Click to Chat for WhatsApp Chat

Version Description

Release Info

Developer	bhvreddy
Plugin	Click to Chat for WhatsApp Chat
Version	1.0
Comparing to
See all releases

Version 1.0

Files changed (19) hide show

admin/add_styles_scripts_admin.php +39 -0
admin/admin.php +22 -0
admin/admin_menu.php +73 -0
admin/admin_page.php +571 -0
admin/admin_page_customize_styles.php +742 -0
admin/default-values.php +130 -0
admin/settings_page.php +27 -0
admin/sp_customize_styles.php +29 -0
assets/css/admin_main.css +4765 -0
assets/css/main.css +3756 -0
assets/fonts/ccw.eot +0 -0
assets/fonts/ccw.svg +14 -0
assets/fonts/ccw.ttf +0 -0
assets/fonts/ccw.woff +0 -0
assets/img/WhatsApp_logo_12.png +0 -0
assets/img/send.svg +7 -0
assets/img/send_16.svg +4 -0
assets/img/whatsapp.svg +7 -0
assets/js/admin_app.js +21815 -0

admin/add_styles_scripts_admin.php ADDED Viewed

	@@ -0,0 +1,39 @@


1	+ <?php
2	+ /*
3	+ * Register css styles, javascript files at admin side
4	+ * instead of register multiple styles - as using sass in dev env,
5	+ * import files and at final create less css files
6	+ */
7	+
8	+ if ( ! defined( 'ABSPATH' ) ) exit;
9	+
10	+ // Register css styles, javascript files only on 'click-to-chat' page
11	+ if( ! function_exists('ccw_register_files_admin') ) {
12	+
13	+ function ccw_register_files_admin($hook) {
14	+
15	+ // ?page=click-to-chat
16	+ if( 'toplevel_page_click-to-chat' == $hook \|\| 'click-to-chat_page_ccw-edit-styles' == $hook ) {
17	+
18	+ wp_register_style('ccw_new_css_admin', plugins_url( 'assets/css/admin_main.css', dirname(__FILE__) ) , '', CCW_VERSION );
19	+
20	+
21	+ wp_enqueue_style('ccw_new_css_admin');
22	+
23	+ wp_enqueue_style( 'wp-color-picker' );
24	+
25	+
26	+ wp_enqueue_script( 'ccw_app_admin', plugins_url( 'assets/js/admin_app.js', dirname(__FILE__) ), array( 'wp-color-picker' ), CCW_VERSION, true );
27	+ // wp_enqueue_script( 'ccw_app_admin_dir', plugins_url( 'assets/js/dir.js', dirname(__FILE__) ), '', '', true );
28	+ // return;
29	+ } else {
30	+ return;
31	+ }
32	+
33	+
34	+ }
35	+
36	+ }
37	+
38	+
39	+ add_action('admin_enqueue_scripts', 'ccw_register_files_admin');

admin/admin.php ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ <?php
2	+ /*
3	+ * starting point for the admin side of this plugin.
4	+ *
5	+ * include other file here .. which need in admin side.
6	+ *
7	+ * In click-to-chat.php this file will be loaded as is_admin
8	+ */
9	+
10	+ if ( ! defined( 'ABSPATH' ) ) exit;
11	+
12	+ /************* includes *********/
13	+ require_once('add_styles_scripts_admin.php');
14	+
15	+
16	+ require_once('admin_menu.php');
17	+ require_once('admin_page.php');
18	+ require_once('admin_page_customize_styles.php');
19	+
20	+
21	+
22	+ /************* hooks *********/

admin/admin_menu.php ADDED Viewed

	@@ -0,0 +1,73 @@


1	+ <?php
2	+ /*
3	+ * Admin - menu page - add_menu_page for this plugin - top level menu
4	+ * calls settings_page.php ( ccw_settings_page - > require_once('settings_page.php') )
5	+ * and page content display at admin_menu.php
6	+ */
7	+
8	+ if ( ! defined( 'ABSPATH' ) ) exit;
9	+
10	+ if( ! function_exists('ccw_options_page') ) {
11	+
12	+ function ccw_options_page() {
13	+ add_menu_page(
14	+ 'Click to Chat for WhatsApp - Plugin Option Page',
15	+ 'Click to Chat',
16	+ 'manage_options',
17	+ 'click-to-chat',
18	+ 'ccw_settings_page',
19	+ 'dashicons-format-chat'
20	+ );
21	+ }
22	+ }
23	+
24	+ add_action('admin_menu', 'ccw_options_page');
25	+
26	+
27	+ if( ! function_exists('ccw_settings_page') ) {
28	+
29	+ function ccw_settings_page() {
30	+
31	+ if ( ! current_user_can('manage_options') ) {
32	+ return;
33	+ }
34	+
35	+ require_once('settings_page.php');
36	+
37	+ }
38	+ }
39	+
40	+
41	+
42	+
43	+ // second page
44	+ if( ! function_exists('ccw_options_page_two') ) {
45	+
46	+ function ccw_options_page_two() {
47	+ add_submenu_page(
48	+ 'click-to-chat',
49	+ 'Edit Styles',
50	+ 'Customize Styles',
51	+ 'manage_options',
52	+ 'ccw-edit-styles',
53	+ 'ccw_settings_page_two'
54	+ );
55	+
56	+ }
57	+ }
58	+
59	+ add_action('admin_menu', 'ccw_options_page_two');
60	+
61	+
62	+ if( ! function_exists('ccw_settings_page_two') ) {
63	+
64	+ function ccw_settings_page_two() {
65	+
66	+ if ( ! current_user_can('manage_options') ) {
67	+ return;
68	+ }
69	+
70	+ require_once('sp_customize_styles.php');
71	+
72	+ }
73	+ }

admin/admin_page.php ADDED Viewed

	@@ -0,0 +1,571 @@


1	+ <?php
2	+ /*
3	+ * content of the options page ..
4	+ * admin_menu.php -> settings_page.php -> admin_page.php
5	+ */
6	+
7	+ if ( ! defined( 'ABSPATH' ) ) exit;
8	+
9	+ function ccw_custom_settings() {
10	+
11	+ register_setting( 'ccw_settings_group', 'ccw_options' , 'ccw_options_sanitize' );
12	+
13	+ add_settings_section( 'ccw_settings', '', 'ccw_settings_section', 'ccw_options_settings' );
14	+
15	+ add_settings_field( 'ccw_enable', 'Enable Floating Styles', 'ccw_enable_cb', 'ccw_options_settings', 'ccw_settings' );
16	+ add_settings_field( 'ccw_enable_sc', 'Enable ShortCodes', 'ccw_enable_sc_cb', 'ccw_options_settings', 'ccw_settings' );
17	+ add_settings_field( 'ccw_return_type', 'Return Type', 'ccw_return_type_cb', 'ccw_options_settings', 'ccw_settings' );
18	+ add_settings_field( 'ccw_number', 'WhatsApp Number', 'ccw_number_input_cb', 'ccw_options_settings', 'ccw_settings' );
19	+ add_settings_field( 'ccw_group_id', 'Group Id', 'ccw_group_id_cb', 'ccw_options_settings', 'ccw_settings' );
20	+ add_settings_field( 'ccw_style', 'Style for Desktops', 'ccw_style_cb', 'ccw_options_settings', 'ccw_settings' );
21	+ add_settings_field( 'ccw_style_mobile', 'Style for Mobile Devices', 'ccw_style_mobile_cb', 'ccw_options_settings', 'ccw_settings' );
22	+ add_settings_field( 'ccw_position', 'Position to Place', 'ccw_position_input_cb', 'ccw_options_settings', 'ccw_settings' );
23	+ add_settings_field( 'ccw_placeholder', 'Text to Display', 'ccw_input_placeholder_cb', 'ccw_options_settings', 'ccw_settings' );
24	+ add_settings_field( 'ccw_checkbox', 'Show / Hide ', 'ccw_checkbox_cb', 'ccw_options_settings', 'ccw_settings' );
25	+ add_settings_field( 'ccw_list_id_tohide', 'Posts, Pages Id\'s to Hide', 'ccw_list_id_tohide_cb', 'ccw_options_settings', 'ccw_settings' );
26	+ add_settings_field( 'ccw_list_cat_tohide', 'Categorys to Hide', 'ccw_list_cat_tohide_cb', 'ccw_options_settings', 'ccw_settings' );
27	+ add_settings_field( 'ccw_custom_shortcode', 'Shortcode name', 'ccw_custom_shortcode_cb', 'ccw_options_settings', 'ccw_settings' );
28	+
29	+ }
30	+
31	+
32	+ add_action( 'admin_init', 'ccw_custom_settings' );
33	+
34	+
35	+ // heading
36	+ if( ! function_exists('ccw_settings_section') ) {
37	+
38	+ function ccw_settings_section() {
39	+ echo '<h1>Click to Chat For WhatsApp - Global Settings</h1>';
40	+ }
41	+ }
42	+
43	+
44	+ // enable / disable floating styles
45	+ if( ! function_exists('ccw_enable_cb') ) {
46	+
47	+ function ccw_enable_cb() {
48	+ $ccw_enable = get_option('ccw_options');
49	+ ?>
50	+ <div class="row">
51	+ <div class="input-field col s12">
52	+ <select name="ccw_options[enable]" class="select-1">
53	+ <option value="1">No</option>
54	+ <option value="2" <?php echo esc_attr( $ccw_enable['enable'] ) == 2 ? 'SELECTED' : ''; ?> >Yes</option>
55	+ </select>
56	+ <label>enable</label>
57	+ </div>
58	+ </div>
59	+ <?php
60	+ }
61	+ }
62	+
63	+ // enable / disable shortcodes
64	+ if( ! function_exists('ccw_enable_sc_cb') ) {
65	+
66	+ function ccw_enable_sc_cb() {
67	+ $ccw_enable_sc = get_option('ccw_options');
68	+ ?>
69	+ <div class="row">
70	+ <div class="input-field col s12 select-margin">
71	+ <select name="ccw_options[enable_sc]" class="select-1">
72	+ <option value="1">No</option>
73	+ <option value="2" <?php echo esc_attr( $ccw_enable_sc['enable_sc'] ) == 2 ? 'SELECTED' : ''; ?> >Yes</option>
74	+ </select>
75	+ <label>enable ShortCodes</label>
76	+ <p class="description"> If Selected - No - then Hides Shortcodes and its syntax - <a target="_blank" href="https://medium.com/clicktochat/enable-disable-styles-84293dca3fbd">more info</a> </p>
77	+ </div>
78	+ </div>
79	+ <?php
80	+ }
81	+ }
82	+
83	+ // Return type - chat or group chat
84	+ if( ! function_exists('ccw_return_type_cb') ) {
85	+
86	+ function ccw_return_type_cb() {
87	+ $ccw_return_type = get_option('ccw_options');
88	+ ?>
89	+ <div class="row">
90	+ <div class="input-field col s12 select-margin">
91	+ <select name="ccw_options[return_type]" class="select-1">
92	+ <option value="chat" <?php echo esc_attr( $ccw_return_type['return_type'] ) == 'chat' ? 'SELECTED' : ''; ?> >Chat</option>
93	+ <option value="group_chat" <?php echo esc_attr( $ccw_return_type['return_type'] ) == 'group_chat' ? 'SELECTED' : ''; ?> >Group chat - Invite</option>
94	+ </select>
95	+ <label>Default return type - Chat or Group Chat Invite</label>
96	+ <p class="description"> Default return type for Floating Style, shortcodes. But for shortcodes can change using shortcode attributes - <a target="_blank" href="https://medium.com/clicktochat/return-type-451635e320eb">more info</a> </p>
97	+ </div>
98	+ </div>
99	+ <?php
100	+ }
101	+ }
102	+
103	+
104	+ // Desktop - select style
105	+ if( ! function_exists('ccw_style_cb') ) {
106	+
107	+ function ccw_style_cb() {
108	+ $ccw_style = get_option('ccw_options');
109	+ $style_value = esc_attr( $ccw_style['style'] );
110	+ ?>
111	+ <div class="row">
112	+ <div class="input-field col s12">
113	+ <select name="ccw_options[style]" class="select-2">
114	+ <option value="1" <?php echo $style_value == 1 ? 'SELECTED' : ''; ?> >Style-1</option>
115	+ <option value="2" <?php echo $style_value == 2 ? 'SELECTED' : ''; ?> >Style-2</option>
116	+ <option value="3" <?php echo $style_value == 3 ? 'SELECTED' : ''; ?> >Style-3</option>
117	+ <option value="4" <?php echo $style_value == 4 ? 'SELECTED' : ''; ?> >Style-4</option>
118	+ <option value="5" <?php echo $style_value == 5 ? 'SELECTED' : ''; ?> >Style-5</option>
119	+ <option value="6" <?php echo $style_value == 6 ? 'SELECTED' : ''; ?> >Style-6</option>
120	+ <option value="7" <?php echo $style_value == 7 ? 'SELECTED' : ''; ?> >Style-7</option>
121	+ <option value="8" <?php echo $style_value == 8 ? 'SELECTED' : ''; ?> >Style-8</option>
122	+ <option value="0" <?php echo $style_value == 0 ? 'SELECTED' : ''; ?> >Hide on Desktop Devices</option>
123	+ </select>
124	+ <label>Select Style for Destops</label>
125	+ <p class="description"> - <a target="_blank" href="https://medium.com/clicktochat/select-styles-48527f73e697">List of syles with images</a> </p>
126	+ </div>
127	+ </div>
128	+ <?php
129	+ }
130	+ }
131	+
132	+ // Mobile - Select Style
133	+ if( ! function_exists('ccw_style_mobile_cb') ) {
134	+
135	+ function ccw_style_mobile_cb() {
136	+ $ccw_stylemobile = get_option('ccw_options');
137	+ $style_mobile_value = esc_attr( $ccw_stylemobile['stylemobile'] );
138	+ ?>
139	+ <div class="row">
140	+ <div class="input-field col s12">
141	+ <select name="ccw_options[stylemobile]" class="select-2_2">
142	+ <option value="1" <?php echo $style_mobile_value == 1 ? 'SELECTED' : ''; ?> >Style-1</option>
143	+ <option value="2" <?php echo $style_mobile_value == 2 ? 'SELECTED' : ''; ?> >Style-2</option>
144	+ <option value="3" <?php echo $style_mobile_value == 3 ? 'SELECTED' : ''; ?> >Style-3</option>
145	+ <option value="4" <?php echo $style_mobile_value == 4 ? 'SELECTED' : ''; ?> >Style-4</option>
146	+ <option value="5" <?php echo $style_mobile_value == 5 ? 'SELECTED' : ''; ?> >Style-5</option>
147	+ <option value="6" <?php echo $style_mobile_value == 6 ? 'SELECTED' : ''; ?> >Style-6</option>
148	+ <option value="7" <?php echo $style_mobile_value == 7 ? 'SELECTED' : ''; ?> >Style-7</option>
149	+ <option value="8" <?php echo $style_mobile_value == 8 ? 'SELECTED' : ''; ?> >Style-8</option>
150	+ <option value="0" <?php echo $style_mobile_value == 0 ? 'SELECTED' : ''; ?> >Hide on Mobile Devices</option>
151	+ </select>
152	+ <label>Select Style for Mobile Devices</label>
153	+ </div>
154	+ </div>
155	+ <?php
156	+ }
157	+ }
158	+
159	+ // number
160	+ if( ! function_exists('ccw_number_input_cb') ) {
161	+
162	+ function ccw_number_input_cb() {
163	+ $ccw_number = get_option('ccw_options');
164	+ ?>
165	+ <div class="row">
166	+ <div class="input-field col s12">
167	+ <input name="ccw_options[number]" value="<?php echo esc_attr( $ccw_number['number'] ) ?>" id="whatsapp_number" type="text" class="validate input-margin">
168	+ <label for="whatsapp_number">Enter whatsapp number </label>
169	+ <p class="description">Enter whatsapp number with country code ( e.g. 916123456789 ) please dont include +, ( here in e.g. 91 is country code 6123456789 is mobile number - <a target="_blank" href="https://medium.com/clicktochat/whatsapp-number-b155206825c8">more info</a> ) </p>
170	+ </div>
171	+ </div>
172	+ <?php
173	+ }
174	+ }
175	+
176	+ // Group ID
177	+ if( ! function_exists('ccw_group_id_cb') ) {
178	+
179	+ function ccw_group_id_cb() {
180	+ $ccw_group_id = get_option('ccw_options');
181	+ ?>
182	+ <div class="row">
183	+ <div class="input-field col s12">
184	+ <input name="ccw_options[group_id]" value="<?php echo esc_attr( $ccw_group_id['group_id'] ) ?>" id="whatsapp_group_id" type="text" class="validate input-margin">
185	+ <label for="whatsapp_group_id">whatsapp group ID Extenstion </label>
186	+ <p class="description">Enter whatsapp Group Id - <a target="_blank" href="https://medium.com/clicktochat/later">more info</a> ) </p>
187	+ </div>
188	+ </div>
189	+ <?php
190	+ }
191	+ }
192	+
193	+ // postion
194	+ if( ! function_exists('ccw_position_input_cb') ) {
195	+
196	+ function ccw_position_input_cb() {
197	+ $ccw_position = get_option('ccw_options');
198	+ $ccw_position_value = esc_attr( $ccw_position['position'] )
199	+ ?>
200	+ <div class="row">
201	+ <div class="input-field col s12">
202	+ <select name="ccw_options[position]" class="select">
203	+ <option value="1" <?php echo $ccw_position_value == 1 ? 'SELECTED' : ''; ?> >bottom right</option>
204	+ <option value="2" <?php echo $ccw_position_value == 2 ? 'SELECTED' : ''; ?> >bottom left</option>
205	+ <option value="3" <?php echo $ccw_position_value == 3 ? 'SELECTED' : ''; ?> >top left</option>
206	+ <option value="4" <?php echo $ccw_position_value == 4 ? 'SELECTED' : ''; ?> >top right</option>
207	+ </select>
208	+ <label>Fixed position to place</label>
209	+ <p class="description"> e.g. 10px - please add css units as suffix, e.g. 10px, 10%, 10rem, 10em .. <a target="_blank" href="https://medium.com/clicktochat/position-to-place-984ac32446e6">more info</a> </p>
210	+ </div>
211	+ </div>
212	+
213	+ <div class="row display-none position position-1 bottom-right">
214	+ <div class="input-field col s6">
215	+ <input name="ccw_options[position-1_bottom]" value="<?php echo esc_attr( $ccw_position['position-1_bottom'] ) ?>" id="position_bottom" type="text" class="validate">
216	+ <label for="position_bottom">position_bottom: </label>
217	+ </div>
218	+ <div class="input-field col s6">
219	+ <input name="ccw_options[position-1_right]" value="<?php echo esc_attr( $ccw_position['position-1_right'] ) ?>" id="position_right" type="text" class="validate">
220	+ <label for="position_right">position_right: </label>
221	+ </div>
222	+ </div>
223	+
224	+ <div class="row display-none position position-2 bottom-left">
225	+ <div class="input-field col s6">
226	+ <input name="ccw_options[position-2_bottom]" value="<?php echo esc_attr( $ccw_position['position-2_bottom'] ) ?>" id="position_bottom" type="text" class="validate">
227	+ <label for="position_bottom">position_bottom: </label>
228	+ </div>
229	+ <div class="input-field col s6">
230	+ <input name="ccw_options[position-2_left]" value="<?php echo esc_attr( $ccw_position['position-2_left'] ) ?>" id="position_left" type="text" class="validate">
231	+ <label for="position_left">position_left: </label>
232	+ </div>
233	+ </div>
234	+
235	+
236	+
237	+ <div class="row display-none position position-3 top-left">
238	+ <div class="input-field col s6">
239	+ <input name="ccw_options[position-3_top]" value="<?php echo esc_attr( $ccw_position['position-3_top'] ) ?>" id="position_top" type="text" class="validate">
240	+ <label for="position_top">position_top: </label>
241	+ </div>
242	+ <div class="input-field col s6">
243	+ <input name="ccw_options[position-3_left]" value="<?php echo esc_attr( $ccw_position['position-3_left'] ) ?>" id="position_left" type="text" class="validate">
244	+ <label for="position_left">position_left: </label>
245	+ </div>
246	+ </div>
247	+
248	+ <div class="row display-none position position-4 top-right">
249	+ <div class="input-field col s6">
250	+ <input name="ccw_options[position-4_top]" value="<?php echo esc_attr( $ccw_position['position-4_top'] ) ?>" id="position_top" type="text" class="validate">
251	+ <label for="position_top">position_top: </label>
252	+ </div>
253	+ <div class="input-field col s6">
254	+ <input name="ccw_options[position-4_right]" value="<?php echo esc_attr( $ccw_position['position-4_right'] ) ?>" id="position_right" type="text" class="validate">
255	+ <label for="position_right">position_right: </label>
256	+ </div>
257	+ </div>
258	+
259	+ <?php
260	+ }
261	+ }
262	+
263	+ // Text - placeholder
264	+ if( ! function_exists('ccw_input_placeholder_cb') ) {
265	+
266	+ function ccw_input_placeholder_cb() {
267	+ $ccw_placeholder = get_option('ccw_options');
268	+ ?>
269	+ <div class="row">
270	+ <div class="input-field col s12">
271	+ <input name="ccw_options[input_placeholder]" value="<?php echo esc_attr( $ccw_placeholder['input_placeholder'] ) ?>" id="input_placeholder" type="text" class="validate input-margin">
272	+ <label for="input_placeholder">placeholder value</label>
273	+ <p class="description"> - <a target="_blank" href="https://medium.com/clicktochat/text-to-display-59c478c87167">more info</a> </p>
274	+ </div>
275	+ </div>
276	+ <?php
277	+ }
278	+ }
279	+
280	+ // checkboxes - based on Type of posts ..
281	+ if( ! function_exists('ccw_checkbox_cb') ) {
282	+
283	+ function ccw_checkbox_cb() {
284	+ $ccw_checkbox = get_option('ccw_options');
285	+
286	+
287	+ // Single Posts
288	+ if ( isset( $ccw_checkbox['showon_posts'] ) ) {
289	+ ?>
290	+ <p>
291	+ <input name="ccw_options[showon_posts]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_posts'], 1 ); ?> id="filled-in-box1" />
292	+ <label for="filled-in-box1">Posts</label>
293	+ </p>
294	+ <?php
295	+ } else {
296	+ ?>
297	+ <p>
298	+ <input name="ccw_options[showon_posts]" type="checkbox" value="1" id="filled-in-box1" />
299	+ <label for="filled-in-box1">Posts</label>
300	+ </p>
301	+ <?php
302	+ }
303	+
304	+
305	+ // Page
306	+ if ( isset( $ccw_checkbox['showon_page'] ) ) {
307	+ ?>
308	+ <p>
309	+ <input name="ccw_options[showon_page]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_page'], 1 ); ?> id="filled-in-box2" />
310	+ <label for="filled-in-box2">Pages</label>
311	+ </p>
312	+ <?php
313	+ } else {
314	+ ?>
315	+ <p>
316	+ <input name="ccw_options[showon_page]" type="checkbox" value="1" id="filled-in-box2" />
317	+ <label for="filled-in-box2">Pages</label>
318	+ </p>
319	+ <?php
320	+ }
321	+
322	+
323	+ // Home Page
324	+ if ( isset( $ccw_checkbox['showon_homepage'] ) ) {
325	+ ?>
326	+ <p>
327	+ <input name="ccw_options[showon_homepage]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_homepage'], 1 ); ?> id="filled-in-box3" />
328	+ <label for="filled-in-box3">Home Page</label>
329	+ </p>
330	+ <?php
331	+ } else {
332	+ ?>
333	+ <p>
334	+ <input name="ccw_options[showon_homepage]" type="checkbox" value="1" id="filled-in-box3" />
335	+ <label for="filled-in-box3">Home Page</label>
336	+ </p>
337	+ <?php
338	+ }
339	+
340	+ /* Front Page
341	+ A front page is also a home page, but home page is not a front page
342	+ if front page unchecked - it works on both homepage and fornt page
343	+ but if home page is unchecked - it works only on home page, not on front page */
344	+ if ( isset( $ccw_checkbox['showon_frontpage'] ) ) {
345	+ ?>
346	+ <p>
347	+ <input name="ccw_options[showon_frontpage]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_frontpage'], 1 ); ?> id="filled-in-box4" />
348	+ <label for="filled-in-box4">Front Page</label>
349	+ </p>
350	+ <?php
351	+ } else {
352	+ ?>
353	+ <p>
354	+ <input name="ccw_options[showon_frontpage]" type="checkbox" value="1" id="filled-in-box4" />
355	+ <label for="filled-in-box4">Front Page</label>
356	+ </p>
357	+ <?php
358	+ }
359	+
360	+ // Category
361	+ if ( isset( $ccw_checkbox['showon_category'] ) ) {
362	+ ?>
363	+ <p>
364	+ <input name="ccw_options[showon_category]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_category'], 1 ); ?> id="filled-in-box5" />
365	+ <label for="filled-in-box5">Category</label>
366	+ </p>
367	+ <?php
368	+ } else {
369	+ ?>
370	+ <p>
371	+ <input name="ccw_options[showon_category]" type="checkbox" value="1" id="filled-in-box5" />
372	+ <label for="filled-in-box5">Category</label>
373	+ </p>
374	+ <?php
375	+ }
376	+
377	+ // Archive
378	+ if ( isset( $ccw_checkbox['showon_archive'] ) ) {
379	+ ?>
380	+ <p>
381	+ <input name="ccw_options[showon_archive]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_archive'], 1 ); ?> id="filled-in-box6" />
382	+ <label for="filled-in-box6">Archive</label>
383	+ </p>
384	+ <?php
385	+ } else {
386	+ ?>
387	+ <p>
388	+ <input name="ccw_options[showon_archive]" type="checkbox" value="1" id="filled-in-box6" />
389	+ <label for="filled-in-box6">Archive</label>
390	+ </p>
391	+ <?php
392	+ }
393	+
394	+
395	+ // 404 Page
396	+ if ( isset( $ccw_checkbox['showon_404'] ) ) {
397	+ ?>
398	+ <p>
399	+ <input name="ccw_options[showon_404]" type="checkbox" value="1" <?php checked( $ccw_checkbox['showon_404'], 1 ); ?> id="filled-in-box7" />
400	+ <label for="filled-in-box7">404 Page</label>
401	+ </p>
402	+ <?php
403	+ } else {
404	+ ?>
405	+ <p>
406	+ <input name="ccw_options[showon_404]" type="checkbox" value="1" id="filled-in-box7" />
407	+ <label for="filled-in-box7">404 Page</label>
408	+ </p>
409	+ <?php
410	+ }
411	+ ?>
412	+ <p class="description"> check to show, uncheck to hide - Show/ Hide - Styles - based on type of the page <a target="_blank" href="https://medium.com/clicktochat/show-hide-styles-based-on-type-of-the-page-4f0542a92909">more info</a> </p>
413	+ <?php
414	+ }
415	+ }
416	+
417	+ // ID 's list to hide styles
418	+ if( ! function_exists('ccw_list_id_tohide_cb') ) {
419	+
420	+ function ccw_list_id_tohide_cb() {
421	+ $ccw_list_id_tohide = get_option('ccw_options');
422	+ ?>
423	+ <div class="row">
424	+ <div class="input-field col s12">
425	+ <input name="ccw_options[list_hideon_pages]" value="<?php echo esc_attr( $ccw_list_id_tohide['list_hideon_pages'] ) ?>" id="ccw_list_id_tohide" type="text" class="validate input-margin">
426	+ <label for="ccw_list_id_tohide">Id's list to Hide - add ',' after each id </label>
427	+ <p class="description"> Add Post, Pages, Media - ID's to hide, can add multiple id's separate with comma ( , ) - <a target="_blank" href="https://medium.com/@bhvreddy/show-hide-styles-based-on-id-bb4cbfa091d7">more info</a> </p>
428	+ </div>
429	+ </div>
430	+ <?php
431	+ }
432	+ }
433	+
434	+
435	+ // Categorys list - to hide
436	+ if( ! function_exists('ccw_list_cat_tohide_cb') ) {
437	+
438	+ function ccw_list_cat_tohide_cb() {
439	+ $ccw_list_cat_tohide = get_option('ccw_options');
440	+ ?>
441	+ <div class="row">
442	+ <div class="input-field col s12">
443	+ <input name="ccw_options[list_hideon_cat]" value="<?php echo esc_attr( $ccw_list_cat_tohide['list_hideon_cat'] ) ?>" id="ccw_list_cat_tohide" type="text" class="validate input-margin">
444	+ <label for="ccw_list_cat_tohide">Category name's to Hide - add ',' after each category name </label>
445	+ <p class="description"> Category name's to hide, can add multiple Categories separate with comma ( , ) - <a target="_blank" href="https://medium.com/@bhvreddy/show-hide-styles-based-on-category-52453616cb65">more info</a> </p>
446	+ </div>
447	+ </div>
448	+ <?php
449	+ }
450	+ }
451	+
452	+ // Custom shortcode
453	+ if( ! function_exists('ccw_custom_shortcode_cb') ) {
454	+
455	+ function ccw_custom_shortcode_cb() {
456	+ $ccw_shortcode = get_option('ccw_options');
457	+ ?>
458	+ <div class="row">
459	+ <div class="input-field col s12">
460	+ <input name="ccw_options[shortcode]" value="<?php echo esc_attr( $ccw_shortcode['shortcode'] ) ?>" id="shortcode" type="text" class="validate input-margin">
461	+ <label for="shortcode">shortcode name</label>
462	+ <?php
463	+ $shorcode_list = '';
464	+ foreach ($GLOBALS['shortcode_tags'] AS $key => $value) {
465	+ $shorcode_list .= $key . ', ';
466	+ }
467	+ ?>
468	+ <p class="description"> Default values is 'chat', can customize shortcode name - <a target="_blank" href="https://medium.com/clicktochat/shortcode-name-d90fd531d589">more info</a> </p>
469	+ <p class="description"> please dont add this already existing shorcode names - <?php echo $shorcode_list ?> </p>
470	+ </div>
471	+ </div>
472	+ <?php
473	+ }
474	+ }
475	+
476	+ // Sanitize callback ..
477	+ if( ! function_exists('ccw_options_sanitize') ) {
478	+
479	+ function ccw_options_sanitize( $input ) {
480	+
481	+ if ( ! current_user_can( 'manage_options' ) ) {
482	+ wp_die( 'not allowed to modify - please contact admin ' );
483	+ }
484	+
485	+ $new_input = array();
486	+
487	+ if( isset( $input['enable'] ) )
488	+ $new_input['enable'] = sanitize_text_field( $input['enable'] );
489	+
490	+ if( isset( $input['enable_sc'] ) )
491	+ $new_input['enable_sc'] = sanitize_text_field( $input['enable_sc'] );
492	+
493	+ if( isset( $input['number'] ) )
494	+ $new_input['number'] = sanitize_text_field( $input['number'] );
495	+
496	+ if( isset( $input['input_placeholder'] ) )
497	+ $new_input['input_placeholder'] = sanitize_text_field( $input['input_placeholder'] );
498	+
499	+ if( isset( $input['position'] ) )
500	+ $new_input['position'] = sanitize_text_field( $input['position'] );
501	+
502	+ if( isset( $input['style'] ) )
503	+ $new_input['style'] = sanitize_text_field( $input['style'] );
504	+
505	+ if( isset( $input['stylemobile'] ) )
506	+ $new_input['stylemobile'] = sanitize_text_field( $input['stylemobile'] );
507	+
508	+ if( isset( $input['position-1_bottom'] ) )
509	+ $new_input['position-1_bottom'] = sanitize_text_field( $input['position-1_bottom'] );
510	+
511	+ if( isset( $input['position-1_right'] ) )
512	+ $new_input['position-1_right'] = sanitize_text_field( $input['position-1_right'] );
513	+
514	+ if( isset( $input['position-2_bottom'] ) )
515	+ $new_input['position-2_bottom'] = sanitize_text_field( $input['position-2_bottom'] );
516	+
517	+ if( isset( $input['position-2_left'] ) )
518	+ $new_input['position-2_left'] = sanitize_text_field( $input['position-2_left'] );
519	+
520	+ if( isset( $input['position-3_top'] ) )
521	+ $new_input['position-3_top'] = sanitize_text_field( $input['position-3_top'] );
522	+
523	+ if( isset( $input['position-3_left'] ) )
524	+ $new_input['position-3_left'] = sanitize_text_field( $input['position-3_left'] );
525	+
526	+ if( isset( $input['position-4_top'] ) )
527	+ $new_input['position-4_top'] = sanitize_text_field( $input['position-4_top'] );
528	+
529	+ if( isset( $input['position-4_right'] ) )
530	+ $new_input['position-4_right'] = sanitize_text_field( $input['position-4_right'] );
531	+
532	+ if( isset( $input['showon_posts'] ) )
533	+ $new_input['showon_posts'] = sanitize_text_field( $input['showon_posts'] );
534	+
535	+ if( isset( $input['showon_page'] ) )
536	+ $new_input['showon_page'] = sanitize_text_field( $input['showon_page'] );
537	+
538	+ if( isset( $input['showon_homepage'] ) )
539	+ $new_input['showon_homepage'] = sanitize_text_field( $input['showon_homepage'] );
540	+
541	+ if( isset( $input['showon_frontpage'] ) )
542	+ $new_input['showon_frontpage'] = sanitize_text_field( $input['showon_frontpage'] );
543	+
544	+ if( isset( $input['showon_category'] ) )
545	+ $new_input['showon_category'] = sanitize_text_field( $input['showon_category'] );
546	+
547	+ if( isset( $input['showon_archive'] ) )
548	+ $new_input['showon_archive'] = sanitize_text_field( $input['showon_archive'] );
549	+
550	+ if( isset( $input['showon_404'] ) )
551	+ $new_input['showon_404'] = sanitize_text_field( $input['showon_404'] );
552	+
553	+ if( isset( $input['list_hideon_pages'] ) )
554	+ $new_input['list_hideon_pages'] = sanitize_text_field( $input['list_hideon_pages'] );
555	+
556	+ if( isset( $input['list_hideon_cat'] ) )
557	+ $new_input['list_hideon_cat'] = sanitize_text_field( $input['list_hideon_cat'] );
558	+
559	+ if( isset( $input['shortcode'] ) )
560	+ $new_input['shortcode'] = sanitize_text_field( $input['shortcode'] );
561	+
562	+ if( isset( $input['return_type'] ) )
563	+ $new_input['return_type'] = sanitize_text_field( $input['return_type'] );
564	+
565	+ if( isset( $input['group_id'] ) )
566	+ $new_input['group_id'] = sanitize_text_field( $input['group_id'] );
567	+
568	+ // $new_input = sanitize_text_field($input);
569	+ return $new_input;
570	+ }
571	+ }

admin/admin_page_customize_styles.php ADDED Viewed

	@@ -0,0 +1,742 @@


1	+ <?php
2	+ /*
3	+ * content of the options page .. Customize Styles ..
4	+ * admin_menu.php -> settings_page.php -> admin_page.php
5	+ * in name exists - this short values - it means
6	+ * cs - customize styles
7	+ * cb - call back - function
8	+ */
9	+
10	+ if ( ! defined( 'ABSPATH' ) ) exit;
11	+
12	+ function ccw_customize_styles() {
13	+
14	+ register_setting( 'ccw_settings_group_cs', 'ccw_options_cs' , 'ccw_options_sanitize_cs_cb' );
15	+
16	+ add_settings_section( 'ccw_settings_cs', '', 'ccw_settings_section_cs_cb', 'ccw_options_settings_cs' );
17	+
18	+ add_settings_field( 'ccw_style_1_cs', 'Style 1', 'ccw_style_1_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
19	+ add_settings_field( 'ccw_style_2_cs', 'Style 2', 'ccw_style_2_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
20	+ add_settings_field( 'ccw_style_3_cs', 'Style 3', 'ccw_style_3_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
21	+ add_settings_field( 'ccw_style_4_cs', 'Style 4', 'ccw_style_4_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
22	+ add_settings_field( 'ccw_style_5_cs', 'Style 5', 'ccw_style_5_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
23	+ add_settings_field( 'ccw_style_6_cs', 'Style 6', 'ccw_style_6_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
24	+ add_settings_field( 'ccw_style_7_cs', 'Style 7', 'ccw_style_7_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
25	+ add_settings_field( 'ccw_style_8_cs', 'Style 8', 'ccw_style_8_cb', 'ccw_options_settings_cs', 'ccw_settings_cs' );
26	+
27	+ }
28	+ add_action( 'admin_init', 'ccw_customize_styles' );
29	+
30	+
31	+
32	+ if( ! function_exists('ccw_settings_section_cs_cb') ) {
33	+
34	+ function ccw_settings_section_cs_cb() {
35	+ echo '<h1>Customize Styles</h1>';
36	+ }
37	+ }
38	+
39	+
40	+ if( ! function_exists('ccw_style_1_cb') ) {
41	+
42	+ function ccw_style_1_cb() {
43	+ $ccw_style_1 = get_option('ccw_options_cs');
44	+ ?>
45	+ <ul class="collapsible" data-collapsible="accordion">
46	+ <li>
47	+ <div class="collapsible-header">Style 1</div>
48	+ <div class="collapsible-body">
49	+
50	+ <div class="row">
51	+ <div class="col s6">
52	+ <p>Color of text</p>
53	+ </div>
54	+ <div class="input-field col s6">
55	+ <input name="ccw_options_cs[s1_text_color]" data-default-color="#9e9e9e" value="<?php echo esc_attr( $ccw_style_1['s1_text_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
56	+ </div>
57	+ </div>
58	+
59	+ <div class="row">
60	+ <div class="col s6">
61	+ <p>Color of text when focus on input box</p>
62	+ </div>
63	+ <div class="input-field col s6">
64	+ <input name="ccw_options_cs[s1_text_color_onfocus]" data-default-color="#26a69a" value="<?php echo esc_attr( $ccw_style_1['s1_text_color_onfocus'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
65	+ </div>
66	+ </div>
67	+
68	+ <div class="row">
69	+ <div class="col s6">
70	+ <p>Color of input field bottom border</p>
71	+ </div>
72	+ <div class="input-field col s6">
73	+ <input name="ccw_options_cs[s1_border_color]" data-default-color="#9e9e9e" value="<?php echo esc_attr( $ccw_style_1['s1_border_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
74	+ </div>
75	+ </div>
76	+
77	+ <div class="row">
78	+ <div class="col s6">
79	+ <p>Color of input field border bottom on focus</p>
80	+ </div>
81	+ <div class="input-field col s6">
82	+ <input name="ccw_options_cs[s1_border_color_onfocus]" data-default-color="#26a69a" value="<?php echo esc_attr( $ccw_style_1['s1_border_color_onfocus'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
83	+ </div>
84	+ </div>
85	+
86	+ <div class="row">
87	+ <div class="col s6">
88	+ <p>Color of submit button</p>
89	+ </div>
90	+ <div class="input-field col s6">
91	+ <input name="ccw_options_cs[s1_submit_btn_color]" data-default-color="#26a69a" value="<?php echo esc_attr( $ccw_style_1['s1_submit_btn_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
92	+ </div>
93	+ </div>
94	+
95	+ <div class="row">
96	+ <div class="col s6">
97	+ <p>Color of submit button - text, icon </p>
98	+ </div>
99	+ <div class="input-field col s6">
100	+ <input name="ccw_options_cs[s1_submit_btn_text_and_icon_color]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_1['s1_submit_btn_text_and_icon_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
101	+ </div>
102	+ </div>
103	+
104	+ <div class="row hide">
105	+ <div class="col s6">
106	+ <p>Icon size</p>
107	+ </div>
108	+ <div class="input-field col s4">
109	+ <input name="ccw_options_cs[s1_width]" value="<?php echo esc_attr( $ccw_style_1['s1_width'] ) ?>" type="text" class="" >
110	+ </div>
111	+ </div>
112	+
113	+ </div>
114	+ </div>
115	+ </li>
116	+ </ul>
117	+ <?php
118	+ }
119	+ }
120	+
121	+
122	+ if( ! function_exists('ccw_style_2_cb') ) {
123	+
124	+ function ccw_style_2_cb() {
125	+ $ccw_style_2 = get_option('ccw_options_cs');
126	+ $s2_decoration_value = esc_attr( $ccw_style_2['s2_decoration'] );
127	+ $s2_decoration_onhover = esc_attr( $ccw_style_2['s2_decoration_onhover'] );
128	+ ?>
129	+ <ul class="collapsible" data-collapsible="accordion">
130	+ <li>
131	+ <div class="collapsible-header">Style 2</div>
132	+ <div class="collapsible-body">
133	+
134	+ <div class="row">
135	+ <div class="col s6">
136	+ <p>Text Color</p>
137	+ </div>
138	+ <div class="input-field col s6">
139	+ <input name="ccw_options_cs[s2_text_color]" data-default-color="inherit" value="<?php echo esc_attr( $ccw_style_2['s2_text_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
140	+ </div>
141	+ </div>
142	+
143	+ <div class="row">
144	+ <div class="col s6">
145	+ <p>Text Color When Hover</p>
146	+ </div>
147	+ <div class="input-field col s6">
148	+ <input name="ccw_options_cs[s2_text_color_onhover]" data-default-color="inherit" value="<?php echo esc_attr( $ccw_style_2['s2_text_color_onhover'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
149	+ </div>
150	+ </div>
151	+
152	+ <div class="row">
153	+ <div class="col s6">
154	+ <p>Text Decoration</p>
155	+ </div>
156	+ <div class="input-field col s6">
157	+ <select name="ccw_options_cs[s2_decoration]" class="select-2_2">
158	+ <option value="none" <?php echo $s2_decoration_value == 'none' ? 'SELECTED' : ''; ?> >none</option>
159	+ <option value="underline" <?php echo $s2_decoration_value == 'underline' ? 'SELECTED' : ''; ?> >underline</option>
160	+ <option value="overline" <?php echo $s2_decoration_value == 'overline' ? 'SELECTED' : ''; ?> >overline</option>
161	+ <option value="line-through" <?php echo $s2_decoration_value == 'line-through' ? 'SELECTED' : ''; ?> >line-through</option>
162	+ <option value="initial" <?php echo $s2_decoration_value == 'initial' ? 'SELECTED' : ''; ?> >initial</option>
163	+ <option value="inherit" <?php echo $s2_decoration_value == 'inherit' ? 'SELECTED' : ''; ?> >inherit</option>
164	+ </select>
165	+ <label>Text Decoration</label>
166	+ </div>
167	+ </div>
168	+
169	+ <div class="row">
170	+ <div class="col s6">
171	+ <p>Text Decoration when Hover</p>
172	+ </div>
173	+ <div class="input-field col s6">
174	+ <select name="ccw_options_cs[s2_decoration_onhover]" class="select-2_2">
175	+ <option value="none" <?php echo $s2_decoration_onhover == 'none' ? 'SELECTED' : ''; ?> >none</option>
176	+ <option value="underline" <?php echo $s2_decoration_onhover == 'underline' ? 'SELECTED' : ''; ?> >underline</option>
177	+ <option value="overline" <?php echo $s2_decoration_onhover == 'overline' ? 'SELECTED' : ''; ?> >overline</option>
178	+ <option value="line-through" <?php echo $s2_decoration_onhover == 'line-through' ? 'SELECTED' : ''; ?> >line-through</option>
179	+ <option value="initial" <?php echo $s2_decoration_onhover == 'initial' ? 'SELECTED' : ''; ?> >initial</option>
180	+ <option value="inherit" <?php echo $s2_decoration_onhover == 'inherit' ? 'SELECTED' : ''; ?> >inherit</option>
181	+ </select>
182	+ <label>Text Decoration on focus</label>
183	+ </div>
184	+ </div>
185	+
186	+ </div>
187	+ </div>
188	+ </li>
189	+ </ul>
190	+ <?php
191	+ }
192	+ }
193	+
194	+
195	+ if( ! function_exists('ccw_style_3_cb') ) {
196	+
197	+ function ccw_style_3_cb() {
198	+ $ccw_style_3 = get_option('ccw_options_cs');
199	+ ?>
200	+ <ul class="collapsible" data-collapsible="accordion">
201	+ <li>
202	+ <div class="collapsible-header">Style 3</div>
203	+ <div class="collapsible-body">
204	+
205	+ <div class="row">
206	+ <div class="col s6">
207	+ <p>Icon size</p>
208	+ </div>
209	+ <div class="input-field col s4">
210	+ <input name="ccw_options_cs[s3_icon_size]" value="<?php echo esc_attr( $ccw_style_3['s3_icon_size'] ) ?>" type="text" class="" >
211	+ </div>
212	+ </div>
213	+
214	+ </div>
215	+ </div>
216	+ </li>
217	+ </ul>
218	+
219	+ <?php
220	+ }
221	+ }
222	+
223	+ if( ! function_exists('ccw_style_4_cb') ) {
224	+
225	+ function ccw_style_4_cb() {
226	+ $ccw_style_4 = get_option('ccw_options_cs');
227	+ ?>
228	+ <ul class="collapsible" data-collapsible="accordion">
229	+ <li>
230	+ <div class="collapsible-header">Style 4</div>
231	+ <div class="collapsible-body">
232	+
233	+
234	+ <div class="row">
235	+ <div class="col s6">
236	+ <p>Text Color</p>
237	+ </div>
238	+ <div class="input-field col s6">
239	+ <input name="ccw_options_cs[s4_text_color]" data-default-color="rgba(0, 0, 0, 0.6)" value="<?php echo esc_attr( $ccw_style_4['s4_text_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
240	+ </div>
241	+ </div>
242	+
243	+ <div class="row">
244	+ <div class="col s6">
245	+ <p>Background Color</p>
246	+ </div>
247	+ <div class="input-field col s6">
248	+ <input name="ccw_options_cs[s4_background_color]" data-default-color="#e4e4e4" value="<?php echo esc_attr( $ccw_style_4['s4_background_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
249	+ </div>
250	+ </div>
251	+
252	+ </div>
253	+ </div>
254	+ </li>
255	+ </ul>
256	+
257	+ <?php
258	+ }
259	+ }
260	+
261	+
262	+
263	+ if( ! function_exists('ccw_style_5_cb') ) {
264	+
265	+ function ccw_style_5_cb() {
266	+ $ccw_style_5 = get_option('ccw_options_cs');
267	+ ?>
268	+ <ul class="collapsible" data-collapsible="accordion">
269	+ <li>
270	+ <div class="collapsible-header">Style 5</div>
271	+ <div class="collapsible-body">
272	+
273	+ <div class="row">
274	+ <div class="col s6">
275	+ <p>Color of icon</p>
276	+ </div>
277	+ <div class="input-field col s6">
278	+ <!-- style="height: 1.375rem;" or 22px -->
279	+ <input name="ccw_options_cs[s5_color]" data-default-color="#000" value="<?php echo esc_attr( $ccw_style_5['s5_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
280	+ </div>
281	+ </div>
282	+
283	+ <div class="row">
284	+ <div class="col s6">
285	+ <p>Color of icon - when hover </p>
286	+ </div>
287	+ <div class="input-field col s6">
288	+ <input name="ccw_options_cs[s5_hover_color]" data-default-color="#ddd" value="<?php echo esc_attr( $ccw_style_5['s5_hover_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
289	+ </div>
290	+ </div>
291	+
292	+ <div class="row">
293	+ <div class="col s6">
294	+ <p>Size of icon</p>
295	+ </div>
296	+ <div class="input-field col s4">
297	+ <input name="ccw_options_cs[s5_icon_size]" value="<?php echo esc_attr( $ccw_style_5['s5_icon_size'] ) ?>" type="text" class="" >
298	+ </div>
299	+ </div>
300	+
301	+ </div>
302	+ </li>
303	+ </ul>
304	+
305	+ <?php
306	+ }
307	+ }
308	+
309	+
310	+ if( ! function_exists('ccw_style_6_cb') ) {
311	+
312	+ function ccw_style_6_cb() {
313	+ $ccw_style_6 = get_option('ccw_options_cs');
314	+ ?>
315	+ <ul class="collapsible" data-collapsible="accordion">
316	+ <li>
317	+ <div class="collapsible-header">Style 6</div>
318	+ <div class="collapsible-body">
319	+
320	+ <div class="row">
321	+ <div class="col s6">
322	+ <p>Color of icon</p>
323	+ </div>
324	+ <div class="input-field col s6">
325	+ <!-- style="height: 1.375rem;" or 22px -->
326	+ <input name="ccw_options_cs[s6_color]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_6['s6_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
327	+ </div>
328	+ </div>
329	+
330	+ <div class="row">
331	+ <div class="col s6">
332	+ <p>Color of icon - when hover </p>
333	+ </div>
334	+ <div class="input-field col s6">
335	+ <input name="ccw_options_cs[s6_hover_color]" data-default-color="#000" value="<?php echo esc_attr( $ccw_style_6['s6_hover_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
336	+ </div>
337	+ </div>
338	+
339	+ <div class="row">
340	+ <div class="col s6">
341	+ <p>Size of icon</p>
342	+ </div>
343	+ <div class="input-field col s4">
344	+ <input name="ccw_options_cs[s6_icon_size]" value="<?php echo esc_attr( $ccw_style_6['s6_icon_size'] ) ?>" type="text" class="" >
345	+ </div>
346	+ </div>
347	+
348	+ <div class="row">
349	+ <div class="col s6">
350	+ <p>Circle color </p>
351	+ </div>
352	+ <div class="input-field col s6">
353	+ <input name="ccw_options_cs[s6_circle_background_color]" data-default-color="#ffa500" value="<?php echo esc_attr( $ccw_style_6['s6_circle_background_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
354	+ </div>
355	+ </div>
356	+
357	+ <div class="row">
358	+ <div class="col s6">
359	+ <p>Circle color - when hover </p>
360	+ </div>
361	+ <div class="input-field col s6">
362	+ <input name="ccw_options_cs[s6_circle_background_hover_color]" data-default-color="#ffa500" value="<?php echo esc_attr( $ccw_style_6['s6_circle_background_hover_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
363	+ </div>
364	+ </div>
365	+
366	+
367	+ <div class="row">
368	+ <div class="col s6">
369	+ <p>Circle Height</p>
370	+ </div>
371	+ <div class="input-field col s4">
372	+ <input name="ccw_options_cs[s6_circle_height]" value="<?php echo esc_attr( $ccw_style_6['s6_circle_height'] ) ?>" type="text" class="" >
373	+ </div>
374	+ </div>
375	+
376	+ <div class="row">
377	+ <div class="col s6">
378	+ <p>Circle Width</p>
379	+ </div>
380	+ <div class="input-field col s4">
381	+ <input name="ccw_options_cs[s6_circle_width]" value="<?php echo esc_attr( $ccw_style_6['s6_circle_width'] ) ?>" type="text" class="" >
382	+ </div>
383	+ </div>
384	+
385	+ <div class="row">
386	+ <div class="col s6">
387	+ <p>Circle Line Height</p>
388	+ </div>
389	+ <div class="input-field col s4">
390	+ <input name="ccw_options_cs[s6_line_height]" value="<?php echo esc_attr( $ccw_style_6['s6_line_height'] ) ?>" type="text" class="" >
391	+ </div>
392	+ </div>
393	+
394	+ <p class="description">initial add height, width, line-height same values - if feels like icon is not center then adjust 'Line Height' to make icon looks center of the circle</p>
395	+
396	+ </div>
397	+ </div>
398	+ </li>
399	+ </ul>
400	+
401	+ <?php
402	+ }
403	+ }
404	+
405	+
406	+
407	+ if( ! function_exists('ccw_style_7_cb') ) {
408	+
409	+ function ccw_style_7_cb() {
410	+ $ccw_style_7 = get_option('ccw_options_cs');
411	+ ?>
412	+ <ul class="collapsible" data-collapsible="accordion">
413	+ <li>
414	+ <div class="collapsible-header">Style 7</div>
415	+ <div class="collapsible-body">
416	+
417	+
418	+ <div class="row">
419	+ <div class="col s6">
420	+ <p>Color of icon</p>
421	+ </div>
422	+ <div class="input-field col s6">
423	+ <!-- style="height: 1.375rem;" or 22px -->
424	+ <input name="ccw_options_cs[s7_color]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_7['s7_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
425	+ </div>
426	+ </div>
427	+
428	+ <div class="row">
429	+ <div class="col s6">
430	+ <p>Color of icon - when hover </p>
431	+ </div>
432	+ <div class="input-field col s6">
433	+ <input name="ccw_options_cs[s7_hover_color]" data-default-color="#000" value="<?php echo esc_attr( $ccw_style_7['s7_hover_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
434	+ </div>
435	+ </div>
436	+
437	+ <div class="row">
438	+ <div class="col s6">
439	+ <p>Size of icon</p>
440	+ </div>
441	+ <div class="input-field col s4">
442	+ <input name="ccw_options_cs[s7_icon_size]" value="<?php echo esc_attr( $ccw_style_7['s7_icon_size'] ) ?>" type="text" class="" >
443	+ </div>
444	+ </div>
445	+
446	+ <div class="row">
447	+ <div class="col s6">
448	+ <p>box color </p>
449	+ </div>
450	+ <div class="input-field col s6">
451	+ <input name="ccw_options_cs[s7_box_background_color]" data-default-color="#ffa500" value="<?php echo esc_attr( $ccw_style_7['s7_box_background_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
452	+ </div>
453	+ </div>
454	+
455	+ <div class="row">
456	+ <div class="col s6">
457	+ <p>box color - when hover </p>
458	+ </div>
459	+ <div class="input-field col s6">
460	+ <input name="ccw_options_cs[s7_box_background_hover_color]" data-default-color="#ffa500" value="<?php echo esc_attr( $ccw_style_7['s7_box_background_hover_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
461	+ </div>
462	+ </div>
463	+
464	+
465	+ <div class="row">
466	+ <div class="col s6">
467	+ <p>box Height</p>
468	+ </div>
469	+ <div class="input-field col s4">
470	+ <input name="ccw_options_cs[s7_box_height]" value="<?php echo esc_attr( $ccw_style_7['s7_box_height'] ) ?>" type="text" class="" >
471	+ </div>
472	+ </div>
473	+
474	+ <div class="row">
475	+ <div class="col s6">
476	+ <p>box Width</p>
477	+ </div>
478	+ <div class="input-field col s4">
479	+ <input name="ccw_options_cs[s7_box_width]" value="<?php echo esc_attr( $ccw_style_7['s7_box_width'] ) ?>" type="text" class="" >
480	+ </div>
481	+ </div>
482	+
483	+ <div class="row">
484	+ <div class="col s6">
485	+ <p>box Line Height</p>
486	+ </div>
487	+ <div class="input-field col s4">
488	+ <input name="ccw_options_cs[s7_line_height]" value="<?php echo esc_attr( $ccw_style_7['s7_line_height'] ) ?>" type="text" class="" >
489	+ </div>
490	+ </div>
491	+
492	+ <p class="description">initial add height, width, line-height same values - if feels like icon is not center then adjust 'Line Height' to make icon looks center of the box</p>
493	+
494	+
495	+ </div>
496	+ </div>
497	+ </li>
498	+ </ul>
499	+
500	+ <?php
501	+ }
502	+ }
503	+
504	+
505	+ if( ! function_exists('ccw_style_8_cb') ) {
506	+
507	+ function ccw_style_8_cb() {
508	+ $ccw_style_8 = get_option('ccw_options_cs');
509	+ $s8_icon_float = esc_attr( $ccw_style_8['s8_icon_float'] )
510	+ ?>
511	+ <ul class="collapsible" data-collapsible="accordion">
512	+ <li>
513	+ <div class="collapsible-header">Style 8</div>
514	+ <div class="collapsible-body">
515	+
516	+
517	+ <div class="row">
518	+ <div class="col s6">
519	+ <p>Text Color</p>
520	+ </div>
521	+ <div class="input-field col s6">
522	+ <input name="ccw_options_cs[s8_text_color]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_8['s8_text_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
523	+ </div>
524	+ </div>
525	+
526	+ <div class="row">
527	+ <div class="col s6">
528	+ <p>Background Color</p>
529	+ </div>
530	+ <div class="input-field col s6">
531	+ <input name="ccw_options_cs[s8_background_color]" data-default-color="#26a69a" value="<?php echo esc_attr( $ccw_style_8['s8_background_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
532	+ </div>
533	+ </div>
534	+
535	+ <div class="row">
536	+ <div class="col s6">
537	+ <p>Icon color</p>
538	+ </div>
539	+ <div class="input-field col s6">
540	+ <input name="ccw_options_cs[s8_icon_color]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_8['s8_icon_color'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
541	+ </div>
542	+ </div>
543	+
544	+ <div class="row">
545	+ <div class="col s6">
546	+ <p>Text Color on hover</p>
547	+ </div>
548	+ <div class="input-field col s6">
549	+ <input name="ccw_options_cs[s8_text_color_onhover]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_8['s8_text_color_onhover'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
550	+ </div>
551	+ </div>
552	+
553	+ <div class="row">
554	+ <div class="col s6">
555	+ <p>Background Color on hover</p>
556	+ </div>
557	+ <div class="input-field col s6">
558	+ <input name="ccw_options_cs[s8_background_color_onhover]" data-default-color="#26a69a" value="<?php echo esc_attr( $ccw_style_8['s8_background_color_onhover'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
559	+ </div>
560	+ </div>
561	+
562	+ <div class="row">
563	+ <div class="col s6">
564	+ <p>Icon color on hover</p>
565	+ </div>
566	+ <div class="input-field col s6">
567	+ <input name="ccw_options_cs[s8_icon_color_onhover]" data-default-color="#fff" value="<?php echo esc_attr( $ccw_style_8['s8_icon_color_onhover'] ) ?>" type="text" class="color-wp" style="height: 1.375rem;" >
568	+ </div>
569	+ </div>
570	+
571	+ <div class="row">
572	+ <div class="col s6">
573	+ <p>Icon float</p>
574	+ </div>
575	+ <div class="input-field col s6">
576	+ <select name="ccw_options_cs[s8_icon_float]" class="select-2_2">
577	+ <option value="left" <?php echo $s8_icon_float == 'left' ? 'SELECTED' : ''; ?> >left</option>
578	+ <option value="right" <?php echo $s8_icon_float == 'right' ? 'SELECTED' : ''; ?> >right</option>
579	+ <option value="hide" <?php echo $s8_icon_float == 'hide' ? 'SELECTED' : ''; ?> >hide</option>
580	+ </select>
581	+ <label>Icon flow</label>
582	+ </div>
583	+ </div>
584	+
585	+ <div class="row hide">
586	+ <div class="col s6">
587	+ <p>Icon size</p>
588	+ </div>
589	+ <div class="input-field col s4">
590	+ <input name="ccw_options_cs[s8_1_width]" value="<?php echo esc_attr( $ccw_style_8['s8_1_width'] ) ?>" type="text" class="" >
591	+ </div>
592	+ </div>
593	+
594	+ </div>
595	+ </div>
596	+ </li>
597	+ </ul>
598	+
599	+ <?php
600	+ }
601	+ }
602	+
603	+
604	+
605	+
606	+
607	+ if( ! function_exists('ccw_options_sanitize_cs_cb') ) {
608	+
609	+ function ccw_options_sanitize_cs_cb( $input ) {
610	+
611	+ if ( ! current_user_can( 'manage_options' ) ) {
612	+ wp_die( 'not allowed to modify - please contact admin ' );
613	+ }
614	+
615	+ $new_input = array();
616	+
617	+ if( isset( $input['s1_text_color'] ) )
618	+ $new_input['s1_text_color'] = sanitize_text_field( $input['s1_text_color'] );
619	+
620	+ if( isset( $input['s1_text_color_onfocus'] ) )
621	+ $new_input['s1_text_color_onfocus'] = sanitize_text_field( $input['s1_text_color_onfocus'] );
622	+
623	+ if( isset( $input['s1_border_color'] ) )
624	+ $new_input['s1_border_color'] = sanitize_text_field( $input['s1_border_color'] );
625	+
626	+ if( isset( $input['s1_border_color_onfocus'] ) )
627	+ $new_input['s1_border_color_onfocus'] = sanitize_text_field( $input['s1_border_color_onfocus'] );
628	+
629	+ if( isset( $input['s1_submit_btn_color'] ) )
630	+ $new_input['s1_submit_btn_color'] = sanitize_text_field( $input['s1_submit_btn_color'] );
631	+
632	+ if( isset( $input['s1_submit_btn_text_and_icon_color'] ) )
633	+ $new_input['s1_submit_btn_text_and_icon_color'] = sanitize_text_field( $input['s1_submit_btn_text_and_icon_color'] );
634	+
635	+ if( isset( $input['s1_width'] ) )
636	+ $new_input['s1_width'] = sanitize_text_field( $input['s1_width'] );
637	+
638	+ if( isset( $input['s2_text_color'] ) )
639	+ $new_input['s2_text_color'] = sanitize_text_field( $input['s2_text_color'] );
640	+
641	+ if( isset( $input['s2_text_color_onhover'] ) )
642	+ $new_input['s2_text_color_onhover'] = sanitize_text_field( $input['s2_text_color_onhover'] );
643	+
644	+ if( isset( $input['s2_decoration'] ) )
645	+ $new_input['s2_decoration'] = sanitize_text_field( $input['s2_decoration'] );
646	+
647	+ if( isset( $input['s2_decoration_onhover'] ) )
648	+ $new_input['s2_decoration_onhover'] = sanitize_text_field( $input['s2_decoration_onhover'] );
649	+
650	+ if( isset( $input['s3_icon_size'] ) )
651	+ $new_input['s3_icon_size'] = sanitize_text_field( $input['s3_icon_size'] );
652	+
653	+ if( isset( $input['s4_text_color'] ) )
654	+ $new_input['s4_text_color'] = sanitize_text_field( $input['s4_text_color'] );
655	+
656	+ if( isset( $input['s4_background_color'] ) )
657	+ $new_input['s4_background_color'] = sanitize_text_field( $input['s4_background_color'] );
658	+
659	+ if( isset( $input['s5_color'] ) )
660	+ $new_input['s5_color'] = sanitize_text_field( $input['s5_color'] );
661	+
662	+ if( isset( $input['s5_hover_color'] ) )
663	+ $new_input['s5_hover_color'] = sanitize_text_field( $input['s5_hover_color'] );
664	+
665	+ if( isset( $input['s5_icon_size'] ) )
666	+ $new_input['s5_icon_size'] = sanitize_text_field( $input['s5_icon_size'] );
667	+
668	+ if( isset( $input['s6_color'] ) )
669	+ $new_input['s6_color'] = sanitize_text_field( $input['s6_color'] );
670	+
671	+ if( isset( $input['s6_hover_color'] ) )
672	+ $new_input['s6_hover_color'] = sanitize_text_field( $input['s6_hover_color'] );
673	+
674	+ if( isset( $input['s6_icon_size'] ) )
675	+ $new_input['s6_icon_size'] = sanitize_text_field( $input['s6_icon_size'] );
676	+
677	+ if( isset( $input['s6_circle_background_color'] ) )
678	+ $new_input['s6_circle_background_color'] = sanitize_text_field( $input['s6_circle_background_color'] );
679	+
680	+ if( isset( $input['s6_circle_background_hover_color'] ) )
681	+ $new_input['s6_circle_background_hover_color'] = sanitize_text_field( $input['s6_circle_background_hover_color'] );
682	+
683	+ if( isset( $input['s6_circle_height'] ) )
684	+ $new_input['s6_circle_height'] = sanitize_text_field( $input['s6_circle_height'] );
685	+
686	+ if( isset( $input['s6_circle_width'] ) )
687	+ $new_input['s6_circle_width'] = sanitize_text_field( $input['s6_circle_width'] );
688	+
689	+ if( isset( $input['s6_line_height'] ) )
690	+ $new_input['s6_line_height'] = sanitize_text_field( $input['s6_line_height'] );
691	+
692	+ if( isset( $input['s7_color'] ) )
693	+ $new_input['s7_color'] = sanitize_text_field( $input['s7_color'] );
694	+
695	+ if( isset( $input['s7_hover_color'] ) )
696	+ $new_input['s7_hover_color'] = sanitize_text_field( $input['s7_hover_color'] );
697	+
698	+ if( isset( $input['s7_icon_size'] ) )
699	+ $new_input['s7_icon_size'] = sanitize_text_field( $input['s7_icon_size'] );
700	+
701	+ if( isset( $input['s7_box_background_color'] ) )
702	+ $new_input['s7_box_background_color'] = sanitize_text_field( $input['s7_box_background_color'] );
703	+
704	+ if( isset( $input['s7_box_background_hover_color'] ) )
705	+ $new_input['s7_box_background_hover_color'] = sanitize_text_field( $input['s7_box_background_hover_color'] );
706	+
707	+ if( isset( $input['s7_box_height'] ) )
708	+ $new_input['s7_box_height'] = sanitize_text_field( $input['s7_box_height'] );
709	+
710	+ if( isset( $input['s7_box_width'] ) )
711	+ $new_input['s7_box_width'] = sanitize_text_field( $input['s7_box_width'] );
712	+
713	+ if( isset( $input['s7_line_height'] ) )
714	+ $new_input['s7_line_height'] = sanitize_text_field( $input['s7_line_height'] );
715	+
716	+ if( isset( $input['s8_text_color'] ) )
717	+ $new_input['s8_text_color'] = sanitize_text_field( $input['s8_text_color'] );
718	+
719	+ if( isset( $input['s8_background_color'] ) )
720	+ $new_input['s8_background_color'] = sanitize_text_field( $input['s8_background_color'] );
721	+
722	+ if( isset( $input['s8_icon_color'] ) )
723	+ $new_input['s8_icon_color'] = sanitize_text_field( $input['s8_icon_color'] );
724	+
725	+ if( isset( $input['s8_text_color_onhover'] ) )
726	+ $new_input['s8_text_color_onhover'] = sanitize_text_field( $input['s8_text_color_onhover'] );
727	+
728	+ if( isset( $input['s8_background_color_onhover'] ) )
729	+ $new_input['s8_background_color_onhover'] = sanitize_text_field( $input['s8_background_color_onhover'] );
730	+
731	+ if( isset( $input['s8_icon_color_onhover'] ) )
732	+ $new_input['s8_icon_color_onhover'] = sanitize_text_field( $input['s8_icon_color_onhover'] );
733	+
734	+ if( isset( $input['s8_icon_float'] ) )
735	+ $new_input['s8_icon_float'] = sanitize_text_field( $input['s8_icon_float'] );
736	+
737	+ if( isset( $input['s8_1_width'] ) )
738	+ $new_input['s8_1_width'] = sanitize_text_field( $input['s8_1_width'] );
739	+
740	+ return $new_input;
741	+ }
742	+ }

admin/default-values.php ADDED Viewed

	@@ -0,0 +1,130 @@


1	+ <?php
2	+ /*
3	+ * set the default values
4	+ * which stores in database options table
5	+ * dont override user settings
6	+ * get user setting value and merge with newly added values
7	+ *
8	+ * ccw_plugin_details - this values will be overrides..
9	+ */
10	+
11	+ if ( ! defined( 'ABSPATH' ) ) exit;
12	+
13	+
14	+ // plugin details
15	+ $plugin_details = array(
16	+ 'version' => '1.0.0',
17	+ );
18	+
19	+ // Always use update_option - override new values .. don't preseve already existing values
20	+ update_option( 'ccw_plugin_details', $plugin_details );
21	+
22	+
23	+
24	+
25	+
26	+ // top level options page
27	+ $values = array(
28	+ 'enable' => '2',
29	+ 'enable_sc' => '2',
30	+ 'number' => '918897606725',
31	+ 'input_placeholder' => 'WhatsApp us',
32	+ 'position' => '1',
33	+ 'style' => '1',
34	+ 'stylemobile' => '3',
35	+ 'position-1_bottom' => '10px',
36	+ 'position-1_right' => '10px',
37	+ 'position-2_bottom' => '10px',
38	+ 'position-2_left' => '10px',
39	+ 'position-3_top' => '10px',
40	+ 'position-3_left' => '10px',
41	+ 'position-4_top' => '10px',
42	+ 'position-4_right' => '10px',
43	+ 'showon_posts' => '1',
44	+ 'showon_page' => '1',
45	+ 'showon_homepage' => '1',
46	+ 'showon_frontpage' => '1',
47	+ 'showon_category' => '1',
48	+ 'showon_archive' => '1',
49	+ 'showon_404' => '1',
50	+ 'list_hideon_pages' => '',
51	+ 'list_hideon_cat' => '',
52	+ 'shortcode' => 'chat',
53	+
54	+ 'return_type' => 'chat', // chat or group_chat
55	+ 'group_id' => 'DuEZlyOo94A1QirOX42zKr',
56	+ );
57	+
58	+ // update_option( 'ccw_options', $values );
59	+ // add_option( 'ccw_options', $values );
60	+
61	+ $db_values = get_option( 'ccw_options', array() );
62	+ $update_values = array_merge($values, $db_values);
63	+ update_option('ccw_options', $update_values);
64	+
65	+
66	+
67	+
68	+
69	+
70	+ // customize styles - options page
71	+ $values_cs = array(
72	+ 's1_text_color' => '#9e9e9e',
73	+ 's1_text_color_onfocus' => '#26a69a',
74	+ 's1_border_color' => '#9e9e9e',
75	+ 's1_border_color_onfocus' => '#26a69a',
76	+ 's1_submit_btn_color' => '#26a69a',
77	+ 's1_submit_btn_text_and_icon_color' => '#fff',
78	+ 's1_width' => 'auto',
79	+
80	+ 's2_text_color' => 'initial',
81	+ 's2_text_color_onhover' => 'initial',
82	+ 's2_decoration' => 'initial',
83	+ 's2_decoration_onhover' => 'initial',
84	+
85	+ 's3_icon_size' => '48px',
86	+
87	+ 's4_text_color' => 'rgba(0, 0, 0, 0.6)',
88	+ 's4_background_color' => '#e4e4e4',
89	+
90	+ 's5_color' => '#000',
91	+ 's5_hover_color' => '#ddd',
92	+ 's5_icon_size' => '24px',
93	+
94	+ 's6_color' => '#fff',
95	+ 's6_hover_color' => '#000',
96	+ 's6_icon_size' => '24px',
97	+ 's6_circle_background_color' => '#ffa500',
98	+ 's6_circle_background_hover_color' => '#00e51e',
99	+ 's6_circle_height' => '48px',
100	+ 's6_circle_width' => '48px',
101	+ 's6_line_height' => '48px',
102	+
103	+ 's7_color' => '#fff',
104	+ 's7_hover_color' => '#000',
105	+ 's7_icon_size' => '24px',
106	+ 's7_box_background_color' => '#ffa500',
107	+ 's7_box_background_hover_color' => '#00e51e',
108	+ 's7_box_height' => '48px',
109	+ 's7_box_width' => '48px',
110	+ 's7_line_height' => '48px',
111	+
112	+ 's8_text_color' => '#fff',
113	+ 's8_background_color' => '#26a69a',
114	+ 's8_icon_color' => '#fff',
115	+
116	+ 's8_text_color_onhover' => '#fff',
117	+ 's8_background_color_onhover' => '#26a69a',
118	+ 's8_icon_color_onhover' => '#fff',
119	+ 's8_icon_float' => 'right',
120	+ 's8_1_width' => '',
121	+ );
122	+
123	+ $db_values_cs = get_option( 'ccw_options_cs', array() );
124	+ $update_values_cs = array_merge($values_cs, $db_values_cs);
125	+ update_option('ccw_options_cs', $update_values_cs);
126	+
127	+
128	+
129	+
130	+

admin/settings_page.php ADDED Viewed

	@@ -0,0 +1,27 @@


1	+ <?php
2	+ /*
3	+ * options page
4	+ * content of this page load / continue at admin_page.php
5	+ */
6	+
7	+ if ( ! defined( 'ABSPATH' ) ) exit;
8	+
9	+ ?>
10	+
11	+ <div class="wrap">
12	+
13	+ <?php settings_errors(); ?>
14	+
15	+ <div class="row">
16	+ <div class="col s12 m12 xl6">
17	+ <form action="options.php" method="post" class="col s12">
18	+ <?php settings_fields( 'ccw_settings_group' ); ?>
19	+ <?php do_settings_sections( 'ccw_options_settings' ) ?>
20	+ <?php submit_button() ?>
21	+ </form>
22	+ </div>
23	+ <div class="col admin_guide">
24	+ </div>
25	+ </div>
26	+
27	+ </div>

admin/sp_customize_styles.php ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ <?php
2	+ /*
3	+ * settings page - customize styles ( settings_page.php is main page and this is sub page )
4	+ * options page
5	+ * content of this page load / continue at admin_page_customize_styles.php
6	+ * cs - customize styles
7	+ */
8	+
9	+ if ( ! defined( 'ABSPATH' ) ) exit;
10	+
11	+ ?>
12	+
13	+ <div class="wrap">
14	+
15	+ <?php settings_errors(); ?>
16	+
17	+ <div class="row">
18	+ <div class="col s12 m12 xl6">
19	+ <form action="options.php" method="post" class="col s12">
20	+ <?php settings_fields( 'ccw_settings_group_cs' ); ?>
21	+ <?php do_settings_sections( 'ccw_options_settings_cs' ) ?>
22	+ <?php submit_button() ?>
23	+ </form>
24	+ </div>
25	+ <div class="col admin_guide">
26	+ </div>
27	+ </div>
28	+
29	+ </div>

assets/css/admin_main.css ADDED Viewed

	@@ -0,0 +1,4765 @@


1	+ /*
2	+ * Materializecss
3	+ * custom Code
4	+ */
5	+
6	+
7	+ /* Materializecss - http://materializecss.com/ */
8	+
9	+ .materialize-red {
10	+ background-color: #e51c23 !important; }
11	+
12	+ .materialize-red-text {
13	+ color: #e51c23 !important; }
14	+
15	+ .materialize-red.lighten-5 {
16	+ background-color: #fdeaeb !important; }
17	+
18	+ .materialize-red-text.text-lighten-5 {
19	+ color: #fdeaeb !important; }
20	+
21	+ .materialize-red.lighten-4 {
22	+ background-color: #f8c1c3 !important; }
23	+
24	+ .materialize-red-text.text-lighten-4 {
25	+ color: #f8c1c3 !important; }
26	+
27	+ .materialize-red.lighten-3 {
28	+ background-color: #f3989b !important; }
29	+
30	+ .materialize-red-text.text-lighten-3 {
31	+ color: #f3989b !important; }
32	+
33	+ .materialize-red.lighten-2 {
34	+ background-color: #ee6e73 !important; }
35	+
36	+ .materialize-red-text.text-lighten-2 {
37	+ color: #ee6e73 !important; }
38	+
39	+ .materialize-red.lighten-1 {
40	+ background-color: #ea454b !important; }
41	+
42	+ .materialize-red-text.text-lighten-1 {
43	+ color: #ea454b !important; }
44	+
45	+ .materialize-red.darken-1 {
46	+ background-color: #d0181e !important; }
47	+
48	+ .materialize-red-text.text-darken-1 {
49	+ color: #d0181e !important; }
50	+
51	+ .materialize-red.darken-2 {
52	+ background-color: #b9151b !important; }
53	+
54	+ .materialize-red-text.text-darken-2 {
55	+ color: #b9151b !important; }
56	+
57	+ .materialize-red.darken-3 {
58	+ background-color: #a21318 !important; }
59	+
60	+ .materialize-red-text.text-darken-3 {
61	+ color: #a21318 !important; }
62	+
63	+ .materialize-red.darken-4 {
64	+ background-color: #8b1014 !important; }
65	+
66	+ .materialize-red-text.text-darken-4 {
67	+ color: #8b1014 !important; }
68	+
69	+ .red {
70	+ background-color: #F44336 !important; }
71	+
72	+ .red-text {
73	+ color: #F44336 !important; }
74	+
75	+ .red.lighten-5 {
76	+ background-color: #FFEBEE !important; }
77	+
78	+ .red-text.text-lighten-5 {
79	+ color: #FFEBEE !important; }
80	+
81	+ .red.lighten-4 {
82	+ background-color: #FFCDD2 !important; }
83	+
84	+ .red-text.text-lighten-4 {
85	+ color: #FFCDD2 !important; }
86	+
87	+ .red.lighten-3 {
88	+ background-color: #EF9A9A !important; }
89	+
90	+ .red-text.text-lighten-3 {
91	+ color: #EF9A9A !important; }
92	+
93	+ .red.lighten-2 {
94	+ background-color: #E57373 !important; }
95	+
96	+ .red-text.text-lighten-2 {
97	+ color: #E57373 !important; }
98	+
99	+ .red.lighten-1 {
100	+ background-color: #EF5350 !important; }
101	+
102	+ .red-text.text-lighten-1 {
103	+ color: #EF5350 !important; }
104	+
105	+ .red.darken-1 {
106	+ background-color: #E53935 !important; }
107	+
108	+ .red-text.text-darken-1 {
109	+ color: #E53935 !important; }
110	+
111	+ .red.darken-2 {
112	+ background-color: #D32F2F !important; }
113	+
114	+ .red-text.text-darken-2 {
115	+ color: #D32F2F !important; }
116	+
117	+ .red.darken-3 {
118	+ background-color: #C62828 !important; }
119	+
120	+ .red-text.text-darken-3 {
121	+ color: #C62828 !important; }
122	+
123	+ .red.darken-4 {
124	+ background-color: #B71C1C !important; }
125	+
126	+ .red-text.text-darken-4 {
127	+ color: #B71C1C !important; }
128	+
129	+ .red.accent-1 {
130	+ background-color: #FF8A80 !important; }
131	+
132	+ .red-text.text-accent-1 {
133	+ color: #FF8A80 !important; }
134	+
135	+ .red.accent-2 {
136	+ background-color: #FF5252 !important; }
137	+
138	+ .red-text.text-accent-2 {
139	+ color: #FF5252 !important; }
140	+
141	+ .red.accent-3 {
142	+ background-color: #FF1744 !important; }
143	+
144	+ .red-text.text-accent-3 {
145	+ color: #FF1744 !important; }
146	+
147	+ .red.accent-4 {
148	+ background-color: #D50000 !important; }
149	+
150	+ .red-text.text-accent-4 {
151	+ color: #D50000 !important; }
152	+
153	+ .pink {
154	+ background-color: #e91e63 !important; }
155	+
156	+ .pink-text {
157	+ color: #e91e63 !important; }
158	+
159	+ .pink.lighten-5 {
160	+ background-color: #fce4ec !important; }
161	+
162	+ .pink-text.text-lighten-5 {
163	+ color: #fce4ec !important; }
164	+
165	+ .pink.lighten-4 {
166	+ background-color: #f8bbd0 !important; }
167	+
168	+ .pink-text.text-lighten-4 {
169	+ color: #f8bbd0 !important; }
170	+
171	+ .pink.lighten-3 {
172	+ background-color: #f48fb1 !important; }
173	+
174	+ .pink-text.text-lighten-3 {
175	+ color: #f48fb1 !important; }
176	+
177	+ .pink.lighten-2 {
178	+ background-color: #f06292 !important; }
179	+
180	+ .pink-text.text-lighten-2 {
181	+ color: #f06292 !important; }
182	+
183	+ .pink.lighten-1 {
184	+ background-color: #ec407a !important; }
185	+
186	+ .pink-text.text-lighten-1 {
187	+ color: #ec407a !important; }
188	+
189	+ .pink.darken-1 {
190	+ background-color: #d81b60 !important; }
191	+
192	+ .pink-text.text-darken-1 {
193	+ color: #d81b60 !important; }
194	+
195	+ .pink.darken-2 {
196	+ background-color: #c2185b !important; }
197	+
198	+ .pink-text.text-darken-2 {
199	+ color: #c2185b !important; }
200	+
201	+ .pink.darken-3 {
202	+ background-color: #ad1457 !important; }
203	+
204	+ .pink-text.text-darken-3 {
205	+ color: #ad1457 !important; }
206	+
207	+ .pink.darken-4 {
208	+ background-color: #880e4f !important; }
209	+
210	+ .pink-text.text-darken-4 {
211	+ color: #880e4f !important; }
212	+
213	+ .pink.accent-1 {
214	+ background-color: #ff80ab !important; }
215	+
216	+ .pink-text.text-accent-1 {
217	+ color: #ff80ab !important; }
218	+
219	+ .pink.accent-2 {
220	+ background-color: #ff4081 !important; }
221	+
222	+ .pink-text.text-accent-2 {
223	+ color: #ff4081 !important; }
224	+
225	+ .pink.accent-3 {
226	+ background-color: #f50057 !important; }
227	+
228	+ .pink-text.text-accent-3 {
229	+ color: #f50057 !important; }
230	+
231	+ .pink.accent-4 {
232	+ background-color: #c51162 !important; }
233	+
234	+ .pink-text.text-accent-4 {
235	+ color: #c51162 !important; }
236	+
237	+ .purple {
238	+ background-color: #9c27b0 !important; }
239	+
240	+ .purple-text {
241	+ color: #9c27b0 !important; }
242	+
243	+ .purple.lighten-5 {
244	+ background-color: #f3e5f5 !important; }
245	+
246	+ .purple-text.text-lighten-5 {
247	+ color: #f3e5f5 !important; }
248	+
249	+ .purple.lighten-4 {
250	+ background-color: #e1bee7 !important; }
251	+
252	+ .purple-text.text-lighten-4 {
253	+ color: #e1bee7 !important; }
254	+
255	+ .purple.lighten-3 {
256	+ background-color: #ce93d8 !important; }
257	+
258	+ .purple-text.text-lighten-3 {
259	+ color: #ce93d8 !important; }
260	+
261	+ .purple.lighten-2 {
262	+ background-color: #ba68c8 !important; }
263	+
264	+ .purple-text.text-lighten-2 {
265	+ color: #ba68c8 !important; }
266	+
267	+ .purple.lighten-1 {
268	+ background-color: #ab47bc !important; }
269	+
270	+ .purple-text.text-lighten-1 {
271	+ color: #ab47bc !important; }
272	+
273	+ .purple.darken-1 {
274	+ background-color: #8e24aa !important; }
275	+
276	+ .purple-text.text-darken-1 {
277	+ color: #8e24aa !important; }
278	+
279	+ .purple.darken-2 {
280	+ background-color: #7b1fa2 !important; }
281	+
282	+ .purple-text.text-darken-2 {
283	+ color: #7b1fa2 !important; }
284	+
285	+ .purple.darken-3 {
286	+ background-color: #6a1b9a !important; }
287	+
288	+ .purple-text.text-darken-3 {
289	+ color: #6a1b9a !important; }
290	+
291	+ .purple.darken-4 {
292	+ background-color: #4a148c !important; }
293	+
294	+ .purple-text.text-darken-4 {
295	+ color: #4a148c !important; }
296	+
297	+ .purple.accent-1 {
298	+ background-color: #ea80fc !important; }
299	+
300	+ .purple-text.text-accent-1 {
301	+ color: #ea80fc !important; }
302	+
303	+ .purple.accent-2 {
304	+ background-color: #e040fb !important; }
305	+
306	+ .purple-text.text-accent-2 {
307	+ color: #e040fb !important; }
308	+
309	+ .purple.accent-3 {
310	+ background-color: #d500f9 !important; }
311	+
312	+ .purple-text.text-accent-3 {
313	+ color: #d500f9 !important; }
314	+
315	+ .purple.accent-4 {
316	+ background-color: #aa00ff !important; }
317	+
318	+ .purple-text.text-accent-4 {
319	+ color: #aa00ff !important; }
320	+
321	+ .deep-purple {
322	+ background-color: #673ab7 !important; }
323	+
324	+ .deep-purple-text {
325	+ color: #673ab7 !important; }
326	+
327	+ .deep-purple.lighten-5 {
328	+ background-color: #ede7f6 !important; }
329	+
330	+ .deep-purple-text.text-lighten-5 {
331	+ color: #ede7f6 !important; }
332	+
333	+ .deep-purple.lighten-4 {
334	+ background-color: #d1c4e9 !important; }
335	+
336	+ .deep-purple-text.text-lighten-4 {
337	+ color: #d1c4e9 !important; }
338	+
339	+ .deep-purple.lighten-3 {
340	+ background-color: #b39ddb !important; }
341	+
342	+ .deep-purple-text.text-lighten-3 {
343	+ color: #b39ddb !important; }
344	+
345	+ .deep-purple.lighten-2 {
346	+ background-color: #9575cd !important; }
347	+
348	+ .deep-purple-text.text-lighten-2 {
349	+ color: #9575cd !important; }
350	+
351	+ .deep-purple.lighten-1 {
352	+ background-color: #7e57c2 !important; }
353	+
354	+ .deep-purple-text.text-lighten-1 {
355	+ color: #7e57c2 !important; }
356	+
357	+ .deep-purple.darken-1 {
358	+ background-color: #5e35b1 !important; }
359	+
360	+ .deep-purple-text.text-darken-1 {
361	+ color: #5e35b1 !important; }
362	+
363	+ .deep-purple.darken-2 {
364	+ background-color: #512da8 !important; }
365	+
366	+ .deep-purple-text.text-darken-2 {
367	+ color: #512da8 !important; }
368	+
369	+ .deep-purple.darken-3 {
370	+ background-color: #4527a0 !important; }
371	+
372	+ .deep-purple-text.text-darken-3 {
373	+ color: #4527a0 !important; }
374	+
375	+ .deep-purple.darken-4 {
376	+ background-color: #311b92 !important; }
377	+
378	+ .deep-purple-text.text-darken-4 {
379	+ color: #311b92 !important; }
380	+
381	+ .deep-purple.accent-1 {
382	+ background-color: #b388ff !important; }
383	+
384	+ .deep-purple-text.text-accent-1 {
385	+ color: #b388ff !important; }
386	+
387	+ .deep-purple.accent-2 {
388	+ background-color: #7c4dff !important; }
389	+
390	+ .deep-purple-text.text-accent-2 {
391	+ color: #7c4dff !important; }
392	+
393	+ .deep-purple.accent-3 {
394	+ background-color: #651fff !important; }
395	+
396	+ .deep-purple-text.text-accent-3 {
397	+ color: #651fff !important; }
398	+
399	+ .deep-purple.accent-4 {
400	+ background-color: #6200ea !important; }
401	+
402	+ .deep-purple-text.text-accent-4 {
403	+ color: #6200ea !important; }
404	+
405	+ .indigo {
406	+ background-color: #3f51b5 !important; }
407	+
408	+ .indigo-text {
409	+ color: #3f51b5 !important; }
410	+
411	+ .indigo.lighten-5 {
412	+ background-color: #e8eaf6 !important; }
413	+
414	+ .indigo-text.text-lighten-5 {
415	+ color: #e8eaf6 !important; }
416	+
417	+ .indigo.lighten-4 {
418	+ background-color: #c5cae9 !important; }
419	+
420	+ .indigo-text.text-lighten-4 {
421	+ color: #c5cae9 !important; }
422	+
423	+ .indigo.lighten-3 {
424	+ background-color: #9fa8da !important; }
425	+
426	+ .indigo-text.text-lighten-3 {
427	+ color: #9fa8da !important; }
428	+
429	+ .indigo.lighten-2 {
430	+ background-color: #7986cb !important; }
431	+
432	+ .indigo-text.text-lighten-2 {
433	+ color: #7986cb !important; }
434	+
435	+ .indigo.lighten-1 {
436	+ background-color: #5c6bc0 !important; }
437	+
438	+ .indigo-text.text-lighten-1 {
439	+ color: #5c6bc0 !important; }
440	+
441	+ .indigo.darken-1 {
442	+ background-color: #3949ab !important; }
443	+
444	+ .indigo-text.text-darken-1 {
445	+ color: #3949ab !important; }
446	+
447	+ .indigo.darken-2 {
448	+ background-color: #303f9f !important; }
449	+
450	+ .indigo-text.text-darken-2 {
451	+ color: #303f9f !important; }
452	+
453	+ .indigo.darken-3 {
454	+ background-color: #283593 !important; }
455	+
456	+ .indigo-text.text-darken-3 {
457	+ color: #283593 !important; }
458	+
459	+ .indigo.darken-4 {
460	+ background-color: #1a237e !important; }
461	+
462	+ .indigo-text.text-darken-4 {
463	+ color: #1a237e !important; }
464	+
465	+ .indigo.accent-1 {
466	+ background-color: #8c9eff !important; }
467	+
468	+ .indigo-text.text-accent-1 {
469	+ color: #8c9eff !important; }
470	+
471	+ .indigo.accent-2 {
472	+ background-color: #536dfe !important; }
473	+
474	+ .indigo-text.text-accent-2 {
475	+ color: #536dfe !important; }
476	+
477	+ .indigo.accent-3 {
478	+ background-color: #3d5afe !important; }
479	+
480	+ .indigo-text.text-accent-3 {
481	+ color: #3d5afe !important; }
482	+
483	+ .indigo.accent-4 {
484	+ background-color: #304ffe !important; }
485	+
486	+ .indigo-text.text-accent-4 {
487	+ color: #304ffe !important; }
488	+
489	+ .blue {
490	+ background-color: #2196F3 !important; }
491	+
492	+ .blue-text {
493	+ color: #2196F3 !important; }
494	+
495	+ .blue.lighten-5 {
496	+ background-color: #E3F2FD !important; }
497	+
498	+ .blue-text.text-lighten-5 {
499	+ color: #E3F2FD !important; }
500	+
501	+ .blue.lighten-4 {
502	+ background-color: #BBDEFB !important; }
503	+
504	+ .blue-text.text-lighten-4 {
505	+ color: #BBDEFB !important; }
506	+
507	+ .blue.lighten-3 {
508	+ background-color: #90CAF9 !important; }
509	+
510	+ .blue-text.text-lighten-3 {
511	+ color: #90CAF9 !important; }
512	+
513	+ .blue.lighten-2 {
514	+ background-color: #64B5F6 !important; }
515	+
516	+ .blue-text.text-lighten-2 {
517	+ color: #64B5F6 !important; }
518	+
519	+ .blue.lighten-1 {
520	+ background-color: #42A5F5 !important; }
521	+
522	+ .blue-text.text-lighten-1 {
523	+ color: #42A5F5 !important; }
524	+
525	+ .blue.darken-1 {
526	+ background-color: #1E88E5 !important; }
527	+
528	+ .blue-text.text-darken-1 {
529	+ color: #1E88E5 !important; }
530	+
531	+ .blue.darken-2 {
532	+ background-color: #1976D2 !important; }
533	+
534	+ .blue-text.text-darken-2 {
535	+ color: #1976D2 !important; }
536	+
537	+ .blue.darken-3 {
538	+ background-color: #1565C0 !important; }
539	+
540	+ .blue-text.text-darken-3 {
541	+ color: #1565C0 !important; }
542	+
543	+ .blue.darken-4 {
544	+ background-color: #0D47A1 !important; }
545	+
546	+ .blue-text.text-darken-4 {
547	+ color: #0D47A1 !important; }
548	+
549	+ .blue.accent-1 {
550	+ background-color: #82B1FF !important; }
551	+
552	+ .blue-text.text-accent-1 {
553	+ color: #82B1FF !important; }
554	+
555	+ .blue.accent-2 {
556	+ background-color: #448AFF !important; }
557	+
558	+ .blue-text.text-accent-2 {
559	+ color: #448AFF !important; }
560	+
561	+ .blue.accent-3 {
562	+ background-color: #2979FF !important; }
563	+
564	+ .blue-text.text-accent-3 {
565	+ color: #2979FF !important; }
566	+
567	+ .blue.accent-4 {
568	+ background-color: #2962FF !important; }
569	+
570	+ .blue-text.text-accent-4 {
571	+ color: #2962FF !important; }
572	+
573	+ .light-blue {
574	+ background-color: #03a9f4 !important; }
575	+
576	+ .light-blue-text {
577	+ color: #03a9f4 !important; }
578	+
579	+ .light-blue.lighten-5 {
580	+ background-color: #e1f5fe !important; }
581	+
582	+ .light-blue-text.text-lighten-5 {
583	+ color: #e1f5fe !important; }
584	+
585	+ .light-blue.lighten-4 {
586	+ background-color: #b3e5fc !important; }
587	+
588	+ .light-blue-text.text-lighten-4 {
589	+ color: #b3e5fc !important; }
590	+
591	+ .light-blue.lighten-3 {
592	+ background-color: #81d4fa !important; }
593	+
594	+ .light-blue-text.text-lighten-3 {
595	+ color: #81d4fa !important; }
596	+
597	+ .light-blue.lighten-2 {
598	+ background-color: #4fc3f7 !important; }
599	+
600	+ .light-blue-text.text-lighten-2 {
601	+ color: #4fc3f7 !important; }
602	+
603	+ .light-blue.lighten-1 {
604	+ background-color: #29b6f6 !important; }
605	+
606	+ .light-blue-text.text-lighten-1 {
607	+ color: #29b6f6 !important; }
608	+
609	+ .light-blue.darken-1 {
610	+ background-color: #039be5 !important; }
611	+
612	+ .light-blue-text.text-darken-1 {
613	+ color: #039be5 !important; }
614	+
615	+ .light-blue.darken-2 {
616	+ background-color: #0288d1 !important; }
617	+
618	+ .light-blue-text.text-darken-2 {
619	+ color: #0288d1 !important; }
620	+
621	+ .light-blue.darken-3 {
622	+ background-color: #0277bd !important; }
623	+
624	+ .light-blue-text.text-darken-3 {
625	+ color: #0277bd !important; }
626	+
627	+ .light-blue.darken-4 {
628	+ background-color: #01579b !important; }
629	+
630	+ .light-blue-text.text-darken-4 {
631	+ color: #01579b !important; }
632	+
633	+ .light-blue.accent-1 {
634	+ background-color: #80d8ff !important; }
635	+
636	+ .light-blue-text.text-accent-1 {
637	+ color: #80d8ff !important; }
638	+
639	+ .light-blue.accent-2 {
640	+ background-color: #40c4ff !important; }
641	+
642	+ .light-blue-text.text-accent-2 {
643	+ color: #40c4ff !important; }
644	+
645	+ .light-blue.accent-3 {
646	+ background-color: #00b0ff !important; }
647	+
648	+ .light-blue-text.text-accent-3 {
649	+ color: #00b0ff !important; }
650	+
651	+ .light-blue.accent-4 {
652	+ background-color: #0091ea !important; }
653	+
654	+ .light-blue-text.text-accent-4 {
655	+ color: #0091ea !important; }
656	+
657	+ .cyan {
658	+ background-color: #00bcd4 !important; }
659	+
660	+ .cyan-text {
661	+ color: #00bcd4 !important; }
662	+
663	+ .cyan.lighten-5 {
664	+ background-color: #e0f7fa !important; }
665	+
666	+ .cyan-text.text-lighten-5 {
667	+ color: #e0f7fa !important; }
668	+
669	+ .cyan.lighten-4 {
670	+ background-color: #b2ebf2 !important; }
671	+
672	+ .cyan-text.text-lighten-4 {
673	+ color: #b2ebf2 !important; }
674	+
675	+ .cyan.lighten-3 {
676	+ background-color: #80deea !important; }
677	+
678	+ .cyan-text.text-lighten-3 {
679	+ color: #80deea !important; }
680	+
681	+ .cyan.lighten-2 {
682	+ background-color: #4dd0e1 !important; }
683	+
684	+ .cyan-text.text-lighten-2 {
685	+ color: #4dd0e1 !important; }
686	+
687	+ .cyan.lighten-1 {
688	+ background-color: #26c6da !important; }
689	+
690	+ .cyan-text.text-lighten-1 {
691	+ color: #26c6da !important; }
692	+
693	+ .cyan.darken-1 {
694	+ background-color: #00acc1 !important; }
695	+
696	+ .cyan-text.text-darken-1 {
697	+ color: #00acc1 !important; }
698	+
699	+ .cyan.darken-2 {
700	+ background-color: #0097a7 !important; }
701	+
702	+ .cyan-text.text-darken-2 {
703	+ color: #0097a7 !important; }
704	+
705	+ .cyan.darken-3 {
706	+ background-color: #00838f !important; }
707	+
708	+ .cyan-text.text-darken-3 {
709	+ color: #00838f !important; }
710	+
711	+ .cyan.darken-4 {
712	+ background-color: #006064 !important; }
713	+
714	+ .cyan-text.text-darken-4 {
715	+ color: #006064 !important; }
716	+
717	+ .cyan.accent-1 {
718	+ background-color: #84ffff !important; }
719	+
720	+ .cyan-text.text-accent-1 {
721	+ color: #84ffff !important; }
722	+
723	+ .cyan.accent-2 {
724	+ background-color: #18ffff !important; }
725	+
726	+ .cyan-text.text-accent-2 {
727	+ color: #18ffff !important; }
728	+
729	+ .cyan.accent-3 {
730	+ background-color: #00e5ff !important; }
731	+
732	+ .cyan-text.text-accent-3 {
733	+ color: #00e5ff !important; }
734	+
735	+ .cyan.accent-4 {
736	+ background-color: #00b8d4 !important; }
737	+
738	+ .cyan-text.text-accent-4 {
739	+ color: #00b8d4 !important; }
740	+
741	+ .teal {
742	+ background-color: #009688 !important; }
743	+
744	+ .teal-text {
745	+ color: #009688 !important; }
746	+
747	+ .teal.lighten-5 {
748	+ background-color: #e0f2f1 !important; }
749	+
750	+ .teal-text.text-lighten-5 {
751	+ color: #e0f2f1 !important; }
752	+
753	+ .teal.lighten-4 {
754	+ background-color: #b2dfdb !important; }
755	+
756	+ .teal-text.text-lighten-4 {
757	+ color: #b2dfdb !important; }
758	+
759	+ .teal.lighten-3 {
760	+ background-color: #80cbc4 !important; }
761	+
762	+ .teal-text.text-lighten-3 {
763	+ color: #80cbc4 !important; }
764	+
765	+ .teal.lighten-2 {
766	+ background-color: #4db6ac !important; }
767	+
768	+ .teal-text.text-lighten-2 {
769	+ color: #4db6ac !important; }
770	+
771	+ .teal.lighten-1 {
772	+ background-color: #26a69a !important; }
773	+
774	+ .teal-text.text-lighten-1 {
775	+ color: #26a69a !important; }
776	+
777	+ .teal.darken-1 {
778	+ background-color: #00897b !important; }
779	+
780	+ .teal-text.text-darken-1 {
781	+ color: #00897b !important; }
782	+
783	+ .teal.darken-2 {
784	+ background-color: #00796b !important; }
785	+
786	+ .teal-text.text-darken-2 {
787	+ color: #00796b !important; }
788	+
789	+ .teal.darken-3 {
790	+ background-color: #00695c !important; }
791	+
792	+ .teal-text.text-darken-3 {
793	+ color: #00695c !important; }
794	+
795	+ .teal.darken-4 {
796	+ background-color: #004d40 !important; }
797	+
798	+ .teal-text.text-darken-4 {
799	+ color: #004d40 !important; }
800	+
801	+ .teal.accent-1 {
802	+ background-color: #a7ffeb !important; }
803	+
804	+ .teal-text.text-accent-1 {
805	+ color: #a7ffeb !important; }
806	+
807	+ .teal.accent-2 {
808	+ background-color: #64ffda !important; }
809	+
810	+ .teal-text.text-accent-2 {
811	+ color: #64ffda !important; }
812	+
813	+ .teal.accent-3 {
814	+ background-color: #1de9b6 !important; }
815	+
816	+ .teal-text.text-accent-3 {
817	+ color: #1de9b6 !important; }
818	+
819	+ .teal.accent-4 {
820	+ background-color: #00bfa5 !important; }
821	+
822	+ .teal-text.text-accent-4 {
823	+ color: #00bfa5 !important; }
824	+
825	+ .green {
826	+ background-color: #4CAF50 !important; }
827	+
828	+ .green-text {
829	+ color: #4CAF50 !important; }
830	+
831	+ .green.lighten-5 {
832	+ background-color: #E8F5E9 !important; }
833	+
834	+ .green-text.text-lighten-5 {
835	+ color: #E8F5E9 !important; }
836	+
837	+ .green.lighten-4 {
838	+ background-color: #C8E6C9 !important; }
839	+
840	+ .green-text.text-lighten-4 {
841	+ color: #C8E6C9 !important; }
842	+
843	+ .green.lighten-3 {
844	+ background-color: #A5D6A7 !important; }
845	+
846	+ .green-text.text-lighten-3 {
847	+ color: #A5D6A7 !important; }
848	+
849	+ .green.lighten-2 {
850	+ background-color: #81C784 !important; }
851	+
852	+ .green-text.text-lighten-2 {
853	+ color: #81C784 !important; }
854	+
855	+ .green.lighten-1 {
856	+ background-color: #66BB6A !important; }
857	+
858	+ .green-text.text-lighten-1 {
859	+ color: #66BB6A !important; }
860	+
861	+ .green.darken-1 {
862	+ background-color: #43A047 !important; }
863	+
864	+ .green-text.text-darken-1 {
865	+ color: #43A047 !important; }
866	+
867	+ .green.darken-2 {
868	+ background-color: #388E3C !important; }
869	+
870	+ .green-text.text-darken-2 {
871	+ color: #388E3C !important; }
872	+
873	+ .green.darken-3 {
874	+ background-color: #2E7D32 !important; }
875	+
876	+ .green-text.text-darken-3 {
877	+ color: #2E7D32 !important; }
878	+
879	+ .green.darken-4 {
880	+ background-color: #1B5E20 !important; }
881	+
882	+ .green-text.text-darken-4 {
883	+ color: #1B5E20 !important; }
884	+
885	+ .green.accent-1 {
886	+ background-color: #B9F6CA !important; }
887	+
888	+ .green-text.text-accent-1 {
889	+ color: #B9F6CA !important; }
890	+
891	+ .green.accent-2 {
892	+ background-color: #69F0AE !important; }
893	+
894	+ .green-text.text-accent-2 {
895	+ color: #69F0AE !important; }
896	+
897	+ .green.accent-3 {
898	+ background-color: #00E676 !important; }
899	+
900	+ .green-text.text-accent-3 {
901	+ color: #00E676 !important; }
902	+
903	+ .green.accent-4 {
904	+ background-color: #00C853 !important; }
905	+
906	+ .green-text.text-accent-4 {
907	+ color: #00C853 !important; }
908	+
909	+ .light-green {
910	+ background-color: #8bc34a !important; }
911	+
912	+ .light-green-text {
913	+ color: #8bc34a !important; }
914	+
915	+ .light-green.lighten-5 {
916	+ background-color: #f1f8e9 !important; }
917	+
918	+ .light-green-text.text-lighten-5 {
919	+ color: #f1f8e9 !important; }
920	+
921	+ .light-green.lighten-4 {
922	+ background-color: #dcedc8 !important; }
923	+
924	+ .light-green-text.text-lighten-4 {
925	+ color: #dcedc8 !important; }
926	+
927	+ .light-green.lighten-3 {
928	+ background-color: #c5e1a5 !important; }
929	+
930	+ .light-green-text.text-lighten-3 {
931	+ color: #c5e1a5 !important; }
932	+
933	+ .light-green.lighten-2 {
934	+ background-color: #aed581 !important; }
935	+
936	+ .light-green-text.text-lighten-2 {
937	+ color: #aed581 !important; }
938	+
939	+ .light-green.lighten-1 {
940	+ background-color: #9ccc65 !important; }
941	+
942	+ .light-green-text.text-lighten-1 {
943	+ color: #9ccc65 !important; }
944	+
945	+ .light-green.darken-1 {
946	+ background-color: #7cb342 !important; }
947	+
948	+ .light-green-text.text-darken-1 {
949	+ color: #7cb342 !important; }
950	+
951	+ .light-green.darken-2 {
952	+ background-color: #689f38 !important; }
953	+
954	+ .light-green-text.text-darken-2 {
955	+ color: #689f38 !important; }
956	+
957	+ .light-green.darken-3 {
958	+ background-color: #558b2f !important; }
959	+
960	+ .light-green-text.text-darken-3 {
961	+ color: #558b2f !important; }
962	+
963	+ .light-green.darken-4 {
964	+ background-color: #33691e !important; }
965	+
966	+ .light-green-text.text-darken-4 {
967	+ color: #33691e !important; }
968	+
969	+ .light-green.accent-1 {
970	+ background-color: #ccff90 !important; }
971	+
972	+ .light-green-text.text-accent-1 {
973	+ color: #ccff90 !important; }
974	+
975	+ .light-green.accent-2 {
976	+ background-color: #b2ff59 !important; }
977	+
978	+ .light-green-text.text-accent-2 {
979	+ color: #b2ff59 !important; }
980	+
981	+ .light-green.accent-3 {
982	+ background-color: #76ff03 !important; }
983	+
984	+ .light-green-text.text-accent-3 {
985	+ color: #76ff03 !important; }
986	+
987	+ .light-green.accent-4 {
988	+ background-color: #64dd17 !important; }
989	+
990	+ .light-green-text.text-accent-4 {
991	+ color: #64dd17 !important; }
992	+
993	+ .lime {
994	+ background-color: #cddc39 !important; }
995	+
996	+ .lime-text {
997	+ color: #cddc39 !important; }
998	+
999	+ .lime.lighten-5 {
1000	+ background-color: #f9fbe7 !important; }
1001	+
1002	+ .lime-text.text-lighten-5 {
1003	+ color: #f9fbe7 !important; }
1004	+
1005	+ .lime.lighten-4 {
1006	+ background-color: #f0f4c3 !important; }
1007	+
1008	+ .lime-text.text-lighten-4 {
1009	+ color: #f0f4c3 !important; }
1010	+
1011	+ .lime.lighten-3 {
1012	+ background-color: #e6ee9c !important; }
1013	+
1014	+ .lime-text.text-lighten-3 {
1015	+ color: #e6ee9c !important; }
1016	+
1017	+ .lime.lighten-2 {
1018	+ background-color: #dce775 !important; }
1019	+
1020	+ .lime-text.text-lighten-2 {
1021	+ color: #dce775 !important; }
1022	+
1023	+ .lime.lighten-1 {
1024	+ background-color: #d4e157 !important; }
1025	+
1026	+ .lime-text.text-lighten-1 {
1027	+ color: #d4e157 !important; }
1028	+
1029	+ .lime.darken-1 {
1030	+ background-color: #c0ca33 !important; }
1031	+
1032	+ .lime-text.text-darken-1 {
1033	+ color: #c0ca33 !important; }
1034	+
1035	+ .lime.darken-2 {
1036	+ background-color: #afb42b !important; }
1037	+
1038	+ .lime-text.text-darken-2 {
1039	+ color: #afb42b !important; }
1040	+
1041	+ .lime.darken-3 {
1042	+ background-color: #9e9d24 !important; }
1043	+
1044	+ .lime-text.text-darken-3 {
1045	+ color: #9e9d24 !important; }
1046	+
1047	+ .lime.darken-4 {
1048	+ background-color: #827717 !important; }
1049	+
1050	+ .lime-text.text-darken-4 {
1051	+ color: #827717 !important; }
1052	+
1053	+ .lime.accent-1 {
1054	+ background-color: #f4ff81 !important; }
1055	+
1056	+ .lime-text.text-accent-1 {
1057	+ color: #f4ff81 !important; }
1058	+
1059	+ .lime.accent-2 {
1060	+ background-color: #eeff41 !important; }
1061	+
1062	+ .lime-text.text-accent-2 {
1063	+ color: #eeff41 !important; }
1064	+
1065	+ .lime.accent-3 {
1066	+ background-color: #c6ff00 !important; }
1067	+
1068	+ .lime-text.text-accent-3 {
1069	+ color: #c6ff00 !important; }
1070	+
1071	+ .lime.accent-4 {
1072	+ background-color: #aeea00 !important; }
1073	+
1074	+ .lime-text.text-accent-4 {
1075	+ color: #aeea00 !important; }
1076	+
1077	+ .yellow {
1078	+ background-color: #ffeb3b !important; }
1079	+
1080	+ .yellow-text {
1081	+ color: #ffeb3b !important; }
1082	+
1083	+ .yellow.lighten-5 {
1084	+ background-color: #fffde7 !important; }
1085	+
1086	+ .yellow-text.text-lighten-5 {
1087	+ color: #fffde7 !important; }
1088	+
1089	+ .yellow.lighten-4 {
1090	+ background-color: #fff9c4 !important; }
1091	+
1092	+ .yellow-text.text-lighten-4 {
1093	+ color: #fff9c4 !important; }
1094	+
1095	+ .yellow.lighten-3 {
1096	+ background-color: #fff59d !important; }
1097	+
1098	+ .yellow-text.text-lighten-3 {
1099	+ color: #fff59d !important; }
1100	+
1101	+ .yellow.lighten-2 {
1102	+ background-color: #fff176 !important; }
1103	+
1104	+ .yellow-text.text-lighten-2 {
1105	+ color: #fff176 !important; }
1106	+
1107	+ .yellow.lighten-1 {
1108	+ background-color: #ffee58 !important; }
1109	+
1110	+ .yellow-text.text-lighten-1 {
1111	+ color: #ffee58 !important; }
1112	+
1113	+ .yellow.darken-1 {
1114	+ background-color: #fdd835 !important; }
1115	+
1116	+ .yellow-text.text-darken-1 {
1117	+ color: #fdd835 !important; }
1118	+
1119	+ .yellow.darken-2 {
1120	+ background-color: #fbc02d !important; }
1121	+
1122	+ .yellow-text.text-darken-2 {
1123	+ color: #fbc02d !important; }
1124	+
1125	+ .yellow.darken-3 {
1126	+ background-color: #f9a825 !important; }
1127	+
1128	+ .yellow-text.text-darken-3 {
1129	+ color: #f9a825 !important; }
1130	+
1131	+ .yellow.darken-4 {
1132	+ background-color: #f57f17 !important; }
1133	+
1134	+ .yellow-text.text-darken-4 {
1135	+ color: #f57f17 !important; }
1136	+
1137	+ .yellow.accent-1 {
1138	+ background-color: #ffff8d !important; }
1139	+
1140	+ .yellow-text.text-accent-1 {
1141	+ color: #ffff8d !important; }
1142	+
1143	+ .yellow.accent-2 {
1144	+ background-color: #ffff00 !important; }
1145	+
1146	+ .yellow-text.text-accent-2 {
1147	+ color: #ffff00 !important; }
1148	+
1149	+ .yellow.accent-3 {
1150	+ background-color: #ffea00 !important; }
1151	+
1152	+ .yellow-text.text-accent-3 {
1153	+ color: #ffea00 !important; }
1154	+
1155	+ .yellow.accent-4 {
1156	+ background-color: #ffd600 !important; }
1157	+
1158	+ .yellow-text.text-accent-4 {
1159	+ color: #ffd600 !important; }
1160	+
1161	+ .amber {
1162	+ background-color: #ffc107 !important; }
1163	+
1164	+ .amber-text {
1165	+ color: #ffc107 !important; }
1166	+
1167	+ .amber.lighten-5 {
1168	+ background-color: #fff8e1 !important; }
1169	+
1170	+ .amber-text.text-lighten-5 {
1171	+ color: #fff8e1 !important; }
1172	+
1173	+ .amber.lighten-4 {
1174	+ background-color: #ffecb3 !important; }
1175	+
1176	+ .amber-text.text-lighten-4 {
1177	+ color: #ffecb3 !important; }
1178	+
1179	+ .amber.lighten-3 {
1180	+ background-color: #ffe082 !important; }
1181	+
1182	+ .amber-text.text-lighten-3 {
1183	+ color: #ffe082 !important; }
1184	+
1185	+ .amber.lighten-2 {
1186	+ background-color: #ffd54f !important; }
1187	+
1188	+ .amber-text.text-lighten-2 {
1189	+ color: #ffd54f !important; }
1190	+
1191	+ .amber.lighten-1 {
1192	+ background-color: #ffca28 !important; }
1193	+
1194	+ .amber-text.text-lighten-1 {
1195	+ color: #ffca28 !important; }
1196	+
1197	+ .amber.darken-1 {
1198	+ background-color: #ffb300 !important; }
1199	+
1200	+ .amber-text.text-darken-1 {
1201	+ color: #ffb300 !important; }
1202	+
1203	+ .amber.darken-2 {
1204	+ background-color: #ffa000 !important; }
1205	+
1206	+ .amber-text.text-darken-2 {
1207	+ color: #ffa000 !important; }
1208	+
1209	+ .amber.darken-3 {
1210	+ background-color: #ff8f00 !important; }
1211	+
1212	+ .amber-text.text-darken-3 {
1213	+ color: #ff8f00 !important; }
1214	+
1215	+ .amber.darken-4 {
1216	+ background-color: #ff6f00 !important; }
1217	+
1218	+ .amber-text.text-darken-4 {
1219	+ color: #ff6f00 !important; }
1220	+
1221	+ .amber.accent-1 {
1222	+ background-color: #ffe57f !important; }
1223	+
1224	+ .amber-text.text-accent-1 {
1225	+ color: #ffe57f !important; }
1226	+
1227	+ .amber.accent-2 {
1228	+ background-color: #ffd740 !important; }
1229	+
1230	+ .amber-text.text-accent-2 {
1231	+ color: #ffd740 !important; }
1232	+
1233	+ .amber.accent-3 {
1234	+ background-color: #ffc400 !important; }
1235	+
1236	+ .amber-text.text-accent-3 {
1237	+ color: #ffc400 !important; }
1238	+
1239	+ .amber.accent-4 {
1240	+ background-color: #ffab00 !important; }
1241	+
1242	+ .amber-text.text-accent-4 {
1243	+ color: #ffab00 !important; }
1244	+
1245	+ .orange {
1246	+ background-color: #ff9800 !important; }
1247	+
1248	+ .orange-text {
1249	+ color: #ff9800 !important; }
1250	+
1251	+ .orange.lighten-5 {
1252	+ background-color: #fff3e0 !important; }
1253	+
1254	+ .orange-text.text-lighten-5 {
1255	+ color: #fff3e0 !important; }
1256	+
1257	+ .orange.lighten-4 {
1258	+ background-color: #ffe0b2 !important; }
1259	+
1260	+ .orange-text.text-lighten-4 {
1261	+ color: #ffe0b2 !important; }
1262	+
1263	+ .orange.lighten-3 {
1264	+ background-color: #ffcc80 !important; }
1265	+
1266	+ .orange-text.text-lighten-3 {
1267	+ color: #ffcc80 !important; }
1268	+
1269	+ .orange.lighten-2 {
1270	+ background-color: #ffb74d !important; }
1271	+
1272	+ .orange-text.text-lighten-2 {
1273	+ color: #ffb74d !important; }
1274	+
1275	+ .orange.lighten-1 {
1276	+ background-color: #ffa726 !important; }
1277	+
1278	+ .orange-text.text-lighten-1 {
1279	+ color: #ffa726 !important; }
1280	+
1281	+ .orange.darken-1 {
1282	+ background-color: #fb8c00 !important; }
1283	+
1284	+ .orange-text.text-darken-1 {
1285	+ color: #fb8c00 !important; }
1286	+
1287	+ .orange.darken-2 {
1288	+ background-color: #f57c00 !important; }
1289	+
1290	+ .orange-text.text-darken-2 {
1291	+ color: #f57c00 !important; }
1292	+
1293	+ .orange.darken-3 {
1294	+ background-color: #ef6c00 !important; }
1295	+
1296	+ .orange-text.text-darken-3 {
1297	+ color: #ef6c00 !important; }
1298	+
1299	+ .orange.darken-4 {
1300	+ background-color: #e65100 !important; }
1301	+
1302	+ .orange-text.text-darken-4 {
1303	+ color: #e65100 !important; }
1304	+
1305	+ .orange.accent-1 {
1306	+ background-color: #ffd180 !important; }
1307	+
1308	+ .orange-text.text-accent-1 {
1309	+ color: #ffd180 !important; }
1310	+
1311	+ .orange.accent-2 {
1312	+ background-color: #ffab40 !important; }
1313	+
1314	+ .orange-text.text-accent-2 {
1315	+ color: #ffab40 !important; }
1316	+
1317	+ .orange.accent-3 {
1318	+ background-color: #ff9100 !important; }
1319	+
1320	+ .orange-text.text-accent-3 {
1321	+ color: #ff9100 !important; }
1322	+
1323	+ .orange.accent-4 {
1324	+ background-color: #ff6d00 !important; }
1325	+
1326	+ .orange-text.text-accent-4 {
1327	+ color: #ff6d00 !important; }
1328	+
1329	+ .deep-orange {
1330	+ background-color: #ff5722 !important; }
1331	+
1332	+ .deep-orange-text {
1333	+ color: #ff5722 !important; }
1334	+
1335	+ .deep-orange.lighten-5 {
1336	+ background-color: #fbe9e7 !important; }
1337	+
1338	+ .deep-orange-text.text-lighten-5 {
1339	+ color: #fbe9e7 !important; }
1340	+
1341	+ .deep-orange.lighten-4 {
1342	+ background-color: #ffccbc !important; }
1343	+
1344	+ .deep-orange-text.text-lighten-4 {
1345	+ color: #ffccbc !important; }
1346	+
1347	+ .deep-orange.lighten-3 {
1348	+ background-color: #ffab91 !important; }
1349	+
1350	+ .deep-orange-text.text-lighten-3 {
1351	+ color: #ffab91 !important; }
1352	+
1353	+ .deep-orange.lighten-2 {
1354	+ background-color: #ff8a65 !important; }
1355	+
1356	+ .deep-orange-text.text-lighten-2 {
1357	+ color: #ff8a65 !important; }
1358	+
1359	+ .deep-orange.lighten-1 {
1360	+ background-color: #ff7043 !important; }
1361	+
1362	+ .deep-orange-text.text-lighten-1 {
1363	+ color: #ff7043 !important; }
1364	+
1365	+ .deep-orange.darken-1 {
1366	+ background-color: #f4511e !important; }
1367	+
1368	+ .deep-orange-text.text-darken-1 {
1369	+ color: #f4511e !important; }
1370	+
1371	+ .deep-orange.darken-2 {
1372	+ background-color: #e64a19 !important; }
1373	+
1374	+ .deep-orange-text.text-darken-2 {
1375	+ color: #e64a19 !important; }
1376	+
1377	+ .deep-orange.darken-3 {
1378	+ background-color: #d84315 !important; }
1379	+
1380	+ .deep-orange-text.text-darken-3 {
1381	+ color: #d84315 !important; }
1382	+
1383	+ .deep-orange.darken-4 {
1384	+ background-color: #bf360c !important; }
1385	+
1386	+ .deep-orange-text.text-darken-4 {
1387	+ color: #bf360c !important; }
1388	+
1389	+ .deep-orange.accent-1 {
1390	+ background-color: #ff9e80 !important; }
1391	+
1392	+ .deep-orange-text.text-accent-1 {
1393	+ color: #ff9e80 !important; }
1394	+
1395	+ .deep-orange.accent-2 {
1396	+ background-color: #ff6e40 !important; }
1397	+
1398	+ .deep-orange-text.text-accent-2 {
1399	+ color: #ff6e40 !important; }
1400	+
1401	+ .deep-orange.accent-3 {
1402	+ background-color: #ff3d00 !important; }
1403	+
1404	+ .deep-orange-text.text-accent-3 {
1405	+ color: #ff3d00 !important; }
1406	+
1407	+ .deep-orange.accent-4 {
1408	+ background-color: #dd2c00 !important; }
1409	+
1410	+ .deep-orange-text.text-accent-4 {
1411	+ color: #dd2c00 !important; }
1412	+
1413	+ .brown {
1414	+ background-color: #795548 !important; }
1415	+
1416	+ .brown-text {
1417	+ color: #795548 !important; }
1418	+
1419	+ .brown.lighten-5 {
1420	+ background-color: #efebe9 !important; }
1421	+
1422	+ .brown-text.text-lighten-5 {
1423	+ color: #efebe9 !important; }
1424	+
1425	+ .brown.lighten-4 {
1426	+ background-color: #d7ccc8 !important; }
1427	+
1428	+ .brown-text.text-lighten-4 {
1429	+ color: #d7ccc8 !important; }
1430	+
1431	+ .brown.lighten-3 {
1432	+ background-color: #bcaaa4 !important; }
1433	+
1434	+ .brown-text.text-lighten-3 {
1435	+ color: #bcaaa4 !important; }
1436	+
1437	+ .brown.lighten-2 {
1438	+ background-color: #a1887f !important; }
1439	+
1440	+ .brown-text.text-lighten-2 {
1441	+ color: #a1887f !important; }
1442	+
1443	+ .brown.lighten-1 {
1444	+ background-color: #8d6e63 !important; }
1445	+
1446	+ .brown-text.text-lighten-1 {
1447	+ color: #8d6e63 !important; }
1448	+
1449	+ .brown.darken-1 {
1450	+ background-color: #6d4c41 !important; }
1451	+
1452	+ .brown-text.text-darken-1 {
1453	+ color: #6d4c41 !important; }
1454	+
1455	+ .brown.darken-2 {
1456	+ background-color: #5d4037 !important; }
1457	+
1458	+ .brown-text.text-darken-2 {
1459	+ color: #5d4037 !important; }
1460	+
1461	+ .brown.darken-3 {
1462	+ background-color: #4e342e !important; }
1463	+
1464	+ .brown-text.text-darken-3 {
1465	+ color: #4e342e !important; }
1466	+
1467	+ .brown.darken-4 {
1468	+ background-color: #3e2723 !important; }
1469	+
1470	+ .brown-text.text-darken-4 {
1471	+ color: #3e2723 !important; }
1472	+
1473	+ .blue-grey {
1474	+ background-color: #607d8b !important; }
1475	+
1476	+ .blue-grey-text {
1477	+ color: #607d8b !important; }
1478	+
1479	+ .blue-grey.lighten-5 {
1480	+ background-color: #eceff1 !important; }
1481	+
1482	+ .blue-grey-text.text-lighten-5 {
1483	+ color: #eceff1 !important; }
1484	+
1485	+ .blue-grey.lighten-4 {
1486	+ background-color: #cfd8dc !important; }
1487	+
1488	+ .blue-grey-text.text-lighten-4 {
1489	+ color: #cfd8dc !important; }
1490	+
1491	+ .blue-grey.lighten-3 {
1492	+ background-color: #b0bec5 !important; }
1493	+
1494	+ .blue-grey-text.text-lighten-3 {
1495	+ color: #b0bec5 !important; }
1496	+
1497	+ .blue-grey.lighten-2 {
1498	+ background-color: #90a4ae !important; }
1499	+
1500	+ .blue-grey-text.text-lighten-2 {
1501	+ color: #90a4ae !important; }
1502	+
1503	+ .blue-grey.lighten-1 {
1504	+ background-color: #78909c !important; }
1505	+
1506	+ .blue-grey-text.text-lighten-1 {
1507	+ color: #78909c !important; }
1508	+
1509	+ .blue-grey.darken-1 {
1510	+ background-color: #546e7a !important; }
1511	+
1512	+ .blue-grey-text.text-darken-1 {
1513	+ color: #546e7a !important; }
1514	+
1515	+ .blue-grey.darken-2 {
1516	+ background-color: #455a64 !important; }
1517	+
1518	+ .blue-grey-text.text-darken-2 {
1519	+ color: #455a64 !important; }
1520	+
1521	+ .blue-grey.darken-3 {
1522	+ background-color: #37474f !important; }
1523	+
1524	+ .blue-grey-text.text-darken-3 {
1525	+ color: #37474f !important; }
1526	+
1527	+ .blue-grey.darken-4 {
1528	+ background-color: #263238 !important; }
1529	+
1530	+ .blue-grey-text.text-darken-4 {
1531	+ color: #263238 !important; }
1532	+
1533	+ .grey {
1534	+ background-color: #9e9e9e !important; }
1535	+
1536	+ .grey-text {
1537	+ color: #9e9e9e !important; }
1538	+
1539	+ .grey.lighten-5 {
1540	+ background-color: #fafafa !important; }
1541	+
1542	+ .grey-text.text-lighten-5 {
1543	+ color: #fafafa !important; }
1544	+
1545	+ .grey.lighten-4 {
1546	+ background-color: #f5f5f5 !important; }
1547	+
1548	+ .grey-text.text-lighten-4 {
1549	+ color: #f5f5f5 !important; }
1550	+
1551	+ .grey.lighten-3 {
1552	+ background-color: #eeeeee !important; }
1553	+
1554	+ .grey-text.text-lighten-3 {
1555	+ color: #eeeeee !important; }
1556	+
1557	+ .grey.lighten-2 {
1558	+ background-color: #e0e0e0 !important; }
1559	+
1560	+ .grey-text.text-lighten-2 {
1561	+ color: #e0e0e0 !important; }
1562	+
1563	+ .grey.lighten-1 {
1564	+ background-color: #bdbdbd !important; }
1565	+
1566	+ .grey-text.text-lighten-1 {
1567	+ color: #bdbdbd !important; }
1568	+
1569	+ .grey.darken-1 {
1570	+ background-color: #757575 !important; }
1571	+
1572	+ .grey-text.text-darken-1 {
1573	+ color: #757575 !important; }
1574	+
1575	+ .grey.darken-2 {
1576	+ background-color: #616161 !important; }
1577	+
1578	+ .grey-text.text-darken-2 {
1579	+ color: #616161 !important; }
1580	+
1581	+ .grey.darken-3 {
1582	+ background-color: #424242 !important; }
1583	+
1584	+ .grey-text.text-darken-3 {
1585	+ color: #424242 !important; }
1586	+
1587	+ .grey.darken-4 {
1588	+ background-color: #212121 !important; }
1589	+
1590	+ .grey-text.text-darken-4 {
1591	+ color: #212121 !important; }
1592	+
1593	+ .black {
1594	+ background-color: #000000 !important; }
1595	+
1596	+ .black-text {
1597	+ color: #000000 !important; }
1598	+
1599	+ .white {
1600	+ background-color: #FFFFFF !important; }
1601	+
1602	+ .white-text {
1603	+ color: #FFFFFF !important; }
1604	+
1605	+ .transparent {
1606	+ background-color: transparent !important; }
1607	+
1608	+ .transparent-text {
1609	+ color: transparent !important; }
1610	+
1611	+ /! normalize.css v3.0.3 \| MIT License \| github.com/necolas/normalize.css /
1612	+ /**
1613	+ * 1. Set default font family to sans-serif.
1614	+ * 2. Prevent iOS and IE text size adjust after device orientation change,
1615	+ * without disabling user zoom.
1616	+ */
1617	+ html {
1618	+ font-family: sans-serif;
1619	+ /* 1 */
1620	+ -ms-text-size-adjust: 100%;
1621	+ /* 2 */
1622	+ -webkit-text-size-adjust: 100%;
1623	+ /* 2 */ }
1624	+
1625	+ /**
1626	+ * Remove default margin.
1627	+ */
1628	+ body {
1629	+ margin: 0; }
1630	+
1631	+ /* HTML5 display definitions
1632	+ ========================================================================== */
1633	+ /**
1634	+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
1635	+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
1636	+ * and Firefox.
1637	+ * Correct `block` display not defined for `main` in IE 11.
1638	+ */
1639	+ article,
1640	+ aside,
1641	+ details,
1642	+ figcaption,
1643	+ figure,
1644	+ footer,
1645	+ header,
1646	+ hgroup,
1647	+ main,
1648	+ menu,
1649	+ nav,
1650	+ section,
1651	+ summary {
1652	+ display: block; }
1653	+
1654	+ /**
1655	+ * 1. Correct `inline-block` display not defined in IE 8/9.
1656	+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
1657	+ */
1658	+ audio,
1659	+ canvas,
1660	+ progress,
1661	+ video {
1662	+ display: inline-block;
1663	+ /* 1 */
1664	+ vertical-align: baseline;
1665	+ /* 2 */ }
1666	+
1667	+ /**
1668	+ * Prevent modern browsers from displaying `audio` without controls.
1669	+ * Remove excess height in iOS 5 devices.
1670	+ */
1671	+ audio:not([controls]) {
1672	+ display: none;
1673	+ height: 0; }
1674	+
1675	+ /**
1676	+ * Address `[hidden]` styling not present in IE 8/9/10.
1677	+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
1678	+ */
1679	+ [hidden],
1680	+ template {
1681	+ display: none; }
1682	+
1683	+ /* Links
1684	+ ========================================================================== */
1685	+ /**
1686	+ * Remove the gray background color from active links in IE 10.
1687	+ */
1688	+ a {
1689	+ background-color: transparent; }
1690	+
1691	+ /**
1692	+ * Improve readability of focused elements when they are also in an
1693	+ * active/hover state.
1694	+ */
1695	+ a:active,
1696	+ a:hover {
1697	+ outline: 0; }
1698	+
1699	+ /* Text-level semantics
1700	+ ========================================================================== */
1701	+ /**
1702	+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
1703	+ */
1704	+ abbr[title] {
1705	+ border-bottom: 1px dotted; }
1706	+
1707	+ /**
1708	+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
1709	+ */
1710	+ b,
1711	+ strong {
1712	+ font-weight: bold; }
1713	+
1714	+ /**
1715	+ * Address styling not present in Safari and Chrome.
1716	+ */
1717	+ dfn {
1718	+ font-style: italic; }
1719	+
1720	+ /**
1721	+ * Address variable `h1` font-size and margin within `section` and `article`
1722	+ * contexts in Firefox 4+, Safari, and Chrome.
1723	+ */
1724	+ h1 {
1725	+ font-size: 2em;
1726	+ margin: 0.67em 0; }
1727	+
1728	+ /**
1729	+ * Address styling not present in IE 8/9.
1730	+ */
1731	+ mark {
1732	+ background: #ff0;
1733	+ color: #000; }
1734	+
1735	+ /**
1736	+ * Address inconsistent and variable font size in all browsers.
1737	+ */
1738	+ small {
1739	+ font-size: 80%; }
1740	+
1741	+ /**
1742	+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
1743	+ */
1744	+ sub,
1745	+ sup {
1746	+ font-size: 75%;
1747	+ line-height: 0;
1748	+ position: relative;
1749	+ vertical-align: baseline; }
1750	+
1751	+ sup {
1752	+ top: -0.5em; }
1753	+
1754	+ sub {
1755	+ bottom: -0.25em; }
1756	+
1757	+ /* Embedded content
1758	+ ========================================================================== */
1759	+ /**
1760	+ * Remove border when inside `a` element in IE 8/9/10.
1761	+ */
1762	+ img {
1763	+ border: 0; }
1764	+
1765	+ /**
1766	+ * Correct overflow not hidden in IE 9/10/11.
1767	+ */
1768	+ svg:not(:root) {
1769	+ overflow: hidden; }
1770	+
1771	+ /* Grouping content
1772	+ ========================================================================== */
1773	+ /**
1774	+ * Address margin not present in IE 8/9 and Safari.
1775	+ */
1776	+ figure {
1777	+ margin: 1em 40px; }
1778	+
1779	+ /**
1780	+ * Address differences between Firefox and other browsers.
1781	+ */
1782	+ hr {
1783	+ box-sizing: content-box;
1784	+ height: 0; }
1785	+
1786	+ /**
1787	+ * Contain overflow in all browsers.
1788	+ */
1789	+ pre {
1790	+ overflow: auto; }
1791	+
1792	+ /**
1793	+ * Address odd `em`-unit font size rendering in all browsers.
1794	+ */
1795	+ code,
1796	+ kbd,
1797	+ pre,
1798	+ samp {
1799	+ font-family: monospace, monospace;
1800	+ font-size: 1em; }
1801	+
1802	+ /* Forms
1803	+ ========================================================================== */
1804	+ /**
1805	+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
1806	+ * styling of `select`, unless a `border` property is set.
1807	+ */
1808	+ /**
1809	+ * 1. Correct color not being inherited.
1810	+ * Known issue: affects color of disabled elements.
1811	+ * 2. Correct font properties not being inherited.
1812	+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
1813	+ */
1814	+ button,
1815	+ input,
1816	+ optgroup,
1817	+ select,
1818	+ textarea {
1819	+ color: inherit;
1820	+ /* 1 */
1821	+ font: inherit;
1822	+ /* 2 */
1823	+ margin: 0;
1824	+ /* 3 */ }
1825	+
1826	+ /**
1827	+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
1828	+ */
1829	+ button {
1830	+ overflow: visible; }
1831	+
1832	+ /**
1833	+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
1834	+ * All other form control elements do not inherit `text-transform` values.
1835	+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
1836	+ * Correct `select` style inheritance in Firefox.
1837	+ */
1838	+ button,
1839	+ select {
1840	+ text-transform: none; }
1841	+
1842	+ /**
1843	+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
1844	+ * and `video` controls.
1845	+ * 2. Correct inability to style clickable `input` types in iOS.
1846	+ * 3. Improve usability and consistency of cursor style between image-type
1847	+ * `input` and others.
1848	+ */
1849	+ button,
1850	+ html input[type="button"],
1851	+ input[type="reset"],
1852	+ input[type="submit"] {
1853	+ -webkit-appearance: button;
1854	+ /* 2 */
1855	+ cursor: pointer;
1856	+ /* 3 */ }
1857	+
1858	+ /**
1859	+ * Re-set default cursor for disabled elements.
1860	+ */
1861	+ button[disabled],
1862	+ html input[disabled] {
1863	+ cursor: default; }
1864	+
1865	+ /**
1866	+ * Remove inner padding and border in Firefox 4+.
1867	+ */
1868	+ button::-moz-focus-inner,
1869	+ input::-moz-focus-inner {
1870	+ border: 0;
1871	+ padding: 0; }
1872	+
1873	+ /**
1874	+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
1875	+ * the UA stylesheet.
1876	+ */
1877	+ input {
1878	+ line-height: normal; }
1879	+
1880	+ /**
1881	+ * It's recommended that you don't attempt to style these elements.
1882	+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
1883	+ *
1884	+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
1885	+ * 2. Remove excess padding in IE 8/9/10.
1886	+ */
1887	+ input[type="checkbox"],
1888	+ input[type="radio"] {
1889	+ box-sizing: border-box;
1890	+ /* 1 */
1891	+ padding: 0;
1892	+ /* 2 */ }
1893	+
1894	+ /**
1895	+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
1896	+ * `font-size` values of the `input`, it causes the cursor style of the
1897	+ * decrement button to change from `default` to `text`.
1898	+ */
1899	+ input[type="number"]::-webkit-inner-spin-button,
1900	+ input[type="number"]::-webkit-outer-spin-button {
1901	+ height: auto; }
1902	+
1903	+ /**
1904	+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
1905	+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
1906	+ */
1907	+ input[type="search"] {
1908	+ -webkit-appearance: textfield;
1909	+ /* 1 */
1910	+ box-sizing: content-box;
1911	+ /* 2 */ }
1912	+
1913	+ /**
1914	+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
1915	+ * Safari (but not Chrome) clips the cancel button when the search input has
1916	+ * padding (and `textfield` appearance).
1917	+ */
1918	+ input[type="search"]::-webkit-search-cancel-button,
1919	+ input[type="search"]::-webkit-search-decoration {
1920	+ -webkit-appearance: none; }
1921	+
1922	+ /**
1923	+ * Define consistent border, margin, and padding.
1924	+ */
1925	+ fieldset {
1926	+ border: 1px solid #c0c0c0;
1927	+ margin: 0 2px;
1928	+ padding: 0.35em 0.625em 0.75em; }
1929	+
1930	+ /**
1931	+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
1932	+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
1933	+ */
1934	+ legend {
1935	+ border: 0;
1936	+ /* 1 */
1937	+ padding: 0;
1938	+ /* 2 */ }
1939	+
1940	+ /**
1941	+ * Remove default vertical scrollbar in IE 8/9/10/11.
1942	+ */
1943	+ textarea {
1944	+ overflow: auto; }
1945	+
1946	+ /**
1947	+ * Don't inherit the `font-weight` (applied by a rule above).
1948	+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
1949	+ */
1950	+ optgroup {
1951	+ font-weight: bold; }
1952	+
1953	+ /* Tables
1954	+ ========================================================================== */
1955	+ /**
1956	+ * Remove most spacing between table cells.
1957	+ */
1958	+ table {
1959	+ border-collapse: collapse;
1960	+ border-spacing: 0; }
1961	+
1962	+ td,
1963	+ th {
1964	+ padding: 0; }
1965	+
1966	+ html {
1967	+ box-sizing: border-box; }
1968	+
1969	+ , :before, *:after {
1970	+ box-sizing: inherit; }
1971	+
1972	+ ul:not(.browser-default) {
1973	+ padding-left: 0;
1974	+ list-style-type: none; }
1975	+ ul:not(.browser-default) > li {
1976	+ list-style-type: none; }
1977	+
1978	+ a {
1979	+ color: #039be5;
1980	+ text-decoration: none;
1981	+ -webkit-tap-highlight-color: transparent; }
1982	+
1983	+ .valign-wrapper {
1984	+ display: flex;
1985	+ align-items: center; }
1986	+
1987	+ .clearfix {
1988	+ clear: both; }
1989	+
1990	+ .z-depth-0 {
1991	+ box-shadow: none !important; }
1992	+
1993	+ .z-depth-1, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible {
1994	+ box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); }
1995	+
1996	+ .z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover {
1997	+ box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); }
1998	+
1999	+ .z-depth-2 {
2000	+ box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); }
2001	+
2002	+ .z-depth-3 {
2003	+ box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); }
2004	+
2005	+ .z-depth-4 {
2006	+ box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); }
2007	+
2008	+ .z-depth-5 {
2009	+ box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); }
2010	+
2011	+ .hoverable {
2012	+ transition: box-shadow .25s; }
2013	+ .hoverable:hover {
2014	+ box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); }
2015	+
2016	+ .divider {
2017	+ height: 1px;
2018	+ overflow: hidden;
2019	+ background-color: #e0e0e0; }
2020	+
2021	+ blockquote {
2022	+ margin: 20px 0;
2023	+ padding-left: 1.5rem;
2024	+ border-left: 5px solid #ee6e73; }
2025	+
2026	+ i {
2027	+ line-height: inherit; }
2028	+ i.left {
2029	+ float: left;
2030	+ margin-right: 15px; }
2031	+ i.right {
2032	+ float: right;
2033	+ margin-left: 15px; }
2034	+ i.tiny {
2035	+ font-size: 1rem; }
2036	+ i.small {
2037	+ font-size: 2rem; }
2038	+ i.medium {
2039	+ font-size: 4rem; }
2040	+ i.large {
2041	+ font-size: 6rem; }
2042	+
2043	+ img.responsive-img,
2044	+ video.responsive-video {
2045	+ max-width: 100%;
2046	+ height: auto; }
2047	+
2048	+ .pagination li {
2049	+ display: inline-block;
2050	+ border-radius: 2px;
2051	+ text-align: center;
2052	+ vertical-align: top;
2053	+ height: 30px; }
2054	+ .pagination li a {
2055	+ color: #444;
2056	+ display: inline-block;
2057	+ font-size: 1.2rem;
2058	+ padding: 0 10px;
2059	+ line-height: 30px; }
2060	+ .pagination li.active a {
2061	+ color: #fff; }
2062	+ .pagination li.active {
2063	+ background-color: #ee6e73; }
2064	+ .pagination li.disabled a {
2065	+ cursor: default;
2066	+ color: #999; }
2067	+ .pagination li i {
2068	+ font-size: 2rem; }
2069	+
2070	+ .pagination li.pages ul li {
2071	+ display: inline-block;
2072	+ float: none; }
2073	+
2074	+ @media only screen and (max-width: 992px) {
2075	+ .pagination {
2076	+ width: 100%; }
2077	+ .pagination li.prev,
2078	+ .pagination li.next {
2079	+ width: 10%; }
2080	+ .pagination li.pages {
2081	+ width: 80%;
2082	+ overflow: hidden;
2083	+ white-space: nowrap; } }
2084	+
2085	+ .breadcrumb {
2086	+ font-size: 18px;
2087	+ color: rgba(255, 255, 255, 0.7); }
2088	+ .breadcrumb i,
2089	+ .breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"],
2090	+ .breadcrumb i.material-icons {
2091	+ display: inline-block;
2092	+ float: left;
2093	+ font-size: 24px; }
2094	+ .breadcrumb:before {
2095	+ content: '\E5CC';
2096	+ color: rgba(255, 255, 255, 0.7);
2097	+ vertical-align: top;
2098	+ display: inline-block;
2099	+ font-family: 'Material Icons';
2100	+ font-weight: normal;
2101	+ font-style: normal;
2102	+ font-size: 25px;
2103	+ margin: 0 10px 0 8px;
2104	+ -webkit-font-smoothing: antialiased; }
2105	+ .breadcrumb:first-child:before {
2106	+ display: none; }
2107	+ .breadcrumb:last-child {
2108	+ color: #fff; }
2109	+
2110	+ .parallax-container {
2111	+ position: relative;
2112	+ overflow: hidden;
2113	+ height: 500px; }
2114	+ .parallax-container .parallax {
2115	+ position: absolute;
2116	+ top: 0;
2117	+ left: 0;
2118	+ right: 0;
2119	+ bottom: 0;
2120	+ z-index: -1; }
2121	+ .parallax-container .parallax img {
2122	+ display: none;
2123	+ position: absolute;
2124	+ left: 50%;
2125	+ bottom: 0;
2126	+ min-width: 100%;
2127	+ min-height: 100%;
2128	+ transform: translate3d(0, 0, 0);
2129	+ transform: translateX(-50%); }
2130	+
2131	+ .pin-top, .pin-bottom {
2132	+ position: relative; }
2133	+
2134	+ .pinned {
2135	+ position: fixed !important; }
2136	+
2137	+ /*********************
2138	+ Transition Classes
2139	+ **********************/
2140	+ ul.staggered-list li {
2141	+ opacity: 0; }
2142	+
2143	+ .fade-in {
2144	+ opacity: 0;
2145	+ transform-origin: 0 50%; }
2146	+
2147	+ /*********************
2148	+ Media Query Classes
2149	+ **********************/
2150	+ @media only screen and (max-width: 600px) {
2151	+ .hide-on-small-only, .hide-on-small-and-down {
2152	+ display: none !important; } }
2153	+
2154	+ @media only screen and (max-width: 992px) {
2155	+ .hide-on-med-and-down {
2156	+ display: none !important; } }
2157	+
2158	+ @media only screen and (min-width: 601px) {
2159	+ .hide-on-med-and-up {
2160	+ display: none !important; } }
2161	+
2162	+ @media only screen and (min-width: 600px) and (max-width: 992px) {
2163	+ .hide-on-med-only {
2164	+ display: none !important; } }
2165	+
2166	+ @media only screen and (min-width: 993px) {
2167	+ .hide-on-large-only {
2168	+ display: none !important; } }
2169	+
2170	+ @media only screen and (min-width: 993px) {
2171	+ .show-on-large {
2172	+ display: block !important; } }
2173	+
2174	+ @media only screen and (min-width: 600px) and (max-width: 992px) {
2175	+ .show-on-medium {
2176	+ display: block !important; } }
2177	+
2178	+ @media only screen and (max-width: 600px) {
2179	+ .show-on-small {
2180	+ display: block !important; } }
2181	+
2182	+ @media only screen and (min-width: 601px) {
2183	+ .show-on-medium-and-up {
2184	+ display: block !important; } }
2185	+
2186	+ @media only screen and (max-width: 992px) {
2187	+ .show-on-medium-and-down {
2188	+ display: block !important; } }
2189	+
2190	+ @media only screen and (max-width: 600px) {
2191	+ .center-on-small-only {
2192	+ text-align: center; } }
2193	+
2194	+ .page-footer {
2195	+ padding-top: 20px;
2196	+ color: #fff;
2197	+ background-color: #ee6e73; }
2198	+ .page-footer .footer-copyright {
2199	+ overflow: hidden;
2200	+ min-height: 50px;
2201	+ display: flex;
2202	+ align-items: center;
2203	+ padding: 10px 0px;
2204	+ color: rgba(255, 255, 255, 0.8);
2205	+ background-color: rgba(51, 51, 51, 0.08); }
2206	+
2207	+ table, th, td {
2208	+ border: none; }
2209	+
2210	+ table {
2211	+ width: 100%;
2212	+ display: table; }
2213	+ table.bordered > thead > tr,
2214	+ table.bordered > tbody > tr {
2215	+ border-bottom: 1px solid #d0d0d0; }
2216	+ table.striped > tbody > tr:nth-child(odd) {
2217	+ background-color: #f2f2f2; }
2218	+ table.striped > tbody > tr > td {
2219	+ border-radius: 0; }
2220	+ table.highlight > tbody > tr {
2221	+ transition: background-color .25s ease; }
2222	+ table.highlight > tbody > tr:hover {
2223	+ background-color: #f2f2f2; }
2224	+ table.centered thead tr th, table.centered tbody tr td {
2225	+ text-align: center; }
2226	+
2227	+ thead {
2228	+ border-bottom: 1px solid #d0d0d0; }
2229	+
2230	+ td, th {
2231	+ padding: 15px 5px;
2232	+ display: table-cell;
2233	+ text-align: left;
2234	+ vertical-align: middle;
2235	+ border-radius: 2px; }
2236	+
2237	+ @media only screen and (max-width: 992px) {
2238	+ table.responsive-table {
2239	+ width: 100%;
2240	+ border-collapse: collapse;
2241	+ border-spacing: 0;
2242	+ display: block;
2243	+ position: relative;
2244	+ /* sort out borders */ }
2245	+ table.responsive-table td:empty:before {
2246	+ content: '\A0'; }
2247	+ table.responsive-table th,
2248	+ table.responsive-table td {
2249	+ margin: 0;
2250	+ vertical-align: top; }
2251	+ table.responsive-table th {
2252	+ text-align: left; }
2253	+ table.responsive-table thead {
2254	+ display: block;
2255	+ float: left; }
2256	+ table.responsive-table thead tr {
2257	+ display: block;
2258	+ padding: 0 10px 0 0; }
2259	+ table.responsive-table thead tr th::before {
2260	+ content: "\A0"; }
2261	+ table.responsive-table tbody {
2262	+ display: block;
2263	+ width: auto;
2264	+ position: relative;
2265	+ overflow-x: auto;
2266	+ white-space: nowrap; }
2267	+ table.responsive-table tbody tr {
2268	+ display: inline-block;
2269	+ vertical-align: top; }
2270	+ table.responsive-table th {
2271	+ display: block;
2272	+ text-align: right; }
2273	+ table.responsive-table td {
2274	+ display: block;
2275	+ min-height: 1.25em;
2276	+ text-align: left; }
2277	+ table.responsive-table tr {
2278	+ padding: 0 10px; }
2279	+ table.responsive-table thead {
2280	+ border: 0;
2281	+ border-right: 1px solid #d0d0d0; }
2282	+ table.responsive-table.bordered th {
2283	+ border-bottom: 0;
2284	+ border-left: 0; }
2285	+ table.responsive-table.bordered td {
2286	+ border-left: 0;
2287	+ border-right: 0;
2288	+ border-bottom: 0; }
2289	+ table.responsive-table.bordered tr {
2290	+ border: 0; }
2291	+ table.responsive-table.bordered tbody tr {
2292	+ border-right: 1px solid #d0d0d0; } }
2293	+
2294	+ .collection {
2295	+ margin: 0.5rem 0 1rem 0;
2296	+ border: 1px solid #e0e0e0;
2297	+ border-radius: 2px;
2298	+ overflow: hidden;
2299	+ position: relative; }
2300	+ .collection .collection-item {
2301	+ background-color: #fff;
2302	+ line-height: 1.5rem;
2303	+ padding: 10px 20px;
2304	+ margin: 0;
2305	+ border-bottom: 1px solid #e0e0e0; }
2306	+ .collection .collection-item.avatar {
2307	+ min-height: 84px;
2308	+ padding-left: 72px;
2309	+ position: relative; }
2310	+ .collection .collection-item.avatar:not(.circle-clipper) > .circle,
2311	+ .collection .collection-item.avatar :not(.circle-clipper) > .circle {
2312	+ position: absolute;
2313	+ width: 42px;
2314	+ height: 42px;
2315	+ overflow: hidden;
2316	+ left: 15px;
2317	+ display: inline-block;
2318	+ vertical-align: middle; }
2319	+ .collection .collection-item.avatar i.circle {
2320	+ font-size: 18px;
2321	+ line-height: 42px;
2322	+ color: #fff;
2323	+ background-color: #999;
2324	+ text-align: center; }
2325	+ .collection .collection-item.avatar .title {
2326	+ font-size: 16px; }
2327	+ .collection .collection-item.avatar p {
2328	+ margin: 0; }
2329	+ .collection .collection-item.avatar .secondary-content {
2330	+ position: absolute;
2331	+ top: 16px;
2332	+ right: 16px; }
2333	+ .collection .collection-item:last-child {
2334	+ border-bottom: none; }
2335	+ .collection .collection-item.active {
2336	+ background-color: #26a69a;
2337	+ color: #eafaf9; }
2338	+ .collection .collection-item.active .secondary-content {
2339	+ color: #fff; }
2340	+ .collection a.collection-item {
2341	+ display: block;
2342	+ transition: .25s;
2343	+ color: #26a69a; }
2344	+ .collection a.collection-item:not(.active):hover {
2345	+ background-color: #ddd; }
2346	+ .collection.with-header .collection-header {
2347	+ background-color: #fff;
2348	+ border-bottom: 1px solid #e0e0e0;
2349	+ padding: 10px 20px; }
2350	+ .collection.with-header .collection-item {
2351	+ padding-left: 30px; }
2352	+ .collection.with-header .collection-item.avatar {
2353	+ padding-left: 72px; }
2354	+
2355	+ .secondary-content {
2356	+ float: right;
2357	+ color: #26a69a; }
2358	+
2359	+ .collapsible .collection {
2360	+ margin: 0;
2361	+ border: none; }
2362	+
2363	+ .video-container {
2364	+ position: relative;
2365	+ padding-bottom: 56.25%;
2366	+ height: 0;
2367	+ overflow: hidden; }
2368	+ .video-container iframe, .video-container object, .video-container embed {
2369	+ position: absolute;
2370	+ top: 0;
2371	+ left: 0;
2372	+ width: 100%;
2373	+ height: 100%; }
2374	+
2375	+ .progress {
2376	+ position: relative;
2377	+ height: 4px;
2378	+ display: block;
2379	+ width: 100%;
2380	+ background-color: #acece6;
2381	+ border-radius: 2px;
2382	+ margin: 0.5rem 0 1rem 0;
2383	+ overflow: hidden; }
2384	+ .progress .determinate {
2385	+ position: absolute;
2386	+ top: 0;
2387	+ left: 0;
2388	+ bottom: 0;
2389	+ background-color: #26a69a;
2390	+ transition: width .3s linear; }
2391	+ .progress .indeterminate {
2392	+ background-color: #26a69a; }
2393	+ .progress .indeterminate:before {
2394	+ content: '';
2395	+ position: absolute;
2396	+ background-color: inherit;
2397	+ top: 0;
2398	+ left: 0;
2399	+ bottom: 0;
2400	+ will-change: left, right;
2401	+ animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; }
2402	+ .progress .indeterminate:after {
2403	+ content: '';
2404	+ position: absolute;
2405	+ background-color: inherit;
2406	+ top: 0;
2407	+ left: 0;
2408	+ bottom: 0;
2409	+ will-change: left, right;
2410	+ animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
2411	+ animation-delay: 1.15s; }
2412	+
2413	+ @keyframes indeterminate {
2414	+ 0% {
2415	+ left: -35%;
2416	+ right: 100%; }
2417	+ 60% {
2418	+ left: 100%;
2419	+ right: -90%; }
2420	+ 100% {
2421	+ left: 100%;
2422	+ right: -90%; } }
2423	+
2424	+ @keyframes indeterminate-short {
2425	+ 0% {
2426	+ left: -200%;
2427	+ right: 100%; }
2428	+ 60% {
2429	+ left: 107%;
2430	+ right: -8%; }
2431	+ 100% {
2432	+ left: 107%;
2433	+ right: -8%; } }
2434	+
2435	+ /*******************
2436	+ Utility Classes
2437	+ *******************/
2438	+ .hide {
2439	+ display: none !important; }
2440	+
2441	+ .left-align {
2442	+ text-align: left; }
2443	+
2444	+ .right-align {
2445	+ text-align: right; }
2446	+
2447	+ .center, .center-align {
2448	+ text-align: center; }
2449	+
2450	+ .left {
2451	+ float: left !important; }
2452	+
2453	+ .right {
2454	+ float: right !important; }
2455	+
2456	+ .no-select, input[type=range],
2457	+ input[type=range] + .thumb {
2458	+ user-select: none; }
2459	+
2460	+ .circle {
2461	+ border-radius: 50%; }
2462	+
2463	+ .center-block {
2464	+ display: block;
2465	+ margin-left: auto;
2466	+ margin-right: auto; }
2467	+
2468	+ .truncate {
2469	+ display: block;
2470	+ white-space: nowrap;
2471	+ overflow: hidden;
2472	+ text-overflow: ellipsis; }
2473	+
2474	+ .no-padding {
2475	+ padding: 0 !important; }
2476	+
2477	+ /* This is needed for some mobile phones to display the Google Icon font properly */
2478	+ .material-icons {
2479	+ text-rendering: optimizeLegibility;
2480	+ font-feature-settings: 'liga'; }
2481	+
2482	+ .container {
2483	+ margin: 0 auto;
2484	+ max-width: 1280px;
2485	+ width: 90%; }
2486	+
2487	+ @media only screen and (min-width: 601px) {
2488	+ .container {
2489	+ width: 85%; } }
2490	+
2491	+ @media only screen and (min-width: 993px) {
2492	+ .container {
2493	+ width: 70%; } }
2494	+
2495	+ .container .row {
2496	+ margin-left: -0.75rem;
2497	+ margin-right: -0.75rem; }
2498	+
2499	+ .section {
2500	+ padding-top: 1rem;
2501	+ padding-bottom: 1rem; }
2502	+ .section.no-pad {
2503	+ padding: 0; }
2504	+ .section.no-pad-bot {
2505	+ padding-bottom: 0; }
2506	+ .section.no-pad-top {
2507	+ padding-top: 0; }
2508	+
2509	+ .row {
2510	+ margin-left: auto;
2511	+ margin-right: auto;
2512	+ margin-bottom: 20px; }
2513	+ .row:after {
2514	+ content: "";
2515	+ display: table;
2516	+ clear: both; }
2517	+ .row .col {
2518	+ float: left;
2519	+ box-sizing: border-box;
2520	+ padding: 0 0.75rem;
2521	+ min-height: 1px; }
2522	+ .row .col[class="push-"], .row .col[class="pull-"] {
2523	+ position: relative; }
2524	+ .row .col.s1 {
2525	+ width: 8.33333%;
2526	+ margin-left: auto;
2527	+ left: auto;
2528	+ right: auto; }
2529	+ .row .col.s2 {
2530	+ width: 16.66667%;
2531	+ margin-left: auto;
2532	+ left: auto;
2533	+ right: auto; }
2534	+ .row .col.s3 {
2535	+ width: 25%;
2536	+ margin-left: auto;
2537	+ left: auto;
2538	+ right: auto; }
2539	+ .row .col.s4 {
2540	+ width: 33.33333%;
2541	+ margin-left: auto;
2542	+ left: auto;
2543	+ right: auto; }
2544	+ .row .col.s5 {
2545	+ width: 41.66667%;
2546	+ margin-left: auto;
2547	+ left: auto;
2548	+ right: auto; }
2549	+ .row .col.s6 {
2550	+ width: 50%;
2551	+ margin-left: auto;
2552	+ left: auto;
2553	+ right: auto; }
2554	+ .row .col.s7 {
2555	+ width: 58.33333%;
2556	+ margin-left: auto;
2557	+ left: auto;
2558	+ right: auto; }
2559	+ .row .col.s8 {
2560	+ width: 66.66667%;
2561	+ margin-left: auto;
2562	+ left: auto;
2563	+ right: auto; }
2564	+ .row .col.s9 {
2565	+ width: 75%;
2566	+ margin-left: auto;
2567	+ left: auto;
2568	+ right: auto; }
2569	+ .row .col.s10 {
2570	+ width: 83.33333%;
2571	+ margin-left: auto;
2572	+ left: auto;
2573	+ right: auto; }
2574	+ .row .col.s11 {
2575	+ width: 91.66667%;
2576	+ margin-left: auto;
2577	+ left: auto;
2578	+ right: auto; }
2579	+ .row .col.s12 {
2580	+ width: 100%;
2581	+ margin-left: auto;
2582	+ left: auto;
2583	+ right: auto; }
2584	+ .row .col.offset-s1 {
2585	+ margin-left: 8.33333%; }
2586	+ .row .col.pull-s1 {
2587	+ right: 8.33333%; }
2588	+ .row .col.push-s1 {
2589	+ left: 8.33333%; }
2590	+ .row .col.offset-s2 {
2591	+ margin-left: 16.66667%; }
2592	+ .row .col.pull-s2 {
2593	+ right: 16.66667%; }
2594	+ .row .col.push-s2 {
2595	+ left: 16.66667%; }
2596	+ .row .col.offset-s3 {
2597	+ margin-left: 25%; }
2598	+ .row .col.pull-s3 {
2599	+ right: 25%; }
2600	+ .row .col.push-s3 {
2601	+ left: 25%; }
2602	+ .row .col.offset-s4 {
2603	+ margin-left: 33.33333%; }
2604	+ .row .col.pull-s4 {
2605	+ right: 33.33333%; }
2606	+ .row .col.push-s4 {
2607	+ left: 33.33333%; }
2608	+ .row .col.offset-s5 {
2609	+ margin-left: 41.66667%; }
2610	+ .row .col.pull-s5 {
2611	+ right: 41.66667%; }
2612	+ .row .col.push-s5 {
2613	+ left: 41.66667%; }
2614	+ .row .col.offset-s6 {
2615	+ margin-left: 50%; }
2616	+ .row .col.pull-s6 {
2617	+ right: 50%; }
2618	+ .row .col.push-s6 {
2619	+ left: 50%; }
2620	+ .row .col.offset-s7 {
2621	+ margin-left: 58.33333%; }
2622	+ .row .col.pull-s7 {
2623	+ right: 58.33333%; }
2624	+ .row .col.push-s7 {
2625	+ left: 58.33333%; }
2626	+ .row .col.offset-s8 {
2627	+ margin-left: 66.66667%; }
2628	+ .row .col.pull-s8 {
2629	+ right: 66.66667%; }
2630	+ .row .col.push-s8 {
2631	+ left: 66.66667%; }
2632	+ .row .col.offset-s9 {
2633	+ margin-left: 75%; }
2634	+ .row .col.pull-s9 {
2635	+ right: 75%; }
2636	+ .row .col.push-s9 {
2637	+ left: 75%; }
2638	+ .row .col.offset-s10 {
2639	+ margin-left: 83.33333%; }
2640	+ .row .col.pull-s10 {
2641	+ right: 83.33333%; }
2642	+ .row .col.push-s10 {
2643	+ left: 83.33333%; }
2644	+ .row .col.offset-s11 {
2645	+ margin-left: 91.66667%; }
2646	+ .row .col.pull-s11 {
2647	+ right: 91.66667%; }
2648	+ .row .col.push-s11 {
2649	+ left: 91.66667%; }
2650	+ .row .col.offset-s12 {
2651	+ margin-left: 100%; }
2652	+ .row .col.pull-s12 {
2653	+ right: 100%; }
2654	+ .row .col.push-s12 {
2655	+ left: 100%; }
2656	+ @media only screen and (min-width: 601px) {
2657	+ .row .col.m1 {
2658	+ width: 8.33333%;
2659	+ margin-left: auto;
2660	+ left: auto;
2661	+ right: auto; }
2662	+ .row .col.m2 {
2663	+ width: 16.66667%;
2664	+ margin-left: auto;
2665	+ left: auto;
2666	+ right: auto; }
2667	+ .row .col.m3 {
2668	+ width: 25%;
2669	+ margin-left: auto;
2670	+ left: auto;
2671	+ right: auto; }
2672	+ .row .col.m4 {
2673	+ width: 33.33333%;
2674	+ margin-left: auto;
2675	+ left: auto;
2676	+ right: auto; }
2677	+ .row .col.m5 {
2678	+ width: 41.66667%;
2679	+ margin-left: auto;
2680	+ left: auto;
2681	+ right: auto; }
2682	+ .row .col.m6 {
2683	+ width: 50%;
2684	+ margin-left: auto;
2685	+ left: auto;
2686	+ right: auto; }
2687	+ .row .col.m7 {
2688	+ width: 58.33333%;
2689	+ margin-left: auto;
2690	+ left: auto;
2691	+ right: auto; }
2692	+ .row .col.m8 {
2693	+ width: 66.66667%;
2694	+ margin-left: auto;
2695	+ left: auto;
2696	+ right: auto; }
2697	+ .row .col.m9 {
2698	+ width: 75%;
2699	+ margin-left: auto;
2700	+ left: auto;
2701	+ right: auto; }
2702	+ .row .col.m10 {
2703	+ width: 83.33333%;
2704	+ margin-left: auto;
2705	+ left: auto;
2706	+ right: auto; }
2707	+ .row .col.m11 {
2708	+ width: 91.66667%;
2709	+ margin-left: auto;
2710	+ left: auto;
2711	+ right: auto; }
2712	+ .row .col.m12 {
2713	+ width: 100%;
2714	+ margin-left: auto;
2715	+ left: auto;
2716	+ right: auto; }
2717	+ .row .col.offset-m1 {
2718	+ margin-left: 8.33333%; }
2719	+ .row .col.pull-m1 {
2720	+ right: 8.33333%; }
2721	+ .row .col.push-m1 {
2722	+ left: 8.33333%; }
2723	+ .row .col.offset-m2 {
2724	+ margin-left: 16.66667%; }
2725	+ .row .col.pull-m2 {
2726	+ right: 16.66667%; }
2727	+ .row .col.push-m2 {
2728	+ left: 16.66667%; }
2729	+ .row .col.offset-m3 {
2730	+ margin-left: 25%; }
2731	+ .row .col.pull-m3 {
2732	+ right: 25%; }
2733	+ .row .col.push-m3 {
2734	+ left: 25%; }
2735	+ .row .col.offset-m4 {
2736	+ margin-left: 33.33333%; }
2737	+ .row .col.pull-m4 {
2738	+ right: 33.33333%; }
2739	+ .row .col.push-m4 {
2740	+ left: 33.33333%; }
2741	+ .row .col.offset-m5 {
2742	+ margin-left: 41.66667%; }
2743	+ .row .col.pull-m5 {
2744	+ right: 41.66667%; }
2745	+ .row .col.push-m5 {
2746	+ left: 41.66667%; }
2747	+ .row .col.offset-m6 {
2748	+ margin-left: 50%; }
2749	+ .row .col.pull-m6 {
2750	+ right: 50%; }
2751	+ .row .col.push-m6 {
2752	+ left: 50%; }
2753	+ .row .col.offset-m7 {
2754	+ margin-left: 58.33333%; }
2755	+ .row .col.pull-m7 {
2756	+ right: 58.33333%; }
2757	+ .row .col.push-m7 {
2758	+ left: 58.33333%; }
2759	+ .row .col.offset-m8 {
2760	+ margin-left: 66.66667%; }
2761	+ .row .col.pull-m8 {
2762	+ right: 66.66667%; }
2763	+ .row .col.push-m8 {
2764	+ left: 66.66667%; }
2765	+ .row .col.offset-m9 {
2766	+ margin-left: 75%; }
2767	+ .row .col.pull-m9 {
2768	+ right: 75%; }
2769	+ .row .col.push-m9 {
2770	+ left: 75%; }
2771	+ .row .col.offset-m10 {
2772	+ margin-left: 83.33333%; }
2773	+ .row .col.pull-m10 {
2774	+ right: 83.33333%; }
2775	+ .row .col.push-m10 {
2776	+ left: 83.33333%; }
2777	+ .row .col.offset-m11 {
2778	+ margin-left: 91.66667%; }
2779	+ .row .col.pull-m11 {
2780	+ right: 91.66667%; }
2781	+ .row .col.push-m11 {
2782	+ left: 91.66667%; }
2783	+ .row .col.offset-m12 {
2784	+ margin-left: 100%; }
2785	+ .row .col.pull-m12 {
2786	+ right: 100%; }
2787	+ .row .col.push-m12 {
2788	+ left: 100%; } }
2789	+ @media only screen and (min-width: 993px) {
2790	+ .row .col.l1 {
2791	+ width: 8.33333%;
2792	+ margin-left: auto;
2793	+ left: auto;
2794	+ right: auto; }
2795	+ .row .col.l2 {
2796	+ width: 16.66667%;
2797	+ margin-left: auto;
2798	+ left: auto;
2799	+ right: auto; }
2800	+ .row .col.l3 {
2801	+ width: 25%;
2802	+ margin-left: auto;
2803	+ left: auto;
2804	+ right: auto; }
2805	+ .row .col.l4 {
2806	+ width: 33.33333%;
2807	+ margin-left: auto;
2808	+ left: auto;
2809	+ right: auto; }
2810	+ .row .col.l5 {
2811	+ width: 41.66667%;
2812	+ margin-left: auto;
2813	+ left: auto;
2814	+ right: auto; }
2815	+ .row .col.l6 {
2816	+ width: 50%;
2817	+ margin-left: auto;
2818	+ left: auto;
2819	+ right: auto; }
2820	+ .row .col.l7 {
2821	+ width: 58.33333%;
2822	+ margin-left: auto;
2823	+ left: auto;
2824	+ right: auto; }
2825	+ .row .col.l8 {
2826	+ width: 66.66667%;
2827	+ margin-left: auto;
2828	+ left: auto;
2829	+ right: auto; }
2830	+ .row .col.l9 {
2831	+ width: 75%;
2832	+ margin-left: auto;
2833	+ left: auto;
2834	+ right: auto; }
2835	+ .row .col.l10 {
2836	+ width: 83.33333%;
2837	+ margin-left: auto;
2838	+ left: auto;
2839	+ right: auto; }
2840	+ .row .col.l11 {
2841	+ width: 91.66667%;
2842	+ margin-left: auto;
2843	+ left: auto;
2844	+ right: auto; }
2845	+ .row .col.l12 {
2846	+ width: 100%;
2847	+ margin-left: auto;
2848	+ left: auto;
2849	+ right: auto; }
2850	+ .row .col.offset-l1 {
2851	+ margin-left: 8.33333%; }
2852	+ .row .col.pull-l1 {
2853	+ right: 8.33333%; }
2854	+ .row .col.push-l1 {
2855	+ left: 8.33333%; }
2856	+ .row .col.offset-l2 {
2857	+ margin-left: 16.66667%; }
2858	+ .row .col.pull-l2 {
2859	+ right: 16.66667%; }
2860	+ .row .col.push-l2 {
2861	+ left: 16.66667%; }
2862	+ .row .col.offset-l3 {
2863	+ margin-left: 25%; }
2864	+ .row .col.pull-l3 {
2865	+ right: 25%; }
2866	+ .row .col.push-l3 {
2867	+ left: 25%; }
2868	+ .row .col.offset-l4 {
2869	+ margin-left: 33.33333%; }
2870	+ .row .col.pull-l4 {
2871	+ right: 33.33333%; }
2872	+ .row .col.push-l4 {
2873	+ left: 33.33333%; }
2874	+ .row .col.offset-l5 {
2875	+ margin-left: 41.66667%; }
2876	+ .row .col.pull-l5 {
2877	+ right: 41.66667%; }
2878	+ .row .col.push-l5 {
2879	+ left: 41.66667%; }
2880	+ .row .col.offset-l6 {
2881	+ margin-left: 50%; }
2882	+ .row .col.pull-l6 {
2883	+ right: 50%; }
2884	+ .row .col.push-l6 {
2885	+ left: 50%; }
2886	+ .row .col.offset-l7 {
2887	+ margin-left: 58.33333%; }
2888	+ .row .col.pull-l7 {
2889	+ right: 58.33333%; }
2890	+ .row .col.push-l7 {
2891	+ left: 58.33333%; }
2892	+ .row .col.offset-l8 {
2893	+ margin-left: 66.66667%; }
2894	+ .row .col.pull-l8 {
2895	+ right: 66.66667%; }
2896	+ .row .col.push-l8 {
2897	+ left: 66.66667%; }
2898	+ .row .col.offset-l9 {
2899	+ margin-left: 75%; }
2900	+ .row .col.pull-l9 {
2901	+ right: 75%; }
2902	+ .row .col.push-l9 {
2903	+ left: 75%; }
2904	+ .row .col.offset-l10 {
2905	+ margin-left: 83.33333%; }
2906	+ .row .col.pull-l10 {
2907	+ right: 83.33333%; }
2908	+ .row .col.push-l10 {
2909	+ left: 83.33333%; }
2910	+ .row .col.offset-l11 {
2911	+ margin-left: 91.66667%; }
2912	+ .row .col.pull-l11 {
2913	+ right: 91.66667%; }
2914	+ .row .col.push-l11 {
2915	+ left: 91.66667%; }
2916	+ .row .col.offset-l12 {
2917	+ margin-left: 100%; }
2918	+ .row .col.pull-l12 {
2919	+ right: 100%; }
2920	+ .row .col.push-l12 {
2921	+ left: 100%; } }
2922	+ @media only screen and (min-width: 1201px) {
2923	+ .row .col.xl1 {
2924	+ width: 8.33333%;
2925	+ margin-left: auto;
2926	+ left: auto;
2927	+ right: auto; }
2928	+ .row .col.xl2 {
2929	+ width: 16.66667%;
2930	+ margin-left: auto;
2931	+ left: auto;
2932	+ right: auto; }
2933	+ .row .col.xl3 {
2934	+ width: 25%;
2935	+ margin-left: auto;
2936	+ left: auto;
2937	+ right: auto; }
2938	+ .row .col.xl4 {
2939	+ width: 33.33333%;
2940	+ margin-left: auto;
2941	+ left: auto;
2942	+ right: auto; }
2943	+ .row .col.xl5 {
2944	+ width: 41.66667%;
2945	+ margin-left: auto;
2946	+ left: auto;
2947	+ right: auto; }
2948	+ .row .col.xl6 {
2949	+ width: 50%;
2950	+ margin-left: auto;
2951	+ left: auto;
2952	+ right: auto; }
2953	+ .row .col.xl7 {
2954	+ width: 58.33333%;
2955	+ margin-left: auto;
2956	+ left: auto;
2957	+ right: auto; }
2958	+ .row .col.xl8 {
2959	+ width: 66.66667%;
2960	+ margin-left: auto;
2961	+ left: auto;
2962	+ right: auto; }
2963	+ .row .col.xl9 {
2964	+ width: 75%;
2965	+ margin-left: auto;
2966	+ left: auto;
2967	+ right: auto; }
2968	+ .row .col.xl10 {
2969	+ width: 83.33333%;
2970	+ margin-left: auto;
2971	+ left: auto;
2972	+ right: auto; }
2973	+ .row .col.xl11 {
2974	+ width: 91.66667%;
2975	+ margin-left: auto;
2976	+ left: auto;
2977	+ right: auto; }
2978	+ .row .col.xl12 {
2979	+ width: 100%;
2980	+ margin-left: auto;
2981	+ left: auto;
2982	+ right: auto; }
2983	+ .row .col.offset-xl1 {
2984	+ margin-left: 8.33333%; }
2985	+ .row .col.pull-xl1 {
2986	+ right: 8.33333%; }
2987	+ .row .col.push-xl1 {
2988	+ left: 8.33333%; }
2989	+ .row .col.offset-xl2 {
2990	+ margin-left: 16.66667%; }
2991	+ .row .col.pull-xl2 {
2992	+ right: 16.66667%; }
2993	+ .row .col.push-xl2 {
2994	+ left: 16.66667%; }
2995	+ .row .col.offset-xl3 {
2996	+ margin-left: 25%; }
2997	+ .row .col.pull-xl3 {
2998	+ right: 25%; }
2999	+ .row .col.push-xl3 {
3000	+ left: 25%; }
3001	+ .row .col.offset-xl4 {
3002	+ margin-left: 33.33333%; }
3003	+ .row .col.pull-xl4 {
3004	+ right: 33.33333%; }
3005	+ .row .col.push-xl4 {
3006	+ left: 33.33333%; }
3007	+ .row .col.offset-xl5 {
3008	+ margin-left: 41.66667%; }
3009	+ .row .col.pull-xl5 {
3010	+ right: 41.66667%; }
3011	+ .row .col.push-xl5 {
3012	+ left: 41.66667%; }
3013	+ .row .col.offset-xl6 {
3014	+ margin-left: 50%; }
3015	+ .row .col.pull-xl6 {
3016	+ right: 50%; }
3017	+ .row .col.push-xl6 {
3018	+ left: 50%; }
3019	+ .row .col.offset-xl7 {
3020	+ margin-left: 58.33333%; }
3021	+ .row .col.pull-xl7 {
3022	+ right: 58.33333%; }
3023	+ .row .col.push-xl7 {
3024	+ left: 58.33333%; }
3025	+ .row .col.offset-xl8 {
3026	+ margin-left: 66.66667%; }
3027	+ .row .col.pull-xl8 {
3028	+ right: 66.66667%; }
3029	+ .row .col.push-xl8 {
3030	+ left: 66.66667%; }
3031	+ .row .col.offset-xl9 {
3032	+ margin-left: 75%; }
3033	+ .row .col.pull-xl9 {
3034	+ right: 75%; }
3035	+ .row .col.push-xl9 {
3036	+ left: 75%; }
3037	+ .row .col.offset-xl10 {
3038	+ margin-left: 83.33333%; }
3039	+ .row .col.pull-xl10 {
3040	+ right: 83.33333%; }
3041	+ .row .col.push-xl10 {
3042	+ left: 83.33333%; }
3043	+ .row .col.offset-xl11 {
3044	+ margin-left: 91.66667%; }
3045	+ .row .col.pull-xl11 {
3046	+ right: 91.66667%; }
3047	+ .row .col.push-xl11 {
3048	+ left: 91.66667%; }
3049	+ .row .col.offset-xl12 {
3050	+ margin-left: 100%; }
3051	+ .row .col.pull-xl12 {
3052	+ right: 100%; }
3053	+ .row .col.push-xl12 {
3054	+ left: 100%; } }
3055	+
3056	+ a {
3057	+ text-decoration: none; }
3058	+
3059	+ html {
3060	+ line-height: 1.5;
3061	+ font-family: "Roboto", sans-serif;
3062	+ font-weight: normal;
3063	+ color: rgba(0, 0, 0, 0.87); }
3064	+ @media only screen and (min-width: 0) {
3065	+ html {
3066	+ font-size: 14px; } }
3067	+ @media only screen and (min-width: 992px) {
3068	+ html {
3069	+ font-size: 14.5px; } }
3070	+ @media only screen and (min-width: 1200px) {
3071	+ html {
3072	+ font-size: 15px; } }
3073	+
3074	+ h1, h2, h3, h4, h5, h6 {
3075	+ font-weight: 400;
3076	+ line-height: 1.1; }
3077	+
3078	+ h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {
3079	+ font-weight: inherit; }
3080	+
3081	+ h1 {
3082	+ font-size: 4.2rem;
3083	+ line-height: 110%;
3084	+ margin: 2.1rem 0 1.68rem 0; }
3085	+
3086	+ h2 {
3087	+ font-size: 3.56rem;
3088	+ line-height: 110%;
3089	+ margin: 1.78rem 0 1.424rem 0; }
3090	+
3091	+ h3 {
3092	+ font-size: 2.92rem;
3093	+ line-height: 110%;
3094	+ margin: 1.46rem 0 1.168rem 0; }
3095	+
3096	+ h4 {
3097	+ font-size: 2.28rem;
3098	+ line-height: 110%;
3099	+ margin: 1.14rem 0 0.912rem 0; }
3100	+
3101	+ h5 {
3102	+ font-size: 1.64rem;
3103	+ line-height: 110%;
3104	+ margin: 0.82rem 0 0.656rem 0; }
3105	+
3106	+ h6 {
3107	+ font-size: 1rem;
3108	+ line-height: 110%;
3109	+ margin: 0.5rem 0 0.4rem 0; }
3110	+
3111	+ em {
3112	+ font-style: italic; }
3113	+
3114	+ strong {
3115	+ font-weight: 500; }
3116	+
3117	+ small {
3118	+ font-size: 75%; }
3119	+
3120	+ .light, .page-footer .footer-copyright {
3121	+ font-weight: 300; }
3122	+
3123	+ .thin {
3124	+ font-weight: 200; }
3125	+
3126	+ .flow-text {
3127	+ font-weight: 300; }
3128	+ @media only screen and (min-width: 360px) {
3129	+ .flow-text {
3130	+ font-size: 1.2rem; } }
3131	+ @media only screen and (min-width: 390px) {
3132	+ .flow-text {
3133	+ font-size: 1.224rem; } }
3134	+ @media only screen and (min-width: 420px) {
3135	+ .flow-text {
3136	+ font-size: 1.248rem; } }
3137	+ @media only screen and (min-width: 450px) {
3138	+ .flow-text {
3139	+ font-size: 1.272rem; } }
3140	+ @media only screen and (min-width: 480px) {
3141	+ .flow-text {
3142	+ font-size: 1.296rem; } }
3143	+ @media only screen and (min-width: 510px) {
3144	+ .flow-text {
3145	+ font-size: 1.32rem; } }
3146	+ @media only screen and (min-width: 540px) {
3147	+ .flow-text {
3148	+ font-size: 1.344rem; } }
3149	+ @media only screen and (min-width: 570px) {
3150	+ .flow-text {
3151	+ font-size: 1.368rem; } }
3152	+ @media only screen and (min-width: 600px) {
3153	+ .flow-text {
3154	+ font-size: 1.392rem; } }
3155	+ @media only screen and (min-width: 630px) {
3156	+ .flow-text {
3157	+ font-size: 1.416rem; } }
3158	+ @media only screen and (min-width: 660px) {
3159	+ .flow-text {
3160	+ font-size: 1.44rem; } }
3161	+ @media only screen and (min-width: 690px) {
3162	+ .flow-text {
3163	+ font-size: 1.464rem; } }
3164	+ @media only screen and (min-width: 720px) {
3165	+ .flow-text {
3166	+ font-size: 1.488rem; } }
3167	+ @media only screen and (min-width: 750px) {
3168	+ .flow-text {
3169	+ font-size: 1.512rem; } }
3170	+ @media only screen and (min-width: 780px) {
3171	+ .flow-text {
3172	+ font-size: 1.536rem; } }
3173	+ @media only screen and (min-width: 810px) {
3174	+ .flow-text {
3175	+ font-size: 1.56rem; } }
3176	+ @media only screen and (min-width: 840px) {
3177	+ .flow-text {
3178	+ font-size: 1.584rem; } }
3179	+ @media only screen and (min-width: 870px) {
3180	+ .flow-text {
3181	+ font-size: 1.608rem; } }
3182	+ @media only screen and (min-width: 900px) {
3183	+ .flow-text {
3184	+ font-size: 1.632rem; } }
3185	+ @media only screen and (min-width: 930px) {
3186	+ .flow-text {
3187	+ font-size: 1.656rem; } }
3188	+ @media only screen and (min-width: 960px) {
3189	+ .flow-text {
3190	+ font-size: 1.68rem; } }
3191	+ @media only screen and (max-width: 360px) {
3192	+ .flow-text {
3193	+ font-size: 1.2rem; } }
3194	+
3195	+ .btn, .btn-large,
3196	+ .btn-flat {
3197	+ border: none;
3198	+ border-radius: 2px;
3199	+ display: inline-block;
3200	+ height: 36px;
3201	+ line-height: 36px;
3202	+ padding: 0 2rem;
3203	+ text-transform: uppercase;
3204	+ vertical-align: middle;
3205	+ -webkit-tap-highlight-color: transparent; }
3206	+
3207	+ .btn.disabled, .disabled.btn-large,
3208	+ .btn-floating.disabled,
3209	+ .btn-large.disabled,
3210	+ .btn-flat.disabled,
3211	+ .btn:disabled,
3212	+ .btn-large:disabled,
3213	+ .btn-floating:disabled,
3214	+ .btn-large:disabled,
3215	+ .btn-flat:disabled,
3216	+ .btn[disabled],
3217	+ [disabled].btn-large,
3218	+ .btn-floating[disabled],
3219	+ .btn-large[disabled],
3220	+ .btn-flat[disabled] {
3221	+ pointer-events: none;
3222	+ background-color: #DFDFDF !important;
3223	+ box-shadow: none;
3224	+ color: #9F9F9F !important;
3225	+ cursor: default; }
3226	+ .btn.disabled:hover, .disabled.btn-large:hover,
3227	+ .btn-floating.disabled:hover,
3228	+ .btn-large.disabled:hover,
3229	+ .btn-flat.disabled:hover,
3230	+ .btn:disabled:hover,
3231	+ .btn-large:disabled:hover,
3232	+ .btn-floating:disabled:hover,
3233	+ .btn-large:disabled:hover,
3234	+ .btn-flat:disabled:hover,
3235	+ .btn[disabled]:hover,
3236	+ [disabled].btn-large:hover,
3237	+ .btn-floating[disabled]:hover,
3238	+ .btn-large[disabled]:hover,
3239	+ .btn-flat[disabled]:hover {
3240	+ background-color: #DFDFDF !important;
3241	+ color: #9F9F9F !important; }
3242	+
3243	+ .btn, .btn-large,
3244	+ .btn-floating,
3245	+ .btn-large,
3246	+ .btn-flat {
3247	+ font-size: 1rem;
3248	+ outline: 0; }
3249	+ .btn i, .btn-large i,
3250	+ .btn-floating i,
3251	+ .btn-large i,
3252	+ .btn-flat i {
3253	+ font-size: 1.3rem;
3254	+ line-height: inherit; }
3255	+
3256	+ .btn:focus, .btn-large:focus,
3257	+ .btn-floating:focus {
3258	+ background-color: #1d7d74; }
3259	+
3260	+ .btn, .btn-large {
3261	+ text-decoration: none;
3262	+ color: #fff;
3263	+ background-color: #26a69a;
3264	+ text-align: center;
3265	+ letter-spacing: .5px;
3266	+ transition: .2s ease-out;
3267	+ cursor: pointer; }
3268	+ .btn:hover, .btn-large:hover {
3269	+ background-color: #2bbbad; }
3270	+
3271	+ .btn-floating {
3272	+ display: inline-block;
3273	+ color: #fff;
3274	+ position: relative;
3275	+ overflow: hidden;
3276	+ z-index: 1;
3277	+ width: 40px;
3278	+ height: 40px;
3279	+ line-height: 40px;
3280	+ padding: 0;
3281	+ background-color: #26a69a;
3282	+ border-radius: 50%;
3283	+ transition: .3s;
3284	+ cursor: pointer;
3285	+ vertical-align: middle; }
3286	+ .btn-floating:hover {
3287	+ background-color: #26a69a; }
3288	+ .btn-floating:before {
3289	+ border-radius: 0; }
3290	+ .btn-floating.btn-large {
3291	+ width: 56px;
3292	+ height: 56px; }
3293	+ .btn-floating.btn-large.halfway-fab {
3294	+ bottom: -28px; }
3295	+ .btn-floating.btn-large i {
3296	+ line-height: 56px; }
3297	+ .btn-floating.halfway-fab {
3298	+ position: absolute;
3299	+ right: 24px;
3300	+ bottom: -20px; }
3301	+ .btn-floating.halfway-fab.left {
3302	+ right: auto;
3303	+ left: 24px; }
3304	+ .btn-floating i {
3305	+ width: inherit;
3306	+ display: inline-block;
3307	+ text-align: center;
3308	+ color: #fff;
3309	+ font-size: 1.6rem;
3310	+ line-height: 40px; }
3311	+
3312	+ button.btn-floating {
3313	+ border: none; }
3314	+
3315	+ .fixed-action-btn {
3316	+ position: fixed;
3317	+ right: 23px;
3318	+ bottom: 23px;
3319	+ padding-top: 15px;
3320	+ margin-bottom: 0;
3321	+ z-index: 997; }
3322	+ .fixed-action-btn.active ul {
3323	+ visibility: visible; }
3324	+ .fixed-action-btn.horizontal {
3325	+ padding: 0 0 0 15px; }
3326	+ .fixed-action-btn.horizontal ul {
3327	+ text-align: right;
3328	+ right: 64px;
3329	+ top: 50%;
3330	+ transform: translateY(-50%);
3331	+ height: 100%;
3332	+ left: auto;
3333	+ width: 500px;
3334	+ /width 100% only goes to width of button container / }
3335	+ .fixed-action-btn.horizontal ul li {
3336	+ display: inline-block;
3337	+ margin: 15px 15px 0 0; }
3338	+ .fixed-action-btn.toolbar {
3339	+ padding: 0;
3340	+ height: 56px; }
3341	+ .fixed-action-btn.toolbar.active > a i {
3342	+ opacity: 0; }
3343	+ .fixed-action-btn.toolbar ul {
3344	+ display: flex;
3345	+ top: 0;
3346	+ bottom: 0;
3347	+ z-index: 1; }
3348	+ .fixed-action-btn.toolbar ul li {
3349	+ flex: 1;
3350	+ display: inline-block;
3351	+ margin: 0;
3352	+ height: 100%;
3353	+ transition: none; }
3354	+ .fixed-action-btn.toolbar ul li a {
3355	+ display: block;
3356	+ overflow: hidden;
3357	+ position: relative;
3358	+ width: 100%;
3359	+ height: 100%;
3360	+ background-color: transparent;
3361	+ box-shadow: none;
3362	+ color: #fff;
3363	+ line-height: 56px;
3364	+ z-index: 1; }
3365	+ .fixed-action-btn.toolbar ul li a i {
3366	+ line-height: inherit; }
3367	+ .fixed-action-btn ul {
3368	+ left: 0;
3369	+ right: 0;
3370	+ text-align: center;
3371	+ position: absolute;
3372	+ bottom: 64px;
3373	+ margin: 0;
3374	+ visibility: hidden; }
3375	+ .fixed-action-btn ul li {
3376	+ margin-bottom: 15px; }
3377	+ .fixed-action-btn ul a.btn-floating {
3378	+ opacity: 0; }
3379	+ .fixed-action-btn .fab-backdrop {
3380	+ position: absolute;
3381	+ top: 0;
3382	+ left: 0;
3383	+ z-index: -1;
3384	+ width: 40px;
3385	+ height: 40px;
3386	+ background-color: #26a69a;
3387	+ border-radius: 50%;
3388	+ transform: scale(0); }
3389	+
3390	+ .btn-flat {
3391	+ box-shadow: none;
3392	+ background-color: transparent;
3393	+ color: #343434;
3394	+ cursor: pointer;
3395	+ transition: background-color .2s; }
3396	+ .btn-flat:focus, .btn-flat:hover {
3397	+ box-shadow: none; }
3398	+ .btn-flat:focus {
3399	+ background-color: rgba(0, 0, 0, 0.1); }
3400	+ .btn-flat.disabled {
3401	+ background-color: transparent !important;
3402	+ color: #b3b3b3 !important;
3403	+ cursor: default; }
3404	+
3405	+ .btn-large {
3406	+ height: 54px;
3407	+ line-height: 54px; }
3408	+ .btn-large i {
3409	+ font-size: 1.6rem; }
3410	+
3411	+ .btn-block {
3412	+ display: block; }
3413	+
3414	+ .dropdown-content {
3415	+ background-color: #fff;
3416	+ margin: 0;
3417	+ display: none;
3418	+ min-width: 100px;
3419	+ max-height: 650px;
3420	+ overflow-y: auto;
3421	+ opacity: 0;
3422	+ position: absolute;
3423	+ z-index: 999;
3424	+ will-change: width, height; }
3425	+ .dropdown-content li {
3426	+ clear: both;
3427	+ color: rgba(0, 0, 0, 0.87);
3428	+ cursor: pointer;
3429	+ min-height: 50px;
3430	+ line-height: 1.5rem;
3431	+ width: 100%;
3432	+ text-align: left;
3433	+ text-transform: none; }
3434	+ .dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected {
3435	+ background-color: #eee; }
3436	+ .dropdown-content li.active.selected {
3437	+ background-color: #e1e1e1; }
3438	+ .dropdown-content li.divider {
3439	+ min-height: 0;
3440	+ height: 1px; }
3441	+ .dropdown-content li > a, .dropdown-content li > span {
3442	+ font-size: 16px;
3443	+ color: #26a69a;
3444	+ display: block;
3445	+ line-height: 22px;
3446	+ padding: 14px 16px; }
3447	+ .dropdown-content li > span > label {
3448	+ top: 1px;
3449	+ left: 0;
3450	+ height: 18px; }
3451	+ .dropdown-content li > a > i {
3452	+ height: inherit;
3453	+ line-height: inherit;
3454	+ float: left;
3455	+ margin: 0 24px 0 0;
3456	+ width: 24px; }
3457	+
3458	+ .input-field.col .dropdown-content [type="checkbox"] + label {
3459	+ top: 1px;
3460	+ left: 0;
3461	+ height: 18px; }
3462	+
3463	+ /*!
3464	+ * Waves v0.6.0
3465	+ * http://fian.my.id/Waves
3466	+ *
3467	+ * Copyright 2014 Alfiana E. Sibuea and other contributors
3468	+ * Released under the MIT license
3469	+ * https://github.com/fians/Waves/blob/master/LICENSE
3470	+ */
3471	+ .waves-effect {
3472	+ position: relative;
3473	+ cursor: pointer;
3474	+ display: inline-block;
3475	+ overflow: hidden;
3476	+ user-select: none;
3477	+ -webkit-tap-highlight-color: transparent;
3478	+ vertical-align: middle;
3479	+ z-index: 1;
3480	+ transition: .3s ease-out; }
3481	+ .waves-effect .waves-ripple {
3482	+ position: absolute;
3483	+ border-radius: 50%;
3484	+ width: 20px;
3485	+ height: 20px;
3486	+ margin-top: -10px;
3487	+ margin-left: -10px;
3488	+ opacity: 0;
3489	+ background: rgba(0, 0, 0, 0.2);
3490	+ transition: all 0.7s ease-out;
3491	+ transition-property: transform, opacity;
3492	+ transform: scale(0);
3493	+ pointer-events: none; }
3494	+ .waves-effect.waves-light .waves-ripple {
3495	+ background-color: rgba(255, 255, 255, 0.45); }
3496	+ .waves-effect.waves-red .waves-ripple {
3497	+ background-color: rgba(244, 67, 54, 0.7); }
3498	+ .waves-effect.waves-yellow .waves-ripple {
3499	+ background-color: rgba(255, 235, 59, 0.7); }
3500	+ .waves-effect.waves-orange .waves-ripple {
3501	+ background-color: rgba(255, 152, 0, 0.7); }
3502	+ .waves-effect.waves-purple .waves-ripple {
3503	+ background-color: rgba(156, 39, 176, 0.7); }
3504	+ .waves-effect.waves-green .waves-ripple {
3505	+ background-color: rgba(76, 175, 80, 0.7); }
3506	+ .waves-effect.waves-teal .waves-ripple {
3507	+ background-color: rgba(0, 150, 136, 0.7); }
3508	+ .waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] {
3509	+ border: 0;
3510	+ font-style: normal;
3511	+ font-size: inherit;
3512	+ text-transform: inherit;
3513	+ background: none; }
3514	+ .waves-effect img {
3515	+ position: relative;
3516	+ z-index: -1; }
3517	+
3518	+ .waves-notransition {
3519	+ transition: none !important; }
3520	+
3521	+ .waves-circle {
3522	+ transform: translateZ(0);
3523	+ -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); }
3524	+
3525	+ .waves-input-wrapper {
3526	+ border-radius: 0.2em;
3527	+ vertical-align: bottom; }
3528	+ .waves-input-wrapper .waves-button-input {
3529	+ position: relative;
3530	+ top: 0;
3531	+ left: 0;
3532	+ z-index: 1; }
3533	+
3534	+ .waves-circle {
3535	+ text-align: center;
3536	+ width: 2.5em;
3537	+ height: 2.5em;
3538	+ line-height: 2.5em;
3539	+ border-radius: 50%;
3540	+ -webkit-mask-image: none; }
3541	+
3542	+ .waves-block {
3543	+ display: block; }
3544	+
3545	+ /* Firefox Bug: link not triggered */
3546	+ .waves-effect .waves-ripple {
3547	+ z-index: -1; }
3548	+
3549	+ .collapsible {
3550	+ border-top: 1px solid #ddd;
3551	+ border-right: 1px solid #ddd;
3552	+ border-left: 1px solid #ddd;
3553	+ margin: 0.5rem 0 1rem 0; }
3554	+
3555	+ .collapsible-header {
3556	+ display: flex;
3557	+ cursor: pointer;
3558	+ -webkit-tap-highlight-color: transparent;
3559	+ line-height: 1.5;
3560	+ padding: 1rem;
3561	+ background-color: #fff;
3562	+ border-bottom: 1px solid #ddd; }
3563	+ .collapsible-header i {
3564	+ width: 2rem;
3565	+ font-size: 1.6rem;
3566	+ display: inline-block;
3567	+ text-align: center;
3568	+ margin-right: 1rem; }
3569	+
3570	+ .collapsible-body {
3571	+ display: none;
3572	+ border-bottom: 1px solid #ddd;
3573	+ box-sizing: border-box;
3574	+ padding: 2rem; }
3575	+
3576	+ .side-nav .collapsible,
3577	+ .side-nav.fixed .collapsible {
3578	+ border: none;
3579	+ box-shadow: none; }
3580	+ .side-nav .collapsible li,
3581	+ .side-nav.fixed .collapsible li {
3582	+ padding: 0; }
3583	+
3584	+ .side-nav .collapsible-header,
3585	+ .side-nav.fixed .collapsible-header {
3586	+ background-color: transparent;
3587	+ border: none;
3588	+ line-height: inherit;
3589	+ height: inherit;
3590	+ padding: 0 16px; }
3591	+ .side-nav .collapsible-header:hover,
3592	+ .side-nav.fixed .collapsible-header:hover {
3593	+ background-color: rgba(0, 0, 0, 0.05); }
3594	+ .side-nav .collapsible-header i,
3595	+ .side-nav.fixed .collapsible-header i {
3596	+ line-height: inherit; }
3597	+
3598	+ .side-nav .collapsible-body,
3599	+ .side-nav.fixed .collapsible-body {
3600	+ border: 0;
3601	+ background-color: #fff; }
3602	+ .side-nav .collapsible-body li a,
3603	+ .side-nav.fixed .collapsible-body li a {
3604	+ padding: 0 23.5px 0 31px; }
3605	+
3606	+ .collapsible.popout {
3607	+ border: none;
3608	+ box-shadow: none; }
3609	+ .collapsible.popout > li {
3610	+ box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
3611	+ margin: 0 24px;
3612	+ transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); }
3613	+ .collapsible.popout > li.active {
3614	+ box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
3615	+ margin: 16px 0; }
3616	+
3617	+ .chip {
3618	+ display: inline-block;
3619	+ height: 32px;
3620	+ font-size: 13px;
3621	+ font-weight: 500;
3622	+ color: rgba(0, 0, 0, 0.6);
3623	+ line-height: 32px;
3624	+ padding: 0 12px;
3625	+ border-radius: 16px;
3626	+ background-color: #e4e4e4;
3627	+ margin-bottom: 5px;
3628	+ margin-right: 5px; }
3629	+ .chip > img {
3630	+ float: left;
3631	+ margin: 0 8px 0 -12px;
3632	+ height: 32px;
3633	+ width: 32px;
3634	+ border-radius: 50%; }
3635	+ .chip .close {
3636	+ cursor: pointer;
3637	+ float: right;
3638	+ font-size: 16px;
3639	+ line-height: 32px;
3640	+ padding-left: 8px; }
3641	+
3642	+ .chips {
3643	+ border: none;
3644	+ border-bottom: 1px solid #9e9e9e;
3645	+ box-shadow: none;
3646	+ margin: 0 0 20px 0;
3647	+ min-height: 45px;
3648	+ outline: none;
3649	+ transition: all .3s; }
3650	+ .chips.focus {
3651	+ border-bottom: 1px solid #26a69a;
3652	+ box-shadow: 0 1px 0 0 #26a69a; }
3653	+ .chips:hover {
3654	+ cursor: text; }
3655	+ .chips .chip.selected {
3656	+ background-color: #26a69a;
3657	+ color: #fff; }
3658	+ .chips .input {
3659	+ background: none;
3660	+ border: 0;
3661	+ color: rgba(0, 0, 0, 0.6);
3662	+ display: inline-block;
3663	+ font-size: 1rem;
3664	+ height: 3rem;
3665	+ line-height: 32px;
3666	+ outline: 0;
3667	+ margin: 0;
3668	+ padding: 0 !important;
3669	+ width: 120px !important; }
3670	+ .chips .input:focus {
3671	+ border: 0 !important;
3672	+ box-shadow: none !important; }
3673	+ .chips .autocomplete-content {
3674	+ margin-top: 0;
3675	+ margin-bottom: 0; }
3676	+
3677	+ .prefix ~ .chips {
3678	+ margin-left: 3rem;
3679	+ width: 92%;
3680	+ width: calc(100% - 3rem); }
3681	+
3682	+ .chips:empty ~ label {
3683	+ font-size: 0.8rem;
3684	+ transform: translateY(-140%); }
3685	+
3686	+ select:focus {
3687	+ outline: 1px solid #c9f3ef; }
3688	+
3689	+ button:focus {
3690	+ outline: none;
3691	+ background-color: #2ab7a9; }
3692	+
3693	+ label {
3694	+ font-size: 0.8rem;
3695	+ color: #9e9e9e; }
3696	+
3697	+ /* Text Inputs + Textarea
3698	+ ========================================================================== */
3699	+ /* Style Placeholders */
3700	+ ::placeholder {
3701	+ color: #d1d1d1; }
3702	+
3703	+ /* Text inputs */
3704	+ input:not([type]),
3705	+ input[type=text]:not(.browser-default),
3706	+ input[type=password]:not(.browser-default),
3707	+ input[type=email]:not(.browser-default),
3708	+ input[type=url]:not(.browser-default),
3709	+ input[type=time]:not(.browser-default),
3710	+ input[type=date]:not(.browser-default),
3711	+ input[type=datetime]:not(.browser-default),
3712	+ input[type=datetime-local]:not(.browser-default),
3713	+ input[type=tel]:not(.browser-default),
3714	+ input[type=number]:not(.browser-default),
3715	+ input[type=search]:not(.browser-default),
3716	+ textarea.materialize-textarea {
3717	+ background-color: transparent;
3718	+ border: none;
3719	+ border-bottom: 1px solid #9e9e9e;
3720	+ border-radius: 0;
3721	+ outline: none;
3722	+ height: 3rem;
3723	+ width: 100%;
3724	+ font-size: 1rem;
3725	+ margin: 0 0 20px 0;
3726	+ padding: 0;
3727	+ box-shadow: none;
3728	+ box-sizing: content-box;
3729	+ transition: all 0.3s; }
3730	+ input:not([type]):disabled, input:not([type])[readonly="readonly"],
3731	+ input[type=text]:not(.browser-default):disabled,
3732	+ input[type=text]:not(.browser-default)[readonly="readonly"],
3733	+ input[type=password]:not(.browser-default):disabled,
3734	+ input[type=password]:not(.browser-default)[readonly="readonly"],
3735	+ input[type=email]:not(.browser-default):disabled,
3736	+ input[type=email]:not(.browser-default)[readonly="readonly"],
3737	+ input[type=url]:not(.browser-default):disabled,
3738	+ input[type=url]:not(.browser-default)[readonly="readonly"],
3739	+ input[type=time]:not(.browser-default):disabled,
3740	+ input[type=time]:not(.browser-default)[readonly="readonly"],
3741	+ input[type=date]:not(.browser-default):disabled,
3742	+ input[type=date]:not(.browser-default)[readonly="readonly"],
3743	+ input[type=datetime]:not(.browser-default):disabled,
3744	+ input[type=datetime]:not(.browser-default)[readonly="readonly"],
3745	+ input[type=datetime-local]:not(.browser-default):disabled,
3746	+ input[type=datetime-local]:not(.browser-default)[readonly="readonly"],
3747	+ input[type=tel]:not(.browser-default):disabled,
3748	+ input[type=tel]:not(.browser-default)[readonly="readonly"],
3749	+ input[type=number]:not(.browser-default):disabled,
3750	+ input[type=number]:not(.browser-default)[readonly="readonly"],
3751	+ input[type=search]:not(.browser-default):disabled,
3752	+ input[type=search]:not(.browser-default)[readonly="readonly"],
3753	+ textarea.materialize-textarea:disabled,
3754	+ textarea.materialize-textarea[readonly="readonly"] {
3755	+ color: rgba(0, 0, 0, 0.42);
3756	+ border-bottom: 1px dotted rgba(0, 0, 0, 0.42); }
3757	+ input:not([type]):disabled + label,
3758	+ input:not([type])[readonly="readonly"] + label,
3759	+ input[type=text]:not(.browser-default):disabled + label,
3760	+ input[type=text]:not(.browser-default)[readonly="readonly"] + label,
3761	+ input[type=password]:not(.browser-default):disabled + label,
3762	+ input[type=password]:not(.browser-default)[readonly="readonly"] + label,
3763	+ input[type=email]:not(.browser-default):disabled + label,
3764	+ input[type=email]:not(.browser-default)[readonly="readonly"] + label,
3765	+ input[type=url]:not(.browser-default):disabled + label,
3766	+ input[type=url]:not(.browser-default)[readonly="readonly"] + label,
3767	+ input[type=time]:not(.browser-default):disabled + label,
3768	+ input[type=time]:not(.browser-default)[readonly="readonly"] + label,
3769	+ input[type=date]:not(.browser-default):disabled + label,
3770	+ input[type=date]:not(.browser-default)[readonly="readonly"] + label,
3771	+ input[type=datetime]:not(.browser-default):disabled + label,
3772	+ input[type=datetime]:not(.browser-default)[readonly="readonly"] + label,
3773	+ input[type=datetime-local]:not(.browser-default):disabled + label,
3774	+ input[type=datetime-local]:not(.browser-default)[readonly="readonly"] + label,
3775	+ input[type=tel]:not(.browser-default):disabled + label,
3776	+ input[type=tel]:not(.browser-default)[readonly="readonly"] + label,
3777	+ input[type=number]:not(.browser-default):disabled + label,
3778	+ input[type=number]:not(.browser-default)[readonly="readonly"] + label,
3779	+ input[type=search]:not(.browser-default):disabled + label,
3780	+ input[type=search]:not(.browser-default)[readonly="readonly"] + label,
3781	+ textarea.materialize-textarea:disabled + label,
3782	+ textarea.materialize-textarea[readonly="readonly"] + label {
3783	+ color: rgba(0, 0, 0, 0.42); }
3784	+ input:not([type]):focus:not([readonly]),
3785	+ input[type=text]:not(.browser-default):focus:not([readonly]),
3786	+ input[type=password]:not(.browser-default):focus:not([readonly]),
3787	+ input[type=email]:not(.browser-default):focus:not([readonly]),
3788	+ input[type=url]:not(.browser-default):focus:not([readonly]),
3789	+ input[type=time]:not(.browser-default):focus:not([readonly]),
3790	+ input[type=date]:not(.browser-default):focus:not([readonly]),
3791	+ input[type=datetime]:not(.browser-default):focus:not([readonly]),
3792	+ input[type=datetime-local]:not(.browser-default):focus:not([readonly]),
3793	+ input[type=tel]:not(.browser-default):focus:not([readonly]),
3794	+ input[type=number]:not(.browser-default):focus:not([readonly]),
3795	+ input[type=search]:not(.browser-default):focus:not([readonly]),
3796	+ textarea.materialize-textarea:focus:not([readonly]) {
3797	+ border-bottom: 1px solid #26a69a;
3798	+ box-shadow: 0 1px 0 0 #26a69a; }
3799	+ input:not([type]):focus:not([readonly]) + label,
3800	+ input[type=text]:not(.browser-default):focus:not([readonly]) + label,
3801	+ input[type=password]:not(.browser-default):focus:not([readonly]) + label,
3802	+ input[type=email]:not(.browser-default):focus:not([readonly]) + label,
3803	+ input[type=url]:not(.browser-default):focus:not([readonly]) + label,
3804	+ input[type=time]:not(.browser-default):focus:not([readonly]) + label,
3805	+ input[type=date]:not(.browser-default):focus:not([readonly]) + label,
3806	+ input[type=datetime]:not(.browser-default):focus:not([readonly]) + label,
3807	+ input[type=datetime-local]:not(.browser-default):focus:not([readonly]) + label,
3808	+ input[type=tel]:not(.browser-default):focus:not([readonly]) + label,
3809	+ input[type=number]:not(.browser-default):focus:not([readonly]) + label,
3810	+ input[type=search]:not(.browser-default):focus:not([readonly]) + label,
3811	+ textarea.materialize-textarea:focus:not([readonly]) + label {
3812	+ color: #26a69a; }
3813	+ input:not([type]).validate + label,
3814	+ input[type=text]:not(.browser-default).validate + label,
3815	+ input[type=password]:not(.browser-default).validate + label,
3816	+ input[type=email]:not(.browser-default).validate + label,
3817	+ input[type=url]:not(.browser-default).validate + label,
3818	+ input[type=time]:not(.browser-default).validate + label,
3819	+ input[type=date]:not(.browser-default).validate + label,
3820	+ input[type=datetime]:not(.browser-default).validate + label,
3821	+ input[type=datetime-local]:not(.browser-default).validate + label,
3822	+ input[type=tel]:not(.browser-default).validate + label,
3823	+ input[type=number]:not(.browser-default).validate + label,
3824	+ input[type=search]:not(.browser-default).validate + label,
3825	+ textarea.materialize-textarea.validate + label {
3826	+ width: 100%; }
3827	+ input:not([type]).invalid + label:after,
3828	+ input:not([type]).valid + label:after,
3829	+ input[type=text]:not(.browser-default).invalid + label:after,
3830	+ input[type=text]:not(.browser-default).valid + label:after,
3831	+ input[type=password]:not(.browser-default).invalid + label:after,
3832	+ input[type=password]:not(.browser-default).valid + label:after,
3833	+ input[type=email]:not(.browser-default).invalid + label:after,
3834	+ input[type=email]:not(.browser-default).valid + label:after,
3835	+ input[type=url]:not(.browser-default).invalid + label:after,
3836	+ input[type=url]:not(.browser-default).valid + label:after,
3837	+ input[type=time]:not(.browser-default).invalid + label:after,
3838	+ input[type=time]:not(.browser-default).valid + label:after,
3839	+ input[type=date]:not(.browser-default).invalid + label:after,
3840	+ input[type=date]:not(.browser-default).valid + label:after,
3841	+ input[type=datetime]:not(.browser-default).invalid + label:after,
3842	+ input[type=datetime]:not(.browser-default).valid + label:after,
3843	+ input[type=datetime-local]:not(.browser-default).invalid + label:after,
3844	+ input[type=datetime-local]:not(.browser-default).valid + label:after,
3845	+ input[type=tel]:not(.browser-default).invalid + label:after,
3846	+ input[type=tel]:not(.browser-default).valid + label:after,
3847	+ input[type=number]:not(.browser-default).invalid + label:after,
3848	+ input[type=number]:not(.browser-default).valid + label:after,
3849	+ input[type=search]:not(.browser-default).invalid + label:after,
3850	+ input[type=search]:not(.browser-default).valid + label:after,
3851	+ textarea.materialize-textarea.invalid + label:after,
3852	+ textarea.materialize-textarea.valid + label:after {
3853	+ display: none; }
3854	+ input:not([type]).invalid + label.active:after,
3855	+ input:not([type]).valid + label.active:after,
3856	+ input[type=text]:not(.browser-default).invalid + label.active:after,
3857	+ input[type=text]:not(.browser-default).valid + label.active:after,
3858	+ input[type=password]:not(.browser-default).invalid + label.active:after,
3859	+ input[type=password]:not(.browser-default).valid + label.active:after,
3860	+ input[type=email]:not(.browser-default).invalid + label.active:after,
3861	+ input[type=email]:not(.browser-default).valid + label.active:after,
3862	+ input[type=url]:not(.browser-default).invalid + label.active:after,
3863	+ input[type=url]:not(.browser-default).valid + label.active:after,
3864	+ input[type=time]:not(.browser-default).invalid + label.active:after,
3865	+ input[type=time]:not(.browser-default).valid + label.active:after,
3866	+ input[type=date]:not(.browser-default).invalid + label.active:after,
3867	+ input[type=date]:not(.browser-default).valid + label.active:after,
3868	+ input[type=datetime]:not(.browser-default).invalid + label.active:after,
3869	+ input[type=datetime]:not(.browser-default).valid + label.active:after,
3870	+ input[type=datetime-local]:not(.browser-default).invalid + label.active:after,
3871	+ input[type=datetime-local]:not(.browser-default).valid + label.active:after,
3872	+ input[type=tel]:not(.browser-default).invalid + label.active:after,
3873	+ input[type=tel]:not(.browser-default).valid + label.active:after,
3874	+ input[type=number]:not(.browser-default).invalid + label.active:after,
3875	+ input[type=number]:not(.browser-default).valid + label.active:after,
3876	+ input[type=search]:not(.browser-default).invalid + label.active:after,
3877	+ input[type=search]:not(.browser-default).valid + label.active:after,
3878	+ textarea.materialize-textarea.invalid + label.active:after,
3879	+ textarea.materialize-textarea.valid + label.active:after {
3880	+ display: block; }
3881	+
3882	+ /* Validation Sass Placeholders */
3883	+ input.valid:not([type]), input.valid:not([type]):focus,
3884	+ input[type=text].valid:not(.browser-default),
3885	+ input[type=text].valid:not(.browser-default):focus,
3886	+ input[type=password].valid:not(.browser-default),
3887	+ input[type=password].valid:not(.browser-default):focus,
3888	+ input[type=email].valid:not(.browser-default),
3889	+ input[type=email].valid:not(.browser-default):focus,
3890	+ input[type=url].valid:not(.browser-default),
3891	+ input[type=url].valid:not(.browser-default):focus,
3892	+ input[type=time].valid:not(.browser-default),
3893	+ input[type=time].valid:not(.browser-default):focus,
3894	+ input[type=date].valid:not(.browser-default),
3895	+ input[type=date].valid:not(.browser-default):focus,
3896	+ input[type=datetime].valid:not(.browser-default),
3897	+ input[type=datetime].valid:not(.browser-default):focus,
3898	+ input[type=datetime-local].valid:not(.browser-default),
3899	+ input[type=datetime-local].valid:not(.browser-default):focus,
3900	+ input[type=tel].valid:not(.browser-default),
3901	+ input[type=tel].valid:not(.browser-default):focus,
3902	+ input[type=number].valid:not(.browser-default),
3903	+ input[type=number].valid:not(.browser-default):focus,
3904	+ input[type=search].valid:not(.browser-default),
3905	+ input[type=search].valid:not(.browser-default):focus,
3906	+ textarea.materialize-textarea.valid,
3907	+ textarea.materialize-textarea.valid:focus, .select-wrapper.valid > input.select-dropdown {
3908	+ border-bottom: 1px solid #4CAF50;
3909	+ box-shadow: 0 1px 0 0 #4CAF50; }
3910	+
3911	+ input.invalid:not([type]), input.invalid:not([type]):focus,
3912	+ input[type=text].invalid:not(.browser-default),
3913	+ input[type=text].invalid:not(.browser-default):focus,
3914	+ input[type=password].invalid:not(.browser-default),
3915	+ input[type=password].invalid:not(.browser-default):focus,
3916	+ input[type=email].invalid:not(.browser-default),
3917	+ input[type=email].invalid:not(.browser-default):focus,
3918	+ input[type=url].invalid:not(.browser-default),
3919	+ input[type=url].invalid:not(.browser-default):focus,
3920	+ input[type=time].invalid:not(.browser-default),
3921	+ input[type=time].invalid:not(.browser-default):focus,
3922	+ input[type=date].invalid:not(.browser-default),
3923	+ input[type=date].invalid:not(.browser-default):focus,
3924	+ input[type=datetime].invalid:not(.browser-default),
3925	+ input[type=datetime].invalid:not(.browser-default):focus,
3926	+ input[type=datetime-local].invalid:not(.browser-default),
3927	+ input[type=datetime-local].invalid:not(.browser-default):focus,
3928	+ input[type=tel].invalid:not(.browser-default),
3929	+ input[type=tel].invalid:not(.browser-default):focus,
3930	+ input[type=number].invalid:not(.browser-default),
3931	+ input[type=number].invalid:not(.browser-default):focus,
3932	+ input[type=search].invalid:not(.browser-default),
3933	+ input[type=search].invalid:not(.browser-default):focus,
3934	+ textarea.materialize-textarea.invalid,
3935	+ textarea.materialize-textarea.invalid:focus, .select-wrapper.invalid > input.select-dropdown {
3936	+ border-bottom: 1px solid #F44336;
3937	+ box-shadow: 0 1px 0 0 #F44336; }
3938	+
3939	+ input:not([type]).valid + label:after,
3940	+ input:not([type]):focus.valid + label:after,
3941	+ input[type=text]:not(.browser-default).valid + label:after,
3942	+ input[type=text]:not(.browser-default):focus.valid + label:after,
3943	+ input[type=password]:not(.browser-default).valid + label:after,
3944	+ input[type=password]:not(.browser-default):focus.valid + label:after,
3945	+ input[type=email]:not(.browser-default).valid + label:after,
3946	+ input[type=email]:not(.browser-default):focus.valid + label:after,
3947	+ input[type=url]:not(.browser-default).valid + label:after,
3948	+ input[type=url]:not(.browser-default):focus.valid + label:after,
3949	+ input[type=time]:not(.browser-default).valid + label:after,
3950	+ input[type=time]:not(.browser-default):focus.valid + label:after,
3951	+ input[type=date]:not(.browser-default).valid + label:after,
3952	+ input[type=date]:not(.browser-default):focus.valid + label:after,
3953	+ input[type=datetime]:not(.browser-default).valid + label:after,
3954	+ input[type=datetime]:not(.browser-default):focus.valid + label:after,
3955	+ input[type=datetime-local]:not(.browser-default).valid + label:after,
3956	+ input[type=datetime-local]:not(.browser-default):focus.valid + label:after,
3957	+ input[type=tel]:not(.browser-default).valid + label:after,
3958	+ input[type=tel]:not(.browser-default):focus.valid + label:after,
3959	+ input[type=number]:not(.browser-default).valid + label:after,
3960	+ input[type=number]:not(.browser-default):focus.valid + label:after,
3961	+ input[type=search]:not(.browser-default).valid + label:after,
3962	+ input[type=search]:not(.browser-default):focus.valid + label:after,
3963	+ textarea.materialize-textarea.valid + label:after,
3964	+ textarea.materialize-textarea:focus.valid + label:after, .select-wrapper.valid + label:after {
3965	+ content: attr(data-success);
3966	+ color: #4CAF50;
3967	+ opacity: 1;
3968	+ transform: translateY(9px); }
3969	+
3970	+ input:not([type]).invalid + label:after,
3971	+ input:not([type]):focus.invalid + label:after,
3972	+ input[type=text]:not(.browser-default).invalid + label:after,
3973	+ input[type=text]:not(.browser-default):focus.invalid + label:after,
3974	+ input[type=password]:not(.browser-default).invalid + label:after,
3975	+ input[type=password]:not(.browser-default):focus.invalid + label:after,
3976	+ input[type=email]:not(.browser-default).invalid + label:after,
3977	+ input[type=email]:not(.browser-default):focus.invalid + label:after,
3978	+ input[type=url]:not(.browser-default).invalid + label:after,
3979	+ input[type=url]:not(.browser-default):focus.invalid + label:after,
3980	+ input[type=time]:not(.browser-default).invalid + label:after,
3981	+ input[type=time]:not(.browser-default):focus.invalid + label:after,
3982	+ input[type=date]:not(.browser-default).invalid + label:after,
3983	+ input[type=date]:not(.browser-default):focus.invalid + label:after,
3984	+ input[type=datetime]:not(.browser-default).invalid + label:after,
3985	+ input[type=datetime]:not(.browser-default):focus.invalid + label:after,
3986	+ input[type=datetime-local]:not(.browser-default).invalid + label:after,
3987	+ input[type=datetime-local]:not(.browser-default):focus.invalid + label:after,
3988	+ input[type=tel]:not(.browser-default).invalid + label:after,
3989	+ input[type=tel]:not(.browser-default):focus.invalid + label:after,
3990	+ input[type=number]:not(.browser-default).invalid + label:after,
3991	+ input[type=number]:not(.browser-default):focus.invalid + label:after,
3992	+ input[type=search]:not(.browser-default).invalid + label:after,
3993	+ input[type=search]:not(.browser-default):focus.invalid + label:after,
3994	+ textarea.materialize-textarea.invalid + label:after,
3995	+ textarea.materialize-textarea:focus.invalid + label:after, .select-wrapper.invalid + label:after {
3996	+ content: attr(data-error);
3997	+ color: #F44336;
3998	+ opacity: 1;
3999	+ transform: translateY(9px); }
4000	+
4001	+ input:not([type]) + label:after,
4002	+ input[type=text]:not(.browser-default) + label:after,
4003	+ input[type=password]:not(.browser-default) + label:after,
4004	+ input[type=email]:not(.browser-default) + label:after,
4005	+ input[type=url]:not(.browser-default) + label:after,
4006	+ input[type=time]:not(.browser-default) + label:after,
4007	+ input[type=date]:not(.browser-default) + label:after,
4008	+ input[type=datetime]:not(.browser-default) + label:after,
4009	+ input[type=datetime-local]:not(.browser-default) + label:after,
4010	+ input[type=tel]:not(.browser-default) + label:after,
4011	+ input[type=number]:not(.browser-default) + label:after,
4012	+ input[type=search]:not(.browser-default) + label:after,
4013	+ textarea.materialize-textarea + label:after, .select-wrapper + label:after {
4014	+ display: block;
4015	+ content: "";
4016	+ position: absolute;
4017	+ top: 100%;
4018	+ left: 0;
4019	+ opacity: 0;
4020	+ transition: .2s opacity ease-out, .2s color ease-out; }
4021	+
4022	+ .input-field {
4023	+ position: relative;
4024	+ margin-top: 1rem; }
4025	+ .input-field.inline {
4026	+ display: inline-block;
4027	+ vertical-align: middle;
4028	+ margin-left: 5px; }
4029	+ .input-field.inline input,
4030	+ .input-field.inline .select-dropdown {
4031	+ margin-bottom: 1rem; }
4032	+ .input-field.col label {
4033	+ left: 0.75rem; }
4034	+ .input-field.col .prefix ~ label,
4035	+ .input-field.col .prefix ~ .validate ~ label {
4036	+ width: calc(100% - 3rem - 1.5rem); }
4037	+ .input-field label {
4038	+ color: #9e9e9e;
4039	+ position: absolute;
4040	+ top: 0;
4041	+ left: 0;
4042	+ height: 100%;
4043	+ font-size: 1rem;
4044	+ cursor: text;
4045	+ transition: transform .2s ease-out;
4046	+ transform-origin: 0% 100%;
4047	+ text-align: initial;
4048	+ transform: translateY(12px);
4049	+ pointer-events: none; }
4050	+ .input-field label:not(.label-icon).active {
4051	+ transform: translateY(-14px) scale(0.8);
4052	+ transform-origin: 0 0; }
4053	+ .input-field .prefix {
4054	+ position: absolute;
4055	+ width: 3rem;
4056	+ font-size: 2rem;
4057	+ transition: color .2s; }
4058	+ .input-field .prefix.active {
4059	+ color: #26a69a; }
4060	+ .input-field .prefix ~ input,
4061	+ .input-field .prefix ~ textarea,
4062	+ .input-field .prefix ~ label,
4063	+ .input-field .prefix ~ .validate ~ label,
4064	+ .input-field .prefix ~ .autocomplete-content {
4065	+ margin-left: 3rem;
4066	+ width: 92%;
4067	+ width: calc(100% - 3rem); }
4068	+ .input-field .prefix ~ label {
4069	+ margin-left: 3rem; }
4070	+ @media only screen and (max-width: 992px) {
4071	+ .input-field .prefix ~ input {
4072	+ width: 86%;
4073	+ width: calc(100% - 3rem); } }
4074	+ @media only screen and (max-width: 600px) {
4075	+ .input-field .prefix ~ input {
4076	+ width: 80%;
4077	+ width: calc(100% - 3rem); } }
4078	+
4079	+ /* Search Field */
4080	+ .input-field input[type=search] {
4081	+ display: block;
4082	+ line-height: inherit; }
4083	+ .nav-wrapper .input-field input[type=search] {
4084	+ height: inherit;
4085	+ padding-left: 4rem;
4086	+ width: calc(100% - 4rem);
4087	+ border: 0;
4088	+ box-shadow: none; }
4089	+ .input-field input[type=search]:focus {
4090	+ background-color: #fff;
4091	+ border: 0;
4092	+ box-shadow: none;
4093	+ color: #444; }
4094	+ .input-field input[type=search]:focus + label i,
4095	+ .input-field input[type=search]:focus ~ .mdi-navigation-close,
4096	+ .input-field input[type=search]:focus ~ .material-icons {
4097	+ color: #444; }
4098	+ .input-field input[type=search] + label {
4099	+ left: 1rem; }
4100	+ .input-field input[type=search] ~ .mdi-navigation-close,
4101	+ .input-field input[type=search] ~ .material-icons {
4102	+ position: absolute;
4103	+ top: 0;
4104	+ right: 1rem;
4105	+ color: transparent;
4106	+ cursor: pointer;
4107	+ font-size: 2rem;
4108	+ transition: .3s color; }
4109	+
4110	+ /* Textarea */
4111	+ textarea {
4112	+ width: 100%;
4113	+ height: 3rem;
4114	+ background-color: transparent; }
4115	+ textarea.materialize-textarea {
4116	+ overflow-y: hidden;
4117	+ /* prevents scroll bar flash */
4118	+ padding: .8rem 0 1.6rem 0;
4119	+ /* prevents text jump on Enter keypress */
4120	+ resize: none;
4121	+ min-height: 3rem; }
4122	+ textarea.materialize-textarea.validate + label {
4123	+ height: 100%; }
4124	+ textarea.materialize-textarea.validate + label::after {
4125	+ top: calc(100% - 12px); }
4126	+ textarea.materialize-textarea.validate + label:not(.label-icon).active {
4127	+ transform: translateY(-25px); }
4128	+
4129	+ .hiddendiv {
4130	+ display: none;
4131	+ white-space: pre-wrap;
4132	+ word-wrap: break-word;
4133	+ overflow-wrap: break-word;
4134	+ /* future version of deprecated 'word-wrap' */
4135	+ padding-top: 1.2rem;
4136	+ /* prevents text jump on Enter keypress */
4137	+ position: absolute;
4138	+ top: 0; }
4139	+
4140	+ /* Autocomplete */
4141	+ .autocomplete-content {
4142	+ margin-top: -20px;
4143	+ margin-bottom: 20px;
4144	+ display: block;
4145	+ opacity: 1;
4146	+ position: static; }
4147	+ .autocomplete-content li .highlight {
4148	+ color: #444; }
4149	+ .autocomplete-content li img {
4150	+ height: 40px;
4151	+ width: 40px;
4152	+ margin: 5px 15px; }
4153	+
4154	+ /* Radio Buttons
4155	+ ========================================================================== */
4156	+ [type="radio"]:not(:checked),
4157	+ [type="radio"]:checked {
4158	+ position: absolute;
4159	+ opacity: 0;
4160	+ pointer-events: none; }
4161	+
4162	+ [type="radio"]:not(:checked) + label,
4163	+ [type="radio"]:checked + label {
4164	+ position: relative;
4165	+ padding-left: 35px;
4166	+ cursor: pointer;
4167	+ display: inline-block;
4168	+ height: 25px;
4169	+ line-height: 25px;
4170	+ font-size: 1rem;
4171	+ transition: .28s ease;
4172	+ user-select: none; }
4173	+
4174	+ [type="radio"] + label:before,
4175	+ [type="radio"] + label:after {
4176	+ content: '';
4177	+ position: absolute;
4178	+ left: 0;
4179	+ top: 0;
4180	+ margin: 4px;
4181	+ width: 16px;
4182	+ height: 16px;
4183	+ z-index: 0;
4184	+ transition: .28s ease; }
4185	+
4186	+ /* Unchecked styles */
4187	+ [type="radio"]:not(:checked) + label:before,
4188	+ [type="radio"]:not(:checked) + label:after,
4189	+ [type="radio"]:checked + label:before,
4190	+ [type="radio"]:checked + label:after,
4191	+ [type="radio"].with-gap:checked + label:before,
4192	+ [type="radio"].with-gap:checked + label:after {
4193	+ border-radius: 50%; }
4194	+
4195	+ [type="radio"]:not(:checked) + label:before,
4196	+ [type="radio"]:not(:checked) + label:after {
4197	+ border: 2px solid #5a5a5a; }
4198	+
4199	+ [type="radio"]:not(:checked) + label:after {
4200	+ transform: scale(0); }
4201	+
4202	+ /* Checked styles */
4203	+ [type="radio"]:checked + label:before {
4204	+ border: 2px solid transparent; }
4205	+
4206	+ [type="radio"]:checked + label:after,
4207	+ [type="radio"].with-gap:checked + label:before,
4208	+ [type="radio"].with-gap:checked + label:after {
4209	+ border: 2px solid #26a69a; }
4210	+
4211	+ [type="radio"]:checked + label:after,
4212	+ [type="radio"].with-gap:checked + label:after {
4213	+ background-color: #26a69a; }
4214	+
4215	+ [type="radio"]:checked + label:after {
4216	+ transform: scale(1.02); }
4217	+
4218	+ /* Radio With gap */
4219	+ [type="radio"].with-gap:checked + label:after {
4220	+ transform: scale(0.5); }
4221	+
4222	+ /* Focused styles */
4223	+ [type="radio"].tabbed:focus + label:before {
4224	+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); }
4225	+
4226	+ /* Disabled Radio With gap */
4227	+ [type="radio"].with-gap:disabled:checked + label:before {
4228	+ border: 2px solid rgba(0, 0, 0, 0.42); }
4229	+
4230	+ [type="radio"].with-gap:disabled:checked + label:after {
4231	+ border: none;
4232	+ background-color: rgba(0, 0, 0, 0.42); }
4233	+
4234	+ /* Disabled style */
4235	+ [type="radio"]:disabled:not(:checked) + label:before,
4236	+ [type="radio"]:disabled:checked + label:before {
4237	+ background-color: transparent;
4238	+ border-color: rgba(0, 0, 0, 0.42); }
4239	+
4240	+ [type="radio"]:disabled + label {
4241	+ color: rgba(0, 0, 0, 0.42); }
4242	+
4243	+ [type="radio"]:disabled:not(:checked) + label:before {
4244	+ border-color: rgba(0, 0, 0, 0.42); }
4245	+
4246	+ [type="radio"]:disabled:checked + label:after {
4247	+ background-color: rgba(0, 0, 0, 0.42);
4248	+ border-color: #949494; }
4249	+
4250	+ /* Checkboxes
4251	+ ========================================================================== */
4252	+ /* CUSTOM CSS CHECKBOXES */
4253	+ form p {
4254	+ margin-bottom: 10px;
4255	+ text-align: left; }
4256	+
4257	+ form p:last-child {
4258	+ margin-bottom: 0; }
4259	+
4260	+ /* Remove default checkbox */
4261	+ [type="checkbox"]:not(:checked),
4262	+ [type="checkbox"]:checked {
4263	+ position: absolute;
4264	+ opacity: 0;
4265	+ pointer-events: none; }
4266	+
4267	+ [type="checkbox"] {
4268	+ /* checkbox aspect */ }
4269	+ [type="checkbox"] + label {
4270	+ position: relative;
4271	+ padding-left: 35px;
4272	+ cursor: pointer;
4273	+ display: inline-block;
4274	+ height: 25px;
4275	+ line-height: 25px;
4276	+ font-size: 1rem;
4277	+ user-select: none; }
4278	+ [type="checkbox"] + label:before,
4279	+ [type="checkbox"]:not(.filled-in) + label:after {
4280	+ content: '';
4281	+ position: absolute;
4282	+ top: 0;
4283	+ left: 0;
4284	+ width: 18px;
4285	+ height: 18px;
4286	+ z-index: 0;
4287	+ border: 2px solid #5a5a5a;
4288	+ border-radius: 1px;
4289	+ margin-top: 2px;
4290	+ transition: .2s; }
4291	+ [type="checkbox"]:not(.filled-in) + label:after {
4292	+ border: 0;
4293	+ transform: scale(0); }
4294	+ [type="checkbox"]:not(:checked):disabled + label:before {
4295	+ border: none;
4296	+ background-color: rgba(0, 0, 0, 0.42); }
4297	+ [type="checkbox"].tabbed:focus + label:after {
4298	+ transform: scale(1);
4299	+ border: 0;
4300	+ border-radius: 50%;
4301	+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
4302	+ background-color: rgba(0, 0, 0, 0.1); }
4303	+
4304	+ [type="checkbox"]:checked + label:before {
4305	+ top: -4px;
4306	+ left: -5px;
4307	+ width: 12px;
4308	+ height: 22px;
4309	+ border-top: 2px solid transparent;
4310	+ border-left: 2px solid transparent;
4311	+ border-right: 2px solid #26a69a;
4312	+ border-bottom: 2px solid #26a69a;
4313	+ transform: rotate(40deg);
4314	+ backface-visibility: hidden;
4315	+ transform-origin: 100% 100%; }
4316	+
4317	+ [type="checkbox"]:checked:disabled + label:before {
4318	+ border-right: 2px solid rgba(0, 0, 0, 0.42);
4319	+ border-bottom: 2px solid rgba(0, 0, 0, 0.42); }
4320	+
4321	+ /* Indeterminate checkbox */
4322	+ [type="checkbox"]:indeterminate + label:before {
4323	+ top: -11px;
4324	+ left: -12px;
4325	+ width: 10px;
4326	+ height: 22px;
4327	+ border-top: none;
4328	+ border-left: none;
4329	+ border-right: 2px solid #26a69a;
4330	+ border-bottom: none;
4331	+ transform: rotate(90deg);
4332	+ backface-visibility: hidden;
4333	+ transform-origin: 100% 100%; }
4334	+
4335	+ [type="checkbox"]:indeterminate:disabled + label:before {
4336	+ border-right: 2px solid rgba(0, 0, 0, 0.42);
4337	+ background-color: transparent; }
4338	+
4339	+ [type="checkbox"].filled-in + label:after {
4340	+ border-radius: 2px; }
4341	+
4342	+ [type="checkbox"].filled-in + label:before,
4343	+ [type="checkbox"].filled-in + label:after {
4344	+ content: '';
4345	+ left: 0;
4346	+ position: absolute;
4347	+ /* .1s delay is for check animation */
4348	+ transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
4349	+ z-index: 1; }
4350	+
4351	+ [type="checkbox"].filled-in:not(:checked) + label:before {
4352	+ width: 0;
4353	+ height: 0;
4354	+ border: 3px solid transparent;
4355	+ left: 6px;
4356	+ top: 10px;
4357	+ transform: rotateZ(37deg);
4358	+ transform-origin: 100% 100%; }
4359	+
4360	+ [type="checkbox"].filled-in:not(:checked) + label:after {
4361	+ height: 20px;
4362	+ width: 20px;
4363	+ background-color: transparent;
4364	+ border: 2px solid #5a5a5a;
4365	+ top: 0px;
4366	+ z-index: 0; }
4367	+
4368	+ [type="checkbox"].filled-in:checked + label:before {
4369	+ top: 0;
4370	+ left: 1px;
4371	+ width: 8px;
4372	+ height: 13px;
4373	+ border-top: 2px solid transparent;
4374	+ border-left: 2px solid transparent;
4375	+ border-right: 2px solid #fff;
4376	+ border-bottom: 2px solid #fff;
4377	+ transform: rotateZ(37deg);
4378	+ transform-origin: 100% 100%; }
4379	+
4380	+ [type="checkbox"].filled-in:checked + label:after {
4381	+ top: 0;
4382	+ width: 20px;
4383	+ height: 20px;
4384	+ border: 2px solid #26a69a;
4385	+ background-color: #26a69a;
4386	+ z-index: 0; }
4387	+
4388	+ [type="checkbox"].filled-in.tabbed:focus + label:after {
4389	+ border-radius: 2px;
4390	+ border-color: #5a5a5a;
4391	+ background-color: rgba(0, 0, 0, 0.1); }
4392	+
4393	+ [type="checkbox"].filled-in.tabbed:checked:focus + label:after {
4394	+ border-radius: 2px;
4395	+ background-color: #26a69a;
4396	+ border-color: #26a69a; }
4397	+
4398	+ [type="checkbox"].filled-in:disabled:not(:checked) + label:before {
4399	+ background-color: transparent;
4400	+ border: 2px solid transparent; }
4401	+
4402	+ [type="checkbox"].filled-in:disabled:not(:checked) + label:after {
4403	+ border-color: transparent;
4404	+ background-color: #949494; }
4405	+
4406	+ [type="checkbox"].filled-in:disabled:checked + label:before {
4407	+ background-color: transparent; }
4408	+
4409	+ [type="checkbox"].filled-in:disabled:checked + label:after {
4410	+ background-color: #949494;
4411	+ border-color: #949494; }
4412	+
4413	+ /* Switch
4414	+ ========================================================================== */
4415	+ .switch,
4416	+ .switch * {
4417	+ -webkit-tap-highlight-color: transparent;
4418	+ user-select: none; }
4419	+
4420	+ .switch label {
4421	+ cursor: pointer; }
4422	+
4423	+ .switch label input[type=checkbox] {
4424	+ opacity: 0;
4425	+ width: 0;
4426	+ height: 0; }
4427	+ .switch label input[type=checkbox]:checked + .lever {
4428	+ background-color: #84c7c1; }
4429	+ .switch label input[type=checkbox]:checked + .lever:before, .switch label input[type=checkbox]:checked + .lever:after {
4430	+ left: 18px; }
4431	+ .switch label input[type=checkbox]:checked + .lever:after {
4432	+ background-color: #26a69a; }
4433	+
4434	+ .switch label .lever {
4435	+ content: "";
4436	+ display: inline-block;
4437	+ position: relative;
4438	+ width: 36px;
4439	+ height: 14px;
4440	+ background-color: rgba(0, 0, 0, 0.38);
4441	+ border-radius: 15px;
4442	+ margin-right: 10px;
4443	+ transition: background 0.3s ease;
4444	+ vertical-align: middle;
4445	+ margin: 0 16px; }
4446	+ .switch label .lever:before, .switch label .lever:after {
4447	+ content: "";
4448	+ position: absolute;
4449	+ display: inline-block;
4450	+ width: 20px;
4451	+ height: 20px;
4452	+ border-radius: 50%;
4453	+ left: 0;
4454	+ top: -3px;
4455	+ transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease; }
4456	+ .switch label .lever:before {
4457	+ background-color: rgba(38, 166, 154, 0.15); }
4458	+ .switch label .lever:after {
4459	+ background-color: #F1F1F1;
4460	+ box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12); }
4461	+
4462	+ input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,
4463	+ input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before {
4464	+ transform: scale(2.4);
4465	+ background-color: rgba(38, 166, 154, 0.15); }
4466	+
4467	+ input[type=checkbox]:not(:disabled) ~ .lever:active:before,
4468	+ input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before {
4469	+ transform: scale(2.4);
4470	+ background-color: rgba(0, 0, 0, 0.08); }
4471	+
4472	+ .switch input[type=checkbox][disabled] + .lever {
4473	+ cursor: default;
4474	+ background-color: rgba(0, 0, 0, 0.12); }
4475	+
4476	+ .switch label input[type=checkbox][disabled] + .lever:after,
4477	+ .switch label input[type=checkbox][disabled]:checked + .lever:after {
4478	+ background-color: #949494; }
4479	+
4480	+ /* Select Field
4481	+ ========================================================================== */
4482	+ select {
4483	+ display: none; }
4484	+
4485	+ select.browser-default {
4486	+ display: block; }
4487	+
4488	+ select {
4489	+ background-color: rgba(255, 255, 255, 0.9);
4490	+ width: 100%;
4491	+ padding: 5px;
4492	+ border: 1px solid #f2f2f2;
4493	+ border-radius: 2px;
4494	+ height: 3rem; }
4495	+
4496	+ .input-field select {
4497	+ display: block;
4498	+ position: absolute;
4499	+ width: 0;
4500	+ pointer-events: none;
4501	+ height: 0;
4502	+ top: 0;
4503	+ left: 0;
4504	+ opacity: 0; }
4505	+
4506	+ .select-label {
4507	+ position: absolute; }
4508	+
4509	+ .select-wrapper {
4510	+ position: relative; }
4511	+ .select-wrapper.valid + label,
4512	+ .select-wrapper.invalid + label {
4513	+ width: 100%;
4514	+ pointer-events: none; }
4515	+ .select-wrapper input.select-dropdown {
4516	+ position: relative;
4517	+ cursor: pointer;
4518	+ background-color: transparent;
4519	+ border: none;
4520	+ border-bottom: 1px solid #9e9e9e;
4521	+ outline: none;
4522	+ height: 3rem;
4523	+ line-height: 3rem;
4524	+ width: 100%;
4525	+ font-size: 1rem;
4526	+ margin: 0 0 20px 0;
4527	+ padding: 0;
4528	+ display: block;
4529	+ user-select: none; }
4530	+ .select-wrapper span.caret {
4531	+ color: initial;
4532	+ position: absolute;
4533	+ right: 0;
4534	+ top: 0;
4535	+ bottom: 0;
4536	+ height: 10px;
4537	+ margin: auto 0;
4538	+ font-size: 10px;
4539	+ line-height: 10px; }
4540	+ .select-wrapper + label {
4541	+ position: absolute;
4542	+ top: -26px;
4543	+ font-size: 0.8rem; }
4544	+
4545	+ select:disabled {
4546	+ color: rgba(0, 0, 0, 0.42); }
4547	+
4548	+ .select-wrapper.disabled span.caret,
4549	+ .select-wrapper.disabled + label {
4550	+ color: rgba(0, 0, 0, 0.42); }
4551	+
4552	+ .select-wrapper input.select-dropdown:disabled {
4553	+ color: rgba(0, 0, 0, 0.42);
4554	+ cursor: default;
4555	+ user-select: none; }
4556	+
4557	+ .select-wrapper i {
4558	+ color: rgba(0, 0, 0, 0.3); }
4559	+
4560	+ .select-dropdown li.disabled,
4561	+ .select-dropdown li.disabled > span,
4562	+ .select-dropdown li.optgroup {
4563	+ color: rgba(0, 0, 0, 0.3);
4564	+ background-color: transparent; }
4565	+
4566	+ .select-dropdown.dropdown-content li.active {
4567	+ background-color: transparent; }
4568	+
4569	+ .select-dropdown.dropdown-content li:hover {
4570	+ background-color: rgba(0, 0, 0, 0.06); }
4571	+
4572	+ .select-dropdown.dropdown-content li.selected {
4573	+ background-color: rgba(0, 0, 0, 0.03); }
4574	+
4575	+ .prefix ~ .select-wrapper {
4576	+ margin-left: 3rem;
4577	+ width: 92%;
4578	+ width: calc(100% - 3rem); }
4579	+
4580	+ .prefix ~ label {
4581	+ margin-left: 3rem; }
4582	+
4583	+ .select-dropdown li img {
4584	+ height: 40px;
4585	+ width: 40px;
4586	+ margin: 5px 15px;
4587	+ float: right; }
4588	+
4589	+ .select-dropdown li.optgroup {
4590	+ border-top: 1px solid #eee; }
4591	+ .select-dropdown li.optgroup.selected > span {
4592	+ color: rgba(0, 0, 0, 0.7); }
4593	+ .select-dropdown li.optgroup > span {
4594	+ color: rgba(0, 0, 0, 0.4); }
4595	+ .select-dropdown li.optgroup ~ li.optgroup-option {
4596	+ padding-left: 1rem; }
4597	+
4598	+ /* File Input
4599	+ ========================================================================== */
4600	+ .file-field {
4601	+ position: relative; }
4602	+ .file-field .file-path-wrapper {
4603	+ overflow: hidden;
4604	+ padding-left: 10px; }
4605	+ .file-field input.file-path {
4606	+ width: 100%; }
4607	+ .file-field .btn, .file-field .btn-large {
4608	+ float: left;
4609	+ height: 3rem;
4610	+ line-height: 3rem; }
4611	+ .file-field span {
4612	+ cursor: pointer; }
4613	+ .file-field input[type=file] {
4614	+ position: absolute;
4615	+ top: 0;
4616	+ right: 0;
4617	+ left: 0;
4618	+ bottom: 0;
4619	+ width: 100%;
4620	+ margin: 0;
4621	+ padding: 0;
4622	+ font-size: 20px;
4623	+ cursor: pointer;
4624	+ opacity: 0;
4625	+ filter: alpha(opacity=0); }
4626	+ .file-field input[type=file]::-webkit-file-upload-button {
4627	+ display: none; }
4628	+
4629	+ /* Range
4630	+ ========================================================================== */
4631	+ .range-field {
4632	+ position: relative; }
4633	+
4634	+ input[type=range],
4635	+ input[type=range] + .thumb {
4636	+ cursor: pointer; }
4637	+
4638	+ input[type=range] {
4639	+ position: relative;
4640	+ background-color: transparent;
4641	+ border: none;
4642	+ outline: none;
4643	+ width: 100%;
4644	+ margin: 15px 0;
4645	+ padding: 0; }
4646	+ input[type=range]:focus {
4647	+ outline: none; }
4648	+
4649	+ input[type=range] + .thumb {
4650	+ position: absolute;
4651	+ top: 10px;
4652	+ left: 0;
4653	+ border: none;
4654	+ height: 0;
4655	+ width: 0;
4656	+ border-radius: 50%;
4657	+ background-color: #26a69a;
4658	+ margin-left: 7px;
4659	+ transform-origin: 50% 50%;
4660	+ transform: rotate(-45deg); }
4661	+ input[type=range] + .thumb .value {
4662	+ display: block;
4663	+ width: 30px;
4664	+ text-align: center;
4665	+ color: #26a69a;
4666	+ font-size: 0;
4667	+ transform: rotate(45deg); }
4668	+ input[type=range] + .thumb.active {
4669	+ border-radius: 50% 50% 50% 0; }
4670	+ input[type=range] + .thumb.active .value {
4671	+ color: #fff;
4672	+ margin-left: -1px;
4673	+ margin-top: 8px;
4674	+ font-size: 10px; }
4675	+
4676	+ input[type=range] {
4677	+ -webkit-appearance: none; }
4678	+
4679	+ input[type=range]::-webkit-slider-runnable-track {
4680	+ height: 3px;
4681	+ background: #c2c0c2;
4682	+ border: none; }
4683	+
4684	+ input[type=range]::-webkit-slider-thumb {
4685	+ -webkit-appearance: none;
4686	+ border: none;
4687	+ height: 14px;
4688	+ width: 14px;
4689	+ border-radius: 50%;
4690	+ background-color: #26a69a;
4691	+ transform-origin: 50% 50%;
4692	+ margin: -5px 0 0 0;
4693	+ transition: .3s; }
4694	+
4695	+ input[type=range]:focus::-webkit-slider-runnable-track {
4696	+ background: #ccc; }
4697	+
4698	+ input[type=range] {
4699	+ /* fix for FF unable to apply focus style bug */
4700	+ border: 1px solid white;
4701	+ /required for proper track sizing in FF/ }
4702	+
4703	+ input[type=range]::-moz-range-track {
4704	+ height: 3px;
4705	+ background: #ddd;
4706	+ border: none; }
4707	+
4708	+ input[type=range]::-moz-range-thumb {
4709	+ border: none;
4710	+ height: 14px;
4711	+ width: 14px;
4712	+ border-radius: 50%;
4713	+ background: #26a69a;
4714	+ margin-top: -5px; }
4715	+
4716	+ input[type=range]:-moz-focusring {
4717	+ outline: 1px solid #fff;
4718	+ outline-offset: -1px; }
4719	+
4720	+ input[type=range]:focus::-moz-range-track {
4721	+ background: #ccc; }
4722	+
4723	+ input[type=range]::-ms-track {
4724	+ height: 3px;
4725	+ background: transparent;
4726	+ border-color: transparent;
4727	+ border-width: 6px 0;
4728	+ /remove default tick marks/
4729	+ color: transparent; }
4730	+
4731	+ input[type=range]::-ms-fill-lower {
4732	+ background: #777; }
4733	+
4734	+ input[type=range]::-ms-fill-upper {
4735	+ background: #ddd; }
4736	+
4737	+ input[type=range]::-ms-thumb {
4738	+ border: none;
4739	+ height: 14px;
4740	+ width: 14px;
4741	+ border-radius: 50%;
4742	+ background: #26a69a; }
4743	+
4744	+ input[type=range]:focus::-ms-fill-lower {
4745	+ background: #888; }
4746	+
4747	+ input[type=range]:focus::-ms-fill-upper {
4748	+ background: #ccc; }
4749	+
4750	+
4751	+
4752	+
4753	+ /* custom styles */
4754	+
4755	+ .display-none {
4756	+ display: none; }
4757	+
4758	+ .display-block {
4759	+ display: block; }
4760	+
4761	+ input.input-margin {
4762	+ margin: 0 0 3px 0 !important; }
4763	+
4764	+ .select-margin .select-1 input {
4765	+ margin: 0 0 3px 0 !important; }

assets/css/main.css ADDED Viewed

	@@ -0,0 +1,3756 @@


1	+ /*
2	+ * icons set
3	+ * Materializecss
4	+ * custom Code
5	+ */
6	+
7	+
8	+ /* ==== custom icons set ==== */
9	+ @font-face {
10	+ font-family: 'ccw';
11	+ src: url(../fonts/ccw.eot);
12	+ src: url(../fonts/ccw.eot#iefix) format('embedded-opentype'),
13	+ url(../fonts/ccw.ttf) format('truetype'),
14	+ url(../fonts/ccw.woff) format('woff'),
15	+ url(../fonts/ccw.svg#ccw) format('svg');
16	+ font-weight: normal;
17	+ font-style: normal;
18	+ }
19	+
20	+ .icon {
21	+ /* use !important to prevent issues with browser extensions that change fonts */
22	+ font-family: 'ccw' !important;
23	+ speak: none;
24	+ font-style: normal;
25	+ font-weight: normal;
26	+ font-variant: normal;
27	+ text-transform: none;
28	+ line-height: 1;
29	+
30	+ /* Better Font Rendering =========== */
31	+ -webkit-font-smoothing: antialiased;
32	+ -moz-osx-font-smoothing: grayscale;
33	+ }
34	+
35	+ .icon-whatsapp2:before {
36	+ content: "\E902";
37	+ }
38	+ .icon-brand:before {
39	+ content: "\E901";
40	+ color: #25d366;
41	+ }
42	+ .icon-send:before {
43	+ content: "\E900";
44	+ }
45	+ .icon-whatsapp:before {
46	+ content: "\EA93";
47	+ }
48	+
49	+ /* ==== Materializecss ==== */
50	+
51	+ /*
52	+ * Materilizecss - http://materializecss.com/
53	+ * To Make this Framework not to conflict with your Theme style,
54	+ * we wrap Materilizecss class with `css_plugin`,
55	+ * that's like adding a root 'ccw_plugin' node on every style
56	+ */
57	+
58	+ .ccw_plugin .materialize-red {
59	+ background-color: #e51c23 !important; }
60	+ .ccw_plugin .materialize-red-text {
61	+ color: #e51c23 !important; }
62	+ .ccw_plugin .materialize-red.lighten-5 {
63	+ background-color: #fdeaeb !important; }
64	+ .ccw_plugin .materialize-red-text.text-lighten-5 {
65	+ color: #fdeaeb !important; }
66	+ .ccw_plugin .materialize-red.lighten-4 {
67	+ background-color: #f8c1c3 !important; }
68	+ .ccw_plugin .materialize-red-text.text-lighten-4 {
69	+ color: #f8c1c3 !important; }
70	+ .ccw_plugin .materialize-red.lighten-3 {
71	+ background-color: #f3989b !important; }
72	+ .ccw_plugin .materialize-red-text.text-lighten-3 {
73	+ color: #f3989b !important; }
74	+ .ccw_plugin .materialize-red.lighten-2 {
75	+ background-color: #ee6e73 !important; }
76	+ .ccw_plugin .materialize-red-text.text-lighten-2 {
77	+ color: #ee6e73 !important; }
78	+ .ccw_plugin .materialize-red.lighten-1 {
79	+ background-color: #ea454b !important; }
80	+ .ccw_plugin .materialize-red-text.text-lighten-1 {
81	+ color: #ea454b !important; }
82	+ .ccw_plugin .materialize-red.darken-1 {
83	+ background-color: #d0181e !important; }
84	+ .ccw_plugin .materialize-red-text.text-darken-1 {
85	+ color: #d0181e !important; }
86	+ .ccw_plugin .materialize-red.darken-2 {
87	+ background-color: #b9151b !important; }
88	+ .ccw_plugin .materialize-red-text.text-darken-2 {
89	+ color: #b9151b !important; }
90	+ .ccw_plugin .materialize-red.darken-3 {
91	+ background-color: #a21318 !important; }
92	+ .ccw_plugin .materialize-red-text.text-darken-3 {
93	+ color: #a21318 !important; }
94	+ .ccw_plugin .materialize-red.darken-4 {
95	+ background-color: #8b1014 !important; }
96	+ .ccw_plugin .materialize-red-text.text-darken-4 {
97	+ color: #8b1014 !important; }
98	+ .ccw_plugin .red {
99	+ background-color: #F44336 !important; }
100	+ .ccw_plugin .red-text {
101	+ color: #F44336 !important; }
102	+ .ccw_plugin .red.lighten-5 {
103	+ background-color: #FFEBEE !important; }
104	+ .ccw_plugin .red-text.text-lighten-5 {
105	+ color: #FFEBEE !important; }
106	+ .ccw_plugin .red.lighten-4 {
107	+ background-color: #FFCDD2 !important; }
108	+ .ccw_plugin .red-text.text-lighten-4 {
109	+ color: #FFCDD2 !important; }
110	+ .ccw_plugin .red.lighten-3 {
111	+ background-color: #EF9A9A !important; }
112	+ .ccw_plugin .red-text.text-lighten-3 {
113	+ color: #EF9A9A !important; }
114	+ .ccw_plugin .red.lighten-2 {
115	+ background-color: #E57373 !important; }
116	+ .ccw_plugin .red-text.text-lighten-2 {
117	+ color: #E57373 !important; }
118	+ .ccw_plugin .red.lighten-1 {
119	+ background-color: #EF5350 !important; }
120	+ .ccw_plugin .red-text.text-lighten-1 {
121	+ color: #EF5350 !important; }
122	+ .ccw_plugin .red.darken-1 {
123	+ background-color: #E53935 !important; }
124	+ .ccw_plugin .red-text.text-darken-1 {
125	+ color: #E53935 !important; }
126	+ .ccw_plugin .red.darken-2 {
127	+ background-color: #D32F2F !important; }
128	+ .ccw_plugin .red-text.text-darken-2 {
129	+ color: #D32F2F !important; }
130	+ .ccw_plugin .red.darken-3 {
131	+ background-color: #C62828 !important; }
132	+ .ccw_plugin .red-text.text-darken-3 {
133	+ color: #C62828 !important; }
134	+ .ccw_plugin .red.darken-4 {
135	+ background-color: #B71C1C !important; }
136	+ .ccw_plugin .red-text.text-darken-4 {
137	+ color: #B71C1C !important; }
138	+ .ccw_plugin .red.accent-1 {
139	+ background-color: #FF8A80 !important; }
140	+ .ccw_plugin .red-text.text-accent-1 {
141	+ color: #FF8A80 !important; }
142	+ .ccw_plugin .red.accent-2 {
143	+ background-color: #FF5252 !important; }
144	+ .ccw_plugin .red-text.text-accent-2 {
145	+ color: #FF5252 !important; }
146	+ .ccw_plugin .red.accent-3 {
147	+ background-color: #FF1744 !important; }
148	+ .ccw_plugin .red-text.text-accent-3 {
149	+ color: #FF1744 !important; }
150	+ .ccw_plugin .red.accent-4 {
151	+ background-color: #D50000 !important; }
152	+ .ccw_plugin .red-text.text-accent-4 {
153	+ color: #D50000 !important; }
154	+ .ccw_plugin .pink {
155	+ background-color: #e91e63 !important; }
156	+ .ccw_plugin .pink-text {
157	+ color: #e91e63 !important; }
158	+ .ccw_plugin .pink.lighten-5 {
159	+ background-color: #fce4ec !important; }
160	+ .ccw_plugin .pink-text.text-lighten-5 {
161	+ color: #fce4ec !important; }
162	+ .ccw_plugin .pink.lighten-4 {
163	+ background-color: #f8bbd0 !important; }
164	+ .ccw_plugin .pink-text.text-lighten-4 {
165	+ color: #f8bbd0 !important; }
166	+ .ccw_plugin .pink.lighten-3 {
167	+ background-color: #f48fb1 !important; }
168	+ .ccw_plugin .pink-text.text-lighten-3 {
169	+ color: #f48fb1 !important; }
170	+ .ccw_plugin .pink.lighten-2 {
171	+ background-color: #f06292 !important; }
172	+ .ccw_plugin .pink-text.text-lighten-2 {
173	+ color: #f06292 !important; }
174	+ .ccw_plugin .pink.lighten-1 {
175	+ background-color: #ec407a !important; }
176	+ .ccw_plugin .pink-text.text-lighten-1 {
177	+ color: #ec407a !important; }
178	+ .ccw_plugin .pink.darken-1 {
179	+ background-color: #d81b60 !important; }
180	+ .ccw_plugin .pink-text.text-darken-1 {
181	+ color: #d81b60 !important; }
182	+ .ccw_plugin .pink.darken-2 {
183	+ background-color: #c2185b !important; }
184	+ .ccw_plugin .pink-text.text-darken-2 {
185	+ color: #c2185b !important; }
186	+ .ccw_plugin .pink.darken-3 {
187	+ background-color: #ad1457 !important; }
188	+ .ccw_plugin .pink-text.text-darken-3 {
189	+ color: #ad1457 !important; }
190	+ .ccw_plugin .pink.darken-4 {
191	+ background-color: #880e4f !important; }
192	+ .ccw_plugin .pink-text.text-darken-4 {
193	+ color: #880e4f !important; }
194	+ .ccw_plugin .pink.accent-1 {
195	+ background-color: #ff80ab !important; }
196	+ .ccw_plugin .pink-text.text-accent-1 {
197	+ color: #ff80ab !important; }
198	+ .ccw_plugin .pink.accent-2 {
199	+ background-color: #ff4081 !important; }
200	+ .ccw_plugin .pink-text.text-accent-2 {
201	+ color: #ff4081 !important; }
202	+ .ccw_plugin .pink.accent-3 {
203	+ background-color: #f50057 !important; }
204	+ .ccw_plugin .pink-text.text-accent-3 {
205	+ color: #f50057 !important; }
206	+ .ccw_plugin .pink.accent-4 {
207	+ background-color: #c51162 !important; }
208	+ .ccw_plugin .pink-text.text-accent-4 {
209	+ color: #c51162 !important; }
210	+ .ccw_plugin .purple {
211	+ background-color: #9c27b0 !important; }
212	+ .ccw_plugin .purple-text {
213	+ color: #9c27b0 !important; }
214	+ .ccw_plugin .purple.lighten-5 {
215	+ background-color: #f3e5f5 !important; }
216	+ .ccw_plugin .purple-text.text-lighten-5 {
217	+ color: #f3e5f5 !important; }
218	+ .ccw_plugin .purple.lighten-4 {
219	+ background-color: #e1bee7 !important; }
220	+ .ccw_plugin .purple-text.text-lighten-4 {
221	+ color: #e1bee7 !important; }
222	+ .ccw_plugin .purple.lighten-3 {
223	+ background-color: #ce93d8 !important; }
224	+ .ccw_plugin .purple-text.text-lighten-3 {
225	+ color: #ce93d8 !important; }
226	+ .ccw_plugin .purple.lighten-2 {
227	+ background-color: #ba68c8 !important; }
228	+ .ccw_plugin .purple-text.text-lighten-2 {
229	+ color: #ba68c8 !important; }
230	+ .ccw_plugin .purple.lighten-1 {
231	+ background-color: #ab47bc !important; }
232	+ .ccw_plugin .purple-text.text-lighten-1 {
233	+ color: #ab47bc !important; }
234	+ .ccw_plugin .purple.darken-1 {
235	+ background-color: #8e24aa !important; }
236	+ .ccw_plugin .purple-text.text-darken-1 {
237	+ color: #8e24aa !important; }
238	+ .ccw_plugin .purple.darken-2 {
239	+ background-color: #7b1fa2 !important; }
240	+ .ccw_plugin .purple-text.text-darken-2 {
241	+ color: #7b1fa2 !important; }
242	+ .ccw_plugin .purple.darken-3 {
243	+ background-color: #6a1b9a !important; }
244	+ .ccw_plugin .purple-text.text-darken-3 {
245	+ color: #6a1b9a !important; }
246	+ .ccw_plugin .purple.darken-4 {
247	+ background-color: #4a148c !important; }
248	+ .ccw_plugin .purple-text.text-darken-4 {
249	+ color: #4a148c !important; }
250	+ .ccw_plugin .purple.accent-1 {
251	+ background-color: #ea80fc !important; }
252	+ .ccw_plugin .purple-text.text-accent-1 {
253	+ color: #ea80fc !important; }
254	+ .ccw_plugin .purple.accent-2 {
255	+ background-color: #e040fb !important; }
256	+ .ccw_plugin .purple-text.text-accent-2 {
257	+ color: #e040fb !important; }
258	+ .ccw_plugin .purple.accent-3 {
259	+ background-color: #d500f9 !important; }
260	+ .ccw_plugin .purple-text.text-accent-3 {
261	+ color: #d500f9 !important; }
262	+ .ccw_plugin .purple.accent-4 {
263	+ background-color: #aa00ff !important; }
264	+ .ccw_plugin .purple-text.text-accent-4 {
265	+ color: #aa00ff !important; }
266	+ .ccw_plugin .deep-purple {
267	+ background-color: #673ab7 !important; }
268	+ .ccw_plugin .deep-purple-text {
269	+ color: #673ab7 !important; }
270	+ .ccw_plugin .deep-purple.lighten-5 {
271	+ background-color: #ede7f6 !important; }
272	+ .ccw_plugin .deep-purple-text.text-lighten-5 {
273	+ color: #ede7f6 !important; }
274	+ .ccw_plugin .deep-purple.lighten-4 {
275	+ background-color: #d1c4e9 !important; }
276	+ .ccw_plugin .deep-purple-text.text-lighten-4 {
277	+ color: #d1c4e9 !important; }
278	+ .ccw_plugin .deep-purple.lighten-3 {
279	+ background-color: #b39ddb !important; }
280	+ .ccw_plugin .deep-purple-text.text-lighten-3 {
281	+ color: #b39ddb !important; }
282	+ .ccw_plugin .deep-purple.lighten-2 {
283	+ background-color: #9575cd !important; }
284	+ .ccw_plugin .deep-purple-text.text-lighten-2 {
285	+ color: #9575cd !important; }
286	+ .ccw_plugin .deep-purple.lighten-1 {
287	+ background-color: #7e57c2 !important; }
288	+ .ccw_plugin .deep-purple-text.text-lighten-1 {
289	+ color: #7e57c2 !important; }
290	+ .ccw_plugin .deep-purple.darken-1 {
291	+ background-color: #5e35b1 !important; }
292	+ .ccw_plugin .deep-purple-text.text-darken-1 {
293	+ color: #5e35b1 !important; }
294	+ .ccw_plugin .deep-purple.darken-2 {
295	+ background-color: #512da8 !important; }
296	+ .ccw_plugin .deep-purple-text.text-darken-2 {
297	+ color: #512da8 !important; }
298	+ .ccw_plugin .deep-purple.darken-3 {
299	+ background-color: #4527a0 !important; }
300	+ .ccw_plugin .deep-purple-text.text-darken-3 {
301	+ color: #4527a0 !important; }
302	+ .ccw_plugin .deep-purple.darken-4 {
303	+ background-color: #311b92 !important; }
304	+ .ccw_plugin .deep-purple-text.text-darken-4 {
305	+ color: #311b92 !important; }
306	+ .ccw_plugin .deep-purple.accent-1 {
307	+ background-color: #b388ff !important; }
308	+ .ccw_plugin .deep-purple-text.text-accent-1 {
309	+ color: #b388ff !important; }
310	+ .ccw_plugin .deep-purple.accent-2 {
311	+ background-color: #7c4dff !important; }
312	+ .ccw_plugin .deep-purple-text.text-accent-2 {
313	+ color: #7c4dff !important; }
314	+ .ccw_plugin .deep-purple.accent-3 {
315	+ background-color: #651fff !important; }
316	+ .ccw_plugin .deep-purple-text.text-accent-3 {
317	+ color: #651fff !important; }
318	+ .ccw_plugin .deep-purple.accent-4 {
319	+ background-color: #6200ea !important; }
320	+ .ccw_plugin .deep-purple-text.text-accent-4 {
321	+ color: #6200ea !important; }
322	+ .ccw_plugin .indigo {
323	+ background-color: #3f51b5 !important; }
324	+ .ccw_plugin .indigo-text {
325	+ color: #3f51b5 !important; }
326	+ .ccw_plugin .indigo.lighten-5 {
327	+ background-color: #e8eaf6 !important; }
328	+ .ccw_plugin .indigo-text.text-lighten-5 {
329	+ color: #e8eaf6 !important; }
330	+ .ccw_plugin .indigo.lighten-4 {
331	+ background-color: #c5cae9 !important; }
332	+ .ccw_plugin .indigo-text.text-lighten-4 {
333	+ color: #c5cae9 !important; }
334	+ .ccw_plugin .indigo.lighten-3 {
335	+ background-color: #9fa8da !important; }
336	+ .ccw_plugin .indigo-text.text-lighten-3 {
337	+ color: #9fa8da !important; }
338	+ .ccw_plugin .indigo.lighten-2 {
339	+ background-color: #7986cb !important; }
340	+ .ccw_plugin .indigo-text.text-lighten-2 {
341	+ color: #7986cb !important; }
342	+ .ccw_plugin .indigo.lighten-1 {
343	+ background-color: #5c6bc0 !important; }
344	+ .ccw_plugin .indigo-text.text-lighten-1 {
345	+ color: #5c6bc0 !important; }
346	+ .ccw_plugin .indigo.darken-1 {
347	+ background-color: #3949ab !important; }
348	+ .ccw_plugin .indigo-text.text-darken-1 {
349	+ color: #3949ab !important; }
350	+ .ccw_plugin .indigo.darken-2 {
351	+ background-color: #303f9f !important; }
352	+ .ccw_plugin .indigo-text.text-darken-2 {
353	+ color: #303f9f !important; }
354	+ .ccw_plugin .indigo.darken-3 {
355	+ background-color: #283593 !important; }
356	+ .ccw_plugin .indigo-text.text-darken-3 {
357	+ color: #283593 !important; }
358	+ .ccw_plugin .indigo.darken-4 {
359	+ background-color: #1a237e !important; }
360	+ .ccw_plugin .indigo-text.text-darken-4 {
361	+ color: #1a237e !important; }
362	+ .ccw_plugin .indigo.accent-1 {
363	+ background-color: #8c9eff !important; }
364	+ .ccw_plugin .indigo-text.text-accent-1 {
365	+ color: #8c9eff !important; }
366	+ .ccw_plugin .indigo.accent-2 {
367	+ background-color: #536dfe !important; }
368	+ .ccw_plugin .indigo-text.text-accent-2 {
369	+ color: #536dfe !important; }
370	+ .ccw_plugin .indigo.accent-3 {
371	+ background-color: #3d5afe !important; }
372	+ .ccw_plugin .indigo-text.text-accent-3 {
373	+ color: #3d5afe !important; }
374	+ .ccw_plugin .indigo.accent-4 {
375	+ background-color: #304ffe !important; }
376	+ .ccw_plugin .indigo-text.text-accent-4 {
377	+ color: #304ffe !important; }
378	+ .ccw_plugin .blue {
379	+ background-color: #2196F3 !important; }
380	+ .ccw_plugin .blue-text {
381	+ color: #2196F3 !important; }
382	+ .ccw_plugin .blue.lighten-5 {
383	+ background-color: #E3F2FD !important; }
384	+ .ccw_plugin .blue-text.text-lighten-5 {
385	+ color: #E3F2FD !important; }
386	+ .ccw_plugin .blue.lighten-4 {
387	+ background-color: #BBDEFB !important; }
388	+ .ccw_plugin .blue-text.text-lighten-4 {
389	+ color: #BBDEFB !important; }
390	+ .ccw_plugin .blue.lighten-3 {
391	+ background-color: #90CAF9 !important; }
392	+ .ccw_plugin .blue-text.text-lighten-3 {
393	+ color: #90CAF9 !important; }
394	+ .ccw_plugin .blue.lighten-2 {
395	+ background-color: #64B5F6 !important; }
396	+ .ccw_plugin .blue-text.text-lighten-2 {
397	+ color: #64B5F6 !important; }
398	+ .ccw_plugin .blue.lighten-1 {
399	+ background-color: #42A5F5 !important; }
400	+ .ccw_plugin .blue-text.text-lighten-1 {
401	+ color: #42A5F5 !important; }
402	+ .ccw_plugin .blue.darken-1 {
403	+ background-color: #1E88E5 !important; }
404	+ .ccw_plugin .blue-text.text-darken-1 {
405	+ color: #1E88E5 !important; }
406	+ .ccw_plugin .blue.darken-2 {
407	+ background-color: #1976D2 !important; }
408	+ .ccw_plugin .blue-text.text-darken-2 {
409	+ color: #1976D2 !important; }
410	+ .ccw_plugin .blue.darken-3 {
411	+ background-color: #1565C0 !important; }
412	+ .ccw_plugin .blue-text.text-darken-3 {
413	+ color: #1565C0 !important; }
414	+ .ccw_plugin .blue.darken-4 {
415	+ background-color: #0D47A1 !important; }
416	+ .ccw_plugin .blue-text.text-darken-4 {
417	+ color: #0D47A1 !important; }
418	+ .ccw_plugin .blue.accent-1 {
419	+ background-color: #82B1FF !important; }
420	+ .ccw_plugin .blue-text.text-accent-1 {
421	+ color: #82B1FF !important; }
422	+ .ccw_plugin .blue.accent-2 {
423	+ background-color: #448AFF !important; }
424	+ .ccw_plugin .blue-text.text-accent-2 {
425	+ color: #448AFF !important; }
426	+ .ccw_plugin .blue.accent-3 {
427	+ background-color: #2979FF !important; }
428	+ .ccw_plugin .blue-text.text-accent-3 {
429	+ color: #2979FF !important; }
430	+ .ccw_plugin .blue.accent-4 {
431	+ background-color: #2962FF !important; }
432	+ .ccw_plugin .blue-text.text-accent-4 {
433	+ color: #2962FF !important; }
434	+ .ccw_plugin .light-blue {
435	+ background-color: #03a9f4 !important; }
436	+ .ccw_plugin .light-blue-text {
437	+ color: #03a9f4 !important; }
438	+ .ccw_plugin .light-blue.lighten-5 {
439	+ background-color: #e1f5fe !important; }
440	+ .ccw_plugin .light-blue-text.text-lighten-5 {
441	+ color: #e1f5fe !important; }
442	+ .ccw_plugin .light-blue.lighten-4 {
443	+ background-color: #b3e5fc !important; }
444	+ .ccw_plugin .light-blue-text.text-lighten-4 {
445	+ color: #b3e5fc !important; }
446	+ .ccw_plugin .light-blue.lighten-3 {
447	+ background-color: #81d4fa !important; }
448	+ .ccw_plugin .light-blue-text.text-lighten-3 {
449	+ color: #81d4fa !important; }
450	+ .ccw_plugin .light-blue.lighten-2 {
451	+ background-color: #4fc3f7 !important; }
452	+ .ccw_plugin .light-blue-text.text-lighten-2 {
453	+ color: #4fc3f7 !important; }
454	+ .ccw_plugin .light-blue.lighten-1 {
455	+ background-color: #29b6f6 !important; }
456	+ .ccw_plugin .light-blue-text.text-lighten-1 {
457	+ color: #29b6f6 !important; }
458	+ .ccw_plugin .light-blue.darken-1 {
459	+ background-color: #039be5 !important; }
460	+ .ccw_plugin .light-blue-text.text-darken-1 {
461	+ color: #039be5 !important; }
462	+ .ccw_plugin .light-blue.darken-2 {
463	+ background-color: #0288d1 !important; }
464	+ .ccw_plugin .light-blue-text.text-darken-2 {
465	+ color: #0288d1 !important; }
466	+ .ccw_plugin .light-blue.darken-3 {
467	+ background-color: #0277bd !important; }
468	+ .ccw_plugin .light-blue-text.text-darken-3 {
469	+ color: #0277bd !important; }
470	+ .ccw_plugin .light-blue.darken-4 {
471	+ background-color: #01579b !important; }
472	+ .ccw_plugin .light-blue-text.text-darken-4 {
473	+ color: #01579b !important; }
474	+ .ccw_plugin .light-blue.accent-1 {
475	+ background-color: #80d8ff !important; }
476	+ .ccw_plugin .light-blue-text.text-accent-1 {
477	+ color: #80d8ff !important; }
478	+ .ccw_plugin .light-blue.accent-2 {
479	+ background-color: #40c4ff !important; }
480	+ .ccw_plugin .light-blue-text.text-accent-2 {
481	+ color: #40c4ff !important; }
482	+ .ccw_plugin .light-blue.accent-3 {
483	+ background-color: #00b0ff !important; }
484	+ .ccw_plugin .light-blue-text.text-accent-3 {
485	+ color: #00b0ff !important; }
486	+ .ccw_plugin .light-blue.accent-4 {
487	+ background-color: #0091ea !important; }
488	+ .ccw_plugin .light-blue-text.text-accent-4 {
489	+ color: #0091ea !important; }
490	+ .ccw_plugin .cyan {
491	+ background-color: #00bcd4 !important; }
492	+ .ccw_plugin .cyan-text {
493	+ color: #00bcd4 !important; }
494	+ .ccw_plugin .cyan.lighten-5 {
495	+ background-color: #e0f7fa !important; }
496	+ .ccw_plugin .cyan-text.text-lighten-5 {
497	+ color: #e0f7fa !important; }
498	+ .ccw_plugin .cyan.lighten-4 {
499	+ background-color: #b2ebf2 !important; }
500	+ .ccw_plugin .cyan-text.text-lighten-4 {
501	+ color: #b2ebf2 !important; }
502	+ .ccw_plugin .cyan.lighten-3 {
503	+ background-color: #80deea !important; }
504	+ .ccw_plugin .cyan-text.text-lighten-3 {
505	+ color: #80deea !important; }
506	+ .ccw_plugin .cyan.lighten-2 {
507	+ background-color: #4dd0e1 !important; }
508	+ .ccw_plugin .cyan-text.text-lighten-2 {
509	+ color: #4dd0e1 !important; }
510	+ .ccw_plugin .cyan.lighten-1 {
511	+ background-color: #26c6da !important; }
512	+ .ccw_plugin .cyan-text.text-lighten-1 {
513	+ color: #26c6da !important; }
514	+ .ccw_plugin .cyan.darken-1 {
515	+ background-color: #00acc1 !important; }
516	+ .ccw_plugin .cyan-text.text-darken-1 {
517	+ color: #00acc1 !important; }
518	+ .ccw_plugin .cyan.darken-2 {
519	+ background-color: #0097a7 !important; }
520	+ .ccw_plugin .cyan-text.text-darken-2 {
521	+ color: #0097a7 !important; }
522	+ .ccw_plugin .cyan.darken-3 {
523	+ background-color: #00838f !important; }
524	+ .ccw_plugin .cyan-text.text-darken-3 {
525	+ color: #00838f !important; }
526	+ .ccw_plugin .cyan.darken-4 {
527	+ background-color: #006064 !important; }
528	+ .ccw_plugin .cyan-text.text-darken-4 {
529	+ color: #006064 !important; }
530	+ .ccw_plugin .cyan.accent-1 {
531	+ background-color: #84ffff !important; }
532	+ .ccw_plugin .cyan-text.text-accent-1 {
533	+ color: #84ffff !important; }
534	+ .ccw_plugin .cyan.accent-2 {
535	+ background-color: #18ffff !important; }
536	+ .ccw_plugin .cyan-text.text-accent-2 {
537	+ color: #18ffff !important; }
538	+ .ccw_plugin .cyan.accent-3 {
539	+ background-color: #00e5ff !important; }
540	+ .ccw_plugin .cyan-text.text-accent-3 {
541	+ color: #00e5ff !important; }
542	+ .ccw_plugin .cyan.accent-4 {
543	+ background-color: #00b8d4 !important; }
544	+ .ccw_plugin .cyan-text.text-accent-4 {
545	+ color: #00b8d4 !important; }
546	+ .ccw_plugin .teal {
547	+ background-color: #009688 !important; }
548	+ .ccw_plugin .teal-text {
549	+ color: #009688 !important; }
550	+ .ccw_plugin .teal.lighten-5 {
551	+ background-color: #e0f2f1 !important; }
552	+ .ccw_plugin .teal-text.text-lighten-5 {
553	+ color: #e0f2f1 !important; }
554	+ .ccw_plugin .teal.lighten-4 {
555	+ background-color: #b2dfdb !important; }
556	+ .ccw_plugin .teal-text.text-lighten-4 {
557	+ color: #b2dfdb !important; }
558	+ .ccw_plugin .teal.lighten-3 {
559	+ background-color: #80cbc4 !important; }
560	+ .ccw_plugin .teal-text.text-lighten-3 {
561	+ color: #80cbc4 !important; }
562	+ .ccw_plugin .teal.lighten-2 {
563	+ background-color: #4db6ac !important; }
564	+ .ccw_plugin .teal-text.text-lighten-2 {
565	+ color: #4db6ac !important; }
566	+ .ccw_plugin .teal.lighten-1 {
567	+ background-color: #26a69a !important; }
568	+ .ccw_plugin .teal-text.text-lighten-1 {
569	+ color: #26a69a !important; }
570	+ .ccw_plugin .teal.darken-1 {
571	+ background-color: #00897b !important; }
572	+ .ccw_plugin .teal-text.text-darken-1 {
573	+ color: #00897b !important; }
574	+ .ccw_plugin .teal.darken-2 {
575	+ background-color: #00796b !important; }
576	+ .ccw_plugin .teal-text.text-darken-2 {
577	+ color: #00796b !important; }
578	+ .ccw_plugin .teal.darken-3 {
579	+ background-color: #00695c !important; }
580	+ .ccw_plugin .teal-text.text-darken-3 {
581	+ color: #00695c !important; }
582	+ .ccw_plugin .teal.darken-4 {
583	+ background-color: #004d40 !important; }
584	+ .ccw_plugin .teal-text.text-darken-4 {
585	+ color: #004d40 !important; }
586	+ .ccw_plugin .teal.accent-1 {
587	+ background-color: #a7ffeb !important; }
588	+ .ccw_plugin .teal-text.text-accent-1 {
589	+ color: #a7ffeb !important; }
590	+ .ccw_plugin .teal.accent-2 {
591	+ background-color: #64ffda !important; }
592	+ .ccw_plugin .teal-text.text-accent-2 {
593	+ color: #64ffda !important; }
594	+ .ccw_plugin .teal.accent-3 {
595	+ background-color: #1de9b6 !important; }
596	+ .ccw_plugin .teal-text.text-accent-3 {
597	+ color: #1de9b6 !important; }
598	+ .ccw_plugin .teal.accent-4 {
599	+ background-color: #00bfa5 !important; }
600	+ .ccw_plugin .teal-text.text-accent-4 {
601	+ color: #00bfa5 !important; }
602	+ .ccw_plugin .green {
603	+ background-color: #4CAF50 !important; }
604	+ .ccw_plugin .green-text {
605	+ color: #4CAF50 !important; }
606	+ .ccw_plugin .green.lighten-5 {
607	+ background-color: #E8F5E9 !important; }
608	+ .ccw_plugin .green-text.text-lighten-5 {
609	+ color: #E8F5E9 !important; }
610	+ .ccw_plugin .green.lighten-4 {
611	+ background-color: #C8E6C9 !important; }
612	+ .ccw_plugin .green-text.text-lighten-4 {
613	+ color: #C8E6C9 !important; }
614	+ .ccw_plugin .green.lighten-3 {
615	+ background-color: #A5D6A7 !important; }
616	+ .ccw_plugin .green-text.text-lighten-3 {
617	+ color: #A5D6A7 !important; }
618	+ .ccw_plugin .green.lighten-2 {
619	+ background-color: #81C784 !important; }
620	+ .ccw_plugin .green-text.text-lighten-2 {
621	+ color: #81C784 !important; }
622	+ .ccw_plugin .green.lighten-1 {
623	+ background-color: #66BB6A !important; }
624	+ .ccw_plugin .green-text.text-lighten-1 {
625	+ color: #66BB6A !important; }
626	+ .ccw_plugin .green.darken-1 {
627	+ background-color: #43A047 !important; }
628	+ .ccw_plugin .green-text.text-darken-1 {
629	+ color: #43A047 !important; }
630	+ .ccw_plugin .green.darken-2 {
631	+ background-color: #388E3C !important; }
632	+ .ccw_plugin .green-text.text-darken-2 {
633	+ color: #388E3C !important; }
634	+ .ccw_plugin .green.darken-3 {
635	+ background-color: #2E7D32 !important; }
636	+ .ccw_plugin .green-text.text-darken-3 {
637	+ color: #2E7D32 !important; }
638	+ .ccw_plugin .green.darken-4 {
639	+ background-color: #1B5E20 !important; }
640	+ .ccw_plugin .green-text.text-darken-4 {
641	+ color: #1B5E20 !important; }
642	+ .ccw_plugin .green.accent-1 {
643	+ background-color: #B9F6CA !important; }
644	+ .ccw_plugin .green-text.text-accent-1 {
645	+ color: #B9F6CA !important; }
646	+ .ccw_plugin .green.accent-2 {
647	+ background-color: #69F0AE !important; }
648	+ .ccw_plugin .green-text.text-accent-2 {
649	+ color: #69F0AE !important; }
650	+ .ccw_plugin .green.accent-3 {
651	+ background-color: #00E676 !important; }
652	+ .ccw_plugin .green-text.text-accent-3 {
653	+ color: #00E676 !important; }
654	+ .ccw_plugin .green.accent-4 {
655	+ background-color: #00C853 !important; }
656	+ .ccw_plugin .green-text.text-accent-4 {
657	+ color: #00C853 !important; }
658	+ .ccw_plugin .light-green {
659	+ background-color: #8bc34a !important; }
660	+ .ccw_plugin .light-green-text {
661	+ color: #8bc34a !important; }
662	+ .ccw_plugin .light-green.lighten-5 {
663	+ background-color: #f1f8e9 !important; }
664	+ .ccw_plugin .light-green-text.text-lighten-5 {
665	+ color: #f1f8e9 !important; }
666	+ .ccw_plugin .light-green.lighten-4 {
667	+ background-color: #dcedc8 !important; }
668	+ .ccw_plugin .light-green-text.text-lighten-4 {
669	+ color: #dcedc8 !important; }
670	+ .ccw_plugin .light-green.lighten-3 {
671	+ background-color: #c5e1a5 !important; }
672	+ .ccw_plugin .light-green-text.text-lighten-3 {
673	+ color: #c5e1a5 !important; }
674	+ .ccw_plugin .light-green.lighten-2 {
675	+ background-color: #aed581 !important; }
676	+ .ccw_plugin .light-green-text.text-lighten-2 {
677	+ color: #aed581 !important; }
678	+ .ccw_plugin .light-green.lighten-1 {
679	+ background-color: #9ccc65 !important; }
680	+ .ccw_plugin .light-green-text.text-lighten-1 {
681	+ color: #9ccc65 !important; }
682	+ .ccw_plugin .light-green.darken-1 {
683	+ background-color: #7cb342 !important; }
684	+ .ccw_plugin .light-green-text.text-darken-1 {
685	+ color: #7cb342 !important; }
686	+ .ccw_plugin .light-green.darken-2 {
687	+ background-color: #689f38 !important; }
688	+ .ccw_plugin .light-green-text.text-darken-2 {
689	+ color: #689f38 !important; }
690	+ .ccw_plugin .light-green.darken-3 {
691	+ background-color: #558b2f !important; }
692	+ .ccw_plugin .light-green-text.text-darken-3 {
693	+ color: #558b2f !important; }
694	+ .ccw_plugin .light-green.darken-4 {
695	+ background-color: #33691e !important; }
696	+ .ccw_plugin .light-green-text.text-darken-4 {
697	+ color: #33691e !important; }
698	+ .ccw_plugin .light-green.accent-1 {
699	+ background-color: #ccff90 !important; }
700	+ .ccw_plugin .light-green-text.text-accent-1 {
701	+ color: #ccff90 !important; }
702	+ .ccw_plugin .light-green.accent-2 {
703	+ background-color: #b2ff59 !important; }
704	+ .ccw_plugin .light-green-text.text-accent-2 {
705	+ color: #b2ff59 !important; }
706	+ .ccw_plugin .light-green.accent-3 {
707	+ background-color: #76ff03 !important; }
708	+ .ccw_plugin .light-green-text.text-accent-3 {
709	+ color: #76ff03 !important; }
710	+ .ccw_plugin .light-green.accent-4 {
711	+ background-color: #64dd17 !important; }
712	+ .ccw_plugin .light-green-text.text-accent-4 {
713	+ color: #64dd17 !important; }
714	+ .ccw_plugin .lime {
715	+ background-color: #cddc39 !important; }
716	+ .ccw_plugin .lime-text {
717	+ color: #cddc39 !important; }
718	+ .ccw_plugin .lime.lighten-5 {
719	+ background-color: #f9fbe7 !important; }
720	+ .ccw_plugin .lime-text.text-lighten-5 {
721	+ color: #f9fbe7 !important; }
722	+ .ccw_plugin .lime.lighten-4 {
723	+ background-color: #f0f4c3 !important; }
724	+ .ccw_plugin .lime-text.text-lighten-4 {
725	+ color: #f0f4c3 !important; }
726	+ .ccw_plugin .lime.lighten-3 {
727	+ background-color: #e6ee9c !important; }
728	+ .ccw_plugin .lime-text.text-lighten-3 {
729	+ color: #e6ee9c !important; }
730	+ .ccw_plugin .lime.lighten-2 {
731	+ background-color: #dce775 !important; }
732	+ .ccw_plugin .lime-text.text-lighten-2 {
733	+ color: #dce775 !important; }
734	+ .ccw_plugin .lime.lighten-1 {
735	+ background-color: #d4e157 !important; }
736	+ .ccw_plugin .lime-text.text-lighten-1 {
737	+ color: #d4e157 !important; }
738	+ .ccw_plugin .lime.darken-1 {
739	+ background-color: #c0ca33 !important; }
740	+ .ccw_plugin .lime-text.text-darken-1 {
741	+ color: #c0ca33 !important; }
742	+ .ccw_plugin .lime.darken-2 {
743	+ background-color: #afb42b !important; }
744	+ .ccw_plugin .lime-text.text-darken-2 {
745	+ color: #afb42b !important; }
746	+ .ccw_plugin .lime.darken-3 {
747	+ background-color: #9e9d24 !important; }
748	+ .ccw_plugin .lime-text.text-darken-3 {
749	+ color: #9e9d24 !important; }
750	+ .ccw_plugin .lime.darken-4 {
751	+ background-color: #827717 !important; }
752	+ .ccw_plugin .lime-text.text-darken-4 {
753	+ color: #827717 !important; }
754	+ .ccw_plugin .lime.accent-1 {
755	+ background-color: #f4ff81 !important; }
756	+ .ccw_plugin .lime-text.text-accent-1 {
757	+ color: #f4ff81 !important; }
758	+ .ccw_plugin .lime.accent-2 {
759	+ background-color: #eeff41 !important; }
760	+ .ccw_plugin .lime-text.text-accent-2 {
761	+ color: #eeff41 !important; }
762	+ .ccw_plugin .lime.accent-3 {
763	+ background-color: #c6ff00 !important; }
764	+ .ccw_plugin .lime-text.text-accent-3 {
765	+ color: #c6ff00 !important; }
766	+ .ccw_plugin .lime.accent-4 {
767	+ background-color: #aeea00 !important; }
768	+ .ccw_plugin .lime-text.text-accent-4 {
769	+ color: #aeea00 !important; }
770	+ .ccw_plugin .yellow {
771	+ background-color: #ffeb3b !important; }
772	+ .ccw_plugin .yellow-text {
773	+ color: #ffeb3b !important; }
774	+ .ccw_plugin .yellow.lighten-5 {
775	+ background-color: #fffde7 !important; }
776	+ .ccw_plugin .yellow-text.text-lighten-5 {
777	+ color: #fffde7 !important; }
778	+ .ccw_plugin .yellow.lighten-4 {
779	+ background-color: #fff9c4 !important; }
780	+ .ccw_plugin .yellow-text.text-lighten-4 {
781	+ color: #fff9c4 !important; }
782	+ .ccw_plugin .yellow.lighten-3 {
783	+ background-color: #fff59d !important; }
784	+ .ccw_plugin .yellow-text.text-lighten-3 {
785	+ color: #fff59d !important; }
786	+ .ccw_plugin .yellow.lighten-2 {
787	+ background-color: #fff176 !important; }
788	+ .ccw_plugin .yellow-text.text-lighten-2 {
789	+ color: #fff176 !important; }
790	+ .ccw_plugin .yellow.lighten-1 {
791	+ background-color: #ffee58 !important; }
792	+ .ccw_plugin .yellow-text.text-lighten-1 {
793	+ color: #ffee58 !important; }
794	+ .ccw_plugin .yellow.darken-1 {
795	+ background-color: #fdd835 !important; }
796	+ .ccw_plugin .yellow-text.text-darken-1 {
797	+ color: #fdd835 !important; }
798	+ .ccw_plugin .yellow.darken-2 {
799	+ background-color: #fbc02d !important; }
800	+ .ccw_plugin .yellow-text.text-darken-2 {
801	+ color: #fbc02d !important; }
802	+ .ccw_plugin .yellow.darken-3 {
803	+ background-color: #f9a825 !important; }
804	+ .ccw_plugin .yellow-text.text-darken-3 {
805	+ color: #f9a825 !important; }
806	+ .ccw_plugin .yellow.darken-4 {
807	+ background-color: #f57f17 !important; }
808	+ .ccw_plugin .yellow-text.text-darken-4 {
809	+ color: #f57f17 !important; }
810	+ .ccw_plugin .yellow.accent-1 {
811	+ background-color: #ffff8d !important; }
812	+ .ccw_plugin .yellow-text.text-accent-1 {
813	+ color: #ffff8d !important; }
814	+ .ccw_plugin .yellow.accent-2 {
815	+ background-color: #ffff00 !important; }
816	+ .ccw_plugin .yellow-text.text-accent-2 {
817	+ color: #ffff00 !important; }
818	+ .ccw_plugin .yellow.accent-3 {
819	+ background-color: #ffea00 !important; }
820	+ .ccw_plugin .yellow-text.text-accent-3 {
821	+ color: #ffea00 !important; }
822	+ .ccw_plugin .yellow.accent-4 {
823	+ background-color: #ffd600 !important; }
824	+ .ccw_plugin .yellow-text.text-accent-4 {
825	+ color: #ffd600 !important; }
826	+ .ccw_plugin .amber {
827	+ background-color: #ffc107 !important; }
828	+ .ccw_plugin .amber-text {
829	+ color: #ffc107 !important; }
830	+ .ccw_plugin .amber.lighten-5 {
831	+ background-color: #fff8e1 !important; }
832	+ .ccw_plugin .amber-text.text-lighten-5 {
833	+ color: #fff8e1 !important; }
834	+ .ccw_plugin .amber.lighten-4 {
835	+ background-color: #ffecb3 !important; }
836	+ .ccw_plugin .amber-text.text-lighten-4 {
837	+ color: #ffecb3 !important; }
838	+ .ccw_plugin .amber.lighten-3 {
839	+ background-color: #ffe082 !important; }
840	+ .ccw_plugin .amber-text.text-lighten-3 {
841	+ color: #ffe082 !important; }
842	+ .ccw_plugin .amber.lighten-2 {
843	+ background-color: #ffd54f !important; }
844	+ .ccw_plugin .amber-text.text-lighten-2 {
845	+ color: #ffd54f !important; }
846	+ .ccw_plugin .amber.lighten-1 {
847	+ background-color: #ffca28 !important; }
848	+ .ccw_plugin .amber-text.text-lighten-1 {
849	+ color: #ffca28 !important; }
850	+ .ccw_plugin .amber.darken-1 {
851	+ background-color: #ffb300 !important; }
852	+ .ccw_plugin .amber-text.text-darken-1 {
853	+ color: #ffb300 !important; }
854	+ .ccw_plugin .amber.darken-2 {
855	+ background-color: #ffa000 !important; }
856	+ .ccw_plugin .amber-text.text-darken-2 {
857	+ color: #ffa000 !important; }
858	+ .ccw_plugin .amber.darken-3 {
859	+ background-color: #ff8f00 !important; }
860	+ .ccw_plugin .amber-text.text-darken-3 {
861	+ color: #ff8f00 !important; }
862	+ .ccw_plugin .amber.darken-4 {
863	+ background-color: #ff6f00 !important; }
864	+ .ccw_plugin .amber-text.text-darken-4 {
865	+ color: #ff6f00 !important; }
866	+ .ccw_plugin .amber.accent-1 {
867	+ background-color: #ffe57f !important; }
868	+ .ccw_plugin .amber-text.text-accent-1 {
869	+ color: #ffe57f !important; }
870	+ .ccw_plugin .amber.accent-2 {
871	+ background-color: #ffd740 !important; }
872	+ .ccw_plugin .amber-text.text-accent-2 {
873	+ color: #ffd740 !important; }
874	+ .ccw_plugin .amber.accent-3 {
875	+ background-color: #ffc400 !important; }
876	+ .ccw_plugin .amber-text.text-accent-3 {
877	+ color: #ffc400 !important; }
878	+ .ccw_plugin .amber.accent-4 {
879	+ background-color: #ffab00 !important; }
880	+ .ccw_plugin .amber-text.text-accent-4 {
881	+ color: #ffab00 !important; }
882	+ .ccw_plugin .orange {
883	+ background-color: #ff9800 !important; }
884	+ .ccw_plugin .orange-text {
885	+ color: #ff9800 !important; }
886	+ .ccw_plugin .orange.lighten-5 {
887	+ background-color: #fff3e0 !important; }
888	+ .ccw_plugin .orange-text.text-lighten-5 {
889	+ color: #fff3e0 !important; }
890	+ .ccw_plugin .orange.lighten-4 {
891	+ background-color: #ffe0b2 !important; }
892	+ .ccw_plugin .orange-text.text-lighten-4 {
893	+ color: #ffe0b2 !important; }
894	+ .ccw_plugin .orange.lighten-3 {
895	+ background-color: #ffcc80 !important; }
896	+ .ccw_plugin .orange-text.text-lighten-3 {
897	+ color: #ffcc80 !important; }
898	+ .ccw_plugin .orange.lighten-2 {
899	+ background-color: #ffb74d !important; }
900	+ .ccw_plugin .orange-text.text-lighten-2 {
901	+ color: #ffb74d !important; }
902	+ .ccw_plugin .orange.lighten-1 {
903	+ background-color: #ffa726 !important; }
904	+ .ccw_plugin .orange-text.text-lighten-1 {
905	+ color: #ffa726 !important; }
906	+ .ccw_plugin .orange.darken-1 {
907	+ background-color: #fb8c00 !important; }
908	+ .ccw_plugin .orange-text.text-darken-1 {
909	+ color: #fb8c00 !important; }
910	+ .ccw_plugin .orange.darken-2 {
911	+ background-color: #f57c00 !important; }
912	+ .ccw_plugin .orange-text.text-darken-2 {
913	+ color: #f57c00 !important; }
914	+ .ccw_plugin .orange.darken-3 {
915	+ background-color: #ef6c00 !important; }
916	+ .ccw_plugin .orange-text.text-darken-3 {
917	+ color: #ef6c00 !important; }
918	+ .ccw_plugin .orange.darken-4 {
919	+ background-color: #e65100 !important; }
920	+ .ccw_plugin .orange-text.text-darken-4 {
921	+ color: #e65100 !important; }
922	+ .ccw_plugin .orange.accent-1 {
923	+ background-color: #ffd180 !important; }
924	+ .ccw_plugin .orange-text.text-accent-1 {
925	+ color: #ffd180 !important; }
926	+ .ccw_plugin .orange.accent-2 {
927	+ background-color: #ffab40 !important; }
928	+ .ccw_plugin .orange-text.text-accent-2 {
929	+ color: #ffab40 !important; }
930	+ .ccw_plugin .orange.accent-3 {
931	+ background-color: #ff9100 !important; }
932	+ .ccw_plugin .orange-text.text-accent-3 {
933	+ color: #ff9100 !important; }
934	+ .ccw_plugin .orange.accent-4 {
935	+ background-color: #ff6d00 !important; }
936	+ .ccw_plugin .orange-text.text-accent-4 {
937	+ color: #ff6d00 !important; }
938	+ .ccw_plugin .deep-orange {
939	+ background-color: #ff5722 !important; }
940	+ .ccw_plugin .deep-orange-text {
941	+ color: #ff5722 !important; }
942	+ .ccw_plugin .deep-orange.lighten-5 {
943	+ background-color: #fbe9e7 !important; }
944	+ .ccw_plugin .deep-orange-text.text-lighten-5 {
945	+ color: #fbe9e7 !important; }
946	+ .ccw_plugin .deep-orange.lighten-4 {
947	+ background-color: #ffccbc !important; }
948	+ .ccw_plugin .deep-orange-text.text-lighten-4 {
949	+ color: #ffccbc !important; }
950	+ .ccw_plugin .deep-orange.lighten-3 {
951	+ background-color: #ffab91 !important; }
952	+ .ccw_plugin .deep-orange-text.text-lighten-3 {
953	+ color: #ffab91 !important; }
954	+ .ccw_plugin .deep-orange.lighten-2 {
955	+ background-color: #ff8a65 !important; }
956	+ .ccw_plugin .deep-orange-text.text-lighten-2 {
957	+ color: #ff8a65 !important; }
958	+ .ccw_plugin .deep-orange.lighten-1 {
959	+ background-color: #ff7043 !important; }
960	+ .ccw_plugin .deep-orange-text.text-lighten-1 {
961	+ color: #ff7043 !important; }
962	+ .ccw_plugin .deep-orange.darken-1 {
963	+ background-color: #f4511e !important; }
964	+ .ccw_plugin .deep-orange-text.text-darken-1 {
965	+ color: #f4511e !important; }
966	+ .ccw_plugin .deep-orange.darken-2 {
967	+ background-color: #e64a19 !important; }
968	+ .ccw_plugin .deep-orange-text.text-darken-2 {
969	+ color: #e64a19 !important; }
970	+ .ccw_plugin .deep-orange.darken-3 {
971	+ background-color: #d84315 !important; }
972	+ .ccw_plugin .deep-orange-text.text-darken-3 {
973	+ color: #d84315 !important; }
974	+ .ccw_plugin .deep-orange.darken-4 {
975	+ background-color: #bf360c !important; }
976	+ .ccw_plugin .deep-orange-text.text-darken-4 {
977	+ color: #bf360c !important; }
978	+ .ccw_plugin .deep-orange.accent-1 {
979	+ background-color: #ff9e80 !important; }
980	+ .ccw_plugin .deep-orange-text.text-accent-1 {
981	+ color: #ff9e80 !important; }
982	+ .ccw_plugin .deep-orange.accent-2 {
983	+ background-color: #ff6e40 !important; }
984	+ .ccw_plugin .deep-orange-text.text-accent-2 {
985	+ color: #ff6e40 !important; }
986	+ .ccw_plugin .deep-orange.accent-3 {
987	+ background-color: #ff3d00 !important; }
988	+ .ccw_plugin .deep-orange-text.text-accent-3 {
989	+ color: #ff3d00 !important; }
990	+ .ccw_plugin .deep-orange.accent-4 {
991	+ background-color: #dd2c00 !important; }
992	+ .ccw_plugin .deep-orange-text.text-accent-4 {
993	+ color: #dd2c00 !important; }
994	+ .ccw_plugin .brown {
995	+ background-color: #795548 !important; }
996	+ .ccw_plugin .brown-text {
997	+ color: #795548 !important; }
998	+ .ccw_plugin .brown.lighten-5 {
999	+ background-color: #efebe9 !important; }
1000	+ .ccw_plugin .brown-text.text-lighten-5 {
1001	+ color: #efebe9 !important; }
1002	+ .ccw_plugin .brown.lighten-4 {
1003	+ background-color: #d7ccc8 !important; }
1004	+ .ccw_plugin .brown-text.text-lighten-4 {
1005	+ color: #d7ccc8 !important; }
1006	+ .ccw_plugin .brown.lighten-3 {
1007	+ background-color: #bcaaa4 !important; }
1008	+ .ccw_plugin .brown-text.text-lighten-3 {
1009	+ color: #bcaaa4 !important; }
1010	+ .ccw_plugin .brown.lighten-2 {
1011	+ background-color: #a1887f !important; }
1012	+ .ccw_plugin .brown-text.text-lighten-2 {
1013	+ color: #a1887f !important; }
1014	+ .ccw_plugin .brown.lighten-1 {
1015	+ background-color: #8d6e63 !important; }
1016	+ .ccw_plugin .brown-text.text-lighten-1 {
1017	+ color: #8d6e63 !important; }
1018	+ .ccw_plugin .brown.darken-1 {
1019	+ background-color: #6d4c41 !important; }
1020	+ .ccw_plugin .brown-text.text-darken-1 {
1021	+ color: #6d4c41 !important; }
1022	+ .ccw_plugin .brown.darken-2 {
1023	+ background-color: #5d4037 !important; }
1024	+ .ccw_plugin .brown-text.text-darken-2 {
1025	+ color: #5d4037 !important; }
1026	+ .ccw_plugin .brown.darken-3 {
1027	+ background-color: #4e342e !important; }
1028	+ .ccw_plugin .brown-text.text-darken-3 {
1029	+ color: #4e342e !important; }
1030	+ .ccw_plugin .brown.darken-4 {
1031	+ background-color: #3e2723 !important; }
1032	+ .ccw_plugin .brown-text.text-darken-4 {
1033	+ color: #3e2723 !important; }
1034	+ .ccw_plugin .blue-grey {
1035	+ background-color: #607d8b !important; }
1036	+ .ccw_plugin .blue-grey-text {
1037	+ color: #607d8b !important; }
1038	+ .ccw_plugin .blue-grey.lighten-5 {
1039	+ background-color: #eceff1 !important; }
1040	+ .ccw_plugin .blue-grey-text.text-lighten-5 {
1041	+ color: #eceff1 !important; }
1042	+ .ccw_plugin .blue-grey.lighten-4 {
1043	+ background-color: #cfd8dc !important; }
1044	+ .ccw_plugin .blue-grey-text.text-lighten-4 {
1045	+ color: #cfd8dc !important; }
1046	+ .ccw_plugin .blue-grey.lighten-3 {
1047	+ background-color: #b0bec5 !important; }
1048	+ .ccw_plugin .blue-grey-text.text-lighten-3 {
1049	+ color: #b0bec5 !important; }
1050	+ .ccw_plugin .blue-grey.lighten-2 {
1051	+ background-color: #90a4ae !important; }
1052	+ .ccw_plugin .blue-grey-text.text-lighten-2 {
1053	+ color: #90a4ae !important; }
1054	+ .ccw_plugin .blue-grey.lighten-1 {
1055	+ background-color: #78909c !important; }
1056	+ .ccw_plugin .blue-grey-text.text-lighten-1 {
1057	+ color: #78909c !important; }
1058	+ .ccw_plugin .blue-grey.darken-1 {
1059	+ background-color: #546e7a !important; }
1060	+ .ccw_plugin .blue-grey-text.text-darken-1 {
1061	+ color: #546e7a !important; }
1062	+ .ccw_plugin .blue-grey.darken-2 {
1063	+ background-color: #455a64 !important; }
1064	+ .ccw_plugin .blue-grey-text.text-darken-2 {
1065	+ color: #455a64 !important; }
1066	+ .ccw_plugin .blue-grey.darken-3 {
1067	+ background-color: #37474f !important; }
1068	+ .ccw_plugin .blue-grey-text.text-darken-3 {
1069	+ color: #37474f !important; }
1070	+ .ccw_plugin .blue-grey.darken-4 {
1071	+ background-color: #263238 !important; }
1072	+ .ccw_plugin .blue-grey-text.text-darken-4 {
1073	+ color: #263238 !important; }
1074	+ .ccw_plugin .grey {
1075	+ background-color: #9e9e9e !important; }
1076	+ .ccw_plugin .grey-text {
1077	+ color: #9e9e9e !important; }
1078	+ .ccw_plugin .grey.lighten-5 {
1079	+ background-color: #fafafa !important; }
1080	+ .ccw_plugin .grey-text.text-lighten-5 {
1081	+ color: #fafafa !important; }
1082	+ .ccw_plugin .grey.lighten-4 {
1083	+ background-color: #f5f5f5 !important; }
1084	+ .ccw_plugin .grey-text.text-lighten-4 {
1085	+ color: #f5f5f5 !important; }
1086	+ .ccw_plugin .grey.lighten-3 {
1087	+ background-color: #eeeeee !important; }
1088	+ .ccw_plugin .grey-text.text-lighten-3 {
1089	+ color: #eeeeee !important; }
1090	+ .ccw_plugin .grey.lighten-2 {
1091	+ background-color: #e0e0e0 !important; }
1092	+ .ccw_plugin .grey-text.text-lighten-2 {
1093	+ color: #e0e0e0 !important; }
1094	+ .ccw_plugin .grey.lighten-1 {
1095	+ background-color: #bdbdbd !important; }
1096	+ .ccw_plugin .grey-text.text-lighten-1 {
1097	+ color: #bdbdbd !important; }
1098	+ .ccw_plugin .grey.darken-1 {
1099	+ background-color: #757575 !important; }
1100	+ .ccw_plugin .grey-text.text-darken-1 {
1101	+ color: #757575 !important; }
1102	+ .ccw_plugin .grey.darken-2 {
1103	+ background-color: #616161 !important; }
1104	+ .ccw_plugin .grey-text.text-darken-2 {
1105	+ color: #616161 !important; }
1106	+ .ccw_plugin .grey.darken-3 {
1107	+ background-color: #424242 !important; }
1108	+ .ccw_plugin .grey-text.text-darken-3 {
1109	+ color: #424242 !important; }
1110	+ .ccw_plugin .grey.darken-4 {
1111	+ background-color: #212121 !important; }
1112	+ .ccw_plugin .grey-text.text-darken-4 {
1113	+ color: #212121 !important; }
1114	+ .ccw_plugin .black {
1115	+ background-color: #000000 !important; }
1116	+ .ccw_plugin .black-text {
1117	+ color: #000000 !important; }
1118	+ .ccw_plugin .white {
1119	+ background-color: #FFFFFF !important; }
1120	+ .ccw_plugin .white-text {
1121	+ color: #FFFFFF !important; }
1122	+ .ccw_plugin .transparent {
1123	+ background-color: transparent !important; }
1124	+ .ccw_plugin .transparent-text {
1125	+ color: transparent !important; }
1126	+ .ccw_plugin html {
1127	+ font-family: sans-serif;
1128	+ /* 1 */
1129	+ -ms-text-size-adjust: 100%;
1130	+ /* 2 */
1131	+ -webkit-text-size-adjust: 100%;
1132	+ /* 2 */ }
1133	+ .ccw_plugin body {
1134	+ margin: 0; }
1135	+ .ccw_plugin article,
1136	+ .ccw_plugin aside,
1137	+ .ccw_plugin details,
1138	+ .ccw_plugin figcaption,
1139	+ .ccw_plugin figure,
1140	+ .ccw_plugin footer,
1141	+ .ccw_plugin header,
1142	+ .ccw_plugin hgroup,
1143	+ .ccw_plugin main,
1144	+ .ccw_plugin menu,
1145	+ .ccw_plugin nav,
1146	+ .ccw_plugin section,
1147	+ .ccw_plugin summary {
1148	+ display: block; }
1149	+ .ccw_plugin audio,
1150	+ .ccw_plugin canvas,
1151	+ .ccw_plugin progress,
1152	+ .ccw_plugin video {
1153	+ display: inline-block;
1154	+ /* 1 */
1155	+ vertical-align: baseline;
1156	+ /* 2 */ }
1157	+ .ccw_plugin audio:not([controls]) {
1158	+ display: none;
1159	+ height: 0; }
1160	+ .ccw_plugin [hidden],
1161	+ .ccw_plugin template {
1162	+ display: none; }
1163	+ .ccw_plugin a {
1164	+ background-color: transparent; }
1165	+ .ccw_plugin a:active,
1166	+ .ccw_plugin a:hover {
1167	+ outline: 0; }
1168	+ .ccw_plugin abbr[title] {
1169	+ border-bottom: 1px dotted; }
1170	+ .ccw_plugin b,
1171	+ .ccw_plugin strong {
1172	+ font-weight: bold; }
1173	+ .ccw_plugin dfn {
1174	+ font-style: italic; }
1175	+ .ccw_plugin h1 {
1176	+ font-size: 2em;
1177	+ margin: 0.67em 0; }
1178	+ .ccw_plugin mark {
1179	+ background: #ff0;
1180	+ color: #000; }
1181	+ .ccw_plugin small {
1182	+ font-size: 80%; }
1183	+ .ccw_plugin sub,
1184	+ .ccw_plugin sup {
1185	+ font-size: 75%;
1186	+ line-height: 0;
1187	+ position: relative;
1188	+ vertical-align: baseline; }
1189	+ .ccw_plugin sup {
1190	+ top: -0.5em; }
1191	+ .ccw_plugin sub {
1192	+ bottom: -0.25em; }
1193	+ .ccw_plugin img {
1194	+ border: 0; }
1195	+ .ccw_plugin svg:not(:root) {
1196	+ overflow: hidden; }
1197	+ .ccw_plugin figure {
1198	+ margin: 1em 40px; }
1199	+ .ccw_plugin hr {
1200	+ box-sizing: content-box;
1201	+ height: 0; }
1202	+ .ccw_plugin pre {
1203	+ overflow: auto; }
1204	+ .ccw_plugin code,
1205	+ .ccw_plugin kbd,
1206	+ .ccw_plugin pre,
1207	+ .ccw_plugin samp {
1208	+ font-family: monospace, monospace;
1209	+ font-size: 1em; }
1210	+ .ccw_plugin button,
1211	+ .ccw_plugin input,
1212	+ .ccw_plugin optgroup,
1213	+ .ccw_plugin select,
1214	+ .ccw_plugin textarea {
1215	+ color: inherit;
1216	+ /* 1 */
1217	+ font: inherit;
1218	+ /* 2 */
1219	+ margin: 0;
1220	+ /* 3 */ }
1221	+ .ccw_plugin button {
1222	+ overflow: visible; }
1223	+ .ccw_plugin button,
1224	+ .ccw_plugin select {
1225	+ text-transform: none; }
1226	+ .ccw_plugin button,
1227	+ .ccw_plugin html input[type="button"],
1228	+ .ccw_plugin input[type="reset"],
1229	+ .ccw_plugin input[type="submit"] {
1230	+ -webkit-appearance: button;
1231	+ /* 2 */
1232	+ cursor: pointer;
1233	+ /* 3 */ }
1234	+ .ccw_plugin button[disabled],
1235	+ .ccw_plugin html input[disabled] {
1236	+ cursor: default; }
1237	+ .ccw_plugin button::-moz-focus-inner,
1238	+ .ccw_plugin input::-moz-focus-inner {
1239	+ border: 0;
1240	+ padding: 0; }
1241	+ .ccw_plugin input {
1242	+ line-height: normal; }
1243	+ .ccw_plugin input[type="checkbox"],
1244	+ .ccw_plugin input[type="radio"] {
1245	+ box-sizing: border-box;
1246	+ /* 1 */
1247	+ padding: 0;
1248	+ /* 2 */ }
1249	+ .ccw_plugin input[type="number"]::-webkit-inner-spin-button,
1250	+ .ccw_plugin input[type="number"]::-webkit-outer-spin-button {
1251	+ height: auto; }
1252	+ .ccw_plugin input[type="search"] {
1253	+ -webkit-appearance: textfield;
1254	+ /* 1 */
1255	+ box-sizing: content-box;
1256	+ /* 2 */ }
1257	+ .ccw_plugin input[type="search"]::-webkit-search-cancel-button,
1258	+ .ccw_plugin input[type="search"]::-webkit-search-decoration {
1259	+ -webkit-appearance: none; }
1260	+ .ccw_plugin fieldset {
1261	+ border: 1px solid #c0c0c0;
1262	+ margin: 0 2px;
1263	+ padding: 0.35em 0.625em 0.75em; }
1264	+ .ccw_plugin legend {
1265	+ border: 0;
1266	+ /* 1 */
1267	+ padding: 0;
1268	+ /* 2 */ }
1269	+ .ccw_plugin textarea {
1270	+ overflow: auto; }
1271	+ .ccw_plugin optgroup {
1272	+ font-weight: bold; }
1273	+ .ccw_plugin table {
1274	+ border-collapse: collapse;
1275	+ border-spacing: 0; }
1276	+ .ccw_plugin td,
1277	+ .ccw_plugin th {
1278	+ padding: 0; }
1279	+ .ccw_plugin html {
1280	+ box-sizing: border-box; }
1281	+ .ccw_plugin , .ccw_plugin :before, .ccw_plugin *:after {
1282	+ box-sizing: inherit; }
1283	+ .ccw_plugin ul:not(.browser-default) {
1284	+ padding-left: 0;
1285	+ list-style-type: none; }
1286	+ .ccw_plugin ul:not(.browser-default) > li {
1287	+ list-style-type: none; }
1288	+ .ccw_plugin a {
1289	+ color: #039be5;
1290	+ text-decoration: none;
1291	+ -webkit-tap-highlight-color: transparent; }
1292	+ .ccw_plugin .valign-wrapper {
1293	+ display: flex;
1294	+ align-items: center; }
1295	+ .ccw_plugin .clearfix {
1296	+ clear: both; }
1297	+ .ccw_plugin .z-depth-0 {
1298	+ box-shadow: none !important; }
1299	+ .ccw_plugin .z-depth-1, .ccw_plugin .btn, .ccw_plugin .btn-large, .ccw_plugin .btn-floating, .ccw_plugin .dropdown-content, .ccw_plugin .collapsible {
1300	+ box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); }
1301	+ .ccw_plugin .z-depth-1-half, .ccw_plugin .btn:hover, .ccw_plugin .btn-large:hover, .ccw_plugin .btn-floating:hover {
1302	+ box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); }
1303	+ .ccw_plugin .z-depth-2 {
1304	+ box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); }
1305	+ .ccw_plugin .z-depth-3 {
1306	+ box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); }
1307	+ .ccw_plugin .z-depth-4 {
1308	+ box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); }
1309	+ .ccw_plugin .z-depth-5 {
1310	+ box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); }
1311	+ .ccw_plugin .hoverable {
1312	+ transition: box-shadow .25s; }
1313	+ .ccw_plugin .hoverable:hover {
1314	+ box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); }
1315	+ .ccw_plugin .divider {
1316	+ height: 1px;
1317	+ overflow: hidden;
1318	+ background-color: #e0e0e0; }
1319	+ .ccw_plugin blockquote {
1320	+ margin: 20px 0;
1321	+ padding-left: 1.5rem;
1322	+ border-left: 5px solid #ee6e73; }
1323	+ .ccw_plugin i {
1324	+ line-height: inherit; }
1325	+ .ccw_plugin i.left {
1326	+ float: left;
1327	+ margin-right: 15px; }
1328	+ .ccw_plugin i.right {
1329	+ float: right;
1330	+ margin-left: 15px; }
1331	+ .ccw_plugin i.tiny {
1332	+ font-size: 1rem; }
1333	+ .ccw_plugin i.small {
1334	+ font-size: 2rem; }
1335	+ .ccw_plugin i.medium {
1336	+ font-size: 4rem; }
1337	+ .ccw_plugin i.large {
1338	+ font-size: 6rem; }
1339	+ .ccw_plugin img.responsive-img,
1340	+ .ccw_plugin video.responsive-video {
1341	+ max-width: 100%;
1342	+ height: auto; }
1343	+ .ccw_plugin .pagination li {
1344	+ display: inline-block;
1345	+ border-radius: 2px;
1346	+ text-align: center;
1347	+ vertical-align: top;
1348	+ height: 30px; }
1349	+ .ccw_plugin .pagination li a {
1350	+ color: #444;
1351	+ display: inline-block;
1352	+ font-size: 1.2rem;
1353	+ padding: 0 10px;
1354	+ line-height: 30px; }
1355	+ .ccw_plugin .pagination li.active a {
1356	+ color: #fff; }
1357	+ .ccw_plugin .pagination li.active {
1358	+ background-color: #ee6e73; }
1359	+ .ccw_plugin .pagination li.disabled a {
1360	+ cursor: default;
1361	+ color: #999; }
1362	+ .ccw_plugin .pagination li i {
1363	+ font-size: 2rem; }
1364	+ .ccw_plugin .pagination li.pages ul li {
1365	+ display: inline-block;
1366	+ float: none; }
1367	+ @media only screen and (max-width: 992px) {
1368	+ .ccw_plugin .pagination {
1369	+ width: 100%; }
1370	+ .ccw_plugin .pagination li.prev,
1371	+ .ccw_plugin .pagination li.next {
1372	+ width: 10%; }
1373	+ .ccw_plugin .pagination li.pages {
1374	+ width: 80%;
1375	+ overflow: hidden;
1376	+ white-space: nowrap; } }
1377	+ .ccw_plugin .breadcrumb {
1378	+ font-size: 18px;
1379	+ color: rgba(255, 255, 255, 0.7); }
1380	+ .ccw_plugin .breadcrumb i,
1381	+ .ccw_plugin .breadcrumb [class^="mdi-"], .ccw_plugin .breadcrumb [class*="mdi-"],
1382	+ .ccw_plugin .breadcrumb i.material-icons {
1383	+ display: inline-block;
1384	+ float: left;
1385	+ font-size: 24px; }
1386	+ .ccw_plugin .breadcrumb:before {
1387	+ content: '\E5CC';
1388	+ color: rgba(255, 255, 255, 0.7);
1389	+ vertical-align: top;
1390	+ display: inline-block;
1391	+ font-family: 'Material Icons';
1392	+ font-weight: normal;
1393	+ font-style: normal;
1394	+ font-size: 25px;
1395	+ margin: 0 10px 0 8px;
1396	+ -webkit-font-smoothing: antialiased; }
1397	+ .ccw_plugin .breadcrumb:first-child:before {
1398	+ display: none; }
1399	+ .ccw_plugin .breadcrumb:last-child {
1400	+ color: #fff; }
1401	+ .ccw_plugin .parallax-container {
1402	+ position: relative;
1403	+ overflow: hidden;
1404	+ height: 500px; }
1405	+ .ccw_plugin .parallax-container .parallax {
1406	+ position: absolute;
1407	+ top: 0;
1408	+ left: 0;
1409	+ right: 0;
1410	+ bottom: 0;
1411	+ z-index: -1; }
1412	+ .ccw_plugin .parallax-container .parallax img {
1413	+ display: none;
1414	+ position: absolute;
1415	+ left: 50%;
1416	+ bottom: 0;
1417	+ min-width: 100%;
1418	+ min-height: 100%;
1419	+ transform: translate3d(0, 0, 0);
1420	+ transform: translateX(-50%); }
1421	+ .ccw_plugin .pin-top, .ccw_plugin .pin-bottom {
1422	+ position: relative; }
1423	+ .ccw_plugin .pinned {
1424	+ position: fixed !important; }
1425	+ .ccw_plugin ul.staggered-list li {
1426	+ opacity: 0; }
1427	+ .ccw_plugin .fade-in {
1428	+ opacity: 0;
1429	+ transform-origin: 0 50%; }
1430	+ @media only screen and (max-width: 600px) {
1431	+ .ccw_plugin .hide-on-small-only, .ccw_plugin .hide-on-small-and-down {
1432	+ display: none !important; } }
1433	+ @media only screen and (max-width: 992px) {
1434	+ .ccw_plugin .hide-on-med-and-down {
1435	+ display: none !important; } }
1436	+ @media only screen and (min-width: 601px) {
1437	+ .ccw_plugin .hide-on-med-and-up {
1438	+ display: none !important; } }
1439	+ @media only screen and (min-width: 600px) and (max-width: 992px) {
1440	+ .ccw_plugin .hide-on-med-only {
1441	+ display: none !important; } }
1442	+ @media only screen and (min-width: 993px) {
1443	+ .ccw_plugin .hide-on-large-only {
1444	+ display: none !important; } }
1445	+ @media only screen and (min-width: 993px) {
1446	+ .ccw_plugin .show-on-large {
1447	+ display: block !important; } }
1448	+ @media only screen and (min-width: 600px) and (max-width: 992px) {
1449	+ .ccw_plugin .show-on-medium {
1450	+ display: block !important; } }
1451	+ @media only screen and (max-width: 600px) {
1452	+ .ccw_plugin .show-on-small {
1453	+ display: block !important; } }
1454	+ @media only screen and (min-width: 601px) {
1455	+ .ccw_plugin .show-on-medium-and-up {
1456	+ display: block !important; } }
1457	+ @media only screen and (max-width: 992px) {
1458	+ .ccw_plugin .show-on-medium-and-down {
1459	+ display: block !important; } }
1460	+ @media only screen and (max-width: 600px) {
1461	+ .ccw_plugin .center-on-small-only {
1462	+ text-align: center; } }
1463	+ .ccw_plugin .page-footer {
1464	+ padding-top: 20px;
1465	+ color: #fff;
1466	+ background-color: #ee6e73; }
1467	+ .ccw_plugin .page-footer .footer-copyright {
1468	+ overflow: hidden;
1469	+ min-height: 50px;
1470	+ display: flex;
1471	+ align-items: center;
1472	+ padding: 10px 0px;
1473	+ color: rgba(255, 255, 255, 0.8);
1474	+ background-color: rgba(51, 51, 51, 0.08); }
1475	+ .ccw_plugin table, .ccw_plugin th, .ccw_plugin td {
1476	+ border: none; }
1477	+ .ccw_plugin table {
1478	+ width: 100%;
1479	+ display: table; }
1480	+ .ccw_plugin table.bordered > thead > tr,
1481	+ .ccw_plugin table.bordered > tbody > tr {
1482	+ border-bottom: 1px solid #d0d0d0; }
1483	+ .ccw_plugin table.striped > tbody > tr:nth-child(odd) {
1484	+ background-color: #f2f2f2; }
1485	+ .ccw_plugin table.striped > tbody > tr > td {
1486	+ border-radius: 0; }
1487	+ .ccw_plugin table.highlight > tbody > tr {
1488	+ transition: background-color .25s ease; }
1489	+ .ccw_plugin table.highlight > tbody > tr:hover {
1490	+ background-color: #f2f2f2; }
1491	+ .ccw_plugin table.centered thead tr th, .ccw_plugin table.centered tbody tr td {
1492	+ text-align: center; }
1493	+ .ccw_plugin thead {
1494	+ border-bottom: 1px solid #d0d0d0; }
1495	+ .ccw_plugin td, .ccw_plugin th {
1496	+ padding: 15px 5px;
1497	+ display: table-cell;
1498	+ text-align: left;
1499	+ vertical-align: middle;
1500	+ border-radius: 2px; }
1501	+ @media only screen and (max-width: 992px) {
1502	+ .ccw_plugin table.responsive-table {
1503	+ width: 100%;
1504	+ border-collapse: collapse;
1505	+ border-spacing: 0;
1506	+ display: block;
1507	+ position: relative;
1508	+ /* sort out borders */ }
1509	+ .ccw_plugin table.responsive-table td:empty:before {
1510	+ content: '\A0'; }
1511	+ .ccw_plugin table.responsive-table th,
1512	+ .ccw_plugin table.responsive-table td {
1513	+ margin: 0;
1514	+ vertical-align: top; }
1515	+ .ccw_plugin table.responsive-table th {
1516	+ text-align: left; }
1517	+ .ccw_plugin table.responsive-table thead {
1518	+ display: block;
1519	+ float: left; }
1520	+ .ccw_plugin table.responsive-table thead tr {
1521	+ display: block;
1522	+ padding: 0 10px 0 0; }
1523	+ .ccw_plugin table.responsive-table thead tr th::before {
1524	+ content: "\A0"; }
1525	+ .ccw_plugin table.responsive-table tbody {
1526	+ display: block;
1527	+ width: auto;
1528	+ position: relative;
1529	+ overflow-x: auto;
1530	+ white-space: nowrap; }
1531	+ .ccw_plugin table.responsive-table tbody tr {
1532	+ display: inline-block;
1533	+ vertical-align: top; }
1534	+ .ccw_plugin table.responsive-table th {
1535	+ display: block;
1536	+ text-align: right; }
1537	+ .ccw_plugin table.responsive-table td {
1538	+ display: block;
1539	+ min-height: 1.25em;
1540	+ text-align: left; }
1541	+ .ccw_plugin table.responsive-table tr {
1542	+ padding: 0 10px; }
1543	+ .ccw_plugin table.responsive-table thead {
1544	+ border: 0;
1545	+ border-right: 1px solid #d0d0d0; }
1546	+ .ccw_plugin table.responsive-table.bordered th {
1547	+ border-bottom: 0;
1548	+ border-left: 0; }
1549	+ .ccw_plugin table.responsive-table.bordered td {
1550	+ border-left: 0;
1551	+ border-right: 0;
1552	+ border-bottom: 0; }
1553	+ .ccw_plugin table.responsive-table.bordered tr {
1554	+ border: 0; }
1555	+ .ccw_plugin table.responsive-table.bordered tbody tr {
1556	+ border-right: 1px solid #d0d0d0; } }
1557	+ .ccw_plugin .collection {
1558	+ margin: 0.5rem 0 1rem 0;
1559	+ border: 1px solid #e0e0e0;
1560	+ border-radius: 2px;
1561	+ overflow: hidden;
1562	+ position: relative; }
1563	+ .ccw_plugin .collection .collection-item {
1564	+ background-color: #fff;
1565	+ line-height: 1.5rem;
1566	+ padding: 10px 20px;
1567	+ margin: 0;
1568	+ border-bottom: 1px solid #e0e0e0; }
1569	+ .ccw_plugin .collection .collection-item.avatar {
1570	+ min-height: 84px;
1571	+ padding-left: 72px;
1572	+ position: relative; }
1573	+ .ccw_plugin .collection .collection-item.avatar:not(.circle-clipper) > .circle,
1574	+ .ccw_plugin .collection .collection-item.avatar :not(.circle-clipper) > .circle {
1575	+ position: absolute;
1576	+ width: 42px;
1577	+ height: 42px;
1578	+ overflow: hidden;
1579	+ left: 15px;
1580	+ display: inline-block;
1581	+ vertical-align: middle; }
1582	+ .ccw_plugin .collection .collection-item.avatar i.circle {
1583	+ font-size: 18px;
1584	+ line-height: 42px;
1585	+ color: #fff;
1586	+ background-color: #999;
1587	+ text-align: center; }
1588	+ .ccw_plugin .collection .collection-item.avatar .title {
1589	+ font-size: 16px; }
1590	+ .ccw_plugin .collection .collection-item.avatar p {
1591	+ margin: 0; }
1592	+ .ccw_plugin .collection .collection-item.avatar .secondary-content {
1593	+ position: absolute;
1594	+ top: 16px;
1595	+ right: 16px; }
1596	+ .ccw_plugin .collection .collection-item:last-child {
1597	+ border-bottom: none; }
1598	+ .ccw_plugin .collection .collection-item.active {
1599	+ background-color: #26a69a;
1600	+ color: #eafaf9; }
1601	+ .ccw_plugin .collection .collection-item.active .secondary-content {
1602	+ color: #fff; }
1603	+ .ccw_plugin .collection a.collection-item {
1604	+ display: block;
1605	+ transition: .25s;
1606	+ color: #26a69a; }
1607	+ .ccw_plugin .collection a.collection-item:not(.active):hover {
1608	+ background-color: #ddd; }
1609	+ .ccw_plugin .collection.with-header .collection-header {
1610	+ background-color: #fff;
1611	+ border-bottom: 1px solid #e0e0e0;
1612	+ padding: 10px 20px; }
1613	+ .ccw_plugin .collection.with-header .collection-item {
1614	+ padding-left: 30px; }
1615	+ .ccw_plugin .collection.with-header .collection-item.avatar {
1616	+ padding-left: 72px; }
1617	+ .ccw_plugin .secondary-content {
1618	+ float: right;
1619	+ color: #26a69a; }
1620	+ .ccw_plugin .collapsible .collection {
1621	+ margin: 0;
1622	+ border: none; }
1623	+ .ccw_plugin .video-container {
1624	+ position: relative;
1625	+ padding-bottom: 56.25%;
1626	+ height: 0;
1627	+ overflow: hidden; }
1628	+ .ccw_plugin .video-container iframe, .ccw_plugin .video-container object, .ccw_plugin .video-container embed {
1629	+ position: absolute;
1630	+ top: 0;
1631	+ left: 0;
1632	+ width: 100%;
1633	+ height: 100%; }
1634	+ .ccw_plugin .progress {
1635	+ position: relative;
1636	+ height: 4px;
1637	+ display: block;
1638	+ width: 100%;
1639	+ background-color: #acece6;
1640	+ border-radius: 2px;
1641	+ margin: 0.5rem 0 1rem 0;
1642	+ overflow: hidden; }
1643	+ .ccw_plugin .progress .determinate {
1644	+ position: absolute;
1645	+ top: 0;
1646	+ left: 0;
1647	+ bottom: 0;
1648	+ background-color: #26a69a;
1649	+ transition: width .3s linear; }
1650	+ .ccw_plugin .progress .indeterminate {
1651	+ background-color: #26a69a; }
1652	+ .ccw_plugin .progress .indeterminate:before {
1653	+ content: '';
1654	+ position: absolute;
1655	+ background-color: inherit;
1656	+ top: 0;
1657	+ left: 0;
1658	+ bottom: 0;
1659	+ will-change: left, right;
1660	+ animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; }
1661	+ .ccw_plugin .progress .indeterminate:after {
1662	+ content: '';
1663	+ position: absolute;
1664	+ background-color: inherit;
1665	+ top: 0;
1666	+ left: 0;
1667	+ bottom: 0;
1668	+ will-change: left, right;
1669	+ animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
1670	+ animation-delay: 1.15s; }
1671	+
1672	+ @keyframes indeterminate {
1673	+ 0% {
1674	+ left: -35%;
1675	+ right: 100%; }
1676	+ 60% {
1677	+ left: 100%;
1678	+ right: -90%; }
1679	+ 100% {
1680	+ left: 100%;
1681	+ right: -90%; } }
1682	+
1683	+ @keyframes indeterminate-short {
1684	+ 0% {
1685	+ left: -200%;
1686	+ right: 100%; }
1687	+ 60% {
1688	+ left: 107%;
1689	+ right: -8%; }
1690	+ 100% {
1691	+ left: 107%;
1692	+ right: -8%; } }
1693	+ .ccw_plugin .hide {
1694	+ display: none !important; }
1695	+ .ccw_plugin .left-align {
1696	+ text-align: left; }
1697	+ .ccw_plugin .right-align {
1698	+ text-align: right; }
1699	+ .ccw_plugin .center, .ccw_plugin .center-align {
1700	+ text-align: center; }
1701	+ .ccw_plugin .left {
1702	+ float: left !important; }
1703	+ .ccw_plugin .right {
1704	+ float: right !important; }
1705	+ .ccw_plugin .no-select, .ccw_plugin input[type=range], .ccw_plugin input[type=range] + .thumb {
1706	+ user-select: none; }
1707	+ .ccw_plugin .circle {
1708	+ border-radius: 50%; }
1709	+ .ccw_plugin .center-block {
1710	+ display: block;
1711	+ margin-left: auto;
1712	+ margin-right: auto; }
1713	+ .ccw_plugin .truncate {
1714	+ display: block;
1715	+ white-space: nowrap;
1716	+ overflow: hidden;
1717	+ text-overflow: ellipsis; }
1718	+ .ccw_plugin .no-padding {
1719	+ padding: 0 !important; }
1720	+ .ccw_plugin .material-icons {
1721	+ text-rendering: optimizeLegibility;
1722	+ font-feature-settings: 'liga'; }
1723	+ .ccw_plugin .container {
1724	+ margin: 0 auto;
1725	+ max-width: 1280px;
1726	+ width: 90%; }
1727	+ @media only screen and (min-width: 601px) {
1728	+ .ccw_plugin .container {
1729	+ width: 85%; } }
1730	+ @media only screen and (min-width: 993px) {
1731	+ .ccw_plugin .container {
1732	+ width: 70%; } }
1733	+ .ccw_plugin .container .row {
1734	+ margin-left: -0.75rem;
1735	+ margin-right: -0.75rem; }
1736	+ .ccw_plugin .section {
1737	+ padding-top: 1rem;
1738	+ padding-bottom: 1rem; }
1739	+ .ccw_plugin .section.no-pad {
1740	+ padding: 0; }
1741	+ .ccw_plugin .section.no-pad-bot {
1742	+ padding-bottom: 0; }
1743	+ .ccw_plugin .section.no-pad-top {
1744	+ padding-top: 0; }
1745	+ .ccw_plugin .row {
1746	+ margin-left: auto;
1747	+ margin-right: auto;
1748	+ margin-bottom: 20px; }
1749	+ .ccw_plugin .row:after {
1750	+ content: "";
1751	+ display: table;
1752	+ clear: both; }
1753	+ .ccw_plugin .row .col {
1754	+ float: left;
1755	+ box-sizing: border-box;
1756	+ padding: 0 0.75rem;
1757	+ min-height: 1px; }
1758	+ .ccw_plugin .row .col[class="push-"], .ccw_plugin .row .col[class="pull-"] {
1759	+ position: relative; }
1760	+ .ccw_plugin .row .col.s1 {
1761	+ width: 8.33333%;
1762	+ margin-left: auto;
1763	+ left: auto;
1764	+ right: auto; }
1765	+ .ccw_plugin .row .col.s2 {
1766	+ width: 16.66667%;
1767	+ margin-left: auto;
1768	+ left: auto;
1769	+ right: auto; }
1770	+ .ccw_plugin .row .col.s3 {
1771	+ width: 25%;
1772	+ margin-left: auto;
1773	+ left: auto;
1774	+ right: auto; }
1775	+ .ccw_plugin .row .col.s4 {
1776	+ width: 33.33333%;
1777	+ margin-left: auto;
1778	+ left: auto;
1779	+ right: auto; }
1780	+ .ccw_plugin .row .col.s5 {
1781	+ width: 41.66667%;
1782	+ margin-left: auto;
1783	+ left: auto;
1784	+ right: auto; }
1785	+ .ccw_plugin .row .col.s6 {
1786	+ width: 50%;
1787	+ margin-left: auto;
1788	+ left: auto;
1789	+ right: auto; }
1790	+ .ccw_plugin .row .col.s7 {
1791	+ width: 58.33333%;
1792	+ margin-left: auto;
1793	+ left: auto;
1794	+ right: auto; }
1795	+ .ccw_plugin .row .col.s8 {
1796	+ width: 66.66667%;
1797	+ margin-left: auto;
1798	+ left: auto;
1799	+ right: auto; }
1800	+ .ccw_plugin .row .col.s9 {
1801	+ width: 75%;
1802	+ margin-left: auto;
1803	+ left: auto;
1804	+ right: auto; }
1805	+ .ccw_plugin .row .col.s10 {
1806	+ width: 83.33333%;
1807	+ margin-left: auto;
1808	+ left: auto;
1809	+ right: auto; }
1810	+ .ccw_plugin .row .col.s11 {
1811	+ width: 91.66667%;
1812	+ margin-left: auto;
1813	+ left: auto;
1814	+ right: auto; }
1815	+ .ccw_plugin .row .col.s12 {
1816	+ width: 100%;
1817	+ margin-left: auto;
1818	+ left: auto;
1819	+ right: auto; }
1820	+ .ccw_plugin .row .col.offset-s1 {
1821	+ margin-left: 8.33333%; }
1822	+ .ccw_plugin .row .col.pull-s1 {
1823	+ right: 8.33333%; }
1824	+ .ccw_plugin .row .col.push-s1 {
1825	+ left: 8.33333%; }
1826	+ .ccw_plugin .row .col.offset-s2 {
1827	+ margin-left: 16.66667%; }
1828	+ .ccw_plugin .row .col.pull-s2 {
1829	+ right: 16.66667%; }
1830	+ .ccw_plugin .row .col.push-s2 {
1831	+ left: 16.66667%; }
1832	+ .ccw_plugin .row .col.offset-s3 {
1833	+ margin-left: 25%; }
1834	+ .ccw_plugin .row .col.pull-s3 {
1835	+ right: 25%; }
1836	+ .ccw_plugin .row .col.push-s3 {
1837	+ left: 25%; }
1838	+ .ccw_plugin .row .col.offset-s4 {
1839	+ margin-left: 33.33333%; }
1840	+ .ccw_plugin .row .col.pull-s4 {
1841	+ right: 33.33333%; }
1842	+ .ccw_plugin .row .col.push-s4 {
1843	+ left: 33.33333%; }
1844	+ .ccw_plugin .row .col.offset-s5 {
1845	+ margin-left: 41.66667%; }
1846	+ .ccw_plugin .row .col.pull-s5 {
1847	+ right: 41.66667%; }
1848	+ .ccw_plugin .row .col.push-s5 {
1849	+ left: 41.66667%; }
1850	+ .ccw_plugin .row .col.offset-s6 {
1851	+ margin-left: 50%; }
1852	+ .ccw_plugin .row .col.pull-s6 {
1853	+ right: 50%; }
1854	+ .ccw_plugin .row .col.push-s6 {
1855	+ left: 50%; }
1856	+ .ccw_plugin .row .col.offset-s7 {
1857	+ margin-left: 58.33333%; }
1858	+ .ccw_plugin .row .col.pull-s7 {
1859	+ right: 58.33333%; }
1860	+ .ccw_plugin .row .col.push-s7 {
1861	+ left: 58.33333%; }
1862	+ .ccw_plugin .row .col.offset-s8 {
1863	+ margin-left: 66.66667%; }
1864	+ .ccw_plugin .row .col.pull-s8 {
1865	+ right: 66.66667%; }
1866	+ .ccw_plugin .row .col.push-s8 {
1867	+ left: 66.66667%; }
1868	+ .ccw_plugin .row .col.offset-s9 {
1869	+ margin-left: 75%; }
1870	+ .ccw_plugin .row .col.pull-s9 {
1871	+ right: 75%; }
1872	+ .ccw_plugin .row .col.push-s9 {
1873	+ left: 75%; }
1874	+ .ccw_plugin .row .col.offset-s10 {
1875	+ margin-left: 83.33333%; }
1876	+ .ccw_plugin .row .col.pull-s10 {
1877	+ right: 83.33333%; }
1878	+ .ccw_plugin .row .col.push-s10 {
1879	+ left: 83.33333%; }
1880	+ .ccw_plugin .row .col.offset-s11 {
1881	+ margin-left: 91.66667%; }
1882	+ .ccw_plugin .row .col.pull-s11 {
1883	+ right: 91.66667%; }
1884	+ .ccw_plugin .row .col.push-s11 {
1885	+ left: 91.66667%; }
1886	+ .ccw_plugin .row .col.offset-s12 {
1887	+ margin-left: 100%; }
1888	+ .ccw_plugin .row .col.pull-s12 {
1889	+ right: 100%; }
1890	+ .ccw_plugin .row .col.push-s12 {
1891	+ left: 100%; }
1892	+ @media only screen and (min-width: 601px) {
1893	+ .ccw_plugin .row .col.m1 {
1894	+ width: 8.33333%;
1895	+ margin-left: auto;
1896	+ left: auto;
1897	+ right: auto; }
1898	+ .ccw_plugin .row .col.m2 {
1899	+ width: 16.66667%;
1900	+ margin-left: auto;
1901	+ left: auto;
1902	+ right: auto; }
1903	+ .ccw_plugin .row .col.m3 {
1904	+ width: 25%;
1905	+ margin-left: auto;
1906	+ left: auto;
1907	+ right: auto; }
1908	+ .ccw_plugin .row .col.m4 {
1909	+ width: 33.33333%;
1910	+ margin-left: auto;
1911	+ left: auto;
1912	+ right: auto; }
1913	+ .ccw_plugin .row .col.m5 {
1914	+ width: 41.66667%;
1915	+ margin-left: auto;
1916	+ left: auto;
1917	+ right: auto; }
1918	+ .ccw_plugin .row .col.m6 {
1919	+ width: 50%;
1920	+ margin-left: auto;
1921	+ left: auto;
1922	+ right: auto; }
1923	+ .ccw_plugin .row .col.m7 {
1924	+ width: 58.33333%;
1925	+ margin-left: auto;
1926	+ left: auto;
1927	+ right: auto; }
1928	+ .ccw_plugin .row .col.m8 {
1929	+ width: 66.66667%;
1930	+ margin-left: auto;
1931	+ left: auto;
1932	+ right: auto; }
1933	+ .ccw_plugin .row .col.m9 {
1934	+ width: 75%;
1935	+ margin-left: auto;
1936	+ left: auto;
1937	+ right: auto; }
1938	+ .ccw_plugin .row .col.m10 {
1939	+ width: 83.33333%;
1940	+ margin-left: auto;
1941	+ left: auto;
1942	+ right: auto; }
1943	+ .ccw_plugin .row .col.m11 {
1944	+ width: 91.66667%;
1945	+ margin-left: auto;
1946	+ left: auto;
1947	+ right: auto; }
1948	+ .ccw_plugin .row .col.m12 {
1949	+ width: 100%;
1950	+ margin-left: auto;
1951	+ left: auto;
1952	+ right: auto; }
1953	+ .ccw_plugin .row .col.offset-m1 {
1954	+ margin-left: 8.33333%; }
1955	+ .ccw_plugin .row .col.pull-m1 {
1956	+ right: 8.33333%; }
1957	+ .ccw_plugin .row .col.push-m1 {
1958	+ left: 8.33333%; }
1959	+ .ccw_plugin .row .col.offset-m2 {
1960	+ margin-left: 16.66667%; }
1961	+ .ccw_plugin .row .col.pull-m2 {
1962	+ right: 16.66667%; }
1963	+ .ccw_plugin .row .col.push-m2 {
1964	+ left: 16.66667%; }
1965	+ .ccw_plugin .row .col.offset-m3 {
1966	+ margin-left: 25%; }
1967	+ .ccw_plugin .row .col.pull-m3 {
1968	+ right: 25%; }
1969	+ .ccw_plugin .row .col.push-m3 {
1970	+ left: 25%; }
1971	+ .ccw_plugin .row .col.offset-m4 {
1972	+ margin-left: 33.33333%; }
1973	+ .ccw_plugin .row .col.pull-m4 {
1974	+ right: 33.33333%; }
1975	+ .ccw_plugin .row .col.push-m4 {
1976	+ left: 33.33333%; }
1977	+ .ccw_plugin .row .col.offset-m5 {
1978	+ margin-left: 41.66667%; }
1979	+ .ccw_plugin .row .col.pull-m5 {
1980	+ right: 41.66667%; }
1981	+ .ccw_plugin .row .col.push-m5 {
1982	+ left: 41.66667%; }
1983	+ .ccw_plugin .row .col.offset-m6 {
1984	+ margin-left: 50%; }
1985	+ .ccw_plugin .row .col.pull-m6 {
1986	+ right: 50%; }
1987	+ .ccw_plugin .row .col.push-m6 {
1988	+ left: 50%; }
1989	+ .ccw_plugin .row .col.offset-m7 {
1990	+ margin-left: 58.33333%; }
1991	+ .ccw_plugin .row .col.pull-m7 {
1992	+ right: 58.33333%; }
1993	+ .ccw_plugin .row .col.push-m7 {
1994	+ left: 58.33333%; }
1995	+ .ccw_plugin .row .col.offset-m8 {
1996	+ margin-left: 66.66667%; }
1997	+ .ccw_plugin .row .col.pull-m8 {
1998	+ right: 66.66667%; }
1999	+ .ccw_plugin .row .col.push-m8 {
2000	+ left: 66.66667%; }
2001	+ .ccw_plugin .row .col.offset-m9 {
2002	+ margin-left: 75%; }
2003	+ .ccw_plugin .row .col.pull-m9 {
2004	+ right: 75%; }
2005	+ .ccw_plugin .row .col.push-m9 {
2006	+ left: 75%; }
2007	+ .ccw_plugin .row .col.offset-m10 {
2008	+ margin-left: 83.33333%; }
2009	+ .ccw_plugin .row .col.pull-m10 {
2010	+ right: 83.33333%; }
2011	+ .ccw_plugin .row .col.push-m10 {
2012	+ left: 83.33333%; }
2013	+ .ccw_plugin .row .col.offset-m11 {
2014	+ margin-left: 91.66667%; }
2015	+ .ccw_plugin .row .col.pull-m11 {
2016	+ right: 91.66667%; }
2017	+ .ccw_plugin .row .col.push-m11 {
2018	+ left: 91.66667%; }
2019	+ .ccw_plugin .row .col.offset-m12 {
2020	+ margin-left: 100%; }
2021	+ .ccw_plugin .row .col.pull-m12 {
2022	+ right: 100%; }
2023	+ .ccw_plugin .row .col.push-m12 {
2024	+ left: 100%; } }
2025	+ @media only screen and (min-width: 993px) {
2026	+ .ccw_plugin .row .col.l1 {
2027	+ width: 8.33333%;
2028	+ margin-left: auto;
2029	+ left: auto;
2030	+ right: auto; }
2031	+ .ccw_plugin .row .col.l2 {
2032	+ width: 16.66667%;
2033	+ margin-left: auto;
2034	+ left: auto;
2035	+ right: auto; }
2036	+ .ccw_plugin .row .col.l3 {
2037	+ width: 25%;
2038	+ margin-left: auto;
2039	+ left: auto;
2040	+ right: auto; }
2041	+ .ccw_plugin .row .col.l4 {
2042	+ width: 33.33333%;
2043	+ margin-left: auto;
2044	+ left: auto;
2045	+ right: auto; }
2046	+ .ccw_plugin .row .col.l5 {
2047	+ width: 41.66667%;
2048	+ margin-left: auto;
2049	+ left: auto;
2050	+ right: auto; }
2051	+ .ccw_plugin .row .col.l6 {
2052	+ width: 50%;
2053	+ margin-left: auto;
2054	+ left: auto;
2055	+ right: auto; }
2056	+ .ccw_plugin .row .col.l7 {
2057	+ width: 58.33333%;
2058	+ margin-left: auto;
2059	+ left: auto;
2060	+ right: auto; }
2061	+ .ccw_plugin .row .col.l8 {
2062	+ width: 66.66667%;
2063	+ margin-left: auto;
2064	+ left: auto;
2065	+ right: auto; }
2066	+ .ccw_plugin .row .col.l9 {
2067	+ width: 75%;
2068	+ margin-left: auto;
2069	+ left: auto;
2070	+ right: auto; }
2071	+ .ccw_plugin .row .col.l10 {
2072	+ width: 83.33333%;
2073	+ margin-left: auto;
2074	+ left: auto;
2075	+ right: auto; }
2076	+ .ccw_plugin .row .col.l11 {
2077	+ width: 91.66667%;
2078	+ margin-left: auto;
2079	+ left: auto;
2080	+ right: auto; }
2081	+ .ccw_plugin .row .col.l12 {
2082	+ width: 100%;
2083	+ margin-left: auto;
2084	+ left: auto;
2085	+ right: auto; }
2086	+ .ccw_plugin .row .col.offset-l1 {
2087	+ margin-left: 8.33333%; }
2088	+ .ccw_plugin .row .col.pull-l1 {
2089	+ right: 8.33333%; }
2090	+ .ccw_plugin .row .col.push-l1 {
2091	+ left: 8.33333%; }
2092	+ .ccw_plugin .row .col.offset-l2 {
2093	+ margin-left: 16.66667%; }
2094	+ .ccw_plugin .row .col.pull-l2 {
2095	+ right: 16.66667%; }
2096	+ .ccw_plugin .row .col.push-l2 {
2097	+ left: 16.66667%; }
2098	+ .ccw_plugin .row .col.offset-l3 {
2099	+ margin-left: 25%; }
2100	+ .ccw_plugin .row .col.pull-l3 {
2101	+ right: 25%; }
2102	+ .ccw_plugin .row .col.push-l3 {
2103	+ left: 25%; }
2104	+ .ccw_plugin .row .col.offset-l4 {
2105	+ margin-left: 33.33333%; }
2106	+ .ccw_plugin .row .col.pull-l4 {
2107	+ right: 33.33333%; }
2108	+ .ccw_plugin .row .col.push-l4 {
2109	+ left: 33.33333%; }
2110	+ .ccw_plugin .row .col.offset-l5 {
2111	+ margin-left: 41.66667%; }
2112	+ .ccw_plugin .row .col.pull-l5 {
2113	+ right: 41.66667%; }
2114	+ .ccw_plugin .row .col.push-l5 {
2115	+ left: 41.66667%; }
2116	+ .ccw_plugin .row .col.offset-l6 {
2117	+ margin-left: 50%; }
2118	+ .ccw_plugin .row .col.pull-l6 {
2119	+ right: 50%; }
2120	+ .ccw_plugin .row .col.push-l6 {
2121	+ left: 50%; }
2122	+ .ccw_plugin .row .col.offset-l7 {
2123	+ margin-left: 58.33333%; }
2124	+ .ccw_plugin .row .col.pull-l7 {
2125	+ right: 58.33333%; }
2126	+ .ccw_plugin .row .col.push-l7 {
2127	+ left: 58.33333%; }
2128	+ .ccw_plugin .row .col.offset-l8 {
2129	+ margin-left: 66.66667%; }
2130	+ .ccw_plugin .row .col.pull-l8 {
2131	+ right: 66.66667%; }
2132	+ .ccw_plugin .row .col.push-l8 {
2133	+ left: 66.66667%; }
2134	+ .ccw_plugin .row .col.offset-l9 {
2135	+ margin-left: 75%; }
2136	+ .ccw_plugin .row .col.pull-l9 {
2137	+ right: 75%; }
2138	+ .ccw_plugin .row .col.push-l9 {
2139	+ left: 75%; }
2140	+ .ccw_plugin .row .col.offset-l10 {
2141	+ margin-left: 83.33333%; }
2142	+ .ccw_plugin .row .col.pull-l10 {
2143	+ right: 83.33333%; }
2144	+ .ccw_plugin .row .col.push-l10 {
2145	+ left: 83.33333%; }
2146	+ .ccw_plugin .row .col.offset-l11 {
2147	+ margin-left: 91.66667%; }
2148	+ .ccw_plugin .row .col.pull-l11 {
2149	+ right: 91.66667%; }
2150	+ .ccw_plugin .row .col.push-l11 {
2151	+ left: 91.66667%; }
2152	+ .ccw_plugin .row .col.offset-l12 {
2153	+ margin-left: 100%; }
2154	+ .ccw_plugin .row .col.pull-l12 {
2155	+ right: 100%; }
2156	+ .ccw_plugin .row .col.push-l12 {
2157	+ left: 100%; } }
2158	+ @media only screen and (min-width: 1201px) {
2159	+ .ccw_plugin .row .col.xl1 {
2160	+ width: 8.33333%;
2161	+ margin-left: auto;
2162	+ left: auto;
2163	+ right: auto; }
2164	+ .ccw_plugin .row .col.xl2 {
2165	+ width: 16.66667%;
2166	+ margin-left: auto;
2167	+ left: auto;
2168	+ right: auto; }
2169	+ .ccw_plugin .row .col.xl3 {
2170	+ width: 25%;
2171	+ margin-left: auto;
2172	+ left: auto;
2173	+ right: auto; }
2174	+ .ccw_plugin .row .col.xl4 {
2175	+ width: 33.33333%;
2176	+ margin-left: auto;
2177	+ left: auto;
2178	+ right: auto; }
2179	+ .ccw_plugin .row .col.xl5 {
2180	+ width: 41.66667%;
2181	+ margin-left: auto;
2182	+ left: auto;
2183	+ right: auto; }
2184	+ .ccw_plugin .row .col.xl6 {
2185	+ width: 50%;
2186	+ margin-left: auto;
2187	+ left: auto;
2188	+ right: auto; }
2189	+ .ccw_plugin .row .col.xl7 {
2190	+ width: 58.33333%;
2191	+ margin-left: auto;
2192	+ left: auto;
2193	+ right: auto; }
2194	+ .ccw_plugin .row .col.xl8 {
2195	+ width: 66.66667%;
2196	+ margin-left: auto;
2197	+ left: auto;
2198	+ right: auto; }
2199	+ .ccw_plugin .row .col.xl9 {
2200	+ width: 75%;
2201	+ margin-left: auto;
2202	+ left: auto;
2203	+ right: auto; }
2204	+ .ccw_plugin .row .col.xl10 {
2205	+ width: 83.33333%;
2206	+ margin-left: auto;
2207	+ left: auto;
2208	+ right: auto; }
2209	+ .ccw_plugin .row .col.xl11 {
2210	+ width: 91.66667%;
2211	+ margin-left: auto;
2212	+ left: auto;
2213	+ right: auto; }
2214	+ .ccw_plugin .row .col.xl12 {
2215	+ width: 100%;
2216	+ margin-left: auto;
2217	+ left: auto;
2218	+ right: auto; }
2219	+ .ccw_plugin .row .col.offset-xl1 {
2220	+ margin-left: 8.33333%; }
2221	+ .ccw_plugin .row .col.pull-xl1 {
2222	+ right: 8.33333%; }
2223	+ .ccw_plugin .row .col.push-xl1 {
2224	+ left: 8.33333%; }
2225	+ .ccw_plugin .row .col.offset-xl2 {
2226	+ margin-left: 16.66667%; }
2227	+ .ccw_plugin .row .col.pull-xl2 {
2228	+ right: 16.66667%; }
2229	+ .ccw_plugin .row .col.push-xl2 {
2230	+ left: 16.66667%; }
2231	+ .ccw_plugin .row .col.offset-xl3 {
2232	+ margin-left: 25%; }
2233	+ .ccw_plugin .row .col.pull-xl3 {
2234	+ right: 25%; }
2235	+ .ccw_plugin .row .col.push-xl3 {
2236	+ left: 25%; }
2237	+ .ccw_plugin .row .col.offset-xl4 {
2238	+ margin-left: 33.33333%; }
2239	+ .ccw_plugin .row .col.pull-xl4 {
2240	+ right: 33.33333%; }
2241	+ .ccw_plugin .row .col.push-xl4 {
2242	+ left: 33.33333%; }
2243	+ .ccw_plugin .row .col.offset-xl5 {
2244	+ margin-left: 41.66667%; }
2245	+ .ccw_plugin .row .col.pull-xl5 {
2246	+ right: 41.66667%; }
2247	+ .ccw_plugin .row .col.push-xl5 {
2248	+ left: 41.66667%; }
2249	+ .ccw_plugin .row .col.offset-xl6 {
2250	+ margin-left: 50%; }
2251	+ .ccw_plugin .row .col.pull-xl6 {
2252	+ right: 50%; }
2253	+ .ccw_plugin .row .col.push-xl6 {
2254	+ left: 50%; }
2255	+ .ccw_plugin .row .col.offset-xl7 {
2256	+ margin-left: 58.33333%; }
2257	+ .ccw_plugin .row .col.pull-xl7 {
2258	+ right: 58.33333%; }
2259	+ .ccw_plugin .row .col.push-xl7 {
2260	+ left: 58.33333%; }
2261	+ .ccw_plugin .row .col.offset-xl8 {
2262	+ margin-left: 66.66667%; }
2263	+ .ccw_plugin .row .col.pull-xl8 {
2264	+ right: 66.66667%; }
2265	+ .ccw_plugin .row .col.push-xl8 {
2266	+ left: 66.66667%; }
2267	+ .ccw_plugin .row .col.offset-xl9 {
2268	+ margin-left: 75%; }
2269	+ .ccw_plugin .row .col.pull-xl9 {
2270	+ right: 75%; }
2271	+ .ccw_plugin .row .col.push-xl9 {
2272	+ left: 75%; }
2273	+ .ccw_plugin .row .col.offset-xl10 {
2274	+ margin-left: 83.33333%; }
2275	+ .ccw_plugin .row .col.pull-xl10 {
2276	+ right: 83.33333%; }
2277	+ .ccw_plugin .row .col.push-xl10 {
2278	+ left: 83.33333%; }
2279	+ .ccw_plugin .row .col.offset-xl11 {
2280	+ margin-left: 91.66667%; }
2281	+ .ccw_plugin .row .col.pull-xl11 {
2282	+ right: 91.66667%; }
2283	+ .ccw_plugin .row .col.push-xl11 {
2284	+ left: 91.66667%; }
2285	+ .ccw_plugin .row .col.offset-xl12 {
2286	+ margin-left: 100%; }
2287	+ .ccw_plugin .row .col.pull-xl12 {
2288	+ right: 100%; }
2289	+ .ccw_plugin .row .col.push-xl12 {
2290	+ left: 100%; } }
2291	+ .ccw_plugin a {
2292	+ text-decoration: none; }
2293	+ .ccw_plugin html {
2294	+ line-height: 1.5;
2295	+ font-family: "Roboto", sans-serif;
2296	+ font-weight: normal;
2297	+ color: rgba(0, 0, 0, 0.87); }
2298	+ @media only screen and (min-width: 0) {
2299	+ .ccw_plugin html {
2300	+ font-size: 14px; } }
2301	+ @media only screen and (min-width: 992px) {
2302	+ .ccw_plugin html {
2303	+ font-size: 14.5px; } }
2304	+ @media only screen and (min-width: 1200px) {
2305	+ .ccw_plugin html {
2306	+ font-size: 15px; } }
2307	+ .ccw_plugin h1, .ccw_plugin h2, .ccw_plugin h3, .ccw_plugin h4, .ccw_plugin h5, .ccw_plugin h6 {
2308	+ font-weight: 400;
2309	+ line-height: 1.1; }
2310	+ .ccw_plugin h1 a, .ccw_plugin h2 a, .ccw_plugin h3 a, .ccw_plugin h4 a, .ccw_plugin h5 a, .ccw_plugin h6 a {
2311	+ font-weight: inherit; }
2312	+ .ccw_plugin h1 {
2313	+ font-size: 4.2rem;
2314	+ line-height: 110%;
2315	+ margin: 2.1rem 0 1.68rem 0; }
2316	+ .ccw_plugin h2 {
2317	+ font-size: 3.56rem;
2318	+ line-height: 110%;
2319	+ margin: 1.78rem 0 1.424rem 0; }
2320	+ .ccw_plugin h3 {
2321	+ font-size: 2.92rem;
2322	+ line-height: 110%;
2323	+ margin: 1.46rem 0 1.168rem 0; }
2324	+ .ccw_plugin h4 {
2325	+ font-size: 2.28rem;
2326	+ line-height: 110%;
2327	+ margin: 1.14rem 0 0.912rem 0; }
2328	+ .ccw_plugin h5 {
2329	+ font-size: 1.64rem;
2330	+ line-height: 110%;
2331	+ margin: 0.82rem 0 0.656rem 0; }
2332	+ .ccw_plugin h6 {
2333	+ font-size: 1rem;
2334	+ line-height: 110%;
2335	+ margin: 0.5rem 0 0.4rem 0; }
2336	+ .ccw_plugin em {
2337	+ font-style: italic; }
2338	+ .ccw_plugin strong {
2339	+ font-weight: 500; }
2340	+ .ccw_plugin small {
2341	+ font-size: 75%; }
2342	+ .ccw_plugin .light, .ccw_plugin .page-footer .footer-copyright {
2343	+ font-weight: 300; }
2344	+ .ccw_plugin .thin {
2345	+ font-weight: 200; }
2346	+ .ccw_plugin .flow-text {
2347	+ font-weight: 300; }
2348	+ @media only screen and (min-width: 360px) {
2349	+ .ccw_plugin .flow-text {
2350	+ font-size: 1.2rem; } }
2351	+ @media only screen and (min-width: 390px) {
2352	+ .ccw_plugin .flow-text {
2353	+ font-size: 1.224rem; } }
2354	+ @media only screen and (min-width: 420px) {
2355	+ .ccw_plugin .flow-text {
2356	+ font-size: 1.248rem; } }
2357	+ @media only screen and (min-width: 450px) {
2358	+ .ccw_plugin .flow-text {
2359	+ font-size: 1.272rem; } }
2360	+ @media only screen and (min-width: 480px) {
2361	+ .ccw_plugin .flow-text {
2362	+ font-size: 1.296rem; } }
2363	+ @media only screen and (min-width: 510px) {
2364	+ .ccw_plugin .flow-text {
2365	+ font-size: 1.32rem; } }
2366	+ @media only screen and (min-width: 540px) {
2367	+ .ccw_plugin .flow-text {
2368	+ font-size: 1.344rem; } }
2369	+ @media only screen and (min-width: 570px) {
2370	+ .ccw_plugin .flow-text {
2371	+ font-size: 1.368rem; } }
2372	+ @media only screen and (min-width: 600px) {
2373	+ .ccw_plugin .flow-text {
2374	+ font-size: 1.392rem; } }
2375	+ @media only screen and (min-width: 630px) {
2376	+ .ccw_plugin .flow-text {
2377	+ font-size: 1.416rem; } }
2378	+ @media only screen and (min-width: 660px) {
2379	+ .ccw_plugin .flow-text {
2380	+ font-size: 1.44rem; } }
2381	+ @media only screen and (min-width: 690px) {
2382	+ .ccw_plugin .flow-text {
2383	+ font-size: 1.464rem; } }
2384	+ @media only screen and (min-width: 720px) {
2385	+ .ccw_plugin .flow-text {
2386	+ font-size: 1.488rem; } }
2387	+ @media only screen and (min-width: 750px) {
2388	+ .ccw_plugin .flow-text {
2389	+ font-size: 1.512rem; } }
2390	+ @media only screen and (min-width: 780px) {
2391	+ .ccw_plugin .flow-text {
2392	+ font-size: 1.536rem; } }
2393	+ @media only screen and (min-width: 810px) {
2394	+ .ccw_plugin .flow-text {
2395	+ font-size: 1.56rem; } }
2396	+ @media only screen and (min-width: 840px) {
2397	+ .ccw_plugin .flow-text {
2398	+ font-size: 1.584rem; } }
2399	+ @media only screen and (min-width: 870px) {
2400	+ .ccw_plugin .flow-text {
2401	+ font-size: 1.608rem; } }
2402	+ @media only screen and (min-width: 900px) {
2403	+ .ccw_plugin .flow-text {
2404	+ font-size: 1.632rem; } }
2405	+ @media only screen and (min-width: 930px) {
2406	+ .ccw_plugin .flow-text {
2407	+ font-size: 1.656rem; } }
2408	+ @media only screen and (min-width: 960px) {
2409	+ .ccw_plugin .flow-text {
2410	+ font-size: 1.68rem; } }
2411	+ @media only screen and (max-width: 360px) {
2412	+ .ccw_plugin .flow-text {
2413	+ font-size: 1.2rem; } }
2414	+ .ccw_plugin .btn, .ccw_plugin .btn-large,
2415	+ .ccw_plugin .btn-flat {
2416	+ border: none;
2417	+ border-radius: 2px;
2418	+ display: inline-block;
2419	+ height: 36px;
2420	+ line-height: 36px;
2421	+ padding: 0 2rem;
2422	+ text-transform: uppercase;
2423	+ vertical-align: middle;
2424	+ -webkit-tap-highlight-color: transparent; }
2425	+ .ccw_plugin .btn.disabled, .ccw_plugin .disabled.btn-large,
2426	+ .ccw_plugin .btn-floating.disabled,
2427	+ .ccw_plugin .btn-large.disabled,
2428	+ .ccw_plugin .btn-flat.disabled,
2429	+ .ccw_plugin .btn:disabled, .ccw_plugin .btn-large:disabled,
2430	+ .ccw_plugin .btn-floating:disabled,
2431	+ .ccw_plugin .btn-large:disabled,
2432	+ .ccw_plugin .btn-flat:disabled,
2433	+ .ccw_plugin .btn[disabled], .ccw_plugin [disabled].btn-large,
2434	+ .ccw_plugin .btn-floating[disabled],
2435	+ .ccw_plugin .btn-large[disabled],
2436	+ .ccw_plugin .btn-flat[disabled] {
2437	+ pointer-events: none;
2438	+ background-color: #DFDFDF !important;
2439	+ box-shadow: none;
2440	+ color: #9F9F9F !important;
2441	+ cursor: default; }
2442	+ .ccw_plugin .btn.disabled:hover, .ccw_plugin .disabled.btn-large:hover,
2443	+ .ccw_plugin .btn-floating.disabled:hover,
2444	+ .ccw_plugin .btn-large.disabled:hover,
2445	+ .ccw_plugin .btn-flat.disabled:hover,
2446	+ .ccw_plugin .btn:disabled:hover, .ccw_plugin .btn-large:disabled:hover,
2447	+ .ccw_plugin .btn-floating:disabled:hover,
2448	+ .ccw_plugin .btn-large:disabled:hover,
2449	+ .ccw_plugin .btn-flat:disabled:hover,
2450	+ .ccw_plugin .btn[disabled]:hover, .ccw_plugin [disabled].btn-large:hover,
2451	+ .ccw_plugin .btn-floating[disabled]:hover,
2452	+ .ccw_plugin .btn-large[disabled]:hover,
2453	+ .ccw_plugin .btn-flat[disabled]:hover {
2454	+ background-color: #DFDFDF !important;
2455	+ color: #9F9F9F !important; }
2456	+ .ccw_plugin .btn, .ccw_plugin .btn-large,
2457	+ .ccw_plugin .btn-floating,
2458	+ .ccw_plugin .btn-large,
2459	+ .ccw_plugin .btn-flat {
2460	+ font-size: 1rem;
2461	+ outline: 0; }
2462	+ .ccw_plugin .btn i, .ccw_plugin .btn-large i,
2463	+ .ccw_plugin .btn-floating i,
2464	+ .ccw_plugin .btn-large i,
2465	+ .ccw_plugin .btn-flat i {
2466	+ font-size: 1.3rem;
2467	+ line-height: inherit; }
2468	+ .ccw_plugin .btn:focus, .ccw_plugin .btn-large:focus,
2469	+ .ccw_plugin .btn-floating:focus {
2470	+ background-color: #1d7d74; }
2471	+ .ccw_plugin .btn, .ccw_plugin .btn-large {
2472	+ text-decoration: none;
2473	+ color: #fff;
2474	+ background-color: #26a69a;
2475	+ text-align: center;
2476	+ letter-spacing: .5px;
2477	+ transition: .2s ease-out;
2478	+ cursor: pointer; }
2479	+ .ccw_plugin .btn:hover, .ccw_plugin .btn-large:hover {
2480	+ background-color: #2bbbad; }
2481	+ .ccw_plugin .btn-floating {
2482	+ display: inline-block;
2483	+ color: #fff;
2484	+ position: relative;
2485	+ overflow: hidden;
2486	+ z-index: 1;
2487	+ width: 40px;
2488	+ height: 40px;
2489	+ line-height: 40px;
2490	+ padding: 0;
2491	+ background-color: #26a69a;
2492	+ border-radius: 50%;
2493	+ transition: .3s;
2494	+ cursor: pointer;
2495	+ vertical-align: middle; }
2496	+ .ccw_plugin .btn-floating:hover {
2497	+ background-color: #26a69a; }
2498	+ .ccw_plugin .btn-floating:before {
2499	+ border-radius: 0; }
2500	+ .ccw_plugin .btn-floating.btn-large {
2501	+ width: 56px;
2502	+ height: 56px; }
2503	+ .ccw_plugin .btn-floating.btn-large.halfway-fab {
2504	+ bottom: -28px; }
2505	+ .ccw_plugin .btn-floating.btn-large i {
2506	+ line-height: 56px; }
2507	+ .ccw_plugin .btn-floating.halfway-fab {
2508	+ position: absolute;
2509	+ right: 24px;
2510	+ bottom: -20px; }
2511	+ .ccw_plugin .btn-floating.halfway-fab.left {
2512	+ right: auto;
2513	+ left: 24px; }
2514	+ .ccw_plugin .btn-floating i {
2515	+ width: inherit;
2516	+ display: inline-block;
2517	+ text-align: center;
2518	+ color: #fff;
2519	+ font-size: 1.6rem;
2520	+ line-height: 40px; }
2521	+ .ccw_plugin button.btn-floating {
2522	+ border: none; }
2523	+ .ccw_plugin .fixed-action-btn {
2524	+ position: fixed;
2525	+ right: 23px;
2526	+ bottom: 23px;
2527	+ padding-top: 15px;
2528	+ margin-bottom: 0;
2529	+ z-index: 997; }
2530	+ .ccw_plugin .fixed-action-btn.active ul {
2531	+ visibility: visible; }
2532	+ .ccw_plugin .fixed-action-btn.horizontal {
2533	+ padding: 0 0 0 15px; }
2534	+ .ccw_plugin .fixed-action-btn.horizontal ul {
2535	+ text-align: right;
2536	+ right: 64px;
2537	+ top: 50%;
2538	+ transform: translateY(-50%);
2539	+ height: 100%;
2540	+ left: auto;
2541	+ width: 500px;
2542	+ /width 100% only goes to width of button container / }
2543	+ .ccw_plugin .fixed-action-btn.horizontal ul li {
2544	+ display: inline-block;
2545	+ margin: 15px 15px 0 0; }
2546	+ .ccw_plugin .fixed-action-btn.toolbar {
2547	+ padding: 0;
2548	+ height: 56px; }
2549	+ .ccw_plugin .fixed-action-btn.toolbar.active > a i {
2550	+ opacity: 0; }
2551	+ .ccw_plugin .fixed-action-btn.toolbar ul {
2552	+ display: flex;
2553	+ top: 0;
2554	+ bottom: 0;
2555	+ z-index: 1; }
2556	+ .ccw_plugin .fixed-action-btn.toolbar ul li {
2557	+ flex: 1;
2558	+ display: inline-block;
2559	+ margin: 0;
2560	+ height: 100%;
2561	+ transition: none; }
2562	+ .ccw_plugin .fixed-action-btn.toolbar ul li a {
2563	+ display: block;
2564	+ overflow: hidden;
2565	+ position: relative;
2566	+ width: 100%;
2567	+ height: 100%;
2568	+ background-color: transparent;
2569	+ box-shadow: none;
2570	+ color: #fff;
2571	+ line-height: 56px;
2572	+ z-index: 1; }
2573	+ .ccw_plugin .fixed-action-btn.toolbar ul li a i {
2574	+ line-height: inherit; }
2575	+ .ccw_plugin .fixed-action-btn ul {
2576	+ left: 0;
2577	+ right: 0;
2578	+ text-align: center;
2579	+ position: absolute;
2580	+ bottom: 64px;
2581	+ margin: 0;
2582	+ visibility: hidden; }
2583	+ .ccw_plugin .fixed-action-btn ul li {
2584	+ margin-bottom: 15px; }
2585	+ .ccw_plugin .fixed-action-btn ul a.btn-floating {
2586	+ opacity: 0; }
2587	+ .ccw_plugin .fixed-action-btn .fab-backdrop {
2588	+ position: absolute;
2589	+ top: 0;
2590	+ left: 0;
2591	+ z-index: -1;
2592	+ width: 40px;
2593	+ height: 40px;
2594	+ background-color: #26a69a;
2595	+ border-radius: 50%;
2596	+ transform: scale(0); }
2597	+ .ccw_plugin .btn-flat {
2598	+ box-shadow: none;
2599	+ background-color: transparent;
2600	+ color: #343434;
2601	+ cursor: pointer;
2602	+ transition: background-color .2s; }
2603	+ .ccw_plugin .btn-flat:focus, .ccw_plugin .btn-flat:hover {
2604	+ box-shadow: none; }
2605	+ .ccw_plugin .btn-flat:focus {
2606	+ background-color: rgba(0, 0, 0, 0.1); }
2607	+ .ccw_plugin .btn-flat.disabled {
2608	+ background-color: transparent !important;
2609	+ color: #b3b3b3 !important;
2610	+ cursor: default; }
2611	+ .ccw_plugin .btn-large {
2612	+ height: 54px;
2613	+ line-height: 54px; }
2614	+ .ccw_plugin .btn-large i {
2615	+ font-size: 1.6rem; }
2616	+ .ccw_plugin .btn-block {
2617	+ display: block; }
2618	+ .ccw_plugin .dropdown-content {
2619	+ background-color: #fff;
2620	+ margin: 0;
2621	+ display: none;
2622	+ min-width: 100px;
2623	+ max-height: 650px;
2624	+ overflow-y: auto;
2625	+ opacity: 0;
2626	+ position: absolute;
2627	+ z-index: 999;
2628	+ will-change: width, height; }
2629	+ .ccw_plugin .dropdown-content li {
2630	+ clear: both;
2631	+ color: rgba(0, 0, 0, 0.87);
2632	+ cursor: pointer;
2633	+ min-height: 50px;
2634	+ line-height: 1.5rem;
2635	+ width: 100%;
2636	+ text-align: left;
2637	+ text-transform: none; }
2638	+ .ccw_plugin .dropdown-content li:hover, .ccw_plugin .dropdown-content li.active, .ccw_plugin .dropdown-content li.selected {
2639	+ background-color: #eee; }
2640	+ .ccw_plugin .dropdown-content li.active.selected {
2641	+ background-color: #e1e1e1; }
2642	+ .ccw_plugin .dropdown-content li.divider {
2643	+ min-height: 0;
2644	+ height: 1px; }
2645	+ .ccw_plugin .dropdown-content li > a, .ccw_plugin .dropdown-content li > span {
2646	+ font-size: 16px;
2647	+ color: #26a69a;
2648	+ display: block;
2649	+ line-height: 22px;
2650	+ padding: 14px 16px; }
2651	+ .ccw_plugin .dropdown-content li > span > label {
2652	+ top: 1px;
2653	+ left: 0;
2654	+ height: 18px; }
2655	+ .ccw_plugin .dropdown-content li > a > i {
2656	+ height: inherit;
2657	+ line-height: inherit;
2658	+ float: left;
2659	+ margin: 0 24px 0 0;
2660	+ width: 24px; }
2661	+ .ccw_plugin .input-field.col .dropdown-content [type="checkbox"] + label {
2662	+ top: 1px;
2663	+ left: 0;
2664	+ height: 18px; }
2665	+ .ccw_plugin .waves-effect {
2666	+ position: relative;
2667	+ cursor: pointer;
2668	+ display: inline-block;
2669	+ overflow: hidden;
2670	+ user-select: none;
2671	+ -webkit-tap-highlight-color: transparent;
2672	+ vertical-align: middle;
2673	+ z-index: 1;
2674	+ transition: .3s ease-out; }
2675	+ .ccw_plugin .waves-effect .waves-ripple {
2676	+ position: absolute;
2677	+ border-radius: 50%;
2678	+ width: 20px;
2679	+ height: 20px;
2680	+ margin-top: -10px;
2681	+ margin-left: -10px;
2682	+ opacity: 0;
2683	+ background: rgba(0, 0, 0, 0.2);
2684	+ transition: all 0.7s ease-out;
2685	+ transition-property: transform, opacity;
2686	+ transform: scale(0);
2687	+ pointer-events: none; }
2688	+ .ccw_plugin .waves-effect.waves-light .waves-ripple {
2689	+ background-color: rgba(255, 255, 255, 0.45); }
2690	+ .ccw_plugin .waves-effect.waves-red .waves-ripple {
2691	+ background-color: rgba(244, 67, 54, 0.7); }
2692	+ .ccw_plugin .waves-effect.waves-yellow .waves-ripple {
2693	+ background-color: rgba(255, 235, 59, 0.7); }
2694	+ .ccw_plugin .waves-effect.waves-orange .waves-ripple {
2695	+ background-color: rgba(255, 152, 0, 0.7); }
2696	+ .ccw_plugin .waves-effect.waves-purple .waves-ripple {
2697	+ background-color: rgba(156, 39, 176, 0.7); }
2698	+ .ccw_plugin .waves-effect.waves-green .waves-ripple {
2699	+ background-color: rgba(76, 175, 80, 0.7); }
2700	+ .ccw_plugin .waves-effect.waves-teal .waves-ripple {
2701	+ background-color: rgba(0, 150, 136, 0.7); }
2702	+ .ccw_plugin .waves-effect input[type="button"], .ccw_plugin .waves-effect input[type="reset"], .ccw_plugin .waves-effect input[type="submit"] {
2703	+ border: 0;
2704	+ font-style: normal;
2705	+ font-size: inherit;
2706	+ text-transform: inherit;
2707	+ background: none; }
2708	+ .ccw_plugin .waves-effect img {
2709	+ position: relative;
2710	+ z-index: -1; }
2711	+ .ccw_plugin .waves-notransition {
2712	+ transition: none !important; }
2713	+ .ccw_plugin .waves-circle {
2714	+ transform: translateZ(0);
2715	+ -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); }
2716	+ .ccw_plugin .waves-input-wrapper {
2717	+ border-radius: 0.2em;
2718	+ vertical-align: bottom; }
2719	+ .ccw_plugin .waves-input-wrapper .waves-button-input {
2720	+ position: relative;
2721	+ top: 0;
2722	+ left: 0;
2723	+ z-index: 1; }
2724	+ .ccw_plugin .waves-circle {
2725	+ text-align: center;
2726	+ width: 2.5em;
2727	+ height: 2.5em;
2728	+ line-height: 2.5em;
2729	+ border-radius: 50%;
2730	+ -webkit-mask-image: none; }
2731	+ .ccw_plugin .waves-block {
2732	+ display: block; }
2733	+ .ccw_plugin .waves-effect .waves-ripple {
2734	+ z-index: -1; }
2735	+ .ccw_plugin .collapsible {
2736	+ border-top: 1px solid #ddd;
2737	+ border-right: 1px solid #ddd;
2738	+ border-left: 1px solid #ddd;
2739	+ margin: 0.5rem 0 1rem 0; }
2740	+ .ccw_plugin .collapsible-header {
2741	+ display: flex;
2742	+ cursor: pointer;
2743	+ -webkit-tap-highlight-color: transparent;
2744	+ line-height: 1.5;
2745	+ padding: 1rem;
2746	+ background-color: #fff;
2747	+ border-bottom: 1px solid #ddd; }
2748	+ .ccw_plugin .collapsible-header i {
2749	+ width: 2rem;
2750	+ font-size: 1.6rem;
2751	+ display: inline-block;
2752	+ text-align: center;
2753	+ margin-right: 1rem; }
2754	+ .ccw_plugin .collapsible-body {
2755	+ display: none;
2756	+ border-bottom: 1px solid #ddd;
2757	+ box-sizing: border-box;
2758	+ padding: 2rem; }
2759	+ .ccw_plugin .side-nav .collapsible,
2760	+ .ccw_plugin .side-nav.fixed .collapsible {
2761	+ border: none;
2762	+ box-shadow: none; }
2763	+ .ccw_plugin .side-nav .collapsible li,
2764	+ .ccw_plugin .side-nav.fixed .collapsible li {
2765	+ padding: 0; }
2766	+ .ccw_plugin .side-nav .collapsible-header,
2767	+ .ccw_plugin .side-nav.fixed .collapsible-header {
2768	+ background-color: transparent;
2769	+ border: none;
2770	+ line-height: inherit;
2771	+ height: inherit;
2772	+ padding: 0 16px; }
2773	+ .ccw_plugin .side-nav .collapsible-header:hover,
2774	+ .ccw_plugin .side-nav.fixed .collapsible-header:hover {
2775	+ background-color: rgba(0, 0, 0, 0.05); }
2776	+ .ccw_plugin .side-nav .collapsible-header i,
2777	+ .ccw_plugin .side-nav.fixed .collapsible-header i {
2778	+ line-height: inherit; }
2779	+ .ccw_plugin .side-nav .collapsible-body,
2780	+ .ccw_plugin .side-nav.fixed .collapsible-body {
2781	+ border: 0;
2782	+ background-color: #fff; }
2783	+ .ccw_plugin .side-nav .collapsible-body li a,
2784	+ .ccw_plugin .side-nav.fixed .collapsible-body li a {
2785	+ padding: 0 23.5px 0 31px; }
2786	+ .ccw_plugin .collapsible.popout {
2787	+ border: none;
2788	+ box-shadow: none; }
2789	+ .ccw_plugin .collapsible.popout > li {
2790	+ box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
2791	+ margin: 0 24px;
2792	+ transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); }
2793	+ .ccw_plugin .collapsible.popout > li.active {
2794	+ box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
2795	+ margin: 16px 0; }
2796	+ .ccw_plugin .chip {
2797	+ display: inline-block;
2798	+ height: 32px;
2799	+ font-size: 13px;
2800	+ font-weight: 500;
2801	+ color: rgba(0, 0, 0, 0.6);
2802	+ line-height: 32px;
2803	+ padding: 0 12px;
2804	+ border-radius: 16px;
2805	+ background-color: #e4e4e4;
2806	+ margin-bottom: 5px;
2807	+ margin-right: 5px; }
2808	+ .ccw_plugin .chip > img {
2809	+ float: left;
2810	+ margin: 0 8px 0 -12px;
2811	+ height: 32px;
2812	+ width: 32px;
2813	+ border-radius: 50%; }
2814	+ .ccw_plugin .chip .close {
2815	+ cursor: pointer;
2816	+ float: right;
2817	+ font-size: 16px;
2818	+ line-height: 32px;
2819	+ padding-left: 8px; }
2820	+ .ccw_plugin .chips {
2821	+ border: none;
2822	+ border-bottom: 1px solid #9e9e9e;
2823	+ box-shadow: none;
2824	+ margin: 0 0 20px 0;
2825	+ min-height: 45px;
2826	+ outline: none;
2827	+ transition: all .3s; }
2828	+ .ccw_plugin .chips.focus {
2829	+ border-bottom: 1px solid #26a69a;
2830	+ box-shadow: 0 1px 0 0 #26a69a; }
2831	+ .ccw_plugin .chips:hover {
2832	+ cursor: text; }
2833	+ .ccw_plugin .chips .chip.selected {
2834	+ background-color: #26a69a;
2835	+ color: #fff; }
2836	+ .ccw_plugin .chips .input {
2837	+ background: none;
2838	+ border: 0;
2839	+ color: rgba(0, 0, 0, 0.6);
2840	+ display: inline-block;
2841	+ font-size: 1rem;
2842	+ height: 3rem;
2843	+ line-height: 32px;
2844	+ outline: 0;
2845	+ margin: 0;
2846	+ padding: 0 !important;
2847	+ width: 120px !important; }
2848	+ .ccw_plugin .chips .input:focus {
2849	+ border: 0 !important;
2850	+ box-shadow: none !important; }
2851	+ .ccw_plugin .chips .autocomplete-content {
2852	+ margin-top: 0;
2853	+ margin-bottom: 0; }
2854	+ .ccw_plugin .prefix ~ .chips {
2855	+ margin-left: 3rem;
2856	+ width: 92%;
2857	+ width: calc(100% - 3rem); }
2858	+ .ccw_plugin .chips:empty ~ label {
2859	+ font-size: 0.8rem;
2860	+ transform: translateY(-140%); }
2861	+ .ccw_plugin select:focus {
2862	+ outline: 1px solid #c9f3ef; }
2863	+ .ccw_plugin button:focus {
2864	+ outline: none;
2865	+ background-color: #2ab7a9; }
2866	+ .ccw_plugin label {
2867	+ font-size: 0.8rem;
2868	+ color: #9e9e9e; }
2869	+ .ccw_plugin ::placeholder {
2870	+ color: #d1d1d1; }
2871	+ .ccw_plugin input:not([type]),
2872	+ .ccw_plugin input[type=text]:not(.browser-default),
2873	+ .ccw_plugin input[type=password]:not(.browser-default),
2874	+ .ccw_plugin input[type=email]:not(.browser-default),
2875	+ .ccw_plugin input[type=url]:not(.browser-default),
2876	+ .ccw_plugin input[type=time]:not(.browser-default),
2877	+ .ccw_plugin input[type=date]:not(.browser-default),
2878	+ .ccw_plugin input[type=datetime]:not(.browser-default),
2879	+ .ccw_plugin input[type=datetime-local]:not(.browser-default),
2880	+ .ccw_plugin input[type=tel]:not(.browser-default),
2881	+ .ccw_plugin input[type=number]:not(.browser-default),
2882	+ .ccw_plugin input[type=search]:not(.browser-default),
2883	+ .ccw_plugin textarea.materialize-textarea {
2884	+ background-color: transparent;
2885	+ border: none;
2886	+ border-bottom: 1px solid #9e9e9e;
2887	+ border-radius: 0;
2888	+ outline: none;
2889	+ height: 3rem;
2890	+ width: 100%;
2891	+ font-size: 1rem;
2892	+ margin: 0 0 20px 0;
2893	+ padding: 0;
2894	+ box-shadow: none;
2895	+ box-sizing: content-box;
2896	+ transition: all 0.3s; }
2897	+ .ccw_plugin input:not([type]):disabled, .ccw_plugin input:not([type])[readonly="readonly"],
2898	+ .ccw_plugin input[type=text]:not(.browser-default):disabled,
2899	+ .ccw_plugin input[type=text]:not(.browser-default)[readonly="readonly"],
2900	+ .ccw_plugin input[type=password]:not(.browser-default):disabled,
2901	+ .ccw_plugin input[type=password]:not(.browser-default)[readonly="readonly"],
2902	+ .ccw_plugin input[type=email]:not(.browser-default):disabled,
2903	+ .ccw_plugin input[type=email]:not(.browser-default)[readonly="readonly"],
2904	+ .ccw_plugin input[type=url]:not(.browser-default):disabled,
2905	+ .ccw_plugin input[type=url]:not(.browser-default)[readonly="readonly"],
2906	+ .ccw_plugin input[type=time]:not(.browser-default):disabled,
2907	+ .ccw_plugin input[type=time]:not(.browser-default)[readonly="readonly"],
2908	+ .ccw_plugin input[type=date]:not(.browser-default):disabled,
2909	+ .ccw_plugin input[type=date]:not(.browser-default)[readonly="readonly"],
2910	+ .ccw_plugin input[type=datetime]:not(.browser-default):disabled,
2911	+ .ccw_plugin input[type=datetime]:not(.browser-default)[readonly="readonly"],
2912	+ .ccw_plugin input[type=datetime-local]:not(.browser-default):disabled,
2913	+ .ccw_plugin input[type=datetime-local]:not(.browser-default)[readonly="readonly"],
2914	+ .ccw_plugin input[type=tel]:not(.browser-default):disabled,
2915	+ .ccw_plugin input[type=tel]:not(.browser-default)[readonly="readonly"],
2916	+ .ccw_plugin input[type=number]:not(.browser-default):disabled,
2917	+ .ccw_plugin input[type=number]:not(.browser-default)[readonly="readonly"],
2918	+ .ccw_plugin input[type=search]:not(.browser-default):disabled,
2919	+ .ccw_plugin input[type=search]:not(.browser-default)[readonly="readonly"],
2920	+ .ccw_plugin textarea.materialize-textarea:disabled,
2921	+ .ccw_plugin textarea.materialize-textarea[readonly="readonly"] {
2922	+ color: rgba(0, 0, 0, 0.42);
2923	+ border-bottom: 1px dotted rgba(0, 0, 0, 0.42); }
2924	+ .ccw_plugin input:not([type]):disabled + label,
2925	+ .ccw_plugin input:not([type])[readonly="readonly"] + label,
2926	+ .ccw_plugin input[type=text]:not(.browser-default):disabled + label,
2927	+ .ccw_plugin input[type=text]:not(.browser-default)[readonly="readonly"] + label,
2928	+ .ccw_plugin input[type=password]:not(.browser-default):disabled + label,
2929	+ .ccw_plugin input[type=password]:not(.browser-default)[readonly="readonly"] + label,
2930	+ .ccw_plugin input[type=email]:not(.browser-default):disabled + label,
2931	+ .ccw_plugin input[type=email]:not(.browser-default)[readonly="readonly"] + label,
2932	+ .ccw_plugin input[type=url]:not(.browser-default):disabled + label,
2933	+ .ccw_plugin input[type=url]:not(.browser-default)[readonly="readonly"] + label,
2934	+ .ccw_plugin input[type=time]:not(.browser-default):disabled + label,
2935	+ .ccw_plugin input[type=time]:not(.browser-default)[readonly="readonly"] + label,
2936	+ .ccw_plugin input[type=date]:not(.browser-default):disabled + label,
2937	+ .ccw_plugin input[type=date]:not(.browser-default)[readonly="readonly"] + label,
2938	+ .ccw_plugin input[type=datetime]:not(.browser-default):disabled + label,
2939	+ .ccw_plugin input[type=datetime]:not(.browser-default)[readonly="readonly"] + label,
2940	+ .ccw_plugin input[type=datetime-local]:not(.browser-default):disabled + label,
2941	+ .ccw_plugin input[type=datetime-local]:not(.browser-default)[readonly="readonly"] + label,
2942	+ .ccw_plugin input[type=tel]:not(.browser-default):disabled + label,
2943	+ .ccw_plugin input[type=tel]:not(.browser-default)[readonly="readonly"] + label,
2944	+ .ccw_plugin input[type=number]:not(.browser-default):disabled + label,
2945	+ .ccw_plugin input[type=number]:not(.browser-default)[readonly="readonly"] + label,
2946	+ .ccw_plugin input[type=search]:not(.browser-default):disabled + label,
2947	+ .ccw_plugin input[type=search]:not(.browser-default)[readonly="readonly"] + label,
2948	+ .ccw_plugin textarea.materialize-textarea:disabled + label,
2949	+ .ccw_plugin textarea.materialize-textarea[readonly="readonly"] + label {
2950	+ color: rgba(0, 0, 0, 0.42); }
2951	+ .ccw_plugin input:not([type]):focus:not([readonly]),
2952	+ .ccw_plugin input[type=text]:not(.browser-default):focus:not([readonly]),
2953	+ .ccw_plugin input[type=password]:not(.browser-default):focus:not([readonly]),
2954	+ .ccw_plugin input[type=email]:not(.browser-default):focus:not([readonly]),
2955	+ .ccw_plugin input[type=url]:not(.browser-default):focus:not([readonly]),
2956	+ .ccw_plugin input[type=time]:not(.browser-default):focus:not([readonly]),
2957	+ .ccw_plugin input[type=date]:not(.browser-default):focus:not([readonly]),
2958	+ .ccw_plugin input[type=datetime]:not(.browser-default):focus:not([readonly]),
2959	+ .ccw_plugin input[type=datetime-local]:not(.browser-default):focus:not([readonly]),
2960	+ .ccw_plugin input[type=tel]:not(.browser-default):focus:not([readonly]),
2961	+ .ccw_plugin input[type=number]:not(.browser-default):focus:not([readonly]),
2962	+ .ccw_plugin input[type=search]:not(.browser-default):focus:not([readonly]),
2963	+ .ccw_plugin textarea.materialize-textarea:focus:not([readonly]) {
2964	+ border-bottom: 1px solid #26a69a;
2965	+ box-shadow: 0 1px 0 0 #26a69a; }
2966	+ .ccw_plugin input:not([type]):focus:not([readonly]) + label,
2967	+ .ccw_plugin input[type=text]:not(.browser-default):focus:not([readonly]) + label,
2968	+ .ccw_plugin input[type=password]:not(.browser-default):focus:not([readonly]) + label,
2969	+ .ccw_plugin input[type=email]:not(.browser-default):focus:not([readonly]) + label,
2970	+ .ccw_plugin input[type=url]:not(.browser-default):focus:not([readonly]) + label,
2971	+ .ccw_plugin input[type=time]:not(.browser-default):focus:not([readonly]) + label,
2972	+ .ccw_plugin input[type=date]:not(.browser-default):focus:not([readonly]) + label,
2973	+ .ccw_plugin input[type=datetime]:not(.browser-default):focus:not([readonly]) + label,
2974	+ .ccw_plugin input[type=datetime-local]:not(.browser-default):focus:not([readonly]) + label,
2975	+ .ccw_plugin input[type=tel]:not(.browser-default):focus:not([readonly]) + label,
2976	+ .ccw_plugin input[type=number]:not(.browser-default):focus:not([readonly]) + label,
2977	+ .ccw_plugin input[type=search]:not(.browser-default):focus:not([readonly]) + label,
2978	+ .ccw_plugin textarea.materialize-textarea:focus:not([readonly]) + label {
2979	+ color: #26a69a; }
2980	+ .ccw_plugin input:not([type]).validate + label,
2981	+ .ccw_plugin input[type=text]:not(.browser-default).validate + label,
2982	+ .ccw_plugin input[type=password]:not(.browser-default).validate + label,
2983	+ .ccw_plugin input[type=email]:not(.browser-default).validate + label,
2984	+ .ccw_plugin input[type=url]:not(.browser-default).validate + label,
2985	+ .ccw_plugin input[type=time]:not(.browser-default).validate + label,
2986	+ .ccw_plugin input[type=date]:not(.browser-default).validate + label,
2987	+ .ccw_plugin input[type=datetime]:not(.browser-default).validate + label,
2988	+ .ccw_plugin input[type=datetime-local]:not(.browser-default).validate + label,
2989	+ .ccw_plugin input[type=tel]:not(.browser-default).validate + label,
2990	+ .ccw_plugin input[type=number]:not(.browser-default).validate + label,
2991	+ .ccw_plugin input[type=search]:not(.browser-default).validate + label,
2992	+ .ccw_plugin textarea.materialize-textarea.validate + label {
2993	+ width: 100%; }
2994	+ .ccw_plugin input:not([type]).invalid + label:after,
2995	+ .ccw_plugin input:not([type]).valid + label:after,
2996	+ .ccw_plugin input[type=text]:not(.browser-default).invalid + label:after,
2997	+ .ccw_plugin input[type=text]:not(.browser-default).valid + label:after,
2998	+ .ccw_plugin input[type=password]:not(.browser-default).invalid + label:after,
2999	+ .ccw_plugin input[type=password]:not(.browser-default).valid + label:after,
3000	+ .ccw_plugin input[type=email]:not(.browser-default).invalid + label:after,
3001	+ .ccw_plugin input[type=email]:not(.browser-default).valid + label:after,
3002	+ .ccw_plugin input[type=url]:not(.browser-default).invalid + label:after,
3003	+ .ccw_plugin input[type=url]:not(.browser-default).valid + label:after,
3004	+ .ccw_plugin input[type=time]:not(.browser-default).invalid + label:after,
3005	+ .ccw_plugin input[type=time]:not(.browser-default).valid + label:after,
3006	+ .ccw_plugin input[type=date]:not(.browser-default).invalid + label:after,
3007	+ .ccw_plugin input[type=date]:not(.browser-default).valid + label:after,
3008	+ .ccw_plugin input[type=datetime]:not(.browser-default).invalid + label:after,
3009	+ .ccw_plugin input[type=datetime]:not(.browser-default).valid + label:after,
3010	+ .ccw_plugin input[type=datetime-local]:not(.browser-default).invalid + label:after,
3011	+ .ccw_plugin input[type=datetime-local]:not(.browser-default).valid + label:after,
3012	+ .ccw_plugin input[type=tel]:not(.browser-default).invalid + label:after,
3013	+ .ccw_plugin input[type=tel]:not(.browser-default).valid + label:after,
3014	+ .ccw_plugin input[type=number]:not(.browser-default).invalid + label:after,
3015	+ .ccw_plugin input[type=number]:not(.browser-default).valid + label:after,
3016	+ .ccw_plugin input[type=search]:not(.browser-default).invalid + label:after,
3017	+ .ccw_plugin input[type=search]:not(.browser-default).valid + label:after,
3018	+ .ccw_plugin textarea.materialize-textarea.invalid + label:after,
3019	+ .ccw_plugin textarea.materialize-textarea.valid + label:after {
3020	+ display: none; }
3021	+ .ccw_plugin input:not([type]).invalid + label.active:after,
3022	+ .ccw_plugin input:not([type]).valid + label.active:after,
3023	+ .ccw_plugin input[type=text]:not(.browser-default).invalid + label.active:after,
3024	+ .ccw_plugin input[type=text]:not(.browser-default).valid + label.active:after,
3025	+ .ccw_plugin input[type=password]:not(.browser-default).invalid + label.active:after,
3026	+ .ccw_plugin input[type=password]:not(.browser-default).valid + label.active:after,
3027	+ .ccw_plugin input[type=email]:not(.browser-default).invalid + label.active:after,
3028	+ .ccw_plugin input[type=email]:not(.browser-default).valid + label.active:after,
3029	+ .ccw_plugin input[type=url]:not(.browser-default).invalid + label.active:after,
3030	+ .ccw_plugin input[type=url]:not(.browser-default).valid + label.active:after,
3031	+ .ccw_plugin input[type=time]:not(.browser-default).invalid + label.active:after,
3032	+ .ccw_plugin input[type=time]:not(.browser-default).valid + label.active:after,
3033	+ .ccw_plugin input[type=date]:not(.browser-default).invalid + label.active:after,
3034	+ .ccw_plugin input[type=date]:not(.browser-default).valid + label.active:after,
3035	+ .ccw_plugin input[type=datetime]:not(.browser-default).invalid + label.active:after,
3036	+ .ccw_plugin input[type=datetime]:not(.browser-default).valid + label.active:after,
3037	+ .ccw_plugin input[type=datetime-local]:not(.browser-default).invalid + label.active:after,
3038	+ .ccw_plugin input[type=datetime-local]:not(.browser-default).valid + label.active:after,
3039	+ .ccw_plugin input[type=tel]:not(.browser-default).invalid + label.active:after,
3040	+ .ccw_plugin input[type=tel]:not(.browser-default).valid + label.active:after,
3041	+ .ccw_plugin input[type=number]:not(.browser-default).invalid + label.active:after,
3042	+ .ccw_plugin input[type=number]:not(.browser-default).valid + label.active:after,
3043	+ .ccw_plugin input[type=search]:not(.browser-default).invalid + label.active:after,
3044	+ .ccw_plugin input[type=search]:not(.browser-default).valid + label.active:after,
3045	+ .ccw_plugin textarea.materialize-textarea.invalid + label.active:after,
3046	+ .ccw_plugin textarea.materialize-textarea.valid + label.active:after {
3047	+ display: block; }
3048	+ .ccw_plugin input.valid:not([type]), .ccw_plugin input.valid:not([type]):focus, .ccw_plugin input[type=text].valid:not(.browser-default), .ccw_plugin input[type=text].valid:not(.browser-default):focus, .ccw_plugin input[type=password].valid:not(.browser-default), .ccw_plugin input[type=password].valid:not(.browser-default):focus, .ccw_plugin input[type=email].valid:not(.browser-default), .ccw_plugin input[type=email].valid:not(.browser-default):focus, .ccw_plugin input[type=url].valid:not(.browser-default), .ccw_plugin input[type=url].valid:not(.browser-default):focus, .ccw_plugin input[type=time].valid:not(.browser-default), .ccw_plugin input[type=time].valid:not(.browser-default):focus, .ccw_plugin input[type=date].valid:not(.browser-default), .ccw_plugin input[type=date].valid:not(.browser-default):focus, .ccw_plugin input[type=datetime].valid:not(.browser-default), .ccw_plugin input[type=datetime].valid:not(.browser-default):focus, .ccw_plugin input[type=datetime-local].valid:not(.browser-default), .ccw_plugin input[type=datetime-local].valid:not(.browser-default):focus, .ccw_plugin input[type=tel].valid:not(.browser-default), .ccw_plugin input[type=tel].valid:not(.browser-default):focus, .ccw_plugin input[type=number].valid:not(.browser-default), .ccw_plugin input[type=number].valid:not(.browser-default):focus, .ccw_plugin input[type=search].valid:not(.browser-default), .ccw_plugin input[type=search].valid:not(.browser-default):focus, .ccw_plugin textarea.materialize-textarea.valid, .ccw_plugin textarea.materialize-textarea.valid:focus, .ccw_plugin .select-wrapper.valid > input.select-dropdown {
3049	+ border-bottom: 1px solid #4CAF50;
3050	+ box-shadow: 0 1px 0 0 #4CAF50; }
3051	+ .ccw_plugin input.invalid:not([type]), .ccw_plugin input.invalid:not([type]):focus, .ccw_plugin input[type=text].invalid:not(.browser-default), .ccw_plugin input[type=text].invalid:not(.browser-default):focus, .ccw_plugin input[type=password].invalid:not(.browser-default), .ccw_plugin input[type=password].invalid:not(.browser-default):focus, .ccw_plugin input[type=email].invalid:not(.browser-default), .ccw_plugin input[type=email].invalid:not(.browser-default):focus, .ccw_plugin input[type=url].invalid:not(.browser-default), .ccw_plugin input[type=url].invalid:not(.browser-default):focus, .ccw_plugin input[type=time].invalid:not(.browser-default), .ccw_plugin input[type=time].invalid:not(.browser-default):focus, .ccw_plugin input[type=date].invalid:not(.browser-default), .ccw_plugin input[type=date].invalid:not(.browser-default):focus, .ccw_plugin input[type=datetime].invalid:not(.browser-default), .ccw_plugin input[type=datetime].invalid:not(.browser-default):focus, .ccw_plugin input[type=datetime-local].invalid:not(.browser-default), .ccw_plugin input[type=datetime-local].invalid:not(.browser-default):focus, .ccw_plugin input[type=tel].invalid:not(.browser-default), .ccw_plugin input[type=tel].invalid:not(.browser-default):focus, .ccw_plugin input[type=number].invalid:not(.browser-default), .ccw_plugin input[type=number].invalid:not(.browser-default):focus, .ccw_plugin input[type=search].invalid:not(.browser-default), .ccw_plugin input[type=search].invalid:not(.browser-default):focus, .ccw_plugin textarea.materialize-textarea.invalid, .ccw_plugin textarea.materialize-textarea.invalid:focus, .ccw_plugin .select-wrapper.invalid > input.select-dropdown {
3052	+ border-bottom: 1px solid #F44336;
3053	+ box-shadow: 0 1px 0 0 #F44336; }
3054	+ .ccw_plugin input:not([type]).valid + label:after, .ccw_plugin input:not([type]):focus.valid + label:after, .ccw_plugin input[type=text]:not(.browser-default).valid + label:after, .ccw_plugin input[type=text]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=password]:not(.browser-default).valid + label:after, .ccw_plugin input[type=password]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=email]:not(.browser-default).valid + label:after, .ccw_plugin input[type=email]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=url]:not(.browser-default).valid + label:after, .ccw_plugin input[type=url]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=time]:not(.browser-default).valid + label:after, .ccw_plugin input[type=time]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=date]:not(.browser-default).valid + label:after, .ccw_plugin input[type=date]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=datetime]:not(.browser-default).valid + label:after, .ccw_plugin input[type=datetime]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=datetime-local]:not(.browser-default).valid + label:after, .ccw_plugin input[type=datetime-local]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=tel]:not(.browser-default).valid + label:after, .ccw_plugin input[type=tel]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=number]:not(.browser-default).valid + label:after, .ccw_plugin input[type=number]:not(.browser-default):focus.valid + label:after, .ccw_plugin input[type=search]:not(.browser-default).valid + label:after, .ccw_plugin input[type=search]:not(.browser-default):focus.valid + label:after, .ccw_plugin textarea.materialize-textarea.valid + label:after, .ccw_plugin textarea.materialize-textarea:focus.valid + label:after, .ccw_plugin .select-wrapper.valid + label:after {
3055	+ content: attr(data-success);
3056	+ color: #4CAF50;
3057	+ opacity: 1;
3058	+ transform: translateY(9px); }
3059	+ .ccw_plugin input:not([type]).invalid + label:after, .ccw_plugin input:not([type]):focus.invalid + label:after, .ccw_plugin input[type=text]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=text]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=password]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=password]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=email]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=email]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=url]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=url]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=time]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=time]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=date]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=date]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=datetime]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=datetime]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=datetime-local]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=datetime-local]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=tel]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=tel]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=number]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=number]:not(.browser-default):focus.invalid + label:after, .ccw_plugin input[type=search]:not(.browser-default).invalid + label:after, .ccw_plugin input[type=search]:not(.browser-default):focus.invalid + label:after, .ccw_plugin textarea.materialize-textarea.invalid + label:after, .ccw_plugin textarea.materialize-textarea:focus.invalid + label:after, .ccw_plugin .select-wrapper.invalid + label:after {
3060	+ content: attr(data-error);
3061	+ color: #F44336;
3062	+ opacity: 1;
3063	+ transform: translateY(9px); }
3064	+ .ccw_plugin input:not([type]) + label:after, .ccw_plugin input[type=text]:not(.browser-default) + label:after, .ccw_plugin input[type=password]:not(.browser-default) + label:after, .ccw_plugin input[type=email]:not(.browser-default) + label:after, .ccw_plugin input[type=url]:not(.browser-default) + label:after, .ccw_plugin input[type=time]:not(.browser-default) + label:after, .ccw_plugin input[type=date]:not(.browser-default) + label:after, .ccw_plugin input[type=datetime]:not(.browser-default) + label:after, .ccw_plugin input[type=datetime-local]:not(.browser-default) + label:after, .ccw_plugin input[type=tel]:not(.browser-default) + label:after, .ccw_plugin input[type=number]:not(.browser-default) + label:after, .ccw_plugin input[type=search]:not(.browser-default) + label:after, .ccw_plugin textarea.materialize-textarea + label:after, .ccw_plugin .select-wrapper + label:after {
3065	+ display: block;
3066	+ content: "";
3067	+ position: absolute;
3068	+ top: 100%;
3069	+ left: 0;
3070	+ opacity: 0;
3071	+ transition: .2s opacity ease-out, .2s color ease-out; }
3072	+ .ccw_plugin .input-field {
3073	+ position: relative;
3074	+ margin-top: 1rem; }
3075	+ .ccw_plugin .input-field.inline {
3076	+ display: inline-block;
3077	+ vertical-align: middle;
3078	+ margin-left: 5px; }
3079	+ .ccw_plugin .input-field.inline input,
3080	+ .ccw_plugin .input-field.inline .select-dropdown {
3081	+ margin-bottom: 1rem; }
3082	+ .ccw_plugin .input-field.col label {
3083	+ left: 0.75rem; }
3084	+ .ccw_plugin .input-field.col .prefix ~ label,
3085	+ .ccw_plugin .input-field.col .prefix ~ .validate ~ label {
3086	+ width: calc(100% - 3rem - 1.5rem); }
3087	+ .ccw_plugin .input-field label {
3088	+ color: #9e9e9e;
3089	+ position: absolute;
3090	+ top: 0;
3091	+ left: 0;
3092	+ height: 100%;
3093	+ font-size: 1rem;
3094	+ cursor: text;
3095	+ transition: transform .2s ease-out;
3096	+ transform-origin: 0% 100%;
3097	+ text-align: initial;
3098	+ transform: translateY(12px);
3099	+ pointer-events: none; }
3100	+ .ccw_plugin .input-field label:not(.label-icon).active {
3101	+ transform: translateY(-14px) scale(0.8);
3102	+ transform-origin: 0 0; }
3103	+ .ccw_plugin .input-field .prefix {
3104	+ position: absolute;
3105	+ width: 3rem;
3106	+ font-size: 2rem;
3107	+ transition: color .2s; }
3108	+ .ccw_plugin .input-field .prefix.active {
3109	+ color: #26a69a; }
3110	+ .ccw_plugin .input-field .prefix ~ input,
3111	+ .ccw_plugin .input-field .prefix ~ textarea,
3112	+ .ccw_plugin .input-field .prefix ~ label,
3113	+ .ccw_plugin .input-field .prefix ~ .validate ~ label,
3114	+ .ccw_plugin .input-field .prefix ~ .autocomplete-content {
3115	+ margin-left: 3rem;
3116	+ width: 92%;
3117	+ width: calc(100% - 3rem); }
3118	+ .ccw_plugin .input-field .prefix ~ label {
3119	+ margin-left: 3rem; }
3120	+ @media only screen and (max-width: 992px) {
3121	+ .ccw_plugin .input-field .prefix ~ input {
3122	+ width: 86%;
3123	+ width: calc(100% - 3rem); } }
3124	+ @media only screen and (max-width: 600px) {
3125	+ .ccw_plugin .input-field .prefix ~ input {
3126	+ width: 80%;
3127	+ width: calc(100% - 3rem); } }
3128	+ .ccw_plugin .input-field input[type=search] {
3129	+ display: block;
3130	+ line-height: inherit; }
3131	+ .nav-wrapper .ccw_plugin .input-field input[type=search] {
3132	+ height: inherit;
3133	+ padding-left: 4rem;
3134	+ width: calc(100% - 4rem);
3135	+ border: 0;
3136	+ box-shadow: none; }
3137	+ .ccw_plugin .input-field input[type=search]:focus {
3138	+ background-color: #fff;
3139	+ border: 0;
3140	+ box-shadow: none;
3141	+ color: #444; }
3142	+ .ccw_plugin .input-field input[type=search]:focus + label i,
3143	+ .ccw_plugin .input-field input[type=search]:focus ~ .mdi-navigation-close,
3144	+ .ccw_plugin .input-field input[type=search]:focus ~ .material-icons {
3145	+ color: #444; }
3146	+ .ccw_plugin .input-field input[type=search] + label {
3147	+ left: 1rem; }
3148	+ .ccw_plugin .input-field input[type=search] ~ .mdi-navigation-close,
3149	+ .ccw_plugin .input-field input[type=search] ~ .material-icons {
3150	+ position: absolute;
3151	+ top: 0;
3152	+ right: 1rem;
3153	+ color: transparent;
3154	+ cursor: pointer;
3155	+ font-size: 2rem;
3156	+ transition: .3s color; }
3157	+ .ccw_plugin textarea {
3158	+ width: 100%;
3159	+ height: 3rem;
3160	+ background-color: transparent; }
3161	+ .ccw_plugin textarea.materialize-textarea {
3162	+ overflow-y: hidden;
3163	+ /* prevents scroll bar flash */
3164	+ padding: .8rem 0 1.6rem 0;
3165	+ /* prevents text jump on Enter keypress */
3166	+ resize: none;
3167	+ min-height: 3rem; }
3168	+ .ccw_plugin textarea.materialize-textarea.validate + label {
3169	+ height: 100%; }
3170	+ .ccw_plugin textarea.materialize-textarea.validate + label::after {
3171	+ top: calc(100% - 12px); }
3172	+ .ccw_plugin textarea.materialize-textarea.validate + label:not(.label-icon).active {
3173	+ transform: translateY(-25px); }
3174	+ .ccw_plugin .hiddendiv {
3175	+ display: none;
3176	+ white-space: pre-wrap;
3177	+ word-wrap: break-word;
3178	+ overflow-wrap: break-word;
3179	+ /* future version of deprecated 'word-wrap' */
3180	+ padding-top: 1.2rem;
3181	+ /* prevents text jump on Enter keypress */
3182	+ position: absolute;
3183	+ top: 0; }
3184	+ .ccw_plugin .autocomplete-content {
3185	+ margin-top: -20px;
3186	+ margin-bottom: 20px;
3187	+ display: block;
3188	+ opacity: 1;
3189	+ position: static; }
3190	+ .ccw_plugin .autocomplete-content li .highlight {
3191	+ color: #444; }
3192	+ .ccw_plugin .autocomplete-content li img {
3193	+ height: 40px;
3194	+ width: 40px;
3195	+ margin: 5px 15px; }
3196	+ .ccw_plugin [type="radio"]:not(:checked),
3197	+ .ccw_plugin [type="radio"]:checked {
3198	+ position: absolute;
3199	+ opacity: 0;
3200	+ pointer-events: none; }
3201	+ .ccw_plugin [type="radio"]:not(:checked) + label,
3202	+ .ccw_plugin [type="radio"]:checked + label {
3203	+ position: relative;
3204	+ padding-left: 35px;
3205	+ cursor: pointer;
3206	+ display: inline-block;
3207	+ height: 25px;
3208	+ line-height: 25px;
3209	+ font-size: 1rem;
3210	+ transition: .28s ease;
3211	+ user-select: none; }
3212	+ .ccw_plugin [type="radio"] + label:before,
3213	+ .ccw_plugin [type="radio"] + label:after {
3214	+ content: '';
3215	+ position: absolute;
3216	+ left: 0;
3217	+ top: 0;
3218	+ margin: 4px;
3219	+ width: 16px;
3220	+ height: 16px;
3221	+ z-index: 0;
3222	+ transition: .28s ease; }
3223	+ .ccw_plugin [type="radio"]:not(:checked) + label:before,
3224	+ .ccw_plugin [type="radio"]:not(:checked) + label:after,
3225	+ .ccw_plugin [type="radio"]:checked + label:before,
3226	+ .ccw_plugin [type="radio"]:checked + label:after,
3227	+ .ccw_plugin [type="radio"].with-gap:checked + label:before,
3228	+ .ccw_plugin [type="radio"].with-gap:checked + label:after {
3229	+ border-radius: 50%; }
3230	+ .ccw_plugin [type="radio"]:not(:checked) + label:before,
3231	+ .ccw_plugin [type="radio"]:not(:checked) + label:after {
3232	+ border: 2px solid #5a5a5a; }
3233	+ .ccw_plugin [type="radio"]:not(:checked) + label:after {
3234	+ transform: scale(0); }
3235	+ .ccw_plugin [type="radio"]:checked + label:before {
3236	+ border: 2px solid transparent; }
3237	+ .ccw_plugin [type="radio"]:checked + label:after,
3238	+ .ccw_plugin [type="radio"].with-gap:checked + label:before,
3239	+ .ccw_plugin [type="radio"].with-gap:checked + label:after {
3240	+ border: 2px solid #26a69a; }
3241	+ .ccw_plugin [type="radio"]:checked + label:after,
3242	+ .ccw_plugin [type="radio"].with-gap:checked + label:after {
3243	+ background-color: #26a69a; }
3244	+ .ccw_plugin [type="radio"]:checked + label:after {
3245	+ transform: scale(1.02); }
3246	+ .ccw_plugin [type="radio"].with-gap:checked + label:after {
3247	+ transform: scale(0.5); }
3248	+ .ccw_plugin [type="radio"].tabbed:focus + label:before {
3249	+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); }
3250	+ .ccw_plugin [type="radio"].with-gap:disabled:checked + label:before {
3251	+ border: 2px solid rgba(0, 0, 0, 0.42); }
3252	+ .ccw_plugin [type="radio"].with-gap:disabled:checked + label:after {
3253	+ border: none;
3254	+ background-color: rgba(0, 0, 0, 0.42); }
3255	+ .ccw_plugin [type="radio"]:disabled:not(:checked) + label:before,
3256	+ .ccw_plugin [type="radio"]:disabled:checked + label:before {
3257	+ background-color: transparent;
3258	+ border-color: rgba(0, 0, 0, 0.42); }
3259	+ .ccw_plugin [type="radio"]:disabled + label {
3260	+ color: rgba(0, 0, 0, 0.42); }
3261	+ .ccw_plugin [type="radio"]:disabled:not(:checked) + label:before {
3262	+ border-color: rgba(0, 0, 0, 0.42); }
3263	+ .ccw_plugin [type="radio"]:disabled:checked + label:after {
3264	+ background-color: rgba(0, 0, 0, 0.42);
3265	+ border-color: #949494; }
3266	+ .ccw_plugin form p {
3267	+ margin-bottom: 10px;
3268	+ text-align: left; }
3269	+ .ccw_plugin form p:last-child {
3270	+ margin-bottom: 0; }
3271	+ .ccw_plugin [type="checkbox"]:not(:checked),
3272	+ .ccw_plugin [type="checkbox"]:checked {
3273	+ position: absolute;
3274	+ opacity: 0;
3275	+ pointer-events: none; }
3276	+ .ccw_plugin [type="checkbox"] {
3277	+ /* checkbox aspect */ }
3278	+ .ccw_plugin [type="checkbox"] + label {
3279	+ position: relative;
3280	+ padding-left: 35px;
3281	+ cursor: pointer;
3282	+ display: inline-block;
3283	+ height: 25px;
3284	+ line-height: 25px;
3285	+ font-size: 1rem;
3286	+ user-select: none; }
3287	+ .ccw_plugin [type="checkbox"] + label:before,
3288	+ .ccw_plugin [type="checkbox"]:not(.filled-in) + label:after {
3289	+ content: '';
3290	+ position: absolute;
3291	+ top: 0;
3292	+ left: 0;
3293	+ width: 18px;
3294	+ height: 18px;
3295	+ z-index: 0;
3296	+ border: 2px solid #5a5a5a;
3297	+ border-radius: 1px;
3298	+ margin-top: 2px;
3299	+ transition: .2s; }
3300	+ .ccw_plugin [type="checkbox"]:not(.filled-in) + label:after {
3301	+ border: 0;
3302	+ transform: scale(0); }
3303	+ .ccw_plugin [type="checkbox"]:not(:checked):disabled + label:before {
3304	+ border: none;
3305	+ background-color: rgba(0, 0, 0, 0.42); }
3306	+ .ccw_plugin [type="checkbox"].tabbed:focus + label:after {
3307	+ transform: scale(1);
3308	+ border: 0;
3309	+ border-radius: 50%;
3310	+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
3311	+ background-color: rgba(0, 0, 0, 0.1); }
3312	+ .ccw_plugin [type="checkbox"]:checked + label:before {
3313	+ top: -4px;
3314	+ left: -5px;
3315	+ width: 12px;
3316	+ height: 22px;
3317	+ border-top: 2px solid transparent;
3318	+ border-left: 2px solid transparent;
3319	+ border-right: 2px solid #26a69a;
3320	+ border-bottom: 2px solid #26a69a;
3321	+ transform: rotate(40deg);
3322	+ backface-visibility: hidden;
3323	+ transform-origin: 100% 100%; }
3324	+ .ccw_plugin [type="checkbox"]:checked:disabled + label:before {
3325	+ border-right: 2px solid rgba(0, 0, 0, 0.42);
3326	+ border-bottom: 2px solid rgba(0, 0, 0, 0.42); }
3327	+ .ccw_plugin [type="checkbox"]:indeterminate + label:before {
3328	+ top: -11px;
3329	+ left: -12px;
3330	+ width: 10px;
3331	+ height: 22px;
3332	+ border-top: none;
3333	+ border-left: none;
3334	+ border-right: 2px solid #26a69a;
3335	+ border-bottom: none;
3336	+ transform: rotate(90deg);
3337	+ backface-visibility: hidden;
3338	+ transform-origin: 100% 100%; }
3339	+ .ccw_plugin [type="checkbox"]:indeterminate:disabled + label:before {
3340	+ border-right: 2px solid rgba(0, 0, 0, 0.42);
3341	+ background-color: transparent; }
3342	+ .ccw_plugin [type="checkbox"].filled-in + label:after {
3343	+ border-radius: 2px; }
3344	+ .ccw_plugin [type="checkbox"].filled-in + label:before,
3345	+ .ccw_plugin [type="checkbox"].filled-in + label:after {
3346	+ content: '';
3347	+ left: 0;
3348	+ position: absolute;
3349	+ /* .1s delay is for check animation */
3350	+ transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
3351	+ z-index: 1; }
3352	+ .ccw_plugin [type="checkbox"].filled-in:not(:checked) + label:before {
3353	+ width: 0;
3354	+ height: 0;
3355	+ border: 3px solid transparent;
3356	+ left: 6px;
3357	+ top: 10px;
3358	+ transform: rotateZ(37deg);
3359	+ transform-origin: 100% 100%; }
3360	+ .ccw_plugin [type="checkbox"].filled-in:not(:checked) + label:after {
3361	+ height: 20px;
3362	+ width: 20px;
3363	+ background-color: transparent;
3364	+ border: 2px solid #5a5a5a;
3365	+ top: 0px;
3366	+ z-index: 0; }
3367	+ .ccw_plugin [type="checkbox"].filled-in:checked + label:before {
3368	+ top: 0;
3369	+ left: 1px;
3370	+ width: 8px;
3371	+ height: 13px;
3372	+ border-top: 2px solid transparent;
3373	+ border-left: 2px solid transparent;
3374	+ border-right: 2px solid #fff;
3375	+ border-bottom: 2px solid #fff;
3376	+ transform: rotateZ(37deg);
3377	+ transform-origin: 100% 100%; }
3378	+ .ccw_plugin [type="checkbox"].filled-in:checked + label:after {
3379	+ top: 0;
3380	+ width: 20px;
3381	+ height: 20px;
3382	+ border: 2px solid #26a69a;
3383	+ background-color: #26a69a;
3384	+ z-index: 0; }
3385	+ .ccw_plugin [type="checkbox"].filled-in.tabbed:focus + label:after {
3386	+ border-radius: 2px;
3387	+ border-color: #5a5a5a;
3388	+ background-color: rgba(0, 0, 0, 0.1); }
3389	+ .ccw_plugin [type="checkbox"].filled-in.tabbed:checked:focus + label:after {
3390	+ border-radius: 2px;
3391	+ background-color: #26a69a;
3392	+ border-color: #26a69a; }
3393	+ .ccw_plugin [type="checkbox"].filled-in:disabled:not(:checked) + label:before {
3394	+ background-color: transparent;
3395	+ border: 2px solid transparent; }
3396	+ .ccw_plugin [type="checkbox"].filled-in:disabled:not(:checked) + label:after {
3397	+ border-color: transparent;
3398	+ background-color: #949494; }
3399	+ .ccw_plugin [type="checkbox"].filled-in:disabled:checked + label:before {
3400	+ background-color: transparent; }
3401	+ .ccw_plugin [type="checkbox"].filled-in:disabled:checked + label:after {
3402	+ background-color: #949494;
3403	+ border-color: #949494; }
3404	+ .ccw_plugin .switch,
3405	+ .ccw_plugin .switch * {
3406	+ -webkit-tap-highlight-color: transparent;
3407	+ user-select: none; }
3408	+ .ccw_plugin .switch label {
3409	+ cursor: pointer; }
3410	+ .ccw_plugin .switch label input[type=checkbox] {
3411	+ opacity: 0;
3412	+ width: 0;
3413	+ height: 0; }
3414	+ .ccw_plugin .switch label input[type=checkbox]:checked + .lever {
3415	+ background-color: #84c7c1; }
3416	+ .ccw_plugin .switch label input[type=checkbox]:checked + .lever:before, .ccw_plugin .switch label input[type=checkbox]:checked + .lever:after {
3417	+ left: 18px; }
3418	+ .ccw_plugin .switch label input[type=checkbox]:checked + .lever:after {
3419	+ background-color: #26a69a; }
3420	+ .ccw_plugin .switch label .lever {
3421	+ content: "";
3422	+ display: inline-block;
3423	+ position: relative;
3424	+ width: 36px;
3425	+ height: 14px;
3426	+ background-color: rgba(0, 0, 0, 0.38);
3427	+ border-radius: 15px;
3428	+ margin-right: 10px;
3429	+ transition: background 0.3s ease;
3430	+ vertical-align: middle;
3431	+ margin: 0 16px; }
3432	+ .ccw_plugin .switch label .lever:before, .ccw_plugin .switch label .lever:after {
3433	+ content: "";
3434	+ position: absolute;
3435	+ display: inline-block;
3436	+ width: 20px;
3437	+ height: 20px;
3438	+ border-radius: 50%;
3439	+ left: 0;
3440	+ top: -3px;
3441	+ transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease; }
3442	+ .ccw_plugin .switch label .lever:before {
3443	+ background-color: rgba(38, 166, 154, 0.15); }
3444	+ .ccw_plugin .switch label .lever:after {
3445	+ background-color: #F1F1F1;
3446	+ box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12); }
3447	+ .ccw_plugin input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,
3448	+ .ccw_plugin input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before {
3449	+ transform: scale(2.4);
3450	+ background-color: rgba(38, 166, 154, 0.15); }
3451	+ .ccw_plugin input[type=checkbox]:not(:disabled) ~ .lever:active:before,
3452	+ .ccw_plugin input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before {
3453	+ transform: scale(2.4);
3454	+ background-color: rgba(0, 0, 0, 0.08); }
3455	+ .ccw_plugin .switch input[type=checkbox][disabled] + .lever {
3456	+ cursor: default;
3457	+ background-color: rgba(0, 0, 0, 0.12); }
3458	+ .ccw_plugin .switch label input[type=checkbox][disabled] + .lever:after,
3459	+ .ccw_plugin .switch label input[type=checkbox][disabled]:checked + .lever:after {
3460	+ background-color: #949494; }
3461	+ .ccw_plugin select {
3462	+ display: none; }
3463	+ .ccw_plugin select.browser-default {
3464	+ display: block; }
3465	+ .ccw_plugin select {
3466	+ background-color: rgba(255, 255, 255, 0.9);
3467	+ width: 100%;
3468	+ padding: 5px;
3469	+ border: 1px solid #f2f2f2;
3470	+ border-radius: 2px;
3471	+ height: 3rem; }
3472	+ .ccw_plugin .input-field select {
3473	+ display: block;
3474	+ position: absolute;
3475	+ width: 0;
3476	+ pointer-events: none;
3477	+ height: 0;
3478	+ top: 0;
3479	+ left: 0;
3480	+ opacity: 0; }
3481	+ .ccw_plugin .select-label {
3482	+ position: absolute; }
3483	+ .ccw_plugin .select-wrapper {
3484	+ position: relative; }
3485	+ .ccw_plugin .select-wrapper.valid + label,
3486	+ .ccw_plugin .select-wrapper.invalid + label {
3487	+ width: 100%;
3488	+ pointer-events: none; }
3489	+ .ccw_plugin .select-wrapper input.select-dropdown {
3490	+ position: relative;
3491	+ cursor: pointer;
3492	+ background-color: transparent;
3493	+ border: none;
3494	+ border-bottom: 1px solid #9e9e9e;
3495	+ outline: none;
3496	+ height: 3rem;
3497	+ line-height: 3rem;
3498	+ width: 100%;
3499	+ font-size: 1rem;
3500	+ margin: 0 0 20px 0;
3501	+ padding: 0;
3502	+ display: block;
3503	+ user-select: none; }
3504	+ .ccw_plugin .select-wrapper span.caret {
3505	+ color: initial;
3506	+ position: absolute;
3507	+ right: 0;
3508	+ top: 0;
3509	+ bottom: 0;
3510	+ height: 10px;
3511	+ margin: auto 0;
3512	+ font-size: 10px;
3513	+ line-height: 10px; }
3514	+ .ccw_plugin .select-wrapper + label {
3515	+ position: absolute;
3516	+ top: -26px;
3517	+ font-size: 0.8rem; }
3518	+ .ccw_plugin select:disabled {
3519	+ color: rgba(0, 0, 0, 0.42); }
3520	+ .ccw_plugin .select-wrapper.disabled span.caret,
3521	+ .ccw_plugin .select-wrapper.disabled + label {
3522	+ color: rgba(0, 0, 0, 0.42); }
3523	+ .ccw_plugin .select-wrapper input.select-dropdown:disabled {
3524	+ color: rgba(0, 0, 0, 0.42);
3525	+ cursor: default;
3526	+ user-select: none; }
3527	+ .ccw_plugin .select-wrapper i {
3528	+ color: rgba(0, 0, 0, 0.3); }
3529	+ .ccw_plugin .select-dropdown li.disabled,
3530	+ .ccw_plugin .select-dropdown li.disabled > span,
3531	+ .ccw_plugin .select-dropdown li.optgroup {
3532	+ color: rgba(0, 0, 0, 0.3);
3533	+ background-color: transparent; }
3534	+ .ccw_plugin .select-dropdown.dropdown-content li.active {
3535	+ background-color: transparent; }
3536	+ .ccw_plugin .select-dropdown.dropdown-content li:hover {
3537	+ background-color: rgba(0, 0, 0, 0.06); }
3538	+ .ccw_plugin .select-dropdown.dropdown-content li.selected {
3539	+ background-color: rgba(0, 0, 0, 0.03); }
3540	+ .ccw_plugin .prefix ~ .select-wrapper {
3541	+ margin-left: 3rem;
3542	+ width: 92%;
3543	+ width: calc(100% - 3rem); }
3544	+ .ccw_plugin .prefix ~ label {
3545	+ margin-left: 3rem; }
3546	+ .ccw_plugin .select-dropdown li img {
3547	+ height: 40px;
3548	+ width: 40px;
3549	+ margin: 5px 15px;
3550	+ float: right; }
3551	+ .ccw_plugin .select-dropdown li.optgroup {
3552	+ border-top: 1px solid #eee; }
3553	+ .ccw_plugin .select-dropdown li.optgroup.selected > span {
3554	+ color: rgba(0, 0, 0, 0.7); }
3555	+ .ccw_plugin .select-dropdown li.optgroup > span {
3556	+ color: rgba(0, 0, 0, 0.4); }
3557	+ .ccw_plugin .select-dropdown li.optgroup ~ li.optgroup-option {
3558	+ padding-left: 1rem; }
3559	+ .ccw_plugin .file-field {
3560	+ position: relative; }
3561	+ .ccw_plugin .file-field .file-path-wrapper {
3562	+ overflow: hidden;
3563	+ padding-left: 10px; }
3564	+ .ccw_plugin .file-field input.file-path {
3565	+ width: 100%; }
3566	+ .ccw_plugin .file-field .btn, .ccw_plugin .file-field .btn-large {
3567	+ float: left;
3568	+ height: 3rem;
3569	+ line-height: 3rem; }
3570	+ .ccw_plugin .file-field span {
3571	+ cursor: pointer; }
3572	+ .ccw_plugin .file-field input[type=file] {
3573	+ position: absolute;
3574	+ top: 0;
3575	+ right: 0;
3576	+ left: 0;
3577	+ bottom: 0;
3578	+ width: 100%;
3579	+ margin: 0;
3580	+ padding: 0;
3581	+ font-size: 20px;
3582	+ cursor: pointer;
3583	+ opacity: 0;
3584	+ filter: alpha(opacity=0); }
3585	+ .ccw_plugin .file-field input[type=file]::-webkit-file-upload-button {
3586	+ display: none; }
3587	+ .ccw_plugin .range-field {
3588	+ position: relative; }
3589	+ .ccw_plugin input[type=range],
3590	+ .ccw_plugin input[type=range] + .thumb {
3591	+ cursor: pointer; }
3592	+ .ccw_plugin input[type=range] {
3593	+ position: relative;
3594	+ background-color: transparent;
3595	+ border: none;
3596	+ outline: none;
3597	+ width: 100%;
3598	+ margin: 15px 0;
3599	+ padding: 0; }
3600	+ .ccw_plugin input[type=range]:focus {
3601	+ outline: none; }
3602	+ .ccw_plugin input[type=range] + .thumb {
3603	+ position: absolute;
3604	+ top: 10px;
3605	+ left: 0;
3606	+ border: none;
3607	+ height: 0;
3608	+ width: 0;
3609	+ border-radius: 50%;
3610	+ background-color: #26a69a;
3611	+ margin-left: 7px;
3612	+ transform-origin: 50% 50%;
3613	+ transform: rotate(-45deg); }
3614	+ .ccw_plugin input[type=range] + .thumb .value {
3615	+ display: block;
3616	+ width: 30px;
3617	+ text-align: center;
3618	+ color: #26a69a;
3619	+ font-size: 0;
3620	+ transform: rotate(45deg); }
3621	+ .ccw_plugin input[type=range] + .thumb.active {
3622	+ border-radius: 50% 50% 50% 0; }
3623	+ .ccw_plugin input[type=range] + .thumb.active .value {
3624	+ color: #fff;
3625	+ margin-left: -1px;
3626	+ margin-top: 8px;
3627	+ font-size: 10px; }
3628	+ .ccw_plugin input[type=range] {
3629	+ -webkit-appearance: none; }
3630	+ .ccw_plugin input[type=range]::-webkit-slider-runnable-track {
3631	+ height: 3px;
3632	+ background: #c2c0c2;
3633	+ border: none; }
3634	+ .ccw_plugin input[type=range]::-webkit-slider-thumb {
3635	+ -webkit-appearance: none;
3636	+ border: none;
3637	+ height: 14px;
3638	+ width: 14px;
3639	+ border-radius: 50%;
3640	+ background-color: #26a69a;
3641	+ transform-origin: 50% 50%;
3642	+ margin: -5px 0 0 0;
3643	+ transition: .3s; }
3644	+ .ccw_plugin input[type=range]:focus::-webkit-slider-runnable-track {
3645	+ background: #ccc; }
3646	+ .ccw_plugin input[type=range] {
3647	+ /* fix for FF unable to apply focus style bug */
3648	+ border: 1px solid white;
3649	+ /required for proper track sizing in FF/ }
3650	+ .ccw_plugin input[type=range]::-moz-range-track {
3651	+ height: 3px;
3652	+ background: #ddd;
3653	+ border: none; }
3654	+ .ccw_plugin input[type=range]::-moz-range-thumb {
3655	+ border: none;
3656	+ height: 14px;
3657	+ width: 14px;
3658	+ border-radius: 50%;
3659	+ background: #26a69a;
3660	+ margin-top: -5px; }
3661	+ .ccw_plugin input[type=range]:-moz-focusring {
3662	+ outline: 1px solid #fff;
3663	+ outline-offset: -1px; }
3664	+ .ccw_plugin input[type=range]:focus::-moz-range-track {
3665	+ background: #ccc; }
3666	+ .ccw_plugin input[type=range]::-ms-track {
3667	+ height: 3px;
3668	+ background: transparent;
3669	+ border-color: transparent;
3670	+ border-width: 6px 0;
3671	+ /remove default tick marks/
3672	+ color: transparent; }
3673	+ .ccw_plugin input[type=range]::-ms-fill-lower {
3674	+ background: #777; }
3675	+ .ccw_plugin input[type=range]::-ms-fill-upper {
3676	+ background: #ddd; }
3677	+ .ccw_plugin input[type=range]::-ms-thumb {
3678	+ border: none;
3679	+ height: 14px;
3680	+ width: 14px;
3681	+ border-radius: 50%;
3682	+ background: #26a69a; }
3683	+ .ccw_plugin input[type=range]:focus::-ms-fill-lower {
3684	+ background: #888; }
3685	+ .ccw_plugin input[type=range]:focus::-ms-fill-upper {
3686	+ background: #ccc; }
3687	+
3688	+
3689	+
3690	+
3691	+ /* ==== custom styles ==== */
3692	+
3693	+ div.ccw_plugin,
3694	+ .inline {
3695	+ display: inline; }
3696	+
3697	+ .inline-block {
3698	+ display: inline-block; }
3699	+
3700	+ .chatbot {
3701	+ position: fixed;
3702	+ z-index: 99; }
3703	+
3704	+ .img-icon {
3705	+ height: 48px; }
3706	+
3707	+ .nofocus:focus {
3708	+ outline: none; }
3709	+
3710	+ .pointer {
3711	+ cursor: pointer; }
3712	+
3713	+ .sc_item {
3714	+ z-index: 99; }
3715	+
3716	+ .style-3-sc {
3717	+ height: 20px; }
3718	+
3719	+ .img-icon-5 {
3720	+ height: 80%;
3721	+ vertical-align: middle; }
3722	+
3723	+ .img-icon-6 {
3724	+ height: 63%;
3725	+ vertical-align: middle;
3726	+ margin-left: 7px; }
3727	+
3728	+ .style-6-img {
3729	+ max-height: 40px;
3730	+ text-decoration: overline; }
3731	+
3732	+ .icon-2 {
3733	+ font-size: 2rem; }
3734	+
3735	+ .btn_only_style_div_circle {
3736	+ border-radius: 50%;
3737	+ text-align: center; }
3738	+
3739	+ .btn_only_style_div_circle_sc {
3740	+ background-color: orange;
3741	+ border-radius: 50%;
3742	+ height: 48px;
3743	+ width: 48px;
3744	+ line-height: 48px;
3745	+ text-align: center; }
3746	+
3747	+ .btn_only_style_div {
3748	+ background-color: orange;
3749	+ height: 48px;
3750	+ width: 48px;
3751	+ line-height: 48px;
3752	+ text-align: center; }
3753	+
3754	+ /* customize styles */
3755	+ .style8 span {
3756	+ text-transform: none; }

assets/fonts/ccw.eot ADDED Viewed

Binary file

assets/fonts/ccw.svg ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ <?xml version="1.0" standalone="no"?>
2	+ <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
3	+ <svg xmlns="http://www.w3.org/2000/svg">
4	+ <metadata>Generated by IcoMoon</metadata>
5	+ <defs>
6	+ <font id="ccw" horiz-adv-x="1024">
7	+ <font-face units-per-em="1024" ascent="960" descent="-64" />
8	+ <missing-glyph horiz-adv-x="1024" />
9	+ <glyph unicode=" " horiz-adv-x="512" d="" />
10	+ <glyph unicode="" glyph-name="send" d="M64 64v298l640 86-640 86v298l896-384z" />
11	+ <glyph unicode="" glyph-name="brand" d="M746.56 346.368c-12.8 6.4-75.328 36.992-87.040 41.216-11.648 4.288-20.16 6.4-28.672-6.4-8.448-12.608-32.896-41.152-40.32-49.6-7.424-8.32-14.848-8.96-27.52-3.2-12.8 6.4-53.888 19.84-102.528 63.36-37.888 33.92-63.36 75.52-70.848 88.32-7.424 12.8-0.832 19.84 5.568 26.24 5.76 5.76 12.8 14.72 19.2 22.4 6.272 7.68 8.32 12.8 12.672 21.12 4.224 8.96 2.112 16-1.088 22.4s-28.672 69.12-39.296 94.080c-10.24 24.96-20.8 21.76-28.672 21.76-7.36 0.64-15.872 0.64-24.32 0.64-8.576 0-22.4-3.2-34.048-15.36-11.648-12.8-44.544-43.52-44.544-105.6s45.632-122.24 51.968-131.2c6.4-8.32 89.856-136.32 217.6-191.36 30.464-12.8 54.144-20.48 72.704-26.88 30.464-9.6 58.24-8.32 80.192-5.12 24.512 3.84 75.392 30.72 86.016 60.8 10.88 30.080 10.88 55.040 7.68 60.8s-11.52 8.96-24.32 14.72zM514.56 32h-0.64c-75.52 0-150.4 20.48-215.68 58.88l-15.36 9.152-160-41.6 42.88 155.52-10.24 16c-42.24 67.2-64.64 144.64-64.64 224.384 0 232.32 190.080 421.76 424.192 421.76 113.28 0 219.52-44.16 299.52-124.16 80-79.36 124.16-185.6 124.16-298.24-0.192-232.32-190.272-421.76-423.872-421.76zM875.52 812.8c-97.28 94.080-225.28 147.2-361.6 147.2-280.832 0-509.44-227.584-509.632-507.392 0-89.408 23.424-176.64 68.032-253.696l-72.32-262.912 270.272 70.528c74.496-40.32 158.336-61.696 243.648-61.76h0.256c280.96 0 509.696 227.648 509.824 507.52 0 135.488-52.928 263.040-149.12 358.912z" />
12	+ <glyph unicode="" glyph-name="whatsapp2" horiz-adv-x="878" d="M562.857 394.286c9.714 0 102.857-48.571 106.857-55.429 1.143-2.857 1.143-6.286 1.143-8.571 0-14.286-4.571-30.286-9.714-43.429-13.143-32-66.286-52.571-98.857-52.571-27.429 0-84 24-108.571 35.429-81.714 37.143-132.571 100.571-181.714 173.143-21.714 32-41.143 71.429-40.571 110.857v4.571c1.143 37.714 14.857 64.571 42.286 90.286 8.571 8 17.714 12.571 29.714 12.571 6.857 0 13.714-1.714 21.143-1.714 15.429 0 18.286-4.571 24-19.429 4-9.714 33.143-87.429 33.143-93.143 0-21.714-39.429-46.286-39.429-59.429 0-2.857 1.143-5.714 2.857-8.571 12.571-26.857 36.571-57.714 58.286-78.286 26.286-25.143 54.286-41.714 86.286-57.714 4-2.286 8-4 12.571-4 17.143 0 45.714 55.429 60.571 55.429zM446.857 91.428c197.714 0 358.857 161.143 358.857 358.857s-161.143 358.857-358.857 358.857-358.857-161.143-358.857-358.857c0-75.429 24-149.143 68.571-210.286l-45.143-133.143 138.286 44c58.286-38.286 127.429-59.429 197.143-59.429zM446.857 881.143c237.714 0 430.857-193.143 430.857-430.857s-193.143-430.857-430.857-430.857c-72.571 0-144.571 18.286-208.571 53.714l-238.286-76.571 77.714 231.429c-40.571 66.857-61.714 144-61.714 222.286 0 237.714 193.143 430.857 430.857 430.857z" />
13	+ <glyph unicode="" glyph-name="whatsapp" d="M873 811.2c-95.8 96-223.2 148.8-359 148.8-279.6 0-507.2-227.6-507.2-507.4 0-89.4 23.4-176.8 67.8-253.6l-72-263 269 70.6c74.2-40.4 157.6-61.8 242.4-61.8h0.2c0 0 0 0 0 0 279.6 0 507.4 227.6 507.4 507.4 0 135.6-52.8 263-148.6 359zM514.2 30.4v0c-75.8 0-150 20.4-214.8 58.8l-15.4 9.2-159.6-41.8 42.6 155.6-10 16c-42.4 67-64.6 144.6-64.6 224.4 0 232.6 189.2 421.8 422 421.8 112.6 0 218.6-44 298.2-123.6 79.6-79.8 123.4-185.6 123.4-298.4-0.2-232.8-189.4-422-421.8-422zM745.4 346.4c-12.6 6.4-75 37-86.6 41.2s-20 6.4-28.6-6.4c-8.4-12.6-32.8-41.2-40.2-49.8-7.4-8.4-14.8-9.6-27.4-3.2s-53.6 19.8-102 63c-37.6 33.6-63.2 75.2-70.6 87.8s-0.8 19.6 5.6 25.8c5.8 5.6 12.6 14.8 19 22.2s8.4 12.6 12.6 21.2c4.2 8.4 2.2 15.8-1 22.2s-28.6 68.8-39 94.2c-10.2 24.8-20.8 21.4-28.6 21.8-7.4 0.4-15.8 0.4-24.2 0.4s-22.2-3.2-33.8-15.8c-11.6-12.6-44.4-43.4-44.4-105.8s45.4-122.6 51.8-131.2c6.4-8.4 89.4-136.6 216.6-191.4 30.2-13 53.8-20.8 72.2-26.8 30.4-9.6 58-8.2 79.8-5 24.4 3.6 75 30.6 85.6 60.2s10.6 55 7.4 60.2c-3 5.6-11.4 8.8-24.2 15.2z" />
14	+ </font></defs></svg>

assets/fonts/ccw.ttf ADDED Viewed

Binary file

assets/fonts/ccw.woff ADDED Viewed

Binary file

assets/img/WhatsApp_logo_12.png ADDED Viewed

Binary file

assets/img/send.svg ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ <!-- Generated by IcoMoon.io -->
2	+ <svg version="1.1" xmlns="http://www.w3.org/2000/svg" width="768" height="768" viewBox="0 0 768 768">
3	+ <title></title>
4	+ <g id="icomoon-ignore">
5	+ </g>
6	+ <path fill="#fff" d="M64.5 672v-223.5l480-64.5-480-64.5v-223.5l672 288z"></path>
7	+ </svg>

assets/img/send_16.svg ADDED Viewed

	@@ -0,0 +1,4 @@


1	+ <!-- Generated by IcoMoon.io -->
2	+ <svg version="1.1" xmlns="http://www.w3.org/2000/svg" width="512" height="512" viewBox="0 0 512 512">
3	+ <path fill="#fff" d="M32 448v-149l320-43-320-43v-149l448 192z"></path>
4	+ </svg>

assets/img/whatsapp.svg ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ <!-- Generated by IcoMoon.io -->
2	+ <svg version="1.1" xmlns="http://www.w3.org/2000/svg" width="384" height="448" viewBox="0 0 384 448">
3	+ <title></title>
4	+ <g id="icomoon-ignore">
5	+ </g>
6	+ <path fill="#000" d="M246.25 243.5c4.25 0 45 21.25 46.75 24.25 0.5 1.25 0.5 2.75 0.5 3.75 0 6.25-2 13.25-4.25 19-5.75 14-29 23-43.25 23-12 0-36.75-10.5-47.5-15.5-35.75-16.25-58-44-79.5-75.75-9.5-14-18-31.25-17.75-48.5v-2c0.5-16.5 6.5-28.25 18.5-39.5 3.75-3.5 7.75-5.5 13-5.5 3 0 6 0.75 9.25 0.75 6.75 0 8 2 10.5 8.5 1.75 4.25 14.5 38.25 14.5 40.75 0 9.5-17.25 20.25-17.25 26 0 1.25 0.5 2.5 1.25 3.75 5.5 11.75 16 25.25 25.5 34.25 11.5 11 23.75 18.25 37.75 25.25 1.75 1 3.5 1.75 5.5 1.75 7.5 0 20-24.25 26.5-24.25zM195.5 376c86.5 0 157-70.5 157-157s-70.5-157-157-157-157 70.5-157 157c0 33 10.5 65.25 30 92l-19.75 58.25 60.5-19.25c25.5 16.75 55.75 26 86.25 26zM195.5 30.5c104 0 188.5 84.5 188.5 188.5s-84.5 188.5-188.5 188.5c-31.75 0-63.25-8-91.25-23.5l-104.25 33.5 34-101.25c-17.75-29.25-27-63-27-97.25 0-104 84.5-188.5 188.5-188.5z"></path>
7	+ </svg>

assets/js/admin_app.js ADDED Viewed

	@@ -0,0 +1,23107 @@


1	+ /******/ (function(modules) { // webpackBootstrap
2	+ /******/ // The module cache
3	+ /******/ var installedModules = {};
4	+ /******/
5	+ /******/ // The require function
6	+ /******/ function __webpack_require__(moduleId) {
7	+ /******/
8	+ /******/ // Check if module is in cache
9	+ /******/ if(installedModules[moduleId]) {
10	+ /******/ return installedModules[moduleId].exports;
11	+ /******/ }
12	+ /******/ // Create a new module (and put it into the cache)
13	+ /******/ var module = installedModules[moduleId] = {
14	+ /******/ i: moduleId,
15	+ /******/ l: false,
16	+ /******/ exports: {}
17	+ /******/ };
18	+ /******/
19	+ /******/ // Execute the module function
20	+ /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
21	+ /******/
22	+ /******/ // Flag the module as loaded
23	+ /******/ module.l = true;
24	+ /******/
25	+ /******/ // Return the exports of the module
26	+ /******/ return module.exports;
27	+ /******/ }
28	+ /******/
29	+ /******/
30	+ /******/ // expose the modules object (__webpack_modules__)
31	+ /******/ __webpack_require__.m = modules;
32	+ /******/
33	+ /******/ // expose the module cache
34	+ /******/ __webpack_require__.c = installedModules;
35	+ /******/
36	+ /******/ // define getter function for harmony exports
37	+ /******/ __webpack_require__.d = function(exports, name, getter) {
38	+ /******/ if(!__webpack_require__.o(exports, name)) {
39	+ /******/ Object.defineProperty(exports, name, {
40	+ /******/ configurable: false,
41	+ /******/ enumerable: true,
42	+ /******/ get: getter
43	+ /******/ });
44	+ /******/ }
45	+ /******/ };
46	+ /******/
47	+ /******/ // getDefaultExport function for compatibility with non-harmony modules
48	+ /******/ __webpack_require__.n = function(module) {
49	+ /******/ var getter = module && module.__esModule ?
50	+ /******/ function getDefault() { return module['default']; } :
51	+ /******/ function getModuleExports() { return module; };
52	+ /******/ __webpack_require__.d(getter, 'a', getter);
53	+ /******/ return getter;
54	+ /******/ };
55	+ /******/
56	+ /******/ // Object.prototype.hasOwnProperty.call
57	+ /******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
58	+ /******/
59	+ /******/ // __webpack_public_path__
60	+ /******/ __webpack_require__.p = "";
61	+ /******/
62	+ /******/ // Load entry module and return exports
63	+ /******/ return __webpack_require__(__webpack_require__.s = 5);
64	+ /******/ })
65	+ /************************************************************************/
66	+ /******/ ([
67	+ /* 0 */
68	+ /***/ (function(module, exports, __webpack_require__) {
69	+
70	+ var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
71	+ * jQuery JavaScript Library v3.2.1
72	+ * https://jquery.com/
73	+ *
74	+ * Includes Sizzle.js
75	+ * https://sizzlejs.com/
76	+ *
77	+ * Copyright JS Foundation and other contributors
78	+ * Released under the MIT license
79	+ * https://jquery.org/license
80	+ *
81	+ * Date: 2017-03-20T18:59Z
82	+ */
83	+ ( function( global, factory ) {
84	+
85	+ "use strict";
86	+
87	+ if ( typeof module === "object" && typeof module.exports === "object" ) {
88	+
89	+ // For CommonJS and CommonJS-like environments where a proper `window`
90	+ // is present, execute the factory and get jQuery.
91	+ // For environments that do not have a `window` with a `document`
92	+ // (such as Node.js), expose a factory as module.exports.
93	+ // This accentuates the need for the creation of a real `window`.
94	+ // e.g. var jQuery = require("jquery")(window);
95	+ // See ticket #14549 for more info.
96	+ module.exports = global.document ?
97	+ factory( global, true ) :
98	+ function( w ) {
99	+ if ( !w.document ) {
100	+ throw new Error( "jQuery requires a window with a document" );
101	+ }
102	+ return factory( w );
103	+ };
104	+ } else {
105	+ factory( global );
106	+ }
107	+
108	+ // Pass this if window is not defined yet
109	+ } )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
110	+
111	+ // Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
112	+ // throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
113	+ // arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
114	+ // enough that all such attempts are guarded in a try block.
115	+ "use strict";
116	+
117	+ var arr = [];
118	+
119	+ var document = window.document;
120	+
121	+ var getProto = Object.getPrototypeOf;
122	+
123	+ var slice = arr.slice;
124	+
125	+ var concat = arr.concat;
126	+
127	+ var push = arr.push;
128	+
129	+ var indexOf = arr.indexOf;
130	+
131	+ var class2type = {};
132	+
133	+ var toString = class2type.toString;
134	+
135	+ var hasOwn = class2type.hasOwnProperty;
136	+
137	+ var fnToString = hasOwn.toString;
138	+
139	+ var ObjectFunctionString = fnToString.call( Object );
140	+
141	+ var support = {};
142	+
143	+
144	+
145	+ function DOMEval( code, doc ) {
146	+ doc = doc \|\| document;
147	+
148	+ var script = doc.createElement( "script" );
149	+
150	+ script.text = code;
151	+ doc.head.appendChild( script ).parentNode.removeChild( script );
152	+ }
153	+ /* global Symbol */
154	+ // Defining this global in .eslintrc.json would create a danger of using the global
155	+ // unguarded in another place, it seems safer to define global only for this module
156	+
157	+
158	+
159	+ var
160	+ version = "3.2.1",
161	+
162	+ // Define a local copy of jQuery
163	+ jQuery = function( selector, context ) {
164	+
165	+ // The jQuery object is actually just the init constructor 'enhanced'
166	+ // Need init if jQuery is called (just allow error to be thrown if not included)
167	+ return new jQuery.fn.init( selector, context );
168	+ },
169	+
170	+ // Support: Android <=4.0 only
171	+ // Make sure we trim BOM and NBSP
172	+ rtrim = /^[\s\uFEFF\xA0]+\|[\s\uFEFF\xA0]+$/g,
173	+
174	+ // Matches dashed string for camelizing
175	+ rmsPrefix = /^-ms-/,
176	+ rdashAlpha = /-([a-z])/g,
177	+
178	+ // Used by jQuery.camelCase as callback to replace()
179	+ fcamelCase = function( all, letter ) {
180	+ return letter.toUpperCase();
181	+ };
182	+
183	+ jQuery.fn = jQuery.prototype = {
184	+
185	+ // The current version of jQuery being used
186	+ jquery: version,
187	+
188	+ constructor: jQuery,
189	+
190	+ // The default length of a jQuery object is 0
191	+ length: 0,
192	+
193	+ toArray: function() {
194	+ return slice.call( this );
195	+ },
196	+
197	+ // Get the Nth element in the matched element set OR
198	+ // Get the whole matched element set as a clean array
199	+ get: function( num ) {
200	+
201	+ // Return all the elements in a clean array
202	+ if ( num == null ) {
203	+ return slice.call( this );
204	+ }
205	+
206	+ // Return just the one element from the set
207	+ return num < 0 ? this[ num + this.length ] : this[ num ];
208	+ },
209	+
210	+ // Take an array of elements and push it onto the stack
211	+ // (returning the new matched element set)
212	+ pushStack: function( elems ) {
213	+
214	+ // Build a new jQuery matched element set
215	+ var ret = jQuery.merge( this.constructor(), elems );
216	+
217	+ // Add the old object onto the stack (as a reference)
218	+ ret.prevObject = this;
219	+
220	+ // Return the newly-formed element set
221	+ return ret;
222	+ },
223	+
224	+ // Execute a callback for every element in the matched set.
225	+ each: function( callback ) {
226	+ return jQuery.each( this, callback );
227	+ },
228	+
229	+ map: function( callback ) {
230	+ return this.pushStack( jQuery.map( this, function( elem, i ) {
231	+ return callback.call( elem, i, elem );
232	+ } ) );
233	+ },
234	+
235	+ slice: function() {
236	+ return this.pushStack( slice.apply( this, arguments ) );
237	+ },
238	+
239	+ first: function() {
240	+ return this.eq( 0 );
241	+ },
242	+
243	+ last: function() {
244	+ return this.eq( -1 );
245	+ },
246	+
247	+ eq: function( i ) {
248	+ var len = this.length,
249	+ j = +i + ( i < 0 ? len : 0 );
250	+ return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
251	+ },
252	+
253	+ end: function() {
254	+ return this.prevObject \|\| this.constructor();
255	+ },
256	+
257	+ // For internal use only.
258	+ // Behaves like an Array's method, not like a jQuery method.
259	+ push: push,
260	+ sort: arr.sort,
261	+ splice: arr.splice
262	+ };
263	+
264	+ jQuery.extend = jQuery.fn.extend = function() {
265	+ var options, name, src, copy, copyIsArray, clone,
266	+ target = arguments[ 0 ] \|\| {},
267	+ i = 1,
268	+ length = arguments.length,
269	+ deep = false;
270	+
271	+ // Handle a deep copy situation
272	+ if ( typeof target === "boolean" ) {
273	+ deep = target;
274	+
275	+ // Skip the boolean and the target
276	+ target = arguments[ i ] \|\| {};
277	+ i++;
278	+ }
279	+
280	+ // Handle case when target is a string or something (possible in deep copy)
281	+ if ( typeof target !== "object" && !jQuery.isFunction( target ) ) {
282	+ target = {};
283	+ }
284	+
285	+ // Extend jQuery itself if only one argument is passed
286	+ if ( i === length ) {
287	+ target = this;
288	+ i--;
289	+ }
290	+
291	+ for ( ; i < length; i++ ) {
292	+
293	+ // Only deal with non-null/undefined values
294	+ if ( ( options = arguments[ i ] ) != null ) {
295	+
296	+ // Extend the base object
297	+ for ( name in options ) {
298	+ src = target[ name ];
299	+ copy = options[ name ];
300	+
301	+ // Prevent never-ending loop
302	+ if ( target === copy ) {
303	+ continue;
304	+ }
305	+
306	+ // Recurse if we're merging plain objects or arrays
307	+ if ( deep && copy && ( jQuery.isPlainObject( copy ) \|\|
308	+ ( copyIsArray = Array.isArray( copy ) ) ) ) {
309	+
310	+ if ( copyIsArray ) {
311	+ copyIsArray = false;
312	+ clone = src && Array.isArray( src ) ? src : [];
313	+
314	+ } else {
315	+ clone = src && jQuery.isPlainObject( src ) ? src : {};
316	+ }
317	+
318	+ // Never move original objects, clone them
319	+ target[ name ] = jQuery.extend( deep, clone, copy );
320	+
321	+ // Don't bring in undefined values
322	+ } else if ( copy !== undefined ) {
323	+ target[ name ] = copy;
324	+ }
325	+ }
326	+ }
327	+ }
328	+
329	+ // Return the modified object
330	+ return target;
331	+ };
332	+
333	+ jQuery.extend( {
334	+
335	+ // Unique for each copy of jQuery on the page
336	+ expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
337	+
338	+ // Assume jQuery is ready without the ready module
339	+ isReady: true,
340	+
341	+ error: function( msg ) {
342	+ throw new Error( msg );
343	+ },
344	+
345	+ noop: function() {},
346	+
347	+ isFunction: function( obj ) {
348	+ return jQuery.type( obj ) === "function";
349	+ },
350	+
351	+ isWindow: function( obj ) {
352	+ return obj != null && obj === obj.window;
353	+ },
354	+
355	+ isNumeric: function( obj ) {
356	+
357	+ // As of jQuery 3.0, isNumeric is limited to
358	+ // strings and numbers (primitives or objects)
359	+ // that can be coerced to finite numbers (gh-2662)
360	+ var type = jQuery.type( obj );
361	+ return ( type === "number" \|\| type === "string" ) &&
362	+
363	+ // parseFloat NaNs numeric-cast false positives ("")
364	+ // ...but misinterprets leading-number strings, particularly hex literals ("0x...")
365	+ // subtraction forces infinities to NaN
366	+ !isNaN( obj - parseFloat( obj ) );
367	+ },
368	+
369	+ isPlainObject: function( obj ) {
370	+ var proto, Ctor;
371	+
372	+ // Detect obvious negatives
373	+ // Use toString instead of jQuery.type to catch host objects
374	+ if ( !obj \|\| toString.call( obj ) !== "[object Object]" ) {
375	+ return false;
376	+ }
377	+
378	+ proto = getProto( obj );
379	+
380	+ // Objects with no prototype (e.g., `Object.create( null )`) are plain
381	+ if ( !proto ) {
382	+ return true;
383	+ }
384	+
385	+ // Objects with prototype are plain iff they were constructed by a global Object function
386	+ Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
387	+ return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
388	+ },
389	+
390	+ isEmptyObject: function( obj ) {
391	+
392	+ /* eslint-disable no-unused-vars */
393	+ // See https://github.com/eslint/eslint/issues/6125
394	+ var name;
395	+
396	+ for ( name in obj ) {
397	+ return false;
398	+ }
399	+ return true;
400	+ },
401	+
402	+ type: function( obj ) {
403	+ if ( obj == null ) {
404	+ return obj + "";
405	+ }
406	+
407	+ // Support: Android <=2.3 only (functionish RegExp)
408	+ return typeof obj === "object" \|\| typeof obj === "function" ?
409	+ class2type[ toString.call( obj ) ] \|\| "object" :
410	+ typeof obj;
411	+ },
412	+
413	+ // Evaluates a script in a global context
414	+ globalEval: function( code ) {
415	+ DOMEval( code );
416	+ },
417	+
418	+ // Convert dashed to camelCase; used by the css and data modules
419	+ // Support: IE <=9 - 11, Edge 12 - 13
420	+ // Microsoft forgot to hump their vendor prefix (#9572)
421	+ camelCase: function( string ) {
422	+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
423	+ },
424	+
425	+ each: function( obj, callback ) {
426	+ var length, i = 0;
427	+
428	+ if ( isArrayLike( obj ) ) {
429	+ length = obj.length;
430	+ for ( ; i < length; i++ ) {
431	+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
432	+ break;
433	+ }
434	+ }
435	+ } else {
436	+ for ( i in obj ) {
437	+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
438	+ break;
439	+ }
440	+ }
441	+ }
442	+
443	+ return obj;
444	+ },
445	+
446	+ // Support: Android <=4.0 only
447	+ trim: function( text ) {
448	+ return text == null ?
449	+ "" :
450	+ ( text + "" ).replace( rtrim, "" );
451	+ },
452	+
453	+ // results is for internal usage only
454	+ makeArray: function( arr, results ) {
455	+ var ret = results \|\| [];
456	+
457	+ if ( arr != null ) {
458	+ if ( isArrayLike( Object( arr ) ) ) {
459	+ jQuery.merge( ret,
460	+ typeof arr === "string" ?
461	+ [ arr ] : arr
462	+ );
463	+ } else {
464	+ push.call( ret, arr );
465	+ }
466	+ }
467	+
468	+ return ret;
469	+ },
470	+
471	+ inArray: function( elem, arr, i ) {
472	+ return arr == null ? -1 : indexOf.call( arr, elem, i );
473	+ },
474	+
475	+ // Support: Android <=4.0 only, PhantomJS 1 only
476	+ // push.apply(_, arraylike) throws on ancient WebKit
477	+ merge: function( first, second ) {
478	+ var len = +second.length,
479	+ j = 0,
480	+ i = first.length;
481	+
482	+ for ( ; j < len; j++ ) {
483	+ first[ i++ ] = second[ j ];
484	+ }
485	+
486	+ first.length = i;
487	+
488	+ return first;
489	+ },
490	+
491	+ grep: function( elems, callback, invert ) {
492	+ var callbackInverse,
493	+ matches = [],
494	+ i = 0,
495	+ length = elems.length,
496	+ callbackExpect = !invert;
497	+
498	+ // Go through the array, only saving the items
499	+ // that pass the validator function
500	+ for ( ; i < length; i++ ) {
501	+ callbackInverse = !callback( elems[ i ], i );
502	+ if ( callbackInverse !== callbackExpect ) {
503	+ matches.push( elems[ i ] );
504	+ }
505	+ }
506	+
507	+ return matches;
508	+ },
509	+
510	+ // arg is for internal usage only
511	+ map: function( elems, callback, arg ) {
512	+ var length, value,
513	+ i = 0,
514	+ ret = [];
515	+
516	+ // Go through the array, translating each of the items to their new values
517	+ if ( isArrayLike( elems ) ) {
518	+ length = elems.length;
519	+ for ( ; i < length; i++ ) {
520	+ value = callback( elems[ i ], i, arg );
521	+
522	+ if ( value != null ) {
523	+ ret.push( value );
524	+ }
525	+ }
526	+
527	+ // Go through every key on the object,
528	+ } else {
529	+ for ( i in elems ) {
530	+ value = callback( elems[ i ], i, arg );
531	+
532	+ if ( value != null ) {
533	+ ret.push( value );
534	+ }
535	+ }
536	+ }
537	+
538	+ // Flatten any nested arrays
539	+ return concat.apply( [], ret );
540	+ },
541	+
542	+ // A global GUID counter for objects
543	+ guid: 1,
544	+
545	+ // Bind a function to a context, optionally partially applying any
546	+ // arguments.
547	+ proxy: function( fn, context ) {
548	+ var tmp, args, proxy;
549	+
550	+ if ( typeof context === "string" ) {
551	+ tmp = fn[ context ];
552	+ context = fn;
553	+ fn = tmp;
554	+ }
555	+
556	+ // Quick check to determine if target is callable, in the spec
557	+ // this throws a TypeError, but we will just return undefined.
558	+ if ( !jQuery.isFunction( fn ) ) {
559	+ return undefined;
560	+ }
561	+
562	+ // Simulated bind
563	+ args = slice.call( arguments, 2 );
564	+ proxy = function() {
565	+ return fn.apply( context \|\| this, args.concat( slice.call( arguments ) ) );
566	+ };
567	+
568	+ // Set the guid of unique handler to the same of original handler, so it can be removed
569	+ proxy.guid = fn.guid = fn.guid \|\| jQuery.guid++;
570	+
571	+ return proxy;
572	+ },
573	+
574	+ now: Date.now,
575	+
576	+ // jQuery.support is not used in Core but other projects attach their
577	+ // properties to it so it needs to exist.
578	+ support: support
579	+ } );
580	+
581	+ if ( typeof Symbol === "function" ) {
582	+ jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
583	+ }
584	+
585	+ // Populate the class2type map
586	+ jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
587	+ function( i, name ) {
588	+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
589	+ } );
590	+
591	+ function isArrayLike( obj ) {
592	+
593	+ // Support: real iOS 8.2 only (not reproducible in simulator)
594	+ // `in` check used to prevent JIT error (gh-2145)
595	+ // hasOwn isn't used here due to false negatives
596	+ // regarding Nodelist length in IE
597	+ var length = !!obj && "length" in obj && obj.length,
598	+ type = jQuery.type( obj );
599	+
600	+ if ( type === "function" \|\| jQuery.isWindow( obj ) ) {
601	+ return false;
602	+ }
603	+
604	+ return type === "array" \|\| length === 0 \|\|
605	+ typeof length === "number" && length > 0 && ( length - 1 ) in obj;
606	+ }
607	+ var Sizzle =
608	+ /*!
609	+ * Sizzle CSS Selector Engine v2.3.3
610	+ * https://sizzlejs.com/
611	+ *
612	+ * Copyright jQuery Foundation and other contributors
613	+ * Released under the MIT license
614	+ * http://jquery.org/license
615	+ *
616	+ * Date: 2016-08-08
617	+ */
618	+ (function( window ) {
619	+
620	+ var i,
621	+ support,
622	+ Expr,
623	+ getText,
624	+ isXML,
625	+ tokenize,
626	+ compile,
627	+ select,
628	+ outermostContext,
629	+ sortInput,
630	+ hasDuplicate,
631	+
632	+ // Local document vars
633	+ setDocument,
634	+ document,
635	+ docElem,
636	+ documentIsHTML,
637	+ rbuggyQSA,
638	+ rbuggyMatches,
639	+ matches,
640	+ contains,
641	+
642	+ // Instance-specific data
643	+ expando = "sizzle" + 1 * new Date(),
644	+ preferredDoc = window.document,
645	+ dirruns = 0,
646	+ done = 0,
647	+ classCache = createCache(),
648	+ tokenCache = createCache(),
649	+ compilerCache = createCache(),
650	+ sortOrder = function( a, b ) {
651	+ if ( a === b ) {
652	+ hasDuplicate = true;
653	+ }
654	+ return 0;
655	+ },
656	+
657	+ // Instance methods
658	+ hasOwn = ({}).hasOwnProperty,
659	+ arr = [],
660	+ pop = arr.pop,
661	+ push_native = arr.push,
662	+ push = arr.push,
663	+ slice = arr.slice,
664	+ // Use a stripped-down indexOf as it's faster than native
665	+ // https://jsperf.com/thor-indexof-vs-for/5
666	+ indexOf = function( list, elem ) {
667	+ var i = 0,
668	+ len = list.length;
669	+ for ( ; i < len; i++ ) {
670	+ if ( list[i] === elem ) {
671	+ return i;
672	+ }
673	+ }
674	+ return -1;
675	+ },
676	+
677	+ booleans = "checked\|selected\|async\|autofocus\|autoplay\|controls\|defer\|disabled\|hidden\|ismap\|loop\|multiple\|open\|readonly\|required\|scoped",
678	+
679	+ // Regular expressions
680	+
681	+ // http://www.w3.org/TR/css3-selectors/#whitespace
682	+ whitespace = "[\\x20\\t\\r\\n\\f]",
683	+
684	+ // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
685	+ identifier = "(?:\\\\.\|[\\w-]\|[^\0-\\xa0])+",
686	+
687	+ // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
688	+ attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
689	+ // Operator (capture 2)
690	+ "([^$\|!~]?=)" + whitespace +
691	+ // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
692	+ "(?:'((?:\\\\.\|[^\\\\']))'\|\"((?:\\\\.\|[^\\\\\"])*)\"\|(" + identifier + "))\|)" + whitespace +
693	+ "*\\]",
694	+
695	+ pseudos = ":(" + identifier + ")(?:\\((" +
696	+ // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
697	+ // 1. quoted (capture 3; capture 4 or capture 5)
698	+ "('((?:\\\\.\|[^\\\\']))'\|\"((?:\\\\.\|[^\\\\\"]))\")\|" +
699	+ // 2. simple (capture 6)
700	+ "((?:\\\\.\|[^\\\\()[\\]]\|" + attributes + ")*)\|" +
701	+ // 3. anything else (capture 2)
702	+ ".*" +
703	+ ")\\)\|)",
704	+
705	+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
706	+ rwhitespace = new RegExp( whitespace + "+", "g" ),
707	+ rtrim = new RegExp( "^" + whitespace + "+\|((?:^\|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
708	+
709	+ rcomma = new RegExp( "^" + whitespace + "," + whitespace + "" ),
710	+ rcombinators = new RegExp( "^" + whitespace + "([>+~]\|" + whitespace + ")" + whitespace + "" ),
711	+
712	+ rattributeQuotes = new RegExp( "=" + whitespace + "([^\\]'\"]?)" + whitespace + "*\\]", "g" ),
713	+
714	+ rpseudo = new RegExp( pseudos ),
715	+ ridentifier = new RegExp( "^" + identifier + "$" ),
716	+
717	+ matchExpr = {
718	+ "ID": new RegExp( "^#(" + identifier + ")" ),
719	+ "CLASS": new RegExp( "^\\.(" + identifier + ")" ),
720	+ "TAG": new RegExp( "^(" + identifier + "\|[*])" ),
721	+ "ATTR": new RegExp( "^" + attributes ),
722	+ "PSEUDO": new RegExp( "^" + pseudos ),
723	+ "CHILD": new RegExp( "^:(only\|first\|last\|nth\|nth-last)-(child\|of-type)(?:\\(" + whitespace +
724	+ "(even\|odd\|(([+-]\|)(\\d)n\|)" + whitespace + "*(?:([+-]\|)" + whitespace +
725	+ "(\\d+)\|))" + whitespace + "\\)\|)", "i" ),
726	+ "bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
727	+ // For use in libraries implementing .is()
728	+ // We use this for POS matching in `select`
729	+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]\|:(even\|odd\|eq\|gt\|lt\|nth\|first\|last)(?:\\(" +
730	+ whitespace + "((?:-\\d)?\\d)" + whitespace + "*\\)\|)(?=[^-]\|$)", "i" )
731	+ },
732	+
733	+ rinputs = /^(?:input\|select\|textarea\|button)$/i,
734	+ rheader = /^h\d$/i,
735	+
736	+ rnative = /^[^{]+\{\s*\[native \w/,
737	+
738	+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
739	+ rquickExpr = /^(?:#([\w-]+)\|(\w+)\|\.([\w-]+))$/,
740	+
741	+ rsibling = /[+~]/,
742	+
743	+ // CSS escapes
744	+ // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
745	+ runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?\|(" + whitespace + ")\|.)", "ig" ),
746	+ funescape = function( _, escaped, escapedWhitespace ) {
747	+ var high = "0x" + escaped - 0x10000;
748	+ // NaN means non-codepoint
749	+ // Support: Firefox<24
750	+ // Workaround erroneous numeric interpretation of +"0x"
751	+ return high !== high \|\| escapedWhitespace ?
752	+ escaped :
753	+ high < 0 ?
754	+ // BMP codepoint
755	+ String.fromCharCode( high + 0x10000 ) :
756	+ // Supplemental Plane codepoint (surrogate pair)
757	+ String.fromCharCode( high >> 10 \| 0xD800, high & 0x3FF \| 0xDC00 );
758	+ },
759	+
760	+ // CSS string/identifier serialization
761	+ // https://drafts.csswg.org/cssom/#common-serializing-idioms
762	+ rcssescape = /([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\0-\x1f\x7f-\uFFFF\w-]/g,
763	+ fcssescape = function( ch, asCodePoint ) {
764	+ if ( asCodePoint ) {
765	+
766	+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
767	+ if ( ch === "\0" ) {
768	+ return "\uFFFD";
769	+ }
770	+
771	+ // Control characters and (dependent upon position) numbers get escaped as code points
772	+ return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
773	+ }
774	+
775	+ // Other potentially-special ASCII characters get backslash-escaped
776	+ return "\\" + ch;
777	+ },
778	+
779	+ // Used for iframes
780	+ // See setDocument()
781	+ // Removing the function wrapper causes a "Permission Denied"
782	+ // error in IE
783	+ unloadHandler = function() {
784	+ setDocument();
785	+ },
786	+
787	+ disabledAncestor = addCombinator(
788	+ function( elem ) {
789	+ return elem.disabled === true && ("form" in elem \|\| "label" in elem);
790	+ },
791	+ { dir: "parentNode", next: "legend" }
792	+ );
793	+
794	+ // Optimize for push.apply( _, NodeList )
795	+ try {
796	+ push.apply(
797	+ (arr = slice.call( preferredDoc.childNodes )),
798	+ preferredDoc.childNodes
799	+ );
800	+ // Support: Android<4.0
801	+ // Detect silently failing push.apply
802	+ arr[ preferredDoc.childNodes.length ].nodeType;
803	+ } catch ( e ) {
804	+ push = { apply: arr.length ?
805	+
806	+ // Leverage slice if possible
807	+ function( target, els ) {
808	+ push_native.apply( target, slice.call(els) );
809	+ } :
810	+
811	+ // Support: IE<9
812	+ // Otherwise append directly
813	+ function( target, els ) {
814	+ var j = target.length,
815	+ i = 0;
816	+ // Can't trust NodeList.length
817	+ while ( (target[j++] = els[i++]) ) {}
818	+ target.length = j - 1;
819	+ }
820	+ };
821	+ }
822	+
823	+ function Sizzle( selector, context, results, seed ) {
824	+ var m, i, elem, nid, match, groups, newSelector,
825	+ newContext = context && context.ownerDocument,
826	+
827	+ // nodeType defaults to 9, since context defaults to document
828	+ nodeType = context ? context.nodeType : 9;
829	+
830	+ results = results \|\| [];
831	+
832	+ // Return early from calls with invalid selector or context
833	+ if ( typeof selector !== "string" \|\| !selector \|\|
834	+ nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
835	+
836	+ return results;
837	+ }
838	+
839	+ // Try to shortcut find operations (as opposed to filters) in HTML documents
840	+ if ( !seed ) {
841	+
842	+ if ( ( context ? context.ownerDocument \|\| context : preferredDoc ) !== document ) {
843	+ setDocument( context );
844	+ }
845	+ context = context \|\| document;
846	+
847	+ if ( documentIsHTML ) {
848	+
849	+ // If the selector is sufficiently simple, try using a "getBy" DOM method
850	+ // (excepting DocumentFragment context, where the methods don't exist)
851	+ if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {
852	+
853	+ // ID selector
854	+ if ( (m = match[1]) ) {
855	+
856	+ // Document context
857	+ if ( nodeType === 9 ) {
858	+ if ( (elem = context.getElementById( m )) ) {
859	+
860	+ // Support: IE, Opera, Webkit
861	+ // TODO: identify versions
862	+ // getElementById can match elements by name instead of ID
863	+ if ( elem.id === m ) {
864	+ results.push( elem );
865	+ return results;
866	+ }
867	+ } else {
868	+ return results;
869	+ }
870	+
871	+ // Element context
872	+ } else {
873	+
874	+ // Support: IE, Opera, Webkit
875	+ // TODO: identify versions
876	+ // getElementById can match elements by name instead of ID
877	+ if ( newContext && (elem = newContext.getElementById( m )) &&
878	+ contains( context, elem ) &&
879	+ elem.id === m ) {
880	+
881	+ results.push( elem );
882	+ return results;
883	+ }
884	+ }
885	+
886	+ // Type selector
887	+ } else if ( match[2] ) {
888	+ push.apply( results, context.getElementsByTagName( selector ) );
889	+ return results;
890	+
891	+ // Class selector
892	+ } else if ( (m = match[3]) && support.getElementsByClassName &&
893	+ context.getElementsByClassName ) {
894	+
895	+ push.apply( results, context.getElementsByClassName( m ) );
896	+ return results;
897	+ }
898	+ }
899	+
900	+ // Take advantage of querySelectorAll
901	+ if ( support.qsa &&
902	+ !compilerCache[ selector + " " ] &&
903	+ (!rbuggyQSA \|\| !rbuggyQSA.test( selector )) ) {
904	+
905	+ if ( nodeType !== 1 ) {
906	+ newContext = context;
907	+ newSelector = selector;
908	+
909	+ // qSA looks outside Element context, which is not what we want
910	+ // Thanks to Andrew Dupont for this workaround technique
911	+ // Support: IE <=8
912	+ // Exclude object elements
913	+ } else if ( context.nodeName.toLowerCase() !== "object" ) {
914	+
915	+ // Capture the context ID, setting it first if necessary
916	+ if ( (nid = context.getAttribute( "id" )) ) {
917	+ nid = nid.replace( rcssescape, fcssescape );
918	+ } else {
919	+ context.setAttribute( "id", (nid = expando) );
920	+ }
921	+
922	+ // Prefix every selector in the list
923	+ groups = tokenize( selector );
924	+ i = groups.length;
925	+ while ( i-- ) {
926	+ groups[i] = "#" + nid + " " + toSelector( groups[i] );
927	+ }
928	+ newSelector = groups.join( "," );
929	+
930	+ // Expand context for sibling selectors
931	+ newContext = rsibling.test( selector ) && testContext( context.parentNode ) \|\|
932	+ context;
933	+ }
934	+
935	+ if ( newSelector ) {
936	+ try {
937	+ push.apply( results,
938	+ newContext.querySelectorAll( newSelector )
939	+ );
940	+ return results;
941	+ } catch ( qsaError ) {
942	+ } finally {
943	+ if ( nid === expando ) {
944	+ context.removeAttribute( "id" );
945	+ }
946	+ }
947	+ }
948	+ }
949	+ }
950	+ }
951	+
952	+ // All others
953	+ return select( selector.replace( rtrim, "$1" ), context, results, seed );
954	+ }
955	+
956	+ /**
957	+ * Create key-value caches of limited size
958	+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
959	+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
960	+ * deleting the oldest entry
961	+ */
962	+ function createCache() {
963	+ var keys = [];
964	+
965	+ function cache( key, value ) {
966	+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
967	+ if ( keys.push( key + " " ) > Expr.cacheLength ) {
968	+ // Only keep the most recent entries
969	+ delete cache[ keys.shift() ];
970	+ }
971	+ return (cache[ key + " " ] = value);
972	+ }
973	+ return cache;
974	+ }
975	+
976	+ /**
977	+ * Mark a function for special use by Sizzle
978	+ * @param {Function} fn The function to mark
979	+ */
980	+ function markFunction( fn ) {
981	+ fn[ expando ] = true;
982	+ return fn;
983	+ }
984	+
985	+ /**
986	+ * Support testing using an element
987	+ * @param {Function} fn Passed the created element and returns a boolean result
988	+ */
989	+ function assert( fn ) {
990	+ var el = document.createElement("fieldset");
991	+
992	+ try {
993	+ return !!fn( el );
994	+ } catch (e) {
995	+ return false;
996	+ } finally {
997	+ // Remove from its parent by default
998	+ if ( el.parentNode ) {
999	+ el.parentNode.removeChild( el );
1000	+ }
1001	+ // release memory in IE
1002	+ el = null;
1003	+ }
1004	+ }
1005	+
1006	+ /**
1007	+ * Adds the same handler for all of the specified attrs
1008	+ * @param {String} attrs Pipe-separated list of attributes
1009	+ * @param {Function} handler The method that will be applied
1010	+ */
1011	+ function addHandle( attrs, handler ) {
1012	+ var arr = attrs.split("\|"),
1013	+ i = arr.length;
1014	+
1015	+ while ( i-- ) {
1016	+ Expr.attrHandle[ arr[i] ] = handler;
1017	+ }
1018	+ }
1019	+
1020	+ /**
1021	+ * Checks document order of two siblings
1022	+ * @param {Element} a
1023	+ * @param {Element} b
1024	+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
1025	+ */
1026	+ function siblingCheck( a, b ) {
1027	+ var cur = b && a,
1028	+ diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
1029	+ a.sourceIndex - b.sourceIndex;
1030	+
1031	+ // Use IE sourceIndex if available on both nodes
1032	+ if ( diff ) {
1033	+ return diff;
1034	+ }
1035	+
1036	+ // Check if b follows a
1037	+ if ( cur ) {
1038	+ while ( (cur = cur.nextSibling) ) {
1039	+ if ( cur === b ) {
1040	+ return -1;
1041	+ }
1042	+ }
1043	+ }
1044	+
1045	+ return a ? 1 : -1;
1046	+ }
1047	+
1048	+ /**
1049	+ * Returns a function to use in pseudos for input types
1050	+ * @param {String} type
1051	+ */
1052	+ function createInputPseudo( type ) {
1053	+ return function( elem ) {
1054	+ var name = elem.nodeName.toLowerCase();
1055	+ return name === "input" && elem.type === type;
1056	+ };
1057	+ }
1058	+
1059	+ /**
1060	+ * Returns a function to use in pseudos for buttons
1061	+ * @param {String} type
1062	+ */
1063	+ function createButtonPseudo( type ) {
1064	+ return function( elem ) {
1065	+ var name = elem.nodeName.toLowerCase();
1066	+ return (name === "input" \|\| name === "button") && elem.type === type;
1067	+ };
1068	+ }
1069	+
1070	+ /**
1071	+ * Returns a function to use in pseudos for :enabled/:disabled
1072	+ * @param {Boolean} disabled true for :disabled; false for :enabled
1073	+ */
1074	+ function createDisabledPseudo( disabled ) {
1075	+
1076	+ // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
1077	+ return function( elem ) {
1078	+
1079	+ // Only certain elements can match :enabled or :disabled
1080	+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
1081	+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
1082	+ if ( "form" in elem ) {
1083	+
1084	+ // Check for inherited disabledness on relevant non-disabled elements:
1085	+ // * listed form-associated elements in a disabled fieldset
1086	+ // https://html.spec.whatwg.org/multipage/forms.html#category-listed
1087	+ // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
1088	+ // * option elements in a disabled optgroup
1089	+ // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
1090	+ // All such elements have a "form" property.
1091	+ if ( elem.parentNode && elem.disabled === false ) {
1092	+
1093	+ // Option elements defer to a parent optgroup if present
1094	+ if ( "label" in elem ) {
1095	+ if ( "label" in elem.parentNode ) {
1096	+ return elem.parentNode.disabled === disabled;
1097	+ } else {
1098	+ return elem.disabled === disabled;
1099	+ }
1100	+ }
1101	+
1102	+ // Support: IE 6 - 11
1103	+ // Use the isDisabled shortcut property to check for disabled fieldset ancestors
1104	+ return elem.isDisabled === disabled \|\|
1105	+
1106	+ // Where there is no isDisabled, check manually
1107	+ /* jshint -W018 */
1108	+ elem.isDisabled !== !disabled &&
1109	+ disabledAncestor( elem ) === disabled;
1110	+ }
1111	+
1112	+ return elem.disabled === disabled;
1113	+
1114	+ // Try to winnow out elements that can't be disabled before trusting the disabled property.
1115	+ // Some victims get caught in our net (label, legend, menu, track), but it shouldn't
1116	+ // even exist on them, let alone have a boolean value.
1117	+ } else if ( "label" in elem ) {
1118	+ return elem.disabled === disabled;
1119	+ }
1120	+
1121	+ // Remaining elements are neither :enabled nor :disabled
1122	+ return false;
1123	+ };
1124	+ }
1125	+
1126	+ /**
1127	+ * Returns a function to use in pseudos for positionals
1128	+ * @param {Function} fn
1129	+ */
1130	+ function createPositionalPseudo( fn ) {
1131	+ return markFunction(function( argument ) {
1132	+ argument = +argument;
1133	+ return markFunction(function( seed, matches ) {
1134	+ var j,
1135	+ matchIndexes = fn( [], seed.length, argument ),
1136	+ i = matchIndexes.length;
1137	+
1138	+ // Match elements found at the specified indexes
1139	+ while ( i-- ) {
1140	+ if ( seed[ (j = matchIndexes[i]) ] ) {
1141	+ seed[j] = !(matches[j] = seed[j]);
1142	+ }
1143	+ }
1144	+ });
1145	+ });
1146	+ }
1147	+
1148	+ /**
1149	+ * Checks a node for validity as a Sizzle context
1150	+ * @param {Element\|Object=} context
1151	+ * @returns {Element\|Object\|Boolean} The input node if acceptable, otherwise a falsy value
1152	+ */
1153	+ function testContext( context ) {
1154	+ return context && typeof context.getElementsByTagName !== "undefined" && context;
1155	+ }
1156	+
1157	+ // Expose support vars for convenience
1158	+ support = Sizzle.support = {};
1159	+
1160	+ /**
1161	+ * Detects XML nodes
1162	+ * @param {Element\|Object} elem An element or a document
1163	+ * @returns {Boolean} True iff elem is a non-HTML XML node
1164	+ */
1165	+ isXML = Sizzle.isXML = function( elem ) {
1166	+ // documentElement is verified for cases where it doesn't yet exist
1167	+ // (such as loading iframes in IE - #4833)
1168	+ var documentElement = elem && (elem.ownerDocument \|\| elem).documentElement;
1169	+ return documentElement ? documentElement.nodeName !== "HTML" : false;
1170	+ };
1171	+
1172	+ /**
1173	+ * Sets document-related variables once based on the current document
1174	+ * @param {Element\|Object} [doc] An element or document object to use to set the document
1175	+ * @returns {Object} Returns the current document
1176	+ */
1177	+ setDocument = Sizzle.setDocument = function( node ) {
1178	+ var hasCompare, subWindow,
1179	+ doc = node ? node.ownerDocument \|\| node : preferredDoc;
1180	+
1181	+ // Return early if doc is invalid or already selected
1182	+ if ( doc === document \|\| doc.nodeType !== 9 \|\| !doc.documentElement ) {
1183	+ return document;
1184	+ }
1185	+
1186	+ // Update global variables
1187	+ document = doc;
1188	+ docElem = document.documentElement;
1189	+ documentIsHTML = !isXML( document );
1190	+
1191	+ // Support: IE 9-11, Edge
1192	+ // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
1193	+ if ( preferredDoc !== document &&
1194	+ (subWindow = document.defaultView) && subWindow.top !== subWindow ) {
1195	+
1196	+ // Support: IE 11, Edge
1197	+ if ( subWindow.addEventListener ) {
1198	+ subWindow.addEventListener( "unload", unloadHandler, false );
1199	+
1200	+ // Support: IE 9 - 10 only
1201	+ } else if ( subWindow.attachEvent ) {
1202	+ subWindow.attachEvent( "onunload", unloadHandler );
1203	+ }
1204	+ }
1205	+
1206	+ /* Attributes
1207	+ ---------------------------------------------------------------------- */
1208	+
1209	+ // Support: IE<8
1210	+ // Verify that getAttribute really returns attributes and not properties
1211	+ // (excepting IE8 booleans)
1212	+ support.attributes = assert(function( el ) {
1213	+ el.className = "i";
1214	+ return !el.getAttribute("className");
1215	+ });
1216	+
1217	+ /* getElement(s)By*
1218	+ ---------------------------------------------------------------------- */
1219	+
1220	+ // Check if getElementsByTagName("*") returns only elements
1221	+ support.getElementsByTagName = assert(function( el ) {
1222	+ el.appendChild( document.createComment("") );
1223	+ return !el.getElementsByTagName("*").length;
1224	+ });
1225	+
1226	+ // Support: IE<9
1227	+ support.getElementsByClassName = rnative.test( document.getElementsByClassName );
1228	+
1229	+ // Support: IE<10
1230	+ // Check if getElementById returns elements by name
1231	+ // The broken getElementById methods don't pick up programmatically-set names,
1232	+ // so use a roundabout getElementsByName test
1233	+ support.getById = assert(function( el ) {
1234	+ docElem.appendChild( el ).id = expando;
1235	+ return !document.getElementsByName \|\| !document.getElementsByName( expando ).length;
1236	+ });
1237	+
1238	+ // ID filter and find
1239	+ if ( support.getById ) {
1240	+ Expr.filter["ID"] = function( id ) {
1241	+ var attrId = id.replace( runescape, funescape );
1242	+ return function( elem ) {
1243	+ return elem.getAttribute("id") === attrId;
1244	+ };
1245	+ };
1246	+ Expr.find["ID"] = function( id, context ) {
1247	+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
1248	+ var elem = context.getElementById( id );
1249	+ return elem ? [ elem ] : [];
1250	+ }
1251	+ };
1252	+ } else {
1253	+ Expr.filter["ID"] = function( id ) {
1254	+ var attrId = id.replace( runescape, funescape );
1255	+ return function( elem ) {
1256	+ var node = typeof elem.getAttributeNode !== "undefined" &&
1257	+ elem.getAttributeNode("id");
1258	+ return node && node.value === attrId;
1259	+ };
1260	+ };
1261	+
1262	+ // Support: IE 6 - 7 only
1263	+ // getElementById is not reliable as a find shortcut
1264	+ Expr.find["ID"] = function( id, context ) {
1265	+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
1266	+ var node, i, elems,
1267	+ elem = context.getElementById( id );
1268	+
1269	+ if ( elem ) {
1270	+
1271	+ // Verify the id attribute
1272	+ node = elem.getAttributeNode("id");
1273	+ if ( node && node.value === id ) {
1274	+ return [ elem ];
1275	+ }
1276	+
1277	+ // Fall back on getElementsByName
1278	+ elems = context.getElementsByName( id );
1279	+ i = 0;
1280	+ while ( (elem = elems[i++]) ) {
1281	+ node = elem.getAttributeNode("id");
1282	+ if ( node && node.value === id ) {
1283	+ return [ elem ];
1284	+ }
1285	+ }
1286	+ }
1287	+
1288	+ return [];
1289	+ }
1290	+ };
1291	+ }
1292	+
1293	+ // Tag
1294	+ Expr.find["TAG"] = support.getElementsByTagName ?
1295	+ function( tag, context ) {
1296	+ if ( typeof context.getElementsByTagName !== "undefined" ) {
1297	+ return context.getElementsByTagName( tag );
1298	+
1299	+ // DocumentFragment nodes don't have gEBTN
1300	+ } else if ( support.qsa ) {
1301	+ return context.querySelectorAll( tag );
1302	+ }
1303	+ } :
1304	+
1305	+ function( tag, context ) {
1306	+ var elem,
1307	+ tmp = [],
1308	+ i = 0,
1309	+ // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
1310	+ results = context.getElementsByTagName( tag );
1311	+
1312	+ // Filter out possible comments
1313	+ if ( tag === "*" ) {
1314	+ while ( (elem = results[i++]) ) {
1315	+ if ( elem.nodeType === 1 ) {
1316	+ tmp.push( elem );
1317	+ }
1318	+ }
1319	+
1320	+ return tmp;
1321	+ }
1322	+ return results;
1323	+ };
1324	+
1325	+ // Class
1326	+ Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
1327	+ if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
1328	+ return context.getElementsByClassName( className );
1329	+ }
1330	+ };
1331	+
1332	+ /* QSA/matchesSelector
1333	+ ---------------------------------------------------------------------- */
1334	+
1335	+ // QSA and matchesSelector support
1336	+
1337	+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
1338	+ rbuggyMatches = [];
1339	+
1340	+ // qSa(:focus) reports false when true (Chrome 21)
1341	+ // We allow this because of a bug in IE8/9 that throws an error
1342	+ // whenever `document.activeElement` is accessed on an iframe
1343	+ // So, we allow :focus to pass through QSA all the time to avoid the IE error
1344	+ // See https://bugs.jquery.com/ticket/13378
1345	+ rbuggyQSA = [];
1346	+
1347	+ if ( (support.qsa = rnative.test( document.querySelectorAll )) ) {
1348	+ // Build QSA regex
1349	+ // Regex strategy adopted from Diego Perini
1350	+ assert(function( el ) {
1351	+ // Select is set to empty string on purpose
1352	+ // This is to test IE's treatment of not explicitly
1353	+ // setting a boolean content attribute,
1354	+ // since its presence should be enough
1355	+ // https://bugs.jquery.com/ticket/12359
1356	+ docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" +
1357	+ "<select id='" + expando + "-\r\\' msallowcapture=''>" +
1358	+ "<option selected=''></option></select>";
1359	+
1360	+ // Support: IE8, Opera 11-12.16
1361	+ // Nothing should be selected when empty strings follow ^= or $= or *=
1362	+ // The test attribute must be unknown in Opera but "safe" for WinRT
1363	+ // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
1364	+ if ( el.querySelectorAll("[msallowcapture^='']").length ) {
1365	+ rbuggyQSA.push( "[^$]=" + whitespace + "(?:''\|\"\")" );
1366	+ }
1367	+
1368	+ // Support: IE8
1369	+ // Boolean attributes and "value" are not treated correctly
1370	+ if ( !el.querySelectorAll("[selected]").length ) {
1371	+ rbuggyQSA.push( "\\[" + whitespace + "*(?:value\|" + booleans + ")" );
1372	+ }
1373	+
1374	+ // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
1375	+ if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
1376	+ rbuggyQSA.push("~=");
1377	+ }
1378	+
1379	+ // Webkit/Opera - :checked should return selected option elements
1380	+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
1381	+ // IE8 throws error here and will not see later tests
1382	+ if ( !el.querySelectorAll(":checked").length ) {
1383	+ rbuggyQSA.push(":checked");
1384	+ }
1385	+
1386	+ // Support: Safari 8+, iOS 8+
1387	+ // https://bugs.webkit.org/show_bug.cgi?id=136851
1388	+ // In-page `selector#id sibling-combinator selector` fails
1389	+ if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
1390	+ rbuggyQSA.push(".#.+[+~]");
1391	+ }
1392	+ });
1393	+
1394	+ assert(function( el ) {
1395	+ el.innerHTML = "<a href='' disabled='disabled'></a>" +
1396	+ "<select disabled='disabled'><option/></select>";
1397	+
1398	+ // Support: Windows 8 Native Apps
1399	+ // The type and name attributes are restricted during .innerHTML assignment
1400	+ var input = document.createElement("input");
1401	+ input.setAttribute( "type", "hidden" );
1402	+ el.appendChild( input ).setAttribute( "name", "D" );
1403	+
1404	+ // Support: IE8
1405	+ // Enforce case-sensitivity of name attribute
1406	+ if ( el.querySelectorAll("[name=d]").length ) {
1407	+ rbuggyQSA.push( "name" + whitespace + "[^$\|!~]?=" );
1408	+ }
1409	+
1410	+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
1411	+ // IE8 throws error here and will not see later tests
1412	+ if ( el.querySelectorAll(":enabled").length !== 2 ) {
1413	+ rbuggyQSA.push( ":enabled", ":disabled" );
1414	+ }
1415	+
1416	+ // Support: IE9-11+
1417	+ // IE's :disabled selector does not pick up the children of disabled fieldsets
1418	+ docElem.appendChild( el ).disabled = true;
1419	+ if ( el.querySelectorAll(":disabled").length !== 2 ) {
1420	+ rbuggyQSA.push( ":enabled", ":disabled" );
1421	+ }
1422	+
1423	+ // Opera 10-11 does not throw on post-comma invalid pseudos
1424	+ el.querySelectorAll("*,:x");
1425	+ rbuggyQSA.push(",.*:");
1426	+ });
1427	+ }
1428	+
1429	+ if ( (support.matchesSelector = rnative.test( (matches = docElem.matches \|\|
1430	+ docElem.webkitMatchesSelector \|\|
1431	+ docElem.mozMatchesSelector \|\|
1432	+ docElem.oMatchesSelector \|\|
1433	+ docElem.msMatchesSelector) )) ) {
1434	+
1435	+ assert(function( el ) {
1436	+ // Check to see if it's possible to do matchesSelector
1437	+ // on a disconnected node (IE 9)
1438	+ support.disconnectedMatch = matches.call( el, "*" );
1439	+
1440	+ // This should fail with an exception
1441	+ // Gecko does not error, returns false instead
1442	+ matches.call( el, "[s!='']:x" );
1443	+ rbuggyMatches.push( "!=", pseudos );
1444	+ });
1445	+ }
1446	+
1447	+ rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("\|") );
1448	+ rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("\|") );
1449	+
1450	+ /* Contains
1451	+ ---------------------------------------------------------------------- */
1452	+ hasCompare = rnative.test( docElem.compareDocumentPosition );
1453	+
1454	+ // Element contains another
1455	+ // Purposefully self-exclusive
1456	+ // As in, an element does not contain itself
1457	+ contains = hasCompare \|\| rnative.test( docElem.contains ) ?
1458	+ function( a, b ) {
1459	+ var adown = a.nodeType === 9 ? a.documentElement : a,
1460	+ bup = b && b.parentNode;
1461	+ return a === bup \|\| !!( bup && bup.nodeType === 1 && (
1462	+ adown.contains ?
1463	+ adown.contains( bup ) :
1464	+ a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
1465	+ ));
1466	+ } :
1467	+ function( a, b ) {
1468	+ if ( b ) {
1469	+ while ( (b = b.parentNode) ) {
1470	+ if ( b === a ) {
1471	+ return true;
1472	+ }
1473	+ }
1474	+ }
1475	+ return false;
1476	+ };
1477	+
1478	+ /* Sorting
1479	+ ---------------------------------------------------------------------- */
1480	+
1481	+ // Document order sorting
1482	+ sortOrder = hasCompare ?
1483	+ function( a, b ) {
1484	+
1485	+ // Flag for duplicate removal
1486	+ if ( a === b ) {
1487	+ hasDuplicate = true;
1488	+ return 0;
1489	+ }
1490	+
1491	+ // Sort on method existence if only one input has compareDocumentPosition
1492	+ var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
1493	+ if ( compare ) {
1494	+ return compare;
1495	+ }
1496	+
1497	+ // Calculate position if both inputs belong to the same document
1498	+ compare = ( a.ownerDocument \|\| a ) === ( b.ownerDocument \|\| b ) ?
1499	+ a.compareDocumentPosition( b ) :
1500	+
1501	+ // Otherwise we know they are disconnected
1502	+ 1;
1503	+
1504	+ // Disconnected nodes
1505	+ if ( compare & 1 \|\|
1506	+ (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
1507	+
1508	+ // Choose the first element that is related to our preferred document
1509	+ if ( a === document \|\| a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
1510	+ return -1;
1511	+ }
1512	+ if ( b === document \|\| b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
1513	+ return 1;
1514	+ }
1515	+
1516	+ // Maintain original order
1517	+ return sortInput ?
1518	+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
1519	+ 0;
1520	+ }
1521	+
1522	+ return compare & 4 ? -1 : 1;
1523	+ } :
1524	+ function( a, b ) {
1525	+ // Exit early if the nodes are identical
1526	+ if ( a === b ) {
1527	+ hasDuplicate = true;
1528	+ return 0;
1529	+ }
1530	+
1531	+ var cur,
1532	+ i = 0,
1533	+ aup = a.parentNode,
1534	+ bup = b.parentNode,
1535	+ ap = [ a ],
1536	+ bp = [ b ];
1537	+
1538	+ // Parentless nodes are either documents or disconnected
1539	+ if ( !aup \|\| !bup ) {
1540	+ return a === document ? -1 :
1541	+ b === document ? 1 :
1542	+ aup ? -1 :
1543	+ bup ? 1 :
1544	+ sortInput ?
1545	+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
1546	+ 0;
1547	+
1548	+ // If the nodes are siblings, we can do a quick check
1549	+ } else if ( aup === bup ) {
1550	+ return siblingCheck( a, b );
1551	+ }
1552	+
1553	+ // Otherwise we need full lists of their ancestors for comparison
1554	+ cur = a;
1555	+ while ( (cur = cur.parentNode) ) {
1556	+ ap.unshift( cur );
1557	+ }
1558	+ cur = b;
1559	+ while ( (cur = cur.parentNode) ) {
1560	+ bp.unshift( cur );
1561	+ }
1562	+
1563	+ // Walk down the tree looking for a discrepancy
1564	+ while ( ap[i] === bp[i] ) {
1565	+ i++;
1566	+ }
1567	+
1568	+ return i ?
1569	+ // Do a sibling check if the nodes have a common ancestor
1570	+ siblingCheck( ap[i], bp[i] ) :
1571	+
1572	+ // Otherwise nodes in our document sort first
1573	+ ap[i] === preferredDoc ? -1 :
1574	+ bp[i] === preferredDoc ? 1 :
1575	+ 0;
1576	+ };
1577	+
1578	+ return document;
1579	+ };
1580	+
1581	+ Sizzle.matches = function( expr, elements ) {
1582	+ return Sizzle( expr, null, null, elements );
1583	+ };
1584	+
1585	+ Sizzle.matchesSelector = function( elem, expr ) {
1586	+ // Set document vars if needed
1587	+ if ( ( elem.ownerDocument \|\| elem ) !== document ) {
1588	+ setDocument( elem );
1589	+ }
1590	+
1591	+ // Make sure that attribute selectors are quoted
1592	+ expr = expr.replace( rattributeQuotes, "='$1']" );
1593	+
1594	+ if ( support.matchesSelector && documentIsHTML &&
1595	+ !compilerCache[ expr + " " ] &&
1596	+ ( !rbuggyMatches \|\| !rbuggyMatches.test( expr ) ) &&
1597	+ ( !rbuggyQSA \|\| !rbuggyQSA.test( expr ) ) ) {
1598	+
1599	+ try {
1600	+ var ret = matches.call( elem, expr );
1601	+
1602	+ // IE 9's matchesSelector returns false on disconnected nodes
1603	+ if ( ret \|\| support.disconnectedMatch \|\|
1604	+ // As well, disconnected nodes are said to be in a document
1605	+ // fragment in IE 9
1606	+ elem.document && elem.document.nodeType !== 11 ) {
1607	+ return ret;
1608	+ }
1609	+ } catch (e) {}
1610	+ }
1611	+
1612	+ return Sizzle( expr, document, null, [ elem ] ).length > 0;
1613	+ };
1614	+
1615	+ Sizzle.contains = function( context, elem ) {
1616	+ // Set document vars if needed
1617	+ if ( ( context.ownerDocument \|\| context ) !== document ) {
1618	+ setDocument( context );
1619	+ }
1620	+ return contains( context, elem );
1621	+ };
1622	+
1623	+ Sizzle.attr = function( elem, name ) {
1624	+ // Set document vars if needed
1625	+ if ( ( elem.ownerDocument \|\| elem ) !== document ) {
1626	+ setDocument( elem );
1627	+ }
1628	+
1629	+ var fn = Expr.attrHandle[ name.toLowerCase() ],
1630	+ // Don't get fooled by Object.prototype properties (jQuery #13807)
1631	+ val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
1632	+ fn( elem, name, !documentIsHTML ) :
1633	+ undefined;
1634	+
1635	+ return val !== undefined ?
1636	+ val :
1637	+ support.attributes \|\| !documentIsHTML ?
1638	+ elem.getAttribute( name ) :
1639	+ (val = elem.getAttributeNode(name)) && val.specified ?
1640	+ val.value :
1641	+ null;
1642	+ };
1643	+
1644	+ Sizzle.escape = function( sel ) {
1645	+ return (sel + "").replace( rcssescape, fcssescape );
1646	+ };
1647	+
1648	+ Sizzle.error = function( msg ) {
1649	+ throw new Error( "Syntax error, unrecognized expression: " + msg );
1650	+ };
1651	+
1652	+ /**
1653	+ * Document sorting and removing duplicates
1654	+ * @param {ArrayLike} results
1655	+ */
1656	+ Sizzle.uniqueSort = function( results ) {
1657	+ var elem,
1658	+ duplicates = [],
1659	+ j = 0,
1660	+ i = 0;
1661	+
1662	+ // Unless we know we can detect duplicates, assume their presence
1663	+ hasDuplicate = !support.detectDuplicates;
1664	+ sortInput = !support.sortStable && results.slice( 0 );
1665	+ results.sort( sortOrder );
1666	+
1667	+ if ( hasDuplicate ) {
1668	+ while ( (elem = results[i++]) ) {
1669	+ if ( elem === results[ i ] ) {
1670	+ j = duplicates.push( i );
1671	+ }
1672	+ }
1673	+ while ( j-- ) {
1674	+ results.splice( duplicates[ j ], 1 );
1675	+ }
1676	+ }
1677	+
1678	+ // Clear input after sorting to release objects
1679	+ // See https://github.com/jquery/sizzle/pull/225
1680	+ sortInput = null;
1681	+
1682	+ return results;
1683	+ };
1684	+
1685	+ /**
1686	+ * Utility function for retrieving the text value of an array of DOM nodes
1687	+ * @param {Array\|Element} elem
1688	+ */
1689	+ getText = Sizzle.getText = function( elem ) {
1690	+ var node,
1691	+ ret = "",
1692	+ i = 0,
1693	+ nodeType = elem.nodeType;
1694	+
1695	+ if ( !nodeType ) {
1696	+ // If no nodeType, this is expected to be an array
1697	+ while ( (node = elem[i++]) ) {
1698	+ // Do not traverse comment nodes
1699	+ ret += getText( node );
1700	+ }
1701	+ } else if ( nodeType === 1 \|\| nodeType === 9 \|\| nodeType === 11 ) {
1702	+ // Use textContent for elements
1703	+ // innerText usage removed for consistency of new lines (jQuery #11153)
1704	+ if ( typeof elem.textContent === "string" ) {
1705	+ return elem.textContent;
1706	+ } else {
1707	+ // Traverse its children
1708	+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
1709	+ ret += getText( elem );
1710	+ }
1711	+ }
1712	+ } else if ( nodeType === 3 \|\| nodeType === 4 ) {
1713	+ return elem.nodeValue;
1714	+ }
1715	+ // Do not include comment or processing instruction nodes
1716	+
1717	+ return ret;
1718	+ };
1719	+
1720	+ Expr = Sizzle.selectors = {
1721	+
1722	+ // Can be adjusted by the user
1723	+ cacheLength: 50,
1724	+
1725	+ createPseudo: markFunction,
1726	+
1727	+ match: matchExpr,
1728	+
1729	+ attrHandle: {},
1730	+
1731	+ find: {},
1732	+
1733	+ relative: {
1734	+ ">": { dir: "parentNode", first: true },
1735	+ " ": { dir: "parentNode" },
1736	+ "+": { dir: "previousSibling", first: true },
1737	+ "~": { dir: "previousSibling" }
1738	+ },
1739	+
1740	+ preFilter: {
1741	+ "ATTR": function( match ) {
1742	+ match[1] = match[1].replace( runescape, funescape );
1743	+
1744	+ // Move the given value to match[3] whether quoted or unquoted
1745	+ match[3] = ( match[3] \|\| match[4] \|\| match[5] \|\| "" ).replace( runescape, funescape );
1746	+
1747	+ if ( match[2] === "~=" ) {
1748	+ match[3] = " " + match[3] + " ";
1749	+ }
1750	+
1751	+ return match.slice( 0, 4 );
1752	+ },
1753	+
1754	+ "CHILD": function( match ) {
1755	+ /* matches from matchExpr["CHILD"]
1756	+ 1 type (only\|nth\|...)
1757	+ 2 what (child\|of-type)
1758	+ 3 argument (even\|odd\|\d\|\dn([+-]\d+)?\|...)
1759	+ 4 xn-component of xn+y argument ([+-]?\d*n\|)
1760	+ 5 sign of xn-component
1761	+ 6 x of xn-component
1762	+ 7 sign of y-component
1763	+ 8 y of y-component
1764	+ */
1765	+ match[1] = match[1].toLowerCase();
1766	+
1767	+ if ( match[1].slice( 0, 3 ) === "nth" ) {
1768	+ // nth-* requires argument
1769	+ if ( !match[3] ) {
1770	+ Sizzle.error( match[0] );
1771	+ }
1772	+
1773	+ // numeric x and y parameters for Expr.filter.CHILD
1774	+ // remember that false/true cast respectively to 0/1
1775	+ match[4] = +( match[4] ? match[5] + (match[6] \|\| 1) : 2 * ( match[3] === "even" \|\| match[3] === "odd" ) );
1776	+ match[5] = +( ( match[7] + match[8] ) \|\| match[3] === "odd" );
1777	+
1778	+ // other types prohibit arguments
1779	+ } else if ( match[3] ) {
1780	+ Sizzle.error( match[0] );
1781	+ }
1782	+
1783	+ return match;
1784	+ },
1785	+
1786	+ "PSEUDO": function( match ) {
1787	+ var excess,
1788	+ unquoted = !match[6] && match[2];
1789	+
1790	+ if ( matchExpr["CHILD"].test( match[0] ) ) {
1791	+ return null;
1792	+ }
1793	+
1794	+ // Accept quoted arguments as-is
1795	+ if ( match[3] ) {
1796	+ match[2] = match[4] \|\| match[5] \|\| "";
1797	+
1798	+ // Strip excess characters from unquoted arguments
1799	+ } else if ( unquoted && rpseudo.test( unquoted ) &&
1800	+ // Get excess from tokenize (recursively)
1801	+ (excess = tokenize( unquoted, true )) &&
1802	+ // advance to the next closing parenthesis
1803	+ (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
1804	+
1805	+ // excess is a negative index
1806	+ match[0] = match[0].slice( 0, excess );
1807	+ match[2] = unquoted.slice( 0, excess );
1808	+ }
1809	+
1810	+ // Return only captures needed by the pseudo filter method (type and argument)
1811	+ return match.slice( 0, 3 );
1812	+ }
1813	+ },
1814	+
1815	+ filter: {
1816	+
1817	+ "TAG": function( nodeNameSelector ) {
1818	+ var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
1819	+ return nodeNameSelector === "*" ?
1820	+ function() { return true; } :
1821	+ function( elem ) {
1822	+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
1823	+ };
1824	+ },
1825	+
1826	+ "CLASS": function( className ) {
1827	+ var pattern = classCache[ className + " " ];
1828	+
1829	+ return pattern \|\|
1830	+ (pattern = new RegExp( "(^\|" + whitespace + ")" + className + "(" + whitespace + "\|$)" )) &&
1831	+ classCache( className, function( elem ) {
1832	+ return pattern.test( typeof elem.className === "string" && elem.className \|\| typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") \|\| "" );
1833	+ });
1834	+ },
1835	+
1836	+ "ATTR": function( name, operator, check ) {
1837	+ return function( elem ) {
1838	+ var result = Sizzle.attr( elem, name );
1839	+
1840	+ if ( result == null ) {
1841	+ return operator === "!=";
1842	+ }
1843	+ if ( !operator ) {
1844	+ return true;
1845	+ }
1846	+
1847	+ result += "";
1848	+
1849	+ return operator === "=" ? result === check :
1850	+ operator === "!=" ? result !== check :
1851	+ operator === "^=" ? check && result.indexOf( check ) === 0 :
1852	+ operator === "*=" ? check && result.indexOf( check ) > -1 :
1853	+ operator === "$=" ? check && result.slice( -check.length ) === check :
1854	+ operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
1855	+ operator === "\|=" ? result === check \|\| result.slice( 0, check.length + 1 ) === check + "-" :
1856	+ false;
1857	+ };
1858	+ },
1859	+
1860	+ "CHILD": function( type, what, argument, first, last ) {
1861	+ var simple = type.slice( 0, 3 ) !== "nth",
1862	+ forward = type.slice( -4 ) !== "last",
1863	+ ofType = what === "of-type";
1864	+
1865	+ return first === 1 && last === 0 ?
1866	+
1867	+ // Shortcut for :nth-*(n)
1868	+ function( elem ) {
1869	+ return !!elem.parentNode;
1870	+ } :
1871	+
1872	+ function( elem, context, xml ) {
1873	+ var cache, uniqueCache, outerCache, node, nodeIndex, start,
1874	+ dir = simple !== forward ? "nextSibling" : "previousSibling",
1875	+ parent = elem.parentNode,
1876	+ name = ofType && elem.nodeName.toLowerCase(),
1877	+ useCache = !xml && !ofType,
1878	+ diff = false;
1879	+
1880	+ if ( parent ) {
1881	+
1882	+ // :(first\|last\|only)-(child\|of-type)
1883	+ if ( simple ) {
1884	+ while ( dir ) {
1885	+ node = elem;
1886	+ while ( (node = node[ dir ]) ) {
1887	+ if ( ofType ?
1888	+ node.nodeName.toLowerCase() === name :
1889	+ node.nodeType === 1 ) {
1890	+
1891	+ return false;
1892	+ }
1893	+ }
1894	+ // Reverse direction for :only-* (if we haven't yet done so)
1895	+ start = dir = type === "only" && !start && "nextSibling";
1896	+ }
1897	+ return true;
1898	+ }
1899	+
1900	+ start = [ forward ? parent.firstChild : parent.lastChild ];
1901	+
1902	+ // non-xml :nth-child(...) stores cache data on `parent`
1903	+ if ( forward && useCache ) {
1904	+
1905	+ // Seek `elem` from a previously-cached index
1906	+
1907	+ // ...in a gzip-friendly way
1908	+ node = parent;
1909	+ outerCache = node[ expando ] \|\| (node[ expando ] = {});
1910	+
1911	+ // Support: IE <9 only
1912	+ // Defend against cloned attroperties (jQuery gh-1709)
1913	+ uniqueCache = outerCache[ node.uniqueID ] \|\|
1914	+ (outerCache[ node.uniqueID ] = {});
1915	+
1916	+ cache = uniqueCache[ type ] \|\| [];
1917	+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
1918	+ diff = nodeIndex && cache[ 2 ];
1919	+ node = nodeIndex && parent.childNodes[ nodeIndex ];
1920	+
1921	+ while ( (node = ++nodeIndex && node && node[ dir ] \|\|
1922	+
1923	+ // Fallback to seeking `elem` from the start
1924	+ (diff = nodeIndex = 0) \|\| start.pop()) ) {
1925	+
1926	+ // When found, cache indexes on `parent` and break
1927	+ if ( node.nodeType === 1 && ++diff && node === elem ) {
1928	+ uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
1929	+ break;
1930	+ }
1931	+ }
1932	+
1933	+ } else {
1934	+ // Use previously-cached element index if available
1935	+ if ( useCache ) {
1936	+ // ...in a gzip-friendly way
1937	+ node = elem;
1938	+ outerCache = node[ expando ] \|\| (node[ expando ] = {});
1939	+
1940	+ // Support: IE <9 only
1941	+ // Defend against cloned attroperties (jQuery gh-1709)
1942	+ uniqueCache = outerCache[ node.uniqueID ] \|\|
1943	+ (outerCache[ node.uniqueID ] = {});
1944	+
1945	+ cache = uniqueCache[ type ] \|\| [];
1946	+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
1947	+ diff = nodeIndex;
1948	+ }
1949	+
1950	+ // xml :nth-child(...)
1951	+ // or :nth-last-child(...) or :nth(-last)?-of-type(...)
1952	+ if ( diff === false ) {
1953	+ // Use the same loop as above to seek `elem` from the start
1954	+ while ( (node = ++nodeIndex && node && node[ dir ] \|\|
1955	+ (diff = nodeIndex = 0) \|\| start.pop()) ) {
1956	+
1957	+ if ( ( ofType ?
1958	+ node.nodeName.toLowerCase() === name :
1959	+ node.nodeType === 1 ) &&
1960	+ ++diff ) {
1961	+
1962	+ // Cache the index of each encountered element
1963	+ if ( useCache ) {
1964	+ outerCache = node[ expando ] \|\| (node[ expando ] = {});
1965	+
1966	+ // Support: IE <9 only
1967	+ // Defend against cloned attroperties (jQuery gh-1709)
1968	+ uniqueCache = outerCache[ node.uniqueID ] \|\|
1969	+ (outerCache[ node.uniqueID ] = {});
1970	+
1971	+ uniqueCache[ type ] = [ dirruns, diff ];
1972	+ }
1973	+
1974	+ if ( node === elem ) {
1975	+ break;
1976	+ }
1977	+ }
1978	+ }
1979	+ }
1980	+ }
1981	+
1982	+ // Incorporate the offset, then check against cycle size
1983	+ diff -= last;
1984	+ return diff === first \|\| ( diff % first === 0 && diff / first >= 0 );
1985	+ }
1986	+ };
1987	+ },
1988	+
1989	+ "PSEUDO": function( pseudo, argument ) {
1990	+ // pseudo-class names are case-insensitive
1991	+ // http://www.w3.org/TR/selectors/#pseudo-classes
1992	+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
1993	+ // Remember that setFilters inherits from pseudos
1994	+ var args,
1995	+ fn = Expr.pseudos[ pseudo ] \|\| Expr.setFilters[ pseudo.toLowerCase() ] \|\|
1996	+ Sizzle.error( "unsupported pseudo: " + pseudo );
1997	+
1998	+ // The user may use createPseudo to indicate that
1999	+ // arguments are needed to create the filter function
2000	+ // just as Sizzle does
2001	+ if ( fn[ expando ] ) {
2002	+ return fn( argument );
2003	+ }
2004	+
2005	+ // But maintain support for old signatures
2006	+ if ( fn.length > 1 ) {
2007	+ args = [ pseudo, pseudo, "", argument ];
2008	+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
2009	+ markFunction(function( seed, matches ) {
2010	+ var idx,
2011	+ matched = fn( seed, argument ),
2012	+ i = matched.length;
2013	+ while ( i-- ) {
2014	+ idx = indexOf( seed, matched[i] );
2015	+ seed[ idx ] = !( matches[ idx ] = matched[i] );
2016	+ }
2017	+ }) :
2018	+ function( elem ) {
2019	+ return fn( elem, 0, args );
2020	+ };
2021	+ }
2022	+
2023	+ return fn;
2024	+ }
2025	+ },
2026	+
2027	+ pseudos: {
2028	+ // Potentially complex pseudos
2029	+ "not": markFunction(function( selector ) {
2030	+ // Trim the selector passed to compile
2031	+ // to avoid treating leading and trailing
2032	+ // spaces as combinators
2033	+ var input = [],
2034	+ results = [],
2035	+ matcher = compile( selector.replace( rtrim, "$1" ) );
2036	+
2037	+ return matcher[ expando ] ?
2038	+ markFunction(function( seed, matches, context, xml ) {
2039	+ var elem,
2040	+ unmatched = matcher( seed, null, xml, [] ),
2041	+ i = seed.length;
2042	+
2043	+ // Match elements unmatched by `matcher`
2044	+ while ( i-- ) {
2045	+ if ( (elem = unmatched[i]) ) {
2046	+ seed[i] = !(matches[i] = elem);
2047	+ }
2048	+ }
2049	+ }) :
2050	+ function( elem, context, xml ) {
2051	+ input[0] = elem;
2052	+ matcher( input, null, xml, results );
2053	+ // Don't keep the element (issue #299)
2054	+ input[0] = null;
2055	+ return !results.pop();
2056	+ };
2057	+ }),
2058	+
2059	+ "has": markFunction(function( selector ) {
2060	+ return function( elem ) {
2061	+ return Sizzle( selector, elem ).length > 0;
2062	+ };
2063	+ }),
2064	+
2065	+ "contains": markFunction(function( text ) {
2066	+ text = text.replace( runescape, funescape );
2067	+ return function( elem ) {
2068	+ return ( elem.textContent \|\| elem.innerText \|\| getText( elem ) ).indexOf( text ) > -1;
2069	+ };
2070	+ }),
2071	+
2072	+ // "Whether an element is represented by a :lang() selector
2073	+ // is based solely on the element's language value
2074	+ // being equal to the identifier C,
2075	+ // or beginning with the identifier C immediately followed by "-".
2076	+ // The matching of C against the element's language value is performed case-insensitively.
2077	+ // The identifier C does not have to be a valid language name."
2078	+ // http://www.w3.org/TR/selectors/#lang-pseudo
2079	+ "lang": markFunction( function( lang ) {
2080	+ // lang value must be a valid identifier
2081	+ if ( !ridentifier.test(lang \|\| "") ) {
2082	+ Sizzle.error( "unsupported lang: " + lang );
2083	+ }
2084	+ lang = lang.replace( runescape, funescape ).toLowerCase();
2085	+ return function( elem ) {
2086	+ var elemLang;
2087	+ do {
2088	+ if ( (elemLang = documentIsHTML ?
2089	+ elem.lang :
2090	+ elem.getAttribute("xml:lang") \|\| elem.getAttribute("lang")) ) {
2091	+
2092	+ elemLang = elemLang.toLowerCase();
2093	+ return elemLang === lang \|\| elemLang.indexOf( lang + "-" ) === 0;
2094	+ }
2095	+ } while ( (elem = elem.parentNode) && elem.nodeType === 1 );
2096	+ return false;
2097	+ };
2098	+ }),
2099	+
2100	+ // Miscellaneous
2101	+ "target": function( elem ) {
2102	+ var hash = window.location && window.location.hash;
2103	+ return hash && hash.slice( 1 ) === elem.id;
2104	+ },
2105	+
2106	+ "root": function( elem ) {
2107	+ return elem === docElem;
2108	+ },
2109	+
2110	+ "focus": function( elem ) {
2111	+ return elem === document.activeElement && (!document.hasFocus \|\| document.hasFocus()) && !!(elem.type \|\| elem.href \|\| ~elem.tabIndex);
2112	+ },
2113	+
2114	+ // Boolean properties
2115	+ "enabled": createDisabledPseudo( false ),
2116	+ "disabled": createDisabledPseudo( true ),
2117	+
2118	+ "checked": function( elem ) {
2119	+ // In CSS3, :checked should return both checked and selected elements
2120	+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
2121	+ var nodeName = elem.nodeName.toLowerCase();
2122	+ return (nodeName === "input" && !!elem.checked) \|\| (nodeName === "option" && !!elem.selected);
2123	+ },
2124	+
2125	+ "selected": function( elem ) {
2126	+ // Accessing this property makes selected-by-default
2127	+ // options in Safari work properly
2128	+ if ( elem.parentNode ) {
2129	+ elem.parentNode.selectedIndex;
2130	+ }
2131	+
2132	+ return elem.selected === true;
2133	+ },
2134	+
2135	+ // Contents
2136	+ "empty": function( elem ) {
2137	+ // http://www.w3.org/TR/selectors/#empty-pseudo
2138	+ // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
2139	+ // but not by others (comment: 8; processing instruction: 7; etc.)
2140	+ // nodeType < 6 works because attributes (2) do not appear as children
2141	+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
2142	+ if ( elem.nodeType < 6 ) {
2143	+ return false;
2144	+ }
2145	+ }
2146	+ return true;
2147	+ },
2148	+
2149	+ "parent": function( elem ) {
2150	+ return !Expr.pseudos["empty"]( elem );
2151	+ },
2152	+
2153	+ // Element/input types
2154	+ "header": function( elem ) {
2155	+ return rheader.test( elem.nodeName );
2156	+ },
2157	+
2158	+ "input": function( elem ) {
2159	+ return rinputs.test( elem.nodeName );
2160	+ },
2161	+
2162	+ "button": function( elem ) {
2163	+ var name = elem.nodeName.toLowerCase();
2164	+ return name === "input" && elem.type === "button" \|\| name === "button";
2165	+ },
2166	+
2167	+ "text": function( elem ) {
2168	+ var attr;
2169	+ return elem.nodeName.toLowerCase() === "input" &&
2170	+ elem.type === "text" &&
2171	+
2172	+ // Support: IE<8
2173	+ // New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
2174	+ ( (attr = elem.getAttribute("type")) == null \|\| attr.toLowerCase() === "text" );
2175	+ },
2176	+
2177	+ // Position-in-collection
2178	+ "first": createPositionalPseudo(function() {
2179	+ return [ 0 ];
2180	+ }),
2181	+
2182	+ "last": createPositionalPseudo(function( matchIndexes, length ) {
2183	+ return [ length - 1 ];
2184	+ }),
2185	+
2186	+ "eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
2187	+ return [ argument < 0 ? argument + length : argument ];
2188	+ }),
2189	+
2190	+ "even": createPositionalPseudo(function( matchIndexes, length ) {
2191	+ var i = 0;
2192	+ for ( ; i < length; i += 2 ) {
2193	+ matchIndexes.push( i );
2194	+ }
2195	+ return matchIndexes;
2196	+ }),
2197	+
2198	+ "odd": createPositionalPseudo(function( matchIndexes, length ) {
2199	+ var i = 1;
2200	+ for ( ; i < length; i += 2 ) {
2201	+ matchIndexes.push( i );
2202	+ }
2203	+ return matchIndexes;
2204	+ }),
2205	+
2206	+ "lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
2207	+ var i = argument < 0 ? argument + length : argument;
2208	+ for ( ; --i >= 0; ) {
2209	+ matchIndexes.push( i );
2210	+ }
2211	+ return matchIndexes;
2212	+ }),
2213	+
2214	+ "gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
2215	+ var i = argument < 0 ? argument + length : argument;
2216	+ for ( ; ++i < length; ) {
2217	+ matchIndexes.push( i );
2218	+ }
2219	+ return matchIndexes;
2220	+ })
2221	+ }
2222	+ };
2223	+
2224	+ Expr.pseudos["nth"] = Expr.pseudos["eq"];
2225	+
2226	+ // Add button/input type pseudos
2227	+ for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
2228	+ Expr.pseudos[ i ] = createInputPseudo( i );
2229	+ }
2230	+ for ( i in { submit: true, reset: true } ) {
2231	+ Expr.pseudos[ i ] = createButtonPseudo( i );
2232	+ }
2233	+
2234	+ // Easy API for creating new setFilters
2235	+ function setFilters() {}
2236	+ setFilters.prototype = Expr.filters = Expr.pseudos;
2237	+ Expr.setFilters = new setFilters();
2238	+
2239	+ tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
2240	+ var matched, match, tokens, type,
2241	+ soFar, groups, preFilters,
2242	+ cached = tokenCache[ selector + " " ];
2243	+
2244	+ if ( cached ) {
2245	+ return parseOnly ? 0 : cached.slice( 0 );
2246	+ }
2247	+
2248	+ soFar = selector;
2249	+ groups = [];
2250	+ preFilters = Expr.preFilter;
2251	+
2252	+ while ( soFar ) {
2253	+
2254	+ // Comma and first run
2255	+ if ( !matched \|\| (match = rcomma.exec( soFar )) ) {
2256	+ if ( match ) {
2257	+ // Don't consume trailing commas as valid
2258	+ soFar = soFar.slice( match[0].length ) \|\| soFar;
2259	+ }
2260	+ groups.push( (tokens = []) );
2261	+ }
2262	+
2263	+ matched = false;
2264	+
2265	+ // Combinators
2266	+ if ( (match = rcombinators.exec( soFar )) ) {
2267	+ matched = match.shift();
2268	+ tokens.push({
2269	+ value: matched,
2270	+ // Cast descendant combinators to space
2271	+ type: match[0].replace( rtrim, " " )
2272	+ });
2273	+ soFar = soFar.slice( matched.length );
2274	+ }
2275	+
2276	+ // Filters
2277	+ for ( type in Expr.filter ) {
2278	+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] \|\|
2279	+ (match = preFilters[ type ]( match ))) ) {
2280	+ matched = match.shift();
2281	+ tokens.push({
2282	+ value: matched,
2283	+ type: type,
2284	+ matches: match
2285	+ });
2286	+ soFar = soFar.slice( matched.length );
2287	+ }
2288	+ }
2289	+
2290	+ if ( !matched ) {
2291	+ break;
2292	+ }
2293	+ }
2294	+
2295	+ // Return the length of the invalid excess
2296	+ // if we're just parsing
2297	+ // Otherwise, throw an error or return tokens
2298	+ return parseOnly ?
2299	+ soFar.length :
2300	+ soFar ?
2301	+ Sizzle.error( selector ) :
2302	+ // Cache the tokens
2303	+ tokenCache( selector, groups ).slice( 0 );
2304	+ };
2305	+
2306	+ function toSelector( tokens ) {
2307	+ var i = 0,
2308	+ len = tokens.length,
2309	+ selector = "";
2310	+ for ( ; i < len; i++ ) {
2311	+ selector += tokens[i].value;
2312	+ }
2313	+ return selector;
2314	+ }
2315	+
2316	+ function addCombinator( matcher, combinator, base ) {
2317	+ var dir = combinator.dir,
2318	+ skip = combinator.next,
2319	+ key = skip \|\| dir,
2320	+ checkNonElements = base && key === "parentNode",
2321	+ doneName = done++;
2322	+
2323	+ return combinator.first ?
2324	+ // Check against closest ancestor/preceding element
2325	+ function( elem, context, xml ) {
2326	+ while ( (elem = elem[ dir ]) ) {
2327	+ if ( elem.nodeType === 1 \|\| checkNonElements ) {
2328	+ return matcher( elem, context, xml );
2329	+ }
2330	+ }
2331	+ return false;
2332	+ } :
2333	+
2334	+ // Check against all ancestor/preceding elements
2335	+ function( elem, context, xml ) {
2336	+ var oldCache, uniqueCache, outerCache,
2337	+ newCache = [ dirruns, doneName ];
2338	+
2339	+ // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
2340	+ if ( xml ) {
2341	+ while ( (elem = elem[ dir ]) ) {
2342	+ if ( elem.nodeType === 1 \|\| checkNonElements ) {
2343	+ if ( matcher( elem, context, xml ) ) {
2344	+ return true;
2345	+ }
2346	+ }
2347	+ }
2348	+ } else {
2349	+ while ( (elem = elem[ dir ]) ) {
2350	+ if ( elem.nodeType === 1 \|\| checkNonElements ) {
2351	+ outerCache = elem[ expando ] \|\| (elem[ expando ] = {});
2352	+
2353	+ // Support: IE <9 only
2354	+ // Defend against cloned attroperties (jQuery gh-1709)
2355	+ uniqueCache = outerCache[ elem.uniqueID ] \|\| (outerCache[ elem.uniqueID ] = {});
2356	+
2357	+ if ( skip && skip === elem.nodeName.toLowerCase() ) {
2358	+ elem = elem[ dir ] \|\| elem;
2359	+ } else if ( (oldCache = uniqueCache[ key ]) &&
2360	+ oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
2361	+
2362	+ // Assign to newCache so results back-propagate to previous elements
2363	+ return (newCache[ 2 ] = oldCache[ 2 ]);
2364	+ } else {
2365	+ // Reuse newcache so results back-propagate to previous elements
2366	+ uniqueCache[ key ] = newCache;
2367	+
2368	+ // A match means we're done; a fail means we have to keep checking
2369	+ if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
2370	+ return true;
2371	+ }
2372	+ }
2373	+ }
2374	+ }
2375	+ }
2376	+ return false;
2377	+ };
2378	+ }
2379	+
2380	+ function elementMatcher( matchers ) {
2381	+ return matchers.length > 1 ?
2382	+ function( elem, context, xml ) {
2383	+ var i = matchers.length;
2384	+ while ( i-- ) {
2385	+ if ( !matchers[i]( elem, context, xml ) ) {
2386	+ return false;
2387	+ }
2388	+ }
2389	+ return true;
2390	+ } :
2391	+ matchers[0];
2392	+ }
2393	+
2394	+ function multipleContexts( selector, contexts, results ) {
2395	+ var i = 0,
2396	+ len = contexts.length;
2397	+ for ( ; i < len; i++ ) {
2398	+ Sizzle( selector, contexts[i], results );
2399	+ }
2400	+ return results;
2401	+ }
2402	+
2403	+ function condense( unmatched, map, filter, context, xml ) {
2404	+ var elem,
2405	+ newUnmatched = [],
2406	+ i = 0,
2407	+ len = unmatched.length,
2408	+ mapped = map != null;
2409	+
2410	+ for ( ; i < len; i++ ) {
2411	+ if ( (elem = unmatched[i]) ) {
2412	+ if ( !filter \|\| filter( elem, context, xml ) ) {
2413	+ newUnmatched.push( elem );
2414	+ if ( mapped ) {
2415	+ map.push( i );
2416	+ }
2417	+ }
2418	+ }
2419	+ }
2420	+
2421	+ return newUnmatched;
2422	+ }
2423	+
2424	+ function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
2425	+ if ( postFilter && !postFilter[ expando ] ) {
2426	+ postFilter = setMatcher( postFilter );
2427	+ }
2428	+ if ( postFinder && !postFinder[ expando ] ) {
2429	+ postFinder = setMatcher( postFinder, postSelector );
2430	+ }
2431	+ return markFunction(function( seed, results, context, xml ) {
2432	+ var temp, i, elem,
2433	+ preMap = [],
2434	+ postMap = [],
2435	+ preexisting = results.length,
2436	+
2437	+ // Get initial elements from seed or context
2438	+ elems = seed \|\| multipleContexts( selector \|\| "*", context.nodeType ? [ context ] : context, [] ),
2439	+
2440	+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
2441	+ matcherIn = preFilter && ( seed \|\| !selector ) ?
2442	+ condense( elems, preMap, preFilter, context, xml ) :
2443	+ elems,
2444	+
2445	+ matcherOut = matcher ?
2446	+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
2447	+ postFinder \|\| ( seed ? preFilter : preexisting \|\| postFilter ) ?
2448	+
2449	+ // ...intermediate processing is necessary
2450	+ [] :
2451	+
2452	+ // ...otherwise use results directly
2453	+ results :
2454	+ matcherIn;
2455	+
2456	+ // Find primary matches
2457	+ if ( matcher ) {
2458	+ matcher( matcherIn, matcherOut, context, xml );
2459	+ }
2460	+
2461	+ // Apply postFilter
2462	+ if ( postFilter ) {
2463	+ temp = condense( matcherOut, postMap );
2464	+ postFilter( temp, [], context, xml );
2465	+
2466	+ // Un-match failing elements by moving them back to matcherIn
2467	+ i = temp.length;
2468	+ while ( i-- ) {
2469	+ if ( (elem = temp[i]) ) {
2470	+ matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
2471	+ }
2472	+ }
2473	+ }
2474	+
2475	+ if ( seed ) {
2476	+ if ( postFinder \|\| preFilter ) {
2477	+ if ( postFinder ) {
2478	+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
2479	+ temp = [];
2480	+ i = matcherOut.length;
2481	+ while ( i-- ) {
2482	+ if ( (elem = matcherOut[i]) ) {
2483	+ // Restore matcherIn since elem is not yet a final match
2484	+ temp.push( (matcherIn[i] = elem) );
2485	+ }
2486	+ }
2487	+ postFinder( null, (matcherOut = []), temp, xml );
2488	+ }
2489	+
2490	+ // Move matched elements from seed to results to keep them synchronized
2491	+ i = matcherOut.length;
2492	+ while ( i-- ) {
2493	+ if ( (elem = matcherOut[i]) &&
2494	+ (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {
2495	+
2496	+ seed[temp] = !(results[temp] = elem);
2497	+ }
2498	+ }
2499	+ }
2500	+
2501	+ // Add elements to results, through postFinder if defined
2502	+ } else {
2503	+ matcherOut = condense(
2504	+ matcherOut === results ?
2505	+ matcherOut.splice( preexisting, matcherOut.length ) :
2506	+ matcherOut
2507	+ );
2508	+ if ( postFinder ) {
2509	+ postFinder( null, results, matcherOut, xml );
2510	+ } else {
2511	+ push.apply( results, matcherOut );
2512	+ }
2513	+ }
2514	+ });
2515	+ }
2516	+
2517	+ function matcherFromTokens( tokens ) {
2518	+ var checkContext, matcher, j,
2519	+ len = tokens.length,
2520	+ leadingRelative = Expr.relative[ tokens[0].type ],
2521	+ implicitRelative = leadingRelative \|\| Expr.relative[" "],
2522	+ i = leadingRelative ? 1 : 0,
2523	+
2524	+ // The foundational matcher ensures that elements are reachable from top-level context(s)
2525	+ matchContext = addCombinator( function( elem ) {
2526	+ return elem === checkContext;
2527	+ }, implicitRelative, true ),
2528	+ matchAnyContext = addCombinator( function( elem ) {
2529	+ return indexOf( checkContext, elem ) > -1;
2530	+ }, implicitRelative, true ),
2531	+ matchers = [ function( elem, context, xml ) {
2532	+ var ret = ( !leadingRelative && ( xml \|\| context !== outermostContext ) ) \|\| (
2533	+ (checkContext = context).nodeType ?
2534	+ matchContext( elem, context, xml ) :
2535	+ matchAnyContext( elem, context, xml ) );
2536	+ // Avoid hanging onto element (issue #299)
2537	+ checkContext = null;
2538	+ return ret;
2539	+ } ];
2540	+
2541	+ for ( ; i < len; i++ ) {
2542	+ if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
2543	+ matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
2544	+ } else {
2545	+ matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
2546	+
2547	+ // Return special upon seeing a positional matcher
2548	+ if ( matcher[ expando ] ) {
2549	+ // Find the next relative operator (if any) for proper handling
2550	+ j = ++i;
2551	+ for ( ; j < len; j++ ) {
2552	+ if ( Expr.relative[ tokens[j].type ] ) {
2553	+ break;
2554	+ }
2555	+ }
2556	+ return setMatcher(
2557	+ i > 1 && elementMatcher( matchers ),
2558	+ i > 1 && toSelector(
2559	+ // If the preceding token was a descendant combinator, insert an implicit any-element `*`
2560	+ tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
2561	+ ).replace( rtrim, "$1" ),
2562	+ matcher,
2563	+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
2564	+ j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
2565	+ j < len && toSelector( tokens )
2566	+ );
2567	+ }
2568	+ matchers.push( matcher );
2569	+ }
2570	+ }
2571	+
2572	+ return elementMatcher( matchers );
2573	+ }
2574	+
2575	+ function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
2576	+ var bySet = setMatchers.length > 0,
2577	+ byElement = elementMatchers.length > 0,
2578	+ superMatcher = function( seed, context, xml, results, outermost ) {
2579	+ var elem, j, matcher,
2580	+ matchedCount = 0,
2581	+ i = "0",
2582	+ unmatched = seed && [],
2583	+ setMatched = [],
2584	+ contextBackup = outermostContext,
2585	+ // We must always have either seed elements or outermost context
2586	+ elems = seed \|\| byElement && Expr.find["TAG"]( "*", outermost ),
2587	+ // Use integer dirruns iff this is the outermost matcher
2588	+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() \|\| 0.1),
2589	+ len = elems.length;
2590	+
2591	+ if ( outermost ) {
2592	+ outermostContext = context === document \|\| context \|\| outermost;
2593	+ }
2594	+
2595	+ // Add elements passing elementMatchers directly to results
2596	+ // Support: IE<9, Safari
2597	+ // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
2598	+ for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
2599	+ if ( byElement && elem ) {
2600	+ j = 0;
2601	+ if ( !context && elem.ownerDocument !== document ) {
2602	+ setDocument( elem );
2603	+ xml = !documentIsHTML;
2604	+ }
2605	+ while ( (matcher = elementMatchers[j++]) ) {
2606	+ if ( matcher( elem, context \|\| document, xml) ) {
2607	+ results.push( elem );
2608	+ break;
2609	+ }
2610	+ }
2611	+ if ( outermost ) {
2612	+ dirruns = dirrunsUnique;
2613	+ }
2614	+ }
2615	+
2616	+ // Track unmatched elements for set filters
2617	+ if ( bySet ) {
2618	+ // They will have gone through all possible matchers
2619	+ if ( (elem = !matcher && elem) ) {
2620	+ matchedCount--;
2621	+ }
2622	+
2623	+ // Lengthen the array for every element, matched or not
2624	+ if ( seed ) {
2625	+ unmatched.push( elem );
2626	+ }
2627	+ }
2628	+ }
2629	+
2630	+ // `i` is now the count of elements visited above, and adding it to `matchedCount`
2631	+ // makes the latter nonnegative.
2632	+ matchedCount += i;
2633	+
2634	+ // Apply set filters to unmatched elements
2635	+ // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
2636	+ // equals `i`), unless we didn't visit _any_ elements in the above loop because we have
2637	+ // no element matchers and no seed.
2638	+ // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
2639	+ // case, which will result in a "00" `matchedCount` that differs from `i` but is also
2640	+ // numerically zero.
2641	+ if ( bySet && i !== matchedCount ) {
2642	+ j = 0;
2643	+ while ( (matcher = setMatchers[j++]) ) {
2644	+ matcher( unmatched, setMatched, context, xml );
2645	+ }
2646	+
2647	+ if ( seed ) {
2648	+ // Reintegrate element matches to eliminate the need for sorting
2649	+ if ( matchedCount > 0 ) {
2650	+ while ( i-- ) {
2651	+ if ( !(unmatched[i] \|\| setMatched[i]) ) {
2652	+ setMatched[i] = pop.call( results );
2653	+ }
2654	+ }
2655	+ }
2656	+
2657	+ // Discard index placeholder values to get only actual matches
2658	+ setMatched = condense( setMatched );
2659	+ }
2660	+
2661	+ // Add matches to results
2662	+ push.apply( results, setMatched );
2663	+
2664	+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
2665	+ if ( outermost && !seed && setMatched.length > 0 &&
2666	+ ( matchedCount + setMatchers.length ) > 1 ) {
2667	+
2668	+ Sizzle.uniqueSort( results );
2669	+ }
2670	+ }
2671	+
2672	+ // Override manipulation of globals by nested matchers
2673	+ if ( outermost ) {
2674	+ dirruns = dirrunsUnique;
2675	+ outermostContext = contextBackup;
2676	+ }
2677	+
2678	+ return unmatched;
2679	+ };
2680	+
2681	+ return bySet ?
2682	+ markFunction( superMatcher ) :
2683	+ superMatcher;
2684	+ }
2685	+
2686	+ compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
2687	+ var i,
2688	+ setMatchers = [],
2689	+ elementMatchers = [],
2690	+ cached = compilerCache[ selector + " " ];
2691	+
2692	+ if ( !cached ) {
2693	+ // Generate a function of recursive functions that can be used to check each element
2694	+ if ( !match ) {
2695	+ match = tokenize( selector );
2696	+ }
2697	+ i = match.length;
2698	+ while ( i-- ) {
2699	+ cached = matcherFromTokens( match[i] );
2700	+ if ( cached[ expando ] ) {
2701	+ setMatchers.push( cached );
2702	+ } else {
2703	+ elementMatchers.push( cached );
2704	+ }
2705	+ }
2706	+
2707	+ // Cache the compiled function
2708	+ cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
2709	+
2710	+ // Save selector and tokenization
2711	+ cached.selector = selector;
2712	+ }
2713	+ return cached;
2714	+ };
2715	+
2716	+ /**
2717	+ * A low-level selection function that works with Sizzle's compiled
2718	+ * selector functions
2719	+ * @param {String\|Function} selector A selector or a pre-compiled
2720	+ * selector function built with Sizzle.compile
2721	+ * @param {Element} context
2722	+ * @param {Array} [results]
2723	+ * @param {Array} [seed] A set of elements to match against
2724	+ */
2725	+ select = Sizzle.select = function( selector, context, results, seed ) {
2726	+ var i, tokens, token, type, find,
2727	+ compiled = typeof selector === "function" && selector,
2728	+ match = !seed && tokenize( (selector = compiled.selector \|\| selector) );
2729	+
2730	+ results = results \|\| [];
2731	+
2732	+ // Try to minimize operations if there is only one selector in the list and no seed
2733	+ // (the latter of which guarantees us context)
2734	+ if ( match.length === 1 ) {
2735	+
2736	+ // Reduce context if the leading compound selector is an ID
2737	+ tokens = match[0] = match[0].slice( 0 );
2738	+ if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
2739	+ context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) {
2740	+
2741	+ context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) \|\| [] )[0];
2742	+ if ( !context ) {
2743	+ return results;
2744	+
2745	+ // Precompiled matchers will still verify ancestry, so step up a level
2746	+ } else if ( compiled ) {
2747	+ context = context.parentNode;
2748	+ }
2749	+
2750	+ selector = selector.slice( tokens.shift().value.length );
2751	+ }
2752	+
2753	+ // Fetch a seed set for right-to-left matching
2754	+ i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
2755	+ while ( i-- ) {
2756	+ token = tokens[i];
2757	+
2758	+ // Abort if we hit a combinator
2759	+ if ( Expr.relative[ (type = token.type) ] ) {
2760	+ break;
2761	+ }
2762	+ if ( (find = Expr.find[ type ]) ) {
2763	+ // Search, expanding context for leading sibling combinators
2764	+ if ( (seed = find(
2765	+ token.matches[0].replace( runescape, funescape ),
2766	+ rsibling.test( tokens[0].type ) && testContext( context.parentNode ) \|\| context
2767	+ )) ) {
2768	+
2769	+ // If seed is empty or no tokens remain, we can return early
2770	+ tokens.splice( i, 1 );
2771	+ selector = seed.length && toSelector( tokens );
2772	+ if ( !selector ) {
2773	+ push.apply( results, seed );
2774	+ return results;
2775	+ }
2776	+
2777	+ break;
2778	+ }
2779	+ }
2780	+ }
2781	+ }
2782	+
2783	+ // Compile and execute a filtering function if one is not provided
2784	+ // Provide `match` to avoid retokenization if we modified the selector above
2785	+ ( compiled \|\| compile( selector, match ) )(
2786	+ seed,
2787	+ context,
2788	+ !documentIsHTML,
2789	+ results,
2790	+ !context \|\| rsibling.test( selector ) && testContext( context.parentNode ) \|\| context
2791	+ );
2792	+ return results;
2793	+ };
2794	+
2795	+ // One-time assignments
2796	+
2797	+ // Sort stability
2798	+ support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
2799	+
2800	+ // Support: Chrome 14-35+
2801	+ // Always assume duplicates if they aren't passed to the comparison function
2802	+ support.detectDuplicates = !!hasDuplicate;
2803	+
2804	+ // Initialize against the default document
2805	+ setDocument();
2806	+
2807	+ // Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
2808	+ // Detached nodes confoundingly follow each other
2809	+ support.sortDetached = assert(function( el ) {
2810	+ // Should return 1, but returns 4 (following)
2811	+ return el.compareDocumentPosition( document.createElement("fieldset") ) & 1;
2812	+ });
2813	+
2814	+ // Support: IE<8
2815	+ // Prevent attribute/property "interpolation"
2816	+ // https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
2817	+ if ( !assert(function( el ) {
2818	+ el.innerHTML = "<a href='#'></a>";
2819	+ return el.firstChild.getAttribute("href") === "#" ;
2820	+ }) ) {
2821	+ addHandle( "type\|href\|height\|width", function( elem, name, isXML ) {
2822	+ if ( !isXML ) {
2823	+ return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
2824	+ }
2825	+ });
2826	+ }
2827	+
2828	+ // Support: IE<9
2829	+ // Use defaultValue in place of getAttribute("value")
2830	+ if ( !support.attributes \|\| !assert(function( el ) {
2831	+ el.innerHTML = "<input/>";
2832	+ el.firstChild.setAttribute( "value", "" );
2833	+ return el.firstChild.getAttribute( "value" ) === "";
2834	+ }) ) {
2835	+ addHandle( "value", function( elem, name, isXML ) {
2836	+ if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
2837	+ return elem.defaultValue;
2838	+ }
2839	+ });
2840	+ }
2841	+
2842	+ // Support: IE<9
2843	+ // Use getAttributeNode to fetch booleans when getAttribute lies
2844	+ if ( !assert(function( el ) {
2845	+ return el.getAttribute("disabled") == null;
2846	+ }) ) {
2847	+ addHandle( booleans, function( elem, name, isXML ) {
2848	+ var val;
2849	+ if ( !isXML ) {
2850	+ return elem[ name ] === true ? name.toLowerCase() :
2851	+ (val = elem.getAttributeNode( name )) && val.specified ?
2852	+ val.value :
2853	+ null;
2854	+ }
2855	+ });
2856	+ }
2857	+
2858	+ return Sizzle;
2859	+
2860	+ })( window );
2861	+
2862	+
2863	+
2864	+ jQuery.find = Sizzle;
2865	+ jQuery.expr = Sizzle.selectors;
2866	+
2867	+ // Deprecated
2868	+ jQuery.expr[ ":" ] = jQuery.expr.pseudos;
2869	+ jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
2870	+ jQuery.text = Sizzle.getText;
2871	+ jQuery.isXMLDoc = Sizzle.isXML;
2872	+ jQuery.contains = Sizzle.contains;
2873	+ jQuery.escapeSelector = Sizzle.escape;
2874	+
2875	+
2876	+
2877	+
2878	+ var dir = function( elem, dir, until ) {
2879	+ var matched = [],
2880	+ truncate = until !== undefined;
2881	+
2882	+ while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
2883	+ if ( elem.nodeType === 1 ) {
2884	+ if ( truncate && jQuery( elem ).is( until ) ) {
2885	+ break;
2886	+ }
2887	+ matched.push( elem );
2888	+ }
2889	+ }
2890	+ return matched;
2891	+ };
2892	+
2893	+
2894	+ var siblings = function( n, elem ) {
2895	+ var matched = [];
2896	+
2897	+ for ( ; n; n = n.nextSibling ) {
2898	+ if ( n.nodeType === 1 && n !== elem ) {
2899	+ matched.push( n );
2900	+ }
2901	+ }
2902	+
2903	+ return matched;
2904	+ };
2905	+
2906	+
2907	+ var rneedsContext = jQuery.expr.match.needsContext;
2908	+
2909	+
2910	+
2911	+ function nodeName( elem, name ) {
2912	+
2913	+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
2914	+
2915	+ };
2916	+ var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f])[\x20\t\r\n\f]\/?>(?:<\/\1>\|)$/i );
2917	+
2918	+
2919	+
2920	+ var risSimple = /^.[^:#\[\.,]*$/;
2921	+
2922	+ // Implement the identical functionality for filter and not
2923	+ function winnow( elements, qualifier, not ) {
2924	+ if ( jQuery.isFunction( qualifier ) ) {
2925	+ return jQuery.grep( elements, function( elem, i ) {
2926	+ return !!qualifier.call( elem, i, elem ) !== not;
2927	+ } );
2928	+ }
2929	+
2930	+ // Single element
2931	+ if ( qualifier.nodeType ) {
2932	+ return jQuery.grep( elements, function( elem ) {
2933	+ return ( elem === qualifier ) !== not;
2934	+ } );
2935	+ }
2936	+
2937	+ // Arraylike of elements (jQuery, arguments, Array)
2938	+ if ( typeof qualifier !== "string" ) {
2939	+ return jQuery.grep( elements, function( elem ) {
2940	+ return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
2941	+ } );
2942	+ }
2943	+
2944	+ // Simple selector that can be filtered directly, removing non-Elements
2945	+ if ( risSimple.test( qualifier ) ) {
2946	+ return jQuery.filter( qualifier, elements, not );
2947	+ }
2948	+
2949	+ // Complex selector, compare the two sets, removing non-Elements
2950	+ qualifier = jQuery.filter( qualifier, elements );
2951	+ return jQuery.grep( elements, function( elem ) {
2952	+ return ( indexOf.call( qualifier, elem ) > -1 ) !== not && elem.nodeType === 1;
2953	+ } );
2954	+ }
2955	+
2956	+ jQuery.filter = function( expr, elems, not ) {
2957	+ var elem = elems[ 0 ];
2958	+
2959	+ if ( not ) {
2960	+ expr = ":not(" + expr + ")";
2961	+ }
2962	+
2963	+ if ( elems.length === 1 && elem.nodeType === 1 ) {
2964	+ return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
2965	+ }
2966	+
2967	+ return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
2968	+ return elem.nodeType === 1;
2969	+ } ) );
2970	+ };
2971	+
2972	+ jQuery.fn.extend( {
2973	+ find: function( selector ) {
2974	+ var i, ret,
2975	+ len = this.length,
2976	+ self = this;
2977	+
2978	+ if ( typeof selector !== "string" ) {
2979	+ return this.pushStack( jQuery( selector ).filter( function() {
2980	+ for ( i = 0; i < len; i++ ) {
2981	+ if ( jQuery.contains( self[ i ], this ) ) {
2982	+ return true;
2983	+ }
2984	+ }
2985	+ } ) );
2986	+ }
2987	+
2988	+ ret = this.pushStack( [] );
2989	+
2990	+ for ( i = 0; i < len; i++ ) {
2991	+ jQuery.find( selector, self[ i ], ret );
2992	+ }
2993	+
2994	+ return len > 1 ? jQuery.uniqueSort( ret ) : ret;
2995	+ },
2996	+ filter: function( selector ) {
2997	+ return this.pushStack( winnow( this, selector \|\| [], false ) );
2998	+ },
2999	+ not: function( selector ) {
3000	+ return this.pushStack( winnow( this, selector \|\| [], true ) );
3001	+ },
3002	+ is: function( selector ) {
3003	+ return !!winnow(
3004	+ this,
3005	+
3006	+ // If this is a positional/relative selector, check membership in the returned set
3007	+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
3008	+ typeof selector === "string" && rneedsContext.test( selector ) ?
3009	+ jQuery( selector ) :
3010	+ selector \|\| [],
3011	+ false
3012	+ ).length;
3013	+ }
3014	+ } );
3015	+
3016	+
3017	+ // Initialize a jQuery object
3018	+
3019	+
3020	+ // A central reference to the root jQuery(document)
3021	+ var rootjQuery,
3022	+
3023	+ // A simple way to check for HTML strings
3024	+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
3025	+ // Strict HTML recognition (#11290: must start with <)
3026	+ // Shortcut simple #id case for speed
3027	+ rquickExpr = /^(?:\s(<[\w\W]+>)[^>]\|#([\w-]+))$/,
3028	+
3029	+ init = jQuery.fn.init = function( selector, context, root ) {
3030	+ var match, elem;
3031	+
3032	+ // HANDLE: $(""), $(null), $(undefined), $(false)
3033	+ if ( !selector ) {
3034	+ return this;
3035	+ }
3036	+
3037	+ // Method init() accepts an alternate rootjQuery
3038	+ // so migrate can support jQuery.sub (gh-2101)
3039	+ root = root \|\| rootjQuery;
3040	+
3041	+ // Handle HTML strings
3042	+ if ( typeof selector === "string" ) {
3043	+ if ( selector[ 0 ] === "<" &&
3044	+ selector[ selector.length - 1 ] === ">" &&
3045	+ selector.length >= 3 ) {
3046	+
3047	+ // Assume that strings that start and end with <> are HTML and skip the regex check
3048	+ match = [ null, selector, null ];
3049	+
3050	+ } else {
3051	+ match = rquickExpr.exec( selector );
3052	+ }
3053	+
3054	+ // Match html or make sure no context is specified for #id
3055	+ if ( match && ( match[ 1 ] \|\| !context ) ) {
3056	+
3057	+ // HANDLE: $(html) -> $(array)
3058	+ if ( match[ 1 ] ) {
3059	+ context = context instanceof jQuery ? context[ 0 ] : context;
3060	+
3061	+ // Option to run scripts is true for back-compat
3062	+ // Intentionally let the error be thrown if parseHTML is not present
3063	+ jQuery.merge( this, jQuery.parseHTML(
3064	+ match[ 1 ],
3065	+ context && context.nodeType ? context.ownerDocument \|\| context : document,
3066	+ true
3067	+ ) );
3068	+
3069	+ // HANDLE: $(html, props)
3070	+ if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
3071	+ for ( match in context ) {
3072	+
3073	+ // Properties of context are called as methods if possible
3074	+ if ( jQuery.isFunction( this[ match ] ) ) {
3075	+ this[ match ]( context[ match ] );
3076	+
3077	+ // ...and otherwise set as attributes
3078	+ } else {
3079	+ this.attr( match, context[ match ] );
3080	+ }
3081	+ }
3082	+ }
3083	+
3084	+ return this;
3085	+
3086	+ // HANDLE: $(#id)
3087	+ } else {
3088	+ elem = document.getElementById( match[ 2 ] );
3089	+
3090	+ if ( elem ) {
3091	+
3092	+ // Inject the element directly into the jQuery object
3093	+ this[ 0 ] = elem;
3094	+ this.length = 1;
3095	+ }
3096	+ return this;
3097	+ }
3098	+
3099	+ // HANDLE: $(expr, $(...))
3100	+ } else if ( !context \|\| context.jquery ) {
3101	+ return ( context \|\| root ).find( selector );
3102	+
3103	+ // HANDLE: $(expr, context)
3104	+ // (which is just equivalent to: $(context).find(expr)
3105	+ } else {
3106	+ return this.constructor( context ).find( selector );
3107	+ }
3108	+
3109	+ // HANDLE: $(DOMElement)
3110	+ } else if ( selector.nodeType ) {
3111	+ this[ 0 ] = selector;
3112	+ this.length = 1;
3113	+ return this;
3114	+
3115	+ // HANDLE: $(function)
3116	+ // Shortcut for document ready
3117	+ } else if ( jQuery.isFunction( selector ) ) {
3118	+ return root.ready !== undefined ?
3119	+ root.ready( selector ) :
3120	+
3121	+ // Execute immediately if ready is not present
3122	+ selector( jQuery );
3123	+ }
3124	+
3125	+ return jQuery.makeArray( selector, this );
3126	+ };
3127	+
3128	+ // Give the init function the jQuery prototype for later instantiation
3129	+ init.prototype = jQuery.fn;
3130	+
3131	+ // Initialize central reference
3132	+ rootjQuery = jQuery( document );
3133	+
3134	+
3135	+ var rparentsprev = /^(?:parents\|prev(?:Until\|All))/,
3136	+
3137	+ // Methods guaranteed to produce a unique set when starting from a unique set
3138	+ guaranteedUnique = {
3139	+ children: true,
3140	+ contents: true,
3141	+ next: true,
3142	+ prev: true
3143	+ };
3144	+
3145	+ jQuery.fn.extend( {
3146	+ has: function( target ) {
3147	+ var targets = jQuery( target, this ),
3148	+ l = targets.length;
3149	+
3150	+ return this.filter( function() {
3151	+ var i = 0;
3152	+ for ( ; i < l; i++ ) {
3153	+ if ( jQuery.contains( this, targets[ i ] ) ) {
3154	+ return true;
3155	+ }
3156	+ }
3157	+ } );
3158	+ },
3159	+
3160	+ closest: function( selectors, context ) {
3161	+ var cur,
3162	+ i = 0,
3163	+ l = this.length,
3164	+ matched = [],
3165	+ targets = typeof selectors !== "string" && jQuery( selectors );
3166	+
3167	+ // Positional selectors never match, since there's no _selection_ context
3168	+ if ( !rneedsContext.test( selectors ) ) {
3169	+ for ( ; i < l; i++ ) {
3170	+ for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
3171	+
3172	+ // Always skip document fragments
3173	+ if ( cur.nodeType < 11 && ( targets ?
3174	+ targets.index( cur ) > -1 :
3175	+
3176	+ // Don't pass non-elements to Sizzle
3177	+ cur.nodeType === 1 &&
3178	+ jQuery.find.matchesSelector( cur, selectors ) ) ) {
3179	+
3180	+ matched.push( cur );
3181	+ break;
3182	+ }
3183	+ }
3184	+ }
3185	+ }
3186	+
3187	+ return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
3188	+ },
3189	+
3190	+ // Determine the position of an element within the set
3191	+ index: function( elem ) {
3192	+
3193	+ // No argument, return index in parent
3194	+ if ( !elem ) {
3195	+ return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
3196	+ }
3197	+
3198	+ // Index in selector
3199	+ if ( typeof elem === "string" ) {
3200	+ return indexOf.call( jQuery( elem ), this[ 0 ] );
3201	+ }
3202	+
3203	+ // Locate the position of the desired element
3204	+ return indexOf.call( this,
3205	+
3206	+ // If it receives a jQuery object, the first element is used
3207	+ elem.jquery ? elem[ 0 ] : elem
3208	+ );
3209	+ },
3210	+
3211	+ add: function( selector, context ) {
3212	+ return this.pushStack(
3213	+ jQuery.uniqueSort(
3214	+ jQuery.merge( this.get(), jQuery( selector, context ) )
3215	+ )
3216	+ );
3217	+ },
3218	+
3219	+ addBack: function( selector ) {
3220	+ return this.add( selector == null ?
3221	+ this.prevObject : this.prevObject.filter( selector )
3222	+ );
3223	+ }
3224	+ } );
3225	+
3226	+ function sibling( cur, dir ) {
3227	+ while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
3228	+ return cur;
3229	+ }
3230	+
3231	+ jQuery.each( {
3232	+ parent: function( elem ) {
3233	+ var parent = elem.parentNode;
3234	+ return parent && parent.nodeType !== 11 ? parent : null;
3235	+ },
3236	+ parents: function( elem ) {
3237	+ return dir( elem, "parentNode" );
3238	+ },
3239	+ parentsUntil: function( elem, i, until ) {
3240	+ return dir( elem, "parentNode", until );
3241	+ },
3242	+ next: function( elem ) {
3243	+ return sibling( elem, "nextSibling" );
3244	+ },
3245	+ prev: function( elem ) {
3246	+ return sibling( elem, "previousSibling" );
3247	+ },
3248	+ nextAll: function( elem ) {
3249	+ return dir( elem, "nextSibling" );
3250	+ },
3251	+ prevAll: function( elem ) {
3252	+ return dir( elem, "previousSibling" );
3253	+ },
3254	+ nextUntil: function( elem, i, until ) {
3255	+ return dir( elem, "nextSibling", until );
3256	+ },
3257	+ prevUntil: function( elem, i, until ) {
3258	+ return dir( elem, "previousSibling", until );
3259	+ },
3260	+ siblings: function( elem ) {
3261	+ return siblings( ( elem.parentNode \|\| {} ).firstChild, elem );
3262	+ },
3263	+ children: function( elem ) {
3264	+ return siblings( elem.firstChild );
3265	+ },
3266	+ contents: function( elem ) {
3267	+ if ( nodeName( elem, "iframe" ) ) {
3268	+ return elem.contentDocument;
3269	+ }
3270	+
3271	+ // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
3272	+ // Treat the template element as a regular one in browsers that
3273	+ // don't support it.
3274	+ if ( nodeName( elem, "template" ) ) {
3275	+ elem = elem.content \|\| elem;
3276	+ }
3277	+
3278	+ return jQuery.merge( [], elem.childNodes );
3279	+ }
3280	+ }, function( name, fn ) {
3281	+ jQuery.fn[ name ] = function( until, selector ) {
3282	+ var matched = jQuery.map( this, fn, until );
3283	+
3284	+ if ( name.slice( -5 ) !== "Until" ) {
3285	+ selector = until;
3286	+ }
3287	+
3288	+ if ( selector && typeof selector === "string" ) {
3289	+ matched = jQuery.filter( selector, matched );
3290	+ }
3291	+
3292	+ if ( this.length > 1 ) {
3293	+
3294	+ // Remove duplicates
3295	+ if ( !guaranteedUnique[ name ] ) {
3296	+ jQuery.uniqueSort( matched );
3297	+ }
3298	+
3299	+ // Reverse order for parents* and prev-derivatives
3300	+ if ( rparentsprev.test( name ) ) {
3301	+ matched.reverse();
3302	+ }
3303	+ }
3304	+
3305	+ return this.pushStack( matched );
3306	+ };
3307	+ } );
3308	+ var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
3309	+
3310	+
3311	+
3312	+ // Convert String-formatted options into Object-formatted ones
3313	+ function createOptions( options ) {
3314	+ var object = {};
3315	+ jQuery.each( options.match( rnothtmlwhite ) \|\| [], function( _, flag ) {
3316	+ object[ flag ] = true;
3317	+ } );
3318	+ return object;
3319	+ }
3320	+
3321	+ /*
3322	+ * Create a callback list using the following parameters:
3323	+ *
3324	+ * options: an optional list of space-separated options that will change how
3325	+ * the callback list behaves or a more traditional option object
3326	+ *
3327	+ * By default a callback list will act like an event callback list and can be
3328	+ * "fired" multiple times.
3329	+ *
3330	+ * Possible options:
3331	+ *
3332	+ * once: will ensure the callback list can only be fired once (like a Deferred)
3333	+ *
3334	+ * memory: will keep track of previous values and will call any callback added
3335	+ * after the list has been fired right away with the latest "memorized"
3336	+ * values (like a Deferred)
3337	+ *
3338	+ * unique: will ensure a callback can only be added once (no duplicate in the list)
3339	+ *
3340	+ * stopOnFalse: interrupt callings when a callback returns false
3341	+ *
3342	+ */
3343	+ jQuery.Callbacks = function( options ) {
3344	+
3345	+ // Convert options from String-formatted to Object-formatted if needed
3346	+ // (we check in cache first)
3347	+ options = typeof options === "string" ?
3348	+ createOptions( options ) :
3349	+ jQuery.extend( {}, options );
3350	+
3351	+ var // Flag to know if list is currently firing
3352	+ firing,
3353	+
3354	+ // Last fire value for non-forgettable lists
3355	+ memory,
3356	+
3357	+ // Flag to know if list was already fired
3358	+ fired,
3359	+
3360	+ // Flag to prevent firing
3361	+ locked,
3362	+
3363	+ // Actual callback list
3364	+ list = [],
3365	+
3366	+ // Queue of execution data for repeatable lists
3367	+ queue = [],
3368	+
3369	+ // Index of currently firing callback (modified by add/remove as needed)
3370	+ firingIndex = -1,
3371	+
3372	+ // Fire callbacks
3373	+ fire = function() {
3374	+
3375	+ // Enforce single-firing
3376	+ locked = locked \|\| options.once;
3377	+
3378	+ // Execute callbacks for all pending executions,
3379	+ // respecting firingIndex overrides and runtime changes
3380	+ fired = firing = true;
3381	+ for ( ; queue.length; firingIndex = -1 ) {
3382	+ memory = queue.shift();
3383	+ while ( ++firingIndex < list.length ) {
3384	+
3385	+ // Run callback and check for early termination
3386	+ if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
3387	+ options.stopOnFalse ) {
3388	+
3389	+ // Jump to end and forget the data so .add doesn't re-fire
3390	+ firingIndex = list.length;
3391	+ memory = false;
3392	+ }
3393	+ }
3394	+ }
3395	+
3396	+ // Forget the data if we're done with it
3397	+ if ( !options.memory ) {
3398	+ memory = false;
3399	+ }
3400	+
3401	+ firing = false;
3402	+
3403	+ // Clean up if we're done firing for good
3404	+ if ( locked ) {
3405	+
3406	+ // Keep an empty list if we have data for future add calls
3407	+ if ( memory ) {
3408	+ list = [];
3409	+
3410	+ // Otherwise, this object is spent
3411	+ } else {
3412	+ list = "";
3413	+ }
3414	+ }
3415	+ },
3416	+
3417	+ // Actual Callbacks object
3418	+ self = {
3419	+
3420	+ // Add a callback or a collection of callbacks to the list
3421	+ add: function() {
3422	+ if ( list ) {
3423	+
3424	+ // If we have memory from a past run, we should fire after adding
3425	+ if ( memory && !firing ) {
3426	+ firingIndex = list.length - 1;
3427	+ queue.push( memory );
3428	+ }
3429	+
3430	+ ( function add( args ) {
3431	+ jQuery.each( args, function( _, arg ) {
3432	+ if ( jQuery.isFunction( arg ) ) {
3433	+ if ( !options.unique \|\| !self.has( arg ) ) {
3434	+ list.push( arg );
3435	+ }
3436	+ } else if ( arg && arg.length && jQuery.type( arg ) !== "string" ) {
3437	+
3438	+ // Inspect recursively
3439	+ add( arg );
3440	+ }
3441	+ } );
3442	+ } )( arguments );
3443	+
3444	+ if ( memory && !firing ) {
3445	+ fire();
3446	+ }
3447	+ }
3448	+ return this;
3449	+ },
3450	+
3451	+ // Remove a callback from the list
3452	+ remove: function() {
3453	+ jQuery.each( arguments, function( _, arg ) {
3454	+ var index;
3455	+ while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
3456	+ list.splice( index, 1 );
3457	+
3458	+ // Handle firing indexes
3459	+ if ( index <= firingIndex ) {
3460	+ firingIndex--;
3461	+ }
3462	+ }
3463	+ } );
3464	+ return this;
3465	+ },
3466	+
3467	+ // Check if a given callback is in the list.
3468	+ // If no argument is given, return whether or not list has callbacks attached.
3469	+ has: function( fn ) {
3470	+ return fn ?
3471	+ jQuery.inArray( fn, list ) > -1 :
3472	+ list.length > 0;
3473	+ },
3474	+
3475	+ // Remove all callbacks from the list
3476	+ empty: function() {
3477	+ if ( list ) {
3478	+ list = [];
3479	+ }
3480	+ return this;
3481	+ },
3482	+
3483	+ // Disable .fire and .add
3484	+ // Abort any current/pending executions
3485	+ // Clear all callbacks and values
3486	+ disable: function() {
3487	+ locked = queue = [];
3488	+ list = memory = "";
3489	+ return this;
3490	+ },
3491	+ disabled: function() {
3492	+ return !list;
3493	+ },
3494	+
3495	+ // Disable .fire
3496	+ // Also disable .add unless we have memory (since it would have no effect)
3497	+ // Abort any pending executions
3498	+ lock: function() {
3499	+ locked = queue = [];
3500	+ if ( !memory && !firing ) {
3501	+ list = memory = "";
3502	+ }
3503	+ return this;
3504	+ },
3505	+ locked: function() {
3506	+ return !!locked;
3507	+ },
3508	+
3509	+ // Call all callbacks with the given context and arguments
3510	+ fireWith: function( context, args ) {
3511	+ if ( !locked ) {
3512	+ args = args \|\| [];
3513	+ args = [ context, args.slice ? args.slice() : args ];
3514	+ queue.push( args );
3515	+ if ( !firing ) {
3516	+ fire();
3517	+ }
3518	+ }
3519	+ return this;
3520	+ },
3521	+
3522	+ // Call all the callbacks with the given arguments
3523	+ fire: function() {
3524	+ self.fireWith( this, arguments );
3525	+ return this;
3526	+ },
3527	+
3528	+ // To know if the callbacks have already been called at least once
3529	+ fired: function() {
3530	+ return !!fired;
3531	+ }
3532	+ };
3533	+
3534	+ return self;
3535	+ };
3536	+
3537	+
3538	+ function Identity( v ) {
3539	+ return v;
3540	+ }
3541	+ function Thrower( ex ) {
3542	+ throw ex;
3543	+ }
3544	+
3545	+ function adoptValue( value, resolve, reject, noValue ) {
3546	+ var method;
3547	+
3548	+ try {
3549	+
3550	+ // Check for promise aspect first to privilege synchronous behavior
3551	+ if ( value && jQuery.isFunction( ( method = value.promise ) ) ) {
3552	+ method.call( value ).done( resolve ).fail( reject );
3553	+
3554	+ // Other thenables
3555	+ } else if ( value && jQuery.isFunction( ( method = value.then ) ) ) {
3556	+ method.call( value, resolve, reject );
3557	+
3558	+ // Other non-thenables
3559	+ } else {
3560	+
3561	+ // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
3562	+ // * false: [ value ].slice( 0 ) => resolve( value )
3563	+ // * true: [ value ].slice( 1 ) => resolve()
3564	+ resolve.apply( undefined, [ value ].slice( noValue ) );
3565	+ }
3566	+
3567	+ // For Promises/A+, convert exceptions into rejections
3568	+ // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
3569	+ // Deferred#then to conditionally suppress rejection.
3570	+ } catch ( value ) {
3571	+
3572	+ // Support: Android 4.0 only
3573	+ // Strict mode functions invoked without .call/.apply get global-object context
3574	+ reject.apply( undefined, [ value ] );
3575	+ }
3576	+ }
3577	+
3578	+ jQuery.extend( {
3579	+
3580	+ Deferred: function( func ) {
3581	+ var tuples = [
3582	+
3583	+ // action, add listener, callbacks,
3584	+ // ... .then handlers, argument index, [final state]
3585	+ [ "notify", "progress", jQuery.Callbacks( "memory" ),
3586	+ jQuery.Callbacks( "memory" ), 2 ],
3587	+ [ "resolve", "done", jQuery.Callbacks( "once memory" ),
3588	+ jQuery.Callbacks( "once memory" ), 0, "resolved" ],
3589	+ [ "reject", "fail", jQuery.Callbacks( "once memory" ),
3590	+ jQuery.Callbacks( "once memory" ), 1, "rejected" ]
3591	+ ],
3592	+ state = "pending",
3593	+ promise = {
3594	+ state: function() {
3595	+ return state;
3596	+ },
3597	+ always: function() {
3598	+ deferred.done( arguments ).fail( arguments );
3599	+ return this;
3600	+ },
3601	+ "catch": function( fn ) {
3602	+ return promise.then( null, fn );
3603	+ },
3604	+
3605	+ // Keep pipe for back-compat
3606	+ pipe: function( /* fnDone, fnFail, fnProgress */ ) {
3607	+ var fns = arguments;
3608	+
3609	+ return jQuery.Deferred( function( newDefer ) {
3610	+ jQuery.each( tuples, function( i, tuple ) {
3611	+
3612	+ // Map tuples (progress, done, fail) to arguments (done, fail, progress)
3613	+ var fn = jQuery.isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
3614	+
3615	+ // deferred.progress(function() { bind to newDefer or newDefer.notify })
3616	+ // deferred.done(function() { bind to newDefer or newDefer.resolve })
3617	+ // deferred.fail(function() { bind to newDefer or newDefer.reject })
3618	+ deferred[ tuple[ 1 ] ]( function() {
3619	+ var returned = fn && fn.apply( this, arguments );
3620	+ if ( returned && jQuery.isFunction( returned.promise ) ) {
3621	+ returned.promise()
3622	+ .progress( newDefer.notify )
3623	+ .done( newDefer.resolve )
3624	+ .fail( newDefer.reject );
3625	+ } else {
3626	+ newDefer[ tuple[ 0 ] + "With" ](
3627	+ this,
3628	+ fn ? [ returned ] : arguments
3629	+ );
3630	+ }
3631	+ } );
3632	+ } );
3633	+ fns = null;
3634	+ } ).promise();
3635	+ },
3636	+ then: function( onFulfilled, onRejected, onProgress ) {
3637	+ var maxDepth = 0;
3638	+ function resolve( depth, deferred, handler, special ) {
3639	+ return function() {
3640	+ var that = this,
3641	+ args = arguments,
3642	+ mightThrow = function() {
3643	+ var returned, then;
3644	+
3645	+ // Support: Promises/A+ section 2.3.3.3.3
3646	+ // https://promisesaplus.com/#point-59
3647	+ // Ignore double-resolution attempts
3648	+ if ( depth < maxDepth ) {
3649	+ return;
3650	+ }
3651	+
3652	+ returned = handler.apply( that, args );
3653	+
3654	+ // Support: Promises/A+ section 2.3.1
3655	+ // https://promisesaplus.com/#point-48
3656	+ if ( returned === deferred.promise() ) {
3657	+ throw new TypeError( "Thenable self-resolution" );
3658	+ }
3659	+
3660	+ // Support: Promises/A+ sections 2.3.3.1, 3.5
3661	+ // https://promisesaplus.com/#point-54
3662	+ // https://promisesaplus.com/#point-75
3663	+ // Retrieve `then` only once
3664	+ then = returned &&
3665	+
3666	+ // Support: Promises/A+ section 2.3.4
3667	+ // https://promisesaplus.com/#point-64
3668	+ // Only check objects and functions for thenability
3669	+ ( typeof returned === "object" \|\|
3670	+ typeof returned === "function" ) &&
3671	+ returned.then;
3672	+
3673	+ // Handle a returned thenable
3674	+ if ( jQuery.isFunction( then ) ) {
3675	+
3676	+ // Special processors (notify) just wait for resolution
3677	+ if ( special ) {
3678	+ then.call(
3679	+ returned,
3680	+ resolve( maxDepth, deferred, Identity, special ),
3681	+ resolve( maxDepth, deferred, Thrower, special )
3682	+ );
3683	+
3684	+ // Normal processors (resolve) also hook into progress
3685	+ } else {
3686	+
3687	+ // ...and disregard older resolution values
3688	+ maxDepth++;
3689	+
3690	+ then.call(
3691	+ returned,
3692	+ resolve( maxDepth, deferred, Identity, special ),
3693	+ resolve( maxDepth, deferred, Thrower, special ),
3694	+ resolve( maxDepth, deferred, Identity,
3695	+ deferred.notifyWith )
3696	+ );
3697	+ }
3698	+
3699	+ // Handle all other returned values
3700	+ } else {
3701	+
3702	+ // Only substitute handlers pass on context
3703	+ // and multiple values (non-spec behavior)
3704	+ if ( handler !== Identity ) {
3705	+ that = undefined;
3706	+ args = [ returned ];
3707	+ }
3708	+
3709	+ // Process the value(s)
3710	+ // Default process is resolve
3711	+ ( special \|\| deferred.resolveWith )( that, args );
3712	+ }
3713	+ },
3714	+
3715	+ // Only normal processors (resolve) catch and reject exceptions
3716	+ process = special ?
3717	+ mightThrow :
3718	+ function() {
3719	+ try {
3720	+ mightThrow();
3721	+ } catch ( e ) {
3722	+
3723	+ if ( jQuery.Deferred.exceptionHook ) {
3724	+ jQuery.Deferred.exceptionHook( e,
3725	+ process.stackTrace );
3726	+ }
3727	+
3728	+ // Support: Promises/A+ section 2.3.3.3.4.1
3729	+ // https://promisesaplus.com/#point-61
3730	+ // Ignore post-resolution exceptions
3731	+ if ( depth + 1 >= maxDepth ) {
3732	+
3733	+ // Only substitute handlers pass on context
3734	+ // and multiple values (non-spec behavior)
3735	+ if ( handler !== Thrower ) {
3736	+ that = undefined;
3737	+ args = [ e ];
3738	+ }
3739	+
3740	+ deferred.rejectWith( that, args );
3741	+ }
3742	+ }
3743	+ };
3744	+
3745	+ // Support: Promises/A+ section 2.3.3.3.1
3746	+ // https://promisesaplus.com/#point-57
3747	+ // Re-resolve promises immediately to dodge false rejection from
3748	+ // subsequent errors
3749	+ if ( depth ) {
3750	+ process();
3751	+ } else {
3752	+
3753	+ // Call an optional hook to record the stack, in case of exception
3754	+ // since it's otherwise lost when execution goes async
3755	+ if ( jQuery.Deferred.getStackHook ) {
3756	+ process.stackTrace = jQuery.Deferred.getStackHook();
3757	+ }
3758	+ window.setTimeout( process );
3759	+ }
3760	+ };
3761	+ }
3762	+
3763	+ return jQuery.Deferred( function( newDefer ) {
3764	+
3765	+ // progress_handlers.add( ... )
3766	+ tuples[ 0 ][ 3 ].add(
3767	+ resolve(
3768	+ 0,
3769	+ newDefer,
3770	+ jQuery.isFunction( onProgress ) ?
3771	+ onProgress :
3772	+ Identity,
3773	+ newDefer.notifyWith
3774	+ )
3775	+ );
3776	+
3777	+ // fulfilled_handlers.add( ... )
3778	+ tuples[ 1 ][ 3 ].add(
3779	+ resolve(
3780	+ 0,
3781	+ newDefer,
3782	+ jQuery.isFunction( onFulfilled ) ?
3783	+ onFulfilled :
3784	+ Identity
3785	+ )
3786	+ );
3787	+
3788	+ // rejected_handlers.add( ... )
3789	+ tuples[ 2 ][ 3 ].add(
3790	+ resolve(
3791	+ 0,
3792	+ newDefer,
3793	+ jQuery.isFunction( onRejected ) ?
3794	+ onRejected :
3795	+ Thrower
3796	+ )
3797	+ );
3798	+ } ).promise();
3799	+ },
3800	+
3801	+ // Get a promise for this deferred
3802	+ // If obj is provided, the promise aspect is added to the object
3803	+ promise: function( obj ) {
3804	+ return obj != null ? jQuery.extend( obj, promise ) : promise;
3805	+ }
3806	+ },
3807	+ deferred = {};
3808	+
3809	+ // Add list-specific methods
3810	+ jQuery.each( tuples, function( i, tuple ) {
3811	+ var list = tuple[ 2 ],
3812	+ stateString = tuple[ 5 ];
3813	+
3814	+ // promise.progress = list.add
3815	+ // promise.done = list.add
3816	+ // promise.fail = list.add
3817	+ promise[ tuple[ 1 ] ] = list.add;
3818	+
3819	+ // Handle state
3820	+ if ( stateString ) {
3821	+ list.add(
3822	+ function() {
3823	+
3824	+ // state = "resolved" (i.e., fulfilled)
3825	+ // state = "rejected"
3826	+ state = stateString;
3827	+ },
3828	+
3829	+ // rejected_callbacks.disable
3830	+ // fulfilled_callbacks.disable
3831	+ tuples[ 3 - i ][ 2 ].disable,
3832	+
3833	+ // progress_callbacks.lock
3834	+ tuples[ 0 ][ 2 ].lock
3835	+ );
3836	+ }
3837	+
3838	+ // progress_handlers.fire
3839	+ // fulfilled_handlers.fire
3840	+ // rejected_handlers.fire
3841	+ list.add( tuple[ 3 ].fire );
3842	+
3843	+ // deferred.notify = function() { deferred.notifyWith(...) }
3844	+ // deferred.resolve = function() { deferred.resolveWith(...) }
3845	+ // deferred.reject = function() { deferred.rejectWith(...) }
3846	+ deferred[ tuple[ 0 ] ] = function() {
3847	+ deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
3848	+ return this;
3849	+ };
3850	+
3851	+ // deferred.notifyWith = list.fireWith
3852	+ // deferred.resolveWith = list.fireWith
3853	+ // deferred.rejectWith = list.fireWith
3854	+ deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
3855	+ } );
3856	+
3857	+ // Make the deferred a promise
3858	+ promise.promise( deferred );
3859	+
3860	+ // Call given func if any
3861	+ if ( func ) {
3862	+ func.call( deferred, deferred );
3863	+ }
3864	+
3865	+ // All done!
3866	+ return deferred;
3867	+ },
3868	+
3869	+ // Deferred helper
3870	+ when: function( singleValue ) {
3871	+ var
3872	+
3873	+ // count of uncompleted subordinates
3874	+ remaining = arguments.length,
3875	+
3876	+ // count of unprocessed arguments
3877	+ i = remaining,
3878	+
3879	+ // subordinate fulfillment data
3880	+ resolveContexts = Array( i ),
3881	+ resolveValues = slice.call( arguments ),
3882	+
3883	+ // the master Deferred
3884	+ master = jQuery.Deferred(),
3885	+
3886	+ // subordinate callback factory
3887	+ updateFunc = function( i ) {
3888	+ return function( value ) {
3889	+ resolveContexts[ i ] = this;
3890	+ resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
3891	+ if ( !( --remaining ) ) {
3892	+ master.resolveWith( resolveContexts, resolveValues );
3893	+ }
3894	+ };
3895	+ };
3896	+
3897	+ // Single- and empty arguments are adopted like Promise.resolve
3898	+ if ( remaining <= 1 ) {
3899	+ adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject,
3900	+ !remaining );
3901	+
3902	+ // Use .then() to unwrap secondary thenables (cf. gh-3000)
3903	+ if ( master.state() === "pending" \|\|
3904	+ jQuery.isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
3905	+
3906	+ return master.then();
3907	+ }
3908	+ }
3909	+
3910	+ // Multiple arguments are aggregated like Promise.all array elements
3911	+ while ( i-- ) {
3912	+ adoptValue( resolveValues[ i ], updateFunc( i ), master.reject );
3913	+ }
3914	+
3915	+ return master.promise();
3916	+ }
3917	+ } );
3918	+
3919	+
3920	+ // These usually indicate a programmer mistake during development,
3921	+ // warn about them ASAP rather than swallowing them by default.
3922	+ var rerrorNames = /^(Eval\|Internal\|Range\|Reference\|Syntax\|Type\|URI)Error$/;
3923	+
3924	+ jQuery.Deferred.exceptionHook = function( error, stack ) {
3925	+
3926	+ // Support: IE 8 - 9 only
3927	+ // Console exists when dev tools are open, which can happen at any time
3928	+ if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
3929	+ window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack );
3930	+ }
3931	+ };
3932	+
3933	+
3934	+
3935	+
3936	+ jQuery.readyException = function( error ) {
3937	+ window.setTimeout( function() {
3938	+ throw error;
3939	+ } );
3940	+ };
3941	+
3942	+
3943	+
3944	+
3945	+ // The deferred used on DOM ready
3946	+ var readyList = jQuery.Deferred();
3947	+
3948	+ jQuery.fn.ready = function( fn ) {
3949	+
3950	+ readyList
3951	+ .then( fn )
3952	+
3953	+ // Wrap jQuery.readyException in a function so that the lookup
3954	+ // happens at the time of error handling instead of callback
3955	+ // registration.
3956	+ .catch( function( error ) {
3957	+ jQuery.readyException( error );
3958	+ } );
3959	+
3960	+ return this;
3961	+ };
3962	+
3963	+ jQuery.extend( {
3964	+
3965	+ // Is the DOM ready to be used? Set to true once it occurs.
3966	+ isReady: false,
3967	+
3968	+ // A counter to track how many items to wait for before
3969	+ // the ready event fires. See #6781
3970	+ readyWait: 1,
3971	+
3972	+ // Handle when the DOM is ready
3973	+ ready: function( wait ) {
3974	+
3975	+ // Abort if there are pending holds or we're already ready
3976	+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
3977	+ return;
3978	+ }
3979	+
3980	+ // Remember that the DOM is ready
3981	+ jQuery.isReady = true;
3982	+
3983	+ // If a normal DOM Ready event fired, decrement, and wait if need be
3984	+ if ( wait !== true && --jQuery.readyWait > 0 ) {
3985	+ return;
3986	+ }
3987	+
3988	+ // If there are functions bound, to execute
3989	+ readyList.resolveWith( document, [ jQuery ] );
3990	+ }
3991	+ } );
3992	+
3993	+ jQuery.ready.then = readyList.then;
3994	+
3995	+ // The ready event handler and self cleanup method
3996	+ function completed() {
3997	+ document.removeEventListener( "DOMContentLoaded", completed );
3998	+ window.removeEventListener( "load", completed );
3999	+ jQuery.ready();
4000	+ }
4001	+
4002	+ // Catch cases where $(document).ready() is called
4003	+ // after the browser event has already occurred.
4004	+ // Support: IE <=9 - 10 only
4005	+ // Older IE sometimes signals "interactive" too soon
4006	+ if ( document.readyState === "complete" \|\|
4007	+ ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
4008	+
4009	+ // Handle it asynchronously to allow scripts the opportunity to delay ready
4010	+ window.setTimeout( jQuery.ready );
4011	+
4012	+ } else {
4013	+
4014	+ // Use the handy event callback
4015	+ document.addEventListener( "DOMContentLoaded", completed );
4016	+
4017	+ // A fallback to window.onload, that will always work
4018	+ window.addEventListener( "load", completed );
4019	+ }
4020	+
4021	+
4022	+
4023	+
4024	+ // Multifunctional method to get and set values of a collection
4025	+ // The value/s can optionally be executed if it's a function
4026	+ var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
4027	+ var i = 0,
4028	+ len = elems.length,
4029	+ bulk = key == null;
4030	+
4031	+ // Sets many values
4032	+ if ( jQuery.type( key ) === "object" ) {
4033	+ chainable = true;
4034	+ for ( i in key ) {
4035	+ access( elems, fn, i, key[ i ], true, emptyGet, raw );
4036	+ }
4037	+
4038	+ // Sets one value
4039	+ } else if ( value !== undefined ) {
4040	+ chainable = true;
4041	+
4042	+ if ( !jQuery.isFunction( value ) ) {
4043	+ raw = true;
4044	+ }
4045	+
4046	+ if ( bulk ) {
4047	+
4048	+ // Bulk operations run against the entire set
4049	+ if ( raw ) {
4050	+ fn.call( elems, value );
4051	+ fn = null;
4052	+
4053	+ // ...except when executing function values
4054	+ } else {
4055	+ bulk = fn;
4056	+ fn = function( elem, key, value ) {
4057	+ return bulk.call( jQuery( elem ), value );
4058	+ };
4059	+ }
4060	+ }
4061	+
4062	+ if ( fn ) {
4063	+ for ( ; i < len; i++ ) {
4064	+ fn(
4065	+ elems[ i ], key, raw ?
4066	+ value :
4067	+ value.call( elems[ i ], i, fn( elems[ i ], key ) )
4068	+ );
4069	+ }
4070	+ }
4071	+ }
4072	+
4073	+ if ( chainable ) {
4074	+ return elems;
4075	+ }
4076	+
4077	+ // Gets
4078	+ if ( bulk ) {
4079	+ return fn.call( elems );
4080	+ }
4081	+
4082	+ return len ? fn( elems[ 0 ], key ) : emptyGet;
4083	+ };
4084	+ var acceptData = function( owner ) {
4085	+
4086	+ // Accepts only:
4087	+ // - Node
4088	+ // - Node.ELEMENT_NODE
4089	+ // - Node.DOCUMENT_NODE
4090	+ // - Object
4091	+ // - Any
4092	+ return owner.nodeType === 1 \|\| owner.nodeType === 9 \|\| !( +owner.nodeType );
4093	+ };
4094	+
4095	+
4096	+
4097	+
4098	+ function Data() {
4099	+ this.expando = jQuery.expando + Data.uid++;
4100	+ }
4101	+
4102	+ Data.uid = 1;
4103	+
4104	+ Data.prototype = {
4105	+
4106	+ cache: function( owner ) {
4107	+
4108	+ // Check if the owner object already has a cache
4109	+ var value = owner[ this.expando ];
4110	+
4111	+ // If not, create one
4112	+ if ( !value ) {
4113	+ value = {};
4114	+
4115	+ // We can accept data for non-element nodes in modern browsers,
4116	+ // but we should not, see #8335.
4117	+ // Always return an empty object.
4118	+ if ( acceptData( owner ) ) {
4119	+
4120	+ // If it is a node unlikely to be stringify-ed or looped over
4121	+ // use plain assignment
4122	+ if ( owner.nodeType ) {
4123	+ owner[ this.expando ] = value;
4124	+
4125	+ // Otherwise secure it in a non-enumerable property
4126	+ // configurable must be true to allow the property to be
4127	+ // deleted when data is removed
4128	+ } else {
4129	+ Object.defineProperty( owner, this.expando, {
4130	+ value: value,
4131	+ configurable: true
4132	+ } );
4133	+ }
4134	+ }
4135	+ }
4136	+
4137	+ return value;
4138	+ },
4139	+ set: function( owner, data, value ) {
4140	+ var prop,
4141	+ cache = this.cache( owner );
4142	+
4143	+ // Handle: [ owner, key, value ] args
4144	+ // Always use camelCase key (gh-2257)
4145	+ if ( typeof data === "string" ) {
4146	+ cache[ jQuery.camelCase( data ) ] = value;
4147	+
4148	+ // Handle: [ owner, { properties } ] args
4149	+ } else {
4150	+
4151	+ // Copy the properties one-by-one to the cache object
4152	+ for ( prop in data ) {
4153	+ cache[ jQuery.camelCase( prop ) ] = data[ prop ];
4154	+ }
4155	+ }
4156	+ return cache;
4157	+ },
4158	+ get: function( owner, key ) {
4159	+ return key === undefined ?
4160	+ this.cache( owner ) :
4161	+
4162	+ // Always use camelCase key (gh-2257)
4163	+ owner[ this.expando ] && owner[ this.expando ][ jQuery.camelCase( key ) ];
4164	+ },
4165	+ access: function( owner, key, value ) {
4166	+
4167	+ // In cases where either:
4168	+ //
4169	+ // 1. No key was specified
4170	+ // 2. A string key was specified, but no value provided
4171	+ //
4172	+ // Take the "read" path and allow the get method to determine
4173	+ // which value to return, respectively either:
4174	+ //
4175	+ // 1. The entire cache object
4176	+ // 2. The data stored at the key
4177	+ //
4178	+ if ( key === undefined \|\|
4179	+ ( ( key && typeof key === "string" ) && value === undefined ) ) {
4180	+
4181	+ return this.get( owner, key );
4182	+ }
4183	+
4184	+ // When the key is not a string, or both a key and value
4185	+ // are specified, set or extend (existing objects) with either:
4186	+ //
4187	+ // 1. An object of properties
4188	+ // 2. A key and value
4189	+ //
4190	+ this.set( owner, key, value );
4191	+
4192	+ // Since the "set" path can have two possible entry points
4193	+ // return the expected data based on which path was taken[*]
4194	+ return value !== undefined ? value : key;
4195	+ },
4196	+ remove: function( owner, key ) {
4197	+ var i,
4198	+ cache = owner[ this.expando ];
4199	+
4200	+ if ( cache === undefined ) {
4201	+ return;
4202	+ }
4203	+
4204	+ if ( key !== undefined ) {
4205	+
4206	+ // Support array or space separated string of keys
4207	+ if ( Array.isArray( key ) ) {
4208	+
4209	+ // If key is an array of keys...
4210	+ // We always set camelCase keys, so remove that.
4211	+ key = key.map( jQuery.camelCase );
4212	+ } else {
4213	+ key = jQuery.camelCase( key );
4214	+
4215	+ // If a key with the spaces exists, use it.
4216	+ // Otherwise, create an array by matching non-whitespace
4217	+ key = key in cache ?
4218	+ [ key ] :
4219	+ ( key.match( rnothtmlwhite ) \|\| [] );
4220	+ }
4221	+
4222	+ i = key.length;
4223	+
4224	+ while ( i-- ) {
4225	+ delete cache[ key[ i ] ];
4226	+ }
4227	+ }
4228	+
4229	+ // Remove the expando if there's no more data
4230	+ if ( key === undefined \|\| jQuery.isEmptyObject( cache ) ) {
4231	+
4232	+ // Support: Chrome <=35 - 45
4233	+ // Webkit & Blink performance suffers when deleting properties
4234	+ // from DOM nodes, so set to undefined instead
4235	+ // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
4236	+ if ( owner.nodeType ) {
4237	+ owner[ this.expando ] = undefined;
4238	+ } else {
4239	+ delete owner[ this.expando ];
4240	+ }
4241	+ }
4242	+ },
4243	+ hasData: function( owner ) {
4244	+ var cache = owner[ this.expando ];
4245	+ return cache !== undefined && !jQuery.isEmptyObject( cache );
4246	+ }
4247	+ };
4248	+ var dataPriv = new Data();
4249	+
4250	+ var dataUser = new Data();
4251	+
4252	+
4253	+
4254	+ // Implementation Summary
4255	+ //
4256	+ // 1. Enforce API surface and semantic compatibility with 1.9.x branch
4257	+ // 2. Improve the module's maintainability by reducing the storage
4258	+ // paths to a single mechanism.
4259	+ // 3. Use the same single mechanism to support "private" and "user" data.
4260	+ // 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
4261	+ // 5. Avoid exposing implementation details on user objects (eg. expando properties)
4262	+ // 6. Provide a clear path for implementation upgrade to WeakMap in 2014
4263	+
4264	+ var rbrace = /^(?:\{[\w\W]\}\|\[[\w\W]\])$/,
4265	+ rmultiDash = /[A-Z]/g;
4266	+
4267	+ function getData( data ) {
4268	+ if ( data === "true" ) {
4269	+ return true;
4270	+ }
4271	+
4272	+ if ( data === "false" ) {
4273	+ return false;
4274	+ }
4275	+
4276	+ if ( data === "null" ) {
4277	+ return null;
4278	+ }
4279	+
4280	+ // Only convert to a number if it doesn't change the string
4281	+ if ( data === +data + "" ) {
4282	+ return +data;
4283	+ }
4284	+
4285	+ if ( rbrace.test( data ) ) {
4286	+ return JSON.parse( data );
4287	+ }
4288	+
4289	+ return data;
4290	+ }
4291	+
4292	+ function dataAttr( elem, key, data ) {
4293	+ var name;
4294	+
4295	+ // If nothing was found internally, try to fetch any
4296	+ // data from the HTML5 data-* attribute
4297	+ if ( data === undefined && elem.nodeType === 1 ) {
4298	+ name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
4299	+ data = elem.getAttribute( name );
4300	+
4301	+ if ( typeof data === "string" ) {
4302	+ try {
4303	+ data = getData( data );
4304	+ } catch ( e ) {}
4305	+
4306	+ // Make sure we set the data so it isn't changed later
4307	+ dataUser.set( elem, key, data );
4308	+ } else {
4309	+ data = undefined;
4310	+ }
4311	+ }
4312	+ return data;
4313	+ }
4314	+
4315	+ jQuery.extend( {
4316	+ hasData: function( elem ) {
4317	+ return dataUser.hasData( elem ) \|\| dataPriv.hasData( elem );
4318	+ },
4319	+
4320	+ data: function( elem, name, data ) {
4321	+ return dataUser.access( elem, name, data );
4322	+ },
4323	+
4324	+ removeData: function( elem, name ) {
4325	+ dataUser.remove( elem, name );
4326	+ },
4327	+
4328	+ // TODO: Now that all calls to _data and _removeData have been replaced
4329	+ // with direct calls to dataPriv methods, these can be deprecated.
4330	+ _data: function( elem, name, data ) {
4331	+ return dataPriv.access( elem, name, data );
4332	+ },
4333	+
4334	+ _removeData: function( elem, name ) {
4335	+ dataPriv.remove( elem, name );
4336	+ }
4337	+ } );
4338	+
4339	+ jQuery.fn.extend( {
4340	+ data: function( key, value ) {
4341	+ var i, name, data,
4342	+ elem = this[ 0 ],
4343	+ attrs = elem && elem.attributes;
4344	+
4345	+ // Gets all values
4346	+ if ( key === undefined ) {
4347	+ if ( this.length ) {
4348	+ data = dataUser.get( elem );
4349	+
4350	+ if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
4351	+ i = attrs.length;
4352	+ while ( i-- ) {
4353	+
4354	+ // Support: IE 11 only
4355	+ // The attrs elements can be null (#14894)
4356	+ if ( attrs[ i ] ) {
4357	+ name = attrs[ i ].name;
4358	+ if ( name.indexOf( "data-" ) === 0 ) {
4359	+ name = jQuery.camelCase( name.slice( 5 ) );
4360	+ dataAttr( elem, name, data[ name ] );
4361	+ }
4362	+ }
4363	+ }
4364	+ dataPriv.set( elem, "hasDataAttrs", true );
4365	+ }
4366	+ }
4367	+
4368	+ return data;
4369	+ }
4370	+
4371	+ // Sets multiple values
4372	+ if ( typeof key === "object" ) {
4373	+ return this.each( function() {
4374	+ dataUser.set( this, key );
4375	+ } );
4376	+ }
4377	+
4378	+ return access( this, function( value ) {
4379	+ var data;
4380	+
4381	+ // The calling jQuery object (element matches) is not empty
4382	+ // (and therefore has an element appears at this[ 0 ]) and the
4383	+ // `value` parameter was not undefined. An empty jQuery object
4384	+ // will result in `undefined` for elem = this[ 0 ] which will
4385	+ // throw an exception if an attempt to read a data cache is made.
4386	+ if ( elem && value === undefined ) {
4387	+
4388	+ // Attempt to get data from the cache
4389	+ // The key will always be camelCased in Data
4390	+ data = dataUser.get( elem, key );
4391	+ if ( data !== undefined ) {
4392	+ return data;
4393	+ }
4394	+
4395	+ // Attempt to "discover" the data in
4396	+ // HTML5 custom data-* attrs
4397	+ data = dataAttr( elem, key );
4398	+ if ( data !== undefined ) {
4399	+ return data;
4400	+ }
4401	+
4402	+ // We tried really hard, but the data doesn't exist.
4403	+ return;
4404	+ }
4405	+
4406	+ // Set the data...
4407	+ this.each( function() {
4408	+
4409	+ // We always store the camelCased key
4410	+ dataUser.set( this, key, value );
4411	+ } );
4412	+ }, null, value, arguments.length > 1, null, true );
4413	+ },
4414	+
4415	+ removeData: function( key ) {
4416	+ return this.each( function() {
4417	+ dataUser.remove( this, key );
4418	+ } );
4419	+ }
4420	+ } );
4421	+
4422	+
4423	+ jQuery.extend( {
4424	+ queue: function( elem, type, data ) {
4425	+ var queue;
4426	+
4427	+ if ( elem ) {
4428	+ type = ( type \|\| "fx" ) + "queue";
4429	+ queue = dataPriv.get( elem, type );
4430	+
4431	+ // Speed up dequeue by getting out quickly if this is just a lookup
4432	+ if ( data ) {
4433	+ if ( !queue \|\| Array.isArray( data ) ) {
4434	+ queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
4435	+ } else {
4436	+ queue.push( data );
4437	+ }
4438	+ }
4439	+ return queue \|\| [];
4440	+ }
4441	+ },
4442	+
4443	+ dequeue: function( elem, type ) {
4444	+ type = type \|\| "fx";
4445	+
4446	+ var queue = jQuery.queue( elem, type ),
4447	+ startLength = queue.length,
4448	+ fn = queue.shift(),
4449	+ hooks = jQuery._queueHooks( elem, type ),
4450	+ next = function() {
4451	+ jQuery.dequeue( elem, type );
4452	+ };
4453	+
4454	+ // If the fx queue is dequeued, always remove the progress sentinel
4455	+ if ( fn === "inprogress" ) {
4456	+ fn = queue.shift();
4457	+ startLength--;
4458	+ }
4459	+
4460	+ if ( fn ) {
4461	+
4462	+ // Add a progress sentinel to prevent the fx queue from being
4463	+ // automatically dequeued
4464	+ if ( type === "fx" ) {
4465	+ queue.unshift( "inprogress" );
4466	+ }
4467	+
4468	+ // Clear up the last queue stop function
4469	+ delete hooks.stop;
4470	+ fn.call( elem, next, hooks );
4471	+ }
4472	+
4473	+ if ( !startLength && hooks ) {
4474	+ hooks.empty.fire();
4475	+ }
4476	+ },
4477	+
4478	+ // Not public - generate a queueHooks object, or return the current one
4479	+ _queueHooks: function( elem, type ) {
4480	+ var key = type + "queueHooks";
4481	+ return dataPriv.get( elem, key ) \|\| dataPriv.access( elem, key, {
4482	+ empty: jQuery.Callbacks( "once memory" ).add( function() {
4483	+ dataPriv.remove( elem, [ type + "queue", key ] );
4484	+ } )
4485	+ } );
4486	+ }
4487	+ } );
4488	+
4489	+ jQuery.fn.extend( {
4490	+ queue: function( type, data ) {
4491	+ var setter = 2;
4492	+
4493	+ if ( typeof type !== "string" ) {
4494	+ data = type;
4495	+ type = "fx";
4496	+ setter--;
4497	+ }
4498	+
4499	+ if ( arguments.length < setter ) {
4500	+ return jQuery.queue( this[ 0 ], type );
4501	+ }
4502	+
4503	+ return data === undefined ?
4504	+ this :
4505	+ this.each( function() {
4506	+ var queue = jQuery.queue( this, type, data );
4507	+
4508	+ // Ensure a hooks for this queue
4509	+ jQuery._queueHooks( this, type );
4510	+
4511	+ if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
4512	+ jQuery.dequeue( this, type );
4513	+ }
4514	+ } );
4515	+ },
4516	+ dequeue: function( type ) {
4517	+ return this.each( function() {
4518	+ jQuery.dequeue( this, type );
4519	+ } );
4520	+ },
4521	+ clearQueue: function( type ) {
4522	+ return this.queue( type \|\| "fx", [] );
4523	+ },
4524	+
4525	+ // Get a promise resolved when queues of a certain type
4526	+ // are emptied (fx is the type by default)
4527	+ promise: function( type, obj ) {
4528	+ var tmp,
4529	+ count = 1,
4530	+ defer = jQuery.Deferred(),
4531	+ elements = this,
4532	+ i = this.length,
4533	+ resolve = function() {
4534	+ if ( !( --count ) ) {
4535	+ defer.resolveWith( elements, [ elements ] );
4536	+ }
4537	+ };
4538	+
4539	+ if ( typeof type !== "string" ) {
4540	+ obj = type;
4541	+ type = undefined;
4542	+ }
4543	+ type = type \|\| "fx";
4544	+
4545	+ while ( i-- ) {
4546	+ tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
4547	+ if ( tmp && tmp.empty ) {
4548	+ count++;
4549	+ tmp.empty.add( resolve );
4550	+ }
4551	+ }
4552	+ resolve();
4553	+ return defer.promise( obj );
4554	+ }
4555	+ } );
4556	+ var pnum = ( /[+-]?(?:\d*\.\|)\d+(?:[eE][+-]?\d+\|)/ ).source;
4557	+
4558	+ var rcssNum = new RegExp( "^(?:([+-])=\|)(" + pnum + ")([a-z%]*)$", "i" );
4559	+
4560	+
4561	+ var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
4562	+
4563	+ var isHiddenWithinTree = function( elem, el ) {
4564	+
4565	+ // isHiddenWithinTree might be called from jQuery#filter function;
4566	+ // in that case, element will be second argument
4567	+ elem = el \|\| elem;
4568	+
4569	+ // Inline style trumps all
4570	+ return elem.style.display === "none" \|\|
4571	+ elem.style.display === "" &&
4572	+
4573	+ // Otherwise, check computed style
4574	+ // Support: Firefox <=43 - 45
4575	+ // Disconnected elements can have computed display: none, so first confirm that elem is
4576	+ // in the document.
4577	+ jQuery.contains( elem.ownerDocument, elem ) &&
4578	+
4579	+ jQuery.css( elem, "display" ) === "none";
4580	+ };
4581	+
4582	+ var swap = function( elem, options, callback, args ) {
4583	+ var ret, name,
4584	+ old = {};
4585	+
4586	+ // Remember the old values, and insert the new ones
4587	+ for ( name in options ) {
4588	+ old[ name ] = elem.style[ name ];
4589	+ elem.style[ name ] = options[ name ];
4590	+ }
4591	+
4592	+ ret = callback.apply( elem, args \|\| [] );
4593	+
4594	+ // Revert the old values
4595	+ for ( name in options ) {
4596	+ elem.style[ name ] = old[ name ];
4597	+ }
4598	+
4599	+ return ret;
4600	+ };
4601	+
4602	+
4603	+
4604	+
4605	+ function adjustCSS( elem, prop, valueParts, tween ) {
4606	+ var adjusted,
4607	+ scale = 1,
4608	+ maxIterations = 20,
4609	+ currentValue = tween ?
4610	+ function() {
4611	+ return tween.cur();
4612	+ } :
4613	+ function() {
4614	+ return jQuery.css( elem, prop, "" );
4615	+ },
4616	+ initial = currentValue(),
4617	+ unit = valueParts && valueParts[ 3 ] \|\| ( jQuery.cssNumber[ prop ] ? "" : "px" ),
4618	+
4619	+ // Starting value computation is required for potential unit mismatches
4620	+ initialInUnit = ( jQuery.cssNumber[ prop ] \|\| unit !== "px" && +initial ) &&
4621	+ rcssNum.exec( jQuery.css( elem, prop ) );
4622	+
4623	+ if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
4624	+
4625	+ // Trust units reported by jQuery.css
4626	+ unit = unit \|\| initialInUnit[ 3 ];
4627	+
4628	+ // Make sure we update the tween properties later on
4629	+ valueParts = valueParts \|\| [];
4630	+
4631	+ // Iteratively approximate from a nonzero starting point
4632	+ initialInUnit = +initial \|\| 1;
4633	+
4634	+ do {
4635	+
4636	+ // If previous iteration zeroed out, double until we get something.
4637	+ // Use string for doubling so we don't accidentally see scale as unchanged below
4638	+ scale = scale \|\| ".5";
4639	+
4640	+ // Adjust and apply
4641	+ initialInUnit = initialInUnit / scale;
4642	+ jQuery.style( elem, prop, initialInUnit + unit );
4643	+
4644	+ // Update scale, tolerating zero or NaN from tween.cur()
4645	+ // Break the loop if scale is unchanged or perfect, or if we've just had enough.
4646	+ } while (
4647	+ scale !== ( scale = currentValue() / initial ) && scale !== 1 && --maxIterations
4648	+ );
4649	+ }
4650	+
4651	+ if ( valueParts ) {
4652	+ initialInUnit = +initialInUnit \|\| +initial \|\| 0;
4653	+
4654	+ // Apply relative offset (+=/-=) if specified
4655	+ adjusted = valueParts[ 1 ] ?
4656	+ initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
4657	+ +valueParts[ 2 ];
4658	+ if ( tween ) {
4659	+ tween.unit = unit;
4660	+ tween.start = initialInUnit;
4661	+ tween.end = adjusted;
4662	+ }
4663	+ }
4664	+ return adjusted;
4665	+ }
4666	+
4667	+
4668	+ var defaultDisplayMap = {};
4669	+
4670	+ function getDefaultDisplay( elem ) {
4671	+ var temp,
4672	+ doc = elem.ownerDocument,
4673	+ nodeName = elem.nodeName,
4674	+ display = defaultDisplayMap[ nodeName ];
4675	+
4676	+ if ( display ) {
4677	+ return display;
4678	+ }
4679	+
4680	+ temp = doc.body.appendChild( doc.createElement( nodeName ) );
4681	+ display = jQuery.css( temp, "display" );
4682	+
4683	+ temp.parentNode.removeChild( temp );
4684	+
4685	+ if ( display === "none" ) {
4686	+ display = "block";
4687	+ }
4688	+ defaultDisplayMap[ nodeName ] = display;
4689	+
4690	+ return display;
4691	+ }
4692	+
4693	+ function showHide( elements, show ) {
4694	+ var display, elem,
4695	+ values = [],
4696	+ index = 0,
4697	+ length = elements.length;
4698	+
4699	+ // Determine new display value for elements that need to change
4700	+ for ( ; index < length; index++ ) {
4701	+ elem = elements[ index ];
4702	+ if ( !elem.style ) {
4703	+ continue;
4704	+ }
4705	+
4706	+ display = elem.style.display;
4707	+ if ( show ) {
4708	+
4709	+ // Since we force visibility upon cascade-hidden elements, an immediate (and slow)
4710	+ // check is required in this first loop unless we have a nonempty display value (either
4711	+ // inline or about-to-be-restored)
4712	+ if ( display === "none" ) {
4713	+ values[ index ] = dataPriv.get( elem, "display" ) \|\| null;
4714	+ if ( !values[ index ] ) {
4715	+ elem.style.display = "";
4716	+ }
4717	+ }
4718	+ if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
4719	+ values[ index ] = getDefaultDisplay( elem );
4720	+ }
4721	+ } else {
4722	+ if ( display !== "none" ) {
4723	+ values[ index ] = "none";
4724	+
4725	+ // Remember what we're overwriting
4726	+ dataPriv.set( elem, "display", display );
4727	+ }
4728	+ }
4729	+ }
4730	+
4731	+ // Set the display of the elements in a second loop to avoid constant reflow
4732	+ for ( index = 0; index < length; index++ ) {
4733	+ if ( values[ index ] != null ) {
4734	+ elements[ index ].style.display = values[ index ];
4735	+ }
4736	+ }
4737	+
4738	+ return elements;
4739	+ }
4740	+
4741	+ jQuery.fn.extend( {
4742	+ show: function() {
4743	+ return showHide( this, true );
4744	+ },
4745	+ hide: function() {
4746	+ return showHide( this );
4747	+ },
4748	+ toggle: function( state ) {
4749	+ if ( typeof state === "boolean" ) {
4750	+ return state ? this.show() : this.hide();
4751	+ }
4752	+
4753	+ return this.each( function() {
4754	+ if ( isHiddenWithinTree( this ) ) {
4755	+ jQuery( this ).show();
4756	+ } else {
4757	+ jQuery( this ).hide();
4758	+ }
4759	+ } );
4760	+ }
4761	+ } );
4762	+ var rcheckableType = ( /^(?:checkbox\|radio)$/i );
4763	+
4764	+ var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]+)/i );
4765	+
4766	+ var rscriptType = ( /^$\|\/(?:java\|ecma)script/i );
4767	+
4768	+
4769	+
4770	+ // We have to close these tags to support XHTML (#13200)
4771	+ var wrapMap = {
4772	+
4773	+ // Support: IE <=9 only
4774	+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
4775	+
4776	+ // XHTML parsers do not magically insert elements in the
4777	+ // same way that tag soup parsers do. So we cannot shorten
4778	+ // this by omitting <tbody> or other required elements.
4779	+ thead: [ 1, "<table>", "</table>" ],
4780	+ col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
4781	+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
4782	+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
4783	+
4784	+ _default: [ 0, "", "" ]
4785	+ };
4786	+
4787	+ // Support: IE <=9 only
4788	+ wrapMap.optgroup = wrapMap.option;
4789	+
4790	+ wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
4791	+ wrapMap.th = wrapMap.td;
4792	+
4793	+
4794	+ function getAll( context, tag ) {
4795	+
4796	+ // Support: IE <=9 - 11 only
4797	+ // Use typeof to avoid zero-argument method invocation on host objects (#15151)
4798	+ var ret;
4799	+
4800	+ if ( typeof context.getElementsByTagName !== "undefined" ) {
4801	+ ret = context.getElementsByTagName( tag \|\| "*" );
4802	+
4803	+ } else if ( typeof context.querySelectorAll !== "undefined" ) {
4804	+ ret = context.querySelectorAll( tag \|\| "*" );
4805	+
4806	+ } else {
4807	+ ret = [];
4808	+ }
4809	+
4810	+ if ( tag === undefined \|\| tag && nodeName( context, tag ) ) {
4811	+ return jQuery.merge( [ context ], ret );
4812	+ }
4813	+
4814	+ return ret;
4815	+ }
4816	+
4817	+
4818	+ // Mark scripts as having already been evaluated
4819	+ function setGlobalEval( elems, refElements ) {
4820	+ var i = 0,
4821	+ l = elems.length;
4822	+
4823	+ for ( ; i < l; i++ ) {
4824	+ dataPriv.set(
4825	+ elems[ i ],
4826	+ "globalEval",
4827	+ !refElements \|\| dataPriv.get( refElements[ i ], "globalEval" )
4828	+ );
4829	+ }
4830	+ }
4831	+
4832	+
4833	+ var rhtml = /<\|&#?\w+;/;
4834	+
4835	+ function buildFragment( elems, context, scripts, selection, ignored ) {
4836	+ var elem, tmp, tag, wrap, contains, j,
4837	+ fragment = context.createDocumentFragment(),
4838	+ nodes = [],
4839	+ i = 0,
4840	+ l = elems.length;
4841	+
4842	+ for ( ; i < l; i++ ) {
4843	+ elem = elems[ i ];
4844	+
4845	+ if ( elem \|\| elem === 0 ) {
4846	+
4847	+ // Add nodes directly
4848	+ if ( jQuery.type( elem ) === "object" ) {
4849	+
4850	+ // Support: Android <=4.0 only, PhantomJS 1 only
4851	+ // push.apply(_, arraylike) throws on ancient WebKit
4852	+ jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
4853	+
4854	+ // Convert non-html into a text node
4855	+ } else if ( !rhtml.test( elem ) ) {
4856	+ nodes.push( context.createTextNode( elem ) );
4857	+
4858	+ // Convert html into DOM nodes
4859	+ } else {
4860	+ tmp = tmp \|\| fragment.appendChild( context.createElement( "div" ) );
4861	+
4862	+ // Deserialize a standard representation
4863	+ tag = ( rtagName.exec( elem ) \|\| [ "", "" ] )[ 1 ].toLowerCase();
4864	+ wrap = wrapMap[ tag ] \|\| wrapMap._default;
4865	+ tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
4866	+
4867	+ // Descend through wrappers to the right content
4868	+ j = wrap[ 0 ];
4869	+ while ( j-- ) {
4870	+ tmp = tmp.lastChild;
4871	+ }
4872	+
4873	+ // Support: Android <=4.0 only, PhantomJS 1 only
4874	+ // push.apply(_, arraylike) throws on ancient WebKit
4875	+ jQuery.merge( nodes, tmp.childNodes );
4876	+
4877	+ // Remember the top-level container
4878	+ tmp = fragment.firstChild;
4879	+
4880	+ // Ensure the created nodes are orphaned (#12392)
4881	+ tmp.textContent = "";
4882	+ }
4883	+ }
4884	+ }
4885	+
4886	+ // Remove wrapper from fragment
4887	+ fragment.textContent = "";
4888	+
4889	+ i = 0;
4890	+ while ( ( elem = nodes[ i++ ] ) ) {
4891	+
4892	+ // Skip elements already in the context collection (trac-4087)
4893	+ if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
4894	+ if ( ignored ) {
4895	+ ignored.push( elem );
4896	+ }
4897	+ continue;
4898	+ }
4899	+
4900	+ contains = jQuery.contains( elem.ownerDocument, elem );
4901	+
4902	+ // Append to fragment
4903	+ tmp = getAll( fragment.appendChild( elem ), "script" );
4904	+
4905	+ // Preserve script evaluation history
4906	+ if ( contains ) {
4907	+ setGlobalEval( tmp );
4908	+ }
4909	+
4910	+ // Capture executables
4911	+ if ( scripts ) {
4912	+ j = 0;
4913	+ while ( ( elem = tmp[ j++ ] ) ) {
4914	+ if ( rscriptType.test( elem.type \|\| "" ) ) {
4915	+ scripts.push( elem );
4916	+ }
4917	+ }
4918	+ }
4919	+ }
4920	+
4921	+ return fragment;
4922	+ }
4923	+
4924	+
4925	+ ( function() {
4926	+ var fragment = document.createDocumentFragment(),
4927	+ div = fragment.appendChild( document.createElement( "div" ) ),
4928	+ input = document.createElement( "input" );
4929	+
4930	+ // Support: Android 4.0 - 4.3 only
4931	+ // Check state lost if the name is set (#11217)
4932	+ // Support: Windows Web Apps (WWA)
4933	+ // `name` and `type` must use .setAttribute for WWA (#14901)
4934	+ input.setAttribute( "type", "radio" );
4935	+ input.setAttribute( "checked", "checked" );
4936	+ input.setAttribute( "name", "t" );
4937	+
4938	+ div.appendChild( input );
4939	+
4940	+ // Support: Android <=4.1 only
4941	+ // Older WebKit doesn't clone checked state correctly in fragments
4942	+ support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
4943	+
4944	+ // Support: IE <=11 only
4945	+ // Make sure textarea (and checkbox) defaultValue is properly cloned
4946	+ div.innerHTML = "<textarea>x</textarea>";
4947	+ support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
4948	+ } )();
4949	+ var documentElement = document.documentElement;
4950	+
4951	+
4952	+
4953	+ var
4954	+ rkeyEvent = /^key/,
4955	+ rmouseEvent = /^(?:mouse\|pointer\|contextmenu\|drag\|drop)\|click/,
4956	+ rtypenamespace = /^([^.]*)(?:\.(.+)\|)/;
4957	+
4958	+ function returnTrue() {
4959	+ return true;
4960	+ }
4961	+
4962	+ function returnFalse() {
4963	+ return false;
4964	+ }
4965	+
4966	+ // Support: IE <=9 only
4967	+ // See #13393 for more info
4968	+ function safeActiveElement() {
4969	+ try {
4970	+ return document.activeElement;
4971	+ } catch ( err ) { }
4972	+ }
4973	+
4974	+ function on( elem, types, selector, data, fn, one ) {
4975	+ var origFn, type;
4976	+
4977	+ // Types can be a map of types/handlers
4978	+ if ( typeof types === "object" ) {
4979	+
4980	+ // ( types-Object, selector, data )
4981	+ if ( typeof selector !== "string" ) {
4982	+
4983	+ // ( types-Object, data )
4984	+ data = data \|\| selector;
4985	+ selector = undefined;
4986	+ }
4987	+ for ( type in types ) {
4988	+ on( elem, type, selector, data, types[ type ], one );
4989	+ }
4990	+ return elem;
4991	+ }
4992	+
4993	+ if ( data == null && fn == null ) {
4994	+
4995	+ // ( types, fn )
4996	+ fn = selector;
4997	+ data = selector = undefined;
4998	+ } else if ( fn == null ) {
4999	+ if ( typeof selector === "string" ) {
5000	+
5001	+ // ( types, selector, fn )
5002	+ fn = data;
5003	+ data = undefined;
5004	+ } else {
5005	+
5006	+ // ( types, data, fn )
5007	+ fn = data;
5008	+ data = selector;
5009	+ selector = undefined;
5010	+ }
5011	+ }
5012	+ if ( fn === false ) {
5013	+ fn = returnFalse;
5014	+ } else if ( !fn ) {
5015	+ return elem;
5016	+ }
5017	+
5018	+ if ( one === 1 ) {
5019	+ origFn = fn;
5020	+ fn = function( event ) {
5021	+
5022	+ // Can use an empty set, since event contains the info
5023	+ jQuery().off( event );
5024	+ return origFn.apply( this, arguments );
5025	+ };
5026	+
5027	+ // Use same guid so caller can remove using origFn
5028	+ fn.guid = origFn.guid \|\| ( origFn.guid = jQuery.guid++ );
5029	+ }
5030	+ return elem.each( function() {
5031	+ jQuery.event.add( this, types, fn, data, selector );
5032	+ } );
5033	+ }
5034	+
5035	+ /*
5036	+ * Helper functions for managing events -- not part of the public interface.
5037	+ * Props to Dean Edwards' addEvent library for many of the ideas.
5038	+ */
5039	+ jQuery.event = {
5040	+
5041	+ global: {},
5042	+
5043	+ add: function( elem, types, handler, data, selector ) {
5044	+
5045	+ var handleObjIn, eventHandle, tmp,
5046	+ events, t, handleObj,
5047	+ special, handlers, type, namespaces, origType,
5048	+ elemData = dataPriv.get( elem );
5049	+
5050	+ // Don't attach events to noData or text/comment nodes (but allow plain objects)
5051	+ if ( !elemData ) {
5052	+ return;
5053	+ }
5054	+
5055	+ // Caller can pass in an object of custom data in lieu of the handler
5056	+ if ( handler.handler ) {
5057	+ handleObjIn = handler;
5058	+ handler = handleObjIn.handler;
5059	+ selector = handleObjIn.selector;
5060	+ }
5061	+
5062	+ // Ensure that invalid selectors throw exceptions at attach time
5063	+ // Evaluate against documentElement in case elem is a non-element node (e.g., document)
5064	+ if ( selector ) {
5065	+ jQuery.find.matchesSelector( documentElement, selector );
5066	+ }
5067	+
5068	+ // Make sure that the handler has a unique ID, used to find/remove it later
5069	+ if ( !handler.guid ) {
5070	+ handler.guid = jQuery.guid++;
5071	+ }
5072	+
5073	+ // Init the element's event structure and main handler, if this is the first
5074	+ if ( !( events = elemData.events ) ) {
5075	+ events = elemData.events = {};
5076	+ }
5077	+ if ( !( eventHandle = elemData.handle ) ) {
5078	+ eventHandle = elemData.handle = function( e ) {
5079	+
5080	+ // Discard the second event of a jQuery.event.trigger() and
5081	+ // when an event is called after a page has unloaded
5082	+ return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
5083	+ jQuery.event.dispatch.apply( elem, arguments ) : undefined;
5084	+ };
5085	+ }
5086	+
5087	+ // Handle multiple events separated by a space
5088	+ types = ( types \|\| "" ).match( rnothtmlwhite ) \|\| [ "" ];
5089	+ t = types.length;
5090	+ while ( t-- ) {
5091	+ tmp = rtypenamespace.exec( types[ t ] ) \|\| [];
5092	+ type = origType = tmp[ 1 ];
5093	+ namespaces = ( tmp[ 2 ] \|\| "" ).split( "." ).sort();
5094	+
5095	+ // There must be a type, no attaching namespace-only handlers
5096	+ if ( !type ) {
5097	+ continue;
5098	+ }
5099	+
5100	+ // If event changes its type, use the special event handlers for the changed type
5101	+ special = jQuery.event.special[ type ] \|\| {};
5102	+
5103	+ // If selector defined, determine special event api type, otherwise given type
5104	+ type = ( selector ? special.delegateType : special.bindType ) \|\| type;
5105	+
5106	+ // Update special based on newly reset type
5107	+ special = jQuery.event.special[ type ] \|\| {};
5108	+
5109	+ // handleObj is passed to all event handlers
5110	+ handleObj = jQuery.extend( {
5111	+ type: type,
5112	+ origType: origType,
5113	+ data: data,
5114	+ handler: handler,
5115	+ guid: handler.guid,
5116	+ selector: selector,
5117	+ needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
5118	+ namespace: namespaces.join( "." )
5119	+ }, handleObjIn );
5120	+
5121	+ // Init the event handler queue if we're the first
5122	+ if ( !( handlers = events[ type ] ) ) {
5123	+ handlers = events[ type ] = [];
5124	+ handlers.delegateCount = 0;
5125	+
5126	+ // Only use addEventListener if the special events handler returns false
5127	+ if ( !special.setup \|\|
5128	+ special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
5129	+
5130	+ if ( elem.addEventListener ) {
5131	+ elem.addEventListener( type, eventHandle );
5132	+ }
5133	+ }
5134	+ }
5135	+
5136	+ if ( special.add ) {
5137	+ special.add.call( elem, handleObj );
5138	+
5139	+ if ( !handleObj.handler.guid ) {
5140	+ handleObj.handler.guid = handler.guid;
5141	+ }
5142	+ }
5143	+
5144	+ // Add to the element's handler list, delegates in front
5145	+ if ( selector ) {
5146	+ handlers.splice( handlers.delegateCount++, 0, handleObj );
5147	+ } else {
5148	+ handlers.push( handleObj );
5149	+ }
5150	+
5151	+ // Keep track of which events have ever been used, for event optimization
5152	+ jQuery.event.global[ type ] = true;
5153	+ }
5154	+
5155	+ },
5156	+
5157	+ // Detach an event or set of events from an element
5158	+ remove: function( elem, types, handler, selector, mappedTypes ) {
5159	+
5160	+ var j, origCount, tmp,
5161	+ events, t, handleObj,
5162	+ special, handlers, type, namespaces, origType,
5163	+ elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
5164	+
5165	+ if ( !elemData \|\| !( events = elemData.events ) ) {
5166	+ return;
5167	+ }
5168	+
5169	+ // Once for each type.namespace in types; type may be omitted
5170	+ types = ( types \|\| "" ).match( rnothtmlwhite ) \|\| [ "" ];
5171	+ t = types.length;
5172	+ while ( t-- ) {
5173	+ tmp = rtypenamespace.exec( types[ t ] ) \|\| [];
5174	+ type = origType = tmp[ 1 ];
5175	+ namespaces = ( tmp[ 2 ] \|\| "" ).split( "." ).sort();
5176	+
5177	+ // Unbind all events (on this namespace, if provided) for the element
5178	+ if ( !type ) {
5179	+ for ( type in events ) {
5180	+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
5181	+ }
5182	+ continue;
5183	+ }
5184	+
5185	+ special = jQuery.event.special[ type ] \|\| {};
5186	+ type = ( selector ? special.delegateType : special.bindType ) \|\| type;
5187	+ handlers = events[ type ] \|\| [];
5188	+ tmp = tmp[ 2 ] &&
5189	+ new RegExp( "(^\|\\.)" + namespaces.join( "\\.(?:.*\\.\|)" ) + "(\\.\|$)" );
5190	+
5191	+ // Remove matching events
5192	+ origCount = j = handlers.length;
5193	+ while ( j-- ) {
5194	+ handleObj = handlers[ j ];
5195	+
5196	+ if ( ( mappedTypes \|\| origType === handleObj.origType ) &&
5197	+ ( !handler \|\| handler.guid === handleObj.guid ) &&
5198	+ ( !tmp \|\| tmp.test( handleObj.namespace ) ) &&
5199	+ ( !selector \|\| selector === handleObj.selector \|\|
5200	+ selector === "**" && handleObj.selector ) ) {
5201	+ handlers.splice( j, 1 );
5202	+
5203	+ if ( handleObj.selector ) {
5204	+ handlers.delegateCount--;
5205	+ }
5206	+ if ( special.remove ) {
5207	+ special.remove.call( elem, handleObj );
5208	+ }
5209	+ }
5210	+ }
5211	+
5212	+ // Remove generic event handler if we removed something and no more handlers exist
5213	+ // (avoids potential for endless recursion during removal of special event handlers)
5214	+ if ( origCount && !handlers.length ) {
5215	+ if ( !special.teardown \|\|
5216	+ special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
5217	+
5218	+ jQuery.removeEvent( elem, type, elemData.handle );
5219	+ }
5220	+
5221	+ delete events[ type ];
5222	+ }
5223	+ }
5224	+
5225	+ // Remove data and the expando if it's no longer used
5226	+ if ( jQuery.isEmptyObject( events ) ) {
5227	+ dataPriv.remove( elem, "handle events" );
5228	+ }
5229	+ },
5230	+
5231	+ dispatch: function( nativeEvent ) {
5232	+
5233	+ // Make a writable jQuery.Event from the native event object
5234	+ var event = jQuery.event.fix( nativeEvent );
5235	+
5236	+ var i, j, ret, matched, handleObj, handlerQueue,
5237	+ args = new Array( arguments.length ),
5238	+ handlers = ( dataPriv.get( this, "events" ) \|\| {} )[ event.type ] \|\| [],
5239	+ special = jQuery.event.special[ event.type ] \|\| {};
5240	+
5241	+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
5242	+ args[ 0 ] = event;
5243	+
5244	+ for ( i = 1; i < arguments.length; i++ ) {
5245	+ args[ i ] = arguments[ i ];
5246	+ }
5247	+
5248	+ event.delegateTarget = this;
5249	+
5250	+ // Call the preDispatch hook for the mapped type, and let it bail if desired
5251	+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
5252	+ return;
5253	+ }
5254	+
5255	+ // Determine handlers
5256	+ handlerQueue = jQuery.event.handlers.call( this, event, handlers );
5257	+
5258	+ // Run delegates first; they may want to stop propagation beneath us
5259	+ i = 0;
5260	+ while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
5261	+ event.currentTarget = matched.elem;
5262	+
5263	+ j = 0;
5264	+ while ( ( handleObj = matched.handlers[ j++ ] ) &&
5265	+ !event.isImmediatePropagationStopped() ) {
5266	+
5267	+ // Triggered event must either 1) have no namespace, or 2) have namespace(s)
5268	+ // a subset or equal to those in the bound event (both can have no namespace).
5269	+ if ( !event.rnamespace \|\| event.rnamespace.test( handleObj.namespace ) ) {
5270	+
5271	+ event.handleObj = handleObj;
5272	+ event.data = handleObj.data;
5273	+
5274	+ ret = ( ( jQuery.event.special[ handleObj.origType ] \|\| {} ).handle \|\|
5275	+ handleObj.handler ).apply( matched.elem, args );
5276	+
5277	+ if ( ret !== undefined ) {
5278	+ if ( ( event.result = ret ) === false ) {
5279	+ event.preventDefault();
5280	+ event.stopPropagation();
5281	+ }
5282	+ }
5283	+ }
5284	+ }
5285	+ }
5286	+
5287	+ // Call the postDispatch hook for the mapped type
5288	+ if ( special.postDispatch ) {
5289	+ special.postDispatch.call( this, event );
5290	+ }
5291	+
5292	+ return event.result;
5293	+ },
5294	+
5295	+ handlers: function( event, handlers ) {
5296	+ var i, handleObj, sel, matchedHandlers, matchedSelectors,
5297	+ handlerQueue = [],
5298	+ delegateCount = handlers.delegateCount,
5299	+ cur = event.target;
5300	+
5301	+ // Find delegate handlers
5302	+ if ( delegateCount &&
5303	+
5304	+ // Support: IE <=9
5305	+ // Black-hole SVG <use> instance trees (trac-13180)
5306	+ cur.nodeType &&
5307	+
5308	+ // Support: Firefox <=42
5309	+ // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
5310	+ // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
5311	+ // Support: IE 11 only
5312	+ // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
5313	+ !( event.type === "click" && event.button >= 1 ) ) {
5314	+
5315	+ for ( ; cur !== this; cur = cur.parentNode \|\| this ) {
5316	+
5317	+ // Don't check non-elements (#13208)
5318	+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
5319	+ if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
5320	+ matchedHandlers = [];
5321	+ matchedSelectors = {};
5322	+ for ( i = 0; i < delegateCount; i++ ) {
5323	+ handleObj = handlers[ i ];
5324	+
5325	+ // Don't conflict with Object.prototype properties (#13203)
5326	+ sel = handleObj.selector + " ";
5327	+
5328	+ if ( matchedSelectors[ sel ] === undefined ) {
5329	+ matchedSelectors[ sel ] = handleObj.needsContext ?
5330	+ jQuery( sel, this ).index( cur ) > -1 :
5331	+ jQuery.find( sel, this, null, [ cur ] ).length;
5332	+ }
5333	+ if ( matchedSelectors[ sel ] ) {
5334	+ matchedHandlers.push( handleObj );
5335	+ }
5336	+ }
5337	+ if ( matchedHandlers.length ) {
5338	+ handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
5339	+ }
5340	+ }
5341	+ }
5342	+ }
5343	+
5344	+ // Add the remaining (directly-bound) handlers
5345	+ cur = this;
5346	+ if ( delegateCount < handlers.length ) {
5347	+ handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
5348	+ }
5349	+
5350	+ return handlerQueue;
5351	+ },
5352	+
5353	+ addProp: function( name, hook ) {
5354	+ Object.defineProperty( jQuery.Event.prototype, name, {
5355	+ enumerable: true,
5356	+ configurable: true,
5357	+
5358	+ get: jQuery.isFunction( hook ) ?
5359	+ function() {
5360	+ if ( this.originalEvent ) {
5361	+ return hook( this.originalEvent );
5362	+ }
5363	+ } :
5364	+ function() {
5365	+ if ( this.originalEvent ) {
5366	+ return this.originalEvent[ name ];
5367	+ }
5368	+ },
5369	+
5370	+ set: function( value ) {
5371	+ Object.defineProperty( this, name, {
5372	+ enumerable: true,
5373	+ configurable: true,
5374	+ writable: true,
5375	+ value: value
5376	+ } );
5377	+ }
5378	+ } );
5379	+ },
5380	+
5381	+ fix: function( originalEvent ) {
5382	+ return originalEvent[ jQuery.expando ] ?
5383	+ originalEvent :
5384	+ new jQuery.Event( originalEvent );
5385	+ },
5386	+
5387	+ special: {
5388	+ load: {
5389	+
5390	+ // Prevent triggered image.load events from bubbling to window.load
5391	+ noBubble: true
5392	+ },
5393	+ focus: {
5394	+
5395	+ // Fire native event if possible so blur/focus sequence is correct
5396	+ trigger: function() {
5397	+ if ( this !== safeActiveElement() && this.focus ) {
5398	+ this.focus();
5399	+ return false;
5400	+ }
5401	+ },
5402	+ delegateType: "focusin"
5403	+ },
5404	+ blur: {
5405	+ trigger: function() {
5406	+ if ( this === safeActiveElement() && this.blur ) {
5407	+ this.blur();
5408	+ return false;
5409	+ }
5410	+ },
5411	+ delegateType: "focusout"
5412	+ },
5413	+ click: {
5414	+
5415	+ // For checkbox, fire native event so checked state will be right
5416	+ trigger: function() {
5417	+ if ( this.type === "checkbox" && this.click && nodeName( this, "input" ) ) {
5418	+ this.click();
5419	+ return false;
5420	+ }
5421	+ },
5422	+
5423	+ // For cross-browser consistency, don't fire native .click() on links
5424	+ _default: function( event ) {
5425	+ return nodeName( event.target, "a" );
5426	+ }
5427	+ },
5428	+
5429	+ beforeunload: {
5430	+ postDispatch: function( event ) {
5431	+
5432	+ // Support: Firefox 20+
5433	+ // Firefox doesn't alert if the returnValue field is not set.
5434	+ if ( event.result !== undefined && event.originalEvent ) {
5435	+ event.originalEvent.returnValue = event.result;
5436	+ }
5437	+ }
5438	+ }
5439	+ }
5440	+ };
5441	+
5442	+ jQuery.removeEvent = function( elem, type, handle ) {
5443	+
5444	+ // This "if" is needed for plain objects
5445	+ if ( elem.removeEventListener ) {
5446	+ elem.removeEventListener( type, handle );
5447	+ }
5448	+ };
5449	+
5450	+ jQuery.Event = function( src, props ) {
5451	+
5452	+ // Allow instantiation without the 'new' keyword
5453	+ if ( !( this instanceof jQuery.Event ) ) {
5454	+ return new jQuery.Event( src, props );
5455	+ }
5456	+
5457	+ // Event object
5458	+ if ( src && src.type ) {
5459	+ this.originalEvent = src;
5460	+ this.type = src.type;
5461	+
5462	+ // Events bubbling up the document may have been marked as prevented
5463	+ // by a handler lower down the tree; reflect the correct value.
5464	+ this.isDefaultPrevented = src.defaultPrevented \|\|
5465	+ src.defaultPrevented === undefined &&
5466	+
5467	+ // Support: Android <=2.3 only
5468	+ src.returnValue === false ?
5469	+ returnTrue :
5470	+ returnFalse;
5471	+
5472	+ // Create target properties
5473	+ // Support: Safari <=6 - 7 only
5474	+ // Target should not be a text node (#504, #13143)
5475	+ this.target = ( src.target && src.target.nodeType === 3 ) ?
5476	+ src.target.parentNode :
5477	+ src.target;
5478	+
5479	+ this.currentTarget = src.currentTarget;
5480	+ this.relatedTarget = src.relatedTarget;
5481	+
5482	+ // Event type
5483	+ } else {
5484	+ this.type = src;
5485	+ }
5486	+
5487	+ // Put explicitly provided properties onto the event object
5488	+ if ( props ) {
5489	+ jQuery.extend( this, props );
5490	+ }
5491	+
5492	+ // Create a timestamp if incoming event doesn't have one
5493	+ this.timeStamp = src && src.timeStamp \|\| jQuery.now();
5494	+
5495	+ // Mark it as fixed
5496	+ this[ jQuery.expando ] = true;
5497	+ };
5498	+
5499	+ // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
5500	+ // https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
5501	+ jQuery.Event.prototype = {
5502	+ constructor: jQuery.Event,
5503	+ isDefaultPrevented: returnFalse,
5504	+ isPropagationStopped: returnFalse,
5505	+ isImmediatePropagationStopped: returnFalse,
5506	+ isSimulated: false,
5507	+
5508	+ preventDefault: function() {
5509	+ var e = this.originalEvent;
5510	+
5511	+ this.isDefaultPrevented = returnTrue;
5512	+
5513	+ if ( e && !this.isSimulated ) {
5514	+ e.preventDefault();
5515	+ }
5516	+ },
5517	+ stopPropagation: function() {
5518	+ var e = this.originalEvent;
5519	+
5520	+ this.isPropagationStopped = returnTrue;
5521	+
5522	+ if ( e && !this.isSimulated ) {
5523	+ e.stopPropagation();
5524	+ }
5525	+ },
5526	+ stopImmediatePropagation: function() {
5527	+ var e = this.originalEvent;
5528	+
5529	+ this.isImmediatePropagationStopped = returnTrue;
5530	+
5531	+ if ( e && !this.isSimulated ) {
5532	+ e.stopImmediatePropagation();
5533	+ }
5534	+
5535	+ this.stopPropagation();
5536	+ }
5537	+ };
5538	+
5539	+ // Includes all common event props including KeyEvent and MouseEvent specific props
5540	+ jQuery.each( {
5541	+ altKey: true,
5542	+ bubbles: true,
5543	+ cancelable: true,
5544	+ changedTouches: true,
5545	+ ctrlKey: true,
5546	+ detail: true,
5547	+ eventPhase: true,
5548	+ metaKey: true,
5549	+ pageX: true,
5550	+ pageY: true,
5551	+ shiftKey: true,
5552	+ view: true,
5553	+ "char": true,
5554	+ charCode: true,
5555	+ key: true,
5556	+ keyCode: true,
5557	+ button: true,
5558	+ buttons: true,
5559	+ clientX: true,
5560	+ clientY: true,
5561	+ offsetX: true,
5562	+ offsetY: true,
5563	+ pointerId: true,
5564	+ pointerType: true,
5565	+ screenX: true,
5566	+ screenY: true,
5567	+ targetTouches: true,
5568	+ toElement: true,
5569	+ touches: true,
5570	+
5571	+ which: function( event ) {
5572	+ var button = event.button;
5573	+
5574	+ // Add which for key events
5575	+ if ( event.which == null && rkeyEvent.test( event.type ) ) {
5576	+ return event.charCode != null ? event.charCode : event.keyCode;
5577	+ }
5578	+
5579	+ // Add which for click: 1 === left; 2 === middle; 3 === right
5580	+ if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) {
5581	+ if ( button & 1 ) {
5582	+ return 1;
5583	+ }
5584	+
5585	+ if ( button & 2 ) {
5586	+ return 3;
5587	+ }
5588	+
5589	+ if ( button & 4 ) {
5590	+ return 2;
5591	+ }
5592	+
5593	+ return 0;
5594	+ }
5595	+
5596	+ return event.which;
5597	+ }
5598	+ }, jQuery.event.addProp );
5599	+
5600	+ // Create mouseenter/leave events using mouseover/out and event-time checks
5601	+ // so that event delegation works in jQuery.
5602	+ // Do the same for pointerenter/pointerleave and pointerover/pointerout
5603	+ //
5604	+ // Support: Safari 7 only
5605	+ // Safari sends mouseenter too often; see:
5606	+ // https://bugs.chromium.org/p/chromium/issues/detail?id=470258
5607	+ // for the description of the bug (it existed in older Chrome versions as well).
5608	+ jQuery.each( {
5609	+ mouseenter: "mouseover",
5610	+ mouseleave: "mouseout",
5611	+ pointerenter: "pointerover",
5612	+ pointerleave: "pointerout"
5613	+ }, function( orig, fix ) {
5614	+ jQuery.event.special[ orig ] = {
5615	+ delegateType: fix,
5616	+ bindType: fix,
5617	+
5618	+ handle: function( event ) {
5619	+ var ret,
5620	+ target = this,
5621	+ related = event.relatedTarget,
5622	+ handleObj = event.handleObj;
5623	+
5624	+ // For mouseenter/leave call the handler if related is outside the target.
5625	+ // NB: No relatedTarget if the mouse left/entered the browser window
5626	+ if ( !related \|\| ( related !== target && !jQuery.contains( target, related ) ) ) {
5627	+ event.type = handleObj.origType;
5628	+ ret = handleObj.handler.apply( this, arguments );
5629	+ event.type = fix;
5630	+ }
5631	+ return ret;
5632	+ }
5633	+ };
5634	+ } );
5635	+
5636	+ jQuery.fn.extend( {
5637	+
5638	+ on: function( types, selector, data, fn ) {
5639	+ return on( this, types, selector, data, fn );
5640	+ },
5641	+ one: function( types, selector, data, fn ) {
5642	+ return on( this, types, selector, data, fn, 1 );
5643	+ },
5644	+ off: function( types, selector, fn ) {
5645	+ var handleObj, type;
5646	+ if ( types && types.preventDefault && types.handleObj ) {
5647	+
5648	+ // ( event ) dispatched jQuery.Event
5649	+ handleObj = types.handleObj;
5650	+ jQuery( types.delegateTarget ).off(
5651	+ handleObj.namespace ?
5652	+ handleObj.origType + "." + handleObj.namespace :
5653	+ handleObj.origType,
5654	+ handleObj.selector,
5655	+ handleObj.handler
5656	+ );
5657	+ return this;
5658	+ }
5659	+ if ( typeof types === "object" ) {
5660	+
5661	+ // ( types-object [, selector] )
5662	+ for ( type in types ) {
5663	+ this.off( type, selector, types[ type ] );
5664	+ }
5665	+ return this;
5666	+ }
5667	+ if ( selector === false \|\| typeof selector === "function" ) {
5668	+
5669	+ // ( types [, fn] )
5670	+ fn = selector;
5671	+ selector = undefined;
5672	+ }
5673	+ if ( fn === false ) {
5674	+ fn = returnFalse;
5675	+ }
5676	+ return this.each( function() {
5677	+ jQuery.event.remove( this, types, fn, selector );
5678	+ } );
5679	+ }
5680	+ } );
5681	+
5682	+
5683	+ var
5684	+
5685	+ /* eslint-disable max-len */
5686	+
5687	+ // See https://github.com/eslint/eslint/issues/3229
5688	+ rxhtmlTag = /<(?!area\|br\|col\|embed\|hr\|img\|input\|link\|meta\|param)(([a-z][^\/\0>\x20\t\r\n\f])[^>])\/>/gi,
5689	+
5690	+ /* eslint-enable */
5691	+
5692	+ // Support: IE <=10 - 11, Edge 12 - 13
5693	+ // In IE/Edge using regex groups here causes severe slowdowns.
5694	+ // See https://connect.microsoft.com/IE/feedback/details/1736512/
5695	+ rnoInnerhtml = /<script\|<style\|<link/i,
5696	+
5697	+ // checked="checked" or checked
5698	+ rchecked = /checked\s(?:[^=]\|=\s.checked.)/i,
5699	+ rscriptTypeMasked = /^true\/(.*)/,
5700	+ rcleanScript = /^\s<!(?:\[CDATA\[\|--)\|(?:\]\]\|--)>\s$/g;
5701	+
5702	+ // Prefer a tbody over its parent table for containing new rows
5703	+ function manipulationTarget( elem, content ) {
5704	+ if ( nodeName( elem, "table" ) &&
5705	+ nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
5706	+
5707	+ return jQuery( ">tbody", elem )[ 0 ] \|\| elem;
5708	+ }
5709	+
5710	+ return elem;
5711	+ }
5712	+
5713	+ // Replace/restore the type attribute of script elements for safe DOM manipulation
5714	+ function disableScript( elem ) {
5715	+ elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
5716	+ return elem;
5717	+ }
5718	+ function restoreScript( elem ) {
5719	+ var match = rscriptTypeMasked.exec( elem.type );
5720	+
5721	+ if ( match ) {
5722	+ elem.type = match[ 1 ];
5723	+ } else {
5724	+ elem.removeAttribute( "type" );
5725	+ }
5726	+
5727	+ return elem;
5728	+ }
5729	+
5730	+ function cloneCopyEvent( src, dest ) {
5731	+ var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
5732	+
5733	+ if ( dest.nodeType !== 1 ) {
5734	+ return;
5735	+ }
5736	+
5737	+ // 1. Copy private data: events, handlers, etc.
5738	+ if ( dataPriv.hasData( src ) ) {
5739	+ pdataOld = dataPriv.access( src );
5740	+ pdataCur = dataPriv.set( dest, pdataOld );
5741	+ events = pdataOld.events;
5742	+
5743	+ if ( events ) {
5744	+ delete pdataCur.handle;
5745	+ pdataCur.events = {};
5746	+
5747	+ for ( type in events ) {
5748	+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
5749	+ jQuery.event.add( dest, type, events[ type ][ i ] );
5750	+ }
5751	+ }
5752	+ }
5753	+ }
5754	+
5755	+ // 2. Copy user data
5756	+ if ( dataUser.hasData( src ) ) {
5757	+ udataOld = dataUser.access( src );
5758	+ udataCur = jQuery.extend( {}, udataOld );
5759	+
5760	+ dataUser.set( dest, udataCur );
5761	+ }
5762	+ }
5763	+
5764	+ // Fix IE bugs, see support tests
5765	+ function fixInput( src, dest ) {
5766	+ var nodeName = dest.nodeName.toLowerCase();
5767	+
5768	+ // Fails to persist the checked state of a cloned checkbox or radio button.
5769	+ if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
5770	+ dest.checked = src.checked;
5771	+
5772	+ // Fails to return the selected option to the default selected state when cloning options
5773	+ } else if ( nodeName === "input" \|\| nodeName === "textarea" ) {
5774	+ dest.defaultValue = src.defaultValue;
5775	+ }
5776	+ }
5777	+
5778	+ function domManip( collection, args, callback, ignored ) {
5779	+
5780	+ // Flatten any nested arrays
5781	+ args = concat.apply( [], args );
5782	+
5783	+ var fragment, first, scripts, hasScripts, node, doc,
5784	+ i = 0,
5785	+ l = collection.length,
5786	+ iNoClone = l - 1,
5787	+ value = args[ 0 ],
5788	+ isFunction = jQuery.isFunction( value );
5789	+
5790	+ // We can't cloneNode fragments that contain checked, in WebKit
5791	+ if ( isFunction \|\|
5792	+ ( l > 1 && typeof value === "string" &&
5793	+ !support.checkClone && rchecked.test( value ) ) ) {
5794	+ return collection.each( function( index ) {
5795	+ var self = collection.eq( index );
5796	+ if ( isFunction ) {
5797	+ args[ 0 ] = value.call( this, index, self.html() );
5798	+ }
5799	+ domManip( self, args, callback, ignored );
5800	+ } );
5801	+ }
5802	+
5803	+ if ( l ) {
5804	+ fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
5805	+ first = fragment.firstChild;
5806	+
5807	+ if ( fragment.childNodes.length === 1 ) {
5808	+ fragment = first;
5809	+ }
5810	+
5811	+ // Require either new content or an interest in ignored elements to invoke the callback
5812	+ if ( first \|\| ignored ) {
5813	+ scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
5814	+ hasScripts = scripts.length;
5815	+
5816	+ // Use the original fragment for the last item
5817	+ // instead of the first because it can end up
5818	+ // being emptied incorrectly in certain situations (#8070).
5819	+ for ( ; i < l; i++ ) {
5820	+ node = fragment;
5821	+
5822	+ if ( i !== iNoClone ) {
5823	+ node = jQuery.clone( node, true, true );
5824	+
5825	+ // Keep references to cloned scripts for later restoration
5826	+ if ( hasScripts ) {
5827	+
5828	+ // Support: Android <=4.0 only, PhantomJS 1 only
5829	+ // push.apply(_, arraylike) throws on ancient WebKit
5830	+ jQuery.merge( scripts, getAll( node, "script" ) );
5831	+ }
5832	+ }
5833	+
5834	+ callback.call( collection[ i ], node, i );
5835	+ }
5836	+
5837	+ if ( hasScripts ) {
5838	+ doc = scripts[ scripts.length - 1 ].ownerDocument;
5839	+
5840	+ // Reenable scripts
5841	+ jQuery.map( scripts, restoreScript );
5842	+
5843	+ // Evaluate executable scripts on first document insertion
5844	+ for ( i = 0; i < hasScripts; i++ ) {
5845	+ node = scripts[ i ];
5846	+ if ( rscriptType.test( node.type \|\| "" ) &&
5847	+ !dataPriv.access( node, "globalEval" ) &&
5848	+ jQuery.contains( doc, node ) ) {
5849	+
5850	+ if ( node.src ) {
5851	+
5852	+ // Optional AJAX dependency, but won't run scripts if not present
5853	+ if ( jQuery._evalUrl ) {
5854	+ jQuery._evalUrl( node.src );
5855	+ }
5856	+ } else {
5857	+ DOMEval( node.textContent.replace( rcleanScript, "" ), doc );
5858	+ }
5859	+ }
5860	+ }
5861	+ }
5862	+ }
5863	+ }
5864	+
5865	+ return collection;
5866	+ }
5867	+
5868	+ function remove( elem, selector, keepData ) {
5869	+ var node,
5870	+ nodes = selector ? jQuery.filter( selector, elem ) : elem,
5871	+ i = 0;
5872	+
5873	+ for ( ; ( node = nodes[ i ] ) != null; i++ ) {
5874	+ if ( !keepData && node.nodeType === 1 ) {
5875	+ jQuery.cleanData( getAll( node ) );
5876	+ }
5877	+
5878	+ if ( node.parentNode ) {
5879	+ if ( keepData && jQuery.contains( node.ownerDocument, node ) ) {
5880	+ setGlobalEval( getAll( node, "script" ) );
5881	+ }
5882	+ node.parentNode.removeChild( node );
5883	+ }
5884	+ }
5885	+
5886	+ return elem;
5887	+ }
5888	+
5889	+ jQuery.extend( {
5890	+ htmlPrefilter: function( html ) {
5891	+ return html.replace( rxhtmlTag, "<$1></$2>" );
5892	+ },
5893	+
5894	+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
5895	+ var i, l, srcElements, destElements,
5896	+ clone = elem.cloneNode( true ),
5897	+ inPage = jQuery.contains( elem.ownerDocument, elem );
5898	+
5899	+ // Fix IE cloning issues
5900	+ if ( !support.noCloneChecked && ( elem.nodeType === 1 \|\| elem.nodeType === 11 ) &&
5901	+ !jQuery.isXMLDoc( elem ) ) {
5902	+
5903	+ // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2
5904	+ destElements = getAll( clone );
5905	+ srcElements = getAll( elem );
5906	+
5907	+ for ( i = 0, l = srcElements.length; i < l; i++ ) {
5908	+ fixInput( srcElements[ i ], destElements[ i ] );
5909	+ }
5910	+ }
5911	+
5912	+ // Copy the events from the original to the clone
5913	+ if ( dataAndEvents ) {
5914	+ if ( deepDataAndEvents ) {
5915	+ srcElements = srcElements \|\| getAll( elem );
5916	+ destElements = destElements \|\| getAll( clone );
5917	+
5918	+ for ( i = 0, l = srcElements.length; i < l; i++ ) {
5919	+ cloneCopyEvent( srcElements[ i ], destElements[ i ] );
5920	+ }
5921	+ } else {
5922	+ cloneCopyEvent( elem, clone );
5923	+ }
5924	+ }
5925	+
5926	+ // Preserve script evaluation history
5927	+ destElements = getAll( clone, "script" );
5928	+ if ( destElements.length > 0 ) {
5929	+ setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
5930	+ }
5931	+
5932	+ // Return the cloned set
5933	+ return clone;
5934	+ },
5935	+
5936	+ cleanData: function( elems ) {
5937	+ var data, elem, type,
5938	+ special = jQuery.event.special,
5939	+ i = 0;
5940	+
5941	+ for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
5942	+ if ( acceptData( elem ) ) {
5943	+ if ( ( data = elem[ dataPriv.expando ] ) ) {
5944	+ if ( data.events ) {
5945	+ for ( type in data.events ) {
5946	+ if ( special[ type ] ) {
5947	+ jQuery.event.remove( elem, type );
5948	+
5949	+ // This is a shortcut to avoid jQuery.event.remove's overhead
5950	+ } else {
5951	+ jQuery.removeEvent( elem, type, data.handle );
5952	+ }
5953	+ }
5954	+ }
5955	+
5956	+ // Support: Chrome <=35 - 45+
5957	+ // Assign undefined instead of using delete, see Data#remove
5958	+ elem[ dataPriv.expando ] = undefined;
5959	+ }
5960	+ if ( elem[ dataUser.expando ] ) {
5961	+
5962	+ // Support: Chrome <=35 - 45+
5963	+ // Assign undefined instead of using delete, see Data#remove
5964	+ elem[ dataUser.expando ] = undefined;
5965	+ }
5966	+ }
5967	+ }
5968	+ }
5969	+ } );
5970	+
5971	+ jQuery.fn.extend( {
5972	+ detach: function( selector ) {
5973	+ return remove( this, selector, true );
5974	+ },
5975	+
5976	+ remove: function( selector ) {
5977	+ return remove( this, selector );
5978	+ },
5979	+
5980	+ text: function( value ) {
5981	+ return access( this, function( value ) {
5982	+ return value === undefined ?
5983	+ jQuery.text( this ) :
5984	+ this.empty().each( function() {
5985	+ if ( this.nodeType === 1 \|\| this.nodeType === 11 \|\| this.nodeType === 9 ) {
5986	+ this.textContent = value;
5987	+ }
5988	+ } );
5989	+ }, null, value, arguments.length );
5990	+ },
5991	+
5992	+ append: function() {
5993	+ return domManip( this, arguments, function( elem ) {
5994	+ if ( this.nodeType === 1 \|\| this.nodeType === 11 \|\| this.nodeType === 9 ) {
5995	+ var target = manipulationTarget( this, elem );
5996	+ target.appendChild( elem );
5997	+ }
5998	+ } );
5999	+ },
6000	+
6001	+ prepend: function() {
6002	+ return domManip( this, arguments, function( elem ) {
6003	+ if ( this.nodeType === 1 \|\| this.nodeType === 11 \|\| this.nodeType === 9 ) {
6004	+ var target = manipulationTarget( this, elem );
6005	+ target.insertBefore( elem, target.firstChild );
6006	+ }
6007	+ } );
6008	+ },
6009	+
6010	+ before: function() {
6011	+ return domManip( this, arguments, function( elem ) {
6012	+ if ( this.parentNode ) {
6013	+ this.parentNode.insertBefore( elem, this );
6014	+ }
6015	+ } );
6016	+ },
6017	+
6018	+ after: function() {
6019	+ return domManip( this, arguments, function( elem ) {
6020	+ if ( this.parentNode ) {
6021	+ this.parentNode.insertBefore( elem, this.nextSibling );
6022	+ }
6023	+ } );
6024	+ },
6025	+
6026	+ empty: function() {
6027	+ var elem,
6028	+ i = 0;
6029	+
6030	+ for ( ; ( elem = this[ i ] ) != null; i++ ) {
6031	+ if ( elem.nodeType === 1 ) {
6032	+
6033	+ // Prevent memory leaks
6034	+ jQuery.cleanData( getAll( elem, false ) );
6035	+
6036	+ // Remove any remaining nodes
6037	+ elem.textContent = "";
6038	+ }
6039	+ }
6040	+
6041	+ return this;
6042	+ },
6043	+
6044	+ clone: function( dataAndEvents, deepDataAndEvents ) {
6045	+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
6046	+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
6047	+
6048	+ return this.map( function() {
6049	+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
6050	+ } );
6051	+ },
6052	+
6053	+ html: function( value ) {
6054	+ return access( this, function( value ) {
6055	+ var elem = this[ 0 ] \|\| {},
6056	+ i = 0,
6057	+ l = this.length;
6058	+
6059	+ if ( value === undefined && elem.nodeType === 1 ) {
6060	+ return elem.innerHTML;
6061	+ }
6062	+
6063	+ // See if we can take a shortcut and just use innerHTML
6064	+ if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
6065	+ !wrapMap[ ( rtagName.exec( value ) \|\| [ "", "" ] )[ 1 ].toLowerCase() ] ) {
6066	+
6067	+ value = jQuery.htmlPrefilter( value );
6068	+
6069	+ try {
6070	+ for ( ; i < l; i++ ) {
6071	+ elem = this[ i ] \|\| {};
6072	+
6073	+ // Remove element nodes and prevent memory leaks
6074	+ if ( elem.nodeType === 1 ) {
6075	+ jQuery.cleanData( getAll( elem, false ) );
6076	+ elem.innerHTML = value;
6077	+ }
6078	+ }
6079	+
6080	+ elem = 0;
6081	+
6082	+ // If using innerHTML throws an exception, use the fallback method
6083	+ } catch ( e ) {}
6084	+ }
6085	+
6086	+ if ( elem ) {
6087	+ this.empty().append( value );
6088	+ }
6089	+ }, null, value, arguments.length );
6090	+ },
6091	+
6092	+ replaceWith: function() {
6093	+ var ignored = [];
6094	+
6095	+ // Make the changes, replacing each non-ignored context element with the new content
6096	+ return domManip( this, arguments, function( elem ) {
6097	+ var parent = this.parentNode;
6098	+
6099	+ if ( jQuery.inArray( this, ignored ) < 0 ) {
6100	+ jQuery.cleanData( getAll( this ) );
6101	+ if ( parent ) {
6102	+ parent.replaceChild( elem, this );
6103	+ }
6104	+ }
6105	+
6106	+ // Force callback invocation
6107	+ }, ignored );
6108	+ }
6109	+ } );
6110	+
6111	+ jQuery.each( {
6112	+ appendTo: "append",
6113	+ prependTo: "prepend",
6114	+ insertBefore: "before",
6115	+ insertAfter: "after",
6116	+ replaceAll: "replaceWith"
6117	+ }, function( name, original ) {
6118	+ jQuery.fn[ name ] = function( selector ) {
6119	+ var elems,
6120	+ ret = [],
6121	+ insert = jQuery( selector ),
6122	+ last = insert.length - 1,
6123	+ i = 0;
6124	+
6125	+ for ( ; i <= last; i++ ) {
6126	+ elems = i === last ? this : this.clone( true );
6127	+ jQuery( insert[ i ] )[ original ]( elems );
6128	+
6129	+ // Support: Android <=4.0 only, PhantomJS 1 only
6130	+ // .get() because push.apply(_, arraylike) throws on ancient WebKit
6131	+ push.apply( ret, elems.get() );
6132	+ }
6133	+
6134	+ return this.pushStack( ret );
6135	+ };
6136	+ } );
6137	+ var rmargin = ( /^margin/ );
6138	+
6139	+ var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
6140	+
6141	+ var getStyles = function( elem ) {
6142	+
6143	+ // Support: IE <=11 only, Firefox <=30 (#15098, #14150)
6144	+ // IE throws on elements created in popups
6145	+ // FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
6146	+ var view = elem.ownerDocument.defaultView;
6147	+
6148	+ if ( !view \|\| !view.opener ) {
6149	+ view = window;
6150	+ }
6151	+
6152	+ return view.getComputedStyle( elem );
6153	+ };
6154	+
6155	+
6156	+
6157	+ ( function() {
6158	+
6159	+ // Executing both pixelPosition & boxSizingReliable tests require only one layout
6160	+ // so they're executed at the same time to save the second computation.
6161	+ function computeStyleTests() {
6162	+
6163	+ // This is a singleton, we need to execute it only once
6164	+ if ( !div ) {
6165	+ return;
6166	+ }
6167	+
6168	+ div.style.cssText =
6169	+ "box-sizing:border-box;" +
6170	+ "position:relative;display:block;" +
6171	+ "margin:auto;border:1px;padding:1px;" +
6172	+ "top:1%;width:50%";
6173	+ div.innerHTML = "";
6174	+ documentElement.appendChild( container );
6175	+
6176	+ var divStyle = window.getComputedStyle( div );
6177	+ pixelPositionVal = divStyle.top !== "1%";
6178	+
6179	+ // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
6180	+ reliableMarginLeftVal = divStyle.marginLeft === "2px";
6181	+ boxSizingReliableVal = divStyle.width === "4px";
6182	+
6183	+ // Support: Android 4.0 - 4.3 only
6184	+ // Some styles come back with percentage values, even though they shouldn't
6185	+ div.style.marginRight = "50%";
6186	+ pixelMarginRightVal = divStyle.marginRight === "4px";
6187	+
6188	+ documentElement.removeChild( container );
6189	+
6190	+ // Nullify the div so it wouldn't be stored in the memory and
6191	+ // it will also be a sign that checks already performed
6192	+ div = null;
6193	+ }
6194	+
6195	+ var pixelPositionVal, boxSizingReliableVal, pixelMarginRightVal, reliableMarginLeftVal,
6196	+ container = document.createElement( "div" ),
6197	+ div = document.createElement( "div" );
6198	+
6199	+ // Finish early in limited (non-browser) environments
6200	+ if ( !div.style ) {
6201	+ return;
6202	+ }
6203	+
6204	+ // Support: IE <=9 - 11 only
6205	+ // Style of cloned element affects source element cloned (#8908)
6206	+ div.style.backgroundClip = "content-box";
6207	+ div.cloneNode( true ).style.backgroundClip = "";
6208	+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
6209	+
6210	+ container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" +
6211	+ "padding:0;margin-top:1px;position:absolute";
6212	+ container.appendChild( div );
6213	+
6214	+ jQuery.extend( support, {
6215	+ pixelPosition: function() {
6216	+ computeStyleTests();
6217	+ return pixelPositionVal;
6218	+ },
6219	+ boxSizingReliable: function() {
6220	+ computeStyleTests();
6221	+ return boxSizingReliableVal;
6222	+ },
6223	+ pixelMarginRight: function() {
6224	+ computeStyleTests();
6225	+ return pixelMarginRightVal;
6226	+ },
6227	+ reliableMarginLeft: function() {
6228	+ computeStyleTests();
6229	+ return reliableMarginLeftVal;
6230	+ }
6231	+ } );
6232	+ } )();
6233	+
6234	+
6235	+ function curCSS( elem, name, computed ) {
6236	+ var width, minWidth, maxWidth, ret,
6237	+
6238	+ // Support: Firefox 51+
6239	+ // Retrieving style before computed somehow
6240	+ // fixes an issue with getting wrong values
6241	+ // on detached elements
6242	+ style = elem.style;
6243	+
6244	+ computed = computed \|\| getStyles( elem );
6245	+
6246	+ // getPropertyValue is needed for:
6247	+ // .css('filter') (IE 9 only, #12537)
6248	+ // .css('--customProperty) (#3144)
6249	+ if ( computed ) {
6250	+ ret = computed.getPropertyValue( name ) \|\| computed[ name ];
6251	+
6252	+ if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
6253	+ ret = jQuery.style( elem, name );
6254	+ }
6255	+
6256	+ // A tribute to the "awesome hack by Dean Edwards"
6257	+ // Android Browser returns percentage for some values,
6258	+ // but width seems to be reliably pixels.
6259	+ // This is against the CSSOM draft spec:
6260	+ // https://drafts.csswg.org/cssom/#resolved-values
6261	+ if ( !support.pixelMarginRight() && rnumnonpx.test( ret ) && rmargin.test( name ) ) {
6262	+
6263	+ // Remember the original values
6264	+ width = style.width;
6265	+ minWidth = style.minWidth;
6266	+ maxWidth = style.maxWidth;
6267	+
6268	+ // Put in the new values to get a computed value out
6269	+ style.minWidth = style.maxWidth = style.width = ret;
6270	+ ret = computed.width;
6271	+
6272	+ // Revert the changed values
6273	+ style.width = width;
6274	+ style.minWidth = minWidth;
6275	+ style.maxWidth = maxWidth;
6276	+ }
6277	+ }
6278	+
6279	+ return ret !== undefined ?
6280	+
6281	+ // Support: IE <=9 - 11 only
6282	+ // IE returns zIndex value as an integer.
6283	+ ret + "" :
6284	+ ret;
6285	+ }
6286	+
6287	+
6288	+ function addGetHookIf( conditionFn, hookFn ) {
6289	+
6290	+ // Define the hook, we'll check on the first run if it's really needed.
6291	+ return {
6292	+ get: function() {
6293	+ if ( conditionFn() ) {
6294	+
6295	+ // Hook not needed (or it's not possible to use it due
6296	+ // to missing dependency), remove it.
6297	+ delete this.get;
6298	+ return;
6299	+ }
6300	+
6301	+ // Hook needed; redefine it so that the support test is not executed again.
6302	+ return ( this.get = hookFn ).apply( this, arguments );
6303	+ }
6304	+ };
6305	+ }
6306	+
6307	+
6308	+ var
6309	+
6310	+ // Swappable if display is none or starts with table
6311	+ // except "table", "table-cell", or "table-caption"
6312	+ // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
6313	+ rdisplayswap = /^(none\|table(?!-c[ea]).+)/,
6314	+ rcustomProp = /^--/,
6315	+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
6316	+ cssNormalTransform = {
6317	+ letterSpacing: "0",
6318	+ fontWeight: "400"
6319	+ },
6320	+
6321	+ cssPrefixes = [ "Webkit", "Moz", "ms" ],
6322	+ emptyStyle = document.createElement( "div" ).style;
6323	+
6324	+ // Return a css property mapped to a potentially vendor prefixed property
6325	+ function vendorPropName( name ) {
6326	+
6327	+ // Shortcut for names that are not vendor prefixed
6328	+ if ( name in emptyStyle ) {
6329	+ return name;
6330	+ }
6331	+
6332	+ // Check for vendor prefixed names
6333	+ var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
6334	+ i = cssPrefixes.length;
6335	+
6336	+ while ( i-- ) {
6337	+ name = cssPrefixes[ i ] + capName;
6338	+ if ( name in emptyStyle ) {
6339	+ return name;
6340	+ }
6341	+ }
6342	+ }
6343	+
6344	+ // Return a property mapped along what jQuery.cssProps suggests or to
6345	+ // a vendor prefixed property.
6346	+ function finalPropName( name ) {
6347	+ var ret = jQuery.cssProps[ name ];
6348	+ if ( !ret ) {
6349	+ ret = jQuery.cssProps[ name ] = vendorPropName( name ) \|\| name;
6350	+ }
6351	+ return ret;
6352	+ }
6353	+
6354	+ function setPositiveNumber( elem, value, subtract ) {
6355	+
6356	+ // Any relative (+/-) values have already been
6357	+ // normalized at this point
6358	+ var matches = rcssNum.exec( value );
6359	+ return matches ?
6360	+
6361	+ // Guard against undefined "subtract", e.g., when used as in cssHooks
6362	+ Math.max( 0, matches[ 2 ] - ( subtract \|\| 0 ) ) + ( matches[ 3 ] \|\| "px" ) :
6363	+ value;
6364	+ }
6365	+
6366	+ function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
6367	+ var i,
6368	+ val = 0;
6369	+
6370	+ // If we already have the right measurement, avoid augmentation
6371	+ if ( extra === ( isBorderBox ? "border" : "content" ) ) {
6372	+ i = 4;
6373	+
6374	+ // Otherwise initialize for horizontal or vertical properties
6375	+ } else {
6376	+ i = name === "width" ? 1 : 0;
6377	+ }
6378	+
6379	+ for ( ; i < 4; i += 2 ) {
6380	+
6381	+ // Both box models exclude margin, so add it if we want it
6382	+ if ( extra === "margin" ) {
6383	+ val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
6384	+ }
6385	+
6386	+ if ( isBorderBox ) {
6387	+
6388	+ // border-box includes padding, so remove it if we want content
6389	+ if ( extra === "content" ) {
6390	+ val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
6391	+ }
6392	+
6393	+ // At this point, extra isn't border nor margin, so remove border
6394	+ if ( extra !== "margin" ) {
6395	+ val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
6396	+ }
6397	+ } else {
6398	+
6399	+ // At this point, extra isn't content, so add padding
6400	+ val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
6401	+
6402	+ // At this point, extra isn't content nor padding, so add border
6403	+ if ( extra !== "padding" ) {
6404	+ val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
6405	+ }
6406	+ }
6407	+ }
6408	+
6409	+ return val;
6410	+ }
6411	+
6412	+ function getWidthOrHeight( elem, name, extra ) {
6413	+
6414	+ // Start with computed style
6415	+ var valueIsBorderBox,
6416	+ styles = getStyles( elem ),
6417	+ val = curCSS( elem, name, styles ),
6418	+ isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
6419	+
6420	+ // Computed unit is not pixels. Stop here and return.
6421	+ if ( rnumnonpx.test( val ) ) {
6422	+ return val;
6423	+ }
6424	+
6425	+ // Check for style in case a browser which returns unreliable values
6426	+ // for getComputedStyle silently falls back to the reliable elem.style
6427	+ valueIsBorderBox = isBorderBox &&
6428	+ ( support.boxSizingReliable() \|\| val === elem.style[ name ] );
6429	+
6430	+ // Fall back to offsetWidth/Height when value is "auto"
6431	+ // This happens for inline elements with no explicit setting (gh-3571)
6432	+ if ( val === "auto" ) {
6433	+ val = elem[ "offset" + name[ 0 ].toUpperCase() + name.slice( 1 ) ];
6434	+ }
6435	+
6436	+ // Normalize "", auto, and prepare for extra
6437	+ val = parseFloat( val ) \|\| 0;
6438	+
6439	+ // Use the active box-sizing model to add/subtract irrelevant styles
6440	+ return ( val +
6441	+ augmentWidthOrHeight(
6442	+ elem,
6443	+ name,
6444	+ extra \|\| ( isBorderBox ? "border" : "content" ),
6445	+ valueIsBorderBox,
6446	+ styles
6447	+ )
6448	+ ) + "px";
6449	+ }
6450	+
6451	+ jQuery.extend( {
6452	+
6453	+ // Add in style property hooks for overriding the default
6454	+ // behavior of getting and setting a style property
6455	+ cssHooks: {
6456	+ opacity: {
6457	+ get: function( elem, computed ) {
6458	+ if ( computed ) {
6459	+
6460	+ // We should always get a number back from opacity
6461	+ var ret = curCSS( elem, "opacity" );
6462	+ return ret === "" ? "1" : ret;
6463	+ }
6464	+ }
6465	+ }
6466	+ },
6467	+
6468	+ // Don't automatically add "px" to these possibly-unitless properties
6469	+ cssNumber: {
6470	+ "animationIterationCount": true,
6471	+ "columnCount": true,
6472	+ "fillOpacity": true,
6473	+ "flexGrow": true,
6474	+ "flexShrink": true,
6475	+ "fontWeight": true,
6476	+ "lineHeight": true,
6477	+ "opacity": true,
6478	+ "order": true,
6479	+ "orphans": true,
6480	+ "widows": true,
6481	+ "zIndex": true,
6482	+ "zoom": true
6483	+ },
6484	+
6485	+ // Add in properties whose names you wish to fix before
6486	+ // setting or getting the value
6487	+ cssProps: {
6488	+ "float": "cssFloat"
6489	+ },
6490	+
6491	+ // Get and set the style property on a DOM Node
6492	+ style: function( elem, name, value, extra ) {
6493	+
6494	+ // Don't set styles on text and comment nodes
6495	+ if ( !elem \|\| elem.nodeType === 3 \|\| elem.nodeType === 8 \|\| !elem.style ) {
6496	+ return;
6497	+ }
6498	+
6499	+ // Make sure that we're working with the right name
6500	+ var ret, type, hooks,
6501	+ origName = jQuery.camelCase( name ),
6502	+ isCustomProp = rcustomProp.test( name ),
6503	+ style = elem.style;
6504	+
6505	+ // Make sure that we're working with the right name. We don't
6506	+ // want to query the value if it is a CSS custom property
6507	+ // since they are user-defined.
6508	+ if ( !isCustomProp ) {
6509	+ name = finalPropName( origName );
6510	+ }
6511	+
6512	+ // Gets hook for the prefixed version, then unprefixed version
6513	+ hooks = jQuery.cssHooks[ name ] \|\| jQuery.cssHooks[ origName ];
6514	+
6515	+ // Check if we're setting a value
6516	+ if ( value !== undefined ) {
6517	+ type = typeof value;
6518	+
6519	+ // Convert "+=" or "-=" to relative numbers (#7345)
6520	+ if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
6521	+ value = adjustCSS( elem, name, ret );
6522	+
6523	+ // Fixes bug #9237
6524	+ type = "number";
6525	+ }
6526	+
6527	+ // Make sure that null and NaN values aren't set (#7116)
6528	+ if ( value == null \|\| value !== value ) {
6529	+ return;
6530	+ }
6531	+
6532	+ // If a number was passed in, add the unit (except for certain CSS properties)
6533	+ if ( type === "number" ) {
6534	+ value += ret && ret[ 3 ] \|\| ( jQuery.cssNumber[ origName ] ? "" : "px" );
6535	+ }
6536	+
6537	+ // background-* props affect original clone's values
6538	+ if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
6539	+ style[ name ] = "inherit";
6540	+ }
6541	+
6542	+ // If a hook was provided, use that value, otherwise just set the specified value
6543	+ if ( !hooks \|\| !( "set" in hooks ) \|\|
6544	+ ( value = hooks.set( elem, value, extra ) ) !== undefined ) {
6545	+
6546	+ if ( isCustomProp ) {
6547	+ style.setProperty( name, value );
6548	+ } else {
6549	+ style[ name ] = value;
6550	+ }
6551	+ }
6552	+
6553	+ } else {
6554	+
6555	+ // If a hook was provided get the non-computed value from there
6556	+ if ( hooks && "get" in hooks &&
6557	+ ( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
6558	+
6559	+ return ret;
6560	+ }
6561	+
6562	+ // Otherwise just get the value from the style object
6563	+ return style[ name ];
6564	+ }
6565	+ },
6566	+
6567	+ css: function( elem, name, extra, styles ) {
6568	+ var val, num, hooks,
6569	+ origName = jQuery.camelCase( name ),
6570	+ isCustomProp = rcustomProp.test( name );
6571	+
6572	+ // Make sure that we're working with the right name. We don't
6573	+ // want to modify the value if it is a CSS custom property
6574	+ // since they are user-defined.
6575	+ if ( !isCustomProp ) {
6576	+ name = finalPropName( origName );
6577	+ }
6578	+
6579	+ // Try prefixed name followed by the unprefixed name
6580	+ hooks = jQuery.cssHooks[ name ] \|\| jQuery.cssHooks[ origName ];
6581	+
6582	+ // If a hook was provided get the computed value from there
6583	+ if ( hooks && "get" in hooks ) {
6584	+ val = hooks.get( elem, true, extra );
6585	+ }
6586	+
6587	+ // Otherwise, if a way to get the computed value exists, use that
6588	+ if ( val === undefined ) {
6589	+ val = curCSS( elem, name, styles );
6590	+ }
6591	+
6592	+ // Convert "normal" to computed value
6593	+ if ( val === "normal" && name in cssNormalTransform ) {
6594	+ val = cssNormalTransform[ name ];
6595	+ }
6596	+
6597	+ // Make numeric if forced or a qualifier was provided and val looks numeric
6598	+ if ( extra === "" \|\| extra ) {
6599	+ num = parseFloat( val );
6600	+ return extra === true \|\| isFinite( num ) ? num \|\| 0 : val;
6601	+ }
6602	+
6603	+ return val;
6604	+ }
6605	+ } );
6606	+
6607	+ jQuery.each( [ "height", "width" ], function( i, name ) {
6608	+ jQuery.cssHooks[ name ] = {
6609	+ get: function( elem, computed, extra ) {
6610	+ if ( computed ) {
6611	+
6612	+ // Certain elements can have dimension info if we invisibly show them
6613	+ // but it must have a current display style that would benefit
6614	+ return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
6615	+
6616	+ // Support: Safari 8+
6617	+ // Table columns in Safari have non-zero offsetWidth & zero
6618	+ // getBoundingClientRect().width unless display is changed.
6619	+ // Support: IE <=11 only
6620	+ // Running getBoundingClientRect on a disconnected node
6621	+ // in IE throws an error.
6622	+ ( !elem.getClientRects().length \|\| !elem.getBoundingClientRect().width ) ?
6623	+ swap( elem, cssShow, function() {
6624	+ return getWidthOrHeight( elem, name, extra );
6625	+ } ) :
6626	+ getWidthOrHeight( elem, name, extra );
6627	+ }
6628	+ },
6629	+
6630	+ set: function( elem, value, extra ) {
6631	+ var matches,
6632	+ styles = extra && getStyles( elem ),
6633	+ subtract = extra && augmentWidthOrHeight(
6634	+ elem,
6635	+ name,
6636	+ extra,
6637	+ jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
6638	+ styles
6639	+ );
6640	+
6641	+ // Convert to pixels if value adjustment is needed
6642	+ if ( subtract && ( matches = rcssNum.exec( value ) ) &&
6643	+ ( matches[ 3 ] \|\| "px" ) !== "px" ) {
6644	+
6645	+ elem.style[ name ] = value;
6646	+ value = jQuery.css( elem, name );
6647	+ }
6648	+
6649	+ return setPositiveNumber( elem, value, subtract );
6650	+ }
6651	+ };
6652	+ } );
6653	+
6654	+ jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
6655	+ function( elem, computed ) {
6656	+ if ( computed ) {
6657	+ return ( parseFloat( curCSS( elem, "marginLeft" ) ) \|\|
6658	+ elem.getBoundingClientRect().left -
6659	+ swap( elem, { marginLeft: 0 }, function() {
6660	+ return elem.getBoundingClientRect().left;
6661	+ } )
6662	+ ) + "px";
6663	+ }
6664	+ }
6665	+ );
6666	+
6667	+ // These hooks are used by animate to expand properties
6668	+ jQuery.each( {
6669	+ margin: "",
6670	+ padding: "",
6671	+ border: "Width"
6672	+ }, function( prefix, suffix ) {
6673	+ jQuery.cssHooks[ prefix + suffix ] = {
6674	+ expand: function( value ) {
6675	+ var i = 0,
6676	+ expanded = {},
6677	+
6678	+ // Assumes a single number if not a string
6679	+ parts = typeof value === "string" ? value.split( " " ) : [ value ];
6680	+
6681	+ for ( ; i < 4; i++ ) {
6682	+ expanded[ prefix + cssExpand[ i ] + suffix ] =
6683	+ parts[ i ] \|\| parts[ i - 2 ] \|\| parts[ 0 ];
6684	+ }
6685	+
6686	+ return expanded;
6687	+ }
6688	+ };
6689	+
6690	+ if ( !rmargin.test( prefix ) ) {
6691	+ jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
6692	+ }
6693	+ } );
6694	+
6695	+ jQuery.fn.extend( {
6696	+ css: function( name, value ) {
6697	+ return access( this, function( elem, name, value ) {
6698	+ var styles, len,
6699	+ map = {},
6700	+ i = 0;
6701	+
6702	+ if ( Array.isArray( name ) ) {
6703	+ styles = getStyles( elem );
6704	+ len = name.length;
6705	+
6706	+ for ( ; i < len; i++ ) {
6707	+ map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
6708	+ }
6709	+
6710	+ return map;
6711	+ }
6712	+
6713	+ return value !== undefined ?
6714	+ jQuery.style( elem, name, value ) :
6715	+ jQuery.css( elem, name );
6716	+ }, name, value, arguments.length > 1 );
6717	+ }
6718	+ } );
6719	+
6720	+
6721	+ function Tween( elem, options, prop, end, easing ) {
6722	+ return new Tween.prototype.init( elem, options, prop, end, easing );
6723	+ }
6724	+ jQuery.Tween = Tween;
6725	+
6726	+ Tween.prototype = {
6727	+ constructor: Tween,
6728	+ init: function( elem, options, prop, end, easing, unit ) {
6729	+ this.elem = elem;
6730	+ this.prop = prop;
6731	+ this.easing = easing \|\| jQuery.easing._default;
6732	+ this.options = options;
6733	+ this.start = this.now = this.cur();
6734	+ this.end = end;
6735	+ this.unit = unit \|\| ( jQuery.cssNumber[ prop ] ? "" : "px" );
6736	+ },
6737	+ cur: function() {
6738	+ var hooks = Tween.propHooks[ this.prop ];
6739	+
6740	+ return hooks && hooks.get ?
6741	+ hooks.get( this ) :
6742	+ Tween.propHooks._default.get( this );
6743	+ },
6744	+ run: function( percent ) {
6745	+ var eased,
6746	+ hooks = Tween.propHooks[ this.prop ];
6747	+
6748	+ if ( this.options.duration ) {
6749	+ this.pos = eased = jQuery.easing[ this.easing ](
6750	+ percent, this.options.duration * percent, 0, 1, this.options.duration
6751	+ );
6752	+ } else {
6753	+ this.pos = eased = percent;
6754	+ }
6755	+ this.now = ( this.end - this.start ) * eased + this.start;
6756	+
6757	+ if ( this.options.step ) {
6758	+ this.options.step.call( this.elem, this.now, this );
6759	+ }
6760	+
6761	+ if ( hooks && hooks.set ) {
6762	+ hooks.set( this );
6763	+ } else {
6764	+ Tween.propHooks._default.set( this );
6765	+ }
6766	+ return this;
6767	+ }
6768	+ };
6769	+
6770	+ Tween.prototype.init.prototype = Tween.prototype;
6771	+
6772	+ Tween.propHooks = {
6773	+ _default: {
6774	+ get: function( tween ) {
6775	+ var result;
6776	+
6777	+ // Use a property on the element directly when it is not a DOM element,
6778	+ // or when there is no matching style property that exists.
6779	+ if ( tween.elem.nodeType !== 1 \|\|
6780	+ tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
6781	+ return tween.elem[ tween.prop ];
6782	+ }
6783	+
6784	+ // Passing an empty string as a 3rd parameter to .css will automatically
6785	+ // attempt a parseFloat and fallback to a string if the parse fails.
6786	+ // Simple values such as "10px" are parsed to Float;
6787	+ // complex values such as "rotate(1rad)" are returned as-is.
6788	+ result = jQuery.css( tween.elem, tween.prop, "" );
6789	+
6790	+ // Empty strings, null, undefined and "auto" are converted to 0.
6791	+ return !result \|\| result === "auto" ? 0 : result;
6792	+ },
6793	+ set: function( tween ) {
6794	+
6795	+ // Use step hook for back compat.
6796	+ // Use cssHook if its there.
6797	+ // Use .style if available and use plain properties where available.
6798	+ if ( jQuery.fx.step[ tween.prop ] ) {
6799	+ jQuery.fx.step[ tween.prop ]( tween );
6800	+ } else if ( tween.elem.nodeType === 1 &&
6801	+ ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null \|\|
6802	+ jQuery.cssHooks[ tween.prop ] ) ) {
6803	+ jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
6804	+ } else {
6805	+ tween.elem[ tween.prop ] = tween.now;
6806	+ }
6807	+ }
6808	+ }
6809	+ };
6810	+
6811	+ // Support: IE <=9 only
6812	+ // Panic based approach to setting things on disconnected nodes
6813	+ Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
6814	+ set: function( tween ) {
6815	+ if ( tween.elem.nodeType && tween.elem.parentNode ) {
6816	+ tween.elem[ tween.prop ] = tween.now;
6817	+ }
6818	+ }
6819	+ };
6820	+
6821	+ jQuery.easing = {
6822	+ linear: function( p ) {
6823	+ return p;
6824	+ },
6825	+ swing: function( p ) {
6826	+ return 0.5 - Math.cos( p * Math.PI ) / 2;
6827	+ },
6828	+ _default: "swing"
6829	+ };
6830	+
6831	+ jQuery.fx = Tween.prototype.init;
6832	+
6833	+ // Back compat <1.8 extension point
6834	+ jQuery.fx.step = {};
6835	+
6836	+
6837	+
6838	+
6839	+ var
6840	+ fxNow, inProgress,
6841	+ rfxtypes = /^(?:toggle\|show\|hide)$/,
6842	+ rrun = /queueHooks$/;
6843	+
6844	+ function schedule() {
6845	+ if ( inProgress ) {
6846	+ if ( document.hidden === false && window.requestAnimationFrame ) {
6847	+ window.requestAnimationFrame( schedule );
6848	+ } else {
6849	+ window.setTimeout( schedule, jQuery.fx.interval );
6850	+ }
6851	+
6852	+ jQuery.fx.tick();
6853	+ }
6854	+ }
6855	+
6856	+ // Animations created synchronously will run synchronously
6857	+ function createFxNow() {
6858	+ window.setTimeout( function() {
6859	+ fxNow = undefined;
6860	+ } );
6861	+ return ( fxNow = jQuery.now() );
6862	+ }
6863	+
6864	+ // Generate parameters to create a standard animation
6865	+ function genFx( type, includeWidth ) {
6866	+ var which,
6867	+ i = 0,
6868	+ attrs = { height: type };
6869	+
6870	+ // If we include width, step value is 1 to do all cssExpand values,
6871	+ // otherwise step value is 2 to skip over Left and Right
6872	+ includeWidth = includeWidth ? 1 : 0;
6873	+ for ( ; i < 4; i += 2 - includeWidth ) {
6874	+ which = cssExpand[ i ];
6875	+ attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
6876	+ }
6877	+
6878	+ if ( includeWidth ) {
6879	+ attrs.opacity = attrs.width = type;
6880	+ }
6881	+
6882	+ return attrs;
6883	+ }
6884	+
6885	+ function createTween( value, prop, animation ) {
6886	+ var tween,
6887	+ collection = ( Animation.tweeners[ prop ] \|\| [] ).concat( Animation.tweeners[ "*" ] ),
6888	+ index = 0,
6889	+ length = collection.length;
6890	+ for ( ; index < length; index++ ) {
6891	+ if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
6892	+
6893	+ // We're done with this property
6894	+ return tween;
6895	+ }
6896	+ }
6897	+ }
6898	+
6899	+ function defaultPrefilter( elem, props, opts ) {
6900	+ var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
6901	+ isBox = "width" in props \|\| "height" in props,
6902	+ anim = this,
6903	+ orig = {},
6904	+ style = elem.style,
6905	+ hidden = elem.nodeType && isHiddenWithinTree( elem ),
6906	+ dataShow = dataPriv.get( elem, "fxshow" );
6907	+
6908	+ // Queue-skipping animations hijack the fx hooks
6909	+ if ( !opts.queue ) {
6910	+ hooks = jQuery._queueHooks( elem, "fx" );
6911	+ if ( hooks.unqueued == null ) {
6912	+ hooks.unqueued = 0;
6913	+ oldfire = hooks.empty.fire;
6914	+ hooks.empty.fire = function() {
6915	+ if ( !hooks.unqueued ) {
6916	+ oldfire();
6917	+ }
6918	+ };
6919	+ }
6920	+ hooks.unqueued++;
6921	+
6922	+ anim.always( function() {
6923	+
6924	+ // Ensure the complete handler is called before this completes
6925	+ anim.always( function() {
6926	+ hooks.unqueued--;
6927	+ if ( !jQuery.queue( elem, "fx" ).length ) {
6928	+ hooks.empty.fire();
6929	+ }
6930	+ } );
6931	+ } );
6932	+ }
6933	+
6934	+ // Detect show/hide animations
6935	+ for ( prop in props ) {
6936	+ value = props[ prop ];
6937	+ if ( rfxtypes.test( value ) ) {
6938	+ delete props[ prop ];
6939	+ toggle = toggle \|\| value === "toggle";
6940	+ if ( value === ( hidden ? "hide" : "show" ) ) {
6941	+
6942	+ // Pretend to be hidden if this is a "show" and
6943	+ // there is still data from a stopped show/hide
6944	+ if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
6945	+ hidden = true;
6946	+
6947	+ // Ignore all other no-op show/hide data
6948	+ } else {
6949	+ continue;
6950	+ }
6951	+ }
6952	+ orig[ prop ] = dataShow && dataShow[ prop ] \|\| jQuery.style( elem, prop );
6953	+ }
6954	+ }
6955	+
6956	+ // Bail out if this is a no-op like .hide().hide()
6957	+ propTween = !jQuery.isEmptyObject( props );
6958	+ if ( !propTween && jQuery.isEmptyObject( orig ) ) {
6959	+ return;
6960	+ }
6961	+
6962	+ // Restrict "overflow" and "display" styles during box animations
6963	+ if ( isBox && elem.nodeType === 1 ) {
6964	+
6965	+ // Support: IE <=9 - 11, Edge 12 - 13
6966	+ // Record all 3 overflow attributes because IE does not infer the shorthand
6967	+ // from identically-valued overflowX and overflowY
6968	+ opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
6969	+
6970	+ // Identify a display type, preferring old show/hide data over the CSS cascade
6971	+ restoreDisplay = dataShow && dataShow.display;
6972	+ if ( restoreDisplay == null ) {
6973	+ restoreDisplay = dataPriv.get( elem, "display" );
6974	+ }
6975	+ display = jQuery.css( elem, "display" );
6976	+ if ( display === "none" ) {
6977	+ if ( restoreDisplay ) {
6978	+ display = restoreDisplay;
6979	+ } else {
6980	+
6981	+ // Get nonempty value(s) by temporarily forcing visibility
6982	+ showHide( [ elem ], true );
6983	+ restoreDisplay = elem.style.display \|\| restoreDisplay;
6984	+ display = jQuery.css( elem, "display" );
6985	+ showHide( [ elem ] );
6986	+ }
6987	+ }
6988	+
6989	+ // Animate inline elements as inline-block
6990	+ if ( display === "inline" \|\| display === "inline-block" && restoreDisplay != null ) {
6991	+ if ( jQuery.css( elem, "float" ) === "none" ) {
6992	+
6993	+ // Restore the original display value at the end of pure show/hide animations
6994	+ if ( !propTween ) {
6995	+ anim.done( function() {
6996	+ style.display = restoreDisplay;
6997	+ } );
6998	+ if ( restoreDisplay == null ) {
6999	+ display = style.display;
7000	+ restoreDisplay = display === "none" ? "" : display;
7001	+ }
7002	+ }
7003	+ style.display = "inline-block";
7004	+ }
7005	+ }
7006	+ }
7007	+
7008	+ if ( opts.overflow ) {
7009	+ style.overflow = "hidden";
7010	+ anim.always( function() {
7011	+ style.overflow = opts.overflow[ 0 ];
7012	+ style.overflowX = opts.overflow[ 1 ];
7013	+ style.overflowY = opts.overflow[ 2 ];
7014	+ } );
7015	+ }
7016	+
7017	+ // Implement show/hide animations
7018	+ propTween = false;
7019	+ for ( prop in orig ) {
7020	+
7021	+ // General show/hide setup for this element animation
7022	+ if ( !propTween ) {
7023	+ if ( dataShow ) {
7024	+ if ( "hidden" in dataShow ) {
7025	+ hidden = dataShow.hidden;
7026	+ }
7027	+ } else {
7028	+ dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
7029	+ }
7030	+
7031	+ // Store hidden/visible for toggle so `.stop().toggle()` "reverses"
7032	+ if ( toggle ) {
7033	+ dataShow.hidden = !hidden;
7034	+ }
7035	+
7036	+ // Show elements before animating them
7037	+ if ( hidden ) {
7038	+ showHide( [ elem ], true );
7039	+ }
7040	+
7041	+ /* eslint-disable no-loop-func */
7042	+
7043	+ anim.done( function() {
7044	+
7045	+ /* eslint-enable no-loop-func */
7046	+
7047	+ // The final step of a "hide" animation is actually hiding the element
7048	+ if ( !hidden ) {
7049	+ showHide( [ elem ] );
7050	+ }
7051	+ dataPriv.remove( elem, "fxshow" );
7052	+ for ( prop in orig ) {
7053	+ jQuery.style( elem, prop, orig[ prop ] );
7054	+ }
7055	+ } );
7056	+ }
7057	+
7058	+ // Per-property setup
7059	+ propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
7060	+ if ( !( prop in dataShow ) ) {
7061	+ dataShow[ prop ] = propTween.start;
7062	+ if ( hidden ) {
7063	+ propTween.end = propTween.start;
7064	+ propTween.start = 0;
7065	+ }
7066	+ }
7067	+ }
7068	+ }
7069	+
7070	+ function propFilter( props, specialEasing ) {
7071	+ var index, name, easing, value, hooks;
7072	+
7073	+ // camelCase, specialEasing and expand cssHook pass
7074	+ for ( index in props ) {
7075	+ name = jQuery.camelCase( index );
7076	+ easing = specialEasing[ name ];
7077	+ value = props[ index ];
7078	+ if ( Array.isArray( value ) ) {
7079	+ easing = value[ 1 ];
7080	+ value = props[ index ] = value[ 0 ];
7081	+ }
7082	+
7083	+ if ( index !== name ) {
7084	+ props[ name ] = value;
7085	+ delete props[ index ];
7086	+ }
7087	+
7088	+ hooks = jQuery.cssHooks[ name ];
7089	+ if ( hooks && "expand" in hooks ) {
7090	+ value = hooks.expand( value );
7091	+ delete props[ name ];
7092	+
7093	+ // Not quite $.extend, this won't overwrite existing keys.
7094	+ // Reusing 'index' because we have the correct "name"
7095	+ for ( index in value ) {
7096	+ if ( !( index in props ) ) {
7097	+ props[ index ] = value[ index ];
7098	+ specialEasing[ index ] = easing;
7099	+ }
7100	+ }
7101	+ } else {
7102	+ specialEasing[ name ] = easing;
7103	+ }
7104	+ }
7105	+ }
7106	+
7107	+ function Animation( elem, properties, options ) {
7108	+ var result,
7109	+ stopped,
7110	+ index = 0,
7111	+ length = Animation.prefilters.length,
7112	+ deferred = jQuery.Deferred().always( function() {
7113	+
7114	+ // Don't match elem in the :animated selector
7115	+ delete tick.elem;
7116	+ } ),
7117	+ tick = function() {
7118	+ if ( stopped ) {
7119	+ return false;
7120	+ }
7121	+ var currentTime = fxNow \|\| createFxNow(),
7122	+ remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
7123	+
7124	+ // Support: Android 2.3 only
7125	+ // Archaic crash bug won't allow us to use `1 - ( 0.5 \|\| 0 )` (#12497)
7126	+ temp = remaining / animation.duration \|\| 0,
7127	+ percent = 1 - temp,
7128	+ index = 0,
7129	+ length = animation.tweens.length;
7130	+
7131	+ for ( ; index < length; index++ ) {
7132	+ animation.tweens[ index ].run( percent );
7133	+ }
7134	+
7135	+ deferred.notifyWith( elem, [ animation, percent, remaining ] );
7136	+
7137	+ // If there's more to do, yield
7138	+ if ( percent < 1 && length ) {
7139	+ return remaining;
7140	+ }
7141	+
7142	+ // If this was an empty animation, synthesize a final progress notification
7143	+ if ( !length ) {
7144	+ deferred.notifyWith( elem, [ animation, 1, 0 ] );
7145	+ }
7146	+
7147	+ // Resolve the animation and report its conclusion
7148	+ deferred.resolveWith( elem, [ animation ] );
7149	+ return false;
7150	+ },
7151	+ animation = deferred.promise( {
7152	+ elem: elem,
7153	+ props: jQuery.extend( {}, properties ),
7154	+ opts: jQuery.extend( true, {
7155	+ specialEasing: {},
7156	+ easing: jQuery.easing._default
7157	+ }, options ),
7158	+ originalProperties: properties,
7159	+ originalOptions: options,
7160	+ startTime: fxNow \|\| createFxNow(),
7161	+ duration: options.duration,
7162	+ tweens: [],
7163	+ createTween: function( prop, end ) {
7164	+ var tween = jQuery.Tween( elem, animation.opts, prop, end,
7165	+ animation.opts.specialEasing[ prop ] \|\| animation.opts.easing );
7166	+ animation.tweens.push( tween );
7167	+ return tween;
7168	+ },
7169	+ stop: function( gotoEnd ) {
7170	+ var index = 0,
7171	+
7172	+ // If we are going to the end, we want to run all the tweens
7173	+ // otherwise we skip this part
7174	+ length = gotoEnd ? animation.tweens.length : 0;
7175	+ if ( stopped ) {
7176	+ return this;
7177	+ }
7178	+ stopped = true;
7179	+ for ( ; index < length; index++ ) {
7180	+ animation.tweens[ index ].run( 1 );
7181	+ }
7182	+
7183	+ // Resolve when we played the last frame; otherwise, reject
7184	+ if ( gotoEnd ) {
7185	+ deferred.notifyWith( elem, [ animation, 1, 0 ] );
7186	+ deferred.resolveWith( elem, [ animation, gotoEnd ] );
7187	+ } else {
7188	+ deferred.rejectWith( elem, [ animation, gotoEnd ] );
7189	+ }
7190	+ return this;
7191	+ }
7192	+ } ),
7193	+ props = animation.props;
7194	+
7195	+ propFilter( props, animation.opts.specialEasing );
7196	+
7197	+ for ( ; index < length; index++ ) {
7198	+ result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
7199	+ if ( result ) {
7200	+ if ( jQuery.isFunction( result.stop ) ) {
7201	+ jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
7202	+ jQuery.proxy( result.stop, result );
7203	+ }
7204	+ return result;
7205	+ }
7206	+ }
7207	+
7208	+ jQuery.map( props, createTween, animation );
7209	+
7210	+ if ( jQuery.isFunction( animation.opts.start ) ) {
7211	+ animation.opts.start.call( elem, animation );
7212	+ }
7213	+
7214	+ // Attach callbacks from options
7215	+ animation
7216	+ .progress( animation.opts.progress )
7217	+ .done( animation.opts.done, animation.opts.complete )
7218	+ .fail( animation.opts.fail )
7219	+ .always( animation.opts.always );
7220	+
7221	+ jQuery.fx.timer(
7222	+ jQuery.extend( tick, {
7223	+ elem: elem,
7224	+ anim: animation,
7225	+ queue: animation.opts.queue
7226	+ } )
7227	+ );
7228	+
7229	+ return animation;
7230	+ }
7231	+
7232	+ jQuery.Animation = jQuery.extend( Animation, {
7233	+
7234	+ tweeners: {
7235	+ "*": [ function( prop, value ) {
7236	+ var tween = this.createTween( prop, value );
7237	+ adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
7238	+ return tween;
7239	+ } ]
7240	+ },
7241	+
7242	+ tweener: function( props, callback ) {
7243	+ if ( jQuery.isFunction( props ) ) {
7244	+ callback = props;
7245	+ props = [ "*" ];
7246	+ } else {
7247	+ props = props.match( rnothtmlwhite );
7248	+ }
7249	+
7250	+ var prop,
7251	+ index = 0,
7252	+ length = props.length;
7253	+
7254	+ for ( ; index < length; index++ ) {
7255	+ prop = props[ index ];
7256	+ Animation.tweeners[ prop ] = Animation.tweeners[ prop ] \|\| [];
7257	+ Animation.tweeners[ prop ].unshift( callback );
7258	+ }
7259	+ },
7260	+
7261	+ prefilters: [ defaultPrefilter ],
7262	+
7263	+ prefilter: function( callback, prepend ) {
7264	+ if ( prepend ) {
7265	+ Animation.prefilters.unshift( callback );
7266	+ } else {
7267	+ Animation.prefilters.push( callback );
7268	+ }
7269	+ }
7270	+ } );
7271	+
7272	+ jQuery.speed = function( speed, easing, fn ) {
7273	+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
7274	+ complete: fn \|\| !fn && easing \|\|
7275	+ jQuery.isFunction( speed ) && speed,
7276	+ duration: speed,
7277	+ easing: fn && easing \|\| easing && !jQuery.isFunction( easing ) && easing
7278	+ };
7279	+
7280	+ // Go to the end state if fx are off
7281	+ if ( jQuery.fx.off ) {
7282	+ opt.duration = 0;
7283	+
7284	+ } else {
7285	+ if ( typeof opt.duration !== "number" ) {
7286	+ if ( opt.duration in jQuery.fx.speeds ) {
7287	+ opt.duration = jQuery.fx.speeds[ opt.duration ];
7288	+
7289	+ } else {
7290	+ opt.duration = jQuery.fx.speeds._default;
7291	+ }
7292	+ }
7293	+ }
7294	+
7295	+ // Normalize opt.queue - true/undefined/null -> "fx"
7296	+ if ( opt.queue == null \|\| opt.queue === true ) {
7297	+ opt.queue = "fx";
7298	+ }
7299	+
7300	+ // Queueing
7301	+ opt.old = opt.complete;
7302	+
7303	+ opt.complete = function() {
7304	+ if ( jQuery.isFunction( opt.old ) ) {
7305	+ opt.old.call( this );
7306	+ }
7307	+
7308	+ if ( opt.queue ) {
7309	+ jQuery.dequeue( this, opt.queue );
7310	+ }
7311	+ };
7312	+
7313	+ return opt;
7314	+ };
7315	+
7316	+ jQuery.fn.extend( {
7317	+ fadeTo: function( speed, to, easing, callback ) {
7318	+
7319	+ // Show any hidden elements after setting opacity to 0
7320	+ return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
7321	+
7322	+ // Animate to the value specified
7323	+ .end().animate( { opacity: to }, speed, easing, callback );
7324	+ },
7325	+ animate: function( prop, speed, easing, callback ) {
7326	+ var empty = jQuery.isEmptyObject( prop ),
7327	+ optall = jQuery.speed( speed, easing, callback ),
7328	+ doAnimation = function() {
7329	+
7330	+ // Operate on a copy of prop so per-property easing won't be lost
7331	+ var anim = Animation( this, jQuery.extend( {}, prop ), optall );
7332	+
7333	+ // Empty animations, or finishing resolves immediately
7334	+ if ( empty \|\| dataPriv.get( this, "finish" ) ) {
7335	+ anim.stop( true );
7336	+ }
7337	+ };
7338	+ doAnimation.finish = doAnimation;
7339	+
7340	+ return empty \|\| optall.queue === false ?
7341	+ this.each( doAnimation ) :
7342	+ this.queue( optall.queue, doAnimation );
7343	+ },
7344	+ stop: function( type, clearQueue, gotoEnd ) {
7345	+ var stopQueue = function( hooks ) {
7346	+ var stop = hooks.stop;
7347	+ delete hooks.stop;
7348	+ stop( gotoEnd );
7349	+ };
7350	+
7351	+ if ( typeof type !== "string" ) {
7352	+ gotoEnd = clearQueue;
7353	+ clearQueue = type;
7354	+ type = undefined;
7355	+ }
7356	+ if ( clearQueue && type !== false ) {
7357	+ this.queue( type \|\| "fx", [] );
7358	+ }
7359	+
7360	+ return this.each( function() {
7361	+ var dequeue = true,
7362	+ index = type != null && type + "queueHooks",
7363	+ timers = jQuery.timers,
7364	+ data = dataPriv.get( this );
7365	+
7366	+ if ( index ) {
7367	+ if ( data[ index ] && data[ index ].stop ) {
7368	+ stopQueue( data[ index ] );
7369	+ }
7370	+ } else {
7371	+ for ( index in data ) {
7372	+ if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
7373	+ stopQueue( data[ index ] );
7374	+ }
7375	+ }
7376	+ }
7377	+
7378	+ for ( index = timers.length; index--; ) {
7379	+ if ( timers[ index ].elem === this &&
7380	+ ( type == null \|\| timers[ index ].queue === type ) ) {
7381	+
7382	+ timers[ index ].anim.stop( gotoEnd );
7383	+ dequeue = false;
7384	+ timers.splice( index, 1 );
7385	+ }
7386	+ }
7387	+
7388	+ // Start the next in the queue if the last step wasn't forced.
7389	+ // Timers currently will call their complete callbacks, which
7390	+ // will dequeue but only if they were gotoEnd.
7391	+ if ( dequeue \|\| !gotoEnd ) {
7392	+ jQuery.dequeue( this, type );
7393	+ }
7394	+ } );
7395	+ },
7396	+ finish: function( type ) {
7397	+ if ( type !== false ) {
7398	+ type = type \|\| "fx";
7399	+ }
7400	+ return this.each( function() {
7401	+ var index,
7402	+ data = dataPriv.get( this ),
7403	+ queue = data[ type + "queue" ],
7404	+ hooks = data[ type + "queueHooks" ],
7405	+ timers = jQuery.timers,
7406	+ length = queue ? queue.length : 0;
7407	+
7408	+ // Enable finishing flag on private data
7409	+ data.finish = true;
7410	+
7411	+ // Empty the queue first
7412	+ jQuery.queue( this, type, [] );
7413	+
7414	+ if ( hooks && hooks.stop ) {
7415	+ hooks.stop.call( this, true );
7416	+ }
7417	+
7418	+ // Look for any active animations, and finish them
7419	+ for ( index = timers.length; index--; ) {
7420	+ if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
7421	+ timers[ index ].anim.stop( true );
7422	+ timers.splice( index, 1 );
7423	+ }
7424	+ }
7425	+
7426	+ // Look for any animations in the old queue and finish them
7427	+ for ( index = 0; index < length; index++ ) {
7428	+ if ( queue[ index ] && queue[ index ].finish ) {
7429	+ queue[ index ].finish.call( this );
7430	+ }
7431	+ }
7432	+
7433	+ // Turn off finishing flag
7434	+ delete data.finish;
7435	+ } );
7436	+ }
7437	+ } );
7438	+
7439	+ jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) {
7440	+ var cssFn = jQuery.fn[ name ];
7441	+ jQuery.fn[ name ] = function( speed, easing, callback ) {
7442	+ return speed == null \|\| typeof speed === "boolean" ?
7443	+ cssFn.apply( this, arguments ) :
7444	+ this.animate( genFx( name, true ), speed, easing, callback );
7445	+ };
7446	+ } );
7447	+
7448	+ // Generate shortcuts for custom animations
7449	+ jQuery.each( {
7450	+ slideDown: genFx( "show" ),
7451	+ slideUp: genFx( "hide" ),
7452	+ slideToggle: genFx( "toggle" ),
7453	+ fadeIn: { opacity: "show" },
7454	+ fadeOut: { opacity: "hide" },
7455	+ fadeToggle: { opacity: "toggle" }
7456	+ }, function( name, props ) {
7457	+ jQuery.fn[ name ] = function( speed, easing, callback ) {
7458	+ return this.animate( props, speed, easing, callback );
7459	+ };
7460	+ } );
7461	+
7462	+ jQuery.timers = [];
7463	+ jQuery.fx.tick = function() {
7464	+ var timer,
7465	+ i = 0,
7466	+ timers = jQuery.timers;
7467	+
7468	+ fxNow = jQuery.now();
7469	+
7470	+ for ( ; i < timers.length; i++ ) {
7471	+ timer = timers[ i ];
7472	+
7473	+ // Run the timer and safely remove it when done (allowing for external removal)
7474	+ if ( !timer() && timers[ i ] === timer ) {
7475	+ timers.splice( i--, 1 );
7476	+ }
7477	+ }
7478	+
7479	+ if ( !timers.length ) {
7480	+ jQuery.fx.stop();
7481	+ }
7482	+ fxNow = undefined;
7483	+ };
7484	+
7485	+ jQuery.fx.timer = function( timer ) {
7486	+ jQuery.timers.push( timer );
7487	+ jQuery.fx.start();
7488	+ };
7489	+
7490	+ jQuery.fx.interval = 13;
7491	+ jQuery.fx.start = function() {
7492	+ if ( inProgress ) {
7493	+ return;
7494	+ }
7495	+
7496	+ inProgress = true;
7497	+ schedule();
7498	+ };
7499	+
7500	+ jQuery.fx.stop = function() {
7501	+ inProgress = null;
7502	+ };
7503	+
7504	+ jQuery.fx.speeds = {
7505	+ slow: 600,
7506	+ fast: 200,
7507	+
7508	+ // Default speed
7509	+ _default: 400
7510	+ };
7511	+
7512	+
7513	+ // Based off of the plugin by Clint Helfers, with permission.
7514	+ // https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
7515	+ jQuery.fn.delay = function( time, type ) {
7516	+ time = jQuery.fx ? jQuery.fx.speeds[ time ] \|\| time : time;
7517	+ type = type \|\| "fx";
7518	+
7519	+ return this.queue( type, function( next, hooks ) {
7520	+ var timeout = window.setTimeout( next, time );
7521	+ hooks.stop = function() {
7522	+ window.clearTimeout( timeout );
7523	+ };
7524	+ } );
7525	+ };
7526	+
7527	+
7528	+ ( function() {
7529	+ var input = document.createElement( "input" ),
7530	+ select = document.createElement( "select" ),
7531	+ opt = select.appendChild( document.createElement( "option" ) );
7532	+
7533	+ input.type = "checkbox";
7534	+
7535	+ // Support: Android <=4.3 only
7536	+ // Default value for a checkbox should be "on"
7537	+ support.checkOn = input.value !== "";
7538	+
7539	+ // Support: IE <=11 only
7540	+ // Must access selectedIndex to make default options select
7541	+ support.optSelected = opt.selected;
7542	+
7543	+ // Support: IE <=11 only
7544	+ // An input loses its value after becoming a radio
7545	+ input = document.createElement( "input" );
7546	+ input.value = "t";
7547	+ input.type = "radio";
7548	+ support.radioValue = input.value === "t";
7549	+ } )();
7550	+
7551	+
7552	+ var boolHook,
7553	+ attrHandle = jQuery.expr.attrHandle;
7554	+
7555	+ jQuery.fn.extend( {
7556	+ attr: function( name, value ) {
7557	+ return access( this, jQuery.attr, name, value, arguments.length > 1 );
7558	+ },
7559	+
7560	+ removeAttr: function( name ) {
7561	+ return this.each( function() {
7562	+ jQuery.removeAttr( this, name );
7563	+ } );
7564	+ }
7565	+ } );
7566	+
7567	+ jQuery.extend( {
7568	+ attr: function( elem, name, value ) {
7569	+ var ret, hooks,
7570	+ nType = elem.nodeType;
7571	+
7572	+ // Don't get/set attributes on text, comment and attribute nodes
7573	+ if ( nType === 3 \|\| nType === 8 \|\| nType === 2 ) {
7574	+ return;
7575	+ }
7576	+
7577	+ // Fallback to prop when attributes are not supported
7578	+ if ( typeof elem.getAttribute === "undefined" ) {
7579	+ return jQuery.prop( elem, name, value );
7580	+ }
7581	+
7582	+ // Attribute hooks are determined by the lowercase version
7583	+ // Grab necessary hook if one is defined
7584	+ if ( nType !== 1 \|\| !jQuery.isXMLDoc( elem ) ) {
7585	+ hooks = jQuery.attrHooks[ name.toLowerCase() ] \|\|
7586	+ ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
7587	+ }
7588	+
7589	+ if ( value !== undefined ) {
7590	+ if ( value === null ) {
7591	+ jQuery.removeAttr( elem, name );
7592	+ return;
7593	+ }
7594	+
7595	+ if ( hooks && "set" in hooks &&
7596	+ ( ret = hooks.set( elem, value, name ) ) !== undefined ) {
7597	+ return ret;
7598	+ }
7599	+
7600	+ elem.setAttribute( name, value + "" );
7601	+ return value;
7602	+ }
7603	+
7604	+ if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
7605	+ return ret;
7606	+ }
7607	+
7608	+ ret = jQuery.find.attr( elem, name );
7609	+
7610	+ // Non-existent attributes return null, we normalize to undefined
7611	+ return ret == null ? undefined : ret;
7612	+ },
7613	+
7614	+ attrHooks: {
7615	+ type: {
7616	+ set: function( elem, value ) {
7617	+ if ( !support.radioValue && value === "radio" &&
7618	+ nodeName( elem, "input" ) ) {
7619	+ var val = elem.value;
7620	+ elem.setAttribute( "type", value );
7621	+ if ( val ) {
7622	+ elem.value = val;
7623	+ }
7624	+ return value;
7625	+ }
7626	+ }
7627	+ }
7628	+ },
7629	+
7630	+ removeAttr: function( elem, value ) {
7631	+ var name,
7632	+ i = 0,
7633	+
7634	+ // Attribute names can contain non-HTML whitespace characters
7635	+ // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
7636	+ attrNames = value && value.match( rnothtmlwhite );
7637	+
7638	+ if ( attrNames && elem.nodeType === 1 ) {
7639	+ while ( ( name = attrNames[ i++ ] ) ) {
7640	+ elem.removeAttribute( name );
7641	+ }
7642	+ }
7643	+ }
7644	+ } );
7645	+
7646	+ // Hooks for boolean attributes
7647	+ boolHook = {
7648	+ set: function( elem, value, name ) {
7649	+ if ( value === false ) {
7650	+
7651	+ // Remove boolean attributes when set to false
7652	+ jQuery.removeAttr( elem, name );
7653	+ } else {
7654	+ elem.setAttribute( name, name );
7655	+ }
7656	+ return name;
7657	+ }
7658	+ };
7659	+
7660	+ jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
7661	+ var getter = attrHandle[ name ] \|\| jQuery.find.attr;
7662	+
7663	+ attrHandle[ name ] = function( elem, name, isXML ) {
7664	+ var ret, handle,
7665	+ lowercaseName = name.toLowerCase();
7666	+
7667	+ if ( !isXML ) {
7668	+
7669	+ // Avoid an infinite loop by temporarily removing this function from the getter
7670	+ handle = attrHandle[ lowercaseName ];
7671	+ attrHandle[ lowercaseName ] = ret;
7672	+ ret = getter( elem, name, isXML ) != null ?
7673	+ lowercaseName :
7674	+ null;
7675	+ attrHandle[ lowercaseName ] = handle;
7676	+ }
7677	+ return ret;
7678	+ };
7679	+ } );
7680	+
7681	+
7682	+
7683	+
7684	+ var rfocusable = /^(?:input\|select\|textarea\|button)$/i,
7685	+ rclickable = /^(?:a\|area)$/i;
7686	+
7687	+ jQuery.fn.extend( {
7688	+ prop: function( name, value ) {
7689	+ return access( this, jQuery.prop, name, value, arguments.length > 1 );
7690	+ },
7691	+
7692	+ removeProp: function( name ) {
7693	+ return this.each( function() {
7694	+ delete this[ jQuery.propFix[ name ] \|\| name ];
7695	+ } );
7696	+ }
7697	+ } );
7698	+
7699	+ jQuery.extend( {
7700	+ prop: function( elem, name, value ) {
7701	+ var ret, hooks,
7702	+ nType = elem.nodeType;
7703	+
7704	+ // Don't get/set properties on text, comment and attribute nodes
7705	+ if ( nType === 3 \|\| nType === 8 \|\| nType === 2 ) {
7706	+ return;
7707	+ }
7708	+
7709	+ if ( nType !== 1 \|\| !jQuery.isXMLDoc( elem ) ) {
7710	+
7711	+ // Fix name and attach hooks
7712	+ name = jQuery.propFix[ name ] \|\| name;
7713	+ hooks = jQuery.propHooks[ name ];
7714	+ }
7715	+
7716	+ if ( value !== undefined ) {
7717	+ if ( hooks && "set" in hooks &&
7718	+ ( ret = hooks.set( elem, value, name ) ) !== undefined ) {
7719	+ return ret;
7720	+ }
7721	+
7722	+ return ( elem[ name ] = value );
7723	+ }
7724	+
7725	+ if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
7726	+ return ret;
7727	+ }
7728	+
7729	+ return elem[ name ];
7730	+ },
7731	+
7732	+ propHooks: {
7733	+ tabIndex: {
7734	+ get: function( elem ) {
7735	+
7736	+ // Support: IE <=9 - 11 only
7737	+ // elem.tabIndex doesn't always return the
7738	+ // correct value when it hasn't been explicitly set
7739	+ // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
7740	+ // Use proper attribute retrieval(#12072)
7741	+ var tabindex = jQuery.find.attr( elem, "tabindex" );
7742	+
7743	+ if ( tabindex ) {
7744	+ return parseInt( tabindex, 10 );
7745	+ }
7746	+
7747	+ if (
7748	+ rfocusable.test( elem.nodeName ) \|\|
7749	+ rclickable.test( elem.nodeName ) &&
7750	+ elem.href
7751	+ ) {
7752	+ return 0;
7753	+ }
7754	+
7755	+ return -1;
7756	+ }
7757	+ }
7758	+ },
7759	+
7760	+ propFix: {
7761	+ "for": "htmlFor",
7762	+ "class": "className"
7763	+ }
7764	+ } );
7765	+
7766	+ // Support: IE <=11 only
7767	+ // Accessing the selectedIndex property
7768	+ // forces the browser to respect setting selected
7769	+ // on the option
7770	+ // The getter ensures a default option is selected
7771	+ // when in an optgroup
7772	+ // eslint rule "no-unused-expressions" is disabled for this code
7773	+ // since it considers such accessions noop
7774	+ if ( !support.optSelected ) {
7775	+ jQuery.propHooks.selected = {
7776	+ get: function( elem ) {
7777	+
7778	+ /* eslint no-unused-expressions: "off" */
7779	+
7780	+ var parent = elem.parentNode;
7781	+ if ( parent && parent.parentNode ) {
7782	+ parent.parentNode.selectedIndex;
7783	+ }
7784	+ return null;
7785	+ },
7786	+ set: function( elem ) {
7787	+
7788	+ /* eslint no-unused-expressions: "off" */
7789	+
7790	+ var parent = elem.parentNode;
7791	+ if ( parent ) {
7792	+ parent.selectedIndex;
7793	+
7794	+ if ( parent.parentNode ) {
7795	+ parent.parentNode.selectedIndex;
7796	+ }
7797	+ }
7798	+ }
7799	+ };
7800	+ }
7801	+
7802	+ jQuery.each( [
7803	+ "tabIndex",
7804	+ "readOnly",
7805	+ "maxLength",
7806	+ "cellSpacing",
7807	+ "cellPadding",
7808	+ "rowSpan",
7809	+ "colSpan",
7810	+ "useMap",
7811	+ "frameBorder",
7812	+ "contentEditable"
7813	+ ], function() {
7814	+ jQuery.propFix[ this.toLowerCase() ] = this;
7815	+ } );
7816	+
7817	+
7818	+
7819	+
7820	+ // Strip and collapse whitespace according to HTML spec
7821	+ // https://html.spec.whatwg.org/multipage/infrastructure.html#strip-and-collapse-whitespace
7822	+ function stripAndCollapse( value ) {
7823	+ var tokens = value.match( rnothtmlwhite ) \|\| [];
7824	+ return tokens.join( " " );
7825	+ }
7826	+
7827	+
7828	+ function getClass( elem ) {
7829	+ return elem.getAttribute && elem.getAttribute( "class" ) \|\| "";
7830	+ }
7831	+
7832	+ jQuery.fn.extend( {
7833	+ addClass: function( value ) {
7834	+ var classes, elem, cur, curValue, clazz, j, finalValue,
7835	+ i = 0;
7836	+
7837	+ if ( jQuery.isFunction( value ) ) {
7838	+ return this.each( function( j ) {
7839	+ jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
7840	+ } );
7841	+ }
7842	+
7843	+ if ( typeof value === "string" && value ) {
7844	+ classes = value.match( rnothtmlwhite ) \|\| [];
7845	+
7846	+ while ( ( elem = this[ i++ ] ) ) {
7847	+ curValue = getClass( elem );
7848	+ cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
7849	+
7850	+ if ( cur ) {
7851	+ j = 0;
7852	+ while ( ( clazz = classes[ j++ ] ) ) {
7853	+ if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
7854	+ cur += clazz + " ";
7855	+ }
7856	+ }
7857	+
7858	+ // Only assign if different to avoid unneeded rendering.
7859	+ finalValue = stripAndCollapse( cur );
7860	+ if ( curValue !== finalValue ) {
7861	+ elem.setAttribute( "class", finalValue );
7862	+ }
7863	+ }
7864	+ }
7865	+ }
7866	+
7867	+ return this;
7868	+ },
7869	+
7870	+ removeClass: function( value ) {
7871	+ var classes, elem, cur, curValue, clazz, j, finalValue,
7872	+ i = 0;
7873	+
7874	+ if ( jQuery.isFunction( value ) ) {
7875	+ return this.each( function( j ) {
7876	+ jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
7877	+ } );
7878	+ }
7879	+
7880	+ if ( !arguments.length ) {
7881	+ return this.attr( "class", "" );
7882	+ }
7883	+
7884	+ if ( typeof value === "string" && value ) {
7885	+ classes = value.match( rnothtmlwhite ) \|\| [];
7886	+
7887	+ while ( ( elem = this[ i++ ] ) ) {
7888	+ curValue = getClass( elem );
7889	+
7890	+ // This expression is here for better compressibility (see addClass)
7891	+ cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
7892	+
7893	+ if ( cur ) {
7894	+ j = 0;
7895	+ while ( ( clazz = classes[ j++ ] ) ) {
7896	+
7897	+ // Remove all instances
7898	+ while ( cur.indexOf( " " + clazz + " " ) > -1 ) {
7899	+ cur = cur.replace( " " + clazz + " ", " " );
7900	+ }
7901	+ }
7902	+
7903	+ // Only assign if different to avoid unneeded rendering.
7904	+ finalValue = stripAndCollapse( cur );
7905	+ if ( curValue !== finalValue ) {
7906	+ elem.setAttribute( "class", finalValue );
7907	+ }
7908	+ }
7909	+ }
7910	+ }
7911	+
7912	+ return this;
7913	+ },
7914	+
7915	+ toggleClass: function( value, stateVal ) {
7916	+ var type = typeof value;
7917	+
7918	+ if ( typeof stateVal === "boolean" && type === "string" ) {
7919	+ return stateVal ? this.addClass( value ) : this.removeClass( value );
7920	+ }
7921	+
7922	+ if ( jQuery.isFunction( value ) ) {
7923	+ return this.each( function( i ) {
7924	+ jQuery( this ).toggleClass(
7925	+ value.call( this, i, getClass( this ), stateVal ),
7926	+ stateVal
7927	+ );
7928	+ } );
7929	+ }
7930	+
7931	+ return this.each( function() {
7932	+ var className, i, self, classNames;
7933	+
7934	+ if ( type === "string" ) {
7935	+
7936	+ // Toggle individual class names
7937	+ i = 0;
7938	+ self = jQuery( this );
7939	+ classNames = value.match( rnothtmlwhite ) \|\| [];
7940	+
7941	+ while ( ( className = classNames[ i++ ] ) ) {
7942	+
7943	+ // Check each className given, space separated list
7944	+ if ( self.hasClass( className ) ) {
7945	+ self.removeClass( className );
7946	+ } else {
7947	+ self.addClass( className );
7948	+ }
7949	+ }
7950	+
7951	+ // Toggle whole class name
7952	+ } else if ( value === undefined \|\| type === "boolean" ) {
7953	+ className = getClass( this );
7954	+ if ( className ) {
7955	+
7956	+ // Store className if set
7957	+ dataPriv.set( this, "__className__", className );
7958	+ }
7959	+
7960	+ // If the element has a class name or if we're passed `false`,
7961	+ // then remove the whole classname (if there was one, the above saved it).
7962	+ // Otherwise bring back whatever was previously saved (if anything),
7963	+ // falling back to the empty string if nothing was stored.
7964	+ if ( this.setAttribute ) {
7965	+ this.setAttribute( "class",
7966	+ className \|\| value === false ?
7967	+ "" :
7968	+ dataPriv.get( this, "__className__" ) \|\| ""
7969	+ );
7970	+ }
7971	+ }
7972	+ } );
7973	+ },
7974	+
7975	+ hasClass: function( selector ) {
7976	+ var className, elem,
7977	+ i = 0;
7978	+
7979	+ className = " " + selector + " ";
7980	+ while ( ( elem = this[ i++ ] ) ) {
7981	+ if ( elem.nodeType === 1 &&
7982	+ ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
7983	+ return true;
7984	+ }
7985	+ }
7986	+
7987	+ return false;
7988	+ }
7989	+ } );
7990	+
7991	+
7992	+
7993	+
7994	+ var rreturn = /\r/g;
7995	+
7996	+ jQuery.fn.extend( {
7997	+ val: function( value ) {
7998	+ var hooks, ret, isFunction,
7999	+ elem = this[ 0 ];
8000	+
8001	+ if ( !arguments.length ) {
8002	+ if ( elem ) {
8003	+ hooks = jQuery.valHooks[ elem.type ] \|\|
8004	+ jQuery.valHooks[ elem.nodeName.toLowerCase() ];
8005	+
8006	+ if ( hooks &&
8007	+ "get" in hooks &&
8008	+ ( ret = hooks.get( elem, "value" ) ) !== undefined
8009	+ ) {
8010	+ return ret;
8011	+ }
8012	+
8013	+ ret = elem.value;
8014	+
8015	+ // Handle most common string cases
8016	+ if ( typeof ret === "string" ) {
8017	+ return ret.replace( rreturn, "" );
8018	+ }
8019	+
8020	+ // Handle cases where value is null/undef or number
8021	+ return ret == null ? "" : ret;
8022	+ }
8023	+
8024	+ return;
8025	+ }
8026	+
8027	+ isFunction = jQuery.isFunction( value );
8028	+
8029	+ return this.each( function( i ) {
8030	+ var val;
8031	+
8032	+ if ( this.nodeType !== 1 ) {
8033	+ return;
8034	+ }
8035	+
8036	+ if ( isFunction ) {
8037	+ val = value.call( this, i, jQuery( this ).val() );
8038	+ } else {
8039	+ val = value;
8040	+ }
8041	+
8042	+ // Treat null/undefined as ""; convert numbers to string
8043	+ if ( val == null ) {
8044	+ val = "";
8045	+
8046	+ } else if ( typeof val === "number" ) {
8047	+ val += "";
8048	+
8049	+ } else if ( Array.isArray( val ) ) {
8050	+ val = jQuery.map( val, function( value ) {
8051	+ return value == null ? "" : value + "";
8052	+ } );
8053	+ }
8054	+
8055	+ hooks = jQuery.valHooks[ this.type ] \|\| jQuery.valHooks[ this.nodeName.toLowerCase() ];
8056	+
8057	+ // If set returns undefined, fall back to normal setting
8058	+ if ( !hooks \|\| !( "set" in hooks ) \|\| hooks.set( this, val, "value" ) === undefined ) {
8059	+ this.value = val;
8060	+ }
8061	+ } );
8062	+ }
8063	+ } );
8064	+
8065	+ jQuery.extend( {
8066	+ valHooks: {
8067	+ option: {
8068	+ get: function( elem ) {
8069	+
8070	+ var val = jQuery.find.attr( elem, "value" );
8071	+ return val != null ?
8072	+ val :
8073	+
8074	+ // Support: IE <=10 - 11 only
8075	+ // option.text throws exceptions (#14686, #14858)
8076	+ // Strip and collapse whitespace
8077	+ // https://html.spec.whatwg.org/#strip-and-collapse-whitespace
8078	+ stripAndCollapse( jQuery.text( elem ) );
8079	+ }
8080	+ },
8081	+ select: {
8082	+ get: function( elem ) {
8083	+ var value, option, i,
8084	+ options = elem.options,
8085	+ index = elem.selectedIndex,
8086	+ one = elem.type === "select-one",
8087	+ values = one ? null : [],
8088	+ max = one ? index + 1 : options.length;
8089	+
8090	+ if ( index < 0 ) {
8091	+ i = max;
8092	+
8093	+ } else {
8094	+ i = one ? index : 0;
8095	+ }
8096	+
8097	+ // Loop through all the selected options
8098	+ for ( ; i < max; i++ ) {
8099	+ option = options[ i ];
8100	+
8101	+ // Support: IE <=9 only
8102	+ // IE8-9 doesn't update selected after form reset (#2551)
8103	+ if ( ( option.selected \|\| i === index ) &&
8104	+
8105	+ // Don't return options that are disabled or in a disabled optgroup
8106	+ !option.disabled &&
8107	+ ( !option.parentNode.disabled \|\|
8108	+ !nodeName( option.parentNode, "optgroup" ) ) ) {
8109	+
8110	+ // Get the specific value for the option
8111	+ value = jQuery( option ).val();
8112	+
8113	+ // We don't need an array for one selects
8114	+ if ( one ) {
8115	+ return value;
8116	+ }
8117	+
8118	+ // Multi-Selects return an array
8119	+ values.push( value );
8120	+ }
8121	+ }
8122	+
8123	+ return values;
8124	+ },
8125	+
8126	+ set: function( elem, value ) {
8127	+ var optionSet, option,
8128	+ options = elem.options,
8129	+ values = jQuery.makeArray( value ),
8130	+ i = options.length;
8131	+
8132	+ while ( i-- ) {
8133	+ option = options[ i ];
8134	+
8135	+ /* eslint-disable no-cond-assign */
8136	+
8137	+ if ( option.selected =
8138	+ jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
8139	+ ) {
8140	+ optionSet = true;
8141	+ }
8142	+
8143	+ /* eslint-enable no-cond-assign */
8144	+ }
8145	+
8146	+ // Force browsers to behave consistently when non-matching value is set
8147	+ if ( !optionSet ) {
8148	+ elem.selectedIndex = -1;
8149	+ }
8150	+ return values;
8151	+ }
8152	+ }
8153	+ }
8154	+ } );
8155	+
8156	+ // Radios and checkboxes getter/setter
8157	+ jQuery.each( [ "radio", "checkbox" ], function() {
8158	+ jQuery.valHooks[ this ] = {
8159	+ set: function( elem, value ) {
8160	+ if ( Array.isArray( value ) ) {
8161	+ return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
8162	+ }
8163	+ }
8164	+ };
8165	+ if ( !support.checkOn ) {
8166	+ jQuery.valHooks[ this ].get = function( elem ) {
8167	+ return elem.getAttribute( "value" ) === null ? "on" : elem.value;
8168	+ };
8169	+ }
8170	+ } );
8171	+
8172	+
8173	+
8174	+
8175	+ // Return jQuery for attributes-only inclusion
8176	+
8177	+
8178	+ var rfocusMorph = /^(?:focusinfocus\|focusoutblur)$/;
8179	+
8180	+ jQuery.extend( jQuery.event, {
8181	+
8182	+ trigger: function( event, data, elem, onlyHandlers ) {
8183	+
8184	+ var i, cur, tmp, bubbleType, ontype, handle, special,
8185	+ eventPath = [ elem \|\| document ],
8186	+ type = hasOwn.call( event, "type" ) ? event.type : event,
8187	+ namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
8188	+
8189	+ cur = tmp = elem = elem \|\| document;
8190	+
8191	+ // Don't do events on text and comment nodes
8192	+ if ( elem.nodeType === 3 \|\| elem.nodeType === 8 ) {
8193	+ return;
8194	+ }
8195	+
8196	+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
8197	+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
8198	+ return;
8199	+ }
8200	+
8201	+ if ( type.indexOf( "." ) > -1 ) {
8202	+
8203	+ // Namespaced trigger; create a regexp to match event type in handle()
8204	+ namespaces = type.split( "." );
8205	+ type = namespaces.shift();
8206	+ namespaces.sort();
8207	+ }
8208	+ ontype = type.indexOf( ":" ) < 0 && "on" + type;
8209	+
8210	+ // Caller can pass in a jQuery.Event object, Object, or just an event type string
8211	+ event = event[ jQuery.expando ] ?
8212	+ event :
8213	+ new jQuery.Event( type, typeof event === "object" && event );
8214	+
8215	+ // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
8216	+ event.isTrigger = onlyHandlers ? 2 : 3;
8217	+ event.namespace = namespaces.join( "." );
8218	+ event.rnamespace = event.namespace ?
8219	+ new RegExp( "(^\|\\.)" + namespaces.join( "\\.(?:.*\\.\|)" ) + "(\\.\|$)" ) :
8220	+ null;
8221	+
8222	+ // Clean up the event in case it is being reused
8223	+ event.result = undefined;
8224	+ if ( !event.target ) {
8225	+ event.target = elem;
8226	+ }
8227	+
8228	+ // Clone any incoming data and prepend the event, creating the handler arg list
8229	+ data = data == null ?
8230	+ [ event ] :
8231	+ jQuery.makeArray( data, [ event ] );
8232	+
8233	+ // Allow special events to draw outside the lines
8234	+ special = jQuery.event.special[ type ] \|\| {};
8235	+ if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
8236	+ return;
8237	+ }
8238	+
8239	+ // Determine event propagation path in advance, per W3C events spec (#9951)
8240	+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
8241	+ if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
8242	+
8243	+ bubbleType = special.delegateType \|\| type;
8244	+ if ( !rfocusMorph.test( bubbleType + type ) ) {
8245	+ cur = cur.parentNode;
8246	+ }
8247	+ for ( ; cur; cur = cur.parentNode ) {
8248	+ eventPath.push( cur );
8249	+ tmp = cur;
8250	+ }
8251	+
8252	+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
8253	+ if ( tmp === ( elem.ownerDocument \|\| document ) ) {
8254	+ eventPath.push( tmp.defaultView \|\| tmp.parentWindow \|\| window );
8255	+ }
8256	+ }
8257	+
8258	+ // Fire handlers on the event path
8259	+ i = 0;
8260	+ while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
8261	+
8262	+ event.type = i > 1 ?
8263	+ bubbleType :
8264	+ special.bindType \|\| type;
8265	+
8266	+ // jQuery handler
8267	+ handle = ( dataPriv.get( cur, "events" ) \|\| {} )[ event.type ] &&
8268	+ dataPriv.get( cur, "handle" );
8269	+ if ( handle ) {
8270	+ handle.apply( cur, data );
8271	+ }
8272	+
8273	+ // Native handler
8274	+ handle = ontype && cur[ ontype ];
8275	+ if ( handle && handle.apply && acceptData( cur ) ) {
8276	+ event.result = handle.apply( cur, data );
8277	+ if ( event.result === false ) {
8278	+ event.preventDefault();
8279	+ }
8280	+ }
8281	+ }
8282	+ event.type = type;
8283	+
8284	+ // If nobody prevented the default action, do it now
8285	+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
8286	+
8287	+ if ( ( !special._default \|\|
8288	+ special._default.apply( eventPath.pop(), data ) === false ) &&
8289	+ acceptData( elem ) ) {
8290	+
8291	+ // Call a native DOM method on the target with the same name as the event.
8292	+ // Don't do default actions on window, that's where global variables be (#6170)
8293	+ if ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) {
8294	+
8295	+ // Don't re-trigger an onFOO event when we call its FOO() method
8296	+ tmp = elem[ ontype ];
8297	+
8298	+ if ( tmp ) {
8299	+ elem[ ontype ] = null;
8300	+ }
8301	+
8302	+ // Prevent re-triggering of the same event, since we already bubbled it above
8303	+ jQuery.event.triggered = type;
8304	+ elem[ type ]();
8305	+ jQuery.event.triggered = undefined;
8306	+
8307	+ if ( tmp ) {
8308	+ elem[ ontype ] = tmp;
8309	+ }
8310	+ }
8311	+ }
8312	+ }
8313	+
8314	+ return event.result;
8315	+ },
8316	+
8317	+ // Piggyback on a donor event to simulate a different one
8318	+ // Used only for `focus(in \| out)` events
8319	+ simulate: function( type, elem, event ) {
8320	+ var e = jQuery.extend(
8321	+ new jQuery.Event(),
8322	+ event,
8323	+ {
8324	+ type: type,
8325	+ isSimulated: true
8326	+ }
8327	+ );
8328	+
8329	+ jQuery.event.trigger( e, null, elem );
8330	+ }
8331	+
8332	+ } );
8333	+
8334	+ jQuery.fn.extend( {
8335	+
8336	+ trigger: function( type, data ) {
8337	+ return this.each( function() {
8338	+ jQuery.event.trigger( type, data, this );
8339	+ } );
8340	+ },
8341	+ triggerHandler: function( type, data ) {
8342	+ var elem = this[ 0 ];
8343	+ if ( elem ) {
8344	+ return jQuery.event.trigger( type, data, elem, true );
8345	+ }
8346	+ }
8347	+ } );
8348	+
8349	+
8350	+ jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " +
8351	+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
8352	+ "change select submit keydown keypress keyup contextmenu" ).split( " " ),
8353	+ function( i, name ) {
8354	+
8355	+ // Handle event binding
8356	+ jQuery.fn[ name ] = function( data, fn ) {
8357	+ return arguments.length > 0 ?
8358	+ this.on( name, null, data, fn ) :
8359	+ this.trigger( name );
8360	+ };
8361	+ } );
8362	+
8363	+ jQuery.fn.extend( {
8364	+ hover: function( fnOver, fnOut ) {
8365	+ return this.mouseenter( fnOver ).mouseleave( fnOut \|\| fnOver );
8366	+ }
8367	+ } );
8368	+
8369	+
8370	+
8371	+
8372	+ support.focusin = "onfocusin" in window;
8373	+
8374	+
8375	+ // Support: Firefox <=44
8376	+ // Firefox doesn't have focus(in \| out) events
8377	+ // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
8378	+ //
8379	+ // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
8380	+ // focus(in \| out) events fire after focus & blur events,
8381	+ // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
8382	+ // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
8383	+ if ( !support.focusin ) {
8384	+ jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) {
8385	+
8386	+ // Attach a single capturing handler on the document while someone wants focusin/focusout
8387	+ var handler = function( event ) {
8388	+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );
8389	+ };
8390	+
8391	+ jQuery.event.special[ fix ] = {
8392	+ setup: function() {
8393	+ var doc = this.ownerDocument \|\| this,
8394	+ attaches = dataPriv.access( doc, fix );
8395	+
8396	+ if ( !attaches ) {
8397	+ doc.addEventListener( orig, handler, true );
8398	+ }
8399	+ dataPriv.access( doc, fix, ( attaches \|\| 0 ) + 1 );
8400	+ },
8401	+ teardown: function() {
8402	+ var doc = this.ownerDocument \|\| this,
8403	+ attaches = dataPriv.access( doc, fix ) - 1;
8404	+
8405	+ if ( !attaches ) {
8406	+ doc.removeEventListener( orig, handler, true );
8407	+ dataPriv.remove( doc, fix );
8408	+
8409	+ } else {
8410	+ dataPriv.access( doc, fix, attaches );
8411	+ }
8412	+ }
8413	+ };
8414	+ } );
8415	+ }
8416	+ var location = window.location;
8417	+
8418	+ var nonce = jQuery.now();
8419	+
8420	+ var rquery = ( /\?/ );
8421	+
8422	+
8423	+
8424	+ // Cross-browser xml parsing
8425	+ jQuery.parseXML = function( data ) {
8426	+ var xml;
8427	+ if ( !data \|\| typeof data !== "string" ) {
8428	+ return null;
8429	+ }
8430	+
8431	+ // Support: IE 9 - 11 only
8432	+ // IE throws on parseFromString with invalid input.
8433	+ try {
8434	+ xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
8435	+ } catch ( e ) {
8436	+ xml = undefined;
8437	+ }
8438	+
8439	+ if ( !xml \|\| xml.getElementsByTagName( "parsererror" ).length ) {
8440	+ jQuery.error( "Invalid XML: " + data );
8441	+ }
8442	+ return xml;
8443	+ };
8444	+
8445	+
8446	+ var
8447	+ rbracket = /\[\]$/,
8448	+ rCRLF = /\r?\n/g,
8449	+ rsubmitterTypes = /^(?:submit\|button\|image\|reset\|file)$/i,
8450	+ rsubmittable = /^(?:input\|select\|textarea\|keygen)/i;
8451	+
8452	+ function buildParams( prefix, obj, traditional, add ) {
8453	+ var name;
8454	+
8455	+ if ( Array.isArray( obj ) ) {
8456	+
8457	+ // Serialize array item.
8458	+ jQuery.each( obj, function( i, v ) {
8459	+ if ( traditional \|\| rbracket.test( prefix ) ) {
8460	+
8461	+ // Treat each array item as a scalar.
8462	+ add( prefix, v );
8463	+
8464	+ } else {
8465	+
8466	+ // Item is non-scalar (array or object), encode its numeric index.
8467	+ buildParams(
8468	+ prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
8469	+ v,
8470	+ traditional,
8471	+ add
8472	+ );
8473	+ }
8474	+ } );
8475	+
8476	+ } else if ( !traditional && jQuery.type( obj ) === "object" ) {
8477	+
8478	+ // Serialize object item.
8479	+ for ( name in obj ) {
8480	+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
8481	+ }
8482	+
8483	+ } else {
8484	+
8485	+ // Serialize scalar item.
8486	+ add( prefix, obj );
8487	+ }
8488	+ }
8489	+
8490	+ // Serialize an array of form elements or a set of
8491	+ // key/values into a query string
8492	+ jQuery.param = function( a, traditional ) {
8493	+ var prefix,
8494	+ s = [],
8495	+ add = function( key, valueOrFunction ) {
8496	+
8497	+ // If value is a function, invoke it and use its return value
8498	+ var value = jQuery.isFunction( valueOrFunction ) ?
8499	+ valueOrFunction() :
8500	+ valueOrFunction;
8501	+
8502	+ s[ s.length ] = encodeURIComponent( key ) + "=" +
8503	+ encodeURIComponent( value == null ? "" : value );
8504	+ };
8505	+
8506	+ // If an array was passed in, assume that it is an array of form elements.
8507	+ if ( Array.isArray( a ) \|\| ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
8508	+
8509	+ // Serialize the form elements
8510	+ jQuery.each( a, function() {
8511	+ add( this.name, this.value );
8512	+ } );
8513	+
8514	+ } else {
8515	+
8516	+ // If traditional, encode the "old" way (the way 1.3.2 or older
8517	+ // did it), otherwise encode params recursively.
8518	+ for ( prefix in a ) {
8519	+ buildParams( prefix, a[ prefix ], traditional, add );
8520	+ }
8521	+ }
8522	+
8523	+ // Return the resulting serialization
8524	+ return s.join( "&" );
8525	+ };
8526	+
8527	+ jQuery.fn.extend( {
8528	+ serialize: function() {
8529	+ return jQuery.param( this.serializeArray() );
8530	+ },
8531	+ serializeArray: function() {
8532	+ return this.map( function() {
8533	+
8534	+ // Can add propHook for "elements" to filter or add form elements
8535	+ var elements = jQuery.prop( this, "elements" );
8536	+ return elements ? jQuery.makeArray( elements ) : this;
8537	+ } )
8538	+ .filter( function() {
8539	+ var type = this.type;
8540	+
8541	+ // Use .is( ":disabled" ) so that fieldset[disabled] works
8542	+ return this.name && !jQuery( this ).is( ":disabled" ) &&
8543	+ rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
8544	+ ( this.checked \|\| !rcheckableType.test( type ) );
8545	+ } )
8546	+ .map( function( i, elem ) {
8547	+ var val = jQuery( this ).val();
8548	+
8549	+ if ( val == null ) {
8550	+ return null;
8551	+ }
8552	+
8553	+ if ( Array.isArray( val ) ) {
8554	+ return jQuery.map( val, function( val ) {
8555	+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
8556	+ } );
8557	+ }
8558	+
8559	+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
8560	+ } ).get();
8561	+ }
8562	+ } );
8563	+
8564	+
8565	+ var
8566	+ r20 = /%20/g,
8567	+ rhash = /#.*$/,
8568	+ rantiCache = /([?&])_=[^&]*/,
8569	+ rheaders = /^(.?):[ \t]([^\r\n]*)$/mg,
8570	+
8571	+ // #7653, #8125, #8152: local protocol detection
8572	+ rlocalProtocol = /^(?:about\|app\|app-storage\|.+-extension\|file\|res\|widget):$/,
8573	+ rnoContent = /^(?:GET\|HEAD)$/,
8574	+ rprotocol = /^\/\//,
8575	+
8576	+ /* Prefilters
8577	+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
8578	+ * 2) These are called:
8579	+ * - BEFORE asking for a transport
8580	+ * - AFTER param serialization (s.data is a string if s.processData is true)
8581	+ * 3) key is the dataType
8582	+ * 4) the catchall symbol "*" can be used
8583	+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
8584	+ */
8585	+ prefilters = {},
8586	+
8587	+ /* Transports bindings
8588	+ * 1) key is the dataType
8589	+ * 2) the catchall symbol "*" can be used
8590	+ * 3) selection will start with transport dataType and THEN go to "*" if needed
8591	+ */
8592	+ transports = {},
8593	+
8594	+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
8595	+ allTypes = "/".concat( "" ),
8596	+
8597	+ // Anchor tag for parsing the document origin
8598	+ originAnchor = document.createElement( "a" );
8599	+ originAnchor.href = location.href;
8600	+
8601	+ // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
8602	+ function addToPrefiltersOrTransports( structure ) {
8603	+
8604	+ // dataTypeExpression is optional and defaults to "*"
8605	+ return function( dataTypeExpression, func ) {
8606	+
8607	+ if ( typeof dataTypeExpression !== "string" ) {
8608	+ func = dataTypeExpression;
8609	+ dataTypeExpression = "*";
8610	+ }
8611	+
8612	+ var dataType,
8613	+ i = 0,
8614	+ dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) \|\| [];
8615	+
8616	+ if ( jQuery.isFunction( func ) ) {
8617	+
8618	+ // For each dataType in the dataTypeExpression
8619	+ while ( ( dataType = dataTypes[ i++ ] ) ) {
8620	+
8621	+ // Prepend if requested
8622	+ if ( dataType[ 0 ] === "+" ) {
8623	+ dataType = dataType.slice( 1 ) \|\| "*";
8624	+ ( structure[ dataType ] = structure[ dataType ] \|\| [] ).unshift( func );
8625	+
8626	+ // Otherwise append
8627	+ } else {
8628	+ ( structure[ dataType ] = structure[ dataType ] \|\| [] ).push( func );
8629	+ }
8630	+ }
8631	+ }
8632	+ };
8633	+ }
8634	+
8635	+ // Base inspection function for prefilters and transports
8636	+ function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
8637	+
8638	+ var inspected = {},
8639	+ seekingTransport = ( structure === transports );
8640	+
8641	+ function inspect( dataType ) {
8642	+ var selected;
8643	+ inspected[ dataType ] = true;
8644	+ jQuery.each( structure[ dataType ] \|\| [], function( _, prefilterOrFactory ) {
8645	+ var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
8646	+ if ( typeof dataTypeOrTransport === "string" &&
8647	+ !seekingTransport && !inspected[ dataTypeOrTransport ] ) {
8648	+
8649	+ options.dataTypes.unshift( dataTypeOrTransport );
8650	+ inspect( dataTypeOrTransport );
8651	+ return false;
8652	+ } else if ( seekingTransport ) {
8653	+ return !( selected = dataTypeOrTransport );
8654	+ }
8655	+ } );
8656	+ return selected;
8657	+ }
8658	+
8659	+ return inspect( options.dataTypes[ 0 ] ) \|\| !inspected[ "" ] && inspect( "" );
8660	+ }
8661	+
8662	+ // A special extend for ajax options
8663	+ // that takes "flat" options (not to be deep extended)
8664	+ // Fixes #9887
8665	+ function ajaxExtend( target, src ) {
8666	+ var key, deep,
8667	+ flatOptions = jQuery.ajaxSettings.flatOptions \|\| {};
8668	+
8669	+ for ( key in src ) {
8670	+ if ( src[ key ] !== undefined ) {
8671	+ ( flatOptions[ key ] ? target : ( deep \|\| ( deep = {} ) ) )[ key ] = src[ key ];
8672	+ }
8673	+ }
8674	+ if ( deep ) {
8675	+ jQuery.extend( true, target, deep );
8676	+ }
8677	+
8678	+ return target;
8679	+ }
8680	+
8681	+ /* Handles responses to an ajax request:
8682	+ * - finds the right dataType (mediates between content-type and expected dataType)
8683	+ * - returns the corresponding response
8684	+ */
8685	+ function ajaxHandleResponses( s, jqXHR, responses ) {
8686	+
8687	+ var ct, type, finalDataType, firstDataType,
8688	+ contents = s.contents,
8689	+ dataTypes = s.dataTypes;
8690	+
8691	+ // Remove auto dataType and get content-type in the process
8692	+ while ( dataTypes[ 0 ] === "*" ) {
8693	+ dataTypes.shift();
8694	+ if ( ct === undefined ) {
8695	+ ct = s.mimeType \|\| jqXHR.getResponseHeader( "Content-Type" );
8696	+ }
8697	+ }
8698	+
8699	+ // Check if we're dealing with a known content-type
8700	+ if ( ct ) {
8701	+ for ( type in contents ) {
8702	+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
8703	+ dataTypes.unshift( type );
8704	+ break;
8705	+ }
8706	+ }
8707	+ }
8708	+
8709	+ // Check to see if we have a response for the expected dataType
8710	+ if ( dataTypes[ 0 ] in responses ) {
8711	+ finalDataType = dataTypes[ 0 ];
8712	+ } else {
8713	+
8714	+ // Try convertible dataTypes
8715	+ for ( type in responses ) {
8716	+ if ( !dataTypes[ 0 ] \|\| s.converters[ type + " " + dataTypes[ 0 ] ] ) {
8717	+ finalDataType = type;
8718	+ break;
8719	+ }
8720	+ if ( !firstDataType ) {
8721	+ firstDataType = type;
8722	+ }
8723	+ }
8724	+
8725	+ // Or just use first one
8726	+ finalDataType = finalDataType \|\| firstDataType;
8727	+ }
8728	+
8729	+ // If we found a dataType
8730	+ // We add the dataType to the list if needed
8731	+ // and return the corresponding response
8732	+ if ( finalDataType ) {
8733	+ if ( finalDataType !== dataTypes[ 0 ] ) {
8734	+ dataTypes.unshift( finalDataType );
8735	+ }
8736	+ return responses[ finalDataType ];
8737	+ }
8738	+ }
8739	+
8740	+ /* Chain conversions given the request and the original response
8741	+ * Also sets the responseXXX fields on the jqXHR instance
8742	+ */
8743	+ function ajaxConvert( s, response, jqXHR, isSuccess ) {
8744	+ var conv2, current, conv, tmp, prev,
8745	+ converters = {},
8746	+
8747	+ // Work with a copy of dataTypes in case we need to modify it for conversion
8748	+ dataTypes = s.dataTypes.slice();
8749	+
8750	+ // Create converters map with lowercased keys
8751	+ if ( dataTypes[ 1 ] ) {
8752	+ for ( conv in s.converters ) {
8753	+ converters[ conv.toLowerCase() ] = s.converters[ conv ];
8754	+ }
8755	+ }
8756	+
8757	+ current = dataTypes.shift();
8758	+
8759	+ // Convert to each sequential dataType
8760	+ while ( current ) {
8761	+
8762	+ if ( s.responseFields[ current ] ) {
8763	+ jqXHR[ s.responseFields[ current ] ] = response;
8764	+ }
8765	+
8766	+ // Apply the dataFilter if provided
8767	+ if ( !prev && isSuccess && s.dataFilter ) {
8768	+ response = s.dataFilter( response, s.dataType );
8769	+ }
8770	+
8771	+ prev = current;
8772	+ current = dataTypes.shift();
8773	+
8774	+ if ( current ) {
8775	+
8776	+ // There's only work to do if current dataType is non-auto
8777	+ if ( current === "*" ) {
8778	+
8779	+ current = prev;
8780	+
8781	+ // Convert response if prev dataType is non-auto and differs from current
8782	+ } else if ( prev !== "*" && prev !== current ) {
8783	+
8784	+ // Seek a direct converter
8785	+ conv = converters[ prev + " " + current ] \|\| converters[ "* " + current ];
8786	+
8787	+ // If none found, seek a pair
8788	+ if ( !conv ) {
8789	+ for ( conv2 in converters ) {
8790	+
8791	+ // If conv2 outputs current
8792	+ tmp = conv2.split( " " );
8793	+ if ( tmp[ 1 ] === current ) {
8794	+
8795	+ // If prev can be converted to accepted input
8796	+ conv = converters[ prev + " " + tmp[ 0 ] ] \|\|
8797	+ converters[ "* " + tmp[ 0 ] ];
8798	+ if ( conv ) {
8799	+
8800	+ // Condense equivalence converters
8801	+ if ( conv === true ) {
8802	+ conv = converters[ conv2 ];
8803	+
8804	+ // Otherwise, insert the intermediate dataType
8805	+ } else if ( converters[ conv2 ] !== true ) {
8806	+ current = tmp[ 0 ];
8807	+ dataTypes.unshift( tmp[ 1 ] );
8808	+ }
8809	+ break;
8810	+ }
8811	+ }
8812	+ }
8813	+ }
8814	+
8815	+ // Apply converter (if not an equivalence)
8816	+ if ( conv !== true ) {
8817	+
8818	+ // Unless errors are allowed to bubble, catch and return them
8819	+ if ( conv && s.throws ) {
8820	+ response = conv( response );
8821	+ } else {
8822	+ try {
8823	+ response = conv( response );
8824	+ } catch ( e ) {
8825	+ return {
8826	+ state: "parsererror",
8827	+ error: conv ? e : "No conversion from " + prev + " to " + current
8828	+ };
8829	+ }
8830	+ }
8831	+ }
8832	+ }
8833	+ }
8834	+ }
8835	+
8836	+ return { state: "success", data: response };
8837	+ }
8838	+
8839	+ jQuery.extend( {
8840	+
8841	+ // Counter for holding the number of active queries
8842	+ active: 0,
8843	+
8844	+ // Last-Modified header cache for next request
8845	+ lastModified: {},
8846	+ etag: {},
8847	+
8848	+ ajaxSettings: {
8849	+ url: location.href,
8850	+ type: "GET",
8851	+ isLocal: rlocalProtocol.test( location.protocol ),
8852	+ global: true,
8853	+ processData: true,
8854	+ async: true,
8855	+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
8856	+
8857	+ /*
8858	+ timeout: 0,
8859	+ data: null,
8860	+ dataType: null,
8861	+ username: null,
8862	+ password: null,
8863	+ cache: null,
8864	+ throws: false,
8865	+ traditional: false,
8866	+ headers: {},
8867	+ */
8868	+
8869	+ accepts: {
8870	+ "*": allTypes,
8871	+ text: "text/plain",
8872	+ html: "text/html",
8873	+ xml: "application/xml, text/xml",
8874	+ json: "application/json, text/javascript"
8875	+ },
8876	+
8877	+ contents: {
8878	+ xml: /\bxml\b/,
8879	+ html: /\bhtml/,
8880	+ json: /\bjson\b/
8881	+ },
8882	+
8883	+ responseFields: {
8884	+ xml: "responseXML",
8885	+ text: "responseText",
8886	+ json: "responseJSON"
8887	+ },
8888	+
8889	+ // Data converters
8890	+ // Keys separate source (or catchall "*") and destination types with a single space
8891	+ converters: {
8892	+
8893	+ // Convert anything to text
8894	+ "* text": String,
8895	+
8896	+ // Text to html (true = no transformation)
8897	+ "text html": true,
8898	+
8899	+ // Evaluate text as a json expression
8900	+ "text json": JSON.parse,
8901	+
8902	+ // Parse text as xml
8903	+ "text xml": jQuery.parseXML
8904	+ },
8905	+
8906	+ // For options that shouldn't be deep extended:
8907	+ // you can add your own custom options here if
8908	+ // and when you create one that shouldn't be
8909	+ // deep extended (see ajaxExtend)
8910	+ flatOptions: {
8911	+ url: true,
8912	+ context: true
8913	+ }
8914	+ },
8915	+
8916	+ // Creates a full fledged settings object into target
8917	+ // with both ajaxSettings and settings fields.
8918	+ // If target is omitted, writes into ajaxSettings.
8919	+ ajaxSetup: function( target, settings ) {
8920	+ return settings ?
8921	+
8922	+ // Building a settings object
8923	+ ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
8924	+
8925	+ // Extending ajaxSettings
8926	+ ajaxExtend( jQuery.ajaxSettings, target );
8927	+ },
8928	+
8929	+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
8930	+ ajaxTransport: addToPrefiltersOrTransports( transports ),
8931	+
8932	+ // Main method
8933	+ ajax: function( url, options ) {
8934	+
8935	+ // If url is an object, simulate pre-1.5 signature
8936	+ if ( typeof url === "object" ) {
8937	+ options = url;
8938	+ url = undefined;
8939	+ }
8940	+
8941	+ // Force options to be an object
8942	+ options = options \|\| {};
8943	+
8944	+ var transport,
8945	+
8946	+ // URL without anti-cache param
8947	+ cacheURL,
8948	+
8949	+ // Response headers
8950	+ responseHeadersString,
8951	+ responseHeaders,
8952	+
8953	+ // timeout handle
8954	+ timeoutTimer,
8955	+
8956	+ // Url cleanup var
8957	+ urlAnchor,
8958	+
8959	+ // Request state (becomes false upon send and true upon completion)
8960	+ completed,
8961	+
8962	+ // To know if global events are to be dispatched
8963	+ fireGlobals,
8964	+
8965	+ // Loop variable
8966	+ i,
8967	+
8968	+ // uncached part of the url
8969	+ uncached,
8970	+
8971	+ // Create the final options object
8972	+ s = jQuery.ajaxSetup( {}, options ),
8973	+
8974	+ // Callbacks context
8975	+ callbackContext = s.context \|\| s,
8976	+
8977	+ // Context for global events is callbackContext if it is a DOM node or jQuery collection
8978	+ globalEventContext = s.context &&
8979	+ ( callbackContext.nodeType \|\| callbackContext.jquery ) ?
8980	+ jQuery( callbackContext ) :
8981	+ jQuery.event,
8982	+
8983	+ // Deferreds
8984	+ deferred = jQuery.Deferred(),
8985	+ completeDeferred = jQuery.Callbacks( "once memory" ),
8986	+
8987	+ // Status-dependent callbacks
8988	+ statusCode = s.statusCode \|\| {},
8989	+
8990	+ // Headers (they are sent all at once)
8991	+ requestHeaders = {},
8992	+ requestHeadersNames = {},
8993	+
8994	+ // Default abort message
8995	+ strAbort = "canceled",
8996	+
8997	+ // Fake xhr
8998	+ jqXHR = {
8999	+ readyState: 0,
9000	+
9001	+ // Builds headers hashtable if needed
9002	+ getResponseHeader: function( key ) {
9003	+ var match;
9004	+ if ( completed ) {
9005	+ if ( !responseHeaders ) {
9006	+ responseHeaders = {};
9007	+ while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
9008	+ responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ];
9009	+ }
9010	+ }
9011	+ match = responseHeaders[ key.toLowerCase() ];
9012	+ }
9013	+ return match == null ? null : match;
9014	+ },
9015	+
9016	+ // Raw string
9017	+ getAllResponseHeaders: function() {
9018	+ return completed ? responseHeadersString : null;
9019	+ },
9020	+
9021	+ // Caches the header
9022	+ setRequestHeader: function( name, value ) {
9023	+ if ( completed == null ) {
9024	+ name = requestHeadersNames[ name.toLowerCase() ] =
9025	+ requestHeadersNames[ name.toLowerCase() ] \|\| name;
9026	+ requestHeaders[ name ] = value;
9027	+ }
9028	+ return this;
9029	+ },
9030	+
9031	+ // Overrides response content-type header
9032	+ overrideMimeType: function( type ) {
9033	+ if ( completed == null ) {
9034	+ s.mimeType = type;
9035	+ }
9036	+ return this;
9037	+ },
9038	+
9039	+ // Status-dependent callbacks
9040	+ statusCode: function( map ) {
9041	+ var code;
9042	+ if ( map ) {
9043	+ if ( completed ) {
9044	+
9045	+ // Execute the appropriate callbacks
9046	+ jqXHR.always( map[ jqXHR.status ] );
9047	+ } else {
9048	+
9049	+ // Lazy-add the new callbacks in a way that preserves old ones
9050	+ for ( code in map ) {
9051	+ statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
9052	+ }
9053	+ }
9054	+ }
9055	+ return this;
9056	+ },
9057	+
9058	+ // Cancel the request
9059	+ abort: function( statusText ) {
9060	+ var finalText = statusText \|\| strAbort;
9061	+ if ( transport ) {
9062	+ transport.abort( finalText );
9063	+ }
9064	+ done( 0, finalText );
9065	+ return this;
9066	+ }
9067	+ };
9068	+
9069	+ // Attach deferreds
9070	+ deferred.promise( jqXHR );
9071	+
9072	+ // Add protocol if not provided (prefilters might expect it)
9073	+ // Handle falsy url in the settings object (#10093: consistency with old signature)
9074	+ // We also use the url parameter if available
9075	+ s.url = ( ( url \|\| s.url \|\| location.href ) + "" )
9076	+ .replace( rprotocol, location.protocol + "//" );
9077	+
9078	+ // Alias method option to type as per ticket #12004
9079	+ s.type = options.method \|\| options.type \|\| s.method \|\| s.type;
9080	+
9081	+ // Extract dataTypes list
9082	+ s.dataTypes = ( s.dataType \|\| "*" ).toLowerCase().match( rnothtmlwhite ) \|\| [ "" ];
9083	+
9084	+ // A cross-domain request is in order when the origin doesn't match the current origin.
9085	+ if ( s.crossDomain == null ) {
9086	+ urlAnchor = document.createElement( "a" );
9087	+
9088	+ // Support: IE <=8 - 11, Edge 12 - 13
9089	+ // IE throws exception on accessing the href property if url is malformed,
9090	+ // e.g. http://example.com:80x/
9091	+ try {
9092	+ urlAnchor.href = s.url;
9093	+
9094	+ // Support: IE <=8 - 11 only
9095	+ // Anchor's host property isn't correctly set when s.url is relative
9096	+ urlAnchor.href = urlAnchor.href;
9097	+ s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
9098	+ urlAnchor.protocol + "//" + urlAnchor.host;
9099	+ } catch ( e ) {
9100	+
9101	+ // If there is an error parsing the URL, assume it is crossDomain,
9102	+ // it can be rejected by the transport if it is invalid
9103	+ s.crossDomain = true;
9104	+ }
9105	+ }
9106	+
9107	+ // Convert data if not already a string
9108	+ if ( s.data && s.processData && typeof s.data !== "string" ) {
9109	+ s.data = jQuery.param( s.data, s.traditional );
9110	+ }
9111	+
9112	+ // Apply prefilters
9113	+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
9114	+
9115	+ // If request was aborted inside a prefilter, stop there
9116	+ if ( completed ) {
9117	+ return jqXHR;
9118	+ }
9119	+
9120	+ // We can fire global events as of now if asked to
9121	+ // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
9122	+ fireGlobals = jQuery.event && s.global;
9123	+
9124	+ // Watch for a new set of requests
9125	+ if ( fireGlobals && jQuery.active++ === 0 ) {
9126	+ jQuery.event.trigger( "ajaxStart" );
9127	+ }
9128	+
9129	+ // Uppercase the type
9130	+ s.type = s.type.toUpperCase();
9131	+
9132	+ // Determine if request has content
9133	+ s.hasContent = !rnoContent.test( s.type );
9134	+
9135	+ // Save the URL in case we're toying with the If-Modified-Since
9136	+ // and/or If-None-Match header later on
9137	+ // Remove hash to simplify url manipulation
9138	+ cacheURL = s.url.replace( rhash, "" );
9139	+
9140	+ // More options handling for requests with no content
9141	+ if ( !s.hasContent ) {
9142	+
9143	+ // Remember the hash so we can put it back
9144	+ uncached = s.url.slice( cacheURL.length );
9145	+
9146	+ // If data is available, append data to url
9147	+ if ( s.data ) {
9148	+ cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
9149	+
9150	+ // #9682: remove data so that it's not used in an eventual retry
9151	+ delete s.data;
9152	+ }
9153	+
9154	+ // Add or update anti-cache param if needed
9155	+ if ( s.cache === false ) {
9156	+ cacheURL = cacheURL.replace( rantiCache, "$1" );
9157	+ uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached;
9158	+ }
9159	+
9160	+ // Put hash and anti-cache on the URL that will be requested (gh-1732)
9161	+ s.url = cacheURL + uncached;
9162	+
9163	+ // Change '%20' to '+' if this is encoded form body content (gh-2658)
9164	+ } else if ( s.data && s.processData &&
9165	+ ( s.contentType \|\| "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
9166	+ s.data = s.data.replace( r20, "+" );
9167	+ }
9168	+
9169	+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
9170	+ if ( s.ifModified ) {
9171	+ if ( jQuery.lastModified[ cacheURL ] ) {
9172	+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
9173	+ }
9174	+ if ( jQuery.etag[ cacheURL ] ) {
9175	+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
9176	+ }
9177	+ }
9178	+
9179	+ // Set the correct header, if data is being sent
9180	+ if ( s.data && s.hasContent && s.contentType !== false \|\| options.contentType ) {
9181	+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
9182	+ }
9183	+
9184	+ // Set the Accepts header for the server, depending on the dataType
9185	+ jqXHR.setRequestHeader(
9186	+ "Accept",
9187	+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
9188	+ s.accepts[ s.dataTypes[ 0 ] ] +
9189	+ ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
9190	+ s.accepts[ "*" ]
9191	+ );
9192	+
9193	+ // Check for headers option
9194	+ for ( i in s.headers ) {
9195	+ jqXHR.setRequestHeader( i, s.headers[ i ] );
9196	+ }
9197	+
9198	+ // Allow custom headers/mimetypes and early abort
9199	+ if ( s.beforeSend &&
9200	+ ( s.beforeSend.call( callbackContext, jqXHR, s ) === false \|\| completed ) ) {
9201	+
9202	+ // Abort if not done already and return
9203	+ return jqXHR.abort();
9204	+ }
9205	+
9206	+ // Aborting is no longer a cancellation
9207	+ strAbort = "abort";
9208	+
9209	+ // Install callbacks on deferreds
9210	+ completeDeferred.add( s.complete );
9211	+ jqXHR.done( s.success );
9212	+ jqXHR.fail( s.error );
9213	+
9214	+ // Get transport
9215	+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
9216	+
9217	+ // If no transport, we auto-abort
9218	+ if ( !transport ) {
9219	+ done( -1, "No Transport" );
9220	+ } else {
9221	+ jqXHR.readyState = 1;
9222	+
9223	+ // Send global event
9224	+ if ( fireGlobals ) {
9225	+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
9226	+ }
9227	+
9228	+ // If request was aborted inside ajaxSend, stop there
9229	+ if ( completed ) {
9230	+ return jqXHR;
9231	+ }
9232	+
9233	+ // Timeout
9234	+ if ( s.async && s.timeout > 0 ) {
9235	+ timeoutTimer = window.setTimeout( function() {
9236	+ jqXHR.abort( "timeout" );
9237	+ }, s.timeout );
9238	+ }
9239	+
9240	+ try {
9241	+ completed = false;
9242	+ transport.send( requestHeaders, done );
9243	+ } catch ( e ) {
9244	+
9245	+ // Rethrow post-completion exceptions
9246	+ if ( completed ) {
9247	+ throw e;
9248	+ }
9249	+
9250	+ // Propagate others as results
9251	+ done( -1, e );
9252	+ }
9253	+ }
9254	+
9255	+ // Callback for when everything is done
9256	+ function done( status, nativeStatusText, responses, headers ) {
9257	+ var isSuccess, success, error, response, modified,
9258	+ statusText = nativeStatusText;
9259	+
9260	+ // Ignore repeat invocations
9261	+ if ( completed ) {
9262	+ return;
9263	+ }
9264	+
9265	+ completed = true;
9266	+
9267	+ // Clear timeout if it exists
9268	+ if ( timeoutTimer ) {
9269	+ window.clearTimeout( timeoutTimer );
9270	+ }
9271	+
9272	+ // Dereference transport for early garbage collection
9273	+ // (no matter how long the jqXHR object will be used)
9274	+ transport = undefined;
9275	+
9276	+ // Cache response headers
9277	+ responseHeadersString = headers \|\| "";
9278	+
9279	+ // Set readyState
9280	+ jqXHR.readyState = status > 0 ? 4 : 0;
9281	+
9282	+ // Determine if successful
9283	+ isSuccess = status >= 200 && status < 300 \|\| status === 304;
9284	+
9285	+ // Get response data
9286	+ if ( responses ) {
9287	+ response = ajaxHandleResponses( s, jqXHR, responses );
9288	+ }
9289	+
9290	+ // Convert no matter what (that way responseXXX fields are always set)
9291	+ response = ajaxConvert( s, response, jqXHR, isSuccess );
9292	+
9293	+ // If successful, handle type chaining
9294	+ if ( isSuccess ) {
9295	+
9296	+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
9297	+ if ( s.ifModified ) {
9298	+ modified = jqXHR.getResponseHeader( "Last-Modified" );
9299	+ if ( modified ) {
9300	+ jQuery.lastModified[ cacheURL ] = modified;
9301	+ }
9302	+ modified = jqXHR.getResponseHeader( "etag" );
9303	+ if ( modified ) {
9304	+ jQuery.etag[ cacheURL ] = modified;
9305	+ }
9306	+ }
9307	+
9308	+ // if no content
9309	+ if ( status === 204 \|\| s.type === "HEAD" ) {
9310	+ statusText = "nocontent";
9311	+
9312	+ // if not modified
9313	+ } else if ( status === 304 ) {
9314	+ statusText = "notmodified";
9315	+
9316	+ // If we have data, let's convert it
9317	+ } else {
9318	+ statusText = response.state;
9319	+ success = response.data;
9320	+ error = response.error;
9321	+ isSuccess = !error;
9322	+ }
9323	+ } else {
9324	+
9325	+ // Extract error from statusText and normalize for non-aborts
9326	+ error = statusText;
9327	+ if ( status \|\| !statusText ) {
9328	+ statusText = "error";
9329	+ if ( status < 0 ) {
9330	+ status = 0;
9331	+ }
9332	+ }
9333	+ }
9334	+
9335	+ // Set data for the fake xhr object
9336	+ jqXHR.status = status;
9337	+ jqXHR.statusText = ( nativeStatusText \|\| statusText ) + "";
9338	+
9339	+ // Success/Error
9340	+ if ( isSuccess ) {
9341	+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
9342	+ } else {
9343	+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
9344	+ }
9345	+
9346	+ // Status-dependent callbacks
9347	+ jqXHR.statusCode( statusCode );
9348	+ statusCode = undefined;
9349	+
9350	+ if ( fireGlobals ) {
9351	+ globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
9352	+ [ jqXHR, s, isSuccess ? success : error ] );
9353	+ }
9354	+
9355	+ // Complete
9356	+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
9357	+
9358	+ if ( fireGlobals ) {
9359	+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
9360	+
9361	+ // Handle the global AJAX counter
9362	+ if ( !( --jQuery.active ) ) {
9363	+ jQuery.event.trigger( "ajaxStop" );
9364	+ }
9365	+ }
9366	+ }
9367	+
9368	+ return jqXHR;
9369	+ },
9370	+
9371	+ getJSON: function( url, data, callback ) {
9372	+ return jQuery.get( url, data, callback, "json" );
9373	+ },
9374	+
9375	+ getScript: function( url, callback ) {
9376	+ return jQuery.get( url, undefined, callback, "script" );
9377	+ }
9378	+ } );
9379	+
9380	+ jQuery.each( [ "get", "post" ], function( i, method ) {
9381	+ jQuery[ method ] = function( url, data, callback, type ) {
9382	+
9383	+ // Shift arguments if data argument was omitted
9384	+ if ( jQuery.isFunction( data ) ) {
9385	+ type = type \|\| callback;
9386	+ callback = data;
9387	+ data = undefined;
9388	+ }
9389	+
9390	+ // The url can be an options object (which then must have .url)
9391	+ return jQuery.ajax( jQuery.extend( {
9392	+ url: url,
9393	+ type: method,
9394	+ dataType: type,
9395	+ data: data,
9396	+ success: callback
9397	+ }, jQuery.isPlainObject( url ) && url ) );
9398	+ };
9399	+ } );
9400	+
9401	+
9402	+ jQuery._evalUrl = function( url ) {
9403	+ return jQuery.ajax( {
9404	+ url: url,
9405	+
9406	+ // Make this explicit, since user can override this through ajaxSetup (#11264)
9407	+ type: "GET",
9408	+ dataType: "script",
9409	+ cache: true,
9410	+ async: false,
9411	+ global: false,
9412	+ "throws": true
9413	+ } );
9414	+ };
9415	+
9416	+
9417	+ jQuery.fn.extend( {
9418	+ wrapAll: function( html ) {
9419	+ var wrap;
9420	+
9421	+ if ( this[ 0 ] ) {
9422	+ if ( jQuery.isFunction( html ) ) {
9423	+ html = html.call( this[ 0 ] );
9424	+ }
9425	+
9426	+ // The elements to wrap the target around
9427	+ wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
9428	+
9429	+ if ( this[ 0 ].parentNode ) {
9430	+ wrap.insertBefore( this[ 0 ] );
9431	+ }
9432	+
9433	+ wrap.map( function() {
9434	+ var elem = this;
9435	+
9436	+ while ( elem.firstElementChild ) {
9437	+ elem = elem.firstElementChild;
9438	+ }
9439	+
9440	+ return elem;
9441	+ } ).append( this );
9442	+ }
9443	+
9444	+ return this;
9445	+ },
9446	+
9447	+ wrapInner: function( html ) {
9448	+ if ( jQuery.isFunction( html ) ) {
9449	+ return this.each( function( i ) {
9450	+ jQuery( this ).wrapInner( html.call( this, i ) );
9451	+ } );
9452	+ }
9453	+
9454	+ return this.each( function() {
9455	+ var self = jQuery( this ),
9456	+ contents = self.contents();
9457	+
9458	+ if ( contents.length ) {
9459	+ contents.wrapAll( html );
9460	+
9461	+ } else {
9462	+ self.append( html );
9463	+ }
9464	+ } );
9465	+ },
9466	+
9467	+ wrap: function( html ) {
9468	+ var isFunction = jQuery.isFunction( html );
9469	+
9470	+ return this.each( function( i ) {
9471	+ jQuery( this ).wrapAll( isFunction ? html.call( this, i ) : html );
9472	+ } );
9473	+ },
9474	+
9475	+ unwrap: function( selector ) {
9476	+ this.parent( selector ).not( "body" ).each( function() {
9477	+ jQuery( this ).replaceWith( this.childNodes );
9478	+ } );
9479	+ return this;
9480	+ }
9481	+ } );
9482	+
9483	+
9484	+ jQuery.expr.pseudos.hidden = function( elem ) {
9485	+ return !jQuery.expr.pseudos.visible( elem );
9486	+ };
9487	+ jQuery.expr.pseudos.visible = function( elem ) {
9488	+ return !!( elem.offsetWidth \|\| elem.offsetHeight \|\| elem.getClientRects().length );
9489	+ };
9490	+
9491	+
9492	+
9493	+
9494	+ jQuery.ajaxSettings.xhr = function() {
9495	+ try {
9496	+ return new window.XMLHttpRequest();
9497	+ } catch ( e ) {}
9498	+ };
9499	+
9500	+ var xhrSuccessStatus = {
9501	+
9502	+ // File protocol always yields status code 0, assume 200
9503	+ 0: 200,
9504	+
9505	+ // Support: IE <=9 only
9506	+ // #1450: sometimes IE returns 1223 when it should be 204
9507	+ 1223: 204
9508	+ },
9509	+ xhrSupported = jQuery.ajaxSettings.xhr();
9510	+
9511	+ support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
9512	+ support.ajax = xhrSupported = !!xhrSupported;
9513	+
9514	+ jQuery.ajaxTransport( function( options ) {
9515	+ var callback, errorCallback;
9516	+
9517	+ // Cross domain only allowed if supported through XMLHttpRequest
9518	+ if ( support.cors \|\| xhrSupported && !options.crossDomain ) {
9519	+ return {
9520	+ send: function( headers, complete ) {
9521	+ var i,
9522	+ xhr = options.xhr();
9523	+
9524	+ xhr.open(
9525	+ options.type,
9526	+ options.url,
9527	+ options.async,
9528	+ options.username,
9529	+ options.password
9530	+ );
9531	+
9532	+ // Apply custom fields if provided
9533	+ if ( options.xhrFields ) {
9534	+ for ( i in options.xhrFields ) {
9535	+ xhr[ i ] = options.xhrFields[ i ];
9536	+ }
9537	+ }
9538	+
9539	+ // Override mime type if needed
9540	+ if ( options.mimeType && xhr.overrideMimeType ) {
9541	+ xhr.overrideMimeType( options.mimeType );
9542	+ }
9543	+
9544	+ // X-Requested-With header
9545	+ // For cross-domain requests, seeing as conditions for a preflight are
9546	+ // akin to a jigsaw puzzle, we simply never set it to be sure.
9547	+ // (it can always be set on a per-request basis or even using ajaxSetup)
9548	+ // For same-domain requests, won't change header if already provided.
9549	+ if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
9550	+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
9551	+ }
9552	+
9553	+ // Set headers
9554	+ for ( i in headers ) {
9555	+ xhr.setRequestHeader( i, headers[ i ] );
9556	+ }
9557	+
9558	+ // Callback
9559	+ callback = function( type ) {
9560	+ return function() {
9561	+ if ( callback ) {
9562	+ callback = errorCallback = xhr.onload =
9563	+ xhr.onerror = xhr.onabort = xhr.onreadystatechange = null;
9564	+
9565	+ if ( type === "abort" ) {
9566	+ xhr.abort();
9567	+ } else if ( type === "error" ) {
9568	+
9569	+ // Support: IE <=9 only
9570	+ // On a manual native abort, IE9 throws
9571	+ // errors on any property access that is not readyState
9572	+ if ( typeof xhr.status !== "number" ) {
9573	+ complete( 0, "error" );
9574	+ } else {
9575	+ complete(
9576	+
9577	+ // File: protocol always yields status 0; see #8605, #14207
9578	+ xhr.status,
9579	+ xhr.statusText
9580	+ );
9581	+ }
9582	+ } else {
9583	+ complete(
9584	+ xhrSuccessStatus[ xhr.status ] \|\| xhr.status,
9585	+ xhr.statusText,
9586	+
9587	+ // Support: IE <=9 only
9588	+ // IE9 has no XHR2 but throws on binary (trac-11426)
9589	+ // For XHR2 non-text, let the caller handle it (gh-2498)
9590	+ ( xhr.responseType \|\| "text" ) !== "text" \|\|
9591	+ typeof xhr.responseText !== "string" ?
9592	+ { binary: xhr.response } :
9593	+ { text: xhr.responseText },
9594	+ xhr.getAllResponseHeaders()
9595	+ );
9596	+ }
9597	+ }
9598	+ };
9599	+ };
9600	+
9601	+ // Listen to events
9602	+ xhr.onload = callback();
9603	+ errorCallback = xhr.onerror = callback( "error" );
9604	+
9605	+ // Support: IE 9 only
9606	+ // Use onreadystatechange to replace onabort
9607	+ // to handle uncaught aborts
9608	+ if ( xhr.onabort !== undefined ) {
9609	+ xhr.onabort = errorCallback;
9610	+ } else {
9611	+ xhr.onreadystatechange = function() {
9612	+
9613	+ // Check readyState before timeout as it changes
9614	+ if ( xhr.readyState === 4 ) {
9615	+
9616	+ // Allow onerror to be called first,
9617	+ // but that will not handle a native abort
9618	+ // Also, save errorCallback to a variable
9619	+ // as xhr.onerror cannot be accessed
9620	+ window.setTimeout( function() {
9621	+ if ( callback ) {
9622	+ errorCallback();
9623	+ }
9624	+ } );
9625	+ }
9626	+ };
9627	+ }
9628	+
9629	+ // Create the abort callback
9630	+ callback = callback( "abort" );
9631	+
9632	+ try {
9633	+
9634	+ // Do send the request (this may raise an exception)
9635	+ xhr.send( options.hasContent && options.data \|\| null );
9636	+ } catch ( e ) {
9637	+
9638	+ // #14683: Only rethrow if this hasn't been notified as an error yet
9639	+ if ( callback ) {
9640	+ throw e;
9641	+ }
9642	+ }
9643	+ },
9644	+
9645	+ abort: function() {
9646	+ if ( callback ) {
9647	+ callback();
9648	+ }
9649	+ }
9650	+ };
9651	+ }
9652	+ } );
9653	+
9654	+
9655	+
9656	+
9657	+ // Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
9658	+ jQuery.ajaxPrefilter( function( s ) {
9659	+ if ( s.crossDomain ) {
9660	+ s.contents.script = false;
9661	+ }
9662	+ } );
9663	+
9664	+ // Install script dataType
9665	+ jQuery.ajaxSetup( {
9666	+ accepts: {
9667	+ script: "text/javascript, application/javascript, " +
9668	+ "application/ecmascript, application/x-ecmascript"
9669	+ },
9670	+ contents: {
9671	+ script: /\b(?:java\|ecma)script\b/
9672	+ },
9673	+ converters: {
9674	+ "text script": function( text ) {
9675	+ jQuery.globalEval( text );
9676	+ return text;
9677	+ }
9678	+ }
9679	+ } );
9680	+
9681	+ // Handle cache's special case and crossDomain
9682	+ jQuery.ajaxPrefilter( "script", function( s ) {
9683	+ if ( s.cache === undefined ) {
9684	+ s.cache = false;
9685	+ }
9686	+ if ( s.crossDomain ) {
9687	+ s.type = "GET";
9688	+ }
9689	+ } );
9690	+
9691	+ // Bind script tag hack transport
9692	+ jQuery.ajaxTransport( "script", function( s ) {
9693	+
9694	+ // This transport only deals with cross domain requests
9695	+ if ( s.crossDomain ) {
9696	+ var script, callback;
9697	+ return {
9698	+ send: function( _, complete ) {
9699	+ script = jQuery( "<script>" ).prop( {
9700	+ charset: s.scriptCharset,
9701	+ src: s.url
9702	+ } ).on(
9703	+ "load error",
9704	+ callback = function( evt ) {
9705	+ script.remove();
9706	+ callback = null;
9707	+ if ( evt ) {
9708	+ complete( evt.type === "error" ? 404 : 200, evt.type );
9709	+ }
9710	+ }
9711	+ );
9712	+
9713	+ // Use native DOM manipulation to avoid our domManip AJAX trickery
9714	+ document.head.appendChild( script[ 0 ] );
9715	+ },
9716	+ abort: function() {
9717	+ if ( callback ) {
9718	+ callback();
9719	+ }
9720	+ }
9721	+ };
9722	+ }
9723	+ } );
9724	+
9725	+
9726	+
9727	+
9728	+ var oldCallbacks = [],
9729	+ rjsonp = /(=)\?(?=&\|$)\|\?\?/;
9730	+
9731	+ // Default jsonp settings
9732	+ jQuery.ajaxSetup( {
9733	+ jsonp: "callback",
9734	+ jsonpCallback: function() {
9735	+ var callback = oldCallbacks.pop() \|\| ( jQuery.expando + "_" + ( nonce++ ) );
9736	+ this[ callback ] = true;
9737	+ return callback;
9738	+ }
9739	+ } );
9740	+
9741	+ // Detect, normalize options and install callbacks for jsonp requests
9742	+ jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
9743	+
9744	+ var callbackName, overwritten, responseContainer,
9745	+ jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
9746	+ "url" :
9747	+ typeof s.data === "string" &&
9748	+ ( s.contentType \|\| "" )
9749	+ .indexOf( "application/x-www-form-urlencoded" ) === 0 &&
9750	+ rjsonp.test( s.data ) && "data"
9751	+ );
9752	+
9753	+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
9754	+ if ( jsonProp \|\| s.dataTypes[ 0 ] === "jsonp" ) {
9755	+
9756	+ // Get callback name, remembering preexisting value associated with it
9757	+ callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
9758	+ s.jsonpCallback() :
9759	+ s.jsonpCallback;
9760	+
9761	+ // Insert callback into url or form data
9762	+ if ( jsonProp ) {
9763	+ s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
9764	+ } else if ( s.jsonp !== false ) {
9765	+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
9766	+ }
9767	+
9768	+ // Use data converter to retrieve json after script execution
9769	+ s.converters[ "script json" ] = function() {
9770	+ if ( !responseContainer ) {
9771	+ jQuery.error( callbackName + " was not called" );
9772	+ }
9773	+ return responseContainer[ 0 ];
9774	+ };
9775	+
9776	+ // Force json dataType
9777	+ s.dataTypes[ 0 ] = "json";
9778	+
9779	+ // Install callback
9780	+ overwritten = window[ callbackName ];
9781	+ window[ callbackName ] = function() {
9782	+ responseContainer = arguments;
9783	+ };
9784	+
9785	+ // Clean-up function (fires after converters)
9786	+ jqXHR.always( function() {
9787	+
9788	+ // If previous value didn't exist - remove it
9789	+ if ( overwritten === undefined ) {
9790	+ jQuery( window ).removeProp( callbackName );
9791	+
9792	+ // Otherwise restore preexisting value
9793	+ } else {
9794	+ window[ callbackName ] = overwritten;
9795	+ }
9796	+
9797	+ // Save back as free
9798	+ if ( s[ callbackName ] ) {
9799	+
9800	+ // Make sure that re-using the options doesn't screw things around
9801	+ s.jsonpCallback = originalSettings.jsonpCallback;
9802	+
9803	+ // Save the callback name for future use
9804	+ oldCallbacks.push( callbackName );
9805	+ }
9806	+
9807	+ // Call if it was a function and we have a response
9808	+ if ( responseContainer && jQuery.isFunction( overwritten ) ) {
9809	+ overwritten( responseContainer[ 0 ] );
9810	+ }
9811	+
9812	+ responseContainer = overwritten = undefined;
9813	+ } );
9814	+
9815	+ // Delegate to script
9816	+ return "script";
9817	+ }
9818	+ } );
9819	+
9820	+
9821	+
9822	+
9823	+ // Support: Safari 8 only
9824	+ // In Safari 8 documents created via document.implementation.createHTMLDocument
9825	+ // collapse sibling forms: the second one becomes a child of the first one.
9826	+ // Because of that, this security measure has to be disabled in Safari 8.
9827	+ // https://bugs.webkit.org/show_bug.cgi?id=137337
9828	+ support.createHTMLDocument = ( function() {
9829	+ var body = document.implementation.createHTMLDocument( "" ).body;
9830	+ body.innerHTML = "<form></form><form></form>";
9831	+ return body.childNodes.length === 2;
9832	+ } )();
9833	+
9834	+
9835	+ // Argument "data" should be string of html
9836	+ // context (optional): If specified, the fragment will be created in this context,
9837	+ // defaults to document
9838	+ // keepScripts (optional): If true, will include scripts passed in the html string
9839	+ jQuery.parseHTML = function( data, context, keepScripts ) {
9840	+ if ( typeof data !== "string" ) {
9841	+ return [];
9842	+ }
9843	+ if ( typeof context === "boolean" ) {
9844	+ keepScripts = context;
9845	+ context = false;
9846	+ }
9847	+
9848	+ var base, parsed, scripts;
9849	+
9850	+ if ( !context ) {
9851	+
9852	+ // Stop scripts or inline event handlers from being executed immediately
9853	+ // by using document.implementation
9854	+ if ( support.createHTMLDocument ) {
9855	+ context = document.implementation.createHTMLDocument( "" );
9856	+
9857	+ // Set the base href for the created document
9858	+ // so any parsed elements with URLs
9859	+ // are based on the document's URL (gh-2965)
9860	+ base = context.createElement( "base" );
9861	+ base.href = document.location.href;
9862	+ context.head.appendChild( base );
9863	+ } else {
9864	+ context = document;
9865	+ }
9866	+ }
9867	+
9868	+ parsed = rsingleTag.exec( data );
9869	+ scripts = !keepScripts && [];
9870	+
9871	+ // Single tag
9872	+ if ( parsed ) {
9873	+ return [ context.createElement( parsed[ 1 ] ) ];
9874	+ }
9875	+
9876	+ parsed = buildFragment( [ data ], context, scripts );
9877	+
9878	+ if ( scripts && scripts.length ) {
9879	+ jQuery( scripts ).remove();
9880	+ }
9881	+
9882	+ return jQuery.merge( [], parsed.childNodes );
9883	+ };
9884	+
9885	+
9886	+ /**
9887	+ * Load a url into a page
9888	+ */
9889	+ jQuery.fn.load = function( url, params, callback ) {
9890	+ var selector, type, response,
9891	+ self = this,
9892	+ off = url.indexOf( " " );
9893	+
9894	+ if ( off > -1 ) {
9895	+ selector = stripAndCollapse( url.slice( off ) );
9896	+ url = url.slice( 0, off );
9897	+ }
9898	+
9899	+ // If it's a function
9900	+ if ( jQuery.isFunction( params ) ) {
9901	+
9902	+ // We assume that it's the callback
9903	+ callback = params;
9904	+ params = undefined;
9905	+
9906	+ // Otherwise, build a param string
9907	+ } else if ( params && typeof params === "object" ) {
9908	+ type = "POST";
9909	+ }
9910	+
9911	+ // If we have elements to modify, make the request
9912	+ if ( self.length > 0 ) {
9913	+ jQuery.ajax( {
9914	+ url: url,
9915	+
9916	+ // If "type" variable is undefined, then "GET" method will be used.
9917	+ // Make value of this field explicit since
9918	+ // user can override it through ajaxSetup method
9919	+ type: type \|\| "GET",
9920	+ dataType: "html",
9921	+ data: params
9922	+ } ).done( function( responseText ) {
9923	+
9924	+ // Save response for use in complete callback
9925	+ response = arguments;
9926	+
9927	+ self.html( selector ?
9928	+
9929	+ // If a selector was specified, locate the right elements in a dummy div
9930	+ // Exclude scripts to avoid IE 'Permission Denied' errors
9931	+ jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
9932	+
9933	+ // Otherwise use the full result
9934	+ responseText );
9935	+
9936	+ // If the request succeeds, this function gets "data", "status", "jqXHR"
9937	+ // but they are ignored because response was set above.
9938	+ // If it fails, this function gets "jqXHR", "status", "error"
9939	+ } ).always( callback && function( jqXHR, status ) {
9940	+ self.each( function() {
9941	+ callback.apply( this, response \|\| [ jqXHR.responseText, status, jqXHR ] );
9942	+ } );
9943	+ } );
9944	+ }
9945	+
9946	+ return this;
9947	+ };
9948	+
9949	+
9950	+
9951	+
9952	+ // Attach a bunch of functions for handling common AJAX events
9953	+ jQuery.each( [
9954	+ "ajaxStart",
9955	+ "ajaxStop",
9956	+ "ajaxComplete",
9957	+ "ajaxError",
9958	+ "ajaxSuccess",
9959	+ "ajaxSend"
9960	+ ], function( i, type ) {
9961	+ jQuery.fn[ type ] = function( fn ) {
9962	+ return this.on( type, fn );
9963	+ };
9964	+ } );
9965	+
9966	+
9967	+
9968	+
9969	+ jQuery.expr.pseudos.animated = function( elem ) {
9970	+ return jQuery.grep( jQuery.timers, function( fn ) {
9971	+ return elem === fn.elem;
9972	+ } ).length;
9973	+ };
9974	+
9975	+
9976	+
9977	+
9978	+ jQuery.offset = {
9979	+ setOffset: function( elem, options, i ) {
9980	+ var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
9981	+ position = jQuery.css( elem, "position" ),
9982	+ curElem = jQuery( elem ),
9983	+ props = {};
9984	+
9985	+ // Set position first, in-case top/left are set even on static elem
9986	+ if ( position === "static" ) {
9987	+ elem.style.position = "relative";
9988	+ }
9989	+
9990	+ curOffset = curElem.offset();
9991	+ curCSSTop = jQuery.css( elem, "top" );
9992	+ curCSSLeft = jQuery.css( elem, "left" );
9993	+ calculatePosition = ( position === "absolute" \|\| position === "fixed" ) &&
9994	+ ( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
9995	+
9996	+ // Need to be able to calculate position if either
9997	+ // top or left is auto and position is either absolute or fixed
9998	+ if ( calculatePosition ) {
9999	+ curPosition = curElem.position();
10000	+ curTop = curPosition.top;
10001	+ curLeft = curPosition.left;
10002	+
10003	+ } else {
10004	+ curTop = parseFloat( curCSSTop ) \|\| 0;
10005	+ curLeft = parseFloat( curCSSLeft ) \|\| 0;
10006	+ }
10007	+
10008	+ if ( jQuery.isFunction( options ) ) {
10009	+
10010	+ // Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
10011	+ options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
10012	+ }
10013	+
10014	+ if ( options.top != null ) {
10015	+ props.top = ( options.top - curOffset.top ) + curTop;
10016	+ }
10017	+ if ( options.left != null ) {
10018	+ props.left = ( options.left - curOffset.left ) + curLeft;
10019	+ }
10020	+
10021	+ if ( "using" in options ) {
10022	+ options.using.call( elem, props );
10023	+
10024	+ } else {
10025	+ curElem.css( props );
10026	+ }
10027	+ }
10028	+ };
10029	+
10030	+ jQuery.fn.extend( {
10031	+ offset: function( options ) {
10032	+
10033	+ // Preserve chaining for setter
10034	+ if ( arguments.length ) {
10035	+ return options === undefined ?
10036	+ this :
10037	+ this.each( function( i ) {
10038	+ jQuery.offset.setOffset( this, options, i );
10039	+ } );
10040	+ }
10041	+
10042	+ var doc, docElem, rect, win,
10043	+ elem = this[ 0 ];
10044	+
10045	+ if ( !elem ) {
10046	+ return;
10047	+ }
10048	+
10049	+ // Return zeros for disconnected and hidden (display: none) elements (gh-2310)
10050	+ // Support: IE <=11 only
10051	+ // Running getBoundingClientRect on a
10052	+ // disconnected node in IE throws an error
10053	+ if ( !elem.getClientRects().length ) {
10054	+ return { top: 0, left: 0 };
10055	+ }
10056	+
10057	+ rect = elem.getBoundingClientRect();
10058	+
10059	+ doc = elem.ownerDocument;
10060	+ docElem = doc.documentElement;
10061	+ win = doc.defaultView;
10062	+
10063	+ return {
10064	+ top: rect.top + win.pageYOffset - docElem.clientTop,
10065	+ left: rect.left + win.pageXOffset - docElem.clientLeft
10066	+ };
10067	+ },
10068	+
10069	+ position: function() {
10070	+ if ( !this[ 0 ] ) {
10071	+ return;
10072	+ }
10073	+
10074	+ var offsetParent, offset,
10075	+ elem = this[ 0 ],
10076	+ parentOffset = { top: 0, left: 0 };
10077	+
10078	+ // Fixed elements are offset from window (parentOffset = {top:0, left: 0},
10079	+ // because it is its only offset parent
10080	+ if ( jQuery.css( elem, "position" ) === "fixed" ) {
10081	+
10082	+ // Assume getBoundingClientRect is there when computed position is fixed
10083	+ offset = elem.getBoundingClientRect();
10084	+
10085	+ } else {
10086	+
10087	+ // Get real offsetParent
10088	+ offsetParent = this.offsetParent();
10089	+
10090	+ // Get correct offsets
10091	+ offset = this.offset();
10092	+ if ( !nodeName( offsetParent[ 0 ], "html" ) ) {
10093	+ parentOffset = offsetParent.offset();
10094	+ }
10095	+
10096	+ // Add offsetParent borders
10097	+ parentOffset = {
10098	+ top: parentOffset.top + jQuery.css( offsetParent[ 0 ], "borderTopWidth", true ),
10099	+ left: parentOffset.left + jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true )
10100	+ };
10101	+ }
10102	+
10103	+ // Subtract parent offsets and element margins
10104	+ return {
10105	+ top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
10106	+ left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
10107	+ };
10108	+ },
10109	+
10110	+ // This method will return documentElement in the following cases:
10111	+ // 1) For the element inside the iframe without offsetParent, this method will return
10112	+ // documentElement of the parent window
10113	+ // 2) For the hidden or detached element
10114	+ // 3) For body or html element, i.e. in case of the html node - it will return itself
10115	+ //
10116	+ // but those exceptions were never presented as a real life use-cases
10117	+ // and might be considered as more preferable results.
10118	+ //
10119	+ // This logic, however, is not guaranteed and can change at any point in the future
10120	+ offsetParent: function() {
10121	+ return this.map( function() {
10122	+ var offsetParent = this.offsetParent;
10123	+
10124	+ while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
10125	+ offsetParent = offsetParent.offsetParent;
10126	+ }
10127	+
10128	+ return offsetParent \|\| documentElement;
10129	+ } );
10130	+ }
10131	+ } );
10132	+
10133	+ // Create scrollLeft and scrollTop methods
10134	+ jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
10135	+ var top = "pageYOffset" === prop;
10136	+
10137	+ jQuery.fn[ method ] = function( val ) {
10138	+ return access( this, function( elem, method, val ) {
10139	+
10140	+ // Coalesce documents and windows
10141	+ var win;
10142	+ if ( jQuery.isWindow( elem ) ) {
10143	+ win = elem;
10144	+ } else if ( elem.nodeType === 9 ) {
10145	+ win = elem.defaultView;
10146	+ }
10147	+
10148	+ if ( val === undefined ) {
10149	+ return win ? win[ prop ] : elem[ method ];
10150	+ }
10151	+
10152	+ if ( win ) {
10153	+ win.scrollTo(
10154	+ !top ? val : win.pageXOffset,
10155	+ top ? val : win.pageYOffset
10156	+ );
10157	+
10158	+ } else {
10159	+ elem[ method ] = val;
10160	+ }
10161	+ }, method, val, arguments.length );
10162	+ };
10163	+ } );
10164	+
10165	+ // Support: Safari <=7 - 9.1, Chrome <=37 - 49
10166	+ // Add the top/left cssHooks using jQuery.fn.position
10167	+ // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
10168	+ // Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
10169	+ // getComputedStyle returns percent when specified for top/left/bottom/right;
10170	+ // rather than make the css module depend on the offset module, just check for it here
10171	+ jQuery.each( [ "top", "left" ], function( i, prop ) {
10172	+ jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
10173	+ function( elem, computed ) {
10174	+ if ( computed ) {
10175	+ computed = curCSS( elem, prop );
10176	+
10177	+ // If curCSS returns percentage, fallback to offset
10178	+ return rnumnonpx.test( computed ) ?
10179	+ jQuery( elem ).position()[ prop ] + "px" :
10180	+ computed;
10181	+ }
10182	+ }
10183	+ );
10184	+ } );
10185	+
10186	+
10187	+ // Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
10188	+ jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
10189	+ jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name },
10190	+ function( defaultExtra, funcName ) {
10191	+
10192	+ // Margin is only for outerHeight, outerWidth
10193	+ jQuery.fn[ funcName ] = function( margin, value ) {
10194	+ var chainable = arguments.length && ( defaultExtra \|\| typeof margin !== "boolean" ),
10195	+ extra = defaultExtra \|\| ( margin === true \|\| value === true ? "margin" : "border" );
10196	+
10197	+ return access( this, function( elem, type, value ) {
10198	+ var doc;
10199	+
10200	+ if ( jQuery.isWindow( elem ) ) {
10201	+
10202	+ // $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
10203	+ return funcName.indexOf( "outer" ) === 0 ?
10204	+ elem[ "inner" + name ] :
10205	+ elem.document.documentElement[ "client" + name ];
10206	+ }
10207	+
10208	+ // Get document width or height
10209	+ if ( elem.nodeType === 9 ) {
10210	+ doc = elem.documentElement;
10211	+
10212	+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
10213	+ // whichever is greatest
10214	+ return Math.max(
10215	+ elem.body[ "scroll" + name ], doc[ "scroll" + name ],
10216	+ elem.body[ "offset" + name ], doc[ "offset" + name ],
10217	+ doc[ "client" + name ]
10218	+ );
10219	+ }
10220	+
10221	+ return value === undefined ?
10222	+
10223	+ // Get width or height on the element, requesting but not forcing parseFloat
10224	+ jQuery.css( elem, type, extra ) :
10225	+
10226	+ // Set width or height on the element
10227	+ jQuery.style( elem, type, value, extra );
10228	+ }, type, chainable ? margin : undefined, chainable );
10229	+ };
10230	+ } );
10231	+ } );
10232	+
10233	+
10234	+ jQuery.fn.extend( {
10235	+
10236	+ bind: function( types, data, fn ) {
10237	+ return this.on( types, null, data, fn );
10238	+ },
10239	+ unbind: function( types, fn ) {
10240	+ return this.off( types, null, fn );
10241	+ },
10242	+
10243	+ delegate: function( selector, types, data, fn ) {
10244	+ return this.on( types, selector, data, fn );
10245	+ },
10246	+ undelegate: function( selector, types, fn ) {
10247	+
10248	+ // ( namespace ) or ( selector, types [, fn] )
10249	+ return arguments.length === 1 ?
10250	+ this.off( selector, "**" ) :
10251	+ this.off( types, selector \|\| "**", fn );
10252	+ }
10253	+ } );
10254	+
10255	+ jQuery.holdReady = function( hold ) {
10256	+ if ( hold ) {
10257	+ jQuery.readyWait++;
10258	+ } else {
10259	+ jQuery.ready( true );
10260	+ }
10261	+ };
10262	+ jQuery.isArray = Array.isArray;
10263	+ jQuery.parseJSON = JSON.parse;
10264	+ jQuery.nodeName = nodeName;
10265	+
10266	+
10267	+
10268	+
10269	+ // Register as a named AMD module, since jQuery can be concatenated with other
10270	+ // files that may use define, but not via a proper concatenation script that
10271	+ // understands anonymous AMD modules. A named AMD is safest and most robust
10272	+ // way to register. Lowercase jquery is used because AMD module names are
10273	+ // derived from file names, and jQuery is normally delivered in a lowercase
10274	+ // file name. Do this after creating the global so that if an AMD module wants
10275	+ // to call noConflict to hide this version of jQuery, it will work.
10276	+
10277	+ // Note that for maximum portability, libraries that are not jQuery should
10278	+ // declare themselves as anonymous modules, and avoid setting a global if an
10279	+ // AMD loader is present. jQuery is a special case. For more information, see
10280	+ // https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
10281	+
10282	+ if ( true ) {
10283	+ !(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = function() {
10284	+ return jQuery;
10285	+ }.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
10286	+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
10287	+ }
10288	+
10289	+
10290	+
10291	+
10292	+ var
10293	+
10294	+ // Map over jQuery in case of overwrite
10295	+ _jQuery = window.jQuery,
10296	+
10297	+ // Map over the $ in case of overwrite
10298	+ _$ = window.$;
10299	+
10300	+ jQuery.noConflict = function( deep ) {
10301	+ if ( window.$ === jQuery ) {
10302	+ window.$ = _$;
10303	+ }
10304	+
10305	+ if ( deep && window.jQuery === jQuery ) {
10306	+ window.jQuery = _jQuery;
10307	+ }
10308	+
10309	+ return jQuery;
10310	+ };
10311	+
10312	+ // Expose jQuery and $ identifiers, even in AMD
10313	+ // (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
10314	+ // and CommonJS for browser emulators (#13566)
10315	+ if ( !noGlobal ) {
10316	+ window.jQuery = window.$ = jQuery;
10317	+ }
10318	+
10319	+
10320	+
10321	+
10322	+ return jQuery;
10323	+ } );
10324	+
10325	+
10326	+ /***/ }),
10327	+ /* 1 */,
10328	+ /* 2 */,
10329	+ /* 3 */,
10330	+ /* 4 */,
10331	+ /* 5 */
10332	+ /***/ (function(module, exports, __webpack_require__) {
10333	+
10334	+ "use strict";
10335	+
10336	+
10337	+ __webpack_require__(6);
10338	+
10339	+ jQuery(document).ready(function ($) {
10340	+
10341	+ // var myOptions = {
10342	+ // // you can declare a default color here,
10343	+ // // or in the data-default-color attribute on the input
10344	+ // defaultColor: 'ddd',
10345	+ // // a callback to fire whenever the color changes to a valid color
10346	+ // change: function(event, ui){},
10347	+ // // a callback to fire when the input is emptied or an invalid color
10348	+ // clear: function() {},
10349	+ // // hide the color picker controls on load
10350	+ // hide: true,
10351	+ // // show a group of common colors beneath the square
10352	+ // // or, supply an array of colors to customize further
10353	+ // palettes: true
10354	+ // };
10355	+ $('.color-wp').wpColorPicker();
10356	+ // $('.color-wp').wpColorPicker(myOptions);
10357	+
10358	+
10359	+ // let s1_options = {
10360	+ // defaultColor: 'ddd',
10361	+ // hide: true,
10362	+ // palettes: true
10363	+ // }
10364	+ // $('.color-wp-s1').wpColorPicker(s1_options);
10365	+
10366	+ });
10367	+
10368	+ $(document).ready(function () {
10369	+ $('select').material_select();
10370	+ $('.collapsible').collapsible();
10371	+
10372	+ var position = document.querySelectorAll('.position');
10373	+
10374	+ var default_display = function default_display() {
10375	+
10376	+ var val = $('.select').find(":selected").val();
10377	+
10378	+ var position1 = document.querySelector('.position-1');
10379	+ var position2 = document.querySelector('.position-2');
10380	+ var position3 = document.querySelector('.position-3');
10381	+ var position4 = document.querySelector('.position-4');
10382	+
10383	+ if (val == '1') {
10384	+ position1.classList.add('display-block');
10385	+ } else if (val == '2') {
10386	+ position2.classList.add('display-block');
10387	+ } else if (val == '3') {
10388	+ position3.classList.add('display-block');
10389	+ } else if (val == '4') {
10390	+ position4.classList.add('display-block');
10391	+ }
10392	+ };
10393	+
10394	+ default_display();
10395	+
10396	+ // incase displya-block is added remove it ..
10397	+ var remove = function remove() {
10398	+ position.forEach(function (e) {
10399	+ e.classList.remove('display-block');
10400	+ });
10401	+ };
10402	+
10403	+ $(".select").on("change", function (e) {
10404	+ var x = e.target;
10405	+ var val = e.target.value;
10406	+
10407	+ var position1 = document.querySelector('.position-1');
10408	+ var position2 = document.querySelector('.position-2');
10409	+ var position3 = document.querySelector('.position-3');
10410	+ var position4 = document.querySelector('.position-4');
10411	+
10412	+ if (val == '1') {
10413	+ remove();
10414	+ position1.classList.add('display-block');
10415	+ } else if (val == '2') {
10416	+ remove();
10417	+ position2.classList.add('display-block');
10418	+ } else if (val == '3') {
10419	+ remove();
10420	+ position3.classList.add('display-block');
10421	+ } else if (val == '4') {
10422	+ remove();
10423	+ position4.classList.add('display-block');
10424	+ }
10425	+ });
10426	+
10427	+ // can impove this code -
10428	+ // https://stackoverflow.com/a/32631357/2591092
10429	+ // https://stackoverflow.com/questions/11208021/jquery-add-css-class-depending-on-selectbox-option
10430	+ });
10431	+
10432	+ /***/ }),
10433	+ /* 6 */
10434	+ /***/ (function(module, exports, __webpack_require__) {
10435	+
10436	+ var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_RESULT__;var __WEBPACK_AMD_DEFINE_RESULT__;var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
10437	+ * Materialize v0.100.1 (http://materializecss.com)
10438	+ * Copyright 2014-2017 Materialize
10439	+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
10440	+ */
10441	+ var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable \|\| false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
10442	+
10443	+ function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
10444	+
10445	+ // Check for jQuery.
10446	+ if (typeof jQuery === 'undefined') {
10447	+ var jQuery;
10448	+ // Check if require is a defined function.
10449	+ if (true) {
10450	+ jQuery = $ = __webpack_require__(0);
10451	+ // Else use the dollar sign alias.
10452	+ } else {
10453	+ jQuery = $;
10454	+ }
10455	+ }
10456	+ ; /*
10457	+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
10458	+ * Open source under the BSD License.
10459	+ * Copyright © 2008 George McGinley Smith
10460	+ * All rights reserved.
10461	+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
10462	+ */
10463	+
10464	+ (function (factory) {
10465	+ if (true) {
10466	+ !(__WEBPACK_AMD_DEFINE_ARRAY__ = [__webpack_require__(0)], __WEBPACK_AMD_DEFINE_RESULT__ = function ($) {
10467	+ return factory($);
10468	+ }.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
10469	+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
10470	+ } else if (typeof module === "object" && typeof module.exports === "object") {
10471	+ exports = factory(require('jquery'));
10472	+ } else {
10473	+ factory(jQuery);
10474	+ }
10475	+ })(function ($) {
10476	+
10477	+ // Preserve the original jQuery "swing" easing as "jswing"
10478	+ $.easing['jswing'] = $.easing['swing'];
10479	+
10480	+ var pow = Math.pow,
10481	+ sqrt = Math.sqrt,
10482	+ sin = Math.sin,
10483	+ cos = Math.cos,
10484	+ PI = Math.PI,
10485	+ c1 = 1.70158,
10486	+ c2 = c1 * 1.525,
10487	+ c3 = c1 + 1,
10488	+ c4 = 2 * PI / 3,
10489	+ c5 = 2 * PI / 4.5;
10490	+
10491	+ // x is the fraction of animation progress, in the range 0..1
10492	+ function bounceOut(x) {
10493	+ var n1 = 7.5625,
10494	+ d1 = 2.75;
10495	+ if (x < 1 / d1) {
10496	+ return n1 * x * x;
10497	+ } else if (x < 2 / d1) {
10498	+ return n1 * (x -= 1.5 / d1) * x + .75;
10499	+ } else if (x < 2.5 / d1) {
10500	+ return n1 * (x -= 2.25 / d1) * x + .9375;
10501	+ } else {
10502	+ return n1 * (x -= 2.625 / d1) * x + .984375;
10503	+ }
10504	+ }
10505	+
10506	+ $.extend($.easing, {
10507	+ def: 'easeOutQuad',
10508	+ swing: function (x) {
10509	+ return $.easing[$.easing.def](x);
10510	+ },
10511	+ easeInQuad: function (x) {
10512	+ return x * x;
10513	+ },
10514	+ easeOutQuad: function (x) {
10515	+ return 1 - (1 - x) * (1 - x);
10516	+ },
10517	+ easeInOutQuad: function (x) {
10518	+ return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
10519	+ },
10520	+ easeInCubic: function (x) {
10521	+ return x * x * x;
10522	+ },
10523	+ easeOutCubic: function (x) {
10524	+ return 1 - pow(1 - x, 3);
10525	+ },
10526	+ easeInOutCubic: function (x) {
10527	+ return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
10528	+ },
10529	+ easeInQuart: function (x) {
10530	+ return x * x * x * x;
10531	+ },
10532	+ easeOutQuart: function (x) {
10533	+ return 1 - pow(1 - x, 4);
10534	+ },
10535	+ easeInOutQuart: function (x) {
10536	+ return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
10537	+ },
10538	+ easeInQuint: function (x) {
10539	+ return x * x * x * x * x;
10540	+ },
10541	+ easeOutQuint: function (x) {
10542	+ return 1 - pow(1 - x, 5);
10543	+ },
10544	+ easeInOutQuint: function (x) {
10545	+ return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
10546	+ },
10547	+ easeInSine: function (x) {
10548	+ return 1 - cos(x * PI / 2);
10549	+ },
10550	+ easeOutSine: function (x) {
10551	+ return sin(x * PI / 2);
10552	+ },
10553	+ easeInOutSine: function (x) {
10554	+ return -(cos(PI * x) - 1) / 2;
10555	+ },
10556	+ easeInExpo: function (x) {
10557	+ return x === 0 ? 0 : pow(2, 10 * x - 10);
10558	+ },
10559	+ easeOutExpo: function (x) {
10560	+ return x === 1 ? 1 : 1 - pow(2, -10 * x);
10561	+ },
10562	+ easeInOutExpo: function (x) {
10563	+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
10564	+ },
10565	+ easeInCirc: function (x) {
10566	+ return 1 - sqrt(1 - pow(x, 2));
10567	+ },
10568	+ easeOutCirc: function (x) {
10569	+ return sqrt(1 - pow(x - 1, 2));
10570	+ },
10571	+ easeInOutCirc: function (x) {
10572	+ return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
10573	+ },
10574	+ easeInElastic: function (x) {
10575	+ return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
10576	+ },
10577	+ easeOutElastic: function (x) {
10578	+ return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
10579	+ },
10580	+ easeInOutElastic: function (x) {
10581	+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
10582	+ },
10583	+ easeInBack: function (x) {
10584	+ return c3 * x * x * x - c1 * x * x;
10585	+ },
10586	+ easeOutBack: function (x) {
10587	+ return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
10588	+ },
10589	+ easeInOutBack: function (x) {
10590	+ return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
10591	+ },
10592	+ easeInBounce: function (x) {
10593	+ return 1 - bounceOut(1 - x);
10594	+ },
10595	+ easeOutBounce: bounceOut,
10596	+ easeInOutBounce: function (x) {
10597	+ return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
10598	+ }
10599	+ });
10600	+ });; // Custom Easing
10601	+ jQuery.extend(jQuery.easing, {
10602	+ easeInOutMaterial: function (x, t, b, c, d) {
10603	+ if ((t /= d / 2) < 1) return c / 2 * t * t + b;
10604	+ return c / 4 * ((t -= 2) * t * t + 2) + b;
10605	+ }
10606	+ });; /! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License /
10607	+ /! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. /
10608	+ /! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. /
10609	+ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
10610	+ function t(e) {
10611	+ var t = e.length,
10612	+ a = r.type(e);return "function" === a \|\| r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a \|\| 0 === t \|\| "number" == typeof t && t > 0 && t - 1 in e;
10613	+ }if (!e.jQuery) {
10614	+ var r = function (e, t) {
10615	+ return new r.fn.init(e, t);
10616	+ };r.isWindow = function (e) {
10617	+ return null != e && e == e.window;
10618	+ }, r.type = function (e) {
10619	+ return null == e ? e + "" : "object" == typeof e \|\| "function" == typeof e ? n[i.call(e)] \|\| "object" : typeof e;
10620	+ }, r.isArray = Array.isArray \|\| function (e) {
10621	+ return "array" === r.type(e);
10622	+ }, r.isPlainObject = function (e) {
10623	+ var t;if (!e \|\| "object" !== r.type(e) \|\| e.nodeType \|\| r.isWindow(e)) return !1;try {
10624	+ if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
10625	+ } catch (a) {
10626	+ return !1;
10627	+ }for (t in e) {}return void 0 === t \|\| o.call(e, t);
10628	+ }, r.each = function (e, r, a) {
10629	+ var n,
10630	+ o = 0,
10631	+ i = e.length,
10632	+ s = t(e);if (a) {
10633	+ if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
10634	+ if (n = r.apply(e[o], a), n === !1) break;
10635	+ }
10636	+ } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
10637	+ if (n = r.call(e[o], o, e[o]), n === !1) break;
10638	+ }return e;
10639	+ }, r.data = function (e, t, n) {
10640	+ if (void 0 === n) {
10641	+ var o = e[r.expando],
10642	+ i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
10643	+ } else if (void 0 !== t) {
10644	+ var o = e[r.expando] \|\| (e[r.expando] = ++r.uuid);return a[o] = a[o] \|\| {}, a[o][t] = n, n;
10645	+ }
10646	+ }, r.removeData = function (e, t) {
10647	+ var n = e[r.expando],
10648	+ o = n && a[n];o && r.each(t, function (e, t) {
10649	+ delete o[t];
10650	+ });
10651	+ }, r.extend = function () {
10652	+ var e,
10653	+ t,
10654	+ a,
10655	+ n,
10656	+ o,
10657	+ i,
10658	+ s = arguments[0] \|\| {},
10659	+ l = 1,
10660	+ u = arguments.length,
10661	+ c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] \|\| {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
10662	+ if (null != (o = arguments[l])) for (n in o) {
10663	+ e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) \|\| (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
10664	+ }
10665	+ }return s;
10666	+ }, r.queue = function (e, a, n) {
10667	+ function o(e, r) {
10668	+ var a = r \|\| [];return null != e && (t(Object(e)) ? !function (e, t) {
10669	+ for (var r = +t.length, a = 0, n = e.length; r > a;) {
10670	+ e[n++] = t[a++];
10671	+ }if (r !== r) for (; void 0 !== t[a];) {
10672	+ e[n++] = t[a++];
10673	+ }return e.length = n, e;
10674	+ }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
10675	+ }if (e) {
10676	+ a = (a \|\| "fx") + "queue";var i = r.data(e, a);return n ? (!i \|\| r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i \|\| [];
10677	+ }
10678	+ }, r.dequeue = function (e, t) {
10679	+ r.each(e.nodeType ? [e] : e, function (e, a) {
10680	+ t = t \|\| "fx";var n = r.queue(a, t),
10681	+ o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
10682	+ r.dequeue(a, t);
10683	+ }));
10684	+ });
10685	+ }, r.fn = r.prototype = { init: function (e) {
10686	+ if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
10687	+ }, offset: function () {
10688	+ var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset \|\| document.scrollTop \|\| 0) - (document.clientTop \|\| 0), left: t.left + (e.pageXOffset \|\| document.scrollLeft \|\| 0) - (document.clientLeft \|\| 0) };
10689	+ }, position: function () {
10690	+ function e() {
10691	+ for (var e = this.offsetParent \|\| document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
10692	+ e = e.offsetParent;
10693	+ }return e \|\| document;
10694	+ }var t = this[0],
10695	+ e = e.apply(t),
10696	+ a = this.offset(),
10697	+ n = /^(?:body\|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) \|\| 0, a.left -= parseFloat(t.style.marginLeft) \|\| 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) \|\| 0, n.left += parseFloat(e.style.borderLeftWidth) \|\| 0), { top: a.top - n.top, left: a.left - n.left };
10698	+ } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
10699	+ n["[object " + s[l] + "]"] = s[l].toLowerCase();
10700	+ }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
10701	+ }
10702	+ }(window), function (e) {
10703	+ "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : true ? !(__WEBPACK_AMD_DEFINE_FACTORY__ = (e),
10704	+ __WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
10705	+ (__WEBPACK_AMD_DEFINE_FACTORY__.call(exports, __webpack_require__, exports, module)) :
10706	+ __WEBPACK_AMD_DEFINE_FACTORY__),
10707	+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__)) : e();
10708	+ }(function () {
10709	+ return function (e, t, r, a) {
10710	+ function n(e) {
10711	+ for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
10712	+ var n = e[t];n && a.push(n);
10713	+ }return a;
10714	+ }function o(e) {
10715	+ return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
10716	+ }function i(e) {
10717	+ var t = f.data(e, "velocity");return null === t ? a : t;
10718	+ }function s(e) {
10719	+ return function (t) {
10720	+ return Math.round(t * e) * (1 / e);
10721	+ };
10722	+ }function l(e, r, a, n) {
10723	+ function o(e, t) {
10724	+ return 1 - 3 * t + 3 * e;
10725	+ }function i(e, t) {
10726	+ return 3 * t - 6 * e;
10727	+ }function s(e) {
10728	+ return 3 * e;
10729	+ }function l(e, t, r) {
10730	+ return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
10731	+ }function u(e, t, r) {
10732	+ return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
10733	+ }function c(t, r) {
10734	+ for (var n = 0; m > n; ++n) {
10735	+ var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
10736	+ }return r;
10737	+ }function p() {
10738	+ for (var t = 0; b > t; ++t) {
10739	+ w[t] = l(t * x, e, a);
10740	+ }
10741	+ }function f(t, r, n) {
10742	+ var o,
10743	+ i,
10744	+ s = 0;do {
10745	+ i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
10746	+ } while (Math.abs(o) > h && ++s < v);return i;
10747	+ }function d(t) {
10748	+ for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
10749	+ r += x;
10750	+ }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
10751	+ s = r + i * x,
10752	+ l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
10753	+ }function g() {
10754	+ V = !0, (e != r \|\| a != n) && p();
10755	+ }var m = 4,
10756	+ y = .001,
10757	+ h = 1e-7,
10758	+ v = 10,
10759	+ b = 11,
10760	+ x = 1 / (b - 1),
10761	+ S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
10762	+ if ("number" != typeof arguments[P] \|\| isNaN(arguments[P]) \|\| !isFinite(arguments[P])) return !1;
10763	+ }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
10764	+ V = !1,
10765	+ C = function (t) {
10766	+ return V \|\| g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
10767	+ };C.getControlPoints = function () {
10768	+ return [{ x: e, y: r }, { x: a, y: n }];
10769	+ };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
10770	+ return T;
10771	+ }, C;
10772	+ }function u(e, t) {
10773	+ var r = e;return m.isString(e) ? b.Easings[e] \|\| (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
10774	+ }function c(e) {
10775	+ if (e) {
10776	+ var t = new Date().getTime(),
10777	+ r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
10778	+ if (b.State.calls[o]) {
10779	+ var s = b.State.calls[o],
10780	+ l = s[0],
10781	+ u = s[2],
10782	+ d = s[3],
10783	+ g = !!d,
10784	+ y = null;d \|\| (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
10785	+ var P = l[v],
10786	+ V = P.element;if (i(V)) {
10787	+ var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
10788	+ if ("flex" === u.display) {
10789	+ var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
10790	+ S.setPropertyValue(V, "display", t);
10791	+ });
10792	+ }S.setPropertyValue(V, "display", u.display);
10793	+ }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
10794	+ if ("element" !== k) {
10795	+ var A,
10796	+ F = P[k],
10797	+ j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
10798	+ var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
10799	+ }if (F.currentValue = A, "tween" === k) y = A;else {
10800	+ if (S.Hooks.registered[k]) {
10801	+ var H = S.Hooks.getRoot(k),
10802	+ N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
10803	+ }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
10804	+ }
10805	+ }
10806	+ }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
10807	+ }
10808	+ }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
10809	+ }
10810	+ }
10811	+ }b.State.isTicking && w(c);
10812	+ }function p(e, t) {
10813	+ if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
10814	+ var p = r[u].element;if (t \|\| o.loop \|\| ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a \|\| !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
10815	+ i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
10816	+ var r = /^scale/.test(t) ? 1 : 0,
10817	+ n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
10818	+ }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
10819	+ }if (!t && o.complete && !o.loop && u === c - 1) try {
10820	+ o.complete.call(n, n);
10821	+ } catch (g) {
10822	+ setTimeout(function () {
10823	+ throw g;
10824	+ }, 1);
10825	+ }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
10826	+ /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
10827	+ }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
10828	+ }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
10829	+ if (b.State.calls[m] !== !1) {
10830	+ l = !0;break;
10831	+ }
10832	+ }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
10833	+ }var f,
10834	+ d = function () {
10835	+ if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
10836	+ var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
10837	+ }return a;
10838	+ }(),
10839	+ g = function () {
10840	+ var e = 0;return t.webkitRequestAnimationFrame \|\| t.mozRequestAnimationFrame \|\| function (t) {
10841	+ var r,
10842	+ a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
10843	+ t(a + r);
10844	+ }, r);
10845	+ };
10846	+ }(),
10847	+ m = { isString: function (e) {
10848	+ return "string" == typeof e;
10849	+ }, isArray: Array.isArray \|\| function (e) {
10850	+ return "[object Array]" === Object.prototype.toString.call(e);
10851	+ }, isFunction: function (e) {
10852	+ return "[object Function]" === Object.prototype.toString.call(e);
10853	+ }, isNode: function (e) {
10854	+ return e && e.nodeType;
10855	+ }, isNodeList: function (e) {
10856	+ return "object" == typeof e && /^\[object (HTMLCollection\|NodeList\|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length \|\| "object" == typeof e[0] && e[0].nodeType > 0);
10857	+ }, isWrapped: function (e) {
10858	+ return e && (e.jquery \|\| t.Zepto && t.Zepto.zepto.isZ(e));
10859	+ }, isSVG: function (e) {
10860	+ return t.SVGElement && e instanceof t.SVGElement;
10861	+ }, isEmptyObject: function (e) {
10862	+ for (var t in e) {
10863	+ return !1;
10864	+ }return !0;
10865	+ } },
10866	+ y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
10867	+ v = "swing",
10868	+ b = { State: { isMobile: /Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry\|IEMobile\|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
10869	+ f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
10870	+ }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement \|\| r.body.parentNode \|\| r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
10871	+ function e(e) {
10872	+ return -e.tension * e.x - e.friction * e.v;
10873	+ }function t(t, r, a) {
10874	+ var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
10875	+ }function r(r, a) {
10876	+ var n = { dx: r.v, dv: e(r) },
10877	+ o = t(r, .5 * a, n),
10878	+ i = t(r, .5 * a, o),
10879	+ s = t(r, a, i),
10880	+ l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
10881	+ u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
10882	+ }return function a(e, t, n) {
10883	+ var o,
10884	+ i,
10885	+ s,
10886	+ l = { x: -1, v: 0, tension: null, friction: null },
10887	+ u = [0],
10888	+ c = 0,
10889	+ p = 1e-4,
10890	+ f = .016;for (e = parseFloat(e) \|\| 500, t = parseFloat(t) \|\| 20, n = n \|\| null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s \|\| l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
10891	+ return u[e * (u.length - 1) \| 0];
10892	+ } : c;
10893	+ };
10894	+ }();b.Easings = { linear: function (e) {
10895	+ return e;
10896	+ }, swing: function (e) {
10897	+ return .5 - Math.cos(e * Math.PI) / 2;
10898	+ }, spring: function (e) {
10899	+ return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
10900	+ } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
10901	+ b.Easings[t[0]] = l.apply(null, t[1]);
10902	+ });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+$(.*)$$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+$.+$)\|(([A-z0-9#-.]+?)(?=\s\|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
10903	+ for (var e = 0; e < S.Lists.colors.length; e++) {
10904	+ var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
10905	+ }var r, a, n;if (d) for (r in S.Hooks.templates) {
10906	+ a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
10907	+ }for (r in S.Hooks.templates) {
10908	+ a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
10909	+ var i = r + n[e],
10910	+ s = e;S.Hooks.registered[i] = [r, s];
10911	+ }
10912	+ }
10913	+ }, getRoot: function (e) {
10914	+ var t = S.Hooks.registered[e];return t ? t[0] : e;
10915	+ }, cleanRootPropertyValue: function (e, t) {
10916	+ return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
10917	+ }, extractValue: function (e, t) {
10918	+ var r = S.Hooks.registered[e];if (r) {
10919	+ var a = r[0],
10920	+ n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
10921	+ }return t;
10922	+ }, injectValue: function (e, t, r) {
10923	+ var a = S.Hooks.registered[e];if (a) {
10924	+ var n,
10925	+ o,
10926	+ i = a[0],
10927	+ s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
10928	+ }return r;
10929	+ } }, Normalizations: { registered: { clip: function (e, t, r) {
10930	+ switch (e) {case "name":
10931	+ return "clip";case "extract":
10932	+ var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
10933	+ return "rect(" + r + ")";}
10934	+ }, blur: function (e, t, r) {
10935	+ switch (e) {case "name":
10936	+ return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
10937	+ var a = parseFloat(r);if (!a && 0 !== a) {
10938	+ var n = r.toString().match(/blur$([0-9]+[A-z]+)$/i);a = n ? n[1] : 0;
10939	+ }return a;case "inject":
10940	+ return parseFloat(r) ? "blur(" + r + ")" : "none";}
10941	+ }, opacity: function (e, t, r) {
10942	+ if (8 >= d) switch (e) {case "name":
10943	+ return "filter";case "extract":
10944	+ var a = r.toString().match(/alpha$opacity=(.*)$/i);return r = a ? a[1] / 100 : 1;case "inject":
10945	+ return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
10946	+ return "opacity";case "extract":
10947	+ return r;case "inject":
10948	+ return r;}
10949	+ } }, register: function () {
10950	+ 9 >= d \|\| b.State.isGingerbread \|\| (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
10951	+ !function () {
10952	+ var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
10953	+ switch (e) {case "name":
10954	+ return "transform";case "extract":
10955	+ return i(r) === a \|\| i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
10956	+ var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
10957	+ o = !/(%\|px\|em\|rem\|vw\|vh\|\d)$/i.test(n);break;case "scal":case "scale":
10958	+ b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
10959	+ o = !/(deg\|\d)$/i.test(n);break;case "rotate":
10960	+ o = !/(deg\|\d)$/i.test(n);}return o \|\| (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
10961	+ };
10962	+ }();
10963	+ }for (var e = 0; e < S.Lists.colors.length; e++) {
10964	+ !function () {
10965	+ var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
10966	+ switch (e) {case "name":
10967	+ return t;case "extract":
10968	+ var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
10969	+ var i,
10970	+ s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) \|\| (i = s.black), o = (i \|\| n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
10971	+ }return 8 >= d \|\| 3 !== o.split(" ").length \|\| (o += " 1"), o;case "inject":
10972	+ return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
10973	+ };
10974	+ }();
10975	+ }
10976	+ } }, Names: { camelCase: function (e) {
10977	+ return e.replace(/-(\w)/g, function (e, t) {
10978	+ return t.toUpperCase();
10979	+ });
10980	+ }, SVGAttribute: function (e) {
10981	+ var t = "width\|height\|x\|y\|cx\|cy\|r\|rx\|ry\|x1\|x2\|y1\|y2";return (d \|\| b.State.isAndroid && !b.State.isChrome) && (t += "\|transform"), new RegExp("^(" + t + ")$", "i").test(e);
10982	+ }, prefixCheck: function (e) {
10983	+ if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
10984	+ var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
10985	+ return e.toUpperCase();
10986	+ }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
10987	+ }return [e, !1];
10988	+ } }, Values: { hexToRgb: function (e) {
10989	+ var t,
10990	+ r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
10991	+ a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
10992	+ return t + t + r + r + a + a;
10993	+ }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
10994	+ }, isCSSNullValue: function (e) {
10995	+ return 0 == e \|\| /^(none\|auto\|transparent\|(rgba$0, ?0, ?0, ?0$))$/i.test(e);
10996	+ }, getUnitType: function (e) {
10997	+ return (/^(rotate\|skew)/i.test(e) ? "deg" : /(^(scale\|scaleX\|scaleY\|scaleZ\|alpha\|flexGrow\|flexHeight\|zIndex\|fontWeight)$)\|((opacity\|red\|green\|blue\|alpha)$)/i.test(e) ? "" : "px"
10998	+ );
10999	+ }, getDisplayType: function (e) {
11000	+ var t = e && e.tagName.toString().toLowerCase();return (/^(b\|big\|i\|small\|tt\|abbr\|acronym\|cite\|code\|dfn\|em\|kbd\|strong\|samp\|var\|a\|bdo\|br\|img\|map\|object\|q\|script\|span\|sub\|sup\|button\|input\|label\|select\|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
11001	+ );
11002	+ }, addClass: function (e, t) {
11003	+ e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
11004	+ }, removeClass: function (e, t) {
11005	+ e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^\|\\s)" + t.split(" ").join("\|") + "(\\s\|$)", "gi"), " ");
11006	+ } }, getPropertyValue: function (e, r, n, o) {
11007	+ function s(e, r) {
11008	+ function n() {
11009	+ u && S.setPropertyValue(e, "display", "none");
11010	+ }var l = 0;if (8 >= d) l = f.css(e, r);else {
11011	+ var u = !1;if (/^(width\|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
11012	+ if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
11013	+ var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) \|\| 0);return n(), c;
11014	+ }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
11015	+ var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) \|\| 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) \|\| 0);return n(), p;
11016	+ }
11017	+ }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l \|\| null === l) && (l = e.style[r]), n();
11018	+ }if ("auto" === l && /^(top\|right\|bottom\|left)$/i.test(r)) {
11019	+ var m = s(e, "position");("fixed" === m \|\| "absolute" === m && /top\|left/i.test(r)) && (l = f(e).position()[r] + "px");
11020	+ }return l;
11021	+ }var l;if (S.Hooks.registered[r]) {
11022	+ var u = r,
11023	+ c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
11024	+ } else if (S.Normalizations.registered[r]) {
11025	+ var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
11026	+ }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
11027	+ if (/^(height\|width)$/i.test(r)) try {
11028	+ l = e.getBBox()[r];
11029	+ } catch (m) {
11030	+ l = 0;
11031	+ } else l = e.getAttribute(r);
11032	+ } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
11033	+ }, setPropertyValue: function (e, r, a, n, o) {
11034	+ var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
11035	+ if (S.Hooks.registered[r]) {
11036	+ var l = r,
11037	+ u = S.Hooks.getRoot(r);n = n \|\| S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
11038	+ }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
11039	+ e.style[s] = a;
11040	+ } catch (c) {
11041	+ b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
11042	+ } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
11043	+ }return [s, a];
11044	+ }, flushTransformCache: function (e) {
11045	+ function t(t) {
11046	+ return parseFloat(S.getPropertyValue(e, t));
11047	+ }var r = "";if ((d \|\| b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
11048	+ var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
11049	+ /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
11050	+ });
11051	+ } else {
11052	+ var n, o;f.each(i(e).transformCache, function (t) {
11053	+ return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
11054	+ }), o && (r = "perspective" + o + " " + r);
11055	+ }S.setPropertyValue(e, "transform", r);
11056	+ } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
11057	+ var n = a;return e = o(e), f.each(e, function (e, o) {
11058	+ if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
11059	+ var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
11060	+ }
11061	+ }), n;
11062	+ };var P = function () {
11063	+ function e() {
11064	+ return s ? k.promise \|\| null : l;
11065	+ }function n() {
11066	+ function e(e) {
11067	+ function p(e, t) {
11068	+ var r = a,
11069	+ n = a,
11070	+ i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) \|\| m.isFunction(e[1]) \|\| S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) \|\| m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t \|\| (n = n \|\| s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r \|\| 0, n, i];
11071	+ }function d(e, t) {
11072	+ var r, a;return a = (t \|\| "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
11073	+ return r = e, "";
11074	+ }), r \|\| (r = S.Values.getUnitType(e)), [a, r];
11075	+ }function h() {
11076	+ var e = { myParent: o.parentNode \|\| r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
11077	+ a = e.position === L.lastPosition && e.myParent === L.lastParent,
11078	+ n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
11079	+ l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
11080	+ var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
11081	+ b.CSS.setPropertyValue(u, t, "hidden");
11082	+ }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
11083	+ b.CSS.setPropertyValue(u, t, s + "%");
11084	+ }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) \|\| 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) \|\| 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) \|\| 1) / s, e.myParent.removeChild(u);
11085	+ }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) \|\| 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
11086	+ }if (s.begin && 0 === V) try {
11087	+ s.begin.call(g, g);
11088	+ } catch (x) {
11089	+ setTimeout(function () {
11090	+ throw x;
11091	+ }, 1);
11092	+ }if ("scroll" === A) {
11093	+ var P,
11094	+ C,
11095	+ T,
11096	+ F = /^x$/i.test(s.axis) ? "Left" : "Top",
11097	+ j = parseFloat(s.offset) \|\| 0;s.container ? m.isWrapped(s.container) \|\| m.isNode(s.container) ? (s.container = s.container[0] \|\| s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
11098	+ } else if ("reverse" === A) {
11099	+ if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing \|\| delete s.easing, v.duration \|\| delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
11100	+ if ("element" !== H) {
11101	+ var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) \|\| (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
11102	+ }
11103	+ }l = E;
11104	+ } else if ("start" === A) {
11105	+ var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
11106	+ if (RegExp("^" + S.Lists.colors.join("$\|^") + "$").test(e)) {
11107	+ var r = p(t, !0),
11108	+ n = r[0],
11109	+ o = r[1],
11110	+ i = r[2];if (S.RegEx.isHex.test(n)) {
11111	+ for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
11112	+ var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
11113	+ }delete y[e];
11114	+ }
11115	+ }
11116	+ });for (var z in y) {
11117	+ var O = p(y[z]),
11118	+ q = O[0],
11119	+ $ = O[1],
11120	+ M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
11121	+ B = !1;if (i(o).isSVG \|\| "tween" === I \|\| S.Names.prefixCheck(I)[1] !== !1 \|\| S.Normalizations.registered[I] !== a) {
11122	+ (s.display !== a && null !== s.display && "none" !== s.display \|\| s.visibility !== a && "hidden" !== s.visibility) && /opacity\|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
11123	+ G,
11124	+ Y,
11125	+ D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
11126	+ return D = t, "";
11127	+ }), G = W[1], M = parseFloat(M) \|\| 0, q = parseFloat(q) \|\| 0, "%" === G && (/^(fontSize\|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red\|Green\|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
11128	+ n = n \|\| h();var Q = /margin\|padding\|left\|right\|width\|text\|word\|letter/i.test(z) \|\| /X$/.test(z) \|\| "x" === z ? "x" : "y";switch (Y) {case "%":
11129	+ M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
11130	+ break;default:
11131	+ M *= n[Y + "ToPx"];}switch (G) {case "%":
11132	+ M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
11133	+ break;default:
11134	+ M *= 1 / n[G + "ToPx"];}
11135	+ }switch (D) {case "+":
11136	+ q = M + q;break;case "-":
11137	+ q = M - q;break;case "*":
11138	+ q = M * q;break;case "/":
11139	+ q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
11140	+ } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
11141	+ }l.element = o;
11142	+ }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
11143	+ }var n,
11144	+ o = this,
11145	+ s = f.extend({}, b.defaults, v),
11146	+ l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
11147	+ b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
11148	+ }), s.duration.toString().toLowerCase()) {case "fast":
11149	+ s.duration = 200;break;case "normal":
11150	+ s.duration = h;break;case "slow":
11151	+ s.duration = 600;break;default:
11152	+ s.duration = parseFloat(s.duration) \|\| 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration = parseFloat(b.mock) \|\| 1, s.delay = parseFloat(b.mock) \|\| 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
11153	+ return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
11154	+ }), "" !== s.queue && "fx" !== s.queue \|\| "inprogress" === f.queue(o)[0] \|\| f.dequeue(o);
11155	+ }var s,
11156	+ l,
11157	+ d,
11158	+ g,
11159	+ y,
11160	+ v,
11161	+ x = arguments[0] && (arguments[0].p \|\| f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names \|\| m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements \|\| arguments[0].e : arguments[0]), g = o(g)) {
11162	+ x ? (y = arguments[0].properties \|\| arguments[0].p, v = arguments[0].options \|\| arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
11163	+ V = 0;if (!/^(stop\|finish)$/i.test(y) && !f.isPlainObject(v)) {
11164	+ var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
11165	+ m.isArray(arguments[T]) \|\| !/^(fast\|normal\|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) \|\| m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
11166	+ }
11167	+ }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
11168	+ k.resolver = e, k.rejecter = t;
11169	+ }));var A;switch (y) {case "scroll":
11170	+ A = "scroll";break;case "reverse":
11171	+ A = "reverse";break;case "finish":case "stop":
11172	+ f.each(g, function (e, t) {
11173	+ i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
11174	+ });var F = [];return f.each(b.State.calls, function (e, t) {
11175	+ t && f.each(t[1], function (r, n) {
11176	+ var o = v === a ? "" : v;return o === !0 \|\| t[2].queue === o \|\| v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
11177	+ a === n && ((v === !0 \|\| m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
11178	+ m.isFunction(t) && t(null, !0);
11179	+ }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
11180	+ t.endValue = t.currentValue;
11181	+ }), F.push(e)) : "finish" === y && (t[2].duration = 1));
11182	+ }) : !0;
11183	+ });
11184	+ }), "stop" === y && (f.each(F, function (e, t) {
11185	+ p(t, !0);
11186	+ }), k.promise && k.resolver(g)), e();default:
11187	+ if (!f.isPlainObject(y) \|\| m.isEmptyObject(y)) {
11188	+ if (m.isString(y) && b.Redirects[y]) {
11189	+ var j = f.extend({}, v),
11190	+ E = j.duration,
11191	+ H = j.delay \|\| 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
11192	+ parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) \|\| (/^(callout\|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j \|\| {}, e, w, g, k.promise ? k : a);
11193	+ }), e();
11194	+ }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
11195	+ }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
11196	+ R = [];f.each(g, function (e, t) {
11197	+ m.isNode(t) && n.call(t);
11198	+ });var z,
11199	+ j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
11200	+ var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
11201	+ }return e();
11202	+ }
11203	+ };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame \|\| g;return b.State.isMobile \|\| r.hidden === a \|\| r.addEventListener("visibilitychange", function () {
11204	+ r.hidden ? (w = function (e) {
11205	+ return setTimeout(function () {
11206	+ e(!0);
11207	+ }, 16);
11208	+ }, c()) : w = t.requestAnimationFrame \|\| g;
11209	+ }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
11210	+ b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
11211	+ var l = f.extend({}, r),
11212	+ u = l.begin,
11213	+ c = l.complete,
11214	+ p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
11215	+ d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
11216	+ u && u.call(i, i);for (var r in p) {
11217	+ d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
11218	+ }d.overflow = e.style.overflow, e.style.overflow = "hidden";
11219	+ }, l.complete = function () {
11220	+ for (var t in d) {
11221	+ e.style[t] = d[t];
11222	+ }c && c.call(i, i), s && s.resolver(i);
11223	+ }, b(e, p, l);
11224	+ };
11225	+ }), f.each(["In", "Out"], function (e, t) {
11226	+ b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
11227	+ var l = f.extend({}, r),
11228	+ u = { opacity: "In" === t ? 1 : 0 },
11229	+ c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
11230	+ c && c.call(i, i), s && s.resolver(i);
11231	+ }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
11232	+ };
11233	+ }), b;
11234	+ }(window.jQuery \|\| window.Zepto \|\| window, window, document);
11235	+ }));
11236	+ ;!function (a, b, c, d) {
11237	+ "use strict";
11238	+ function k(a, b, c) {
11239	+ return setTimeout(q(a, c), b);
11240	+ }function l(a, b, c) {
11241	+ return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
11242	+ }function m(a, b, c) {
11243	+ var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
11244	+ b.call(c, a[e], e, a), e++;
11245	+ } else for (e in a) {
11246	+ a.hasOwnProperty(e) && b.call(c, a[e], e, a);
11247	+ }
11248	+ }function n(a, b, c) {
11249	+ for (var e = Object.keys(b), f = 0; f < e.length;) {
11250	+ (!c \|\| c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
11251	+ }return a;
11252	+ }function o(a, b) {
11253	+ return n(a, b, !0);
11254	+ }function p(a, b, c) {
11255	+ var e,
11256	+ d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
11257	+ }function q(a, b) {
11258	+ return function () {
11259	+ return a.apply(b, arguments);
11260	+ };
11261	+ }function r(a, b) {
11262	+ return typeof a == g ? a.apply(b ? b[0] \|\| d : d, b) : a;
11263	+ }function s(a, b) {
11264	+ return a === d ? b : a;
11265	+ }function t(a, b, c) {
11266	+ m(x(b), function (b) {
11267	+ a.addEventListener(b, c, !1);
11268	+ });
11269	+ }function u(a, b, c) {
11270	+ m(x(b), function (b) {
11271	+ a.removeEventListener(b, c, !1);
11272	+ });
11273	+ }function v(a, b) {
11274	+ for (; a;) {
11275	+ if (a == b) return !0;a = a.parentNode;
11276	+ }return !1;
11277	+ }function w(a, b) {
11278	+ return a.indexOf(b) > -1;
11279	+ }function x(a) {
11280	+ return a.trim().split(/\s+/g);
11281	+ }function y(a, b, c) {
11282	+ if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
11283	+ if (c && a[d][c] == b \|\| !c && a[d] === b) return d;d++;
11284	+ }return -1;
11285	+ }function z(a) {
11286	+ return Array.prototype.slice.call(a, 0);
11287	+ }function A(a, b, c) {
11288	+ for (var d = [], e = [], f = 0; f < a.length;) {
11289	+ var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
11290	+ }return c && (d = b ? d.sort(function (a, c) {
11291	+ return a[b] > c[b];
11292	+ }) : d.sort()), d;
11293	+ }function B(a, b) {
11294	+ for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
11295	+ if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
11296	+ }return d;
11297	+ }function D() {
11298	+ return C++;
11299	+ }function E(a) {
11300	+ var b = a.ownerDocument;return b.defaultView \|\| b.parentWindow;
11301	+ }function ab(a, b) {
11302	+ var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
11303	+ r(a.options.enable, [a]) && c.handler(b);
11304	+ }, this.init();
11305	+ }function bb(a) {
11306	+ var b,
11307	+ c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
11308	+ }function cb(a, b, c) {
11309	+ var d = c.pointers.length,
11310	+ e = c.changedPointers.length,
11311	+ f = b & O && 0 === d - e,
11312	+ g = b & (Q \| R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
11313	+ }function db(a, b) {
11314	+ var c = a.session,
11315	+ d = b.pointers,
11316	+ e = d.length;c.firstInput \|\| (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
11317	+ g = c.firstMultiple,
11318	+ h = g ? g.center : f.center,
11319	+ i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
11320	+ }function eb(a, b) {
11321	+ var c = b.center,
11322	+ d = a.offsetDelta \|\| {},
11323	+ e = a.prevDelta \|\| {},
11324	+ f = a.prevInput \|\| {};(b.eventType === O \|\| f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX \|\| 0, y: f.deltaY \|\| 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
11325	+ }function fb(a, b) {
11326	+ var f,
11327	+ g,
11328	+ h,
11329	+ j,
11330	+ c = a.lastInterval \|\| b,
11331	+ e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N \|\| c.velocity === d)) {
11332	+ var k = c.deltaX - b.deltaX,
11333	+ l = c.deltaY - b.deltaY,
11334	+ m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
11335	+ } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
11336	+ }function gb(a) {
11337	+ for (var b = [], c = 0; c < a.pointers.length;) {
11338	+ b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
11339	+ }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
11340	+ }function hb(a) {
11341	+ var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
11342	+ c += a[e].clientX, d += a[e].clientY, e++;
11343	+ }return { x: h(c / b), y: h(d / b) };
11344	+ }function ib(a, b, c) {
11345	+ return { x: b / a \|\| 0, y: c / a \|\| 0 };
11346	+ }function jb(a, b) {
11347	+ return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
11348	+ }function kb(a, b, c) {
11349	+ c \|\| (c = $);var d = b[c[0]] - a[c[0]],
11350	+ e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
11351	+ }function lb(a, b, c) {
11352	+ c \|\| (c = $);var d = b[c[0]] - a[c[0]],
11353	+ e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
11354	+ }function mb(a, b) {
11355	+ return lb(b[1], b[0], _) - lb(a[1], a[0], _);
11356	+ }function nb(a, b) {
11357	+ return kb(b[0], b[1], _) / kb(a[0], a[1], _);
11358	+ }function rb() {
11359	+ this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
11360	+ }function wb() {
11361	+ this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
11362	+ }function Ab() {
11363	+ this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
11364	+ }function Bb(a, b) {
11365	+ var c = z(a.touches),
11366	+ d = z(a.changedTouches);return b & (Q \| R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
11367	+ }function Eb() {
11368	+ this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
11369	+ }function Fb(a, b) {
11370	+ var c = z(a.touches),
11371	+ d = this.targetIds;if (b & (O \| P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
11372	+ f,
11373	+ g = z(a.changedTouches),
11374	+ h = [],
11375	+ i = this.target;if (f = c.filter(function (a) {
11376	+ return v(a.target, i);
11377	+ }), b === O) for (e = 0; e < f.length;) {
11378	+ d[f[e].identifier] = !0, e++;
11379	+ }for (e = 0; e < g.length;) {
11380	+ d[g[e].identifier] && h.push(g[e]), b & (Q \| R) && delete d[g[e].identifier], e++;
11381	+ }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
11382	+ }function Gb() {
11383	+ ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
11384	+ }function Pb(a, b) {
11385	+ this.manager = a, this.set(b);
11386	+ }function Qb(a) {
11387	+ if (w(a, Mb)) return Mb;var b = w(a, Nb),
11388	+ c = w(a, Ob);return b && c ? Nb + " " + Ob : b \|\| c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
11389	+ }function Yb(a) {
11390	+ this.id = D(), this.manager = null, this.options = o(a \|\| {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
11391	+ }function Zb(a) {
11392	+ return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
11393	+ }function $b(a) {
11394	+ return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
11395	+ }function _b(a, b) {
11396	+ var c = b.manager;return c ? c.get(a) : a;
11397	+ }function ac() {
11398	+ Yb.apply(this, arguments);
11399	+ }function bc() {
11400	+ ac.apply(this, arguments), this.pX = null, this.pY = null;
11401	+ }function cc() {
11402	+ ac.apply(this, arguments);
11403	+ }function dc() {
11404	+ Yb.apply(this, arguments), this._timer = null, this._input = null;
11405	+ }function ec() {
11406	+ ac.apply(this, arguments);
11407	+ }function fc() {
11408	+ ac.apply(this, arguments);
11409	+ }function gc() {
11410	+ Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
11411	+ }function hc(a, b) {
11412	+ return b = b \|\| {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
11413	+ }function kc(a, b) {
11414	+ b = b \|\| {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget \|\| a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
11415	+ var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
11416	+ }, this);
11417	+ }function lc(a, b) {
11418	+ var c = a.element;m(a.options.cssProps, function (a, d) {
11419	+ c.style[B(c.style, d)] = b ? a : "";
11420	+ });
11421	+ }function mc(a, c) {
11422	+ var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
11423	+ }var e = ["", "webkit", "moz", "MS", "ms", "o"],
11424	+ f = b.createElement("div"),
11425	+ g = "function",
11426	+ h = Math.round,
11427	+ i = Math.abs,
11428	+ j = Date.now,
11429	+ C = 1,
11430	+ F = /mobile\|tablet\|ip(ad\|hone\|od)\|android/i,
11431	+ G = "ontouchstart" in a,
11432	+ H = B(a, "PointerEvent") !== d,
11433	+ I = G && F.test(navigator.userAgent),
11434	+ J = "touch",
11435	+ K = "pen",
11436	+ L = "mouse",
11437	+ M = "kinect",
11438	+ N = 25,
11439	+ O = 1,
11440	+ P = 2,
11441	+ Q = 4,
11442	+ R = 8,
11443	+ S = 1,
11444	+ T = 2,
11445	+ U = 4,
11446	+ V = 8,
11447	+ W = 16,
11448	+ X = T \| U,
11449	+ Y = V \| W,
11450	+ Z = X \| Y,
11451	+ $ = ["x", "y"],
11452	+ _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
11453	+ this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
11454	+ }, destroy: function () {
11455	+ this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
11456	+ } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
11457	+ pb = "mousedown",
11458	+ qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
11459	+ var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
11460	+ } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
11461	+ tb = { 2: J, 3: K, 4: L, 5: M },
11462	+ ub = "pointerdown",
11463	+ vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
11464	+ var b = this.store,
11465	+ c = !1,
11466	+ d = a.type.toLowerCase().replace("ms", ""),
11467	+ e = sb[d],
11468	+ f = tb[a.pointerType] \|\| a.pointerType,
11469	+ g = f == J,
11470	+ h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button \|\| g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q \| R) && (c = !0), 0 > h \|\| (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
11471	+ } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
11472	+ yb = "touchstart",
11473	+ zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
11474	+ var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
11475	+ var c = Bb.call(this, a, b);b & (Q \| R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
11476	+ }
11477	+ } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
11478	+ Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
11479	+ var b = Cb[a.type],
11480	+ c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
11481	+ } }), p(Gb, ab, { handler: function (a, b, c) {
11482	+ var d = c.pointerType == J,
11483	+ e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q \| R) && (this.mouse.allow = !0), this.callback(a, b, c);
11484	+ }, destroy: function () {
11485	+ this.touch.destroy(), this.mouse.destroy();
11486	+ } });var Hb = B(f.style, "touchAction"),
11487	+ Ib = Hb !== d,
11488	+ Jb = "compute",
11489	+ Kb = "auto",
11490	+ Lb = "manipulation",
11491	+ Mb = "none",
11492	+ Nb = "pan-x",
11493	+ Ob = "pan-y";Pb.prototype = { set: function (a) {
11494	+ a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
11495	+ }, update: function () {
11496	+ this.set(this.manager.options.touchAction);
11497	+ }, compute: function () {
11498	+ var a = [];return m(this.manager.recognizers, function (b) {
11499	+ r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
11500	+ }), Qb(a.join(" "));
11501	+ }, preventDefaults: function (a) {
11502	+ if (!Ib) {
11503	+ var b = a.srcEvent,
11504	+ c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
11505	+ e = w(d, Mb),
11506	+ f = w(d, Ob),
11507	+ g = w(d, Nb);return e \|\| f && c & X \|\| g && c & Y ? this.preventSrc(b) : void 0;
11508	+ }
11509	+ }, preventSrc: function (a) {
11510	+ this.manager.session.prevented = !0, a.preventDefault();
11511	+ } };var Rb = 1,
11512	+ Sb = 2,
11513	+ Tb = 4,
11514	+ Ub = 8,
11515	+ Vb = Ub,
11516	+ Wb = 16,
11517	+ Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
11518	+ return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
11519	+ }, recognizeWith: function (a) {
11520	+ if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] \|\| (b[a.id] = a, a.recognizeWith(this)), this;
11521	+ }, dropRecognizeWith: function (a) {
11522	+ return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
11523	+ }, requireFailure: function (a) {
11524	+ if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
11525	+ }, dropRequireFailure: function (a) {
11526	+ if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
11527	+ }, hasRequireFailures: function () {
11528	+ return this.requireFail.length > 0;
11529	+ }, canRecognizeWith: function (a) {
11530	+ return !!this.simultaneous[a.id];
11531	+ }, emit: function (a) {
11532	+ function d(d) {
11533	+ b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
11534	+ }var b = this,
11535	+ c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
11536	+ }, tryEmit: function (a) {
11537	+ return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
11538	+ }, canEmit: function () {
11539	+ for (var a = 0; a < this.requireFail.length;) {
11540	+ if (!(this.requireFail[a].state & (Xb \| Rb))) return !1;a++;
11541	+ }return !0;
11542	+ }, recognize: function (a) {
11543	+ var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb \| Wb \| Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb \| Tb \| Ub \| Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
11544	+ }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
11545	+ var b = this.options.pointers;return 0 === b \|\| a.pointers.length === b;
11546	+ }, process: function (a) {
11547	+ var b = this.state,
11548	+ c = a.eventType,
11549	+ d = b & (Sb \| Tb),
11550	+ e = this.attrTest(a);return d && (c & R \|\| !e) ? b \| Wb : d \|\| e ? c & Q ? b \| Ub : b & Sb ? b \| Tb : Sb : Xb;
11551	+ } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
11552	+ var a = this.options.direction,
11553	+ b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
11554	+ }, directionTest: function (a) {
11555	+ var b = this.options,
11556	+ c = !0,
11557	+ d = a.distance,
11558	+ e = a.direction,
11559	+ f = a.deltaX,
11560	+ g = a.deltaY;return e & b.direction \|\| (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
11561	+ }, attrTest: function (a) {
11562	+ return ac.prototype.attrTest.call(this, a) && (this.state & Sb \|\| !(this.state & Sb) && this.directionTest(a));
11563	+ }, emit: function (a) {
11564	+ this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
11565	+ } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
11566	+ return [Mb];
11567	+ }, attrTest: function (a) {
11568	+ return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold \|\| this.state & Sb);
11569	+ }, emit: function (a) {
11570	+ if (this._super.emit.call(this, a), 1 !== a.scale) {
11571	+ var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
11572	+ }
11573	+ } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
11574	+ return [Kb];
11575	+ }, process: function (a) {
11576	+ var b = this.options,
11577	+ c = a.pointers.length === b.pointers,
11578	+ d = a.distance < b.threshold,
11579	+ e = a.deltaTime > b.time;if (this._input = a, !d \|\| !c \|\| a.eventType & (Q \| R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
11580	+ this.state = Vb, this.tryEmit();
11581	+ }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
11582	+ }, reset: function () {
11583	+ clearTimeout(this._timer);
11584	+ }, emit: function (a) {
11585	+ this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
11586	+ } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
11587	+ return [Mb];
11588	+ }, attrTest: function (a) {
11589	+ return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold \|\| this.state & Sb);
11590	+ } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X \| Y, pointers: 1 }, getTouchAction: function () {
11591	+ return bc.prototype.getTouchAction.call(this);
11592	+ }, attrTest: function (a) {
11593	+ var c,
11594	+ b = this.options.direction;return b & (X \| Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
11595	+ }, emit: function (a) {
11596	+ var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
11597	+ } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
11598	+ return [Lb];
11599	+ }, process: function (a) {
11600	+ var b = this.options,
11601	+ c = a.pointers.length === b.pointers,
11602	+ d = a.distance < b.threshold,
11603	+ e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
11604	+ if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
11605	+ g = !this.pCenter \|\| kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
11606	+ this.state = Vb, this.tryEmit();
11607	+ }, b.interval, this), Sb) : Vb;
11608	+ }return Xb;
11609	+ }, failTimeout: function () {
11610	+ return this._timer = k(function () {
11611	+ this.state = Xb;
11612	+ }, this.options.interval, this), Xb;
11613	+ }, reset: function () {
11614	+ clearTimeout(this._timer);
11615	+ }, emit: function () {
11616	+ this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
11617	+ } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
11618	+ jc = 2;kc.prototype = { set: function (a) {
11619	+ return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
11620	+ }, stop: function (a) {
11621	+ this.session.stopped = a ? jc : ic;
11622	+ }, recognize: function (a) {
11623	+ var b = this.session;if (!b.stopped) {
11624	+ this.touchAction.preventDefaults(a);var c,
11625	+ d = this.recognizers,
11626	+ e = b.curRecognizer;(!e \|\| e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
11627	+ c = d[f], b.stopped === jc \|\| e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb \| Tb \| Ub) && (e = b.curRecognizer = c), f++;
11628	+ }
11629	+ }
11630	+ }, get: function (a) {
11631	+ if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
11632	+ if (b[c].options.event == a) return b[c];
11633	+ }return null;
11634	+ }, add: function (a) {
11635	+ if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
11636	+ }, remove: function (a) {
11637	+ if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
11638	+ }, on: function (a, b) {
11639	+ var c = this.handlers;return m(x(a), function (a) {
11640	+ c[a] = c[a] \|\| [], c[a].push(b);
11641	+ }), this;
11642	+ }, off: function (a, b) {
11643	+ var c = this.handlers;return m(x(a), function (a) {
11644	+ b ? c[a].splice(y(c[a], b), 1) : delete c[a];
11645	+ }), this;
11646	+ }, emit: function (a, b) {
11647	+ this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
11648	+ b.type = a, b.preventDefault = function () {
11649	+ b.srcEvent.preventDefault();
11650	+ };for (var d = 0; d < c.length;) {
11651	+ c[d](b), d++;
11652	+ }
11653	+ }
11654	+ }, destroy: function () {
11655	+ this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
11656	+ } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), "function" == g && __webpack_require__(7) ? !(__WEBPACK_AMD_DEFINE_RESULT__ = function () {
11657	+ return hc;
11658	+ }.call(exports, __webpack_require__, exports, module),
11659	+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__)) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
11660	+ }(window, document, "Hammer");;(function (factory) {
11661	+ if (true) {
11662	+ !(__WEBPACK_AMD_DEFINE_ARRAY__ = [__webpack_require__(0), __webpack_require__(8)], __WEBPACK_AMD_DEFINE_FACTORY__ = (factory),
11663	+ __WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
11664	+ (__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__),
11665	+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
11666	+ } else if (typeof exports === 'object') {
11667	+ factory(require('jquery'), require('hammerjs'));
11668	+ } else {
11669	+ factory(jQuery, Hammer);
11670	+ }
11671	+ })(function ($, Hammer) {
11672	+ function hammerify(el, options) {
11673	+ var $el = $(el);
11674	+ if (!$el.data("hammer")) {
11675	+ $el.data("hammer", new Hammer($el[0], options));
11676	+ }
11677	+ }
11678	+
11679	+ $.fn.hammer = function (options) {
11680	+ return this.each(function () {
11681	+ hammerify(this, options);
11682	+ });
11683	+ };
11684	+
11685	+ // extend the emit method to also trigger jQuery events
11686	+ Hammer.Manager.prototype.emit = function (originalEmit) {
11687	+ return function (type, data) {
11688	+ originalEmit.call(this, type, data);
11689	+ $(this.element).trigger({
11690	+ type: type,
11691	+ gesture: data
11692	+ });
11693	+ };
11694	+ }(Hammer.Manager.prototype.emit);
11695	+ });
11696	+ ; // Required for Meteor package, the use of window prevents export by Meteor
11697	+ (function (window) {
11698	+ if (window.Package) {
11699	+ Materialize = {};
11700	+ } else {
11701	+ window.Materialize = {};
11702	+ }
11703	+ })(window);
11704	+
11705	+ /*
11706	+ * raf.js
11707	+ * https://github.com/ngryman/raf.js
11708	+ *
11709	+ * original requestAnimationFrame polyfill by Erik Möller
11710	+ * inspired from paul_irish gist and post
11711	+ *
11712	+ * Copyright (c) 2013 ngryman
11713	+ * Licensed under the MIT license.
11714	+ */
11715	+ (function (window) {
11716	+ var lastTime = 0,
11717	+ vendors = ['webkit', 'moz'],
11718	+ requestAnimationFrame = window.requestAnimationFrame,
11719	+ cancelAnimationFrame = window.cancelAnimationFrame,
11720	+ i = vendors.length;
11721	+
11722	+ // try to un-prefix existing raf
11723	+ while (--i >= 0 && !requestAnimationFrame) {
11724	+ requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
11725	+ cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
11726	+ }
11727	+
11728	+ // polyfill with setTimeout fallback
11729	+ // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
11730	+ if (!requestAnimationFrame \|\| !cancelAnimationFrame) {
11731	+ requestAnimationFrame = function (callback) {
11732	+ var now = +Date.now(),
11733	+ nextTime = Math.max(lastTime + 16, now);
11734	+ return setTimeout(function () {
11735	+ callback(lastTime = nextTime);
11736	+ }, nextTime - now);
11737	+ };
11738	+
11739	+ cancelAnimationFrame = clearTimeout;
11740	+ }
11741	+
11742	+ // export to window
11743	+ window.requestAnimationFrame = requestAnimationFrame;
11744	+ window.cancelAnimationFrame = cancelAnimationFrame;
11745	+ })(window);
11746	+
11747	+ /**
11748	+ * Generate approximated selector string for a jQuery object
11749	+ * @param {jQuery} obj jQuery object to be parsed
11750	+ * @returns {string}
11751	+ */
11752	+ Materialize.objectSelectorString = function (obj) {
11753	+ var tagStr = obj.prop('tagName') \|\| '';
11754	+ var idStr = obj.attr('id') \|\| '';
11755	+ var classStr = obj.attr('class') \|\| '';
11756	+ return (tagStr + idStr + classStr).replace(/\s/g, '');
11757	+ };
11758	+
11759	+ // Unique Random ID
11760	+ Materialize.guid = function () {
11761	+ function s4() {
11762	+ return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
11763	+ }
11764	+ return function () {
11765	+ return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
11766	+ };
11767	+ }();
11768	+
11769	+ /**
11770	+ * Escapes hash from special characters
11771	+ * @param {string} hash String returned from this.hash
11772	+ * @returns {string}
11773	+ */
11774	+ Materialize.escapeHash = function (hash) {
11775	+ return hash.replace(/(:\|\.\|\[\|\]\|,\|=)/g, "\\$1");
11776	+ };
11777	+
11778	+ Materialize.elementOrParentIsFixed = function (element) {
11779	+ var $element = $(element);
11780	+ var $checkElements = $element.add($element.parents());
11781	+ var isFixed = false;
11782	+ $checkElements.each(function () {
11783	+ if ($(this).css("position") === "fixed") {
11784	+ isFixed = true;
11785	+ return false;
11786	+ }
11787	+ });
11788	+ return isFixed;
11789	+ };
11790	+
11791	+ /**
11792	+ * Get time in ms
11793	+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
11794	+ * @type {function}
11795	+ * @return {number}
11796	+ */
11797	+ var getTime = Date.now \|\| function () {
11798	+ return new Date().getTime();
11799	+ };
11800	+
11801	+ /**
11802	+ * Returns a function, that, when invoked, will only be triggered at most once
11803	+ * during a given window of time. Normally, the throttled function will run
11804	+ * as much as it can, without ever going more than once per `wait` duration;
11805	+ * but if you'd like to disable the execution on the leading edge, pass
11806	+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
11807	+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
11808	+ * @param {function} func
11809	+ * @param {number} wait
11810	+ * @param {Object=} options
11811	+ * @returns {Function}
11812	+ */
11813	+ Materialize.throttle = function (func, wait, options) {
11814	+ var context, args, result;
11815	+ var timeout = null;
11816	+ var previous = 0;
11817	+ options \|\| (options = {});
11818	+ var later = function () {
11819	+ previous = options.leading === false ? 0 : getTime();
11820	+ timeout = null;
11821	+ result = func.apply(context, args);
11822	+ context = args = null;
11823	+ };
11824	+ return function () {
11825	+ var now = getTime();
11826	+ if (!previous && options.leading === false) previous = now;
11827	+ var remaining = wait - (now - previous);
11828	+ context = this;
11829	+ args = arguments;
11830	+ if (remaining <= 0) {
11831	+ clearTimeout(timeout);
11832	+ timeout = null;
11833	+ previous = now;
11834	+ result = func.apply(context, args);
11835	+ context = args = null;
11836	+ } else if (!timeout && options.trailing !== false) {
11837	+ timeout = setTimeout(later, remaining);
11838	+ }
11839	+ return result;
11840	+ };
11841	+ };
11842	+
11843	+ // Velocity has conflicts when loaded with jQuery, this will check for it
11844	+ // First, check if in noConflict mode
11845	+ var Vel;
11846	+ if (jQuery) {
11847	+ Vel = jQuery.Velocity;
11848	+ } else if ($) {
11849	+ Vel = $.Velocity;
11850	+ } else {
11851	+ Vel = Velocity;
11852	+ }
11853	+ ;(function ($) {
11854	+ $.fn.collapsible = function (options, methodParam) {
11855	+ var defaults = {
11856	+ accordion: undefined,
11857	+ onOpen: undefined,
11858	+ onClose: undefined
11859	+ };
11860	+
11861	+ var methodName = options;
11862	+ options = $.extend(defaults, options);
11863	+
11864	+ return this.each(function () {
11865	+
11866	+ var $this = $(this);
11867	+
11868	+ var $panel_headers = $(this).find('> li > .collapsible-header');
11869	+
11870	+ var collapsible_type = $this.data("collapsible");
11871	+
11872	+ /****************
11873	+ Helper Functions
11874	+ ****************/
11875	+
11876	+ // Accordion Open
11877	+ function accordionOpen(object) {
11878	+ $panel_headers = $this.find('> li > .collapsible-header');
11879	+ if (object.hasClass('active')) {
11880	+ object.parent().addClass('active');
11881	+ } else {
11882	+ object.parent().removeClass('active');
11883	+ }
11884	+ if (object.parent().hasClass('active')) {
11885	+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
11886	+ $(this).css('height', '');
11887	+ } });
11888	+ } else {
11889	+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
11890	+ $(this).css('height', '');
11891	+ } });
11892	+ }
11893	+
11894	+ $panel_headers.not(object).removeClass('active').parent().removeClass('active');
11895	+
11896	+ // Close previously open accordion elements.
11897	+ $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
11898	+ if ($(this).is(':visible')) {
11899	+ $(this).slideUp({
11900	+ duration: 350,
11901	+ easing: "easeOutQuart",
11902	+ queue: false,
11903	+ complete: function () {
11904	+ $(this).css('height', '');
11905	+ execCallbacks($(this).siblings('.collapsible-header'));
11906	+ }
11907	+ });
11908	+ }
11909	+ });
11910	+ }
11911	+
11912	+ // Expandable Open
11913	+ function expandableOpen(object) {
11914	+ if (object.hasClass('active')) {
11915	+ object.parent().addClass('active');
11916	+ } else {
11917	+ object.parent().removeClass('active');
11918	+ }
11919	+ if (object.parent().hasClass('active')) {
11920	+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
11921	+ $(this).css('height', '');
11922	+ } });
11923	+ } else {
11924	+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
11925	+ $(this).css('height', '');
11926	+ } });
11927	+ }
11928	+ }
11929	+
11930	+ // Open collapsible. object: .collapsible-header
11931	+ function collapsibleOpen(object, noToggle) {
11932	+ if (!noToggle) {
11933	+ object.toggleClass('active');
11934	+ }
11935	+
11936	+ if (options.accordion \|\| collapsible_type === "accordion" \|\| collapsible_type === undefined) {
11937	+ // Handle Accordion
11938	+ accordionOpen(object);
11939	+ } else {
11940	+ // Handle Expandables
11941	+ expandableOpen(object);
11942	+ }
11943	+
11944	+ execCallbacks(object);
11945	+ }
11946	+
11947	+ // Handle callbacks
11948	+ function execCallbacks(object) {
11949	+ if (object.hasClass('active')) {
11950	+ if (typeof options.onOpen === "function") {
11951	+ options.onOpen.call(this, object.parent());
11952	+ }
11953	+ } else {
11954	+ if (typeof options.onClose === "function") {
11955	+ options.onClose.call(this, object.parent());
11956	+ }
11957	+ }
11958	+ }
11959	+
11960	+ /**
11961	+ * Check if object is children of panel header
11962	+ * @param {Object} object Jquery object
11963	+ * @return {Boolean} true if it is children
11964	+ */
11965	+ function isChildrenOfPanelHeader(object) {
11966	+
11967	+ var panelHeader = getPanelHeader(object);
11968	+
11969	+ return panelHeader.length > 0;
11970	+ }
11971	+
11972	+ /**
11973	+ * Get panel header from a children element
11974	+ * @param {Object} object Jquery object
11975	+ * @return {Object} panel header object
11976	+ */
11977	+ function getPanelHeader(object) {
11978	+
11979	+ return object.closest('li > .collapsible-header');
11980	+ }
11981	+
11982	+ // Turn off any existing event handlers
11983	+ function removeEventHandlers() {
11984	+ $this.off('click.collapse', '> li > .collapsible-header');
11985	+ }
11986	+
11987	+ /*** End Helper Functions ***/
11988	+
11989	+ // Methods
11990	+ if (methodName === 'destroy') {
11991	+ removeEventHandlers();
11992	+ return;
11993	+ } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
11994	+ var $curr_header = $panel_headers.eq(methodParam);
11995	+ if ($curr_header.length && (methodName === 'open' \|\| methodName === 'close' && $curr_header.hasClass('active'))) {
11996	+ collapsibleOpen($curr_header);
11997	+ }
11998	+ return;
11999	+ }
12000	+
12001	+ removeEventHandlers();
12002	+
12003	+ // Add click handler to only direct collapsible header children
12004	+ $this.on('click.collapse', '> li > .collapsible-header', function (e) {
12005	+ var element = $(e.target);
12006	+
12007	+ if (isChildrenOfPanelHeader(element)) {
12008	+ element = getPanelHeader(element);
12009	+ }
12010	+
12011	+ collapsibleOpen(element);
12012	+ });
12013	+
12014	+ // Open first active
12015	+ if (options.accordion \|\| collapsible_type === "accordion" \|\| collapsible_type === undefined) {
12016	+ // Handle Accordion
12017	+ collapsibleOpen($panel_headers.filter('.active').first(), true);
12018	+ } else {
12019	+ // Handle Expandables
12020	+ $panel_headers.filter('.active').each(function () {
12021	+ collapsibleOpen($(this), true);
12022	+ });
12023	+ }
12024	+ });
12025	+ };
12026	+
12027	+ $(document).ready(function () {
12028	+ $('.collapsible').collapsible();
12029	+ });
12030	+ })(jQuery);;(function ($) {
12031	+
12032	+ // Add posibility to scroll to selected option
12033	+ // usefull for select for example
12034	+ $.fn.scrollTo = function (elem) {
12035	+ $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
12036	+ return this;
12037	+ };
12038	+
12039	+ $.fn.dropdown = function (options) {
12040	+ var defaults = {
12041	+ inDuration: 300,
12042	+ outDuration: 225,
12043	+ constrainWidth: true, // Constrains width of dropdown to the activator
12044	+ hover: false,
12045	+ gutter: 0, // Spacing from edge
12046	+ belowOrigin: false,
12047	+ alignment: 'left',
12048	+ stopPropagation: false
12049	+ };
12050	+
12051	+ // Open dropdown.
12052	+ if (options === "open") {
12053	+ this.each(function () {
12054	+ $(this).trigger('open');
12055	+ });
12056	+ return false;
12057	+ }
12058	+
12059	+ // Close dropdown.
12060	+ if (options === "close") {
12061	+ this.each(function () {
12062	+ $(this).trigger('close');
12063	+ });
12064	+ return false;
12065	+ }
12066	+
12067	+ this.each(function () {
12068	+ var origin = $(this);
12069	+ var curr_options = $.extend({}, defaults, options);
12070	+ var isFocused = false;
12071	+
12072	+ // Dropdown menu
12073	+ var activates = $("#" + origin.attr('data-activates'));
12074	+
12075	+ function updateOptions() {
12076	+ if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
12077	+ if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
12078	+ if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
12079	+ if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
12080	+ if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
12081	+ if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
12082	+ if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
12083	+ if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
12084	+ }
12085	+
12086	+ updateOptions();
12087	+
12088	+ // Attach dropdown to its activator
12089	+ origin.after(activates);
12090	+
12091	+ /*
12092	+ Helper function to position and resize dropdown.
12093	+ Used in hover and click handler.
12094	+ */
12095	+ function placeDropdown(eventType) {
12096	+ // Check for simultaneous focus and click events.
12097	+ if (eventType === 'focus') {
12098	+ isFocused = true;
12099	+ }
12100	+
12101	+ // Check html data attributes
12102	+ updateOptions();
12103	+
12104	+ // Set Dropdown state
12105	+ activates.addClass('active');
12106	+ origin.addClass('active');
12107	+
12108	+ var originWidth = origin[0].getBoundingClientRect().width;
12109	+
12110	+ // Constrain width
12111	+ if (curr_options.constrainWidth === true) {
12112	+ activates.css('width', originWidth);
12113	+ } else {
12114	+ activates.css('white-space', 'nowrap');
12115	+ }
12116	+
12117	+ // Offscreen detection
12118	+ var windowHeight = window.innerHeight;
12119	+ var originHeight = origin.innerHeight();
12120	+ var offsetLeft = origin.offset().left;
12121	+ var offsetTop = origin.offset().top - $(window).scrollTop();
12122	+ var currAlignment = curr_options.alignment;
12123	+ var gutterSpacing = 0;
12124	+ var leftPosition = 0;
12125	+
12126	+ // Below Origin
12127	+ var verticalOffset = 0;
12128	+ if (curr_options.belowOrigin === true) {
12129	+ verticalOffset = originHeight;
12130	+ }
12131	+
12132	+ // Check for scrolling positioned container.
12133	+ var scrollYOffset = 0;
12134	+ var scrollXOffset = 0;
12135	+ var wrapper = origin.parent();
12136	+ if (!wrapper.is('body')) {
12137	+ if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
12138	+ scrollYOffset = wrapper[0].scrollTop;
12139	+ }
12140	+ if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
12141	+ scrollXOffset = wrapper[0].scrollLeft;
12142	+ }
12143	+ }
12144	+
12145	+ if (offsetLeft + activates.innerWidth() > $(window).width()) {
12146	+ // Dropdown goes past screen on right, force right alignment
12147	+ currAlignment = 'right';
12148	+ } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
12149	+ // Dropdown goes past screen on left, force left alignment
12150	+ currAlignment = 'left';
12151	+ }
12152	+ // Vertical bottom offscreen detection
12153	+ if (offsetTop + activates.innerHeight() > windowHeight) {
12154	+ // If going upwards still goes offscreen, just crop height of dropdown.
12155	+ if (offsetTop + originHeight - activates.innerHeight() < 0) {
12156	+ var adjustedHeight = windowHeight - offsetTop - verticalOffset;
12157	+ activates.css('max-height', adjustedHeight);
12158	+ } else {
12159	+ // Flow upwards.
12160	+ if (!verticalOffset) {
12161	+ verticalOffset += originHeight;
12162	+ }
12163	+ verticalOffset -= activates.innerHeight();
12164	+ }
12165	+ }
12166	+
12167	+ // Handle edge alignment
12168	+ if (currAlignment === 'left') {
12169	+ gutterSpacing = curr_options.gutter;
12170	+ leftPosition = origin.position().left + gutterSpacing;
12171	+ } else if (currAlignment === 'right') {
12172	+ // Material icons fix
12173	+ activates.stop(true, true).css({
12174	+ opacity: 0,
12175	+ left: 0
12176	+ });
12177	+
12178	+ var offsetRight = origin.position().left + originWidth - activates.width();
12179	+ gutterSpacing = -curr_options.gutter;
12180	+ leftPosition = offsetRight + gutterSpacing;
12181	+ }
12182	+
12183	+ // Position dropdown
12184	+ activates.css({
12185	+ position: 'absolute',
12186	+ top: origin.position().top + verticalOffset + scrollYOffset,
12187	+ left: leftPosition + scrollXOffset
12188	+ });
12189	+
12190	+ // Show dropdown
12191	+ activates.slideDown({
12192	+ queue: false,
12193	+ duration: curr_options.inDuration,
12194	+ easing: 'easeOutCubic',
12195	+ complete: function () {
12196	+ $(this).css('height', '');
12197	+ }
12198	+ }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
12199	+
12200	+ // Add click close handler to document
12201	+ setTimeout(function () {
12202	+ $(document).on('click.' + activates.attr('id'), function (e) {
12203	+ hideDropdown();
12204	+ $(document).off('click.' + activates.attr('id'));
12205	+ });
12206	+ }, 0);
12207	+ }
12208	+
12209	+ function hideDropdown() {
12210	+ // Check for simultaneous focus and click events.
12211	+ isFocused = false;
12212	+ activates.fadeOut(curr_options.outDuration);
12213	+ activates.removeClass('active');
12214	+ origin.removeClass('active');
12215	+ $(document).off('click.' + activates.attr('id'));
12216	+ setTimeout(function () {
12217	+ activates.css('max-height', '');
12218	+ }, curr_options.outDuration);
12219	+ }
12220	+
12221	+ // Hover
12222	+ if (curr_options.hover) {
12223	+ var open = false;
12224	+ origin.off('click.' + origin.attr('id'));
12225	+ // Hover handler to show dropdown
12226	+ origin.on('mouseenter', function (e) {
12227	+ // Mouse over
12228	+ if (open === false) {
12229	+ placeDropdown();
12230	+ open = true;
12231	+ }
12232	+ });
12233	+ origin.on('mouseleave', function (e) {
12234	+ // If hover on origin then to something other than dropdown content, then close
12235	+ var toEl = e.toElement \|\| e.relatedTarget; // added browser compatibility for target element
12236	+ if (!$(toEl).closest('.dropdown-content').is(activates)) {
12237	+ activates.stop(true, true);
12238	+ hideDropdown();
12239	+ open = false;
12240	+ }
12241	+ });
12242	+
12243	+ activates.on('mouseleave', function (e) {
12244	+ // Mouse out
12245	+ var toEl = e.toElement \|\| e.relatedTarget;
12246	+ if (!$(toEl).closest('.dropdown-button').is(origin)) {
12247	+ activates.stop(true, true);
12248	+ hideDropdown();
12249	+ open = false;
12250	+ }
12251	+ });
12252	+
12253	+ // Click
12254	+ } else {
12255	+ // Click handler to show dropdown
12256	+ origin.off('click.' + origin.attr('id'));
12257	+ origin.on('click.' + origin.attr('id'), function (e) {
12258	+ if (!isFocused) {
12259	+ if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
12260	+ e.preventDefault(); // Prevents button click from moving window
12261	+ if (curr_options.stopPropagation) {
12262	+ e.stopPropagation();
12263	+ }
12264	+ placeDropdown('click');
12265	+ }
12266	+ // If origin is clicked and menu is open, close menu
12267	+ else if (origin.hasClass('active')) {
12268	+ hideDropdown();
12269	+ $(document).off('click.' + activates.attr('id'));
12270	+ }
12271	+ }
12272	+ });
12273	+ } // End else
12274	+
12275	+ // Listen to open and close event - useful for select component
12276	+ origin.on('open', function (e, eventType) {
12277	+ placeDropdown(eventType);
12278	+ });
12279	+ origin.on('close', hideDropdown);
12280	+ });
12281	+ }; // End dropdown plugin
12282	+
12283	+ $(document).ready(function () {
12284	+ $('.dropdown-button').dropdown();
12285	+ });
12286	+ })(jQuery);
12287	+ ;(function ($) {
12288	+ 'use strict';
12289	+
12290	+ var _defaults = {
12291	+ opacity: 0.5,
12292	+ inDuration: 250,
12293	+ outDuration: 250,
12294	+ ready: undefined,
12295	+ complete: undefined,
12296	+ dismissible: true,
12297	+ startingTop: '4%',
12298	+ endingTop: '10%'
12299	+ };
12300	+
12301	+ /**
12302	+ * @class
12303	+ *
12304	+ */
12305	+
12306	+ var Modal = function () {
12307	+ /**
12308	+ * Construct Modal instance and set up overlay
12309	+ * @constructor
12310	+ * @param {jQuery} $el
12311	+ * @param {Object} options
12312	+ */
12313	+ function Modal($el, options) {
12314	+ _classCallCheck(this, Modal);
12315	+
12316	+ // If exists, destroy and reinitialize
12317	+ if (!!$el[0].M_Modal) {
12318	+ $el[0].M_Modal.destroy();
12319	+ }
12320	+
12321	+ /**
12322	+ * The jQuery element
12323	+ * @type {jQuery}
12324	+ */
12325	+ this.$el = $el;
12326	+
12327	+ /**
12328	+ * Options for the modal
12329	+ * @member Modal#options
12330	+ * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
12331	+ * @prop {Number} [inDuration=250] - Length in ms of enter transition
12332	+ * @prop {Number} [outDuration=250] - Length in ms of exit transition
12333	+ * @prop {Function} ready - Callback function called when modal is finished entering
12334	+ * @prop {Function} complete - Callback function called when modal is finished exiting
12335	+ * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
12336	+ * @prop {String} [startingTop='4%'] - startingTop
12337	+ * @prop {String} [endingTop='10%'] - endingTop
12338	+ */
12339	+ this.options = $.extend({}, Modal.defaults, options);
12340	+
12341	+ /**
12342	+ * Describes open/close state of modal
12343	+ * @type {Boolean}
12344	+ */
12345	+ this.isOpen = false;
12346	+
12347	+ this.$el[0].M_Modal = this;
12348	+ this.id = $el.attr('id');
12349	+ this.openingTrigger = undefined;
12350	+ this.$overlay = $('<div class="modal-overlay"></div>');
12351	+
12352	+ Modal._increment++;
12353	+ Modal._count++;
12354	+ this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
12355	+ this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
12356	+ this.setupEventHandlers();
12357	+ }
12358	+
12359	+ _createClass(Modal, [{
12360	+ key: 'getInstance',
12361	+
12362	+
12363	+ /**
12364	+ * Get Instance
12365	+ */
12366	+ value: function getInstance() {
12367	+ return this;
12368	+ }
12369	+
12370	+ /**
12371	+ * Teardown component
12372	+ */
12373	+
12374	+ }, {
12375	+ key: 'destroy',
12376	+ value: function destroy() {
12377	+ this.removeEventHandlers();
12378	+ this.$el[0].removeAttribute('style');
12379	+ if (!!this.$overlay[0].parentNode) {
12380	+ this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
12381	+ }
12382	+ this.$el[0].M_Modal = undefined;
12383	+ Modal._count--;
12384	+ }
12385	+
12386	+ /**
12387	+ * Setup Event Handlers
12388	+ */
12389	+
12390	+ }, {
12391	+ key: 'setupEventHandlers',
12392	+ value: function setupEventHandlers() {
12393	+ this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
12394	+ this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
12395	+
12396	+ if (Modal._count === 1) {
12397	+ document.addEventListener('click', this.handleTriggerClick);
12398	+ }
12399	+ this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
12400	+ this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
12401	+ }
12402	+
12403	+ /**
12404	+ * Remove Event Handlers
12405	+ */
12406	+
12407	+ }, {
12408	+ key: 'removeEventHandlers',
12409	+ value: function removeEventHandlers() {
12410	+ if (Modal._count === 0) {
12411	+ document.removeEventListener('click', this.handleTriggerClick);
12412	+ }
12413	+ this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
12414	+ this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
12415	+ }
12416	+
12417	+ /**
12418	+ * Handle Trigger Click
12419	+ * @param {Event} e
12420	+ */
12421	+
12422	+ }, {
12423	+ key: 'handleTriggerClick',
12424	+ value: function handleTriggerClick(e) {
12425	+ var $trigger = $(e.target).closest('.modal-trigger');
12426	+ if (e.target && $trigger.length) {
12427	+ var modalId = $trigger[0].getAttribute('href');
12428	+ if (modalId) {
12429	+ modalId = modalId.slice(1);
12430	+ } else {
12431	+ modalId = $trigger[0].getAttribute('data-target');
12432	+ }
12433	+ var modalInstance = document.getElementById(modalId).M_Modal;
12434	+ if (modalInstance) {
12435	+ modalInstance.open($trigger);
12436	+ }
12437	+ e.preventDefault();
12438	+ }
12439	+ }
12440	+
12441	+ /**
12442	+ * Handle Overlay Click
12443	+ */
12444	+
12445	+ }, {
12446	+ key: 'handleOverlayClick',
12447	+ value: function handleOverlayClick() {
12448	+ if (this.options.dismissible) {
12449	+ this.close();
12450	+ }
12451	+ }
12452	+
12453	+ /**
12454	+ * Handle Modal Close Click
12455	+ * @param {Event} e
12456	+ */
12457	+
12458	+ }, {
12459	+ key: 'handleModalCloseClick',
12460	+ value: function handleModalCloseClick(e) {
12461	+ var $closeTrigger = $(e.target).closest('.modal-close');
12462	+ if (e.target && $closeTrigger.length) {
12463	+ this.close();
12464	+ }
12465	+ }
12466	+
12467	+ /**
12468	+ * Handle Keydown
12469	+ * @param {Event} e
12470	+ */
12471	+
12472	+ }, {
12473	+ key: 'handleKeydown',
12474	+ value: function handleKeydown(e) {
12475	+ // ESC key
12476	+ if (e.keyCode === 27 && this.options.dismissible) {
12477	+ this.close();
12478	+ }
12479	+ }
12480	+
12481	+ /**
12482	+ * Animate in modal
12483	+ */
12484	+
12485	+ }, {
12486	+ key: 'animateIn',
12487	+ value: function animateIn() {
12488	+ var _this = this;
12489	+
12490	+ // Set initial styles
12491	+ $.extend(this.$el[0].style, {
12492	+ display: 'block',
12493	+ opacity: 0
12494	+ });
12495	+ $.extend(this.$overlay[0].style, {
12496	+ display: 'block',
12497	+ opacity: 0
12498	+ });
12499	+
12500	+ // Animate overlay
12501	+ Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
12502	+
12503	+ // Define modal animation options
12504	+ var enterVelocityOptions = {
12505	+ duration: this.options.inDuration,
12506	+ queue: false,
12507	+ ease: 'easeOutCubic',
12508	+ // Handle modal ready callback
12509	+ complete: function () {
12510	+ if (typeof _this.options.ready === 'function') {
12511	+ _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
12512	+ }
12513	+ }
12514	+ };
12515	+
12516	+ // Bottom sheet animation
12517	+ if (this.$el[0].classList.contains('bottom-sheet')) {
12518	+ Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
12519	+
12520	+ // Normal modal animation
12521	+ } else {
12522	+ Vel.hook(this.$el[0], 'scaleX', 0.7);
12523	+ this.$el[0].style.top = this.options.startingTop;
12524	+ Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
12525	+ }
12526	+ }
12527	+
12528	+ /**
12529	+ * Animate out modal
12530	+ */
12531	+
12532	+ }, {
12533	+ key: 'animateOut',
12534	+ value: function animateOut() {
12535	+ var _this2 = this;
12536	+
12537	+ // Animate overlay
12538	+ Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
12539	+
12540	+ // Define modal animation options
12541	+ var exitVelocityOptions = {
12542	+ duration: this.options.outDuration,
12543	+ queue: false,
12544	+ ease: 'easeOutCubic',
12545	+ // Handle modal ready callback
12546	+ complete: function () {
12547	+ _this2.$el[0].style.display = 'none';
12548	+ // Call complete callback
12549	+ if (typeof _this2.options.complete === 'function') {
12550	+ _this2.options.complete.call(_this2, _this2.$el);
12551	+ }
12552	+ _this2.$overlay[0].remove();
12553	+ }
12554	+ };
12555	+
12556	+ // Bottom sheet animation
12557	+ if (this.$el[0].classList.contains('bottom-sheet')) {
12558	+ Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
12559	+
12560	+ // Normal modal animation
12561	+ } else {
12562	+ Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
12563	+ }
12564	+ }
12565	+
12566	+ /**
12567	+ * Open Modal
12568	+ * @param {jQuery} [$trigger]
12569	+ */
12570	+
12571	+ }, {
12572	+ key: 'open',
12573	+ value: function open($trigger) {
12574	+ if (this.isOpen) {
12575	+ return;
12576	+ }
12577	+
12578	+ this.isOpen = true;
12579	+ var body = document.body;
12580	+ body.style.overflow = 'hidden';
12581	+ this.$el[0].classList.add('open');
12582	+ body.appendChild(this.$overlay[0]);
12583	+
12584	+ // Set opening trigger, undefined indicates modal was opened by javascript
12585	+ this.openingTrigger = !!$trigger ? $trigger : undefined;
12586	+
12587	+ if (this.options.dismissible) {
12588	+ this.handleKeydownBound = this.handleKeydown.bind(this);
12589	+ document.addEventListener('keydown', this.handleKeydownBound);
12590	+ }
12591	+
12592	+ this.animateIn();
12593	+
12594	+ return this;
12595	+ }
12596	+
12597	+ /**
12598	+ * Close Modal
12599	+ */
12600	+
12601	+ }, {
12602	+ key: 'close',
12603	+ value: function close() {
12604	+ if (!this.isOpen) {
12605	+ return;
12606	+ }
12607	+
12608	+ this.isOpen = false;
12609	+ this.$el[0].classList.remove('open');
12610	+ document.body.style.overflow = null;
12611	+
12612	+ if (this.options.dismissible) {
12613	+ document.removeEventListener('keydown', this.handleKeydownBound);
12614	+ }
12615	+
12616	+ this.animateOut();
12617	+
12618	+ return this;
12619	+ }
12620	+ }], [{
12621	+ key: 'init',
12622	+ value: function init($els, options) {
12623	+ var arr = [];
12624	+ $els.each(function () {
12625	+ arr.push(new Modal($(this), options));
12626	+ });
12627	+ return arr;
12628	+ }
12629	+ }, {
12630	+ key: 'defaults',
12631	+ get: function () {
12632	+ return _defaults;
12633	+ }
12634	+ }]);
12635	+
12636	+ return Modal;
12637	+ }();
12638	+
12639	+ /**
12640	+ * @static
12641	+ * @memberof Modal
12642	+ */
12643	+
12644	+
12645	+ Modal._increment = 0;
12646	+
12647	+ /**
12648	+ * @static
12649	+ * @memberof Modal
12650	+ */
12651	+ Modal._count = 0;
12652	+
12653	+ window.Materialize.Modal = Modal;
12654	+
12655	+ $.fn.modal = function (methodOrOptions) {
12656	+ // Call plugin method if valid method name is passed in
12657	+ if (Modal.prototype[methodOrOptions]) {
12658	+ // Getter methods
12659	+ if (methodOrOptions.slice(0, 3) === 'get') {
12660	+ return this.first()[0].M_Modal[methodOrOptions]();
12661	+
12662	+ // Void methods
12663	+ } else {
12664	+ return this.each(function () {
12665	+ this.M_Modal[methodOrOptions]();
12666	+ });
12667	+ }
12668	+
12669	+ // Initialize plugin if options or no argument is passed in
12670	+ } else if (typeof methodOrOptions === 'object' \|\| !methodOrOptions) {
12671	+ Modal.init(this, arguments[0]);
12672	+ return this;
12673	+
12674	+ // Return error if an unrecognized method name is passed in
12675	+ } else {
12676	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
12677	+ }
12678	+ };
12679	+ })(jQuery);
12680	+ ;(function ($) {
12681	+
12682	+ $.fn.materialbox = function () {
12683	+
12684	+ return this.each(function () {
12685	+
12686	+ if ($(this).hasClass('initialized')) {
12687	+ return;
12688	+ }
12689	+
12690	+ $(this).addClass('initialized');
12691	+
12692	+ var overlayActive = false;
12693	+ var doneAnimating = true;
12694	+ var inDuration = 275;
12695	+ var outDuration = 200;
12696	+ var origin = $(this);
12697	+ var placeholder = $('<div></div>').addClass('material-placeholder');
12698	+ var originalWidth = 0;
12699	+ var originalHeight = 0;
12700	+ var ancestorsChanged;
12701	+ var ancestor;
12702	+ var originInlineStyles = origin.attr('style');
12703	+ origin.wrap(placeholder);
12704	+
12705	+ // Start click handler
12706	+ origin.on('click', function () {
12707	+ var placeholder = origin.parent('.material-placeholder');
12708	+ var windowWidth = window.innerWidth;
12709	+ var windowHeight = window.innerHeight;
12710	+ var originalWidth = origin.width();
12711	+ var originalHeight = origin.height();
12712	+
12713	+ // If already modal, return to original
12714	+ if (doneAnimating === false) {
12715	+ returnToOriginal();
12716	+ return false;
12717	+ } else if (overlayActive && doneAnimating === true) {
12718	+ returnToOriginal();
12719	+ return false;
12720	+ }
12721	+
12722	+ // Set states
12723	+ doneAnimating = false;
12724	+ origin.addClass('active');
12725	+ overlayActive = true;
12726	+
12727	+ // Set positioning for placeholder
12728	+ placeholder.css({
12729	+ width: placeholder[0].getBoundingClientRect().width,
12730	+ height: placeholder[0].getBoundingClientRect().height,
12731	+ position: 'relative',
12732	+ top: 0,
12733	+ left: 0
12734	+ });
12735	+
12736	+ // Find ancestor with overflow: hidden; and remove it
12737	+ ancestorsChanged = undefined;
12738	+ ancestor = placeholder[0].parentNode;
12739	+ var count = 0;
12740	+ while (ancestor !== null && !$(ancestor).is(document)) {
12741	+ var curr = $(ancestor);
12742	+ if (curr.css('overflow') !== 'visible') {
12743	+ curr.css('overflow', 'visible');
12744	+ if (ancestorsChanged === undefined) {
12745	+ ancestorsChanged = curr;
12746	+ } else {
12747	+ ancestorsChanged = ancestorsChanged.add(curr);
12748	+ }
12749	+ }
12750	+ ancestor = ancestor.parentNode;
12751	+ }
12752	+
12753	+ // Set css on origin
12754	+ origin.css({
12755	+ position: 'absolute',
12756	+ 'z-index': 1000,
12757	+ 'will-change': 'left, top, width, height'
12758	+ }).data('width', originalWidth).data('height', originalHeight);
12759	+
12760	+ // Add overlay
12761	+ var overlay = $('<div id="materialbox-overlay"></div>').css({
12762	+ opacity: 0
12763	+ }).click(function () {
12764	+ if (doneAnimating === true) returnToOriginal();
12765	+ });
12766	+
12767	+ // Put before in origin image to preserve z-index layering.
12768	+ origin.before(overlay);
12769	+
12770	+ // Set dimensions if needed
12771	+ var overlayOffset = overlay[0].getBoundingClientRect();
12772	+ overlay.css({
12773	+ width: windowWidth,
12774	+ height: windowHeight,
12775	+ left: -1 * overlayOffset.left,
12776	+ top: -1 * overlayOffset.top
12777	+ });
12778	+
12779	+ // Animate Overlay
12780	+ overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
12781	+
12782	+ // Add and animate caption if it exists
12783	+ if (origin.data('caption') !== "") {
12784	+ var $photo_caption = $('<div class="materialbox-caption"></div>');
12785	+ $photo_caption.text(origin.data('caption'));
12786	+ $('body').append($photo_caption);
12787	+ $photo_caption.css({ "display": "inline" });
12788	+ $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
12789	+ }
12790	+
12791	+ // Resize Image
12792	+ var ratio = 0;
12793	+ var widthPercent = originalWidth / windowWidth;
12794	+ var heightPercent = originalHeight / windowHeight;
12795	+ var newWidth = 0;
12796	+ var newHeight = 0;
12797	+
12798	+ if (widthPercent > heightPercent) {
12799	+ ratio = originalHeight / originalWidth;
12800	+ newWidth = windowWidth * 0.9;
12801	+ newHeight = windowWidth * 0.9 * ratio;
12802	+ } else {
12803	+ ratio = originalWidth / originalHeight;
12804	+ newWidth = windowHeight * 0.9 * ratio;
12805	+ newHeight = windowHeight * 0.9;
12806	+ }
12807	+
12808	+ // Animate image + set z-index
12809	+ if (origin.hasClass('responsive-img')) {
12810	+ origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
12811	+ complete: function () {
12812	+ origin.css({ left: 0, top: 0 }).velocity({
12813	+ height: newHeight,
12814	+ width: newWidth,
12815	+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
12816	+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
12817	+ }, {
12818	+ duration: inDuration,
12819	+ queue: false,
12820	+ easing: 'easeOutQuad',
12821	+ complete: function () {
12822	+ doneAnimating = true;
12823	+ }
12824	+ });
12825	+ } // End Complete
12826	+ }); // End Velocity
12827	+ } else {
12828	+ origin.css('left', 0).css('top', 0).velocity({
12829	+ height: newHeight,
12830	+ width: newWidth,
12831	+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
12832	+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
12833	+ }, {
12834	+ duration: inDuration,
12835	+ queue: false,
12836	+ easing: 'easeOutQuad',
12837	+ complete: function () {
12838	+ doneAnimating = true;
12839	+ }
12840	+ }); // End Velocity
12841	+ }
12842	+
12843	+ // Handle Exit triggers
12844	+ $(window).on('scroll.materialbox', function () {
12845	+ if (overlayActive) {
12846	+ returnToOriginal();
12847	+ }
12848	+ });
12849	+
12850	+ $(window).on('resize.materialbox', function () {
12851	+ if (overlayActive) {
12852	+ returnToOriginal();
12853	+ }
12854	+ });
12855	+
12856	+ $(document).on('keyup.materialbox', function (e) {
12857	+ // ESC key
12858	+ if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
12859	+ returnToOriginal();
12860	+ }
12861	+ });
12862	+ }); // End click handler
12863	+
12864	+
12865	+ // This function returns the modaled image to the original spot
12866	+ function returnToOriginal() {
12867	+
12868	+ doneAnimating = false;
12869	+
12870	+ var placeholder = origin.parent('.material-placeholder');
12871	+ var windowWidth = window.innerWidth;
12872	+ var windowHeight = window.innerHeight;
12873	+ var originalWidth = origin.data('width');
12874	+ var originalHeight = origin.data('height');
12875	+
12876	+ origin.velocity("stop", true);
12877	+ $('#materialbox-overlay').velocity("stop", true);
12878	+ $('.materialbox-caption').velocity("stop", true);
12879	+
12880	+ // disable exit handlers
12881	+ $(window).off('scroll.materialbox');
12882	+ $(document).off('keyup.materialbox');
12883	+ $(window).off('resize.materialbox');
12884	+
12885	+ $('#materialbox-overlay').velocity({ opacity: 0 }, {
12886	+ duration: outDuration, // Delay prevents animation overlapping
12887	+ queue: false, easing: 'easeOutQuad',
12888	+ complete: function () {
12889	+ // Remove Overlay
12890	+ overlayActive = false;
12891	+ $(this).remove();
12892	+ }
12893	+ });
12894	+
12895	+ // Resize Image
12896	+ origin.velocity({
12897	+ width: originalWidth,
12898	+ height: originalHeight,
12899	+ left: 0,
12900	+ top: 0
12901	+ }, {
12902	+ duration: outDuration,
12903	+ queue: false, easing: 'easeOutQuad',
12904	+ complete: function () {
12905	+ placeholder.css({
12906	+ height: '',
12907	+ width: '',
12908	+ position: '',
12909	+ top: '',
12910	+ left: ''
12911	+ });
12912	+
12913	+ origin.removeAttr('style');
12914	+ origin.attr('style', originInlineStyles);
12915	+
12916	+ // Remove class
12917	+ origin.removeClass('active');
12918	+ doneAnimating = true;
12919	+
12920	+ // Remove overflow overrides on ancestors
12921	+ if (ancestorsChanged) {
12922	+ ancestorsChanged.css('overflow', '');
12923	+ }
12924	+ }
12925	+ });
12926	+
12927	+ // Remove Caption + reset css settings on image
12928	+ $('.materialbox-caption').velocity({ opacity: 0 }, {
12929	+ duration: outDuration, // Delay prevents animation overlapping
12930	+ queue: false, easing: 'easeOutQuad',
12931	+ complete: function () {
12932	+ $(this).remove();
12933	+ }
12934	+ });
12935	+ }
12936	+ });
12937	+ };
12938	+
12939	+ $(document).ready(function () {
12940	+ $('.materialboxed').materialbox();
12941	+ });
12942	+ })(jQuery);
12943	+ ;(function ($) {
12944	+
12945	+ $.fn.parallax = function () {
12946	+ var window_width = $(window).width();
12947	+ // Parallax Scripts
12948	+ return this.each(function (i) {
12949	+ var $this = $(this);
12950	+ $this.addClass('parallax');
12951	+
12952	+ function updateParallax(initial) {
12953	+ var container_height;
12954	+ if (window_width < 601) {
12955	+ container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
12956	+ } else {
12957	+ container_height = $this.height() > 0 ? $this.height() : 500;
12958	+ }
12959	+ var $img = $this.children("img").first();
12960	+ var img_height = $img.height();
12961	+ var parallax_dist = img_height - container_height;
12962	+ var bottom = $this.offset().top + container_height;
12963	+ var top = $this.offset().top;
12964	+ var scrollTop = $(window).scrollTop();
12965	+ var windowHeight = window.innerHeight;
12966	+ var windowBottom = scrollTop + windowHeight;
12967	+ var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
12968	+ var parallax = Math.round(parallax_dist * percentScrolled);
12969	+
12970	+ if (initial) {
12971	+ $img.css('display', 'block');
12972	+ }
12973	+ if (bottom > scrollTop && top < scrollTop + windowHeight) {
12974	+ $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
12975	+ }
12976	+ }
12977	+
12978	+ // Wait for image load
12979	+ $this.children("img").one("load", function () {
12980	+ updateParallax(true);
12981	+ }).each(function () {
12982	+ if (this.complete) $(this).trigger("load");
12983	+ });
12984	+
12985	+ $(window).scroll(function () {
12986	+ window_width = $(window).width();
12987	+ updateParallax(false);
12988	+ });
12989	+
12990	+ $(window).resize(function () {
12991	+ window_width = $(window).width();
12992	+ updateParallax(false);
12993	+ });
12994	+ });
12995	+ };
12996	+ })(jQuery);
12997	+ ;(function ($) {
12998	+
12999	+ var methods = {
13000	+ init: function (options) {
13001	+ var defaults = {
13002	+ onShow: null,
13003	+ swipeable: false,
13004	+ responsiveThreshold: Infinity // breakpoint for swipeable
13005	+ };
13006	+ options = $.extend(defaults, options);
13007	+ var namespace = Materialize.objectSelectorString($(this));
13008	+
13009	+ return this.each(function (i) {
13010	+
13011	+ var uniqueNamespace = namespace + i;
13012	+
13013	+ // For each set of tabs, we want to keep track of
13014	+ // which tab is active and its associated content
13015	+ var $this = $(this),
13016	+ window_width = $(window).width();
13017	+
13018	+ var $active,
13019	+ $content,
13020	+ $links = $this.find('li.tab a'),
13021	+ $tabs_width = $this.width(),
13022	+ $tabs_content = $(),
13023	+ $tabs_wrapper,
13024	+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
13025	+ $indicator,
13026	+ index = prev_index = 0,
13027	+ clicked = false,
13028	+ clickedTimeout,
13029	+ transition = 300;
13030	+
13031	+ // Finds right attribute for indicator based on active tab.
13032	+ // el: jQuery Object
13033	+ var calcRightPos = function (el) {
13034	+ return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
13035	+ };
13036	+
13037	+ // Finds left attribute for indicator based on active tab.
13038	+ // el: jQuery Object
13039	+ var calcLeftPos = function (el) {
13040	+ return Math.floor(el.position().left + $this.scrollLeft());
13041	+ };
13042	+
13043	+ // Animates Indicator to active tab.
13044	+ // prev_index: Number
13045	+ var animateIndicator = function (prev_index) {
13046	+ if (index - prev_index >= 0) {
13047	+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
13048	+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
13049	+ } else {
13050	+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
13051	+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
13052	+ }
13053	+ };
13054	+
13055	+ // Change swipeable according to responsive threshold
13056	+ if (options.swipeable) {
13057	+ if (window_width > options.responsiveThreshold) {
13058	+ options.swipeable = false;
13059	+ }
13060	+ }
13061	+
13062	+ // If the location.hash matches one of the links, use that as the active tab.
13063	+ $active = $($links.filter('[href="' + location.hash + '"]'));
13064	+
13065	+ // If no match is found, use the first link or any with class 'active' as the initial active tab.
13066	+ if ($active.length === 0) {
13067	+ $active = $(this).find('li.tab a.active').first();
13068	+ }
13069	+ if ($active.length === 0) {
13070	+ $active = $(this).find('li.tab a').first();
13071	+ }
13072	+
13073	+ $active.addClass('active');
13074	+ index = $links.index($active);
13075	+ if (index < 0) {
13076	+ index = 0;
13077	+ }
13078	+
13079	+ if ($active[0] !== undefined) {
13080	+ $content = $($active[0].hash);
13081	+ $content.addClass('active');
13082	+ }
13083	+
13084	+ // append indicator then set indicator width to tab width
13085	+ if (!$this.find('.indicator').length) {
13086	+ $this.append('<li class="indicator"></li>');
13087	+ }
13088	+ $indicator = $this.find('.indicator');
13089	+
13090	+ // we make sure that the indicator is at the end of the tabs
13091	+ $this.append($indicator);
13092	+
13093	+ if ($this.is(":visible")) {
13094	+ // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
13095	+ // $indicator.css({"left": index * $tab_width});
13096	+ setTimeout(function () {
13097	+ $indicator.css({ "right": calcRightPos($active) });
13098	+ $indicator.css({ "left": calcLeftPos($active) });
13099	+ }, 0);
13100	+ }
13101	+ $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
13102	+ $tabs_width = $this.width();
13103	+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
13104	+ if (index < 0) {
13105	+ index = 0;
13106	+ }
13107	+ if ($tab_width !== 0 && $tabs_width !== 0) {
13108	+ $indicator.css({ "right": calcRightPos($active) });
13109	+ $indicator.css({ "left": calcLeftPos($active) });
13110	+ }
13111	+ });
13112	+
13113	+ // Initialize Tabs Content.
13114	+ if (options.swipeable) {
13115	+ // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
13116	+ $links.each(function () {
13117	+ var $curr_content = $(Materialize.escapeHash(this.hash));
13118	+ $curr_content.addClass('carousel-item');
13119	+ $tabs_content = $tabs_content.add($curr_content);
13120	+ });
13121	+ $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
13122	+ $tabs_content.css('display', '');
13123	+ $('.tabs-content.carousel').carousel({
13124	+ fullWidth: true,
13125	+ noWrap: true,
13126	+ onCycleTo: function (item) {
13127	+ if (!clicked) {
13128	+ var prev_index = index;
13129	+ index = $tabs_wrapper.index(item);
13130	+ $active.removeClass('active');
13131	+ $active = $links.eq(index);
13132	+ $active.addClass('active');
13133	+ animateIndicator(prev_index);
13134	+ if (typeof options.onShow === "function") {
13135	+ options.onShow.call($this[0], $content);
13136	+ }
13137	+ }
13138	+ }
13139	+ });
13140	+ } else {
13141	+ // Hide the remaining content
13142	+ $links.not($active).each(function () {
13143	+ $(Materialize.escapeHash(this.hash)).hide();
13144	+ });
13145	+ }
13146	+
13147	+ // Bind the click event handler
13148	+ $this.off('click.tabs').on('click.tabs', 'a', function (e) {
13149	+ if ($(this).parent().hasClass('disabled')) {
13150	+ e.preventDefault();
13151	+ return;
13152	+ }
13153	+
13154	+ // Act as regular link if target attribute is specified.
13155	+ if (!!$(this).attr("target")) {
13156	+ return;
13157	+ }
13158	+
13159	+ clicked = true;
13160	+ $tabs_width = $this.width();
13161	+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
13162	+
13163	+ // Make the old tab inactive.
13164	+ $active.removeClass('active');
13165	+ var $oldContent = $content;
13166	+
13167	+ // Update the variables with the new link and content
13168	+ $active = $(this);
13169	+ $content = $(Materialize.escapeHash(this.hash));
13170	+ $links = $this.find('li.tab a');
13171	+ var activeRect = $active.position();
13172	+
13173	+ // Make the tab active.
13174	+ $active.addClass('active');
13175	+ prev_index = index;
13176	+ index = $links.index($(this));
13177	+ if (index < 0) {
13178	+ index = 0;
13179	+ }
13180	+ // Change url to current tab
13181	+ // window.location.hash = $active.attr('href');
13182	+
13183	+ // Swap content
13184	+ if (options.swipeable) {
13185	+ if ($tabs_content.length) {
13186	+ $tabs_content.carousel('set', index, function () {
13187	+ if (typeof options.onShow === "function") {
13188	+ options.onShow.call($this[0], $content);
13189	+ }
13190	+ });
13191	+ }
13192	+ } else {
13193	+ if ($content !== undefined) {
13194	+ $content.show();
13195	+ $content.addClass('active');
13196	+ if (typeof options.onShow === "function") {
13197	+ options.onShow.call(this, $content);
13198	+ }
13199	+ }
13200	+
13201	+ if ($oldContent !== undefined && !$oldContent.is($content)) {
13202	+ $oldContent.hide();
13203	+ $oldContent.removeClass('active');
13204	+ }
13205	+ }
13206	+
13207	+ // Reset clicked state
13208	+ clickedTimeout = setTimeout(function () {
13209	+ clicked = false;
13210	+ }, transition);
13211	+
13212	+ // Update indicator
13213	+ animateIndicator(prev_index);
13214	+
13215	+ // Prevent the anchor's default click action
13216	+ e.preventDefault();
13217	+ });
13218	+ });
13219	+ },
13220	+ select_tab: function (id) {
13221	+ this.find('a[href="#' + id + '"]').trigger('click');
13222	+ }
13223	+ };
13224	+
13225	+ $.fn.tabs = function (methodOrOptions) {
13226	+ if (methods[methodOrOptions]) {
13227	+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
13228	+ } else if (typeof methodOrOptions === 'object' \|\| !methodOrOptions) {
13229	+ // Default to "init"
13230	+ return methods.init.apply(this, arguments);
13231	+ } else {
13232	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
13233	+ }
13234	+ };
13235	+
13236	+ $(document).ready(function () {
13237	+ $('ul.tabs').tabs();
13238	+ });
13239	+ })(jQuery);
13240	+ ;(function ($) {
13241	+ $.fn.tooltip = function (options) {
13242	+ var timeout = null,
13243	+ margin = 5;
13244	+
13245	+ // Defaults
13246	+ var defaults = {
13247	+ delay: 350,
13248	+ tooltip: '',
13249	+ position: 'bottom',
13250	+ html: false
13251	+ };
13252	+
13253	+ // Remove tooltip from the activator
13254	+ if (options === "remove") {
13255	+ this.each(function () {
13256	+ $('#' + $(this).attr('data-tooltip-id')).remove();
13257	+ $(this).removeAttr('data-tooltip-id');
13258	+ $(this).off('mouseenter.tooltip mouseleave.tooltip');
13259	+ });
13260	+ return false;
13261	+ }
13262	+
13263	+ options = $.extend(defaults, options);
13264	+
13265	+ return this.each(function () {
13266	+ var tooltipId = Materialize.guid();
13267	+ var origin = $(this);
13268	+
13269	+ // Destroy old tooltip
13270	+ if (origin.attr('data-tooltip-id')) {
13271	+ $('#' + origin.attr('data-tooltip-id')).remove();
13272	+ }
13273	+
13274	+ origin.attr('data-tooltip-id', tooltipId);
13275	+
13276	+ // Get attributes.
13277	+ var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
13278	+ var setAttributes = function () {
13279	+ allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
13280	+ tooltipDelay = origin.attr('data-delay');
13281	+ tooltipDelay = tooltipDelay === undefined \|\| tooltipDelay === '' ? options.delay : tooltipDelay;
13282	+ tooltipPosition = origin.attr('data-position');
13283	+ tooltipPosition = tooltipPosition === undefined \|\| tooltipPosition === '' ? options.position : tooltipPosition;
13284	+ tooltipText = origin.attr('data-tooltip');
13285	+ tooltipText = tooltipText === undefined \|\| tooltipText === '' ? options.tooltip : tooltipText;
13286	+ };
13287	+ setAttributes();
13288	+
13289	+ var renderTooltipEl = function () {
13290	+ var tooltip = $('<div class="material-tooltip"></div>');
13291	+
13292	+ // Create Text span
13293	+ if (allowHtml) {
13294	+ tooltipText = $('<span></span>').html(tooltipText);
13295	+ } else {
13296	+ tooltipText = $('<span></span>').text(tooltipText);
13297	+ }
13298	+
13299	+ // Create tooltip
13300	+ tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
13301	+
13302	+ // Create backdrop
13303	+ backdrop = $('<div class="backdrop"></div>');
13304	+ backdrop.appendTo(tooltip);
13305	+ return tooltip;
13306	+ };
13307	+ tooltipEl = renderTooltipEl();
13308	+
13309	+ // Destroy previously binded events
13310	+ origin.off('mouseenter.tooltip mouseleave.tooltip');
13311	+ // Mouse In
13312	+ var started = false,
13313	+ timeoutRef;
13314	+ origin.on({ 'mouseenter.tooltip': function (e) {
13315	+ var showTooltip = function () {
13316	+ setAttributes();
13317	+ started = true;
13318	+ tooltipEl.velocity('stop');
13319	+ backdrop.velocity('stop');
13320	+ tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
13321	+
13322	+ // Tooltip positioning
13323	+ var originWidth = origin.outerWidth();
13324	+ var originHeight = origin.outerHeight();
13325	+ var tooltipHeight = tooltipEl.outerHeight();
13326	+ var tooltipWidth = tooltipEl.outerWidth();
13327	+ var tooltipVerticalMovement = '0px';
13328	+ var tooltipHorizontalMovement = '0px';
13329	+ var backdropOffsetWidth = backdrop[0].offsetWidth;
13330	+ var backdropOffsetHeight = backdrop[0].offsetHeight;
13331	+ var scaleXFactor = 8;
13332	+ var scaleYFactor = 8;
13333	+ var scaleFactor = 0;
13334	+ var targetTop, targetLeft, newCoordinates;
13335	+
13336	+ if (tooltipPosition === "top") {
13337	+ // Top Position
13338	+ targetTop = origin.offset().top - tooltipHeight - margin;
13339	+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
13340	+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
13341	+ tooltipVerticalMovement = '-10px';
13342	+ backdrop.css({
13343	+ bottom: 0,
13344	+ left: 0,
13345	+ borderRadius: '14px 14px 0 0',
13346	+ transformOrigin: '50% 100%',
13347	+ marginTop: tooltipHeight,
13348	+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
13349	+ });
13350	+ }
13351	+ // Left Position
13352	+ else if (tooltipPosition === "left") {
13353	+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
13354	+ targetLeft = origin.offset().left - tooltipWidth - margin;
13355	+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
13356	+
13357	+ tooltipHorizontalMovement = '-10px';
13358	+ backdrop.css({
13359	+ top: '-7px',
13360	+ right: 0,
13361	+ width: '14px',
13362	+ height: '14px',
13363	+ borderRadius: '14px 0 0 14px',
13364	+ transformOrigin: '95% 50%',
13365	+ marginTop: tooltipHeight / 2,
13366	+ marginLeft: tooltipWidth
13367	+ });
13368	+ }
13369	+ // Right Position
13370	+ else if (tooltipPosition === "right") {
13371	+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
13372	+ targetLeft = origin.offset().left + originWidth + margin;
13373	+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
13374	+
13375	+ tooltipHorizontalMovement = '+10px';
13376	+ backdrop.css({
13377	+ top: '-7px',
13378	+ left: 0,
13379	+ width: '14px',
13380	+ height: '14px',
13381	+ borderRadius: '0 14px 14px 0',
13382	+ transformOrigin: '5% 50%',
13383	+ marginTop: tooltipHeight / 2,
13384	+ marginLeft: '0px'
13385	+ });
13386	+ } else {
13387	+ // Bottom Position
13388	+ targetTop = origin.offset().top + origin.outerHeight() + margin;
13389	+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
13390	+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
13391	+ tooltipVerticalMovement = '+10px';
13392	+ backdrop.css({
13393	+ top: 0,
13394	+ left: 0,
13395	+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
13396	+ });
13397	+ }
13398	+
13399	+ // Set tooptip css placement
13400	+ tooltipEl.css({
13401	+ top: newCoordinates.y,
13402	+ left: newCoordinates.x
13403	+ });
13404	+
13405	+ // Calculate Scale to fill
13406	+ scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
13407	+ scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
13408	+ scaleFactor = Math.max(scaleXFactor, scaleYFactor);
13409	+
13410	+ tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
13411	+ backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
13412	+ };
13413	+
13414	+ timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
13415	+
13416	+ // Mouse Out
13417	+ },
13418	+ 'mouseleave.tooltip': function () {
13419	+ // Reset State
13420	+ started = false;
13421	+ clearTimeout(timeoutRef);
13422	+
13423	+ // Animate back
13424	+ setTimeout(function () {
13425	+ if (started !== true) {
13426	+ tooltipEl.velocity({
13427	+ opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
13428	+ backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
13429	+ duration: 225,
13430	+ queue: false,
13431	+ complete: function () {
13432	+ backdrop.css({ visibility: 'hidden' });
13433	+ tooltipEl.css({ visibility: 'hidden' });
13434	+ started = false;
13435	+ }
13436	+ });
13437	+ }
13438	+ }, 225);
13439	+ }
13440	+ });
13441	+ });
13442	+ };
13443	+
13444	+ var repositionWithinScreen = function (x, y, width, height) {
13445	+ var newX = x;
13446	+ var newY = y;
13447	+
13448	+ if (newX < 0) {
13449	+ newX = 4;
13450	+ } else if (newX + width > window.innerWidth) {
13451	+ newX -= newX + width - window.innerWidth;
13452	+ }
13453	+
13454	+ if (newY < 0) {
13455	+ newY = 4;
13456	+ } else if (newY + height > window.innerHeight + $(window).scrollTop) {
13457	+ newY -= newY + height - window.innerHeight;
13458	+ }
13459	+
13460	+ return { x: newX, y: newY };
13461	+ };
13462	+
13463	+ $(document).ready(function () {
13464	+ $('.tooltipped').tooltip();
13465	+ });
13466	+ })(jQuery);
13467	+ ; /*!
13468	+ * Waves v0.6.4
13469	+ * http://fian.my.id/Waves
13470	+ *
13471	+ * Copyright 2014 Alfiana E. Sibuea and other contributors
13472	+ * Released under the MIT license
13473	+ * https://github.com/fians/Waves/blob/master/LICENSE
13474	+ */
13475	+
13476	+ ;(function (window) {
13477	+ 'use strict';
13478	+
13479	+ var Waves = Waves \|\| {};
13480	+ var $$ = document.querySelectorAll.bind(document);
13481	+
13482	+ // Find exact position of element
13483	+ function isWindow(obj) {
13484	+ return obj !== null && obj === obj.window;
13485	+ }
13486	+
13487	+ function getWindow(elem) {
13488	+ return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
13489	+ }
13490	+
13491	+ function offset(elem) {
13492	+ var docElem,
13493	+ win,
13494	+ box = { top: 0, left: 0 },
13495	+ doc = elem && elem.ownerDocument;
13496	+
13497	+ docElem = doc.documentElement;
13498	+
13499	+ if (typeof elem.getBoundingClientRect !== typeof undefined) {
13500	+ box = elem.getBoundingClientRect();
13501	+ }
13502	+ win = getWindow(doc);
13503	+ return {
13504	+ top: box.top + win.pageYOffset - docElem.clientTop,
13505	+ left: box.left + win.pageXOffset - docElem.clientLeft
13506	+ };
13507	+ }
13508	+
13509	+ function convertStyle(obj) {
13510	+ var style = '';
13511	+
13512	+ for (var a in obj) {
13513	+ if (obj.hasOwnProperty(a)) {
13514	+ style += a + ':' + obj[a] + ';';
13515	+ }
13516	+ }
13517	+
13518	+ return style;
13519	+ }
13520	+
13521	+ var Effect = {
13522	+
13523	+ // Effect delay
13524	+ duration: 750,
13525	+
13526	+ show: function (e, element) {
13527	+
13528	+ // Disable right click
13529	+ if (e.button === 2) {
13530	+ return false;
13531	+ }
13532	+
13533	+ var el = element \|\| this;
13534	+
13535	+ // Create ripple
13536	+ var ripple = document.createElement('div');
13537	+ ripple.className = 'waves-ripple';
13538	+ el.appendChild(ripple);
13539	+
13540	+ // Get click coordinate and element witdh
13541	+ var pos = offset(el);
13542	+ var relativeY = e.pageY - pos.top;
13543	+ var relativeX = e.pageX - pos.left;
13544	+ var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
13545	+
13546	+ // Support for touch devices
13547	+ if ('touches' in e) {
13548	+ relativeY = e.touches[0].pageY - pos.top;
13549	+ relativeX = e.touches[0].pageX - pos.left;
13550	+ }
13551	+
13552	+ // Attach data to element
13553	+ ripple.setAttribute('data-hold', Date.now());
13554	+ ripple.setAttribute('data-scale', scale);
13555	+ ripple.setAttribute('data-x', relativeX);
13556	+ ripple.setAttribute('data-y', relativeY);
13557	+
13558	+ // Set ripple position
13559	+ var rippleStyle = {
13560	+ 'top': relativeY + 'px',
13561	+ 'left': relativeX + 'px'
13562	+ };
13563	+
13564	+ ripple.className = ripple.className + ' waves-notransition';
13565	+ ripple.setAttribute('style', convertStyle(rippleStyle));
13566	+ ripple.className = ripple.className.replace('waves-notransition', '');
13567	+
13568	+ // Scale the ripple
13569	+ rippleStyle['-webkit-transform'] = scale;
13570	+ rippleStyle['-moz-transform'] = scale;
13571	+ rippleStyle['-ms-transform'] = scale;
13572	+ rippleStyle['-o-transform'] = scale;
13573	+ rippleStyle.transform = scale;
13574	+ rippleStyle.opacity = '1';
13575	+
13576	+ rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
13577	+ rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
13578	+ rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
13579	+ rippleStyle['transition-duration'] = Effect.duration + 'ms';
13580	+
13581	+ rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
13582	+ rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
13583	+ rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
13584	+ rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
13585	+
13586	+ ripple.setAttribute('style', convertStyle(rippleStyle));
13587	+ },
13588	+
13589	+ hide: function (e) {
13590	+ TouchHandler.touchup(e);
13591	+
13592	+ var el = this;
13593	+ var width = el.clientWidth * 1.4;
13594	+
13595	+ // Get first ripple
13596	+ var ripple = null;
13597	+ var ripples = el.getElementsByClassName('waves-ripple');
13598	+ if (ripples.length > 0) {
13599	+ ripple = ripples[ripples.length - 1];
13600	+ } else {
13601	+ return false;
13602	+ }
13603	+
13604	+ var relativeX = ripple.getAttribute('data-x');
13605	+ var relativeY = ripple.getAttribute('data-y');
13606	+ var scale = ripple.getAttribute('data-scale');
13607	+
13608	+ // Get delay beetween mousedown and mouse leave
13609	+ var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
13610	+ var delay = 350 - diff;
13611	+
13612	+ if (delay < 0) {
13613	+ delay = 0;
13614	+ }
13615	+
13616	+ // Fade out ripple after delay
13617	+ setTimeout(function () {
13618	+ var style = {
13619	+ 'top': relativeY + 'px',
13620	+ 'left': relativeX + 'px',
13621	+ 'opacity': '0',
13622	+
13623	+ // Duration
13624	+ '-webkit-transition-duration': Effect.duration + 'ms',
13625	+ '-moz-transition-duration': Effect.duration + 'ms',
13626	+ '-o-transition-duration': Effect.duration + 'ms',
13627	+ 'transition-duration': Effect.duration + 'ms',
13628	+ '-webkit-transform': scale,
13629	+ '-moz-transform': scale,
13630	+ '-ms-transform': scale,
13631	+ '-o-transform': scale,
13632	+ 'transform': scale
13633	+ };
13634	+
13635	+ ripple.setAttribute('style', convertStyle(style));
13636	+
13637	+ setTimeout(function () {
13638	+ try {
13639	+ el.removeChild(ripple);
13640	+ } catch (e) {
13641	+ return false;
13642	+ }
13643	+ }, Effect.duration);
13644	+ }, delay);
13645	+ },
13646	+
13647	+ // Little hack to make <input> can perform waves effect
13648	+ wrapInput: function (elements) {
13649	+ for (var a = 0; a < elements.length; a++) {
13650	+ var el = elements[a];
13651	+
13652	+ if (el.tagName.toLowerCase() === 'input') {
13653	+ var parent = el.parentNode;
13654	+
13655	+ // If input already have parent just pass through
13656	+ if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
13657	+ continue;
13658	+ }
13659	+
13660	+ // Put element class and style to the specified parent
13661	+ var wrapper = document.createElement('i');
13662	+ wrapper.className = el.className + ' waves-input-wrapper';
13663	+
13664	+ var elementStyle = el.getAttribute('style');
13665	+
13666	+ if (!elementStyle) {
13667	+ elementStyle = '';
13668	+ }
13669	+
13670	+ wrapper.setAttribute('style', elementStyle);
13671	+
13672	+ el.className = 'waves-button-input';
13673	+ el.removeAttribute('style');
13674	+
13675	+ // Put element as child
13676	+ parent.replaceChild(wrapper, el);
13677	+ wrapper.appendChild(el);
13678	+ }
13679	+ }
13680	+ }
13681	+ };
13682	+
13683	+ /**
13684	+ * Disable mousedown event for 500ms during and after touch
13685	+ */
13686	+ var TouchHandler = {
13687	+ /* uses an integer rather than bool so there's no issues with
13688	+ * needing to clear timeouts if another touch event occurred
13689	+ * within the 500ms. Cannot mouseup between touchstart and
13690	+ * touchend, nor in the 500ms after touchend. */
13691	+ touches: 0,
13692	+ allowEvent: function (e) {
13693	+ var allow = true;
13694	+
13695	+ if (e.type === 'touchstart') {
13696	+ TouchHandler.touches += 1; //push
13697	+ } else if (e.type === 'touchend' \|\| e.type === 'touchcancel') {
13698	+ setTimeout(function () {
13699	+ if (TouchHandler.touches > 0) {
13700	+ TouchHandler.touches -= 1; //pop after 500ms
13701	+ }
13702	+ }, 500);
13703	+ } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
13704	+ allow = false;
13705	+ }
13706	+
13707	+ return allow;
13708	+ },
13709	+ touchup: function (e) {
13710	+ TouchHandler.allowEvent(e);
13711	+ }
13712	+ };
13713	+
13714	+ /**
13715	+ * Delegated click handler for .waves-effect element.
13716	+ * returns null when .waves-effect element not in "click tree"
13717	+ */
13718	+ function getWavesEffectElement(e) {
13719	+ if (TouchHandler.allowEvent(e) === false) {
13720	+ return null;
13721	+ }
13722	+
13723	+ var element = null;
13724	+ var target = e.target \|\| e.srcElement;
13725	+
13726	+ while (target.parentNode !== null) {
13727	+ if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
13728	+ element = target;
13729	+ break;
13730	+ }
13731	+ target = target.parentNode;
13732	+ }
13733	+ return element;
13734	+ }
13735	+
13736	+ /**
13737	+ * Bubble the click and show effect if .waves-effect elem was found
13738	+ */
13739	+ function showEffect(e) {
13740	+ var element = getWavesEffectElement(e);
13741	+
13742	+ if (element !== null) {
13743	+ Effect.show(e, element);
13744	+
13745	+ if ('ontouchstart' in window) {
13746	+ element.addEventListener('touchend', Effect.hide, false);
13747	+ element.addEventListener('touchcancel', Effect.hide, false);
13748	+ }
13749	+
13750	+ element.addEventListener('mouseup', Effect.hide, false);
13751	+ element.addEventListener('mouseleave', Effect.hide, false);
13752	+ element.addEventListener('dragend', Effect.hide, false);
13753	+ }
13754	+ }
13755	+
13756	+ Waves.displayEffect = function (options) {
13757	+ options = options \|\| {};
13758	+
13759	+ if ('duration' in options) {
13760	+ Effect.duration = options.duration;
13761	+ }
13762	+
13763	+ //Wrap input inside <i> tag
13764	+ Effect.wrapInput($$('.waves-effect'));
13765	+
13766	+ if ('ontouchstart' in window) {
13767	+ document.body.addEventListener('touchstart', showEffect, false);
13768	+ }
13769	+
13770	+ document.body.addEventListener('mousedown', showEffect, false);
13771	+ };
13772	+
13773	+ /**
13774	+ * Attach Waves to an input element (or any element which doesn't
13775	+ * bubble mouseup/mousedown events).
13776	+ * Intended to be used with dynamically loaded forms/inputs, or
13777	+ * where the user doesn't want a delegated click handler.
13778	+ */
13779	+ Waves.attach = function (element) {
13780	+ //FUTURE: automatically add waves classes and allow users
13781	+ // to specify them with an options param? Eg. light/classic/button
13782	+ if (element.tagName.toLowerCase() === 'input') {
13783	+ Effect.wrapInput([element]);
13784	+ element = element.parentNode;
13785	+ }
13786	+
13787	+ if ('ontouchstart' in window) {
13788	+ element.addEventListener('touchstart', showEffect, false);
13789	+ }
13790	+
13791	+ element.addEventListener('mousedown', showEffect, false);
13792	+ };
13793	+
13794	+ window.Waves = Waves;
13795	+
13796	+ document.addEventListener('DOMContentLoaded', function () {
13797	+ Waves.displayEffect();
13798	+ }, false);
13799	+ })(window);
13800	+ ;(function ($) {
13801	+ 'use strict';
13802	+
13803	+ var _defaults = {
13804	+ displayLength: Infinity,
13805	+ inDuration: 300,
13806	+ outDuration: 375,
13807	+ className: undefined,
13808	+ completeCallback: undefined,
13809	+ activationPercent: 0.8
13810	+ };
13811	+
13812	+ var Toast = function () {
13813	+ function Toast(message, displayLength, className, completeCallback) {
13814	+ _classCallCheck(this, Toast);
13815	+
13816	+ if (!message) {
13817	+ return;
13818	+ }
13819	+
13820	+ /**
13821	+ * Options for the toast
13822	+ * @member Toast#options
13823	+ */
13824	+ this.options = {
13825	+ displayLength: displayLength,
13826	+ className: className,
13827	+ completeCallback: completeCallback
13828	+ };
13829	+
13830	+ this.options = $.extend({}, Toast.defaults, this.options);
13831	+ this.message = message;
13832	+
13833	+ /**
13834	+ * Describes current pan state toast
13835	+ * @type {Boolean}
13836	+ */
13837	+ this.panning = false;
13838	+
13839	+ /**
13840	+ * Time remaining until toast is removed
13841	+ */
13842	+ this.timeRemaining = this.options.displayLength;
13843	+
13844	+ if (Toast._toasts.length === 0) {
13845	+ Toast._createContainer();
13846	+ }
13847	+
13848	+ // Create new toast
13849	+ Toast._toasts.push(this);
13850	+ var toastElement = this.createToast();
13851	+ toastElement.M_Toast = this;
13852	+ this.el = toastElement;
13853	+ this._animateIn();
13854	+ this.setTimer();
13855	+ }
13856	+
13857	+ _createClass(Toast, [{
13858	+ key: 'createToast',
13859	+
13860	+
13861	+ /**
13862	+ * Create toast and append it to toast container
13863	+ */
13864	+ value: function createToast() {
13865	+ var toast = document.createElement('div');
13866	+ toast.classList.add('toast');
13867	+
13868	+ // Add custom classes onto toast
13869	+ if (this.options.className) {
13870	+ var classes = this.options.className.split(' ');
13871	+ var i = void 0,
13872	+ count = void 0;
13873	+ for (i = 0, count = classes.length; i < count; i++) {
13874	+ toast.classList.add(classes[i]);
13875	+ }
13876	+ }
13877	+
13878	+ // Set content
13879	+ if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
13880	+ toast.appendChild(this.message);
13881	+
13882	+ // Check if it is jQuery object
13883	+ } else if (this.message instanceof jQuery) {
13884	+ $(toast).append(this.message);
13885	+
13886	+ // Insert as text;
13887	+ } else {
13888	+ toast.innerHTML = this.message;
13889	+ }
13890	+
13891	+ // Append toasft
13892	+ Toast._container.appendChild(toast);
13893	+ return toast;
13894	+ }
13895	+
13896	+ /**
13897	+ * Animate in toast
13898	+ */
13899	+
13900	+ }, {
13901	+ key: '_animateIn',
13902	+ value: function _animateIn() {
13903	+ // Animate toast in
13904	+ Vel(this.el, { top: 0, opacity: 1 }, {
13905	+ duration: 300,
13906	+ easing: 'easeOutCubic',
13907	+ queue: false
13908	+ });
13909	+ }
13910	+
13911	+ /**
13912	+ * Create setInterval which automatically removes toast when timeRemaining >= 0
13913	+ * has been reached
13914	+ */
13915	+
13916	+ }, {
13917	+ key: 'setTimer',
13918	+ value: function setTimer() {
13919	+ var _this3 = this;
13920	+
13921	+ if (this.timeRemaining !== Infinity) {
13922	+ this.counterInterval = setInterval(function () {
13923	+ // If toast is not being dragged, decrease its time remaining
13924	+ if (!_this3.panning) {
13925	+ _this3.timeRemaining -= 20;
13926	+ }
13927	+
13928	+ // Animate toast out
13929	+ if (_this3.timeRemaining <= 0) {
13930	+ _this3.remove();
13931	+ }
13932	+ }, 20);
13933	+ }
13934	+ }
13935	+
13936	+ /**
13937	+ * Dismiss toast with animation
13938	+ */
13939	+
13940	+ }, {
13941	+ key: 'remove',
13942	+ value: function remove() {
13943	+ var _this4 = this;
13944	+
13945	+ window.clearInterval(this.counterInterval);
13946	+ var activationDistance = this.el.offsetWidth * this.options.activationPercent;
13947	+
13948	+ if (this.wasSwiped) {
13949	+ this.el.style.transition = 'transform .05s, opacity .05s';
13950	+ this.el.style.transform = 'translateX(' + activationDistance + 'px)';
13951	+ this.el.style.opacity = 0;
13952	+ }
13953	+
13954	+ Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
13955	+ duration: this.options.outDuration,
13956	+ easing: 'easeOutExpo',
13957	+ queue: false,
13958	+ complete: function () {
13959	+ // Call the optional callback
13960	+ if (typeof _this4.options.completeCallback === 'function') {
13961	+ _this4.options.completeCallback();
13962	+ }
13963	+ // Remove toast from DOM
13964	+ _this4.el.parentNode.removeChild(_this4.el);
13965	+ Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
13966	+ if (Toast._toasts.length === 0) {
13967	+ Toast._removeContainer();
13968	+ }
13969	+ }
13970	+ });
13971	+ }
13972	+ }], [{
13973	+ key: '_createContainer',
13974	+
13975	+
13976	+ /**
13977	+ * Append toast container and add event handlers
13978	+ */
13979	+ value: function _createContainer() {
13980	+ var container = document.createElement('div');
13981	+ container.setAttribute('id', 'toast-container');
13982	+
13983	+ // Add event handler
13984	+ container.addEventListener('touchstart', Toast._onDragStart);
13985	+ container.addEventListener('touchmove', Toast._onDragMove);
13986	+ container.addEventListener('touchend', Toast._onDragEnd);
13987	+
13988	+ container.addEventListener('mousedown', Toast._onDragStart);
13989	+ document.addEventListener('mousemove', Toast._onDragMove);
13990	+ document.addEventListener('mouseup', Toast._onDragEnd);
13991	+
13992	+ document.body.appendChild(container);
13993	+ Toast._container = container;
13994	+ }
13995	+
13996	+ /**
13997	+ * Remove toast container and event handlers
13998	+ */
13999	+
14000	+ }, {
14001	+ key: '_removeContainer',
14002	+ value: function _removeContainer() {
14003	+ // Add event handler
14004	+ document.removeEventListener('mousemove', Toast._onDragMove);
14005	+ document.removeEventListener('mouseup', Toast._onDragEnd);
14006	+
14007	+ Toast._container.parentNode.removeChild(Toast._container);
14008	+ Toast._container = null;
14009	+ }
14010	+
14011	+ /**
14012	+ * Begin drag handler
14013	+ * @param {Event} e
14014	+ */
14015	+
14016	+ }, {
14017	+ key: '_onDragStart',
14018	+ value: function _onDragStart(e) {
14019	+ if (e.target && $(e.target).closest('.toast').length) {
14020	+ var $toast = $(e.target).closest('.toast');
14021	+ var toast = $toast[0].M_Toast;
14022	+ toast.panning = true;
14023	+ Toast._draggedToast = toast;
14024	+ toast.el.classList.add('panning');
14025	+ toast.el.style.transition = null;
14026	+ toast.startingXPos = Toast._xPos(e);
14027	+ toast.time = Date.now();
14028	+ toast.xPos = Toast._xPos(e);
14029	+ }
14030	+ }
14031	+
14032	+ /**
14033	+ * Drag move handler
14034	+ * @param {Event} e
14035	+ */
14036	+
14037	+ }, {
14038	+ key: '_onDragMove',
14039	+ value: function _onDragMove(e) {
14040	+ if (!!Toast._draggedToast) {
14041	+ e.preventDefault();
14042	+ var toast = Toast._draggedToast;
14043	+ toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
14044	+ toast.xPos = Toast._xPos(e);
14045	+ toast.velocityX = toast.deltaX / (Date.now() - toast.time);
14046	+ toast.time = Date.now();
14047	+
14048	+ var totalDeltaX = toast.xPos - toast.startingXPos;
14049	+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
14050	+ toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
14051	+ toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
14052	+ }
14053	+ }
14054	+
14055	+ /**
14056	+ * End drag handler
14057	+ * @param {Event} e
14058	+ */
14059	+
14060	+ }, {
14061	+ key: '_onDragEnd',
14062	+ value: function _onDragEnd(e) {
14063	+ if (!!Toast._draggedToast) {
14064	+ var toast = Toast._draggedToast;
14065	+ toast.panning = false;
14066	+ toast.el.classList.remove('panning');
14067	+
14068	+ var totalDeltaX = toast.xPos - toast.startingXPos;
14069	+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
14070	+ var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance \|\| toast.velocityX > 1;
14071	+
14072	+ // Remove toast
14073	+ if (shouldBeDismissed) {
14074	+ toast.wasSwiped = true;
14075	+ toast.remove();
14076	+
14077	+ // Animate toast back to original position
14078	+ } else {
14079	+ toast.el.style.transition = 'transform .2s, opacity .2s';
14080	+ toast.el.style.transform = null;
14081	+ toast.el.style.opacity = null;
14082	+ }
14083	+ Toast._draggedToast = null;
14084	+ }
14085	+ }
14086	+
14087	+ /**
14088	+ * Get x position of mouse or touch event
14089	+ * @param {Event} e
14090	+ */
14091	+
14092	+ }, {
14093	+ key: '_xPos',
14094	+ value: function _xPos(e) {
14095	+ if (e.targetTouches && e.targetTouches.length >= 1) {
14096	+ return e.targetTouches[0].clientX;
14097	+ }
14098	+ // mouse event
14099	+ return e.clientX;
14100	+ }
14101	+
14102	+ /**
14103	+ * Remove all toasts
14104	+ */
14105	+
14106	+ }, {
14107	+ key: 'removeAll',
14108	+ value: function removeAll() {
14109	+ for (var toastIndex in Toast._toasts) {
14110	+ Toast._toasts[toastIndex].remove();
14111	+ }
14112	+ }
14113	+ }, {
14114	+ key: 'defaults',
14115	+ get: function () {
14116	+ return _defaults;
14117	+ }
14118	+ }]);
14119	+
14120	+ return Toast;
14121	+ }();
14122	+
14123	+ /**
14124	+ * @static
14125	+ * @memberof Toast
14126	+ * @type {Array.<Toast>}
14127	+ */
14128	+
14129	+
14130	+ Toast._toasts = [];
14131	+
14132	+ /**
14133	+ * @static
14134	+ * @memberof Toast
14135	+ */
14136	+ Toast._container = null;
14137	+
14138	+ /**
14139	+ * @static
14140	+ * @memberof Toast
14141	+ * @type {Toast}
14142	+ */
14143	+ Toast._draggedToast = null;
14144	+
14145	+ window.Materialize.Toast = Toast;
14146	+ window.Materialize.toast = function (message, displayLength, className, completeCallback) {
14147	+ return new Toast(message, displayLength, className, completeCallback);
14148	+ };
14149	+ })(jQuery);
14150	+ ;(function ($) {
14151	+
14152	+ var methods = {
14153	+ init: function (options) {
14154	+ var defaults = {
14155	+ menuWidth: 300,
14156	+ edge: 'left',
14157	+ closeOnClick: false,
14158	+ draggable: true,
14159	+ onOpen: null,
14160	+ onClose: null
14161	+ };
14162	+ options = $.extend(defaults, options);
14163	+
14164	+ $(this).each(function () {
14165	+ var $this = $(this);
14166	+ var menuId = $this.attr('data-activates');
14167	+ var menu = $("#" + menuId);
14168	+
14169	+ // Set to width
14170	+ if (options.menuWidth != 300) {
14171	+ menu.css('width', options.menuWidth);
14172	+ }
14173	+
14174	+ // Add Touch Area
14175	+ var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
14176	+ if (options.draggable) {
14177	+ // Regenerate dragTarget
14178	+ if ($dragTarget.length) {
14179	+ $dragTarget.remove();
14180	+ }
14181	+
14182	+ $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
14183	+ $('body').append($dragTarget);
14184	+ } else {
14185	+ $dragTarget = $();
14186	+ }
14187	+
14188	+ if (options.edge == 'left') {
14189	+ menu.css('transform', 'translateX(-100%)');
14190	+ $dragTarget.css({ 'left': 0 }); // Add Touch Area
14191	+ } else {
14192	+ menu.addClass('right-aligned') // Change text-alignment to right
14193	+ .css('transform', 'translateX(100%)');
14194	+ $dragTarget.css({ 'right': 0 }); // Add Touch Area
14195	+ }
14196	+
14197	+ // If fixed sidenav, bring menu out
14198	+ if (menu.hasClass('fixed')) {
14199	+ if (window.innerWidth > 992) {
14200	+ menu.css('transform', 'translateX(0)');
14201	+ }
14202	+ }
14203	+
14204	+ // Window resize to reset on large screens fixed
14205	+ if (menu.hasClass('fixed')) {
14206	+ $(window).resize(function () {
14207	+ if (window.innerWidth > 992) {
14208	+ // Close menu if window is resized bigger than 992 and user has fixed sidenav
14209	+ if ($('#sidenav-overlay').length !== 0 && menuOut) {
14210	+ removeMenu(true);
14211	+ } else {
14212	+ // menu.removeAttr('style');
14213	+ menu.css('transform', 'translateX(0%)');
14214	+ // menu.css('width', options.menuWidth);
14215	+ }
14216	+ } else if (menuOut === false) {
14217	+ if (options.edge === 'left') {
14218	+ menu.css('transform', 'translateX(-100%)');
14219	+ } else {
14220	+ menu.css('transform', 'translateX(100%)');
14221	+ }
14222	+ }
14223	+ });
14224	+ }
14225	+
14226	+ // if closeOnClick, then add close event for all a tags in side sideNav
14227	+ if (options.closeOnClick === true) {
14228	+ menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
14229	+ if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
14230	+ removeMenu();
14231	+ }
14232	+ });
14233	+ }
14234	+
14235	+ var removeMenu = function (restoreNav) {
14236	+ panning = false;
14237	+ menuOut = false;
14238	+ // Reenable scrolling
14239	+ $('body').css({
14240	+ overflow: '',
14241	+ width: ''
14242	+ });
14243	+
14244	+ $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
14245	+ queue: false, easing: 'easeOutQuad',
14246	+ complete: function () {
14247	+ $(this).remove();
14248	+ } });
14249	+ if (options.edge === 'left') {
14250	+ // Reset phantom div
14251	+ $dragTarget.css({ width: '', right: '', left: '0' });
14252	+ menu.velocity({ 'translateX': '-100%' }, { duration: 200,
14253	+ queue: false,
14254	+ easing: 'easeOutCubic',
14255	+ complete: function () {
14256	+ if (restoreNav === true) {
14257	+ // Restore Fixed sidenav
14258	+ menu.removeAttr('style');
14259	+ menu.css('width', options.menuWidth);
14260	+ }
14261	+ }
14262	+
14263	+ });
14264	+ } else {
14265	+ // Reset phantom div
14266	+ $dragTarget.css({ width: '', right: '0', left: '' });
14267	+ menu.velocity({ 'translateX': '100%' }, { duration: 200,
14268	+ queue: false,
14269	+ easing: 'easeOutCubic',
14270	+ complete: function () {
14271	+ if (restoreNav === true) {
14272	+ // Restore Fixed sidenav
14273	+ menu.removeAttr('style');
14274	+ menu.css('width', options.menuWidth);
14275	+ }
14276	+ }
14277	+ });
14278	+ }
14279	+
14280	+ // Callback
14281	+ if (typeof options.onClose === 'function') {
14282	+ options.onClose.call(this, menu);
14283	+ }
14284	+ };
14285	+
14286	+ // Touch Event
14287	+ var panning = false;
14288	+ var menuOut = false;
14289	+
14290	+ if (options.draggable) {
14291	+ $dragTarget.on('click', function () {
14292	+ if (menuOut) {
14293	+ removeMenu();
14294	+ }
14295	+ });
14296	+
14297	+ $dragTarget.hammer({
14298	+ prevent_default: false
14299	+ }).on('pan', function (e) {
14300	+
14301	+ if (e.gesture.pointerType == "touch") {
14302	+
14303	+ var direction = e.gesture.direction;
14304	+ var x = e.gesture.center.x;
14305	+ var y = e.gesture.center.y;
14306	+ var velocityX = e.gesture.velocityX;
14307	+
14308	+ // Vertical scroll bugfix
14309	+ if (x === 0 && y === 0) {
14310	+ return;
14311	+ }
14312	+
14313	+ // Disable Scrolling
14314	+ var $body = $('body');
14315	+ var $overlay = $('#sidenav-overlay');
14316	+ var oldWidth = $body.innerWidth();
14317	+ $body.css('overflow', 'hidden');
14318	+ $body.width(oldWidth);
14319	+
14320	+ // If overlay does not exist, create one and if it is clicked, close menu
14321	+ if ($overlay.length === 0) {
14322	+ $overlay = $('<div id="sidenav-overlay"></div>');
14323	+ $overlay.css('opacity', 0).click(function () {
14324	+ removeMenu();
14325	+ });
14326	+
14327	+ // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
14328	+ if (typeof options.onOpen === 'function') {
14329	+ options.onOpen.call(this, menu);
14330	+ }
14331	+
14332	+ $('body').append($overlay);
14333	+ }
14334	+
14335	+ // Keep within boundaries
14336	+ if (options.edge === 'left') {
14337	+ if (x > options.menuWidth) {
14338	+ x = options.menuWidth;
14339	+ } else if (x < 0) {
14340	+ x = 0;
14341	+ }
14342	+ }
14343	+
14344	+ if (options.edge === 'left') {
14345	+ // Left Direction
14346	+ if (x < options.menuWidth / 2) {
14347	+ menuOut = false;
14348	+ }
14349	+ // Right Direction
14350	+ else if (x >= options.menuWidth / 2) {
14351	+ menuOut = true;
14352	+ }
14353	+ menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
14354	+ } else {
14355	+ // Left Direction
14356	+ if (x < window.innerWidth - options.menuWidth / 2) {
14357	+ menuOut = true;
14358	+ }
14359	+ // Right Direction
14360	+ else if (x >= window.innerWidth - options.menuWidth / 2) {
14361	+ menuOut = false;
14362	+ }
14363	+ var rightPos = x - options.menuWidth / 2;
14364	+ if (rightPos < 0) {
14365	+ rightPos = 0;
14366	+ }
14367	+
14368	+ menu.css('transform', 'translateX(' + rightPos + 'px)');
14369	+ }
14370	+
14371	+ // Percentage overlay
14372	+ var overlayPerc;
14373	+ if (options.edge === 'left') {
14374	+ overlayPerc = x / options.menuWidth;
14375	+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
14376	+ } else {
14377	+ overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
14378	+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
14379	+ }
14380	+ }
14381	+ }).on('panend', function (e) {
14382	+
14383	+ if (e.gesture.pointerType == "touch") {
14384	+ var $overlay = $('#sidenav-overlay');
14385	+ var velocityX = e.gesture.velocityX;
14386	+ var x = e.gesture.center.x;
14387	+ var leftPos = x - options.menuWidth;
14388	+ var rightPos = x - options.menuWidth / 2;
14389	+ if (leftPos > 0) {
14390	+ leftPos = 0;
14391	+ }
14392	+ if (rightPos < 0) {
14393	+ rightPos = 0;
14394	+ }
14395	+ panning = false;
14396	+
14397	+ if (options.edge === 'left') {
14398	+ // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
14399	+ if (menuOut && velocityX <= 0.3 \|\| velocityX < -0.5) {
14400	+ // Return menu to open
14401	+ if (leftPos !== 0) {
14402	+ menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
14403	+ }
14404	+
14405	+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
14406	+ $dragTarget.css({ width: '50%', right: 0, left: '' });
14407	+ menuOut = true;
14408	+ } else if (!menuOut \|\| velocityX > 0.3) {
14409	+ // Enable Scrolling
14410	+ $('body').css({
14411	+ overflow: '',
14412	+ width: ''
14413	+ });
14414	+ // Slide menu closed
14415	+ menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
14416	+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
14417	+ complete: function () {
14418	+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
14419	+ if (typeof options.onClose === 'function') {
14420	+ options.onClose.call(this, menu);
14421	+ }
14422	+
14423	+ $(this).remove();
14424	+ } });
14425	+ $dragTarget.css({ width: '10px', right: '', left: 0 });
14426	+ }
14427	+ } else {
14428	+ if (menuOut && velocityX >= -0.3 \|\| velocityX > 0.5) {
14429	+ // Return menu to open
14430	+ if (rightPos !== 0) {
14431	+ menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
14432	+ }
14433	+
14434	+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
14435	+ $dragTarget.css({ width: '50%', right: '', left: 0 });
14436	+ menuOut = true;
14437	+ } else if (!menuOut \|\| velocityX < -0.3) {
14438	+ // Enable Scrolling
14439	+ $('body').css({
14440	+ overflow: '',
14441	+ width: ''
14442	+ });
14443	+
14444	+ // Slide menu closed
14445	+ menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
14446	+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
14447	+ complete: function () {
14448	+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
14449	+ if (typeof options.onClose === 'function') {
14450	+ options.onClose.call(this, menu);
14451	+ }
14452	+
14453	+ $(this).remove();
14454	+ } });
14455	+ $dragTarget.css({ width: '10px', right: 0, left: '' });
14456	+ }
14457	+ }
14458	+ }
14459	+ });
14460	+ }
14461	+
14462	+ $this.off('click.sidenav').on('click.sidenav', function () {
14463	+ if (menuOut === true) {
14464	+ menuOut = false;
14465	+ panning = false;
14466	+ removeMenu();
14467	+ } else {
14468	+
14469	+ // Disable Scrolling
14470	+ var $body = $('body');
14471	+ var $overlay = $('<div id="sidenav-overlay"></div>');
14472	+ var oldWidth = $body.innerWidth();
14473	+ $body.css('overflow', 'hidden');
14474	+ $body.width(oldWidth);
14475	+
14476	+ // Push current drag target on top of DOM tree
14477	+ $('body').append($dragTarget);
14478	+
14479	+ if (options.edge === 'left') {
14480	+ $dragTarget.css({ width: '50%', right: 0, left: '' });
14481	+ menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
14482	+ } else {
14483	+ $dragTarget.css({ width: '50%', right: '', left: 0 });
14484	+ menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
14485	+ }
14486	+
14487	+ // Overlay close on click
14488	+ $overlay.css('opacity', 0).click(function () {
14489	+ menuOut = false;
14490	+ panning = false;
14491	+ removeMenu();
14492	+ $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
14493	+ complete: function () {
14494	+ $(this).remove();
14495	+ }
14496	+ });
14497	+ });
14498	+
14499	+ // Append body
14500	+ $('body').append($overlay);
14501	+ $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
14502	+ complete: function () {
14503	+ menuOut = true;
14504	+ panning = false;
14505	+ }
14506	+ });
14507	+
14508	+ // Callback
14509	+ if (typeof options.onOpen === 'function') {
14510	+ options.onOpen.call(this, menu);
14511	+ }
14512	+ }
14513	+
14514	+ return false;
14515	+ });
14516	+ });
14517	+ },
14518	+ destroy: function () {
14519	+ var $overlay = $('#sidenav-overlay');
14520	+ var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
14521	+ $overlay.trigger('click');
14522	+ $dragTarget.remove();
14523	+ $(this).off('click');
14524	+ $overlay.remove();
14525	+ },
14526	+ show: function () {
14527	+ this.trigger('click');
14528	+ },
14529	+ hide: function () {
14530	+ $('#sidenav-overlay').trigger('click');
14531	+ }
14532	+ };
14533	+
14534	+ $.fn.sideNav = function (methodOrOptions) {
14535	+ if (methods[methodOrOptions]) {
14536	+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
14537	+ } else if (typeof methodOrOptions === 'object' \|\| !methodOrOptions) {
14538	+ // Default to "init"
14539	+ return methods.init.apply(this, arguments);
14540	+ } else {
14541	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
14542	+ }
14543	+ }; // Plugin end
14544	+ })(jQuery);
14545	+ ; /**
14546	+ * Extend jquery with a scrollspy plugin.
14547	+ * This watches the window scroll and fires events when elements are scrolled into viewport.
14548	+ *
14549	+ * throttle() and getTime() taken from Underscore.js
14550	+ * https://github.com/jashkenas/underscore
14551	+ *
14552	+ * @author Copyright 2013 John Smart
14553	+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
14554	+ * @see https://github.com/thesmart
14555	+ * @version 0.1.2
14556	+ */
14557	+ (function ($) {
14558	+
14559	+ var jWindow = $(window);
14560	+ var elements = [];
14561	+ var elementsInView = [];
14562	+ var isSpying = false;
14563	+ var ticks = 0;
14564	+ var unique_id = 1;
14565	+ var offset = {
14566	+ top: 0,
14567	+ right: 0,
14568	+ bottom: 0,
14569	+ left: 0
14570	+
14571	+ /**
14572	+ * Find elements that are within the boundary
14573	+ * @param {number} top
14574	+ * @param {number} right
14575	+ * @param {number} bottom
14576	+ * @param {number} left
14577	+ * @return {jQuery} A collection of elements
14578	+ */
14579	+ };function findElements(top, right, bottom, left) {
14580	+ var hits = $();
14581	+ $.each(elements, function (i, element) {
14582	+ if (element.height() > 0) {
14583	+ var elTop = element.offset().top,
14584	+ elLeft = element.offset().left,
14585	+ elRight = elLeft + element.width(),
14586	+ elBottom = elTop + element.height();
14587	+
14588	+ var isIntersect = !(elLeft > right \|\| elRight < left \|\| elTop > bottom \|\| elBottom < top);
14589	+
14590	+ if (isIntersect) {
14591	+ hits.push(element);
14592	+ }
14593	+ }
14594	+ });
14595	+
14596	+ return hits;
14597	+ }
14598	+
14599	+ /**
14600	+ * Called when the user scrolls the window
14601	+ */
14602	+ function onScroll(scrollOffset) {
14603	+ // unique tick id
14604	+ ++ticks;
14605	+
14606	+ // viewport rectangle
14607	+ var top = jWindow.scrollTop(),
14608	+ left = jWindow.scrollLeft(),
14609	+ right = left + jWindow.width(),
14610	+ bottom = top + jWindow.height();
14611	+
14612	+ // determine which elements are in view
14613	+ var intersections = findElements(top + offset.top + scrollOffset \|\| 200, right + offset.right, bottom + offset.bottom, left + offset.left);
14614	+ $.each(intersections, function (i, element) {
14615	+
14616	+ var lastTick = element.data('scrollSpy:ticks');
14617	+ if (typeof lastTick != 'number') {
14618	+ // entered into view
14619	+ element.triggerHandler('scrollSpy:enter');
14620	+ }
14621	+
14622	+ // update tick id
14623	+ element.data('scrollSpy:ticks', ticks);
14624	+ });
14625	+
14626	+ // determine which elements are no longer in view
14627	+ $.each(elementsInView, function (i, element) {
14628	+ var lastTick = element.data('scrollSpy:ticks');
14629	+ if (typeof lastTick == 'number' && lastTick !== ticks) {
14630	+ // exited from view
14631	+ element.triggerHandler('scrollSpy:exit');
14632	+ element.data('scrollSpy:ticks', null);
14633	+ }
14634	+ });
14635	+
14636	+ // remember elements in view for next tick
14637	+ elementsInView = intersections;
14638	+ }
14639	+
14640	+ /**
14641	+ * Called when window is resized
14642	+ */
14643	+ function onWinSize() {
14644	+ jWindow.trigger('scrollSpy:winSize');
14645	+ }
14646	+
14647	+ /**
14648	+ * Enables ScrollSpy using a selector
14649	+ * @param {jQuery\|string} selector The elements collection, or a selector
14650	+ * @param {Object=} options Optional.
14651	+ throttle : number -> scrollspy throttling. Default: 100 ms
14652	+ offsetTop : number -> offset from top. Default: 0
14653	+ offsetRight : number -> offset from right. Default: 0
14654	+ offsetBottom : number -> offset from bottom. Default: 0
14655	+ offsetLeft : number -> offset from left. Default: 0
14656	+ activeClass : string -> Class name to be added to the active link. Default: active
14657	+ * @returns {jQuery}
14658	+ */
14659	+ $.scrollSpy = function (selector, options) {
14660	+ var defaults = {
14661	+ throttle: 100,
14662	+ scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
14663	+ activeClass: 'active',
14664	+ getActiveElement: function (id) {
14665	+ return 'a[href="#' + id + '"]';
14666	+ }
14667	+ };
14668	+ options = $.extend(defaults, options);
14669	+
14670	+ var visible = [];
14671	+ selector = $(selector);
14672	+ selector.each(function (i, element) {
14673	+ elements.push($(element));
14674	+ $(element).data("scrollSpy:id", i);
14675	+ // Smooth scroll to section
14676	+ $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
14677	+ e.preventDefault();
14678	+ var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
14679	+ $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
14680	+ });
14681	+ });
14682	+
14683	+ offset.top = options.offsetTop \|\| 0;
14684	+ offset.right = options.offsetRight \|\| 0;
14685	+ offset.bottom = options.offsetBottom \|\| 0;
14686	+ offset.left = options.offsetLeft \|\| 0;
14687	+
14688	+ var throttledScroll = Materialize.throttle(function () {
14689	+ onScroll(options.scrollOffset);
14690	+ }, options.throttle \|\| 100);
14691	+ var readyScroll = function () {
14692	+ $(document).ready(throttledScroll);
14693	+ };
14694	+
14695	+ if (!isSpying) {
14696	+ jWindow.on('scroll', readyScroll);
14697	+ jWindow.on('resize', readyScroll);
14698	+ isSpying = true;
14699	+ }
14700	+
14701	+ // perform a scan once, after current execution context, and after dom is ready
14702	+ setTimeout(readyScroll, 0);
14703	+
14704	+ selector.on('scrollSpy:enter', function () {
14705	+ visible = $.grep(visible, function (value) {
14706	+ return value.height() != 0;
14707	+ });
14708	+
14709	+ var $this = $(this);
14710	+
14711	+ if (visible[0]) {
14712	+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
14713	+ if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
14714	+ visible.unshift($(this));
14715	+ } else {
14716	+ visible.push($(this));
14717	+ }
14718	+ } else {
14719	+ visible.push($(this));
14720	+ }
14721	+
14722	+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
14723	+ });
14724	+ selector.on('scrollSpy:exit', function () {
14725	+ visible = $.grep(visible, function (value) {
14726	+ return value.height() != 0;
14727	+ });
14728	+
14729	+ if (visible[0]) {
14730	+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
14731	+ var $this = $(this);
14732	+ visible = $.grep(visible, function (value) {
14733	+ return value.attr('id') != $this.attr('id');
14734	+ });
14735	+ if (visible[0]) {
14736	+ // Check if empty
14737	+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
14738	+ }
14739	+ }
14740	+ });
14741	+
14742	+ return selector;
14743	+ };
14744	+
14745	+ /**
14746	+ * Listen for window resize events
14747	+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
14748	+ * @returns {jQuery} $(window)
14749	+ */
14750	+ $.winSizeSpy = function (options) {
14751	+ $.winSizeSpy = function () {
14752	+ return jWindow;
14753	+ }; // lock from multiple calls
14754	+ options = options \|\| {
14755	+ throttle: 100
14756	+ };
14757	+ return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle \|\| 100));
14758	+ };
14759	+
14760	+ /**
14761	+ * Enables ScrollSpy on a collection of elements
14762	+ * e.g. $('.scrollSpy').scrollSpy()
14763	+ * @param {Object=} options Optional.
14764	+ throttle : number -> scrollspy throttling. Default: 100 ms
14765	+ offsetTop : number -> offset from top. Default: 0
14766	+ offsetRight : number -> offset from right. Default: 0
14767	+ offsetBottom : number -> offset from bottom. Default: 0
14768	+ offsetLeft : number -> offset from left. Default: 0
14769	+ * @returns {jQuery}
14770	+ */
14771	+ $.fn.scrollSpy = function (options) {
14772	+ return $.scrollSpy($(this), options);
14773	+ };
14774	+ })(jQuery);
14775	+ ;(function ($) {
14776	+ $(document).ready(function () {
14777	+
14778	+ // Function to update labels of text fields
14779	+ Materialize.updateTextFields = function () {
14780	+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
14781	+ $(input_selector).each(function (index, element) {
14782	+ var $this = $(this);
14783	+ if ($(element).val().length > 0 \|\| $(element).is(':focus') \|\| element.autofocus \|\| $this.attr('placeholder') !== undefined) {
14784	+ $this.siblings('label').addClass('active');
14785	+ } else if ($(element)[0].validity) {
14786	+ $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
14787	+ } else {
14788	+ $this.siblings('label').removeClass('active');
14789	+ }
14790	+ });
14791	+ };
14792	+
14793	+ // Text based inputs
14794	+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
14795	+
14796	+ // Add active if form auto complete
14797	+ $(document).on('change', input_selector, function () {
14798	+ if ($(this).val().length !== 0 \|\| $(this).attr('placeholder') !== undefined) {
14799	+ $(this).siblings('label').addClass('active');
14800	+ }
14801	+ validate_field($(this));
14802	+ });
14803	+
14804	+ // Add active if input element has been pre-populated on document ready
14805	+ $(document).ready(function () {
14806	+ Materialize.updateTextFields();
14807	+ });
14808	+
14809	+ // HTML DOM FORM RESET handling
14810	+ $(document).on('reset', function (e) {
14811	+ var formReset = $(e.target);
14812	+ if (formReset.is('form')) {
14813	+ formReset.find(input_selector).removeClass('valid').removeClass('invalid');
14814	+ formReset.find(input_selector).each(function () {
14815	+ if ($(this).attr('value') === '') {
14816	+ $(this).siblings('label').removeClass('active');
14817	+ }
14818	+ });
14819	+
14820	+ // Reset select
14821	+ formReset.find('select.initialized').each(function () {
14822	+ var reset_text = formReset.find('option[selected]').text();
14823	+ formReset.siblings('input.select-dropdown').val(reset_text);
14824	+ });
14825	+ }
14826	+ });
14827	+
14828	+ // Add active when element has focus
14829	+ $(document).on('focus', input_selector, function () {
14830	+ $(this).siblings('label, .prefix').addClass('active');
14831	+ });
14832	+
14833	+ $(document).on('blur', input_selector, function () {
14834	+ var $inputElement = $(this);
14835	+ var selector = ".prefix";
14836	+
14837	+ if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
14838	+ selector += ", label";
14839	+ }
14840	+
14841	+ $inputElement.siblings(selector).removeClass('active');
14842	+
14843	+ validate_field($inputElement);
14844	+ });
14845	+
14846	+ window.validate_field = function (object) {
14847	+ var hasLength = object.attr('data-length') !== undefined;
14848	+ var lenAttr = parseInt(object.attr('data-length'));
14849	+ var len = object.val().length;
14850	+
14851	+ if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
14852	+ if (object.hasClass('validate')) {
14853	+ object.removeClass('valid');
14854	+ object.removeClass('invalid');
14855	+ }
14856	+ } else {
14857	+ if (object.hasClass('validate')) {
14858	+ // Check for character counter attributes
14859	+ if (object.is(':valid') && hasLength && len <= lenAttr \|\| object.is(':valid') && !hasLength) {
14860	+ object.removeClass('invalid');
14861	+ object.addClass('valid');
14862	+ } else {
14863	+ object.removeClass('valid');
14864	+ object.addClass('invalid');
14865	+ }
14866	+ }
14867	+ }
14868	+ };
14869	+
14870	+ // Radio and Checkbox focus class
14871	+ var radio_checkbox = 'input[type=radio], input[type=checkbox]';
14872	+ $(document).on('keyup.radio', radio_checkbox, function (e) {
14873	+ // TAB, check if tabbing to radio or checkbox.
14874	+ if (e.which === 9) {
14875	+ $(this).addClass('tabbed');
14876	+ var $this = $(this);
14877	+ $this.one('blur', function (e) {
14878	+
14879	+ $(this).removeClass('tabbed');
14880	+ });
14881	+ return;
14882	+ }
14883	+ });
14884	+
14885	+ // Textarea Auto Resize
14886	+ var hiddenDiv = $('.hiddendiv').first();
14887	+ if (!hiddenDiv.length) {
14888	+ hiddenDiv = $('<div class="hiddendiv common"></div>');
14889	+ $('body').append(hiddenDiv);
14890	+ }
14891	+ var text_area_selector = '.materialize-textarea';
14892	+
14893	+ function textareaAutoResize($textarea) {
14894	+ // Set font properties of hiddenDiv
14895	+
14896	+ var fontFamily = $textarea.css('font-family');
14897	+ var fontSize = $textarea.css('font-size');
14898	+ var lineHeight = $textarea.css('line-height');
14899	+ var padding = $textarea.css('padding');
14900	+
14901	+ if (fontSize) {
14902	+ hiddenDiv.css('font-size', fontSize);
14903	+ }
14904	+ if (fontFamily) {
14905	+ hiddenDiv.css('font-family', fontFamily);
14906	+ }
14907	+ if (lineHeight) {
14908	+ hiddenDiv.css('line-height', lineHeight);
14909	+ }
14910	+ if (padding) {
14911	+ hiddenDiv.css('padding', padding);
14912	+ }
14913	+
14914	+ // Set original-height, if none
14915	+ if (!$textarea.data('original-height')) {
14916	+ $textarea.data('original-height', $textarea.height());
14917	+ }
14918	+
14919	+ if ($textarea.attr('wrap') === 'off') {
14920	+ hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
14921	+ }
14922	+
14923	+ hiddenDiv.text($textarea.val() + '\n');
14924	+ var content = hiddenDiv.html().replace(/\n/g, '<br>');
14925	+ hiddenDiv.html(content);
14926	+
14927	+ // When textarea is hidden, width goes crazy.
14928	+ // Approximate with half of window size
14929	+
14930	+ if ($textarea.is(':visible')) {
14931	+ hiddenDiv.css('width', $textarea.width());
14932	+ } else {
14933	+ hiddenDiv.css('width', $(window).width() / 2);
14934	+ }
14935	+
14936	+ /**
14937	+ * Resize if the new height is greater than the
14938	+ * original height of the textarea
14939	+ */
14940	+ if ($textarea.data('original-height') <= hiddenDiv.height()) {
14941	+ $textarea.css('height', hiddenDiv.height());
14942	+ } else if ($textarea.val().length < $textarea.data('previous-length')) {
14943	+ /**
14944	+ * In case the new height is less than original height, it
14945	+ * means the textarea has less text than before
14946	+ * So we set the height to the original one
14947	+ */
14948	+ $textarea.css('height', $textarea.data('original-height'));
14949	+ }
14950	+ $textarea.data('previous-length', $textarea.val().length);
14951	+ }
14952	+
14953	+ $(text_area_selector).each(function () {
14954	+ var $textarea = $(this);
14955	+ /**
14956	+ * Instead of resizing textarea on document load,
14957	+ * store the original height and the original length
14958	+ */
14959	+ $textarea.data('original-height', $textarea.height());
14960	+ $textarea.data('previous-length', $textarea.val().length);
14961	+ });
14962	+
14963	+ $('body').on('keyup keydown autoresize', text_area_selector, function () {
14964	+ textareaAutoResize($(this));
14965	+ });
14966	+
14967	+ // File Input Path
14968	+ $(document).on('change', '.file-field input[type="file"]', function () {
14969	+ var file_field = $(this).closest('.file-field');
14970	+ var path_input = file_field.find('input.file-path');
14971	+ var files = $(this)[0].files;
14972	+ var file_names = [];
14973	+ for (var i = 0; i < files.length; i++) {
14974	+ file_names.push(files[i].name);
14975	+ }
14976	+ path_input.val(file_names.join(", "));
14977	+ path_input.trigger('change');
14978	+ });
14979	+
14980	+ /****************
14981	+ * Range Input *
14982	+ ****************/
14983	+
14984	+ var range_type = 'input[type=range]';
14985	+ var range_mousedown = false;
14986	+ var left;
14987	+
14988	+ $(range_type).each(function () {
14989	+ var thumb = $('<span class="thumb"><span class="value"></span></span>');
14990	+ $(this).after(thumb);
14991	+ });
14992	+
14993	+ var showRangeBubble = function (thumb) {
14994	+ var paddingLeft = parseInt(thumb.parent().css('padding-left'));
14995	+ var marginLeft = -7 + paddingLeft + 'px';
14996	+ thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
14997	+ };
14998	+
14999	+ var calcRangeOffset = function (range) {
15000	+ var width = range.width() - 15;
15001	+ var max = parseFloat(range.attr('max'));
15002	+ var min = parseFloat(range.attr('min'));
15003	+ var percent = (parseFloat(range.val()) - min) / (max - min);
15004	+ return percent * width;
15005	+ };
15006	+
15007	+ var range_wrapper = '.range-field';
15008	+ $(document).on('change', range_type, function (e) {
15009	+ var thumb = $(this).siblings('.thumb');
15010	+ thumb.find('.value').html($(this).val());
15011	+
15012	+ if (!thumb.hasClass('active')) {
15013	+ showRangeBubble(thumb);
15014	+ }
15015	+
15016	+ var offsetLeft = calcRangeOffset($(this));
15017	+ thumb.addClass('active').css('left', offsetLeft);
15018	+ });
15019	+
15020	+ $(document).on('mousedown touchstart', range_type, function (e) {
15021	+ var thumb = $(this).siblings('.thumb');
15022	+
15023	+ // If thumb indicator does not exist yet, create it
15024	+ if (thumb.length <= 0) {
15025	+ thumb = $('<span class="thumb"><span class="value"></span></span>');
15026	+ $(this).after(thumb);
15027	+ }
15028	+
15029	+ // Set indicator value
15030	+ thumb.find('.value').html($(this).val());
15031	+
15032	+ range_mousedown = true;
15033	+ $(this).addClass('active');
15034	+
15035	+ if (!thumb.hasClass('active')) {
15036	+ showRangeBubble(thumb);
15037	+ }
15038	+
15039	+ if (e.type !== 'input') {
15040	+ var offsetLeft = calcRangeOffset($(this));
15041	+ thumb.addClass('active').css('left', offsetLeft);
15042	+ }
15043	+ });
15044	+
15045	+ $(document).on('mouseup touchend', range_wrapper, function () {
15046	+ range_mousedown = false;
15047	+ $(this).removeClass('active');
15048	+ });
15049	+
15050	+ $(document).on('input mousemove touchmove', range_wrapper, function (e) {
15051	+ var thumb = $(this).children('.thumb');
15052	+ var left;
15053	+ var input = $(this).find(range_type);
15054	+
15055	+ if (range_mousedown) {
15056	+ if (!thumb.hasClass('active')) {
15057	+ showRangeBubble(thumb);
15058	+ }
15059	+
15060	+ var offsetLeft = calcRangeOffset(input);
15061	+ thumb.addClass('active').css('left', offsetLeft);
15062	+ thumb.find('.value').html(thumb.siblings(range_type).val());
15063	+ }
15064	+ });
15065	+
15066	+ $(document).on('mouseout touchleave', range_wrapper, function () {
15067	+ if (!range_mousedown) {
15068	+
15069	+ var thumb = $(this).children('.thumb');
15070	+ var paddingLeft = parseInt($(this).css('padding-left'));
15071	+ var marginLeft = 7 + paddingLeft + 'px';
15072	+
15073	+ if (thumb.hasClass('active')) {
15074	+ thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
15075	+ }
15076	+ thumb.removeClass('active');
15077	+ }
15078	+ });
15079	+
15080	+ /**************************
15081	+ * Auto complete plugin *
15082	+ *************************/
15083	+ $.fn.autocomplete = function (options) {
15084	+ // Defaults
15085	+ var defaults = {
15086	+ data: {},
15087	+ limit: Infinity,
15088	+ onAutocomplete: null,
15089	+ minLength: 1
15090	+ };
15091	+
15092	+ options = $.extend(defaults, options);
15093	+
15094	+ return this.each(function () {
15095	+ var $input = $(this);
15096	+ var data = options.data,
15097	+ count = 0,
15098	+ activeIndex = -1,
15099	+ oldVal,
15100	+ $inputDiv = $input.closest('.input-field'); // Div to append on
15101	+
15102	+ // Check if data isn't empty
15103	+ if (!$.isEmptyObject(data)) {
15104	+ var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
15105	+ var $oldAutocomplete;
15106	+
15107	+ // Append autocomplete element.
15108	+ // Prevent double structure init.
15109	+ if ($inputDiv.length) {
15110	+ $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
15111	+ if (!$oldAutocomplete.length) {
15112	+ $inputDiv.append($autocomplete); // Set ul in body
15113	+ }
15114	+ } else {
15115	+ $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
15116	+ if (!$oldAutocomplete.length) {
15117	+ $input.after($autocomplete);
15118	+ }
15119	+ }
15120	+ if ($oldAutocomplete.length) {
15121	+ $autocomplete = $oldAutocomplete;
15122	+ }
15123	+
15124	+ // Highlight partial match.
15125	+ var highlight = function (string, $el) {
15126	+ var img = $el.find('img');
15127	+ var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
15128	+ matchEnd = matchStart + string.length - 1,
15129	+ beforeMatch = $el.text().slice(0, matchStart),
15130	+ matchText = $el.text().slice(matchStart, matchEnd + 1),
15131	+ afterMatch = $el.text().slice(matchEnd + 1);
15132	+ $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
15133	+ if (img.length) {
15134	+ $el.prepend(img);
15135	+ }
15136	+ };
15137	+
15138	+ // Reset current element position
15139	+ var resetCurrentElement = function () {
15140	+ activeIndex = -1;
15141	+ $autocomplete.find('.active').removeClass('active');
15142	+ };
15143	+
15144	+ // Remove autocomplete elements
15145	+ var removeAutocomplete = function () {
15146	+ $autocomplete.empty();
15147	+ resetCurrentElement();
15148	+ oldVal = undefined;
15149	+ };
15150	+
15151	+ $input.off('blur.autocomplete').on('blur.autocomplete', function () {
15152	+ removeAutocomplete();
15153	+ });
15154	+
15155	+ // Perform search
15156	+ $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
15157	+ // Reset count.
15158	+ count = 0;
15159	+ var val = $input.val().toLowerCase();
15160	+
15161	+ // Don't capture enter or arrow key usage.
15162	+ if (e.which === 13 \|\| e.which === 38 \|\| e.which === 40) {
15163	+ return;
15164	+ }
15165	+
15166	+ // Check if the input isn't empty
15167	+ if (oldVal !== val) {
15168	+ removeAutocomplete();
15169	+
15170	+ if (val.length >= options.minLength) {
15171	+ for (var key in data) {
15172	+ if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
15173	+ // Break if past limit
15174	+ if (count >= options.limit) {
15175	+ break;
15176	+ }
15177	+
15178	+ var autocompleteOption = $('<li></li>');
15179	+ if (!!data[key]) {
15180	+ autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
15181	+ } else {
15182	+ autocompleteOption.append('<span>' + key + '</span>');
15183	+ }
15184	+
15185	+ $autocomplete.append(autocompleteOption);
15186	+ highlight(val, autocompleteOption);
15187	+ count++;
15188	+ }
15189	+ }
15190	+ }
15191	+ }
15192	+
15193	+ // Update oldVal
15194	+ oldVal = val;
15195	+ });
15196	+
15197	+ $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
15198	+ // Arrow keys and enter key usage
15199	+ var keyCode = e.which,
15200	+ liElement,
15201	+ numItems = $autocomplete.children('li').length,
15202	+ $active = $autocomplete.children('.active').first();
15203	+
15204	+ // select element on Enter
15205	+ if (keyCode === 13 && activeIndex >= 0) {
15206	+ liElement = $autocomplete.children('li').eq(activeIndex);
15207	+ if (liElement.length) {
15208	+ liElement.trigger('mousedown.autocomplete');
15209	+ e.preventDefault();
15210	+ }
15211	+ return;
15212	+ }
15213	+
15214	+ // Capture up and down key
15215	+ if (keyCode === 38 \|\| keyCode === 40) {
15216	+ e.preventDefault();
15217	+
15218	+ if (keyCode === 38 && activeIndex > 0) {
15219	+ activeIndex--;
15220	+ }
15221	+
15222	+ if (keyCode === 40 && activeIndex < numItems - 1) {
15223	+ activeIndex++;
15224	+ }
15225	+
15226	+ $active.removeClass('active');
15227	+ if (activeIndex >= 0) {
15228	+ $autocomplete.children('li').eq(activeIndex).addClass('active');
15229	+ }
15230	+ }
15231	+ });
15232	+
15233	+ // Set input value
15234	+ $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
15235	+ var text = $(this).text().trim();
15236	+ $input.val(text);
15237	+ $input.trigger('change');
15238	+ removeAutocomplete();
15239	+
15240	+ // Handle onAutocomplete callback.
15241	+ if (typeof options.onAutocomplete === "function") {
15242	+ options.onAutocomplete.call(this, text);
15243	+ }
15244	+ });
15245	+
15246	+ // Empty data
15247	+ } else {
15248	+ $input.off('keyup.autocomplete focus.autocomplete');
15249	+ }
15250	+ });
15251	+ };
15252	+ }); // End of $(document).ready
15253	+
15254	+ /*******************
15255	+ * Select Plugin *
15256	+ ******************/
15257	+ $.fn.material_select = function (callback) {
15258	+ $(this).each(function () {
15259	+ var $select = $(this);
15260	+
15261	+ if ($select.hasClass('browser-default')) {
15262	+ return; // Continue to next (return false breaks out of entire loop)
15263	+ }
15264	+
15265	+ var multiple = $select.attr('multiple') ? true : false,
15266	+ lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
15267	+
15268	+ if (lastID) {
15269	+ $select.parent().find('span.caret').remove();
15270	+ $select.parent().find('input').remove();
15271	+
15272	+ $select.unwrap();
15273	+ $('ul#select-options-' + lastID).remove();
15274	+ }
15275	+
15276	+ // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
15277	+ if (callback === 'destroy') {
15278	+ $select.removeAttr('data-select-id').removeClass('initialized');
15279	+ $(window).off('click.select');
15280	+ return;
15281	+ }
15282	+
15283	+ var uniqueID = Materialize.guid();
15284	+ $select.attr('data-select-id', uniqueID);
15285	+ var wrapper = $('<div class="select-wrapper"></div>');
15286	+ wrapper.addClass($select.attr('class'));
15287	+ if ($select.is(':disabled')) wrapper.addClass('disabled');
15288	+ var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
15289	+ selectChildren = $select.children('option, optgroup'),
15290	+ valuesSelected = [],
15291	+ optionsHover = false;
15292	+
15293	+ var label = $select.find('option:selected').html() \|\| $select.find('option:first').html() \|\| "";
15294	+
15295	+ // Function that renders and appends the option taking into
15296	+ // account type and possible image icon.
15297	+ var appendOptionWithIcon = function (select, option, type) {
15298	+ // Add disabled attr if disabled
15299	+ var disabledClass = option.is(':disabled') ? 'disabled ' : '';
15300	+ var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
15301	+ var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
15302	+
15303	+ // add icons
15304	+ var icon_url = option.data('icon');
15305	+ var classes = option.attr('class');
15306	+ if (!!icon_url) {
15307	+ var classString = '';
15308	+ if (!!classes) classString = ' class="' + classes + '"';
15309	+
15310	+ // Check for multiple type.
15311	+ options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
15312	+ return true;
15313	+ }
15314	+
15315	+ // Check for multiple type.
15316	+ options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
15317	+ };
15318	+
15319	+ /* Create dropdown structure. */
15320	+ if (selectChildren.length) {
15321	+ selectChildren.each(function () {
15322	+ if ($(this).is('option')) {
15323	+ // Direct descendant option.
15324	+ if (multiple) {
15325	+ appendOptionWithIcon($select, $(this), 'multiple');
15326	+ } else {
15327	+ appendOptionWithIcon($select, $(this));
15328	+ }
15329	+ } else if ($(this).is('optgroup')) {
15330	+ // Optgroup.
15331	+ var selectOptions = $(this).children('option');
15332	+ options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
15333	+
15334	+ selectOptions.each(function () {
15335	+ appendOptionWithIcon($select, $(this), 'optgroup-option');
15336	+ });
15337	+ }
15338	+ });
15339	+ }
15340	+
15341	+ options.find('li:not(.optgroup)').each(function (i) {
15342	+ $(this).click(function (e) {
15343	+ // Check if option element is disabled
15344	+ if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
15345	+ var selected = true;
15346	+
15347	+ if (multiple) {
15348	+ $('input[type="checkbox"]', this).prop('checked', function (i, v) {
15349	+ return !v;
15350	+ });
15351	+ selected = toggleEntryFromArray(valuesSelected, i, $select);
15352	+ $newSelect.trigger('focus');
15353	+ } else {
15354	+ options.find('li').removeClass('active');
15355	+ $(this).toggleClass('active');
15356	+ $newSelect.val($(this).text());
15357	+ }
15358	+
15359	+ activateOption(options, $(this));
15360	+ $select.find('option').eq(i).prop('selected', selected);
15361	+ // Trigger onchange() event
15362	+ $select.trigger('change');
15363	+ if (typeof callback !== 'undefined') callback();
15364	+ }
15365	+
15366	+ e.stopPropagation();
15367	+ });
15368	+ });
15369	+
15370	+ // Wrap Elements
15371	+ $select.wrap(wrapper);
15372	+ // Add Select Display Element
15373	+ var dropdownIcon = $('<span class="caret">▼</span>');
15374	+
15375	+ // escape double quotes
15376	+ var sanitizedLabelHtml = label.replace(/"/g, '"');
15377	+
15378	+ var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
15379	+ $select.before($newSelect);
15380	+ $newSelect.before(dropdownIcon);
15381	+
15382	+ $newSelect.after(options);
15383	+ // Check if section element is disabled
15384	+ if (!$select.is(':disabled')) {
15385	+ $newSelect.dropdown({ 'hover': false });
15386	+ }
15387	+
15388	+ // Copy tabindex
15389	+ if ($select.attr('tabindex')) {
15390	+ $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
15391	+ }
15392	+
15393	+ $select.addClass('initialized');
15394	+
15395	+ $newSelect.on({
15396	+ 'focus': function () {
15397	+ if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
15398	+ $('input.select-dropdown').trigger('close');
15399	+ $(window).off('click.select');
15400	+ }
15401	+ if (!options.is(':visible')) {
15402	+ $(this).trigger('open', ['focus']);
15403	+ var label = $(this).val();
15404	+ if (multiple && label.indexOf(',') >= 0) {
15405	+ label = label.split(',')[0];
15406	+ }
15407	+
15408	+ var selectedOption = options.find('li').filter(function () {
15409	+ return $(this).text().toLowerCase() === label.toLowerCase();
15410	+ })[0];
15411	+ activateOption(options, selectedOption, true);
15412	+
15413	+ $(window).off('click.select').on('click.select', function () {
15414	+ multiple && (optionsHover \|\| $newSelect.trigger('close'));
15415	+ $(window).off('click.select');
15416	+ });
15417	+ }
15418	+ },
15419	+ 'click': function (e) {
15420	+ e.stopPropagation();
15421	+ }
15422	+ });
15423	+
15424	+ $newSelect.on('blur', function () {
15425	+ if (!multiple) {
15426	+ $(this).trigger('close');
15427	+ $(window).off('click.select');
15428	+ }
15429	+ options.find('li.selected').removeClass('selected');
15430	+ });
15431	+
15432	+ options.hover(function () {
15433	+ optionsHover = true;
15434	+ }, function () {
15435	+ optionsHover = false;
15436	+ });
15437	+
15438	+ // Add initial multiple selections.
15439	+ if (multiple) {
15440	+ $select.find("option:selected:not(:disabled)").each(function () {
15441	+ var index = $(this).index();
15442	+
15443	+ toggleEntryFromArray(valuesSelected, index, $select);
15444	+ options.find("li").eq(index).find(":checkbox").prop("checked", true);
15445	+ });
15446	+ }
15447	+
15448	+ /**
15449	+ * Make option as selected and scroll to selected position
15450	+ * @param {jQuery} collection Select options jQuery element
15451	+ * @param {Element} newOption element of the new option
15452	+ * @param {Boolean} firstActivation If on first activation of select
15453	+ */
15454	+ var activateOption = function (collection, newOption, firstActivation) {
15455	+ if (newOption) {
15456	+ collection.find('li.selected').removeClass('selected');
15457	+ var option = $(newOption);
15458	+ option.addClass('selected');
15459	+ if (!multiple \|\| !!firstActivation) {
15460	+ options.scrollTo(option);
15461	+ }
15462	+ }
15463	+ };
15464	+
15465	+ // Allow user to search by typing
15466	+ // this array is cleared after 1 second
15467	+ var filterQuery = [],
15468	+ onKeyDown = function (e) {
15469	+ // TAB - switch to another input
15470	+ if (e.which == 9) {
15471	+ $newSelect.trigger('close');
15472	+ return;
15473	+ }
15474	+
15475	+ // ARROW DOWN WHEN SELECT IS CLOSED - open select options
15476	+ if (e.which == 40 && !options.is(':visible')) {
15477	+ $newSelect.trigger('open');
15478	+ return;
15479	+ }
15480	+
15481	+ // ENTER WHEN SELECT IS CLOSED - submit form
15482	+ if (e.which == 13 && !options.is(':visible')) {
15483	+ return;
15484	+ }
15485	+
15486	+ e.preventDefault();
15487	+
15488	+ // CASE WHEN USER TYPE LETTERS
15489	+ var letter = String.fromCharCode(e.which).toLowerCase(),
15490	+ nonLetters = [9, 13, 27, 38, 40];
15491	+ if (letter && nonLetters.indexOf(e.which) === -1) {
15492	+ filterQuery.push(letter);
15493	+
15494	+ var string = filterQuery.join(''),
15495	+ newOption = options.find('li').filter(function () {
15496	+ return $(this).text().toLowerCase().indexOf(string) === 0;
15497	+ })[0];
15498	+
15499	+ if (newOption) {
15500	+ activateOption(options, newOption);
15501	+ }
15502	+ }
15503	+
15504	+ // ENTER - select option and close when select options are opened
15505	+ if (e.which == 13) {
15506	+ var activeOption = options.find('li.selected:not(.disabled)')[0];
15507	+ if (activeOption) {
15508	+ $(activeOption).trigger('click');
15509	+ if (!multiple) {
15510	+ $newSelect.trigger('close');
15511	+ }
15512	+ }
15513	+ }
15514	+
15515	+ // ARROW DOWN - move to next not disabled option
15516	+ if (e.which == 40) {
15517	+ if (options.find('li.selected').length) {
15518	+ newOption = options.find('li.selected').next('li:not(.disabled)')[0];
15519	+ } else {
15520	+ newOption = options.find('li:not(.disabled)')[0];
15521	+ }
15522	+ activateOption(options, newOption);
15523	+ }
15524	+
15525	+ // ESC - close options
15526	+ if (e.which == 27) {
15527	+ $newSelect.trigger('close');
15528	+ }
15529	+
15530	+ // ARROW UP - move to previous not disabled option
15531	+ if (e.which == 38) {
15532	+ newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
15533	+ if (newOption) activateOption(options, newOption);
15534	+ }
15535	+
15536	+ // Automaticaly clean filter query so user can search again by starting letters
15537	+ setTimeout(function () {
15538	+ filterQuery = [];
15539	+ }, 1000);
15540	+ };
15541	+
15542	+ $newSelect.on('keydown', onKeyDown);
15543	+ });
15544	+
15545	+ function toggleEntryFromArray(entriesArray, entryIndex, select) {
15546	+ var index = entriesArray.indexOf(entryIndex),
15547	+ notAdded = index === -1;
15548	+
15549	+ if (notAdded) {
15550	+ entriesArray.push(entryIndex);
15551	+ } else {
15552	+ entriesArray.splice(index, 1);
15553	+ }
15554	+
15555	+ select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
15556	+
15557	+ // use notAdded instead of true (to detect if the option is selected or not)
15558	+ select.find('option').eq(entryIndex).prop('selected', notAdded);
15559	+ setValueToInput(entriesArray, select);
15560	+
15561	+ return notAdded;
15562	+ }
15563	+
15564	+ function setValueToInput(entriesArray, select) {
15565	+ var value = '';
15566	+
15567	+ for (var i = 0, count = entriesArray.length; i < count; i++) {
15568	+ var text = select.find('option').eq(entriesArray[i]).text();
15569	+
15570	+ i === 0 ? value += text : value += ', ' + text;
15571	+ }
15572	+
15573	+ if (value === '') {
15574	+ value = select.find('option:disabled').eq(0).text();
15575	+ }
15576	+
15577	+ select.siblings('input.select-dropdown').val(value);
15578	+ }
15579	+ };
15580	+ })(jQuery);
15581	+ ;(function ($) {
15582	+
15583	+ var methods = {
15584	+
15585	+ init: function (options) {
15586	+ var defaults = {
15587	+ indicators: true,
15588	+ height: 400,
15589	+ transition: 500,
15590	+ interval: 6000
15591	+ };
15592	+ options = $.extend(defaults, options);
15593	+
15594	+ return this.each(function () {
15595	+
15596	+ // For each slider, we want to keep track of
15597	+ // which slide is active and its associated content
15598	+ var $this = $(this);
15599	+ var $slider = $this.find('ul.slides').first();
15600	+ var $slides = $slider.find('> li');
15601	+ var $active_index = $slider.find('.active').index();
15602	+ var $active, $indicators, $interval;
15603	+ if ($active_index != -1) {
15604	+ $active = $slides.eq($active_index);
15605	+ }
15606	+
15607	+ // Transitions the caption depending on alignment
15608	+ function captionTransition(caption, duration) {
15609	+ if (caption.hasClass("center-align")) {
15610	+ caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
15611	+ } else if (caption.hasClass("right-align")) {
15612	+ caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
15613	+ } else if (caption.hasClass("left-align")) {
15614	+ caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
15615	+ }
15616	+ }
15617	+
15618	+ // This function will transition the slide to any index of the next slide
15619	+ function moveToSlide(index) {
15620	+ // Wrap around indices.
15621	+ if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
15622	+
15623	+ $active_index = $slider.find('.active').index();
15624	+
15625	+ // Only do if index changes
15626	+ if ($active_index != index) {
15627	+ $active = $slides.eq($active_index);
15628	+ $caption = $active.find('.caption');
15629	+
15630	+ $active.removeClass('active');
15631	+ $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
15632	+ complete: function () {
15633	+ $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
15634	+ } });
15635	+ captionTransition($caption, options.transition);
15636	+
15637	+ // Update indicators
15638	+ if (options.indicators) {
15639	+ $indicators.eq($active_index).removeClass('active');
15640	+ }
15641	+
15642	+ $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
15643	+ $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
15644	+ $slides.eq(index).addClass('active');
15645	+
15646	+ // Update indicators
15647	+ if (options.indicators) {
15648	+ $indicators.eq(index).addClass('active');
15649	+ }
15650	+ }
15651	+ }
15652	+
15653	+ // Set height of slider
15654	+ // If fullscreen, do nothing
15655	+ if (!$this.hasClass('fullscreen')) {
15656	+ if (options.indicators) {
15657	+ // Add height if indicators are present
15658	+ $this.height(options.height + 40);
15659	+ } else {
15660	+ $this.height(options.height);
15661	+ }
15662	+ $slider.height(options.height);
15663	+ }
15664	+
15665	+ // Set initial positions of captions
15666	+ $slides.find('.caption').each(function () {
15667	+ captionTransition($(this), 0);
15668	+ });
15669	+
15670	+ // Move img src into background-image
15671	+ $slides.find('img').each(function () {
15672	+ var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
15673	+ if ($(this).attr('src') !== placeholderBase64) {
15674	+ $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
15675	+ $(this).attr('src', placeholderBase64);
15676	+ }
15677	+ });
15678	+
15679	+ // dynamically add indicators
15680	+ if (options.indicators) {
15681	+ $indicators = $('<ul class="indicators"></ul>');
15682	+ $slides.each(function (index) {
15683	+ var $indicator = $('<li class="indicator-item"></li>');
15684	+
15685	+ // Handle clicks on indicators
15686	+ $indicator.click(function () {
15687	+ var $parent = $slider.parent();
15688	+ var curr_index = $parent.find($(this)).index();
15689	+ moveToSlide(curr_index);
15690	+
15691	+ // reset interval
15692	+ clearInterval($interval);
15693	+ $interval = setInterval(function () {
15694	+ $active_index = $slider.find('.active').index();
15695	+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
15696	+ else $active_index += 1;
15697	+
15698	+ moveToSlide($active_index);
15699	+ }, options.transition + options.interval);
15700	+ });
15701	+ $indicators.append($indicator);
15702	+ });
15703	+ $this.append($indicators);
15704	+ $indicators = $this.find('ul.indicators').find('li.indicator-item');
15705	+ }
15706	+
15707	+ if ($active) {
15708	+ $active.show();
15709	+ } else {
15710	+ $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
15711	+
15712	+ $active_index = 0;
15713	+ $active = $slides.eq($active_index);
15714	+
15715	+ // Update indicators
15716	+ if (options.indicators) {
15717	+ $indicators.eq($active_index).addClass('active');
15718	+ }
15719	+ }
15720	+
15721	+ // Adjust height to current slide
15722	+ $active.find('img').each(function () {
15723	+ $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
15724	+ });
15725	+
15726	+ // auto scroll
15727	+ $interval = setInterval(function () {
15728	+ $active_index = $slider.find('.active').index();
15729	+ moveToSlide($active_index + 1);
15730	+ }, options.transition + options.interval);
15731	+
15732	+ // HammerJS, Swipe navigation
15733	+
15734	+ // Touch Event
15735	+ var panning = false;
15736	+ var swipeLeft = false;
15737	+ var swipeRight = false;
15738	+
15739	+ $this.hammer({
15740	+ prevent_default: false
15741	+ }).on('pan', function (e) {
15742	+ if (e.gesture.pointerType === "touch") {
15743	+
15744	+ // reset interval
15745	+ clearInterval($interval);
15746	+
15747	+ var direction = e.gesture.direction;
15748	+ var x = e.gesture.deltaX;
15749	+ var velocityX = e.gesture.velocityX;
15750	+ var velocityY = e.gesture.velocityY;
15751	+
15752	+ $curr_slide = $slider.find('.active');
15753	+ if (Math.abs(velocityX) > Math.abs(velocityY)) {
15754	+ $curr_slide.velocity({ translateX: x
15755	+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
15756	+ }
15757	+
15758	+ // Swipe Left
15759	+ if (direction === 4 && (x > $this.innerWidth() / 2 \|\| velocityX < -0.65)) {
15760	+ swipeRight = true;
15761	+ }
15762	+ // Swipe Right
15763	+ else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 \|\| velocityX > 0.65)) {
15764	+ swipeLeft = true;
15765	+ }
15766	+
15767	+ // Make Slide Behind active slide visible
15768	+ var next_slide;
15769	+ if (swipeLeft) {
15770	+ next_slide = $curr_slide.next();
15771	+ if (next_slide.length === 0) {
15772	+ next_slide = $slides.first();
15773	+ }
15774	+ next_slide.velocity({ opacity: 1
15775	+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
15776	+ }
15777	+ if (swipeRight) {
15778	+ next_slide = $curr_slide.prev();
15779	+ if (next_slide.length === 0) {
15780	+ next_slide = $slides.last();
15781	+ }
15782	+ next_slide.velocity({ opacity: 1
15783	+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
15784	+ }
15785	+ }
15786	+ }).on('panend', function (e) {
15787	+ if (e.gesture.pointerType === "touch") {
15788	+
15789	+ $curr_slide = $slider.find('.active');
15790	+ panning = false;
15791	+ curr_index = $slider.find('.active').index();
15792	+
15793	+ if (!swipeRight && !swipeLeft \|\| $slides.length <= 1) {
15794	+ // Return to original spot
15795	+ $curr_slide.velocity({ translateX: 0
15796	+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
15797	+ } else if (swipeLeft) {
15798	+ moveToSlide(curr_index + 1);
15799	+ $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
15800	+ complete: function () {
15801	+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
15802	+ } });
15803	+ } else if (swipeRight) {
15804	+ moveToSlide(curr_index - 1);
15805	+ $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
15806	+ complete: function () {
15807	+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
15808	+ } });
15809	+ }
15810	+ swipeLeft = false;
15811	+ swipeRight = false;
15812	+
15813	+ // Restart interval
15814	+ clearInterval($interval);
15815	+ $interval = setInterval(function () {
15816	+ $active_index = $slider.find('.active').index();
15817	+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
15818	+ else $active_index += 1;
15819	+
15820	+ moveToSlide($active_index);
15821	+ }, options.transition + options.interval);
15822	+ }
15823	+ });
15824	+
15825	+ $this.on('sliderPause', function () {
15826	+ clearInterval($interval);
15827	+ });
15828	+
15829	+ $this.on('sliderStart', function () {
15830	+ clearInterval($interval);
15831	+ $interval = setInterval(function () {
15832	+ $active_index = $slider.find('.active').index();
15833	+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
15834	+ else $active_index += 1;
15835	+
15836	+ moveToSlide($active_index);
15837	+ }, options.transition + options.interval);
15838	+ });
15839	+
15840	+ $this.on('sliderNext', function () {
15841	+ $active_index = $slider.find('.active').index();
15842	+ moveToSlide($active_index + 1);
15843	+ });
15844	+
15845	+ $this.on('sliderPrev', function () {
15846	+ $active_index = $slider.find('.active').index();
15847	+ moveToSlide($active_index - 1);
15848	+ });
15849	+ });
15850	+ },
15851	+ pause: function () {
15852	+ $(this).trigger('sliderPause');
15853	+ },
15854	+ start: function () {
15855	+ $(this).trigger('sliderStart');
15856	+ },
15857	+ next: function () {
15858	+ $(this).trigger('sliderNext');
15859	+ },
15860	+ prev: function () {
15861	+ $(this).trigger('sliderPrev');
15862	+ }
15863	+ };
15864	+
15865	+ $.fn.slider = function (methodOrOptions) {
15866	+ if (methods[methodOrOptions]) {
15867	+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
15868	+ } else if (typeof methodOrOptions === 'object' \|\| !methodOrOptions) {
15869	+ // Default to "init"
15870	+ return methods.init.apply(this, arguments);
15871	+ } else {
15872	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
15873	+ }
15874	+ }; // Plugin end
15875	+ })(jQuery);
15876	+ ;(function ($) {
15877	+ $(document).ready(function () {
15878	+
15879	+ $(document).on('click.card', '.card', function (e) {
15880	+ if ($(this).find('> .card-reveal').length) {
15881	+ var $card = $(e.target).closest('.card');
15882	+ if ($card.data('initialOverflow') === undefined) {
15883	+ $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
15884	+ }
15885	+ if ($(e.target).is($('.card-reveal .card-title')) \|\| $(e.target).is($('.card-reveal .card-title i'))) {
15886	+ // Make Reveal animate down and display none
15887	+ $(this).find('.card-reveal').velocity({ translateY: 0 }, {
15888	+ duration: 225,
15889	+ queue: false,
15890	+ easing: 'easeInOutQuad',
15891	+ complete: function () {
15892	+ $(this).css({ display: 'none' });
15893	+ $card.css('overflow', $card.data('initialOverflow'));
15894	+ }
15895	+ });
15896	+ } else if ($(e.target).is($('.card .activator')) \|\| $(e.target).is($('.card .activator i'))) {
15897	+ $card.css('overflow', 'hidden');
15898	+ $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
15899	+ }
15900	+ }
15901	+ });
15902	+ });
15903	+ })(jQuery);
15904	+ ;(function ($) {
15905	+ var materialChipsDefaults = {
15906	+ data: [],
15907	+ placeholder: '',
15908	+ secondaryPlaceholder: '',
15909	+ autocompleteOptions: {}
15910	+ };
15911	+
15912	+ $(document).ready(function () {
15913	+ // Handle removal of static chips.
15914	+ $(document).on('click', '.chip .close', function (e) {
15915	+ var $chips = $(this).closest('.chips');
15916	+ if ($chips.attr('data-initialized')) {
15917	+ return;
15918	+ }
15919	+ $(this).closest('.chip').remove();
15920	+ });
15921	+ });
15922	+
15923	+ $.fn.material_chip = function (options) {
15924	+ var self = this;
15925	+ this.$el = $(this);
15926	+ this.$document = $(document);
15927	+ this.SELS = {
15928	+ CHIPS: '.chips',
15929	+ CHIP: '.chip',
15930	+ INPUT: 'input',
15931	+ DELETE: '.material-icons',
15932	+ SELECTED_CHIP: '.selected'
15933	+ };
15934	+
15935	+ if ('data' === options) {
15936	+ return this.$el.data('chips');
15937	+ }
15938	+
15939	+ var curr_options = $.extend({}, materialChipsDefaults, options);
15940	+ self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
15941	+
15942	+ // Initialize
15943	+ this.init = function () {
15944	+ var i = 0;
15945	+ var chips;
15946	+ self.$el.each(function () {
15947	+ var $chips = $(this);
15948	+ var chipId = Materialize.guid();
15949	+ self.chipId = chipId;
15950	+
15951	+ if (!curr_options.data \|\| !(curr_options.data instanceof Array)) {
15952	+ curr_options.data = [];
15953	+ }
15954	+ $chips.data('chips', curr_options.data);
15955	+ $chips.attr('data-index', i);
15956	+ $chips.attr('data-initialized', true);
15957	+
15958	+ if (!$chips.hasClass(self.SELS.CHIPS)) {
15959	+ $chips.addClass('chips');
15960	+ }
15961	+
15962	+ self.chips($chips, chipId);
15963	+ i++;
15964	+ });
15965	+ };
15966	+
15967	+ this.handleEvents = function () {
15968	+ var SELS = self.SELS;
15969	+
15970	+ self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
15971	+ $(e.target).find(SELS.INPUT).focus();
15972	+ });
15973	+
15974	+ self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
15975	+ var $chip = $(e.target);
15976	+ if ($chip.length) {
15977	+ var wasSelected = $chip.hasClass('selected');
15978	+ var $chips = $chip.closest(SELS.CHIPS);
15979	+ $(SELS.CHIP).removeClass('selected');
15980	+
15981	+ if (!wasSelected) {
15982	+ self.selectChip($chip.index(), $chips);
15983	+ }
15984	+ }
15985	+ });
15986	+
15987	+ self.$document.off('keydown.chips').on('keydown.chips', function (e) {
15988	+ if ($(e.target).is('input, textarea')) {
15989	+ return;
15990	+ }
15991	+
15992	+ // delete
15993	+ var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
15994	+ var $chips = $chip.closest(SELS.CHIPS);
15995	+ var length = $chip.siblings(SELS.CHIP).length;
15996	+ var index;
15997	+
15998	+ if (!$chip.length) {
15999	+ return;
16000	+ }
16001	+
16002	+ if (e.which === 8 \|\| e.which === 46) {
16003	+ e.preventDefault();
16004	+
16005	+ index = $chip.index();
16006	+ self.deleteChip(index, $chips);
16007	+
16008	+ var selectIndex = null;
16009	+ if (index + 1 < length) {
16010	+ selectIndex = index;
16011	+ } else if (index === length \|\| index + 1 === length) {
16012	+ selectIndex = length - 1;
16013	+ }
16014	+
16015	+ if (selectIndex < 0) selectIndex = null;
16016	+
16017	+ if (null !== selectIndex) {
16018	+ self.selectChip(selectIndex, $chips);
16019	+ }
16020	+ if (!length) $chips.find('input').focus();
16021	+
16022	+ // left
16023	+ } else if (e.which === 37) {
16024	+ index = $chip.index() - 1;
16025	+ if (index < 0) {
16026	+ return;
16027	+ }
16028	+ $(SELS.CHIP).removeClass('selected');
16029	+ self.selectChip(index, $chips);
16030	+
16031	+ // right
16032	+ } else if (e.which === 39) {
16033	+ index = $chip.index() + 1;
16034	+ $(SELS.CHIP).removeClass('selected');
16035	+ if (index > length) {
16036	+ $chips.find('input').focus();
16037	+ return;
16038	+ }
16039	+ self.selectChip(index, $chips);
16040	+ }
16041	+ });
16042	+
16043	+ self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
16044	+ var $currChips = $(e.target).closest(SELS.CHIPS);
16045	+ $currChips.addClass('focus');
16046	+ $currChips.siblings('label, .prefix').addClass('active');
16047	+ $(SELS.CHIP).removeClass('selected');
16048	+ });
16049	+
16050	+ self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
16051	+ var $currChips = $(e.target).closest(SELS.CHIPS);
16052	+ $currChips.removeClass('focus');
16053	+
16054	+ // Remove active if empty
16055	+ if ($currChips.data('chips') === undefined \|\| !$currChips.data('chips').length) {
16056	+ $currChips.siblings('label').removeClass('active');
16057	+ }
16058	+ $currChips.siblings('.prefix').removeClass('active');
16059	+ });
16060	+
16061	+ self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
16062	+ var $target = $(e.target);
16063	+ var $chips = $target.closest(SELS.CHIPS);
16064	+ var chipsLength = $chips.children(SELS.CHIP).length;
16065	+
16066	+ // enter
16067	+ if (13 === e.which) {
16068	+ // Override enter if autocompleting.
16069	+ if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
16070	+ return;
16071	+ }
16072	+
16073	+ e.preventDefault();
16074	+ self.addChip({ tag: $target.val() }, $chips);
16075	+ $target.val('');
16076	+ return;
16077	+ }
16078	+
16079	+ // delete or left
16080	+ if ((8 === e.keyCode \|\| 37 === e.keyCode) && '' === $target.val() && chipsLength) {
16081	+ e.preventDefault();
16082	+ self.selectChip(chipsLength - 1, $chips);
16083	+ $target.blur();
16084	+ return;
16085	+ }
16086	+ });
16087	+
16088	+ // Click on delete icon in chip.
16089	+ self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
16090	+ var $target = $(e.target);
16091	+ var $chips = $target.closest(SELS.CHIPS);
16092	+ var $chip = $target.closest(SELS.CHIP);
16093	+ e.stopPropagation();
16094	+ self.deleteChip($chip.index(), $chips);
16095	+ $chips.find('input').focus();
16096	+ });
16097	+ };
16098	+
16099	+ this.chips = function ($chips, chipId) {
16100	+ $chips.empty();
16101	+ $chips.data('chips').forEach(function (elem) {
16102	+ $chips.append(self.renderChip(elem));
16103	+ });
16104	+ $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
16105	+ self.setPlaceholder($chips);
16106	+
16107	+ // Set for attribute for label
16108	+ var label = $chips.next('label');
16109	+ if (label.length) {
16110	+ label.attr('for', chipId);
16111	+
16112	+ if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
16113	+ label.addClass('active');
16114	+ }
16115	+ }
16116	+
16117	+ // Setup autocomplete if needed.
16118	+ var input = $('#' + chipId);
16119	+ if (self.hasAutocomplete) {
16120	+ curr_options.autocompleteOptions.onAutocomplete = function (val) {
16121	+ self.addChip({ tag: val }, $chips);
16122	+ input.val('');
16123	+ input.focus();
16124	+ };
16125	+ input.autocomplete(curr_options.autocompleteOptions);
16126	+ }
16127	+ };
16128	+
16129	+ /**
16130	+ * Render chip jQuery element.
16131	+ * @param {Object} elem
16132	+ * @return {jQuery}
16133	+ */
16134	+ this.renderChip = function (elem) {
16135	+ if (!elem.tag) return;
16136	+
16137	+ var $renderedChip = $('<div class="chip"></div>');
16138	+ $renderedChip.text(elem.tag);
16139	+ if (elem.image) {
16140	+ $renderedChip.prepend($('<img />').attr('src', elem.image));
16141	+ }
16142	+ $renderedChip.append($('<i class="material-icons close">close</i>'));
16143	+ return $renderedChip;
16144	+ };
16145	+
16146	+ this.setPlaceholder = function ($chips) {
16147	+ if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
16148	+ $chips.find('input').prop('placeholder', curr_options.placeholder);
16149	+ } else if (($chips.data('chips') === undefined \|\| !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
16150	+ $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
16151	+ }
16152	+ };
16153	+
16154	+ this.isValid = function ($chips, elem) {
16155	+ var chips = $chips.data('chips');
16156	+ var exists = false;
16157	+ for (var i = 0; i < chips.length; i++) {
16158	+ if (chips[i].tag === elem.tag) {
16159	+ exists = true;
16160	+ return;
16161	+ }
16162	+ }
16163	+ return '' !== elem.tag && !exists;
16164	+ };
16165	+
16166	+ this.addChip = function (elem, $chips) {
16167	+ if (!self.isValid($chips, elem)) {
16168	+ return;
16169	+ }
16170	+ var $renderedChip = self.renderChip(elem);
16171	+ var newData = [];
16172	+ var oldData = $chips.data('chips');
16173	+ for (var i = 0; i < oldData.length; i++) {
16174	+ newData.push(oldData[i]);
16175	+ }
16176	+ newData.push(elem);
16177	+
16178	+ $chips.data('chips', newData);
16179	+ $renderedChip.insertBefore($chips.find('input'));
16180	+ $chips.trigger('chip.add', elem);
16181	+ self.setPlaceholder($chips);
16182	+ };
16183	+
16184	+ this.deleteChip = function (chipIndex, $chips) {
16185	+ var chip = $chips.data('chips')[chipIndex];
16186	+ $chips.find('.chip').eq(chipIndex).remove();
16187	+
16188	+ var newData = [];
16189	+ var oldData = $chips.data('chips');
16190	+ for (var i = 0; i < oldData.length; i++) {
16191	+ if (i !== chipIndex) {
16192	+ newData.push(oldData[i]);
16193	+ }
16194	+ }
16195	+
16196	+ $chips.data('chips', newData);
16197	+ $chips.trigger('chip.delete', chip);
16198	+ self.setPlaceholder($chips);
16199	+ };
16200	+
16201	+ this.selectChip = function (chipIndex, $chips) {
16202	+ var $chip = $chips.find('.chip').eq(chipIndex);
16203	+ if ($chip && false === $chip.hasClass('selected')) {
16204	+ $chip.addClass('selected');
16205	+ $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
16206	+ }
16207	+ };
16208	+
16209	+ this.getChipsElement = function (index, $chips) {
16210	+ return $chips.eq(index);
16211	+ };
16212	+
16213	+ // init
16214	+ this.init();
16215	+
16216	+ this.handleEvents();
16217	+ };
16218	+ })(jQuery);
16219	+ ;(function ($) {
16220	+ $.fn.pushpin = function (options) {
16221	+ // Defaults
16222	+ var defaults = {
16223	+ top: 0,
16224	+ bottom: Infinity,
16225	+ offset: 0
16226	+ };
16227	+
16228	+ // Remove pushpin event and classes
16229	+ if (options === "remove") {
16230	+ this.each(function () {
16231	+ if (id = $(this).data('pushpin-id')) {
16232	+ $(window).off('scroll.' + id);
16233	+ $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
16234	+ }
16235	+ });
16236	+ return false;
16237	+ }
16238	+
16239	+ options = $.extend(defaults, options);
16240	+
16241	+ $index = 0;
16242	+ return this.each(function () {
16243	+ var $uniqueId = Materialize.guid(),
16244	+ $this = $(this),
16245	+ $original_offset = $(this).offset().top;
16246	+
16247	+ function removePinClasses(object) {
16248	+ object.removeClass('pin-top');
16249	+ object.removeClass('pinned');
16250	+ object.removeClass('pin-bottom');
16251	+ }
16252	+
16253	+ function updateElements(objects, scrolled) {
16254	+ objects.each(function () {
16255	+ // Add position fixed (because its between top and bottom)
16256	+ if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
16257	+ removePinClasses($(this));
16258	+ $(this).css('top', options.offset);
16259	+ $(this).addClass('pinned');
16260	+ }
16261	+
16262	+ // Add pin-top (when scrolled position is above top)
16263	+ if (scrolled < options.top && !$(this).hasClass('pin-top')) {
16264	+ removePinClasses($(this));
16265	+ $(this).css('top', 0);
16266	+ $(this).addClass('pin-top');
16267	+ }
16268	+
16269	+ // Add pin-bottom (when scrolled position is below bottom)
16270	+ if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
16271	+ removePinClasses($(this));
16272	+ $(this).addClass('pin-bottom');
16273	+ $(this).css('top', options.bottom - $original_offset);
16274	+ }
16275	+ });
16276	+ }
16277	+
16278	+ $(this).data('pushpin-id', $uniqueId);
16279	+ updateElements($this, $(window).scrollTop());
16280	+ $(window).on('scroll.' + $uniqueId, function () {
16281	+ var $scrolled = $(window).scrollTop() + options.offset;
16282	+ updateElements($this, $scrolled);
16283	+ });
16284	+ });
16285	+ };
16286	+ })(jQuery);;(function ($) {
16287	+ $(document).ready(function () {
16288	+
16289	+ // jQuery reverse
16290	+ $.fn.reverse = [].reverse;
16291	+
16292	+ // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
16293	+ $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
16294	+ var $this = $(this);
16295	+ openFABMenu($this);
16296	+ });
16297	+ $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
16298	+ var $this = $(this);
16299	+ closeFABMenu($this);
16300	+ });
16301	+
16302	+ // Toggle-on-click behaviour.
16303	+ $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
16304	+ var $this = $(this);
16305	+ var $menu = $this.parent();
16306	+ if ($menu.hasClass('active')) {
16307	+ closeFABMenu($menu);
16308	+ } else {
16309	+ openFABMenu($menu);
16310	+ }
16311	+ });
16312	+
16313	+ // Toolbar transition behaviour.
16314	+ $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
16315	+ var $this = $(this);
16316	+ var $menu = $this.parent();
16317	+ FABtoToolbar($menu);
16318	+ });
16319	+ });
16320	+
16321	+ $.fn.extend({
16322	+ openFAB: function () {
16323	+ openFABMenu($(this));
16324	+ },
16325	+ closeFAB: function () {
16326	+ closeFABMenu($(this));
16327	+ },
16328	+ openToolbar: function () {
16329	+ FABtoToolbar($(this));
16330	+ },
16331	+ closeToolbar: function () {
16332	+ toolbarToFAB($(this));
16333	+ }
16334	+ });
16335	+
16336	+ var openFABMenu = function (btn) {
16337	+ var $this = btn;
16338	+ if ($this.hasClass('active') === false) {
16339	+
16340	+ // Get direction option
16341	+ var horizontal = $this.hasClass('horizontal');
16342	+ var offsetY, offsetX;
16343	+
16344	+ if (horizontal === true) {
16345	+ offsetX = 40;
16346	+ } else {
16347	+ offsetY = 40;
16348	+ }
16349	+
16350	+ $this.addClass('active');
16351	+ $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
16352	+
16353	+ var time = 0;
16354	+ $this.find('ul .btn-floating').reverse().each(function () {
16355	+ $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
16356	+ time += 40;
16357	+ });
16358	+ }
16359	+ };
16360	+
16361	+ var closeFABMenu = function (btn) {
16362	+ var $this = btn;
16363	+ // Get direction option
16364	+ var horizontal = $this.hasClass('horizontal');
16365	+ var offsetY, offsetX;
16366	+
16367	+ if (horizontal === true) {
16368	+ offsetX = 40;
16369	+ } else {
16370	+ offsetY = 40;
16371	+ }
16372	+
16373	+ $this.removeClass('active');
16374	+ var time = 0;
16375	+ $this.find('ul .btn-floating').velocity("stop", true);
16376	+ $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
16377	+ };
16378	+
16379	+ /**
16380	+ * Transform FAB into toolbar
16381	+ * @param {Object} object jQuery object
16382	+ */
16383	+ var FABtoToolbar = function (btn) {
16384	+ if (btn.attr('data-open') === "true") {
16385	+ return;
16386	+ }
16387	+
16388	+ var offsetX, offsetY, scaleFactor;
16389	+ var windowWidth = window.innerWidth;
16390	+ var windowHeight = window.innerHeight;
16391	+ var btnRect = btn[0].getBoundingClientRect();
16392	+ var anchor = btn.find('> a').first();
16393	+ var menu = btn.find('> ul').first();
16394	+ var backdrop = $('<div class="fab-backdrop"></div>');
16395	+ var fabColor = anchor.css('background-color');
16396	+ anchor.append(backdrop);
16397	+
16398	+ offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
16399	+ offsetY = windowHeight - btnRect.bottom;
16400	+ scaleFactor = windowWidth / backdrop.width();
16401	+ btn.attr('data-origin-bottom', btnRect.bottom);
16402	+ btn.attr('data-origin-left', btnRect.left);
16403	+ btn.attr('data-origin-width', btnRect.width);
16404	+
16405	+ // Set initial state
16406	+ btn.addClass('active');
16407	+ btn.attr('data-open', true);
16408	+ btn.css({
16409	+ 'text-align': 'center',
16410	+ width: '100%',
16411	+ bottom: 0,
16412	+ left: 0,
16413	+ transform: 'translateX(' + offsetX + 'px)',
16414	+ transition: 'none'
16415	+ });
16416	+ anchor.css({
16417	+ transform: 'translateY(' + -offsetY + 'px)',
16418	+ transition: 'none'
16419	+ });
16420	+ backdrop.css({
16421	+ 'background-color': fabColor
16422	+ });
16423	+
16424	+ setTimeout(function () {
16425	+ btn.css({
16426	+ transform: '',
16427	+ transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
16428	+ });
16429	+ anchor.css({
16430	+ overflow: 'visible',
16431	+ transform: '',
16432	+ transition: 'transform .2s'
16433	+ });
16434	+
16435	+ setTimeout(function () {
16436	+ btn.css({
16437	+ overflow: 'hidden',
16438	+ 'background-color': fabColor
16439	+ });
16440	+ backdrop.css({
16441	+ transform: 'scale(' + scaleFactor + ')',
16442	+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
16443	+ });
16444	+ menu.find('> li > a').css({
16445	+ opacity: 1
16446	+ });
16447	+
16448	+ // Scroll to close.
16449	+ $(window).on('scroll.fabToolbarClose', function () {
16450	+ toolbarToFAB(btn);
16451	+ $(window).off('scroll.fabToolbarClose');
16452	+ $(document).off('click.fabToolbarClose');
16453	+ });
16454	+
16455	+ $(document).on('click.fabToolbarClose', function (e) {
16456	+ if (!$(e.target).closest(menu).length) {
16457	+ toolbarToFAB(btn);
16458	+ $(window).off('scroll.fabToolbarClose');
16459	+ $(document).off('click.fabToolbarClose');
16460	+ }
16461	+ });
16462	+ }, 100);
16463	+ }, 0);
16464	+ };
16465	+
16466	+ /**
16467	+ * Transform toolbar back into FAB
16468	+ * @param {Object} object jQuery object
16469	+ */
16470	+ var toolbarToFAB = function (btn) {
16471	+ if (btn.attr('data-open') !== "true") {
16472	+ return;
16473	+ }
16474	+
16475	+ var offsetX, offsetY, scaleFactor;
16476	+ var windowWidth = window.innerWidth;
16477	+ var windowHeight = window.innerHeight;
16478	+ var btnWidth = btn.attr('data-origin-width');
16479	+ var btnBottom = btn.attr('data-origin-bottom');
16480	+ var btnLeft = btn.attr('data-origin-left');
16481	+ var anchor = btn.find('> .btn-floating').first();
16482	+ var menu = btn.find('> ul').first();
16483	+ var backdrop = btn.find('.fab-backdrop');
16484	+ var fabColor = anchor.css('background-color');
16485	+
16486	+ offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
16487	+ offsetY = windowHeight - btnBottom;
16488	+ scaleFactor = windowWidth / backdrop.width();
16489	+
16490	+ // Hide backdrop
16491	+ btn.removeClass('active');
16492	+ btn.attr('data-open', false);
16493	+ btn.css({
16494	+ 'background-color': 'transparent',
16495	+ transition: 'none'
16496	+ });
16497	+ anchor.css({
16498	+ transition: 'none'
16499	+ });
16500	+ backdrop.css({
16501	+ transform: 'scale(0)',
16502	+ 'background-color': fabColor
16503	+ });
16504	+ menu.find('> li > a').css({
16505	+ opacity: ''
16506	+ });
16507	+
16508	+ setTimeout(function () {
16509	+ backdrop.remove();
16510	+
16511	+ // Set initial state.
16512	+ btn.css({
16513	+ 'text-align': '',
16514	+ width: '',
16515	+ bottom: '',
16516	+ left: '',
16517	+ overflow: '',
16518	+ 'background-color': '',
16519	+ transform: 'translate3d(' + -offsetX + 'px,0,0)'
16520	+ });
16521	+ anchor.css({
16522	+ overflow: '',
16523	+ transform: 'translate3d(0,' + offsetY + 'px,0)'
16524	+ });
16525	+
16526	+ setTimeout(function () {
16527	+ btn.css({
16528	+ transform: 'translate3d(0,0,0)',
16529	+ transition: 'transform .2s'
16530	+ });
16531	+ anchor.css({
16532	+ transform: 'translate3d(0,0,0)',
16533	+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
16534	+ });
16535	+ }, 20);
16536	+ }, 200);
16537	+ };
16538	+ })(jQuery);
16539	+ ;(function ($) {
16540	+ // Image transition function
16541	+ Materialize.fadeInImage = function (selectorOrEl) {
16542	+ var element;
16543	+ if (typeof selectorOrEl === 'string') {
16544	+ element = $(selectorOrEl);
16545	+ } else if (typeof selectorOrEl === 'object') {
16546	+ element = selectorOrEl;
16547	+ } else {
16548	+ return;
16549	+ }
16550	+ element.css({ opacity: 0 });
16551	+ $(element).velocity({ opacity: 1 }, {
16552	+ duration: 650,
16553	+ queue: false,
16554	+ easing: 'easeOutSine'
16555	+ });
16556	+ $(element).velocity({ opacity: 1 }, {
16557	+ duration: 1300,
16558	+ queue: false,
16559	+ easing: 'swing',
16560	+ step: function (now, fx) {
16561	+ fx.start = 100;
16562	+ var grayscale_setting = now / 100;
16563	+ var brightness_setting = 150 - (100 - now) / 1.75;
16564	+
16565	+ if (brightness_setting < 100) {
16566	+ brightness_setting = 100;
16567	+ }
16568	+ if (now >= 0) {
16569	+ $(this).css({
16570	+ "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
16571	+ "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
16572	+ });
16573	+ }
16574	+ }
16575	+ });
16576	+ };
16577	+
16578	+ // Horizontal staggered list
16579	+ Materialize.showStaggeredList = function (selectorOrEl) {
16580	+ var element;
16581	+ if (typeof selectorOrEl === 'string') {
16582	+ element = $(selectorOrEl);
16583	+ } else if (typeof selectorOrEl === 'object') {
16584	+ element = selectorOrEl;
16585	+ } else {
16586	+ return;
16587	+ }
16588	+ var time = 0;
16589	+ element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
16590	+
16591	+ element.find('li').each(function () {
16592	+ $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
16593	+ time += 120;
16594	+ });
16595	+ };
16596	+
16597	+ $(document).ready(function () {
16598	+ // Hardcoded .staggered-list scrollFire
16599	+ // var staggeredListOptions = [];
16600	+ // $('ul.staggered-list').each(function (i) {
16601	+
16602	+ // var label = 'scrollFire-' + i;
16603	+ // $(this).addClass(label);
16604	+ // staggeredListOptions.push(
16605	+ // {selector: 'ul.staggered-list.' + label,
16606	+ // offset: 200,
16607	+ // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
16608	+ // });
16609	+ // scrollFire(staggeredListOptions);
16610	+
16611	+ // HammerJS, Swipe navigation
16612	+
16613	+ // Touch Event
16614	+ var swipeLeft = false;
16615	+ var swipeRight = false;
16616	+
16617	+ // Dismissible Collections
16618	+ $('.dismissable').each(function () {
16619	+ $(this).hammer({
16620	+ prevent_default: false
16621	+ }).on('pan', function (e) {
16622	+ if (e.gesture.pointerType === "touch") {
16623	+ var $this = $(this);
16624	+ var direction = e.gesture.direction;
16625	+ var x = e.gesture.deltaX;
16626	+ var velocityX = e.gesture.velocityX;
16627	+
16628	+ $this.velocity({ translateX: x
16629	+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
16630	+
16631	+ // Swipe Left
16632	+ if (direction === 4 && (x > $this.innerWidth() / 2 \|\| velocityX < -0.75)) {
16633	+ swipeLeft = true;
16634	+ }
16635	+
16636	+ // Swipe Right
16637	+ if (direction === 2 && (x < -1 * $this.innerWidth() / 2 \|\| velocityX > 0.75)) {
16638	+ swipeRight = true;
16639	+ }
16640	+ }
16641	+ }).on('panend', function (e) {
16642	+ // Reset if collection is moved back into original position
16643	+ if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
16644	+ swipeRight = false;
16645	+ swipeLeft = false;
16646	+ }
16647	+
16648	+ if (e.gesture.pointerType === "touch") {
16649	+ var $this = $(this);
16650	+ if (swipeLeft \|\| swipeRight) {
16651	+ var fullWidth;
16652	+ if (swipeLeft) {
16653	+ fullWidth = $this.innerWidth();
16654	+ } else {
16655	+ fullWidth = -1 * $this.innerWidth();
16656	+ }
16657	+
16658	+ $this.velocity({ translateX: fullWidth
16659	+ }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
16660	+ $this.css('border', 'none');
16661	+ $this.velocity({ height: 0, padding: 0
16662	+ }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
16663	+ $this.remove();
16664	+ }
16665	+ });
16666	+ }
16667	+ });
16668	+ } else {
16669	+ $this.velocity({ translateX: 0
16670	+ }, { duration: 100, queue: false, easing: 'easeOutQuad' });
16671	+ }
16672	+ swipeLeft = false;
16673	+ swipeRight = false;
16674	+ }
16675	+ });
16676	+ });
16677	+
16678	+ // time = 0
16679	+ // // Vertical Staggered list
16680	+ // $('ul.staggered-list.vertical li').velocity(
16681	+ // { translateY: "100px"},
16682	+ // { duration: 0 });
16683	+
16684	+ // $('ul.staggered-list.vertical li').each(function() {
16685	+ // $(this).velocity(
16686	+ // { opacity: "1", translateY: "0"},
16687	+ // { duration: 800, delay: time, easing: [60, 25] });
16688	+ // time += 120;
16689	+ // });
16690	+
16691	+ // // Fade in and Scale
16692	+ // $('.fade-in.scale').velocity(
16693	+ // { scaleX: .4, scaleY: .4, translateX: -600},
16694	+ // { duration: 0});
16695	+ // $('.fade-in').each(function() {
16696	+ // $(this).velocity(
16697	+ // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
16698	+ // { duration: 800, easing: [60, 10] });
16699	+ // });
16700	+ });
16701	+ })(jQuery);
16702	+ ;(function ($) {
16703	+
16704	+ var scrollFireEventsHandled = false;
16705	+
16706	+ // Input: Array of JSON objects {selector, offset, callback}
16707	+ Materialize.scrollFire = function (options) {
16708	+ var onScroll = function () {
16709	+ var windowScroll = window.pageYOffset + window.innerHeight;
16710	+
16711	+ for (var i = 0; i < options.length; i++) {
16712	+ // Get options from each line
16713	+ var value = options[i];
16714	+ var selector = value.selector,
16715	+ offset = value.offset,
16716	+ callback = value.callback;
16717	+
16718	+ var currentElement = document.querySelector(selector);
16719	+ if (currentElement !== null) {
16720	+ var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
16721	+
16722	+ if (windowScroll > elementOffset + offset) {
16723	+ if (value.done !== true) {
16724	+ if (typeof callback === 'function') {
16725	+ callback.call(this, currentElement);
16726	+ } else if (typeof callback === 'string') {
16727	+ var callbackFunc = new Function(callback);
16728	+ callbackFunc(currentElement);
16729	+ }
16730	+ value.done = true;
16731	+ }
16732	+ }
16733	+ }
16734	+ }
16735	+ };
16736	+
16737	+ var throttledScroll = Materialize.throttle(function () {
16738	+ onScroll();
16739	+ }, options.throttle \|\| 100);
16740	+
16741	+ if (!scrollFireEventsHandled) {
16742	+ window.addEventListener("scroll", throttledScroll);
16743	+ window.addEventListener("resize", throttledScroll);
16744	+ scrollFireEventsHandled = true;
16745	+ }
16746	+
16747	+ // perform a scan once, after current execution context, and after dom is ready
16748	+ setTimeout(throttledScroll, 0);
16749	+ };
16750	+ })(jQuery);
16751	+ ; /*!
16752	+ * pickadate.js v3.5.0, 2014/04/13
16753	+ * By Amsul, http://amsul.ca
16754	+ * Hosted on http://amsul.github.io/pickadate.js
16755	+ * Licensed under MIT
16756	+ */
16757	+
16758	+ (function (factory) {
16759	+
16760	+ Materialize.Picker = factory(jQuery);
16761	+ })(function ($) {
16762	+
16763	+ var $window = $(window);
16764	+ var $document = $(document);
16765	+ var $html = $(document.documentElement);
16766	+
16767	+ /**
16768	+ * The picker constructor that creates a blank picker.
16769	+ */
16770	+ function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
16771	+
16772	+ // If there’s no element, return the picker constructor.
16773	+ if (!ELEMENT) return PickerConstructor;
16774	+
16775	+ var IS_DEFAULT_THEME = false,
16776	+
16777	+
16778	+ // The state of the picker.
16779	+ STATE = {
16780	+ id: ELEMENT.id \|\| 'P' + Math.abs(~~(Math.random() * new Date()))
16781	+ },
16782	+
16783	+
16784	+ // Merge the defaults and options passed.
16785	+ SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS \|\| {},
16786	+
16787	+
16788	+ // Merge the default classes with the settings classes.
16789	+ CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
16790	+
16791	+
16792	+ // The element node wrapper into a jQuery object.
16793	+ $ELEMENT = $(ELEMENT),
16794	+
16795	+
16796	+ // Pseudo picker constructor.
16797	+ PickerInstance = function () {
16798	+ return this.start();
16799	+ },
16800	+
16801	+
16802	+ // The picker prototype.
16803	+ P = PickerInstance.prototype = {
16804	+
16805	+ constructor: PickerInstance,
16806	+
16807	+ $node: $ELEMENT,
16808	+
16809	+ /**
16810	+ * Initialize everything
16811	+ */
16812	+ start: function () {
16813	+
16814	+ // If it’s already started, do nothing.
16815	+ if (STATE && STATE.start) return P;
16816	+
16817	+ // Update the picker states.
16818	+ STATE.methods = {};
16819	+ STATE.start = true;
16820	+ STATE.open = false;
16821	+ STATE.type = ELEMENT.type;
16822	+
16823	+ // Confirm focus state, convert into text input to remove UA stylings,
16824	+ // and set as readonly to prevent keyboard popup.
16825	+ ELEMENT.autofocus = ELEMENT == getActiveElement();
16826	+ ELEMENT.readOnly = !SETTINGS.editable;
16827	+ ELEMENT.id = ELEMENT.id \|\| STATE.id;
16828	+ if (ELEMENT.type != 'text') {
16829	+ ELEMENT.type = 'text';
16830	+ }
16831	+
16832	+ // Create a new picker component with the settings.
16833	+ P.component = new COMPONENT(P, SETTINGS);
16834	+
16835	+ // Create the picker root with a holder and then prepare it.
16836	+ P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
16837	+ prepareElementRoot();
16838	+
16839	+ // If there’s a format for the hidden input element, create the element.
16840	+ if (SETTINGS.formatSubmit) {
16841	+ prepareElementHidden();
16842	+ }
16843	+
16844	+ // Prepare the input element.
16845	+ prepareElement();
16846	+
16847	+ // Insert the root as specified in the settings.
16848	+ if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
16849	+
16850	+ // Bind the default component and settings events.
16851	+ P.on({
16852	+ start: P.component.onStart,
16853	+ render: P.component.onRender,
16854	+ stop: P.component.onStop,
16855	+ open: P.component.onOpen,
16856	+ close: P.component.onClose,
16857	+ set: P.component.onSet
16858	+ }).on({
16859	+ start: SETTINGS.onStart,
16860	+ render: SETTINGS.onRender,
16861	+ stop: SETTINGS.onStop,
16862	+ open: SETTINGS.onOpen,
16863	+ close: SETTINGS.onClose,
16864	+ set: SETTINGS.onSet
16865	+ });
16866	+
16867	+ // Once we’re all set, check the theme in use.
16868	+ IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
16869	+
16870	+ // If the element has autofocus, open the picker.
16871	+ if (ELEMENT.autofocus) {
16872	+ P.open();
16873	+ }
16874	+
16875	+ // Trigger queued the “start” and “render” events.
16876	+ return P.trigger('start').trigger('render');
16877	+ }, //start
16878	+
16879	+
16880	+ /**
16881	+ * Render a new picker
16882	+ */
16883	+ render: function (entireComponent) {
16884	+
16885	+ // Insert a new component holder in the root or box.
16886	+ if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
16887	+
16888	+ // Trigger the queued “render” events.
16889	+ return P.trigger('render');
16890	+ }, //render
16891	+
16892	+
16893	+ /**
16894	+ * Destroy everything
16895	+ */
16896	+ stop: function () {
16897	+
16898	+ // If it’s already stopped, do nothing.
16899	+ if (!STATE.start) return P;
16900	+
16901	+ // Then close the picker.
16902	+ P.close();
16903	+
16904	+ // Remove the hidden field.
16905	+ if (P._hidden) {
16906	+ P._hidden.parentNode.removeChild(P._hidden);
16907	+ }
16908	+
16909	+ // Remove the root.
16910	+ P.$root.remove();
16911	+
16912	+ // Remove the input class, remove the stored data, and unbind
16913	+ // the events (after a tick for IE - see `P.close`).
16914	+ $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
16915	+ setTimeout(function () {
16916	+ $ELEMENT.off('.' + STATE.id);
16917	+ }, 0);
16918	+
16919	+ // Restore the element state
16920	+ ELEMENT.type = STATE.type;
16921	+ ELEMENT.readOnly = false;
16922	+
16923	+ // Trigger the queued “stop” events.
16924	+ P.trigger('stop');
16925	+
16926	+ // Reset the picker states.
16927	+ STATE.methods = {};
16928	+ STATE.start = false;
16929	+
16930	+ return P;
16931	+ }, //stop
16932	+
16933	+
16934	+ /**
16935	+ * Open up the picker
16936	+ */
16937	+ open: function (dontGiveFocus) {
16938	+
16939	+ // If it’s already open, do nothing.
16940	+ if (STATE.open) return P;
16941	+
16942	+ // Add the “active” class.
16943	+ $ELEMENT.addClass(CLASSES.active);
16944	+ aria(ELEMENT, 'expanded', true);
16945	+
16946	+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
16947	+ // killing transitions :(. So add the “opened” state on the next tick.
16948	+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
16949	+ setTimeout(function () {
16950	+
16951	+ // Add the “opened” class to the picker root.
16952	+ P.$root.addClass(CLASSES.opened);
16953	+ aria(P.$root[0], 'hidden', false);
16954	+ }, 0);
16955	+
16956	+ // If we have to give focus, bind the element and doc events.
16957	+ if (dontGiveFocus !== false) {
16958	+
16959	+ // Set it as open.
16960	+ STATE.open = true;
16961	+
16962	+ // Prevent the page from scrolling.
16963	+ if (IS_DEFAULT_THEME) {
16964	+ $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
16965	+ }
16966	+
16967	+ // Pass focus to the root element’s jQuery object.
16968	+ // * Workaround for iOS8 to bring the picker’s root into view.
16969	+ P.$root.eq(0).focus();
16970	+
16971	+ // Bind the document events.
16972	+ $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
16973	+
16974	+ var target = event.target;
16975	+
16976	+ // If the target of the event is not the element, close the picker picker.
16977	+ // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
16978	+ // Also, for Firefox, a click on an `option` element bubbles up directly
16979	+ // to the doc. So make sure the target wasn't the doc.
16980	+ // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
16981	+ // which causes the picker to unexpectedly close when right-clicking it. So make
16982	+ // sure the event wasn’t a right-click.
16983	+ if (target != ELEMENT && target != document && event.which != 3) {
16984	+
16985	+ // If the target was the holder that covers the screen,
16986	+ // keep the element focused to maintain tabindex.
16987	+ P.close(target === P.$root.children()[0]);
16988	+ }
16989	+ }).on('keydown.' + STATE.id, function (event) {
16990	+
16991	+ var
16992	+ // Get the keycode.
16993	+ keycode = event.keyCode,
16994	+
16995	+
16996	+ // Translate that to a selection change.
16997	+ keycodeToMove = P.component.key[keycode],
16998	+
16999	+
17000	+ // Grab the target.
17001	+ target = event.target;
17002	+
17003	+ // On escape, close the picker and give focus.
17004	+ if (keycode == 27) {
17005	+ P.close(true);
17006	+ }
17007	+
17008	+ // Check if there is a key movement or “enter” keypress on the element.
17009	+ else if (target == P.$root[0] && (keycodeToMove \|\| keycode == 13)) {
17010	+
17011	+ // Prevent the default action to stop page movement.
17012	+ event.preventDefault();
17013	+
17014	+ // Trigger the key movement action.
17015	+ if (keycodeToMove) {
17016	+ PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
17017	+ }
17018	+
17019	+ // On “enter”, if the highlighted item isn’t disabled, set the value and close.
17020	+ else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
17021	+ P.set('select', P.component.item.highlight);
17022	+ if (SETTINGS.closeOnSelect) {
17023	+ P.close(true);
17024	+ }
17025	+ }
17026	+ }
17027	+
17028	+ // If the target is within the root and “enter” is pressed,
17029	+ // prevent the default action and trigger a click on the target instead.
17030	+ else if ($.contains(P.$root[0], target) && keycode == 13) {
17031	+ event.preventDefault();
17032	+ target.click();
17033	+ }
17034	+ });
17035	+ }
17036	+
17037	+ // Trigger the queued “open” events.
17038	+ return P.trigger('open');
17039	+ }, //open
17040	+
17041	+
17042	+ /**
17043	+ * Close the picker
17044	+ */
17045	+ close: function (giveFocus) {
17046	+
17047	+ // If we need to give focus, do it before changing states.
17048	+ if (giveFocus) {
17049	+ // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :\|
17050	+ // The focus is triggered after the close has completed - causing it
17051	+ // to open again. So unbind and rebind the event at the next tick.
17052	+ P.$root.off('focus.toOpen').eq(0).focus();
17053	+ setTimeout(function () {
17054	+ P.$root.on('focus.toOpen', handleFocusToOpenEvent);
17055	+ }, 0);
17056	+ }
17057	+
17058	+ // Remove the “active” class.
17059	+ $ELEMENT.removeClass(CLASSES.active);
17060	+ aria(ELEMENT, 'expanded', false);
17061	+
17062	+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
17063	+ // killing transitions :(. So remove the “opened” state on the next tick.
17064	+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
17065	+ setTimeout(function () {
17066	+
17067	+ // Remove the “opened” and “focused” class from the picker root.
17068	+ P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
17069	+ aria(P.$root[0], 'hidden', true);
17070	+ }, 0);
17071	+
17072	+ // If it’s already closed, do nothing more.
17073	+ if (!STATE.open) return P;
17074	+
17075	+ // Set it as closed.
17076	+ STATE.open = false;
17077	+
17078	+ // Allow the page to scroll.
17079	+ if (IS_DEFAULT_THEME) {
17080	+ $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
17081	+ }
17082	+
17083	+ // Unbind the document events.
17084	+ $document.off('.' + STATE.id);
17085	+
17086	+ // Trigger the queued “close” events.
17087	+ return P.trigger('close');
17088	+ }, //close
17089	+
17090	+
17091	+ /**
17092	+ * Clear the values
17093	+ */
17094	+ clear: function (options) {
17095	+ return P.set('clear', null, options);
17096	+ }, //clear
17097	+
17098	+
17099	+ /**
17100	+ * Set something
17101	+ */
17102	+ set: function (thing, value, options) {
17103	+
17104	+ var thingItem,
17105	+ thingValue,
17106	+ thingIsObject = $.isPlainObject(thing),
17107	+ thingObject = thingIsObject ? thing : {};
17108	+
17109	+ // Make sure we have usable options.
17110	+ options = thingIsObject && $.isPlainObject(value) ? value : options \|\| {};
17111	+
17112	+ if (thing) {
17113	+
17114	+ // If the thing isn’t an object, make it one.
17115	+ if (!thingIsObject) {
17116	+ thingObject[thing] = value;
17117	+ }
17118	+
17119	+ // Go through the things of items to set.
17120	+ for (thingItem in thingObject) {
17121	+
17122	+ // Grab the value of the thing.
17123	+ thingValue = thingObject[thingItem];
17124	+
17125	+ // First, if the item exists and there’s a value, set it.
17126	+ if (thingItem in P.component.item) {
17127	+ if (thingValue === undefined) thingValue = null;
17128	+ P.component.set(thingItem, thingValue, options);
17129	+ }
17130	+
17131	+ // Then, check to update the element value and broadcast a change.
17132	+ if (thingItem == 'select' \|\| thingItem == 'clear') {
17133	+ $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
17134	+ }
17135	+ }
17136	+
17137	+ // Render a new picker.
17138	+ P.render();
17139	+ }
17140	+
17141	+ // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
17142	+ return options.muted ? P : P.trigger('set', thingObject);
17143	+ }, //set
17144	+
17145	+
17146	+ /**
17147	+ * Get something
17148	+ */
17149	+ get: function (thing, format) {
17150	+
17151	+ // Make sure there’s something to get.
17152	+ thing = thing \|\| 'value';
17153	+
17154	+ // If a picker state exists, return that.
17155	+ if (STATE[thing] != null) {
17156	+ return STATE[thing];
17157	+ }
17158	+
17159	+ // Return the submission value, if that.
17160	+ if (thing == 'valueSubmit') {
17161	+ if (P._hidden) {
17162	+ return P._hidden.value;
17163	+ }
17164	+ thing = 'value';
17165	+ }
17166	+
17167	+ // Return the value, if that.
17168	+ if (thing == 'value') {
17169	+ return ELEMENT.value;
17170	+ }
17171	+
17172	+ // Check if a component item exists, return that.
17173	+ if (thing in P.component.item) {
17174	+ if (typeof format == 'string') {
17175	+ var thingValue = P.component.get(thing);
17176	+ return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
17177	+ }
17178	+ return P.component.get(thing);
17179	+ }
17180	+ }, //get
17181	+
17182	+
17183	+ /**
17184	+ * Bind events on the things.
17185	+ */
17186	+ on: function (thing, method, internal) {
17187	+
17188	+ var thingName,
17189	+ thingMethod,
17190	+ thingIsObject = $.isPlainObject(thing),
17191	+ thingObject = thingIsObject ? thing : {};
17192	+
17193	+ if (thing) {
17194	+
17195	+ // If the thing isn’t an object, make it one.
17196	+ if (!thingIsObject) {
17197	+ thingObject[thing] = method;
17198	+ }
17199	+
17200	+ // Go through the things to bind to.
17201	+ for (thingName in thingObject) {
17202	+
17203	+ // Grab the method of the thing.
17204	+ thingMethod = thingObject[thingName];
17205	+
17206	+ // If it was an internal binding, prefix it.
17207	+ if (internal) {
17208	+ thingName = '_' + thingName;
17209	+ }
17210	+
17211	+ // Make sure the thing methods collection exists.
17212	+ STATE.methods[thingName] = STATE.methods[thingName] \|\| [];
17213	+
17214	+ // Add the method to the relative method collection.
17215	+ STATE.methods[thingName].push(thingMethod);
17216	+ }
17217	+ }
17218	+
17219	+ return P;
17220	+ }, //on
17221	+
17222	+
17223	+ /**
17224	+ * Unbind events on the things.
17225	+ */
17226	+ off: function () {
17227	+ var i,
17228	+ thingName,
17229	+ names = arguments;
17230	+ for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
17231	+ thingName = names[i];
17232	+ if (thingName in STATE.methods) {
17233	+ delete STATE.methods[thingName];
17234	+ }
17235	+ }
17236	+ return P;
17237	+ },
17238	+
17239	+ /**
17240	+ * Fire off method events.
17241	+ */
17242	+ trigger: function (name, data) {
17243	+ var _trigger = function (name) {
17244	+ var methodList = STATE.methods[name];
17245	+ if (methodList) {
17246	+ methodList.map(function (method) {
17247	+ PickerConstructor._.trigger(method, P, [data]);
17248	+ });
17249	+ }
17250	+ };
17251	+ _trigger('_' + name);
17252	+ _trigger(name);
17253	+ return P;
17254	+ } //trigger
17255	+ //PickerInstance.prototype
17256	+
17257	+
17258	+ /**
17259	+ * Wrap the picker holder components together.
17260	+ */
17261	+ };function createWrappedComponent() {
17262	+
17263	+ // Create a picker wrapper holder
17264	+ return PickerConstructor._.node('div',
17265	+
17266	+ // Create a picker wrapper node
17267	+ PickerConstructor._.node('div',
17268	+
17269	+ // Create a picker frame
17270	+ PickerConstructor._.node('div',
17271	+
17272	+ // Create a picker box node
17273	+ PickerConstructor._.node('div',
17274	+
17275	+ // Create the components nodes.
17276	+ P.component.nodes(STATE.open),
17277	+
17278	+ // The picker box class
17279	+ CLASSES.box),
17280	+
17281	+ // Picker wrap class
17282	+ CLASSES.wrap),
17283	+
17284	+ // Picker frame class
17285	+ CLASSES.frame),
17286	+
17287	+ // Picker holder class
17288	+ CLASSES.holder); //endreturn
17289	+ } //createWrappedComponent
17290	+
17291	+
17292	+ /**
17293	+ * Prepare the input element with all bindings.
17294	+ */
17295	+ function prepareElement() {
17296	+
17297	+ $ELEMENT.
17298	+
17299	+ // Store the picker data by component name.
17300	+ data(NAME, P).
17301	+
17302	+ // Add the “input” class name.
17303	+ addClass(CLASSES.input).
17304	+
17305	+ // Remove the tabindex.
17306	+ attr('tabindex', -1).
17307	+
17308	+ // If there’s a `data-value`, update the value of the element.
17309	+ val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
17310	+
17311	+ // Only bind keydown events if the element isn’t editable.
17312	+ if (!SETTINGS.editable) {
17313	+
17314	+ $ELEMENT.
17315	+
17316	+ // On focus/click, focus onto the root to open it up.
17317	+ on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
17318	+ event.preventDefault();
17319	+ P.$root.eq(0).focus();
17320	+ }).
17321	+
17322	+ // Handle keyboard event based on the picker being opened or not.
17323	+ on('keydown.' + STATE.id, handleKeydownEvent);
17324	+ }
17325	+
17326	+ // Update the aria attributes.
17327	+ aria(ELEMENT, {
17328	+ haspopup: true,
17329	+ expanded: false,
17330	+ readonly: false,
17331	+ owns: ELEMENT.id + '_root'
17332	+ });
17333	+ }
17334	+
17335	+ /**
17336	+ * Prepare the root picker element with all bindings.
17337	+ */
17338	+ function prepareElementRoot() {
17339	+
17340	+ P.$root.on({
17341	+
17342	+ // For iOS8.
17343	+ keydown: handleKeydownEvent,
17344	+
17345	+ // When something within the root is focused, stop from bubbling
17346	+ // to the doc and remove the “focused” state from the root.
17347	+ focusin: function (event) {
17348	+ P.$root.removeClass(CLASSES.focused);
17349	+ event.stopPropagation();
17350	+ },
17351	+
17352	+ // When something within the root holder is clicked, stop it
17353	+ // from bubbling to the doc.
17354	+ 'mousedown click': function (event) {
17355	+
17356	+ var target = event.target;
17357	+
17358	+ // Make sure the target isn’t the root holder so it can bubble up.
17359	+ if (target != P.$root.children()[0]) {
17360	+
17361	+ event.stopPropagation();
17362	+
17363	+ // * For mousedown events, cancel the default action in order to
17364	+ // prevent cases where focus is shifted onto external elements
17365	+ // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
17366	+ // Also, for Firefox, don’t prevent action on the `option` element.
17367	+ if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
17368	+
17369	+ event.preventDefault();
17370	+
17371	+ // Re-focus onto the root so that users can click away
17372	+ // from elements focused within the picker.
17373	+ P.$root.eq(0).focus();
17374	+ }
17375	+ }
17376	+ }
17377	+ }).
17378	+
17379	+ // Add/remove the “target” class on focus and blur.
17380	+ on({
17381	+ focus: function () {
17382	+ $ELEMENT.addClass(CLASSES.target);
17383	+ },
17384	+ blur: function () {
17385	+ $ELEMENT.removeClass(CLASSES.target);
17386	+ }
17387	+ }).
17388	+
17389	+ // Open the picker and adjust the root “focused” state
17390	+ on('focus.toOpen', handleFocusToOpenEvent).
17391	+
17392	+ // If there’s a click on an actionable element, carry out the actions.
17393	+ on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
17394	+
17395	+ var $target = $(this),
17396	+ targetData = $target.data(),
17397	+ targetDisabled = $target.hasClass(CLASSES.navDisabled) \|\| $target.hasClass(CLASSES.disabled),
17398	+
17399	+
17400	+ // * For IE, non-focusable elements can be active elements as well
17401	+ // (http://stackoverflow.com/a/2684561).
17402	+ activeElement = getActiveElement();
17403	+ activeElement = activeElement && (activeElement.type \|\| activeElement.href);
17404	+
17405	+ // If it’s disabled or nothing inside is actively focused, re-focus the element.
17406	+ if (targetDisabled \|\| activeElement && !$.contains(P.$root[0], activeElement)) {
17407	+ P.$root.eq(0).focus();
17408	+ }
17409	+
17410	+ // If something is superficially changed, update the `highlight` based on the `nav`.
17411	+ if (!targetDisabled && targetData.nav) {
17412	+ P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
17413	+ }
17414	+
17415	+ // If something is picked, set `select` then close with focus.
17416	+ else if (!targetDisabled && 'pick' in targetData) {
17417	+ P.set('select', targetData.pick);
17418	+ if (SETTINGS.closeOnSelect) {
17419	+ P.close(true);
17420	+ }
17421	+ }
17422	+
17423	+ // If a “clear” button is pressed, empty the values and close with focus.
17424	+ else if (targetData.clear) {
17425	+ P.clear();
17426	+ if (SETTINGS.closeOnSelect) {
17427	+ P.close(true);
17428	+ }
17429	+ } else if (targetData.close) {
17430	+ P.close(true);
17431	+ }
17432	+ }); //P.$root
17433	+
17434	+ aria(P.$root[0], 'hidden', true);
17435	+ }
17436	+
17437	+ /**
17438	+ * Prepare the hidden input element along with all bindings.
17439	+ */
17440	+ function prepareElementHidden() {
17441	+
17442	+ var name;
17443	+
17444	+ if (SETTINGS.hiddenName === true) {
17445	+ name = ELEMENT.name;
17446	+ ELEMENT.name = '';
17447	+ } else {
17448	+ name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
17449	+ name = name[0] + ELEMENT.name + name[1];
17450	+ }
17451	+
17452	+ P._hidden = $('<input ' + 'type=hidden ' +
17453	+
17454	+ // Create the name using the original input’s with a prefix and suffix.
17455	+ 'name="' + name + '"' + (
17456	+
17457	+ // If the element has a value, set the hidden value as well.
17458	+ $ELEMENT.data('value') \|\| ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
17459	+
17460	+ $ELEMENT.
17461	+
17462	+ // If the value changes, update the hidden input with the correct format.
17463	+ on('change.' + STATE.id, function () {
17464	+ P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
17465	+ });
17466	+
17467	+ // Insert the hidden input as specified in the settings.
17468	+ if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
17469	+ }
17470	+
17471	+ // For iOS8.
17472	+ function handleKeydownEvent(event) {
17473	+
17474	+ var keycode = event.keyCode,
17475	+
17476	+
17477	+ // Check if one of the delete keys was pressed.
17478	+ isKeycodeDelete = /^(8\|46)$/.test(keycode);
17479	+
17480	+ // For some reason IE clears the input value on “escape”.
17481	+ if (keycode == 27) {
17482	+ P.close();
17483	+ return false;
17484	+ }
17485	+
17486	+ // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
17487	+ if (keycode == 32 \|\| isKeycodeDelete \|\| !STATE.open && P.component.key[keycode]) {
17488	+
17489	+ // Prevent it from moving the page and bubbling to doc.
17490	+ event.preventDefault();
17491	+ event.stopPropagation();
17492	+
17493	+ // If `delete` was pressed, clear the values and close the picker.
17494	+ // Otherwise open the picker.
17495	+ if (isKeycodeDelete) {
17496	+ P.clear().close();
17497	+ } else {
17498	+ P.open();
17499	+ }
17500	+ }
17501	+ }
17502	+
17503	+ // Separated for IE
17504	+ function handleFocusToOpenEvent(event) {
17505	+
17506	+ // Stop the event from propagating to the doc.
17507	+ event.stopPropagation();
17508	+
17509	+ // If it’s a focus event, add the “focused” class to the root.
17510	+ if (event.type == 'focus') {
17511	+ P.$root.addClass(CLASSES.focused);
17512	+ }
17513	+
17514	+ // And then finally open the picker.
17515	+ P.open();
17516	+ }
17517	+
17518	+ // Return a new picker instance.
17519	+ return new PickerInstance();
17520	+ } //PickerConstructor
17521	+
17522	+
17523	+ /**
17524	+ * The default classes and prefix to use for the HTML classes.
17525	+ */
17526	+ PickerConstructor.klasses = function (prefix) {
17527	+ prefix = prefix \|\| 'picker';
17528	+ return {
17529	+
17530	+ picker: prefix,
17531	+ opened: prefix + '--opened',
17532	+ focused: prefix + '--focused',
17533	+
17534	+ input: prefix + '__input',
17535	+ active: prefix + '__input--active',
17536	+ target: prefix + '__input--target',
17537	+
17538	+ holder: prefix + '__holder',
17539	+
17540	+ frame: prefix + '__frame',
17541	+ wrap: prefix + '__wrap',
17542	+
17543	+ box: prefix + '__box'
17544	+ };
17545	+ }; //PickerConstructor.klasses
17546	+
17547	+
17548	+ /**
17549	+ * Check if the default theme is being used.
17550	+ */
17551	+ function isUsingDefaultTheme(element) {
17552	+
17553	+ var theme,
17554	+ prop = 'position';
17555	+
17556	+ // For IE.
17557	+ if (element.currentStyle) {
17558	+ theme = element.currentStyle[prop];
17559	+ }
17560	+
17561	+ // For normal browsers.
17562	+ else if (window.getComputedStyle) {
17563	+ theme = getComputedStyle(element)[prop];
17564	+ }
17565	+
17566	+ return theme == 'fixed';
17567	+ }
17568	+
17569	+ /**
17570	+ * Get the width of the browser’s scrollbar.
17571	+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
17572	+ */
17573	+ function getScrollbarWidth() {
17574	+
17575	+ if ($html.height() <= $window.height()) {
17576	+ return 0;
17577	+ }
17578	+
17579	+ var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
17580	+
17581	+ // Get the width without scrollbars.
17582	+ var widthWithoutScroll = $outer[0].offsetWidth;
17583	+
17584	+ // Force adding scrollbars.
17585	+ $outer.css('overflow', 'scroll');
17586	+
17587	+ // Add the inner div.
17588	+ var $inner = $('<div style="width:100%" />').appendTo($outer);
17589	+
17590	+ // Get the width with scrollbars.
17591	+ var widthWithScroll = $inner[0].offsetWidth;
17592	+
17593	+ // Remove the divs.
17594	+ $outer.remove();
17595	+
17596	+ // Return the difference between the widths.
17597	+ return widthWithoutScroll - widthWithScroll;
17598	+ }
17599	+
17600	+ /**
17601	+ * PickerConstructor helper methods.
17602	+ */
17603	+ PickerConstructor._ = {
17604	+
17605	+ /**
17606	+ * Create a group of nodes. Expects:
17607	+ * `
17608	+ {
17609	+ min: {Integer},
17610	+ max: {Integer},
17611	+ i: {Integer},
17612	+ node: {String},
17613	+ item: {Function}
17614	+ }
17615	+ * `
17616	+ */
17617	+ group: function (groupObject) {
17618	+
17619	+ var
17620	+ // Scope for the looped object
17621	+ loopObjectScope,
17622	+
17623	+
17624	+ // Create the nodes list
17625	+ nodesList = '',
17626	+
17627	+
17628	+ // The counter starts from the `min`
17629	+ counter = PickerConstructor._.trigger(groupObject.min, groupObject);
17630	+
17631	+ // Loop from the `min` to `max`, incrementing by `i`
17632	+ for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
17633	+
17634	+ // Trigger the `item` function within scope of the object
17635	+ loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
17636	+
17637	+ // Splice the subgroup and create nodes out of the sub nodes
17638	+ nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
17639	+ loopObjectScope[1], // the classes
17640	+ loopObjectScope[2] // the attributes
17641	+ );
17642	+ }
17643	+
17644	+ // Return the list of nodes
17645	+ return nodesList;
17646	+ }, //group
17647	+
17648	+
17649	+ /**
17650	+ * Create a dom node string
17651	+ */
17652	+ node: function (wrapper, item, klass, attribute) {
17653	+
17654	+ // If the item is false-y, just return an empty string
17655	+ if (!item) return '';
17656	+
17657	+ // If the item is an array, do a join
17658	+ item = $.isArray(item) ? item.join('') : item;
17659	+
17660	+ // Check for the class
17661	+ klass = klass ? ' class="' + klass + '"' : '';
17662	+
17663	+ // Check for any attributes
17664	+ attribute = attribute ? ' ' + attribute : '';
17665	+
17666	+ // Return the wrapped item
17667	+ return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
17668	+ }, //node
17669	+
17670	+
17671	+ /**
17672	+ * Lead numbers below 10 with a zero.
17673	+ */
17674	+ lead: function (number) {
17675	+ return (number < 10 ? '0' : '') + number;
17676	+ },
17677	+
17678	+ /**
17679	+ * Trigger a function otherwise return the value.
17680	+ */
17681	+ trigger: function (callback, scope, args) {
17682	+ return typeof callback == 'function' ? callback.apply(scope, args \|\| []) : callback;
17683	+ },
17684	+
17685	+ /**
17686	+ * If the second character is a digit, length is 2 otherwise 1.
17687	+ */
17688	+ digits: function (string) {
17689	+ return (/\d/.test(string[1]) ? 2 : 1
17690	+ );
17691	+ },
17692	+
17693	+ /**
17694	+ * Tell if something is a date object.
17695	+ */
17696	+ isDate: function (value) {
17697	+ return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
17698	+ },
17699	+
17700	+ /**
17701	+ * Tell if something is an integer.
17702	+ */
17703	+ isInteger: function (value) {
17704	+ return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
17705	+ },
17706	+
17707	+ /**
17708	+ * Create ARIA attribute strings.
17709	+ */
17710	+ ariaAttr: ariaAttr //PickerConstructor._
17711	+
17712	+
17713	+ /**
17714	+ * Extend the picker with a component and defaults.
17715	+ */
17716	+ };PickerConstructor.extend = function (name, Component) {
17717	+
17718	+ // Extend jQuery.
17719	+ $.fn[name] = function (options, action) {
17720	+
17721	+ // Grab the component data.
17722	+ var componentData = this.data(name);
17723	+
17724	+ // If the picker is requested, return the data object.
17725	+ if (options == 'picker') {
17726	+ return componentData;
17727	+ }
17728	+
17729	+ // If the component data exists and `options` is a string, carry out the action.
17730	+ if (componentData && typeof options == 'string') {
17731	+ return PickerConstructor._.trigger(componentData[options], componentData, [action]);
17732	+ }
17733	+
17734	+ // Otherwise go through each matched element and if the component
17735	+ // doesn’t exist, create a new picker using `this` element
17736	+ // and merging the defaults and options with a deep copy.
17737	+ return this.each(function () {
17738	+ var $this = $(this);
17739	+ if (!$this.data(name)) {
17740	+ new PickerConstructor(this, name, Component, options);
17741	+ }
17742	+ });
17743	+ };
17744	+
17745	+ // Set the defaults.
17746	+ $.fn[name].defaults = Component.defaults;
17747	+ }; //PickerConstructor.extend
17748	+
17749	+
17750	+ function aria(element, attribute, value) {
17751	+ if ($.isPlainObject(attribute)) {
17752	+ for (var key in attribute) {
17753	+ ariaSet(element, key, attribute[key]);
17754	+ }
17755	+ } else {
17756	+ ariaSet(element, attribute, value);
17757	+ }
17758	+ }
17759	+ function ariaSet(element, attribute, value) {
17760	+ element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
17761	+ }
17762	+ function ariaAttr(attribute, data) {
17763	+ if (!$.isPlainObject(attribute)) {
17764	+ attribute = { attribute: data };
17765	+ }
17766	+ data = '';
17767	+ for (var key in attribute) {
17768	+ var attr = (key == 'role' ? '' : 'aria-') + key,
17769	+ attrVal = attribute[key];
17770	+ data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
17771	+ }
17772	+ return data;
17773	+ }
17774	+
17775	+ // IE8 bug throws an error for activeElements within iframes.
17776	+ function getActiveElement() {
17777	+ try {
17778	+ return document.activeElement;
17779	+ } catch (err) {}
17780	+ }
17781	+
17782	+ // Expose the picker constructor.
17783	+ return PickerConstructor;
17784	+ });
17785	+ ; /*!
17786	+ * Date picker for pickadate.js v3.5.0
17787	+ * http://amsul.github.io/pickadate.js/date.htm
17788	+ */
17789	+
17790	+ (function (factory) {
17791	+ factory(Materialize.Picker, jQuery);
17792	+ })(function (Picker, $) {
17793	+
17794	+ /**
17795	+ * Globals and constants
17796	+ */
17797	+ var DAYS_IN_WEEK = 7,
17798	+ WEEKS_IN_CALENDAR = 6,
17799	+ _ = Picker._;
17800	+
17801	+ /**
17802	+ * The date picker constructor
17803	+ */
17804	+ function DatePicker(picker, settings) {
17805	+
17806	+ var calendar = this,
17807	+ element = picker.$node[0],
17808	+ elementValue = element.value,
17809	+ elementDataValue = picker.$node.data('value'),
17810	+ valueString = elementDataValue \|\| elementValue,
17811	+ formatString = elementDataValue ? settings.formatSubmit : settings.format,
17812	+ isRTL = function () {
17813	+
17814	+ return element.currentStyle ?
17815	+
17816	+ // For IE.
17817	+ element.currentStyle.direction == 'rtl' :
17818	+
17819	+ // For normal browsers.
17820	+ getComputedStyle(picker.$root[0]).direction == 'rtl';
17821	+ };
17822	+
17823	+ calendar.settings = settings;
17824	+ calendar.$node = picker.$node;
17825	+
17826	+ // The queue of methods that will be used to build item objects.
17827	+ calendar.queue = {
17828	+ min: 'measure create',
17829	+ max: 'measure create',
17830	+ now: 'now create',
17831	+ select: 'parse create validate',
17832	+ highlight: 'parse navigate create validate',
17833	+ view: 'parse create validate viewset',
17834	+ disable: 'deactivate',
17835	+ enable: 'activate'
17836	+
17837	+ // The component's item object.
17838	+ };calendar.item = {};
17839	+
17840	+ calendar.item.clear = null;
17841	+ calendar.item.disable = (settings.disable \|\| []).slice(0);
17842	+ calendar.item.enable = -function (collectionDisabled) {
17843	+ return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
17844	+ }(calendar.item.disable);
17845	+
17846	+ calendar.set('min', settings.min).set('max', settings.max).set('now');
17847	+
17848	+ // When there’s a value, set the `select`, which in turn
17849	+ // also sets the `highlight` and `view`.
17850	+ if (valueString) {
17851	+ calendar.set('select', valueString, { format: formatString });
17852	+ }
17853	+
17854	+ // If there’s no value, default to highlighting “today”.
17855	+ else {
17856	+ calendar.set('select', null).set('highlight', calendar.item.now);
17857	+ }
17858	+
17859	+ // The keycode to movement mapping.
17860	+ calendar.key = {
17861	+ 40: 7, // Down
17862	+ 38: -7, // Up
17863	+ 39: function () {
17864	+ return isRTL() ? -1 : 1;
17865	+ }, // Right
17866	+ 37: function () {
17867	+ return isRTL() ? 1 : -1;
17868	+ }, // Left
17869	+ go: function (timeChange) {
17870	+ var highlightedObject = calendar.item.highlight,
17871	+ targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
17872	+ calendar.set('highlight', targetDate, { interval: timeChange });
17873	+ this.render();
17874	+ }
17875	+
17876	+ // Bind some picker events.
17877	+ };picker.on('render', function () {
17878	+ picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
17879	+ var value = this.value;
17880	+ if (value) {
17881	+ picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
17882	+ picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
17883	+ }
17884	+ });
17885	+ picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
17886	+ var value = this.value;
17887	+ if (value) {
17888	+ picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
17889	+ picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
17890	+ }
17891	+ });
17892	+ }, 1).on('open', function () {
17893	+ var includeToday = '';
17894	+ if (calendar.disabled(calendar.get('now'))) {
17895	+ includeToday = ':not(.' + settings.klass.buttonToday + ')';
17896	+ }
17897	+ picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
17898	+ }, 1).on('close', function () {
17899	+ picker.$root.find('button, select').attr('disabled', true);
17900	+ }, 1);
17901	+ } //DatePicker
17902	+
17903	+
17904	+ /**
17905	+ * Set a datepicker item object.
17906	+ */
17907	+ DatePicker.prototype.set = function (type, value, options) {
17908	+
17909	+ var calendar = this,
17910	+ calendarItem = calendar.item;
17911	+
17912	+ // If the value is `null` just set it immediately.
17913	+ if (value === null) {
17914	+ if (type == 'clear') type = 'select';
17915	+ calendarItem[type] = value;
17916	+ return calendar;
17917	+ }
17918	+
17919	+ // Otherwise go through the queue of methods, and invoke the functions.
17920	+ // Update this as the time unit, and set the final value as this item.
17921	+ // * In the case of `enable`, keep the queue but set `disable` instead.
17922	+ // And in the case of `flip`, keep the queue but set `enable` instead.
17923	+ calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
17924	+ value = calendar[method](type, value, options);
17925	+ return value;
17926	+ }).pop();
17927	+
17928	+ // Check if we need to cascade through more updates.
17929	+ if (type == 'select') {
17930	+ calendar.set('highlight', calendarItem.select, options);
17931	+ } else if (type == 'highlight') {
17932	+ calendar.set('view', calendarItem.highlight, options);
17933	+ } else if (type.match(/^(flip\|min\|max\|disable\|enable)$/)) {
17934	+ if (calendarItem.select && calendar.disabled(calendarItem.select)) {
17935	+ calendar.set('select', calendarItem.select, options);
17936	+ }
17937	+ if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
17938	+ calendar.set('highlight', calendarItem.highlight, options);
17939	+ }
17940	+ }
17941	+
17942	+ return calendar;
17943	+ }; //DatePicker.prototype.set
17944	+
17945	+
17946	+ /**
17947	+ * Get a datepicker item object.
17948	+ */
17949	+ DatePicker.prototype.get = function (type) {
17950	+ return this.item[type];
17951	+ }; //DatePicker.prototype.get
17952	+
17953	+
17954	+ /**
17955	+ * Create a picker date object.
17956	+ */
17957	+ DatePicker.prototype.create = function (type, value, options) {
17958	+
17959	+ var isInfiniteValue,
17960	+ calendar = this;
17961	+
17962	+ // If there’s no value, use the type as the value.
17963	+ value = value === undefined ? type : value;
17964	+
17965	+ // If it’s infinity, update the value.
17966	+ if (value == -Infinity \|\| value == Infinity) {
17967	+ isInfiniteValue = value;
17968	+ }
17969	+
17970	+ // If it’s an object, use the native date object.
17971	+ else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
17972	+ value = value.obj;
17973	+ }
17974	+
17975	+ // If it’s an array, convert it into a date and make sure
17976	+ // that it’s a valid date – otherwise default to today.
17977	+ else if ($.isArray(value)) {
17978	+ value = new Date(value[0], value[1], value[2]);
17979	+ value = _.isDate(value) ? value : calendar.create().obj;
17980	+ }
17981	+
17982	+ // If it’s a number or date object, make a normalized date.
17983	+ else if (_.isInteger(value) \|\| _.isDate(value)) {
17984	+ value = calendar.normalize(new Date(value), options);
17985	+ }
17986	+
17987	+ // If it’s a literal true or any other case, set it to now.
17988	+ else /if ( value === true )/{
17989	+ value = calendar.now(type, value, options);
17990	+ }
17991	+
17992	+ // Return the compiled object.
17993	+ return {
17994	+ year: isInfiniteValue \|\| value.getFullYear(),
17995	+ month: isInfiniteValue \|\| value.getMonth(),
17996	+ date: isInfiniteValue \|\| value.getDate(),
17997	+ day: isInfiniteValue \|\| value.getDay(),
17998	+ obj: isInfiniteValue \|\| value,
17999	+ pick: isInfiniteValue \|\| value.getTime()
18000	+ };
18001	+ }; //DatePicker.prototype.create
18002	+
18003	+
18004	+ /**
18005	+ * Create a range limit object using an array, date object,
18006	+ * literal “true”, or integer relative to another time.
18007	+ */
18008	+ DatePicker.prototype.createRange = function (from, to) {
18009	+
18010	+ var calendar = this,
18011	+ createDate = function (date) {
18012	+ if (date === true \|\| $.isArray(date) \|\| _.isDate(date)) {
18013	+ return calendar.create(date);
18014	+ }
18015	+ return date;
18016	+ };
18017	+
18018	+ // Create objects if possible.
18019	+ if (!_.isInteger(from)) {
18020	+ from = createDate(from);
18021	+ }
18022	+ if (!_.isInteger(to)) {
18023	+ to = createDate(to);
18024	+ }
18025	+
18026	+ // Create relative dates.
18027	+ if (_.isInteger(from) && $.isPlainObject(to)) {
18028	+ from = [to.year, to.month, to.date + from];
18029	+ } else if (_.isInteger(to) && $.isPlainObject(from)) {
18030	+ to = [from.year, from.month, from.date + to];
18031	+ }
18032	+
18033	+ return {
18034	+ from: createDate(from),
18035	+ to: createDate(to)
18036	+ };
18037	+ }; //DatePicker.prototype.createRange
18038	+
18039	+
18040	+ /**
18041	+ * Check if a date unit falls within a date range object.
18042	+ */
18043	+ DatePicker.prototype.withinRange = function (range, dateUnit) {
18044	+ range = this.createRange(range.from, range.to);
18045	+ return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
18046	+ };
18047	+
18048	+ /**
18049	+ * Check if two date range objects overlap.
18050	+ */
18051	+ DatePicker.prototype.overlapRanges = function (one, two) {
18052	+
18053	+ var calendar = this;
18054	+
18055	+ // Convert the ranges into comparable dates.
18056	+ one = calendar.createRange(one.from, one.to);
18057	+ two = calendar.createRange(two.from, two.to);
18058	+
18059	+ return calendar.withinRange(one, two.from) \|\| calendar.withinRange(one, two.to) \|\| calendar.withinRange(two, one.from) \|\| calendar.withinRange(two, one.to);
18060	+ };
18061	+
18062	+ /**
18063	+ * Get the date today.
18064	+ */
18065	+ DatePicker.prototype.now = function (type, value, options) {
18066	+ value = new Date();
18067	+ if (options && options.rel) {
18068	+ value.setDate(value.getDate() + options.rel);
18069	+ }
18070	+ return this.normalize(value, options);
18071	+ };
18072	+
18073	+ /**
18074	+ * Navigate to next/prev month.
18075	+ */
18076	+ DatePicker.prototype.navigate = function (type, value, options) {
18077	+
18078	+ var targetDateObject,
18079	+ targetYear,
18080	+ targetMonth,
18081	+ targetDate,
18082	+ isTargetArray = $.isArray(value),
18083	+ isTargetObject = $.isPlainObject(value),
18084	+ viewsetObject = this.item.view; /*,
18085	+ safety = 100*/
18086	+
18087	+ if (isTargetArray \|\| isTargetObject) {
18088	+
18089	+ if (isTargetObject) {
18090	+ targetYear = value.year;
18091	+ targetMonth = value.month;
18092	+ targetDate = value.date;
18093	+ } else {
18094	+ targetYear = +value[0];
18095	+ targetMonth = +value[1];
18096	+ targetDate = +value[2];
18097	+ }
18098	+
18099	+ // If we’re navigating months but the view is in a different
18100	+ // month, navigate to the view’s year and month.
18101	+ if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
18102	+ targetYear = viewsetObject.year;
18103	+ targetMonth = viewsetObject.month;
18104	+ }
18105	+
18106	+ // Figure out the expected target year and month.
18107	+ targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
18108	+ targetYear = targetDateObject.getFullYear();
18109	+ targetMonth = targetDateObject.getMonth();
18110	+
18111	+ // If the month we’re going to doesn’t have enough days,
18112	+ // keep decreasing the date until we reach the month’s last date.
18113	+ while ( /safety &&/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
18114	+ targetDate -= 1;
18115	+ /*safety -= 1
18116	+ if ( !safety ) {
18117	+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
18118	+ }*/
18119	+ }
18120	+
18121	+ value = [targetYear, targetMonth, targetDate];
18122	+ }
18123	+
18124	+ return value;
18125	+ }; //DatePicker.prototype.navigate
18126	+
18127	+
18128	+ /**
18129	+ * Normalize a date by setting the hours to midnight.
18130	+ */
18131	+ DatePicker.prototype.normalize = function (value /, options/) {
18132	+ value.setHours(0, 0, 0, 0);
18133	+ return value;
18134	+ };
18135	+
18136	+ /**
18137	+ * Measure the range of dates.
18138	+ */
18139	+ DatePicker.prototype.measure = function (type, value /, options/) {
18140	+
18141	+ var calendar = this;
18142	+
18143	+ // If it’s anything false-y, remove the limits.
18144	+ if (!value) {
18145	+ value = type == 'min' ? -Infinity : Infinity;
18146	+ }
18147	+
18148	+ // If it’s a string, parse it.
18149	+ else if (typeof value == 'string') {
18150	+ value = calendar.parse(type, value);
18151	+ }
18152	+
18153	+ // If it's an integer, get a date relative to today.
18154	+ else if (_.isInteger(value)) {
18155	+ value = calendar.now(type, value, { rel: value });
18156	+ }
18157	+
18158	+ return value;
18159	+ }; ///DatePicker.prototype.measure
18160	+
18161	+
18162	+ /**
18163	+ * Create a viewset object based on navigation.
18164	+ */
18165	+ DatePicker.prototype.viewset = function (type, dateObject /, options/) {
18166	+ return this.create([dateObject.year, dateObject.month, 1]);
18167	+ };
18168	+
18169	+ /**
18170	+ * Validate a date as enabled and shift if needed.
18171	+ */
18172	+ DatePicker.prototype.validate = function (type, dateObject, options) {
18173	+
18174	+ var calendar = this,
18175	+
18176	+
18177	+ // Keep a reference to the original date.
18178	+ originalDateObject = dateObject,
18179	+
18180	+
18181	+ // Make sure we have an interval.
18182	+ interval = options && options.interval ? options.interval : 1,
18183	+
18184	+
18185	+ // Check if the calendar enabled dates are inverted.
18186	+ isFlippedBase = calendar.item.enable === -1,
18187	+
18188	+
18189	+ // Check if we have any enabled dates after/before now.
18190	+ hasEnabledBeforeTarget,
18191	+ hasEnabledAfterTarget,
18192	+
18193	+
18194	+ // The min & max limits.
18195	+ minLimitObject = calendar.item.min,
18196	+ maxLimitObject = calendar.item.max,
18197	+
18198	+
18199	+ // Check if we’ve reached the limit during shifting.
18200	+ reachedMin,
18201	+ reachedMax,
18202	+
18203	+
18204	+ // Check if the calendar is inverted and at least one weekday is enabled.
18205	+ hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
18206	+
18207	+ // If there’s a date, check where it is relative to the target.
18208	+ if ($.isArray(value)) {
18209	+ var dateTime = calendar.create(value).pick;
18210	+ if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
18211	+ }
18212	+
18213	+ // Return only integers for enabled weekdays.
18214	+ return _.isInteger(value);
18215	+ }).length; /*,
18216	+ safety = 100*/
18217	+
18218	+ // Cases to validate for:
18219	+ // [1] Not inverted and date disabled.
18220	+ // [2] Inverted and some dates enabled.
18221	+ // [3] Not inverted and out of range.
18222	+ //
18223	+ // Cases to not validate for:
18224	+ // • Navigating months.
18225	+ // • Not inverted and date enabled.
18226	+ // • Inverted and all dates disabled.
18227	+ // • ..and anything else.
18228	+ if (!options \|\| !options.nav) if (
18229	+ /* 1 */!isFlippedBase && calendar.disabled(dateObject) \|\|
18230	+ /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays \|\| hasEnabledBeforeTarget \|\| hasEnabledAfterTarget) \|\|
18231	+ /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick \|\| dateObject.pick >= maxLimitObject.pick)) {
18232	+
18233	+ // When inverted, flip the direction if there aren’t any enabled weekdays
18234	+ // and there are no enabled dates in the direction of the interval.
18235	+ if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 \|\| !hasEnabledBeforeTarget && interval < 0)) {
18236	+ interval *= -1;
18237	+ }
18238	+
18239	+ // Keep looping until we reach an enabled date.
18240	+ while ( /safety &&/calendar.disabled(dateObject)) {
18241	+
18242	+ /*safety -= 1
18243	+ if ( !safety ) {
18244	+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
18245	+ }*/
18246	+
18247	+ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
18248	+ if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month \|\| dateObject.month > originalDateObject.month)) {
18249	+ dateObject = originalDateObject;
18250	+ interval = interval > 0 ? 1 : -1;
18251	+ }
18252	+
18253	+ // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
18254	+ if (dateObject.pick <= minLimitObject.pick) {
18255	+ reachedMin = true;
18256	+ interval = 1;
18257	+ dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
18258	+ } else if (dateObject.pick >= maxLimitObject.pick) {
18259	+ reachedMax = true;
18260	+ interval = -1;
18261	+ dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
18262	+ }
18263	+
18264	+ // If we’ve reached both limits, just break out of the loop.
18265	+ if (reachedMin && reachedMax) {
18266	+ break;
18267	+ }
18268	+
18269	+ // Finally, create the shifted date using the interval and keep looping.
18270	+ dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
18271	+ }
18272	+ } //endif
18273	+
18274	+
18275	+ // Return the date object settled on.
18276	+ return dateObject;
18277	+ }; //DatePicker.prototype.validate
18278	+
18279	+
18280	+ /**
18281	+ * Check if a date is disabled.
18282	+ */
18283	+ DatePicker.prototype.disabled = function (dateToVerify) {
18284	+
18285	+ var calendar = this,
18286	+
18287	+
18288	+ // Filter through the disabled dates to check if this is one.
18289	+ isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
18290	+
18291	+ // If the date is a number, match the weekday with 0index and `firstDay` check.
18292	+ if (_.isInteger(dateToDisable)) {
18293	+ return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
18294	+ }
18295	+
18296	+ // If it’s an array or a native JS date, create and match the exact date.
18297	+ if ($.isArray(dateToDisable) \|\| _.isDate(dateToDisable)) {
18298	+ return dateToVerify.pick === calendar.create(dateToDisable).pick;
18299	+ }
18300	+
18301	+ // If it’s an object, match a date within the “from” and “to” range.
18302	+ if ($.isPlainObject(dateToDisable)) {
18303	+ return calendar.withinRange(dateToDisable, dateToVerify);
18304	+ }
18305	+ });
18306	+
18307	+ // If this date matches a disabled date, confirm it’s not inverted.
18308	+ isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
18309	+ return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' \|\| $.isPlainObject(dateToDisable) && dateToDisable.inverted;
18310	+ }).length;
18311	+
18312	+ // Check the calendar “enabled” flag and respectively flip the
18313	+ // disabled state. Then also check if it’s beyond the min/max limits.
18314	+ return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch \|\| dateToVerify.pick < calendar.item.min.pick \|\| dateToVerify.pick > calendar.item.max.pick;
18315	+ }; //DatePicker.prototype.disabled
18316	+
18317	+
18318	+ /**
18319	+ * Parse a string into a usable type.
18320	+ */
18321	+ DatePicker.prototype.parse = function (type, value, options) {
18322	+
18323	+ var calendar = this,
18324	+ parsingObject = {};
18325	+
18326	+ // If it’s already parsed, we’re good.
18327	+ if (!value \|\| typeof value != 'string') {
18328	+ return value;
18329	+ }
18330	+
18331	+ // We need a `.format` to parse the value with.
18332	+ if (!(options && options.format)) {
18333	+ options = options \|\| {};
18334	+ options.format = calendar.settings.format;
18335	+ }
18336	+
18337	+ // Convert the format into an array and then map through it.
18338	+ calendar.formats.toArray(options.format).map(function (label) {
18339	+
18340	+ var
18341	+ // Grab the formatting label.
18342	+ formattingLabel = calendar.formats[label],
18343	+
18344	+
18345	+ // The format length is from the formatting label function or the
18346	+ // label length without the escaping exclamation (!) mark.
18347	+ formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
18348	+
18349	+ // If there's a format label, split the value up to the format length.
18350	+ // Then add it to the parsing object with appropriate label.
18351	+ if (formattingLabel) {
18352	+ parsingObject[label] = value.substr(0, formatLength);
18353	+ }
18354	+
18355	+ // Update the value as the substring from format length to end.
18356	+ value = value.substr(formatLength);
18357	+ });
18358	+
18359	+ // Compensate for month 0index.
18360	+ return [parsingObject.yyyy \|\| parsingObject.yy, +(parsingObject.mm \|\| parsingObject.m) - 1, parsingObject.dd \|\| parsingObject.d];
18361	+ }; //DatePicker.prototype.parse
18362	+
18363	+
18364	+ /**
18365	+ * Various formats to display the object in.
18366	+ */
18367	+ DatePicker.prototype.formats = function () {
18368	+
18369	+ // Return the length of the first word in a collection.
18370	+ function getWordLengthFromCollection(string, collection, dateObject) {
18371	+
18372	+ // Grab the first word from the string.
18373	+ var word = string.match(/\w+/)[0];
18374	+
18375	+ // If there's no month index, add it to the date object
18376	+ if (!dateObject.mm && !dateObject.m) {
18377	+ dateObject.m = collection.indexOf(word) + 1;
18378	+ }
18379	+
18380	+ // Return the length of the word.
18381	+ return word.length;
18382	+ }
18383	+
18384	+ // Get the length of the first word in a string.
18385	+ function getFirstWordLength(string) {
18386	+ return string.match(/\w+/)[0].length;
18387	+ }
18388	+
18389	+ return {
18390	+
18391	+ d: function (string, dateObject) {
18392	+
18393	+ // If there's string, then get the digits length.
18394	+ // Otherwise return the selected date.
18395	+ return string ? _.digits(string) : dateObject.date;
18396	+ },
18397	+ dd: function (string, dateObject) {
18398	+
18399	+ // If there's a string, then the length is always 2.
18400	+ // Otherwise return the selected date with a leading zero.
18401	+ return string ? 2 : _.lead(dateObject.date);
18402	+ },
18403	+ ddd: function (string, dateObject) {
18404	+
18405	+ // If there's a string, then get the length of the first word.
18406	+ // Otherwise return the short selected weekday.
18407	+ return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
18408	+ },
18409	+ dddd: function (string, dateObject) {
18410	+
18411	+ // If there's a string, then get the length of the first word.
18412	+ // Otherwise return the full selected weekday.
18413	+ return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
18414	+ },
18415	+ m: function (string, dateObject) {
18416	+
18417	+ // If there's a string, then get the length of the digits
18418	+ // Otherwise return the selected month with 0index compensation.
18419	+ return string ? _.digits(string) : dateObject.month + 1;
18420	+ },
18421	+ mm: function (string, dateObject) {
18422	+
18423	+ // If there's a string, then the length is always 2.
18424	+ // Otherwise return the selected month with 0index and leading zero.
18425	+ return string ? 2 : _.lead(dateObject.month + 1);
18426	+ },
18427	+ mmm: function (string, dateObject) {
18428	+
18429	+ var collection = this.settings.monthsShort;
18430	+
18431	+ // If there's a string, get length of the relevant month from the short
18432	+ // months collection. Otherwise return the selected month from that collection.
18433	+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
18434	+ },
18435	+ mmmm: function (string, dateObject) {
18436	+
18437	+ var collection = this.settings.monthsFull;
18438	+
18439	+ // If there's a string, get length of the relevant month from the full
18440	+ // months collection. Otherwise return the selected month from that collection.
18441	+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
18442	+ },
18443	+ yy: function (string, dateObject) {
18444	+
18445	+ // If there's a string, then the length is always 2.
18446	+ // Otherwise return the selected year by slicing out the first 2 digits.
18447	+ return string ? 2 : ('' + dateObject.year).slice(2);
18448	+ },
18449	+ yyyy: function (string, dateObject) {
18450	+
18451	+ // If there's a string, then the length is always 4.
18452	+ // Otherwise return the selected year.
18453	+ return string ? 4 : dateObject.year;
18454	+ },
18455	+
18456	+ // Create an array by splitting the formatting string passed.
18457	+ toArray: function (formatString) {
18458	+ return formatString.split(/(d{1,4}\|m{1,4}\|y{4}\|yy\|!.)/g);
18459	+ },
18460	+
18461	+ // Format an object into a string using the formatting options.
18462	+ toString: function (formatString, itemObject) {
18463	+ var calendar = this;
18464	+ return calendar.formats.toArray(formatString).map(function (label) {
18465	+ return _.trigger(calendar.formats[label], calendar, [0, itemObject]) \|\| label.replace(/^!/, '');
18466	+ }).join('');
18467	+ }
18468	+ };
18469	+ }(); //DatePicker.prototype.formats
18470	+
18471	+
18472	+ /**
18473	+ * Check if two date units are the exact.
18474	+ */
18475	+ DatePicker.prototype.isDateExact = function (one, two) {
18476	+
18477	+ var calendar = this;
18478	+
18479	+ // When we’re working with weekdays, do a direct comparison.
18480	+ if (_.isInteger(one) && _.isInteger(two) \|\| typeof one == 'boolean' && typeof two == 'boolean') {
18481	+ return one === two;
18482	+ }
18483	+
18484	+ // When we’re working with date representations, compare the “pick” value.
18485	+ if ((_.isDate(one) \|\| $.isArray(one)) && (_.isDate(two) \|\| $.isArray(two))) {
18486	+ return calendar.create(one).pick === calendar.create(two).pick;
18487	+ }
18488	+
18489	+ // When we’re working with range objects, compare the “from” and “to”.
18490	+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
18491	+ return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
18492	+ }
18493	+
18494	+ return false;
18495	+ };
18496	+
18497	+ /**
18498	+ * Check if two date units overlap.
18499	+ */
18500	+ DatePicker.prototype.isDateOverlap = function (one, two) {
18501	+
18502	+ var calendar = this,
18503	+ firstDay = calendar.settings.firstDay ? 1 : 0;
18504	+
18505	+ // When we’re working with a weekday index, compare the days.
18506	+ if (_.isInteger(one) && (_.isDate(two) \|\| $.isArray(two))) {
18507	+ one = one % 7 + firstDay;
18508	+ return one === calendar.create(two).day + 1;
18509	+ }
18510	+ if (_.isInteger(two) && (_.isDate(one) \|\| $.isArray(one))) {
18511	+ two = two % 7 + firstDay;
18512	+ return two === calendar.create(one).day + 1;
18513	+ }
18514	+
18515	+ // When we’re working with range objects, check if the ranges overlap.
18516	+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
18517	+ return calendar.overlapRanges(one, two);
18518	+ }
18519	+
18520	+ return false;
18521	+ };
18522	+
18523	+ /**
18524	+ * Flip the “enabled” state.
18525	+ */
18526	+ DatePicker.prototype.flipEnable = function (val) {
18527	+ var itemObject = this.item;
18528	+ itemObject.enable = val \|\| (itemObject.enable == -1 ? 1 : -1);
18529	+ };
18530	+
18531	+ /**
18532	+ * Mark a collection of dates as “disabled”.
18533	+ */
18534	+ DatePicker.prototype.deactivate = function (type, datesToDisable) {
18535	+
18536	+ var calendar = this,
18537	+ disabledItems = calendar.item.disable.slice(0);
18538	+
18539	+ // If we’re flipping, that’s all we need to do.
18540	+ if (datesToDisable == 'flip') {
18541	+ calendar.flipEnable();
18542	+ } else if (datesToDisable === false) {
18543	+ calendar.flipEnable(1);
18544	+ disabledItems = [];
18545	+ } else if (datesToDisable === true) {
18546	+ calendar.flipEnable(-1);
18547	+ disabledItems = [];
18548	+ }
18549	+
18550	+ // Otherwise go through the dates to disable.
18551	+ else {
18552	+
18553	+ datesToDisable.map(function (unitToDisable) {
18554	+
18555	+ var matchFound;
18556	+
18557	+ // When we have disabled items, check for matches.
18558	+ // If something is matched, immediately break out.
18559	+ for (var index = 0; index < disabledItems.length; index += 1) {
18560	+ if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
18561	+ matchFound = true;
18562	+ break;
18563	+ }
18564	+ }
18565	+
18566	+ // If nothing was found, add the validated unit to the collection.
18567	+ if (!matchFound) {
18568	+ if (_.isInteger(unitToDisable) \|\| _.isDate(unitToDisable) \|\| $.isArray(unitToDisable) \|\| $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
18569	+ disabledItems.push(unitToDisable);
18570	+ }
18571	+ }
18572	+ });
18573	+ }
18574	+
18575	+ // Return the updated collection.
18576	+ return disabledItems;
18577	+ }; //DatePicker.prototype.deactivate
18578	+
18579	+
18580	+ /**
18581	+ * Mark a collection of dates as “enabled”.
18582	+ */
18583	+ DatePicker.prototype.activate = function (type, datesToEnable) {
18584	+
18585	+ var calendar = this,
18586	+ disabledItems = calendar.item.disable,
18587	+ disabledItemsCount = disabledItems.length;
18588	+
18589	+ // If we’re flipping, that’s all we need to do.
18590	+ if (datesToEnable == 'flip') {
18591	+ calendar.flipEnable();
18592	+ } else if (datesToEnable === true) {
18593	+ calendar.flipEnable(1);
18594	+ disabledItems = [];
18595	+ } else if (datesToEnable === false) {
18596	+ calendar.flipEnable(-1);
18597	+ disabledItems = [];
18598	+ }
18599	+
18600	+ // Otherwise go through the disabled dates.
18601	+ else {
18602	+
18603	+ datesToEnable.map(function (unitToEnable) {
18604	+
18605	+ var matchFound, disabledUnit, index, isExactRange;
18606	+
18607	+ // Go through the disabled items and try to find a match.
18608	+ for (index = 0; index < disabledItemsCount; index += 1) {
18609	+
18610	+ disabledUnit = disabledItems[index];
18611	+
18612	+ // When an exact match is found, remove it from the collection.
18613	+ if (calendar.isDateExact(disabledUnit, unitToEnable)) {
18614	+ matchFound = disabledItems[index] = null;
18615	+ isExactRange = true;
18616	+ break;
18617	+ }
18618	+
18619	+ // When an overlapped match is found, add the “inverted” state to it.
18620	+ else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
18621	+ if ($.isPlainObject(unitToEnable)) {
18622	+ unitToEnable.inverted = true;
18623	+ matchFound = unitToEnable;
18624	+ } else if ($.isArray(unitToEnable)) {
18625	+ matchFound = unitToEnable;
18626	+ if (!matchFound[3]) matchFound.push('inverted');
18627	+ } else if (_.isDate(unitToEnable)) {
18628	+ matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
18629	+ }
18630	+ break;
18631	+ }
18632	+ }
18633	+
18634	+ // If a match was found, remove a previous duplicate entry.
18635	+ if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
18636	+ if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
18637	+ disabledItems[index] = null;
18638	+ break;
18639	+ }
18640	+ }
18641	+
18642	+ // In the event that we’re dealing with an exact range of dates,
18643	+ // make sure there are no “inverted” dates because of it.
18644	+ if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
18645	+ if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
18646	+ disabledItems[index] = null;
18647	+ break;
18648	+ }
18649	+ }
18650	+
18651	+ // If something is still matched, add it into the collection.
18652	+ if (matchFound) {
18653	+ disabledItems.push(matchFound);
18654	+ }
18655	+ });
18656	+ }
18657	+
18658	+ // Return the updated collection.
18659	+ return disabledItems.filter(function (val) {
18660	+ return val != null;
18661	+ });
18662	+ }; //DatePicker.prototype.activate
18663	+
18664	+
18665	+ /**
18666	+ * Create a string for the nodes in the picker.
18667	+ */
18668	+ DatePicker.prototype.nodes = function (isOpen) {
18669	+
18670	+ var calendar = this,
18671	+ settings = calendar.settings,
18672	+ calendarItem = calendar.item,
18673	+ nowObject = calendarItem.now,
18674	+ selectedObject = calendarItem.select,
18675	+ highlightedObject = calendarItem.highlight,
18676	+ viewsetObject = calendarItem.view,
18677	+ disabledCollection = calendarItem.disable,
18678	+ minLimitObject = calendarItem.min,
18679	+ maxLimitObject = calendarItem.max,
18680	+
18681	+
18682	+ // Create the calendar table head using a copy of weekday labels collection.
18683	+ // * We do a copy so we don't mutate the original array.
18684	+ tableHead = function (collection, fullCollection) {
18685	+
18686	+ // If the first day should be Monday, move Sunday to the end.
18687	+ if (settings.firstDay) {
18688	+ collection.push(collection.shift());
18689	+ fullCollection.push(fullCollection.shift());
18690	+ }
18691	+
18692	+ // Create and return the table head group.
18693	+ return _.node('thead', _.node('tr', _.group({
18694	+ min: 0,
18695	+ max: DAYS_IN_WEEK - 1,
18696	+ i: 1,
18697	+ node: 'th',
18698	+ item: function (counter) {
18699	+ return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
18700	+ }
18701	+ }))); //endreturn
18702	+
18703	+ // Materialize modified
18704	+ }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
18705	+ //tableHead
18706	+
18707	+
18708	+ // Create the nav for next/prev month.
18709	+ createMonthNav = function (next) {
18710	+
18711	+ // Otherwise, return the created month tag.
18712	+ return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
18713	+
18714	+ // If the focused month is outside the range, disabled the button.
18715	+ next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month \|\| !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next \|\| -1) + ' ' + _.ariaAttr({
18716	+ role: 'button',
18717	+ controls: calendar.$node[0].id + '_table'
18718	+ }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
18719	+ },
18720	+ //createMonthNav
18721	+
18722	+
18723	+ // Create the month label.
18724	+ //Materialize modified
18725	+ createMonthLabel = function (override) {
18726	+
18727	+ var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
18728	+
18729	+ // Materialize modified
18730	+ if (override == "short_months") {
18731	+ monthsCollection = settings.monthsShort;
18732	+ }
18733	+
18734	+ // If there are months to select, add a dropdown menu.
18735	+ if (settings.selectMonths && override == undefined) {
18736	+
18737	+ return _.node('select', _.group({
18738	+ min: 0,
18739	+ max: 11,
18740	+ i: 1,
18741	+ node: 'option',
18742	+ item: function (loopedMonth) {
18743	+
18744	+ return [
18745	+
18746	+ // The looped month and no classes.
18747	+ monthsCollection[loopedMonth], 0,
18748	+
18749	+ // Set the value and selected index.
18750	+ 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month \|\| viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
18751	+ }
18752	+ }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
18753	+ }
18754	+
18755	+ // Materialize modified
18756	+ if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
18757	+
18758	+ // If there's a need for a month selector
18759	+ return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
18760	+ },
18761	+ //createMonthLabel
18762	+
18763	+
18764	+ // Create the year label.
18765	+ // Materialize modified
18766	+ createYearLabel = function (override) {
18767	+
18768	+ var focusedYear = viewsetObject.year,
18769	+
18770	+
18771	+ // If years selector is set to a literal "true", set it to 5. Otherwise
18772	+ // divide in half to get half before and half after focused year.
18773	+ numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
18774	+
18775	+ // If there are years to select, add a dropdown menu.
18776	+ if (numberYears) {
18777	+
18778	+ var minYear = minLimitObject.year,
18779	+ maxYear = maxLimitObject.year,
18780	+ lowestYear = focusedYear - numberYears,
18781	+ highestYear = focusedYear + numberYears;
18782	+
18783	+ // If the min year is greater than the lowest year, increase the highest year
18784	+ // by the difference and set the lowest year to the min year.
18785	+ if (minYear > lowestYear) {
18786	+ highestYear += minYear - lowestYear;
18787	+ lowestYear = minYear;
18788	+ }
18789	+
18790	+ // If the max year is less than the highest year, decrease the lowest year
18791	+ // by the lower of the two: available and needed years. Then set the
18792	+ // highest year to the max year.
18793	+ if (maxYear < highestYear) {
18794	+
18795	+ var availableYears = lowestYear - minYear,
18796	+ neededYears = highestYear - maxYear;
18797	+
18798	+ lowestYear -= availableYears > neededYears ? neededYears : availableYears;
18799	+ highestYear = maxYear;
18800	+ }
18801	+
18802	+ if (settings.selectYears && override == undefined) {
18803	+ return _.node('select', _.group({
18804	+ min: lowestYear,
18805	+ max: highestYear,
18806	+ i: 1,
18807	+ node: 'option',
18808	+ item: function (loopedYear) {
18809	+ return [
18810	+
18811	+ // The looped year and no classes.
18812	+ loopedYear, 0,
18813	+
18814	+ // Set the value and selected index.
18815	+ 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
18816	+ }
18817	+ }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
18818	+ }
18819	+ }
18820	+
18821	+ // Materialize modified
18822	+ if (override == "raw") return _.node('div', focusedYear);
18823	+
18824	+ // Otherwise just return the year focused
18825	+ return _.node('div', focusedYear, settings.klass.year);
18826	+ }; //createYearLabel
18827	+
18828	+
18829	+ // Materialize modified
18830	+ createDayLabel = function () {
18831	+ if (selectedObject != null) return selectedObject.date;else return nowObject.date;
18832	+ };
18833	+ createWeekdayLabel = function () {
18834	+ var display_day;
18835	+
18836	+ if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
18837	+ var weekday = settings.weekdaysShort[display_day];
18838	+ return weekday;
18839	+ };
18840	+
18841	+ // Create and return the entire calendar.
18842	+
18843	+ return _.node(
18844	+ // Date presentation View
18845	+ 'div', _.node(
18846	+ // Div for Year
18847	+ 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
18848	+ // Div for short Month
18849	+ 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
18850	+ // Div for Day
18851	+ 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
18852	+ // Calendar container
18853	+ _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
18854	+ min: 0,
18855	+ max: WEEKS_IN_CALENDAR - 1,
18856	+ i: 1,
18857	+ node: 'tr',
18858	+ item: function (rowCounter) {
18859	+
18860	+ // If Monday is the first day and the month starts on Sunday, shift the date back a week.
18861	+ var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
18862	+
18863	+ return [_.group({
18864	+ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
18865	+ max: function () {
18866	+ return this.min + DAYS_IN_WEEK - 1;
18867	+ },
18868	+ i: 1,
18869	+ node: 'td',
18870	+ item: function (targetDate) {
18871	+
18872	+ // Convert the time date from a relative date to a target date.
18873	+ targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
18874	+
18875	+ var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
18876	+ isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
18877	+ isDisabled = disabledCollection && calendar.disabled(targetDate) \|\| targetDate.pick < minLimitObject.pick \|\| targetDate.pick > maxLimitObject.pick,
18878	+ formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
18879	+
18880	+ return [_.node('div', targetDate.date, function (klasses) {
18881	+
18882	+ // Add the `infocus` or `outfocus` classes based on month in view.
18883	+ klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
18884	+
18885	+ // Add the `today` class if needed.
18886	+ if (nowObject.pick == targetDate.pick) {
18887	+ klasses.push(settings.klass.now);
18888	+ }
18889	+
18890	+ // Add the `selected` class if something's selected and the time matches.
18891	+ if (isSelected) {
18892	+ klasses.push(settings.klass.selected);
18893	+ }
18894	+
18895	+ // Add the `highlighted` class if something's highlighted and the time matches.
18896	+ if (isHighlighted) {
18897	+ klasses.push(settings.klass.highlighted);
18898	+ }
18899	+
18900	+ // Add the `disabled` class if something's disabled and the object matches.
18901	+ if (isDisabled) {
18902	+ klasses.push(settings.klass.disabled);
18903	+ }
18904	+
18905	+ return klasses.join(' ');
18906	+ }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
18907	+ role: 'gridcell',
18908	+ label: formattedDate,
18909	+ selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
18910	+ activedescendant: isHighlighted ? true : null,
18911	+ disabled: isDisabled ? true : null
18912	+ }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
18913	+ }
18914	+ })]; //endreturn
18915	+ }
18916	+ })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
18917	+ role: 'grid',
18918	+ controls: calendar.$node[0].id,
18919	+ readonly: true
18920	+ })), settings.klass.calendar_container) // end calendar
18921	+
18922	+ +
18923	+
18924	+ // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
18925	+ _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
18926	+ }; //DatePicker.prototype.nodes
18927	+
18928	+
18929	+ /**
18930	+ * The date picker defaults.
18931	+ */
18932	+ DatePicker.defaults = function (prefix) {
18933	+
18934	+ return {
18935	+
18936	+ // The title label to use for the month nav buttons
18937	+ labelMonthNext: 'Next month',
18938	+ labelMonthPrev: 'Previous month',
18939	+
18940	+ // The title label to use for the dropdown selectors
18941	+ labelMonthSelect: 'Select a month',
18942	+ labelYearSelect: 'Select a year',
18943	+
18944	+ // Months and weekdays
18945	+ monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
18946	+ monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
18947	+ weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
18948	+ weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
18949	+
18950	+ // Materialize modified
18951	+ weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
18952	+
18953	+ // Today and clear
18954	+ today: 'Today',
18955	+ clear: 'Clear',
18956	+ close: 'Ok',
18957	+
18958	+ // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
18959	+ closeOnSelect: false,
18960	+
18961	+ // The format to show on the `input` element
18962	+ format: 'd mmmm, yyyy',
18963	+
18964	+ // Classes
18965	+ klass: {
18966	+
18967	+ table: prefix + 'table',
18968	+
18969	+ header: prefix + 'header',
18970	+
18971	+ // Materialize Added klasses
18972	+ date_display: prefix + 'date-display',
18973	+ day_display: prefix + 'day-display',
18974	+ month_display: prefix + 'month-display',
18975	+ year_display: prefix + 'year-display',
18976	+ calendar_container: prefix + 'calendar-container',
18977	+ // end
18978	+
18979	+
18980	+ navPrev: prefix + 'nav--prev',
18981	+ navNext: prefix + 'nav--next',
18982	+ navDisabled: prefix + 'nav--disabled',
18983	+
18984	+ month: prefix + 'month',
18985	+ year: prefix + 'year',
18986	+
18987	+ selectMonth: prefix + 'select--month',
18988	+ selectYear: prefix + 'select--year',
18989	+
18990	+ weekdays: prefix + 'weekday',
18991	+
18992	+ day: prefix + 'day',
18993	+ disabled: prefix + 'day--disabled',
18994	+ selected: prefix + 'day--selected',
18995	+ highlighted: prefix + 'day--highlighted',
18996	+ now: prefix + 'day--today',
18997	+ infocus: prefix + 'day--infocus',
18998	+ outfocus: prefix + 'day--outfocus',
18999	+
19000	+ footer: prefix + 'footer',
19001	+
19002	+ buttonClear: prefix + 'button--clear',
19003	+ buttonToday: prefix + 'button--today',
19004	+ buttonClose: prefix + 'button--close'
19005	+ }
19006	+ };
19007	+ }(Picker.klasses().picker + '__');
19008	+
19009	+ /**
19010	+ * Extend the picker to add the date picker.
19011	+ */
19012	+ Picker.extend('pickadate', DatePicker);
19013	+ });
19014	+ ; /*!
19015	+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
19016	+ * Copyright 2014 Wang Shenwei.
19017	+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
19018	+ *
19019	+ * Further modified
19020	+ * Copyright 2015 Ching Yaw Hao.
19021	+ */
19022	+
19023	+ (function () {
19024	+ var $ = window.jQuery,
19025	+ $win = $(window),
19026	+ $doc = $(document);
19027	+
19028	+ // Can I use inline svg ?
19029	+ var svgNS = 'http://www.w3.org/2000/svg',
19030	+ svgSupported = 'SVGAngle' in window && function () {
19031	+ var supported,
19032	+ el = document.createElement('div');
19033	+ el.innerHTML = '<svg/>';
19034	+ supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
19035	+ el.innerHTML = '';
19036	+ return supported;
19037	+ }();
19038	+
19039	+ // Can I use transition ?
19040	+ var transitionSupported = function () {
19041	+ var style = document.createElement('div').style;
19042	+ return 'transition' in style \|\| 'WebkitTransition' in style \|\| 'MozTransition' in style \|\| 'msTransition' in style \|\| 'OTransition' in style;
19043	+ }();
19044	+
19045	+ // Listen touch events in touch screen device, instead of mouse events in desktop.
19046	+ var touchSupported = 'ontouchstart' in window,
19047	+ mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
19048	+ mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
19049	+ mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
19050	+
19051	+ // Vibrate the device if supported
19052	+ var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
19053	+
19054	+ function createSvgElement(name) {
19055	+ return document.createElementNS(svgNS, name);
19056	+ }
19057	+
19058	+ function leadingZero(num) {
19059	+ return (num < 10 ? '0' : '') + num;
19060	+ }
19061	+
19062	+ // Get a unique id
19063	+ var idCounter = 0;
19064	+ function uniqueId(prefix) {
19065	+ var id = ++idCounter + '';
19066	+ return prefix ? prefix + id : id;
19067	+ }
19068	+
19069	+ // Clock size
19070	+ var dialRadius = 135,
19071	+ outerRadius = 105,
19072	+
19073	+ // innerRadius = 80 on 12 hour clock
19074	+ innerRadius = 80,
19075	+ tickRadius = 20,
19076	+ diameter = dialRadius * 2,
19077	+ duration = transitionSupported ? 350 : 1;
19078	+
19079	+ // Popover template
19080	+ var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
19081	+
19082	+ // ClockPicker
19083	+ function ClockPicker(element, options) {
19084	+ var popover = $(tpl),
19085	+ plate = popover.find('.clockpicker-plate'),
19086	+ holder = popover.find('.picker__holder'),
19087	+ hoursView = popover.find('.clockpicker-hours'),
19088	+ minutesView = popover.find('.clockpicker-minutes'),
19089	+ amPmBlock = popover.find('.clockpicker-am-pm-block'),
19090	+ isInput = element.prop('tagName') === 'INPUT',
19091	+ input = isInput ? element : element.find('input'),
19092	+ label = $("label[for=" + input.attr("id") + "]"),
19093	+ self = this;
19094	+
19095	+ this.id = uniqueId('cp');
19096	+ this.element = element;
19097	+ this.holder = holder;
19098	+ this.options = options;
19099	+ this.isAppended = false;
19100	+ this.isShown = false;
19101	+ this.currentView = 'hours';
19102	+ this.isInput = isInput;
19103	+ this.input = input;
19104	+ this.label = label;
19105	+ this.popover = popover;
19106	+ this.plate = plate;
19107	+ this.hoursView = hoursView;
19108	+ this.minutesView = minutesView;
19109	+ this.amPmBlock = amPmBlock;
19110	+ this.spanHours = popover.find('.clockpicker-span-hours');
19111	+ this.spanMinutes = popover.find('.clockpicker-span-minutes');
19112	+ this.spanAmPm = popover.find('.clockpicker-span-am-pm');
19113	+ this.footer = popover.find('.picker__footer');
19114	+ this.amOrPm = "PM";
19115	+
19116	+ // Setup for for 12 hour clock if option is selected
19117	+ if (options.twelvehour) {
19118	+ if (!options.ampmclickable) {
19119	+ this.spanAmPm.empty();
19120	+ $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
19121	+ $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
19122	+ } else {
19123	+ this.spanAmPm.empty();
19124	+ $('<div id="click-am">AM</div>').on("click", function () {
19125	+ self.spanAmPm.children('#click-am').addClass("text-primary");
19126	+ self.spanAmPm.children('#click-pm').removeClass("text-primary");
19127	+ self.amOrPm = "AM";
19128	+ }).appendTo(this.spanAmPm);
19129	+ $('<div id="click-pm">PM</div>').on("click", function () {
19130	+ self.spanAmPm.children('#click-pm').addClass("text-primary");
19131	+ self.spanAmPm.children('#click-am').removeClass("text-primary");
19132	+ self.amOrPm = 'PM';
19133	+ }).appendTo(this.spanAmPm);
19134	+ }
19135	+ }
19136	+
19137	+ // Add buttons to footer
19138	+ $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
19139	+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
19140	+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
19141	+
19142	+ this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
19143	+ this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
19144	+
19145	+ // Show or toggle
19146	+ input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
19147	+
19148	+ // Build ticks
19149	+ var tickTpl = $('<div class="clockpicker-tick"></div>'),
19150	+ i,
19151	+ tick,
19152	+ radian,
19153	+ radius;
19154	+
19155	+ // Hours view
19156	+ if (options.twelvehour) {
19157	+ for (i = 1; i < 13; i += 1) {
19158	+ tick = tickTpl.clone();
19159	+ radian = i / 6 * Math.PI;
19160	+ radius = outerRadius;
19161	+ tick.css({
19162	+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
19163	+ top: dialRadius - Math.cos(radian) * radius - tickRadius
19164	+ });
19165	+ tick.html(i === 0 ? '00' : i);
19166	+ hoursView.append(tick);
19167	+ tick.on(mousedownEvent, mousedown);
19168	+ }
19169	+ } else {
19170	+ for (i = 0; i < 24; i += 1) {
19171	+ tick = tickTpl.clone();
19172	+ radian = i / 6 * Math.PI;
19173	+ var inner = i > 0 && i < 13;
19174	+ radius = inner ? innerRadius : outerRadius;
19175	+ tick.css({
19176	+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
19177	+ top: dialRadius - Math.cos(radian) * radius - tickRadius
19178	+ });
19179	+ tick.html(i === 0 ? '00' : i);
19180	+ hoursView.append(tick);
19181	+ tick.on(mousedownEvent, mousedown);
19182	+ }
19183	+ }
19184	+
19185	+ // Minutes view
19186	+ for (i = 0; i < 60; i += 5) {
19187	+ tick = tickTpl.clone();
19188	+ radian = i / 30 * Math.PI;
19189	+ tick.css({
19190	+ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
19191	+ top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
19192	+ });
19193	+ tick.html(leadingZero(i));
19194	+ minutesView.append(tick);
19195	+ tick.on(mousedownEvent, mousedown);
19196	+ }
19197	+
19198	+ // Clicking on minutes view space
19199	+ plate.on(mousedownEvent, function (e) {
19200	+ if ($(e.target).closest('.clockpicker-tick').length === 0) {
19201	+ mousedown(e, true);
19202	+ }
19203	+ });
19204	+
19205	+ // Mousedown or touchstart
19206	+ function mousedown(e, space) {
19207	+ var offset = plate.offset(),
19208	+ isTouch = /^touch/.test(e.type),
19209	+ x0 = offset.left + dialRadius,
19210	+ y0 = offset.top + dialRadius,
19211	+ dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
19212	+ dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
19213	+ z = Math.sqrt(dx * dx + dy * dy),
19214	+ moved = false;
19215	+
19216	+ // When clicking on minutes view space, check the mouse position
19217	+ if (space && (z < outerRadius - tickRadius \|\| z > outerRadius + tickRadius)) {
19218	+ return;
19219	+ }
19220	+ e.preventDefault();
19221	+
19222	+ // Set cursor style of body after 200ms
19223	+ var movingTimer = setTimeout(function () {
19224	+ self.popover.addClass('clockpicker-moving');
19225	+ }, 200);
19226	+
19227	+ // Clock
19228	+ self.setHand(dx, dy, !space, true);
19229	+
19230	+ // Mousemove on document
19231	+ $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
19232	+ e.preventDefault();
19233	+ var isTouch = /^touch/.test(e.type),
19234	+ x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
19235	+ y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
19236	+ if (!moved && x === dx && y === dy) {
19237	+ // Clicking in chrome on windows will trigger a mousemove event
19238	+ return;
19239	+ }
19240	+ moved = true;
19241	+ self.setHand(x, y, false, true);
19242	+ });
19243	+
19244	+ // Mouseup on document
19245	+ $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
19246	+ $doc.off(mouseupEvent);
19247	+ e.preventDefault();
19248	+ var isTouch = /^touch/.test(e.type),
19249	+ x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
19250	+ y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
19251	+ if ((space \|\| moved) && x === dx && y === dy) {
19252	+ self.setHand(x, y);
19253	+ }
19254	+
19255	+ if (self.currentView === 'hours') {
19256	+ self.toggleView('minutes', duration / 2);
19257	+ } else if (options.autoclose) {
19258	+ self.minutesView.addClass('clockpicker-dial-out');
19259	+ setTimeout(function () {
19260	+ self.done();
19261	+ }, duration / 2);
19262	+ }
19263	+ plate.prepend(canvas);
19264	+
19265	+ // Reset cursor style of body
19266	+ clearTimeout(movingTimer);
19267	+ self.popover.removeClass('clockpicker-moving');
19268	+
19269	+ // Unbind mousemove event
19270	+ $doc.off(mousemoveEvent);
19271	+ });
19272	+ }
19273	+
19274	+ if (svgSupported) {
19275	+ // Draw clock hands and others
19276	+ var canvas = popover.find('.clockpicker-canvas'),
19277	+ svg = createSvgElement('svg');
19278	+ svg.setAttribute('class', 'clockpicker-svg');
19279	+ svg.setAttribute('width', diameter);
19280	+ svg.setAttribute('height', diameter);
19281	+ var g = createSvgElement('g');
19282	+ g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
19283	+ var bearing = createSvgElement('circle');
19284	+ bearing.setAttribute('class', 'clockpicker-canvas-bearing');
19285	+ bearing.setAttribute('cx', 0);
19286	+ bearing.setAttribute('cy', 0);
19287	+ bearing.setAttribute('r', 4);
19288	+ var hand = createSvgElement('line');
19289	+ hand.setAttribute('x1', 0);
19290	+ hand.setAttribute('y1', 0);
19291	+ var bg = createSvgElement('circle');
19292	+ bg.setAttribute('class', 'clockpicker-canvas-bg');
19293	+ bg.setAttribute('r', tickRadius);
19294	+ g.appendChild(hand);
19295	+ g.appendChild(bg);
19296	+ g.appendChild(bearing);
19297	+ svg.appendChild(g);
19298	+ canvas.append(svg);
19299	+
19300	+ this.hand = hand;
19301	+ this.bg = bg;
19302	+ this.bearing = bearing;
19303	+ this.g = g;
19304	+ this.canvas = canvas;
19305	+ }
19306	+
19307	+ raiseCallback(this.options.init);
19308	+ }
19309	+
19310	+ function raiseCallback(callbackFunction) {
19311	+ if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
19312	+ }
19313	+
19314	+ // Default options
19315	+ ClockPicker.DEFAULTS = {
19316	+ 'default': '', // default time, 'now' or '13:14' e.g.
19317	+ fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
19318	+ donetext: 'Ok', // done button text
19319	+ cleartext: 'Clear',
19320	+ canceltext: 'Cancel',
19321	+ autoclose: false, // auto close when minute is selected
19322	+ ampmclickable: true, // set am/pm button on itself
19323	+ darktheme: false, // set to dark theme
19324	+ twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
19325	+ vibrate: true // vibrate the device when dragging clock hand
19326	+ };
19327	+
19328	+ // Show or hide popover
19329	+ ClockPicker.prototype.toggle = function () {
19330	+ this[this.isShown ? 'hide' : 'show']();
19331	+ };
19332	+
19333	+ // Set popover position
19334	+ ClockPicker.prototype.locate = function () {
19335	+ var element = this.element,
19336	+ popover = this.popover,
19337	+ offset = element.offset(),
19338	+ width = element.outerWidth(),
19339	+ height = element.outerHeight(),
19340	+ align = this.options.align,
19341	+ self = this;
19342	+
19343	+ popover.show();
19344	+ };
19345	+
19346	+ // Show popover
19347	+ ClockPicker.prototype.show = function (e) {
19348	+ // Not show again
19349	+ if (this.isShown) {
19350	+ return;
19351	+ }
19352	+ raiseCallback(this.options.beforeShow);
19353	+ $(':input').each(function () {
19354	+ $(this).attr('tabindex', -1);
19355	+ });
19356	+ var self = this;
19357	+ // Initialize
19358	+ this.input.blur();
19359	+ this.popover.addClass('picker--opened');
19360	+ this.input.addClass('picker__input picker__input--active');
19361	+ $(document.body).css('overflow', 'hidden');
19362	+ // Get the time
19363	+ var value = ((this.input.prop('value') \|\| this.options['default'] \|\| '') + '').split(':');
19364	+ if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
19365	+ if (value[1].indexOf("AM") > 0) {
19366	+ this.amOrPm = 'AM';
19367	+ } else {
19368	+ this.amOrPm = 'PM';
19369	+ }
19370	+ value[1] = value[1].replace("AM", "").replace("PM", "");
19371	+ }
19372	+ if (value[0] === 'now') {
19373	+ var now = new Date(+new Date() + this.options.fromnow);
19374	+ value = [now.getHours(), now.getMinutes()];
19375	+ if (this.options.twelvehour) {
19376	+ this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
19377	+ }
19378	+ }
19379	+ this.hours = +value[0] \|\| 0;
19380	+ this.minutes = +value[1] \|\| 0;
19381	+ this.spanHours.html(this.hours);
19382	+ this.spanMinutes.html(leadingZero(this.minutes));
19383	+ if (!this.isAppended) {
19384	+ // Append popover to body
19385	+ this.popover.insertAfter(this.input);
19386	+ if (this.options.twelvehour) {
19387	+ if (this.amOrPm === 'PM') {
19388	+ this.spanAmPm.children('#click-pm').addClass("text-primary");
19389	+ this.spanAmPm.children('#click-am').removeClass("text-primary");
19390	+ } else {
19391	+ this.spanAmPm.children('#click-am').addClass("text-primary");
19392	+ this.spanAmPm.children('#click-pm').removeClass("text-primary");
19393	+ }
19394	+ }
19395	+ // Reset position when resize
19396	+ $win.on('resize.clockpicker' + this.id, function () {
19397	+ if (self.isShown) {
19398	+ self.locate();
19399	+ }
19400	+ });
19401	+ this.isAppended = true;
19402	+ }
19403	+ // Toggle to hours view
19404	+ this.toggleView('hours');
19405	+ // Set position
19406	+ this.locate();
19407	+ this.isShown = true;
19408	+ // Hide when clicking or tabbing on any element except the clock and input
19409	+ $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
19410	+ var target = $(e.target);
19411	+ if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
19412	+ self.hide();
19413	+ }
19414	+ });
19415	+ // Hide when ESC is pressed
19416	+ $doc.on('keyup.clockpicker.' + this.id, function (e) {
19417	+ if (e.keyCode === 27) {
19418	+ self.hide();
19419	+ }
19420	+ });
19421	+ raiseCallback(this.options.afterShow);
19422	+ };
19423	+ // Hide popover
19424	+ ClockPicker.prototype.hide = function () {
19425	+ raiseCallback(this.options.beforeHide);
19426	+ this.input.removeClass('picker__input picker__input--active');
19427	+ this.popover.removeClass('picker--opened');
19428	+ $(document.body).css('overflow', 'visible');
19429	+ this.isShown = false;
19430	+ $(':input').each(function (index) {
19431	+ $(this).attr('tabindex', index + 1);
19432	+ });
19433	+ // Unbinding events on document
19434	+ $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
19435	+ $doc.off('keyup.clockpicker.' + this.id);
19436	+ this.popover.hide();
19437	+ raiseCallback(this.options.afterHide);
19438	+ };
19439	+ // Toggle to hours or minutes view
19440	+ ClockPicker.prototype.toggleView = function (view, delay) {
19441	+ var raiseAfterHourSelect = false;
19442	+ if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
19443	+ raiseCallback(this.options.beforeHourSelect);
19444	+ raiseAfterHourSelect = true;
19445	+ }
19446	+ var isHours = view === 'hours',
19447	+ nextView = isHours ? this.hoursView : this.minutesView,
19448	+ hideView = isHours ? this.minutesView : this.hoursView;
19449	+ this.currentView = view;
19450	+
19451	+ this.spanHours.toggleClass('text-primary', isHours);
19452	+ this.spanMinutes.toggleClass('text-primary', !isHours);
19453	+
19454	+ // Let's make transitions
19455	+ hideView.addClass('clockpicker-dial-out');
19456	+ nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
19457	+
19458	+ // Reset clock hand
19459	+ this.resetClock(delay);
19460	+
19461	+ // After transitions ended
19462	+ clearTimeout(this.toggleViewTimer);
19463	+ this.toggleViewTimer = setTimeout(function () {
19464	+ hideView.css('visibility', 'hidden');
19465	+ }, duration);
19466	+
19467	+ if (raiseAfterHourSelect) {
19468	+ raiseCallback(this.options.afterHourSelect);
19469	+ }
19470	+ };
19471	+
19472	+ // Reset clock hand
19473	+ ClockPicker.prototype.resetClock = function (delay) {
19474	+ var view = this.currentView,
19475	+ value = this[view],
19476	+ isHours = view === 'hours',
19477	+ unit = Math.PI / (isHours ? 6 : 30),
19478	+ radian = value * unit,
19479	+ radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
19480	+ x = Math.sin(radian) * radius,
19481	+ y = -Math.cos(radian) * radius,
19482	+ self = this;
19483	+
19484	+ if (svgSupported && delay) {
19485	+ self.canvas.addClass('clockpicker-canvas-out');
19486	+ setTimeout(function () {
19487	+ self.canvas.removeClass('clockpicker-canvas-out');
19488	+ self.setHand(x, y);
19489	+ }, delay);
19490	+ } else this.setHand(x, y);
19491	+ };
19492	+
19493	+ // Set clock hand to (x, y)
19494	+ ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
19495	+ var radian = Math.atan2(x, -y),
19496	+ isHours = this.currentView === 'hours',
19497	+ unit = Math.PI / (isHours \|\| roundBy5 ? 6 : 30),
19498	+ z = Math.sqrt(x * x + y * y),
19499	+ options = this.options,
19500	+ inner = isHours && z < (outerRadius + innerRadius) / 2,
19501	+ radius = inner ? innerRadius : outerRadius,
19502	+ value;
19503	+
19504	+ if (options.twelvehour) {
19505	+ radius = outerRadius;
19506	+ }
19507	+
19508	+ // Radian should in range [0, 2PI]
19509	+ if (radian < 0) {
19510	+ radian = Math.PI * 2 + radian;
19511	+ }
19512	+
19513	+ // Get the round value
19514	+ value = Math.round(radian / unit);
19515	+
19516	+ // Get the round radian
19517	+ radian = value * unit;
19518	+
19519	+ // Correct the hours or minutes
19520	+ if (options.twelvehour) {
19521	+ if (isHours) {
19522	+ if (value === 0) value = 12;
19523	+ } else {
19524	+ if (roundBy5) value *= 5;
19525	+ if (value === 60) value = 0;
19526	+ }
19527	+ } else {
19528	+ if (isHours) {
19529	+ if (value === 12) value = 0;
19530	+ value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
19531	+ } else {
19532	+ if (roundBy5) value *= 5;
19533	+ if (value === 60) value = 0;
19534	+ }
19535	+ }
19536	+
19537	+ // Once hours or minutes changed, vibrate the device
19538	+ if (this[this.currentView] !== value) {
19539	+ if (vibrate && this.options.vibrate) {
19540	+ // Do not vibrate too frequently
19541	+ if (!this.vibrateTimer) {
19542	+ navigator[vibrate](10);
19543	+ this.vibrateTimer = setTimeout($.proxy(function () {
19544	+ this.vibrateTimer = null;
19545	+ }, this), 100);
19546	+ }
19547	+ }
19548	+ }
19549	+
19550	+ this[this.currentView] = value;
19551	+ if (isHours) {
19552	+ this['spanHours'].html(value);
19553	+ } else {
19554	+ this['spanMinutes'].html(leadingZero(value));
19555	+ }
19556	+
19557	+ // If svg is not supported, just add an active class to the tick
19558	+ if (!svgSupported) {
19559	+ this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
19560	+ var tick = $(this);
19561	+ tick.toggleClass('active', value === +tick.html());
19562	+ });
19563	+ return;
19564	+ }
19565	+
19566	+ // Set clock hand and others' position
19567	+ var cx1 = Math.sin(radian) * (radius - tickRadius),
19568	+ cy1 = -Math.cos(radian) * (radius - tickRadius),
19569	+ cx2 = Math.sin(radian) * radius,
19570	+ cy2 = -Math.cos(radian) * radius;
19571	+ this.hand.setAttribute('x2', cx1);
19572	+ this.hand.setAttribute('y2', cy1);
19573	+ this.bg.setAttribute('cx', cx2);
19574	+ this.bg.setAttribute('cy', cy2);
19575	+ };
19576	+
19577	+ // Hours and minutes are selected
19578	+ ClockPicker.prototype.done = function () {
19579	+ raiseCallback(this.options.beforeDone);
19580	+ this.hide();
19581	+ this.label.addClass('active');
19582	+
19583	+ var last = this.input.prop('value'),
19584	+ value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
19585	+ if (this.options.twelvehour) {
19586	+ value = value + this.amOrPm;
19587	+ }
19588	+
19589	+ this.input.prop('value', value);
19590	+ if (value !== last) {
19591	+ this.input.triggerHandler('change');
19592	+ if (!this.isInput) {
19593	+ this.element.trigger('change');
19594	+ }
19595	+ }
19596	+
19597	+ if (this.options.autoclose) this.input.trigger('blur');
19598	+
19599	+ raiseCallback(this.options.afterDone);
19600	+ };
19601	+
19602	+ // Clear input field
19603	+ ClockPicker.prototype.clear = function () {
19604	+ this.hide();
19605	+ this.label.removeClass('active');
19606	+
19607	+ var last = this.input.prop('value'),
19608	+ value = '';
19609	+
19610	+ this.input.prop('value', value);
19611	+ if (value !== last) {
19612	+ this.input.triggerHandler('change');
19613	+ if (!this.isInput) {
19614	+ this.element.trigger('change');
19615	+ }
19616	+ }
19617	+
19618	+ if (this.options.autoclose) {
19619	+ this.input.trigger('blur');
19620	+ }
19621	+ };
19622	+
19623	+ // Remove clockpicker from input
19624	+ ClockPicker.prototype.remove = function () {
19625	+ this.element.removeData('clockpicker');
19626	+ this.input.off('focus.clockpicker click.clockpicker');
19627	+ if (this.isShown) {
19628	+ this.hide();
19629	+ }
19630	+ if (this.isAppended) {
19631	+ $win.off('resize.clockpicker' + this.id);
19632	+ this.popover.remove();
19633	+ }
19634	+ };
19635	+
19636	+ // Extends $.fn.clockpicker
19637	+ $.fn.pickatime = function (option) {
19638	+ var args = Array.prototype.slice.call(arguments, 1);
19639	+ return this.each(function () {
19640	+ var $this = $(this),
19641	+ data = $this.data('clockpicker');
19642	+ if (!data) {
19643	+ var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
19644	+ $this.data('clockpicker', new ClockPicker($this, options));
19645	+ } else {
19646	+ // Manual operatsions. show, hide, remove, e.g.
19647	+ if (typeof data[option] === 'function') {
19648	+ data[option].apply(data, args);
19649	+ }
19650	+ }
19651	+ });
19652	+ };
19653	+ })();
19654	+ ;(function ($) {
19655	+
19656	+ $.fn.characterCounter = function () {
19657	+ return this.each(function () {
19658	+ var $input = $(this);
19659	+ var $counterElement = $input.parent().find('span[class="character-counter"]');
19660	+
19661	+ // character counter has already been added appended to the parent container
19662	+ if ($counterElement.length) {
19663	+ return;
19664	+ }
19665	+
19666	+ var itHasLengthAttribute = $input.attr('data-length') !== undefined;
19667	+
19668	+ if (itHasLengthAttribute) {
19669	+ $input.on('input', updateCounter);
19670	+ $input.on('focus', updateCounter);
19671	+ $input.on('blur', removeCounterElement);
19672	+
19673	+ addCounterElement($input);
19674	+ }
19675	+ });
19676	+ };
19677	+
19678	+ function updateCounter() {
19679	+ var maxLength = +$(this).attr('data-length'),
19680	+ actualLength = +$(this).val().length,
19681	+ isValidLength = actualLength <= maxLength;
19682	+
19683	+ $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
19684	+
19685	+ addInputStyle(isValidLength, $(this));
19686	+ }
19687	+
19688	+ function addCounterElement($input) {
19689	+ var $counterElement = $input.parent().find('span[class="character-counter"]');
19690	+
19691	+ if ($counterElement.length) {
19692	+ return;
19693	+ }
19694	+
19695	+ $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
19696	+
19697	+ $input.parent().append($counterElement);
19698	+ }
19699	+
19700	+ function removeCounterElement() {
19701	+ $(this).parent().find('span[class="character-counter"]').html('');
19702	+ }
19703	+
19704	+ function addInputStyle(isValidLength, $input) {
19705	+ var inputHasInvalidClass = $input.hasClass('invalid');
19706	+ if (isValidLength && inputHasInvalidClass) {
19707	+ $input.removeClass('invalid');
19708	+ } else if (!isValidLength && !inputHasInvalidClass) {
19709	+ $input.removeClass('valid');
19710	+ $input.addClass('invalid');
19711	+ }
19712	+ }
19713	+
19714	+ $(document).ready(function () {
19715	+ $('input, textarea').characterCounter();
19716	+ });
19717	+ })(jQuery);
19718	+ ;(function ($) {
19719	+
19720	+ var methods = {
19721	+
19722	+ init: function (options) {
19723	+ var defaults = {
19724	+ duration: 200, // ms
19725	+ dist: -100, // zoom scale TODO: make this more intuitive as an option
19726	+ shift: 0, // spacing for center image
19727	+ padding: 0, // Padding between non center items
19728	+ fullWidth: false, // Change to full width styles
19729	+ indicators: false, // Toggle indicators
19730	+ noWrap: false, // Don't wrap around and cycle through items.
19731	+ onCycleTo: null // Callback for when a new slide is cycled to.
19732	+ };
19733	+ options = $.extend(defaults, options);
19734	+ var namespace = Materialize.objectSelectorString($(this));
19735	+
19736	+ return this.each(function (i) {
19737	+
19738	+ var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
19739	+ var $indicators = $('<ul class="indicators"></ul>');
19740	+ var scrollingTimeout = null;
19741	+ var oneTimeCallback = null;
19742	+
19743	+ // Initialize
19744	+ var view = $(this);
19745	+ var hasMultipleSlides = view.find('.carousel-item').length > 1;
19746	+ var showIndicators = (view.attr('data-indicators') \|\| options.indicators) && hasMultipleSlides;
19747	+ var noWrap = view.attr('data-no-wrap') \|\| options.noWrap \|\| !hasMultipleSlides;
19748	+ var uniqueNamespace = view.attr('data-namespace') \|\| namespace + i;
19749	+ view.attr('data-namespace', uniqueNamespace);
19750	+
19751	+ // Options
19752	+ var setCarouselHeight = function (imageOnly) {
19753	+ var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
19754	+ var firstImage = firstSlide.find('img').first();
19755	+ if (firstImage.length) {
19756	+ if (firstImage[0].complete) {
19757	+ // If image won't trigger the load event
19758	+ var imageHeight = firstImage.height();
19759	+ if (imageHeight > 0) {
19760	+ view.css('height', firstImage.height());
19761	+ } else {
19762	+ // If image still has no height, use the natural dimensions to calculate
19763	+ var naturalWidth = firstImage[0].naturalWidth;
19764	+ var naturalHeight = firstImage[0].naturalHeight;
19765	+ var adjustedHeight = view.width() / naturalWidth * naturalHeight;
19766	+ view.css('height', adjustedHeight);
19767	+ }
19768	+ } else {
19769	+ // Get height when image is loaded normally
19770	+ firstImage.on('load', function () {
19771	+ view.css('height', $(this).height());
19772	+ });
19773	+ }
19774	+ } else if (!imageOnly) {
19775	+ var slideHeight = firstSlide.height();
19776	+ view.css('height', slideHeight);
19777	+ }
19778	+ };
19779	+
19780	+ if (options.fullWidth) {
19781	+ options.dist = 0;
19782	+ setCarouselHeight();
19783	+
19784	+ // Offset fixed items when indicators.
19785	+ if (showIndicators) {
19786	+ view.find('.carousel-fixed-item').addClass('with-indicators');
19787	+ }
19788	+ }
19789	+
19790	+ // Don't double initialize.
19791	+ if (view.hasClass('initialized')) {
19792	+ // Recalculate variables
19793	+ $(window).trigger('resize');
19794	+
19795	+ // Redraw carousel.
19796	+ view.trigger('carouselNext', [0.000001]);
19797	+ return true;
19798	+ }
19799	+
19800	+ view.addClass('initialized');
19801	+ pressed = false;
19802	+ offset = target = 0;
19803	+ images = [];
19804	+ item_width = view.find('.carousel-item').first().innerWidth();
19805	+ item_height = view.find('.carousel-item').first().innerHeight();
19806	+ dim = item_width * 2 + options.padding;
19807	+
19808	+ view.find('.carousel-item').each(function (i) {
19809	+ images.push($(this)[0]);
19810	+ if (showIndicators) {
19811	+ var $indicator = $('<li class="indicator-item"></li>');
19812	+
19813	+ // Add active to first by default.
19814	+ if (i === 0) {
19815	+ $indicator.addClass('active');
19816	+ }
19817	+
19818	+ // Handle clicks on indicators.
19819	+ $indicator.click(function (e) {
19820	+ e.stopPropagation();
19821	+
19822	+ var index = $(this).index();
19823	+ cycleTo(index);
19824	+ });
19825	+ $indicators.append($indicator);
19826	+ }
19827	+ });
19828	+
19829	+ if (showIndicators) {
19830	+ view.append($indicators);
19831	+ }
19832	+ count = images.length;
19833	+
19834	+ function setupEvents() {
19835	+ if (typeof window.ontouchstart !== 'undefined') {
19836	+ view.on('touchstart.carousel', tap);
19837	+ view.on('touchmove.carousel', drag);
19838	+ view.on('touchend.carousel', release);
19839	+ }
19840	+ view.on('mousedown.carousel', tap);
19841	+ view.on('mousemove.carousel', drag);
19842	+ view.on('mouseup.carousel', release);
19843	+ view.on('mouseleave.carousel', release);
19844	+ view.on('click.carousel', click);
19845	+ }
19846	+
19847	+ function xpos(e) {
19848	+ // touch event
19849	+ if (e.targetTouches && e.targetTouches.length >= 1) {
19850	+ return e.targetTouches[0].clientX;
19851	+ }
19852	+
19853	+ // mouse event
19854	+ return e.clientX;
19855	+ }
19856	+
19857	+ function ypos(e) {
19858	+ // touch event
19859	+ if (e.targetTouches && e.targetTouches.length >= 1) {
19860	+ return e.targetTouches[0].clientY;
19861	+ }
19862	+
19863	+ // mouse event
19864	+ return e.clientY;
19865	+ }
19866	+
19867	+ function wrap(x) {
19868	+ return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
19869	+ }
19870	+
19871	+ function scroll(x) {
19872	+ // Track scrolling state
19873	+ scrolling = true;
19874	+ if (!view.hasClass('scrolling')) {
19875	+ view.addClass('scrolling');
19876	+ }
19877	+ if (scrollingTimeout != null) {
19878	+ window.clearTimeout(scrollingTimeout);
19879	+ }
19880	+ scrollingTimeout = window.setTimeout(function () {
19881	+ scrolling = false;
19882	+ view.removeClass('scrolling');
19883	+ }, options.duration);
19884	+
19885	+ // Start actual scroll
19886	+ var i, half, delta, dir, tween, el, alignment, xTranslation;
19887	+ var lastCenter = center;
19888	+
19889	+ offset = typeof x === 'number' ? x : offset;
19890	+ center = Math.floor((offset + dim / 2) / dim);
19891	+ delta = offset - center * dim;
19892	+ dir = delta < 0 ? 1 : -1;
19893	+ tween = -dir * delta * 2 / dim;
19894	+ half = count >> 1;
19895	+
19896	+ if (!options.fullWidth) {
19897	+ alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
19898	+ alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
19899	+ } else {
19900	+ alignment = 'translateX(0)';
19901	+ }
19902	+
19903	+ // Set indicator active
19904	+ if (showIndicators) {
19905	+ var diff = center % count;
19906	+ var activeIndicator = $indicators.find('.indicator-item.active');
19907	+ if (activeIndicator.index() !== diff) {
19908	+ activeIndicator.removeClass('active');
19909	+ $indicators.find('.indicator-item').eq(diff).addClass('active');
19910	+ }
19911	+ }
19912	+
19913	+ // center
19914	+ // Don't show wrapped items.
19915	+ if (!noWrap \|\| center >= 0 && center < count) {
19916	+ el = images[wrap(center)];
19917	+
19918	+ // Add active class to center item.
19919	+ if (!$(el).hasClass('active')) {
19920	+ view.find('.carousel-item').removeClass('active');
19921	+ $(el).addClass('active');
19922	+ }
19923	+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
19924	+ el.style.zIndex = 0;
19925	+ if (options.fullWidth) {
19926	+ tweenedOpacity = 1;
19927	+ } else {
19928	+ tweenedOpacity = 1 - 0.2 * tween;
19929	+ }
19930	+ el.style.opacity = tweenedOpacity;
19931	+ el.style.display = 'block';
19932	+ }
19933	+
19934	+ for (i = 1; i <= half; ++i) {
19935	+ // right side
19936	+ if (options.fullWidth) {
19937	+ zTranslation = options.dist;
19938	+ tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
19939	+ } else {
19940	+ zTranslation = options.dist * (i * 2 + tween * dir);
19941	+ tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
19942	+ }
19943	+ // Don't show wrapped items.
19944	+ if (!noWrap \|\| center + i < count) {
19945	+ el = images[wrap(center + i)];
19946	+ el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
19947	+ el.style.zIndex = -i;
19948	+ el.style.opacity = tweenedOpacity;
19949	+ el.style.display = 'block';
19950	+ }
19951	+
19952	+ // left side
19953	+ if (options.fullWidth) {
19954	+ zTranslation = options.dist;
19955	+ tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
19956	+ } else {
19957	+ zTranslation = options.dist * (i * 2 - tween * dir);
19958	+ tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
19959	+ }
19960	+ // Don't show wrapped items.
19961	+ if (!noWrap \|\| center - i >= 0) {
19962	+ el = images[wrap(center - i)];
19963	+ el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
19964	+ el.style.zIndex = -i;
19965	+ el.style.opacity = tweenedOpacity;
19966	+ el.style.display = 'block';
19967	+ }
19968	+ }
19969	+
19970	+ // center
19971	+ // Don't show wrapped items.
19972	+ if (!noWrap \|\| center >= 0 && center < count) {
19973	+ el = images[wrap(center)];
19974	+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
19975	+ el.style.zIndex = 0;
19976	+ if (options.fullWidth) {
19977	+ tweenedOpacity = 1;
19978	+ } else {
19979	+ tweenedOpacity = 1 - 0.2 * tween;
19980	+ }
19981	+ el.style.opacity = tweenedOpacity;
19982	+ el.style.display = 'block';
19983	+ }
19984	+
19985	+ // onCycleTo callback
19986	+ if (lastCenter !== center && typeof options.onCycleTo === "function") {
19987	+ var $curr_item = view.find('.carousel-item').eq(wrap(center));
19988	+ options.onCycleTo.call(this, $curr_item, dragged);
19989	+ }
19990	+
19991	+ // One time callback
19992	+ if (typeof oneTimeCallback === "function") {
19993	+ oneTimeCallback.call(this, $curr_item, dragged);
19994	+ oneTimeCallback = null;
19995	+ }
19996	+ }
19997	+
19998	+ function track() {
19999	+ var now, elapsed, delta, v;
20000	+
20001	+ now = Date.now();
20002	+ elapsed = now - timestamp;
20003	+ timestamp = now;
20004	+ delta = offset - frame;
20005	+ frame = offset;
20006	+
20007	+ v = 1000 * delta / (1 + elapsed);
20008	+ velocity = 0.8 * v + 0.2 * velocity;
20009	+ }
20010	+
20011	+ function autoScroll() {
20012	+ var elapsed, delta;
20013	+
20014	+ if (amplitude) {
20015	+ elapsed = Date.now() - timestamp;
20016	+ delta = amplitude * Math.exp(-elapsed / options.duration);
20017	+ if (delta > 2 \|\| delta < -2) {
20018	+ scroll(target - delta);
20019	+ requestAnimationFrame(autoScroll);
20020	+ } else {
20021	+ scroll(target);
20022	+ }
20023	+ }
20024	+ }
20025	+
20026	+ function click(e) {
20027	+ // Disable clicks if carousel was dragged.
20028	+ if (dragged) {
20029	+ e.preventDefault();
20030	+ e.stopPropagation();
20031	+ return false;
20032	+ } else if (!options.fullWidth) {
20033	+ var clickedIndex = $(e.target).closest('.carousel-item').index();
20034	+ var diff = wrap(center) - clickedIndex;
20035	+
20036	+ // Disable clicks if carousel was shifted by click
20037	+ if (diff !== 0) {
20038	+ e.preventDefault();
20039	+ e.stopPropagation();
20040	+ }
20041	+ cycleTo(clickedIndex);
20042	+ }
20043	+ }
20044	+
20045	+ function cycleTo(n) {
20046	+ var diff = center % count - n;
20047	+
20048	+ // Account for wraparound.
20049	+ if (!noWrap) {
20050	+ if (diff < 0) {
20051	+ if (Math.abs(diff + count) < Math.abs(diff)) {
20052	+ diff += count;
20053	+ }
20054	+ } else if (diff > 0) {
20055	+ if (Math.abs(diff - count) < diff) {
20056	+ diff -= count;
20057	+ }
20058	+ }
20059	+ }
20060	+
20061	+ // Call prev or next accordingly.
20062	+ if (diff < 0) {
20063	+ view.trigger('carouselNext', [Math.abs(diff)]);
20064	+ } else if (diff > 0) {
20065	+ view.trigger('carouselPrev', [diff]);
20066	+ }
20067	+ }
20068	+
20069	+ function tap(e) {
20070	+ // Fixes firefox draggable image bug
20071	+ if (e.type === 'mousedown' && $(e.target).is('img')) {
20072	+ e.preventDefault();
20073	+ }
20074	+ pressed = true;
20075	+ dragged = false;
20076	+ vertical_dragged = false;
20077	+ reference = xpos(e);
20078	+ referenceY = ypos(e);
20079	+
20080	+ velocity = amplitude = 0;
20081	+ frame = offset;
20082	+ timestamp = Date.now();
20083	+ clearInterval(ticker);
20084	+ ticker = setInterval(track, 100);
20085	+ }
20086	+
20087	+ function drag(e) {
20088	+ var x, delta, deltaY;
20089	+ if (pressed) {
20090	+ x = xpos(e);
20091	+ y = ypos(e);
20092	+ delta = reference - x;
20093	+ deltaY = Math.abs(referenceY - y);
20094	+ if (deltaY < 30 && !vertical_dragged) {
20095	+ // If vertical scrolling don't allow dragging.
20096	+ if (delta > 2 \|\| delta < -2) {
20097	+ dragged = true;
20098	+ reference = x;
20099	+ scroll(offset + delta);
20100	+ }
20101	+ } else if (dragged) {
20102	+ // If dragging don't allow vertical scroll.
20103	+ e.preventDefault();
20104	+ e.stopPropagation();
20105	+ return false;
20106	+ } else {
20107	+ // Vertical scrolling.
20108	+ vertical_dragged = true;
20109	+ }
20110	+ }
20111	+
20112	+ if (dragged) {
20113	+ // If dragging don't allow vertical scroll.
20114	+ e.preventDefault();
20115	+ e.stopPropagation();
20116	+ return false;
20117	+ }
20118	+ }
20119	+
20120	+ function release(e) {
20121	+ if (pressed) {
20122	+ pressed = false;
20123	+ } else {
20124	+ return;
20125	+ }
20126	+
20127	+ clearInterval(ticker);
20128	+ target = offset;
20129	+ if (velocity > 10 \|\| velocity < -10) {
20130	+ amplitude = 0.9 * velocity;
20131	+ target = offset + amplitude;
20132	+ }
20133	+ target = Math.round(target / dim) * dim;
20134	+
20135	+ // No wrap of items.
20136	+ if (noWrap) {
20137	+ if (target >= dim * (count - 1)) {
20138	+ target = dim * (count - 1);
20139	+ } else if (target < 0) {
20140	+ target = 0;
20141	+ }
20142	+ }
20143	+ amplitude = target - offset;
20144	+ timestamp = Date.now();
20145	+ requestAnimationFrame(autoScroll);
20146	+
20147	+ if (dragged) {
20148	+ e.preventDefault();
20149	+ e.stopPropagation();
20150	+ }
20151	+ return false;
20152	+ }
20153	+
20154	+ xform = 'transform';
20155	+ ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
20156	+ var e = prefix + 'Transform';
20157	+ if (typeof document.body.style[e] !== 'undefined') {
20158	+ xform = e;
20159	+ return false;
20160	+ }
20161	+ return true;
20162	+ });
20163	+
20164	+ var throttledResize = Materialize.throttle(function () {
20165	+ if (options.fullWidth) {
20166	+ item_width = view.find('.carousel-item').first().innerWidth();
20167	+ var imageHeight = view.find('.carousel-item.active').height();
20168	+ dim = item_width * 2 + options.padding;
20169	+ offset = center * 2 * item_width;
20170	+ target = offset;
20171	+ setCarouselHeight(true);
20172	+ } else {
20173	+ scroll();
20174	+ }
20175	+ }, 200);
20176	+ $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
20177	+
20178	+ setupEvents();
20179	+ scroll(offset);
20180	+
20181	+ $(this).on('carouselNext', function (e, n, callback) {
20182	+ if (n === undefined) {
20183	+ n = 1;
20184	+ }
20185	+ if (typeof callback === "function") {
20186	+ oneTimeCallback = callback;
20187	+ }
20188	+
20189	+ target = dim * Math.round(offset / dim) + dim * n;
20190	+ if (offset !== target) {
20191	+ amplitude = target - offset;
20192	+ timestamp = Date.now();
20193	+ requestAnimationFrame(autoScroll);
20194	+ }
20195	+ });
20196	+
20197	+ $(this).on('carouselPrev', function (e, n, callback) {
20198	+ if (n === undefined) {
20199	+ n = 1;
20200	+ }
20201	+ if (typeof callback === "function") {
20202	+ oneTimeCallback = callback;
20203	+ }
20204	+
20205	+ target = dim * Math.round(offset / dim) - dim * n;
20206	+ if (offset !== target) {
20207	+ amplitude = target - offset;
20208	+ timestamp = Date.now();
20209	+ requestAnimationFrame(autoScroll);
20210	+ }
20211	+ });
20212	+
20213	+ $(this).on('carouselSet', function (e, n, callback) {
20214	+ if (n === undefined) {
20215	+ n = 0;
20216	+ }
20217	+ if (typeof callback === "function") {
20218	+ oneTimeCallback = callback;
20219	+ }
20220	+
20221	+ cycleTo(n);
20222	+ });
20223	+ });
20224	+ },
20225	+ next: function (n, callback) {
20226	+ $(this).trigger('carouselNext', [n, callback]);
20227	+ },
20228	+ prev: function (n, callback) {
20229	+ $(this).trigger('carouselPrev', [n, callback]);
20230	+ },
20231	+ set: function (n, callback) {
20232	+ $(this).trigger('carouselSet', [n, callback]);
20233	+ },
20234	+ destroy: function () {
20235	+ var uniqueNamespace = $(this).attr('data-namespace');
20236	+ $(this).removeAttr('data-namespace');
20237	+ $(this).removeClass('initialized');
20238	+ $(this).find('.indicators').remove();
20239	+
20240	+ // Remove event handlers
20241	+ $(this).off('carouselNext carouselPrev carouselSet');
20242	+ $(window).off('resize.carousel-' + uniqueNamespace);
20243	+ if (typeof window.ontouchstart !== 'undefined') {
20244	+ $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
20245	+ }
20246	+ $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
20247	+ }
20248	+ };
20249	+
20250	+ $.fn.carousel = function (methodOrOptions) {
20251	+ if (methods[methodOrOptions]) {
20252	+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
20253	+ } else if (typeof methodOrOptions === 'object' \|\| !methodOrOptions) {
20254	+ // Default to "init"
20255	+ return methods.init.apply(this, arguments);
20256	+ } else {
20257	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
20258	+ }
20259	+ }; // Plugin end
20260	+ })(jQuery);
20261	+ ;(function ($) {
20262	+
20263	+ var methods = {
20264	+ init: function (options) {
20265	+ return this.each(function () {
20266	+ var origin = $('#' + $(this).attr('data-activates'));
20267	+ var screen = $('body');
20268	+
20269	+ // Creating tap target
20270	+ var tapTargetEl = $(this);
20271	+ var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
20272	+ var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
20273	+ var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
20274	+ var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
20275	+
20276	+ // Creating wrapper
20277	+ if (!tapTargetWrapper.length) {
20278	+ tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
20279	+ }
20280	+
20281	+ // Creating content
20282	+ if (!tapTargetContentEl.length) {
20283	+ tapTargetContentEl = $('<div class="tap-target-content"></div>');
20284	+ tapTargetEl.append(tapTargetContentEl);
20285	+ }
20286	+
20287	+ // Creating foreground wave
20288	+ if (!tapTargetWave.length) {
20289	+ tapTargetWave = $('<div class="tap-target-wave"></div>');
20290	+
20291	+ // Creating origin
20292	+ if (!tapTargetOriginEl.length) {
20293	+ tapTargetOriginEl = origin.clone(true, true);
20294	+ tapTargetOriginEl.addClass('tap-target-origin');
20295	+ tapTargetOriginEl.removeAttr('id');
20296	+ tapTargetOriginEl.removeAttr('style');
20297	+ tapTargetWave.append(tapTargetOriginEl);
20298	+ }
20299	+
20300	+ tapTargetWrapper.append(tapTargetWave);
20301	+ }
20302	+
20303	+ // Open
20304	+ var openTapTarget = function () {
20305	+ if (tapTargetWrapper.is('.open')) {
20306	+ return;
20307	+ }
20308	+
20309	+ // Adding open class
20310	+ tapTargetWrapper.addClass('open');
20311	+
20312	+ setTimeout(function () {
20313	+ tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
20314	+ closeTapTarget();
20315	+ tapTargetOriginEl.off('click.tapTarget');
20316	+ });
20317	+
20318	+ $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
20319	+ closeTapTarget();
20320	+ $(document).off('click.tapTarget');
20321	+ });
20322	+
20323	+ var throttledCalc = Materialize.throttle(function () {
20324	+ calculateTapTarget();
20325	+ }, 200);
20326	+ $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
20327	+ }, 0);
20328	+ };
20329	+
20330	+ // Close
20331	+ var closeTapTarget = function () {
20332	+ if (!tapTargetWrapper.is('.open')) {
20333	+ return;
20334	+ }
20335	+
20336	+ tapTargetWrapper.removeClass('open');
20337	+ tapTargetOriginEl.off('click.tapTarget');
20338	+ $(document).off('click.tapTarget');
20339	+ $(window).off('resize.tapTarget');
20340	+ };
20341	+
20342	+ // Pre calculate
20343	+ var calculateTapTarget = function () {
20344	+ // Element or parent is fixed position?
20345	+ var isFixed = origin.css('position') === 'fixed';
20346	+ if (!isFixed) {
20347	+ var parents = origin.parents();
20348	+ for (var i = 0; i < parents.length; i++) {
20349	+ isFixed = $(parents[i]).css('position') == 'fixed';
20350	+ if (isFixed) {
20351	+ break;
20352	+ }
20353	+ }
20354	+ }
20355	+
20356	+ // Calculating origin
20357	+ var originWidth = origin.outerWidth();
20358	+ var originHeight = origin.outerHeight();
20359	+ var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
20360	+ var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
20361	+
20362	+ // Calculating screen
20363	+ var windowWidth = $(window).width();
20364	+ var windowHeight = $(window).height();
20365	+ var centerX = windowWidth / 2;
20366	+ var centerY = windowHeight / 2;
20367	+ var isLeft = originLeft <= centerX;
20368	+ var isRight = originLeft > centerX;
20369	+ var isTop = originTop <= centerY;
20370	+ var isBottom = originTop > centerY;
20371	+ var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
20372	+ var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
20373	+
20374	+ // Calculating tap target
20375	+ var tapTargetWidth = tapTargetEl.outerWidth();
20376	+ var tapTargetHeight = tapTargetEl.outerHeight();
20377	+ var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
20378	+ var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
20379	+ var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
20380	+
20381	+ // Calculating content
20382	+ var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
20383	+ var tapTargetTextHeight = tapTargetHeight / 2;
20384	+ var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
20385	+ var tapTargetTextBottom = 0;
20386	+ var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
20387	+ var tapTargetTextRight = 0;
20388	+ var tapTargetTextPadding = originWidth;
20389	+ var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
20390	+
20391	+ // Calculating wave
20392	+ var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
20393	+ var tapTargetWaveHeight = tapTargetWaveWidth;
20394	+ var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
20395	+ var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
20396	+
20397	+ // Setting tap target
20398	+ var tapTargetWrapperCssObj = {};
20399	+ tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
20400	+ tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
20401	+ tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
20402	+ tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
20403	+ tapTargetWrapperCssObj.position = tapTargetPosition;
20404	+ tapTargetWrapper.css(tapTargetWrapperCssObj);
20405	+
20406	+ // Setting content
20407	+ tapTargetContentEl.css({
20408	+ width: tapTargetTextWidth,
20409	+ height: tapTargetTextHeight,
20410	+ top: tapTargetTextTop,
20411	+ right: tapTargetTextRight,
20412	+ bottom: tapTargetTextBottom,
20413	+ left: tapTargetTextLeft,
20414	+ padding: tapTargetTextPadding,
20415	+ verticalAlign: tapTargetTextAlign
20416	+ });
20417	+
20418	+ // Setting wave
20419	+ tapTargetWave.css({
20420	+ top: tapTargetWaveTop,
20421	+ left: tapTargetWaveLeft,
20422	+ width: tapTargetWaveWidth,
20423	+ height: tapTargetWaveHeight
20424	+ });
20425	+ };
20426	+
20427	+ if (options == 'open') {
20428	+ calculateTapTarget();
20429	+ openTapTarget();
20430	+ }
20431	+
20432	+ if (options == 'close') closeTapTarget();
20433	+ });
20434	+ },
20435	+ open: function () {},
20436	+ close: function () {}
20437	+ };
20438	+
20439	+ $.fn.tapTarget = function (methodOrOptions) {
20440	+ if (methods[methodOrOptions] \|\| typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
20441	+
20442	+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
20443	+ };
20444	+ })(jQuery);
20445	+
20446	+
20447	+ /***/ }),
20448	+ /* 7 */
20449	+ /***/ (function(module, exports) {
20450	+
20451	+ /* WEBPACK VAR INJECTION /(function(__webpack_amd_options__) {/ globals __webpack_amd_options__ */
20452	+ module.exports = __webpack_amd_options__;
20453	+
20454	+ /* WEBPACK VAR INJECTION */}.call(exports, {}))
20455	+
20456	+ /***/ }),
20457	+ /* 8 */
20458	+ /***/ (function(module, exports, __webpack_require__) {
20459	+
20460	+ var __WEBPACK_AMD_DEFINE_RESULT__;/*! Hammer.JS - v2.0.7 - 2016-04-22
20461	+ * http://hammerjs.github.io/
20462	+ *
20463	+ * Copyright (c) 2016 Jorik Tangelder;
20464	+ * Licensed under the MIT license */
20465	+ (function(window, document, exportName, undefined) {
20466	+ 'use strict';
20467	+
20468	+ var VENDOR_PREFIXES = ['', 'webkit', 'Moz', 'MS', 'ms', 'o'];
20469	+ var TEST_ELEMENT = document.createElement('div');
20470	+
20471	+ var TYPE_FUNCTION = 'function';
20472	+
20473	+ var round = Math.round;
20474	+ var abs = Math.abs;
20475	+ var now = Date.now;
20476	+
20477	+ /**
20478	+ * set a timeout with a given scope
20479	+ * @param {Function} fn
20480	+ * @param {Number} timeout
20481	+ * @param {Object} context
20482	+ * @returns {number}
20483	+ */
20484	+ function setTimeoutContext(fn, timeout, context) {
20485	+ return setTimeout(bindFn(fn, context), timeout);
20486	+ }
20487	+
20488	+ /**
20489	+ * if the argument is an array, we want to execute the fn on each entry
20490	+ * if it aint an array we don't want to do a thing.
20491	+ * this is used by all the methods that accept a single and array argument.
20492	+ * @param {*\|Array} arg
20493	+ * @param {String} fn
20494	+ * @param {Object} [context]
20495	+ * @returns {Boolean}
20496	+ */
20497	+ function invokeArrayArg(arg, fn, context) {
20498	+ if (Array.isArray(arg)) {
20499	+ each(arg, context[fn], context);
20500	+ return true;
20501	+ }
20502	+ return false;
20503	+ }
20504	+
20505	+ /**
20506	+ * walk objects and arrays
20507	+ * @param {Object} obj
20508	+ * @param {Function} iterator
20509	+ * @param {Object} context
20510	+ */
20511	+ function each(obj, iterator, context) {
20512	+ var i;
20513	+
20514	+ if (!obj) {
20515	+ return;
20516	+ }
20517	+
20518	+ if (obj.forEach) {
20519	+ obj.forEach(iterator, context);
20520	+ } else if (obj.length !== undefined) {
20521	+ i = 0;
20522	+ while (i < obj.length) {
20523	+ iterator.call(context, obj[i], i, obj);
20524	+ i++;
20525	+ }
20526	+ } else {
20527	+ for (i in obj) {
20528	+ obj.hasOwnProperty(i) && iterator.call(context, obj[i], i, obj);
20529	+ }
20530	+ }
20531	+ }
20532	+
20533	+ /**
20534	+ * wrap a method with a deprecation warning and stack trace
20535	+ * @param {Function} method
20536	+ * @param {String} name
20537	+ * @param {String} message
20538	+ * @returns {Function} A new function wrapping the supplied method.
20539	+ */
20540	+ function deprecate(method, name, message) {
20541	+ var deprecationMessage = 'DEPRECATED METHOD: ' + name + '\n' + message + ' AT \n';
20542	+ return function() {
20543	+ var e = new Error('get-stack-trace');
20544	+ var stack = e && e.stack ? e.stack.replace(/^[^\(]+?[\n$]/gm, '')
20545	+ .replace(/^\s+at\s+/gm, '')
20546	+ .replace(/^Object.<anonymous>\s*\(/gm, '{anonymous}()@') : 'Unknown Stack Trace';
20547	+
20548	+ var log = window.console && (window.console.warn \|\| window.console.log);
20549	+ if (log) {
20550	+ log.call(window.console, deprecationMessage, stack);
20551	+ }
20552	+ return method.apply(this, arguments);
20553	+ };
20554	+ }
20555	+
20556	+ /**
20557	+ * extend object.
20558	+ * means that properties in dest will be overwritten by the ones in src.
20559	+ * @param {Object} target
20560	+ * @param {...Object} objects_to_assign
20561	+ * @returns {Object} target
20562	+ */
20563	+ var assign;
20564	+ if (typeof Object.assign !== 'function') {
20565	+ assign = function assign(target) {
20566	+ if (target === undefined \|\| target === null) {
20567	+ throw new TypeError('Cannot convert undefined or null to object');
20568	+ }
20569	+
20570	+ var output = Object(target);
20571	+ for (var index = 1; index < arguments.length; index++) {
20572	+ var source = arguments[index];
20573	+ if (source !== undefined && source !== null) {
20574	+ for (var nextKey in source) {
20575	+ if (source.hasOwnProperty(nextKey)) {
20576	+ output[nextKey] = source[nextKey];
20577	+ }
20578	+ }
20579	+ }
20580	+ }
20581	+ return output;
20582	+ };
20583	+ } else {
20584	+ assign = Object.assign;
20585	+ }
20586	+
20587	+ /**
20588	+ * extend object.
20589	+ * means that properties in dest will be overwritten by the ones in src.
20590	+ * @param {Object} dest
20591	+ * @param {Object} src
20592	+ * @param {Boolean} [merge=false]
20593	+ * @returns {Object} dest
20594	+ */
20595	+ var extend = deprecate(function extend(dest, src, merge) {
20596	+ var keys = Object.keys(src);
20597	+ var i = 0;
20598	+ while (i < keys.length) {
20599	+ if (!merge \|\| (merge && dest[keys[i]] === undefined)) {
20600	+ dest[keys[i]] = src[keys[i]];
20601	+ }
20602	+ i++;
20603	+ }
20604	+ return dest;
20605	+ }, 'extend', 'Use `assign`.');
20606	+
20607	+ /**
20608	+ * merge the values from src in the dest.
20609	+ * means that properties that exist in dest will not be overwritten by src
20610	+ * @param {Object} dest
20611	+ * @param {Object} src
20612	+ * @returns {Object} dest
20613	+ */
20614	+ var merge = deprecate(function merge(dest, src) {
20615	+ return extend(dest, src, true);
20616	+ }, 'merge', 'Use `assign`.');
20617	+
20618	+ /**
20619	+ * simple class inheritance
20620	+ * @param {Function} child
20621	+ * @param {Function} base
20622	+ * @param {Object} [properties]
20623	+ */
20624	+ function inherit(child, base, properties) {
20625	+ var baseP = base.prototype,
20626	+ childP;
20627	+
20628	+ childP = child.prototype = Object.create(baseP);
20629	+ childP.constructor = child;
20630	+ childP._super = baseP;
20631	+
20632	+ if (properties) {
20633	+ assign(childP, properties);
20634	+ }
20635	+ }
20636	+
20637	+ /**
20638	+ * simple function bind
20639	+ * @param {Function} fn
20640	+ * @param {Object} context
20641	+ * @returns {Function}
20642	+ */
20643	+ function bindFn(fn, context) {
20644	+ return function boundFn() {
20645	+ return fn.apply(context, arguments);
20646	+ };
20647	+ }
20648	+
20649	+ /**
20650	+ * let a boolean value also be a function that must return a boolean
20651	+ * this first item in args will be used as the context
20652	+ * @param {Boolean\|Function} val
20653	+ * @param {Array} [args]
20654	+ * @returns {Boolean}
20655	+ */
20656	+ function boolOrFn(val, args) {
20657	+ if (typeof val == TYPE_FUNCTION) {
20658	+ return val.apply(args ? args[0] \|\| undefined : undefined, args);
20659	+ }
20660	+ return val;
20661	+ }
20662	+
20663	+ /**
20664	+ * use the val2 when val1 is undefined
20665	+ * @param {*} val1
20666	+ * @param {*} val2
20667	+ * @returns {*}
20668	+ */
20669	+ function ifUndefined(val1, val2) {
20670	+ return (val1 === undefined) ? val2 : val1;
20671	+ }
20672	+
20673	+ /**
20674	+ * addEventListener with multiple events at once
20675	+ * @param {EventTarget} target
20676	+ * @param {String} types
20677	+ * @param {Function} handler
20678	+ */
20679	+ function addEventListeners(target, types, handler) {
20680	+ each(splitStr(types), function(type) {
20681	+ target.addEventListener(type, handler, false);
20682	+ });
20683	+ }
20684	+
20685	+ /**
20686	+ * removeEventListener with multiple events at once
20687	+ * @param {EventTarget} target
20688	+ * @param {String} types
20689	+ * @param {Function} handler
20690	+ */
20691	+ function removeEventListeners(target, types, handler) {
20692	+ each(splitStr(types), function(type) {
20693	+ target.removeEventListener(type, handler, false);
20694	+ });
20695	+ }
20696	+
20697	+ /**
20698	+ * find if a node is in the given parent
20699	+ * @method hasParent
20700	+ * @param {HTMLElement} node
20701	+ * @param {HTMLElement} parent
20702	+ * @return {Boolean} found
20703	+ */
20704	+ function hasParent(node, parent) {
20705	+ while (node) {
20706	+ if (node == parent) {
20707	+ return true;
20708	+ }
20709	+ node = node.parentNode;
20710	+ }
20711	+ return false;
20712	+ }
20713	+
20714	+ /**
20715	+ * small indexOf wrapper
20716	+ * @param {String} str
20717	+ * @param {String} find
20718	+ * @returns {Boolean} found
20719	+ */
20720	+ function inStr(str, find) {
20721	+ return str.indexOf(find) > -1;
20722	+ }
20723	+
20724	+ /**
20725	+ * split string on whitespace
20726	+ * @param {String} str
20727	+ * @returns {Array} words
20728	+ */
20729	+ function splitStr(str) {
20730	+ return str.trim().split(/\s+/g);
20731	+ }
20732	+
20733	+ /**
20734	+ * find if a array contains the object using indexOf or a simple polyFill
20735	+ * @param {Array} src
20736	+ * @param {String} find
20737	+ * @param {String} [findByKey]
20738	+ * @return {Boolean\|Number} false when not found, or the index
20739	+ */
20740	+ function inArray(src, find, findByKey) {
20741	+ if (src.indexOf && !findByKey) {
20742	+ return src.indexOf(find);
20743	+ } else {
20744	+ var i = 0;
20745	+ while (i < src.length) {
20746	+ if ((findByKey && src[i][findByKey] == find) \|\| (!findByKey && src[i] === find)) {
20747	+ return i;
20748	+ }
20749	+ i++;
20750	+ }
20751	+ return -1;
20752	+ }
20753	+ }
20754	+
20755	+ /**
20756	+ * convert array-like objects to real arrays
20757	+ * @param {Object} obj
20758	+ * @returns {Array}
20759	+ */
20760	+ function toArray(obj) {
20761	+ return Array.prototype.slice.call(obj, 0);
20762	+ }
20763	+
20764	+ /**
20765	+ * unique array with objects based on a key (like 'id') or just by the array's value
20766	+ * @param {Array} src [{id:1},{id:2},{id:1}]
20767	+ * @param {String} [key]
20768	+ * @param {Boolean} [sort=False]
20769	+ * @returns {Array} [{id:1},{id:2}]
20770	+ */
20771	+ function uniqueArray(src, key, sort) {
20772	+ var results = [];
20773	+ var values = [];
20774	+ var i = 0;
20775	+
20776	+ while (i < src.length) {
20777	+ var val = key ? src[i][key] : src[i];
20778	+ if (inArray(values, val) < 0) {
20779	+ results.push(src[i]);
20780	+ }
20781	+ values[i] = val;
20782	+ i++;
20783	+ }
20784	+
20785	+ if (sort) {
20786	+ if (!key) {
20787	+ results = results.sort();
20788	+ } else {
20789	+ results = results.sort(function sortUniqueArray(a, b) {
20790	+ return a[key] > b[key];
20791	+ });
20792	+ }
20793	+ }
20794	+
20795	+ return results;
20796	+ }
20797	+
20798	+ /**
20799	+ * get the prefixed property
20800	+ * @param {Object} obj
20801	+ * @param {String} property
20802	+ * @returns {String\|Undefined} prefixed
20803	+ */
20804	+ function prefixed(obj, property) {
20805	+ var prefix, prop;
20806	+ var camelProp = property[0].toUpperCase() + property.slice(1);
20807	+
20808	+ var i = 0;
20809	+ while (i < VENDOR_PREFIXES.length) {
20810	+ prefix = VENDOR_PREFIXES[i];
20811	+ prop = (prefix) ? prefix + camelProp : property;
20812	+
20813	+ if (prop in obj) {
20814	+ return prop;
20815	+ }
20816	+ i++;
20817	+ }
20818	+ return undefined;
20819	+ }
20820	+
20821	+ /**
20822	+ * get a unique id
20823	+ * @returns {number} uniqueId
20824	+ */
20825	+ var _uniqueId = 1;
20826	+ function uniqueId() {
20827	+ return _uniqueId++;
20828	+ }
20829	+
20830	+ /**
20831	+ * get the window object of an element
20832	+ * @param {HTMLElement} element
20833	+ * @returns {DocumentView\|Window}
20834	+ */
20835	+ function getWindowForElement(element) {
20836	+ var doc = element.ownerDocument \|\| element;
20837	+ return (doc.defaultView \|\| doc.parentWindow \|\| window);
20838	+ }
20839	+
20840	+ var MOBILE_REGEX = /mobile\|tablet\|ip(ad\|hone\|od)\|android/i;
20841	+
20842	+ var SUPPORT_TOUCH = ('ontouchstart' in window);
20843	+ var SUPPORT_POINTER_EVENTS = prefixed(window, 'PointerEvent') !== undefined;
20844	+ var SUPPORT_ONLY_TOUCH = SUPPORT_TOUCH && MOBILE_REGEX.test(navigator.userAgent);
20845	+
20846	+ var INPUT_TYPE_TOUCH = 'touch';
20847	+ var INPUT_TYPE_PEN = 'pen';
20848	+ var INPUT_TYPE_MOUSE = 'mouse';
20849	+ var INPUT_TYPE_KINECT = 'kinect';
20850	+
20851	+ var COMPUTE_INTERVAL = 25;
20852	+
20853	+ var INPUT_START = 1;
20854	+ var INPUT_MOVE = 2;
20855	+ var INPUT_END = 4;
20856	+ var INPUT_CANCEL = 8;
20857	+
20858	+ var DIRECTION_NONE = 1;
20859	+ var DIRECTION_LEFT = 2;
20860	+ var DIRECTION_RIGHT = 4;
20861	+ var DIRECTION_UP = 8;
20862	+ var DIRECTION_DOWN = 16;
20863	+
20864	+ var DIRECTION_HORIZONTAL = DIRECTION_LEFT \| DIRECTION_RIGHT;
20865	+ var DIRECTION_VERTICAL = DIRECTION_UP \| DIRECTION_DOWN;
20866	+ var DIRECTION_ALL = DIRECTION_HORIZONTAL \| DIRECTION_VERTICAL;
20867	+
20868	+ var PROPS_XY = ['x', 'y'];
20869	+ var PROPS_CLIENT_XY = ['clientX', 'clientY'];
20870	+
20871	+ /**
20872	+ * create new input type manager
20873	+ * @param {Manager} manager
20874	+ * @param {Function} callback
20875	+ * @returns {Input}
20876	+ * @constructor
20877	+ */
20878	+ function Input(manager, callback) {
20879	+ var self = this;
20880	+ this.manager = manager;
20881	+ this.callback = callback;
20882	+ this.element = manager.element;
20883	+ this.target = manager.options.inputTarget;
20884	+
20885	+ // smaller wrapper around the handler, for the scope and the enabled state of the manager,
20886	+ // so when disabled the input events are completely bypassed.
20887	+ this.domHandler = function(ev) {
20888	+ if (boolOrFn(manager.options.enable, [manager])) {
20889	+ self.handler(ev);
20890	+ }
20891	+ };
20892	+
20893	+ this.init();
20894	+
20895	+ }
20896	+
20897	+ Input.prototype = {
20898	+ /**
20899	+ * should handle the inputEvent data and trigger the callback
20900	+ * @virtual
20901	+ */
20902	+ handler: function() { },
20903	+
20904	+ /**
20905	+ * bind the events
20906	+ */
20907	+ init: function() {
20908	+ this.evEl && addEventListeners(this.element, this.evEl, this.domHandler);
20909	+ this.evTarget && addEventListeners(this.target, this.evTarget, this.domHandler);
20910	+ this.evWin && addEventListeners(getWindowForElement(this.element), this.evWin, this.domHandler);
20911	+ },
20912	+
20913	+ /**
20914	+ * unbind the events
20915	+ */
20916	+ destroy: function() {
20917	+ this.evEl && removeEventListeners(this.element, this.evEl, this.domHandler);
20918	+ this.evTarget && removeEventListeners(this.target, this.evTarget, this.domHandler);
20919	+ this.evWin && removeEventListeners(getWindowForElement(this.element), this.evWin, this.domHandler);
20920	+ }
20921	+ };
20922	+
20923	+ /**
20924	+ * create new input type manager
20925	+ * called by the Manager constructor
20926	+ * @param {Hammer} manager
20927	+ * @returns {Input}
20928	+ */
20929	+ function createInputInstance(manager) {
20930	+ var Type;
20931	+ var inputClass = manager.options.inputClass;
20932	+
20933	+ if (inputClass) {
20934	+ Type = inputClass;
20935	+ } else if (SUPPORT_POINTER_EVENTS) {
20936	+ Type = PointerEventInput;
20937	+ } else if (SUPPORT_ONLY_TOUCH) {
20938	+ Type = TouchInput;
20939	+ } else if (!SUPPORT_TOUCH) {
20940	+ Type = MouseInput;
20941	+ } else {
20942	+ Type = TouchMouseInput;
20943	+ }
20944	+ return new (Type)(manager, inputHandler);
20945	+ }
20946	+
20947	+ /**
20948	+ * handle input events
20949	+ * @param {Manager} manager
20950	+ * @param {String} eventType
20951	+ * @param {Object} input
20952	+ */
20953	+ function inputHandler(manager, eventType, input) {
20954	+ var pointersLen = input.pointers.length;
20955	+ var changedPointersLen = input.changedPointers.length;
20956	+ var isFirst = (eventType & INPUT_START && (pointersLen - changedPointersLen === 0));
20957	+ var isFinal = (eventType & (INPUT_END \| INPUT_CANCEL) && (pointersLen - changedPointersLen === 0));
20958	+
20959	+ input.isFirst = !!isFirst;
20960	+ input.isFinal = !!isFinal;
20961	+
20962	+ if (isFirst) {
20963	+ manager.session = {};
20964	+ }
20965	+
20966	+ // source event is the normalized value of the domEvents
20967	+ // like 'touchstart, mouseup, pointerdown'
20968	+ input.eventType = eventType;
20969	+
20970	+ // compute scale, rotation etc
20971	+ computeInputData(manager, input);
20972	+
20973	+ // emit secret event
20974	+ manager.emit('hammer.input', input);
20975	+
20976	+ manager.recognize(input);
20977	+ manager.session.prevInput = input;
20978	+ }
20979	+
20980	+ /**
20981	+ * extend the data with some usable properties like scale, rotate, velocity etc
20982	+ * @param {Object} manager
20983	+ * @param {Object} input
20984	+ */
20985	+ function computeInputData(manager, input) {
20986	+ var session = manager.session;
20987	+ var pointers = input.pointers;
20988	+ var pointersLength = pointers.length;
20989	+
20990	+ // store the first input to calculate the distance and direction
20991	+ if (!session.firstInput) {
20992	+ session.firstInput = simpleCloneInputData(input);
20993	+ }
20994	+
20995	+ // to compute scale and rotation we need to store the multiple touches
20996	+ if (pointersLength > 1 && !session.firstMultiple) {
20997	+ session.firstMultiple = simpleCloneInputData(input);
20998	+ } else if (pointersLength === 1) {
20999	+ session.firstMultiple = false;
21000	+ }
21001	+
21002	+ var firstInput = session.firstInput;
21003	+ var firstMultiple = session.firstMultiple;
21004	+ var offsetCenter = firstMultiple ? firstMultiple.center : firstInput.center;
21005	+
21006	+ var center = input.center = getCenter(pointers);
21007	+ input.timeStamp = now();
21008	+ input.deltaTime = input.timeStamp - firstInput.timeStamp;
21009	+
21010	+ input.angle = getAngle(offsetCenter, center);
21011	+ input.distance = getDistance(offsetCenter, center);
21012	+
21013	+ computeDeltaXY(session, input);
21014	+ input.offsetDirection = getDirection(input.deltaX, input.deltaY);
21015	+
21016	+ var overallVelocity = getVelocity(input.deltaTime, input.deltaX, input.deltaY);
21017	+ input.overallVelocityX = overallVelocity.x;
21018	+ input.overallVelocityY = overallVelocity.y;
21019	+ input.overallVelocity = (abs(overallVelocity.x) > abs(overallVelocity.y)) ? overallVelocity.x : overallVelocity.y;
21020	+
21021	+ input.scale = firstMultiple ? getScale(firstMultiple.pointers, pointers) : 1;
21022	+ input.rotation = firstMultiple ? getRotation(firstMultiple.pointers, pointers) : 0;
21023	+
21024	+ input.maxPointers = !session.prevInput ? input.pointers.length : ((input.pointers.length >
21025	+ session.prevInput.maxPointers) ? input.pointers.length : session.prevInput.maxPointers);
21026	+
21027	+ computeIntervalInputData(session, input);
21028	+
21029	+ // find the correct target
21030	+ var target = manager.element;
21031	+ if (hasParent(input.srcEvent.target, target)) {
21032	+ target = input.srcEvent.target;
21033	+ }
21034	+ input.target = target;
21035	+ }
21036	+
21037	+ function computeDeltaXY(session, input) {
21038	+ var center = input.center;
21039	+ var offset = session.offsetDelta \|\| {};
21040	+ var prevDelta = session.prevDelta \|\| {};
21041	+ var prevInput = session.prevInput \|\| {};
21042	+
21043	+ if (input.eventType === INPUT_START \|\| prevInput.eventType === INPUT_END) {
21044	+ prevDelta = session.prevDelta = {
21045	+ x: prevInput.deltaX \|\| 0,
21046	+ y: prevInput.deltaY \|\| 0
21047	+ };
21048	+
21049	+ offset = session.offsetDelta = {
21050	+ x: center.x,
21051	+ y: center.y
21052	+ };
21053	+ }
21054	+
21055	+ input.deltaX = prevDelta.x + (center.x - offset.x);
21056	+ input.deltaY = prevDelta.y + (center.y - offset.y);
21057	+ }
21058	+
21059	+ /**
21060	+ * velocity is calculated every x ms
21061	+ * @param {Object} session
21062	+ * @param {Object} input
21063	+ */
21064	+ function computeIntervalInputData(session, input) {
21065	+ var last = session.lastInterval \|\| input,
21066	+ deltaTime = input.timeStamp - last.timeStamp,
21067	+ velocity, velocityX, velocityY, direction;
21068	+
21069	+ if (input.eventType != INPUT_CANCEL && (deltaTime > COMPUTE_INTERVAL \|\| last.velocity === undefined)) {
21070	+ var deltaX = input.deltaX - last.deltaX;
21071	+ var deltaY = input.deltaY - last.deltaY;
21072	+
21073	+ var v = getVelocity(deltaTime, deltaX, deltaY);
21074	+ velocityX = v.x;
21075	+ velocityY = v.y;
21076	+ velocity = (abs(v.x) > abs(v.y)) ? v.x : v.y;
21077	+ direction = getDirection(deltaX, deltaY);
21078	+
21079	+ session.lastInterval = input;
21080	+ } else {
21081	+ // use latest velocity info if it doesn't overtake a minimum period
21082	+ velocity = last.velocity;
21083	+ velocityX = last.velocityX;
21084	+ velocityY = last.velocityY;
21085	+ direction = last.direction;
21086	+ }
21087	+
21088	+ input.velocity = velocity;
21089	+ input.velocityX = velocityX;
21090	+ input.velocityY = velocityY;
21091	+ input.direction = direction;
21092	+ }
21093	+
21094	+ /**
21095	+ * create a simple clone from the input used for storage of firstInput and firstMultiple
21096	+ * @param {Object} input
21097	+ * @returns {Object} clonedInputData
21098	+ */
21099	+ function simpleCloneInputData(input) {
21100	+ // make a simple copy of the pointers because we will get a reference if we don't
21101	+ // we only need clientXY for the calculations
21102	+ var pointers = [];
21103	+ var i = 0;
21104	+ while (i < input.pointers.length) {
21105	+ pointers[i] = {
21106	+ clientX: round(input.pointers[i].clientX),
21107	+ clientY: round(input.pointers[i].clientY)
21108	+ };
21109	+ i++;
21110	+ }
21111	+
21112	+ return {
21113	+ timeStamp: now(),
21114	+ pointers: pointers,
21115	+ center: getCenter(pointers),
21116	+ deltaX: input.deltaX,
21117	+ deltaY: input.deltaY
21118	+ };
21119	+ }
21120	+
21121	+ /**
21122	+ * get the center of all the pointers
21123	+ * @param {Array} pointers
21124	+ * @return {Object} center contains `x` and `y` properties
21125	+ */
21126	+ function getCenter(pointers) {
21127	+ var pointersLength = pointers.length;
21128	+
21129	+ // no need to loop when only one touch
21130	+ if (pointersLength === 1) {
21131	+ return {
21132	+ x: round(pointers[0].clientX),
21133	+ y: round(pointers[0].clientY)
21134	+ };
21135	+ }
21136	+
21137	+ var x = 0, y = 0, i = 0;
21138	+ while (i < pointersLength) {
21139	+ x += pointers[i].clientX;
21140	+ y += pointers[i].clientY;
21141	+ i++;
21142	+ }
21143	+
21144	+ return {
21145	+ x: round(x / pointersLength),
21146	+ y: round(y / pointersLength)
21147	+ };
21148	+ }
21149	+
21150	+ /**
21151	+ * calculate the velocity between two points. unit is in px per ms.
21152	+ * @param {Number} deltaTime
21153	+ * @param {Number} x
21154	+ * @param {Number} y
21155	+ * @return {Object} velocity `x` and `y`
21156	+ */
21157	+ function getVelocity(deltaTime, x, y) {
21158	+ return {
21159	+ x: x / deltaTime \|\| 0,
21160	+ y: y / deltaTime \|\| 0
21161	+ };
21162	+ }
21163	+
21164	+ /**
21165	+ * get the direction between two points
21166	+ * @param {Number} x
21167	+ * @param {Number} y
21168	+ * @return {Number} direction
21169	+ */
21170	+ function getDirection(x, y) {
21171	+ if (x === y) {
21172	+ return DIRECTION_NONE;
21173	+ }
21174	+
21175	+ if (abs(x) >= abs(y)) {
21176	+ return x < 0 ? DIRECTION_LEFT : DIRECTION_RIGHT;
21177	+ }
21178	+ return y < 0 ? DIRECTION_UP : DIRECTION_DOWN;
21179	+ }
21180	+
21181	+ /**
21182	+ * calculate the absolute distance between two points
21183	+ * @param {Object} p1 {x, y}
21184	+ * @param {Object} p2 {x, y}
21185	+ * @param {Array} [props] containing x and y keys
21186	+ * @return {Number} distance
21187	+ */
21188	+ function getDistance(p1, p2, props) {
21189	+ if (!props) {
21190	+ props = PROPS_XY;
21191	+ }
21192	+ var x = p2[props[0]] - p1[props[0]],
21193	+ y = p2[props[1]] - p1[props[1]];
21194	+
21195	+ return Math.sqrt((x * x) + (y * y));
21196	+ }
21197	+
21198	+ /**
21199	+ * calculate the angle between two coordinates
21200	+ * @param {Object} p1
21201	+ * @param {Object} p2
21202	+ * @param {Array} [props] containing x and y keys
21203	+ * @return {Number} angle
21204	+ */
21205	+ function getAngle(p1, p2, props) {
21206	+ if (!props) {
21207	+ props = PROPS_XY;
21208	+ }
21209	+ var x = p2[props[0]] - p1[props[0]],
21210	+ y = p2[props[1]] - p1[props[1]];
21211	+ return Math.atan2(y, x) * 180 / Math.PI;
21212	+ }
21213	+
21214	+ /**
21215	+ * calculate the rotation degrees between two pointersets
21216	+ * @param {Array} start array of pointers
21217	+ * @param {Array} end array of pointers
21218	+ * @return {Number} rotation
21219	+ */
21220	+ function getRotation(start, end) {
21221	+ return getAngle(end[1], end[0], PROPS_CLIENT_XY) + getAngle(start[1], start[0], PROPS_CLIENT_XY);
21222	+ }
21223	+
21224	+ /**
21225	+ * calculate the scale factor between two pointersets
21226	+ * no scale is 1, and goes down to 0 when pinched together, and bigger when pinched out
21227	+ * @param {Array} start array of pointers
21228	+ * @param {Array} end array of pointers
21229	+ * @return {Number} scale
21230	+ */
21231	+ function getScale(start, end) {
21232	+ return getDistance(end[0], end[1], PROPS_CLIENT_XY) / getDistance(start[0], start[1], PROPS_CLIENT_XY);
21233	+ }
21234	+
21235	+ var MOUSE_INPUT_MAP = {
21236	+ mousedown: INPUT_START,
21237	+ mousemove: INPUT_MOVE,
21238	+ mouseup: INPUT_END
21239	+ };
21240	+
21241	+ var MOUSE_ELEMENT_EVENTS = 'mousedown';
21242	+ var MOUSE_WINDOW_EVENTS = 'mousemove mouseup';
21243	+
21244	+ /**
21245	+ * Mouse events input
21246	+ * @constructor
21247	+ * @extends Input
21248	+ */
21249	+ function MouseInput() {
21250	+ this.evEl = MOUSE_ELEMENT_EVENTS;
21251	+ this.evWin = MOUSE_WINDOW_EVENTS;
21252	+
21253	+ this.pressed = false; // mousedown state
21254	+
21255	+ Input.apply(this, arguments);
21256	+ }
21257	+
21258	+ inherit(MouseInput, Input, {
21259	+ /**
21260	+ * handle mouse events
21261	+ * @param {Object} ev
21262	+ */
21263	+ handler: function MEhandler(ev) {
21264	+ var eventType = MOUSE_INPUT_MAP[ev.type];
21265	+
21266	+ // on start we want to have the left mouse button down
21267	+ if (eventType & INPUT_START && ev.button === 0) {
21268	+ this.pressed = true;
21269	+ }
21270	+
21271	+ if (eventType & INPUT_MOVE && ev.which !== 1) {
21272	+ eventType = INPUT_END;
21273	+ }
21274	+
21275	+ // mouse must be down
21276	+ if (!this.pressed) {
21277	+ return;
21278	+ }
21279	+
21280	+ if (eventType & INPUT_END) {
21281	+ this.pressed = false;
21282	+ }
21283	+
21284	+ this.callback(this.manager, eventType, {
21285	+ pointers: [ev],
21286	+ changedPointers: [ev],
21287	+ pointerType: INPUT_TYPE_MOUSE,
21288	+ srcEvent: ev
21289	+ });
21290	+ }
21291	+ });
21292	+
21293	+ var POINTER_INPUT_MAP = {
21294	+ pointerdown: INPUT_START,
21295	+ pointermove: INPUT_MOVE,
21296	+ pointerup: INPUT_END,
21297	+ pointercancel: INPUT_CANCEL,
21298	+ pointerout: INPUT_CANCEL
21299	+ };
21300	+
21301	+ // in IE10 the pointer types is defined as an enum
21302	+ var IE10_POINTER_TYPE_ENUM = {
21303	+ 2: INPUT_TYPE_TOUCH,
21304	+ 3: INPUT_TYPE_PEN,
21305	+ 4: INPUT_TYPE_MOUSE,
21306	+ 5: INPUT_TYPE_KINECT // see https://twitter.com/jacobrossi/status/480596438489890816
21307	+ };
21308	+
21309	+ var POINTER_ELEMENT_EVENTS = 'pointerdown';
21310	+ var POINTER_WINDOW_EVENTS = 'pointermove pointerup pointercancel';
21311	+
21312	+ // IE10 has prefixed support, and case-sensitive
21313	+ if (window.MSPointerEvent && !window.PointerEvent) {
21314	+ POINTER_ELEMENT_EVENTS = 'MSPointerDown';
21315	+ POINTER_WINDOW_EVENTS = 'MSPointerMove MSPointerUp MSPointerCancel';
21316	+ }
21317	+
21318	+ /**
21319	+ * Pointer events input
21320	+ * @constructor
21321	+ * @extends Input
21322	+ */
21323	+ function PointerEventInput() {
21324	+ this.evEl = POINTER_ELEMENT_EVENTS;
21325	+ this.evWin = POINTER_WINDOW_EVENTS;
21326	+
21327	+ Input.apply(this, arguments);
21328	+
21329	+ this.store = (this.manager.session.pointerEvents = []);
21330	+ }
21331	+
21332	+ inherit(PointerEventInput, Input, {
21333	+ /**
21334	+ * handle mouse events
21335	+ * @param {Object} ev
21336	+ */
21337	+ handler: function PEhandler(ev) {
21338	+ var store = this.store;
21339	+ var removePointer = false;
21340	+
21341	+ var eventTypeNormalized = ev.type.toLowerCase().replace('ms', '');
21342	+ var eventType = POINTER_INPUT_MAP[eventTypeNormalized];
21343	+ var pointerType = IE10_POINTER_TYPE_ENUM[ev.pointerType] \|\| ev.pointerType;
21344	+
21345	+ var isTouch = (pointerType == INPUT_TYPE_TOUCH);
21346	+
21347	+ // get index of the event in the store
21348	+ var storeIndex = inArray(store, ev.pointerId, 'pointerId');
21349	+
21350	+ // start and mouse must be down
21351	+ if (eventType & INPUT_START && (ev.button === 0 \|\| isTouch)) {
21352	+ if (storeIndex < 0) {
21353	+ store.push(ev);
21354	+ storeIndex = store.length - 1;
21355	+ }
21356	+ } else if (eventType & (INPUT_END \| INPUT_CANCEL)) {
21357	+ removePointer = true;
21358	+ }
21359	+
21360	+ // it not found, so the pointer hasn't been down (so it's probably a hover)
21361	+ if (storeIndex < 0) {
21362	+ return;
21363	+ }
21364	+
21365	+ // update the event in the store
21366	+ store[storeIndex] = ev;
21367	+
21368	+ this.callback(this.manager, eventType, {
21369	+ pointers: store,
21370	+ changedPointers: [ev],
21371	+ pointerType: pointerType,
21372	+ srcEvent: ev
21373	+ });
21374	+
21375	+ if (removePointer) {
21376	+ // remove from the store
21377	+ store.splice(storeIndex, 1);
21378	+ }
21379	+ }
21380	+ });
21381	+
21382	+ var SINGLE_TOUCH_INPUT_MAP = {
21383	+ touchstart: INPUT_START,
21384	+ touchmove: INPUT_MOVE,
21385	+ touchend: INPUT_END,
21386	+ touchcancel: INPUT_CANCEL
21387	+ };
21388	+
21389	+ var SINGLE_TOUCH_TARGET_EVENTS = 'touchstart';
21390	+ var SINGLE_TOUCH_WINDOW_EVENTS = 'touchstart touchmove touchend touchcancel';
21391	+
21392	+ /**
21393	+ * Touch events input
21394	+ * @constructor
21395	+ * @extends Input
21396	+ */
21397	+ function SingleTouchInput() {
21398	+ this.evTarget = SINGLE_TOUCH_TARGET_EVENTS;
21399	+ this.evWin = SINGLE_TOUCH_WINDOW_EVENTS;
21400	+ this.started = false;
21401	+
21402	+ Input.apply(this, arguments);
21403	+ }
21404	+
21405	+ inherit(SingleTouchInput, Input, {
21406	+ handler: function TEhandler(ev) {
21407	+ var type = SINGLE_TOUCH_INPUT_MAP[ev.type];
21408	+
21409	+ // should we handle the touch events?
21410	+ if (type === INPUT_START) {
21411	+ this.started = true;
21412	+ }
21413	+
21414	+ if (!this.started) {
21415	+ return;
21416	+ }
21417	+
21418	+ var touches = normalizeSingleTouches.call(this, ev, type);
21419	+
21420	+ // when done, reset the started state
21421	+ if (type & (INPUT_END \| INPUT_CANCEL) && touches[0].length - touches[1].length === 0) {
21422	+ this.started = false;
21423	+ }
21424	+
21425	+ this.callback(this.manager, type, {
21426	+ pointers: touches[0],
21427	+ changedPointers: touches[1],
21428	+ pointerType: INPUT_TYPE_TOUCH,
21429	+ srcEvent: ev
21430	+ });
21431	+ }
21432	+ });
21433	+
21434	+ /**
21435	+ * @this {TouchInput}
21436	+ * @param {Object} ev
21437	+ * @param {Number} type flag
21438	+ * @returns {undefined\|Array} [all, changed]
21439	+ */
21440	+ function normalizeSingleTouches(ev, type) {
21441	+ var all = toArray(ev.touches);
21442	+ var changed = toArray(ev.changedTouches);
21443	+
21444	+ if (type & (INPUT_END \| INPUT_CANCEL)) {
21445	+ all = uniqueArray(all.concat(changed), 'identifier', true);
21446	+ }
21447	+
21448	+ return [all, changed];
21449	+ }
21450	+
21451	+ var TOUCH_INPUT_MAP = {
21452	+ touchstart: INPUT_START,
21453	+ touchmove: INPUT_MOVE,
21454	+ touchend: INPUT_END,
21455	+ touchcancel: INPUT_CANCEL
21456	+ };
21457	+
21458	+ var TOUCH_TARGET_EVENTS = 'touchstart touchmove touchend touchcancel';
21459	+
21460	+ /**
21461	+ * Multi-user touch events input
21462	+ * @constructor
21463	+ * @extends Input
21464	+ */
21465	+ function TouchInput() {
21466	+ this.evTarget = TOUCH_TARGET_EVENTS;
21467	+ this.targetIds = {};
21468	+
21469	+ Input.apply(this, arguments);
21470	+ }
21471	+
21472	+ inherit(TouchInput, Input, {
21473	+ handler: function MTEhandler(ev) {
21474	+ var type = TOUCH_INPUT_MAP[ev.type];
21475	+ var touches = getTouches.call(this, ev, type);
21476	+ if (!touches) {
21477	+ return;
21478	+ }
21479	+
21480	+ this.callback(this.manager, type, {
21481	+ pointers: touches[0],
21482	+ changedPointers: touches[1],
21483	+ pointerType: INPUT_TYPE_TOUCH,
21484	+ srcEvent: ev
21485	+ });
21486	+ }
21487	+ });
21488	+
21489	+ /**
21490	+ * @this {TouchInput}
21491	+ * @param {Object} ev
21492	+ * @param {Number} type flag
21493	+ * @returns {undefined\|Array} [all, changed]
21494	+ */
21495	+ function getTouches(ev, type) {
21496	+ var allTouches = toArray(ev.touches);
21497	+ var targetIds = this.targetIds;
21498	+
21499	+ // when there is only one touch, the process can be simplified
21500	+ if (type & (INPUT_START \| INPUT_MOVE) && allTouches.length === 1) {
21501	+ targetIds[allTouches[0].identifier] = true;
21502	+ return [allTouches, allTouches];
21503	+ }
21504	+
21505	+ var i,
21506	+ targetTouches,
21507	+ changedTouches = toArray(ev.changedTouches),
21508	+ changedTargetTouches = [],
21509	+ target = this.target;
21510	+
21511	+ // get target touches from touches
21512	+ targetTouches = allTouches.filter(function(touch) {
21513	+ return hasParent(touch.target, target);
21514	+ });
21515	+
21516	+ // collect touches
21517	+ if (type === INPUT_START) {
21518	+ i = 0;
21519	+ while (i < targetTouches.length) {
21520	+ targetIds[targetTouches[i].identifier] = true;
21521	+ i++;
21522	+ }
21523	+ }
21524	+
21525	+ // filter changed touches to only contain touches that exist in the collected target ids
21526	+ i = 0;
21527	+ while (i < changedTouches.length) {
21528	+ if (targetIds[changedTouches[i].identifier]) {
21529	+ changedTargetTouches.push(changedTouches[i]);
21530	+ }
21531	+
21532	+ // cleanup removed touches
21533	+ if (type & (INPUT_END \| INPUT_CANCEL)) {
21534	+ delete targetIds[changedTouches[i].identifier];
21535	+ }
21536	+ i++;
21537	+ }
21538	+
21539	+ if (!changedTargetTouches.length) {
21540	+ return;
21541	+ }
21542	+
21543	+ return [
21544	+ // merge targetTouches with changedTargetTouches so it contains ALL touches, including 'end' and 'cancel'
21545	+ uniqueArray(targetTouches.concat(changedTargetTouches), 'identifier', true),
21546	+ changedTargetTouches
21547	+ ];
21548	+ }
21549	+
21550	+ /**
21551	+ * Combined touch and mouse input
21552	+ *
21553	+ * Touch has a higher priority then mouse, and while touching no mouse events are allowed.
21554	+ * This because touch devices also emit mouse events while doing a touch.
21555	+ *
21556	+ * @constructor
21557	+ * @extends Input
21558	+ */
21559	+
21560	+ var DEDUP_TIMEOUT = 2500;
21561	+ var DEDUP_DISTANCE = 25;
21562	+
21563	+ function TouchMouseInput() {
21564	+ Input.apply(this, arguments);
21565	+
21566	+ var handler = bindFn(this.handler, this);
21567	+ this.touch = new TouchInput(this.manager, handler);
21568	+ this.mouse = new MouseInput(this.manager, handler);
21569	+
21570	+ this.primaryTouch = null;
21571	+ this.lastTouches = [];
21572	+ }
21573	+
21574	+ inherit(TouchMouseInput, Input, {
21575	+ /**
21576	+ * handle mouse and touch events
21577	+ * @param {Hammer} manager
21578	+ * @param {String} inputEvent
21579	+ * @param {Object} inputData
21580	+ */
21581	+ handler: function TMEhandler(manager, inputEvent, inputData) {
21582	+ var isTouch = (inputData.pointerType == INPUT_TYPE_TOUCH),
21583	+ isMouse = (inputData.pointerType == INPUT_TYPE_MOUSE);
21584	+
21585	+ if (isMouse && inputData.sourceCapabilities && inputData.sourceCapabilities.firesTouchEvents) {
21586	+ return;
21587	+ }
21588	+
21589	+ // when we're in a touch event, record touches to de-dupe synthetic mouse event
21590	+ if (isTouch) {
21591	+ recordTouches.call(this, inputEvent, inputData);
21592	+ } else if (isMouse && isSyntheticEvent.call(this, inputData)) {
21593	+ return;
21594	+ }
21595	+
21596	+ this.callback(manager, inputEvent, inputData);
21597	+ },
21598	+
21599	+ /**
21600	+ * remove the event listeners
21601	+ */
21602	+ destroy: function destroy() {
21603	+ this.touch.destroy();
21604	+ this.mouse.destroy();
21605	+ }
21606	+ });
21607	+
21608	+ function recordTouches(eventType, eventData) {
21609	+ if (eventType & INPUT_START) {
21610	+ this.primaryTouch = eventData.changedPointers[0].identifier;
21611	+ setLastTouch.call(this, eventData);
21612	+ } else if (eventType & (INPUT_END \| INPUT_CANCEL)) {
21613	+ setLastTouch.call(this, eventData);
21614	+ }
21615	+ }
21616	+
21617	+ function setLastTouch(eventData) {
21618	+ var touch = eventData.changedPointers[0];
21619	+
21620	+ if (touch.identifier === this.primaryTouch) {
21621	+ var lastTouch = {x: touch.clientX, y: touch.clientY};
21622	+ this.lastTouches.push(lastTouch);
21623	+ var lts = this.lastTouches;
21624	+ var removeLastTouch = function() {
21625	+ var i = lts.indexOf(lastTouch);
21626	+ if (i > -1) {
21627	+ lts.splice(i, 1);
21628	+ }
21629	+ };
21630	+ setTimeout(removeLastTouch, DEDUP_TIMEOUT);
21631	+ }
21632	+ }
21633	+
21634	+ function isSyntheticEvent(eventData) {
21635	+ var x = eventData.srcEvent.clientX, y = eventData.srcEvent.clientY;
21636	+ for (var i = 0; i < this.lastTouches.length; i++) {
21637	+ var t = this.lastTouches[i];
21638	+ var dx = Math.abs(x - t.x), dy = Math.abs(y - t.y);
21639	+ if (dx <= DEDUP_DISTANCE && dy <= DEDUP_DISTANCE) {
21640	+ return true;
21641	+ }
21642	+ }
21643	+ return false;
21644	+ }
21645	+
21646	+ var PREFIXED_TOUCH_ACTION = prefixed(TEST_ELEMENT.style, 'touchAction');
21647	+ var NATIVE_TOUCH_ACTION = PREFIXED_TOUCH_ACTION !== undefined;
21648	+
21649	+ // magical touchAction value
21650	+ var TOUCH_ACTION_COMPUTE = 'compute';
21651	+ var TOUCH_ACTION_AUTO = 'auto';
21652	+ var TOUCH_ACTION_MANIPULATION = 'manipulation'; // not implemented
21653	+ var TOUCH_ACTION_NONE = 'none';
21654	+ var TOUCH_ACTION_PAN_X = 'pan-x';
21655	+ var TOUCH_ACTION_PAN_Y = 'pan-y';
21656	+ var TOUCH_ACTION_MAP = getTouchActionProps();
21657	+
21658	+ /**
21659	+ * Touch Action
21660	+ * sets the touchAction property or uses the js alternative
21661	+ * @param {Manager} manager
21662	+ * @param {String} value
21663	+ * @constructor
21664	+ */
21665	+ function TouchAction(manager, value) {
21666	+ this.manager = manager;
21667	+ this.set(value);
21668	+ }
21669	+
21670	+ TouchAction.prototype = {
21671	+ /**
21672	+ * set the touchAction value on the element or enable the polyfill
21673	+ * @param {String} value
21674	+ */
21675	+ set: function(value) {
21676	+ // find out the touch-action by the event handlers
21677	+ if (value == TOUCH_ACTION_COMPUTE) {
21678	+ value = this.compute();
21679	+ }
21680	+
21681	+ if (NATIVE_TOUCH_ACTION && this.manager.element.style && TOUCH_ACTION_MAP[value]) {
21682	+ this.manager.element.style[PREFIXED_TOUCH_ACTION] = value;
21683	+ }
21684	+ this.actions = value.toLowerCase().trim();
21685	+ },
21686	+
21687	+ /**
21688	+ * just re-set the touchAction value
21689	+ */
21690	+ update: function() {
21691	+ this.set(this.manager.options.touchAction);
21692	+ },
21693	+
21694	+ /**
21695	+ * compute the value for the touchAction property based on the recognizer's settings
21696	+ * @returns {String} value
21697	+ */
21698	+ compute: function() {
21699	+ var actions = [];
21700	+ each(this.manager.recognizers, function(recognizer) {
21701	+ if (boolOrFn(recognizer.options.enable, [recognizer])) {
21702	+ actions = actions.concat(recognizer.getTouchAction());
21703	+ }
21704	+ });
21705	+ return cleanTouchActions(actions.join(' '));
21706	+ },
21707	+
21708	+ /**
21709	+ * this method is called on each input cycle and provides the preventing of the browser behavior
21710	+ * @param {Object} input
21711	+ */
21712	+ preventDefaults: function(input) {
21713	+ var srcEvent = input.srcEvent;
21714	+ var direction = input.offsetDirection;
21715	+
21716	+ // if the touch action did prevented once this session
21717	+ if (this.manager.session.prevented) {
21718	+ srcEvent.preventDefault();
21719	+ return;
21720	+ }
21721	+
21722	+ var actions = this.actions;
21723	+ var hasNone = inStr(actions, TOUCH_ACTION_NONE) && !TOUCH_ACTION_MAP[TOUCH_ACTION_NONE];
21724	+ var hasPanY = inStr(actions, TOUCH_ACTION_PAN_Y) && !TOUCH_ACTION_MAP[TOUCH_ACTION_PAN_Y];
21725	+ var hasPanX = inStr(actions, TOUCH_ACTION_PAN_X) && !TOUCH_ACTION_MAP[TOUCH_ACTION_PAN_X];
21726	+
21727	+ if (hasNone) {
21728	+ //do not prevent defaults if this is a tap gesture
21729	+
21730	+ var isTapPointer = input.pointers.length === 1;
21731	+ var isTapMovement = input.distance < 2;
21732	+ var isTapTouchTime = input.deltaTime < 250;
21733	+
21734	+ if (isTapPointer && isTapMovement && isTapTouchTime) {
21735	+ return;
21736	+ }
21737	+ }
21738	+
21739	+ if (hasPanX && hasPanY) {
21740	+ // `pan-x pan-y` means browser handles all scrolling/panning, do not prevent
21741	+ return;
21742	+ }
21743	+
21744	+ if (hasNone \|\|
21745	+ (hasPanY && direction & DIRECTION_HORIZONTAL) \|\|
21746	+ (hasPanX && direction & DIRECTION_VERTICAL)) {
21747	+ return this.preventSrc(srcEvent);
21748	+ }
21749	+ },
21750	+
21751	+ /**
21752	+ * call preventDefault to prevent the browser's default behavior (scrolling in most cases)
21753	+ * @param {Object} srcEvent
21754	+ */
21755	+ preventSrc: function(srcEvent) {
21756	+ this.manager.session.prevented = true;
21757	+ srcEvent.preventDefault();
21758	+ }
21759	+ };
21760	+
21761	+ /**
21762	+ * when the touchActions are collected they are not a valid value, so we need to clean things up. *
21763	+ * @param {String} actions
21764	+ * @returns {*}
21765	+ */
21766	+ function cleanTouchActions(actions) {
21767	+ // none
21768	+ if (inStr(actions, TOUCH_ACTION_NONE)) {
21769	+ return TOUCH_ACTION_NONE;
21770	+ }
21771	+
21772	+ var hasPanX = inStr(actions, TOUCH_ACTION_PAN_X);
21773	+ var hasPanY = inStr(actions, TOUCH_ACTION_PAN_Y);
21774	+
21775	+ // if both pan-x and pan-y are set (different recognizers
21776	+ // for different directions, e.g. horizontal pan but vertical swipe?)
21777	+ // we need none (as otherwise with pan-x pan-y combined none of these
21778	+ // recognizers will work, since the browser would handle all panning
21779	+ if (hasPanX && hasPanY) {
21780	+ return TOUCH_ACTION_NONE;
21781	+ }
21782	+
21783	+ // pan-x OR pan-y
21784	+ if (hasPanX \|\| hasPanY) {
21785	+ return hasPanX ? TOUCH_ACTION_PAN_X : TOUCH_ACTION_PAN_Y;
21786	+ }
21787	+
21788	+ // manipulation
21789	+ if (inStr(actions, TOUCH_ACTION_MANIPULATION)) {
21790	+ return TOUCH_ACTION_MANIPULATION;
21791	+ }
21792	+
21793	+ return TOUCH_ACTION_AUTO;
21794	+ }
21795	+
21796	+ function getTouchActionProps() {
21797	+ if (!NATIVE_TOUCH_ACTION) {
21798	+ return false;
21799	+ }
21800	+ var touchMap = {};
21801	+ var cssSupports = window.CSS && window.CSS.supports;
21802	+ ['auto', 'manipulation', 'pan-y', 'pan-x', 'pan-x pan-y', 'none'].forEach(function(val) {
21803	+
21804	+ // If css.supports is not supported but there is native touch-action assume it supports
21805	+ // all values. This is the case for IE 10 and 11.
21806	+ touchMap[val] = cssSupports ? window.CSS.supports('touch-action', val) : true;
21807	+ });
21808	+ return touchMap;
21809	+ }
21810	+
21811	+ /**
21812	+ * Recognizer flow explained; *
21813	+ * All recognizers have the initial state of POSSIBLE when a input session starts.
21814	+ * The definition of a input session is from the first input until the last input, with all it's movement in it. *
21815	+ * Example session for mouse-input: mousedown -> mousemove -> mouseu

Click to Chat for WhatsApp Chat - Version 1.0

Version Description

Release Info

Version 1.0