry, File not uploaded."
|
| 127 |
+
msgstr "Desculpe, não foi possível enviar o ficheiro."
|
| 128 |
+
|
| 129 |
+
#: ../classes/admin.php:1188
|
| 130 |
+
msgid "Form does not exist."
|
| 131 |
+
msgstr "Formulário não existe."
|
| 132 |
+
|
| 133 |
+
#: ../classes/admin.php:1229
|
| 134 |
+
msgid "Export selection has expired"
|
| 135 |
+
msgstr "Selecção para exportação expirou"
|
| 136 |
+
|
| 137 |
+
#: ../classes/admin.php:1229
|
| 138 |
+
msgid "Export Expired"
|
| 139 |
+
msgstr "Exportação expirou"
|
| 140 |
+
|
| 141 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 142 |
+
msgid "Form has been successfully submitted. Thank you."
|
| 143 |
+
msgstr "O formulário foi enviado com sucesso. Obrigado."
|
| 144 |
+
|
| 145 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 146 |
+
msgid "Layout"
|
| 147 |
+
msgstr "Layout"
|
| 148 |
+
|
| 149 |
+
#: ../classes/admin.php:1465
|
| 150 |
+
msgid "Layout Builder"
|
| 151 |
+
msgstr "Construtor de Layout"
|
| 152 |
+
|
| 153 |
+
#: ../classes/admin.php:1475
|
| 154 |
+
msgid "Pages"
|
| 155 |
+
msgstr "Páginas"
|
| 156 |
+
|
| 157 |
+
#: ../classes/admin.php:1477
|
| 158 |
+
msgid "Form Pages"
|
| 159 |
+
msgstr "Páginas de formulário"
|
| 160 |
+
|
| 161 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 162 |
+
msgid "Conditions"
|
| 163 |
+
msgstr "Condições"
|
| 164 |
+
|
| 165 |
+
#: ../classes/admin.php:1487
|
| 166 |
+
msgid "Processors"
|
| 167 |
+
msgstr "Processadores"
|
| 168 |
+
|
| 169 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 170 |
+
msgid "Form Processors"
|
| 171 |
+
msgstr "Processadores de Formulário"
|
| 172 |
+
|
| 173 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 174 |
+
#: ../ui/panels/variables.php:83
|
| 175 |
+
msgid "Variables"
|
| 176 |
+
msgstr "Variáveis"
|
| 177 |
+
|
| 178 |
+
#: ../classes/admin.php:1502
|
| 179 |
+
msgid "Responsive"
|
| 180 |
+
msgstr "Responsive"
|
| 181 |
+
|
| 182 |
+
#: ../classes/admin.php:1504
|
| 183 |
+
msgid "Resposive Settings"
|
| 184 |
+
msgstr "Configurações Resposive"
|
| 185 |
+
|
| 186 |
+
#: ../classes/admin.php:1508
|
| 187 |
+
msgid "Grid Collapse"
|
| 188 |
+
msgstr "Fechar Grelha"
|
| 189 |
+
|
| 190 |
+
#: ../classes/admin.php:1510
|
| 191 |
+
msgid ""
|
| 192 |
+
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 193 |
+
"Bootstrap 3.0)"
|
| 194 |
+
msgstr ""
|
| 195 |
+
"Define o tamanho de écran mínimo a partir do qual a grelha é anulada. "
|
| 196 |
+
"(baseado em Boostrap 3.0)"
|
| 197 |
+
|
| 198 |
+
#: ../classes/admin.php:1517
|
| 199 |
+
msgid "Maintain grid always"
|
| 200 |
+
msgstr "Manter sempre a grelha"
|
| 201 |
+
|
| 202 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 203 |
+
msgid "Mailer"
|
| 204 |
+
msgstr "Mailer"
|
| 205 |
+
|
| 206 |
+
#: ../classes/admin.php:1539
|
| 207 |
+
msgid "Email Notification Settings"
|
| 208 |
+
msgstr "Definições das notificações por email"
|
| 209 |
+
|
| 210 |
+
#: ../classes/core.php:396
|
| 211 |
+
msgid "The wasn't entered correct."
|
| 212 |
+
msgstr "O valor não foi inserido correctamente."
|
| 213 |
+
|
| 214 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 215 |
+
msgid "Reset"
|
| 216 |
+
msgstr "Reset"
|
| 217 |
+
|
| 218 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 219 |
+
msgid "Permission denied."
|
| 220 |
+
msgstr "Não autorizado."
|
| 221 |
+
|
| 222 |
+
#: ../classes/core.php:787
|
| 223 |
+
msgid "Auto Responder"
|
| 224 |
+
msgstr "Resposta Automática"
|
| 225 |
+
|
| 226 |
+
#: ../classes/core.php:788
|
| 227 |
+
msgid "Sends out an auto response e-mail"
|
| 228 |
+
msgstr "Envia email de resposta automática"
|
| 229 |
+
|
| 230 |
+
#: ../classes/core.php:792
|
| 231 |
+
msgid "Thank you for contacting us"
|
| 232 |
+
msgstr "Obrigado pelo seu contacto"
|
| 233 |
+
|
| 234 |
+
#: ../classes/core.php:796
|
| 235 |
+
msgid "Redirect"
|
| 236 |
+
msgstr "Redirecionar"
|
| 237 |
+
|
| 238 |
+
#: ../classes/core.php:797
|
| 239 |
+
msgid "Redirects user to URL on successful submit"
|
| 240 |
+
msgstr ""
|
| 241 |
+
"Redirecciona o utilizador para o endereço ao submeter o formulário com "
|
| 242 |
+
"sucesso"
|
| 243 |
+
|
| 244 |
+
#: ../classes/core.php:802
|
| 245 |
+
msgid "Increment Value"
|
| 246 |
+
msgstr "Incrementar Valor"
|
| 247 |
+
|
| 248 |
+
#: ../classes/core.php:803
|
| 249 |
+
msgid "Increment a value per entry."
|
| 250 |
+
msgstr "Incrementar valor por entrada"
|
| 251 |
+
|
| 252 |
+
#: ../classes/core.php:817
|
| 253 |
+
msgid "Akismet"
|
| 254 |
+
msgstr "Akismet"
|
| 255 |
+
|
| 256 |
+
#: ../classes/core.php:818
|
| 257 |
+
msgid "Anti-spam filtering"
|
| 258 |
+
msgstr "Filtro anti-spam"
|
| 259 |
+
|
| 260 |
+
#: ../classes/core.php:866
|
| 261 |
+
msgid "Akismet not setup."
|
| 262 |
+
msgstr "Akismet não configurado."
|
| 263 |
+
|
| 264 |
+
#: ../classes/core.php:1017
|
| 265 |
+
msgid "Calculation"
|
| 266 |
+
msgstr "Cálculo"
|
| 267 |
+
|
| 268 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 269 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 270 |
+
msgid "Special"
|
| 271 |
+
msgstr "Especial"
|
| 272 |
+
|
| 273 |
+
#: ../classes/core.php:1020
|
| 274 |
+
msgid "Math"
|
| 275 |
+
msgstr "Matemática"
|
| 276 |
+
|
| 277 |
+
#: ../classes/core.php:1021
|
| 278 |
+
msgid "Calculate values"
|
| 279 |
+
msgstr "Calcular valores"
|
| 280 |
+
|
| 281 |
+
#: ../classes/core.php:1028
|
| 282 |
+
msgid "Total"
|
| 283 |
+
msgstr "Total"
|
| 284 |
+
|
| 285 |
+
#: ../classes/core.php:1040
|
| 286 |
+
msgid "Range Slider"
|
| 287 |
+
msgstr "Selector de Intervalo"
|
| 288 |
+
|
| 289 |
+
#: ../classes/core.php:1043
|
| 290 |
+
msgid "Range Slider input field"
|
| 291 |
+
msgstr "Campo de introdução do Selector de Intervalo"
|
| 292 |
+
|
| 293 |
+
#: ../classes/core.php:1077
|
| 294 |
+
msgid "Star Rating"
|
| 295 |
+
msgstr "Classificação"
|
| 296 |
+
|
| 297 |
+
#: ../classes/core.php:1079
|
| 298 |
+
msgid "Feedback"
|
| 299 |
+
msgstr "Feedback"
|
| 300 |
+
|
| 301 |
+
#: ../classes/core.php:1080
|
| 302 |
+
msgid "Star rating input for feedback"
|
| 303 |
+
msgstr "Entrada de classificação por estrelas"
|
| 304 |
+
|
| 305 |
+
#: ../classes/core.php:1112
|
| 306 |
+
msgid "Phone Number"
|
| 307 |
+
msgstr "Número de Telefone"
|
| 308 |
+
|
| 309 |
+
#: ../classes/core.php:1113
|
| 310 |
+
msgid "Phone number with masking"
|
| 311 |
+
msgstr "Número de telefone com máscara de introdução"
|
| 312 |
+
|
| 313 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 314 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 315 |
+
#: ../classes/core.php:1376
|
| 316 |
+
msgid "Text Fields"
|
| 317 |
+
msgstr "Campos de Texto"
|
| 318 |
+
|
| 319 |
+
#: ../classes/core.php:1115
|
| 320 |
+
msgid "User"
|
| 321 |
+
msgstr "Utilizador"
|
| 322 |
+
|
| 323 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 324 |
+
msgid "Single Line Text"
|
| 325 |
+
msgstr "Texto de linha única"
|
| 326 |
+
|
| 327 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 328 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 329 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 330 |
+
#: ../ui/edit.php:215
|
| 331 |
+
msgid "Basic"
|
| 332 |
+
msgstr "Básico"
|
| 333 |
+
|
| 334 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 335 |
+
msgid "File"
|
| 336 |
+
msgstr "Ficheiro"
|
| 337 |
+
|
| 338 |
+
#: ../classes/core.php:1149
|
| 339 |
+
msgid "File Uploader"
|
| 340 |
+
msgstr "Upload de Ficheiro"
|
| 341 |
+
|
| 342 |
+
#: ../classes/core.php:1159
|
| 343 |
+
msgid "reCAPTCHA"
|
| 344 |
+
msgstr "reCAPTCHA"
|
| 345 |
+
|
| 346 |
+
#: ../classes/core.php:1160
|
| 347 |
+
msgid "reCAPTCHA anti-spam field"
|
| 348 |
+
msgstr "Campo de anti-spam reCAPTCHA"
|
| 349 |
+
|
| 350 |
+
#: ../classes/core.php:1185
|
| 351 |
+
msgid "HTML"
|
| 352 |
+
msgstr "HTML"
|
| 353 |
+
|
| 354 |
+
#: ../classes/core.php:1186
|
| 355 |
+
msgid "Add text/html content"
|
| 356 |
+
msgstr "Adicionar conteúdo de texto/html"
|
| 357 |
+
|
| 358 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 359 |
+
#: ../processors/akismet/config.php:20
|
| 360 |
+
msgid "Content"
|
| 361 |
+
msgstr "Conteúdo"
|
| 362 |
+
|
| 363 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 364 |
+
msgid "Hidden"
|
| 365 |
+
msgstr "Oculto"
|
| 366 |
+
|
| 367 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 368 |
+
msgid "Button"
|
| 369 |
+
msgstr "Botão"
|
| 370 |
+
|
| 371 |
+
#: ../classes/core.php:1220
|
| 372 |
+
msgid "Button, Submit and Reset types"
|
| 373 |
+
msgstr "Tipos Botão, Submeter e Reset"
|
| 374 |
+
|
| 375 |
+
#: ../classes/core.php:1222
|
| 376 |
+
msgid "Buttons"
|
| 377 |
+
msgstr "Botões"
|
| 378 |
+
|
| 379 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 380 |
+
msgid "Email Address"
|
| 381 |
+
msgstr "Endereço de Email"
|
| 382 |
+
|
| 383 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 384 |
+
msgid "Paragraph Textarea"
|
| 385 |
+
msgstr "Área de Texto"
|
| 386 |
+
|
| 387 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 388 |
+
msgid "Toggle Switch"
|
| 389 |
+
msgstr "Botão Comutador"
|
| 390 |
+
|
| 391 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 392 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 393 |
+
msgid "Select Options"
|
| 394 |
+
msgstr "Opções do Selector"
|
| 395 |
+
|
| 396 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 397 |
+
msgid "Dropdown Select"
|
| 398 |
+
msgstr "Selector Dropdown"
|
| 399 |
+
|
| 400 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 401 |
+
msgid "Checkbox"
|
| 402 |
+
msgstr "Checkbox"
|
| 403 |
+
|
| 404 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 405 |
+
msgid "Radio"
|
| 406 |
+
msgstr "Rádio"
|
| 407 |
+
|
| 408 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 409 |
+
msgid "Date Picker"
|
| 410 |
+
msgstr "Selector de Data"
|
| 411 |
+
|
| 412 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 413 |
+
msgid "Pickers"
|
| 414 |
+
msgstr "Selectores"
|
| 415 |
+
|
| 416 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 417 |
+
msgid "Color Picker"
|
| 418 |
+
msgstr "Selector de Cor"
|
| 419 |
+
|
| 420 |
+
#: ../classes/core.php:1402
|
| 421 |
+
msgid "State/ Province Select"
|
| 422 |
+
msgstr "Estado / Província"
|
| 423 |
+
|
| 424 |
+
#: ../classes/core.php:1403
|
| 425 |
+
msgid "Dropdown select for US states and Canadian provinces."
|
| 426 |
+
msgstr ""
|
| 427 |
+
"Selector dropdown para estados Norte-Americanos e províncias do Canadá."
|
| 428 |
+
|
| 429 |
+
#: ../classes/core.php:1417
|
| 430 |
+
msgid "Autocomplete"
|
| 431 |
+
msgstr "Autopreenchimento"
|
| 432 |
+
|
| 433 |
+
#: ../classes/core.php:1419
|
| 434 |
+
msgid "Pickers,Select Options"
|
| 435 |
+
msgstr "Opções do Selector"
|
| 436 |
+
|
| 437 |
+
#: ../classes/core.php:1838
|
| 438 |
+
msgid "System Tags"
|
| 439 |
+
msgstr "Tags de sistema"
|
| 440 |
+
|
| 441 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 442 |
+
msgid "Mailer Debug"
|
| 443 |
+
msgstr "Debug do Mailer"
|
| 444 |
+
|
| 445 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 446 |
+
msgid "Invalid form ID"
|
| 447 |
+
msgstr "ID de formulário inválido"
|
| 448 |
+
|
| 449 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 450 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 451 |
+
#: ../classes/core.php:4111
|
| 452 |
+
msgid "Permission denied or entry does not exist."
|
| 453 |
+
msgstr "Não autorizado ou entrada não existe."
|
| 454 |
+
|
| 455 |
+
#: ../classes/core.php:3053
|
| 456 |
+
msgid "is required"
|
| 457 |
+
msgstr "é obrigatório"
|
| 458 |
+
|
| 459 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 460 |
+
msgid "Form is currently not active."
|
| 461 |
+
msgstr "Formulário não está activo de momento."
|
| 462 |
+
|
| 463 |
+
#: ../classes/core.php:4393
|
| 464 |
+
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 465 |
+
msgstr ""
|
| 466 |
+
"AVISO: O formulário está em modo Debug do Mailer. Desabilite antes de tornar "
|
| 467 |
+
"público."
|
| 468 |
+
|
| 469 |
+
#: ../classes/widget.php:43
|
| 470 |
+
msgid "Title"
|
| 471 |
+
msgstr "Título"
|
| 472 |
+
|
| 473 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 474 |
+
msgid "Form"
|
| 475 |
+
msgstr "Formulário"
|
| 476 |
+
|
| 477 |
+
#: ../fields/button/config_template.php:2
|
| 478 |
+
msgid "Type"
|
| 479 |
+
msgstr "Tipo"
|
| 480 |
+
|
| 481 |
+
#: ../fields/button/config_template.php:5
|
| 482 |
+
msgid "Submit"
|
| 483 |
+
msgstr "Enviar"
|
| 484 |
+
|
| 485 |
+
#: ../fields/button/config_template.php:7
|
| 486 |
+
msgid "Next Page"
|
| 487 |
+
msgstr "Página Seguinte"
|
| 488 |
+
|
| 489 |
+
#: ../fields/button/config_template.php:8
|
| 490 |
+
msgid "Previous Page"
|
| 491 |
+
msgstr "Página Anterior"
|
| 492 |
+
|
| 493 |
+
#: ../fields/button/config_template.php:14
|
| 494 |
+
msgid "Class"
|
| 495 |
+
msgstr "Classe"
|
| 496 |
+
|
| 497 |
+
#: ../fields/calculation/config.php:2
|
| 498 |
+
msgid "Element"
|
| 499 |
+
msgstr "Elemento"
|
| 500 |
+
|
| 501 |
+
#: ../fields/calculation/config.php:8
|
| 502 |
+
msgid "Classes"
|
| 503 |
+
msgstr "Classes"
|
| 504 |
+
|
| 505 |
+
#: ../fields/calculation/config.php:14
|
| 506 |
+
msgid "Before"
|
| 507 |
+
msgstr "Antes"
|
| 508 |
+
|
| 509 |
+
#: ../fields/calculation/config.php:20
|
| 510 |
+
msgid "After"
|
| 511 |
+
msgstr "Depois"
|
| 512 |
+
|
| 513 |
+
#: ../fields/calculation/config.php:27
|
| 514 |
+
msgid "Money Format"
|
| 515 |
+
msgstr "Formato Monetário"
|
| 516 |
+
|
| 517 |
+
#: ../fields/calculation/config.php:32
|
| 518 |
+
msgid "Separator"
|
| 519 |
+
msgstr "Separador"
|
| 520 |
+
|
| 521 |
+
#: ../fields/calculation/config.php:35
|
| 522 |
+
msgid "Setup a custom thousand separator. e.g 10,000.00 or 10.000.00"
|
| 523 |
+
msgstr "Configurar um separador para os milhares. Ex. 10,000.00 ou 10.000.00"
|
| 524 |
+
|
| 525 |
+
#: ../fields/calculation/config.php:41
|
| 526 |
+
msgid "Manual Formula"
|
| 527 |
+
msgstr "Fórmula manual"
|
| 528 |
+
|
| 529 |
+
#: ../fields/calculation/config.php:54
|
| 530 |
+
msgid "Add Operator Group"
|
| 531 |
+
msgstr "Adicionar Grupo de Operador"
|
| 532 |
+
|
| 533 |
+
#: ../fields/calculation/config.php:63
|
| 534 |
+
msgid "Use %field_slug% as field value variables"
|
| 535 |
+
msgstr "Usar o %field_slug % como variáveis para o valor do campo"
|
| 536 |
+
|
| 537 |
+
#: ../fields/checkbox/config_template.php:3
|
| 538 |
+
#: ../fields/radio/config_template.php:4
|
| 539 |
+
msgid "Inline"
|
| 540 |
+
msgstr "Em Linha"
|
| 541 |
+
|
| 542 |
+
#: ../fields/color_picker/setup.php:2 ../fields/date_picker/setup.php:2
|
| 543 |
+
#: ../fields/email/config.php:8 ../fields/paragraph/config_template.php:14
|
| 544 |
+
#: ../fields/phone/config.php:8 ../fields/range_slider/config.php:10
|
| 545 |
+
#: ../fields/text/config.php:8
|
| 546 |
+
msgid "Default"
|
| 547 |
+
msgstr "Padrão"
|
| 548 |
+
|
| 549 |
+
#: ../fields/color_picker/setup.php:2
|
| 550 |
+
msgid "Color"
|
| 551 |
+
msgstr "Cor"
|
| 552 |
+
|
| 553 |
+
#: ../fields/date_picker/setup.php:8
|
| 554 |
+
msgid "Format"
|
| 555 |
+
msgstr "Formato"
|
| 556 |
+
|
| 557 |
+
#: ../fields/date_picker/setup.php:14
|
| 558 |
+
msgid "Autoclose"
|
| 559 |
+
msgstr "Encerrar automaticamente"
|
| 560 |
+
|
| 561 |
+
#: ../fields/date_picker/setup.php:16
|
| 562 |
+
msgid "Enable autoclose"
|
| 563 |
+
msgstr "Activar o encerramento automático"
|
| 564 |
+
|
| 565 |
+
#: ../fields/date_picker/setup.php:17
|
| 566 |
+
msgid ""
|
| 567 |
+
"If enabled, the date picker will automatically close after selecting the "
|
| 568 |
+
"final input"
|
| 569 |
+
msgstr ""
|
| 570 |
+
"Se activo, o selector de data irá fechar automaticamente após selecção de "
|
| 571 |
+
"uma data"
|
| 572 |
+
|
| 573 |
+
#: ../fields/date_picker/setup.php:21
|
| 574 |
+
msgid "Start View"
|
| 575 |
+
msgstr "Modo Inicial"
|
| 576 |
+
|
| 577 |
+
#: ../fields/date_picker/setup.php:24
|
| 578 |
+
msgid "Month (Default)"
|
| 579 |
+
msgstr "Mês (padrão)"
|
| 580 |
+
|
| 581 |
+
#: ../fields/date_picker/setup.php:25
|
| 582 |
+
msgid "Year"
|
| 583 |
+
msgstr "Ano"
|
| 584 |
+
|
| 585 |
+
#: ../fields/date_picker/setup.php:26
|
| 586 |
+
msgid "Decade"
|
| 587 |
+
msgstr "Década"
|
| 588 |
+
|
| 589 |
+
#: ../fields/date_picker/setup.php:28
|
| 590 |
+
msgid "The starting view of the date picker (month, year, decade)"
|
| 591 |
+
msgstr "O modo inicial do selector de data (mês, ano, década)"
|
| 592 |
+
|
| 593 |
+
#: ../fields/date_picker/setup.php:32
|
| 594 |
+
msgid "Start Date"
|
| 595 |
+
msgstr ""
|
| 596 |
+
|
| 597 |
+
#: ../fields/date_picker/setup.php:35
|
| 598 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 599 |
+
msgstr ""
|
| 600 |
+
|
| 601 |
+
#: ../fields/date_picker/setup.php:39
|
| 602 |
+
msgid "End Date"
|
| 603 |
+
msgstr ""
|
| 604 |
+
|
| 605 |
+
#: ../fields/date_picker/setup.php:42
|
| 606 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 607 |
+
msgstr ""
|
| 608 |
+
|
| 609 |
+
#: ../fields/date_picker/setup.php:46
|
| 610 |
+
msgid "language"
|
| 611 |
+
msgstr "linguagem"
|
| 612 |
+
|
| 613 |
+
#: ../fields/date_picker/setup.php:114
|
| 614 |
+
msgid "Language to use. e.g. pt-BR"
|
| 615 |
+
msgstr "Idioma a ser utilizado. por exemplo, pt-PT"
|
| 616 |
+
|
| 617 |
+
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 618 |
+
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 619 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 620 |
+
msgid "Placeholder"
|
| 621 |
+
msgstr "Texto indicativo"
|
| 622 |
+
|
| 623 |
+
#: ../fields/file/config_template.php:2
|
| 624 |
+
msgid "Attach to mailer"
|
| 625 |
+
msgstr "Anexar ao mailer"
|
| 626 |
+
|
| 627 |
+
#: ../fields/file/config_template.php:9
|
| 628 |
+
msgid "Allow Multiple"
|
| 629 |
+
msgstr "Permitir múltiplos"
|
| 630 |
+
|
| 631 |
+
#: ../fields/file/config_template.php:16
|
| 632 |
+
msgid "Allowed Types"
|
| 633 |
+
msgstr "Tipos Permitidos"
|
| 634 |
+
|
| 635 |
+
#: ../fields/file/config_template.php:19
|
| 636 |
+
msgid "Comma separated eg. jpg,pdf,txt"
|
| 637 |
+
msgstr "Lista de valores separados por vírgula Ex. jpg,pdf,txt"
|
| 638 |
+
|
| 639 |
+
#: ../fields/gravatar/config.php:2
|
| 640 |
+
msgid "Email Field"
|
| 641 |
+
msgstr "Campo Email"
|
| 642 |
+
|
| 643 |
+
#: ../fields/gravatar/config.php:10
|
| 644 |
+
msgid "Mystery Man"
|
| 645 |
+
msgstr "Homem misterioso"
|
| 646 |
+
|
| 647 |
+
#: ../fields/gravatar/config.php:11
|
| 648 |
+
msgid "Blank"
|
| 649 |
+
msgstr "Em Branco"
|
| 650 |
+
|
| 651 |
+
#: ../fields/gravatar/config.php:12
|
| 652 |
+
msgid "Gravatar Logo"
|
| 653 |
+
msgstr "Logotipo Gravatar"
|
| 654 |
+
|
| 655 |
+
#: ../fields/gravatar/config.php:13
|
| 656 |
+
msgid "Identicon (Generated)"
|
| 657 |
+
msgstr "Identicon (Gerado)"
|
| 658 |
+
|
| 659 |
+
#: ../fields/gravatar/config.php:14
|
| 660 |
+
msgid "Wavatar (Generated)"
|
| 661 |
+
msgstr "Wavatar (Gerado)"
|
| 662 |
+
|
| 663 |
+
#: ../fields/gravatar/config.php:15
|
| 664 |
+
msgid "MonsterID (Generated)"
|
| 665 |
+
msgstr "MonsterID (Gerado)"
|
| 666 |
+
|
| 667 |
+
#: ../fields/gravatar/config.php:16
|
| 668 |
+
msgid "Retro (Generated)"
|
| 669 |
+
msgstr "Retro (Gerado)"
|
| 670 |
+
|
| 671 |
+
#: ../fields/gravatar/config.php:21
|
| 672 |
+
msgid "Fallback"
|
| 673 |
+
msgstr "Fallback"
|
| 674 |
+
|
| 675 |
+
#: ../fields/gravatar/config.php:35
|
| 676 |
+
msgid "Size"
|
| 677 |
+
msgstr "Tamanho"
|
| 678 |
+
|
| 679 |
+
#: ../fields/gravatar/config.php:42
|
| 680 |
+
msgid "Border Color"
|
| 681 |
+
msgstr "Cor do Contorno"
|
| 682 |
+
|
| 683 |
+
#: ../fields/gravatar/config.php:49
|
| 684 |
+
msgid "Border Size"
|
| 685 |
+
msgstr "Tamanho do Contorno"
|
| 686 |
+
|
| 687 |
+
#: ../fields/gravatar/config.php:56
|
| 688 |
+
msgid "Border Radius"
|
| 689 |
+
msgstr "Raio do Contorno (cantos redondos)"
|
| 690 |
+
|
| 691 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 692 |
+
#: ../ui/panels/variables.php:12
|
| 693 |
+
msgid "Value"
|
| 694 |
+
msgstr "Valor"
|
| 695 |
+
|
| 696 |
+
#: ../fields/paragraph/config_template.php:8
|
| 697 |
+
msgid "Rows"
|
| 698 |
+
msgstr "Linhas"
|
| 699 |
+
|
| 700 |
+
#: ../fields/phone/config.php:14
|
| 701 |
+
msgid "Style"
|
| 702 |
+
msgstr "Estilo"
|
| 703 |
+
|
| 704 |
+
#: ../fields/phone/config.php:16
|
| 705 |
+
msgid "Local"
|
| 706 |
+
msgstr "Local"
|
| 707 |
+
|
| 708 |
+
#: ../fields/phone/config.php:18
|
| 709 |
+
msgid "International"
|
| 710 |
+
msgstr "Internacional"
|
| 711 |
+
|
| 712 |
+
#: ../fields/phone/config.php:20
|
| 713 |
+
msgid "Custom"
|
| 714 |
+
msgstr "Customizado"
|
| 715 |
+
|
| 716 |
+
#: ../fields/phone/config.php:22
|
| 717 |
+
msgid "Use the digit 9 to indicate a number"
|
| 718 |
+
msgstr "Use o dígito 9 para indicar um número"
|
| 719 |
+
|
| 720 |
+
#: ../fields/range_slider/config.php:17
|
| 721 |
+
msgid "Track"
|
| 722 |
+
msgstr ""
|
| 723 |
+
|
| 724 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 725 |
+
msgid "Highlight"
|
| 726 |
+
msgstr "Destacar"
|
| 727 |
+
|
| 728 |
+
#: ../fields/range_slider/config.php:29
|
| 729 |
+
msgid "Handle"
|
| 730 |
+
msgstr "Manusear"
|
| 731 |
+
|
| 732 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 733 |
+
msgid "Border"
|
| 734 |
+
msgstr "Contorno"
|
| 735 |
+
|
| 736 |
+
#: ../fields/range_slider/config.php:42
|
| 737 |
+
msgid "Steps"
|
| 738 |
+
msgstr "Passos"
|
| 739 |
+
|
| 740 |
+
#: ../fields/range_slider/config.php:48
|
| 741 |
+
msgid "Minimum"
|
| 742 |
+
msgstr "Mínimo"
|
| 743 |
+
|
| 744 |
+
#: ../fields/range_slider/config.php:54
|
| 745 |
+
msgid "Maximum"
|
| 746 |
+
msgstr "Máximo"
|
| 747 |
+
|
| 748 |
+
#: ../fields/range_slider/config.php:60
|
| 749 |
+
msgid "Show Value"
|
| 750 |
+
msgstr "Mostrar valor"
|
| 751 |
+
|
| 752 |
+
#: ../fields/range_slider/config.php:66
|
| 753 |
+
msgid "Prefix"
|
| 754 |
+
msgstr "Prefixo"
|
| 755 |
+
|
| 756 |
+
#: ../fields/range_slider/config.php:72
|
| 757 |
+
msgid "Suffix"
|
| 758 |
+
msgstr "Sufixo"
|
| 759 |
+
|
| 760 |
+
#: ../fields/recaptcha/config.php:1
|
| 761 |
+
msgid "reCaptcha required keys from Google."
|
| 762 |
+
msgstr "Chaves reCaptcha do Google necessárias"
|
| 763 |
+
|
| 764 |
+
#: ../fields/recaptcha/config.php:3
|
| 765 |
+
msgid "Site Key"
|
| 766 |
+
msgstr "Chave do Site"
|
| 767 |
+
|
| 768 |
+
#: ../fields/recaptcha/config.php:9
|
| 769 |
+
msgid "Secret Key"
|
| 770 |
+
msgstr "Chave secreta"
|
| 771 |
+
|
| 772 |
+
#: ../fields/recaptcha/config.php:15
|
| 773 |
+
msgid "Theme"
|
| 774 |
+
msgstr "Tema"
|
| 775 |
+
|
| 776 |
+
#: ../fields/recaptcha/config.php:18
|
| 777 |
+
msgid "Light"
|
| 778 |
+
msgstr "Claro"
|
| 779 |
+
|
| 780 |
+
#: ../fields/recaptcha/config.php:19
|
| 781 |
+
msgid "Dark"
|
| 782 |
+
msgstr "Escuro"
|
| 783 |
+
|
| 784 |
+
#: ../fields/recaptcha/config.php:21
|
| 785 |
+
msgid ""
|
| 786 |
+
"Theme changes not available in preview. Update form and reload to see new "
|
| 787 |
+
"theme."
|
| 788 |
+
msgstr ""
|
| 789 |
+
"Alterações ao tema não estão disponíveis na visualização. Guardar formulário "
|
| 790 |
+
"e recarregar para visualizar o novo tema."
|
| 791 |
+
|
| 792 |
+
#: ../fields/recaptcha/preview.php:20
|
| 793 |
+
msgid "No Secret Key Added"
|
| 794 |
+
msgstr "Nenhuma chave secreta adicionada"
|
| 795 |
+
|
| 796 |
+
#: ../fields/recaptcha/preview.php:23
|
| 797 |
+
msgid "No Site Key Added"
|
| 798 |
+
msgstr "Nenhuma chave site adicionada"
|
| 799 |
+
|
| 800 |
+
#: ../fields/select2/field/config.php:11
|
| 801 |
+
msgid "Multiple"
|
| 802 |
+
msgstr "Múltiplo"
|
| 803 |
+
|
| 804 |
+
#: ../fields/select2/field/config.php:15
|
| 805 |
+
msgid "Enable multiple selections"
|
| 806 |
+
msgstr "Permitir selecção múltipla"
|
| 807 |
+
|
| 808 |
+
#: ../fields/star-rate/config.php:2
|
| 809 |
+
msgid "Number of Stars"
|
| 810 |
+
msgstr "Número de Estrelas"
|
| 811 |
+
|
| 812 |
+
#: ../fields/star-rate/config.php:8
|
| 813 |
+
msgid "Star Type"
|
| 814 |
+
msgstr "Tipo de Estrela"
|
| 815 |
+
|
| 816 |
+
#: ../fields/star-rate/config.php:11
|
| 817 |
+
msgid "Star"
|
| 818 |
+
msgstr "Estrela"
|
| 819 |
+
|
| 820 |
+
#: ../fields/star-rate/config.php:12
|
| 821 |
+
msgid "Heart"
|
| 822 |
+
msgstr "Coração"
|
| 823 |
+
|
| 824 |
+
#: ../fields/star-rate/config.php:13
|
| 825 |
+
msgid "Face"
|
| 826 |
+
msgstr "Face"
|
| 827 |
+
|
| 828 |
+
#: ../fields/star-rate/config.php:14
|
| 829 |
+
msgid "Dot"
|
| 830 |
+
msgstr "Ponto"
|
| 831 |
+
|
| 832 |
+
#: ../fields/star-rate/config.php:19
|
| 833 |
+
msgid "Star Size"
|
| 834 |
+
msgstr "Tamanho de estrela"
|
| 835 |
+
|
| 836 |
+
#: ../fields/star-rate/config.php:25
|
| 837 |
+
msgid "Star Spacing"
|
| 838 |
+
msgstr "Espaçamento de estrela"
|
| 839 |
+
|
| 840 |
+
#: ../fields/star-rate/config.php:31
|
| 841 |
+
msgid "Single Select"
|
| 842 |
+
msgstr "Selector único"
|
| 843 |
+
|
| 844 |
+
#: ../fields/star-rate/config.php:38
|
| 845 |
+
msgid "Star Color"
|
| 846 |
+
msgstr "Cor de estrela"
|
| 847 |
+
|
| 848 |
+
#: ../fields/star-rate/config.php:44
|
| 849 |
+
msgid "Track Color"
|
| 850 |
+
msgstr "Cor da faixa"
|
| 851 |
+
|
| 852 |
+
#: ../fields/star-rate/config.php:50
|
| 853 |
+
msgid "Include Cancel"
|
| 854 |
+
msgstr "Incluir Cancelar"
|
| 855 |
+
|
| 856 |
+
#: ../fields/text/config.php:15
|
| 857 |
+
msgid "Masked Input"
|
| 858 |
+
msgstr "Entrada de dados com máscara"
|
| 859 |
+
|
| 860 |
+
#: ../fields/text/config.php:17
|
| 861 |
+
msgid "Enable input mask"
|
| 862 |
+
msgstr "Habilitar a máscara de entrada"
|
| 863 |
+
|
| 864 |
+
#: ../fields/text/config.php:22
|
| 865 |
+
msgid "Mask"
|
| 866 |
+
msgstr "Máscara"
|
| 867 |
+
|
| 868 |
+
#: ../fields/text/config.php:30
|
| 869 |
+
msgid "numeric"
|
| 870 |
+
msgstr "numérico"
|
| 871 |
+
|
| 872 |
+
#: ../fields/text/config.php:31
|
| 873 |
+
msgid "alphabetical"
|
| 874 |
+
msgstr "alfabético"
|
| 875 |
+
|
| 876 |
+
#: ../fields/text/config.php:32
|
| 877 |
+
msgid "alphanumeric"
|
| 878 |
+
msgstr "alfanumérico"
|
| 879 |
+
|
| 880 |
+
#: ../fields/text/config.php:33
|
| 881 |
+
msgid "optional"
|
| 882 |
+
msgstr "opcional"
|
| 883 |
+
|
| 884 |
+
#: ../fields/text/config.php:34
|
| 885 |
+
msgid "length"
|
| 886 |
+
msgstr "comprimento"
|
| 887 |
+
|
| 888 |
+
#: ../fields/text/config.php:36
|
| 889 |
+
msgid "Any length character only"
|
| 890 |
+
msgstr "Qualquer comprimento e apenas caracteres"
|
| 891 |
+
|
| 892 |
+
#: ../fields/text/config.php:37
|
| 893 |
+
msgid "Any length number only"
|
| 894 |
+
msgstr "Qualquer comprimento e apenas números"
|
| 895 |
+
|
| 896 |
+
#: ../fields/text/config.php:38
|
| 897 |
+
msgid "email"
|
| 898 |
+
msgstr "email"
|
| 899 |
+
|
| 900 |
+
#: ../fields/toggle_switch/config_template.php:2
|
| 901 |
+
msgid "Orientation"
|
| 902 |
+
msgstr "Orientação"
|
| 903 |
+
|
| 904 |
+
#: ../fields/toggle_switch/config_template.php:5
|
| 905 |
+
msgid "Horizontal"
|
| 906 |
+
msgstr "Horizontal"
|
| 907 |
+
|
| 908 |
+
#: ../fields/toggle_switch/config_template.php:6
|
| 909 |
+
msgid "Justified"
|
| 910 |
+
msgstr "Justificado"
|
| 911 |
+
|
| 912 |
+
#: ../fields/toggle_switch/config_template.php:7
|
| 913 |
+
msgid "Vertical"
|
| 914 |
+
msgstr "Vertical"
|
| 915 |
+
|
| 916 |
+
#: ../fields/toggle_switch/config_template.php:13
|
| 917 |
+
msgid "Active Class"
|
| 918 |
+
msgstr "Classe Activa"
|
| 919 |
+
|
| 920 |
+
#: ../fields/toggle_switch/config_template.php:20
|
| 921 |
+
msgid "Inactive Class"
|
| 922 |
+
msgstr "Classe Inactiva"
|
| 923 |
+
|
| 924 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 925 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 926 |
+
msgid "Enable"
|
| 927 |
+
msgstr "Ativar"
|
| 928 |
+
|
| 929 |
+
#: ../includes/cf-ajax/plugin.php:38
|
| 930 |
+
msgid "Ajax Submissions"
|
| 931 |
+
msgstr "Submissões de Ajax"
|
| 932 |
+
|
| 933 |
+
#: ../includes/cf-ajax/plugin.php:40
|
| 934 |
+
msgid "Enable Ajax Submissions. (No page reloads)"
|
| 935 |
+
msgstr "Activar submissões via Ajax. (Sem recarregar a página)"
|
| 936 |
+
|
| 937 |
+
#: ../includes/cf-ajax/plugin.php:46
|
| 938 |
+
msgid "Custom Callback"
|
| 939 |
+
msgstr "Callback customizado"
|
| 940 |
+
|
| 941 |
+
#: ../includes/cf-ajax/plugin.php:48
|
| 942 |
+
msgid "Add a custom Javascript callback handlers on submission."
|
| 943 |
+
msgstr "Adiciona um callback de Javascript ao submeter formulário."
|
| 944 |
+
|
| 945 |
+
#: ../includes/cf-ajax/plugin.php:55
|
| 946 |
+
msgid "Inhibit Notices"
|
| 947 |
+
msgstr "Inibir Notificações"
|
| 948 |
+
|
| 949 |
+
#: ../includes/cf-ajax/plugin.php:57
|
| 950 |
+
msgid "Don't show default alerts (success etc.)"
|
| 951 |
+
msgstr "Não mostrar alertas padrão (sucesso etc.)"
|
| 952 |
+
|
| 953 |
+
#: ../includes/cf-ajax/plugin.php:63
|
| 954 |
+
msgid "Callback Function"
|
| 955 |
+
msgstr "Função Callback"
|
| 956 |
+
|
| 957 |
+
#: ../includes/cf-ajax/plugin.php:66
|
| 958 |
+
msgid ""
|
| 959 |
+
"Javascript function to call on submission. Passed an object containing form "
|
| 960 |
+
"submission result."
|
| 961 |
+
msgstr ""
|
| 962 |
+
"Função Javascript a ser chamada na submissão. É passado um objecto que "
|
| 963 |
+
"contém os resultados da submissão do formulário."
|
| 964 |
+
|
| 965 |
+
#: ../includes/cf-ajax/plugin.php:91
|
| 966 |
+
msgid "Multiple Ajax Submissions"
|
| 967 |
+
msgstr "Múltiplos envios Ajax"
|
| 968 |
+
|
| 969 |
+
#: ../includes/cf-ajax/plugin.php:93
|
| 970 |
+
msgid "If set, form can be submitted multiple times with out a new page load."
|
| 971 |
+
msgstr ""
|
| 972 |
+
"Se activo, o formulário pode ser enviado múltiplas vezes sem novo "
|
| 973 |
+
"carregamento da página."
|
| 974 |
+
|
| 975 |
+
#: ../includes/cf-ajax/plugin.php:147 ../includes/cf-ajax/plugin.php:158
|
| 976 |
+
#: ../processors/redirect/config.php:10
|
| 977 |
+
msgid "Redirecting"
|
| 978 |
+
msgstr "A redirecionar…"
|
| 979 |
+
|
| 980 |
+
#: ../includes/custom_field_class.php:21
|
| 981 |
+
msgid "Custom Class"
|
| 982 |
+
msgstr "Classe personalizada"
|
| 983 |
+
|
| 984 |
+
#: ../includes/field_processors.php:45
|
| 985 |
+
msgid "File type not allowed. Allowed types are: "
|
| 986 |
+
msgstr "Tipo de ficheiro não permitido. Os tipos aceites são:"
|
| 987 |
+
|
| 988 |
+
#: ../includes/field_processors.php:47
|
| 989 |
+
msgid "File type needs to be"
|
| 990 |
+
msgstr "O tipo de ficheiro deve ser"
|
| 991 |
+
|
| 992 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 993 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 994 |
+
msgid "Name"
|
| 995 |
+
msgstr "Nome"
|
| 996 |
+
|
| 997 |
+
#: ../processors/akismet/config.php:8
|
| 998 |
+
msgid "Email"
|
| 999 |
+
msgstr "Email"
|
| 1000 |
+
|
| 1001 |
+
#: ../processors/akismet/config.php:14 ../processors/redirect/config.php:2
|
| 1002 |
+
msgid "URL"
|
| 1003 |
+
msgstr "URL"
|
| 1004 |
+
|
| 1005 |
+
#: ../processors/akismet/config.php:27
|
| 1006 |
+
msgid "Error Message"
|
| 1007 |
+
msgstr "Mensagem de Erro"
|
| 1008 |
+
|
| 1009 |
+
#: ../processors/akismet/config.php:29
|
| 1010 |
+
msgid "Sorry, that looked very spammy, try rephrasing things"
|
| 1011 |
+
msgstr ""
|
| 1012 |
+
"Desculpe, a informação parece ser spam, tente recompor um pouco a sua "
|
| 1013 |
+
"mensagem"
|
| 1014 |
+
|
| 1015 |
+
#: ../processors/auto_responder/config.php:2 ../ui/panels/emailer.php:42
|
| 1016 |
+
msgid "From Name"
|
| 1017 |
+
msgstr "Nome Remetente"
|
| 1018 |
+
|
| 1019 |
+
#: ../processors/auto_responder/config.php:8 ../ui/panels/emailer.php:49
|
| 1020 |
+
msgid "From Email"
|
| 1021 |
+
msgstr "Email Remetente"
|
| 1022 |
+
|
| 1023 |
+
#: ../processors/auto_responder/config.php:14 ../ui/panels/emailer.php:97
|
| 1024 |
+
msgid "Email Subject"
|
| 1025 |
+
msgstr "Assunto do Email"
|
| 1026 |
+
|
| 1027 |
+
#: ../processors/auto_responder/config.php:20
|
| 1028 |
+
msgid "Recipient Name"
|
| 1029 |
+
msgstr "Nome Destinatário"
|
| 1030 |
+
|
| 1031 |
+
#: ../processors/auto_responder/config.php:26
|
| 1032 |
+
msgid "Recipient Email"
|
| 1033 |
+
msgstr "Email Destinatário"
|
| 1034 |
+
|
| 1035 |
+
#: ../processors/auto_responder/config.php:32
|
| 1036 |
+
msgid "Message"
|
| 1037 |
+
msgstr "Mensagem"
|
| 1038 |
+
|
| 1039 |
+
#: ../processors/classes/get_data.php:76
|
| 1040 |
+
#, php-format
|
| 1041 |
+
msgid "%s is required"
|
| 1042 |
+
msgstr ""
|
| 1043 |
+
|
| 1044 |
+
#: ../processors/increment/config.php:2
|
| 1045 |
+
msgid "Increment Start"
|
| 1046 |
+
msgstr "Início do Incremento"
|
| 1047 |
+
|
| 1048 |
+
#: ../processors/increment/config.php:6
|
| 1049 |
+
msgid "Number to start incrementing."
|
| 1050 |
+
msgstr "Valor inicial para incremento."
|
| 1051 |
+
|
| 1052 |
+
#: ../processors/increment/config.php:8
|
| 1053 |
+
msgid ""
|
| 1054 |
+
"Incremenets started at {{start}}. to reset, delete this and insert a new "
|
| 1055 |
+
"increment processor."
|
| 1056 |
+
msgstr ""
|
| 1057 |
+
"Incrementos iniciados em {{start}}. Para redefinir elimine isto e insira um "
|
| 1058 |
+
"novo processador de incremento."
|
| 1059 |
+
|
| 1060 |
+
#: ../processors/increment/config.php:14
|
| 1061 |
+
msgid "Increment Field"
|
| 1062 |
+
msgstr "Campo de incremento"
|
| 1063 |
+
|
| 1064 |
+
#: ../processors/increment/config.php:17
|
| 1065 |
+
msgid ""
|
| 1066 |
+
"If you want to show the value in the entries, Select a Hidden field in form "
|
| 1067 |
+
"to capture the value to."
|
| 1068 |
+
msgstr ""
|
| 1069 |
+
"Se desejar mostrar o valor nos registos, seleccione um campo oculto no "
|
| 1070 |
+
"formulário para capturar o valor."
|
| 1071 |
+
|
| 1072 |
+
#: ../processors/redirect/config.php:8
|
| 1073 |
+
msgid "Redirect Message"
|
| 1074 |
+
msgstr "Mensagem de redirecionamento"
|
| 1075 |
+
|
| 1076 |
+
#: ../processors/redirect/config.php:11
|
| 1077 |
+
msgid "Message text shown when redirecting in Ajax mode."
|
| 1078 |
+
msgstr ""
|
| 1079 |
+
"Mensagem a ser apresentada enquanto decorre o redireccionamento em modo Ajax."
|
| 1080 |
+
|
| 1081 |
+
#: ../ui/admin.php:26
|
| 1082 |
+
msgid "Create Form"
|
| 1083 |
+
msgstr "Criar Formulário"
|
| 1084 |
+
|
| 1085 |
+
#: ../ui/admin.php:38
|
| 1086 |
+
msgid "Create New Form"
|
| 1087 |
+
msgstr "Criar novo Formulário"
|
| 1088 |
+
|
| 1089 |
+
#: ../ui/admin.php:38
|
| 1090 |
+
msgid "New Form"
|
| 1091 |
+
msgstr "Novo Formulário"
|
| 1092 |
+
|
| 1093 |
+
#: ../ui/admin.php:41 ../ui/admin_templates.php:33
|
| 1094 |
+
msgid "Import Form"
|
| 1095 |
+
msgstr "Importar Formulário"
|
| 1096 |
+
|
| 1097 |
+
#: ../ui/admin.php:41
|
| 1098 |
+
msgid "Import"
|
| 1099 |
+
msgstr "Importar"
|
| 1100 |
+
|
| 1101 |
+
#: ../ui/admin.php:47
|
| 1102 |
+
msgid "Front-end Style Includes"
|
| 1103 |
+
msgstr "Includes de estilo em Front-end"
|
| 1104 |
+
|
| 1105 |
+
#: ../ui/admin.php:51
|
| 1106 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form alert notices"
|
| 1107 |
+
msgstr ""
|
| 1108 |
+
"Incluir estilos Bootstrap 3 no front-end para formulários e notificações"
|
| 1109 |
+
|
| 1110 |
+
#: ../ui/admin.php:51
|
| 1111 |
+
msgid "Alert"
|
| 1112 |
+
msgstr "Alerta"
|
| 1113 |
+
|
| 1114 |
+
#: ../ui/admin.php:52
|
| 1115 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form fields and buttons"
|
| 1116 |
+
msgstr ""
|
| 1117 |
+
"Incluir estilos Bootstrap 3 no front-end para campos e botões do formulário"
|
| 1118 |
+
|
| 1119 |
+
#: ../ui/admin.php:53
|
| 1120 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form grid layouts"
|
| 1121 |
+
msgstr "Incluir estilos Bootstrap 3 no front-end para as grelhas de formulário"
|
| 1122 |
+
|
| 1123 |
+
#: ../ui/admin.php:53
|
| 1124 |
+
msgid "Grid"
|
| 1125 |
+
msgstr "Grelha"
|
| 1126 |
+
|
| 1127 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1128 |
+
msgid "Entries"
|
| 1129 |
+
msgstr "Entradas"
|
| 1130 |
+
|
| 1131 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1132 |
+
#: ../ui/panels/emailer.php:35
|
| 1133 |
+
msgid "Disabled"
|
| 1134 |
+
msgstr "Desativado"
|
| 1135 |
+
|
| 1136 |
+
#: ../ui/admin.php:112
|
| 1137 |
+
msgid "Mailer Debug enabled."
|
| 1138 |
+
msgstr "Debug de Mailer activo."
|
| 1139 |
+
|
| 1140 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1141 |
+
msgid "Edit"
|
| 1142 |
+
msgstr "Editar"
|
| 1143 |
+
|
| 1144 |
+
#: ../ui/admin.php:141
|
| 1145 |
+
msgid "Export"
|
| 1146 |
+
msgstr "Exportar"
|
| 1147 |
+
|
| 1148 |
+
#: ../ui/admin.php:142
|
| 1149 |
+
msgid "Clone Form"
|
| 1150 |
+
msgstr "Clonar Formulário"
|
| 1151 |
+
|
| 1152 |
+
#: ../ui/admin.php:142
|
| 1153 |
+
msgid "Clone"
|
| 1154 |
+
msgstr "Clonar"
|
| 1155 |
+
|
| 1156 |
+
#: ../ui/admin.php:143
|
| 1157 |
+
msgid "This will delete this form permanently. Continue?"
|
| 1158 |
+
msgstr "Irá eliminar o formulário de forma permanente. Continuar?"
|
| 1159 |
+
|
| 1160 |
+
#: ../ui/admin.php:143
|
| 1161 |
+
msgid "Delete"
|
| 1162 |
+
msgstr "Apagar"
|
| 1163 |
+
|
| 1164 |
+
#: ../ui/admin.php:163
|
| 1165 |
+
msgid "You don't have any forms."
|
| 1166 |
+
msgstr "Não possui qualquer formulário."
|
| 1167 |
+
|
| 1168 |
+
#: ../ui/admin.php:204
|
| 1169 |
+
msgid "An form name is required"
|
| 1170 |
+
msgstr "É necessário atribuir nome ao formulário"
|
| 1171 |
+
|
| 1172 |
+
#: ../ui/admin.php:231
|
| 1173 |
+
msgid ""
|
| 1174 |
+
"Looks like something is not working. Please try again a little later or post "
|
| 1175 |
+
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1176 |
+
"\"_blank\">support forum</a>."
|
| 1177 |
+
msgstr ""
|
| 1178 |
+
"Aparentemente algo não está a funcionar correctamente. Por favor tente "
|
| 1179 |
+
"novamente mais tarde ou submeta um pedido de suporte no <a href=\"http://"
|
| 1180 |
+
"wordpress.org/support/plugin/caldera-forms\" target=\"_blank\">fórum de "
|
| 1181 |
+
"suporte</a>."
|
| 1182 |
+
|
| 1183 |
+
#: ../ui/admin_templates.php:2 ../ui/admin_templates.php:7
|
| 1184 |
+
msgid "Bulk Actions"
|
| 1185 |
+
msgstr "Acções em Bloco"
|
| 1186 |
+
|
| 1187 |
+
#: ../ui/admin_templates.php:3 ../ui/admin_templates.php:8
|
| 1188 |
+
msgid "Export Selected"
|
| 1189 |
+
msgstr "Exportar Selecção"
|
| 1190 |
+
|
| 1191 |
+
#: ../ui/admin_templates.php:4
|
| 1192 |
+
msgid "Move to Trash"
|
| 1193 |
+
msgstr "Mover para o Lixo"
|
| 1194 |
+
|
| 1195 |
+
#: ../ui/admin_templates.php:10
|
| 1196 |
+
msgid "Delete Permanently"
|
| 1197 |
+
msgstr "Apagar Permanentemente"
|
| 1198 |
+
|
| 1199 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
| 1200 |
+
msgid "Form Name"
|
| 1201 |
+
msgstr "Nome do Formulário"
|
| 1202 |
+
|
| 1203 |
+
#: ../ui/admin_templates.php:25
|
| 1204 |
+
msgid "Form File"
|
| 1205 |
+
msgstr "Ficheiro do Formulário"
|
| 1206 |
+
|
| 1207 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1208 |
+
msgid "Description"
|
| 1209 |
+
msgstr "Descrição"
|
| 1210 |
+
|
| 1211 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1212 |
+
msgid "ID"
|
| 1213 |
+
msgstr "ID"
|
| 1214 |
+
|
| 1215 |
+
#: ../ui/admin_templates.php:73 ../ui/admin_templates.php:111
|
| 1216 |
+
msgid "Submitted"
|
| 1217 |
+
msgstr "Enviado"
|
| 1218 |
+
|
| 1219 |
+
#: ../ui/admin_templates.php:94
|
| 1220 |
+
msgid "No entries found"
|
| 1221 |
+
msgstr "Nenhuma entrada"
|
| 1222 |
+
|
| 1223 |
+
#: ../ui/admin_templates.php:100
|
| 1224 |
+
msgid "No entries yet."
|
| 1225 |
+
msgstr "Sem entradas de momento."
|
| 1226 |
+
|
| 1227 |
+
#: ../ui/edit.php:13
|
| 1228 |
+
msgid "Form has successfully been submitted. Thank you."
|
| 1229 |
+
msgstr "O formulário foi enviado com sucesso. Obrigado."
|
| 1230 |
+
|
| 1231 |
+
#: ../ui/edit.php:99
|
| 1232 |
+
msgid "Auto Populate"
|
| 1233 |
+
msgstr "Preenchimento Automático"
|
| 1234 |
+
|
| 1235 |
+
#: ../ui/edit.php:105
|
| 1236 |
+
msgid "Auto Type"
|
| 1237 |
+
msgstr ""
|
| 1238 |
+
|
| 1239 |
+
#: ../ui/edit.php:108
|
| 1240 |
+
msgid "Select a source"
|
| 1241 |
+
msgstr "Seleccionar origem"
|
| 1242 |
+
|
| 1243 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1244 |
+
msgid "Post Type"
|
| 1245 |
+
msgstr "Tipo de artigo"
|
| 1246 |
+
|
| 1247 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1248 |
+
msgid "Taxonomy"
|
| 1249 |
+
msgstr "Taxonomia"
|
| 1250 |
+
|
| 1251 |
+
#: ../ui/edit.php:167
|
| 1252 |
+
msgid "Add Option"
|
| 1253 |
+
msgstr "Adicionar Opção"
|
| 1254 |
+
|
| 1255 |
+
#: ../ui/edit.php:168
|
| 1256 |
+
msgid "Bulk Insert"
|
| 1257 |
+
msgstr "Inserção em Bloco"
|
| 1258 |
+
|
| 1259 |
+
#: ../ui/edit.php:171
|
| 1260 |
+
msgid "Single option per line. These replace the current list."
|
| 1261 |
+
msgstr "Opção única por linha. Irá substituir a lista actual."
|
| 1262 |
+
|
| 1263 |
+
#: ../ui/edit.php:172
|
| 1264 |
+
msgid "Insert Options"
|
| 1265 |
+
msgstr "Opções de Introdução"
|
| 1266 |
+
|
| 1267 |
+
#: ../ui/edit.php:176
|
| 1268 |
+
msgid "No Default"
|
| 1269 |
+
msgstr "Sem Padrão"
|
| 1270 |
+
|
| 1271 |
+
#: ../ui/edit.php:177
|
| 1272 |
+
msgid "Show Values"
|
| 1273 |
+
msgstr "Mostrar Valores"
|
| 1274 |
+
|
| 1275 |
+
#: ../ui/edit.php:181
|
| 1276 |
+
msgid "Label"
|
| 1277 |
+
msgstr "Etiqueta"
|
| 1278 |
+
|
| 1279 |
+
#: ../ui/edit.php:342
|
| 1280 |
+
msgid "Elements"
|
| 1281 |
+
msgstr "Elementos"
|
| 1282 |
+
|
| 1283 |
+
#: ../ui/edit.php:354
|
| 1284 |
+
msgid "Element Type"
|
| 1285 |
+
msgstr "Tipo de Elemento"
|
| 1286 |
+
|
| 1287 |
+
#: ../ui/edit.php:379
|
| 1288 |
+
msgid "Hide Label"
|
| 1289 |
+
msgstr "Ocultar Etiqueta"
|
| 1290 |
+
|
| 1291 |
+
#: ../ui/edit.php:386
|
| 1292 |
+
msgid "Slug"
|
| 1293 |
+
msgstr "Slug"
|
| 1294 |
+
|
| 1295 |
+
#: ../ui/edit.php:392
|
| 1296 |
+
msgid "Condition"
|
| 1297 |
+
msgstr ""
|
| 1298 |
+
|
| 1299 |
+
#: ../ui/edit.php:397
|
| 1300 |
+
msgid "Disable"
|
| 1301 |
+
msgstr "Desactivar"
|
| 1302 |
+
|
| 1303 |
+
#: ../ui/edit.php:403
|
| 1304 |
+
msgid "Required"
|
| 1305 |
+
msgstr "Obrigatório"
|
| 1306 |
+
|
| 1307 |
+
#: ../ui/edit.php:417
|
| 1308 |
+
msgid "Show in Entry List"
|
| 1309 |
+
msgstr "Mostrar na lista de entradas"
|
| 1310 |
+
|
| 1311 |
+
#: ../ui/edit.php:427
|
| 1312 |
+
msgid ""
|
| 1313 |
+
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1314 |
+
msgstr "Tem certeza que deseja remover este campo?"
|
| 1315 |
+
|
| 1316 |
+
#: ../ui/edit.php:427
|
| 1317 |
+
msgid "Delete Element"
|
| 1318 |
+
msgstr "Apagar Elemento"
|
| 1319 |
+
|
| 1320 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
| 1321 |
+
msgid "General Settings"
|
| 1322 |
+
msgstr "Definições Gerais"
|
| 1323 |
+
|
| 1324 |
+
#: ../ui/edit.php:498
|
| 1325 |
+
msgid "Updated Successfully"
|
| 1326 |
+
msgstr "Atualizado com sucesso"
|
| 1327 |
+
|
| 1328 |
+
#: ../ui/edit.php:500
|
| 1329 |
+
msgid "Update Form"
|
| 1330 |
+
msgstr "Actualizar Formulário"
|
| 1331 |
+
|
| 1332 |
+
#: ../ui/edit.php:501
|
| 1333 |
+
msgid "Preview Form"
|
| 1334 |
+
msgstr "Visualizar Formulário"
|
| 1335 |
+
|
| 1336 |
+
#: ../ui/edit.php:514
|
| 1337 |
+
msgid "Form Description"
|
| 1338 |
+
msgstr "Descrição do Formulário"
|
| 1339 |
+
|
| 1340 |
+
#: ../ui/edit.php:521
|
| 1341 |
+
msgid "State"
|
| 1342 |
+
msgstr "Estado"
|
| 1343 |
+
|
| 1344 |
+
#: ../ui/edit.php:523
|
| 1345 |
+
msgid "Deactivate / Draft"
|
| 1346 |
+
msgstr "Desativar / Rascunho"
|
| 1347 |
+
|
| 1348 |
+
#: ../ui/edit.php:528
|
| 1349 |
+
msgid "Capture Entries"
|
| 1350 |
+
msgstr "Capturar Entradas"
|
| 1351 |
+
|
| 1352 |
+
#: ../ui/edit.php:536
|
| 1353 |
+
msgid "Pin to Menu"
|
| 1354 |
+
msgstr "Fixar no Menu"
|
| 1355 |
+
|
| 1356 |
+
#: ../ui/edit.php:545
|
| 1357 |
+
msgid "View Entries"
|
| 1358 |
+
msgstr "Ver Entradas"
|
| 1359 |
+
|
| 1360 |
+
#: ../ui/edit.php:547
|
| 1361 |
+
msgid "All"
|
| 1362 |
+
msgstr "Todos"
|
| 1363 |
+
|
| 1364 |
+
#: ../ui/edit.php:569
|
| 1365 |
+
msgid "Hide Form"
|
| 1366 |
+
msgstr "Ocultar formulário"
|
| 1367 |
+
|
| 1368 |
+
#: ../ui/edit.php:571
|
| 1369 |
+
msgid "Hide form after successful submission"
|
| 1370 |
+
msgstr "Ocultar o formulário após submissão bem sucedida"
|
| 1371 |
+
|
| 1372 |
+
#: ../ui/edit.php:576
|
| 1373 |
+
msgid "Honeypot"
|
| 1374 |
+
msgstr ""
|
| 1375 |
+
|
| 1376 |
+
#: ../ui/edit.php:578
|
| 1377 |
+
msgid "Place an invisible field to trick spambots"
|
| 1378 |
+
msgstr "Insere um campo oculto para enganar os sistemas de spam"
|
| 1379 |
+
|
| 1380 |
+
#: ../ui/edit.php:583
|
| 1381 |
+
msgid "Success Message"
|
| 1382 |
+
msgstr "Mensagem de Sucesso"
|
| 1383 |
+
|
| 1384 |
+
#: ../ui/edit.php:589
|
| 1385 |
+
msgid "Gravatar Field"
|
| 1386 |
+
msgstr "Campo de Gravatar"
|
| 1387 |
+
|
| 1388 |
+
#: ../ui/edit.php:596
|
| 1389 |
+
msgid "Used when viewing an entry from a non-logged in user."
|
| 1390 |
+
msgstr "Usada ao exibir uma entrada de utilizador sem sessão iniciada."
|
| 1391 |
+
|
| 1392 |
+
#: ../ui/edit.php:670
|
| 1393 |
+
msgid "Add New"
|
| 1394 |
+
msgstr "Adicionar Novo"
|
| 1395 |
+
|
| 1396 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1397 |
+
msgid "Remove"
|
| 1398 |
+
msgstr "Remover"
|
| 1399 |
+
|
| 1400 |
+
#: ../ui/edit.php:825
|
| 1401 |
+
msgid "Set Element"
|
| 1402 |
+
msgstr "Definir Elemento"
|
| 1403 |
+
|
| 1404 |
+
#: ../ui/edit.php:828
|
| 1405 |
+
msgid "No description given"
|
| 1406 |
+
msgstr "Nenhuma descrição inserida"
|
| 1407 |
+
|
| 1408 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1409 |
+
msgid "or"
|
| 1410 |
+
msgstr "ou"
|
| 1411 |
+
|
| 1412 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1413 |
+
msgid "is"
|
| 1414 |
+
msgstr "é"
|
| 1415 |
+
|
| 1416 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1417 |
+
msgid "is not"
|
| 1418 |
+
msgstr "não é"
|
| 1419 |
+
|
| 1420 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1421 |
+
msgid "is greater than"
|
| 1422 |
+
msgstr "é maior que"
|
| 1423 |
+
|
| 1424 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1425 |
+
msgid "is less than"
|
| 1426 |
+
msgstr "é menor que"
|
| 1427 |
+
|
| 1428 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1429 |
+
msgid "starts with"
|
| 1430 |
+
msgstr "começa com"
|
| 1431 |
+
|
| 1432 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1433 |
+
msgid "ends with"
|
| 1434 |
+
msgstr "termina com"
|
| 1435 |
+
|
| 1436 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1437 |
+
msgid "contains"
|
| 1438 |
+
msgstr "contém"
|
| 1439 |
+
|
| 1440 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1441 |
+
msgid "Select field first"
|
| 1442 |
+
msgstr "Seleccione o campo primeiro"
|
| 1443 |
+
|
| 1444 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1445 |
+
#: ../ui/panels/conditions.php:129
|
| 1446 |
+
msgid "Add Condition"
|
| 1447 |
+
msgstr "Adicionar Condição"
|
| 1448 |
+
|
| 1449 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1450 |
+
msgid "and"
|
| 1451 |
+
msgstr "e"
|
| 1452 |
+
|
| 1453 |
+
#: ../ui/entries_toolbar.php:15
|
| 1454 |
+
msgid "Active"
|
| 1455 |
+
msgstr "Activo"
|
| 1456 |
+
|
| 1457 |
+
#: ../ui/entries_toolbar.php:31
|
| 1458 |
+
msgid "Export Entries"
|
| 1459 |
+
msgstr "Exportar Entradas"
|
| 1460 |
+
|
| 1461 |
+
#: ../ui/entries_toolbar.php:35
|
| 1462 |
+
msgid "Apply"
|
| 1463 |
+
msgstr "Aplicar"
|
| 1464 |
+
|
| 1465 |
+
#: ../ui/entry_navigation.php:23
|
| 1466 |
+
msgid "item"
|
| 1467 |
+
msgstr "item"
|
| 1468 |
+
|
| 1469 |
+
#: ../ui/entry_navigation.php:23
|
| 1470 |
+
msgid "items"
|
| 1471 |
+
msgstr "itens"
|
| 1472 |
+
|
| 1473 |
+
#: ../ui/extend.php:23
|
| 1474 |
+
msgid ""
|
| 1475 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1476 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1477 |
+
"Forms."
|
| 1478 |
+
msgstr ""
|
| 1479 |
+
"Nota: Estamos de momento a migrar licenças Caldera Forms para o Caldera "
|
| 1480 |
+
"License Manager. Este painel será removido em versões futuras do Caldera "
|
| 1481 |
+
"Forms."
|
| 1482 |
+
|
| 1483 |
+
#: ../ui/extend.php:29
|
| 1484 |
+
msgid "No licensed addons installed."
|
| 1485 |
+
msgstr "Sem licenças para addons instaladas"
|
| 1486 |
+
|
| 1487 |
+
#: ../ui/extend.php:54
|
| 1488 |
+
msgid "Already Installed"
|
| 1489 |
+
msgstr "Já Instalado"
|
| 1490 |
+
|
| 1491 |
+
#: ../ui/insert_shortcode.php:5
|
| 1492 |
+
msgid "Insert Caldera Form"
|
| 1493 |
+
msgstr "Inserir formulário Caldera"
|
| 1494 |
+
|
| 1495 |
+
#: ../ui/insert_shortcode.php:24
|
| 1496 |
+
msgid "You don't have any forms to insert."
|
| 1497 |
+
msgstr "Não possui qualquer formulário para inserir."
|
| 1498 |
+
|
| 1499 |
+
#: ../ui/insert_shortcode.php:32
|
| 1500 |
+
msgid "Insert Form"
|
| 1501 |
+
msgstr "Inserir Formulário"
|
| 1502 |
+
|
| 1503 |
+
#: ../ui/insert_shortcode.php:34
|
| 1504 |
+
msgid "Close"
|
| 1505 |
+
msgstr "Fechar"
|
| 1506 |
+
|
| 1507 |
+
#: ../ui/news_templates.php:21
|
| 1508 |
+
msgid "Unable to connect or no extensions available."
|
| 1509 |
+
msgstr "Impossível obter ligação ou sem extensões disponíveis."
|
| 1510 |
+
|
| 1511 |
+
#: ../ui/panels/conditions.php:65
|
| 1512 |
+
msgid "Show"
|
| 1513 |
+
msgstr "Mostrar"
|
| 1514 |
+
|
| 1515 |
+
#: ../ui/panels/conditions.php:66
|
| 1516 |
+
msgid "Hide"
|
| 1517 |
+
msgstr "Esconder"
|
| 1518 |
+
|
| 1519 |
+
#: ../ui/panels/conditions.php:69
|
| 1520 |
+
msgid "Add Conditional Line"
|
| 1521 |
+
msgstr ""
|
| 1522 |
+
|
| 1523 |
+
#: ../ui/panels/conditions.php:83
|
| 1524 |
+
msgid "if"
|
| 1525 |
+
msgstr ""
|
| 1526 |
+
|
| 1527 |
+
#: ../ui/panels/conditions.php:133
|
| 1528 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1529 |
+
msgstr ""
|
| 1530 |
+
|
| 1531 |
+
#: ../ui/panels/conditions.php:133
|
| 1532 |
+
msgid "Remove Condition"
|
| 1533 |
+
msgstr ""
|
| 1534 |
+
|
| 1535 |
+
#: ../ui/panels/conditions.php:137
|
| 1536 |
+
msgid "Applied Fields"
|
| 1537 |
+
msgstr ""
|
| 1538 |
+
|
| 1539 |
+
#: ../ui/panels/conditions.php:138
|
| 1540 |
+
msgid "Select the fields to apply this condition to."
|
| 1541 |
+
msgstr ""
|
| 1542 |
+
|
| 1543 |
+
#: ../ui/panels/emailer.php:36
|
| 1544 |
+
msgid "Enabled"
|
| 1545 |
+
msgstr "Activado"
|
| 1546 |
+
|
| 1547 |
+
#: ../ui/panels/emailer.php:45
|
| 1548 |
+
msgid "Name from which the email comes"
|
| 1549 |
+
msgstr "Nome de onde vem o email"
|
| 1550 |
+
|
| 1551 |
+
#: ../ui/panels/emailer.php:52
|
| 1552 |
+
msgid ""
|
| 1553 |
+
"Email Address from which the mail comes. Try not to use a field from the "
|
| 1554 |
+
"form. Rather use your own email and use a form field in the \"Reply To Email"
|
| 1555 |
+
"\" below."
|
| 1556 |
+
msgstr ""
|
| 1557 |
+
"Endereço de email de onde o email é enviado. Tente não usar um campo do "
|
| 1558 |
+
"formulário. Use antes o seu próprio email e use um campo “Responder para "
|
| 1559 |
+
"Email” abaixo."
|
| 1560 |
+
|
| 1561 |
+
#: ../ui/panels/emailer.php:56
|
| 1562 |
+
msgid "Reply To Email"
|
| 1563 |
+
msgstr "Responder para Email"
|
| 1564 |
+
|
| 1565 |
+
#: ../ui/panels/emailer.php:59
|
| 1566 |
+
msgid ""
|
| 1567 |
+
"The email address of the person filling in the form. This will allow the "
|
| 1568 |
+
"email to be replied directly to the sender."
|
| 1569 |
+
msgstr ""
|
| 1570 |
+
"O endereço de email da pessoa a preencher o formulário. Isto irá permitir "
|
| 1571 |
+
"responder directamente ao email para o remetente."
|
| 1572 |
+
|
| 1573 |
+
#: ../ui/panels/emailer.php:64
|
| 1574 |
+
msgid "Email Type"
|
| 1575 |
+
msgstr "Tipo de Email"
|
| 1576 |
+
|
| 1577 |
+
#: ../ui/panels/emailer.php:73
|
| 1578 |
+
msgid "CSV Include"
|
| 1579 |
+
msgstr "Incluir CSV"
|
| 1580 |
+
|
| 1581 |
+
#: ../ui/panels/emailer.php:75
|
| 1582 |
+
msgid "Attach a CSV version of the submission"
|
| 1583 |
+
msgstr "Anexa um ficheiro CSV com as informações da submissão"
|
| 1584 |
+
|
| 1585 |
+
#: ../ui/panels/emailer.php:81
|
| 1586 |
+
msgid "Recipients"
|
| 1587 |
+
msgstr "Destinatários"
|
| 1588 |
+
|
| 1589 |
+
#: ../ui/panels/emailer.php:84
|
| 1590 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1591 |
+
msgstr ""
|
| 1592 |
+
|
| 1593 |
+
#: ../ui/panels/emailer.php:89
|
| 1594 |
+
msgid "BCC"
|
| 1595 |
+
msgstr "BCC"
|
| 1596 |
+
|
| 1597 |
+
#: ../ui/panels/emailer.php:92
|
| 1598 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1599 |
+
msgstr ""
|
| 1600 |
+
|
| 1601 |
+
#: ../ui/panels/emailer.php:100
|
| 1602 |
+
msgid "Use %field_slug% to use a value from the form"
|
| 1603 |
+
msgstr "Usar o %field_slug% para usar um valor com origem no formulário"
|
| 1604 |
+
|
| 1605 |
+
#: ../ui/panels/emailer.php:104
|
| 1606 |
+
msgid "Email Message"
|
| 1607 |
+
msgstr "Mensagem de Email"
|
| 1608 |
+
|
| 1609 |
+
#: ../ui/panels/emailer.php:107
|
| 1610 |
+
msgid ""
|
| 1611 |
+
"Magic tags, %field_slug% are replaced with submitted data. Use {summary} to "
|
| 1612 |
+
"build an automatic mail based on form content. Leaving the mailer blank, "
|
| 1613 |
+
"will create and automatic summary."
|
| 1614 |
+
msgstr ""
|
| 1615 |
+
"Tags mágicas, %field_slug% será substituída com os dados enviados pelo "
|
| 1616 |
+
"utilizador. Use {summary} para construir um email automático baseado nos "
|
| 1617 |
+
"conteúdos do formulário. Se deixar em branco irá ser criado um resumo "
|
| 1618 |
+
"automático."
|
| 1619 |
+
|
| 1620 |
+
#: ../ui/panels/emailer.php:113
|
| 1621 |
+
msgid "Debug Mailer"
|
| 1622 |
+
msgstr ""
|
| 1623 |
+
|
| 1624 |
+
#: ../ui/panels/emailer.php:115
|
| 1625 |
+
msgid "Enable email send transation log"
|
| 1626 |
+
msgstr "Activa as informações de registo para programadores"
|
| 1627 |
+
|
| 1628 |
+
#: ../ui/panels/emailer.php:116
|
| 1629 |
+
msgid ""
|
| 1630 |
+
"If set, entries will have a \"Mailer Debug\" meta tab to see the transaction "
|
| 1631 |
+
"log. Do not keep this enabled on production as it sends two emails for "
|
| 1632 |
+
"tracking."
|
| 1633 |
+
msgstr ""
|
| 1634 |
+
"Se definido, as entradas irão conter um tabulador “Mailer Debug” para "
|
| 1635 |
+
"mostrar os registos de transação. Não mantenha esta opção activa em produção "
|
| 1636 |
+
"pois irá enviar dois emails para teste."
|
| 1637 |
+
|
| 1638 |
+
#: ../ui/panels/emailer.php:118
|
| 1639 |
+
msgid "Learn more here"
|
| 1640 |
+
msgstr ""
|
| 1641 |
+
|
| 1642 |
+
#: ../ui/panels/emailer.php:130
|
| 1643 |
+
msgid ""
|
| 1644 |
+
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1645 |
+
"the form submittable."
|
| 1646 |
+
msgstr ""
|
| 1647 |
+
"Por favor adicionar um Botão e configure-o para “Submeter” para que este "
|
| 1648 |
+
"formulário possa ser processado."
|
| 1649 |
+
|
| 1650 |
+
#: ../ui/panels/layout.php:13
|
| 1651 |
+
msgid "This will remove all the fields in this row. Are you sure?"
|
| 1652 |
+
msgstr "Irá eliminar todos os campos nesta linha. Continuar?"
|
| 1653 |
+
|
| 1654 |
+
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1655 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1656 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1657 |
+
msgid "Page"
|
| 1658 |
+
msgstr "Página"
|
| 1659 |
+
|
| 1660 |
+
#: ../ui/panels/layout_toolbar.php:11
|
| 1661 |
+
msgid "Add Page"
|
| 1662 |
+
msgstr "Adicionar Página"
|
| 1663 |
+
|
| 1664 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1665 |
+
msgid "Drag onto the form grid below"
|
| 1666 |
+
msgstr "Arrastar para a grelha de formulário abaixo"
|
| 1667 |
+
|
| 1668 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1669 |
+
msgid "Add Element"
|
| 1670 |
+
msgstr "Adicionar Elemento"
|
| 1671 |
+
|
| 1672 |
+
#: ../ui/panels/pages.php:2
|
| 1673 |
+
msgid "Progress Bar"
|
| 1674 |
+
msgstr "Barra de Progresso"
|
| 1675 |
+
|
| 1676 |
+
#: ../ui/panels/pages.php:4
|
| 1677 |
+
msgid "Show Breadcrumbs"
|
| 1678 |
+
msgstr "Mostrar Trilha de Navegação"
|
| 1679 |
+
|
| 1680 |
+
#: ../ui/panels/pages.php:5
|
| 1681 |
+
msgid "ProTip: Use an HTML element to build a custom progress per page"
|
| 1682 |
+
msgstr ""
|
| 1683 |
+
"Dica: Use um elemento HTML para construir informação de progresso custodiada."
|
| 1684 |
+
|
| 1685 |
+
#: ../ui/panels/processors.php:22 ../ui/panels/processors.php:47
|
| 1686 |
+
#: ../ui/panels/processors.php:100
|
| 1687 |
+
msgid "New Form Processor"
|
| 1688 |
+
msgstr "Novo Processador de Formulário"
|
| 1689 |
+
|
| 1690 |
+
#: ../ui/panels/processors.php:103
|
| 1691 |
+
msgid "Processor Type"
|
| 1692 |
+
msgstr "Tipo de Processador"
|
| 1693 |
+
|
| 1694 |
+
#: ../ui/panels/processors.php:117
|
| 1695 |
+
msgid "Are you sure you want to remove this processor?"
|
| 1696 |
+
msgstr "Tem certeza que deseja remover este processador?"
|
| 1697 |
+
|
| 1698 |
+
#: ../ui/panels/processors.php:117
|
| 1699 |
+
msgid "Remove Processor"
|
| 1700 |
+
msgstr "Remover o Processador"
|
| 1701 |
+
|
| 1702 |
+
#: ../ui/panels/processors.php:123
|
| 1703 |
+
msgid "Use"
|
| 1704 |
+
msgstr "Usar"
|
| 1705 |
+
|
| 1706 |
+
#: ../ui/panels/processors.php:124
|
| 1707 |
+
msgid "Don't Use"
|
| 1708 |
+
msgstr "Não Usar"
|
| 1709 |
+
|
| 1710 |
+
#: ../ui/panels/processors.php:126
|
| 1711 |
+
msgid "Add Conditional Group"
|
| 1712 |
+
msgstr "Adicionar Grupo Condicional"
|
| 1713 |
+
|
| 1714 |
+
#: ../ui/panels/processors.php:171
|
| 1715 |
+
msgid "Add Processor"
|
| 1716 |
+
msgstr "Adicionar Processador"
|
| 1717 |
+
|
| 1718 |
+
#: ../ui/panels/processors.php:221
|
| 1719 |
+
msgid "Use Processor"
|
| 1720 |
+
msgstr "Usar Processador"
|
| 1721 |
+
|
| 1722 |
+
#: ../ui/panels/processors.php:226
|
| 1723 |
+
msgid "by"
|
| 1724 |
+
msgstr "por"
|
| 1725 |
+
|
| 1726 |
+
#: ../ui/panels/processors.php:284
|
| 1727 |
+
msgid "This processor has no configurable options."
|
| 1728 |
+
msgstr "Este processador não possui opções configuráveis."
|
| 1729 |
+
|
| 1730 |
+
#: ../ui/panels/variable_add.php:1
|
| 1731 |
+
msgid "Add Variable"
|
| 1732 |
+
msgstr "Adicionar Variável"
|
| 1733 |
+
|
| 1734 |
+
#: ../ui/panels/variables.php:14
|
| 1735 |
+
msgid "Behaviour"
|
| 1736 |
+
msgstr "Comportamento"
|
| 1737 |
+
|
| 1738 |
+
#: ../ui/panels/variables.php:16
|
| 1739 |
+
msgid "No variables defined"
|
| 1740 |
+
msgstr "Não há variáveis definidas"
|
| 1741 |
+
|
| 1742 |
+
#: ../ui/panels/variables.php:29 ../ui/panels/variables.php:49
|
| 1743 |
+
msgid "Static"
|
| 1744 |
+
msgstr "Estático"
|
| 1745 |
+
|
| 1746 |
+
#: ../ui/panels/variables.php:30 ../ui/panels/variables.php:50
|
| 1747 |
+
msgid "Passback"
|
| 1748 |
+
msgstr ""
|
| 1749 |
+
|
| 1750 |
+
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
| 1751 |
+
msgid "Entry List"
|
| 1752 |
+
msgstr "Lista de Entradas"
|
| 1753 |
+
|
| 1754 |
+
#~ msgid "Settings"
|
| 1755 |
+
#~ msgstr "Definições"
|
| 1756 |
+
|
| 1757 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1758 |
+
#~ msgstr "Lista de destinatários separados por vírgula."
|
| 1759 |
+
|
| 1760 |
+
#~ msgid "Add Row"
|
| 1761 |
+
#~ msgstr "Adicionar Linha"
|
languages/caldera-forms-tr_TR.mo
ADDED
|
Binary file
|
languages/caldera-forms-tr_TR.po
ADDED
|
@@ -0,0 +1,1753 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Yavuz Uyar <yvzuyr@gmail.com>, 2015.
|
| 2 |
+
msgid ""
|
| 3 |
+
msgstr ""
|
| 4 |
+
"Project-Id-Version: Caldera Forms\n"
|
| 5 |
+
"POT-Creation-Date: 2015-08-24 12:17+0200\n"
|
| 6 |
+
"PO-Revision-Date: 2015-08-24 12:18+0200\n"
|
| 7 |
+
"Last-Translator: Yavuz Uyar <yvzuyr@gmail.com>\n"
|
| 8 |
+
"Language-Team: Yavuz Uyar\n"
|
| 9 |
+
"Language: tr\n"
|
| 10 |
+
"MIME-Version: 1.0\n"
|
| 11 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 14 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
| 17 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 18 |
+
"X-Poedit-SearchPath-0: ..\n"
|
| 19 |
+
|
| 20 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 21 |
+
msgid "Caldera Forms Notification"
|
| 22 |
+
msgstr "Caldera Formları Bildirimleri"
|
| 23 |
+
|
| 24 |
+
#: ../classes/admin.php:124
|
| 25 |
+
msgid "Invalid Form."
|
| 26 |
+
msgstr "Geçersiz Form."
|
| 27 |
+
|
| 28 |
+
#: ../classes/admin.php:143
|
| 29 |
+
msgid "Starter Contact Form"
|
| 30 |
+
msgstr "Yeni Başlayanlar İçin İletişim Formu"
|
| 31 |
+
|
| 32 |
+
#: ../classes/admin.php:147
|
| 33 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 34 |
+
msgstr ""
|
| 35 |
+
|
| 36 |
+
#: ../classes/admin.php:151
|
| 37 |
+
msgid "Registration Form, with optional additional participants."
|
| 38 |
+
msgstr ""
|
| 39 |
+
|
| 40 |
+
#: ../classes/admin.php:174
|
| 41 |
+
msgid "Form Template"
|
| 42 |
+
msgstr "Form şablonu"
|
| 43 |
+
|
| 44 |
+
#: ../classes/admin.php:177
|
| 45 |
+
msgid "no template - blank form"
|
| 46 |
+
msgstr "şablon yok - boş form"
|
| 47 |
+
|
| 48 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 49 |
+
#: ../ui/entries_toolbar.php:27
|
| 50 |
+
msgid "Trash"
|
| 51 |
+
msgstr "Çöp"
|
| 52 |
+
|
| 53 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 54 |
+
#: ../ui/admin_templates.php:9
|
| 55 |
+
msgid "Restore"
|
| 56 |
+
msgstr "Geri Yükle"
|
| 57 |
+
|
| 58 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 59 |
+
msgid "Entry"
|
| 60 |
+
msgstr "Girdi"
|
| 61 |
+
|
| 62 |
+
#: ../classes/admin.php:385
|
| 63 |
+
msgid "View"
|
| 64 |
+
msgstr "Görüntüle"
|
| 65 |
+
|
| 66 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 67 |
+
msgid "Add Form to Page"
|
| 68 |
+
msgstr "Fomu Sayfaya Ekle"
|
| 69 |
+
|
| 70 |
+
#: ../classes/admin.php:428
|
| 71 |
+
msgid "Insert Form Shortcode"
|
| 72 |
+
msgstr "Form Kısa Kodu Ekle"
|
| 73 |
+
|
| 74 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 75 |
+
msgid "Caldera Form"
|
| 76 |
+
msgstr "Caldera Formu"
|
| 77 |
+
|
| 78 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 79 |
+
msgid "Deactivate"
|
| 80 |
+
msgstr "Devre Dışı Bırak"
|
| 81 |
+
|
| 82 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 83 |
+
msgid "Activate"
|
| 84 |
+
msgstr "Etkinleştir"
|
| 85 |
+
|
| 86 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 87 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 88 |
+
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 89 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 90 |
+
msgid "Caldera Forms"
|
| 91 |
+
msgstr "Caldera Formları"
|
| 92 |
+
|
| 93 |
+
#: ../classes/admin.php:746
|
| 94 |
+
msgid "Caldera Forms Admin"
|
| 95 |
+
msgstr "Caldera Formları Yöneticisi"
|
| 96 |
+
|
| 97 |
+
#: ../classes/admin.php:746
|
| 98 |
+
msgid "Forms"
|
| 99 |
+
msgstr "Formlar"
|
| 100 |
+
|
| 101 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 102 |
+
msgid "Community"
|
| 103 |
+
msgstr "Topluluk"
|
| 104 |
+
|
| 105 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 106 |
+
msgid "Extend"
|
| 107 |
+
msgstr "Uzatmak"
|
| 108 |
+
|
| 109 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 110 |
+
msgid "Sorry, please try again"
|
| 111 |
+
msgstr "Üzgünüm, lütfen tekrar deneyin"
|
| 112 |
+
|
| 113 |
+
#: ../classes/admin.php:1017
|
| 114 |
+
msgid "Form Delete Error"
|
| 115 |
+
msgstr "Formu Silme Hatası"
|
| 116 |
+
|
| 117 |
+
#: ../classes/admin.php:1170
|
| 118 |
+
msgid "Sorry, File is not valid."
|
| 119 |
+
msgstr "Üzgünüz, dosya geçerli değil."
|
| 120 |
+
|
| 121 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 122 |
+
#: ../classes/admin.php:1179
|
| 123 |
+
msgid "Form Import Error"
|
| 124 |
+
msgstr "Form İçe Aktarma Hatası"
|
| 125 |
+
|
| 126 |
+
#: ../classes/admin.php:1174
|
| 127 |
+
msgid "Sorry, File not uploaded."
|
| 128 |
+
msgstr "Üzgünüz, Dosya yüklenmedi."
|
| 129 |
+
|
| 130 |
+
#: ../classes/admin.php:1188
|
| 131 |
+
msgid "Form does not exist."
|
| 132 |
+
msgstr "Form mevcut değil."
|
| 133 |
+
|
| 134 |
+
#: ../classes/admin.php:1229
|
| 135 |
+
msgid "Export selection has expired"
|
| 136 |
+
msgstr "Dışa aktarma seçeneğinin süresi doldu"
|
| 137 |
+
|
| 138 |
+
#: ../classes/admin.php:1229
|
| 139 |
+
msgid "Export Expired"
|
| 140 |
+
msgstr "Dışa Aktarmanın Süresi Doldu"
|
| 141 |
+
|
| 142 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 143 |
+
msgid "Form has been successfully submitted. Thank you."
|
| 144 |
+
msgstr "Form başarıyla gönderildi. Teşekkürler."
|
| 145 |
+
|
| 146 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 147 |
+
msgid "Layout"
|
| 148 |
+
msgstr "Düzen"
|
| 149 |
+
|
| 150 |
+
#: ../classes/admin.php:1465
|
| 151 |
+
msgid "Layout Builder"
|
| 152 |
+
msgstr "Düzen Oluşturucu"
|
| 153 |
+
|
| 154 |
+
#: ../classes/admin.php:1475
|
| 155 |
+
msgid "Pages"
|
| 156 |
+
msgstr "Sayfalar"
|
| 157 |
+
|
| 158 |
+
#: ../classes/admin.php:1477
|
| 159 |
+
msgid "Form Pages"
|
| 160 |
+
msgstr "Form Sayfaları"
|
| 161 |
+
|
| 162 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 163 |
+
msgid "Conditions"
|
| 164 |
+
msgstr "Durumlar"
|
| 165 |
+
|
| 166 |
+
#: ../classes/admin.php:1487
|
| 167 |
+
msgid "Processors"
|
| 168 |
+
msgstr "İişlemciler"
|
| 169 |
+
|
| 170 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 171 |
+
msgid "Form Processors"
|
| 172 |
+
msgstr "Form İşlemcileri"
|
| 173 |
+
|
| 174 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 175 |
+
#: ../ui/panels/variables.php:83
|
| 176 |
+
msgid "Variables"
|
| 177 |
+
msgstr "Değişkenler"
|
| 178 |
+
|
| 179 |
+
#: ../classes/admin.php:1502
|
| 180 |
+
msgid "Responsive"
|
| 181 |
+
msgstr "Uyumlu"
|
| 182 |
+
|
| 183 |
+
#: ../classes/admin.php:1504
|
| 184 |
+
msgid "Resposive Settings"
|
| 185 |
+
msgstr "Uyumluluk Ayarları"
|
| 186 |
+
|
| 187 |
+
#: ../classes/admin.php:1508
|
| 188 |
+
msgid "Grid Collapse"
|
| 189 |
+
msgstr "Izgarayı Daralt"
|
| 190 |
+
|
| 191 |
+
#: ../classes/admin.php:1510
|
| 192 |
+
msgid ""
|
| 193 |
+
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 194 |
+
"Bootstrap 3.0)"
|
| 195 |
+
msgstr ""
|
| 196 |
+
"Izgara daraltmak için en küçük ekran boyutunu ayarlayın. (Bootstrap 3.0 "
|
| 197 |
+
"tabanlı)"
|
| 198 |
+
|
| 199 |
+
#: ../classes/admin.php:1517
|
| 200 |
+
msgid "Maintain grid always"
|
| 201 |
+
msgstr "Her zaman ızgarayı koru"
|
| 202 |
+
|
| 203 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 204 |
+
msgid "Mailer"
|
| 205 |
+
msgstr "Posta Göndericileri"
|
| 206 |
+
|
| 207 |
+
#: ../classes/admin.php:1539
|
| 208 |
+
msgid "Email Notification Settings"
|
| 209 |
+
msgstr "E-posta Bildirimi Ayarları"
|
| 210 |
+
|
| 211 |
+
#: ../classes/core.php:396
|
| 212 |
+
msgid "The wasn't entered correct."
|
| 213 |
+
msgstr "Doğru girilmedi."
|
| 214 |
+
|
| 215 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 216 |
+
msgid "Reset"
|
| 217 |
+
msgstr "Sıfırla"
|
| 218 |
+
|
| 219 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 220 |
+
msgid "Permission denied."
|
| 221 |
+
msgstr "Erişim Engellendi."
|
| 222 |
+
|
| 223 |
+
#: ../classes/core.php:787
|
| 224 |
+
msgid "Auto Responder"
|
| 225 |
+
msgstr "Otomatik Yanıtlayıcı"
|
| 226 |
+
|
| 227 |
+
#: ../classes/core.php:788
|
| 228 |
+
msgid "Sends out an auto response e-mail"
|
| 229 |
+
msgstr "Otomatik yanıt e-postası gönderir"
|
| 230 |
+
|
| 231 |
+
#: ../classes/core.php:792
|
| 232 |
+
msgid "Thank you for contacting us"
|
| 233 |
+
msgstr "Bizimle iletişime geçtiğiniz için teşekkür ederiz"
|
| 234 |
+
|
| 235 |
+
#: ../classes/core.php:796
|
| 236 |
+
msgid "Redirect"
|
| 237 |
+
msgstr "Yönlendirme"
|
| 238 |
+
|
| 239 |
+
#: ../classes/core.php:797
|
| 240 |
+
msgid "Redirects user to URL on successful submit"
|
| 241 |
+
msgstr "Başarılı gönderilerde kullanıcıları URL'ye yönlendirir"
|
| 242 |
+
|
| 243 |
+
#: ../classes/core.php:802
|
| 244 |
+
msgid "Increment Value"
|
| 245 |
+
msgstr "Artım Değeri"
|
| 246 |
+
|
| 247 |
+
#: ../classes/core.php:803
|
| 248 |
+
msgid "Increment a value per entry."
|
| 249 |
+
msgstr "Giriş başına değeri artırmak."
|
| 250 |
+
|
| 251 |
+
#: ../classes/core.php:817
|
| 252 |
+
msgid "Akismet"
|
| 253 |
+
msgstr "Akismet"
|
| 254 |
+
|
| 255 |
+
#: ../classes/core.php:818
|
| 256 |
+
msgid "Anti-spam filtering"
|
| 257 |
+
msgstr "Anti-spam filtreleme"
|
| 258 |
+
|
| 259 |
+
#: ../classes/core.php:866
|
| 260 |
+
msgid "Akismet not setup."
|
| 261 |
+
msgstr "Akismet kurulu değil."
|
| 262 |
+
|
| 263 |
+
#: ../classes/core.php:1017
|
| 264 |
+
msgid "Calculation"
|
| 265 |
+
msgstr "Hesaplama"
|
| 266 |
+
|
| 267 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 268 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 269 |
+
msgid "Special"
|
| 270 |
+
msgstr "Özel"
|
| 271 |
+
|
| 272 |
+
#: ../classes/core.php:1020
|
| 273 |
+
msgid "Math"
|
| 274 |
+
msgstr "Matematik"
|
| 275 |
+
|
| 276 |
+
#: ../classes/core.php:1021
|
| 277 |
+
msgid "Calculate values"
|
| 278 |
+
msgstr "Değerleri hesapla"
|
| 279 |
+
|
| 280 |
+
#: ../classes/core.php:1028
|
| 281 |
+
msgid "Total"
|
| 282 |
+
msgstr "Toplam"
|
| 283 |
+
|
| 284 |
+
#: ../classes/core.php:1040
|
| 285 |
+
msgid "Range Slider"
|
| 286 |
+
msgstr "Aralık Sürgüsü"
|
| 287 |
+
|
| 288 |
+
#: ../classes/core.php:1043
|
| 289 |
+
msgid "Range Slider input field"
|
| 290 |
+
msgstr "Aralık Sürgüsü giriş alanı"
|
| 291 |
+
|
| 292 |
+
#: ../classes/core.php:1077
|
| 293 |
+
msgid "Star Rating"
|
| 294 |
+
msgstr "Yıldız Dereceleme"
|
| 295 |
+
|
| 296 |
+
#: ../classes/core.php:1079
|
| 297 |
+
msgid "Feedback"
|
| 298 |
+
msgstr "Geri bildirim"
|
| 299 |
+
|
| 300 |
+
#: ../classes/core.php:1080
|
| 301 |
+
msgid "Star rating input for feedback"
|
| 302 |
+
msgstr "Geri bildirim için yıldız derecelemesi"
|
| 303 |
+
|
| 304 |
+
#: ../classes/core.php:1112
|
| 305 |
+
msgid "Phone Number"
|
| 306 |
+
msgstr "Telefon Numarası"
|
| 307 |
+
|
| 308 |
+
#: ../classes/core.php:1113
|
| 309 |
+
msgid "Phone number with masking"
|
| 310 |
+
msgstr "Maskeleme ile telefon numarası"
|
| 311 |
+
|
| 312 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 313 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 314 |
+
#: ../classes/core.php:1376
|
| 315 |
+
msgid "Text Fields"
|
| 316 |
+
msgstr "Metin Alanları"
|
| 317 |
+
|
| 318 |
+
#: ../classes/core.php:1115
|
| 319 |
+
msgid "User"
|
| 320 |
+
msgstr "Kullanıcı"
|
| 321 |
+
|
| 322 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 323 |
+
msgid "Single Line Text"
|
| 324 |
+
msgstr "Tek Satırlık Yazı"
|
| 325 |
+
|
| 326 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 327 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 328 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 329 |
+
#: ../ui/edit.php:215
|
| 330 |
+
msgid "Basic"
|
| 331 |
+
msgstr "Basit"
|
| 332 |
+
|
| 333 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 334 |
+
msgid "File"
|
| 335 |
+
msgstr "Dosya"
|
| 336 |
+
|
| 337 |
+
#: ../classes/core.php:1149
|
| 338 |
+
msgid "File Uploader"
|
| 339 |
+
msgstr "Dosya Yükleyici"
|
| 340 |
+
|
| 341 |
+
#: ../classes/core.php:1159
|
| 342 |
+
msgid "reCAPTCHA"
|
| 343 |
+
msgstr "reCAPTCHA"
|
| 344 |
+
|
| 345 |
+
#: ../classes/core.php:1160
|
| 346 |
+
msgid "reCAPTCHA anti-spam field"
|
| 347 |
+
msgstr "reCAPTCHA anti-spam alan"
|
| 348 |
+
|
| 349 |
+
#: ../classes/core.php:1185
|
| 350 |
+
msgid "HTML"
|
| 351 |
+
msgstr "HTML"
|
| 352 |
+
|
| 353 |
+
#: ../classes/core.php:1186
|
| 354 |
+
msgid "Add text/html content"
|
| 355 |
+
msgstr "Metin/html içeriği ekleyin"
|
| 356 |
+
|
| 357 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 358 |
+
#: ../processors/akismet/config.php:20
|
| 359 |
+
msgid "Content"
|
| 360 |
+
msgstr "Içerik"
|
| 361 |
+
|
| 362 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 363 |
+
msgid "Hidden"
|
| 364 |
+
msgstr "Gizli"
|
| 365 |
+
|
| 366 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 367 |
+
msgid "Button"
|
| 368 |
+
msgstr "Buton"
|
| 369 |
+
|
| 370 |
+
#: ../classes/core.php:1220
|
| 371 |
+
msgid "Button, Submit and Reset types"
|
| 372 |
+
msgstr "Buton, Gönder ve Sıfırlama türleri"
|
| 373 |
+
|
| 374 |
+
#: ../classes/core.php:1222
|
| 375 |
+
msgid "Buttons"
|
| 376 |
+
msgstr "Butonlar"
|
| 377 |
+
|
| 378 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 379 |
+
msgid "Email Address"
|
| 380 |
+
msgstr "E-posta Adresi"
|
| 381 |
+
|
| 382 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 383 |
+
msgid "Paragraph Textarea"
|
| 384 |
+
msgstr "Metin Alanı"
|
| 385 |
+
|
| 386 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 387 |
+
msgid "Toggle Switch"
|
| 388 |
+
msgstr "Anahtar"
|
| 389 |
+
|
| 390 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 391 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 392 |
+
msgid "Select Options"
|
| 393 |
+
msgstr "Seçme Ayarları"
|
| 394 |
+
|
| 395 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 396 |
+
msgid "Dropdown Select"
|
| 397 |
+
msgstr "Açılır liste"
|
| 398 |
+
|
| 399 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 400 |
+
msgid "Checkbox"
|
| 401 |
+
msgstr "Onay kutusu"
|
| 402 |
+
|
| 403 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 404 |
+
msgid "Radio"
|
| 405 |
+
msgstr "Radyo"
|
| 406 |
+
|
| 407 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 408 |
+
msgid "Date Picker"
|
| 409 |
+
msgstr "Tarih Seçici"
|
| 410 |
+
|
| 411 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 412 |
+
msgid "Pickers"
|
| 413 |
+
msgstr "Seçiciler"
|
| 414 |
+
|
| 415 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 416 |
+
msgid "Color Picker"
|
| 417 |
+
msgstr "Renk Seçici"
|
| 418 |
+
|
| 419 |
+
#: ../classes/core.php:1402
|
| 420 |
+
msgid "State/ Province Select"
|
| 421 |
+
msgstr "Eyalet / İl Seçiniz"
|
| 422 |
+
|
| 423 |
+
#: ../classes/core.php:1403
|
| 424 |
+
msgid "Dropdown select for US states and Canadian provinces."
|
| 425 |
+
msgstr "ABD ve Canada için açılır liste seçici"
|
| 426 |
+
|
| 427 |
+
#: ../classes/core.php:1417
|
| 428 |
+
msgid "Autocomplete"
|
| 429 |
+
msgstr "Otomatik Tamamlama"
|
| 430 |
+
|
| 431 |
+
#: ../classes/core.php:1419
|
| 432 |
+
msgid "Pickers,Select Options"
|
| 433 |
+
msgstr "Seçiciler, Seçenekleri Seçin"
|
| 434 |
+
|
| 435 |
+
#: ../classes/core.php:1838
|
| 436 |
+
msgid "System Tags"
|
| 437 |
+
msgstr "Sistem Etiketler"
|
| 438 |
+
|
| 439 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 440 |
+
msgid "Mailer Debug"
|
| 441 |
+
msgstr "Hata ayıklama"
|
| 442 |
+
|
| 443 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 444 |
+
msgid "Invalid form ID"
|
| 445 |
+
msgstr "Geçersiz formu kimliği"
|
| 446 |
+
|
| 447 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 448 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 449 |
+
#: ../classes/core.php:4111
|
| 450 |
+
msgid "Permission denied or entry does not exist."
|
| 451 |
+
msgstr "İzin verilmedi veya giriş yok."
|
| 452 |
+
|
| 453 |
+
#: ../classes/core.php:3053
|
| 454 |
+
msgid "is required"
|
| 455 |
+
msgstr "gereklidir"
|
| 456 |
+
|
| 457 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 458 |
+
msgid "Form is currently not active."
|
| 459 |
+
msgstr "Form şu anda etkin değil."
|
| 460 |
+
|
| 461 |
+
#: ../classes/core.php:4393
|
| 462 |
+
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 463 |
+
msgstr ""
|
| 464 |
+
"UYARI: Form hata ayıklama modunda. Yayınlamadan önce devre dışı bırakın."
|
| 465 |
+
|
| 466 |
+
#: ../classes/widget.php:43
|
| 467 |
+
msgid "Title"
|
| 468 |
+
msgstr "Başlık"
|
| 469 |
+
|
| 470 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 471 |
+
msgid "Form"
|
| 472 |
+
msgstr "Form"
|
| 473 |
+
|
| 474 |
+
#: ../fields/button/config_template.php:2
|
| 475 |
+
msgid "Type"
|
| 476 |
+
msgstr "Tür"
|
| 477 |
+
|
| 478 |
+
#: ../fields/button/config_template.php:5
|
| 479 |
+
msgid "Submit"
|
| 480 |
+
msgstr "Gönder"
|
| 481 |
+
|
| 482 |
+
#: ../fields/button/config_template.php:7
|
| 483 |
+
msgid "Next Page"
|
| 484 |
+
msgstr "Sonraki Sayfa"
|
| 485 |
+
|
| 486 |
+
#: ../fields/button/config_template.php:8
|
| 487 |
+
msgid "Previous Page"
|
| 488 |
+
msgstr "Önceki Sayfa"
|
| 489 |
+
|
| 490 |
+
#: ../fields/button/config_template.php:14
|
| 491 |
+
msgid "Class"
|
| 492 |
+
msgstr "Sınıf"
|
| 493 |
+
|
| 494 |
+
#: ../fields/calculation/config.php:2
|
| 495 |
+
msgid "Element"
|
| 496 |
+
msgstr "Öge"
|
| 497 |
+
|
| 498 |
+
#: ../fields/calculation/config.php:8
|
| 499 |
+
msgid "Classes"
|
| 500 |
+
msgstr "Sınıflar"
|
| 501 |
+
|
| 502 |
+
#: ../fields/calculation/config.php:14
|
| 503 |
+
msgid "Before"
|
| 504 |
+
msgstr "Önce"
|
| 505 |
+
|
| 506 |
+
#: ../fields/calculation/config.php:20
|
| 507 |
+
msgid "After"
|
| 508 |
+
msgstr "Sonra"
|
| 509 |
+
|
| 510 |
+
#: ../fields/calculation/config.php:27
|
| 511 |
+
msgid "Money Format"
|
| 512 |
+
msgstr "Para Biçimi"
|
| 513 |
+
|
| 514 |
+
#: ../fields/calculation/config.php:32
|
| 515 |
+
msgid "Separator"
|
| 516 |
+
msgstr "Ayraç"
|
| 517 |
+
|
| 518 |
+
#: ../fields/calculation/config.php:35
|
| 519 |
+
msgid "Setup a custom thousand separator. e.g 10,000.00 or 10.000.00"
|
| 520 |
+
msgstr "Özel bir ayırıcı ayarla. Örneğin 10,000.00 veya 10.000.00"
|
| 521 |
+
|
| 522 |
+
#: ../fields/calculation/config.php:41
|
| 523 |
+
msgid "Manual Formula"
|
| 524 |
+
msgstr "Manuel Formül"
|
| 525 |
+
|
| 526 |
+
#: ../fields/calculation/config.php:54
|
| 527 |
+
msgid "Add Operator Group"
|
| 528 |
+
msgstr "Operatör Grubu Ekle"
|
| 529 |
+
|
| 530 |
+
#: ../fields/calculation/config.php:63
|
| 531 |
+
msgid "Use %field_slug% as field value variables"
|
| 532 |
+
msgstr "Alan değeri değişkenleri olarak % field_slug% kullanın"
|
| 533 |
+
|
| 534 |
+
#: ../fields/checkbox/config_template.php:3
|
| 535 |
+
#: ../fields/radio/config_template.php:4
|
| 536 |
+
msgid "Inline"
|
| 537 |
+
msgstr "Satıriçi"
|
| 538 |
+
|
| 539 |
+
#: ../fields/color_picker/setup.php:2 ../fields/date_picker/setup.php:2
|
| 540 |
+
#: ../fields/email/config.php:8 ../fields/paragraph/config_template.php:14
|
| 541 |
+
#: ../fields/phone/config.php:8 ../fields/range_slider/config.php:10
|
| 542 |
+
#: ../fields/text/config.php:8
|
| 543 |
+
msgid "Default"
|
| 544 |
+
msgstr "Varsayılan"
|
| 545 |
+
|
| 546 |
+
#: ../fields/color_picker/setup.php:2
|
| 547 |
+
msgid "Color"
|
| 548 |
+
msgstr "Renk"
|
| 549 |
+
|
| 550 |
+
#: ../fields/date_picker/setup.php:8
|
| 551 |
+
msgid "Format"
|
| 552 |
+
msgstr "Biçim"
|
| 553 |
+
|
| 554 |
+
#: ../fields/date_picker/setup.php:14
|
| 555 |
+
msgid "Autoclose"
|
| 556 |
+
msgstr "Otomatik Kapatma"
|
| 557 |
+
|
| 558 |
+
#: ../fields/date_picker/setup.php:16
|
| 559 |
+
msgid "Enable autoclose"
|
| 560 |
+
msgstr "Otomatik Kapatmayı Etkinleştir"
|
| 561 |
+
|
| 562 |
+
#: ../fields/date_picker/setup.php:17
|
| 563 |
+
msgid ""
|
| 564 |
+
"If enabled, the date picker will automatically close after selecting the "
|
| 565 |
+
"final input"
|
| 566 |
+
msgstr "Etkinse, tarih seçici otomatik son girişi seçtikten sonra kapanacak"
|
| 567 |
+
|
| 568 |
+
#: ../fields/date_picker/setup.php:21
|
| 569 |
+
msgid "Start View"
|
| 570 |
+
msgstr "Başlangıç Görünümü"
|
| 571 |
+
|
| 572 |
+
#: ../fields/date_picker/setup.php:24
|
| 573 |
+
msgid "Month (Default)"
|
| 574 |
+
msgstr "Ay (Varsayılan)"
|
| 575 |
+
|
| 576 |
+
#: ../fields/date_picker/setup.php:25
|
| 577 |
+
msgid "Year"
|
| 578 |
+
msgstr "Yıl"
|
| 579 |
+
|
| 580 |
+
#: ../fields/date_picker/setup.php:26
|
| 581 |
+
msgid "Decade"
|
| 582 |
+
msgstr "Onyıl"
|
| 583 |
+
|
| 584 |
+
#: ../fields/date_picker/setup.php:28
|
| 585 |
+
msgid "The starting view of the date picker (month, year, decade)"
|
| 586 |
+
msgstr "Tarih seçicinin başlangıç görünümü (ay, yıl, onyıl)"
|
| 587 |
+
|
| 588 |
+
#: ../fields/date_picker/setup.php:32
|
| 589 |
+
msgid "Start Date"
|
| 590 |
+
msgstr ""
|
| 591 |
+
|
| 592 |
+
#: ../fields/date_picker/setup.php:35
|
| 593 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 594 |
+
msgstr ""
|
| 595 |
+
|
| 596 |
+
#: ../fields/date_picker/setup.php:39
|
| 597 |
+
msgid "End Date"
|
| 598 |
+
msgstr ""
|
| 599 |
+
|
| 600 |
+
#: ../fields/date_picker/setup.php:42
|
| 601 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 602 |
+
msgstr ""
|
| 603 |
+
|
| 604 |
+
#: ../fields/date_picker/setup.php:46
|
| 605 |
+
msgid "language"
|
| 606 |
+
msgstr "dil"
|
| 607 |
+
|
| 608 |
+
#: ../fields/date_picker/setup.php:114
|
| 609 |
+
msgid "Language to use. e.g. pt-BR"
|
| 610 |
+
msgstr "Kullanılacak dil. Örneğin pt-BR"
|
| 611 |
+
|
| 612 |
+
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 613 |
+
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 614 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 615 |
+
msgid "Placeholder"
|
| 616 |
+
msgstr "Yer Tutucu"
|
| 617 |
+
|
| 618 |
+
#: ../fields/file/config_template.php:2
|
| 619 |
+
msgid "Attach to mailer"
|
| 620 |
+
msgstr "E-posta göndericiye ekle"
|
| 621 |
+
|
| 622 |
+
#: ../fields/file/config_template.php:9
|
| 623 |
+
msgid "Allow Multiple"
|
| 624 |
+
msgstr "Çokluya izin ver"
|
| 625 |
+
|
| 626 |
+
#: ../fields/file/config_template.php:16
|
| 627 |
+
msgid "Allowed Types"
|
| 628 |
+
msgstr "İzin Verilen Türler"
|
| 629 |
+
|
| 630 |
+
#: ../fields/file/config_template.php:19
|
| 631 |
+
msgid "Comma separated eg. jpg,pdf,txt"
|
| 632 |
+
msgstr "Virgülle ayrılmış örn. jpg, pdf, txt"
|
| 633 |
+
|
| 634 |
+
#: ../fields/gravatar/config.php:2
|
| 635 |
+
msgid "Email Field"
|
| 636 |
+
msgstr "E-posta Alanı"
|
| 637 |
+
|
| 638 |
+
#: ../fields/gravatar/config.php:10
|
| 639 |
+
msgid "Mystery Man"
|
| 640 |
+
msgstr "Gizemli Adam"
|
| 641 |
+
|
| 642 |
+
#: ../fields/gravatar/config.php:11
|
| 643 |
+
msgid "Blank"
|
| 644 |
+
msgstr "Boş"
|
| 645 |
+
|
| 646 |
+
#: ../fields/gravatar/config.php:12
|
| 647 |
+
msgid "Gravatar Logo"
|
| 648 |
+
msgstr "Gravatar Logosu"
|
| 649 |
+
|
| 650 |
+
#: ../fields/gravatar/config.php:13
|
| 651 |
+
msgid "Identicon (Generated)"
|
| 652 |
+
msgstr "Identicon (Oluşturulmuş)"
|
| 653 |
+
|
| 654 |
+
#: ../fields/gravatar/config.php:14
|
| 655 |
+
msgid "Wavatar (Generated)"
|
| 656 |
+
msgstr "Wavatar (Oluşturulmuş)"
|
| 657 |
+
|
| 658 |
+
#: ../fields/gravatar/config.php:15
|
| 659 |
+
msgid "MonsterID (Generated)"
|
| 660 |
+
msgstr "MonsterID (Oluşturulmuş)"
|
| 661 |
+
|
| 662 |
+
#: ../fields/gravatar/config.php:16
|
| 663 |
+
msgid "Retro (Generated)"
|
| 664 |
+
msgstr "Retro (Oluşturulmuş)"
|
| 665 |
+
|
| 666 |
+
#: ../fields/gravatar/config.php:21
|
| 667 |
+
msgid "Fallback"
|
| 668 |
+
msgstr "Geri Çekil"
|
| 669 |
+
|
| 670 |
+
#: ../fields/gravatar/config.php:35
|
| 671 |
+
msgid "Size"
|
| 672 |
+
msgstr "Boyut"
|
| 673 |
+
|
| 674 |
+
#: ../fields/gravatar/config.php:42
|
| 675 |
+
msgid "Border Color"
|
| 676 |
+
msgstr "Kenar Çizgisi Rengi"
|
| 677 |
+
|
| 678 |
+
#: ../fields/gravatar/config.php:49
|
| 679 |
+
msgid "Border Size"
|
| 680 |
+
msgstr "Kenar Çizgisi Boyutu"
|
| 681 |
+
|
| 682 |
+
#: ../fields/gravatar/config.php:56
|
| 683 |
+
msgid "Border Radius"
|
| 684 |
+
msgstr "Kenar Yuvarlaklığı"
|
| 685 |
+
|
| 686 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 687 |
+
#: ../ui/panels/variables.php:12
|
| 688 |
+
msgid "Value"
|
| 689 |
+
msgstr "Değer"
|
| 690 |
+
|
| 691 |
+
#: ../fields/paragraph/config_template.php:8
|
| 692 |
+
msgid "Rows"
|
| 693 |
+
msgstr "Satırlar"
|
| 694 |
+
|
| 695 |
+
#: ../fields/phone/config.php:14
|
| 696 |
+
msgid "Style"
|
| 697 |
+
msgstr "Biçim"
|
| 698 |
+
|
| 699 |
+
#: ../fields/phone/config.php:16
|
| 700 |
+
msgid "Local"
|
| 701 |
+
msgstr "Yerel"
|
| 702 |
+
|
| 703 |
+
#: ../fields/phone/config.php:18
|
| 704 |
+
msgid "International"
|
| 705 |
+
msgstr "Uluslararası"
|
| 706 |
+
|
| 707 |
+
#: ../fields/phone/config.php:20
|
| 708 |
+
msgid "Custom"
|
| 709 |
+
msgstr "Özel"
|
| 710 |
+
|
| 711 |
+
#: ../fields/phone/config.php:22
|
| 712 |
+
msgid "Use the digit 9 to indicate a number"
|
| 713 |
+
msgstr "Numara olduğunu belirtmek için 9 rakamını kullanınız"
|
| 714 |
+
|
| 715 |
+
#: ../fields/range_slider/config.php:17
|
| 716 |
+
msgid "Track"
|
| 717 |
+
msgstr "Takip"
|
| 718 |
+
|
| 719 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 720 |
+
msgid "Highlight"
|
| 721 |
+
msgstr "Vurgula"
|
| 722 |
+
|
| 723 |
+
#: ../fields/range_slider/config.php:29
|
| 724 |
+
msgid "Handle"
|
| 725 |
+
msgstr "Yönet"
|
| 726 |
+
|
| 727 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 728 |
+
msgid "Border"
|
| 729 |
+
msgstr "Kenar Çizgisi"
|
| 730 |
+
|
| 731 |
+
#: ../fields/range_slider/config.php:42
|
| 732 |
+
msgid "Steps"
|
| 733 |
+
msgstr "Adımlar"
|
| 734 |
+
|
| 735 |
+
#: ../fields/range_slider/config.php:48
|
| 736 |
+
msgid "Minimum"
|
| 737 |
+
msgstr "En az"
|
| 738 |
+
|
| 739 |
+
#: ../fields/range_slider/config.php:54
|
| 740 |
+
msgid "Maximum"
|
| 741 |
+
msgstr "En çok"
|
| 742 |
+
|
| 743 |
+
#: ../fields/range_slider/config.php:60
|
| 744 |
+
msgid "Show Value"
|
| 745 |
+
msgstr "Değer Göster"
|
| 746 |
+
|
| 747 |
+
#: ../fields/range_slider/config.php:66
|
| 748 |
+
msgid "Prefix"
|
| 749 |
+
msgstr "Öneki"
|
| 750 |
+
|
| 751 |
+
#: ../fields/range_slider/config.php:72
|
| 752 |
+
msgid "Suffix"
|
| 753 |
+
msgstr "Soneki"
|
| 754 |
+
|
| 755 |
+
#: ../fields/recaptcha/config.php:1
|
| 756 |
+
msgid "reCaptcha required keys from Google."
|
| 757 |
+
msgstr "reCaptcha'nın Google'dan anahtara ihtiyacı var."
|
| 758 |
+
|
| 759 |
+
#: ../fields/recaptcha/config.php:3
|
| 760 |
+
msgid "Site Key"
|
| 761 |
+
msgstr "Site Anahtarı"
|
| 762 |
+
|
| 763 |
+
#: ../fields/recaptcha/config.php:9
|
| 764 |
+
msgid "Secret Key"
|
| 765 |
+
msgstr "Gizli Anahtar"
|
| 766 |
+
|
| 767 |
+
#: ../fields/recaptcha/config.php:15
|
| 768 |
+
msgid "Theme"
|
| 769 |
+
msgstr "Tema"
|
| 770 |
+
|
| 771 |
+
#: ../fields/recaptcha/config.php:18
|
| 772 |
+
msgid "Light"
|
| 773 |
+
msgstr "Açık renkli"
|
| 774 |
+
|
| 775 |
+
#: ../fields/recaptcha/config.php:19
|
| 776 |
+
msgid "Dark"
|
| 777 |
+
msgstr "Koyu renkli"
|
| 778 |
+
|
| 779 |
+
#: ../fields/recaptcha/config.php:21
|
| 780 |
+
msgid ""
|
| 781 |
+
"Theme changes not available in preview. Update form and reload to see new "
|
| 782 |
+
"theme."
|
| 783 |
+
msgstr ""
|
| 784 |
+
"Temada yapılan değişiklikler önizlemede gösterilmez. Formu kaydedip, sayfayı "
|
| 785 |
+
"yenileyerek değişiklikleri görebilirsiniz."
|
| 786 |
+
|
| 787 |
+
#: ../fields/recaptcha/preview.php:20
|
| 788 |
+
msgid "No Secret Key Added"
|
| 789 |
+
msgstr "Gizli Anahtar Eklenmedi"
|
| 790 |
+
|
| 791 |
+
#: ../fields/recaptcha/preview.php:23
|
| 792 |
+
msgid "No Site Key Added"
|
| 793 |
+
msgstr "Site Anahtarı Eklenmedi"
|
| 794 |
+
|
| 795 |
+
#: ../fields/select2/field/config.php:11
|
| 796 |
+
msgid "Multiple"
|
| 797 |
+
msgstr "Çoklu"
|
| 798 |
+
|
| 799 |
+
#: ../fields/select2/field/config.php:15
|
| 800 |
+
msgid "Enable multiple selections"
|
| 801 |
+
msgstr "Çoklu seçimlere izin ver"
|
| 802 |
+
|
| 803 |
+
#: ../fields/star-rate/config.php:2
|
| 804 |
+
msgid "Number of Stars"
|
| 805 |
+
msgstr "Yıldız sayısı"
|
| 806 |
+
|
| 807 |
+
#: ../fields/star-rate/config.php:8
|
| 808 |
+
msgid "Star Type"
|
| 809 |
+
msgstr "Yıldız Tipi"
|
| 810 |
+
|
| 811 |
+
#: ../fields/star-rate/config.php:11
|
| 812 |
+
msgid "Star"
|
| 813 |
+
msgstr "Yıldız"
|
| 814 |
+
|
| 815 |
+
#: ../fields/star-rate/config.php:12
|
| 816 |
+
msgid "Heart"
|
| 817 |
+
msgstr "Kalp"
|
| 818 |
+
|
| 819 |
+
#: ../fields/star-rate/config.php:13
|
| 820 |
+
msgid "Face"
|
| 821 |
+
msgstr "Yüz"
|
| 822 |
+
|
| 823 |
+
#: ../fields/star-rate/config.php:14
|
| 824 |
+
msgid "Dot"
|
| 825 |
+
msgstr "Nokta"
|
| 826 |
+
|
| 827 |
+
#: ../fields/star-rate/config.php:19
|
| 828 |
+
msgid "Star Size"
|
| 829 |
+
msgstr "Yıldız Boyutu"
|
| 830 |
+
|
| 831 |
+
#: ../fields/star-rate/config.php:25
|
| 832 |
+
msgid "Star Spacing"
|
| 833 |
+
msgstr "Yıldız Aralığı"
|
| 834 |
+
|
| 835 |
+
#: ../fields/star-rate/config.php:31
|
| 836 |
+
msgid "Single Select"
|
| 837 |
+
msgstr "Tek Seç"
|
| 838 |
+
|
| 839 |
+
#: ../fields/star-rate/config.php:38
|
| 840 |
+
msgid "Star Color"
|
| 841 |
+
msgstr "Yıldız Rengi"
|
| 842 |
+
|
| 843 |
+
#: ../fields/star-rate/config.php:44
|
| 844 |
+
msgid "Track Color"
|
| 845 |
+
msgstr "Parça Rengi"
|
| 846 |
+
|
| 847 |
+
#: ../fields/star-rate/config.php:50
|
| 848 |
+
msgid "Include Cancel"
|
| 849 |
+
msgstr "İptal İçer"
|
| 850 |
+
|
| 851 |
+
#: ../fields/text/config.php:15
|
| 852 |
+
msgid "Masked Input"
|
| 853 |
+
msgstr "Maskeli Girdi"
|
| 854 |
+
|
| 855 |
+
#: ../fields/text/config.php:17
|
| 856 |
+
msgid "Enable input mask"
|
| 857 |
+
msgstr "Girdi maskesi etkinleştir"
|
| 858 |
+
|
| 859 |
+
#: ../fields/text/config.php:22
|
| 860 |
+
msgid "Mask"
|
| 861 |
+
msgstr "Maske"
|
| 862 |
+
|
| 863 |
+
#: ../fields/text/config.php:30
|
| 864 |
+
msgid "numeric"
|
| 865 |
+
msgstr "sayısal"
|
| 866 |
+
|
| 867 |
+
#: ../fields/text/config.php:31
|
| 868 |
+
msgid "alphabetical"
|
| 869 |
+
msgstr "alfabetik"
|
| 870 |
+
|
| 871 |
+
#: ../fields/text/config.php:32
|
| 872 |
+
msgid "alphanumeric"
|
| 873 |
+
msgstr "alfanümerik"
|
| 874 |
+
|
| 875 |
+
#: ../fields/text/config.php:33
|
| 876 |
+
msgid "optional"
|
| 877 |
+
msgstr "isteğe bağlı"
|
| 878 |
+
|
| 879 |
+
#: ../fields/text/config.php:34
|
| 880 |
+
msgid "length"
|
| 881 |
+
msgstr "uzunluk"
|
| 882 |
+
|
| 883 |
+
#: ../fields/text/config.php:36
|
| 884 |
+
msgid "Any length character only"
|
| 885 |
+
msgstr "Herhangi bir uzunlukta ve sadece karakterler"
|
| 886 |
+
|
| 887 |
+
#: ../fields/text/config.php:37
|
| 888 |
+
msgid "Any length number only"
|
| 889 |
+
msgstr "Herhangi bir uzunlukta ve sadece sayılar"
|
| 890 |
+
|
| 891 |
+
#: ../fields/text/config.php:38
|
| 892 |
+
msgid "email"
|
| 893 |
+
msgstr "e-posta"
|
| 894 |
+
|
| 895 |
+
#: ../fields/toggle_switch/config_template.php:2
|
| 896 |
+
msgid "Orientation"
|
| 897 |
+
msgstr "Oryantasyon"
|
| 898 |
+
|
| 899 |
+
#: ../fields/toggle_switch/config_template.php:5
|
| 900 |
+
msgid "Horizontal"
|
| 901 |
+
msgstr "Yatay"
|
| 902 |
+
|
| 903 |
+
#: ../fields/toggle_switch/config_template.php:6
|
| 904 |
+
msgid "Justified"
|
| 905 |
+
msgstr "Ayarlanmış"
|
| 906 |
+
|
| 907 |
+
#: ../fields/toggle_switch/config_template.php:7
|
| 908 |
+
msgid "Vertical"
|
| 909 |
+
msgstr "Dikey"
|
| 910 |
+
|
| 911 |
+
#: ../fields/toggle_switch/config_template.php:13
|
| 912 |
+
msgid "Active Class"
|
| 913 |
+
msgstr "Aktif Sınıf"
|
| 914 |
+
|
| 915 |
+
#: ../fields/toggle_switch/config_template.php:20
|
| 916 |
+
msgid "Inactive Class"
|
| 917 |
+
msgstr "İnaktif Sınıf"
|
| 918 |
+
|
| 919 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 920 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 921 |
+
msgid "Enable"
|
| 922 |
+
msgstr "Etkinleştir"
|
| 923 |
+
|
| 924 |
+
#: ../includes/cf-ajax/plugin.php:38
|
| 925 |
+
msgid "Ajax Submissions"
|
| 926 |
+
msgstr "Ajax Gönderileri"
|
| 927 |
+
|
| 928 |
+
#: ../includes/cf-ajax/plugin.php:40
|
| 929 |
+
msgid "Enable Ajax Submissions. (No page reloads)"
|
| 930 |
+
msgstr "Ajax Gönderilerini Etkinleştirin. (sayfa yenileme yok)"
|
| 931 |
+
|
| 932 |
+
#: ../includes/cf-ajax/plugin.php:46
|
| 933 |
+
msgid "Custom Callback"
|
| 934 |
+
msgstr "Özel Geri Arama"
|
| 935 |
+
|
| 936 |
+
#: ../includes/cf-ajax/plugin.php:48
|
| 937 |
+
msgid "Add a custom Javascript callback handlers on submission."
|
| 938 |
+
msgstr "Sunulmasına ilişkin özel bir Javascript geri arama işleyicisi ekleyin."
|
| 939 |
+
|
| 940 |
+
#: ../includes/cf-ajax/plugin.php:55
|
| 941 |
+
msgid "Inhibit Notices"
|
| 942 |
+
msgstr "Bildirimleri Engelle"
|
| 943 |
+
|
| 944 |
+
#: ../includes/cf-ajax/plugin.php:57
|
| 945 |
+
msgid "Don't show default alerts (success etc.)"
|
| 946 |
+
msgstr "Varsayılan uyarıları gösterme (başarıyla tamamlandı vb.)"
|
| 947 |
+
|
| 948 |
+
#: ../includes/cf-ajax/plugin.php:63
|
| 949 |
+
msgid "Callback Function"
|
| 950 |
+
msgstr "Geri çağırma fonksiyonu"
|
| 951 |
+
|
| 952 |
+
#: ../includes/cf-ajax/plugin.php:66
|
| 953 |
+
msgid ""
|
| 954 |
+
"Javascript function to call on submission. Passed an object containing form "
|
| 955 |
+
"submission result."
|
| 956 |
+
msgstr ""
|
| 957 |
+
"Javascript işlevi teslim çağırmak için. Form gönderme sonucunu içeren bir "
|
| 958 |
+
"nesne geçti."
|
| 959 |
+
|
| 960 |
+
#: ../includes/cf-ajax/plugin.php:91
|
| 961 |
+
msgid "Multiple Ajax Submissions"
|
| 962 |
+
msgstr "Çoklu Ajax Gönderileri"
|
| 963 |
+
|
| 964 |
+
#: ../includes/cf-ajax/plugin.php:93
|
| 965 |
+
msgid "If set, form can be submitted multiple times with out a new page load."
|
| 966 |
+
msgstr ""
|
| 967 |
+
"Ayarlarsanız, form yenilenmeye gerek duyamdan birden çok kez gönderilebilir."
|
| 968 |
+
|
| 969 |
+
#: ../includes/cf-ajax/plugin.php:147 ../includes/cf-ajax/plugin.php:158
|
| 970 |
+
#: ../processors/redirect/config.php:10
|
| 971 |
+
msgid "Redirecting"
|
| 972 |
+
msgstr "Yönlendiriliyor"
|
| 973 |
+
|
| 974 |
+
#: ../includes/custom_field_class.php:21
|
| 975 |
+
msgid "Custom Class"
|
| 976 |
+
msgstr "Özel Sınıf"
|
| 977 |
+
|
| 978 |
+
#: ../includes/field_processors.php:45
|
| 979 |
+
msgid "File type not allowed. Allowed types are: "
|
| 980 |
+
msgstr "Dosya türüne izin verilmiyor. İzin verilen türler şunlardır:"
|
| 981 |
+
|
| 982 |
+
#: ../includes/field_processors.php:47
|
| 983 |
+
msgid "File type needs to be"
|
| 984 |
+
msgstr "Dosya türünün şöyle olması gerekir"
|
| 985 |
+
|
| 986 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 987 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 988 |
+
msgid "Name"
|
| 989 |
+
msgstr "Ad"
|
| 990 |
+
|
| 991 |
+
#: ../processors/akismet/config.php:8
|
| 992 |
+
msgid "Email"
|
| 993 |
+
msgstr "E-posta"
|
| 994 |
+
|
| 995 |
+
#: ../processors/akismet/config.php:14 ../processors/redirect/config.php:2
|
| 996 |
+
msgid "URL"
|
| 997 |
+
msgstr "URL"
|
| 998 |
+
|
| 999 |
+
#: ../processors/akismet/config.php:27
|
| 1000 |
+
msgid "Error Message"
|
| 1001 |
+
msgstr "Hata Mesajı"
|
| 1002 |
+
|
| 1003 |
+
#: ../processors/akismet/config.php:29
|
| 1004 |
+
msgid "Sorry, that looked very spammy, try rephrasing things"
|
| 1005 |
+
msgstr "Üzgünüm, bu çok spam gibi duruyor, yeniden ifadelendirmeyi deneyin"
|
| 1006 |
+
|
| 1007 |
+
#: ../processors/auto_responder/config.php:2 ../ui/panels/emailer.php:42
|
| 1008 |
+
msgid "From Name"
|
| 1009 |
+
msgstr "Kimden (İsim)"
|
| 1010 |
+
|
| 1011 |
+
#: ../processors/auto_responder/config.php:8 ../ui/panels/emailer.php:49
|
| 1012 |
+
msgid "From Email"
|
| 1013 |
+
msgstr "Kimden (E-posta)"
|
| 1014 |
+
|
| 1015 |
+
#: ../processors/auto_responder/config.php:14 ../ui/panels/emailer.php:97
|
| 1016 |
+
msgid "Email Subject"
|
| 1017 |
+
msgstr "E-posta Konusu"
|
| 1018 |
+
|
| 1019 |
+
#: ../processors/auto_responder/config.php:20
|
| 1020 |
+
msgid "Recipient Name"
|
| 1021 |
+
msgstr "Alıcı Adı"
|
| 1022 |
+
|
| 1023 |
+
#: ../processors/auto_responder/config.php:26
|
| 1024 |
+
msgid "Recipient Email"
|
| 1025 |
+
msgstr "Alıcı E-Posta"
|
| 1026 |
+
|
| 1027 |
+
#: ../processors/auto_responder/config.php:32
|
| 1028 |
+
msgid "Message"
|
| 1029 |
+
msgstr "Mesaj"
|
| 1030 |
+
|
| 1031 |
+
#: ../processors/classes/get_data.php:76
|
| 1032 |
+
#, php-format
|
| 1033 |
+
msgid "%s is required"
|
| 1034 |
+
msgstr ""
|
| 1035 |
+
|
| 1036 |
+
#: ../processors/increment/config.php:2
|
| 1037 |
+
msgid "Increment Start"
|
| 1038 |
+
msgstr "Artım Başlangıcı"
|
| 1039 |
+
|
| 1040 |
+
#: ../processors/increment/config.php:6
|
| 1041 |
+
msgid "Number to start incrementing."
|
| 1042 |
+
msgstr "Artırmaya başlatma sayısı."
|
| 1043 |
+
|
| 1044 |
+
#: ../processors/increment/config.php:8
|
| 1045 |
+
msgid ""
|
| 1046 |
+
"Incremenets started at {{start}}. to reset, delete this and insert a new "
|
| 1047 |
+
"increment processor."
|
| 1048 |
+
msgstr ""
|
| 1049 |
+
"Artım {{start}} sıfırlamaya başladı. Bunu silerek yeni bir artım işlemcisi "
|
| 1050 |
+
"ekleyin."
|
| 1051 |
+
|
| 1052 |
+
#: ../processors/increment/config.php:14
|
| 1053 |
+
msgid "Increment Field"
|
| 1054 |
+
msgstr "Artım Alan"
|
| 1055 |
+
|
| 1056 |
+
#: ../processors/increment/config.php:17
|
| 1057 |
+
msgid ""
|
| 1058 |
+
"If you want to show the value in the entries, Select a Hidden field in form "
|
| 1059 |
+
"to capture the value to."
|
| 1060 |
+
msgstr ""
|
| 1061 |
+
"Eğer girdilerinde değerini göstermek istiyorsanız, değeri yakalamak için "
|
| 1062 |
+
"formda bir gizli alan seçin."
|
| 1063 |
+
|
| 1064 |
+
#: ../processors/redirect/config.php:8
|
| 1065 |
+
msgid "Redirect Message"
|
| 1066 |
+
msgstr "Mesaj yönlendir"
|
| 1067 |
+
|
| 1068 |
+
#: ../processors/redirect/config.php:11
|
| 1069 |
+
msgid "Message text shown when redirecting in Ajax mode."
|
| 1070 |
+
msgstr "Ajax modunda yönlendirme yapılırken gösterilen mesaj metni."
|
| 1071 |
+
|
| 1072 |
+
#: ../ui/admin.php:26
|
| 1073 |
+
msgid "Create Form"
|
| 1074 |
+
msgstr "Form Oluştur"
|
| 1075 |
+
|
| 1076 |
+
#: ../ui/admin.php:38
|
| 1077 |
+
msgid "Create New Form"
|
| 1078 |
+
msgstr "Yeni Form Oluştur"
|
| 1079 |
+
|
| 1080 |
+
#: ../ui/admin.php:38
|
| 1081 |
+
msgid "New Form"
|
| 1082 |
+
msgstr "Yeni Form"
|
| 1083 |
+
|
| 1084 |
+
#: ../ui/admin.php:41 ../ui/admin_templates.php:33
|
| 1085 |
+
msgid "Import Form"
|
| 1086 |
+
msgstr "İçe Form Aktar"
|
| 1087 |
+
|
| 1088 |
+
#: ../ui/admin.php:41
|
| 1089 |
+
msgid "Import"
|
| 1090 |
+
msgstr "İçe Aktar"
|
| 1091 |
+
|
| 1092 |
+
#: ../ui/admin.php:47
|
| 1093 |
+
msgid "Front-end Style Includes"
|
| 1094 |
+
msgstr "Önuçlu Stil İçerir"
|
| 1095 |
+
|
| 1096 |
+
#: ../ui/admin.php:51
|
| 1097 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form alert notices"
|
| 1098 |
+
msgstr "Önuçta form uyarı bildirimleri için Bootstrap 3 stilleri içerir."
|
| 1099 |
+
|
| 1100 |
+
#: ../ui/admin.php:51
|
| 1101 |
+
msgid "Alert"
|
| 1102 |
+
msgstr "Uyarı"
|
| 1103 |
+
|
| 1104 |
+
#: ../ui/admin.php:52
|
| 1105 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form fields and buttons"
|
| 1106 |
+
msgstr "Önuçta form alanları ve butonları için Bootstrap 3 stilleri içerir."
|
| 1107 |
+
|
| 1108 |
+
#: ../ui/admin.php:53
|
| 1109 |
+
msgid "Includes Bootstrap 3 styles on the frontend for form grid layouts"
|
| 1110 |
+
msgstr "Önuçta form düzenleri için Bootstrap 3 stilleri içerir."
|
| 1111 |
+
|
| 1112 |
+
#: ../ui/admin.php:53
|
| 1113 |
+
msgid "Grid"
|
| 1114 |
+
msgstr "Izgara"
|
| 1115 |
+
|
| 1116 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1117 |
+
msgid "Entries"
|
| 1118 |
+
msgstr "Girişler"
|
| 1119 |
+
|
| 1120 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1121 |
+
#: ../ui/panels/emailer.php:35
|
| 1122 |
+
msgid "Disabled"
|
| 1123 |
+
msgstr "Devre Dışı"
|
| 1124 |
+
|
| 1125 |
+
#: ../ui/admin.php:112
|
| 1126 |
+
msgid "Mailer Debug enabled."
|
| 1127 |
+
msgstr "Mailer Debug etkinleştirildi."
|
| 1128 |
+
|
| 1129 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1130 |
+
msgid "Edit"
|
| 1131 |
+
msgstr "Düzenle"
|
| 1132 |
+
|
| 1133 |
+
#: ../ui/admin.php:141
|
| 1134 |
+
msgid "Export"
|
| 1135 |
+
msgstr "Dışa aktar"
|
| 1136 |
+
|
| 1137 |
+
#: ../ui/admin.php:142
|
| 1138 |
+
msgid "Clone Form"
|
| 1139 |
+
msgstr "Formu Klonla"
|
| 1140 |
+
|
| 1141 |
+
#: ../ui/admin.php:142
|
| 1142 |
+
msgid "Clone"
|
| 1143 |
+
msgstr "Klon"
|
| 1144 |
+
|
| 1145 |
+
#: ../ui/admin.php:143
|
| 1146 |
+
msgid "This will delete this form permanently. Continue?"
|
| 1147 |
+
msgstr "Bu yaptığınız formu kalıcı olarak silecektir. Devam?"
|
| 1148 |
+
|
| 1149 |
+
#: ../ui/admin.php:143
|
| 1150 |
+
msgid "Delete"
|
| 1151 |
+
msgstr "Sil"
|
| 1152 |
+
|
| 1153 |
+
#: ../ui/admin.php:163
|
| 1154 |
+
msgid "You don't have any forms."
|
| 1155 |
+
msgstr "Henüz herhangi bir form oluşturmadınız."
|
| 1156 |
+
|
| 1157 |
+
#: ../ui/admin.php:204
|
| 1158 |
+
msgid "An form name is required"
|
| 1159 |
+
msgstr "Form adı gereklidir"
|
| 1160 |
+
|
| 1161 |
+
#: ../ui/admin.php:231
|
| 1162 |
+
msgid ""
|
| 1163 |
+
"Looks like something is not working. Please try again a little later or post "
|
| 1164 |
+
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1165 |
+
"\"_blank\">support forum</a>."
|
| 1166 |
+
msgstr ""
|
| 1167 |
+
"Bir şey çalışmıyor gibi görünüyor. Bir süre sonra tekrar deneyin ya da "
|
| 1168 |
+
"lütfen <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1169 |
+
"\"_blank\">destek foruma</a> mesajınızı gönderin. "
|
| 1170 |
+
|
| 1171 |
+
#: ../ui/admin_templates.php:2 ../ui/admin_templates.php:7
|
| 1172 |
+
msgid "Bulk Actions"
|
| 1173 |
+
msgstr "Toplu İşlemler"
|
| 1174 |
+
|
| 1175 |
+
#: ../ui/admin_templates.php:3 ../ui/admin_templates.php:8
|
| 1176 |
+
msgid "Export Selected"
|
| 1177 |
+
msgstr "Seçilenleri Dışa Aktar"
|
| 1178 |
+
|
| 1179 |
+
#: ../ui/admin_templates.php:4
|
| 1180 |
+
msgid "Move to Trash"
|
| 1181 |
+
msgstr "Çöpe Taşı"
|
| 1182 |
+
|
| 1183 |
+
#: ../ui/admin_templates.php:10
|
| 1184 |
+
msgid "Delete Permanently"
|
| 1185 |
+
msgstr "Kalıcı Olarak Sil"
|
| 1186 |
+
|
| 1187 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
| 1188 |
+
msgid "Form Name"
|
| 1189 |
+
msgstr "Form Adı"
|
| 1190 |
+
|
| 1191 |
+
#: ../ui/admin_templates.php:25
|
| 1192 |
+
msgid "Form File"
|
| 1193 |
+
msgstr "Form Dosyası"
|
| 1194 |
+
|
| 1195 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1196 |
+
msgid "Description"
|
| 1197 |
+
msgstr "Açıklama"
|
| 1198 |
+
|
| 1199 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1200 |
+
msgid "ID"
|
| 1201 |
+
msgstr "ID"
|
| 1202 |
+
|
| 1203 |
+
#: ../ui/admin_templates.php:73 ../ui/admin_templates.php:111
|
| 1204 |
+
msgid "Submitted"
|
| 1205 |
+
msgstr "Gönderildi"
|
| 1206 |
+
|
| 1207 |
+
#: ../ui/admin_templates.php:94
|
| 1208 |
+
msgid "No entries found"
|
| 1209 |
+
msgstr "Kayıt bulunamadı"
|
| 1210 |
+
|
| 1211 |
+
#: ../ui/admin_templates.php:100
|
| 1212 |
+
msgid "No entries yet."
|
| 1213 |
+
msgstr "Henüz hiç kayıt yok."
|
| 1214 |
+
|
| 1215 |
+
#: ../ui/edit.php:13
|
| 1216 |
+
msgid "Form has successfully been submitted. Thank you."
|
| 1217 |
+
msgstr "Form başarıyla gönderildi. Teşekkürler."
|
| 1218 |
+
|
| 1219 |
+
#: ../ui/edit.php:99
|
| 1220 |
+
msgid "Auto Populate"
|
| 1221 |
+
msgstr "Otomatik Doldur"
|
| 1222 |
+
|
| 1223 |
+
#: ../ui/edit.php:105
|
| 1224 |
+
msgid "Auto Type"
|
| 1225 |
+
msgstr "Otomatik Yaz"
|
| 1226 |
+
|
| 1227 |
+
#: ../ui/edit.php:108
|
| 1228 |
+
msgid "Select a source"
|
| 1229 |
+
msgstr "Kaynak seç"
|
| 1230 |
+
|
| 1231 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1232 |
+
msgid "Post Type"
|
| 1233 |
+
msgstr "Yazı Türü"
|
| 1234 |
+
|
| 1235 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1236 |
+
msgid "Taxonomy"
|
| 1237 |
+
msgstr "Taksonomi"
|
| 1238 |
+
|
| 1239 |
+
#: ../ui/edit.php:167
|
| 1240 |
+
msgid "Add Option"
|
| 1241 |
+
msgstr "Seçenek Ekle"
|
| 1242 |
+
|
| 1243 |
+
#: ../ui/edit.php:168
|
| 1244 |
+
msgid "Bulk Insert"
|
| 1245 |
+
msgstr "Toplu Ekle"
|
| 1246 |
+
|
| 1247 |
+
#: ../ui/edit.php:171
|
| 1248 |
+
msgid "Single option per line. These replace the current list."
|
| 1249 |
+
msgstr "Satır başına tek seçenek. Geçerli siteyi değiştir."
|
| 1250 |
+
|
| 1251 |
+
#: ../ui/edit.php:172
|
| 1252 |
+
msgid "Insert Options"
|
| 1253 |
+
msgstr "Seçenek Ekle"
|
| 1254 |
+
|
| 1255 |
+
#: ../ui/edit.php:176
|
| 1256 |
+
msgid "No Default"
|
| 1257 |
+
msgstr "Varsayılan Yok"
|
| 1258 |
+
|
| 1259 |
+
#: ../ui/edit.php:177
|
| 1260 |
+
msgid "Show Values"
|
| 1261 |
+
msgstr "Değerleri Göster"
|
| 1262 |
+
|
| 1263 |
+
#: ../ui/edit.php:181
|
| 1264 |
+
msgid "Label"
|
| 1265 |
+
msgstr "Etiket"
|
| 1266 |
+
|
| 1267 |
+
#: ../ui/edit.php:342
|
| 1268 |
+
msgid "Elements"
|
| 1269 |
+
msgstr "Öğeler"
|
| 1270 |
+
|
| 1271 |
+
#: ../ui/edit.php:354
|
| 1272 |
+
msgid "Element Type"
|
| 1273 |
+
msgstr "Öğe Türü"
|
| 1274 |
+
|
| 1275 |
+
#: ../ui/edit.php:379
|
| 1276 |
+
msgid "Hide Label"
|
| 1277 |
+
msgstr "Etiketi gizle"
|
| 1278 |
+
|
| 1279 |
+
#: ../ui/edit.php:386
|
| 1280 |
+
msgid "Slug"
|
| 1281 |
+
msgstr "Kısa isim"
|
| 1282 |
+
|
| 1283 |
+
#: ../ui/edit.php:392
|
| 1284 |
+
msgid "Condition"
|
| 1285 |
+
msgstr ""
|
| 1286 |
+
|
| 1287 |
+
#: ../ui/edit.php:397
|
| 1288 |
+
msgid "Disable"
|
| 1289 |
+
msgstr "Devre Dışı Bırak"
|
| 1290 |
+
|
| 1291 |
+
#: ../ui/edit.php:403
|
| 1292 |
+
msgid "Required"
|
| 1293 |
+
msgstr "Gerekli"
|
| 1294 |
+
|
| 1295 |
+
#: ../ui/edit.php:417
|
| 1296 |
+
msgid "Show in Entry List"
|
| 1297 |
+
msgstr "Kayıt Listesinde Göster"
|
| 1298 |
+
|
| 1299 |
+
#: ../ui/edit.php:427
|
| 1300 |
+
msgid ""
|
| 1301 |
+
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1302 |
+
msgstr ""
|
| 1303 |
+
"Bu alanı karldırmak istediğinize emin misiniz? 'İptal'e tıklayarak durdurum "
|
| 1304 |
+
"veya 'Tamam'a basarak siliin"
|
| 1305 |
+
|
| 1306 |
+
#: ../ui/edit.php:427
|
| 1307 |
+
msgid "Delete Element"
|
| 1308 |
+
msgstr "Öğeyi Sil"
|
| 1309 |
+
|
| 1310 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
| 1311 |
+
msgid "General Settings"
|
| 1312 |
+
msgstr "Genel Ayarlar"
|
| 1313 |
+
|
| 1314 |
+
#: ../ui/edit.php:498
|
| 1315 |
+
msgid "Updated Successfully"
|
| 1316 |
+
msgstr "Başarıyla Güncellendi"
|
| 1317 |
+
|
| 1318 |
+
#: ../ui/edit.php:500
|
| 1319 |
+
msgid "Update Form"
|
| 1320 |
+
msgstr "Formu Güncelle"
|
| 1321 |
+
|
| 1322 |
+
#: ../ui/edit.php:501
|
| 1323 |
+
msgid "Preview Form"
|
| 1324 |
+
msgstr "Formu Görüntüle"
|
| 1325 |
+
|
| 1326 |
+
#: ../ui/edit.php:514
|
| 1327 |
+
msgid "Form Description"
|
| 1328 |
+
msgstr "Form Açıklaması"
|
| 1329 |
+
|
| 1330 |
+
#: ../ui/edit.php:521
|
| 1331 |
+
msgid "State"
|
| 1332 |
+
msgstr "Durum"
|
| 1333 |
+
|
| 1334 |
+
#: ../ui/edit.php:523
|
| 1335 |
+
msgid "Deactivate / Draft"
|
| 1336 |
+
msgstr "Devredışı Bırak / Taslak"
|
| 1337 |
+
|
| 1338 |
+
#: ../ui/edit.php:528
|
| 1339 |
+
msgid "Capture Entries"
|
| 1340 |
+
msgstr "Kayıtları Yakala"
|
| 1341 |
+
|
| 1342 |
+
#: ../ui/edit.php:536
|
| 1343 |
+
msgid "Pin to Menu"
|
| 1344 |
+
msgstr "Menüye Ekle"
|
| 1345 |
+
|
| 1346 |
+
#: ../ui/edit.php:545
|
| 1347 |
+
msgid "View Entries"
|
| 1348 |
+
msgstr "Kayıtları Görüntüle"
|
| 1349 |
+
|
| 1350 |
+
#: ../ui/edit.php:547
|
| 1351 |
+
msgid "All"
|
| 1352 |
+
msgstr "Hepsi"
|
| 1353 |
+
|
| 1354 |
+
#: ../ui/edit.php:569
|
| 1355 |
+
msgid "Hide Form"
|
| 1356 |
+
msgstr "Formu Gizle"
|
| 1357 |
+
|
| 1358 |
+
#: ../ui/edit.php:571
|
| 1359 |
+
msgid "Hide form after successful submission"
|
| 1360 |
+
msgstr "Başarılı girişlerden sonra formu gizle"
|
| 1361 |
+
|
| 1362 |
+
#: ../ui/edit.php:576
|
| 1363 |
+
msgid "Honeypot"
|
| 1364 |
+
msgstr "Bal küpü"
|
| 1365 |
+
|
| 1366 |
+
#: ../ui/edit.php:578
|
| 1367 |
+
msgid "Place an invisible field to trick spambots"
|
| 1368 |
+
msgstr "Spam botlarını kandırmak için görünmez bir alan ekleyin"
|
| 1369 |
+
|
| 1370 |
+
#: ../ui/edit.php:583
|
| 1371 |
+
msgid "Success Message"
|
| 1372 |
+
msgstr "Başarılı Mesajı"
|
| 1373 |
+
|
| 1374 |
+
#: ../ui/edit.php:589
|
| 1375 |
+
msgid "Gravatar Field"
|
| 1376 |
+
msgstr "Gravatar Alanı"
|
| 1377 |
+
|
| 1378 |
+
#: ../ui/edit.php:596
|
| 1379 |
+
msgid "Used when viewing an entry from a non-logged in user."
|
| 1380 |
+
msgstr ""
|
| 1381 |
+
"Giriş yapmamış bir kullanıcı tarafından girilmiş bir kayıt görüntülenirken "
|
| 1382 |
+
"kullanılıır"
|
| 1383 |
+
|
| 1384 |
+
#: ../ui/edit.php:670
|
| 1385 |
+
msgid "Add New"
|
| 1386 |
+
msgstr "Yeni Ekle"
|
| 1387 |
+
|
| 1388 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1389 |
+
msgid "Remove"
|
| 1390 |
+
msgstr "Kaldır"
|
| 1391 |
+
|
| 1392 |
+
#: ../ui/edit.php:825
|
| 1393 |
+
msgid "Set Element"
|
| 1394 |
+
msgstr "Öğeyi Belirle"
|
| 1395 |
+
|
| 1396 |
+
#: ../ui/edit.php:828
|
| 1397 |
+
msgid "No description given"
|
| 1398 |
+
msgstr "Verilmiş açıklama yok"
|
| 1399 |
+
|
| 1400 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1401 |
+
msgid "or"
|
| 1402 |
+
msgstr "veya"
|
| 1403 |
+
|
| 1404 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1405 |
+
msgid "is"
|
| 1406 |
+
msgstr "eşittir"
|
| 1407 |
+
|
| 1408 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1409 |
+
msgid "is not"
|
| 1410 |
+
msgstr "eşit değildir"
|
| 1411 |
+
|
| 1412 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1413 |
+
msgid "is greater than"
|
| 1414 |
+
msgstr "büyüktür"
|
| 1415 |
+
|
| 1416 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1417 |
+
msgid "is less than"
|
| 1418 |
+
msgstr "küçüktür"
|
| 1419 |
+
|
| 1420 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1421 |
+
msgid "starts with"
|
| 1422 |
+
msgstr "başlar"
|
| 1423 |
+
|
| 1424 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1425 |
+
msgid "ends with"
|
| 1426 |
+
msgstr "biter"
|
| 1427 |
+
|
| 1428 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1429 |
+
msgid "contains"
|
| 1430 |
+
msgstr "içerir"
|
| 1431 |
+
|
| 1432 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1433 |
+
msgid "Select field first"
|
| 1434 |
+
msgstr "Önce alan seçin"
|
| 1435 |
+
|
| 1436 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1437 |
+
#: ../ui/panels/conditions.php:129
|
| 1438 |
+
msgid "Add Condition"
|
| 1439 |
+
msgstr "Koşul Ekle"
|
| 1440 |
+
|
| 1441 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1442 |
+
msgid "and"
|
| 1443 |
+
msgstr "ve"
|
| 1444 |
+
|
| 1445 |
+
#: ../ui/entries_toolbar.php:15
|
| 1446 |
+
msgid "Active"
|
| 1447 |
+
msgstr "Aktif"
|
| 1448 |
+
|
| 1449 |
+
#: ../ui/entries_toolbar.php:31
|
| 1450 |
+
msgid "Export Entries"
|
| 1451 |
+
msgstr "Kayıtları Dışa Aktar"
|
| 1452 |
+
|
| 1453 |
+
#: ../ui/entries_toolbar.php:35
|
| 1454 |
+
msgid "Apply"
|
| 1455 |
+
msgstr "Uygula"
|
| 1456 |
+
|
| 1457 |
+
#: ../ui/entry_navigation.php:23
|
| 1458 |
+
msgid "item"
|
| 1459 |
+
msgstr "öğe"
|
| 1460 |
+
|
| 1461 |
+
#: ../ui/entry_navigation.php:23
|
| 1462 |
+
msgid "items"
|
| 1463 |
+
msgstr "öğeler"
|
| 1464 |
+
|
| 1465 |
+
#: ../ui/extend.php:23
|
| 1466 |
+
msgid ""
|
| 1467 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1468 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1469 |
+
"Forms."
|
| 1470 |
+
msgstr ""
|
| 1471 |
+
"Not: Şu anda Caldera Formları lisanslarını CalderaWP Lisans Yöneticisine "
|
| 1472 |
+
"taşıyoruz. Bu panel Caldera Formlarının gelecekteki versiyonlarında "
|
| 1473 |
+
"kaldırılacaktır."
|
| 1474 |
+
|
| 1475 |
+
#: ../ui/extend.php:29
|
| 1476 |
+
msgid "No licensed addons installed."
|
| 1477 |
+
msgstr "Hiçbir lisans eklentisi yüklenmedi."
|
| 1478 |
+
|
| 1479 |
+
#: ../ui/extend.php:54
|
| 1480 |
+
msgid "Already Installed"
|
| 1481 |
+
msgstr "Zaten Yüklü"
|
| 1482 |
+
|
| 1483 |
+
#: ../ui/insert_shortcode.php:5
|
| 1484 |
+
msgid "Insert Caldera Form"
|
| 1485 |
+
msgstr "Caldera Formu Ekle"
|
| 1486 |
+
|
| 1487 |
+
#: ../ui/insert_shortcode.php:24
|
| 1488 |
+
msgid "You don't have any forms to insert."
|
| 1489 |
+
msgstr "Ekleyebileceğiniz hiç form yok."
|
| 1490 |
+
|
| 1491 |
+
#: ../ui/insert_shortcode.php:32
|
| 1492 |
+
msgid "Insert Form"
|
| 1493 |
+
msgstr "Form Ekle"
|
| 1494 |
+
|
| 1495 |
+
#: ../ui/insert_shortcode.php:34
|
| 1496 |
+
msgid "Close"
|
| 1497 |
+
msgstr "Kapat"
|
| 1498 |
+
|
| 1499 |
+
#: ../ui/news_templates.php:21
|
| 1500 |
+
msgid "Unable to connect or no extensions available."
|
| 1501 |
+
msgstr "Bağlanamıyor veya mevcut eklenti yok."
|
| 1502 |
+
|
| 1503 |
+
#: ../ui/panels/conditions.php:65
|
| 1504 |
+
msgid "Show"
|
| 1505 |
+
msgstr "Göster"
|
| 1506 |
+
|
| 1507 |
+
#: ../ui/panels/conditions.php:66
|
| 1508 |
+
msgid "Hide"
|
| 1509 |
+
msgstr "Gizle"
|
| 1510 |
+
|
| 1511 |
+
#: ../ui/panels/conditions.php:69
|
| 1512 |
+
msgid "Add Conditional Line"
|
| 1513 |
+
msgstr ""
|
| 1514 |
+
|
| 1515 |
+
#: ../ui/panels/conditions.php:83
|
| 1516 |
+
msgid "if"
|
| 1517 |
+
msgstr ""
|
| 1518 |
+
|
| 1519 |
+
#: ../ui/panels/conditions.php:133
|
| 1520 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1521 |
+
msgstr ""
|
| 1522 |
+
|
| 1523 |
+
#: ../ui/panels/conditions.php:133
|
| 1524 |
+
msgid "Remove Condition"
|
| 1525 |
+
msgstr ""
|
| 1526 |
+
|
| 1527 |
+
#: ../ui/panels/conditions.php:137
|
| 1528 |
+
msgid "Applied Fields"
|
| 1529 |
+
msgstr ""
|
| 1530 |
+
|
| 1531 |
+
#: ../ui/panels/conditions.php:138
|
| 1532 |
+
msgid "Select the fields to apply this condition to."
|
| 1533 |
+
msgstr ""
|
| 1534 |
+
|
| 1535 |
+
#: ../ui/panels/emailer.php:36
|
| 1536 |
+
msgid "Enabled"
|
| 1537 |
+
msgstr "Etkin"
|
| 1538 |
+
|
| 1539 |
+
#: ../ui/panels/emailer.php:45
|
| 1540 |
+
msgid "Name from which the email comes"
|
| 1541 |
+
msgstr "Gelen e-postadaki isim"
|
| 1542 |
+
|
| 1543 |
+
#: ../ui/panels/emailer.php:52
|
| 1544 |
+
msgid ""
|
| 1545 |
+
"Email Address from which the mail comes. Try not to use a field from the "
|
| 1546 |
+
"form. Rather use your own email and use a form field in the \"Reply To Email"
|
| 1547 |
+
"\" below."
|
| 1548 |
+
msgstr ""
|
| 1549 |
+
"Gelen e-postadaki, e-posta adresi. Formdan bir alan kullanmamaya çalış. "
|
| 1550 |
+
"Aksine kendi e-posta adresini kullan ve aşağıdaki \"Reply To Email\" form "
|
| 1551 |
+
"alanlarını kullan."
|
| 1552 |
+
|
| 1553 |
+
#: ../ui/panels/emailer.php:56
|
| 1554 |
+
msgid "Reply To Email"
|
| 1555 |
+
msgstr "E-postayı Cevapla"
|
| 1556 |
+
|
| 1557 |
+
#: ../ui/panels/emailer.php:59
|
| 1558 |
+
msgid ""
|
| 1559 |
+
"The email address of the person filling in the form. This will allow the "
|
| 1560 |
+
"email to be replied directly to the sender."
|
| 1561 |
+
msgstr ""
|
| 1562 |
+
"Formu dolduran kişinin e-posta adresi. Bu e-postanın gönderene doğrudan "
|
| 1563 |
+
"cevaplandırılmasını sağlayacaktır."
|
| 1564 |
+
|
| 1565 |
+
#: ../ui/panels/emailer.php:64
|
| 1566 |
+
msgid "Email Type"
|
| 1567 |
+
msgstr "E-posta Tipi"
|
| 1568 |
+
|
| 1569 |
+
#: ../ui/panels/emailer.php:73
|
| 1570 |
+
msgid "CSV Include"
|
| 1571 |
+
msgstr "CSV dahil"
|
| 1572 |
+
|
| 1573 |
+
#: ../ui/panels/emailer.php:75
|
| 1574 |
+
msgid "Attach a CSV version of the submission"
|
| 1575 |
+
msgstr "Gönderinin CSV sürümünü ekleyin"
|
| 1576 |
+
|
| 1577 |
+
#: ../ui/panels/emailer.php:81
|
| 1578 |
+
msgid "Recipients"
|
| 1579 |
+
msgstr "Alıcılar"
|
| 1580 |
+
|
| 1581 |
+
#: ../ui/panels/emailer.php:84
|
| 1582 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1583 |
+
msgstr ""
|
| 1584 |
+
|
| 1585 |
+
#: ../ui/panels/emailer.php:89
|
| 1586 |
+
msgid "BCC"
|
| 1587 |
+
msgstr "BCC"
|
| 1588 |
+
|
| 1589 |
+
#: ../ui/panels/emailer.php:92
|
| 1590 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1591 |
+
msgstr ""
|
| 1592 |
+
|
| 1593 |
+
#: ../ui/panels/emailer.php:100
|
| 1594 |
+
msgid "Use %field_slug% to use a value from the form"
|
| 1595 |
+
msgstr "Formdan bir değer kullanmak için %kısaad% olarak yazın."
|
| 1596 |
+
|
| 1597 |
+
#: ../ui/panels/emailer.php:104
|
| 1598 |
+
msgid "Email Message"
|
| 1599 |
+
msgstr "E-posta Mesajı"
|
| 1600 |
+
|
| 1601 |
+
#: ../ui/panels/emailer.php:107
|
| 1602 |
+
msgid ""
|
| 1603 |
+
"Magic tags, %field_slug% are replaced with submitted data. Use {summary} to "
|
| 1604 |
+
"build an automatic mail based on form content. Leaving the mailer blank, "
|
| 1605 |
+
"will create and automatic summary."
|
| 1606 |
+
msgstr ""
|
| 1607 |
+
"Sihirli etiketler, %kısaad% gönderilmiş bilgiyle değiştirildi. {summary} "
|
| 1608 |
+
"etiketini kullanarak form içeriğine dayalı otomatik bir e-posta oluşturun. "
|
| 1609 |
+
"Posta göndericiyi boş bırakmak, otomatik özet oluşturacaktır."
|
| 1610 |
+
|
| 1611 |
+
#: ../ui/panels/emailer.php:113
|
| 1612 |
+
msgid "Debug Mailer"
|
| 1613 |
+
msgstr "Mail Göndericiyi Hatalardan Ayıkla"
|
| 1614 |
+
|
| 1615 |
+
#: ../ui/panels/emailer.php:115
|
| 1616 |
+
msgid "Enable email send transation log"
|
| 1617 |
+
msgstr "E-posta gönderme işlem kaydını etkinleştir"
|
| 1618 |
+
|
| 1619 |
+
#: ../ui/panels/emailer.php:116
|
| 1620 |
+
msgid ""
|
| 1621 |
+
"If set, entries will have a \"Mailer Debug\" meta tab to see the transaction "
|
| 1622 |
+
"log. Do not keep this enabled on production as it sends two emails for "
|
| 1623 |
+
"tracking."
|
| 1624 |
+
msgstr ""
|
| 1625 |
+
"Ayarlanırsa, kayıtlar \"Meular Debug\" etiketini alarak işlem kaydını "
|
| 1626 |
+
"görmenizi sağlayacak. Bunu çalışırken etkin bırakmayın çünkü takip için iki "
|
| 1627 |
+
"e-posta gönderir."
|
| 1628 |
+
|
| 1629 |
+
#: ../ui/panels/emailer.php:118
|
| 1630 |
+
msgid "Learn more here"
|
| 1631 |
+
msgstr ""
|
| 1632 |
+
|
| 1633 |
+
#: ../ui/panels/emailer.php:130
|
| 1634 |
+
msgid ""
|
| 1635 |
+
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1636 |
+
"the form submittable."
|
| 1637 |
+
msgstr ""
|
| 1638 |
+
"Eğer gönderilebilir bir form istiyorsanız lütfen bir \"Button\" öğesi "
|
| 1639 |
+
"ekleyip, \"Submit\" olarak ayarlayınız."
|
| 1640 |
+
|
| 1641 |
+
#: ../ui/panels/layout.php:13
|
| 1642 |
+
msgid "This will remove all the fields in this row. Are you sure?"
|
| 1643 |
+
msgstr "Bu işlem satırdaki tüm alanları kaldıracaktır. Emin misiniz?"
|
| 1644 |
+
|
| 1645 |
+
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1646 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1647 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1648 |
+
msgid "Page"
|
| 1649 |
+
msgstr "Sayfa"
|
| 1650 |
+
|
| 1651 |
+
#: ../ui/panels/layout_toolbar.php:11
|
| 1652 |
+
msgid "Add Page"
|
| 1653 |
+
msgstr "Sayfa ekle"
|
| 1654 |
+
|
| 1655 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1656 |
+
msgid "Drag onto the form grid below"
|
| 1657 |
+
msgstr "Aşağıdaki form ızgarasının üzerine sürükleyiniz"
|
| 1658 |
+
|
| 1659 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1660 |
+
msgid "Add Element"
|
| 1661 |
+
msgstr "Öğe Ekle"
|
| 1662 |
+
|
| 1663 |
+
#: ../ui/panels/pages.php:2
|
| 1664 |
+
msgid "Progress Bar"
|
| 1665 |
+
msgstr "İlerleme Çubuğu"
|
| 1666 |
+
|
| 1667 |
+
#: ../ui/panels/pages.php:4
|
| 1668 |
+
msgid "Show Breadcrumbs"
|
| 1669 |
+
msgstr "Breadcrumbs'ı göster."
|
| 1670 |
+
|
| 1671 |
+
#: ../ui/panels/pages.php:5
|
| 1672 |
+
msgid "ProTip: Use an HTML element to build a custom progress per page"
|
| 1673 |
+
msgstr ""
|
| 1674 |
+
"Profesyoneller için ipucu: Her sayfaya özel ilerleme şeyi koymak için HTML "
|
| 1675 |
+
"öğesini kullanın."
|
| 1676 |
+
|
| 1677 |
+
#: ../ui/panels/processors.php:22 ../ui/panels/processors.php:47
|
| 1678 |
+
#: ../ui/panels/processors.php:100
|
| 1679 |
+
msgid "New Form Processor"
|
| 1680 |
+
msgstr "Yeni Form İşlemcisi"
|
| 1681 |
+
|
| 1682 |
+
#: ../ui/panels/processors.php:103
|
| 1683 |
+
msgid "Processor Type"
|
| 1684 |
+
msgstr "İşlemci Tipi"
|
| 1685 |
+
|
| 1686 |
+
#: ../ui/panels/processors.php:117
|
| 1687 |
+
msgid "Are you sure you want to remove this processor?"
|
| 1688 |
+
msgstr "Bu işlemci kaldırmak istediğinizden emin misiniz?"
|
| 1689 |
+
|
| 1690 |
+
#: ../ui/panels/processors.php:117
|
| 1691 |
+
msgid "Remove Processor"
|
| 1692 |
+
msgstr "İşlemciyi kaldır"
|
| 1693 |
+
|
| 1694 |
+
#: ../ui/panels/processors.php:123
|
| 1695 |
+
msgid "Use"
|
| 1696 |
+
msgstr "Kullan"
|
| 1697 |
+
|
| 1698 |
+
#: ../ui/panels/processors.php:124
|
| 1699 |
+
msgid "Don't Use"
|
| 1700 |
+
msgstr "Kullanma"
|
| 1701 |
+
|
| 1702 |
+
#: ../ui/panels/processors.php:126
|
| 1703 |
+
msgid "Add Conditional Group"
|
| 1704 |
+
msgstr "Şartlı Grup Ekle"
|
| 1705 |
+
|
| 1706 |
+
#: ../ui/panels/processors.php:171
|
| 1707 |
+
msgid "Add Processor"
|
| 1708 |
+
msgstr "İşlemci ekle"
|
| 1709 |
+
|
| 1710 |
+
#: ../ui/panels/processors.php:221
|
| 1711 |
+
msgid "Use Processor"
|
| 1712 |
+
msgstr "İşlemciyi Kullan"
|
| 1713 |
+
|
| 1714 |
+
#: ../ui/panels/processors.php:226
|
| 1715 |
+
msgid "by"
|
| 1716 |
+
msgstr "tarafından"
|
| 1717 |
+
|
| 1718 |
+
#: ../ui/panels/processors.php:284
|
| 1719 |
+
msgid "This processor has no configurable options."
|
| 1720 |
+
msgstr "Bu işlemcinin yapılandırılabilir seçeneği yok."
|
| 1721 |
+
|
| 1722 |
+
#: ../ui/panels/variable_add.php:1
|
| 1723 |
+
msgid "Add Variable"
|
| 1724 |
+
msgstr "Değişken Ekle"
|
| 1725 |
+
|
| 1726 |
+
#: ../ui/panels/variables.php:14
|
| 1727 |
+
msgid "Behaviour"
|
| 1728 |
+
msgstr "Davranış"
|
| 1729 |
+
|
| 1730 |
+
#: ../ui/panels/variables.php:16
|
| 1731 |
+
msgid "No variables defined"
|
| 1732 |
+
msgstr "Hiçbir değişken tanımlanmadı"
|
| 1733 |
+
|
| 1734 |
+
#: ../ui/panels/variables.php:29 ../ui/panels/variables.php:49
|
| 1735 |
+
msgid "Static"
|
| 1736 |
+
msgstr "Statik"
|
| 1737 |
+
|
| 1738 |
+
#: ../ui/panels/variables.php:30 ../ui/panels/variables.php:50
|
| 1739 |
+
msgid "Passback"
|
| 1740 |
+
msgstr "Passback"
|
| 1741 |
+
|
| 1742 |
+
#: ../ui/panels/variables.php:31 ../ui/panels/variables.php:51
|
| 1743 |
+
msgid "Entry List"
|
| 1744 |
+
msgstr "Kayıt Listesi"
|
| 1745 |
+
|
| 1746 |
+
#~ msgid "Settings"
|
| 1747 |
+
#~ msgstr "Ayarlar"
|
| 1748 |
+
|
| 1749 |
+
#~ msgid "Comma separated list of email addresses."
|
| 1750 |
+
#~ msgstr "E-posta adreslerinin virgülle ayrıldığı liste."
|
| 1751 |
+
|
| 1752 |
+
#~ msgid "Add Row"
|
| 1753 |
+
#~ msgstr "Satır Ekle"
|
languages/caldera-forms.pot
CHANGED
|
@@ -1,428 +1,461 @@
|
|
|
|
|
| 1 |
msgid ""
|
| 2 |
msgstr ""
|
| 3 |
"Project-Id-Version: Caldera Forms\n"
|
| 4 |
-
"POT-Creation-Date: 2015-
|
| 5 |
-
"PO-Revision-Date: 2015-06
|
| 6 |
"Last-Translator: \n"
|
| 7 |
"Language-Team: \n"
|
| 8 |
"MIME-Version: 1.0\n"
|
| 9 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
-
"X-Generator: Poedit 1.
|
| 12 |
"X-Poedit-Basepath: .\n"
|
| 13 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 14 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 16 |
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
|
| 18 |
-
#: ../classes/
|
|
|
|
|
|
|
|
|
|
|
|
|
| 19 |
msgid "Invalid Form."
|
| 20 |
msgstr ""
|
| 21 |
|
| 22 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 23 |
#: ../ui/entries_toolbar.php:27
|
| 24 |
msgid "Trash"
|
| 25 |
msgstr ""
|
| 26 |
|
| 27 |
-
#: ../classes/admin.php:
|
| 28 |
#: ../ui/admin_templates.php:9
|
| 29 |
msgid "Restore"
|
| 30 |
msgstr ""
|
| 31 |
|
| 32 |
-
#: ../classes/admin.php:
|
| 33 |
msgid "Entry"
|
| 34 |
msgstr ""
|
| 35 |
|
| 36 |
-
#: ../classes/admin.php:
|
| 37 |
msgid "View"
|
| 38 |
msgstr ""
|
| 39 |
|
| 40 |
-
#: ../classes/admin.php:
|
| 41 |
msgid "Add Form to Page"
|
| 42 |
msgstr ""
|
| 43 |
|
| 44 |
-
#: ../classes/admin.php:
|
| 45 |
msgid "Insert Form Shortcode"
|
| 46 |
msgstr ""
|
| 47 |
|
| 48 |
-
#: ../classes/admin.php:
|
| 49 |
msgid "Caldera Form"
|
| 50 |
msgstr ""
|
| 51 |
|
| 52 |
-
#: ../classes/admin.php:
|
| 53 |
msgid "Deactivate"
|
| 54 |
msgstr ""
|
| 55 |
|
| 56 |
-
#: ../classes/admin.php:
|
| 57 |
msgid "Activate"
|
| 58 |
msgstr ""
|
| 59 |
|
| 60 |
-
#: ../classes/admin.php:
|
| 61 |
-
#: ../classes/admin.php:
|
| 62 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 63 |
-
#: ../ui/community.php:5 ../ui/edit.php:
|
| 64 |
msgid "Caldera Forms"
|
| 65 |
msgstr ""
|
| 66 |
|
| 67 |
-
#: ../classes/admin.php:
|
| 68 |
msgid "Caldera Forms Admin"
|
| 69 |
msgstr ""
|
| 70 |
|
| 71 |
-
#: ../classes/admin.php:
|
| 72 |
msgid "Forms"
|
| 73 |
msgstr ""
|
| 74 |
|
| 75 |
-
#: ../classes/admin.php:
|
| 76 |
msgid "Community"
|
| 77 |
msgstr ""
|
| 78 |
|
| 79 |
-
#: ../classes/admin.php:
|
| 80 |
msgid "Extend"
|
| 81 |
msgstr ""
|
| 82 |
|
| 83 |
-
#: ../classes/admin.php:
|
| 84 |
msgid "Sorry, please try again"
|
| 85 |
msgstr ""
|
| 86 |
|
| 87 |
-
#: ../classes/admin.php:
|
| 88 |
msgid "Form Delete Error"
|
| 89 |
msgstr ""
|
| 90 |
|
| 91 |
-
#: ../classes/admin.php:
|
| 92 |
msgid "Sorry, File is not valid."
|
| 93 |
msgstr ""
|
| 94 |
|
| 95 |
-
#: ../classes/admin.php:
|
| 96 |
-
#: ../classes/admin.php:
|
| 97 |
msgid "Form Import Error"
|
| 98 |
msgstr ""
|
| 99 |
|
| 100 |
-
#: ../classes/admin.php:
|
| 101 |
msgid "Sorry, File not uploaded."
|
| 102 |
msgstr ""
|
| 103 |
|
| 104 |
-
#: ../classes/admin.php:
|
| 105 |
msgid "Form does not exist."
|
| 106 |
msgstr ""
|
| 107 |
|
| 108 |
-
#: ../classes/admin.php:
|
| 109 |
msgid "Export selection has expired"
|
| 110 |
msgstr ""
|
| 111 |
|
| 112 |
-
#: ../classes/admin.php:
|
| 113 |
msgid "Export Expired"
|
| 114 |
msgstr ""
|
| 115 |
|
| 116 |
-
#: ../classes/admin.php:
|
| 117 |
msgid "Form has been successfully submitted. Thank you."
|
| 118 |
msgstr ""
|
| 119 |
|
| 120 |
-
#: ../classes/admin.php:
|
| 121 |
msgid "Layout"
|
| 122 |
msgstr ""
|
| 123 |
|
| 124 |
-
#: ../classes/admin.php:
|
| 125 |
msgid "Layout Builder"
|
| 126 |
msgstr ""
|
| 127 |
|
| 128 |
-
#: ../classes/admin.php:
|
| 129 |
msgid "Pages"
|
| 130 |
msgstr ""
|
| 131 |
|
| 132 |
-
#: ../classes/admin.php:
|
| 133 |
msgid "Form Pages"
|
| 134 |
msgstr ""
|
| 135 |
|
| 136 |
-
#: ../classes/admin.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 137 |
msgid "Processors"
|
| 138 |
msgstr ""
|
| 139 |
|
| 140 |
-
#: ../classes/admin.php:
|
| 141 |
msgid "Form Processors"
|
| 142 |
msgstr ""
|
| 143 |
|
| 144 |
-
#: ../classes/admin.php:
|
| 145 |
#: ../ui/panels/variables.php:83
|
| 146 |
msgid "Variables"
|
| 147 |
msgstr ""
|
| 148 |
|
| 149 |
-
#: ../classes/admin.php:
|
| 150 |
msgid "Responsive"
|
| 151 |
msgstr ""
|
| 152 |
|
| 153 |
-
#: ../classes/admin.php:
|
| 154 |
msgid "Resposive Settings"
|
| 155 |
msgstr ""
|
| 156 |
|
| 157 |
-
#: ../classes/admin.php:
|
| 158 |
msgid "Grid Collapse"
|
| 159 |
msgstr ""
|
| 160 |
|
| 161 |
-
#: ../classes/admin.php:
|
| 162 |
msgid ""
|
| 163 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 164 |
"Bootstrap 3.0)"
|
| 165 |
msgstr ""
|
| 166 |
|
| 167 |
-
#: ../classes/admin.php:
|
| 168 |
msgid "Maintain grid always"
|
| 169 |
msgstr ""
|
| 170 |
|
| 171 |
-
#: ../classes/admin.php:
|
| 172 |
msgid "Mailer"
|
| 173 |
msgstr ""
|
| 174 |
|
| 175 |
-
#: ../classes/admin.php:
|
| 176 |
msgid "Email Notification Settings"
|
| 177 |
msgstr ""
|
| 178 |
|
| 179 |
-
#: ../classes/core.php:
|
| 180 |
msgid "The wasn't entered correct."
|
| 181 |
msgstr ""
|
| 182 |
|
| 183 |
-
#: ../classes/core.php:
|
| 184 |
msgid "Reset"
|
| 185 |
msgstr ""
|
| 186 |
|
| 187 |
-
#: ../classes/core.php:
|
| 188 |
msgid "Permission denied."
|
| 189 |
msgstr ""
|
| 190 |
|
| 191 |
-
#: ../classes/core.php:
|
| 192 |
-
msgid "Caldera Forms Notification"
|
| 193 |
-
msgstr ""
|
| 194 |
-
|
| 195 |
-
#: ../classes/core.php:973
|
| 196 |
msgid "Auto Responder"
|
| 197 |
msgstr ""
|
| 198 |
|
| 199 |
-
#: ../classes/core.php:
|
| 200 |
msgid "Sends out an auto response e-mail"
|
| 201 |
msgstr ""
|
| 202 |
|
| 203 |
-
#: ../classes/core.php:
|
| 204 |
msgid "Thank you for contacting us"
|
| 205 |
msgstr ""
|
| 206 |
|
| 207 |
-
#: ../classes/core.php:
|
| 208 |
msgid "Redirect"
|
| 209 |
msgstr ""
|
| 210 |
|
| 211 |
-
#: ../classes/core.php:
|
| 212 |
msgid "Redirects user to URL on successful submit"
|
| 213 |
msgstr ""
|
| 214 |
|
| 215 |
-
#: ../classes/core.php:
|
| 216 |
msgid "Increment Value"
|
| 217 |
msgstr ""
|
| 218 |
|
| 219 |
-
#: ../classes/core.php:
|
| 220 |
msgid "Increment a value per entry."
|
| 221 |
msgstr ""
|
| 222 |
|
| 223 |
-
#: ../classes/core.php:
|
| 224 |
msgid "Akismet"
|
| 225 |
msgstr ""
|
| 226 |
|
| 227 |
-
#: ../classes/core.php:
|
| 228 |
msgid "Anti-spam filtering"
|
| 229 |
msgstr ""
|
| 230 |
|
| 231 |
-
#: ../classes/core.php:
|
| 232 |
msgid "Akismet not setup."
|
| 233 |
msgstr ""
|
| 234 |
|
| 235 |
-
#: ../classes/core.php:
|
| 236 |
msgid "Calculation"
|
| 237 |
msgstr ""
|
| 238 |
|
| 239 |
-
#: ../classes/core.php:
|
| 240 |
-
#: ../classes/core.php:
|
| 241 |
msgid "Special"
|
| 242 |
msgstr ""
|
| 243 |
|
| 244 |
-
#: ../classes/core.php:
|
| 245 |
msgid "Math"
|
| 246 |
msgstr ""
|
| 247 |
|
| 248 |
-
#: ../classes/core.php:
|
| 249 |
msgid "Calculate values"
|
| 250 |
msgstr ""
|
| 251 |
|
| 252 |
-
#: ../classes/core.php:
|
| 253 |
msgid "Total"
|
| 254 |
msgstr ""
|
| 255 |
|
| 256 |
-
#: ../classes/core.php:
|
| 257 |
msgid "Range Slider"
|
| 258 |
msgstr ""
|
| 259 |
|
| 260 |
-
#: ../classes/core.php:
|
| 261 |
msgid "Range Slider input field"
|
| 262 |
msgstr ""
|
| 263 |
|
| 264 |
-
#: ../classes/core.php:
|
| 265 |
msgid "Star Rating"
|
| 266 |
msgstr ""
|
| 267 |
|
| 268 |
-
#: ../classes/core.php:
|
| 269 |
msgid "Feedback"
|
| 270 |
msgstr ""
|
| 271 |
|
| 272 |
-
#: ../classes/core.php:
|
| 273 |
msgid "Star rating input for feedback"
|
| 274 |
msgstr ""
|
| 275 |
|
| 276 |
-
#: ../classes/core.php:
|
| 277 |
msgid "Phone Number"
|
| 278 |
msgstr ""
|
| 279 |
|
| 280 |
-
#: ../classes/core.php:
|
| 281 |
msgid "Phone number with masking"
|
| 282 |
msgstr ""
|
| 283 |
|
| 284 |
-
#: ../classes/core.php:
|
| 285 |
-
#: ../classes/core.php:
|
| 286 |
-
#: ../classes/core.php:
|
| 287 |
msgid "Text Fields"
|
| 288 |
msgstr ""
|
| 289 |
|
| 290 |
-
#: ../classes/core.php:
|
| 291 |
-
#: ../classes/core.php:1353 ../classes/core.php:1369 ../classes/core.php:1390
|
| 292 |
-
#: ../classes/core.php:1400 ../classes/core.php:1441 ../classes/core.php:1460
|
| 293 |
-
#: ../classes/core.php:1479 ../classes/core.php:1552 ../ui/edit.php:170
|
| 294 |
-
msgid "Basic"
|
| 295 |
-
msgstr ""
|
| 296 |
-
|
| 297 |
-
#: ../classes/core.php:1262
|
| 298 |
msgid "User"
|
| 299 |
msgstr ""
|
| 300 |
|
| 301 |
-
#: ../classes/core.php:
|
| 302 |
msgid "Single Line Text"
|
| 303 |
msgstr ""
|
| 304 |
|
| 305 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 306 |
msgid "File"
|
| 307 |
msgstr ""
|
| 308 |
|
| 309 |
-
#: ../classes/core.php:
|
| 310 |
msgid "File Uploader"
|
| 311 |
msgstr ""
|
| 312 |
|
| 313 |
-
#: ../classes/core.php:
|
| 314 |
msgid "reCAPTCHA"
|
| 315 |
msgstr ""
|
| 316 |
|
| 317 |
-
#: ../classes/core.php:
|
| 318 |
msgid "reCAPTCHA anti-spam field"
|
| 319 |
msgstr ""
|
| 320 |
|
| 321 |
-
#: ../classes/core.php:
|
| 322 |
msgid "HTML"
|
| 323 |
msgstr ""
|
| 324 |
|
| 325 |
-
#: ../classes/core.php:
|
| 326 |
msgid "Add text/html content"
|
| 327 |
msgstr ""
|
| 328 |
|
| 329 |
-
#: ../classes/core.php:
|
| 330 |
#: ../processors/akismet/config.php:20
|
| 331 |
msgid "Content"
|
| 332 |
msgstr ""
|
| 333 |
|
| 334 |
-
#: ../classes/core.php:
|
| 335 |
msgid "Hidden"
|
| 336 |
msgstr ""
|
| 337 |
|
| 338 |
-
#: ../classes/core.php:
|
| 339 |
msgid "Button"
|
| 340 |
msgstr ""
|
| 341 |
|
| 342 |
-
#: ../classes/core.php:
|
| 343 |
msgid "Button, Submit and Reset types"
|
| 344 |
msgstr ""
|
| 345 |
|
| 346 |
-
#: ../classes/core.php:
|
| 347 |
msgid "Buttons"
|
| 348 |
msgstr ""
|
| 349 |
|
| 350 |
-
#: ../classes/core.php:
|
| 351 |
msgid "Email Address"
|
| 352 |
msgstr ""
|
| 353 |
|
| 354 |
-
#: ../classes/core.php:
|
| 355 |
msgid "Paragraph Textarea"
|
| 356 |
msgstr ""
|
| 357 |
|
| 358 |
-
#: ../classes/core.php:
|
| 359 |
msgid "Toggle Switch"
|
| 360 |
msgstr ""
|
| 361 |
|
| 362 |
-
#: ../classes/core.php:
|
| 363 |
-
#: ../classes/core.php:
|
| 364 |
msgid "Select Options"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
-
#: ../classes/core.php:
|
| 368 |
msgid "Dropdown Select"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
-
#: ../classes/core.php:
|
| 372 |
msgid "Checkbox"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
-
#: ../classes/core.php:
|
| 376 |
msgid "Radio"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
-
#: ../classes/core.php:
|
| 380 |
msgid "Date Picker"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
-
#: ../classes/core.php:
|
| 384 |
msgid "Pickers"
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
-
#: ../classes/core.php:
|
| 388 |
msgid "Color Picker"
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
-
#: ../classes/core.php:
|
| 392 |
msgid "State/ Province Select"
|
| 393 |
msgstr ""
|
| 394 |
|
| 395 |
-
#: ../classes/core.php:
|
| 396 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 397 |
msgstr ""
|
| 398 |
|
| 399 |
-
#: ../classes/core.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 400 |
msgid "System Tags"
|
| 401 |
msgstr ""
|
| 402 |
|
| 403 |
-
#: ../classes/core.php:
|
| 404 |
msgid "Mailer Debug"
|
| 405 |
msgstr ""
|
| 406 |
|
| 407 |
-
#: ../classes/core.php:
|
| 408 |
msgid "Invalid form ID"
|
| 409 |
msgstr ""
|
| 410 |
|
| 411 |
-
#: ../classes/core.php:
|
| 412 |
-
#: ../classes/core.php:
|
| 413 |
-
#: ../classes/core.php:
|
| 414 |
msgid "Permission denied or entry does not exist."
|
| 415 |
msgstr ""
|
| 416 |
|
| 417 |
-
#: ../classes/core.php:
|
| 418 |
msgid "is required"
|
| 419 |
msgstr ""
|
| 420 |
|
| 421 |
-
#: ../classes/core.php:
|
| 422 |
msgid "Form is currently not active."
|
| 423 |
msgstr ""
|
| 424 |
|
| 425 |
-
#: ../classes/core.php:
|
| 426 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 427 |
msgstr ""
|
| 428 |
|
|
@@ -430,7 +463,7 @@ msgstr ""
|
|
| 430 |
msgid "Title"
|
| 431 |
msgstr ""
|
| 432 |
|
| 433 |
-
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:
|
| 434 |
msgid "Form"
|
| 435 |
msgstr ""
|
| 436 |
|
|
@@ -549,16 +582,32 @@ msgid "The starting view of the date picker (month, year, decade)"
|
|
| 549 |
msgstr ""
|
| 550 |
|
| 551 |
#: ../fields/date_picker/setup.php:32
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 552 |
msgid "language"
|
| 553 |
msgstr ""
|
| 554 |
|
| 555 |
-
#: ../fields/date_picker/setup.php:
|
| 556 |
msgid "Language to use. e.g. pt-BR"
|
| 557 |
msgstr ""
|
| 558 |
|
| 559 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 560 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 561 |
-
#: ../fields/text/config.php:2
|
| 562 |
msgid "Placeholder"
|
| 563 |
msgstr ""
|
| 564 |
|
|
@@ -567,10 +616,14 @@ msgid "Attach to mailer"
|
|
| 567 |
msgstr ""
|
| 568 |
|
| 569 |
#: ../fields/file/config_template.php:9
|
|
|
|
|
|
|
|
|
|
|
|
|
| 570 |
msgid "Allowed Types"
|
| 571 |
msgstr ""
|
| 572 |
|
| 573 |
-
#: ../fields/file/config_template.php:
|
| 574 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 575 |
msgstr ""
|
| 576 |
|
|
@@ -626,7 +679,7 @@ msgstr ""
|
|
| 626 |
msgid "Border Radius"
|
| 627 |
msgstr ""
|
| 628 |
|
| 629 |
-
#: ../fields/hidden/setup.php:2 ../ui/edit.php:
|
| 630 |
#: ../ui/panels/variables.php:12
|
| 631 |
msgid "Value"
|
| 632 |
msgstr ""
|
|
@@ -659,7 +712,7 @@ msgstr ""
|
|
| 659 |
msgid "Track"
|
| 660 |
msgstr ""
|
| 661 |
|
| 662 |
-
#: ../fields/range_slider/config.php:23
|
| 663 |
msgid "Highlight"
|
| 664 |
msgstr ""
|
| 665 |
|
|
@@ -667,7 +720,7 @@ msgstr ""
|
|
| 667 |
msgid "Handle"
|
| 668 |
msgstr ""
|
| 669 |
|
| 670 |
-
#: ../fields/range_slider/config.php:35
|
| 671 |
msgid "Border"
|
| 672 |
msgstr ""
|
| 673 |
|
|
@@ -733,6 +786,14 @@ msgstr ""
|
|
| 733 |
msgid "No Site Key Added"
|
| 734 |
msgstr ""
|
| 735 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 736 |
#: ../fields/star-rate/config.php:2
|
| 737 |
msgid "Number of Stars"
|
| 738 |
msgstr ""
|
|
@@ -849,8 +910,8 @@ msgstr ""
|
|
| 849 |
msgid "Inactive Class"
|
| 850 |
msgstr ""
|
| 851 |
|
| 852 |
-
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:
|
| 853 |
-
#: ../ui/edit.php:
|
| 854 |
msgid "Enable"
|
| 855 |
msgstr ""
|
| 856 |
|
|
@@ -905,16 +966,16 @@ msgstr ""
|
|
| 905 |
msgid "Custom Class"
|
| 906 |
msgstr ""
|
| 907 |
|
| 908 |
-
#: ../includes/field_processors.php:
|
| 909 |
msgid "File type not allowed. Allowed types are: "
|
| 910 |
msgstr ""
|
| 911 |
|
| 912 |
-
#: ../includes/field_processors.php:
|
| 913 |
msgid "File type needs to be"
|
| 914 |
msgstr ""
|
| 915 |
|
| 916 |
-
#: ../processors/akismet/config.php:2 ../ui/edit.php:
|
| 917 |
-
#: ../ui/panels/variables.php:10
|
| 918 |
msgid "Name"
|
| 919 |
msgstr ""
|
| 920 |
|
|
@@ -958,6 +1019,11 @@ msgstr ""
|
|
| 958 |
msgid "Message"
|
| 959 |
msgstr ""
|
| 960 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 961 |
#: ../processors/increment/config.php:2
|
| 962 |
msgid "Increment Start"
|
| 963 |
msgstr ""
|
|
@@ -1034,52 +1100,52 @@ msgstr ""
|
|
| 1034 |
msgid "Grid"
|
| 1035 |
msgstr ""
|
| 1036 |
|
| 1037 |
-
#: ../ui/admin.php:
|
| 1038 |
msgid "Entries"
|
| 1039 |
msgstr ""
|
| 1040 |
|
| 1041 |
-
#: ../ui/admin.php:
|
| 1042 |
#: ../ui/panels/emailer.php:35
|
| 1043 |
msgid "Disabled"
|
| 1044 |
msgstr ""
|
| 1045 |
|
| 1046 |
-
#: ../ui/admin.php:
|
| 1047 |
msgid "Mailer Debug enabled."
|
| 1048 |
msgstr ""
|
| 1049 |
|
| 1050 |
-
#: ../ui/admin.php:
|
| 1051 |
msgid "Edit"
|
| 1052 |
msgstr ""
|
| 1053 |
|
| 1054 |
-
#: ../ui/admin.php:
|
| 1055 |
msgid "Export"
|
| 1056 |
msgstr ""
|
| 1057 |
|
| 1058 |
-
#: ../ui/admin.php:
|
| 1059 |
msgid "Clone Form"
|
| 1060 |
msgstr ""
|
| 1061 |
|
| 1062 |
-
#: ../ui/admin.php:
|
| 1063 |
msgid "Clone"
|
| 1064 |
msgstr ""
|
| 1065 |
|
| 1066 |
-
#: ../ui/admin.php:
|
| 1067 |
msgid "This will delete this form permanently. Continue?"
|
| 1068 |
msgstr ""
|
| 1069 |
|
| 1070 |
-
#: ../ui/admin.php:
|
| 1071 |
msgid "Delete"
|
| 1072 |
msgstr ""
|
| 1073 |
|
| 1074 |
-
#: ../ui/admin.php:
|
| 1075 |
msgid "You don't have any forms."
|
| 1076 |
msgstr ""
|
| 1077 |
|
| 1078 |
-
#: ../ui/admin.php:
|
| 1079 |
msgid "An form name is required"
|
| 1080 |
msgstr ""
|
| 1081 |
|
| 1082 |
-
#: ../ui/admin.php:
|
| 1083 |
msgid ""
|
| 1084 |
"Looks like something is not working. Please try again a little later or post "
|
| 1085 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
|
@@ -1102,8 +1168,7 @@ msgstr ""
|
|
| 1102 |
msgid "Delete Permanently"
|
| 1103 |
msgstr ""
|
| 1104 |
|
| 1105 |
-
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48
|
| 1106 |
-
#: ../ui/edit.php:468
|
| 1107 |
msgid "Form Name"
|
| 1108 |
msgstr ""
|
| 1109 |
|
|
@@ -1111,11 +1176,11 @@ msgstr ""
|
|
| 1111 |
msgid "Form File"
|
| 1112 |
msgstr ""
|
| 1113 |
|
| 1114 |
-
#: ../ui/admin_templates.php:54 ../ui/edit.php:
|
| 1115 |
msgid "Description"
|
| 1116 |
msgstr ""
|
| 1117 |
|
| 1118 |
-
#: ../ui/admin_templates.php:72 ../ui/edit.php:
|
| 1119 |
msgid "ID"
|
| 1120 |
msgstr ""
|
| 1121 |
|
|
@@ -1135,240 +1200,225 @@ msgstr ""
|
|
| 1135 |
msgid "Form has successfully been submitted. Thank you."
|
| 1136 |
msgstr ""
|
| 1137 |
|
| 1138 |
-
#: ../ui/edit.php:
|
| 1139 |
msgid "Auto Populate"
|
| 1140 |
msgstr ""
|
| 1141 |
|
| 1142 |
-
#: ../ui/edit.php:
|
| 1143 |
msgid "Auto Type"
|
| 1144 |
msgstr ""
|
| 1145 |
|
| 1146 |
-
#: ../ui/edit.php:
|
| 1147 |
msgid "Select a source"
|
| 1148 |
msgstr ""
|
| 1149 |
|
| 1150 |
-
#: ../ui/edit.php:
|
| 1151 |
msgid "Post Type"
|
| 1152 |
msgstr ""
|
| 1153 |
|
| 1154 |
-
#: ../ui/edit.php:
|
| 1155 |
msgid "Taxonomy"
|
| 1156 |
msgstr ""
|
| 1157 |
|
| 1158 |
-
#: ../ui/edit.php:
|
| 1159 |
msgid "Add Option"
|
| 1160 |
msgstr ""
|
| 1161 |
|
| 1162 |
-
#: ../ui/edit.php:
|
| 1163 |
msgid "Bulk Insert"
|
| 1164 |
msgstr ""
|
| 1165 |
|
| 1166 |
-
#: ../ui/edit.php:
|
| 1167 |
msgid "Single option per line. These replace the current list."
|
| 1168 |
msgstr ""
|
| 1169 |
|
| 1170 |
-
#: ../ui/edit.php:
|
| 1171 |
msgid "Insert Options"
|
| 1172 |
msgstr ""
|
| 1173 |
|
| 1174 |
-
#: ../ui/edit.php:
|
| 1175 |
msgid "No Default"
|
| 1176 |
msgstr ""
|
| 1177 |
|
| 1178 |
-
#: ../ui/edit.php:
|
| 1179 |
msgid "Show Values"
|
| 1180 |
msgstr ""
|
| 1181 |
|
| 1182 |
-
#: ../ui/edit.php:
|
| 1183 |
msgid "Label"
|
| 1184 |
msgstr ""
|
| 1185 |
|
| 1186 |
-
#: ../ui/edit.php:
|
| 1187 |
msgid "Elements"
|
| 1188 |
msgstr ""
|
| 1189 |
|
| 1190 |
-
#: ../ui/edit.php:
|
| 1191 |
-
msgid "
|
| 1192 |
msgstr ""
|
| 1193 |
|
| 1194 |
-
#: ../ui/edit.php:
|
| 1195 |
-
msgid "
|
| 1196 |
msgstr ""
|
| 1197 |
|
| 1198 |
-
#: ../ui/edit.php:
|
| 1199 |
-
msgid "
|
| 1200 |
msgstr ""
|
| 1201 |
|
| 1202 |
-
#: ../ui/edit.php:
|
| 1203 |
-
msgid "
|
| 1204 |
msgstr ""
|
| 1205 |
|
| 1206 |
-
#: ../ui/edit.php:
|
| 1207 |
-
msgid "
|
| 1208 |
msgstr ""
|
| 1209 |
|
| 1210 |
-
#: ../ui/edit.php:
|
| 1211 |
msgid "Required"
|
| 1212 |
msgstr ""
|
| 1213 |
|
| 1214 |
-
#: ../ui/edit.php:
|
| 1215 |
msgid "Show in Entry List"
|
| 1216 |
msgstr ""
|
| 1217 |
|
| 1218 |
-
#: ../ui/edit.php:
|
| 1219 |
msgid ""
|
| 1220 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1221 |
msgstr ""
|
| 1222 |
|
| 1223 |
-
#: ../ui/edit.php:
|
| 1224 |
msgid "Delete Element"
|
| 1225 |
msgstr ""
|
| 1226 |
|
| 1227 |
-
#: ../ui/edit.php:
|
| 1228 |
-
msgid "Show"
|
| 1229 |
-
msgstr ""
|
| 1230 |
-
|
| 1231 |
-
#: ../ui/edit.php:381
|
| 1232 |
-
msgid "Hide"
|
| 1233 |
-
msgstr ""
|
| 1234 |
-
|
| 1235 |
-
#: ../ui/edit.php:382
|
| 1236 |
-
msgid "Disable"
|
| 1237 |
-
msgstr ""
|
| 1238 |
-
|
| 1239 |
-
#: ../ui/edit.php:384 ../ui/panels/processors.php:126
|
| 1240 |
-
msgid "Add Conditional Group"
|
| 1241 |
-
msgstr ""
|
| 1242 |
-
|
| 1243 |
-
#: ../ui/edit.php:454 ../ui/edit.php:466
|
| 1244 |
msgid "General Settings"
|
| 1245 |
msgstr ""
|
| 1246 |
|
| 1247 |
-
#: ../ui/edit.php:
|
| 1248 |
msgid "Updated Successfully"
|
| 1249 |
msgstr ""
|
| 1250 |
|
| 1251 |
-
#: ../ui/edit.php:
|
| 1252 |
msgid "Update Form"
|
| 1253 |
msgstr ""
|
| 1254 |
|
| 1255 |
-
#: ../ui/edit.php:
|
| 1256 |
msgid "Preview Form"
|
| 1257 |
msgstr ""
|
| 1258 |
|
| 1259 |
-
#: ../ui/edit.php:
|
| 1260 |
msgid "Form Description"
|
| 1261 |
msgstr ""
|
| 1262 |
|
| 1263 |
-
#: ../ui/edit.php:
|
| 1264 |
msgid "State"
|
| 1265 |
msgstr ""
|
| 1266 |
|
| 1267 |
-
#: ../ui/edit.php:
|
| 1268 |
msgid "Deactivate / Draft"
|
| 1269 |
msgstr ""
|
| 1270 |
|
| 1271 |
-
#: ../ui/edit.php:
|
| 1272 |
msgid "Capture Entries"
|
| 1273 |
msgstr ""
|
| 1274 |
|
| 1275 |
-
#: ../ui/edit.php:
|
| 1276 |
msgid "Pin to Menu"
|
| 1277 |
msgstr ""
|
| 1278 |
|
| 1279 |
-
#: ../ui/edit.php:
|
| 1280 |
msgid "View Entries"
|
| 1281 |
msgstr ""
|
| 1282 |
|
| 1283 |
-
#: ../ui/edit.php:
|
| 1284 |
msgid "All"
|
| 1285 |
msgstr ""
|
| 1286 |
|
| 1287 |
-
#: ../ui/edit.php:
|
| 1288 |
msgid "Hide Form"
|
| 1289 |
msgstr ""
|
| 1290 |
|
| 1291 |
-
#: ../ui/edit.php:
|
| 1292 |
msgid "Hide form after successful submission"
|
| 1293 |
msgstr ""
|
| 1294 |
|
| 1295 |
-
#: ../ui/edit.php:
|
| 1296 |
msgid "Honeypot"
|
| 1297 |
msgstr ""
|
| 1298 |
|
| 1299 |
-
#: ../ui/edit.php:
|
| 1300 |
msgid "Place an invisible field to trick spambots"
|
| 1301 |
msgstr ""
|
| 1302 |
|
| 1303 |
-
#: ../ui/edit.php:
|
| 1304 |
msgid "Success Message"
|
| 1305 |
msgstr ""
|
| 1306 |
|
| 1307 |
-
#: ../ui/edit.php:
|
| 1308 |
msgid "Gravatar Field"
|
| 1309 |
msgstr ""
|
| 1310 |
|
| 1311 |
-
#: ../ui/edit.php:
|
| 1312 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1313 |
msgstr ""
|
| 1314 |
|
| 1315 |
-
#: ../ui/edit.php:
|
| 1316 |
msgid "Add New"
|
| 1317 |
msgstr ""
|
| 1318 |
|
| 1319 |
-
#: ../ui/edit.php:
|
| 1320 |
msgid "Remove"
|
| 1321 |
msgstr ""
|
| 1322 |
|
| 1323 |
-
#: ../ui/edit.php:
|
| 1324 |
msgid "Set Element"
|
| 1325 |
msgstr ""
|
| 1326 |
|
| 1327 |
-
#: ../ui/edit.php:
|
| 1328 |
msgid "No description given"
|
| 1329 |
msgstr ""
|
| 1330 |
|
| 1331 |
-
#: ../ui/edit.php:
|
| 1332 |
msgid "or"
|
| 1333 |
msgstr ""
|
| 1334 |
|
| 1335 |
-
#: ../ui/edit.php:
|
| 1336 |
msgid "is"
|
| 1337 |
msgstr ""
|
| 1338 |
|
| 1339 |
-
#: ../ui/edit.php:
|
| 1340 |
msgid "is not"
|
| 1341 |
msgstr ""
|
| 1342 |
|
| 1343 |
-
#: ../ui/edit.php:
|
| 1344 |
msgid "is greater than"
|
| 1345 |
msgstr ""
|
| 1346 |
|
| 1347 |
-
#: ../ui/edit.php:
|
| 1348 |
msgid "is less than"
|
| 1349 |
msgstr ""
|
| 1350 |
|
| 1351 |
-
#: ../ui/edit.php:
|
| 1352 |
msgid "starts with"
|
| 1353 |
msgstr ""
|
| 1354 |
|
| 1355 |
-
#: ../ui/edit.php:
|
| 1356 |
msgid "ends with"
|
| 1357 |
msgstr ""
|
| 1358 |
|
| 1359 |
-
#: ../ui/edit.php:
|
| 1360 |
msgid "contains"
|
| 1361 |
msgstr ""
|
| 1362 |
|
| 1363 |
-
#: ../ui/edit.php:
|
| 1364 |
msgid "Select field first"
|
| 1365 |
msgstr ""
|
| 1366 |
|
| 1367 |
-
#: ../ui/edit.php:
|
|
|
|
| 1368 |
msgid "Add Condition"
|
| 1369 |
msgstr ""
|
| 1370 |
|
| 1371 |
-
#: ../ui/edit.php:
|
| 1372 |
msgid "and"
|
| 1373 |
msgstr ""
|
| 1374 |
|
|
@@ -1393,10 +1443,17 @@ msgid "items"
|
|
| 1393 |
msgstr ""
|
| 1394 |
|
| 1395 |
#: ../ui/extend.php:23
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1396 |
msgid "No licensed addons installed."
|
| 1397 |
msgstr ""
|
| 1398 |
|
| 1399 |
-
#: ../ui/extend.php:
|
| 1400 |
msgid "Already Installed"
|
| 1401 |
msgstr ""
|
| 1402 |
|
|
@@ -1420,6 +1477,38 @@ msgstr ""
|
|
| 1420 |
msgid "Unable to connect or no extensions available."
|
| 1421 |
msgstr ""
|
| 1422 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1423 |
#: ../ui/panels/emailer.php:36
|
| 1424 |
msgid "Enabled"
|
| 1425 |
msgstr ""
|
|
@@ -1461,14 +1550,18 @@ msgstr ""
|
|
| 1461 |
msgid "Recipients"
|
| 1462 |
msgstr ""
|
| 1463 |
|
| 1464 |
-
#: ../ui/panels/emailer.php:84
|
| 1465 |
-
msgid "Comma separated list of email addresses."
|
| 1466 |
msgstr ""
|
| 1467 |
|
| 1468 |
#: ../ui/panels/emailer.php:89
|
| 1469 |
msgid "BCC"
|
| 1470 |
msgstr ""
|
| 1471 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1472 |
#: ../ui/panels/emailer.php:100
|
| 1473 |
msgid "Use %field_slug% to use a value from the form"
|
| 1474 |
msgstr ""
|
|
@@ -1499,7 +1592,11 @@ msgid ""
|
|
| 1499 |
"tracking."
|
| 1500 |
msgstr ""
|
| 1501 |
|
| 1502 |
-
#: ../ui/panels/emailer.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1503 |
msgid ""
|
| 1504 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1505 |
"the form submittable."
|
|
@@ -1510,24 +1607,20 @@ msgid "This will remove all the fields in this row. Are you sure?"
|
|
| 1510 |
msgstr ""
|
| 1511 |
|
| 1512 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1513 |
-
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:
|
| 1514 |
-
#: ../ui/panels/
|
| 1515 |
msgid "Page"
|
| 1516 |
msgstr ""
|
| 1517 |
|
| 1518 |
-
#: ../ui/panels/
|
| 1519 |
-
msgid "Add Row"
|
| 1520 |
-
msgstr ""
|
| 1521 |
-
|
| 1522 |
-
#: ../ui/panels/layout_add_row.php:11
|
| 1523 |
msgid "Add Page"
|
| 1524 |
msgstr ""
|
| 1525 |
|
| 1526 |
-
#: ../ui/panels/
|
| 1527 |
msgid "Drag onto the form grid below"
|
| 1528 |
msgstr ""
|
| 1529 |
|
| 1530 |
-
#: ../ui/panels/
|
| 1531 |
msgid "Add Element"
|
| 1532 |
msgstr ""
|
| 1533 |
|
|
@@ -1568,6 +1661,10 @@ msgstr ""
|
|
| 1568 |
msgid "Don't Use"
|
| 1569 |
msgstr ""
|
| 1570 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1571 |
#: ../ui/panels/processors.php:171
|
| 1572 |
msgid "Add Processor"
|
| 1573 |
msgstr ""
|
| 1 |
+
#, fuzzy
|
| 2 |
msgid ""
|
| 3 |
msgstr ""
|
| 4 |
"Project-Id-Version: Caldera Forms\n"
|
| 5 |
+
"POT-Creation-Date: 2015-08-24 12:16+0200\n"
|
| 6 |
+
"PO-Revision-Date: 2015-07-06 10:23+0200\n"
|
| 7 |
"Last-Translator: \n"
|
| 8 |
"Language-Team: \n"
|
| 9 |
"MIME-Version: 1.0\n"
|
| 10 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Generator: Poedit 1.8.4\n"
|
| 13 |
"X-Poedit-Basepath: .\n"
|
| 14 |
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
| 15 |
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
"X-Poedit-KeywordsList: __;_e\n"
|
| 17 |
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
|
| 19 |
+
#: ../classes/Caldera_Forms_Save_Final.php:152 ../ui/panels/emailer.php:4
|
| 20 |
+
msgid "Caldera Forms Notification"
|
| 21 |
+
msgstr ""
|
| 22 |
+
|
| 23 |
+
#: ../classes/admin.php:124
|
| 24 |
msgid "Invalid Form."
|
| 25 |
msgstr ""
|
| 26 |
|
| 27 |
+
#: ../classes/admin.php:143
|
| 28 |
+
msgid "Starter Contact Form"
|
| 29 |
+
msgstr ""
|
| 30 |
+
|
| 31 |
+
#: ../classes/admin.php:147
|
| 32 |
+
msgid "Variable Pricing Form, with add-on products."
|
| 33 |
+
msgstr ""
|
| 34 |
+
|
| 35 |
+
#: ../classes/admin.php:151
|
| 36 |
+
msgid "Registration Form, with optional additional participants."
|
| 37 |
+
msgstr ""
|
| 38 |
+
|
| 39 |
+
#: ../classes/admin.php:174
|
| 40 |
+
msgid "Form Template"
|
| 41 |
+
msgstr ""
|
| 42 |
+
|
| 43 |
+
#: ../classes/admin.php:177
|
| 44 |
+
msgid "no template - blank form"
|
| 45 |
+
msgstr ""
|
| 46 |
+
|
| 47 |
+
#: ../classes/admin.php:284 ../classes/admin.php:285 ../classes/admin.php:387
|
| 48 |
#: ../ui/entries_toolbar.php:27
|
| 49 |
msgid "Trash"
|
| 50 |
msgstr ""
|
| 51 |
|
| 52 |
+
#: ../classes/admin.php:285 ../classes/admin.php:387
|
| 53 |
#: ../ui/admin_templates.php:9
|
| 54 |
msgid "Restore"
|
| 55 |
msgstr ""
|
| 56 |
|
| 57 |
+
#: ../classes/admin.php:385 ../ui/admin_templates.php:110
|
| 58 |
msgid "Entry"
|
| 59 |
msgstr ""
|
| 60 |
|
| 61 |
+
#: ../classes/admin.php:385
|
| 62 |
msgid "View"
|
| 63 |
msgstr ""
|
| 64 |
|
| 65 |
+
#: ../classes/admin.php:427 ../classes/admin.php:435
|
| 66 |
msgid "Add Form to Page"
|
| 67 |
msgstr ""
|
| 68 |
|
| 69 |
+
#: ../classes/admin.php:428
|
| 70 |
msgid "Insert Form Shortcode"
|
| 71 |
msgstr ""
|
| 72 |
|
| 73 |
+
#: ../classes/admin.php:428 ../classes/widget.php:8
|
| 74 |
msgid "Caldera Form"
|
| 75 |
msgstr ""
|
| 76 |
|
| 77 |
+
#: ../classes/admin.php:455 ../ui/admin.php:124
|
| 78 |
msgid "Deactivate"
|
| 79 |
msgstr ""
|
| 80 |
|
| 81 |
+
#: ../classes/admin.php:459 ../ui/admin.php:124
|
| 82 |
msgid "Activate"
|
| 83 |
msgstr ""
|
| 84 |
|
| 85 |
+
#: ../classes/admin.php:745 ../classes/admin.php:751 ../classes/admin.php:757
|
| 86 |
+
#: ../classes/admin.php:758 ../classes/admin.php:792 ../classes/admin.php:796
|
| 87 |
#: ../includes/filter_addon_plugins.php:50 ../ui/admin.php:32
|
| 88 |
+
#: ../ui/community.php:5 ../ui/edit.php:487 ../ui/extend.php:5
|
| 89 |
msgid "Caldera Forms"
|
| 90 |
msgstr ""
|
| 91 |
|
| 92 |
+
#: ../classes/admin.php:746
|
| 93 |
msgid "Caldera Forms Admin"
|
| 94 |
msgstr ""
|
| 95 |
|
| 96 |
+
#: ../classes/admin.php:746
|
| 97 |
msgid "Forms"
|
| 98 |
msgstr ""
|
| 99 |
|
| 100 |
+
#: ../classes/admin.php:757 ../ui/community.php:8
|
| 101 |
msgid "Community"
|
| 102 |
msgstr ""
|
| 103 |
|
| 104 |
+
#: ../classes/admin.php:758 ../ui/extend.php:8
|
| 105 |
msgid "Extend"
|
| 106 |
msgstr ""
|
| 107 |
|
| 108 |
+
#: ../classes/admin.php:1017 ../classes/admin.php:1179
|
| 109 |
msgid "Sorry, please try again"
|
| 110 |
msgstr ""
|
| 111 |
|
| 112 |
+
#: ../classes/admin.php:1017
|
| 113 |
msgid "Form Delete Error"
|
| 114 |
msgstr ""
|
| 115 |
|
| 116 |
+
#: ../classes/admin.php:1170
|
| 117 |
msgid "Sorry, File is not valid."
|
| 118 |
msgstr ""
|
| 119 |
|
| 120 |
+
#: ../classes/admin.php:1170 ../classes/admin.php:1174
|
| 121 |
+
#: ../classes/admin.php:1179
|
| 122 |
msgid "Form Import Error"
|
| 123 |
msgstr ""
|
| 124 |
|
| 125 |
+
#: ../classes/admin.php:1174
|
| 126 |
msgid "Sorry, File not uploaded."
|
| 127 |
msgstr ""
|
| 128 |
|
| 129 |
+
#: ../classes/admin.php:1188
|
| 130 |
msgid "Form does not exist."
|
| 131 |
msgstr ""
|
| 132 |
|
| 133 |
+
#: ../classes/admin.php:1229
|
| 134 |
msgid "Export selection has expired"
|
| 135 |
msgstr ""
|
| 136 |
|
| 137 |
+
#: ../classes/admin.php:1229
|
| 138 |
msgid "Export Expired"
|
| 139 |
msgstr ""
|
| 140 |
|
| 141 |
+
#: ../classes/admin.php:1404 ../ui/edit.php:585
|
| 142 |
msgid "Form has been successfully submitted. Thank you."
|
| 143 |
msgstr ""
|
| 144 |
|
| 145 |
+
#: ../classes/admin.php:1447 ../classes/admin.php:1463
|
| 146 |
msgid "Layout"
|
| 147 |
msgstr ""
|
| 148 |
|
| 149 |
+
#: ../classes/admin.php:1465
|
| 150 |
msgid "Layout Builder"
|
| 151 |
msgstr ""
|
| 152 |
|
| 153 |
+
#: ../classes/admin.php:1475
|
| 154 |
msgid "Pages"
|
| 155 |
msgstr ""
|
| 156 |
|
| 157 |
+
#: ../classes/admin.php:1477
|
| 158 |
msgid "Form Pages"
|
| 159 |
msgstr ""
|
| 160 |
|
| 161 |
+
#: ../classes/admin.php:1481 ../classes/admin.php:1483
|
| 162 |
+
msgid "Conditions"
|
| 163 |
+
msgstr ""
|
| 164 |
+
|
| 165 |
+
#: ../classes/admin.php:1487
|
| 166 |
msgid "Processors"
|
| 167 |
msgstr ""
|
| 168 |
|
| 169 |
+
#: ../classes/admin.php:1489 ../ui/panels/processors.php:166
|
| 170 |
msgid "Form Processors"
|
| 171 |
msgstr ""
|
| 172 |
|
| 173 |
+
#: ../classes/admin.php:1493 ../classes/admin.php:1495
|
| 174 |
#: ../ui/panels/variables.php:83
|
| 175 |
msgid "Variables"
|
| 176 |
msgstr ""
|
| 177 |
|
| 178 |
+
#: ../classes/admin.php:1502
|
| 179 |
msgid "Responsive"
|
| 180 |
msgstr ""
|
| 181 |
|
| 182 |
+
#: ../classes/admin.php:1504
|
| 183 |
msgid "Resposive Settings"
|
| 184 |
msgstr ""
|
| 185 |
|
| 186 |
+
#: ../classes/admin.php:1508
|
| 187 |
msgid "Grid Collapse"
|
| 188 |
msgstr ""
|
| 189 |
|
| 190 |
+
#: ../classes/admin.php:1510
|
| 191 |
msgid ""
|
| 192 |
"Set the smallest screen size at which to collapse the grid. (based on "
|
| 193 |
"Bootstrap 3.0)"
|
| 194 |
msgstr ""
|
| 195 |
|
| 196 |
+
#: ../classes/admin.php:1517
|
| 197 |
msgid "Maintain grid always"
|
| 198 |
msgstr ""
|
| 199 |
|
| 200 |
+
#: ../classes/admin.php:1537 ../ui/panels/emailer.php:32
|
| 201 |
msgid "Mailer"
|
| 202 |
msgstr ""
|
| 203 |
|
| 204 |
+
#: ../classes/admin.php:1539
|
| 205 |
msgid "Email Notification Settings"
|
| 206 |
msgstr ""
|
| 207 |
|
| 208 |
+
#: ../classes/core.php:396
|
| 209 |
msgid "The wasn't entered correct."
|
| 210 |
msgstr ""
|
| 211 |
|
| 212 |
+
#: ../classes/core.php:396 ../fields/button/config_template.php:9
|
| 213 |
msgid "Reset"
|
| 214 |
msgstr ""
|
| 215 |
|
| 216 |
+
#: ../classes/core.php:545 ../classes/core.php:559 ../classes/core.php:2991
|
| 217 |
msgid "Permission denied."
|
| 218 |
msgstr ""
|
| 219 |
|
| 220 |
+
#: ../classes/core.php:787
|
|
|
|
|
|
|
|
|
|
|
|
|
| 221 |
msgid "Auto Responder"
|
| 222 |
msgstr ""
|
| 223 |
|
| 224 |
+
#: ../classes/core.php:788
|
| 225 |
msgid "Sends out an auto response e-mail"
|
| 226 |
msgstr ""
|
| 227 |
|
| 228 |
+
#: ../classes/core.php:792
|
| 229 |
msgid "Thank you for contacting us"
|
| 230 |
msgstr ""
|
| 231 |
|
| 232 |
+
#: ../classes/core.php:796
|
| 233 |
msgid "Redirect"
|
| 234 |
msgstr ""
|
| 235 |
|
| 236 |
+
#: ../classes/core.php:797
|
| 237 |
msgid "Redirects user to URL on successful submit"
|
| 238 |
msgstr ""
|
| 239 |
|
| 240 |
+
#: ../classes/core.php:802
|
| 241 |
msgid "Increment Value"
|
| 242 |
msgstr ""
|
| 243 |
|
| 244 |
+
#: ../classes/core.php:803
|
| 245 |
msgid "Increment a value per entry."
|
| 246 |
msgstr ""
|
| 247 |
|
| 248 |
+
#: ../classes/core.php:817
|
| 249 |
msgid "Akismet"
|
| 250 |
msgstr ""
|
| 251 |
|
| 252 |
+
#: ../classes/core.php:818
|
| 253 |
msgid "Anti-spam filtering"
|
| 254 |
msgstr ""
|
| 255 |
|
| 256 |
+
#: ../classes/core.php:866
|
| 257 |
msgid "Akismet not setup."
|
| 258 |
msgstr ""
|
| 259 |
|
| 260 |
+
#: ../classes/core.php:1017
|
| 261 |
msgid "Calculation"
|
| 262 |
msgstr ""
|
| 263 |
|
| 264 |
+
#: ../classes/core.php:1020 ../classes/core.php:1042 ../classes/core.php:1079
|
| 265 |
+
#: ../classes/core.php:1162 ../classes/core.php:1265
|
| 266 |
msgid "Special"
|
| 267 |
msgstr ""
|
| 268 |
|
| 269 |
+
#: ../classes/core.php:1020
|
| 270 |
msgid "Math"
|
| 271 |
msgstr ""
|
| 272 |
|
| 273 |
+
#: ../classes/core.php:1021
|
| 274 |
msgid "Calculate values"
|
| 275 |
msgstr ""
|
| 276 |
|
| 277 |
+
#: ../classes/core.php:1028
|
| 278 |
msgid "Total"
|
| 279 |
msgstr ""
|
| 280 |
|
| 281 |
+
#: ../classes/core.php:1040
|
| 282 |
msgid "Range Slider"
|
| 283 |
msgstr ""
|
| 284 |
|
| 285 |
+
#: ../classes/core.php:1043
|
| 286 |
msgid "Range Slider input field"
|
| 287 |
msgstr ""
|
| 288 |
|
| 289 |
+
#: ../classes/core.php:1077
|
| 290 |
msgid "Star Rating"
|
| 291 |
msgstr ""
|
| 292 |
|
| 293 |
+
#: ../classes/core.php:1079
|
| 294 |
msgid "Feedback"
|
| 295 |
msgstr ""
|
| 296 |
|
| 297 |
+
#: ../classes/core.php:1080
|
| 298 |
msgid "Star rating input for feedback"
|
| 299 |
msgstr ""
|
| 300 |
|
| 301 |
+
#: ../classes/core.php:1112
|
| 302 |
msgid "Phone Number"
|
| 303 |
msgstr ""
|
| 304 |
|
| 305 |
+
#: ../classes/core.php:1113
|
| 306 |
msgid "Phone number with masking"
|
| 307 |
msgstr ""
|
| 308 |
|
| 309 |
+
#: ../classes/core.php:1115 ../classes/core.php:1137 ../classes/core.php:1206
|
| 310 |
+
#: ../classes/core.php:1243 ../classes/core.php:1253 ../classes/core.php:1350
|
| 311 |
+
#: ../classes/core.php:1376
|
| 312 |
msgid "Text Fields"
|
| 313 |
msgstr ""
|
| 314 |
|
| 315 |
+
#: ../classes/core.php:1115
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 316 |
msgid "User"
|
| 317 |
msgstr ""
|
| 318 |
|
| 319 |
+
#: ../classes/core.php:1134 ../classes/core.php:1135
|
| 320 |
msgid "Single Line Text"
|
| 321 |
msgstr ""
|
| 322 |
|
| 323 |
+
#: ../classes/core.php:1137 ../classes/core.php:1152 ../classes/core.php:1206
|
| 324 |
+
#: ../classes/core.php:1222 ../classes/core.php:1243 ../classes/core.php:1253
|
| 325 |
+
#: ../classes/core.php:1294 ../classes/core.php:1313 ../classes/core.php:1332
|
| 326 |
+
#: ../ui/edit.php:215
|
| 327 |
+
msgid "Basic"
|
| 328 |
+
msgstr ""
|
| 329 |
+
|
| 330 |
+
#: ../classes/core.php:1148 ../classes/core.php:1152
|
| 331 |
msgid "File"
|
| 332 |
msgstr ""
|
| 333 |
|
| 334 |
+
#: ../classes/core.php:1149
|
| 335 |
msgid "File Uploader"
|
| 336 |
msgstr ""
|
| 337 |
|
| 338 |
+
#: ../classes/core.php:1159
|
| 339 |
msgid "reCAPTCHA"
|
| 340 |
msgstr ""
|
| 341 |
|
| 342 |
+
#: ../classes/core.php:1160
|
| 343 |
msgid "reCAPTCHA anti-spam field"
|
| 344 |
msgstr ""
|
| 345 |
|
| 346 |
+
#: ../classes/core.php:1185
|
| 347 |
msgid "HTML"
|
| 348 |
msgstr ""
|
| 349 |
|
| 350 |
+
#: ../classes/core.php:1186
|
| 351 |
msgid "Add text/html content"
|
| 352 |
msgstr ""
|
| 353 |
|
| 354 |
+
#: ../classes/core.php:1188 ../fields/html/config_template.php:2
|
| 355 |
#: ../processors/akismet/config.php:20
|
| 356 |
msgid "Content"
|
| 357 |
msgstr ""
|
| 358 |
|
| 359 |
+
#: ../classes/core.php:1203 ../classes/core.php:1204
|
| 360 |
msgid "Hidden"
|
| 361 |
msgstr ""
|
| 362 |
|
| 363 |
+
#: ../classes/core.php:1219 ../fields/button/config_template.php:6
|
| 364 |
msgid "Button"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
+
#: ../classes/core.php:1220
|
| 368 |
msgid "Button, Submit and Reset types"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
+
#: ../classes/core.php:1222
|
| 372 |
msgid "Buttons"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
+
#: ../classes/core.php:1240 ../classes/core.php:1241
|
| 376 |
msgid "Email Address"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
+
#: ../classes/core.php:1250 ../classes/core.php:1251
|
| 380 |
msgid "Paragraph Textarea"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
+
#: ../classes/core.php:1263 ../classes/core.php:1264
|
| 384 |
msgid "Toggle Switch"
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
+
#: ../classes/core.php:1265 ../classes/core.php:1294 ../classes/core.php:1313
|
| 388 |
+
#: ../classes/core.php:1332 ../classes/core.php:1405
|
| 389 |
msgid "Select Options"
|
| 390 |
msgstr ""
|
| 391 |
|
| 392 |
+
#: ../classes/core.php:1291 ../classes/core.php:1292
|
| 393 |
msgid "Dropdown Select"
|
| 394 |
msgstr ""
|
| 395 |
|
| 396 |
+
#: ../classes/core.php:1310 ../classes/core.php:1311
|
| 397 |
msgid "Checkbox"
|
| 398 |
msgstr ""
|
| 399 |
|
| 400 |
+
#: ../classes/core.php:1329 ../classes/core.php:1330
|
| 401 |
msgid "Radio"
|
| 402 |
msgstr ""
|
| 403 |
|
| 404 |
+
#: ../classes/core.php:1347 ../classes/core.php:1348
|
| 405 |
msgid "Date Picker"
|
| 406 |
msgstr ""
|
| 407 |
|
| 408 |
+
#: ../classes/core.php:1350 ../classes/core.php:1376
|
| 409 |
msgid "Pickers"
|
| 410 |
msgstr ""
|
| 411 |
|
| 412 |
+
#: ../classes/core.php:1374 ../classes/core.php:1375
|
| 413 |
msgid "Color Picker"
|
| 414 |
msgstr ""
|
| 415 |
|
| 416 |
+
#: ../classes/core.php:1402
|
| 417 |
msgid "State/ Province Select"
|
| 418 |
msgstr ""
|
| 419 |
|
| 420 |
+
#: ../classes/core.php:1403
|
| 421 |
msgid "Dropdown select for US states and Canadian provinces."
|
| 422 |
msgstr ""
|
| 423 |
|
| 424 |
+
#: ../classes/core.php:1417
|
| 425 |
+
msgid "Autocomplete"
|
| 426 |
+
msgstr ""
|
| 427 |
+
|
| 428 |
+
#: ../classes/core.php:1419
|
| 429 |
+
msgid "Pickers,Select Options"
|
| 430 |
+
msgstr ""
|
| 431 |
+
|
| 432 |
+
#: ../classes/core.php:1838
|
| 433 |
msgid "System Tags"
|
| 434 |
msgstr ""
|
| 435 |
|
| 436 |
+
#: ../classes/core.php:2652 ../classes/core.php:2686
|
| 437 |
msgid "Mailer Debug"
|
| 438 |
msgstr ""
|
| 439 |
|
| 440 |
+
#: ../classes/core.php:2752 ../classes/core.php:3688
|
| 441 |
msgid "Invalid form ID"
|
| 442 |
msgstr ""
|
| 443 |
|
| 444 |
+
#: ../classes/core.php:3001 ../classes/core.php:3006 ../classes/core.php:3013
|
| 445 |
+
#: ../classes/core.php:4088 ../classes/core.php:4104 ../classes/core.php:4107
|
| 446 |
+
#: ../classes/core.php:4111
|
| 447 |
msgid "Permission denied or entry does not exist."
|
| 448 |
msgstr ""
|
| 449 |
|
| 450 |
+
#: ../classes/core.php:3053
|
| 451 |
msgid "is required"
|
| 452 |
msgstr ""
|
| 453 |
|
| 454 |
+
#: ../classes/core.php:3938 ../classes/core.php:3944
|
| 455 |
msgid "Form is currently not active."
|
| 456 |
msgstr ""
|
| 457 |
|
| 458 |
+
#: ../classes/core.php:4393
|
| 459 |
msgid "WARNING: Form is in Mailer Debug mode. Disable before going live."
|
| 460 |
msgstr ""
|
| 461 |
|
| 463 |
msgid "Title"
|
| 464 |
msgstr ""
|
| 465 |
|
| 466 |
+
#: ../classes/widget.php:47 ../ui/admin.php:52 ../ui/admin.php:84
|
| 467 |
msgid "Form"
|
| 468 |
msgstr ""
|
| 469 |
|
| 582 |
msgstr ""
|
| 583 |
|
| 584 |
#: ../fields/date_picker/setup.php:32
|
| 585 |
+
msgid "Start Date"
|
| 586 |
+
msgstr ""
|
| 587 |
+
|
| 588 |
+
#: ../fields/date_picker/setup.php:35
|
| 589 |
+
msgid "The starting date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 590 |
+
msgstr ""
|
| 591 |
+
|
| 592 |
+
#: ../fields/date_picker/setup.php:39
|
| 593 |
+
msgid "End Date"
|
| 594 |
+
msgstr ""
|
| 595 |
+
|
| 596 |
+
#: ../fields/date_picker/setup.php:42
|
| 597 |
+
msgid "The ending date of the date picker like +1d, -2y, +4m. 0d for today "
|
| 598 |
+
msgstr ""
|
| 599 |
+
|
| 600 |
+
#: ../fields/date_picker/setup.php:46
|
| 601 |
msgid "language"
|
| 602 |
msgstr ""
|
| 603 |
|
| 604 |
+
#: ../fields/date_picker/setup.php:114
|
| 605 |
msgid "Language to use. e.g. pt-BR"
|
| 606 |
msgstr ""
|
| 607 |
|
| 608 |
#: ../fields/dropdown/config_template.php:2 ../fields/email/config.php:2
|
| 609 |
#: ../fields/paragraph/config_template.php:2 ../fields/phone/config.php:2
|
| 610 |
+
#: ../fields/select2/field/config.php:3 ../fields/text/config.php:2
|
| 611 |
msgid "Placeholder"
|
| 612 |
msgstr ""
|
| 613 |
|
| 616 |
msgstr ""
|
| 617 |
|
| 618 |
#: ../fields/file/config_template.php:9
|
| 619 |
+
msgid "Allow Multiple"
|
| 620 |
+
msgstr ""
|
| 621 |
+
|
| 622 |
+
#: ../fields/file/config_template.php:16
|
| 623 |
msgid "Allowed Types"
|
| 624 |
msgstr ""
|
| 625 |
|
| 626 |
+
#: ../fields/file/config_template.php:19
|
| 627 |
msgid "Comma separated eg. jpg,pdf,txt"
|
| 628 |
msgstr ""
|
| 629 |
|
| 679 |
msgid "Border Radius"
|
| 680 |
msgstr ""
|
| 681 |
|
| 682 |
+
#: ../fields/hidden/setup.php:2 ../ui/edit.php:151 ../ui/edit.php:180
|
| 683 |
#: ../ui/panels/variables.php:12
|
| 684 |
msgid "Value"
|
| 685 |
msgstr ""
|
| 712 |
msgid "Track"
|
| 713 |
msgstr ""
|
| 714 |
|
| 715 |
+
#: ../fields/range_slider/config.php:23 ../fields/select2/field/config.php:20
|
| 716 |
msgid "Highlight"
|
| 717 |
msgstr ""
|
| 718 |
|
| 720 |
msgid "Handle"
|
| 721 |
msgstr ""
|
| 722 |
|
| 723 |
+
#: ../fields/range_slider/config.php:35 ../fields/select2/field/config.php:29
|
| 724 |
msgid "Border"
|
| 725 |
msgstr ""
|
| 726 |
|
| 786 |
msgid "No Site Key Added"
|
| 787 |
msgstr ""
|
| 788 |
|
| 789 |
+
#: ../fields/select2/field/config.php:11
|
| 790 |
+
msgid "Multiple"
|
| 791 |
+
msgstr ""
|
| 792 |
+
|
| 793 |
+
#: ../fields/select2/field/config.php:15
|
| 794 |
+
msgid "Enable multiple selections"
|
| 795 |
+
msgstr ""
|
| 796 |
+
|
| 797 |
#: ../fields/star-rate/config.php:2
|
| 798 |
msgid "Number of Stars"
|
| 799 |
msgstr ""
|
| 910 |
msgid "Inactive Class"
|
| 911 |
msgstr ""
|
| 912 |
|
| 913 |
+
#: ../fields/toggle_switch/field.php:39 ../ui/edit.php:530 ../ui/edit.php:538
|
| 914 |
+
#: ../ui/edit.php:571 ../ui/edit.php:578
|
| 915 |
msgid "Enable"
|
| 916 |
msgstr ""
|
| 917 |
|
| 966 |
msgid "Custom Class"
|
| 967 |
msgstr ""
|
| 968 |
|
| 969 |
+
#: ../includes/field_processors.php:45
|
| 970 |
msgid "File type not allowed. Allowed types are: "
|
| 971 |
msgstr ""
|
| 972 |
|
| 973 |
+
#: ../includes/field_processors.php:47
|
| 974 |
msgid "File type needs to be"
|
| 975 |
msgstr ""
|
| 976 |
|
| 977 |
+
#: ../processors/akismet/config.php:2 ../ui/edit.php:372
|
| 978 |
+
#: ../ui/panels/conditions.php:54 ../ui/panels/variables.php:10
|
| 979 |
msgid "Name"
|
| 980 |
msgstr ""
|
| 981 |
|
| 1019 |
msgid "Message"
|
| 1020 |
msgstr ""
|
| 1021 |
|
| 1022 |
+
#: ../processors/classes/get_data.php:76
|
| 1023 |
+
#, php-format
|
| 1024 |
+
msgid "%s is required"
|
| 1025 |
+
msgstr ""
|
| 1026 |
+
|
| 1027 |
#: ../processors/increment/config.php:2
|
| 1028 |
msgid "Increment Start"
|
| 1029 |
msgstr ""
|
| 1100 |
msgid "Grid"
|
| 1101 |
msgstr ""
|
| 1102 |
|
| 1103 |
+
#: ../ui/admin.php:85 ../ui/admin.php:140
|
| 1104 |
msgid "Entries"
|
| 1105 |
msgstr ""
|
| 1106 |
|
| 1107 |
+
#: ../ui/admin.php:102 ../ui/edit.php:531 ../ui/edit.php:539
|
| 1108 |
#: ../ui/panels/emailer.php:35
|
| 1109 |
msgid "Disabled"
|
| 1110 |
msgstr ""
|
| 1111 |
|
| 1112 |
+
#: ../ui/admin.php:112
|
| 1113 |
msgid "Mailer Debug enabled."
|
| 1114 |
msgstr ""
|
| 1115 |
|
| 1116 |
+
#: ../ui/admin.php:116 ../ui/entries.php:14
|
| 1117 |
msgid "Edit"
|
| 1118 |
msgstr ""
|
| 1119 |
|
| 1120 |
+
#: ../ui/admin.php:141
|
| 1121 |
msgid "Export"
|
| 1122 |
msgstr ""
|
| 1123 |
|
| 1124 |
+
#: ../ui/admin.php:142
|
| 1125 |
msgid "Clone Form"
|
| 1126 |
msgstr ""
|
| 1127 |
|
| 1128 |
+
#: ../ui/admin.php:142
|
| 1129 |
msgid "Clone"
|
| 1130 |
msgstr ""
|
| 1131 |
|
| 1132 |
+
#: ../ui/admin.php:143
|
| 1133 |
msgid "This will delete this form permanently. Continue?"
|
| 1134 |
msgstr ""
|
| 1135 |
|
| 1136 |
+
#: ../ui/admin.php:143
|
| 1137 |
msgid "Delete"
|
| 1138 |
msgstr ""
|
| 1139 |
|
| 1140 |
+
#: ../ui/admin.php:163
|
| 1141 |
msgid "You don't have any forms."
|
| 1142 |
msgstr ""
|
| 1143 |
|
| 1144 |
+
#: ../ui/admin.php:204
|
| 1145 |
msgid "An form name is required"
|
| 1146 |
msgstr ""
|
| 1147 |
|
| 1148 |
+
#: ../ui/admin.php:231
|
| 1149 |
msgid ""
|
| 1150 |
"Looks like something is not working. Please try again a little later or post "
|
| 1151 |
"to the <a href=\"http://wordpress.org/support/plugin/caldera-forms\" target="
|
| 1168 |
msgid "Delete Permanently"
|
| 1169 |
msgstr ""
|
| 1170 |
|
| 1171 |
+
#: ../ui/admin_templates.php:19 ../ui/admin_templates.php:48 ../ui/edit.php:507
|
|
|
|
| 1172 |
msgid "Form Name"
|
| 1173 |
msgstr ""
|
| 1174 |
|
| 1176 |
msgid "Form File"
|
| 1177 |
msgstr ""
|
| 1178 |
|
| 1179 |
+
#: ../ui/admin_templates.php:54 ../ui/edit.php:410
|
| 1180 |
msgid "Description"
|
| 1181 |
msgstr ""
|
| 1182 |
|
| 1183 |
+
#: ../ui/admin_templates.php:72 ../ui/edit.php:364
|
| 1184 |
msgid "ID"
|
| 1185 |
msgstr ""
|
| 1186 |
|
| 1200 |
msgid "Form has successfully been submitted. Thank you."
|
| 1201 |
msgstr ""
|
| 1202 |
|
| 1203 |
+
#: ../ui/edit.php:99
|
| 1204 |
msgid "Auto Populate"
|
| 1205 |
msgstr ""
|
| 1206 |
|
| 1207 |
+
#: ../ui/edit.php:105
|
| 1208 |
msgid "Auto Type"
|
| 1209 |
msgstr ""
|
| 1210 |
|
| 1211 |
+
#: ../ui/edit.php:108
|
| 1212 |
msgid "Select a source"
|
| 1213 |
msgstr ""
|
| 1214 |
|
| 1215 |
+
#: ../ui/edit.php:109 ../ui/edit.php:135
|
| 1216 |
msgid "Post Type"
|
| 1217 |
msgstr ""
|
| 1218 |
|
| 1219 |
+
#: ../ui/edit.php:110 ../ui/edit.php:119
|
| 1220 |
msgid "Taxonomy"
|
| 1221 |
msgstr ""
|
| 1222 |
|
| 1223 |
+
#: ../ui/edit.php:167
|
| 1224 |
msgid "Add Option"
|
| 1225 |
msgstr ""
|
| 1226 |
|
| 1227 |
+
#: ../ui/edit.php:168
|
| 1228 |
msgid "Bulk Insert"
|
| 1229 |
msgstr ""
|
| 1230 |
|
| 1231 |
+
#: ../ui/edit.php:171
|
| 1232 |
msgid "Single option per line. These replace the current list."
|
| 1233 |
msgstr ""
|
| 1234 |
|
| 1235 |
+
#: ../ui/edit.php:172
|
| 1236 |
msgid "Insert Options"
|
| 1237 |
msgstr ""
|
| 1238 |
|
| 1239 |
+
#: ../ui/edit.php:176
|
| 1240 |
msgid "No Default"
|
| 1241 |
msgstr ""
|
| 1242 |
|
| 1243 |
+
#: ../ui/edit.php:177
|
| 1244 |
msgid "Show Values"
|
| 1245 |
msgstr ""
|
| 1246 |
|
| 1247 |
+
#: ../ui/edit.php:181
|
| 1248 |
msgid "Label"
|
| 1249 |
msgstr ""
|
| 1250 |
|
| 1251 |
+
#: ../ui/edit.php:342
|
| 1252 |
msgid "Elements"
|
| 1253 |
msgstr ""
|
| 1254 |
|
| 1255 |
+
#: ../ui/edit.php:354
|
| 1256 |
+
msgid "Element Type"
|
| 1257 |
msgstr ""
|
| 1258 |
|
| 1259 |
+
#: ../ui/edit.php:379
|
| 1260 |
+
msgid "Hide Label"
|
| 1261 |
msgstr ""
|
| 1262 |
|
| 1263 |
+
#: ../ui/edit.php:386
|
| 1264 |
+
msgid "Slug"
|
| 1265 |
msgstr ""
|
| 1266 |
|
| 1267 |
+
#: ../ui/edit.php:392
|
| 1268 |
+
msgid "Condition"
|
| 1269 |
msgstr ""
|
| 1270 |
|
| 1271 |
+
#: ../ui/edit.php:397
|
| 1272 |
+
msgid "Disable"
|
| 1273 |
msgstr ""
|
| 1274 |
|
| 1275 |
+
#: ../ui/edit.php:403
|
| 1276 |
msgid "Required"
|
| 1277 |
msgstr ""
|
| 1278 |
|
| 1279 |
+
#: ../ui/edit.php:417
|
| 1280 |
msgid "Show in Entry List"
|
| 1281 |
msgstr ""
|
| 1282 |
|
| 1283 |
+
#: ../ui/edit.php:427
|
| 1284 |
msgid ""
|
| 1285 |
"Are you sure you want to remove this field?. 'Cancel' to stop. 'OK' to delete"
|
| 1286 |
msgstr ""
|
| 1287 |
|
| 1288 |
+
#: ../ui/edit.php:427
|
| 1289 |
msgid "Delete Element"
|
| 1290 |
msgstr ""
|
| 1291 |
|
| 1292 |
+
#: ../ui/edit.php:493 ../ui/edit.php:505
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1293 |
msgid "General Settings"
|
| 1294 |
msgstr ""
|
| 1295 |
|
| 1296 |
+
#: ../ui/edit.php:498
|
| 1297 |
msgid "Updated Successfully"
|
| 1298 |
msgstr ""
|
| 1299 |
|
| 1300 |
+
#: ../ui/edit.php:500
|
| 1301 |
msgid "Update Form"
|
| 1302 |
msgstr ""
|
| 1303 |
|
| 1304 |
+
#: ../ui/edit.php:501
|
| 1305 |
msgid "Preview Form"
|
| 1306 |
msgstr ""
|
| 1307 |
|
| 1308 |
+
#: ../ui/edit.php:514
|
| 1309 |
msgid "Form Description"
|
| 1310 |
msgstr ""
|
| 1311 |
|
| 1312 |
+
#: ../ui/edit.php:521
|
| 1313 |
msgid "State"
|
| 1314 |
msgstr ""
|
| 1315 |
|
| 1316 |
+
#: ../ui/edit.php:523
|
| 1317 |
msgid "Deactivate / Draft"
|
| 1318 |
msgstr ""
|
| 1319 |
|
| 1320 |
+
#: ../ui/edit.php:528
|
| 1321 |
msgid "Capture Entries"
|
| 1322 |
msgstr ""
|
| 1323 |
|
| 1324 |
+
#: ../ui/edit.php:536
|
| 1325 |
msgid "Pin to Menu"
|
| 1326 |
msgstr ""
|
| 1327 |
|
| 1328 |
+
#: ../ui/edit.php:545
|
| 1329 |
msgid "View Entries"
|
| 1330 |
msgstr ""
|
| 1331 |
|
| 1332 |
+
#: ../ui/edit.php:547
|
| 1333 |
msgid "All"
|
| 1334 |
msgstr ""
|
| 1335 |
|
| 1336 |
+
#: ../ui/edit.php:569
|
| 1337 |
msgid "Hide Form"
|
| 1338 |
msgstr ""
|
| 1339 |
|
| 1340 |
+
#: ../ui/edit.php:571
|
| 1341 |
msgid "Hide form after successful submission"
|
| 1342 |
msgstr ""
|
| 1343 |
|
| 1344 |
+
#: ../ui/edit.php:576
|
| 1345 |
msgid "Honeypot"
|
| 1346 |
msgstr ""
|
| 1347 |
|
| 1348 |
+
#: ../ui/edit.php:578
|
| 1349 |
msgid "Place an invisible field to trick spambots"
|
| 1350 |
msgstr ""
|
| 1351 |
|
| 1352 |
+
#: ../ui/edit.php:583
|
| 1353 |
msgid "Success Message"
|
| 1354 |
msgstr ""
|
| 1355 |
|
| 1356 |
+
#: ../ui/edit.php:589
|
| 1357 |
msgid "Gravatar Field"
|
| 1358 |
msgstr ""
|
| 1359 |
|
| 1360 |
+
#: ../ui/edit.php:596
|
| 1361 |
msgid "Used when viewing an entry from a non-logged in user."
|
| 1362 |
msgstr ""
|
| 1363 |
|
| 1364 |
+
#: ../ui/edit.php:670
|
| 1365 |
msgid "Add New"
|
| 1366 |
msgstr ""
|
| 1367 |
|
| 1368 |
+
#: ../ui/edit.php:735 ../ui/edit.php:769
|
| 1369 |
msgid "Remove"
|
| 1370 |
msgstr ""
|
| 1371 |
|
| 1372 |
+
#: ../ui/edit.php:825
|
| 1373 |
msgid "Set Element"
|
| 1374 |
msgstr ""
|
| 1375 |
|
| 1376 |
+
#: ../ui/edit.php:828
|
| 1377 |
msgid "No description given"
|
| 1378 |
msgstr ""
|
| 1379 |
|
| 1380 |
+
#: ../ui/edit.php:890 ../ui/panels/conditions.php:75
|
| 1381 |
msgid "or"
|
| 1382 |
msgstr ""
|
| 1383 |
|
| 1384 |
+
#: ../ui/edit.php:899 ../ui/edit.php:922 ../ui/panels/conditions.php:102
|
| 1385 |
msgid "is"
|
| 1386 |
msgstr ""
|
| 1387 |
|
| 1388 |
+
#: ../ui/edit.php:900 ../ui/edit.php:923 ../ui/panels/conditions.php:103
|
| 1389 |
msgid "is not"
|
| 1390 |
msgstr ""
|
| 1391 |
|
| 1392 |
+
#: ../ui/edit.php:901 ../ui/edit.php:924 ../ui/panels/conditions.php:104
|
| 1393 |
msgid "is greater than"
|
| 1394 |
msgstr ""
|
| 1395 |
|
| 1396 |
+
#: ../ui/edit.php:902 ../ui/edit.php:925 ../ui/panels/conditions.php:105
|
| 1397 |
msgid "is less than"
|
| 1398 |
msgstr ""
|
| 1399 |
|
| 1400 |
+
#: ../ui/edit.php:903 ../ui/edit.php:926 ../ui/panels/conditions.php:106
|
| 1401 |
msgid "starts with"
|
| 1402 |
msgstr ""
|
| 1403 |
|
| 1404 |
+
#: ../ui/edit.php:904 ../ui/edit.php:927 ../ui/panels/conditions.php:107
|
| 1405 |
msgid "ends with"
|
| 1406 |
msgstr ""
|
| 1407 |
|
| 1408 |
+
#: ../ui/edit.php:905 ../ui/edit.php:928 ../ui/panels/conditions.php:108
|
| 1409 |
msgid "contains"
|
| 1410 |
msgstr ""
|
| 1411 |
|
| 1412 |
+
#: ../ui/edit.php:907 ../ui/edit.php:930
|
| 1413 |
msgid "Select field first"
|
| 1414 |
msgstr ""
|
| 1415 |
|
| 1416 |
+
#: ../ui/edit.php:912 ../ui/panels/conditions.php:5
|
| 1417 |
+
#: ../ui/panels/conditions.php:129
|
| 1418 |
msgid "Add Condition"
|
| 1419 |
msgstr ""
|
| 1420 |
|
| 1421 |
+
#: ../ui/edit.php:918 ../ui/panels/conditions.php:85
|
| 1422 |
msgid "and"
|
| 1423 |
msgstr ""
|
| 1424 |
|
| 1443 |
msgstr ""
|
| 1444 |
|
| 1445 |
#: ../ui/extend.php:23
|
| 1446 |
+
msgid ""
|
| 1447 |
+
"Note: We are currently moving Caldera Forms licenses to the CalderaWP "
|
| 1448 |
+
"License Manager. This panel will be removed in a future version of Caldera "
|
| 1449 |
+
"Forms."
|
| 1450 |
+
msgstr ""
|
| 1451 |
+
|
| 1452 |
+
#: ../ui/extend.php:29
|
| 1453 |
msgid "No licensed addons installed."
|
| 1454 |
msgstr ""
|
| 1455 |
|
| 1456 |
+
#: ../ui/extend.php:54
|
| 1457 |
msgid "Already Installed"
|
| 1458 |
msgstr ""
|
| 1459 |
|
| 1477 |
msgid "Unable to connect or no extensions available."
|
| 1478 |
msgstr ""
|
| 1479 |
|
| 1480 |
+
#: ../ui/panels/conditions.php:65
|
| 1481 |
+
msgid "Show"
|
| 1482 |
+
msgstr ""
|
| 1483 |
+
|
| 1484 |
+
#: ../ui/panels/conditions.php:66
|
| 1485 |
+
msgid "Hide"
|
| 1486 |
+
msgstr ""
|
| 1487 |
+
|
| 1488 |
+
#: ../ui/panels/conditions.php:69
|
| 1489 |
+
msgid "Add Conditional Line"
|
| 1490 |
+
msgstr ""
|
| 1491 |
+
|
| 1492 |
+
#: ../ui/panels/conditions.php:83
|
| 1493 |
+
msgid "if"
|
| 1494 |
+
msgstr ""
|
| 1495 |
+
|
| 1496 |
+
#: ../ui/panels/conditions.php:133
|
| 1497 |
+
msgid "Are you sure you want to remove this condition?"
|
| 1498 |
+
msgstr ""
|
| 1499 |
+
|
| 1500 |
+
#: ../ui/panels/conditions.php:133
|
| 1501 |
+
msgid "Remove Condition"
|
| 1502 |
+
msgstr ""
|
| 1503 |
+
|
| 1504 |
+
#: ../ui/panels/conditions.php:137
|
| 1505 |
+
msgid "Applied Fields"
|
| 1506 |
+
msgstr ""
|
| 1507 |
+
|
| 1508 |
+
#: ../ui/panels/conditions.php:138
|
| 1509 |
+
msgid "Select the fields to apply this condition to."
|
| 1510 |
+
msgstr ""
|
| 1511 |
+
|
| 1512 |
#: ../ui/panels/emailer.php:36
|
| 1513 |
msgid "Enabled"
|
| 1514 |
msgstr ""
|
| 1550 |
msgid "Recipients"
|
| 1551 |
msgstr ""
|
| 1552 |
|
| 1553 |
+
#: ../ui/panels/emailer.php:84
|
| 1554 |
+
msgid "Comma separated list of email addresses to send the message to."
|
| 1555 |
msgstr ""
|
| 1556 |
|
| 1557 |
#: ../ui/panels/emailer.php:89
|
| 1558 |
msgid "BCC"
|
| 1559 |
msgstr ""
|
| 1560 |
|
| 1561 |
+
#: ../ui/panels/emailer.php:92
|
| 1562 |
+
msgid "Comma separated list of email addresses to send a BCC to."
|
| 1563 |
+
msgstr ""
|
| 1564 |
+
|
| 1565 |
#: ../ui/panels/emailer.php:100
|
| 1566 |
msgid "Use %field_slug% to use a value from the form"
|
| 1567 |
msgstr ""
|
| 1592 |
"tracking."
|
| 1593 |
msgstr ""
|
| 1594 |
|
| 1595 |
+
#: ../ui/panels/emailer.php:118
|
| 1596 |
+
msgid "Learn more here"
|
| 1597 |
+
msgstr ""
|
| 1598 |
+
|
| 1599 |
+
#: ../ui/panels/emailer.php:130
|
| 1600 |
msgid ""
|
| 1601 |
"Please add a \"Button\" element and set it to \"Submit\" if you want to have "
|
| 1602 |
"the form submittable."
|
| 1607 |
msgstr ""
|
| 1608 |
|
| 1609 |
#: ../ui/panels/layout.php:14 ../ui/panels/layout.php:18
|
| 1610 |
+
#: ../ui/panels/layout.php:22 ../ui/panels/layout.php:109
|
| 1611 |
+
#: ../ui/panels/layout_toolbar.php:4 ../ui/panels/pages.php:14
|
| 1612 |
msgid "Page"
|
| 1613 |
msgstr ""
|
| 1614 |
|
| 1615 |
+
#: ../ui/panels/layout_toolbar.php:11
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1616 |
msgid "Add Page"
|
| 1617 |
msgstr ""
|
| 1618 |
|
| 1619 |
+
#: ../ui/panels/layout_toolbar.php:12
|
| 1620 |
msgid "Drag onto the form grid below"
|
| 1621 |
msgstr ""
|
| 1622 |
|
| 1623 |
+
#: ../ui/panels/layout_toolbar.php:15
|
| 1624 |
msgid "Add Element"
|
| 1625 |
msgstr ""
|
| 1626 |
|
| 1661 |
msgid "Don't Use"
|
| 1662 |
msgstr ""
|
| 1663 |
|
| 1664 |
+
#: ../ui/panels/processors.php:126
|
| 1665 |
+
msgid "Add Conditional Group"
|
| 1666 |
+
msgstr ""
|
| 1667 |
+
|
| 1668 |
#: ../ui/panels/processors.php:171
|
| 1669 |
msgid "Add Processor"
|
| 1670 |
msgstr ""
|
processors/classes/get_data.php
ADDED
|
@@ -0,0 +1,231 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Prepare data from processor
|
| 4 |
+
*
|
| 5 |
+
* @package Caldera_Forms
|
| 6 |
+
* @author Josh Pollock <Josh@CalderaWP.com>
|
| 7 |
+
* @license GPL-2.0+
|
| 8 |
+
* @link
|
| 9 |
+
* @copyright 2015 CalderaWP LLC
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
class Caldera_Forms_Processor_Get_Data {
|
| 13 |
+
|
| 14 |
+
/**
|
| 15 |
+
* The values from current submission
|
| 16 |
+
*
|
| 17 |
+
* @since 1.3.0
|
| 18 |
+
*
|
| 19 |
+
* @access private
|
| 20 |
+
*
|
| 21 |
+
* @var array|null
|
| 22 |
+
*/
|
| 23 |
+
private $values;
|
| 24 |
+
|
| 25 |
+
/**
|
| 26 |
+
* The errors from current submission
|
| 27 |
+
*
|
| 28 |
+
* @since 1.3.0
|
| 29 |
+
*
|
| 30 |
+
* @access private
|
| 31 |
+
*
|
| 32 |
+
* @var array|null
|
| 33 |
+
*/
|
| 34 |
+
private $errors;
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* The fields needed from this processor
|
| 38 |
+
*
|
| 39 |
+
* @since 1.3.0
|
| 40 |
+
*
|
| 41 |
+
* @access private
|
| 42 |
+
*
|
| 43 |
+
* @var array
|
| 44 |
+
*/
|
| 45 |
+
private $fields;
|
| 46 |
+
|
| 47 |
+
/**
|
| 48 |
+
* Contsructor for class
|
| 49 |
+
*
|
| 50 |
+
* @since 1.3.0
|
| 51 |
+
*
|
| 52 |
+
* @param array $config Proccessor config
|
| 53 |
+
* @param array $form Form config
|
| 54 |
+
* @param array $fields Fields array
|
| 55 |
+
*/
|
| 56 |
+
function __construct( $config, $form, $fields ) {
|
| 57 |
+
if ( ! empty( $fields ) && is_array( $fields ) ) {
|
| 58 |
+
$this->set_fields( $fields, $config, $form );
|
| 59 |
+
$this->set_value( $config, $form );
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Validate, and set fields property
|
| 66 |
+
*
|
| 67 |
+
* @since 1.3.0
|
| 68 |
+
*
|
| 69 |
+
* @access protected
|
| 70 |
+
*
|
| 71 |
+
* @param array $fields Fields array
|
| 72 |
+
* @param array $config Proccessor config
|
| 73 |
+
* @param array $form Form config
|
| 74 |
+
*/
|
| 75 |
+
protected function set_fields( $fields, $config, $form ) {
|
| 76 |
+
$message_pattern = __( '%s is required', 'caldera-forms' );
|
| 77 |
+
$default_args = array(
|
| 78 |
+
'message' => false,
|
| 79 |
+
'default' => false,
|
| 80 |
+
'sanatize' => 'strip_tags',
|
| 81 |
+
'magic' => true,
|
| 82 |
+
'required' => true,
|
| 83 |
+
);
|
| 84 |
+
|
| 85 |
+
|
| 86 |
+
foreach( $fields as $field => $args ) {
|
| 87 |
+
if ( ( 0 == $field || is_int( $field ) ) ) {
|
| 88 |
+
if ( is_string( $args ) ) {
|
| 89 |
+
$key = $field;
|
| 90 |
+
$fields[ $field ] = $default_args;
|
| 91 |
+
unset( $fields[ $field ] );
|
| 92 |
+
}elseif ( 0 == $field || is_int( $field ) && is_array( $args ) &&isset( $args[ 'id' ]) ) {
|
| 93 |
+
$key = $args[ 'id' ];
|
| 94 |
+
$fields[ $key ] = $args;
|
| 95 |
+
unset( $fields[ $field ] );
|
| 96 |
+
}else{
|
| 97 |
+
unset( $fields[ $field ] );
|
| 98 |
+
continue;
|
| 99 |
+
}
|
| 100 |
+
}else{
|
| 101 |
+
$key = $field;
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
$fields[ $key ] = wp_parse_args( $args, $default_args );
|
| 105 |
+
|
| 106 |
+
if ( isset( $config[ $key ] ) ) {
|
| 107 |
+
$_field = Caldera_Forms::get_field_by_slug( str_replace( '%', '', $config[ $key ] ), $form );
|
| 108 |
+
} else {
|
| 109 |
+
$_field = null;
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
if ( is_array( $_field ) ) {
|
| 113 |
+
$fields[ $key ][ 'config_field' ] = $_field[ 'ID' ];
|
| 114 |
+
}else{
|
| 115 |
+
$fields[ $key ][ 'config_field' ] = false;
|
| 116 |
+
}
|
| 117 |
+
if ( false === $fields[ $key][ 'message' ] ) {
|
| 118 |
+
$fields[ $key ][ 'message' ] = sprintf( $message_pattern, $args[ 'label' ] );
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
$this->fields = $fields;
|
| 124 |
+
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
+
/**
|
| 128 |
+
* Get values from POST data and set in the value property
|
| 129 |
+
*
|
| 130 |
+
* @since 1.3.0
|
| 131 |
+
*
|
| 132 |
+
* @access protected
|
| 133 |
+
*
|
| 134 |
+
* @param $config
|
| 135 |
+
* @param $form
|
| 136 |
+
*/
|
| 137 |
+
protected function set_value( $config, $form ) {
|
| 138 |
+
foreach ( $this->fields as $field => $args ) {
|
| 139 |
+
|
| 140 |
+
if ( isset( $config[ $field ]) ) {
|
| 141 |
+
if ( $args[ 'magic' ] ) {
|
| 142 |
+
$value = Caldera_Forms::do_magic_tags( $config[ $field ] );
|
| 143 |
+
} else {
|
| 144 |
+
$value = $config[ $field ];
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
$field_id_passed = strpos( $value, 'fld_' );
|
| 148 |
+
if ( false !== $field_id_passed ) {
|
| 149 |
+
$value = Caldera_Forms::get_field_data( $value, $form );
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
}else{
|
| 153 |
+
$value = null;
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
if ( ! empty( $value ) ) {
|
| 157 |
+
$value = call_user_func( $args['sanatize'], $value );
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
if ( ! empty( $value ) ) {
|
| 161 |
+
$this->values[ $field ] = $value;
|
| 162 |
+
|
| 163 |
+
}else{
|
| 164 |
+
if ( $args[ 'required' ] ) {
|
| 165 |
+
$this->add_error( $args[ 'message' ] );
|
| 166 |
+
}else{
|
| 167 |
+
$this->values[ $field ] = null;
|
| 168 |
+
}
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
|
| 176 |
+
/**
|
| 177 |
+
* Add an error message to the errors property
|
| 178 |
+
*
|
| 179 |
+
* @since 1.3.0
|
| 180 |
+
*
|
| 181 |
+
* @param string $message Message for error
|
| 182 |
+
*/
|
| 183 |
+
public function add_error( $message ) {
|
| 184 |
+
if ( is_null( $this->errors ) ) {
|
| 185 |
+
$this->errors = array(
|
| 186 |
+
'type' => 'error',
|
| 187 |
+
'note' => ''
|
| 188 |
+
);
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
$this->errors[ 'note' ] .= $message . "<br>";
|
| 192 |
+
|
| 193 |
+
}
|
| 194 |
+
|
| 195 |
+
/**
|
| 196 |
+
* Get the errors
|
| 197 |
+
*
|
| 198 |
+
* @since 1.3.0
|
| 199 |
+
*
|
| 200 |
+
* @return array|null
|
| 201 |
+
*/
|
| 202 |
+
public function get_errors() {
|
| 203 |
+
return $this->errors;
|
| 204 |
+
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
/**
|
| 208 |
+
* Get the values
|
| 209 |
+
*
|
| 210 |
+
* @since 1.3.0
|
| 211 |
+
*
|
| 212 |
+
* @return array|null
|
| 213 |
+
*/
|
| 214 |
+
public function get_values() {
|
| 215 |
+
return $this->values;
|
| 216 |
+
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
/**
|
| 220 |
+
* Get prepared fields
|
| 221 |
+
*
|
| 222 |
+
* @since 1.3.0
|
| 223 |
+
*
|
| 224 |
+
* @return array|null
|
| 225 |
+
*/
|
| 226 |
+
public function get_fields() {
|
| 227 |
+
return $this->fields;
|
| 228 |
+
|
| 229 |
+
}
|
| 230 |
+
|
| 231 |
+
}
|
processors/classes/load.php
ADDED
|
@@ -0,0 +1,209 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Load processors
|
| 4 |
+
*
|
| 5 |
+
* @package Caldera_Forms
|
| 6 |
+
* @author Josh Pollock <Josh@CalderaWP.com>
|
| 7 |
+
* @license GPL-2.0+
|
| 8 |
+
* @link
|
| 9 |
+
* @copyright 2015 CalderaWP LLC
|
| 10 |
+
*/
|
| 11 |
+
class Caldera_Forms_Processor_Load {
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* Holds validated processors.
|
| 15 |
+
*
|
| 16 |
+
* @since 1.3.0
|
| 17 |
+
*
|
| 18 |
+
* @access private
|
| 19 |
+
*
|
| 20 |
+
* @var array
|
| 21 |
+
*/
|
| 22 |
+
private $processors = array();
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Holds accumulated errors notices.
|
| 26 |
+
*
|
| 27 |
+
* @since 1.3.0
|
| 28 |
+
*
|
| 29 |
+
* @access private
|
| 30 |
+
*
|
| 31 |
+
* @var array
|
| 32 |
+
*/
|
| 33 |
+
private $notices = array();
|
| 34 |
+
|
| 35 |
+
/**
|
| 36 |
+
* Holds class instance
|
| 37 |
+
*
|
| 38 |
+
* @since 1.3.0
|
| 39 |
+
*
|
| 40 |
+
* @access private
|
| 41 |
+
*
|
| 42 |
+
* @var Caldera_Forms_Processor_Load
|
| 43 |
+
*/
|
| 44 |
+
private static $init;
|
| 45 |
+
|
| 46 |
+
/**
|
| 47 |
+
* Constructor for class
|
| 48 |
+
*
|
| 49 |
+
* @since 1.3.0
|
| 50 |
+
*
|
| 51 |
+
* @access private
|
| 52 |
+
*
|
| 53 |
+
* @var array
|
| 54 |
+
*/
|
| 55 |
+
private function __construct() {
|
| 56 |
+
$this->load_processors();
|
| 57 |
+
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
/**
|
| 61 |
+
* Get all valid processors
|
| 62 |
+
*
|
| 63 |
+
* @since 1.3.0
|
| 64 |
+
*
|
| 65 |
+
* @return array
|
| 66 |
+
*/
|
| 67 |
+
public function get_processors() {
|
| 68 |
+
return $this->processors;
|
| 69 |
+
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
/**
|
| 73 |
+
* Get any errors that were generated by invalid processors.
|
| 74 |
+
*
|
| 75 |
+
* @since 1.3.0
|
| 76 |
+
*
|
| 77 |
+
* @return array
|
| 78 |
+
*/
|
| 79 |
+
public function get_notices() {
|
| 80 |
+
return $this->notices;
|
| 81 |
+
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
/**
|
| 85 |
+
* Validate and load processors
|
| 86 |
+
*
|
| 87 |
+
* @since 1.3.0
|
| 88 |
+
*
|
| 89 |
+
* @access private
|
| 90 |
+
*/
|
| 91 |
+
private function load_processors() {
|
| 92 |
+
|
| 93 |
+
/**
|
| 94 |
+
* Add processors
|
| 95 |
+
*
|
| 96 |
+
* @param array $processors
|
| 97 |
+
*/
|
| 98 |
+
$processors = apply_filters( 'caldera_forms_get_form_processors', array() );
|
| 99 |
+
$this->processors = array();
|
| 100 |
+
foreach( $processors as $id => $processor ) {
|
| 101 |
+
$processor = $this->validate_processor( $processor );
|
| 102 |
+
if ( $processor ) {
|
| 103 |
+
$this->processors[ $id ] = $processor;
|
| 104 |
+
}
|
| 105 |
+
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
/**
|
| 112 |
+
* Validates a processor.
|
| 113 |
+
*
|
| 114 |
+
* @param $processor
|
| 115 |
+
*
|
| 116 |
+
* @since 1.3.0
|
| 117 |
+
*
|
| 118 |
+
* @access private
|
| 119 |
+
*
|
| 120 |
+
* @return bool|array Processor config array, or false if invalid.
|
| 121 |
+
*/
|
| 122 |
+
private function validate_processor( $processor ) {
|
| 123 |
+
$dependencies = array(
|
| 124 |
+
'php_ver' => false,
|
| 125 |
+
'cf_ver' => false,
|
| 126 |
+
'wp_ver' => false,
|
| 127 |
+
);
|
| 128 |
+
|
| 129 |
+
//backwards compat, woo!
|
| 130 |
+
$processor = wp_parse_args( $processor, $dependencies );
|
| 131 |
+
|
| 132 |
+
$fail = false;
|
| 133 |
+
$pattern = '%1 requires %2s version %3s or later. Current version is %4s.';
|
| 134 |
+
if ( false != $processor[ 'cf_ver' ] ) {
|
| 135 |
+
if ( ! version_compare( CFCORE_VER, $processor[ 'cf_ver' ], '>=' ) ) {
|
| 136 |
+
$this->add_notice( __( sprintf( $pattern, $processor[ 'name'], 'Caldera Forms', $processor[ 'cf_ver' ], CFCORE_VER ) ) );
|
| 137 |
+
$fail = true;
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
if ( false != $processor[ 'php_ver' ] ) {
|
| 143 |
+
if ( ! version_compare( PHP_VERSION, $processor[ 'php_ver' ], '>=' ) ) {
|
| 144 |
+
$this->add_notice( __( sprintf( $pattern, $processor[ 'name'], 'PHP', $processor[ 'php_ver' ], CFCORE_VER ) ) );
|
| 145 |
+
$fail = true;
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
if ( false != $processor[ 'wp_ver' ] ) {
|
| 151 |
+
global $wp_version;
|
| 152 |
+
if ( ! version_compare( $wp_version, $processor[ 'wp_ver' ], '>=' ) ) {
|
| 153 |
+
$this->add_notice( __( sprintf( $pattern, $processor[ 'name' ], 'WordPress ', $processor[ 'wp_ver' ], CFCORE_VER ) ) );
|
| 154 |
+
$fail = true;
|
| 155 |
+
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
if ( isset( $processor[ 'icon' ] ) ) {
|
| 161 |
+
$works = file_get_contents( $processor[ 'icon' ] );
|
| 162 |
+
if ( ! $works ) {
|
| 163 |
+
unset( $processor[ 'icon' ] );
|
| 164 |
+
}
|
| 165 |
+
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
if ( $fail ) {
|
| 169 |
+
return false;
|
| 170 |
+
|
| 171 |
+
}else{
|
| 172 |
+
return $processor;
|
| 173 |
+
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
/**
|
| 179 |
+
* Get class instance
|
| 180 |
+
*
|
| 181 |
+
* @since 1.3.0
|
| 182 |
+
*
|
| 183 |
+
* @return \Caldera_Forms_Processor_Load
|
| 184 |
+
*/
|
| 185 |
+
public static function get_instance() {
|
| 186 |
+
if ( is_null( self::$init ) ) {
|
| 187 |
+
self::$init = new self();
|
| 188 |
+
}
|
| 189 |
+
|
| 190 |
+
return self::$init;
|
| 191 |
+
|
| 192 |
+
}
|
| 193 |
+
|
| 194 |
+
/**
|
| 195 |
+
* Add an error notice in admin.
|
| 196 |
+
*
|
| 197 |
+
* @since 1.3
|
| 198 |
+
*
|
| 199 |
+
* @param string $notice The message.
|
| 200 |
+
*/
|
| 201 |
+
protected function add_notice( $notice ) {
|
| 202 |
+
if ( class_exists( 'Caldera_Forms_Admin' ) ) {
|
| 203 |
+
Caldera_Forms_Admin::add_admin_notice( $notice );
|
| 204 |
+
}
|
| 205 |
+
|
| 206 |
+
$this->notices[] = $notice;
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
}
|
processors/classes/ui.php
ADDED
|
@@ -0,0 +1,275 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Create markup for add-on config fields.
|
| 4 |
+
*
|
| 5 |
+
* @package Caldera_Forms
|
| 6 |
+
* @author Josh Pollock <Josh@CalderaWP.com>
|
| 7 |
+
* @license GPL-2.0+
|
| 8 |
+
* @link
|
| 9 |
+
* @copyright 2015 CalderaWP LLC
|
| 10 |
+
*/
|
| 11 |
+
class Caldera_Forms_Processor_UI {
|
| 12 |
+
|
| 13 |
+
/**
|
| 14 |
+
* Output field markup form an array fo field args
|
| 15 |
+
*
|
| 16 |
+
* @since 1.3.0
|
| 17 |
+
*
|
| 18 |
+
* @param array $fields Array of args to pass to self::config_field()
|
| 19 |
+
* @param null|string|int Optional. If null, all fields (except those with print args set to false will be printed). Can be used to print a group of fields based on the value of the print arg.
|
| 20 |
+
*
|
| 21 |
+
* @return bool|string The Markup or false if invalid.
|
| 22 |
+
*/
|
| 23 |
+
public static function config_fields( $fields, $print_group = null ) {
|
| 24 |
+
$out = '';
|
| 25 |
+
if ( ! empty( $fields ) && is_array( $fields ) ) {
|
| 26 |
+
foreach( $fields as $args ) {
|
| 27 |
+
if ( ! empty( $args ) ) {
|
| 28 |
+
if ( isset( $args[ 'print' ] ) && false == $args[ 'print' ] ){
|
| 29 |
+
continue;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
if ( ! is_null( $print_group ) ) {
|
| 33 |
+
if ( isset( $args[ 'print' ] ) || $print_group != $args[ 'print' ] ) {
|
| 34 |
+
continue;
|
| 35 |
+
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
$out .= self::config_field( $args );
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
return $out;
|
| 48 |
+
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Create markup for a processor config field.
|
| 53 |
+
*
|
| 54 |
+
* @param array $args {
|
| 55 |
+
* An array of arguments.
|
| 56 |
+
*
|
| 57 |
+
* @type string $id Field ID (REQUIRED)
|
| 58 |
+
* @type string $label Label for field (REQUIRED)
|
| 59 |
+
* @type bool $magic If field is magic tag enabled. Default is true.
|
| 60 |
+
* @type bool $block Use block style, Default is true
|
| 61 |
+
* @type string $type Field type. Default is "text". Options: simple|checkbox|advanced|dropdown
|
| 62 |
+
* @type array|string $extra_class Additional classes to apply.
|
| 63 |
+
* @type string $desc Extra description to add to markup.
|
| 64 |
+
* @type bool|string|array $allow_types Type(s) of fields that are allowed to bind to this or false to allow all.
|
| 65 |
+
* @type bool|string|array $exclude Type(s) of fields that are NOT allowed to bind to this or false to not exclude any.
|
| 66 |
+
* }
|
| 67 |
+
*
|
| 68 |
+
* @return string|void HTML markup if input is valid. Void if not.
|
| 69 |
+
*/
|
| 70 |
+
public static function config_field( $args ) {
|
| 71 |
+
if ( ! is_array( $args ) || ! isset( $args[ 'label' ] ) || ! isset( $args[ 'id' ] ) ) {
|
| 72 |
+
return;
|
| 73 |
+
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
$defaults = array(
|
| 77 |
+
'label' => '',
|
| 78 |
+
'magic' => true,
|
| 79 |
+
'block' => true,
|
| 80 |
+
'type' => 'text',
|
| 81 |
+
'extra_classes' => array(),
|
| 82 |
+
'required' => false,
|
| 83 |
+
'desc' => false,
|
| 84 |
+
'allow_types' => false,
|
| 85 |
+
'exclude' => false,
|
| 86 |
+
'print' => true
|
| 87 |
+
);
|
| 88 |
+
|
| 89 |
+
$args = wp_parse_args( $args, $defaults );
|
| 90 |
+
|
| 91 |
+
|
| 92 |
+
/**
|
| 93 |
+
* Filter arguments for field markup
|
| 94 |
+
*
|
| 95 |
+
* @since 1.3.0
|
| 96 |
+
*
|
| 97 |
+
* @param array $args
|
| 98 |
+
*/
|
| 99 |
+
$args = apply_filters( 'caldera_forms_addon_config_field_args', $args );
|
| 100 |
+
|
| 101 |
+
$input_type = 'simple';
|
| 102 |
+
|
| 103 |
+
if ( 'checkbox' == $args[ 'type'] ) {
|
| 104 |
+
$args[ 'block' ] = false;
|
| 105 |
+
$args[ 'magic' ] = false;
|
| 106 |
+
$input_type = 'checkbox';
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
if ( is_string( $args[ 'extra_classes']) ) {
|
| 110 |
+
$args[ 'extra_classes' ] = array( $args[ 'extra_classes' ] );
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
if( $args[ 'block' ] ) {
|
| 114 |
+
$args[ 'extra_classes'][] = 'block-input';
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
if ( $args[ 'magic'] ) {
|
| 118 |
+
$args[ 'extra_classes' ][] = 'magic-tag-enabled';
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
if ( $args[ 'required' ] ) {
|
| 122 |
+
$args[ 'extra_classes' ][] = 'required';
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
$args[ 'extra_classes' ][] = 'field-config';
|
| 126 |
+
|
| 127 |
+
$classes = implode( ' ', $args[ 'extra_classes' ] );
|
| 128 |
+
$id = trim( $args['id'] );
|
| 129 |
+
|
| 130 |
+
$desc = false;
|
| 131 |
+
if ( $args[ 'desc' ] ) {
|
| 132 |
+
$desc = sprintf( '<p class="description">%1s</p>', esc_html( $args[ 'desc' ] ) );
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
$allow_types = '';
|
| 136 |
+
if ( $args[ 'allow_types' ] ) {
|
| 137 |
+
$input_type = 'advanced';
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
$required = $args[ 'required' ];
|
| 141 |
+
if ( $required ) {
|
| 142 |
+
$required = 'required';
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
$field = sprintf( '
|
| 146 |
+
<div class="caldera-config-group">
|
| 147 |
+
<label for="%1s">
|
| 148 |
+
%2s
|
| 149 |
+
</label>
|
| 150 |
+
<div class="caldera-config-field">
|
| 151 |
+
%3s
|
| 152 |
+
</div>
|
| 153 |
+
%4s
|
| 154 |
+
</div>',
|
| 155 |
+
esc_attr( $id ),
|
| 156 |
+
$args[ 'label' ],
|
| 157 |
+
self::input( $input_type, $args, $id, $classes, $required ),
|
| 158 |
+
$desc
|
| 159 |
+
);
|
| 160 |
+
|
| 161 |
+
return $field;
|
| 162 |
+
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
/**
|
| 166 |
+
* Create the input for proccesor config field.
|
| 167 |
+
*
|
| 168 |
+
* @since 1.3.0
|
| 169 |
+
*
|
| 170 |
+
* @param string $type The type of input. This is NOT The input type. Options are simple|checkbox|advanced|dropdown
|
| 171 |
+
* @param array $args Field args
|
| 172 |
+
* @param string $id ID attribute
|
| 173 |
+
* @param string $classes Class attribute.
|
| 174 |
+
* @param bool|string $required If is required or not
|
| 175 |
+
*
|
| 176 |
+
* @return string HTML markup for input
|
| 177 |
+
*/
|
| 178 |
+
public static function input( $type, $args, $id, $classes, $required ) {
|
| 179 |
+
switch( $type ) {
|
| 180 |
+
case 'checkbox' == $type :
|
| 181 |
+
$field = sprintf( '<input type="%1s" class="%2s" id="%3s" name="{{_name}}[%4s]" %5s>',
|
| 182 |
+
$args[ 'type' ],
|
| 183 |
+
$classes,
|
| 184 |
+
esc_attr( $id ),
|
| 185 |
+
esc_attr( $id ),
|
| 186 |
+
sprintf( '{{#if %s}}checked{{/if}}', esc_attr( $id ) )
|
| 187 |
+
);
|
| 188 |
+
break;
|
| 189 |
+
case 'advanced' :
|
| 190 |
+
if ( $required ) {
|
| 191 |
+
$required = "true";
|
| 192 |
+
}else{
|
| 193 |
+
$required = "false";
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
if ( is_string( $args[ 'allow_types' ] ) ) {
|
| 197 |
+
$allow_types = $args[ 'allow_types' ] ;
|
| 198 |
+
}elseif ( is_array( $args[ 'allow_types' ] ) ){
|
| 199 |
+
$allow_types = implode( ',', $args[ 'allow_types' ] );
|
| 200 |
+
}else{
|
| 201 |
+
$allow_types = 'all';
|
| 202 |
+
}
|
| 203 |
+
|
| 204 |
+
if ( is_string( $args[ 'exclude' ] ) ) {
|
| 205 |
+
$excludes = $args[ 'exclude' ] ;
|
| 206 |
+
}elseif ( is_array( $args[ 'exclude' ] ) ){
|
| 207 |
+
$excludes = implode( ',', $args[ 'exclude' ] );
|
| 208 |
+
}else{
|
| 209 |
+
$excludes = 'all';
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
|
| 213 |
+
|
| 214 |
+
$field = sprintf( '{{{_field slug="%1s" type="%2s" exclude="%3s" required="%4s"}}}',
|
| 215 |
+
esc_attr( $id ),
|
| 216 |
+
$allow_types,
|
| 217 |
+
$excludes,
|
| 218 |
+
$required
|
| 219 |
+
);
|
| 220 |
+
break;
|
| 221 |
+
case 'dropdown' :
|
| 222 |
+
if ( isset( $args[ 'options' ] ) ){
|
| 223 |
+
foreach( $args[ 'options' ] as $value => $label ) {
|
| 224 |
+
$options[] = sprintf( '<option value="%1s" {{#is %2s value="%3s"}}selected{{/is}}>%4s</option>',
|
| 225 |
+
esc_attr( $value ),
|
| 226 |
+
esc_attr( $id ),
|
| 227 |
+
esc_attr( $value ),
|
| 228 |
+
esc_html( $label )
|
| 229 |
+
);
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
$field = sprintf( '<select class="%1s" id="%2s" name="{{_name}}[%3s]" >%4s,</select>',
|
| 233 |
+
$classes,
|
| 234 |
+
esc_attr( $id ),
|
| 235 |
+
esc_attr( $id ),
|
| 236 |
+
implode( "/n", $options )
|
| 237 |
+
);
|
| 238 |
+
}
|
| 239 |
+
break;
|
| 240 |
+
default :
|
| 241 |
+
$field = sprintf( '<input type="%1s" class="%2s" id="%3s" name="{{_name}}[%4s]" value="%5s" %6s>',
|
| 242 |
+
$args[ 'type' ],
|
| 243 |
+
$classes,
|
| 244 |
+
esc_attr( $id ),
|
| 245 |
+
esc_attr( $id ),
|
| 246 |
+
'{{' . esc_attr( $id ) . '}}',
|
| 247 |
+
$required
|
| 248 |
+
);
|
| 249 |
+
break;
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
return $field;
|
| 253 |
+
|
| 254 |
+
}
|
| 255 |
+
|
| 256 |
+
/**
|
| 257 |
+
* Helper function to place a notice in processor config, if SSL required and not in use.
|
| 258 |
+
*
|
| 259 |
+
* @since 1.3.0
|
| 260 |
+
*
|
| 261 |
+
* @param string $name Name of add-on.
|
| 262 |
+
*
|
| 263 |
+
* @return string
|
| 264 |
+
*/
|
| 265 |
+
public static function ssl_notice( $name ) {
|
| 266 |
+
if ( is_ssl() ) {
|
| 267 |
+
return;
|
| 268 |
+
}
|
| 269 |
+
|
| 270 |
+
return sprintf( '<div class="error"><p>%1s</p></div>', __( sprintf( '%1s requires a valid SSL certificate. It will only function in test mode unless SSL/HTTPS is used. Your site does not appear to be using the secure HTTPS protocol.', $name ), 'caldera-forms' ) );
|
| 271 |
+
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
|
| 275 |
+
}
|
readme.txt
CHANGED
|
@@ -1,15 +1,15 @@
|
|
| 1 |
=== Caldera Forms ===
|
| 2 |
Contributors: Desertsnowman, Shelob9
|
| 3 |
-
Tags: forms, formbuilder, form builder, contact form, contact, custom form, custom forms, forms creator, caldera forms
|
| 4 |
Requires at least: 3.9
|
| 5 |
-
Tested up to: 4.
|
| 6 |
-
Stable tag: 1.
|
| 7 |
License: GPLv2
|
| 8 |
|
| 9 |
Create beautiful, responsive forms with a simple drag and drop editor.
|
| 10 |
|
| 11 |
== Description ==
|
| 12 |
-
A
|
| 13 |
|
| 14 |
Easy enough for everyday users to create forms, and powerful enough for PHP experts to extend.
|
| 15 |
|
|
@@ -34,6 +34,8 @@ John Teague of Theme Surgeons includes Caldera Forms in his list of [WordPress p
|
|
| 34 |
* [Run Action](https://calderawp.com/downloads/caldera-forms-run-action/) - Trigger a WordPress action with your form submission.
|
| 35 |
* [Sprout Invoices Integration](https://wordpress.org/plugins/caldera-forms-sprout-invoices-integration/) - Use Caldera Forms for [Sprout Invoice](https://sproutapps.co/sprout-invoices/) forms.
|
| 36 |
* [Conditional Fail](https://wordpress.org/plugins/conditional-fail-for-caldera-forms/) - Set conditions to cause that if met will allow or prevent form submssion.
|
|
|
|
|
|
|
| 37 |
|
| 38 |
= Premium Add-Ons =
|
| 39 |
* [MailChimp](https://calderawp.com/downloads/caldera-forms-mailchimp-add-on/) - Seamlessly integrate MailChimp optins into your forms
|
|
@@ -42,6 +44,10 @@ John Teague of Theme Surgeons includes Caldera Forms in his list of [WordPress p
|
|
| 42 |
* [Users](https://calderawp.com/downloads/caldera-forms-users-add/) - Register or login users from your form.
|
| 43 |
* [Geolocation](https://calderawp.com/downloads/geolocation-field-for-caldera-forms/) - Make a text field a geolocation auto-complete field and recorded geocoded data.
|
| 44 |
* [Mark Viewed](https://calderawp.com/downloads/caldera-forms-mark-viewed/) - Let users track what content they have viewed.
|
|
|
|
|
|
|
|
|
|
|
|
|
| 45 |
|
| 46 |
= A Few Feature Highlights =
|
| 47 |
* Drag and drop responsive form builder.
|
|
@@ -100,6 +106,45 @@ none yet.
|
|
| 100 |
|
| 101 |
== Changelog ==
|
| 102 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 103 |
= 1.2.2 ( June, 2015) =
|
| 104 |
|
| 105 |
= Bugs Fixed =
|
|
@@ -490,4 +535,5 @@ none yet.
|
|
| 490 |
Initial Release
|
| 491 |
|
| 492 |
== Upgrade Notice ==
|
| 493 |
-
|
|
|
| 1 |
=== Caldera Forms ===
|
| 2 |
Contributors: Desertsnowman, Shelob9
|
| 3 |
+
Tags: forms, formbuilder, form builder, contact form, contact, custom form, custom forms, forms creator, caldera forms, calderawp, wp form, responsive, forms, form, drag and drop, email, awesome, wordpress free form builder, form builder plugin wordpress, wordpress builder plugin, wordpress forms builder, form builder wordpress, contact form builder wordpress
|
| 4 |
Requires at least: 3.9
|
| 5 |
+
Tested up to: 4.3
|
| 6 |
+
Stable tag: 1.3.0
|
| 7 |
License: GPLv2
|
| 8 |
|
| 9 |
Create beautiful, responsive forms with a simple drag and drop editor.
|
| 10 |
|
| 11 |
== Description ==
|
| 12 |
+
A diffrent kind of WordPress form builder. With an intuitive drag and drop interface -– based on a responsive grid -- and a wide range of add-ons, it’s never been easier to create forms for your WordPress site that look great on any device, thanks to Caldera Forms. This free plugin includes all of the form types you want, mail and redirect processors, entry logging and AJAX submissions.
|
| 13 |
|
| 14 |
Easy enough for everyday users to create forms, and powerful enough for PHP experts to extend.
|
| 15 |
|
| 34 |
* [Run Action](https://calderawp.com/downloads/caldera-forms-run-action/) - Trigger a WordPress action with your form submission.
|
| 35 |
* [Sprout Invoices Integration](https://wordpress.org/plugins/caldera-forms-sprout-invoices-integration/) - Use Caldera Forms for [Sprout Invoice](https://sproutapps.co/sprout-invoices/) forms.
|
| 36 |
* [Conditional Fail](https://wordpress.org/plugins/conditional-fail-for-caldera-forms/) - Set conditions to cause that if met will allow or prevent form submssion.
|
| 37 |
+
* [Postmatic](https://calderawp.com/downloads/postmatic-for-caldera-forms/) - Subscribe users to your posts and comments using Postmatic.
|
| 38 |
+
* [Mail Templates](https://calderawp.com/downloads/mail-templates-for-caldera-forms/) - Add your logo, and your brand's color scheme to your emails sent from Caldera Forms.
|
| 39 |
|
| 40 |
= Premium Add-Ons =
|
| 41 |
* [MailChimp](https://calderawp.com/downloads/caldera-forms-mailchimp-add-on/) - Seamlessly integrate MailChimp optins into your forms
|
| 44 |
* [Users](https://calderawp.com/downloads/caldera-forms-users-add/) - Register or login users from your form.
|
| 45 |
* [Geolocation](https://calderawp.com/downloads/geolocation-field-for-caldera-forms/) - Make a text field a geolocation auto-complete field and recorded geocoded data.
|
| 46 |
* [Mark Viewed](https://calderawp.com/downloads/caldera-forms-mark-viewed/) - Let users track what content they have viewed.
|
| 47 |
+
* [Dwolla](https://calderawp.com/downloads/dwolla-for-caldera-forms/) - Accept payments with low fees using Dwolla.
|
| 48 |
+
* [Authorize.net](https://calderawp.com/downloads/authorize-net-for-caldera-forms/) Accept all major credit cards by integrating with Authorize.net.
|
| 49 |
+
* [BrainTree](https://calderawp.com/downloads/braintree-for-caldera-forms/) Accept credit card payments using BrainTree.
|
| 50 |
+
* [Nexmo](https://calderawp.com/downloads/nexmo-caldera-forms/) Get SMS notifications of form submissions.
|
| 51 |
|
| 52 |
= A Few Feature Highlights =
|
| 53 |
* Drag and drop responsive form builder.
|
| 106 |
|
| 107 |
== Changelog ==
|
| 108 |
|
| 109 |
+
= 1.3.0 ( August 23, 2015 ) =
|
| 110 |
+
* Improved: Adding rows in form layout.
|
| 111 |
+
* Added: Conditional groups.
|
| 112 |
+
* Added: New helper classes for form processors.
|
| 113 |
+
* Fixed: Issue where forms with a file field, without a file uploaded, would break mailer validation.
|
| 114 |
+
* Added: Date range settings for date picker fields.
|
| 115 |
+
* Improved: Colors in form editor.
|
| 116 |
+
* Improved: Inline docs in Caldera_Forms class.
|
| 117 |
+
* Added: 2 new form templates.
|
| 118 |
+
* Fixed: Issue with field scripts being double loaded.
|
| 119 |
+
* Fixed: Issue affecting color pickers as conditional fields.
|
| 120 |
+
* Update Translations: German (de_DE), Spanish (es_ES), French (fr_FR), Japanese (ja), Portuguese (pt_PT), Turkish (tr_TR).
|
| 121 |
+
|
| 122 |
+
= 1.2.3 ( August 7, 2015) =
|
| 123 |
+
|
| 124 |
+
= Bugs Fixed =
|
| 125 |
+
* Fixed Checkbox values showing as [Object object] in entry view
|
| 126 |
+
* HTML field with magic tags now work with conditions
|
| 127 |
+
* Toggle switches magic tag now doesn't show ,,,
|
| 128 |
+
* Range Slider in conditions improved
|
| 129 |
+
* State / Province field correctly uses the required setting
|
| 130 |
+
* issue where if you had a single entry in trach, would show no entries.
|
| 131 |
+
* some smaller annoying bugs solved
|
| 132 |
+
|
| 133 |
+
= New Features =
|
| 134 |
+
* Added form templates when creating new form.
|
| 135 |
+
* Automcomplete (select2) field type.
|
| 136 |
+
* File field can now be set to accept mulitple to allow selecting multiple files.
|
| 137 |
+
* Portuguese translation thanks to Luis Martins
|
| 138 |
+
* Turkish translation thanks to Yavuz Uyar
|
| 139 |
+
* Added login/logout link magic tags: {login_url} {logout_url} {register_url} {lostpassword_url}
|
| 140 |
+
* Abstracted final DB saving and mailer into new class
|
| 141 |
+
|
| 142 |
+
= New Hooks =
|
| 143 |
+
* caldera_forms_get_form_templates : filter to add your own templates to new form templates
|
| 144 |
+
* Added "caldera_forms_mailer_failed" action to run when main mailer fails
|
| 145 |
+
* Added "caldera_forms_autoresponder_failed" action to run when autoresponder fails.
|
| 146 |
+
|
| 147 |
+
|
| 148 |
= 1.2.2 ( June, 2015) =
|
| 149 |
|
| 150 |
= Bugs Fixed =
|
| 535 |
Initial Release
|
| 536 |
|
| 537 |
== Upgrade Notice ==
|
| 538 |
+
= 1.3.0 =
|
| 539 |
+
New conditional groups!
|
ui/admin.php
CHANGED
|
@@ -61,6 +61,22 @@ $modal_new_form = __('Create Form', 'caldera-forms').'|{"data-action" : "create_
|
|
| 61 |
</div>
|
| 62 |
<div class="form-admin-page-wrap">
|
| 63 |
<div class="form-panel-wrap">
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 64 |
<?php if(!empty($forms)){ ?>
|
| 65 |
<table class="widefat fixed">
|
| 66 |
<thead>
|
|
@@ -221,6 +237,20 @@ function start_new_form(obj){
|
|
| 221 |
}
|
| 222 |
return {};
|
| 223 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 224 |
</script>
|
| 225 |
<?php
|
| 226 |
|
| 61 |
</div>
|
| 62 |
<div class="form-admin-page-wrap">
|
| 63 |
<div class="form-panel-wrap">
|
| 64 |
+
<?php
|
| 65 |
+
|
| 66 |
+
// admin notices
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
?>
|
| 70 |
+
<div class="cf-notification" style="display:none;">
|
| 71 |
+
<span class="dashicons dashicons-arrow-down cf-notice-toggle"></span>
|
| 72 |
+
<span class="dashicons dashicons-arrow-up cf-notice-toggle" style="display:none;"></span>
|
| 73 |
+
<div class="cf-notification-notice">
|
| 74 |
+
<span class="dashicons dashicons-warning"></span>
|
| 75 |
+
<span class="cf-notice-info-line"></span>
|
| 76 |
+
</div>
|
| 77 |
+
<div class="cf-notification-count"></div>
|
| 78 |
+
<div class="cf-notification-panel"></div>
|
| 79 |
+
</div>
|
| 80 |
<?php if(!empty($forms)){ ?>
|
| 81 |
<table class="widefat fixed">
|
| 82 |
<thead>
|
| 237 |
}
|
| 238 |
return {};
|
| 239 |
}
|
| 240 |
+
jQuery( function( $ ){
|
| 241 |
+
var notices = $('.error,.notice,.notice-error');
|
| 242 |
+
|
| 243 |
+
if( notices.length ){
|
| 244 |
+
$('.cf-notice-info-line').html( notices.first().text() );
|
| 245 |
+
$('.cf-notification-panel').hide();
|
| 246 |
+
$('.cf-notification').fadeIn();
|
| 247 |
+
notices.appendTo( $('.cf-notification-panel') );
|
| 248 |
+
$( '.cf-notice-toggle').click( function(){
|
| 249 |
+
$( '.cf-notice-toggle').toggle();
|
| 250 |
+
$('.cf-notification-panel').slideToggle();
|
| 251 |
+
});
|
| 252 |
+
}
|
| 253 |
+
});
|
| 254 |
</script>
|
| 255 |
<?php
|
| 256 |
|
ui/admin_templates.php
CHANGED
|
@@ -28,7 +28,7 @@
|
|
| 28 |
</div>
|
| 29 |
</div>
|
| 30 |
|
| 31 |
-
<div class="baldrick-modal-footer" style="display: block; clear: both; position: relative; height:
|
| 32 |
|
| 33 |
<button type="submit" class="button button-primary" style="float:right;"><?php echo __('Import Form', 'caldera-forms'); ?></button>
|
| 34 |
|
| 28 |
</div>
|
| 29 |
</div>
|
| 30 |
|
| 31 |
+
<div class="baldrick-modal-footer" style="display: block; clear: both; position: relative; height: 24px; width: 100%; margin: 0px -12px;">
|
| 32 |
|
| 33 |
<button type="submit" class="button button-primary" style="float:right;"><?php echo __('Import Form', 'caldera-forms'); ?></button>
|
| 34 |
|
ui/community.php
CHANGED
|
@@ -14,7 +14,7 @@
|
|
| 14 |
<ul class="caldera-editor-header-nav ajax-trigger" data-load-class="spinner" data-request="<?php echo CFCORE_EXTEND_URL . 'channels/community/?version=' . CFCORE_VER; ?>" data-target="#main-cat-nav" data-target-insert="append" data-template="#nav-items-tmpl" data-event="loadchannels" data-autoload="true" id="main-cat-nav" >
|
| 15 |
</ul>
|
| 16 |
</div>
|
| 17 |
-
<div class="form-extend-page-wrap" id="form-extend-viewer"></div>
|
| 18 |
|
| 19 |
<?php
|
| 20 |
do_action('caldera_forms_admin_templates');
|
| 14 |
<ul class="caldera-editor-header-nav ajax-trigger" data-load-class="spinner" data-request="<?php echo CFCORE_EXTEND_URL . 'channels/community/?version=' . CFCORE_VER; ?>" data-target="#main-cat-nav" data-target-insert="append" data-template="#nav-items-tmpl" data-event="loadchannels" data-autoload="true" id="main-cat-nav" >
|
| 15 |
</ul>
|
| 16 |
</div>
|
| 17 |
+
<div class="form-extend-page-wrap" id="form-extend-viewer" style="visibility:visible;"></div>
|
| 18 |
|
| 19 |
<?php
|
| 20 |
do_action('caldera_forms_admin_templates');
|
ui/edit.php
CHANGED
|
@@ -16,11 +16,56 @@ if(empty($element['success'])){
|
|
| 16 |
if(!isset($element['db_support'])){
|
| 17 |
$element['db_support'] = 1;
|
| 18 |
}
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 22 |
}
|
| 23 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 24 |
|
| 25 |
// place nonce field
|
| 26 |
wp_nonce_field( 'cf_edit_element', 'cf_edit_nonce' );
|
|
@@ -301,10 +346,6 @@ function field_wrapper_template($id = '{{id}}', $label = '{{label}}', $slug = '{
|
|
| 301 |
|
| 302 |
id="<?php echo $id; ?>" style="display:none;">
|
| 303 |
|
| 304 |
-
<div class="toggle_option_tab">
|
| 305 |
-
<a href="#<?php echo $id; ?>_settings_pane" class="button button-primary"><?php _e('Settings'); ?></a>
|
| 306 |
-
<a href="#<?php echo $id; ?>_conditions_pane" class="button "><?php _e('Conditions', 'caldera-forms'); ?></a>
|
| 307 |
-
</div>
|
| 308 |
|
| 309 |
<h3 class="caldera-editor-field-title"><?php echo $label; ?> </h3>
|
| 310 |
<input type="hidden" class="field-config" name="config[fields][<?php echo $id; ?>][ID]" value="<?php echo $id; ?>">
|
|
@@ -325,7 +366,8 @@ function field_wrapper_template($id = '{{id}}', $label = '{{label}}', $slug = '{
|
|
| 325 |
<input type="text" class="block-input field-id" id="<?php echo $id; ?>_fid" value="<?php echo $id; ?>" readonly="readonly">
|
| 326 |
</div>
|
| 327 |
</div>
|
| 328 |
-
|
|
|
|
| 329 |
<div class="caldera-config-group">
|
| 330 |
<label for="<?php echo $id; ?>_lable"><?php echo __('Name', 'caldera-forms'); ?></label>
|
| 331 |
<div class="caldera-config-field">
|
|
@@ -346,7 +388,17 @@ function field_wrapper_template($id = '{{id}}', $label = '{{label}}', $slug = '{
|
|
| 346 |
<input type="text" class="block-input field-config field-slug required" id="<?php echo $id; ?>_slug" name="config[fields][<?php echo $id; ?>][slug]" value="<?php echo $slug; ?>">
|
| 347 |
</div>
|
| 348 |
</div>
|
| 349 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 350 |
<div class="caldera-config-group required-field">
|
| 351 |
<label for="<?php echo $id; ?>_required"><?php echo __('Required', 'caldera-forms'); ?></label>
|
| 352 |
<div class="caldera-config-field">
|
|
@@ -370,24 +422,11 @@ function field_wrapper_template($id = '{{id}}', $label = '{{label}}', $slug = '{
|
|
| 370 |
<div class="caldera-config-field-setup">
|
| 371 |
</div>
|
| 372 |
<input type="hidden" class="field_config_string block-input" value="<?php echo htmlentities( $config_str ); ?>">
|
| 373 |
-
<br>
|
| 374 |
-
<button class="button delete-field block-button" data-confirm="<?php echo __('Are you sure you want to remove this field?. \'Cancel\' to stop. \'OK\' to delete', 'caldera-forms'); ?>" type="button"><i class="icn-delete"></i> <?php echo __('Delete Element', 'caldera-forms'); ?></button>
|
| 375 |
-
</div>
|
| 376 |
-
<div id="<?php echo $id; ?>_conditions_pane" style="display:none;" class="wrapper-instance-pane">
|
| 377 |
-
<p>
|
| 378 |
-
<select name="config[fields][<?php echo $id; ?>][conditions][type]" data-id="<?php echo $id; ?>" class="caldera-conditionals-usetype">
|
| 379 |
-
<option value=""></option>
|
| 380 |
-
<option value="show" <?php if($condition_type == 'show'){ echo 'selected="selected"'; } ?>><?php echo __('Show', 'caldera-forms'); ?></option>
|
| 381 |
-
<option value="hide" <?php if($condition_type == 'hide'){ echo 'selected="selected"'; } ?>><?php echo __('Hide', 'caldera-forms'); ?></option>
|
| 382 |
-
<option value="disable" <?php if($condition_type == 'disable'){ echo 'selected="selected"'; } ?>><?php echo __('Disable', 'caldera-forms'); ?></option>
|
| 383 |
-
</select>
|
| 384 |
-
<button id="<?php echo $id; ?>_condition_group_add" style="display:none;" type="button" data-id="<?php echo $id; ?>" class="pull-right button button-small add-conditional-group ajax-trigger" data-template="#conditional-group-tmpl" data-target-insert="append" data-request="new_conditional_group" data-type="fields" data-callback="rebuild_field_binding" data-target="#<?php echo $id; ?>_conditional_wrap"><?php echo __('Add Conditional Group', 'caldera-forms'); ?></button>
|
| 385 |
-
</p>
|
| 386 |
-
<div class="caldera-conditionals-wrapper" id="<?php echo $id; ?>_conditional_wrap"></div>
|
| 387 |
-
<?php do_action('caldera_forms_field_conditionals_template', $id); ?>
|
| 388 |
<input type="hidden" class="field_conditions_config_string block-input ajax-trigger" data-event="none" data-autoload="true" data-request="build_conditions_config" data-template="#conditional-group-tmpl" data-id="<?php echo $id; ?>" data-target="#<?php echo $id; ?>_conditional_wrap" data-type="fields" data-callback="rebuild_field_binding" value="<?php echo htmlentities( $conditions_str ); ?>">
|
| 389 |
-
|
|
|
|
| 390 |
</div>
|
|
|
|
| 391 |
</div>
|
| 392 |
<?php
|
| 393 |
}
|
|
@@ -543,7 +582,7 @@ function field_line_template($id = '{{id}}', $label = '{{label}}', $group = '{{g
|
|
| 543 |
<div class="caldera-config-group" style="width:500px;">
|
| 544 |
<label><?php echo __('Success Message', 'caldera-forms'); ?> </label>
|
| 545 |
<div class="caldera-config-field">
|
| 546 |
-
<textarea class="field-config block-input magic-tag-enabled required" name="config[success]" required="required"><?php echo esc_html( $element['success'] ); ?></textarea>
|
| 547 |
</div>
|
| 548 |
</div>
|
| 549 |
<div class="caldera-config-group">
|
| 16 |
if(!isset($element['db_support'])){
|
| 17 |
$element['db_support'] = 1;
|
| 18 |
}
|
| 19 |
+
|
| 20 |
+
|
| 21 |
+
/**
|
| 22 |
+
* Convert existing field conditions if old method used
|
| 23 |
+
*
|
| 24 |
+
* @since 1.3.0
|
| 25 |
+
*/
|
| 26 |
+
if( empty( $element['conditional_groups'] ) ){
|
| 27 |
+
|
| 28 |
+
$element['conditional_groups'] = array();
|
| 29 |
+
if( !empty( $element['fields'] ) ){
|
| 30 |
+
foreach( $element['fields'] as $field_id=>$field ){
|
| 31 |
+
|
| 32 |
+
if( !empty( $field['conditions'] ) && !empty( $field['conditions']['type'] ) ){
|
| 33 |
+
|
| 34 |
+
if( empty( $field['conditions']['group'] ) ){
|
| 35 |
+
continue;
|
| 36 |
+
}
|
| 37 |
+
$element['conditional_groups']['conditions'][ 'con_' . $field['ID'] ] = array(
|
| 38 |
+
'id' => 'con_' . $field['ID'],
|
| 39 |
+
'name' => $field['label'],
|
| 40 |
+
'type' => $field['conditions']['type'],
|
| 41 |
+
'fields'=> array(),
|
| 42 |
+
'group' => array()
|
| 43 |
+
);
|
| 44 |
+
|
| 45 |
+
foreach( $field['conditions']['group'] as $groups_id=>$groups ){
|
| 46 |
+
foreach( $groups as $group_id => $group ){
|
| 47 |
+
$element['conditional_groups']['conditions'][ 'con_' . $field['ID'] ]['fields'][ $group_id ] = $group['field'];
|
| 48 |
+
$element['conditional_groups']['conditions'][ 'con_' . $field['ID'] ]['group'][ $groups_id ][ $group_id ] = array(
|
| 49 |
+
'parent' => $groups_id,
|
| 50 |
+
'field' => $group['field'],
|
| 51 |
+
'compare' => $group['compare'],
|
| 52 |
+
'value' => $group['value']
|
| 53 |
+
);
|
| 54 |
+
}
|
| 55 |
+
}
|
| 56 |
+
$element['fields'][ $field_id ]['conditions'] = array(
|
| 57 |
+
'type' => 'con_' . $field['ID']
|
| 58 |
+
);
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
}
|
| 62 |
}
|
| 63 |
|
| 64 |
+
if ( ! isset( $element['fields'] ) ) {
|
| 65 |
+
$element['fields'] = array();
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
$element['conditional_groups']['fields'] = $element['fields'];
|
| 69 |
|
| 70 |
// place nonce field
|
| 71 |
wp_nonce_field( 'cf_edit_element', 'cf_edit_nonce' );
|
| 346 |
|
| 347 |
id="<?php echo $id; ?>" style="display:none;">
|
| 348 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 349 |
|
| 350 |
<h3 class="caldera-editor-field-title"><?php echo $label; ?> </h3>
|
| 351 |
<input type="hidden" class="field-config" name="config[fields][<?php echo $id; ?>][ID]" value="<?php echo $id; ?>">
|
| 366 |
<input type="text" class="block-input field-id" id="<?php echo $id; ?>_fid" value="<?php echo $id; ?>" readonly="readonly">
|
| 367 |
</div>
|
| 368 |
</div>
|
| 369 |
+
|
| 370 |
+
|
| 371 |
<div class="caldera-config-group">
|
| 372 |
<label for="<?php echo $id; ?>_lable"><?php echo __('Name', 'caldera-forms'); ?></label>
|
| 373 |
<div class="caldera-config-field">
|
| 388 |
<input type="text" class="block-input field-config field-slug required" id="<?php echo $id; ?>_slug" name="config[fields][<?php echo $id; ?>][slug]" value="<?php echo $slug; ?>">
|
| 389 |
</div>
|
| 390 |
</div>
|
| 391 |
+
<div class="caldera-config-group">
|
| 392 |
+
<label for="<?php echo $id; ?>_fcond"><?php echo __('Condition', 'caldera-forms'); ?></label>
|
| 393 |
+
<div class="caldera-config-field">
|
| 394 |
+
<select id="field-condition-type-<?php echo $id; ?>" name="config[fields][<?php echo $id; ?>][conditions][type]" data-id="<?php echo $id; ?>" class="caldera-conditionals-usetype block-input">
|
| 395 |
+
<option></option>
|
| 396 |
+
<optgroup class="cf-conditional-selector">
|
| 397 |
+
<?php if( !in_array( $condition_type, array( 'show', 'hide','disable' ) ) ){ ?><option value="<?php echo $condition_type; ?>" selected="selected"><?php echo __('Disable', 'caldera-forms'); ?></option><?php } ?></optgroup>
|
| 398 |
+
</optgroup>
|
| 399 |
+
</select>
|
| 400 |
+
</div>
|
| 401 |
+
</div>
|
| 402 |
<div class="caldera-config-group required-field">
|
| 403 |
<label for="<?php echo $id; ?>_required"><?php echo __('Required', 'caldera-forms'); ?></label>
|
| 404 |
<div class="caldera-config-field">
|
| 422 |
<div class="caldera-config-field-setup">
|
| 423 |
</div>
|
| 424 |
<input type="hidden" class="field_config_string block-input" value="<?php echo htmlentities( $config_str ); ?>">
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 425 |
<input type="hidden" class="field_conditions_config_string block-input ajax-trigger" data-event="none" data-autoload="true" data-request="build_conditions_config" data-template="#conditional-group-tmpl" data-id="<?php echo $id; ?>" data-target="#<?php echo $id; ?>_conditional_wrap" data-type="fields" data-callback="rebuild_field_binding" value="<?php echo htmlentities( $conditions_str ); ?>">
|
| 426 |
+
<br>
|
| 427 |
+
<button class="button delete-field block-button" data-confirm="<?php echo __('Are you sure you want to remove this field?. \'Cancel\' to stop. \'OK\' to delete', 'caldera-forms'); ?>" type="button"><?php echo __('Delete Element', 'caldera-forms'); ?></button>
|
| 428 |
</div>
|
| 429 |
+
|
| 430 |
</div>
|
| 431 |
<?php
|
| 432 |
}
|
| 582 |
<div class="caldera-config-group" style="width:500px;">
|
| 583 |
<label><?php echo __('Success Message', 'caldera-forms'); ?> </label>
|
| 584 |
<div class="caldera-config-field">
|
| 585 |
+
<textarea class="field-config block-input magic-tag-enabled required" name="config[success]" required="required"><?php if (!empty($element['success'])) { echo esc_html( $element['success'] ); } else { echo __('Form has been successfully submitted. Thank you.', 'caldera-forms'); } ?></textarea>
|
| 586 |
</div>
|
| 587 |
</div>
|
| 588 |
<div class="caldera-config-group">
|
ui/extend.php
CHANGED
|
@@ -15,8 +15,14 @@
|
|
| 15 |
<ul class="caldera-editor-header-nav ajax-trigger" data-load-class="spinner" data-request="<?php echo CFCORE_EXTEND_URL . 'channels/marketing/?version=' . CFCORE_VER; ?>" data-target="#main-cat-nav" data-target-insert="append" data-template="#nav-items-tmpl" data-event="none" data-autoload="true" id="main-cat-nav" >
|
| 16 |
</ul>
|
| 17 |
</div>
|
| 18 |
-
|
|
|
|
| 19 |
<div class="form-extend-page-wrap" id="form-license-viewer" style="display:none;">
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 20 |
<?php
|
| 21 |
$addons = apply_filters( 'caldera_forms_get_active_addons', array() );
|
| 22 |
if(empty($addons)){
|
|
@@ -75,4 +81,4 @@ jQuery(function($){
|
|
| 75 |
|
| 76 |
})
|
| 77 |
|
| 78 |
-
</script>
|
| 15 |
<ul class="caldera-editor-header-nav ajax-trigger" data-load-class="spinner" data-request="<?php echo CFCORE_EXTEND_URL . 'channels/marketing/?version=' . CFCORE_VER; ?>" data-target="#main-cat-nav" data-target-insert="append" data-template="#nav-items-tmpl" data-event="none" data-autoload="true" id="main-cat-nav" >
|
| 16 |
</ul>
|
| 17 |
</div>
|
| 18 |
+
|
| 19 |
+
<div class="form-extend-page-wrap" id="form-extend-viewer" style="visibility:visible;"></div>
|
| 20 |
<div class="form-extend-page-wrap" id="form-license-viewer" style="display:none;">
|
| 21 |
+
<div>
|
| 22 |
+
<em>
|
| 23 |
+
<?php _e( 'Note: We are currently moving Caldera Forms licenses to the CalderaWP License Manager. This panel will be removed in a future version of Caldera Forms.', 'caldera-forms' ); ?>
|
| 24 |
+
</em>
|
| 25 |
+
</div>
|
| 26 |
<?php
|
| 27 |
$addons = apply_filters( 'caldera_forms_get_active_addons', array() );
|
| 28 |
if(empty($addons)){
|
| 81 |
|
| 82 |
})
|
| 83 |
|
| 84 |
+
</script>
|
ui/news_templates.php
CHANGED
|
@@ -8,7 +8,7 @@
|
|
| 8 |
{{#if buttons}}
|
| 9 |
<div style="position: absolute; bottom: 0px; padding: 6px; background: none repeat scroll 0 0 rgba(0, 0, 0, 0.03); left: 0px; right: 0px; border-top: 1px solid rgba(0, 0, 0, 0.06);">
|
| 10 |
{{#each buttons}}
|
| 11 |
-
<a class="button {{#if class}}{{class}}{{/if}}" href="{{link}}" target="_blank">{{title}}</a>
|
| 12 |
{{/each}}
|
| 13 |
</div>
|
| 14 |
{{/if}}
|
|
@@ -51,4 +51,4 @@
|
|
| 51 |
</li>
|
| 52 |
{{/each}}
|
| 53 |
{{/if}}
|
| 54 |
-
</script>
|
| 8 |
{{#if buttons}}
|
| 9 |
<div style="position: absolute; bottom: 0px; padding: 6px; background: none repeat scroll 0 0 rgba(0, 0, 0, 0.03); left: 0px; right: 0px; border-top: 1px solid rgba(0, 0, 0, 0.06);">
|
| 10 |
{{#each buttons}}
|
| 11 |
+
<a class="button {{#if class}}{{class}}{{/if}}" href="{{link}}" target="_blank" rel="nofollow">{{title}}</a>
|
| 12 |
{{/each}}
|
| 13 |
</div>
|
| 14 |
{{/if}}
|
| 51 |
</li>
|
| 52 |
{{/each}}
|
| 53 |
{{/if}}
|
| 54 |
+
</script>
|
ui/panels/conditions.php
ADDED
|
@@ -0,0 +1,366 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
// conditional groups template
|
| 3 |
+
$element['conditional_groups']['magic'] = $magic_tags['system']['tags'];
|
| 4 |
+
?>
|
| 5 |
+
<button style="width:250px;" class="button ajax-trigger" data-request="cf_new_condition_group" data-template="#conditions-tmpl" data-target="#caldera-forms-conditions-panel" type="button"><?php _e( 'Add Condition', 'caldera-forms' ); ?></button>
|
| 6 |
+
<input type="hidden" name="_magic" value="<?php echo esc_attr( json_encode( $magic_tags['system']['tags'] ) ); ?>">
|
| 7 |
+
<input type="hidden" id="cf-conditions-db" name="config[conditional_groups]" value="<?php echo esc_attr( json_encode( $element['conditional_groups'] ) ); ?>"
|
| 8 |
+
class="ajax-trigger"
|
| 9 |
+
data-event="rebuild-conditions"
|
| 10 |
+
data-request="#cf-conditions-db"
|
| 11 |
+
data-type="json"
|
| 12 |
+
data-template="#conditions-tmpl"
|
| 13 |
+
data-target="#caldera-forms-conditions-panel"
|
| 14 |
+
data-autoload="true"
|
| 15 |
+
>
|
| 16 |
+
<div id="caldera-forms-conditions-panel"></div>
|
| 17 |
+
<script type="text/html" id="conditions-tmpl">
|
| 18 |
+
<input type="hidden" name="_open_condition" value="{{_open_condition}}">
|
| 19 |
+
<div class="caldera-editor-conditions-panel" style="margin-bottom: 32px;">
|
| 20 |
+
<ul class="active-conditions-list">
|
| 21 |
+
{{#each conditions}}
|
| 22 |
+
<li class="caldera-condition-nav {{#is @root/_open_condition value=id}}active{{/is}} caldera-forms-condition-group condition-point-{{id}}" style="">
|
| 23 |
+
<input type="hidden" name="conditions[{{id}}][id]" value="{{id}}">
|
| 24 |
+
{{#if name}}
|
| 25 |
+
{{#is @root/_open_condition not=id}}
|
| 26 |
+
<input type="hidden" name="conditions[{{id}}][name]" value="{{name}}">
|
| 27 |
+
<input type="hidden" name="conditions[{{id}}][type]" value="{{type}}">
|
| 28 |
+
{{#if fields}}
|
| 29 |
+
<input type="hidden" name="conditions[{{id}}][fields]" value="{{json fields}}">
|
| 30 |
+
{{/if}}
|
| 31 |
+
{{#if group}}
|
| 32 |
+
<input type="hidden" name="conditions[{{id}}][group]" value="{{json group}}">
|
| 33 |
+
{{/if}}
|
| 34 |
+
|
| 35 |
+
{{/is}}
|
| 36 |
+
<a data-open-group="{{id}}" style="cursor:pointer;"><span id="condition-group-{{id}}">{{name}}</span> <span class="condition-line-number"></span></a>
|
| 37 |
+
{{else}}
|
| 38 |
+
<input type="text" name="conditions[{{id}}][name]" value="{{name}}" data-new-condition="{{id}}" style="width:100%;">
|
| 39 |
+
{{#script}}
|
| 40 |
+
jQuery('[data-new-condition]').focus();
|
| 41 |
+
{{/script}}
|
| 42 |
+
{{/if}}
|
| 43 |
+
</li>
|
| 44 |
+
|
| 45 |
+
{{/each}}
|
| 46 |
+
</ul>
|
| 47 |
+
</div>
|
| 48 |
+
|
| 49 |
+
{{#find conditions @root/_open_condition}}
|
| 50 |
+
<div class="caldera-editor-condition-config caldera-forms-condition-edit" style="margin-top: -27px; width:auto;">
|
| 51 |
+
{{#if name}}
|
| 52 |
+
<div class="condition-point-{{id}}" style="width: 550px; float: left;">
|
| 53 |
+
<div class="caldera-config-group">
|
| 54 |
+
<label for="{{id}}_lable"><?php _e( 'Name', 'caldera-forms' ); ?></label>
|
| 55 |
+
<div class="caldera-config-field">
|
| 56 |
+
<input type="text" name="conditions[{{id}}][name]" id="condition-group-name-{{id}}" data-sync="#condition-group-{{id}}" value="{{name}}" required class="required block-input">
|
| 57 |
+
</div>
|
| 58 |
+
</div>
|
| 59 |
+
|
| 60 |
+
<div class="caldera-config-group">
|
| 61 |
+
<label for="{{id}}_lable">Type</label>
|
| 62 |
+
<div class="caldera-config-field">
|
| 63 |
+
<select name="conditions[{{id}}][type]" data-live-sync="true">
|
| 64 |
+
<option value=""></option>
|
| 65 |
+
<option value="show" {{#is type value="show"}}selected="selected"{{/is}}><?php _e('Show', 'caldera-forms'); ?></option>
|
| 66 |
+
<option value="hide" {{#is type value="hide"}}selected="selected"{{/is}}><?php _e('Hide', 'caldera-forms'); ?></option>
|
| 67 |
+
</select>
|
| 68 |
+
{{#if type}}
|
| 69 |
+
<button type="button" data-add-group="{{id}}" class="pull-right button button-small"><?php echo __('Add Conditional Line', 'caldera-forms'); ?></button>
|
| 70 |
+
{{/if}}
|
| 71 |
+
</div>
|
| 72 |
+
</div>
|
| 73 |
+
{{#each group}}
|
| 74 |
+
{{#unless @first}}
|
| 75 |
+
<span style="display: block; margin: 0px 0px 8px;"><?php _e( 'or', 'caldera-forms' ); ?></span>
|
| 76 |
+
{{/unless}}
|
| 77 |
+
<div class="caldera-condition-group caldera-condition-lines">
|
| 78 |
+
{{#each this}}
|
| 79 |
+
|
| 80 |
+
<div class="caldera-condition-line condition-line-{{@key}}">
|
| 81 |
+
<input type="hidden" name="conditions[{{../../id}}][group][{{parent}}][{{@key}}][parent]" value="{{parent}}">
|
| 82 |
+
<span style="display:inline-block;">{{#if @first}}
|
| 83 |
+
<?php _e( 'if', 'caldera-forms' ); ?>
|
| 84 |
+
{{else}}
|
| 85 |
+
<?php _e( 'and', 'caldera-forms' ); ?>
|
| 86 |
+
{{/if}}</span>
|
| 87 |
+
<input type="hidden" name="conditions[{{../../../id}}][fields][{{@key}}]" value="{{field}}" id="condition-bound-field-{{@key}}" data-live-sync="true">
|
| 88 |
+
<select style="max-width:120px;vertical-align: inherit;" name="conditions[{{../../id}}][group][{{parent}}][{{@key}}][field]" data-sync="#condition-bound-field-{{@key}}">
|
| 89 |
+
<option></option>
|
| 90 |
+
<optgroup label="Fields">
|
| 91 |
+
{{#each @root/fields}}
|
| 92 |
+
<option value="{{ID}}" {{#is ../field value=ID}}selected="selected"{{/is}} {{#is conditions/type value=../../../id}}disabled="disabled"{{/is}}>{{label}} [{{slug}}]</option>
|
| 93 |
+
{{/each}}
|
| 94 |
+
</optgroup>
|
| 95 |
+
<?php /*<optgroup label="System Tags">
|
| 96 |
+
{{#each @root/magic}}
|
| 97 |
+
<option value="{{this}}" {{#is ../field value=this}}selected="selected"{{/is}}>{{this}}</option>
|
| 98 |
+
{{/each}}
|
| 99 |
+
</optgroup>*/ ?>
|
| 100 |
+
</select>
|
| 101 |
+
<select style="max-width:110px;vertical-align: inherit;" name="conditions[{{../../id}}][group][{{parent}}][{{@key}}][compare]">
|
| 102 |
+
<option value="is" {{#is compare value="is"}}selected="selected"{{/is}}><?php _e( 'is', 'caldera-forms' ); ?></option>
|
| 103 |
+
<option value="isnot" {{#is compare value="isnot"}}selected="selected"{{/is}}><?php _e( 'is not', 'caldera-forms' ); ?></option>
|
| 104 |
+
<option value=">" {{#is compare value=">"}}selected="selected"{{/is}}><?php _e( 'is greater than', 'caldera-forms' ); ?></option>
|
| 105 |
+
<option value="<" {{#is compare value="<"}}selected="selected"{{/is}}><?php _e( 'is less than', 'caldera-forms' ); ?></option>
|
| 106 |
+
<option value="startswith" {{#is compare value="startswith"}}selected="selected"{{/is}}><?php _e( 'starts with', 'caldera-forms' ); ?></option>
|
| 107 |
+
<option value="endswith" {{#is compare value="endswith"}}selected="selected"{{/is}}><?php _e( 'ends with', 'caldera-forms' ); ?></option>
|
| 108 |
+
<option value="contains" {{#is compare value="contains"}}selected="selected"{{/is}}><?php _e( 'contains', 'caldera-forms' ); ?></option>
|
| 109 |
+
</select>
|
| 110 |
+
<span data-value="" class="caldera-conditional-field-value" style="padding: 0 12px 0; display:inline-block; width:200px;">
|
| 111 |
+
{{#find @root/fields field}}
|
| 112 |
+
{{#if config/option}}
|
| 113 |
+
<select style="width:165px;vertical-align: inherit;" name="conditions[{{../../../../id}}][group][{{../../parent}}][{{@key}}][value]">
|
| 114 |
+
<option></option>
|
| 115 |
+
{{#each config/option}}
|
| 116 |
+
<option value="{{@key}}" {{#is ../../../value value=@key}}selected="selected"{{/is}}>{{label}}</option>
|
| 117 |
+
{{/each}}
|
| 118 |
+
</select>
|
| 119 |
+
{{else}}
|
| 120 |
+
<input type="text" class="magic-tag-enabled block-input" name="conditions[{{../../../../id}}][group][{{../../parent}}][{{@key}}][value]" value="{{../../value}}" {{#unless ../../field}}placeholder="Select field first" disabled=""{{/unless}}>
|
| 121 |
+
{{/if}}
|
| 122 |
+
{{else}}
|
| 123 |
+
<input type="text" class="magic-tag-enabled block-input" name="conditions[{{../../../../id}}][group][{{../parent}}][{{@key}}][value]" value="{{../value}}" {{#unless ../field}}placeholder="Select field first" disabled=""{{/unless}}>
|
| 124 |
+
{{/find}}
|
| 125 |
+
</span>
|
| 126 |
+
<button class="button pull-right" data-remove-line="{{@key}}" type="button"><i class="icon-join"></i></button>
|
| 127 |
+
</div>
|
| 128 |
+
{{/each}}
|
| 129 |
+
<div style="margin: 12px 0 0;"><button class="button button-small" data-add-line="{{@key}}" data-group="{{../id}}" type="button"><?php _e( 'Add Condition', 'caldera-forms' ); ?></button></div>
|
| 130 |
+
</div>
|
| 131 |
+
{{/each}}
|
| 132 |
+
|
| 133 |
+
<button style="margin: 12px 0 12px;" type="button" class="block-input button" data-confirm="<?php echo esc_attr( __('Are you sure you want to remove this condition?', 'caldera forms') ); ?>" data-remove-group="{{id}}"><?php _e( 'Remove Condition', 'caldera-forms' ); ?></button>
|
| 134 |
+
</div>
|
| 135 |
+
<div style="float: left; width: 288px; padding-left: 12px;">
|
| 136 |
+
{{#if @root/fields}}
|
| 137 |
+
<h4 style="border-bottom: 1px solid rgb(191, 191, 191); margin: 0px 0px 6px; padding: 0px 0px 6px;"><?php _e('Applied Fields', 'caldera-forms'); ?></h4>
|
| 138 |
+
<p class="description"><?php _e('Select the fields to apply this condition to.', 'caldera-forms' ); ?></p>
|
| 139 |
+
{{#each @root/fields}}
|
| 140 |
+
|
| 141 |
+
<label style="display: block; margin-left: 20px;{{#find ../../fields ID}}opacity:0.7;{{/find}}"><input style="margin-left: -20px;" type="checkbox" data-bind-condition="#field-condition-type-{{ID}}" value="{{../id}}" {{#is conditions/type value=../id}}checked="checked"{{else}}{{#find @root/conditions conditions/type}}disabled="disabled"{{/find}}{{/is}} {{#find ../../fields ID}}disabled="disabled"{{/find}}>{{label}} [{{slug}}]</label>
|
| 142 |
+
|
| 143 |
+
{{/each}}
|
| 144 |
+
{{/if}}
|
| 145 |
+
</div>
|
| 146 |
+
{{/if}}
|
| 147 |
+
</div>
|
| 148 |
+
{{/find}}
|
| 149 |
+
|
| 150 |
+
</script>
|
| 151 |
+
<script type="text/javascript">
|
| 152 |
+
var cf_new_condition_line, cf_new_condition_group;
|
| 153 |
+
|
| 154 |
+
jQuery( function( $ ){
|
| 155 |
+
|
| 156 |
+
function get_base_form(){
|
| 157 |
+
var data_fields = $('.caldera-forms-options-form').formJSON(),
|
| 158 |
+
object = {
|
| 159 |
+
_open_condition : data_fields._open_condition,
|
| 160 |
+
conditions : data_fields.conditions,
|
| 161 |
+
fields : data_fields.config.fields,
|
| 162 |
+
magic : data_fields._magic
|
| 163 |
+
};
|
| 164 |
+
|
| 165 |
+
return object;
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
cf_new_condition_group = function(){
|
| 169 |
+
var data = get_base_form(),
|
| 170 |
+
db = $('#cf-conditions-db'),
|
| 171 |
+
id = 'con_' + Math.round(Math.random() * 99887766) + '' + Math.round(Math.random() * 99887766);
|
| 172 |
+
|
| 173 |
+
if( !data.conditions ){
|
| 174 |
+
data.conditions = {};
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
data.conditions[id] = {
|
| 178 |
+
id : id
|
| 179 |
+
};
|
| 180 |
+
|
| 181 |
+
data._open_condition = id;
|
| 182 |
+
|
| 183 |
+
db.val( JSON.stringify( data ) );
|
| 184 |
+
|
| 185 |
+
return data;
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
$( document ).on('click', '[data-add-line]', function(){
|
| 189 |
+
var clicked = $( this ),
|
| 190 |
+
id = clicked.data('addLine'),
|
| 191 |
+
db = $('#cf-conditions-db'),
|
| 192 |
+
data = get_base_form(),
|
| 193 |
+
pid = clicked.data('group'),
|
| 194 |
+
cid = 'cl' + Math.round(Math.random() * 99887766) + '' + Math.round(Math.random() * 99887766);
|
| 195 |
+
|
| 196 |
+
if( !data.conditions[pid].group ){
|
| 197 |
+
data.conditions[pid].group = {};
|
| 198 |
+
}
|
| 199 |
+
if( !data.conditions[pid].group[id] ){
|
| 200 |
+
data.conditions[pid].group[id] = {};
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
// initial line
|
| 204 |
+
data.conditions[pid].group[id][cid] = {
|
| 205 |
+
parent : id
|
| 206 |
+
};
|
| 207 |
+
get_base_form();
|
| 208 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 209 |
+
});
|
| 210 |
+
|
| 211 |
+
$( document ).on('click', '[data-add-group]', function(){
|
| 212 |
+
var clicked = $( this ),
|
| 213 |
+
pid = clicked.data('addGroup'),
|
| 214 |
+
db = $('#cf-conditions-db'),
|
| 215 |
+
data = get_base_form(),
|
| 216 |
+
id = 'rw' + Math.round(Math.random() * 99887766) + '' + Math.round(Math.random() * 99887766),
|
| 217 |
+
cid = 'cl' + Math.round(Math.random() * 99887766) + '' + Math.round(Math.random() * 99887766);
|
| 218 |
+
|
| 219 |
+
if( !data.conditions[pid].group ){
|
| 220 |
+
data.conditions[pid].group = {};
|
| 221 |
+
}
|
| 222 |
+
if( !data.conditions[pid].group[id] ){
|
| 223 |
+
data.conditions[pid].group[id] = {};
|
| 224 |
+
}
|
| 225 |
+
|
| 226 |
+
// initial line
|
| 227 |
+
data.conditions[pid].group[id][cid] = {
|
| 228 |
+
parent : id
|
| 229 |
+
};
|
| 230 |
+
|
| 231 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 232 |
+
});
|
| 233 |
+
$( document ).on('blur change', '[data-new-condition]', function(){
|
| 234 |
+
var clicked = $( this ),
|
| 235 |
+
id = clicked.data('newCondition');
|
| 236 |
+
if( !clicked.val().length ){
|
| 237 |
+
$('.condition-point-' + id).remove();
|
| 238 |
+
}
|
| 239 |
+
var db = $('#cf-conditions-db'),
|
| 240 |
+
data = get_base_form();
|
| 241 |
+
|
| 242 |
+
data._open_condition = id;
|
| 243 |
+
|
| 244 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 245 |
+
});
|
| 246 |
+
$( document ).on('change', '[data-live-sync]', function(){
|
| 247 |
+
|
| 248 |
+
var data = get_base_form(),
|
| 249 |
+
db = $('#cf-conditions-db');
|
| 250 |
+
|
| 251 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 252 |
+
|
| 253 |
+
});
|
| 254 |
+
$( document ).on('click', '#tab_conditions', function(){
|
| 255 |
+
|
| 256 |
+
var data = get_base_form(),
|
| 257 |
+
db = $('#cf-conditions-db');
|
| 258 |
+
|
| 259 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 260 |
+
|
| 261 |
+
});
|
| 262 |
+
|
| 263 |
+
$( document ).on('click', '[data-open-group]', function(){
|
| 264 |
+
var clicked = $( this ),
|
| 265 |
+
id = clicked.data('openGroup'),
|
| 266 |
+
db = $('#cf-conditions-db'),
|
| 267 |
+
data = get_base_form();
|
| 268 |
+
|
| 269 |
+
data._open_condition = id;
|
| 270 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 271 |
+
|
| 272 |
+
});
|
| 273 |
+
|
| 274 |
+
$( document ).on('click', '[data-remove-line]', function(){
|
| 275 |
+
var clicked = $( this ),
|
| 276 |
+
id = clicked.data('removeLine');
|
| 277 |
+
|
| 278 |
+
$('.condition-line-' + id).remove();
|
| 279 |
+
|
| 280 |
+
var db = $('#cf-conditions-db'),
|
| 281 |
+
data = get_base_form();
|
| 282 |
+
|
| 283 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 284 |
+
});
|
| 285 |
+
|
| 286 |
+
$( document ).on('click', '[data-remove-group]', function(){
|
| 287 |
+
var clicked = $( this ),
|
| 288 |
+
id = clicked.data('removeGroup');
|
| 289 |
+
|
| 290 |
+
if( clicked.data('confirm') ){
|
| 291 |
+
if( !confirm( clicked.data('confirm') ) ){
|
| 292 |
+
return;
|
| 293 |
+
}
|
| 294 |
+
}
|
| 295 |
+
|
| 296 |
+
$('.condition-point-' + id).remove();
|
| 297 |
+
|
| 298 |
+
var db = $('#cf-conditions-db'),
|
| 299 |
+
data = get_base_form();
|
| 300 |
+
|
| 301 |
+
data._open_condition = '';
|
| 302 |
+
|
| 303 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 304 |
+
});
|
| 305 |
+
|
| 306 |
+
$( document ).on( 'keydown keyup keypress change', '[data-sync]', function( e ){
|
| 307 |
+
var press = $( this ),
|
| 308 |
+
target = $( press.data('sync') );
|
| 309 |
+
if( target.is( 'input' ) ){
|
| 310 |
+
target.val( press.val() ).trigger( 'change' );
|
| 311 |
+
}else{
|
| 312 |
+
target.html( press.val() );
|
| 313 |
+
}
|
| 314 |
+
});
|
| 315 |
+
$( document ).on( 'change', '[data-bind-condition]', function(){
|
| 316 |
+
|
| 317 |
+
$(document).trigger('show.fieldedit');
|
| 318 |
+
|
| 319 |
+
var clicked = $(this),
|
| 320 |
+
bind = $( clicked.data('bindCondition') );
|
| 321 |
+
if( clicked.is(':checked') ){
|
| 322 |
+
bind.val( clicked.val() );
|
| 323 |
+
}else{
|
| 324 |
+
bind.val( '' );
|
| 325 |
+
}
|
| 326 |
+
|
| 327 |
+
var data = get_base_form(),
|
| 328 |
+
db = $('#cf-conditions-db');
|
| 329 |
+
|
| 330 |
+
db.val( JSON.stringify( data ) ).trigger( 'rebuild-conditions' );
|
| 331 |
+
});
|
| 332 |
+
$( document ).on( 'show.fieldedit', function(){
|
| 333 |
+
|
| 334 |
+
var data = $('#caldera-forms-conditions-panel').formJSON(),
|
| 335 |
+
condition_selectors = $( '.cf-conditional-selector');
|
| 336 |
+
condition_selectors.each( function(){
|
| 337 |
+
var select = $(this),
|
| 338 |
+
selected = select.parent().val(),
|
| 339 |
+
field = select.parent().data('id');
|
| 340 |
+
|
| 341 |
+
select.empty();
|
| 342 |
+
for( var con in data.conditions ){
|
| 343 |
+
var run = true;
|
| 344 |
+
// check field is not in here.
|
| 345 |
+
for( var grp in data.conditions[con].group ){
|
| 346 |
+
for( var ln in data.conditions[con].group[grp] ){
|
| 347 |
+
if( data.conditions[con].group[grp][ln].field === field ){
|
| 348 |
+
run = false;
|
| 349 |
+
}
|
| 350 |
+
}
|
| 351 |
+
}
|
| 352 |
+
if( true === run ){
|
| 353 |
+
var sel = '',
|
| 354 |
+
line = '<option value="' + con + '" ' + ( selected === con ? 'selected="selected"' : '' ) + '>' + data.conditions[con].name + '</option>';
|
| 355 |
+
|
| 356 |
+
select.append( line );
|
| 357 |
+
}
|
| 358 |
+
}
|
| 359 |
+
|
| 360 |
+
});
|
| 361 |
+
});
|
| 362 |
+
|
| 363 |
+
|
| 364 |
+
} );
|
| 365 |
+
|
| 366 |
+
</script>
|
ui/panels/emailer.php
CHANGED
|
@@ -81,7 +81,7 @@ if(!isset($element['mailer']['enable_mailer'])){
|
|
| 81 |
<label><?php echo __('Recipients', 'caldera-forms'); ?> </label>
|
| 82 |
<div class="caldera-config-field">
|
| 83 |
<input type="text" class="field-config magic-tag-enabled" name="config[mailer][recipients]" value="<?php echo $element['mailer']['recipients']; ?>" style="width:400px;">
|
| 84 |
-
<p class="description"><?php echo __('Comma separated list of email addresses.', 'caldera-forms'); ?></p>
|
| 85 |
</div>
|
| 86 |
|
| 87 |
</div>
|
|
@@ -89,7 +89,7 @@ if(!isset($element['mailer']['enable_mailer'])){
|
|
| 89 |
<label><?php echo __('BCC', 'caldera-forms'); ?> </label>
|
| 90 |
<div class="caldera-config-field">
|
| 91 |
<input type="text" class="field-config magic-tag-enabled" name="config[mailer][bcc_to]" value="<?php if(isset( $element['mailer']['bcc_to'] ) ){ echo $element['mailer']['bcc_to']; } ?>" style="width:400px;">
|
| 92 |
-
<p class="description"><?php echo __('Comma separated list of email addresses.', 'caldera-forms'); ?></p>
|
| 93 |
</div>
|
| 94 |
</div>
|
| 95 |
|
|
@@ -114,9 +114,14 @@ if(!isset($element['mailer']['enable_mailer'])){
|
|
| 114 |
<div class="caldera-config-field">
|
| 115 |
<label><input type="checkbox" value="1" name="config[debug_mailer]" class="field-config"<?php if(isset($element['debug_mailer'])){ echo ' checked="checked"'; } ?>> <?php echo __('Enable email send transation log', 'caldera-forms'); ?></label>
|
| 116 |
<p class="description"><?php echo __('If set, entries will have a "Mailer Debug" meta tab to see the transaction log. Do not keep this enabled on production as it sends two emails for tracking.', 'caldera-forms'); ?></p>
|
|
|
|
|
|
|
|
|
|
| 117 |
</div>
|
| 118 |
</div>
|
| 119 |
|
|
|
|
|
|
|
| 120 |
<?php do_action( 'caldera_forms_mailer_config', $element ); ?>
|
| 121 |
|
| 122 |
</div>
|
| 81 |
<label><?php echo __('Recipients', 'caldera-forms'); ?> </label>
|
| 82 |
<div class="caldera-config-field">
|
| 83 |
<input type="text" class="field-config magic-tag-enabled" name="config[mailer][recipients]" value="<?php echo $element['mailer']['recipients']; ?>" style="width:400px;">
|
| 84 |
+
<p class="description"><?php echo __('Comma separated list of email addresses to send the message to.', 'caldera-forms'); ?></p>
|
| 85 |
</div>
|
| 86 |
|
| 87 |
</div>
|
| 89 |
<label><?php echo __('BCC', 'caldera-forms'); ?> </label>
|
| 90 |
<div class="caldera-config-field">
|
| 91 |
<input type="text" class="field-config magic-tag-enabled" name="config[mailer][bcc_to]" value="<?php if(isset( $element['mailer']['bcc_to'] ) ){ echo $element['mailer']['bcc_to']; } ?>" style="width:400px;">
|
| 92 |
+
<p class="description"><?php echo __('Comma separated list of email addresses to send a BCC to.', 'caldera-forms'); ?></p>
|
| 93 |
</div>
|
| 94 |
</div>
|
| 95 |
|
| 114 |
<div class="caldera-config-field">
|
| 115 |
<label><input type="checkbox" value="1" name="config[debug_mailer]" class="field-config"<?php if(isset($element['debug_mailer'])){ echo ' checked="checked"'; } ?>> <?php echo __('Enable email send transation log', 'caldera-forms'); ?></label>
|
| 116 |
<p class="description"><?php echo __('If set, entries will have a "Mailer Debug" meta tab to see the transaction log. Do not keep this enabled on production as it sends two emails for tracking.', 'caldera-forms'); ?></p>
|
| 117 |
+
<p class="description">
|
| 118 |
+
<?php _e( sprintf( 'If you are having email issues, we strongly recommend configuring a third-party mailer service, which is easy to do. %1s.', sprintf( '<a href="https://calderawp.com/doc/improving-the-reliability-of-emails-sent-through-caldera-forms/" target="_blank" rel="nofollow">%1s</a>' , __( 'Learn more here', 'caldera-forms' ), 'caldera-forms') ) ); ?>
|
| 119 |
+
</p>
|
| 120 |
</div>
|
| 121 |
</div>
|
| 122 |
|
| 123 |
+
|
| 124 |
+
|
| 125 |
<?php do_action( 'caldera_forms_mailer_config', $element ); ?>
|
| 126 |
|
| 127 |
</div>
|
ui/panels/layout.php
CHANGED
|
@@ -103,6 +103,7 @@ foreach( (array) $element['layout_grid']['structure'] as $page_key=>$page_struct
|
|
| 103 |
</div>
|
| 104 |
<?php } ?>
|
| 105 |
</div>
|
|
|
|
| 106 |
<?php do_action( 'caldera_forms_layout_config', $element ); ?>
|
| 107 |
<script type="text/html" id="grid-page-tmpl">
|
| 108 |
<div class="layout-grid-panel layout-grid" data-page="{{page_no}}" data-name="<?php echo __('Page', 'caldera-forms'); ?> {{count}}" style="display:none;" id="{{page_no}}">
|
| 103 |
</div>
|
| 104 |
<?php } ?>
|
| 105 |
</div>
|
| 106 |
+
<div class="add-new-item caldera-add-group caldera-add-row"><span class="dashicons dashicons-plus"></span></div>
|
| 107 |
<?php do_action( 'caldera_forms_layout_config', $element ); ?>
|
| 108 |
<script type="text/html" id="grid-page-tmpl">
|
| 109 |
<div class="layout-grid-panel layout-grid" data-page="{{page_no}}" data-name="<?php echo __('Page', 'caldera-forms'); ?> {{count}}" style="display:none;" id="{{page_no}}">
|
ui/panels/layout_toolbar.php
ADDED
|
@@ -0,0 +1,62 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
|
| 2 |
+
<a class="add-new-h2 caldera-add-group caldera-add-page ajax-trigger"
|
| 3 |
+
|
| 4 |
+
data-addtitle="<?php echo __('Page', 'caldera-forms'); ?>"
|
| 5 |
+
data-template="#grid-page-tmpl"
|
| 6 |
+
data-target-insert="append"
|
| 7 |
+
data-request="add_new_grid_page"
|
| 8 |
+
data-target="#grid-pages-panel"
|
| 9 |
+
data-callback="add_page_grid"
|
| 10 |
+
|
| 11 |
+
href="#code_panels_tag"><?php echo __('Add Page', 'caldera-forms'); ?></a>
|
| 12 |
+
<div id="newfield-tool" class="button button-primary button-small layout-new-form-field" title="<?php echo __('Drag onto the form grid below', 'caldera-forms'); ?>">
|
| 13 |
+
<i class="icon-edit" style="display:none;"></i>
|
| 14 |
+
<i class="dashicons dashicons-menu" style="display:none;"></i>
|
| 15 |
+
<span id="new-form-element" class="layout_field_name"><span class="dashicons dashicons-menu" style="margin: 1px 0px 0px -5px;"></span> <?php echo __('Add Element', 'caldera-forms'); ?></span>
|
| 16 |
+
<div class="drag-handle">
|
| 17 |
+
<div class="field_preview"></div>
|
| 18 |
+
</div><input value="" type="hidden" class="field-location">
|
| 19 |
+
</div>
|
| 20 |
+
|
| 21 |
+
<?php
|
| 22 |
+
/*
|
| 23 |
+
<button class="button button-small compact-mode" style="margin-top:-3px; margin-left:10px;" type="button"><?php _e('Compact', 'caldera-forms'); ?></button>
|
| 24 |
+
*/
|
| 25 |
+
?>
|
| 26 |
+
<span id="dismiss-add-element" class="ajax-trigger" data-action="cf_dismiss_pointer" data-pointer="add_element"></span>
|
| 27 |
+
<?php
|
| 28 |
+
$haspointer = get_user_meta( get_current_user_id() , 'cf_pointer_add_element' );
|
| 29 |
+
if(empty($haspointer)){ ?>
|
| 30 |
+
<script>
|
| 31 |
+
|
| 32 |
+
jQuery(document).ready( function($) {
|
| 33 |
+
$( '#new-form-element' ).pointer( {
|
| 34 |
+
content: '<h3>Form Elements & Fields</h3><p><img src="<?php echo CFCORE_URL . 'assets/images/howto.gif'; ?>"></p>',
|
| 35 |
+
position: {
|
| 36 |
+
edge: 'top',
|
| 37 |
+
align: 'left'
|
| 38 |
+
},
|
| 39 |
+
close: function() {
|
| 40 |
+
$('#dismiss-add-element').trigger('click');
|
| 41 |
+
}
|
| 42 |
+
} ).pointer( 'open' );
|
| 43 |
+
});
|
| 44 |
+
|
| 45 |
+
</script>
|
| 46 |
+
<?php } ?>
|
| 47 |
+
<script>
|
| 48 |
+
jQuery(document).on('click','.compact-mode', function(){
|
| 49 |
+
|
| 50 |
+
var form = jQuery('.caldera-forms-options-form'),
|
| 51 |
+
clicked = jQuery(this);
|
| 52 |
+
//console.log(this);
|
| 53 |
+
if(form.hasClass('mini-mode')){
|
| 54 |
+
form.removeClass('mini-mode');
|
| 55 |
+
clicked.removeClass('button-primary');
|
| 56 |
+
}else{
|
| 57 |
+
form.addClass('mini-mode');
|
| 58 |
+
clicked.addClass('button-primary');
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
});
|
| 62 |
+
</script>
|
ui/panels/processors.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
global $form_processors;
|
| 3 |
//dump($element,0);
|
| 4 |
// Get Processors
|
| 5 |
-
$form_processors =
|
| 6 |
|
| 7 |
$form_processors_defaults = array(
|
| 8 |
"var processor_defaults = {};"
|
|
@@ -114,7 +114,7 @@ function processor_wrapper_template($id = '{{id}}', $type = '{{type}}', $config_
|
|
| 114 |
<input type="hidden" class="processor_config_string block-input" value="<?php echo htmlentities( $config_str ); ?>">
|
| 115 |
<br>
|
| 116 |
<br>
|
| 117 |
-
<button class="button block-button delete-processor" data-confirm="<?php echo __('Are you sure you want to remove this processor?', 'caldera-forms'); ?>" type="button"
|
| 118 |
</div>
|
| 119 |
<div id="<?php echo $id; ?>_conditions_pane" style="display:none;" class="wrapper-instance-pane">
|
| 120 |
<p>
|
| 2 |
global $form_processors;
|
| 3 |
//dump($element,0);
|
| 4 |
// Get Processors
|
| 5 |
+
$form_processors = $processors = Caldera_Forms_Processor_Load::get_instance()->get_processors();
|
| 6 |
|
| 7 |
$form_processors_defaults = array(
|
| 8 |
"var processor_defaults = {};"
|
| 114 |
<input type="hidden" class="processor_config_string block-input" value="<?php echo htmlentities( $config_str ); ?>">
|
| 115 |
<br>
|
| 116 |
<br>
|
| 117 |
+
<button class="button block-button delete-processor" data-confirm="<?php echo __('Are you sure you want to remove this processor?', 'caldera-forms'); ?>" type="button"><?php echo __('Remove Processor', 'caldera-forms'); ?></button>
|
| 118 |
</div>
|
| 119 |
<div id="<?php echo $id; ?>_conditions_pane" style="display:none;" class="wrapper-instance-pane">
|
| 120 |
<p>
|
