Version Description
- Added: Various styling options during the form building process.
- Added: Initial Akismet integration to help aid with spam submissions.
- Added: Clear form fields after successful AJAX-based form submissions.
- Added: Clear success/error message after small delay, for AJAX-based form submissions.
- Added: WordPress action hooks before and after form output. Useful to add your own output for a given form.
- Added: Compatibility with "Call To Action" plugin.
- Added: Include custom field labels in email notifications.
- Added: Ability to customize who receives email notifications, per form.
- Added: Frontend form submit button disabled if hidden honeypot field has changed.
- Fixed: Consistently applied ctct_process_form_success filter to AJAX form submission success messages.
- Fixed: Prevent errors with Constant Contact social links and array_merge issues.
- Fixed: Prevent errors with array_key_exists() and the ctct_get_settings_option function.
- Fixed: Wording around associated lists for a form, in the WordPress admin.
- Fixed: Removed .gitignore files from /vendor folders.
- Fixed: Prevent potential PHP warnings and notices in various areas.
- Updated: Better support for emailing notifications to multiple recipiants.
- Updated: Better disabling of submit button during AJAX-based submissions.
- Updated: Tightened up form builder screen to not use so much space.
Download this release
Release Info
| Developer | constantcontact |
| Plugin |  Constant Contact Forms |
| Version | 1.4.0 |
| Comparing to | |
| See all releases | |
Code changes from version 1.3.7 to 1.4.0
- assets/css/admin-forms.css +0 -449
- assets/css/admin-global-no-connection.css +0 -307
- assets/css/admin-notices.css +0 -50
- assets/css/admin-pages.css +0 -351
- assets/css/admin-style.css +1307 -0
- assets/css/oath.css +0 -84
- assets/css/style.css +50 -1
- assets/css/style.min.css +1 -1
- assets/images/oval.min.svg +1 -0
- assets/js/ctct-plugin-frontend.js +55 -12
- assets/js/ctct-plugin-frontend.min.js +1 -1
- assets/js/ctct-plugin-frontend/validation.js +55 -12
- assets/sass/_admin-forms.scss +210 -0
- assets/sass/{admin-global-no-connection.scss → _admin-global-no-connection.scss} +0 -3
- assets/sass/{admin-notices.scss → _admin-notices.scss} +0 -0
- assets/sass/{admin-pages.scss → _admin-pages.scss} +0 -3
- assets/sass/_forms.scss +8 -3
- assets/sass/_inputs.scss +38 -0
- assets/sass/{oath.scss → _oath.scss} +0 -3
- assets/sass/admin-forms.scss +0 -123
- assets/sass/admin-style.scss +13 -0
- constant-contact-forms.php +38 -3
- includes/class-admin-pages.php +1 -15
- includes/class-admin.php +10 -2
- includes/class-api.php +2 -2
- includes/class-builder-fields.php +211 -10
- includes/class-builder.php +1 -1
- includes/class-check.php +1 -1
- includes/class-connect.php +1 -10
- includes/class-cpts.php +1 -1
- includes/class-display-shortcode.php +8 -8
- includes/class-display.php +555 -159
- includes/class-lists.php +40 -24
- includes/class-logging.php +2 -2
- includes/class-mail.php +63 -17
- includes/class-notifications.php +1 -6
- includes/class-process-form.php +18 -3
- includes/class-settings.php +45 -11
- includes/class-user-customizations.php +29 -0
- includes/compatibility.php +39 -0
- includes/helper-functions.php +210 -3
- languages/constant-contact-forms.pot +320 -202
- readme.txt +25 -4
- vendor/constantcontact/constantcontact/.gitignore +25 -0
- vendor/constantcontact/constantcontact/.travis.yml +20 -0
- vendor/constantcontact/constantcontact/constantcontact/phpunit.xml +0 -8
- vendor/constantcontact/constantcontact/constantcontact/test/Auth/CtctOAuth2UnitTest.php +0 -140
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Account/get_account_info.json +0 -21
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Account/get_verified_email_addresses.json +0 -6
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/get_activities.json +0 -52
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/get_activity.json +0 -24
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_add_contacts.json +0 -6
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_clear_lists.json +0 -6
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_export_contacts.json +0 -6
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_remove_contacts_from_lists.json +0 -6
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Auth/get_access_token.json +0 -5
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Auth/token_info.json +0 -5
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_campaign.json +0 -63
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_campaigns.json +0 -57
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_preview.json +0 -7
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_schedule.json +0 -4
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_schedules.json +0 -10
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/post_test_send.json +0 -7
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contact.json +0 -63
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contacts.json +0 -111
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contacts_no_next.json +0 -108
- vendor/constantcontact/constantcontact/constantcontact/test/Json/JsonLoader.php +0 -177
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_file_upload_status.json +0 -7
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_file.json +0 -22
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_files.json +0 -29
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_folder.json +0 -27
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_folders.json +0 -34
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Lists/get_list.json +0 -7
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Lists/get_lists.json +0 -16
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_bounces.json +0 -29
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_clicks.json +0 -25
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_forwards.json +0 -23
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_opens.json +0 -23
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_opt_outs.json +0 -27
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_sends.json +0 -30
- vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_summary.json +0 -9
- vendor/constantcontact/constantcontact/constantcontact/test/Services/AccountServiceUnitTest.php +0 -62
- vendor/constantcontact/constantcontact/constantcontact/test/Services/ActivityServiceUnitTest.php +0 -119
- vendor/constantcontact/constantcontact/constantcontact/test/Services/CampaignScheduleServiceUnitTest.php +0 -113
- vendor/constantcontact/constantcontact/constantcontact/test/Services/CampaignTrackingServiceUnitTest.php +0 -203
- vendor/constantcontact/constantcontact/constantcontact/test/Services/ContactServiceUnitTest.php +0 -353
- vendor/constantcontact/constantcontact/constantcontact/test/Services/ContactTrackingServiceUnitTest.php +0 -185
- vendor/constantcontact/constantcontact/constantcontact/test/Services/EmailCampaignServiceUnitTest.php +0 -291
- vendor/constantcontact/constantcontact/constantcontact/test/Services/LibraryServiceUnitTest.php +0 -195
- vendor/constantcontact/constantcontact/constantcontact/test/Services/ListServiceUnitTest.php +0 -143
- vendor/constantcontact/constantcontact/constantcontact/test/bootstrap.php +0 -9
- vendor/constantcontact/guzzlehttp/ringphp/docs/Makefile +0 -153
- vendor/constantcontact/guzzlehttp/ringphp/docs/client_handlers.rst +0 -173
- vendor/constantcontact/guzzlehttp/ringphp/docs/client_middleware.rst +0 -165
- vendor/constantcontact/guzzlehttp/ringphp/docs/conf.py +0 -23
- vendor/constantcontact/guzzlehttp/ringphp/docs/futures.rst +0 -164
- vendor/constantcontact/guzzlehttp/ringphp/docs/index.rst +0 -50
- vendor/constantcontact/guzzlehttp/ringphp/docs/requirements.txt +0 -1
- vendor/constantcontact/guzzlehttp/ringphp/docs/spec.rst +0 -311
- vendor/constantcontact/guzzlehttp/ringphp/docs/testing.rst +0 -74
- vendor/constantcontact/guzzlehttp/ringphp/phpunit.xml.dist +0 -14
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlFactoryTest.php +0 -821
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlHandlerTest.php +0 -96
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlMultiHandlerTest.php +0 -165
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/MiddlewareTest.php +0 -65
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/MockHandlerTest.php +0 -86
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/Server.php +0 -183
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/StreamHandlerTest.php +0 -480
- vendor/constantcontact/guzzlehttp/ringphp/tests/Client/server.js +0 -241
- vendor/constantcontact/guzzlehttp/ringphp/tests/CoreTest.php +0 -336
- vendor/constantcontact/guzzlehttp/ringphp/tests/Future/CompletedFutureArrayTest.php +0 -21
- vendor/constantcontact/guzzlehttp/ringphp/tests/Future/CompletedFutureValueTest.php +0 -46
- vendor/constantcontact/guzzlehttp/ringphp/tests/Future/FutureArrayTest.php +0 -56
- vendor/constantcontact/guzzlehttp/ringphp/tests/Future/FutureValueTest.php +0 -109
- vendor/constantcontact/guzzlehttp/ringphp/tests/bootstrap.php +0 -11
- vendor/constantcontact/guzzlehttp/streams/phpunit.xml.dist +0 -17
- vendor/constantcontact/guzzlehttp/streams/tests/AppendStreamTest.php +0 -178
- vendor/constantcontact/guzzlehttp/streams/tests/AsyncReadStreamTest.php +0 -186
- vendor/constantcontact/guzzlehttp/streams/tests/BufferStreamTest.php +0 -69
- vendor/constantcontact/guzzlehttp/streams/tests/CachingStreamTest.php +0 -136
- vendor/constantcontact/guzzlehttp/streams/tests/DroppingStreamTest.php +0 -26
- vendor/constantcontact/guzzlehttp/streams/tests/Exception/SeekExceptionTest.php +0 -16
- vendor/constantcontact/guzzlehttp/streams/tests/FnStreamTest.php +0 -89
- vendor/constantcontact/guzzlehttp/streams/tests/GuzzleStreamWrapperTest.php +0 -99
- vendor/constantcontact/guzzlehttp/streams/tests/InflateStreamTest.php +0 -16
- vendor/constantcontact/guzzlehttp/streams/tests/LazyOpenStreamTest.php +0 -64
- vendor/constantcontact/guzzlehttp/streams/tests/LimitStreamTest.php +0 -133
- vendor/constantcontact/guzzlehttp/streams/tests/NoSeekStreamTest.php +0 -41
- vendor/constantcontact/guzzlehttp/streams/tests/NullStreamTest.php +0 -39
- vendor/constantcontact/guzzlehttp/streams/tests/PumpStreamTest.php +0 -77
- vendor/constantcontact/guzzlehttp/streams/tests/StreamDecoratorTraitTest.php +0 -147
- vendor/constantcontact/guzzlehttp/streams/tests/StreamTest.php +0 -252
- vendor/constantcontact/guzzlehttp/streams/tests/UtilsTest.php +0 -155
- vendor/constantcontact/react/promise/phpunit.xml.dist +0 -25
- vendor/constantcontact/react/promise/tests/DeferredTest.php +0 -42
- vendor/constantcontact/react/promise/tests/FulfilledPromiseTest.php +0 -50
- vendor/constantcontact/react/promise/tests/FunctionAllTest.php +0 -97
- vendor/constantcontact/react/promise/tests/FunctionAnyTest.php +0 -116
- vendor/constantcontact/react/promise/tests/FunctionCheckTypehintTest.php +0 -118
- vendor/constantcontact/react/promise/tests/FunctionMapTest.php +0 -125
- vendor/constantcontact/react/promise/tests/FunctionRaceTest.php +0 -122
- vendor/constantcontact/react/promise/tests/FunctionReduceTest.php +0 -290
- vendor/constantcontact/react/promise/tests/FunctionRejectTest.php +0 -64
- vendor/constantcontact/react/promise/tests/FunctionResolveTest.php +0 -102
- vendor/constantcontact/react/promise/tests/FunctionSomeTest.php +0 -126
- vendor/constantcontact/react/promise/tests/LazyPromiseTest.php +0 -107
- vendor/constantcontact/react/promise/tests/PromiseAdapter/CallbackPromiseAdapter.php +0 -40
- vendor/constantcontact/react/promise/tests/PromiseAdapter/PromiseAdapterInterface.php +0 -14
- vendor/constantcontact/react/promise/tests/PromiseTest.php +0 -116
- vendor/constantcontact/react/promise/tests/PromiseTest/CancelTestTrait.php +0 -206
- vendor/constantcontact/react/promise/tests/PromiseTest/FullTestTrait.php +0 -15
- vendor/constantcontact/react/promise/tests/PromiseTest/NotifyTestTrait.php +0 -336
- vendor/constantcontact/react/promise/tests/PromiseTest/PromiseFulfilledTestTrait.php +0 -351
- vendor/constantcontact/react/promise/tests/PromiseTest/PromisePendingTestTrait.php +0 -68
- vendor/constantcontact/react/promise/tests/PromiseTest/PromiseRejectedTestTrait.php +0 -492
- vendor/constantcontact/react/promise/tests/PromiseTest/PromiseSettledTestTrait.php +0 -86
- vendor/constantcontact/react/promise/tests/PromiseTest/RejectTestTrait.php +0 -368
- vendor/constantcontact/react/promise/tests/PromiseTest/ResolveTestTrait.php +0 -263
- vendor/constantcontact/react/promise/tests/RejectedPromiseTest.php +0 -50
- vendor/constantcontact/react/promise/tests/Stub/CallableStub.php +0 -10
- vendor/constantcontact/react/promise/tests/TestCase.php +0 -41
- vendor/constantcontact/react/promise/tests/bootstrap.php +0 -7
- vendor/monolog/monolog/{CHANGELOG.mdown → CHANGELOG.md} +25 -0
- vendor/monolog/monolog/{README.mdown → README.md} +0 -0
- vendor/monolog/monolog/doc/01-usage.md +0 -231
- vendor/monolog/monolog/doc/02-handlers-formatters-processors.md +0 -155
- vendor/monolog/monolog/doc/03-utilities.md +0 -13
- vendor/monolog/monolog/doc/04-extending.md +0 -76
- vendor/monolog/monolog/doc/sockets.md +0 -39
- vendor/monolog/monolog/phpunit.xml.dist +0 -19
- vendor/monolog/monolog/src/Monolog/Handler/Slack/SlackRecord.php +294 -0
- vendor/monolog/monolog/src/Monolog/Handler/SlackWebhookHandler.php +115 -0
- vendor/monolog/monolog/src/Monolog/Handler/SlackbotHandler.php +80 -0
- vendor/monolog/monolog/src/Monolog/Processor/MercurialProcessor.php +63 -0
- vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php +0 -31
- vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php +0 -158
- vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php +0 -79
- vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php +0 -55
- vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php +0 -62
- vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php +0 -234
- vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php +0 -122
- vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php +0 -222
- vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php +0 -40
- vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php +0 -333
- vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php +0 -262
- vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php +0 -405
- vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php +0 -110
- vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php +0 -142
- vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php +0 -115
- vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php +0 -80
- vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php +0 -136
- vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php +0 -130
- vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php +0 -158
- vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php +0 -141
- vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php +0 -31
- vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php +0 -165
- vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php +0 -52
- vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php +0 -75
- vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php +0 -239
- vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php +0 -66
- vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php +0 -170
- vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php +0 -279
- vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php +0 -96
- vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep +0 -0
- vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php +0 -85
- vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php +0 -88
- vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php +0 -95
- vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php +0 -117
- vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php +0 -25
- vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php +0 -112
- vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php +0 -130
- vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php +0 -279
- vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php +0 -84
- vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php +0 -75
- vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php +0 -27
- vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php +0 -65
- vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php +0 -111
- vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php +0 -200
- vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php +0 -33
- vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php +0 -273
- vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php +0 -50
- vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php +0 -141
- vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php +0 -227
- vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php +0 -127
- vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php +84 -0
- vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php +0 -211
- vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php +0 -33
- vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php +387 -0
- vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php +0 -151
- vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php +107 -0
- vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php +47 -0
- vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php +0 -309
- vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php +0 -184
- vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php +0 -113
- vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php +0 -44
- vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php +0 -49
- vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php +0 -66
- vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php +0 -64
- vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php +0 -121
- vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php +0 -69
- vendor/monolog/monolog/tests/Monolog/LoggerTest.php +0 -383
assets/css/admin-forms.css
DELETED
|
@@ -1,449 +0,0 @@
|
|
| 1 |
-
.ctct-modal {
|
| 2 |
-
-moz-osx-font-smoothing: grayscale;
|
| 3 |
-
-webkit-font-smoothing: antialiased;
|
| 4 |
-
background-color: rgba(0, 0, 0, 0.3);
|
| 5 |
-
bottom: 0;
|
| 6 |
-
display: none;
|
| 7 |
-
left: 0;
|
| 8 |
-
overflow: hidden;
|
| 9 |
-
position: fixed;
|
| 10 |
-
right: 0;
|
| 11 |
-
top: 0;
|
| 12 |
-
z-index: 9999;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.ctct-modal:after {
|
| 16 |
-
clear: both;
|
| 17 |
-
content: "";
|
| 18 |
-
display: table;
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
.ctct-modal h2 {
|
| 22 |
-
color: #fff;
|
| 23 |
-
font-size: 28px;
|
| 24 |
-
font-weight: 400;
|
| 25 |
-
line-height: 1.2;
|
| 26 |
-
margin: 0;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
.ctct-modal h3 {
|
| 30 |
-
color: #005990;
|
| 31 |
-
font-size: 18px;
|
| 32 |
-
line-height: 1.2;
|
| 33 |
-
margin-bottom: 15px;
|
| 34 |
-
margin-top: 10px;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
.ctct-modal p {
|
| 38 |
-
color: #555555;
|
| 39 |
-
font-size: 14.7px;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
.ctct-modal.ctct-modal-open {
|
| 43 |
-
display: block;
|
| 44 |
-
overflow-x: hidden;
|
| 45 |
-
overflow-y: auto;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
.ctct-modal .ctct-modal-dialog {
|
| 49 |
-
left: 50%;
|
| 50 |
-
position: absolute;
|
| 51 |
-
top: 50%;
|
| 52 |
-
transform: translate(-50%, -50%);
|
| 53 |
-
width: 100%;
|
| 54 |
-
max-width: 720px;
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
@media screen and (max-width: 1024px) {
|
| 58 |
-
.ctct-modal .ctct-modal-dialog {
|
| 59 |
-
max-width: 75%;
|
| 60 |
-
}
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
@media screen and (max-width: 782px) {
|
| 64 |
-
.ctct-modal .ctct-modal-dialog {
|
| 65 |
-
left: 7.5%;
|
| 66 |
-
top: 15%;
|
| 67 |
-
transform: translate(0, 0);
|
| 68 |
-
margin-bottom: 15%;
|
| 69 |
-
max-width: 85%;
|
| 70 |
-
}
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
.ctct-modal .ctct-modal-content {
|
| 74 |
-
background-clip: padding-box;
|
| 75 |
-
background-color: #ffffff;
|
| 76 |
-
border-radius: 8px;
|
| 77 |
-
box-shadow: 0 0 15px 0 rgba(0, 0, 0, 0.4);
|
| 78 |
-
outline: 0;
|
| 79 |
-
padding: rem(10);
|
| 80 |
-
position: relative;
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header {
|
| 84 |
-
background: #88C5E2 url(../images/cc-modal-bg.png) 50% 50% no-repeat;
|
| 85 |
-
border-top-left-radius: 8px;
|
| 86 |
-
border-top-right-radius: 8px;
|
| 87 |
-
padding: 65px 20px 40px;
|
| 88 |
-
text-align: center;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header p {
|
| 92 |
-
color: #fff;
|
| 93 |
-
font-size: 16px;
|
| 94 |
-
margin-bottom: 0;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header p .displayed-shortcode {
|
| 98 |
-
color: #333333;
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-logo img {
|
| 102 |
-
max-width: 75%;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-modal-close {
|
| 106 |
-
color: #ffffff;
|
| 107 |
-
cursor: pointer;
|
| 108 |
-
font-size: 26px;
|
| 109 |
-
height: 16px;
|
| 110 |
-
line-height: 0;
|
| 111 |
-
margin: 0;
|
| 112 |
-
outline: none;
|
| 113 |
-
padding: 0;
|
| 114 |
-
padding: 0;
|
| 115 |
-
position: absolute;
|
| 116 |
-
right: 10px;
|
| 117 |
-
text-decoration: none;
|
| 118 |
-
top: 18px;
|
| 119 |
-
width: 16px;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-modal-close:after {
|
| 123 |
-
clear: both;
|
| 124 |
-
content: "";
|
| 125 |
-
display: table;
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer {
|
| 129 |
-
background-color: #EFEFEE;
|
| 130 |
-
border-bottom-left-radius: 8px;
|
| 131 |
-
border-bottom-right-radius: 8px;
|
| 132 |
-
border-top: 3px solid #fff;
|
| 133 |
-
padding: 15px 15px 18px;
|
| 134 |
-
text-align: center;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer p {
|
| 138 |
-
margin: 0;
|
| 139 |
-
font-size: 16px;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer a {
|
| 143 |
-
color: #0078C3;
|
| 144 |
-
text-decoration: underline;
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer.ctct-modal-footer-privacy a {
|
| 148 |
-
text-decoration: none;
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button {
|
| 152 |
-
border-radius: 4px;
|
| 153 |
-
color: #fff;
|
| 154 |
-
font-size: 16px;
|
| 155 |
-
font-weight: 600;
|
| 156 |
-
height: auto;
|
| 157 |
-
line-height: 1;
|
| 158 |
-
margin-bottom: 10px;
|
| 159 |
-
min-width: 180px;
|
| 160 |
-
padding: 14px 30px;
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.no-bg {
|
| 164 |
-
border: none;
|
| 165 |
-
box-shadow: none;
|
| 166 |
-
color: #0078C3;
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange {
|
| 170 |
-
background-color: #FFA901;
|
| 171 |
-
border: 1px solid #cd8800;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange:hover, .ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange:focus {
|
| 175 |
-
background-color: #cd8800;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue {
|
| 179 |
-
background-color: #0078C3;
|
| 180 |
-
border: 1px solid #005990;
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue:hover, .ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue:focus {
|
| 184 |
-
background-color: #005990;
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body {
|
| 188 |
-
padding: 15px;
|
| 189 |
-
position: relative;
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body:after {
|
| 193 |
-
clear: both;
|
| 194 |
-
content: "";
|
| 195 |
-
display: table;
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-privacy-modal-body {
|
| 199 |
-
overflow: scroll;
|
| 200 |
-
height: 350px;
|
| 201 |
-
}
|
| 202 |
-
|
| 203 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left,
|
| 204 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 205 |
-
float: left;
|
| 206 |
-
padding: 15px 50px 15px;
|
| 207 |
-
text-align: center;
|
| 208 |
-
width: 50%;
|
| 209 |
-
box-sizing: border-box;
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
@media screen and (max-width: 782px) {
|
| 213 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left,
|
| 214 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 215 |
-
width: 100%;
|
| 216 |
-
float: none;
|
| 217 |
-
}
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left img.ctct-modal-flare,
|
| 221 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left svg.ctct-modal-flare,
|
| 222 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right img.ctct-modal-flare,
|
| 223 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right svg.ctct-modal-flare {
|
| 224 |
-
max-width: 120px;
|
| 225 |
-
height: auto;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left p,
|
| 229 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right p {
|
| 230 |
-
max-width: 90%;
|
| 231 |
-
margin: 0 auto 25px;
|
| 232 |
-
}
|
| 233 |
-
|
| 234 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left p.small,
|
| 235 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right p.small {
|
| 236 |
-
line-height: 1;
|
| 237 |
-
margin: 0;
|
| 238 |
-
max-width: 100%;
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left small,
|
| 242 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right small {
|
| 243 |
-
font-style: italic;
|
| 244 |
-
}
|
| 245 |
-
|
| 246 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .now-what {
|
| 247 |
-
text-align: center;
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left {
|
| 251 |
-
border-right: 1px solid #EFEFEE;
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
@media screen and (max-width: 782px) {
|
| 255 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left {
|
| 256 |
-
border-bottom: 1px solid #EFEFEE;
|
| 257 |
-
border-right: 0;
|
| 258 |
-
}
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 262 |
-
border-left: 2px solid #EFEFEE;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
@media screen and (max-width: 782px) {
|
| 266 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 267 |
-
border-top: 1px solid #EFEFEE;
|
| 268 |
-
border-left: 0;
|
| 269 |
-
}
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-left {
|
| 273 |
-
border: none;
|
| 274 |
-
padding-left: 15px;
|
| 275 |
-
text-align: left;
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-right {
|
| 279 |
-
border: none;
|
| 280 |
-
padding: 15px;
|
| 281 |
-
}
|
| 282 |
-
|
| 283 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-right img {
|
| 284 |
-
max-width: 100%;
|
| 285 |
-
}
|
| 286 |
-
|
| 287 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .button {
|
| 288 |
-
border-radius: 4px;
|
| 289 |
-
color: #fff;
|
| 290 |
-
font-size: 16px;
|
| 291 |
-
font-weight: 600;
|
| 292 |
-
height: auto;
|
| 293 |
-
line-height: 1;
|
| 294 |
-
margin-bottom: 10px;
|
| 295 |
-
min-width: 180px;
|
| 296 |
-
padding: 14px 30px;
|
| 297 |
-
}
|
| 298 |
-
|
| 299 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange {
|
| 300 |
-
background-color: #FFA901;
|
| 301 |
-
border: 1px solid #cd8800;
|
| 302 |
-
}
|
| 303 |
-
|
| 304 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange:hover, .ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange:focus {
|
| 305 |
-
background-color: #cd8800;
|
| 306 |
-
}
|
| 307 |
-
|
| 308 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue {
|
| 309 |
-
background-color: #0078C3;
|
| 310 |
-
border: 1px solid #005990;
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue:hover, .ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue:focus {
|
| 314 |
-
background-color: #005990;
|
| 315 |
-
}
|
| 316 |
-
|
| 317 |
-
.post-type-ctct_forms .misc-pub-section.misc-pub-visibility, .post-type-ctct_forms .misc-pub-section.misc-pub-curtime {
|
| 318 |
-
display: none;
|
| 319 |
-
}
|
| 320 |
-
|
| 321 |
-
body.post-type-ctct_lists .misc-pub-post-status {
|
| 322 |
-
display: none;
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
body.post-type-ctct_forms #titlediv #title {
|
| 326 |
-
height: 2.7em;
|
| 327 |
-
}
|
| 328 |
-
|
| 329 |
-
.ctct-admin-title-details {
|
| 330 |
-
font-size: .6em;
|
| 331 |
-
vertical-align: middle;
|
| 332 |
-
display: block;
|
| 333 |
-
line-height: 2em;
|
| 334 |
-
}
|
| 335 |
-
|
| 336 |
-
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in-instructions,
|
| 337 |
-
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in {
|
| 338 |
-
display: none;
|
| 339 |
-
}
|
| 340 |
-
|
| 341 |
-
#ctct_0_description_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type),
|
| 342 |
-
#ctct_1_optin_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type),
|
| 343 |
-
#ctct_2_fields_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type) {
|
| 344 |
-
border-bottom: none;
|
| 345 |
-
padding-bottom: 0.1em;
|
| 346 |
-
}
|
| 347 |
-
|
| 348 |
-
#ctct_0_description_metabox #custom_fields_group_repeat .required,
|
| 349 |
-
#ctct_1_optin_metabox #custom_fields_group_repeat .required,
|
| 350 |
-
#ctct_2_fields_metabox #custom_fields_group_repeat .required {
|
| 351 |
-
padding-bottom: 0.1em;
|
| 352 |
-
padding-top: 0.1em;
|
| 353 |
-
}
|
| 354 |
-
|
| 355 |
-
#ctct_0_description_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row,
|
| 356 |
-
#ctct_1_optin_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row,
|
| 357 |
-
#ctct_2_fields_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row {
|
| 358 |
-
padding-top: 0.5em;
|
| 359 |
-
}
|
| 360 |
-
|
| 361 |
-
#ctct_0_description_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type),
|
| 362 |
-
#ctct_1_optin_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type),
|
| 363 |
-
#ctct_2_fields_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type) {
|
| 364 |
-
padding-bottom: 0.1em;
|
| 365 |
-
border-bottom: 1px solid #e9e9e9 !important;
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping,
|
| 369 |
-
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping,
|
| 370 |
-
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping {
|
| 371 |
-
margin: 0 0 1.5em 0;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row,
|
| 375 |
-
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row,
|
| 376 |
-
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row {
|
| 377 |
-
margin: 0 0 0 0.3em;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
#ctct_0_description_metabox .postbox-container .cmb-remove-field-row,
|
| 381 |
-
#ctct_1_optin_metabox .postbox-container .cmb-remove-field-row,
|
| 382 |
-
#ctct_2_fields_metabox .postbox-container .cmb-remove-field-row {
|
| 383 |
-
padding-top: 0.8em;
|
| 384 |
-
padding-bottom: 0.8em;
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
#ctct_0_description_metabox .cmb-repeat-group-wrap,
|
| 388 |
-
#ctct_1_optin_metabox .cmb-repeat-group-wrap,
|
| 389 |
-
#ctct_2_fields_metabox .cmb-repeat-group-wrap {
|
| 390 |
-
padding: 0 !important;
|
| 391 |
-
}
|
| 392 |
-
|
| 393 |
-
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field,
|
| 394 |
-
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field,
|
| 395 |
-
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field {
|
| 396 |
-
padding-top: 0.2em;
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
#ctct_0_description_metabox button.cmb-add-group-row,
|
| 400 |
-
#ctct_1_optin_metabox button.cmb-add-group-row,
|
| 401 |
-
#ctct_2_fields_metabox button.cmb-add-group-row {
|
| 402 |
-
color: white !important;
|
| 403 |
-
background: #008ec2 !important;
|
| 404 |
-
border-color: #006799 !important;
|
| 405 |
-
}
|
| 406 |
-
|
| 407 |
-
#ctct_0_description_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row,
|
| 408 |
-
#ctct_1_optin_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row,
|
| 409 |
-
#ctct_2_fields_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 410 |
-
top: .3em;
|
| 411 |
-
}
|
| 412 |
-
|
| 413 |
-
#ctct_0_description_metabox button.cmb-remove-group-row,
|
| 414 |
-
#ctct_1_optin_metabox button.cmb-remove-group-row,
|
| 415 |
-
#ctct_2_fields_metabox button.cmb-remove-group-row {
|
| 416 |
-
background: #ffdfa3 !important;
|
| 417 |
-
}
|
| 418 |
-
|
| 419 |
-
#ctct_0_description_metabox button.cmb-remove-group-row,
|
| 420 |
-
#ctct_1_optin_metabox button.cmb-remove-group-row,
|
| 421 |
-
#ctct_2_fields_metabox button.cmb-remove-group-row {
|
| 422 |
-
display: none;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
#ctct_0_description_metabox h3.cmb-group-title.cmbhandle-title,
|
| 426 |
-
#ctct_1_optin_metabox h3.cmb-group-title.cmbhandle-title,
|
| 427 |
-
#ctct_2_fields_metabox h3.cmb-group-title.cmbhandle-title {
|
| 428 |
-
padding-left: 1em;
|
| 429 |
-
}
|
| 430 |
-
|
| 431 |
-
#ctct_1_optin_metabox .cmb-row {
|
| 432 |
-
border-bottom: none;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
#ctct_1_optin_metabox .cmb2-id--ctct-list {
|
| 436 |
-
padding-bottom: 0.5em;
|
| 437 |
-
}
|
| 438 |
-
|
| 439 |
-
#ctct_1_optin_metabox .cmb-th {
|
| 440 |
-
width: 25%;
|
| 441 |
-
}
|
| 442 |
-
|
| 443 |
-
#ctct_1_optin_metabox .cmb-th + .cmb-td {
|
| 444 |
-
width: 70%;
|
| 445 |
-
}
|
| 446 |
-
|
| 447 |
-
#ctct_option_metabox_settings span.cmb2-metabox-description {
|
| 448 |
-
color: #444444;
|
| 449 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/admin-global-no-connection.css
DELETED
|
@@ -1,307 +0,0 @@
|
|
| 1 |
-
#adminmenu .wp-submenu a[href="edit.php?post_type=ctct_forms&page=ctct_options_connect"] {
|
| 2 |
-
color: #3ad182;
|
| 3 |
-
}
|
| 4 |
-
|
| 5 |
-
.ctct_options_connect {
|
| 6 |
-
box-sizing: border-box;
|
| 7 |
-
padding: 70px;
|
| 8 |
-
text-align: center;
|
| 9 |
-
width: 100%;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
.ctct_options_connect hr {
|
| 13 |
-
margin-bottom: 45px;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
@media screen and (max-width: 782px) {
|
| 17 |
-
.ctct_options_connect {
|
| 18 |
-
padding: 30px 30px 0;
|
| 19 |
-
margin-left: -10px;
|
| 20 |
-
}
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
.ctct_options_connect .ctct-call-to-action {
|
| 24 |
-
margin-bottom: 45px;
|
| 25 |
-
overflow: hidden;
|
| 26 |
-
text-align: left;
|
| 27 |
-
width: 100%;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
.ctct_options_connect .ctct-call-to-action p {
|
| 31 |
-
float: left;
|
| 32 |
-
margin: 0;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
.ctct_options_connect .ctct-call-to-action a {
|
| 36 |
-
float: right;
|
| 37 |
-
text-align: center;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
@media screen and (max-width: 782px) {
|
| 41 |
-
.ctct_options_connect .ctct-call-to-action a {
|
| 42 |
-
float: none;
|
| 43 |
-
}
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
.ctct_options_connect .ctct-call-to-action .ctct-call-to-action-text a {
|
| 47 |
-
float: none;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
.ctct_options_connect .ctct-call-to-action .ctct-call-to-action-text small {
|
| 51 |
-
line-height: 1.2px;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.ctct_options_connect .ctct-call-to-action #subbox {
|
| 55 |
-
height: 40px;
|
| 56 |
-
margin: 15px 0;
|
| 57 |
-
width: 50%;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
.ctct_options_connect .ctct-call-to-action #subbutton {
|
| 61 |
-
color: #0078C3;
|
| 62 |
-
float: right;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
@media screen and (max-width: 782px) {
|
| 66 |
-
.ctct_options_connect .ctct-call-to-action #subbutton {
|
| 67 |
-
float: none;
|
| 68 |
-
}
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
.ctct_options_connect img {
|
| 72 |
-
width: 100%;
|
| 73 |
-
max-width: 400px;
|
| 74 |
-
height: auto;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
.ctct_options_connect h3 {
|
| 78 |
-
color: #005990;
|
| 79 |
-
font-size: 20px;
|
| 80 |
-
line-height: 1.2;
|
| 81 |
-
margin-bottom: 10px;
|
| 82 |
-
margin-top: 10px;
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
.ctct_options_connect p {
|
| 86 |
-
color: #606d78;
|
| 87 |
-
font-size: 14.7px;
|
| 88 |
-
margin: 0;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
.ctct_options_connect p.ctct-description {
|
| 92 |
-
font-size: 16px;
|
| 93 |
-
margin-bottom: 50px;
|
| 94 |
-
margin-top: 5px;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
.ctct_options_connect p.small {
|
| 98 |
-
color: #747e88;
|
| 99 |
-
font-size: 13.3px;
|
| 100 |
-
margin: 15px auto 0;
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
@media screen and (max-width: 782px) {
|
| 104 |
-
.ctct_options_connect p.small {
|
| 105 |
-
max-width: 100%;
|
| 106 |
-
}
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
.ctct_options_connect .ctct-body {
|
| 110 |
-
margin: 0 auto;
|
| 111 |
-
max-width: 75%;
|
| 112 |
-
overflow-y: hidden;
|
| 113 |
-
position: relative;
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
.ctct_options_connect .ctct-body:after {
|
| 117 |
-
clear: both;
|
| 118 |
-
content: "";
|
| 119 |
-
display: table;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.ctct_options_connect .ctct-body .ctct-call-to-action-text {
|
| 123 |
-
float: left;
|
| 124 |
-
width: 75%;
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
@media screen and (max-width: 782px) {
|
| 128 |
-
.ctct_options_connect .ctct-body .ctct-call-to-action-text {
|
| 129 |
-
width: 100%;
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
.ctct_options_connect .ctct-body .ctct-call-to-action-text h3 {
|
| 134 |
-
margin-top: 0;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
.ctct_options_connect .ctct-body .clear {
|
| 138 |
-
width: 100%;
|
| 139 |
-
clear: both;
|
| 140 |
-
height: 0;
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
.ctct_options_connect .ctct-body .left,
|
| 144 |
-
.ctct_options_connect .ctct-body .right {
|
| 145 |
-
box-sizing: border-box;
|
| 146 |
-
box-sizing: border-box;
|
| 147 |
-
float: left;
|
| 148 |
-
margin-bottom: -500px;
|
| 149 |
-
padding: 15px 0px 520px;
|
| 150 |
-
text-align: center;
|
| 151 |
-
width: 50%;
|
| 152 |
-
}
|
| 153 |
-
|
| 154 |
-
@media screen and (max-width: 782px) {
|
| 155 |
-
.ctct_options_connect .ctct-body .left,
|
| 156 |
-
.ctct_options_connect .ctct-body .right {
|
| 157 |
-
float: none;
|
| 158 |
-
margin-bottom: 0;
|
| 159 |
-
padding: 15px 0;
|
| 160 |
-
width: 100%;
|
| 161 |
-
}
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
.ctct_options_connect .ctct-body .left img.flare,
|
| 165 |
-
.ctct_options_connect .ctct-body .left svg.flare,
|
| 166 |
-
.ctct_options_connect .ctct-body .right img.flare,
|
| 167 |
-
.ctct_options_connect .ctct-body .right svg.flare {
|
| 168 |
-
width: 180px;
|
| 169 |
-
height: auto;
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
.ctct_options_connect .ctct-body .left {
|
| 173 |
-
border-right: 1px solid #ddd;
|
| 174 |
-
padding-right: 70px;
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
@media screen and (max-width: 782px) {
|
| 178 |
-
.ctct_options_connect .ctct-body .left {
|
| 179 |
-
border-bottom: 1px solid #ddd;
|
| 180 |
-
border-right: 0;
|
| 181 |
-
padding-bottom: 30px;
|
| 182 |
-
padding-right: 0;
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
.ctct_options_connect .ctct-body .left p {
|
| 187 |
-
max-width: 220px;
|
| 188 |
-
margin: 0 auto 25px;
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
@media screen and (max-width: 782px) {
|
| 192 |
-
.ctct_options_connect .ctct-body .left p {
|
| 193 |
-
max-width: 100%;
|
| 194 |
-
}
|
| 195 |
-
}
|
| 196 |
-
|
| 197 |
-
.ctct_options_connect .ctct-body .right {
|
| 198 |
-
padding-left: 70px;
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
@media screen and (max-width: 782px) {
|
| 202 |
-
.ctct_options_connect .ctct-body .right {
|
| 203 |
-
padding-left: 0;
|
| 204 |
-
padding-top: 30px;
|
| 205 |
-
}
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
.ctct_options_connect .ctct-body .right p {
|
| 209 |
-
display: block;
|
| 210 |
-
max-width: 350px;
|
| 211 |
-
margin: 0 auto 25px;
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
@media screen and (max-width: 782px) {
|
| 215 |
-
.ctct_options_connect .ctct-body .right p {
|
| 216 |
-
max-width: 100%;
|
| 217 |
-
}
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
.ctct_options_connect .ctct-body .button {
|
| 221 |
-
border-radius: 4px;
|
| 222 |
-
color: #fff;
|
| 223 |
-
font-size: 16px;
|
| 224 |
-
font-weight: 600;
|
| 225 |
-
height: auto;
|
| 226 |
-
line-height: 1;
|
| 227 |
-
margin-bottom: 10px;
|
| 228 |
-
min-width: 180px;
|
| 229 |
-
padding: 14px 30px;
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
.ctct_options_connect .ctct-body .button.button-orange {
|
| 233 |
-
background-color: #FFA901;
|
| 234 |
-
border: 1px solid #cd8800;
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
.ctct_options_connect .ctct-body .button.button-orange:hover, .ctct_options_connect .ctct-body .button.button-orange:focus {
|
| 238 |
-
background-color: #cd8800;
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
.ctct_options_connect .ctct-body .button.button-blue {
|
| 242 |
-
background-color: #0078C3;
|
| 243 |
-
border: 1px solid #005990;
|
| 244 |
-
}
|
| 245 |
-
|
| 246 |
-
.ctct_options_connect .ctct-body .button.button-blue:hover, .ctct_options_connect .ctct-body .button.button-blue:focus {
|
| 247 |
-
background-color: #005990;
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step {
|
| 251 |
-
margin-bottom: 40px;
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step h3 {
|
| 255 |
-
color: #2ECC40;
|
| 256 |
-
}
|
| 257 |
-
|
| 258 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-disconnect-text {
|
| 259 |
-
float: left;
|
| 260 |
-
margin-bottom: 50px;
|
| 261 |
-
overflow: hidden;
|
| 262 |
-
text-align: left;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
.ctct_options_connect .ctct-body .ctct-connected form {
|
| 266 |
-
float: right;
|
| 267 |
-
}
|
| 268 |
-
|
| 269 |
-
.ctct_options_connect .ctct-body .ctct-connected .button {
|
| 270 |
-
color: #0078C3;
|
| 271 |
-
}
|
| 272 |
-
|
| 273 |
-
.ctct_options_connect .ctct-body .ctct-connected .button.button-blue {
|
| 274 |
-
color: #fff;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step {
|
| 278 |
-
clear: both;
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-connect-ga-optin {
|
| 282 |
-
margin-top: 15px;
|
| 283 |
-
}
|
| 284 |
-
|
| 285 |
-
@media screen and (max-width: 782px) {
|
| 286 |
-
.ctct_options_connect .ctct-body .ctct-connected .ctct-disconnect-text {
|
| 287 |
-
float: none;
|
| 288 |
-
text-align: center;
|
| 289 |
-
}
|
| 290 |
-
.ctct_options_connect .ctct-body .ctct-connected form {
|
| 291 |
-
float: none;
|
| 292 |
-
}
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
.error {
|
| 296 |
-
background: none !important;
|
| 297 |
-
border-left: 1px solid #FF4136 !important;
|
| 298 |
-
border-radius: 3px;
|
| 299 |
-
border: 1px solid #FF4136;
|
| 300 |
-
box-shadow: none !important;
|
| 301 |
-
display: inline-block;
|
| 302 |
-
margin: 0 0 20px 0 !important;
|
| 303 |
-
}
|
| 304 |
-
|
| 305 |
-
.error p {
|
| 306 |
-
color: #FF4136 !important;
|
| 307 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/admin-notices.css
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
.updated.ctct-admin-notice,
|
| 2 |
-
.error.ctct-admin-notice {
|
| 3 |
-
padding: 1em 38px 1em 1em;
|
| 4 |
-
position: relative;
|
| 5 |
-
}
|
| 6 |
-
|
| 7 |
-
a.ctct-notice-dismiss {
|
| 8 |
-
text-decoration: none;
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
#ctct-admin-notice-activation {
|
| 12 |
-
padding: 1em 1em 0 1em;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
#ctct-admin-notice-activation .ctct-notice-intro {
|
| 16 |
-
max-width: 600px;
|
| 17 |
-
line-height: 1.5em;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
#ctct-admin-notice-activation .ctct-notice-button,
|
| 21 |
-
#ctct-admin-notice-activation .ctct-notice-button:active {
|
| 22 |
-
vertical-align: middle;
|
| 23 |
-
margin: .5em;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
.ctct-admin-notice {
|
| 27 |
-
overflow: hidden;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
.ctct-admin-notice.updated {
|
| 31 |
-
border-left-color: #1a5285;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
.ctct-admin-notice > div {
|
| 35 |
-
float: left;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
.ctct-admin-notice .admin-notice-message {
|
| 39 |
-
margin-left: 15px;
|
| 40 |
-
width: 80%;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
.ctct-admin-notice .admin-notice-message h4 {
|
| 44 |
-
color: #1a5285;
|
| 45 |
-
margin: 0 0 10px;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
.ctct-admin-notice .admin-notice-message > div {
|
| 49 |
-
float: left;
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/admin-pages.css
DELETED
|
@@ -1,351 +0,0 @@
|
|
| 1 |
-
.constant-contact-about {
|
| 2 |
-
padding: 15px;
|
| 3 |
-
}
|
| 4 |
-
|
| 5 |
-
@media screen and (max-width: 782px) {
|
| 6 |
-
.constant-contact-about {
|
| 7 |
-
padding: 0;
|
| 8 |
-
}
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
.constant-contact-about .ctct-section {
|
| 12 |
-
margin-bottom: 50px;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.constant-contact-about h1.about-header {
|
| 16 |
-
color: #1a5285;
|
| 17 |
-
font-size: 26px;
|
| 18 |
-
margin: 0 0 15px 0;
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
.constant-contact-about h3 {
|
| 22 |
-
padding: 20px 0;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
.constant-contact-about p {
|
| 26 |
-
font-size: 16px;
|
| 27 |
-
font-weight: 300;
|
| 28 |
-
color: #333333;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
.constant-contact-about .clear {
|
| 32 |
-
width: 100%;
|
| 33 |
-
clear: both;
|
| 34 |
-
height: 0;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
.constant-contact-about .button {
|
| 38 |
-
border-radius: 4px;
|
| 39 |
-
color: #fff;
|
| 40 |
-
font-size: 16px;
|
| 41 |
-
font-weight: 600;
|
| 42 |
-
height: auto;
|
| 43 |
-
line-height: 1;
|
| 44 |
-
margin-bottom: 10px;
|
| 45 |
-
min-width: 180px;
|
| 46 |
-
padding: 14px 30px;
|
| 47 |
-
text-align: center;
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
.constant-contact-about .button.button-orange {
|
| 51 |
-
background-color: #FFA901;
|
| 52 |
-
border: 1px solid #cd8800;
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
.constant-contact-about .button.button-orange:hover, .constant-contact-about .button.button-orange:focus {
|
| 56 |
-
background-color: #cd8800;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.constant-contact-about .button.button-blue {
|
| 60 |
-
background-color: #0078C3;
|
| 61 |
-
border: 1px solid #005990;
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
.constant-contact-about .button.button-blue:hover, .constant-contact-about .button.button-blue:focus {
|
| 65 |
-
background-color: #005990;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
.constant-contact-about .about-text {
|
| 69 |
-
margin: 0 50px 0 0;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
@media screen and (max-width: 482px) {
|
| 73 |
-
.constant-contact-about .about-text {
|
| 74 |
-
margiun: 0;
|
| 75 |
-
}
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
.constant-contact-about .feature-section.two-col > div {
|
| 79 |
-
width: 49%;
|
| 80 |
-
float: left;
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
.constant-contact-about .headline-feature {
|
| 84 |
-
max-width: 90%;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
@media screen and (max-width: 782px) {
|
| 88 |
-
.constant-contact-about .headline-feature {
|
| 89 |
-
max-width: 100%;
|
| 90 |
-
}
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
.constant-contact-about .headline-feature p {
|
| 94 |
-
margin-bottom: 0;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
.constant-contact-about .headline-feature h5 {
|
| 98 |
-
font-weight: 300;
|
| 99 |
-
color: #747e88;
|
| 100 |
-
font-style: italic;
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
.constant-contact-about .headline-title, .constant-contact-about .c-text {
|
| 104 |
-
text-align: center;
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
.constant-contact-about .featured-image {
|
| 108 |
-
min-height: 150px;
|
| 109 |
-
position: relative;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
.constant-contact-about .fff-img {
|
| 113 |
-
height: 315px;
|
| 114 |
-
margin: 20px;
|
| 115 |
-
overflow: hidden;
|
| 116 |
-
max-width: 720px;
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
.constant-contact-about .introduction {
|
| 120 |
-
padding: 20px 0;
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
.constant-contact-about .featured-title {
|
| 124 |
-
color: white;
|
| 125 |
-
font-size: 2em;
|
| 126 |
-
font-weight: bold;
|
| 127 |
-
margin: 0 auto;
|
| 128 |
-
position: absolute;
|
| 129 |
-
text-align: center;
|
| 130 |
-
text-shadow: 0 0 15px #000;
|
| 131 |
-
top: 80px;
|
| 132 |
-
width: 100%;
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
@media screen and (max-width: 482px) {
|
| 136 |
-
.constant-contact-about .featured-title {
|
| 137 |
-
color: #1a5285;
|
| 138 |
-
font-size: 26px;
|
| 139 |
-
line-height: 28px;
|
| 140 |
-
margin-top: 15px;
|
| 141 |
-
position: relative;
|
| 142 |
-
text-shadow: none;
|
| 143 |
-
top: 0;
|
| 144 |
-
}
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
.constant-contact-about .featured-introduction {
|
| 148 |
-
color: white;
|
| 149 |
-
font-size: 1.2em;
|
| 150 |
-
margin: 0 auto;
|
| 151 |
-
position: absolute;
|
| 152 |
-
text-align: center;
|
| 153 |
-
text-shadow: 0 0 15px #000;
|
| 154 |
-
top: 120px;
|
| 155 |
-
width: 100%;
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
@media screen and (max-width: 482px) {
|
| 159 |
-
.constant-contact-about .featured-introduction {
|
| 160 |
-
color: #1a5285;
|
| 161 |
-
line-height: 1;
|
| 162 |
-
margin-top: 15px;
|
| 163 |
-
position: relative;
|
| 164 |
-
text-shadow: none;
|
| 165 |
-
top: 0;
|
| 166 |
-
}
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.constant-contact-about .hide-overflow {
|
| 170 |
-
overflow: hidden;
|
| 171 |
-
position: relative;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.constant-contact-about .hide-overflow hr {
|
| 175 |
-
margin-top: 30px;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.constant-contact-about .hide-overflow h2 {
|
| 179 |
-
font-weight: 400;
|
| 180 |
-
font-size: 16px;
|
| 181 |
-
color: #1a5285;
|
| 182 |
-
text-align: left;
|
| 183 |
-
margin-top: 30px;
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
.constant-contact-about .left-side {
|
| 187 |
-
float: left;
|
| 188 |
-
box-sizing: border-box;
|
| 189 |
-
padding-right: 160px;
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
@media screen and (max-width: 482px) {
|
| 193 |
-
.constant-contact-about .left-side {
|
| 194 |
-
padding-right: 0;
|
| 195 |
-
}
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
.constant-contact-about .plugin-badge {
|
| 199 |
-
float: right;
|
| 200 |
-
max-height: 180px;
|
| 201 |
-
max-width: 160px;
|
| 202 |
-
margin-left: 40px;
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
@media screen and (max-width: 482px) {
|
| 206 |
-
.constant-contact-about .plugin-badge {
|
| 207 |
-
display: none;
|
| 208 |
-
}
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
.constant-contact-about .feature-image {
|
| 212 |
-
text-align: center;
|
| 213 |
-
}
|
| 214 |
-
|
| 215 |
-
.cc-a-block {
|
| 216 |
-
margin: 0 auto;
|
| 217 |
-
max-width: 90%;
|
| 218 |
-
padding: 50px 0;
|
| 219 |
-
text-align: center;
|
| 220 |
-
}
|
| 221 |
-
|
| 222 |
-
.cc-a-block:after {
|
| 223 |
-
clear: both;
|
| 224 |
-
content: "";
|
| 225 |
-
display: table;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
@media screen and (max-width: 482px) {
|
| 229 |
-
.cc-a-block {
|
| 230 |
-
padding: 25px 0;
|
| 231 |
-
}
|
| 232 |
-
}
|
| 233 |
-
|
| 234 |
-
.cc-a-block h3 {
|
| 235 |
-
color: #1a5285;
|
| 236 |
-
font-size: 21px;
|
| 237 |
-
font-weight: 300;
|
| 238 |
-
height: 63px;
|
| 239 |
-
margin: 0 auto;
|
| 240 |
-
max-width: 70%;
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
@media screen and (max-width: 782px) {
|
| 244 |
-
.cc-a-block h3 {
|
| 245 |
-
height: auto;
|
| 246 |
-
max-width: 100%;
|
| 247 |
-
}
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
.cc-a-block .left,
|
| 251 |
-
.cc-a-block .right {
|
| 252 |
-
float: left;
|
| 253 |
-
width: 50%;
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
.cc-a-block .left:after,
|
| 257 |
-
.cc-a-block .right:after {
|
| 258 |
-
clear: both;
|
| 259 |
-
content: "";
|
| 260 |
-
display: table;
|
| 261 |
-
}
|
| 262 |
-
|
| 263 |
-
@media screen and (max-width: 482px) {
|
| 264 |
-
.cc-a-block .left,
|
| 265 |
-
.cc-a-block .right {
|
| 266 |
-
width: 100%;
|
| 267 |
-
float: none;
|
| 268 |
-
}
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
.cc-a-block .left .ad-1,
|
| 272 |
-
.cc-a-block .left .ad-2,
|
| 273 |
-
.cc-a-block .right .ad-1,
|
| 274 |
-
.cc-a-block .right .ad-2 {
|
| 275 |
-
width: 90%;
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
-
@media screen and (max-width: 482px) {
|
| 279 |
-
.cc-a-block .left .ad-1,
|
| 280 |
-
.cc-a-block .left .ad-2,
|
| 281 |
-
.cc-a-block .right .ad-1,
|
| 282 |
-
.cc-a-block .right .ad-2 {
|
| 283 |
-
width: 100%;
|
| 284 |
-
float: none;
|
| 285 |
-
}
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.cc-a-block .left .ad-1 img,
|
| 289 |
-
.cc-a-block .left .ad-2 img,
|
| 290 |
-
.cc-a-block .right .ad-1 img,
|
| 291 |
-
.cc-a-block .right .ad-2 img {
|
| 292 |
-
width: 100%;
|
| 293 |
-
height: auto;
|
| 294 |
-
}
|
| 295 |
-
|
| 296 |
-
.cc-a-block .left .ad-1,
|
| 297 |
-
.cc-a-block .right .ad-1 {
|
| 298 |
-
float: left;
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
.cc-a-block .left .ad-1 h3,
|
| 302 |
-
.cc-a-block .right .ad-1 h3 {
|
| 303 |
-
padding-top: 35px;
|
| 304 |
-
height: 47px;
|
| 305 |
-
}
|
| 306 |
-
|
| 307 |
-
.cc-a-block .left .ad-2,
|
| 308 |
-
.cc-a-block .right .ad-2 {
|
| 309 |
-
float: right;
|
| 310 |
-
}
|
| 311 |
-
|
| 312 |
-
.ctct-bonus-points {
|
| 313 |
-
list-style: circle;
|
| 314 |
-
padding-left: 50px;
|
| 315 |
-
font-size: 16px;
|
| 316 |
-
font-weight: 300;
|
| 317 |
-
color: #2b5e8c;
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
.section-try-us .ctct-bonus-points {
|
| 321 |
-
margin-bottom: 50px;
|
| 322 |
-
}
|
| 323 |
-
|
| 324 |
-
.section-try-us a.button {
|
| 325 |
-
margin-right: 40px;
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
.section-try-us a.ctct-connect {
|
| 329 |
-
font-weight: bold;
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
.section-marketing-tips #subbox {
|
| 333 |
-
height: 40px;
|
| 334 |
-
width: 50%;
|
| 335 |
-
}
|
| 336 |
-
|
| 337 |
-
#cmb2-metabox-ctct_option_metabox_settings .regular-text {
|
| 338 |
-
width: 500px;
|
| 339 |
-
}
|
| 340 |
-
|
| 341 |
-
.cmb2-options-page #ctct_option_metabox_settings .cmb2-metabox > .cmb-row {
|
| 342 |
-
background: transparent;
|
| 343 |
-
border: none;
|
| 344 |
-
box-shadow: none;
|
| 345 |
-
}
|
| 346 |
-
|
| 347 |
-
.ctct-body #ctct_error_logs {
|
| 348 |
-
height: 400px;
|
| 349 |
-
resize: vertical;
|
| 350 |
-
width: 100%;
|
| 351 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/admin-style.css
ADDED
|
@@ -0,0 +1,1307 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.ctct-modal {
|
| 2 |
+
-moz-osx-font-smoothing: grayscale;
|
| 3 |
+
-webkit-font-smoothing: antialiased;
|
| 4 |
+
background-color: rgba(0, 0, 0, 0.3);
|
| 5 |
+
bottom: 0;
|
| 6 |
+
display: none;
|
| 7 |
+
left: 0;
|
| 8 |
+
overflow: hidden;
|
| 9 |
+
position: fixed;
|
| 10 |
+
right: 0;
|
| 11 |
+
top: 0;
|
| 12 |
+
z-index: 9999;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.ctct-modal:after {
|
| 16 |
+
clear: both;
|
| 17 |
+
content: "";
|
| 18 |
+
display: table;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
.ctct-modal h2 {
|
| 22 |
+
color: #fff;
|
| 23 |
+
font-size: 28px;
|
| 24 |
+
font-weight: 400;
|
| 25 |
+
line-height: 1.2;
|
| 26 |
+
margin: 0;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.ctct-modal h3 {
|
| 30 |
+
color: #005990;
|
| 31 |
+
font-size: 18px;
|
| 32 |
+
line-height: 1.2;
|
| 33 |
+
margin-bottom: 15px;
|
| 34 |
+
margin-top: 10px;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
.ctct-modal p {
|
| 38 |
+
color: #555555;
|
| 39 |
+
font-size: 14.7px;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
.ctct-modal.ctct-modal-open {
|
| 43 |
+
display: block;
|
| 44 |
+
overflow-x: hidden;
|
| 45 |
+
overflow-y: auto;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
.ctct-modal .ctct-modal-dialog {
|
| 49 |
+
left: 50%;
|
| 50 |
+
position: absolute;
|
| 51 |
+
top: 50%;
|
| 52 |
+
transform: translate(-50%, -50%);
|
| 53 |
+
width: 100%;
|
| 54 |
+
max-width: 720px;
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
@media screen and (max-width: 1024px) {
|
| 58 |
+
.ctct-modal .ctct-modal-dialog {
|
| 59 |
+
max-width: 75%;
|
| 60 |
+
}
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
@media screen and (max-width: 782px) {
|
| 64 |
+
.ctct-modal .ctct-modal-dialog {
|
| 65 |
+
left: 7.5%;
|
| 66 |
+
top: 15%;
|
| 67 |
+
transform: translate(0, 0);
|
| 68 |
+
margin-bottom: 15%;
|
| 69 |
+
max-width: 85%;
|
| 70 |
+
}
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
.ctct-modal .ctct-modal-content {
|
| 74 |
+
background-clip: padding-box;
|
| 75 |
+
background-color: #ffffff;
|
| 76 |
+
border-radius: 8px;
|
| 77 |
+
box-shadow: 0 0 15px 0 rgba(0, 0, 0, 0.4);
|
| 78 |
+
outline: 0;
|
| 79 |
+
padding: rem(10);
|
| 80 |
+
position: relative;
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header {
|
| 84 |
+
background: #88C5E2 url(../images/cc-modal-bg.png) 50% 50% no-repeat;
|
| 85 |
+
border-top-left-radius: 8px;
|
| 86 |
+
border-top-right-radius: 8px;
|
| 87 |
+
padding: 65px 20px 40px;
|
| 88 |
+
text-align: center;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header p {
|
| 92 |
+
color: #fff;
|
| 93 |
+
font-size: 16px;
|
| 94 |
+
margin-bottom: 0;
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header p .displayed-shortcode {
|
| 98 |
+
color: #333333;
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-logo img {
|
| 102 |
+
max-width: 75%;
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-modal-close {
|
| 106 |
+
color: #ffffff;
|
| 107 |
+
cursor: pointer;
|
| 108 |
+
font-size: 26px;
|
| 109 |
+
height: 16px;
|
| 110 |
+
line-height: 0;
|
| 111 |
+
margin: 0;
|
| 112 |
+
outline: none;
|
| 113 |
+
padding: 0;
|
| 114 |
+
padding: 0;
|
| 115 |
+
position: absolute;
|
| 116 |
+
right: 10px;
|
| 117 |
+
text-decoration: none;
|
| 118 |
+
top: 18px;
|
| 119 |
+
width: 16px;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
.ctct-modal .ctct-modal-content .ctct-modal-header .ctct-modal-close:after {
|
| 123 |
+
clear: both;
|
| 124 |
+
content: "";
|
| 125 |
+
display: table;
|
| 126 |
+
}
|
| 127 |
+
|
| 128 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer {
|
| 129 |
+
background-color: #EFEFEE;
|
| 130 |
+
border-bottom-left-radius: 8px;
|
| 131 |
+
border-bottom-right-radius: 8px;
|
| 132 |
+
border-top: 3px solid #fff;
|
| 133 |
+
padding: 15px 15px 18px;
|
| 134 |
+
text-align: center;
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer p {
|
| 138 |
+
margin: 0;
|
| 139 |
+
font-size: 16px;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer a {
|
| 143 |
+
color: #0078C3;
|
| 144 |
+
text-decoration: underline;
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer.ctct-modal-footer-privacy a {
|
| 148 |
+
text-decoration: none;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button {
|
| 152 |
+
border-radius: 4px;
|
| 153 |
+
color: #fff;
|
| 154 |
+
font-size: 16px;
|
| 155 |
+
font-weight: 600;
|
| 156 |
+
height: auto;
|
| 157 |
+
line-height: 1;
|
| 158 |
+
margin-bottom: 10px;
|
| 159 |
+
min-width: 180px;
|
| 160 |
+
padding: 14px 30px;
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.no-bg {
|
| 164 |
+
border: none;
|
| 165 |
+
box-shadow: none;
|
| 166 |
+
color: #0078C3;
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange {
|
| 170 |
+
background-color: #FFA901;
|
| 171 |
+
border: 1px solid #cd8800;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange:hover, .ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-orange:focus {
|
| 175 |
+
background-color: #cd8800;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue {
|
| 179 |
+
background-color: #0078C3;
|
| 180 |
+
border: 1px solid #005990;
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
.ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue:hover, .ctct-modal .ctct-modal-content .ctct-modal-footer .button.button-blue:focus {
|
| 184 |
+
background-color: #005990;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body {
|
| 188 |
+
padding: 15px;
|
| 189 |
+
position: relative;
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body:after {
|
| 193 |
+
clear: both;
|
| 194 |
+
content: "";
|
| 195 |
+
display: table;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-privacy-modal-body {
|
| 199 |
+
overflow: scroll;
|
| 200 |
+
height: 350px;
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left,
|
| 204 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 205 |
+
float: left;
|
| 206 |
+
padding: 15px 50px 15px;
|
| 207 |
+
text-align: center;
|
| 208 |
+
width: 50%;
|
| 209 |
+
box-sizing: border-box;
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
@media screen and (max-width: 782px) {
|
| 213 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left,
|
| 214 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 215 |
+
width: 100%;
|
| 216 |
+
float: none;
|
| 217 |
+
}
|
| 218 |
+
}
|
| 219 |
+
|
| 220 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left img.ctct-modal-flare,
|
| 221 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left svg.ctct-modal-flare,
|
| 222 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right img.ctct-modal-flare,
|
| 223 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right svg.ctct-modal-flare {
|
| 224 |
+
max-width: 120px;
|
| 225 |
+
height: auto;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left p,
|
| 229 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right p {
|
| 230 |
+
max-width: 90%;
|
| 231 |
+
margin: 0 auto 25px;
|
| 232 |
+
}
|
| 233 |
+
|
| 234 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left p.small,
|
| 235 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right p.small {
|
| 236 |
+
line-height: 1;
|
| 237 |
+
margin: 0;
|
| 238 |
+
max-width: 100%;
|
| 239 |
+
}
|
| 240 |
+
|
| 241 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left small,
|
| 242 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right small {
|
| 243 |
+
font-style: italic;
|
| 244 |
+
}
|
| 245 |
+
|
| 246 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .now-what {
|
| 247 |
+
text-align: center;
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left {
|
| 251 |
+
border-right: 1px solid #EFEFEE;
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
@media screen and (max-width: 782px) {
|
| 255 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-left {
|
| 256 |
+
border-bottom: 1px solid #EFEFEE;
|
| 257 |
+
border-right: 0;
|
| 258 |
+
}
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 262 |
+
border-left: 2px solid #EFEFEE;
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
@media screen and (max-width: 782px) {
|
| 266 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .ctct-modal-right {
|
| 267 |
+
border-top: 1px solid #EFEFEE;
|
| 268 |
+
border-left: 0;
|
| 269 |
+
}
|
| 270 |
+
}
|
| 271 |
+
|
| 272 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-left {
|
| 273 |
+
border: none;
|
| 274 |
+
padding-left: 15px;
|
| 275 |
+
text-align: left;
|
| 276 |
+
}
|
| 277 |
+
|
| 278 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-right {
|
| 279 |
+
border: none;
|
| 280 |
+
padding: 15px;
|
| 281 |
+
}
|
| 282 |
+
|
| 283 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body.ctct-custom-textarea .ctct-modal-right img {
|
| 284 |
+
max-width: 100%;
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .button {
|
| 288 |
+
border-radius: 4px;
|
| 289 |
+
color: #fff;
|
| 290 |
+
font-size: 16px;
|
| 291 |
+
font-weight: 600;
|
| 292 |
+
height: auto;
|
| 293 |
+
line-height: 1;
|
| 294 |
+
margin-bottom: 10px;
|
| 295 |
+
min-width: 180px;
|
| 296 |
+
padding: 14px 30px;
|
| 297 |
+
}
|
| 298 |
+
|
| 299 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange {
|
| 300 |
+
background-color: #FFA901;
|
| 301 |
+
border: 1px solid #cd8800;
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange:hover, .ctct-modal .ctct-modal-content .ctct-modal-body .button.button-orange:focus {
|
| 305 |
+
background-color: #cd8800;
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue {
|
| 309 |
+
background-color: #0078C3;
|
| 310 |
+
border: 1px solid #005990;
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
.ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue:hover, .ctct-modal .ctct-modal-content .ctct-modal-body .button.button-blue:focus {
|
| 314 |
+
background-color: #005990;
|
| 315 |
+
}
|
| 316 |
+
|
| 317 |
+
.post-type-ctct_forms .misc-pub-section.misc-pub-visibility, .post-type-ctct_forms .misc-pub-section.misc-pub-curtime {
|
| 318 |
+
display: none;
|
| 319 |
+
}
|
| 320 |
+
|
| 321 |
+
body.post-type-ctct_lists .misc-pub-post-status {
|
| 322 |
+
display: none;
|
| 323 |
+
}
|
| 324 |
+
|
| 325 |
+
body.post-type-ctct_forms #titlediv #title {
|
| 326 |
+
height: 2.7em;
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
.ctct-admin-title-details {
|
| 330 |
+
font-size: .6em;
|
| 331 |
+
vertical-align: middle;
|
| 332 |
+
display: block;
|
| 333 |
+
line-height: 2em;
|
| 334 |
+
}
|
| 335 |
+
|
| 336 |
+
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in-instructions,
|
| 337 |
+
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in {
|
| 338 |
+
display: none;
|
| 339 |
+
}
|
| 340 |
+
|
| 341 |
+
#ctct_0_list_metabox .cmb-row,
|
| 342 |
+
#ctct_1_custom_form_css_metabox .cmb-row,
|
| 343 |
+
#ctct_1_custom_input_css_metabox .cmb-row {
|
| 344 |
+
padding-bottom: 0;
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
#cmb2-metabox-ctct_2_fields_metabox .cmb2-id--ctct-title {
|
| 348 |
+
padding: .8em 0 1em;
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
#ctct_1_custom_form_css_metabox .cmb2-id-form-title-title {
|
| 352 |
+
padding: .8em 0 1em;
|
| 353 |
+
}
|
| 354 |
+
|
| 355 |
+
#ctct_0_description_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type),
|
| 356 |
+
#ctct_1_optin_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type),
|
| 357 |
+
#ctct_2_fields_metabox #custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type) {
|
| 358 |
+
border-bottom: none;
|
| 359 |
+
padding-bottom: 0.1em;
|
| 360 |
+
}
|
| 361 |
+
|
| 362 |
+
#ctct_0_description_metabox #custom_fields_group_repeat .required,
|
| 363 |
+
#ctct_1_optin_metabox #custom_fields_group_repeat .required,
|
| 364 |
+
#ctct_2_fields_metabox #custom_fields_group_repeat .required {
|
| 365 |
+
padding-bottom: 0.1em;
|
| 366 |
+
padding-top: 0.1em;
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
#ctct_0_description_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row,
|
| 370 |
+
#ctct_1_optin_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row,
|
| 371 |
+
#ctct_2_fields_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row {
|
| 372 |
+
padding-top: 0.5em;
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
#ctct_0_description_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type),
|
| 376 |
+
#ctct_1_optin_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type),
|
| 377 |
+
#ctct_2_fields_metabox #default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type) {
|
| 378 |
+
padding-bottom: 0.1em;
|
| 379 |
+
border-bottom: 1px solid #e9e9e9 !important;
|
| 380 |
+
}
|
| 381 |
+
|
| 382 |
+
#ctct_0_description_metabox .cmb-repeat-group-wrap,
|
| 383 |
+
#ctct_1_optin_metabox .cmb-repeat-group-wrap,
|
| 384 |
+
#ctct_2_fields_metabox .cmb-repeat-group-wrap {
|
| 385 |
+
padding: 0 !important;
|
| 386 |
+
}
|
| 387 |
+
|
| 388 |
+
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping,
|
| 389 |
+
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping,
|
| 390 |
+
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping {
|
| 391 |
+
margin: 0 0 1.5em 0;
|
| 392 |
+
}
|
| 393 |
+
|
| 394 |
+
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row,
|
| 395 |
+
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row,
|
| 396 |
+
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row {
|
| 397 |
+
margin: 0 0 0 0.3em;
|
| 398 |
+
}
|
| 399 |
+
|
| 400 |
+
#ctct_0_description_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field,
|
| 401 |
+
#ctct_1_optin_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field,
|
| 402 |
+
#ctct_2_fields_metabox .cmb-repeat-group-wrap .cmb-repeat-group-field {
|
| 403 |
+
padding-top: 0.2em;
|
| 404 |
+
}
|
| 405 |
+
|
| 406 |
+
#ctct_0_description_metabox .postbox-container .cmb-remove-field-row,
|
| 407 |
+
#ctct_1_optin_metabox .postbox-container .cmb-remove-field-row,
|
| 408 |
+
#ctct_2_fields_metabox .postbox-container .cmb-remove-field-row {
|
| 409 |
+
padding-top: 0.8em;
|
| 410 |
+
padding-bottom: 0.8em;
|
| 411 |
+
}
|
| 412 |
+
|
| 413 |
+
#ctct_0_description_metabox button.cmb-add-group-row,
|
| 414 |
+
#ctct_1_optin_metabox button.cmb-add-group-row,
|
| 415 |
+
#ctct_2_fields_metabox button.cmb-add-group-row {
|
| 416 |
+
color: white !important;
|
| 417 |
+
background: #008ec2 !important;
|
| 418 |
+
border-color: #006799 !important;
|
| 419 |
+
}
|
| 420 |
+
|
| 421 |
+
#ctct_0_description_metabox button.cmb-remove-group-row,
|
| 422 |
+
#ctct_1_optin_metabox button.cmb-remove-group-row,
|
| 423 |
+
#ctct_2_fields_metabox button.cmb-remove-group-row {
|
| 424 |
+
background: #ffdfa3 !important;
|
| 425 |
+
display: none;
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
#ctct_0_description_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row,
|
| 429 |
+
#ctct_1_optin_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row,
|
| 430 |
+
#ctct_2_fields_metabox .cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 431 |
+
top: .3em;
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
#ctct_0_description_metabox h3.cmb-group-title.cmbhandle-title,
|
| 435 |
+
#ctct_1_optin_metabox h3.cmb-group-title.cmbhandle-title,
|
| 436 |
+
#ctct_2_fields_metabox h3.cmb-group-title.cmbhandle-title {
|
| 437 |
+
padding-left: 1em;
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
#ctct_1_optin_metabox .cmb-row {
|
| 441 |
+
border-bottom: none;
|
| 442 |
+
padding: .5em 0px;
|
| 443 |
+
}
|
| 444 |
+
|
| 445 |
+
#ctct_1_optin_metabox .cmb2-id--ctct-list {
|
| 446 |
+
padding-bottom: 0.5em;
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
#ctct_1_optin_metabox .cmb-th {
|
| 450 |
+
width: 25%;
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
#ctct_1_optin_metabox .cmb-th + .cmb-td {
|
| 454 |
+
width: 70%;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
#ctct_option_metabox_settings span.cmb2-metabox-description {
|
| 458 |
+
color: #444444;
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
#cmb2-metabox-email_settings .cmb-row,
|
| 462 |
+
#cmb2-metabox-ctct_2_generated_metabox .cmb-row,
|
| 463 |
+
#cmb2-metabox-ctct_1_custom_input_css_metabox .cmb-row {
|
| 464 |
+
padding-bottom: 0px !important;
|
| 465 |
+
}
|
| 466 |
+
|
| 467 |
+
#side-sortables #ctct_1_custom_form_css_metabox .cmb-row {
|
| 468 |
+
padding: 0.5em 0 0 0;
|
| 469 |
+
}
|
| 470 |
+
|
| 471 |
+
#side-sortables #ctct_1_custom_form_css_metabox .cmb-th {
|
| 472 |
+
padding-bottom: 0;
|
| 473 |
+
}
|
| 474 |
+
|
| 475 |
+
#side-sortables #ctct_1_custom_form_css_metabox .cmb-type-title {
|
| 476 |
+
border-bottom: none;
|
| 477 |
+
}
|
| 478 |
+
|
| 479 |
+
#side-sortables #ctct_1_custom_form_css_metabox .cmb2-id--ctct-form-title-font-size,
|
| 480 |
+
#side-sortables #ctct_1_custom_form_css_metabox .cmb2-id--ctct-form-description-font-size {
|
| 481 |
+
border-bottom: none;
|
| 482 |
+
margin-bottom: 0;
|
| 483 |
+
}
|
| 484 |
+
|
| 485 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb2-id-form-padding-title {
|
| 486 |
+
border-bottom: 0;
|
| 487 |
+
padding-bottom: 0;
|
| 488 |
+
}
|
| 489 |
+
|
| 490 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb2-id--ctct-input-margin-top,
|
| 491 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb2-id--ctct-input-margin-right {
|
| 492 |
+
margin-bottom: 0;
|
| 493 |
+
margin-top: 0;
|
| 494 |
+
padding-bottom: 0;
|
| 495 |
+
padding-top: 0;
|
| 496 |
+
}
|
| 497 |
+
|
| 498 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb2-id--ctct-form-label-placement {
|
| 499 |
+
padding-bottom: 0;
|
| 500 |
+
margin-bottom: 0;
|
| 501 |
+
}
|
| 502 |
+
|
| 503 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb-type-text-small {
|
| 504 |
+
border-bottom: none;
|
| 505 |
+
float: left;
|
| 506 |
+
width: 50%;
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
#side-sortables #ctct_1_custom_input_css_metabox .cmb-type-text-small .cmb-th {
|
| 510 |
+
padding-bottom: 0;
|
| 511 |
+
}
|
| 512 |
+
|
| 513 |
+
#adminmenu .wp-submenu a[href="edit.php?post_type=ctct_forms&page=ctct_options_connect"] {
|
| 514 |
+
color: #3ad182;
|
| 515 |
+
}
|
| 516 |
+
|
| 517 |
+
.ctct_options_connect {
|
| 518 |
+
box-sizing: border-box;
|
| 519 |
+
padding: 70px;
|
| 520 |
+
text-align: center;
|
| 521 |
+
width: 100%;
|
| 522 |
+
}
|
| 523 |
+
|
| 524 |
+
.ctct_options_connect hr {
|
| 525 |
+
margin-bottom: 45px;
|
| 526 |
+
}
|
| 527 |
+
|
| 528 |
+
@media screen and (max-width: 782px) {
|
| 529 |
+
.ctct_options_connect {
|
| 530 |
+
padding: 30px 30px 0;
|
| 531 |
+
margin-left: -10px;
|
| 532 |
+
}
|
| 533 |
+
}
|
| 534 |
+
|
| 535 |
+
.ctct_options_connect .ctct-call-to-action {
|
| 536 |
+
margin-bottom: 45px;
|
| 537 |
+
overflow: hidden;
|
| 538 |
+
text-align: left;
|
| 539 |
+
width: 100%;
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
.ctct_options_connect .ctct-call-to-action p {
|
| 543 |
+
float: left;
|
| 544 |
+
margin: 0;
|
| 545 |
+
}
|
| 546 |
+
|
| 547 |
+
.ctct_options_connect .ctct-call-to-action a {
|
| 548 |
+
float: right;
|
| 549 |
+
text-align: center;
|
| 550 |
+
}
|
| 551 |
+
|
| 552 |
+
@media screen and (max-width: 782px) {
|
| 553 |
+
.ctct_options_connect .ctct-call-to-action a {
|
| 554 |
+
float: none;
|
| 555 |
+
}
|
| 556 |
+
}
|
| 557 |
+
|
| 558 |
+
.ctct_options_connect .ctct-call-to-action .ctct-call-to-action-text a {
|
| 559 |
+
float: none;
|
| 560 |
+
}
|
| 561 |
+
|
| 562 |
+
.ctct_options_connect .ctct-call-to-action .ctct-call-to-action-text small {
|
| 563 |
+
line-height: 1.2px;
|
| 564 |
+
}
|
| 565 |
+
|
| 566 |
+
.ctct_options_connect .ctct-call-to-action #subbox {
|
| 567 |
+
height: 40px;
|
| 568 |
+
margin: 15px 0;
|
| 569 |
+
width: 50%;
|
| 570 |
+
}
|
| 571 |
+
|
| 572 |
+
.ctct_options_connect .ctct-call-to-action #subbutton {
|
| 573 |
+
color: #0078C3;
|
| 574 |
+
float: right;
|
| 575 |
+
}
|
| 576 |
+
|
| 577 |
+
@media screen and (max-width: 782px) {
|
| 578 |
+
.ctct_options_connect .ctct-call-to-action #subbutton {
|
| 579 |
+
float: none;
|
| 580 |
+
}
|
| 581 |
+
}
|
| 582 |
+
|
| 583 |
+
.ctct_options_connect img {
|
| 584 |
+
width: 100%;
|
| 585 |
+
max-width: 400px;
|
| 586 |
+
height: auto;
|
| 587 |
+
}
|
| 588 |
+
|
| 589 |
+
.ctct_options_connect h3 {
|
| 590 |
+
color: #005990;
|
| 591 |
+
font-size: 20px;
|
| 592 |
+
line-height: 1.2;
|
| 593 |
+
margin-bottom: 10px;
|
| 594 |
+
margin-top: 10px;
|
| 595 |
+
}
|
| 596 |
+
|
| 597 |
+
.ctct_options_connect p {
|
| 598 |
+
color: #606d78;
|
| 599 |
+
font-size: 14.7px;
|
| 600 |
+
margin: 0;
|
| 601 |
+
}
|
| 602 |
+
|
| 603 |
+
.ctct_options_connect p.ctct-description {
|
| 604 |
+
font-size: 16px;
|
| 605 |
+
margin-bottom: 50px;
|
| 606 |
+
margin-top: 5px;
|
| 607 |
+
}
|
| 608 |
+
|
| 609 |
+
.ctct_options_connect p.small {
|
| 610 |
+
color: #747e88;
|
| 611 |
+
font-size: 13.3px;
|
| 612 |
+
margin: 15px auto 0;
|
| 613 |
+
}
|
| 614 |
+
|
| 615 |
+
@media screen and (max-width: 782px) {
|
| 616 |
+
.ctct_options_connect p.small {
|
| 617 |
+
max-width: 100%;
|
| 618 |
+
}
|
| 619 |
+
}
|
| 620 |
+
|
| 621 |
+
.ctct_options_connect .ctct-body {
|
| 622 |
+
margin: 0 auto;
|
| 623 |
+
max-width: 75%;
|
| 624 |
+
overflow-y: hidden;
|
| 625 |
+
position: relative;
|
| 626 |
+
}
|
| 627 |
+
|
| 628 |
+
.ctct_options_connect .ctct-body:after {
|
| 629 |
+
clear: both;
|
| 630 |
+
content: "";
|
| 631 |
+
display: table;
|
| 632 |
+
}
|
| 633 |
+
|
| 634 |
+
.ctct_options_connect .ctct-body .ctct-call-to-action-text {
|
| 635 |
+
float: left;
|
| 636 |
+
width: 75%;
|
| 637 |
+
}
|
| 638 |
+
|
| 639 |
+
@media screen and (max-width: 782px) {
|
| 640 |
+
.ctct_options_connect .ctct-body .ctct-call-to-action-text {
|
| 641 |
+
width: 100%;
|
| 642 |
+
}
|
| 643 |
+
}
|
| 644 |
+
|
| 645 |
+
.ctct_options_connect .ctct-body .ctct-call-to-action-text h3 {
|
| 646 |
+
margin-top: 0;
|
| 647 |
+
}
|
| 648 |
+
|
| 649 |
+
.ctct_options_connect .ctct-body .clear {
|
| 650 |
+
width: 100%;
|
| 651 |
+
clear: both;
|
| 652 |
+
height: 0;
|
| 653 |
+
}
|
| 654 |
+
|
| 655 |
+
.ctct_options_connect .ctct-body .left,
|
| 656 |
+
.ctct_options_connect .ctct-body .right {
|
| 657 |
+
box-sizing: border-box;
|
| 658 |
+
box-sizing: border-box;
|
| 659 |
+
float: left;
|
| 660 |
+
margin-bottom: -500px;
|
| 661 |
+
padding: 15px 0px 520px;
|
| 662 |
+
text-align: center;
|
| 663 |
+
width: 50%;
|
| 664 |
+
}
|
| 665 |
+
|
| 666 |
+
@media screen and (max-width: 782px) {
|
| 667 |
+
.ctct_options_connect .ctct-body .left,
|
| 668 |
+
.ctct_options_connect .ctct-body .right {
|
| 669 |
+
float: none;
|
| 670 |
+
margin-bottom: 0;
|
| 671 |
+
padding: 15px 0;
|
| 672 |
+
width: 100%;
|
| 673 |
+
}
|
| 674 |
+
}
|
| 675 |
+
|
| 676 |
+
.ctct_options_connect .ctct-body .left img.flare,
|
| 677 |
+
.ctct_options_connect .ctct-body .left svg.flare,
|
| 678 |
+
.ctct_options_connect .ctct-body .right img.flare,
|
| 679 |
+
.ctct_options_connect .ctct-body .right svg.flare {
|
| 680 |
+
width: 180px;
|
| 681 |
+
height: auto;
|
| 682 |
+
}
|
| 683 |
+
|
| 684 |
+
.ctct_options_connect .ctct-body .left {
|
| 685 |
+
border-right: 1px solid #ddd;
|
| 686 |
+
padding-right: 70px;
|
| 687 |
+
}
|
| 688 |
+
|
| 689 |
+
@media screen and (max-width: 782px) {
|
| 690 |
+
.ctct_options_connect .ctct-body .left {
|
| 691 |
+
border-bottom: 1px solid #ddd;
|
| 692 |
+
border-right: 0;
|
| 693 |
+
padding-bottom: 30px;
|
| 694 |
+
padding-right: 0;
|
| 695 |
+
}
|
| 696 |
+
}
|
| 697 |
+
|
| 698 |
+
.ctct_options_connect .ctct-body .left p {
|
| 699 |
+
max-width: 220px;
|
| 700 |
+
margin: 0 auto 25px;
|
| 701 |
+
}
|
| 702 |
+
|
| 703 |
+
@media screen and (max-width: 782px) {
|
| 704 |
+
.ctct_options_connect .ctct-body .left p {
|
| 705 |
+
max-width: 100%;
|
| 706 |
+
}
|
| 707 |
+
}
|
| 708 |
+
|
| 709 |
+
.ctct_options_connect .ctct-body .right {
|
| 710 |
+
padding-left: 70px;
|
| 711 |
+
}
|
| 712 |
+
|
| 713 |
+
@media screen and (max-width: 782px) {
|
| 714 |
+
.ctct_options_connect .ctct-body .right {
|
| 715 |
+
padding-left: 0;
|
| 716 |
+
padding-top: 30px;
|
| 717 |
+
}
|
| 718 |
+
}
|
| 719 |
+
|
| 720 |
+
.ctct_options_connect .ctct-body .right p {
|
| 721 |
+
display: block;
|
| 722 |
+
max-width: 350px;
|
| 723 |
+
margin: 0 auto 25px;
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
@media screen and (max-width: 782px) {
|
| 727 |
+
.ctct_options_connect .ctct-body .right p {
|
| 728 |
+
max-width: 100%;
|
| 729 |
+
}
|
| 730 |
+
}
|
| 731 |
+
|
| 732 |
+
.ctct_options_connect .ctct-body .button {
|
| 733 |
+
border-radius: 4px;
|
| 734 |
+
color: #fff;
|
| 735 |
+
font-size: 16px;
|
| 736 |
+
font-weight: 600;
|
| 737 |
+
height: auto;
|
| 738 |
+
line-height: 1;
|
| 739 |
+
margin-bottom: 10px;
|
| 740 |
+
min-width: 180px;
|
| 741 |
+
padding: 14px 30px;
|
| 742 |
+
}
|
| 743 |
+
|
| 744 |
+
.ctct_options_connect .ctct-body .button.button-orange {
|
| 745 |
+
background-color: #FFA901;
|
| 746 |
+
border: 1px solid #cd8800;
|
| 747 |
+
}
|
| 748 |
+
|
| 749 |
+
.ctct_options_connect .ctct-body .button.button-orange:hover, .ctct_options_connect .ctct-body .button.button-orange:focus {
|
| 750 |
+
background-color: #cd8800;
|
| 751 |
+
}
|
| 752 |
+
|
| 753 |
+
.ctct_options_connect .ctct-body .button.button-blue {
|
| 754 |
+
background-color: #0078C3;
|
| 755 |
+
border: 1px solid #005990;
|
| 756 |
+
}
|
| 757 |
+
|
| 758 |
+
.ctct_options_connect .ctct-body .button.button-blue:hover, .ctct_options_connect .ctct-body .button.button-blue:focus {
|
| 759 |
+
background-color: #005990;
|
| 760 |
+
}
|
| 761 |
+
|
| 762 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step {
|
| 763 |
+
margin-bottom: 40px;
|
| 764 |
+
}
|
| 765 |
+
|
| 766 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step h3 {
|
| 767 |
+
color: #2ECC40;
|
| 768 |
+
}
|
| 769 |
+
|
| 770 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-disconnect-text {
|
| 771 |
+
float: left;
|
| 772 |
+
margin-bottom: 50px;
|
| 773 |
+
overflow: hidden;
|
| 774 |
+
text-align: left;
|
| 775 |
+
}
|
| 776 |
+
|
| 777 |
+
.ctct_options_connect .ctct-body .ctct-connected form {
|
| 778 |
+
float: right;
|
| 779 |
+
}
|
| 780 |
+
|
| 781 |
+
.ctct_options_connect .ctct-body .ctct-connected .button {
|
| 782 |
+
color: #0078C3;
|
| 783 |
+
}
|
| 784 |
+
|
| 785 |
+
.ctct_options_connect .ctct-body .ctct-connected .button.button-blue {
|
| 786 |
+
color: #fff;
|
| 787 |
+
}
|
| 788 |
+
|
| 789 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-connected-next-step {
|
| 790 |
+
clear: both;
|
| 791 |
+
}
|
| 792 |
+
|
| 793 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-connect-ga-optin {
|
| 794 |
+
margin-top: 15px;
|
| 795 |
+
}
|
| 796 |
+
|
| 797 |
+
@media screen and (max-width: 782px) {
|
| 798 |
+
.ctct_options_connect .ctct-body .ctct-connected .ctct-disconnect-text {
|
| 799 |
+
float: none;
|
| 800 |
+
text-align: center;
|
| 801 |
+
}
|
| 802 |
+
.ctct_options_connect .ctct-body .ctct-connected form {
|
| 803 |
+
float: none;
|
| 804 |
+
}
|
| 805 |
+
}
|
| 806 |
+
|
| 807 |
+
.error {
|
| 808 |
+
background: none !important;
|
| 809 |
+
border-left: 1px solid #FF4136 !important;
|
| 810 |
+
border-radius: 3px;
|
| 811 |
+
border: 1px solid #FF4136;
|
| 812 |
+
box-shadow: none !important;
|
| 813 |
+
display: inline-block;
|
| 814 |
+
margin: 0 0 20px 0 !important;
|
| 815 |
+
}
|
| 816 |
+
|
| 817 |
+
.error p {
|
| 818 |
+
color: #FF4136 !important;
|
| 819 |
+
}
|
| 820 |
+
|
| 821 |
+
.updated.ctct-admin-notice,
|
| 822 |
+
.error.ctct-admin-notice {
|
| 823 |
+
padding: 1em 38px 1em 1em;
|
| 824 |
+
position: relative;
|
| 825 |
+
}
|
| 826 |
+
|
| 827 |
+
a.ctct-notice-dismiss {
|
| 828 |
+
text-decoration: none;
|
| 829 |
+
}
|
| 830 |
+
|
| 831 |
+
#ctct-admin-notice-activation {
|
| 832 |
+
padding: 1em 1em 0 1em;
|
| 833 |
+
}
|
| 834 |
+
|
| 835 |
+
#ctct-admin-notice-activation .ctct-notice-intro {
|
| 836 |
+
max-width: 600px;
|
| 837 |
+
line-height: 1.5em;
|
| 838 |
+
}
|
| 839 |
+
|
| 840 |
+
#ctct-admin-notice-activation .ctct-notice-button,
|
| 841 |
+
#ctct-admin-notice-activation .ctct-notice-button:active {
|
| 842 |
+
vertical-align: middle;
|
| 843 |
+
margin: .5em;
|
| 844 |
+
}
|
| 845 |
+
|
| 846 |
+
.ctct-admin-notice {
|
| 847 |
+
overflow: hidden;
|
| 848 |
+
}
|
| 849 |
+
|
| 850 |
+
.ctct-admin-notice.updated {
|
| 851 |
+
border-left-color: #1a5285;
|
| 852 |
+
}
|
| 853 |
+
|
| 854 |
+
.ctct-admin-notice > div {
|
| 855 |
+
float: left;
|
| 856 |
+
}
|
| 857 |
+
|
| 858 |
+
.ctct-admin-notice .admin-notice-message {
|
| 859 |
+
margin-left: 15px;
|
| 860 |
+
width: 80%;
|
| 861 |
+
}
|
| 862 |
+
|
| 863 |
+
.ctct-admin-notice .admin-notice-message h4 {
|
| 864 |
+
color: #1a5285;
|
| 865 |
+
margin: 0 0 10px;
|
| 866 |
+
}
|
| 867 |
+
|
| 868 |
+
.ctct-admin-notice .admin-notice-message > div {
|
| 869 |
+
float: left;
|
| 870 |
+
}
|
| 871 |
+
|
| 872 |
+
.constant-contact-about {
|
| 873 |
+
padding: 15px;
|
| 874 |
+
}
|
| 875 |
+
|
| 876 |
+
@media screen and (max-width: 782px) {
|
| 877 |
+
.constant-contact-about {
|
| 878 |
+
padding: 0;
|
| 879 |
+
}
|
| 880 |
+
}
|
| 881 |
+
|
| 882 |
+
.constant-contact-about .ctct-section {
|
| 883 |
+
margin-bottom: 50px;
|
| 884 |
+
}
|
| 885 |
+
|
| 886 |
+
.constant-contact-about h1.about-header {
|
| 887 |
+
color: #1a5285;
|
| 888 |
+
font-size: 26px;
|
| 889 |
+
margin: 0 0 15px 0;
|
| 890 |
+
}
|
| 891 |
+
|
| 892 |
+
.constant-contact-about h3 {
|
| 893 |
+
padding: 20px 0;
|
| 894 |
+
}
|
| 895 |
+
|
| 896 |
+
.constant-contact-about p {
|
| 897 |
+
font-size: 16px;
|
| 898 |
+
font-weight: 300;
|
| 899 |
+
color: #333333;
|
| 900 |
+
}
|
| 901 |
+
|
| 902 |
+
.constant-contact-about .clear {
|
| 903 |
+
width: 100%;
|
| 904 |
+
clear: both;
|
| 905 |
+
height: 0;
|
| 906 |
+
}
|
| 907 |
+
|
| 908 |
+
.constant-contact-about .button {
|
| 909 |
+
border-radius: 4px;
|
| 910 |
+
color: #fff;
|
| 911 |
+
font-size: 16px;
|
| 912 |
+
font-weight: 600;
|
| 913 |
+
height: auto;
|
| 914 |
+
line-height: 1;
|
| 915 |
+
margin-bottom: 10px;
|
| 916 |
+
min-width: 180px;
|
| 917 |
+
padding: 14px 30px;
|
| 918 |
+
text-align: center;
|
| 919 |
+
}
|
| 920 |
+
|
| 921 |
+
.constant-contact-about .button.button-orange {
|
| 922 |
+
background-color: #FFA901;
|
| 923 |
+
border: 1px solid #cd8800;
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
.constant-contact-about .button.button-orange:hover, .constant-contact-about .button.button-orange:focus {
|
| 927 |
+
background-color: #cd8800;
|
| 928 |
+
}
|
| 929 |
+
|
| 930 |
+
.constant-contact-about .button.button-blue {
|
| 931 |
+
background-color: #0078C3;
|
| 932 |
+
border: 1px solid #005990;
|
| 933 |
+
}
|
| 934 |
+
|
| 935 |
+
.constant-contact-about .button.button-blue:hover, .constant-contact-about .button.button-blue:focus {
|
| 936 |
+
background-color: #005990;
|
| 937 |
+
}
|
| 938 |
+
|
| 939 |
+
.constant-contact-about .about-text {
|
| 940 |
+
margin: 0 50px 0 0;
|
| 941 |
+
}
|
| 942 |
+
|
| 943 |
+
@media screen and (max-width: 482px) {
|
| 944 |
+
.constant-contact-about .about-text {
|
| 945 |
+
margiun: 0;
|
| 946 |
+
}
|
| 947 |
+
}
|
| 948 |
+
|
| 949 |
+
.constant-contact-about .feature-section.two-col > div {
|
| 950 |
+
width: 49%;
|
| 951 |
+
float: left;
|
| 952 |
+
}
|
| 953 |
+
|
| 954 |
+
.constant-contact-about .headline-feature {
|
| 955 |
+
max-width: 90%;
|
| 956 |
+
}
|
| 957 |
+
|
| 958 |
+
@media screen and (max-width: 782px) {
|
| 959 |
+
.constant-contact-about .headline-feature {
|
| 960 |
+
max-width: 100%;
|
| 961 |
+
}
|
| 962 |
+
}
|
| 963 |
+
|
| 964 |
+
.constant-contact-about .headline-feature p {
|
| 965 |
+
margin-bottom: 0;
|
| 966 |
+
}
|
| 967 |
+
|
| 968 |
+
.constant-contact-about .headline-feature h5 {
|
| 969 |
+
font-weight: 300;
|
| 970 |
+
color: #747e88;
|
| 971 |
+
font-style: italic;
|
| 972 |
+
}
|
| 973 |
+
|
| 974 |
+
.constant-contact-about .headline-title, .constant-contact-about .c-text {
|
| 975 |
+
text-align: center;
|
| 976 |
+
}
|
| 977 |
+
|
| 978 |
+
.constant-contact-about .featured-image {
|
| 979 |
+
min-height: 150px;
|
| 980 |
+
position: relative;
|
| 981 |
+
}
|
| 982 |
+
|
| 983 |
+
.constant-contact-about .fff-img {
|
| 984 |
+
height: 315px;
|
| 985 |
+
margin: 20px;
|
| 986 |
+
overflow: hidden;
|
| 987 |
+
max-width: 720px;
|
| 988 |
+
}
|
| 989 |
+
|
| 990 |
+
.constant-contact-about .introduction {
|
| 991 |
+
padding: 20px 0;
|
| 992 |
+
}
|
| 993 |
+
|
| 994 |
+
.constant-contact-about .featured-title {
|
| 995 |
+
color: white;
|
| 996 |
+
font-size: 2em;
|
| 997 |
+
font-weight: bold;
|
| 998 |
+
margin: 0 auto;
|
| 999 |
+
position: absolute;
|
| 1000 |
+
text-align: center;
|
| 1001 |
+
text-shadow: 0 0 15px #000;
|
| 1002 |
+
top: 80px;
|
| 1003 |
+
width: 100%;
|
| 1004 |
+
}
|
| 1005 |
+
|
| 1006 |
+
@media screen and (max-width: 482px) {
|
| 1007 |
+
.constant-contact-about .featured-title {
|
| 1008 |
+
color: #1a5285;
|
| 1009 |
+
font-size: 26px;
|
| 1010 |
+
line-height: 28px;
|
| 1011 |
+
margin-top: 15px;
|
| 1012 |
+
position: relative;
|
| 1013 |
+
text-shadow: none;
|
| 1014 |
+
top: 0;
|
| 1015 |
+
}
|
| 1016 |
+
}
|
| 1017 |
+
|
| 1018 |
+
.constant-contact-about .featured-introduction {
|
| 1019 |
+
color: white;
|
| 1020 |
+
font-size: 1.2em;
|
| 1021 |
+
margin: 0 auto;
|
| 1022 |
+
position: absolute;
|
| 1023 |
+
text-align: center;
|
| 1024 |
+
text-shadow: 0 0 15px #000;
|
| 1025 |
+
top: 120px;
|
| 1026 |
+
width: 100%;
|
| 1027 |
+
}
|
| 1028 |
+
|
| 1029 |
+
@media screen and (max-width: 482px) {
|
| 1030 |
+
.constant-contact-about .featured-introduction {
|
| 1031 |
+
color: #1a5285;
|
| 1032 |
+
line-height: 1;
|
| 1033 |
+
margin-top: 15px;
|
| 1034 |
+
position: relative;
|
| 1035 |
+
text-shadow: none;
|
| 1036 |
+
top: 0;
|
| 1037 |
+
}
|
| 1038 |
+
}
|
| 1039 |
+
|
| 1040 |
+
.constant-contact-about .hide-overflow {
|
| 1041 |
+
overflow: hidden;
|
| 1042 |
+
position: relative;
|
| 1043 |
+
}
|
| 1044 |
+
|
| 1045 |
+
.constant-contact-about .hide-overflow hr {
|
| 1046 |
+
margin-top: 30px;
|
| 1047 |
+
}
|
| 1048 |
+
|
| 1049 |
+
.constant-contact-about .hide-overflow h2 {
|
| 1050 |
+
font-weight: 400;
|
| 1051 |
+
font-size: 16px;
|
| 1052 |
+
color: #1a5285;
|
| 1053 |
+
text-align: left;
|
| 1054 |
+
margin-top: 30px;
|
| 1055 |
+
}
|
| 1056 |
+
|
| 1057 |
+
.constant-contact-about .left-side {
|
| 1058 |
+
float: left;
|
| 1059 |
+
box-sizing: border-box;
|
| 1060 |
+
padding-right: 160px;
|
| 1061 |
+
}
|
| 1062 |
+
|
| 1063 |
+
@media screen and (max-width: 482px) {
|
| 1064 |
+
.constant-contact-about .left-side {
|
| 1065 |
+
padding-right: 0;
|
| 1066 |
+
}
|
| 1067 |
+
}
|
| 1068 |
+
|
| 1069 |
+
.constant-contact-about .plugin-badge {
|
| 1070 |
+
float: right;
|
| 1071 |
+
max-height: 180px;
|
| 1072 |
+
max-width: 160px;
|
| 1073 |
+
margin-left: 40px;
|
| 1074 |
+
}
|
| 1075 |
+
|
| 1076 |
+
@media screen and (max-width: 482px) {
|
| 1077 |
+
.constant-contact-about .plugin-badge {
|
| 1078 |
+
display: none;
|
| 1079 |
+
}
|
| 1080 |
+
}
|
| 1081 |
+
|
| 1082 |
+
.constant-contact-about .feature-image {
|
| 1083 |
+
text-align: center;
|
| 1084 |
+
}
|
| 1085 |
+
|
| 1086 |
+
.cc-a-block {
|
| 1087 |
+
margin: 0 auto;
|
| 1088 |
+
max-width: 90%;
|
| 1089 |
+
padding: 50px 0;
|
| 1090 |
+
text-align: center;
|
| 1091 |
+
}
|
| 1092 |
+
|
| 1093 |
+
.cc-a-block:after {
|
| 1094 |
+
clear: both;
|
| 1095 |
+
content: "";
|
| 1096 |
+
display: table;
|
| 1097 |
+
}
|
| 1098 |
+
|
| 1099 |
+
@media screen and (max-width: 482px) {
|
| 1100 |
+
.cc-a-block {
|
| 1101 |
+
padding: 25px 0;
|
| 1102 |
+
}
|
| 1103 |
+
}
|
| 1104 |
+
|
| 1105 |
+
.cc-a-block h3 {
|
| 1106 |
+
color: #1a5285;
|
| 1107 |
+
font-size: 21px;
|
| 1108 |
+
font-weight: 300;
|
| 1109 |
+
height: 63px;
|
| 1110 |
+
margin: 0 auto;
|
| 1111 |
+
max-width: 70%;
|
| 1112 |
+
}
|
| 1113 |
+
|
| 1114 |
+
@media screen and (max-width: 782px) {
|
| 1115 |
+
.cc-a-block h3 {
|
| 1116 |
+
height: auto;
|
| 1117 |
+
max-width: 100%;
|
| 1118 |
+
}
|
| 1119 |
+
}
|
| 1120 |
+
|
| 1121 |
+
.cc-a-block .left,
|
| 1122 |
+
.cc-a-block .right {
|
| 1123 |
+
float: left;
|
| 1124 |
+
width: 50%;
|
| 1125 |
+
}
|
| 1126 |
+
|
| 1127 |
+
.cc-a-block .left:after,
|
| 1128 |
+
.cc-a-block .right:after {
|
| 1129 |
+
clear: both;
|
| 1130 |
+
content: "";
|
| 1131 |
+
display: table;
|
| 1132 |
+
}
|
| 1133 |
+
|
| 1134 |
+
@media screen and (max-width: 482px) {
|
| 1135 |
+
.cc-a-block .left,
|
| 1136 |
+
.cc-a-block .right {
|
| 1137 |
+
width: 100%;
|
| 1138 |
+
float: none;
|
| 1139 |
+
}
|
| 1140 |
+
}
|
| 1141 |
+
|
| 1142 |
+
.cc-a-block .left .ad-1,
|
| 1143 |
+
.cc-a-block .left .ad-2,
|
| 1144 |
+
.cc-a-block .right .ad-1,
|
| 1145 |
+
.cc-a-block .right .ad-2 {
|
| 1146 |
+
width: 90%;
|
| 1147 |
+
}
|
| 1148 |
+
|
| 1149 |
+
@media screen and (max-width: 482px) {
|
| 1150 |
+
.cc-a-block .left .ad-1,
|
| 1151 |
+
.cc-a-block .left .ad-2,
|
| 1152 |
+
.cc-a-block .right .ad-1,
|
| 1153 |
+
.cc-a-block .right .ad-2 {
|
| 1154 |
+
width: 100%;
|
| 1155 |
+
float: none;
|
| 1156 |
+
}
|
| 1157 |
+
}
|
| 1158 |
+
|
| 1159 |
+
.cc-a-block .left .ad-1 img,
|
| 1160 |
+
.cc-a-block .left .ad-2 img,
|
| 1161 |
+
.cc-a-block .right .ad-1 img,
|
| 1162 |
+
.cc-a-block .right .ad-2 img {
|
| 1163 |
+
width: 100%;
|
| 1164 |
+
height: auto;
|
| 1165 |
+
}
|
| 1166 |
+
|
| 1167 |
+
.cc-a-block .left .ad-1,
|
| 1168 |
+
.cc-a-block .right .ad-1 {
|
| 1169 |
+
float: left;
|
| 1170 |
+
}
|
| 1171 |
+
|
| 1172 |
+
.cc-a-block .left .ad-1 h3,
|
| 1173 |
+
.cc-a-block .right .ad-1 h3 {
|
| 1174 |
+
padding-top: 35px;
|
| 1175 |
+
height: 47px;
|
| 1176 |
+
}
|
| 1177 |
+
|
| 1178 |
+
.cc-a-block .left .ad-2,
|
| 1179 |
+
.cc-a-block .right .ad-2 {
|
| 1180 |
+
float: right;
|
| 1181 |
+
}
|
| 1182 |
+
|
| 1183 |
+
.ctct-bonus-points {
|
| 1184 |
+
list-style: circle;
|
| 1185 |
+
padding-left: 50px;
|
| 1186 |
+
font-size: 16px;
|
| 1187 |
+
font-weight: 300;
|
| 1188 |
+
color: #2b5e8c;
|
| 1189 |
+
}
|
| 1190 |
+
|
| 1191 |
+
.section-try-us .ctct-bonus-points {
|
| 1192 |
+
margin-bottom: 50px;
|
| 1193 |
+
}
|
| 1194 |
+
|
| 1195 |
+
.section-try-us a.button {
|
| 1196 |
+
margin-right: 40px;
|
| 1197 |
+
}
|
| 1198 |
+
|
| 1199 |
+
.section-try-us a.ctct-connect {
|
| 1200 |
+
font-weight: bold;
|
| 1201 |
+
}
|
| 1202 |
+
|
| 1203 |
+
.section-marketing-tips #subbox {
|
| 1204 |
+
height: 40px;
|
| 1205 |
+
width: 50%;
|
| 1206 |
+
}
|
| 1207 |
+
|
| 1208 |
+
#cmb2-metabox-ctct_option_metabox_settings .regular-text {
|
| 1209 |
+
width: 500px;
|
| 1210 |
+
}
|
| 1211 |
+
|
| 1212 |
+
.cmb2-options-page #ctct_option_metabox_settings .cmb2-metabox > .cmb-row {
|
| 1213 |
+
background: transparent;
|
| 1214 |
+
border: none;
|
| 1215 |
+
box-shadow: none;
|
| 1216 |
+
}
|
| 1217 |
+
|
| 1218 |
+
.ctct-body #ctct_error_logs {
|
| 1219 |
+
height: 400px;
|
| 1220 |
+
resize: vertical;
|
| 1221 |
+
width: 100%;
|
| 1222 |
+
}
|
| 1223 |
+
|
| 1224 |
+
.ctct-logo {
|
| 1225 |
+
max-width: 400px;
|
| 1226 |
+
}
|
| 1227 |
+
|
| 1228 |
+
.ctct_options_connect {
|
| 1229 |
+
box-sizing: border-box;
|
| 1230 |
+
padding: 70px;
|
| 1231 |
+
text-align: center;
|
| 1232 |
+
width: 100%;
|
| 1233 |
+
}
|
| 1234 |
+
|
| 1235 |
+
@media screen and (max-width: 782px) {
|
| 1236 |
+
.ctct_options_connect {
|
| 1237 |
+
padding: 30px 30px 0;
|
| 1238 |
+
margin-left: -10px;
|
| 1239 |
+
}
|
| 1240 |
+
}
|
| 1241 |
+
|
| 1242 |
+
.ctct_options_connect img {
|
| 1243 |
+
width: 100%;
|
| 1244 |
+
max-width: 400px;
|
| 1245 |
+
height: auto;
|
| 1246 |
+
}
|
| 1247 |
+
|
| 1248 |
+
.ctct_options_connect p {
|
| 1249 |
+
color: #606d78;
|
| 1250 |
+
font-size: 16px;
|
| 1251 |
+
}
|
| 1252 |
+
|
| 1253 |
+
.ctct_options_connect .ctct-description {
|
| 1254 |
+
text-align: left;
|
| 1255 |
+
}
|
| 1256 |
+
|
| 1257 |
+
.ctct_options_connect .ctct-body {
|
| 1258 |
+
margin: 0 auto;
|
| 1259 |
+
max-width: 75%;
|
| 1260 |
+
overflow-y: hidden;
|
| 1261 |
+
padding: 0 15px;
|
| 1262 |
+
position: relative;
|
| 1263 |
+
}
|
| 1264 |
+
|
| 1265 |
+
.ctct_options_connect .ctct-body:after {
|
| 1266 |
+
clear: both;
|
| 1267 |
+
content: "";
|
| 1268 |
+
display: table;
|
| 1269 |
+
}
|
| 1270 |
+
|
| 1271 |
+
.ctct_options_connect .ctct-body .notice {
|
| 1272 |
+
background: none;
|
| 1273 |
+
border-left: none;
|
| 1274 |
+
box-shadow: none;
|
| 1275 |
+
margin: 0 0 20px 0;
|
| 1276 |
+
padding: 0;
|
| 1277 |
+
}
|
| 1278 |
+
|
| 1279 |
+
.ctct_options_connect .ctct-body .button {
|
| 1280 |
+
border-radius: 4px;
|
| 1281 |
+
color: #fff;
|
| 1282 |
+
font-size: 16px;
|
| 1283 |
+
font-weight: 600;
|
| 1284 |
+
height: auto;
|
| 1285 |
+
line-height: 1;
|
| 1286 |
+
margin-bottom: 10px;
|
| 1287 |
+
min-width: 180px;
|
| 1288 |
+
padding: 14px 30px;
|
| 1289 |
+
}
|
| 1290 |
+
|
| 1291 |
+
.ctct_options_connect .ctct-body .button.button-orange {
|
| 1292 |
+
background-color: #FFA901;
|
| 1293 |
+
border: 1px solid #cd8800;
|
| 1294 |
+
}
|
| 1295 |
+
|
| 1296 |
+
.ctct_options_connect .ctct-body .button.button-orange:hover, .ctct_options_connect .ctct-body .button.button-orange:focus {
|
| 1297 |
+
background-color: #cd8800;
|
| 1298 |
+
}
|
| 1299 |
+
|
| 1300 |
+
.ctct_options_connect .ctct-body .button.button-blue {
|
| 1301 |
+
background-color: #0078C3;
|
| 1302 |
+
border: 1px solid #005990;
|
| 1303 |
+
}
|
| 1304 |
+
|
| 1305 |
+
.ctct_options_connect .ctct-body .button.button-blue:hover, .ctct_options_connect .ctct-body .button.button-blue:focus {
|
| 1306 |
+
background-color: #005990;
|
| 1307 |
+
}
|
assets/css/oath.css
DELETED
|
@@ -1,84 +0,0 @@
|
|
| 1 |
-
.ctct-logo {
|
| 2 |
-
max-width: 400px;
|
| 3 |
-
}
|
| 4 |
-
|
| 5 |
-
.ctct_options_connect {
|
| 6 |
-
box-sizing: border-box;
|
| 7 |
-
padding: 70px;
|
| 8 |
-
text-align: center;
|
| 9 |
-
width: 100%;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
@media screen and (max-width: 782px) {
|
| 13 |
-
.ctct_options_connect {
|
| 14 |
-
padding: 30px 30px 0;
|
| 15 |
-
margin-left: -10px;
|
| 16 |
-
}
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
.ctct_options_connect img {
|
| 20 |
-
width: 100%;
|
| 21 |
-
max-width: 400px;
|
| 22 |
-
height: auto;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
.ctct_options_connect p {
|
| 26 |
-
color: #606d78;
|
| 27 |
-
font-size: 16px;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
.ctct_options_connect .ctct-description {
|
| 31 |
-
text-align: left;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
.ctct_options_connect .ctct-body {
|
| 35 |
-
margin: 0 auto;
|
| 36 |
-
max-width: 75%;
|
| 37 |
-
overflow-y: hidden;
|
| 38 |
-
padding: 0 15px;
|
| 39 |
-
position: relative;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
.ctct_options_connect .ctct-body:after {
|
| 43 |
-
clear: both;
|
| 44 |
-
content: "";
|
| 45 |
-
display: table;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
.ctct_options_connect .ctct-body .notice {
|
| 49 |
-
background: none;
|
| 50 |
-
border-left: none;
|
| 51 |
-
box-shadow: none;
|
| 52 |
-
margin: 0 0 20px 0;
|
| 53 |
-
padding: 0;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
.ctct_options_connect .ctct-body .button {
|
| 57 |
-
border-radius: 4px;
|
| 58 |
-
color: #fff;
|
| 59 |
-
font-size: 16px;
|
| 60 |
-
font-weight: 600;
|
| 61 |
-
height: auto;
|
| 62 |
-
line-height: 1;
|
| 63 |
-
margin-bottom: 10px;
|
| 64 |
-
min-width: 180px;
|
| 65 |
-
padding: 14px 30px;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
.ctct_options_connect .ctct-body .button.button-orange {
|
| 69 |
-
background-color: #FFA901;
|
| 70 |
-
border: 1px solid #cd8800;
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
.ctct_options_connect .ctct-body .button.button-orange:hover, .ctct_options_connect .ctct-body .button.button-orange:focus {
|
| 74 |
-
background-color: #cd8800;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
.ctct_options_connect .ctct-body .button.button-blue {
|
| 78 |
-
background-color: #0078C3;
|
| 79 |
-
border: 1px solid #005990;
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
.ctct_options_connect .ctct-body .button.button-blue:hover, .ctct_options_connect .ctct-body .button.button-blue:focus {
|
| 83 |
-
background-color: #005990;
|
| 84 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/style.css
CHANGED
|
@@ -58,6 +58,36 @@
|
|
| 58 |
padding-left: 40px;
|
| 59 |
}
|
| 60 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 61 |
.ctct-form-wrapper #ctct_usage {
|
| 62 |
position: absolute;
|
| 63 |
overflow: hidden;
|
|
@@ -69,12 +99,31 @@
|
|
| 69 |
padding: 0px;
|
| 70 |
}
|
| 71 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 72 |
.ctct-form-wrapper .ctct-form:after {
|
| 73 |
clear: both;
|
| 74 |
content: "";
|
| 75 |
display: table;
|
| 76 |
}
|
| 77 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 78 |
.ctct-form-wrapper .ctct-form abbr {
|
| 79 |
border: none;
|
| 80 |
color: #FF4136;
|
|
@@ -131,4 +180,4 @@
|
|
| 131 |
}
|
| 132 |
}
|
| 133 |
|
| 134 |
-
/*# sourceMappingURL=data:application/json;charset=utf8;base64,
|
| 58 |
padding-left: 40px;
|
| 59 |
}
|
| 60 |
|
| 61 |
+
.ctct-form-wrapper input.ctct-label-left,
|
| 62 |
+
.ctct-form-wrapper textarea.ctct-label-left {
|
| 63 |
+
display: inline-block;
|
| 64 |
+
width: 75%;
|
| 65 |
+
}
|
| 66 |
+
|
| 67 |
+
.ctct-form-wrapper span.ctct-label-left {
|
| 68 |
+
display: inline-block;
|
| 69 |
+
margin-right: 5%;
|
| 70 |
+
width: 20%;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
.ctct-form-wrapper input.ctct-label-right,
|
| 74 |
+
.ctct-form-wrapper textarea.ctct-label-right {
|
| 75 |
+
display: inline-block;
|
| 76 |
+
margin-right: 5%;
|
| 77 |
+
width: 75%;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
.ctct-form-wrapper span.ctct-label-right {
|
| 81 |
+
display: inline-block;
|
| 82 |
+
width: 20%;
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
.ctct-form-wrapper span.ctct-label-hidden {
|
| 86 |
+
left: -9999px !important;
|
| 87 |
+
position: absolute !important;
|
| 88 |
+
top: -9999px !important;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
.ctct-form-wrapper #ctct_usage {
|
| 92 |
position: absolute;
|
| 93 |
overflow: hidden;
|
| 99 |
padding: 0px;
|
| 100 |
}
|
| 101 |
|
| 102 |
+
.ctct-form-wrapper #ctct-submitted:disabled {
|
| 103 |
+
background-image: url("../images/oval.min.svg");
|
| 104 |
+
background-position: center;
|
| 105 |
+
background-repeat: no-repeat;
|
| 106 |
+
color: transparent;
|
| 107 |
+
cursor: wait;
|
| 108 |
+
opacity: 0.3;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
.ctct-form-wrapper .ctct-form:after {
|
| 112 |
clear: both;
|
| 113 |
content: "";
|
| 114 |
display: table;
|
| 115 |
}
|
| 116 |
|
| 117 |
+
.ctct-form-wrapper .ctct-form .ctct-label-top label,
|
| 118 |
+
.ctct-form-wrapper .ctct-form .ctct-label-bottom label {
|
| 119 |
+
display: block;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
.ctct-form-wrapper .ctct-form .ctct-label-left label,
|
| 123 |
+
.ctct-form-wrapper .ctct-form .ctct-label-right label {
|
| 124 |
+
display: inline-block;
|
| 125 |
+
}
|
| 126 |
+
|
| 127 |
.ctct-form-wrapper .ctct-form abbr {
|
| 128 |
border: none;
|
| 129 |
color: #FF4136;
|
| 180 |
}
|
| 181 |
}
|
| 182 |
|
| 183 |
+
/*# sourceMappingURL=data:application/json;charset=utf8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbInN0eWxlLmNzcyJdLCJuYW1lcyI6W10sIm1hcHBpbmdzIjoiQUFBQTtFQUNFLGlCQUFpQjtDQUNsQjs7QUFFRDtFQUNFLGtCQUFrQjtFQUNsQixhQUFhO0NBQ2Q7O0FBRUQ7RUFDRSwwQ0FBMEM7RUFDMUMsc0JBQXNCO0VBQ3RCLGVBQWU7Q0FDaEI7O0FBRUQ7RUFDRSwwQ0FBMEM7RUFDMUMsc0JBQXNCO0VBQ3RCLGVBQWU7Q0FDaEI7O0FBRUQ7RUFDRSxnQkFBZ0I7Q0FDakI7O0FBRUQ7RUFDRSxzQkFBc0I7Q0FDdkI7O0FBbUNEO0VBQ0UsOERBQThEO0VBQzlELDZCQUE2QjtFQUM3QixzQkFBc0I7RUFDdEIsc0JBQXNCO0VBQ3RCLG1CQUFtQjtDQUNwQjs7QUFFRDtFQUNFLHVEQUF1RDtFQUN2RCwwQ0FBMEM7RUFDMUMsNkJBQTZCO0VBQzdCLHNCQUFzQjtFQUN0QixzQkFBc0I7RUFDdEIsbUJBQW1CO0NBQ3BCOztBQUVEO0VBQ0Usa0JBQWtCO0VBQ2xCLG1CQUFtQjtDQUNwQjs7QUFFRDtFQUNFLHVEQUF1RDtFQUN2RCwwQ0FBMEM7RUFDMUMsNkJBQTZCO0VBQzdCLHNCQUFzQjtFQUN0QixzQkFBc0I7RUFDdEIsbUJBQW1CO0NBQ3BCOztBQUVEOztFQUVFLHNCQUFzQjtFQUN0QixXQUFXO0NBQ1o7O0FBRUQ7RUFDRSxzQkFBc0I7RUFDdEIsaUJBQWlCO0VBQ2pCLFdBQVc7Q0FDWjs7QUFFRDs7RUFFRSxzQkFBc0I7RUFDdEIsaUJBQWlCO0VBQ2pCLFdBQVc7Q0FDWjs7QUFFRDtFQUNFLHNCQUFzQjtFQUN0QixXQUFXO0NBQ1o7O0FBRUQ7RUFDRSx5QkFBeUI7RUFDekIsOEJBQThCO0VBQzlCLHdCQUF3QjtDQUN6Qjs7QUFFRDtFQUNFLG1CQUFtQjtFQUNuQixpQkFBaUI7RUFDakIsK0JBQStCO0VBQy9CLFlBQVk7RUFDWixXQUFXO0VBQ1gsYUFBYTtFQUNiLGlCQUFpQjtFQUNqQixhQUFhO0NBQ2Q7O0FBRUQ7RUFDRSxnREFBZ0Q7RUFDaEQsNEJBQTRCO0VBQzVCLDZCQUE2QjtFQUM3QixtQkFBbUI7RUFDbkIsYUFBYTtFQUNiLGFBQWE7Q0FDZDs7QUFFRDtFQUNFLFlBQVk7RUFDWixZQUFZO0VBQ1osZUFBZTtDQUNoQjs7QUFFRDs7RUFFRSxlQUFlO0NBQ2hCOztBQUVEOztFQUVFLHNCQUFzQjtDQUN2Qjs7QUFFRDtFQUNFLGFBQWE7RUFDYixlQUFlO0VBQ2YsaUJBQWlCO0NBQ2xCOztBQUVEO0VBQ0UsWUFBWTtFQUNaLGlCQUFpQjtDQUNsQjs7QUFFRDtFQUNFLGVBQWU7Q0FDaEI7O0FBRUQ7RUFDRSxnQkFBZ0I7Q0FDakI7O0FBRUQ7RUFDRSxZQUFZO0NBQ2I7O0FBdkpEOztFQUNFO0lBQ0UsWUFBWTtJQUNaLGlCQUFpQjtJQUNqQixXQUFXO0dBQ1o7O0VBQ0Q7SUFDRSxnQkFBZ0I7R0FDakI7O0VBSUQ7SUFDRSxZQUFZO0lBQ1osaUJBQWlCO0lBQ2pCLFdBQVc7R0FDWjs7RUFDRDtJQUNFLGdCQUFnQjtHQUNqQjs7RUFJRDtJQUNFLFlBQVk7SUFDWixpQkFBaUI7SUFDakIsV0FBVztHQUNaOztFQUNEO0lBQ0UsZ0JBQWdCO0dBQ2pCO0NBckJGIiwiZmlsZSI6InN0eWxlLmNzcyIsInNvdXJjZXNDb250ZW50IjpbIi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1idXR0b24ge1xuICBmb250LXNpemU6IDAuOWVtO1xufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtbWVzc2FnZSB7XG4gIGJvcmRlcjogMXB4IHNvbGlkO1xuICBwYWRkaW5nOiAxZW07XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciAuZXJyb3Ige1xuICBiYWNrZ3JvdW5kLWNvbG9yOiByZ2JhKDI1NSwgNjUsIDU0LCAwLjAyKTtcbiAgYm9yZGVyLWNvbG9yOiAjRkY0MTM2O1xuICBjb2xvcjogI2NmMGIwMDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIC5zdWNjZXNzIHtcbiAgYmFja2dyb3VuZC1jb2xvcjogcmdiYSg0NiwgMjA0LCA2NCwgMC4wMik7XG4gIGJvcmRlci1jb2xvcjogIzJFQ0M0MDtcbiAgY29sb3I6ICMxYjc5MjY7XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1mb3JtLWZpZWxkIHtcbiAgbWFyZ2luOiAwIDAgMWVtO1xufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtZmllbGQtaW5saW5lIHtcbiAgZGlzcGxheTogaW5saW5lLWJsb2NrO1xufVxuXG5AbWVkaWEgKG1pbi13aWR0aDogOTkycHgpIHtcbiAgLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZpZWxkLWhhbGYge1xuICAgIGZsb2F0OiBsZWZ0O1xuICAgIG1hcmdpbi1yaWdodDogMiU7XG4gICAgd2lkdGg6IDQ4JTtcbiAgfVxuICAuY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtZmllbGQtaGFsZjpsYXN0LW9mLXR5cGUge1xuICAgIG1hcmdpbi1yaWdodDogMDtcbiAgfVxufVxuXG5AbWVkaWEgKG1pbi13aWR0aDogOTkycHgpIHtcbiAgLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZpZWxkLXRoaXJkIHtcbiAgICBmbG9hdDogbGVmdDtcbiAgICBtYXJnaW4tcmlnaHQ6IDIlO1xuICAgIHdpZHRoOiAzMiU7XG4gIH1cbiAgLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZpZWxkLXRoaXJkOmxhc3Qtb2YtdHlwZSB7XG4gICAgbWFyZ2luLXJpZ2h0OiAwO1xuICB9XG59XG5cbkBtZWRpYSAobWluLXdpZHRoOiA5OTJweCkge1xuICAuY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtZmllbGQtZm91cnRoIHtcbiAgICBmbG9hdDogbGVmdDtcbiAgICBtYXJnaW4tcmlnaHQ6IDIlO1xuICAgIHdpZHRoOiAyNCU7XG4gIH1cbiAgLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZpZWxkLWZvdXJ0aDpsYXN0LW9mLXR5cGUge1xuICAgIG1hcmdpbi1yaWdodDogMDtcbiAgfVxufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgaW5wdXRbdHlwZT1cInRleHRcIl06cmVxdWlyZWQ6dmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwiZW1haWxcIl06cmVxdWlyZWQ6dmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwicGFzc3dvcmRcIl06cmVxdWlyZWQ6dmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwidGVsXCJdOnJlcXVpcmVkOnZhbGlkLCAuY3RjdC1mb3JtLXdyYXBwZXIgaW5wdXRbdHlwZT1cIm51bWJlclwiXTpyZXF1aXJlZDp2YWxpZCB7XG4gIGJhY2tncm91bmQ6IHdoaXRlIHVybChcIi4uL2ltYWdlcy9jaGVja19jaXJjbGUuc3ZnXCIpIG5vLXJlcGVhdDtcbiAgYmFja2dyb3VuZC1wb3NpdGlvbjogOHB4IDUwJTtcbiAgYmFja2dyb3VuZC1zaXplOiAyNHB4O1xuICBib3JkZXItY29sb3I6ICMyRUNDNDA7XG4gIHBhZGRpbmctbGVmdDogNDBweDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0W3R5cGU9XCJ0ZXh0XCJdOnJlcXVpcmVkLmN0Y3QtaW52YWxpZCwgLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0W3R5cGU9XCJ0ZXh0XCJdLmN0Y3QtaW52YWxpZCwgLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0W3R5cGU9XCJlbWFpbFwiXTpyZXF1aXJlZC5jdGN0LWludmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwiZW1haWxcIl0uY3RjdC1pbnZhbGlkLCAuY3RjdC1mb3JtLXdyYXBwZXIgaW5wdXRbdHlwZT1cInBhc3N3b3JkXCJdOnJlcXVpcmVkLmN0Y3QtaW52YWxpZCwgLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0W3R5cGU9XCJwYXNzd29yZFwiXS5jdGN0LWludmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwidGVsXCJdOnJlcXVpcmVkLmN0Y3QtaW52YWxpZCwgLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0W3R5cGU9XCJ0ZWxcIl0uY3RjdC1pbnZhbGlkLCAuY3RjdC1mb3JtLXdyYXBwZXIgaW5wdXRbdHlwZT1cIm51bWJlclwiXTpyZXF1aXJlZC5jdGN0LWludmFsaWQsIC5jdGN0LWZvcm0td3JhcHBlciBpbnB1dFt0eXBlPVwibnVtYmVyXCJdLmN0Y3QtaW52YWxpZCB7XG4gIGJhY2tncm91bmQ6IHdoaXRlIHVybChcIi4uL2ltYWdlcy9lcnJvci5zdmdcIikgbm8tcmVwZWF0O1xuICBiYWNrZ3JvdW5kLWNvbG9yOiByZ2JhKDI1NSwgNjUsIDU0LCAwLjAyKTtcbiAgYmFja2dyb3VuZC1wb3NpdGlvbjogOHB4IDUwJTtcbiAgYmFja2dyb3VuZC1zaXplOiAyNHB4O1xuICBib3JkZXItY29sb3I6ICNGRjQxMzY7XG4gIHBhZGRpbmctbGVmdDogNDBweDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZpZWxkLWVycm9yIHtcbiAgZm9udC1zaXplOiAwLjg1ZW07XG4gIGZvbnQtc3R5bGU6IGl0YWxpYztcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0LmN0Y3QtaW52YWxpZCB7XG4gIGJhY2tncm91bmQ6IHdoaXRlIHVybChcIi4uL2ltYWdlcy9lcnJvci5zdmdcIikgbm8tcmVwZWF0O1xuICBiYWNrZ3JvdW5kLWNvbG9yOiByZ2JhKDI1NSwgNjUsIDU0LCAwLjAyKTtcbiAgYmFja2dyb3VuZC1wb3NpdGlvbjogOHB4IDUwJTtcbiAgYmFja2dyb3VuZC1zaXplOiAyNHB4O1xuICBib3JkZXItY29sb3I6ICNGRjQxMzY7XG4gIHBhZGRpbmctbGVmdDogNDBweDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0LmN0Y3QtbGFiZWwtbGVmdCxcbi5jdGN0LWZvcm0td3JhcHBlciB0ZXh0YXJlYS5jdGN0LWxhYmVsLWxlZnQge1xuICBkaXNwbGF5OiBpbmxpbmUtYmxvY2s7XG4gIHdpZHRoOiA3NSU7XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciBzcGFuLmN0Y3QtbGFiZWwtbGVmdCB7XG4gIGRpc3BsYXk6IGlubGluZS1ibG9jaztcbiAgbWFyZ2luLXJpZ2h0OiA1JTtcbiAgd2lkdGg6IDIwJTtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIGlucHV0LmN0Y3QtbGFiZWwtcmlnaHQsXG4uY3RjdC1mb3JtLXdyYXBwZXIgdGV4dGFyZWEuY3RjdC1sYWJlbC1yaWdodCB7XG4gIGRpc3BsYXk6IGlubGluZS1ibG9jaztcbiAgbWFyZ2luLXJpZ2h0OiA1JTtcbiAgd2lkdGg6IDc1JTtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIHNwYW4uY3RjdC1sYWJlbC1yaWdodCB7XG4gIGRpc3BsYXk6IGlubGluZS1ibG9jaztcbiAgd2lkdGg6IDIwJTtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIHNwYW4uY3RjdC1sYWJlbC1oaWRkZW4ge1xuICBsZWZ0OiAtOTk5OXB4ICFpbXBvcnRhbnQ7XG4gIHBvc2l0aW9uOiBhYnNvbHV0ZSAhaW1wb3J0YW50O1xuICB0b3A6IC05OTk5cHggIWltcG9ydGFudDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyICNjdGN0X3VzYWdlIHtcbiAgcG9zaXRpb246IGFic29sdXRlO1xuICBvdmVyZmxvdzogaGlkZGVuO1xuICBjbGlwOiByZWN0KDBweCwgMHB4LCAwcHgsIDBweCk7XG4gIGhlaWdodDogMXB4O1xuICB3aWR0aDogMXB4O1xuICBtYXJnaW46IC0xcHg7XG4gIGJvcmRlcjogMHB4IG5vbmU7XG4gIHBhZGRpbmc6IDBweDtcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyICNjdGN0LXN1Ym1pdHRlZDpkaXNhYmxlZCB7XG4gIGJhY2tncm91bmQtaW1hZ2U6IHVybChcIi4uL2ltYWdlcy9vdmFsLm1pbi5zdmdcIik7XG4gIGJhY2tncm91bmQtcG9zaXRpb246IGNlbnRlcjtcbiAgYmFja2dyb3VuZC1yZXBlYXQ6IG5vLXJlcGVhdDtcbiAgY29sb3I6IHRyYW5zcGFyZW50O1xuICBjdXJzb3I6IHdhaXQ7XG4gIG9wYWNpdHk6IDAuMztcbn1cblxuLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZvcm06YWZ0ZXIge1xuICBjbGVhcjogYm90aDtcbiAgY29udGVudDogXCJcIjtcbiAgZGlzcGxheTogdGFibGU7XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1mb3JtIC5jdGN0LWxhYmVsLXRvcCBsYWJlbCxcbi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1mb3JtIC5jdGN0LWxhYmVsLWJvdHRvbSBsYWJlbCB7XG4gIGRpc3BsYXk6IGJsb2NrO1xufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtZm9ybSAuY3RjdC1sYWJlbC1sZWZ0IGxhYmVsLFxuLmN0Y3QtZm9ybS13cmFwcGVyIC5jdGN0LWZvcm0gLmN0Y3QtbGFiZWwtcmlnaHQgbGFiZWwge1xuICBkaXNwbGF5OiBpbmxpbmUtYmxvY2s7XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1mb3JtIGFiYnIge1xuICBib3JkZXI6IG5vbmU7XG4gIGNvbG9yOiAjRkY0MTM2O1xuICBmb250LXNpemU6IDAuOWVtO1xufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3QtaW5wdXQtY29udGFpbmVyIGxhYmVsIHtcbiAgY29sb3I6ICNhYWE7XG4gIGZvbnQtc2l6ZTogMC44ZW07XG59XG5cbi5jdGN0LWZvcm0td3JhcHBlciAuY3RjdC1maWVsZC1lcnJvciB7XG4gIGNvbG9yOiAjRkY0MTM2O1xufVxuXG4uY3RjdC1mb3JtLXdyYXBwZXIgLmN0Y3Qtc3VibWl0IHtcbiAgY3Vyc29yOiBwb2ludGVyO1xufVxuXG4uY3RjdC10d2VudHlmb3VydGVlbiAuY3RjdC1mb3JtLWZpZWxkIGlucHV0IHtcbiAgd2lkdGg6IDEwMCU7XG59XG4iXX0= */
|
assets/css/style.min.css
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
.ctct-form-wrapper .ctct-button{font-size:.9em}.ctct-form-wrapper .ctct-message{border:1px solid;padding:1em}.ctct-form-wrapper .error{background-color:rgba(255,65,54,.02);border-color:#ff4136;color:#cf0b00}.ctct-form-wrapper .success{background-color:rgba(46,204,64,.02);border-color:#2ecc40;color:#1b7926}.ctct-form-wrapper .ctct-form-field{margin:0 0 1em}.ctct-form-wrapper .ctct-field-inline{display:inline-block}.ctct-form-wrapper input[type=email]:required:valid,.ctct-form-wrapper input[type=number]:required:valid,.ctct-form-wrapper input[type=password]:required:valid,.ctct-form-wrapper input[type=tel]:required:valid,.ctct-form-wrapper input[type=text]:required:valid{background:#fff url(../images/check_circle.svg) no-repeat;background-position:8px 50%;background-size:24px;border-color:#2ecc40;padding-left:40px}.ctct-form-wrapper input[type=email].ctct-invalid,.ctct-form-wrapper input[type=email]:required.ctct-invalid,.ctct-form-wrapper input[type=number].ctct-invalid,.ctct-form-wrapper input[type=number]:required.ctct-invalid,.ctct-form-wrapper input[type=password].ctct-invalid,.ctct-form-wrapper input[type=password]:required.ctct-invalid,.ctct-form-wrapper input[type=tel].ctct-invalid,.ctct-form-wrapper input[type=tel]:required.ctct-invalid,.ctct-form-wrapper input[type=text].ctct-invalid,.ctct-form-wrapper input[type=text]:required.ctct-invalid{background:#fff url(../images/error.svg) no-repeat;background-color:rgba(255,65,54,.02);background-position:8px 50%;background-size:24px;border-color:#ff4136;padding-left:40px}.ctct-form-wrapper .ctct-field-error{font-size:.85em;font-style:italic}.ctct-form-wrapper input.ctct-invalid{background:#fff url(../images/error.svg) no-repeat;background-color:rgba(255,65,54,.02);background-position:8px 50%;background-size:24px;border-color:#ff4136;padding-left:40px}.ctct-form-wrapper #ctct_usage{position:absolute;overflow:hidden;clip:rect(0,0,0,0);height:1px;width:1px;margin:-1px;border:0 none;padding:0}.ctct-form-wrapper .ctct-form:after{clear:both;content:"";display:table}.ctct-form-wrapper .ctct-form abbr{border:none;color:#ff4136;font-size:.9em}.ctct-form-wrapper .ctct-input-container label{color:#aaa;font-size:.8em}.ctct-form-wrapper .ctct-field-error{color:#ff4136}.ctct-form-wrapper .ctct-submit{cursor:pointer}.ctct-twentyfourteen .ctct-form-field input{width:100%}@media (min-width:992px){.ctct-form-wrapper .ctct-field-half{float:left;margin-right:2%;width:48%}.ctct-form-wrapper .ctct-field-half:last-of-type{margin-right:0}.ctct-form-wrapper .ctct-field-third{float:left;margin-right:2%;width:32%}.ctct-form-wrapper .ctct-field-third:last-of-type{margin-right:0}.ctct-form-wrapper .ctct-field-fourth{float:left;margin-right:2%;width:24%}.ctct-form-wrapper .ctct-field-fourth:last-of-type{margin-right:0}}
|
| 1 |
+
.ctct-form-wrapper .ctct-button{font-size:.9em}.ctct-form-wrapper .ctct-message{border:1px solid;padding:1em}.ctct-form-wrapper .error{background-color:rgba(255,65,54,.02);border-color:#ff4136;color:#cf0b00}.ctct-form-wrapper .success{background-color:rgba(46,204,64,.02);border-color:#2ecc40;color:#1b7926}.ctct-form-wrapper .ctct-form-field{margin:0 0 1em}.ctct-form-wrapper .ctct-field-inline{display:inline-block}.ctct-form-wrapper input[type=email]:required:valid,.ctct-form-wrapper input[type=number]:required:valid,.ctct-form-wrapper input[type=password]:required:valid,.ctct-form-wrapper input[type=tel]:required:valid,.ctct-form-wrapper input[type=text]:required:valid{background:#fff url(../images/check_circle.svg) no-repeat;background-position:8px 50%;background-size:24px;border-color:#2ecc40;padding-left:40px}.ctct-form-wrapper input[type=email].ctct-invalid,.ctct-form-wrapper input[type=email]:required.ctct-invalid,.ctct-form-wrapper input[type=number].ctct-invalid,.ctct-form-wrapper input[type=number]:required.ctct-invalid,.ctct-form-wrapper input[type=password].ctct-invalid,.ctct-form-wrapper input[type=password]:required.ctct-invalid,.ctct-form-wrapper input[type=tel].ctct-invalid,.ctct-form-wrapper input[type=tel]:required.ctct-invalid,.ctct-form-wrapper input[type=text].ctct-invalid,.ctct-form-wrapper input[type=text]:required.ctct-invalid{background:#fff url(../images/error.svg) no-repeat;background-color:rgba(255,65,54,.02);background-position:8px 50%;background-size:24px;border-color:#ff4136;padding-left:40px}.ctct-form-wrapper .ctct-field-error{font-size:.85em;font-style:italic}.ctct-form-wrapper input.ctct-invalid{background:#fff url(../images/error.svg) no-repeat;background-color:rgba(255,65,54,.02);background-position:8px 50%;background-size:24px;border-color:#ff4136;padding-left:40px}.ctct-form-wrapper input.ctct-label-left,.ctct-form-wrapper textarea.ctct-label-left{display:inline-block;width:75%}.ctct-form-wrapper span.ctct-label-left{display:inline-block;margin-right:5%;width:20%}.ctct-form-wrapper input.ctct-label-right,.ctct-form-wrapper textarea.ctct-label-right{display:inline-block;margin-right:5%;width:75%}.ctct-form-wrapper span.ctct-label-right{display:inline-block;width:20%}.ctct-form-wrapper span.ctct-label-hidden{left:-9999px!important;position:absolute!important;top:-9999px!important}.ctct-form-wrapper #ctct_usage{position:absolute;overflow:hidden;clip:rect(0,0,0,0);height:1px;width:1px;margin:-1px;border:0 none;padding:0}.ctct-form-wrapper #ctct-submitted:disabled{background-image:url(../images/oval.min.svg);background-position:50%;background-repeat:no-repeat;color:transparent;cursor:wait;opacity:.3}.ctct-form-wrapper .ctct-form:after{clear:both;content:"";display:table}.ctct-form-wrapper .ctct-form .ctct-label-bottom label,.ctct-form-wrapper .ctct-form .ctct-label-top label{display:block}.ctct-form-wrapper .ctct-form .ctct-label-left label,.ctct-form-wrapper .ctct-form .ctct-label-right label{display:inline-block}.ctct-form-wrapper .ctct-form abbr{border:none;color:#ff4136;font-size:.9em}.ctct-form-wrapper .ctct-input-container label{color:#aaa;font-size:.8em}.ctct-form-wrapper .ctct-field-error{color:#ff4136}.ctct-form-wrapper .ctct-submit{cursor:pointer}.ctct-twentyfourteen .ctct-form-field input{width:100%}@media (min-width:992px){.ctct-form-wrapper .ctct-field-half{float:left;margin-right:2%;width:48%}.ctct-form-wrapper .ctct-field-half:last-of-type{margin-right:0}.ctct-form-wrapper .ctct-field-third{float:left;margin-right:2%;width:32%}.ctct-form-wrapper .ctct-field-third:last-of-type{margin-right:0}.ctct-form-wrapper .ctct-field-fourth{float:left;margin-right:2%;width:24%}.ctct-form-wrapper .ctct-field-fourth:last-of-type{margin-right:0}}
|
assets/images/oval.min.svg
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
<svg width="38" height="38" xmlns="http://www.w3.org/2000/svg" stroke="#fff"><g transform="translate(1 1)" stroke-width="2" fill="none" fill-rule="evenodd"><circle stroke-opacity=".5" cx="18" cy="18" r="18"/><path d="M36 18c0-9.94-8.06-18-18-18"><animateTransform attributeName="transform" type="rotate" from="0 18 18" to="360 18 18" dur="1s" repeatCount="indefinite"/></path></g></svg>
|
assets/js/ctct-plugin-frontend.js
CHANGED
|
@@ -31,15 +31,15 @@ window.CTCTSupport = {};
|
|
| 31 |
that.cache();
|
| 32 |
that.bindEvents();
|
| 33 |
that.removePlaceholder();
|
| 34 |
-
}
|
| 35 |
|
| 36 |
that.removePlaceholder = function() {
|
| 37 |
$( '.ctct-form-field input,textarea' ).focus( function() {
|
| 38 |
-
$( this ).data( 'placeholder', $( this ).attr( 'placeholder' ) ).attr( 'placeholder','' );
|
| 39 |
}).blur( function() {
|
| 40 |
$( this ).attr( 'placeholder', $( this ).data( 'placeholder' ) );
|
| 41 |
});
|
| 42 |
-
}
|
| 43 |
|
| 44 |
// Cache all the things.
|
| 45 |
that.cache = function() {
|
|
@@ -47,13 +47,22 @@ window.CTCTSupport = {};
|
|
| 47 |
window: $( window ),
|
| 48 |
body: $( 'body' ),
|
| 49 |
form: '.ctct-form-wrapper form',
|
|
|
|
|
|
|
| 50 |
};
|
|
|
|
| 51 |
that.timeout = null;
|
| 52 |
-
}
|
| 53 |
|
| 54 |
that.setAllInputsValid = function() {
|
| 55 |
$( that.$c.form + ' .ctct-invalid' ).removeClass( 'ctct-invalid' );
|
| 56 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 57 |
|
| 58 |
that.processError = function( error ) {
|
| 59 |
|
|
@@ -62,11 +71,27 @@ window.CTCTSupport = {};
|
|
| 62 |
$( '#' + error.id ).addClass( 'ctct-invalid' );
|
| 63 |
}
|
| 64 |
|
| 65 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 66 |
|
| 67 |
// Combine all events.
|
| 68 |
that.bindEvents = function() {
|
| 69 |
$( that.$c.form ).on( 'click', 'input[type=submit]', function(e) {
|
|
|
|
| 70 |
if ('on' === $('.ctct-form').attr('data-doajax')) {
|
| 71 |
var $form_id = $(this).closest('.ctct-form-wrapper').attr('id');
|
| 72 |
var form_id_selector = '';
|
|
@@ -87,19 +112,32 @@ window.CTCTSupport = {};
|
|
| 87 |
clearTimeout(that.timeout);
|
| 88 |
|
| 89 |
that.timeout = setTimeout(function () {
|
|
|
|
| 90 |
$.post(
|
| 91 |
ajaxurl,
|
| 92 |
{
|
| 93 |
'action': 'ctct_process_form',
|
| 94 |
-
'data' : $(form_id_selector + 'form').serialize()
|
| 95 |
},
|
| 96 |
function (response) {
|
| 97 |
-
|
| 98 |
-
// Make sure we got the 'status'
|
| 99 |
if (typeof( response.status ) !== 'undefined') {
|
| 100 |
|
| 101 |
-
if ('success'
|
| 102 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 103 |
} else {
|
| 104 |
// Here we'll want to disable the submit button and
|
| 105 |
// add some error classes
|
|
@@ -117,7 +155,12 @@ window.CTCTSupport = {};
|
|
| 117 |
}, 500)
|
| 118 |
}
|
| 119 |
});
|
| 120 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 121 |
|
| 122 |
// Engage!
|
| 123 |
$( that.init );
|
| 31 |
that.cache();
|
| 32 |
that.bindEvents();
|
| 33 |
that.removePlaceholder();
|
| 34 |
+
};
|
| 35 |
|
| 36 |
that.removePlaceholder = function() {
|
| 37 |
$( '.ctct-form-field input,textarea' ).focus( function() {
|
| 38 |
+
$( this ).data( 'placeholder', $( this ).attr( 'placeholder' ) ).attr( 'placeholder', '' );
|
| 39 |
}).blur( function() {
|
| 40 |
$( this ).attr( 'placeholder', $( this ).data( 'placeholder' ) );
|
| 41 |
});
|
| 42 |
+
};
|
| 43 |
|
| 44 |
// Cache all the things.
|
| 45 |
that.cache = function() {
|
| 47 |
window: $( window ),
|
| 48 |
body: $( 'body' ),
|
| 49 |
form: '.ctct-form-wrapper form',
|
| 50 |
+
honeypot: $( '#ctct_usage_field' ),
|
| 51 |
+
submitButton: $( '.ctct-form-wrapper form input[type=submit]' )
|
| 52 |
};
|
| 53 |
+
|
| 54 |
that.timeout = null;
|
| 55 |
+
};
|
| 56 |
|
| 57 |
that.setAllInputsValid = function() {
|
| 58 |
$( that.$c.form + ' .ctct-invalid' ).removeClass( 'ctct-invalid' );
|
| 59 |
+
};
|
| 60 |
+
|
| 61 |
+
that.clearFormInputs = function (form_id_selector) {
|
| 62 |
+
var submitted_form = $(form_id_selector + ' form');
|
| 63 |
+
// jQuery doesn't have a native reset function so the [0] will convert to a JavaScript object.
|
| 64 |
+
submitted_form[0].reset();
|
| 65 |
+
};
|
| 66 |
|
| 67 |
that.processError = function( error ) {
|
| 68 |
|
| 71 |
$( '#' + error.id ).addClass( 'ctct-invalid' );
|
| 72 |
}
|
| 73 |
|
| 74 |
+
};
|
| 75 |
+
|
| 76 |
+
/**
|
| 77 |
+
* Check the value of the hidden honeypot field.
|
| 78 |
+
* If there is anything in it, disable the form submission button.
|
| 79 |
+
*/
|
| 80 |
+
that.checkHoneypot = function() {
|
| 81 |
+
var honeypot_length = that.$c.honeypot.val().length;
|
| 82 |
+
|
| 83 |
+
// If there is text in the honeypot, disable the submit button
|
| 84 |
+
if( honeypot_length > 0 ) {
|
| 85 |
+
that.$c.submitButton.attr( 'disabled', 'disabled' );
|
| 86 |
+
} else {
|
| 87 |
+
that.$c.submitButton.attr( 'disabled', false );
|
| 88 |
+
}
|
| 89 |
+
};
|
| 90 |
|
| 91 |
// Combine all events.
|
| 92 |
that.bindEvents = function() {
|
| 93 |
$( that.$c.form ).on( 'click', 'input[type=submit]', function(e) {
|
| 94 |
+
|
| 95 |
if ('on' === $('.ctct-form').attr('data-doajax')) {
|
| 96 |
var $form_id = $(this).closest('.ctct-form-wrapper').attr('id');
|
| 97 |
var form_id_selector = '';
|
| 112 |
clearTimeout(that.timeout);
|
| 113 |
|
| 114 |
that.timeout = setTimeout(function () {
|
| 115 |
+
$('#ctct-submitted').prop('disabled', true);
|
| 116 |
$.post(
|
| 117 |
ajaxurl,
|
| 118 |
{
|
| 119 |
'action': 'ctct_process_form',
|
| 120 |
+
'data' : $(form_id_selector + 'form').serialize()
|
| 121 |
},
|
| 122 |
function (response) {
|
| 123 |
+
$('#ctct-submitted').prop('disabled', false);
|
| 124 |
+
// Make sure we got the 'status' attribute in our response
|
| 125 |
if (typeof( response.status ) !== 'undefined') {
|
| 126 |
|
| 127 |
+
if ( 'success' === response.status ) {
|
| 128 |
+
// Add a timestamp to the message so that we only remove this message and not all at once.
|
| 129 |
+
var time_class = 'message-time-' + $.now();
|
| 130 |
+
|
| 131 |
+
var message_class = 'ctct-message ' + response.status + ' ' + time_class;
|
| 132 |
+
$(form_id_selector+'.ctct-form').before('<p class="' + message_class + '">' + response.message + '</p>');
|
| 133 |
+
|
| 134 |
+
if ( '' !== form_id_selector ) {
|
| 135 |
+
that.clearFormInputs( form_id_selector );
|
| 136 |
+
}
|
| 137 |
+
// Set a 5 second timeout to remove the added success message.
|
| 138 |
+
setTimeout( function() {
|
| 139 |
+
$( '.' + time_class ).fadeOut('slow');
|
| 140 |
+
}, 5000 );
|
| 141 |
} else {
|
| 142 |
// Here we'll want to disable the submit button and
|
| 143 |
// add some error classes
|
| 155 |
}, 500)
|
| 156 |
}
|
| 157 |
});
|
| 158 |
+
|
| 159 |
+
// Look for any changes on the honeypot input field.
|
| 160 |
+
$( that.$c.honeypot ).on( 'change keyup', function( e ) {
|
| 161 |
+
that.checkHoneypot();
|
| 162 |
+
});
|
| 163 |
+
};
|
| 164 |
|
| 165 |
// Engage!
|
| 166 |
$( that.init );
|
assets/js/ctct-plugin-frontend.min.js
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
!function(t,e){function c(){return e("#ctct-submitted").attr("disabled","disabled")}function o(){return e("#ctct-submitted").attr("disabled",null)}e(document).ready(function(){e("#ctct-submitted").on("click",function(){setTimeout(function(){c(),setTimeout(o,3e3)},100)})})}(window,jQuery),window.CTCTSupport={},function(t,e,c){c.init=function(){c.cache(),c.bindEvents(),c.removePlaceholder()},c.removePlaceholder=function(){e(".ctct-form-field input,textarea").focus(function(){e(this).data("placeholder",e(this).attr("placeholder")).attr("placeholder","")}).blur(function(){e(this).attr("placeholder",e(this).data("placeholder"))})},c.cache=function(){c.$c={window:e(t),body:e("body"),form:".ctct-form-wrapper form"},c.timeout=null},c.setAllInputsValid=function(){e(c.$c.form+" .ctct-invalid").removeClass("ctct-invalid")},c.processError=function(t){"undefined"!=typeof t.id&&e("#"+t.id).addClass("ctct-invalid")},c.bindEvents=function(){e(c.$c.form).on("click","input[type=submit]",function(t){if("on"===e(".ctct-form").attr("data-doajax")){var o=e(this).closest(".ctct-form-wrapper").attr("id"),i="";""!=o&&(i="#"+o+" ");var n=!0;if(e.each(e(i+".ctct-form [required]"),function(t,e){e.checkValidity()===!1&&(n=!1)}),!1===n)return;t.preventDefault(),clearTimeout(c.timeout),c.timeout=setTimeout(function(){e.post(ajaxurl,{action:"ctct_process_form",data:e(i+"form").serialize()},function(t){"undefined"!=typeof t.status
|
| 1 |
+
!function(t,e){function c(){return e("#ctct-submitted").attr("disabled","disabled")}function o(){return e("#ctct-submitted").attr("disabled",null)}e(document).ready(function(){e("#ctct-submitted").on("click",function(){setTimeout(function(){c(),setTimeout(o,3e3)},100)})})}(window,jQuery),window.CTCTSupport={},function(t,e,c){c.init=function(){c.cache(),c.bindEvents(),c.removePlaceholder()},c.removePlaceholder=function(){e(".ctct-form-field input,textarea").focus(function(){e(this).data("placeholder",e(this).attr("placeholder")).attr("placeholder","")}).blur(function(){e(this).attr("placeholder",e(this).data("placeholder"))})},c.cache=function(){c.$c={window:e(t),body:e("body"),form:".ctct-form-wrapper form",honeypot:e("#ctct_usage_field"),submitButton:e(".ctct-form-wrapper form input[type=submit]")},c.timeout=null},c.setAllInputsValid=function(){e(c.$c.form+" .ctct-invalid").removeClass("ctct-invalid")},c.clearFormInputs=function(t){var c=e(t+" form");c[0].reset()},c.processError=function(t){"undefined"!=typeof t.id&&e("#"+t.id).addClass("ctct-invalid")},c.checkHoneypot=function(){var t=c.$c.honeypot.val().length;t>0?c.$c.submitButton.attr("disabled","disabled"):c.$c.submitButton.attr("disabled",!1)},c.bindEvents=function(){e(c.$c.form).on("click","input[type=submit]",function(t){if("on"===e(".ctct-form").attr("data-doajax")){var o=e(this).closest(".ctct-form-wrapper").attr("id"),i="";""!=o&&(i="#"+o+" ");var n=!0;if(e.each(e(i+".ctct-form [required]"),function(t,e){e.checkValidity()===!1&&(n=!1)}),!1===n)return;t.preventDefault(),clearTimeout(c.timeout),c.timeout=setTimeout(function(){e("#ctct-submitted").prop("disabled",!0),e.post(ajaxurl,{action:"ctct_process_form",data:e(i+"form").serialize()},function(t){if(e("#ctct-submitted").prop("disabled",!1),"undefined"!=typeof t.status)if("success"===t.status){var o="message-time-"+e.now(),n="ctct-message "+t.status+" "+o;e(i+".ctct-form").before('<p class="'+n+'">'+t.message+"</p>"),""!==i&&c.clearFormInputs(i),setTimeout(function(){e("."+o).fadeOut("slow")},5e3)}else"undefined"!=typeof t.errors?(c.setAllInputsValid(),t.errors.forEach(c.processError)):e(i+".ctct-form").before('<p class="ctct-message '+t.status+'">'+t.message+"</p>")})},500)}}),e(c.$c.honeypot).on("change keyup",function(t){c.checkHoneypot()})},e(c.init)}(window,jQuery,window.CTCTSupport);
|
assets/js/ctct-plugin-frontend/validation.js
CHANGED
|
@@ -6,15 +6,15 @@ window.CTCTSupport = {};
|
|
| 6 |
that.cache();
|
| 7 |
that.bindEvents();
|
| 8 |
that.removePlaceholder();
|
| 9 |
-
}
|
| 10 |
|
| 11 |
that.removePlaceholder = function() {
|
| 12 |
$( '.ctct-form-field input,textarea' ).focus( function() {
|
| 13 |
-
$( this ).data( 'placeholder', $( this ).attr( 'placeholder' ) ).attr( 'placeholder','' );
|
| 14 |
}).blur( function() {
|
| 15 |
$( this ).attr( 'placeholder', $( this ).data( 'placeholder' ) );
|
| 16 |
});
|
| 17 |
-
}
|
| 18 |
|
| 19 |
// Cache all the things.
|
| 20 |
that.cache = function() {
|
|
@@ -22,13 +22,22 @@ window.CTCTSupport = {};
|
|
| 22 |
window: $( window ),
|
| 23 |
body: $( 'body' ),
|
| 24 |
form: '.ctct-form-wrapper form',
|
|
|
|
|
|
|
| 25 |
};
|
|
|
|
| 26 |
that.timeout = null;
|
| 27 |
-
}
|
| 28 |
|
| 29 |
that.setAllInputsValid = function() {
|
| 30 |
$( that.$c.form + ' .ctct-invalid' ).removeClass( 'ctct-invalid' );
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
|
| 33 |
that.processError = function( error ) {
|
| 34 |
|
|
@@ -37,11 +46,27 @@ window.CTCTSupport = {};
|
|
| 37 |
$( '#' + error.id ).addClass( 'ctct-invalid' );
|
| 38 |
}
|
| 39 |
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 41 |
|
| 42 |
// Combine all events.
|
| 43 |
that.bindEvents = function() {
|
| 44 |
$( that.$c.form ).on( 'click', 'input[type=submit]', function(e) {
|
|
|
|
| 45 |
if ('on' === $('.ctct-form').attr('data-doajax')) {
|
| 46 |
var $form_id = $(this).closest('.ctct-form-wrapper').attr('id');
|
| 47 |
var form_id_selector = '';
|
|
@@ -62,19 +87,32 @@ window.CTCTSupport = {};
|
|
| 62 |
clearTimeout(that.timeout);
|
| 63 |
|
| 64 |
that.timeout = setTimeout(function () {
|
|
|
|
| 65 |
$.post(
|
| 66 |
ajaxurl,
|
| 67 |
{
|
| 68 |
'action': 'ctct_process_form',
|
| 69 |
-
'data' : $(form_id_selector + 'form').serialize()
|
| 70 |
},
|
| 71 |
function (response) {
|
| 72 |
-
|
| 73 |
-
// Make sure we got the 'status'
|
| 74 |
if (typeof( response.status ) !== 'undefined') {
|
| 75 |
|
| 76 |
-
if ('success'
|
| 77 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 78 |
} else {
|
| 79 |
// Here we'll want to disable the submit button and
|
| 80 |
// add some error classes
|
|
@@ -92,7 +130,12 @@ window.CTCTSupport = {};
|
|
| 92 |
}, 500)
|
| 93 |
}
|
| 94 |
});
|
| 95 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 96 |
|
| 97 |
// Engage!
|
| 98 |
$( that.init );
|
| 6 |
that.cache();
|
| 7 |
that.bindEvents();
|
| 8 |
that.removePlaceholder();
|
| 9 |
+
};
|
| 10 |
|
| 11 |
that.removePlaceholder = function() {
|
| 12 |
$( '.ctct-form-field input,textarea' ).focus( function() {
|
| 13 |
+
$( this ).data( 'placeholder', $( this ).attr( 'placeholder' ) ).attr( 'placeholder', '' );
|
| 14 |
}).blur( function() {
|
| 15 |
$( this ).attr( 'placeholder', $( this ).data( 'placeholder' ) );
|
| 16 |
});
|
| 17 |
+
};
|
| 18 |
|
| 19 |
// Cache all the things.
|
| 20 |
that.cache = function() {
|
| 22 |
window: $( window ),
|
| 23 |
body: $( 'body' ),
|
| 24 |
form: '.ctct-form-wrapper form',
|
| 25 |
+
honeypot: $( '#ctct_usage_field' ),
|
| 26 |
+
submitButton: $( '.ctct-form-wrapper form input[type=submit]' )
|
| 27 |
};
|
| 28 |
+
|
| 29 |
that.timeout = null;
|
| 30 |
+
};
|
| 31 |
|
| 32 |
that.setAllInputsValid = function() {
|
| 33 |
$( that.$c.form + ' .ctct-invalid' ).removeClass( 'ctct-invalid' );
|
| 34 |
+
};
|
| 35 |
+
|
| 36 |
+
that.clearFormInputs = function (form_id_selector) {
|
| 37 |
+
var submitted_form = $(form_id_selector + ' form');
|
| 38 |
+
// jQuery doesn't have a native reset function so the [0] will convert to a JavaScript object.
|
| 39 |
+
submitted_form[0].reset();
|
| 40 |
+
};
|
| 41 |
|
| 42 |
that.processError = function( error ) {
|
| 43 |
|
| 46 |
$( '#' + error.id ).addClass( 'ctct-invalid' );
|
| 47 |
}
|
| 48 |
|
| 49 |
+
};
|
| 50 |
+
|
| 51 |
+
/**
|
| 52 |
+
* Check the value of the hidden honeypot field.
|
| 53 |
+
* If there is anything in it, disable the form submission button.
|
| 54 |
+
*/
|
| 55 |
+
that.checkHoneypot = function() {
|
| 56 |
+
var honeypot_length = that.$c.honeypot.val().length;
|
| 57 |
+
|
| 58 |
+
// If there is text in the honeypot, disable the submit button
|
| 59 |
+
if( honeypot_length > 0 ) {
|
| 60 |
+
that.$c.submitButton.attr( 'disabled', 'disabled' );
|
| 61 |
+
} else {
|
| 62 |
+
that.$c.submitButton.attr( 'disabled', false );
|
| 63 |
+
}
|
| 64 |
+
};
|
| 65 |
|
| 66 |
// Combine all events.
|
| 67 |
that.bindEvents = function() {
|
| 68 |
$( that.$c.form ).on( 'click', 'input[type=submit]', function(e) {
|
| 69 |
+
|
| 70 |
if ('on' === $('.ctct-form').attr('data-doajax')) {
|
| 71 |
var $form_id = $(this).closest('.ctct-form-wrapper').attr('id');
|
| 72 |
var form_id_selector = '';
|
| 87 |
clearTimeout(that.timeout);
|
| 88 |
|
| 89 |
that.timeout = setTimeout(function () {
|
| 90 |
+
$('#ctct-submitted').prop('disabled', true);
|
| 91 |
$.post(
|
| 92 |
ajaxurl,
|
| 93 |
{
|
| 94 |
'action': 'ctct_process_form',
|
| 95 |
+
'data' : $(form_id_selector + 'form').serialize()
|
| 96 |
},
|
| 97 |
function (response) {
|
| 98 |
+
$('#ctct-submitted').prop('disabled', false);
|
| 99 |
+
// Make sure we got the 'status' attribute in our response
|
| 100 |
if (typeof( response.status ) !== 'undefined') {
|
| 101 |
|
| 102 |
+
if ( 'success' === response.status ) {
|
| 103 |
+
// Add a timestamp to the message so that we only remove this message and not all at once.
|
| 104 |
+
var time_class = 'message-time-' + $.now();
|
| 105 |
+
|
| 106 |
+
var message_class = 'ctct-message ' + response.status + ' ' + time_class;
|
| 107 |
+
$(form_id_selector+'.ctct-form').before('<p class="' + message_class + '">' + response.message + '</p>');
|
| 108 |
+
|
| 109 |
+
if ( '' !== form_id_selector ) {
|
| 110 |
+
that.clearFormInputs( form_id_selector );
|
| 111 |
+
}
|
| 112 |
+
// Set a 5 second timeout to remove the added success message.
|
| 113 |
+
setTimeout( function() {
|
| 114 |
+
$( '.' + time_class ).fadeOut('slow');
|
| 115 |
+
}, 5000 );
|
| 116 |
} else {
|
| 117 |
// Here we'll want to disable the submit button and
|
| 118 |
// add some error classes
|
| 130 |
}, 500)
|
| 131 |
}
|
| 132 |
});
|
| 133 |
+
|
| 134 |
+
// Look for any changes on the honeypot input field.
|
| 135 |
+
$( that.$c.honeypot ).on( 'change keyup', function( e ) {
|
| 136 |
+
that.checkHoneypot();
|
| 137 |
+
});
|
| 138 |
+
};
|
| 139 |
|
| 140 |
// Engage!
|
| 141 |
$( that.init );
|
assets/sass/_admin-forms.scss
ADDED
|
@@ -0,0 +1,210 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.post-type-ctct_forms {
|
| 2 |
+
.misc-pub-section {
|
| 3 |
+
&.misc-pub-visibility,
|
| 4 |
+
&.misc-pub-curtime {
|
| 5 |
+
display: none;
|
| 6 |
+
}
|
| 7 |
+
}
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
body.post-type-ctct_lists .misc-pub-post-status {
|
| 11 |
+
display: none;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
body.post-type-ctct_forms #titlediv #title {
|
| 15 |
+
height: 2.7em;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
.ctct-admin-title-details {
|
| 19 |
+
font-size: .6em;
|
| 20 |
+
vertical-align: middle;
|
| 21 |
+
display: block;
|
| 22 |
+
line-height: 2em;
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
#cmb2-metabox-ctct_1_optin_metabox {
|
| 26 |
+
.cmb2-id--ctct-opt-in-instructions,
|
| 27 |
+
.cmb2-id--ctct-opt-in {
|
| 28 |
+
display: none;
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
#ctct_0_list_metabox,
|
| 34 |
+
#ctct_1_custom_form_css_metabox,
|
| 35 |
+
#ctct_1_custom_input_css_metabox {
|
| 36 |
+
.cmb-row {
|
| 37 |
+
padding-bottom: 0;
|
| 38 |
+
}
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
#cmb2-metabox-ctct_2_fields_metabox {
|
| 42 |
+
.cmb2-id--ctct-title {
|
| 43 |
+
padding: .8em 0 1em;
|
| 44 |
+
}
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
#ctct_1_custom_form_css_metabox {
|
| 48 |
+
.cmb2-id-form-title-title {
|
| 49 |
+
padding: .8em 0 1em;
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
#ctct_0_description_metabox,
|
| 54 |
+
#ctct_1_optin_metabox,
|
| 55 |
+
#ctct_2_fields_metabox {
|
| 56 |
+
|
| 57 |
+
#custom_fields_group_repeat {
|
| 58 |
+
.cmb-field-list .cmb-row:not(:last-of-type) {
|
| 59 |
+
border-bottom: none;
|
| 60 |
+
padding-bottom: 0.1em;
|
| 61 |
+
}
|
| 62 |
+
.required {
|
| 63 |
+
padding-bottom: 0.1em;
|
| 64 |
+
padding-top: 0.1em;
|
| 65 |
+
}
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
#default_fields_group_repeat {
|
| 69 |
+
.cmb-field-list {
|
| 70 |
+
& > .cmb-row {
|
| 71 |
+
padding-top: 0.5em;
|
| 72 |
+
|
| 73 |
+
&:not(:last-of-type) {
|
| 74 |
+
padding-bottom: 0.1em;
|
| 75 |
+
border-bottom: 1px solid #e9e9e9 !important;
|
| 76 |
+
}
|
| 77 |
+
}
|
| 78 |
+
}
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
.cmb-repeat-group-wrap {
|
| 82 |
+
padding: 0 !important;
|
| 83 |
+
|
| 84 |
+
.cmb-repeatable-grouping {
|
| 85 |
+
margin: 0 0 1.5em 0;
|
| 86 |
+
|
| 87 |
+
.cmb-row {
|
| 88 |
+
margin: 0 0 0 0.3em;
|
| 89 |
+
}
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
.cmb-repeat-group-field {
|
| 93 |
+
padding-top: 0.2em;
|
| 94 |
+
}
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
.postbox-container .cmb-remove-field-row {
|
| 98 |
+
padding-top: 0.8em;
|
| 99 |
+
padding-bottom: 0.8em;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
button {
|
| 103 |
+
&.cmb-add-group-row {
|
| 104 |
+
color: white !important;
|
| 105 |
+
background: #008ec2 !important;
|
| 106 |
+
border-color: #006799 !important;
|
| 107 |
+
}
|
| 108 |
+
&.cmb-remove-group-row {
|
| 109 |
+
background: #ffdfa3 !important;
|
| 110 |
+
display: none;
|
| 111 |
+
}
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 115 |
+
top: .3em;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
h3.cmb-group-title.cmbhandle-title {
|
| 119 |
+
padding-left: 1em;
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
#ctct_1_optin_metabox {
|
| 124 |
+
|
| 125 |
+
.cmb-row {
|
| 126 |
+
border-bottom: none;
|
| 127 |
+
padding: .5em 0px;
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
.cmb2-id--ctct-list {
|
| 131 |
+
padding-bottom: 0.5em;
|
| 132 |
+
}
|
| 133 |
+
|
| 134 |
+
.cmb-th {
|
| 135 |
+
width: 25%;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
.cmb-th + .cmb-td {
|
| 139 |
+
width: 70%;
|
| 140 |
+
}
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
#ctct_option_metabox_settings {
|
| 144 |
+
span.cmb2-metabox-description {
|
| 145 |
+
color: rgb(68, 68, 68);
|
| 146 |
+
}
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
#cmb2-metabox-email_settings,
|
| 150 |
+
#cmb2-metabox-ctct_2_generated_metabox,
|
| 151 |
+
#cmb2-metabox-ctct_1_custom_input_css_metabox {
|
| 152 |
+
.cmb-row {
|
| 153 |
+
padding-bottom: 0px !important;
|
| 154 |
+
}
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
#side-sortables {
|
| 158 |
+
|
| 159 |
+
#ctct_1_custom_form_css_metabox {
|
| 160 |
+
|
| 161 |
+
.cmb-row {
|
| 162 |
+
padding: 0.5em 0 0 0;
|
| 163 |
+
} // .cmb-row
|
| 164 |
+
|
| 165 |
+
.cmb-th {
|
| 166 |
+
padding-bottom: 0;
|
| 167 |
+
} // .cmb-th
|
| 168 |
+
|
| 169 |
+
.cmb-type-title {
|
| 170 |
+
border-bottom: none;
|
| 171 |
+
} // .cmb-type-title
|
| 172 |
+
|
| 173 |
+
.cmb2-id--ctct-form-title-font-size,
|
| 174 |
+
.cmb2-id--ctct-form-description-font-size {
|
| 175 |
+
border-bottom: none;
|
| 176 |
+
margin-bottom: 0;
|
| 177 |
+
} // .cmb2-id--ctct-form-title-font-size
|
| 178 |
+
|
| 179 |
+
} // #ctct_1_custom_form_css_metabox
|
| 180 |
+
|
| 181 |
+
#ctct_1_custom_input_css_metabox {
|
| 182 |
+
.cmb2-id-form-padding-title {
|
| 183 |
+
border-bottom: 0;
|
| 184 |
+
padding-bottom: 0;
|
| 185 |
+
} // .cmb2-id-form-padding-title
|
| 186 |
+
|
| 187 |
+
.cmb2-id--ctct-input-margin-top,
|
| 188 |
+
.cmb2-id--ctct-input-margin-right {
|
| 189 |
+
margin-bottom: 0;
|
| 190 |
+
margin-top: 0;
|
| 191 |
+
padding-bottom: 0;
|
| 192 |
+
padding-top: 0;
|
| 193 |
+
} // .cmb2-id--ctct-input-margin-top, .cmb2-id--ctct-input-margin-right
|
| 194 |
+
|
| 195 |
+
.cmb2-id--ctct-form-label-placement {
|
| 196 |
+
padding-bottom: 0;
|
| 197 |
+
margin-bottom: 0;
|
| 198 |
+
} // .cmb2-id--ctct-form-label-placement
|
| 199 |
+
|
| 200 |
+
.cmb-type-text-small {
|
| 201 |
+
border-bottom: none;
|
| 202 |
+
float: left;
|
| 203 |
+
width: 50%;
|
| 204 |
+
|
| 205 |
+
.cmb-th {
|
| 206 |
+
padding-bottom: 0;
|
| 207 |
+
} // .cmb-th
|
| 208 |
+
} // .cmb-type-text-small
|
| 209 |
+
} // #ctct_1_custom_input_css_metabox
|
| 210 |
+
} // #side-sortables
|
assets/sass/{admin-global-no-connection.scss → _admin-global-no-connection.scss}
RENAMED
|
@@ -1,6 +1,3 @@
|
|
| 1 |
-
@import 'variables';
|
| 2 |
-
@import 'mixins';
|
| 3 |
-
|
| 4 |
#adminmenu .wp-submenu a[href="edit.php?post_type=ctct_forms&page=ctct_options_connect"] {
|
| 5 |
color: rgb(58, 209, 130);
|
| 6 |
}
|
|
|
|
|
|
|
|
|
|
| 1 |
#adminmenu .wp-submenu a[href="edit.php?post_type=ctct_forms&page=ctct_options_connect"] {
|
| 2 |
color: rgb(58, 209, 130);
|
| 3 |
}
|
assets/sass/{admin-notices.scss → _admin-notices.scss}
RENAMED
|
File without changes
|
assets/sass/{admin-pages.scss → _admin-pages.scss}
RENAMED
|
@@ -1,6 +1,3 @@
|
|
| 1 |
-
@import 'variables';
|
| 2 |
-
@import 'mixins';
|
| 3 |
-
|
| 4 |
//--------------------------------------------------------------
|
| 5 |
// About Page
|
| 6 |
//--------------------------------------------------------------
|
|
|
|
|
|
|
|
|
|
| 1 |
//--------------------------------------------------------------
|
| 2 |
// About Page
|
| 3 |
//--------------------------------------------------------------
|
assets/sass/_forms.scss
CHANGED
|
@@ -6,9 +6,14 @@
|
|
| 6 |
.ctct-form {
|
| 7 |
@include clearfix;
|
| 8 |
|
| 9 |
-
label
|
| 10 |
-
|
| 11 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 12 |
|
| 13 |
abbr {
|
| 14 |
border: none;
|
| 6 |
.ctct-form {
|
| 7 |
@include clearfix;
|
| 8 |
|
| 9 |
+
.ctct-label-top label,
|
| 10 |
+
.ctct-label-bottom label {
|
| 11 |
+
display: block;
|
| 12 |
+
}
|
| 13 |
+
.ctct-label-left label,
|
| 14 |
+
.ctct-label-right label {
|
| 15 |
+
display: inline-block;
|
| 16 |
+
}
|
| 17 |
|
| 18 |
abbr {
|
| 19 |
border: none;
|
assets/sass/_inputs.scss
CHANGED
|
@@ -49,6 +49,36 @@
|
|
| 49 |
padding-left: 40px;
|
| 50 |
}
|
| 51 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 52 |
#ctct_usage {
|
| 53 |
position: absolute;
|
| 54 |
overflow: hidden;
|
|
@@ -59,4 +89,12 @@
|
|
| 59 |
border: 0px none;
|
| 60 |
padding: 0px;
|
| 61 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 62 |
}
|
| 49 |
padding-left: 40px;
|
| 50 |
}
|
| 51 |
|
| 52 |
+
input.ctct-label-left,
|
| 53 |
+
textarea.ctct-label-left {
|
| 54 |
+
display: inline-block;
|
| 55 |
+
width: 75%;
|
| 56 |
+
} // input.ctct-label-left, textarea.ctct-label-left
|
| 57 |
+
|
| 58 |
+
span.ctct-label-left {
|
| 59 |
+
display: inline-block;
|
| 60 |
+
margin-right: 5%;
|
| 61 |
+
width: 20%;
|
| 62 |
+
} // span.ctct-label-left
|
| 63 |
+
|
| 64 |
+
input.ctct-label-right,
|
| 65 |
+
textarea.ctct-label-right {
|
| 66 |
+
display: inline-block;
|
| 67 |
+
margin-right: 5%;
|
| 68 |
+
width: 75%;
|
| 69 |
+
} // input.ctct-label-right, textarea.ctct-label-right
|
| 70 |
+
|
| 71 |
+
span.ctct-label-right {
|
| 72 |
+
display: inline-block;
|
| 73 |
+
width: 20%;
|
| 74 |
+
} // span.ctct-label-right
|
| 75 |
+
|
| 76 |
+
span.ctct-label-hidden {
|
| 77 |
+
left: -9999px !important;
|
| 78 |
+
position: absolute !important;
|
| 79 |
+
top: -9999px !important;
|
| 80 |
+
} // span.ctct-label-hidden
|
| 81 |
+
|
| 82 |
#ctct_usage {
|
| 83 |
position: absolute;
|
| 84 |
overflow: hidden;
|
| 89 |
border: 0px none;
|
| 90 |
padding: 0px;
|
| 91 |
}
|
| 92 |
+
#ctct-submitted:disabled {
|
| 93 |
+
background-image: url('../images/oval.min.svg');
|
| 94 |
+
background-position: center;
|
| 95 |
+
background-repeat: no-repeat;
|
| 96 |
+
color: transparent;
|
| 97 |
+
cursor: wait;
|
| 98 |
+
opacity: 0.3;
|
| 99 |
+
}
|
| 100 |
}
|
assets/sass/{oath.scss → _oath.scss}
RENAMED
|
@@ -1,6 +1,3 @@
|
|
| 1 |
-
@import 'variables';
|
| 2 |
-
@import 'mixins';
|
| 3 |
-
|
| 4 |
//--------------------------------------------------------------
|
| 5 |
// Disconnect Page
|
| 6 |
//--------------------------------------------------------------
|
|
|
|
|
|
|
|
|
|
| 1 |
//--------------------------------------------------------------
|
| 2 |
// Disconnect Page
|
| 3 |
//--------------------------------------------------------------
|
assets/sass/admin-forms.scss
DELETED
|
@@ -1,123 +0,0 @@
|
|
| 1 |
-
@import 'variables';
|
| 2 |
-
@import 'mixins';
|
| 3 |
-
@import 'modal';
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
.post-type-ctct_forms .misc-pub-section {
|
| 7 |
-
&.misc-pub-visibility,
|
| 8 |
-
&.misc-pub-curtime {
|
| 9 |
-
display: none;
|
| 10 |
-
}
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
body.post-type-ctct_lists .misc-pub-post-status {
|
| 14 |
-
display: none;
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
body.post-type-ctct_forms #titlediv #title {
|
| 18 |
-
height: 2.7em;
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
.ctct-admin-title-details {
|
| 22 |
-
font-size: .6em;
|
| 23 |
-
vertical-align: middle;
|
| 24 |
-
display: block;
|
| 25 |
-
line-height: 2em;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in-instructions,
|
| 29 |
-
#cmb2-metabox-ctct_1_optin_metabox .cmb2-id--ctct-opt-in {
|
| 30 |
-
display: none;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
#ctct_0_description_metabox,
|
| 34 |
-
#ctct_1_optin_metabox,
|
| 35 |
-
#ctct_2_fields_metabox {
|
| 36 |
-
|
| 37 |
-
#custom_fields_group_repeat .cmb-field-list .cmb-row:not(:last-of-type) {
|
| 38 |
-
border-bottom: none;
|
| 39 |
-
padding-bottom: 0.1em;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
#custom_fields_group_repeat .required {
|
| 43 |
-
padding-bottom: 0.1em;
|
| 44 |
-
padding-top: 0.1em;
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
#default_fields_group_repeat .cmb-field-list > .cmb-row {
|
| 48 |
-
padding-top: 0.5em;
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
#default_fields_group_repeat .cmb-field-list > .cmb-row:not(:last-of-type) {
|
| 52 |
-
padding-bottom: 0.1em;
|
| 53 |
-
border-bottom: 1px solid #e9e9e9 !important;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
.cmb-repeat-group-wrap .cmb-repeatable-grouping {
|
| 57 |
-
margin: 0 0 1.5em 0;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
.cmb-repeat-group-wrap .cmb-repeatable-grouping .cmb-row {
|
| 61 |
-
margin: 0 0 0 0.3em;
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
.postbox-container .cmb-remove-field-row {
|
| 65 |
-
padding-top: 0.8em;
|
| 66 |
-
padding-bottom: 0.8em;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.cmb-repeat-group-wrap {
|
| 70 |
-
padding: 0 !important;
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
.cmb-repeat-group-wrap .cmb-repeat-group-field {
|
| 74 |
-
padding-top: 0.2em;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
button.cmb-add-group-row {
|
| 78 |
-
color: white !important;
|
| 79 |
-
background: #008ec2 !important;
|
| 80 |
-
border-color: #006799 !important;
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
.cmb2-metabox button.dashicons-before.dashicons-no-alt.cmb-remove-group-row {
|
| 84 |
-
top: .3em;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
button.cmb-remove-group-row {
|
| 88 |
-
background: #ffdfa3 !important;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
button.cmb-remove-group-row {
|
| 92 |
-
display: none;
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
h3.cmb-group-title.cmbhandle-title {
|
| 96 |
-
padding-left: 1em;
|
| 97 |
-
}
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
#ctct_1_optin_metabox {
|
| 101 |
-
|
| 102 |
-
.cmb-row {
|
| 103 |
-
border-bottom: none;
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
.cmb2-id--ctct-list {
|
| 107 |
-
padding-bottom: 0.5em;
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
.cmb-th {
|
| 111 |
-
width: 25%;
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
.cmb-th + .cmb-td {
|
| 115 |
-
width: 70%;
|
| 116 |
-
}
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
#ctct_option_metabox_settings {
|
| 120 |
-
span.cmb2-metabox-description {
|
| 121 |
-
color: rgb(68, 68, 68);
|
| 122 |
-
}
|
| 123 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/sass/admin-style.scss
ADDED
|
@@ -0,0 +1,13 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
//--------------------------------------------------------------
|
| 2 |
+
// Let's import all the things - admin-style.css
|
| 3 |
+
//--------------------------------------------------------------
|
| 4 |
+
|
| 5 |
+
@import "variables";
|
| 6 |
+
@import "mixins";
|
| 7 |
+
@import 'modal';
|
| 8 |
+
|
| 9 |
+
@import "admin-forms";
|
| 10 |
+
@import "admin-global-no-connection";
|
| 11 |
+
@import "admin-notices";
|
| 12 |
+
@import "admin-pages";
|
| 13 |
+
@import "oath";
|
constant-contact-forms.php
CHANGED
|
@@ -12,7 +12,7 @@
|
|
| 12 |
* Plugin Name: Constant Contact Forms for WordPress
|
| 13 |
* Plugin URI: https://www.constantcontact.com
|
| 14 |
* Description: Be a better marketer. All it takes is Constant Contact email marketing.
|
| 15 |
-
* Version: 1.
|
| 16 |
* Author: Constant Contact
|
| 17 |
* Author URI: https://www.constantcontact.com/index?pn=miwordpress
|
| 18 |
* License: GPLv3
|
|
@@ -77,7 +77,7 @@ class Constant_Contact {
|
|
| 77 |
* @since 1.0.0
|
| 78 |
* @var string
|
| 79 |
*/
|
| 80 |
-
const VERSION = '1.
|
| 81 |
|
| 82 |
/**
|
| 83 |
* URL of plugin directory.
|
|
@@ -379,6 +379,9 @@ class Constant_Contact {
|
|
| 379 |
|
| 380 |
// Include our helper functions function for end-users.
|
| 381 |
self::include_file( 'helper-functions', false );
|
|
|
|
|
|
|
|
|
|
| 382 |
}
|
| 383 |
|
| 384 |
/**
|
|
@@ -455,10 +458,14 @@ class Constant_Contact {
|
|
| 455 |
// Allow shortcodes in widgets for our plugin.
|
| 456 |
add_filter( 'widget_text', 'do_shortcode' );
|
| 457 |
|
|
|
|
|
|
|
|
|
|
| 458 |
if ( is_admin() ) {
|
| 459 |
add_action( 'wp_ajax_ctct_dismiss_first_modal', array( $this, 'ajax_save_clear_first_form' ) );
|
| 460 |
add_action( 'wp_ajax_nopriv_ctct_dismiss_first_modal', array( $this, 'ajax_save_clear_first_form' ) );
|
| 461 |
}
|
|
|
|
| 462 |
}
|
| 463 |
|
| 464 |
/**
|
|
@@ -598,7 +605,7 @@ class Constant_Contact {
|
|
| 598 |
|
| 599 |
if ( isset( $_POST['action'] ) && 'ctct_dismiss_first_modal' === $_POST['action'] ) {
|
| 600 |
// Save our dismiss for the first form modal.
|
| 601 |
-
update_option( 'ctct_first_form_modal_dismissed',
|
| 602 |
}
|
| 603 |
wp_die();
|
| 604 |
}
|
|
@@ -767,6 +774,34 @@ class Constant_Contact {
|
|
| 767 |
return $classes;
|
| 768 |
}
|
| 769 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 770 |
/**
|
| 771 |
* Determine if we are in a Constant Contact area.
|
| 772 |
*
|
| 12 |
* Plugin Name: Constant Contact Forms for WordPress
|
| 13 |
* Plugin URI: https://www.constantcontact.com
|
| 14 |
* Description: Be a better marketer. All it takes is Constant Contact email marketing.
|
| 15 |
+
* Version: 1.4.0
|
| 16 |
* Author: Constant Contact
|
| 17 |
* Author URI: https://www.constantcontact.com/index?pn=miwordpress
|
| 18 |
* License: GPLv3
|
| 77 |
* @since 1.0.0
|
| 78 |
* @var string
|
| 79 |
*/
|
| 80 |
+
const VERSION = '1.4.0';
|
| 81 |
|
| 82 |
/**
|
| 83 |
* URL of plugin directory.
|
| 379 |
|
| 380 |
// Include our helper functions function for end-users.
|
| 381 |
self::include_file( 'helper-functions', false );
|
| 382 |
+
|
| 383 |
+
// Include compatibility fixes to address conflicts with other plug-ins.
|
| 384 |
+
self::include_file( 'compatibility', false );
|
| 385 |
}
|
| 386 |
|
| 387 |
/**
|
| 458 |
// Allow shortcodes in widgets for our plugin.
|
| 459 |
add_filter( 'widget_text', 'do_shortcode' );
|
| 460 |
|
| 461 |
+
add_action( 'admin_enqueue_scripts', array( $this, 'register_admin_assets' ), 1 );
|
| 462 |
+
add_action( 'wp_enqueue_scripts', array( $this, 'register_front_assets' ), 1 );
|
| 463 |
+
|
| 464 |
if ( is_admin() ) {
|
| 465 |
add_action( 'wp_ajax_ctct_dismiss_first_modal', array( $this, 'ajax_save_clear_first_form' ) );
|
| 466 |
add_action( 'wp_ajax_nopriv_ctct_dismiss_first_modal', array( $this, 'ajax_save_clear_first_form' ) );
|
| 467 |
}
|
| 468 |
+
|
| 469 |
}
|
| 470 |
|
| 471 |
/**
|
| 605 |
|
| 606 |
if ( isset( $_POST['action'] ) && 'ctct_dismiss_first_modal' === $_POST['action'] ) {
|
| 607 |
// Save our dismiss for the first form modal.
|
| 608 |
+
update_option( 'ctct_first_form_modal_dismissed', current_time( 'timestamp' ) );
|
| 609 |
}
|
| 610 |
wp_die();
|
| 611 |
}
|
| 774 |
return $classes;
|
| 775 |
}
|
| 776 |
|
| 777 |
+
/**
|
| 778 |
+
* Register our admin styles.
|
| 779 |
+
*
|
| 780 |
+
* @since 1.4.0
|
| 781 |
+
*/
|
| 782 |
+
public function register_admin_assets() {
|
| 783 |
+
wp_register_style(
|
| 784 |
+
'constant-contact-forms-admin',
|
| 785 |
+
$this->url() . 'assets/css/admin-style.css',
|
| 786 |
+
array(),
|
| 787 |
+
self::VERSION
|
| 788 |
+
);
|
| 789 |
+
}
|
| 790 |
+
|
| 791 |
+
/**
|
| 792 |
+
* Register our frontend styles.
|
| 793 |
+
*
|
| 794 |
+
* @since 1.4.0
|
| 795 |
+
*/
|
| 796 |
+
public function register_front_assets() {
|
| 797 |
+
wp_register_style(
|
| 798 |
+
'ctct_form_styles',
|
| 799 |
+
$this->url() . 'assets/css/style.css',
|
| 800 |
+
array(),
|
| 801 |
+
self::VERSION
|
| 802 |
+
);
|
| 803 |
+
}
|
| 804 |
+
|
| 805 |
/**
|
| 806 |
* Determine if we are in a Constant Contact area.
|
| 807 |
*
|
includes/class-admin-pages.php
CHANGED
|
@@ -49,21 +49,7 @@ class ConstantContact_Admin_Pages {
|
|
| 49 |
* @since 1.0.0
|
| 50 |
*/
|
| 51 |
public function styles() {
|
| 52 |
-
|
| 53 |
-
wp_enqueue_style(
|
| 54 |
-
'constant-contact-forms',
|
| 55 |
-
constant_contact()->url() . 'assets/css/admin-forms.css',
|
| 56 |
-
array(),
|
| 57 |
-
Constant_Contact::VERSION
|
| 58 |
-
);
|
| 59 |
-
|
| 60 |
-
wp_enqueue_style(
|
| 61 |
-
'constant_contact_admin_pages',
|
| 62 |
-
constant_contact()->url() . 'assets/css/admin-pages.css',
|
| 63 |
-
array(),
|
| 64 |
-
Constant_Contact::VERSION
|
| 65 |
-
);
|
| 66 |
-
|
| 67 |
wp_enqueue_script( 'ctct_form' );
|
| 68 |
}
|
| 69 |
|
| 49 |
* @since 1.0.0
|
| 50 |
*/
|
| 51 |
public function styles() {
|
| 52 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 53 |
wp_enqueue_script( 'ctct_form' );
|
| 54 |
}
|
| 55 |
|
includes/class-admin.php
CHANGED
|
@@ -290,7 +290,7 @@ class ConstantContact_Admin {
|
|
| 290 |
get_the_title( $list->ID )
|
| 291 |
);
|
| 292 |
} else {
|
| 293 |
-
esc_html_e( 'No associated
|
| 294 |
}
|
| 295 |
break;
|
| 296 |
}
|
|
@@ -352,6 +352,13 @@ class ConstantContact_Admin {
|
|
| 352 |
* @return array
|
| 353 |
*/
|
| 354 |
public function add_social_links( $links ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 355 |
// Get Twitter share link.
|
| 356 |
$twitter_cta = __( 'Check out the official WordPress plugin from @constantcontact :', 'constant-contact-forms' );
|
| 357 |
|
|
@@ -501,12 +508,13 @@ class ConstantContact_Admin {
|
|
| 501 |
*
|
| 502 |
* @since 1.3.0
|
| 503 |
*
|
| 504 |
-
* @param string $list_id Constant Contact list ID value
|
| 505 |
* @return mixed
|
| 506 |
*/
|
| 507 |
public function get_associated_list_by_id( $list_id ) {
|
| 508 |
global $wpdb;
|
| 509 |
$sql = "SELECT p.ID FROM $wpdb->posts as p INNER JOIN $wpdb->postmeta as pm on p.ID = pm.post_id WHERE pm.meta_key = '_ctct_list_id' AND pm.meta_value = %s";
|
|
|
|
| 510 |
$rs = $wpdb->get_results(
|
| 511 |
$wpdb->prepare( $sql, $list_id )
|
| 512 |
);
|
| 290 |
get_the_title( $list->ID )
|
| 291 |
);
|
| 292 |
} else {
|
| 293 |
+
esc_html_e( 'No associated list', 'constant-contact-forms' );
|
| 294 |
}
|
| 295 |
break;
|
| 296 |
}
|
| 352 |
* @return array
|
| 353 |
*/
|
| 354 |
public function add_social_links( $links ) {
|
| 355 |
+
|
| 356 |
+
// No code beyond this point can account for a non-array value for this passed parameter,
|
| 357 |
+
// so let's just return early.
|
| 358 |
+
if ( ! is_array( $links ) ) {
|
| 359 |
+
return $links;
|
| 360 |
+
}
|
| 361 |
+
|
| 362 |
// Get Twitter share link.
|
| 363 |
$twitter_cta = __( 'Check out the official WordPress plugin from @constantcontact :', 'constant-contact-forms' );
|
| 364 |
|
| 508 |
*
|
| 509 |
* @since 1.3.0
|
| 510 |
*
|
| 511 |
+
* @param string $list_id Constant Contact list ID value.
|
| 512 |
* @return mixed
|
| 513 |
*/
|
| 514 |
public function get_associated_list_by_id( $list_id ) {
|
| 515 |
global $wpdb;
|
| 516 |
$sql = "SELECT p.ID FROM $wpdb->posts as p INNER JOIN $wpdb->postmeta as pm on p.ID = pm.post_id WHERE pm.meta_key = '_ctct_list_id' AND pm.meta_value = %s";
|
| 517 |
+
|
| 518 |
$rs = $wpdb->get_results(
|
| 519 |
$wpdb->prepare( $sql, $list_id )
|
| 520 |
);
|
includes/class-api.php
CHANGED
|
@@ -827,8 +827,8 @@ class ConstantContact_API {
|
|
| 827 |
}
|
| 828 |
|
| 829 |
$disclosure = array(
|
| 830 |
-
'name' => empty( $account_info->organization_name ) ? ctct_get_settings_option( '_ctct_disclose_name' ) : $account_info->organization_name,
|
| 831 |
-
'address' => ctct_get_settings_option( '_ctct_disclose_address' ),
|
| 832 |
);
|
| 833 |
|
| 834 |
// Bail if we don't have a name.
|
| 827 |
}
|
| 828 |
|
| 829 |
$disclosure = array(
|
| 830 |
+
'name' => empty( $account_info->organization_name ) ? ctct_get_settings_option( '_ctct_disclose_name', '' ) : $account_info->organization_name,
|
| 831 |
+
'address' => ctct_get_settings_option( '_ctct_disclose_address', '' ),
|
| 832 |
);
|
| 833 |
|
| 834 |
// Bail if we don't have a name.
|
includes/class-builder-fields.php
CHANGED
|
@@ -77,8 +77,11 @@ class ConstantContact_Builder_Fields {
|
|
| 77 |
add_action( 'cmb2_admin_init', array( $this, 'description_metabox' ) );
|
| 78 |
add_action( 'cmb2_admin_init', array( $this, 'constant_contact_list_metabox' ) );
|
| 79 |
add_action( 'cmb2_admin_init', array( $this, 'opt_ins_metabox' ) );
|
| 80 |
-
add_action( 'cmb2_admin_init', array( $this, 'fields_metabox' ) );
|
| 81 |
add_action( 'cmb2_admin_init', array( $this, 'generated_shortcode' ) );
|
|
|
|
|
|
|
|
|
|
|
|
|
| 82 |
add_filter( 'cmb2_override__ctct_generated_shortcode_meta_save', '__return_empty_string' );
|
| 83 |
}
|
| 84 |
|
|
@@ -177,9 +180,9 @@ class ConstantContact_Builder_Fields {
|
|
| 177 |
) );
|
| 178 |
|
| 179 |
$options_metabox->add_field( array(
|
| 180 |
-
'name'
|
| 181 |
-
'type'
|
| 182 |
-
'id'
|
| 183 |
'after' => '<hr/>',
|
| 184 |
) );
|
| 185 |
|
|
@@ -198,13 +201,181 @@ class ConstantContact_Builder_Fields {
|
|
| 198 |
'description' => __( 'Enable form submission without a page refresh. This option overrides the Redirect URL choice above.', 'constant-contact-forms' ),
|
| 199 |
) );
|
| 200 |
|
| 201 |
-
|
| 202 |
-
|
| 203 |
if ( constant_contact()->api->is_connected() ) {
|
| 204 |
$this->show_optin_connected_fields( $options_metabox );
|
| 205 |
}
|
| 206 |
}
|
| 207 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 208 |
/**
|
| 209 |
* Helper method to show our connected optin fields.
|
| 210 |
*
|
|
@@ -299,11 +470,11 @@ class ConstantContact_Builder_Fields {
|
|
| 299 |
$business_name ? ( $business_name ) : __( 'Your Business Name', 'constant-contact-forms' );
|
| 300 |
|
| 301 |
$options_metabox->add_field( array(
|
| 302 |
-
'name'
|
| 303 |
-
'id'
|
| 304 |
-
'type'
|
| 305 |
// translators: placeholder has a business name from Constant Contact.
|
| 306 |
-
'default'
|
| 307 |
) );
|
| 308 |
}
|
| 309 |
|
|
@@ -511,4 +682,34 @@ class ConstantContact_Builder_Fields {
|
|
| 511 |
),
|
| 512 |
) );
|
| 513 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 514 |
}
|
| 77 |
add_action( 'cmb2_admin_init', array( $this, 'description_metabox' ) );
|
| 78 |
add_action( 'cmb2_admin_init', array( $this, 'constant_contact_list_metabox' ) );
|
| 79 |
add_action( 'cmb2_admin_init', array( $this, 'opt_ins_metabox' ) );
|
|
|
|
| 80 |
add_action( 'cmb2_admin_init', array( $this, 'generated_shortcode' ) );
|
| 81 |
+
add_action( 'cmb2_admin_init', array( $this, 'email_settings' ) );
|
| 82 |
+
add_action( 'cmb2_admin_init', array( $this, 'custom_form_css_metabox' ) );
|
| 83 |
+
add_action( 'cmb2_admin_init', array( $this, 'custom_input_css_metabox' ) );
|
| 84 |
+
add_action( 'cmb2_admin_init', array( $this, 'fields_metabox' ) );
|
| 85 |
add_filter( 'cmb2_override__ctct_generated_shortcode_meta_save', '__return_empty_string' );
|
| 86 |
}
|
| 87 |
|
| 180 |
) );
|
| 181 |
|
| 182 |
$options_metabox->add_field( array(
|
| 183 |
+
'name' => esc_html__( 'Submission behavior', 'constant-contact-forms' ),
|
| 184 |
+
'type' => 'title',
|
| 185 |
+
'id' => 'submission_behavior_title',
|
| 186 |
'after' => '<hr/>',
|
| 187 |
) );
|
| 188 |
|
| 201 |
'description' => __( 'Enable form submission without a page refresh. This option overrides the Redirect URL choice above.', 'constant-contact-forms' ),
|
| 202 |
) );
|
| 203 |
|
|
|
|
|
|
|
| 204 |
if ( constant_contact()->api->is_connected() ) {
|
| 205 |
$this->show_optin_connected_fields( $options_metabox );
|
| 206 |
}
|
| 207 |
}
|
| 208 |
|
| 209 |
+
/**
|
| 210 |
+
* Metabox for user to set custom CSS for a form.
|
| 211 |
+
*
|
| 212 |
+
* @since 1.4.0
|
| 213 |
+
*/
|
| 214 |
+
public function custom_form_css_metabox() {
|
| 215 |
+
$custom_css_metabox = new_cmb2_box( array(
|
| 216 |
+
'id' => 'ctct_1_custom_form_css_metabox',
|
| 217 |
+
'title' => __( 'Form Design', 'constant-contact-forms' ),
|
| 218 |
+
'object_types' => array( 'ctct_forms' ),
|
| 219 |
+
'context' => 'side',
|
| 220 |
+
'priority' => 'low',
|
| 221 |
+
) );
|
| 222 |
+
|
| 223 |
+
$custom_css_metabox->add_field( array(
|
| 224 |
+
'name' => __( 'Background Color', 'constant-contact-forms' ),
|
| 225 |
+
'id' => $this->prefix . 'form_background_color',
|
| 226 |
+
'type' => 'colorpicker',
|
| 227 |
+
'description' => esc_html__(
|
| 228 |
+
'Applies to the whole form.',
|
| 229 |
+
'constant-contact-forms'
|
| 230 |
+
),
|
| 231 |
+
) );
|
| 232 |
+
|
| 233 |
+
$custom_css_metabox->add_field( array(
|
| 234 |
+
'name' => esc_html__( 'Form Description', 'constant-contact-forms' ),
|
| 235 |
+
'type' => 'title',
|
| 236 |
+
'id' => 'form-description-title',
|
| 237 |
+
) );
|
| 238 |
+
|
| 239 |
+
$custom_css_metabox->add_field( array(
|
| 240 |
+
'name' => __( 'Font Size', 'constant-contact-forms' ),
|
| 241 |
+
'id' => $this->prefix . 'form_description_font_size',
|
| 242 |
+
'type' => 'select',
|
| 243 |
+
'show_option_none' => 'Default',
|
| 244 |
+
'options_cb' => 'constant_contact_get_font_dropdown_sizes',
|
| 245 |
+
) );
|
| 246 |
+
|
| 247 |
+
$custom_css_metabox->add_field( array(
|
| 248 |
+
'name' => __( 'Font Color', 'constant-contact-forms' ),
|
| 249 |
+
'id' => $this->prefix . 'form_description_color',
|
| 250 |
+
'type' => 'colorpicker',
|
| 251 |
+
) );
|
| 252 |
+
|
| 253 |
+
$custom_css_metabox->add_field( array(
|
| 254 |
+
'name' => esc_html__( 'Form Submit Button', 'constant-contact-forms' ),
|
| 255 |
+
'type' => 'title',
|
| 256 |
+
'id' => 'form-submit-button-title',
|
| 257 |
+
) );
|
| 258 |
+
|
| 259 |
+
$custom_css_metabox->add_field( array(
|
| 260 |
+
'name' => __( 'Font Size', 'constant-contact-forms' ),
|
| 261 |
+
'id' => $this->prefix . 'form_submit_button_font_size',
|
| 262 |
+
'type' => 'select',
|
| 263 |
+
'show_option_none' => 'Default',
|
| 264 |
+
'options_cb' => 'constant_contact_get_font_dropdown_sizes',
|
| 265 |
+
) );
|
| 266 |
+
|
| 267 |
+
$custom_css_metabox->add_field( array(
|
| 268 |
+
'name' => __( 'Font Color', 'constant-contact-forms' ),
|
| 269 |
+
'id' => $this->prefix . 'form_submit_button_text_color',
|
| 270 |
+
'type' => 'colorpicker',
|
| 271 |
+
'description' => esc_html__(
|
| 272 |
+
'Choose a color for the submit button text.',
|
| 273 |
+
'constant-contact-forms'
|
| 274 |
+
),
|
| 275 |
+
) );
|
| 276 |
+
|
| 277 |
+
$custom_css_metabox->add_field( array(
|
| 278 |
+
'name' => __( 'Background Color', 'constant-contact-forms' ),
|
| 279 |
+
'id' => $this->prefix . 'form_submit_button_background_color',
|
| 280 |
+
'type' => 'colorpicker',
|
| 281 |
+
'description' => esc_html__(
|
| 282 |
+
'Choose a color for the submit button background.',
|
| 283 |
+
'constant-contact-forms'
|
| 284 |
+
),
|
| 285 |
+
) );
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
/**
|
| 289 |
+
* Metabox for user to set custom CSS for a form.
|
| 290 |
+
*
|
| 291 |
+
* @since 1.4.0
|
| 292 |
+
*/
|
| 293 |
+
public function custom_input_css_metabox() {
|
| 294 |
+
$custom_css_metabox = new_cmb2_box( array(
|
| 295 |
+
'id' => 'ctct_1_custom_input_css_metabox',
|
| 296 |
+
'title' => __( 'Input Design', 'constant-contact-forms' ),
|
| 297 |
+
'object_types' => array( 'ctct_forms' ),
|
| 298 |
+
'context' => 'side',
|
| 299 |
+
'priority' => 'low',
|
| 300 |
+
) );
|
| 301 |
+
|
| 302 |
+
$custom_css_metabox->add_field( array(
|
| 303 |
+
'name' => esc_html__( 'Form Padding', 'constant-contact-forms' ),
|
| 304 |
+
'type' => 'title',
|
| 305 |
+
'id' => 'form-padding-title',
|
| 306 |
+
'description' => esc_html__(
|
| 307 |
+
'Enter padding values in number of pixels. Padding will be applied to four sides of the form.',
|
| 308 |
+
'constant-contact-form' ),
|
| 309 |
+
) );
|
| 310 |
+
|
| 311 |
+
$custom_css_metabox->add_field( array(
|
| 312 |
+
'name' => __( 'Top', 'constant-contact-forms' ),
|
| 313 |
+
'id' => $this->prefix . 'form_padding_top',
|
| 314 |
+
'type' => 'text_small',
|
| 315 |
+
'show_names' => true,
|
| 316 |
+
'attributes' => array(
|
| 317 |
+
'type' => 'number',
|
| 318 |
+
),
|
| 319 |
+
) );
|
| 320 |
+
|
| 321 |
+
$custom_css_metabox->add_field( array(
|
| 322 |
+
'name' => __( 'Right', 'constant-contact-forms' ),
|
| 323 |
+
'id' => $this->prefix . 'form_padding_right',
|
| 324 |
+
'type' => 'text_small',
|
| 325 |
+
'show_names' => true,
|
| 326 |
+
'attributes' => array(
|
| 327 |
+
'type' => 'number',
|
| 328 |
+
),
|
| 329 |
+
) );
|
| 330 |
+
|
| 331 |
+
$custom_css_metabox->add_field( array(
|
| 332 |
+
'name' => __( 'Bottom', 'constant-contact-forms' ),
|
| 333 |
+
'id' => $this->prefix . 'form_padding_bottom',
|
| 334 |
+
'type' => 'text_small',
|
| 335 |
+
'show_names' => true,
|
| 336 |
+
'attributes' => array(
|
| 337 |
+
'type' => 'number',
|
| 338 |
+
),
|
| 339 |
+
) );
|
| 340 |
+
|
| 341 |
+
$custom_css_metabox->add_field( array(
|
| 342 |
+
'name' => __( 'Left', 'constant-contact-forms' ),
|
| 343 |
+
'id' => $this->prefix . 'form_padding_left',
|
| 344 |
+
'type' => 'text_small',
|
| 345 |
+
'show_names' => true,
|
| 346 |
+
'attributes' => array(
|
| 347 |
+
'type' => 'number',
|
| 348 |
+
),
|
| 349 |
+
) );
|
| 350 |
+
|
| 351 |
+
$custom_css_metabox->add_field( array(
|
| 352 |
+
'name' => __( 'Custom Classes', 'constant-contact-forms' ),
|
| 353 |
+
'id' => $this->prefix . 'input_custom_classes',
|
| 354 |
+
'type' => 'text',
|
| 355 |
+
'description' => esc_html__(
|
| 356 |
+
'Set custom CSS class(es) for inputs. Separate multiple classes with spaces.',
|
| 357 |
+
'constant-contact-forms'
|
| 358 |
+
),
|
| 359 |
+
) );
|
| 360 |
+
|
| 361 |
+
$custom_css_metabox->add_field( array(
|
| 362 |
+
'name' => __( 'Label Placement', 'constant-contact-forms' ),
|
| 363 |
+
'id' => $this->prefix . 'form_label_placement',
|
| 364 |
+
'type' => 'select',
|
| 365 |
+
'show_option_none' => 'Global',
|
| 366 |
+
'options' => array(
|
| 367 |
+
'top' => 'Top',
|
| 368 |
+
'left' => 'Left',
|
| 369 |
+
'bottom' => 'Bottom',
|
| 370 |
+
'right' => 'Right',
|
| 371 |
+
),
|
| 372 |
+
'description' => esc_html__(
|
| 373 |
+
'Set the position for labels for inputs.',
|
| 374 |
+
'constant-contact-forms'
|
| 375 |
+
),
|
| 376 |
+
) );
|
| 377 |
+
}
|
| 378 |
+
|
| 379 |
/**
|
| 380 |
* Helper method to show our connected optin fields.
|
| 381 |
*
|
| 470 |
$business_name ? ( $business_name ) : __( 'Your Business Name', 'constant-contact-forms' );
|
| 471 |
|
| 472 |
$options_metabox->add_field( array(
|
| 473 |
+
'name' => __( 'Opt-in Affirmation', 'constant-contact-forms' ),
|
| 474 |
+
'id' => $this->prefix . 'opt_in_instructions',
|
| 475 |
+
'type' => 'textarea_small',
|
| 476 |
// translators: placeholder has a business name from Constant Contact.
|
| 477 |
+
'default' => sprintf( __( 'Example: Yes, I would like to receive emails from %s. (You can unsubscribe anytime)', 'constant-contact-forms' ), $business_name ),
|
| 478 |
) );
|
| 479 |
}
|
| 480 |
|
| 682 |
),
|
| 683 |
) );
|
| 684 |
}
|
| 685 |
+
|
| 686 |
+
/**
|
| 687 |
+
* Add a metabox for customizing destination email for a given form.
|
| 688 |
+
*
|
| 689 |
+
* @since 1.4.0
|
| 690 |
+
*/
|
| 691 |
+
public function email_settings() {
|
| 692 |
+
|
| 693 |
+
$email_settings = new_cmb2_box( array(
|
| 694 |
+
'id' => 'email_settings',
|
| 695 |
+
'title' => esc_html__( 'Email settings', 'constant-contact-forms' ),
|
| 696 |
+
'object_types' => array( 'ctct_forms' ),
|
| 697 |
+
'context' => 'side',
|
| 698 |
+
'priority' => 'low',
|
| 699 |
+
) );
|
| 700 |
+
|
| 701 |
+
$email_settings->add_field( array(
|
| 702 |
+
'name' => esc_html__( 'Email destination', 'constant-contact-forms' ),
|
| 703 |
+
'desc' => esc_html__( 'Who should receive email notifications for this form. Separate multiple emails by a comma. Leave blank to default to admin email.', 'constant-contact-forms' ),
|
| 704 |
+
'id' => $this->prefix . 'email_settings',
|
| 705 |
+
'type' => 'text_medium',
|
| 706 |
+
) );
|
| 707 |
+
|
| 708 |
+
$email_settings->add_field( array(
|
| 709 |
+
'name' => esc_html__( 'Disable email notifications for this form?', 'constant-contact-forms' ),
|
| 710 |
+
'desc' => esc_html__( 'Check this option to disable emails for this Constant Contact Forms form.', 'constant-contact-forms' ),
|
| 711 |
+
'id' => $this->prefix . 'disable_emails_for_form',
|
| 712 |
+
'type' => 'checkbox',
|
| 713 |
+
) );
|
| 714 |
+
}
|
| 715 |
}
|
includes/class-builder.php
CHANGED
|
@@ -117,7 +117,7 @@ class ConstantContact_Builder {
|
|
| 117 |
public function add_form_css() {
|
| 118 |
|
| 119 |
// Let's style this thing
|
| 120 |
-
wp_enqueue_style( 'constant-contact-forms' );
|
| 121 |
}
|
| 122 |
|
| 123 |
/**
|
| 117 |
public function add_form_css() {
|
| 118 |
|
| 119 |
// Let's style this thing
|
| 120 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
| 121 |
}
|
| 122 |
|
| 123 |
/**
|
includes/class-check.php
CHANGED
|
@@ -162,7 +162,7 @@ class ConstantContact_Check {
|
|
| 162 |
|
| 163 |
if ( defined( 'DISABLE_WP_CRON' ) && DISABLE_WP_CRON ) {
|
| 164 |
// translators: placeholder will be a timestamp for the current time.
|
| 165 |
-
return sprintf( __( 'The DISABLE_WP_CRON constant is set to true as of %s. WP-Cron is disabled and will not run.', 'constant-contact-forms' ), current_time( 'm/d/Y g:i:s a' ) );
|
| 166 |
}
|
| 167 |
|
| 168 |
if ( defined( 'ALTERNATE_WP_CRON' ) && ALTERNATE_WP_CRON ) {
|
| 162 |
|
| 163 |
if ( defined( 'DISABLE_WP_CRON' ) && DISABLE_WP_CRON ) {
|
| 164 |
// translators: placeholder will be a timestamp for the current time.
|
| 165 |
+
return sprintf( __( 'The DISABLE_WP_CRON constant is set to true as of %s. WP-Cron is disabled and will not run.', 'constant-contact-forms' ), current_time( 'm/d/Y g:i:s a' ) ); // Both uses of current_time like this are valid.
|
| 166 |
}
|
| 167 |
|
| 168 |
if ( defined( 'ALTERNATE_WP_CRON' ) && ALTERNATE_WP_CRON ) {
|
includes/class-connect.php
CHANGED
|
@@ -158,20 +158,11 @@ class ConstantContact_Connect {
|
|
| 158 |
*/
|
| 159 |
public function admin_page_display() {
|
| 160 |
|
| 161 |
-
wp_register_style(
|
| 162 |
-
'constant_contact_admin_global_no_connection',
|
| 163 |
-
constant_contact()->url() . 'assets/css/admin-global-no-connection.css',
|
| 164 |
-
array(),
|
| 165 |
-
Constant_Contact::VERSION
|
| 166 |
-
);
|
| 167 |
-
|
| 168 |
-
wp_enqueue_style( 'constant_contact_admin_global_no_connection' );
|
| 169 |
-
|
| 170 |
if ( ! current_user_can( 'manage_options' ) ) {
|
| 171 |
return false;
|
| 172 |
}
|
| 173 |
|
| 174 |
-
wp_enqueue_style( 'constant-contact-
|
| 175 |
|
| 176 |
wp_localize_script( 'ctct_form', 'ctct_texts', array( 'disconnectconfirm' => __( 'Are you sure you want to disconnect?', 'constant-contact-forms' ) ) );
|
| 177 |
|
| 158 |
*/
|
| 159 |
public function admin_page_display() {
|
| 160 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 161 |
if ( ! current_user_can( 'manage_options' ) ) {
|
| 162 |
return false;
|
| 163 |
}
|
| 164 |
|
| 165 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
| 166 |
|
| 167 |
wp_localize_script( 'ctct_form', 'ctct_texts', array( 'disconnectconfirm' => __( 'Are you sure you want to disconnect?', 'constant-contact-forms' ) ) );
|
| 168 |
|
includes/class-cpts.php
CHANGED
|
@@ -307,7 +307,7 @@ class ConstantContact_CPTS {
|
|
| 307 |
$title = ( $form->post_title ) ? $form->post_title : __( 'No title', 'constant-contact-forms' );
|
| 308 |
|
| 309 |
// Get the last modified time in human text.
|
| 310 |
-
$last_modified = human_time_diff( strtotime( $form->post_modified ),
|
| 311 |
|
| 312 |
// Build up our title for the shortcode form admin.
|
| 313 |
$title = sprintf(
|
| 307 |
$title = ( $form->post_title ) ? $form->post_title : __( 'No title', 'constant-contact-forms' );
|
| 308 |
|
| 309 |
// Get the last modified time in human text.
|
| 310 |
+
$last_modified = human_time_diff( strtotime( $form->post_modified ), current_time( 'timestamp' ) );
|
| 311 |
|
| 312 |
// Build up our title for the shortcode form admin.
|
| 313 |
$title = sprintf(
|
includes/class-display-shortcode.php
CHANGED
|
@@ -44,7 +44,7 @@ class ConstantContact_Display_Shortcode {
|
|
| 44 |
}
|
| 45 |
|
| 46 |
/**
|
| 47 |
-
* Acts as a wrapper so our shortcode class
|
| 48 |
*
|
| 49 |
* @since 1.0.0
|
| 50 |
*
|
|
@@ -71,7 +71,7 @@ class ConstantContact_Display_Shortcode {
|
|
| 71 |
*/
|
| 72 |
public function get_form( $form_id ) {
|
| 73 |
|
| 74 |
-
//
|
| 75 |
$form_id = absint( $form_id );
|
| 76 |
if ( ! $form_id ) {
|
| 77 |
return '';
|
|
@@ -145,11 +145,11 @@ class ConstantContact_Display_Shortcode {
|
|
| 145 |
* @param array $custom_fields Custom fields to parse through.
|
| 146 |
* @param array $full_data Array of full data.
|
| 147 |
* @param int $form_id Form ID.
|
| 148 |
-
* @return
|
| 149 |
*/
|
| 150 |
public function get_field_values( $custom_fields, $full_data, $form_id ) {
|
| 151 |
|
| 152 |
-
// Get all our data from our fields, while we unserialize them
|
| 153 |
$fields = $this->generate_field_values_for_fields( maybe_unserialize( $custom_fields ) );
|
| 154 |
|
| 155 |
// Now that we've finished checking all of our form fields, we'll
|
|
@@ -158,10 +158,10 @@ class ConstantContact_Display_Shortcode {
|
|
| 158 |
$fields['options']['form_id'] = $form_id;
|
| 159 |
}
|
| 160 |
|
| 161 |
-
// add in our form description, if we have one
|
| 162 |
$fields['options']['description'] = $this->get_nested_value_from_data( '_ctct_description', $full_data );
|
| 163 |
|
| 164 |
-
// Get our optin data
|
| 165 |
$fields['options']['optin'] = $this->generate_optin_data( $full_data );
|
| 166 |
|
| 167 |
return $fields;
|
|
@@ -188,7 +188,7 @@ class ConstantContact_Display_Shortcode {
|
|
| 188 |
// Loop through each of our fields.
|
| 189 |
foreach ( $custom_fields as $key => $value ) {
|
| 190 |
|
| 191 |
-
// Make sure we have the parts of our array that we expect
|
| 192 |
if ( ! isset( $custom_fields ) || ! isset( $custom_fields[ $key ] ) ) {
|
| 193 |
continue;
|
| 194 |
}
|
|
@@ -203,7 +203,7 @@ class ConstantContact_Display_Shortcode {
|
|
| 203 |
// Set our field description, if we can.
|
| 204 |
$fields = $this->set_field( '_ctct_field_desc', 'description', $key, $fields, $custom_fields );
|
| 205 |
|
| 206 |
-
// Set our field requirement, if we can. We do this by casting the results of our two checks to a boolean
|
| 207 |
$fields['fields'][ $key ]['required'] = (
|
| 208 |
isset( $custom_fields[ $key ]['_ctct_required_field'] ) &&
|
| 209 |
'on' === $custom_fields[ $key ]['_ctct_required_field']
|
| 44 |
}
|
| 45 |
|
| 46 |
/**
|
| 47 |
+
* Acts as a wrapper so our shortcode class doesn't have to do this.
|
| 48 |
*
|
| 49 |
* @since 1.0.0
|
| 50 |
*
|
| 71 |
*/
|
| 72 |
public function get_form( $form_id ) {
|
| 73 |
|
| 74 |
+
// Sanity check it.
|
| 75 |
$form_id = absint( $form_id );
|
| 76 |
if ( ! $form_id ) {
|
| 77 |
return '';
|
| 145 |
* @param array $custom_fields Custom fields to parse through.
|
| 146 |
* @param array $full_data Array of full data.
|
| 147 |
* @param int $form_id Form ID.
|
| 148 |
+
* @return array Form field markup.
|
| 149 |
*/
|
| 150 |
public function get_field_values( $custom_fields, $full_data, $form_id ) {
|
| 151 |
|
| 152 |
+
// Get all our data from our fields, while we unserialize them.
|
| 153 |
$fields = $this->generate_field_values_for_fields( maybe_unserialize( $custom_fields ) );
|
| 154 |
|
| 155 |
// Now that we've finished checking all of our form fields, we'll
|
| 158 |
$fields['options']['form_id'] = $form_id;
|
| 159 |
}
|
| 160 |
|
| 161 |
+
// add in our form description, if we have one.
|
| 162 |
$fields['options']['description'] = $this->get_nested_value_from_data( '_ctct_description', $full_data );
|
| 163 |
|
| 164 |
+
// Get our optin data.
|
| 165 |
$fields['options']['optin'] = $this->generate_optin_data( $full_data );
|
| 166 |
|
| 167 |
return $fields;
|
| 188 |
// Loop through each of our fields.
|
| 189 |
foreach ( $custom_fields as $key => $value ) {
|
| 190 |
|
| 191 |
+
// Make sure we have the parts of our array that we expect.
|
| 192 |
if ( ! isset( $custom_fields ) || ! isset( $custom_fields[ $key ] ) ) {
|
| 193 |
continue;
|
| 194 |
}
|
| 203 |
// Set our field description, if we can.
|
| 204 |
$fields = $this->set_field( '_ctct_field_desc', 'description', $key, $fields, $custom_fields );
|
| 205 |
|
| 206 |
+
// Set our field requirement, if we can. We do this by casting the results of our two checks to a boolean.
|
| 207 |
$fields['fields'][ $key ]['required'] = (
|
| 208 |
isset( $custom_fields[ $key ]['_ctct_required_field'] ) &&
|
| 209 |
'on' === $custom_fields[ $key ]['_ctct_required_field']
|
includes/class-display.php
CHANGED
|
@@ -21,6 +21,22 @@ class ConstantContact_Display {
|
|
| 21 |
*/
|
| 22 |
protected $plugin = null;
|
| 23 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 24 |
/**
|
| 25 |
* Constructor.
|
| 26 |
*
|
|
@@ -30,18 +46,21 @@ class ConstantContact_Display {
|
|
| 30 |
*/
|
| 31 |
public function __construct( $plugin ) {
|
| 32 |
$this->plugin = $plugin;
|
|
|
|
|
|
|
| 33 |
}
|
| 34 |
|
| 35 |
/**
|
| 36 |
* Scripts.
|
| 37 |
*
|
| 38 |
* @since 1.0.0
|
|
|
|
| 39 |
*
|
| 40 |
* @param bool $enqueue Set true to enqueue the scripts after registering.
|
| 41 |
*/
|
| 42 |
public function scripts( $enqueue = false ) {
|
| 43 |
|
| 44 |
-
$debug
|
| 45 |
$suffix = ( true === $debug ) ? '' : '.min';
|
| 46 |
|
| 47 |
wp_register_script(
|
|
@@ -52,29 +71,131 @@ class ConstantContact_Display {
|
|
| 52 |
true
|
| 53 |
);
|
| 54 |
|
| 55 |
-
|
| 56 |
-
wp_enqueue_script( 'ctct_frontend_forms' );
|
| 57 |
-
}
|
| 58 |
}
|
| 59 |
|
| 60 |
/**
|
| 61 |
-
*
|
| 62 |
*
|
| 63 |
* @since 1.0.0
|
|
|
|
| 64 |
*
|
| 65 |
* @param bool $enqueue Set true to enqueue the scripts after registering.
|
| 66 |
*/
|
| 67 |
public function styles( $enqueue = false ) {
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 73 |
);
|
| 74 |
|
| 75 |
-
|
| 76 |
-
|
|
|
|
|
|
|
|
|
|
| 77 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 78 |
}
|
| 79 |
|
| 80 |
/**
|
|
@@ -93,14 +214,8 @@ class ConstantContact_Display {
|
|
| 93 |
return '';
|
| 94 |
}
|
| 95 |
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
$this->styles( true );
|
| 99 |
-
$this->scripts( true );
|
| 100 |
-
} else {
|
| 101 |
-
$this->scripts();
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
$return = '';
|
| 105 |
$form_err_display = '';
|
| 106 |
$error_message = false;
|
|
@@ -120,7 +235,7 @@ class ConstantContact_Display {
|
|
| 120 |
// Check to see if we got a response, and if it has the fields we expect.
|
| 121 |
if ( $response && isset( $response['message'] ) && isset( $response['status'] ) ) {
|
| 122 |
|
| 123 |
-
// If we were
|
| 124 |
if ( 'success' === $response['status'] ) {
|
| 125 |
|
| 126 |
// If we were successful, we'll return here so we don't display the entire form again.
|
|
@@ -129,9 +244,9 @@ class ConstantContact_Display {
|
|
| 129 |
} else {
|
| 130 |
|
| 131 |
// If we didn't get a success message, then we want to error.
|
| 132 |
-
// We already checked for a
|
| 133 |
// status to error if we're not here.
|
| 134 |
-
$status
|
| 135 |
$error_message = trim( $response['message'] );
|
| 136 |
}
|
| 137 |
}
|
|
@@ -159,9 +274,37 @@ class ConstantContact_Display {
|
|
| 159 |
$form_action = apply_filters( 'constant_contact_front_form_action', '', $form_id );
|
| 160 |
$should_do_ajax = get_post_meta( $form_id, '_ctct_do_ajax', true );
|
| 161 |
$do_ajax = ( 'on' === $should_do_ajax ) ? $should_do_ajax : 'off';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 162 |
|
| 163 |
// Build out our form.
|
| 164 |
-
$return .= '<form class="
|
|
|
|
|
|
|
|
|
|
|
|
|
| 165 |
|
| 166 |
// If we have errors, display them.
|
| 167 |
$return .= $form_err_display;
|
|
@@ -194,6 +337,18 @@ class ConstantContact_Display {
|
|
| 194 |
|
| 195 |
$return .= '</form>';
|
| 196 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 197 |
$return .= '<script type="text/javascript">';
|
| 198 |
$return .= 'var ajaxurl = "' . esc_url( admin_url( 'admin-ajax.php' ) ) . '";';
|
| 199 |
$return .= '</script>';
|
|
@@ -286,8 +441,8 @@ class ConstantContact_Display {
|
|
| 286 |
public function build_form_fields( $form_data, $old_values, $req_errors ) {
|
| 287 |
|
| 288 |
// Start our wrapper return var.
|
| 289 |
-
$return
|
| 290 |
-
$form_id =
|
| 291 |
|
| 292 |
// Check to see if we have a form ID for the form, and display our description.
|
| 293 |
if ( isset( $form_data['options'] ) && isset( $form_data['options']['form_id'] ) ) {
|
|
@@ -295,16 +450,21 @@ class ConstantContact_Display {
|
|
| 295 |
// Get our description.
|
| 296 |
$desc = isset( $form_data['options']['description'] ) ? $form_data['options']['description'] : '';
|
| 297 |
|
| 298 |
-
//
|
| 299 |
-
$form_id = absint( $form_data['options']['form_id'] );
|
| 300 |
-
|
| 301 |
-
// Add in our Description.
|
| 302 |
$return .= $this->description( $desc, $form_id );
|
|
|
|
| 303 |
}
|
| 304 |
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 308 |
}
|
| 309 |
|
| 310 |
// Check to see if we have an opt-in for the form, and display it.
|
|
@@ -335,7 +495,7 @@ class ConstantContact_Display {
|
|
| 335 |
|
| 336 |
public function build_recaptcha() {
|
| 337 |
// If we've reached this point, we know we have our keys.
|
| 338 |
-
$site_key = ctct_get_settings_option( '_ctct_recaptcha_site_key' );
|
| 339 |
|
| 340 |
/**
|
| 341 |
* Filters the language code to be used with Google reCAPTCHA.
|
|
@@ -360,7 +520,19 @@ class ConstantContact_Display {
|
|
| 360 |
}
|
| 361 |
|
| 362 |
public function build_timestamp() {
|
| 363 |
-
return '<input type="hidden" name="ctct_time" value="' .
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 364 |
}
|
| 365 |
|
| 366 |
/**
|
|
@@ -383,14 +555,16 @@ class ConstantContact_Display {
|
|
| 383 |
* Wrapper for single field display.
|
| 384 |
*
|
| 385 |
* @since 1.0.0
|
|
|
|
| 386 |
*
|
| 387 |
-
* @param array
|
| 388 |
-
* @param array
|
| 389 |
-
* @param array
|
| 390 |
-
* @param int
|
|
|
|
| 391 |
* @return string HTML markup
|
| 392 |
*/
|
| 393 |
-
public function field( $field, $old_values = array(), $req_errors = array(), $form_id = 0 ) {
|
| 394 |
|
| 395 |
// If we don't have a name or a mapping, it will be hard to do things.
|
| 396 |
if ( ! isset( $field['name'] ) || ! isset( $field['map_to'] ) ) {
|
|
@@ -398,20 +572,21 @@ class ConstantContact_Display {
|
|
| 398 |
}
|
| 399 |
|
| 400 |
$field = wp_parse_args( $field, array(
|
| 401 |
-
'name'
|
| 402 |
-
'map_to'
|
| 403 |
-
'type'
|
| 404 |
-
'description'
|
| 405 |
-
'
|
|
|
|
| 406 |
) );
|
| 407 |
|
| 408 |
// Check all our data points.
|
| 409 |
-
$name
|
| 410 |
-
$map
|
| 411 |
-
$desc
|
| 412 |
-
$type
|
| 413 |
-
$value
|
| 414 |
-
$req
|
| 415 |
|
| 416 |
// We may have more than one of the same field in our array.
|
| 417 |
// this makes sure we keep them unique when processing them.
|
|
@@ -439,7 +614,7 @@ class ConstantContact_Display {
|
|
| 439 |
|
| 440 |
// Based on the error type, display an error.
|
| 441 |
if ( 'invalid' === $error['error'] ) {
|
| 442 |
-
|
| 443 |
} else {
|
| 444 |
$field_error .= __( ' Error: Please fill out this field.', 'constant-contact-forms' );
|
| 445 |
}
|
|
@@ -464,13 +639,13 @@ class ConstantContact_Display {
|
|
| 464 |
case 'company':
|
| 465 |
case 'website':
|
| 466 |
case 'text_field':
|
| 467 |
-
return $this->input( 'text', $name, $map, $value, $desc, $req, false, $field_error, $form_id );
|
| 468 |
break;
|
| 469 |
case 'custom_text_area':
|
| 470 |
-
return $this->textarea( $name, $map, $value, $desc, $req, $field_error, 'maxlength="500"' );
|
| 471 |
break;
|
| 472 |
case 'email':
|
| 473 |
-
return $this->input( 'email', $name, $map, $value, $desc, $req, false, $field_error );
|
| 474 |
break;
|
| 475 |
case 'hidden':
|
| 476 |
return $this->input( 'hidden', $name, $map, $value, $desc, $req );
|
|
@@ -482,7 +657,7 @@ class ConstantContact_Display {
|
|
| 482 |
return $this->input( 'submit', $name, $map, $value, $desc, $req, false, $field_error );
|
| 483 |
break;
|
| 484 |
case 'address':
|
| 485 |
-
return $this->address( $name, $map, $value, $desc, $req, $field_error );
|
| 486 |
break;
|
| 487 |
case 'anniversery':
|
| 488 |
case 'birthday':
|
|
@@ -502,7 +677,7 @@ class ConstantContact_Display {
|
|
| 502 |
*
|
| 503 |
* @param string|array $value Field value.
|
| 504 |
* @param string $map Map value.
|
| 505 |
-
* @param array $field Array of fields
|
| 506 |
* @param array $submitted_vals Array of submitted values.
|
| 507 |
* @return string Submitted value.
|
| 508 |
*/
|
|
@@ -591,6 +766,36 @@ class ConstantContact_Display {
|
|
| 591 |
return '<p class="ctct-message ' . esc_attr( $type ) . '">' . esc_attr( $message ) . '</p>';
|
| 592 |
}
|
| 593 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 594 |
/**
|
| 595 |
* Helper method to display form description.
|
| 596 |
*
|
|
@@ -602,7 +807,8 @@ class ConstantContact_Display {
|
|
| 602 |
*/
|
| 603 |
public function description( $desc = '', $form_id = false ) {
|
| 604 |
|
| 605 |
-
$display
|
|
|
|
| 606 |
|
| 607 |
// If we have the permissions, also display an edit link.
|
| 608 |
if ( current_user_can( 'edit_posts' ) && $form_id ) {
|
|
@@ -616,7 +822,7 @@ class ConstantContact_Display {
|
|
| 616 |
}
|
| 617 |
}
|
| 618 |
|
| 619 |
-
return '<span class="ctct-form-description">' . wpautop( wp_kses_post( $desc ) ) . '</span>' . $display;
|
| 620 |
}
|
| 621 |
|
| 622 |
/**
|
|
@@ -624,32 +830,16 @@ class ConstantContact_Display {
|
|
| 624 |
*
|
| 625 |
* @since 1.0.0
|
| 626 |
*
|
| 627 |
-
* @param string $type
|
| 628 |
-
* @param string $name
|
| 629 |
-
* @param string $f_id
|
| 630 |
-
* @param string $label
|
| 631 |
-
* @param boolean $req
|
| 632 |
-
* @param boolean $use_label
|
| 633 |
* @return string HTML markup.
|
| 634 |
*/
|
| 635 |
public function field_top( $type = '', $name = '', $f_id = '', $label = '', $req = false, $use_label = true ) {
|
| 636 |
|
| 637 |
-
// Set blank defaults for required info.
|
| 638 |
-
$req_label = '';
|
| 639 |
-
|
| 640 |
-
// If this is required, we output the HMTL5 required att.
|
| 641 |
-
if ( $req ) {
|
| 642 |
-
|
| 643 |
-
/**
|
| 644 |
-
* Filters the markup used for the required indicator.
|
| 645 |
-
*
|
| 646 |
-
* @since 1.0.0
|
| 647 |
-
*
|
| 648 |
-
* @param string $value An `<abbr>` tag with an asterisk indicating required status.
|
| 649 |
-
*/
|
| 650 |
-
$req_label = apply_filters( 'constant_contact_required_label', '<abbr title="required">*</abbr>' );
|
| 651 |
-
}
|
| 652 |
-
|
| 653 |
$classes = array(
|
| 654 |
'ctct-form-field',
|
| 655 |
'ctct-form-field-' . $type,
|
|
@@ -661,13 +851,6 @@ class ConstantContact_Display {
|
|
| 661 |
// Start building our return markup.
|
| 662 |
$markup = '<p class="' . implode( ' ', $classes ) . '">';
|
| 663 |
|
| 664 |
-
// Allow skipping label, also don't show for submit buttons.
|
| 665 |
-
if ( $use_label && ( 'submit' !== $type ) && ( 'hidden' !== $type ) ) {
|
| 666 |
-
|
| 667 |
-
// Our field label will be the form name + required asterisk + our label.
|
| 668 |
-
$markup .= $this->get_label( $f_id, $name . ' ' . $req_label );
|
| 669 |
-
}
|
| 670 |
-
|
| 671 |
// If we're not on submit or hidden, but still doing label on bottom,
|
| 672 |
// then output a container div.
|
| 673 |
if ( ! $use_label ) {
|
|
@@ -703,6 +886,40 @@ class ConstantContact_Display {
|
|
| 703 |
return $markup . '</p>';
|
| 704 |
}
|
| 705 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 706 |
/**
|
| 707 |
* Helper method to get form label.
|
| 708 |
*
|
|
@@ -721,32 +938,67 @@ class ConstantContact_Display {
|
|
| 721 |
*
|
| 722 |
* @since 1.0.0
|
| 723 |
*
|
| 724 |
-
* @param string $type
|
| 725 |
-
* @param string $name
|
| 726 |
-
* @param string $id
|
| 727 |
-
* @param string $value
|
| 728 |
-
* @param string $label
|
| 729 |
-
* @param boolean $req
|
| 730 |
-
* @param boolean $f_only
|
| 731 |
-
* @param boolean $field_error
|
| 732 |
-
* @param int $form_id
|
|
|
|
| 733 |
* @return string HTML markup for field.
|
| 734 |
*/
|
| 735 |
-
public function input( $type = 'text', $name = '', $id = '', $value = '', $label = '', $req = false, $f_only = false, $field_error = false, $form_id = 0 ) {
|
| 736 |
|
| 737 |
// Sanitize our stuff / set values.
|
| 738 |
-
$name
|
| 739 |
-
$f_id
|
| 740 |
-
$
|
| 741 |
-
$
|
| 742 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 743 |
$req_text = $req ? 'required' : '';
|
| 744 |
|
| 745 |
// Start our markup.
|
| 746 |
$markup = $this->field_top( $type, $name, $f_id, $label, $req );
|
| 747 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 748 |
// Provide some CSS class(es).
|
| 749 |
-
$classes
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 750 |
|
| 751 |
/**
|
| 752 |
* Filter to add classes for the rendering input.
|
|
@@ -766,12 +1018,10 @@ class ConstantContact_Display {
|
|
| 766 |
* @param bool $value Whether or not to truncate. Default false.
|
| 767 |
*/
|
| 768 |
$truncate_max_length = apply_filters( 'constant_contact_include_custom_field_label', false, $form_id );
|
| 769 |
-
$max_length
|
| 770 |
if ( false !== strpos( $id, 'custom___' ) ) {
|
| 771 |
$max_length = ( $truncate_max_length ) ? $this->get_max_length_attr( $name ) : $this->get_max_length_attr();
|
| 772 |
}
|
| 773 |
-
// Set our field as as seprate var, because we allow for only returning that.
|
| 774 |
-
$field = '<input ' . $req_text . ' type="' . $type . '" name="' . $f_id . '" id="' . $f_id . '" value="' . $value . '" ' . $max_length . ' placeholder="' . $label . '" ';
|
| 775 |
|
| 776 |
// If we have an error.
|
| 777 |
if ( $field_error ) {
|
|
@@ -779,16 +1029,35 @@ class ConstantContact_Display {
|
|
| 779 |
$classes[] = 'ctct-invalid';
|
| 780 |
}
|
| 781 |
|
|
|
|
| 782 |
// Append classes to our field.
|
| 783 |
if ( count( $classes ) ) {
|
| 784 |
-
$
|
| 785 |
}
|
| 786 |
|
| 787 |
// Finish the markup for our field itself.
|
| 788 |
-
$field
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 789 |
|
| 790 |
-
|
| 791 |
-
|
|
|
|
|
|
|
|
|
|
| 792 |
|
| 793 |
// If we got an error, add it to the bottom label.
|
| 794 |
if ( $field_error ) {
|
|
@@ -839,7 +1108,7 @@ class ConstantContact_Display {
|
|
| 839 |
*/
|
| 840 |
$classes = apply_filters( 'constant_contact_input_classes', $classes, $type );
|
| 841 |
|
| 842 |
-
$markup
|
| 843 |
$markup .= '<input type="' . $type . '" name="' . $f_id . '" id="' . $f_id . '" value="' . $value . '" class="' . implode( ' ', $classes ) . '" />';
|
| 844 |
$markup .= $this->field_bottom( $name, ' ' . $label );
|
| 845 |
|
|
@@ -959,7 +1228,7 @@ class ConstantContact_Display {
|
|
| 959 |
// If we aren't showing the field, then we default our checkbox to checked.
|
| 960 |
$checked = $show ? '' : 'checked';
|
| 961 |
|
| 962 |
-
$markup
|
| 963 |
$markup .= '<input type="checkbox" ' . $checked . ' name="ctct-opt-in" id="ctct-opt-in" class="ctct-checkbox ctct-opt-in" value="' . $value . '" />';
|
| 964 |
$markup .= $this->field_bottom( 'ctct-opt-in', ' ' . wp_kses_post( $label ), false );
|
| 965 |
|
|
@@ -971,15 +1240,16 @@ class ConstantContact_Display {
|
|
| 971 |
*
|
| 972 |
* @since 1.0.0
|
| 973 |
*
|
| 974 |
-
* @param string $name
|
| 975 |
-
* @param string $f_id
|
| 976 |
-
* @param array $value
|
| 977 |
-
* @param string $desc
|
| 978 |
-
* @param boolean $req
|
| 979 |
-
* @param string $field_error
|
|
|
|
| 980 |
* @return string field HTML markup.
|
| 981 |
*/
|
| 982 |
-
public function address( $name = '', $f_id = '', $value = array(), $desc = '', $req = false, $field_error = '' ) {
|
| 983 |
|
| 984 |
// Set up our text strings.
|
| 985 |
$street = __( 'Street Address', 'constant-contact-forms' );
|
|
@@ -1002,37 +1272,149 @@ class ConstantContact_Display {
|
|
| 1002 |
*
|
| 1003 |
* @param string $value An `<abbr>` tag with an asterisk indicating required status.
|
| 1004 |
*/
|
| 1005 |
-
$req_label
|
| 1006 |
-
$req_class
|
| 1007 |
-
$req
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1008 |
|
| 1009 |
-
|
| 1010 |
-
$
|
| 1011 |
-
|
| 1012 |
-
|
| 1013 |
-
|
| 1014 |
-
|
| 1015 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1016 |
// Address Line 2 is not required, note the missing $req inclusion.
|
| 1017 |
-
$
|
| 1018 |
-
|
| 1019 |
-
|
| 1020 |
-
|
| 1021 |
-
|
| 1022 |
-
|
| 1023 |
-
|
| 1024 |
-
|
| 1025 |
-
$
|
| 1026 |
-
|
| 1027 |
-
|
| 1028 |
-
|
| 1029 |
-
|
| 1030 |
-
|
| 1031 |
-
|
| 1032 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1033 |
$return .= '</fieldset>';
|
| 1034 |
|
| 1035 |
-
return
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1036 |
}
|
| 1037 |
|
| 1038 |
/**
|
|
@@ -1256,23 +1638,28 @@ class ConstantContact_Display {
|
|
| 1256 |
*
|
| 1257 |
* @since 1.0.0
|
| 1258 |
*
|
| 1259 |
-
* @param string $name
|
| 1260 |
-
* @param string $map
|
| 1261 |
-
* @param string $value
|
| 1262 |
-
* @param string $desc
|
| 1263 |
-
* @param boolean $req
|
| 1264 |
-
* @param string $field_error
|
| 1265 |
-
* @param string $extra_attrs
|
|
|
|
| 1266 |
* @return string HTML markup.
|
| 1267 |
*/
|
| 1268 |
-
public function textarea( $name = '', $map = '', $value = '', $desc = '', $req = false, $field_error = '', $extra_attrs = '' ) {
|
|
|
|
|
|
|
|
|
|
| 1269 |
|
| 1270 |
-
$classes = array( 'ctct-form-field' );
|
| 1271 |
// Set our required text.
|
| 1272 |
$req_text = $req ? 'required' : '';
|
| 1273 |
if ( $req ) {
|
| 1274 |
$classes[] = 'ctct-form-field-required';
|
| 1275 |
}
|
|
|
|
|
|
|
| 1276 |
|
| 1277 |
// If required, get our label.
|
| 1278 |
$req_label = '';
|
|
@@ -1288,9 +1675,16 @@ class ConstantContact_Display {
|
|
| 1288 |
$req_label = apply_filters( 'constant_contact_required_label', '<abbr title="required">*</abbr>' );
|
| 1289 |
}
|
| 1290 |
|
| 1291 |
-
$return
|
| 1292 |
-
$
|
|
|
|
| 1293 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1294 |
if ( $field_error ) {
|
| 1295 |
$return .= '<span class="ctct-field-error"><label for="' . esc_attr( $map ) . '">' . esc_attr( __( 'Error: Please correct your entry.', 'constant-contact-forms' ) ) . '</label></span>';
|
| 1296 |
}
|
|
@@ -1299,7 +1693,7 @@ class ConstantContact_Display {
|
|
| 1299 |
}
|
| 1300 |
|
| 1301 |
/**
|
| 1302 |
-
* Maybe display the
|
| 1303 |
*
|
| 1304 |
* @since 1.0.0
|
| 1305 |
*
|
|
@@ -1381,5 +1775,7 @@ class ConstantContact_Display {
|
|
| 1381 |
}
|
| 1382 |
return 'maxlength="' . $length . '"';
|
| 1383 |
}
|
|
|
|
|
|
|
| 1384 |
}
|
| 1385 |
|
| 21 |
*/
|
| 22 |
protected $plugin = null;
|
| 23 |
|
| 24 |
+
/**
|
| 25 |
+
* The global custom styles.
|
| 26 |
+
*
|
| 27 |
+
* @since 1.4.0
|
| 28 |
+
* @var array
|
| 29 |
+
*/
|
| 30 |
+
protected $global_form_styles = array();
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* Styles set for a particular form.
|
| 34 |
+
*
|
| 35 |
+
* @since 1.4.0
|
| 36 |
+
* @var array
|
| 37 |
+
*/
|
| 38 |
+
protected $specific_form_styles = array();
|
| 39 |
+
|
| 40 |
/**
|
| 41 |
* Constructor.
|
| 42 |
*
|
| 46 |
*/
|
| 47 |
public function __construct( $plugin ) {
|
| 48 |
$this->plugin = $plugin;
|
| 49 |
+
add_action( 'wp_enqueue_scripts', array( $this, 'scripts' ) );
|
| 50 |
+
add_action( 'wp_enqueue_scripts', array( $this, 'styles' ) );
|
| 51 |
}
|
| 52 |
|
| 53 |
/**
|
| 54 |
* Scripts.
|
| 55 |
*
|
| 56 |
* @since 1.0.0
|
| 57 |
+
* @since 1.4.0 Deprecated parameter.
|
| 58 |
*
|
| 59 |
* @param bool $enqueue Set true to enqueue the scripts after registering.
|
| 60 |
*/
|
| 61 |
public function scripts( $enqueue = false ) {
|
| 62 |
|
| 63 |
+
$debug = defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG === true ? true : false;
|
| 64 |
$suffix = ( true === $debug ) ? '' : '.min';
|
| 65 |
|
| 66 |
wp_register_script(
|
| 71 |
true
|
| 72 |
);
|
| 73 |
|
| 74 |
+
wp_enqueue_script( 'ctct_frontend_forms' );
|
|
|
|
|
|
|
| 75 |
}
|
| 76 |
|
| 77 |
/**
|
| 78 |
+
* Enqueue styles.
|
| 79 |
*
|
| 80 |
* @since 1.0.0
|
| 81 |
+
* @since 1.4.0 Deprecated parameter.
|
| 82 |
*
|
| 83 |
* @param bool $enqueue Set true to enqueue the scripts after registering.
|
| 84 |
*/
|
| 85 |
public function styles( $enqueue = false ) {
|
| 86 |
+
wp_enqueue_style( 'ctct_form_styles' );
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
/**
|
| 90 |
+
* Retrieve the styles set globally for forms.
|
| 91 |
+
*
|
| 92 |
+
* @since 1.4.0
|
| 93 |
+
* @author Scott Tirrell
|
| 94 |
+
*/
|
| 95 |
+
public function set_global_form_css() {
|
| 96 |
+
|
| 97 |
+
$defaults = array(
|
| 98 |
+
'global_form_classes' => '',
|
| 99 |
+
'global_label_placement' => '',
|
| 100 |
);
|
| 101 |
|
| 102 |
+
$global_form_css = array();
|
| 103 |
+
|
| 104 |
+
$global_form_classes = ctct_get_settings_option( '_ctct_form_custom_classes' );
|
| 105 |
+
if ( $global_form_classes ) {
|
| 106 |
+
$global_form_css['global_form_classes'] = $global_form_classes;
|
| 107 |
}
|
| 108 |
+
|
| 109 |
+
$global_label_placement = ctct_get_settings_option( 'ctct_form_label_placement' );
|
| 110 |
+
if ( $global_label_placement ) {
|
| 111 |
+
$global_form_css['global_label_placement'] = $global_label_placement;
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
$this->global_form_styles = wp_parse_args( $global_form_css, $defaults );
|
| 115 |
+
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
/**
|
| 119 |
+
* Retrieve the styles set for a specific form.
|
| 120 |
+
*
|
| 121 |
+
* @param int $form_id The id of the form.
|
| 122 |
+
*
|
| 123 |
+
* @since 1.4.0
|
| 124 |
+
* @author Scott Tirrell
|
| 125 |
+
*/
|
| 126 |
+
public function set_specific_form_css( $form_id ) {
|
| 127 |
+
$defaults = array(
|
| 128 |
+
'form_background_color' => '',
|
| 129 |
+
'form_description_font_size' => '',
|
| 130 |
+
'form_description_color' => '',
|
| 131 |
+
'form_submit_button_font_size' => '',
|
| 132 |
+
'form_submit_button_text_color' => '',
|
| 133 |
+
'form_submit_button_background_color' => '',
|
| 134 |
+
'form_padding_top' => '',
|
| 135 |
+
'form_padding_right' => '',
|
| 136 |
+
'form_padding_bottom' => '',
|
| 137 |
+
'form_padding_left' => '',
|
| 138 |
+
'input_custom_classes' => '',
|
| 139 |
+
);
|
| 140 |
+
|
| 141 |
+
$specific_form_css = array();
|
| 142 |
+
|
| 143 |
+
$ctct_form_background_color = get_post_meta( $form_id, '_ctct_form_background_color', true );
|
| 144 |
+
if ( ! empty( $ctct_form_background_color ) ) {
|
| 145 |
+
$specific_form_css['form_background_color'] = "background-color: {$ctct_form_background_color};";
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
$ctct_form_description_font_size = get_post_meta( $form_id, '_ctct_form_description_font_size', true );
|
| 149 |
+
if ( ! empty( $ctct_form_description_font_size ) ) {
|
| 150 |
+
$specific_form_css['form_description_font_size'] = "font-size: {$ctct_form_description_font_size};";
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
$ctct_form_description_color = get_post_meta( $form_id, '_ctct_form_description_color', true );
|
| 154 |
+
if ( ! empty( $ctct_form_description_color ) ) {
|
| 155 |
+
$specific_form_css['form_description_color'] = "color: {$ctct_form_description_color};";
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
$ctct_form_submit_button_font_size = get_post_meta( $form_id, '_ctct_form_submit_button_font_size', true );
|
| 159 |
+
if ( ! empty( $ctct_form_submit_button_font_size ) ) {
|
| 160 |
+
$specific_form_css['form_submit_button_font_size'] = "font-size: {$ctct_form_submit_button_font_size};";
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
$ctct_form_submit_button_text_color = get_post_meta( $form_id, '_ctct_form_submit_button_text_color', true );
|
| 164 |
+
if ( ! empty( $ctct_form_submit_button_text_color ) ) {
|
| 165 |
+
$specific_form_css['form_submit_button_text_color'] = "color: {$ctct_form_submit_button_text_color};";
|
| 166 |
+
}
|
| 167 |
+
|
| 168 |
+
$ctct_form_submit_button_background_color = get_post_meta( $form_id, '_ctct_form_submit_button_background_color', true );
|
| 169 |
+
if ( ! empty( $ctct_form_submit_button_background_color ) ) {
|
| 170 |
+
$specific_form_css['form_submit_button_background_color'] = "background-color: {$ctct_form_submit_button_background_color};";
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
$ctct_form_padding_top = get_post_meta( $form_id, '_ctct_form_padding_top', true );
|
| 174 |
+
if ( ! empty( $ctct_form_padding_top ) ) {
|
| 175 |
+
$specific_form_css['form_padding_top'] = "padding-top: {$ctct_form_padding_top}px;";
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
$ctct_form_padding_right = get_post_meta( $form_id, '_ctct_form_padding_right', true );
|
| 179 |
+
if ( ! empty( $ctct_form_padding_right ) ) {
|
| 180 |
+
$specific_form_css['form_padding_right'] = "padding-right: {$ctct_form_padding_right}px;";
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
$ctct_form_padding_bottom = get_post_meta( $form_id, '_ctct_form_padding_bottom', true );
|
| 184 |
+
if ( ! empty( $ctct_form_padding_bottom ) ) {
|
| 185 |
+
$specific_form_css['form_padding_bottom'] = "padding-bottom: {$ctct_form_padding_bottom}px;";
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
$ctct_form_padding_left = get_post_meta( $form_id, '_ctct_form_padding_left', true );
|
| 189 |
+
if ( ! empty( $ctct_form_padding_left ) ) {
|
| 190 |
+
$specific_form_css['form_padding_left'] = "padding-left: {$ctct_form_padding_left}px;";
|
| 191 |
+
}
|
| 192 |
+
|
| 193 |
+
$ctct_input_custom_classes = get_post_meta( $form_id, '_ctct_input_custom_classes', true );
|
| 194 |
+
if ( ! empty( $ctct_input_custom_classes ) ) {
|
| 195 |
+
$specific_form_css['input_custom_classes'] = esc_attr( $ctct_input_custom_classes );
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
$this->specific_form_styles = wp_parse_args( $specific_form_css, $defaults );
|
| 199 |
}
|
| 200 |
|
| 201 |
/**
|
| 214 |
return '';
|
| 215 |
}
|
| 216 |
|
| 217 |
+
$this->set_global_form_css();
|
| 218 |
+
$this->set_specific_form_css( $form_id );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 219 |
$return = '';
|
| 220 |
$form_err_display = '';
|
| 221 |
$error_message = false;
|
| 235 |
// Check to see if we got a response, and if it has the fields we expect.
|
| 236 |
if ( $response && isset( $response['message'] ) && isset( $response['status'] ) ) {
|
| 237 |
|
| 238 |
+
// If we were successful, then display success message.
|
| 239 |
if ( 'success' === $response['status'] ) {
|
| 240 |
|
| 241 |
// If we were successful, we'll return here so we don't display the entire form again.
|
| 244 |
} else {
|
| 245 |
|
| 246 |
// If we didn't get a success message, then we want to error.
|
| 247 |
+
// We already checked for a message response, but we'll force the
|
| 248 |
// status to error if we're not here.
|
| 249 |
+
$status = 'error';
|
| 250 |
$error_message = trim( $response['message'] );
|
| 251 |
}
|
| 252 |
}
|
| 274 |
$form_action = apply_filters( 'constant_contact_front_form_action', '', $form_id );
|
| 275 |
$should_do_ajax = get_post_meta( $form_id, '_ctct_do_ajax', true );
|
| 276 |
$do_ajax = ( 'on' === $should_do_ajax ) ? $should_do_ajax : 'off';
|
| 277 |
+
$form_classes = 'ctct-form ctct-form-' . $form_id;
|
| 278 |
+
$form_classes .= $this->build_custom_form_classes();
|
| 279 |
+
|
| 280 |
+
$form_styles = '';
|
| 281 |
+
if ( ! empty( $this->specific_form_styles['form_background_color'] ) ) {
|
| 282 |
+
$form_styles = $this->specific_form_styles['form_background_color'];
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
foreach( ['bottom','left','right','top'] as $pos ) {
|
| 286 |
+
$form_styles .= $this->specific_form_styles[ 'form_padding_' . $pos ];
|
| 287 |
+
}
|
| 288 |
+
|
| 289 |
+
// Add action before form for custom actions.
|
| 290 |
+
ob_start();
|
| 291 |
+
/**
|
| 292 |
+
* Fires before the start of the form tag.
|
| 293 |
+
*
|
| 294 |
+
* @since 1.4.0
|
| 295 |
+
*
|
| 296 |
+
* @param int $form_id Current form ID.
|
| 297 |
+
*/
|
| 298 |
+
do_action( 'ctct_before_form', $form_id );
|
| 299 |
+
$return .= ob_get_contents();
|
| 300 |
+
ob_end_clean();
|
| 301 |
|
| 302 |
// Build out our form.
|
| 303 |
+
$return .= '<form class="' . esc_attr( $form_classes ) . '" id="' . $rf_id . '" ';
|
| 304 |
+
$return .= 'data-doajax="' . esc_attr( $do_ajax ) . '" ';
|
| 305 |
+
$return .= 'style="' . esc_attr( $form_styles ) . '" ';
|
| 306 |
+
$return .= 'action="' . esc_attr( $form_action ) . '" ';
|
| 307 |
+
$return .= 'method="post">';
|
| 308 |
|
| 309 |
// If we have errors, display them.
|
| 310 |
$return .= $form_err_display;
|
| 337 |
|
| 338 |
$return .= '</form>';
|
| 339 |
|
| 340 |
+
ob_start();
|
| 341 |
+
/**
|
| 342 |
+
* Fires after the end of the form tag.
|
| 343 |
+
*
|
| 344 |
+
* @since 1.4.0
|
| 345 |
+
*
|
| 346 |
+
* @param int $form_id Current form ID.
|
| 347 |
+
*/
|
| 348 |
+
do_action( 'ctct_after_form', $form_id );
|
| 349 |
+
$return .= ob_get_contents();
|
| 350 |
+
ob_end_clean();
|
| 351 |
+
|
| 352 |
$return .= '<script type="text/javascript">';
|
| 353 |
$return .= 'var ajaxurl = "' . esc_url( admin_url( 'admin-ajax.php' ) ) . '";';
|
| 354 |
$return .= '</script>';
|
| 441 |
public function build_form_fields( $form_data, $old_values, $req_errors ) {
|
| 442 |
|
| 443 |
// Start our wrapper return var.
|
| 444 |
+
$return = '';
|
| 445 |
+
$form_id = absint( $form_data['options']['form_id'] );
|
| 446 |
|
| 447 |
// Check to see if we have a form ID for the form, and display our description.
|
| 448 |
if ( isset( $form_data['options'] ) && isset( $form_data['options']['form_id'] ) ) {
|
| 450 |
// Get our description.
|
| 451 |
$desc = isset( $form_data['options']['description'] ) ? $form_data['options']['description'] : '';
|
| 452 |
|
| 453 |
+
// Get our Description.
|
|
|
|
|
|
|
|
|
|
| 454 |
$return .= $this->description( $desc, $form_id );
|
| 455 |
+
|
| 456 |
}
|
| 457 |
|
| 458 |
+
$label_placement = constant_contact_get_css_customization( $form_id, '_ctct_form_label_placement' );
|
| 459 |
+
if ( empty( $label_placement ) ) {
|
| 460 |
+
$label_placement = 'top';
|
| 461 |
+
}
|
| 462 |
+
|
| 463 |
+
if ( isset( $form_data['fields'] ) && is_array( $form_data['fields'] ) ) {
|
| 464 |
+
// Loop through each of our form fields and output it.
|
| 465 |
+
foreach ( $form_data['fields'] as $key => $value ) {
|
| 466 |
+
$return .= $this->field( $value, $old_values, $req_errors, $form_id, $label_placement );
|
| 467 |
+
}
|
| 468 |
}
|
| 469 |
|
| 470 |
// Check to see if we have an opt-in for the form, and display it.
|
| 495 |
|
| 496 |
public function build_recaptcha() {
|
| 497 |
// If we've reached this point, we know we have our keys.
|
| 498 |
+
$site_key = ctct_get_settings_option( '_ctct_recaptcha_site_key', '' );
|
| 499 |
|
| 500 |
/**
|
| 501 |
* Filters the language code to be used with Google reCAPTCHA.
|
| 520 |
}
|
| 521 |
|
| 522 |
public function build_timestamp() {
|
| 523 |
+
return '<input type="hidden" name="ctct_time" value="' . current_time( 'timestamp' ) . '" />';
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
public function build_custom_form_classes() {
|
| 527 |
+
$custom = '';
|
| 528 |
+
if ( ! empty( $this->global_form_styles['global_form_classes'] ) ) {
|
| 529 |
+
$custom .= ' ' . esc_attr( $this->global_form_styles['global_form_classes'] );
|
| 530 |
+
}
|
| 531 |
+
if ( ! empty( $this->specific_form_styles['input_custom_classes'] ) ) {
|
| 532 |
+
$custom .= ' ' . esc_attr( $this->specific_form_styles['input_custom_classes'] );
|
| 533 |
+
}
|
| 534 |
+
|
| 535 |
+
return $custom;
|
| 536 |
}
|
| 537 |
|
| 538 |
/**
|
| 555 |
* Wrapper for single field display.
|
| 556 |
*
|
| 557 |
* @since 1.0.0
|
| 558 |
+
* @since 1.4.0 Added label placement parameter.
|
| 559 |
*
|
| 560 |
+
* @param array $field Field data.
|
| 561 |
+
* @param array $old_values Original values.
|
| 562 |
+
* @param array $req_errors Errors.
|
| 563 |
+
* @param int $form_id Current form ID.
|
| 564 |
+
* @param string $label_placement Label placement location.
|
| 565 |
* @return string HTML markup
|
| 566 |
*/
|
| 567 |
+
public function field( $field, $old_values = array(), $req_errors = array(), $form_id = 0, $label_placement = 'top' ) {
|
| 568 |
|
| 569 |
// If we don't have a name or a mapping, it will be hard to do things.
|
| 570 |
if ( ! isset( $field['name'] ) || ! isset( $field['map_to'] ) ) {
|
| 572 |
}
|
| 573 |
|
| 574 |
$field = wp_parse_args( $field, array(
|
| 575 |
+
'name' => '',
|
| 576 |
+
'map_to' => '',
|
| 577 |
+
'type' => '',
|
| 578 |
+
'description' => '',
|
| 579 |
+
'field_custom_css' => array(),
|
| 580 |
+
'required' => false,
|
| 581 |
) );
|
| 582 |
|
| 583 |
// Check all our data points.
|
| 584 |
+
$name = sanitize_text_field( $field['name'] );
|
| 585 |
+
$map = sanitize_text_field( $field['map_to'] );
|
| 586 |
+
$desc = sanitize_text_field( isset( $field['description'] ) ? $field['description'] : '' );
|
| 587 |
+
$type = sanitize_text_field( isset( $field['type'] ) ? $field['type'] : 'text_field' );
|
| 588 |
+
$value = sanitize_text_field( isset( $field['value'] ) ? $field['value'] : false );
|
| 589 |
+
$req = isset( $field['required'] ) ? $field['required'] : false;
|
| 590 |
|
| 591 |
// We may have more than one of the same field in our array.
|
| 592 |
// this makes sure we keep them unique when processing them.
|
| 614 |
|
| 615 |
// Based on the error type, display an error.
|
| 616 |
if ( 'invalid' === $error['error'] ) {
|
| 617 |
+
$field_error .= __( 'Error: Please correct your entry.', 'constant-contact-forms' );
|
| 618 |
} else {
|
| 619 |
$field_error .= __( ' Error: Please fill out this field.', 'constant-contact-forms' );
|
| 620 |
}
|
| 639 |
case 'company':
|
| 640 |
case 'website':
|
| 641 |
case 'text_field':
|
| 642 |
+
return $this->input( 'text', $name, $map, $value, $desc, $req, false, $field_error, $form_id, $label_placement );
|
| 643 |
break;
|
| 644 |
case 'custom_text_area':
|
| 645 |
+
return $this->textarea( $name, $map, $value, $desc, $req, $field_error, 'maxlength="500"', $label_placement );
|
| 646 |
break;
|
| 647 |
case 'email':
|
| 648 |
+
return $this->input( 'email', $name, $map, $value, $desc, $req, false, $field_error, $form_id, $label_placement );
|
| 649 |
break;
|
| 650 |
case 'hidden':
|
| 651 |
return $this->input( 'hidden', $name, $map, $value, $desc, $req );
|
| 657 |
return $this->input( 'submit', $name, $map, $value, $desc, $req, false, $field_error );
|
| 658 |
break;
|
| 659 |
case 'address':
|
| 660 |
+
return $this->address( $name, $map, $value, $desc, $req, $field_error, $label_placement );
|
| 661 |
break;
|
| 662 |
case 'anniversery':
|
| 663 |
case 'birthday':
|
| 677 |
*
|
| 678 |
* @param string|array $value Field value.
|
| 679 |
* @param string $map Map value.
|
| 680 |
+
* @param array $field Array of fields.
|
| 681 |
* @param array $submitted_vals Array of submitted values.
|
| 682 |
* @return string Submitted value.
|
| 683 |
*/
|
| 766 |
return '<p class="ctct-message ' . esc_attr( $type ) . '">' . esc_attr( $message ) . '</p>';
|
| 767 |
}
|
| 768 |
|
| 769 |
+
/**
|
| 770 |
+
* Get an inline style tag to use for the form's description.
|
| 771 |
+
*
|
| 772 |
+
* @author Scott Tirrell
|
| 773 |
+
* @since 1.4.0
|
| 774 |
+
*
|
| 775 |
+
* @return string The inline style tag for the form's description.
|
| 776 |
+
*/
|
| 777 |
+
public function get_description_inline_styles() {
|
| 778 |
+
$inline_style = '';
|
| 779 |
+
$styles = array();
|
| 780 |
+
|
| 781 |
+
// Set any custom CSS for the form description.
|
| 782 |
+
$specific_form_styles = $this->specific_form_styles;
|
| 783 |
+
|
| 784 |
+
if ( ! empty( $specific_form_styles['form_description_font_size'] ) ) {
|
| 785 |
+
$styles[] = $specific_form_styles['form_description_font_size'];
|
| 786 |
+
}
|
| 787 |
+
|
| 788 |
+
if ( ! empty( $specific_form_styles['form_description_color'] ) ) {
|
| 789 |
+
$styles[] = $specific_form_styles['form_description_color'];
|
| 790 |
+
}
|
| 791 |
+
|
| 792 |
+
if ( ! empty( $styles ) ) {
|
| 793 |
+
$inline_style = 'style="' . esc_attr( implode( ' ', $styles ) ) . '"';
|
| 794 |
+
}
|
| 795 |
+
|
| 796 |
+
return $inline_style;
|
| 797 |
+
}
|
| 798 |
+
|
| 799 |
/**
|
| 800 |
* Helper method to display form description.
|
| 801 |
*
|
| 807 |
*/
|
| 808 |
public function description( $desc = '', $form_id = false ) {
|
| 809 |
|
| 810 |
+
$display = '';
|
| 811 |
+
$inline_style = $this->get_description_inline_styles();
|
| 812 |
|
| 813 |
// If we have the permissions, also display an edit link.
|
| 814 |
if ( current_user_can( 'edit_posts' ) && $form_id ) {
|
| 822 |
}
|
| 823 |
}
|
| 824 |
|
| 825 |
+
return '<span class="ctct-form-description" ' . $inline_style . '>' . wpautop( wp_kses_post( $desc ) ) . '</span>' . $display;
|
| 826 |
}
|
| 827 |
|
| 828 |
/**
|
| 830 |
*
|
| 831 |
* @since 1.0.0
|
| 832 |
*
|
| 833 |
+
* @param string $type Type of field.
|
| 834 |
+
* @param string $name Name / id of field.
|
| 835 |
+
* @param string $f_id Field ID.
|
| 836 |
+
* @param string $label Label text for field.
|
| 837 |
+
* @param boolean $req If this field required.
|
| 838 |
+
* @param boolean $use_label Whether or not to use label.
|
| 839 |
* @return string HTML markup.
|
| 840 |
*/
|
| 841 |
public function field_top( $type = '', $name = '', $f_id = '', $label = '', $req = false, $use_label = true ) {
|
| 842 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 843 |
$classes = array(
|
| 844 |
'ctct-form-field',
|
| 845 |
'ctct-form-field-' . $type,
|
| 851 |
// Start building our return markup.
|
| 852 |
$markup = '<p class="' . implode( ' ', $classes ) . '">';
|
| 853 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 854 |
// If we're not on submit or hidden, but still doing label on bottom,
|
| 855 |
// then output a container div.
|
| 856 |
if ( ! $use_label ) {
|
| 886 |
return $markup . '</p>';
|
| 887 |
}
|
| 888 |
|
| 889 |
+
/**
|
| 890 |
+
* Get inline styles for the form's submit button.
|
| 891 |
+
*
|
| 892 |
+
* @since 1.4.0
|
| 893 |
+
* @author Scott Tirrell
|
| 894 |
+
*
|
| 895 |
+
* @return string
|
| 896 |
+
*/
|
| 897 |
+
public function get_submit_inline_styles() {
|
| 898 |
+
$inline_style = '';
|
| 899 |
+
$styles = array();
|
| 900 |
+
|
| 901 |
+
// Set any custom CSS for the form submit button.
|
| 902 |
+
$specific_form_styles = $this->specific_form_styles;
|
| 903 |
+
|
| 904 |
+
if ( ! empty( $specific_form_styles['form_submit_button_font_size'] ) ) {
|
| 905 |
+
$styles[] = $specific_form_styles['form_submit_button_font_size'];
|
| 906 |
+
}
|
| 907 |
+
|
| 908 |
+
if ( ! empty( $specific_form_styles['form_submit_button_text_color'] ) ) {
|
| 909 |
+
$styles[] = $specific_form_styles['form_submit_button_text_color'];
|
| 910 |
+
}
|
| 911 |
+
|
| 912 |
+
if ( ! empty( $specific_form_styles['form_submit_button_background_color'] ) ) {
|
| 913 |
+
$styles[] = $specific_form_styles['form_submit_button_background_color'];
|
| 914 |
+
}
|
| 915 |
+
|
| 916 |
+
if ( ! empty( $styles ) ) {
|
| 917 |
+
$inline_style = 'style="' . esc_attr( implode( ' ', $styles ) ) . '"';
|
| 918 |
+
}
|
| 919 |
+
|
| 920 |
+
return $inline_style;
|
| 921 |
+
}
|
| 922 |
+
|
| 923 |
/**
|
| 924 |
* Helper method to get form label.
|
| 925 |
*
|
| 938 |
*
|
| 939 |
* @since 1.0.0
|
| 940 |
*
|
| 941 |
+
* @param string $type Type of form field.
|
| 942 |
+
* @param string $name ID of form field.
|
| 943 |
+
* @param string $id ID attribute value.
|
| 944 |
+
* @param string $value pre-filled value.
|
| 945 |
+
* @param string $label label text for input.
|
| 946 |
+
* @param boolean $req If field required.
|
| 947 |
+
* @param boolean $f_only If we only return the field itself, with no label.
|
| 948 |
+
* @param boolean $field_error Field error.
|
| 949 |
+
* @param int $form_id Current form ID.
|
| 950 |
+
* @param string $label_placement Where to place the label.
|
| 951 |
* @return string HTML markup for field.
|
| 952 |
*/
|
| 953 |
+
public function input( $type = 'text', $name = '', $id = '', $value = '', $label = '', $req = false, $f_only = false, $field_error = false, $form_id = 0, $label_placement = '' ) {
|
| 954 |
|
| 955 |
// Sanitize our stuff / set values.
|
| 956 |
+
$name = sanitize_text_field( $name );
|
| 957 |
+
$f_id = sanitize_title( $id );
|
| 958 |
+
$input_inline_styles = '';
|
| 959 |
+
$label_placement_class = 'ctct-label-' . $label_placement;
|
| 960 |
+
$specific_form_styles = $this->specific_form_styles;
|
| 961 |
+
|
| 962 |
+
// Use different styles for submit button.
|
| 963 |
+
if ( 'submit' === $type ) {
|
| 964 |
+
$input_inline_styles = $this->get_submit_inline_styles();
|
| 965 |
+
}
|
| 966 |
+
|
| 967 |
+
$type = sanitize_text_field( $type );
|
| 968 |
+
$value = sanitize_text_field( $value );
|
| 969 |
+
$label = sanitize_text_field( $label );
|
| 970 |
$req_text = $req ? 'required' : '';
|
| 971 |
|
| 972 |
// Start our markup.
|
| 973 |
$markup = $this->field_top( $type, $name, $f_id, $label, $req );
|
| 974 |
|
| 975 |
+
// Set blank defaults for required info.
|
| 976 |
+
$req_label = '';
|
| 977 |
+
// If this is required, we output the HMTL5 required att.
|
| 978 |
+
if ( $req ) {
|
| 979 |
+
|
| 980 |
+
/**
|
| 981 |
+
* Filters the markup used for the required indicator.
|
| 982 |
+
*
|
| 983 |
+
* @since 1.0.0
|
| 984 |
+
*
|
| 985 |
+
* @param string $value An `<abbr>` tag with an asterisk indicating required status.
|
| 986 |
+
*/
|
| 987 |
+
$req_label = apply_filters( 'constant_contact_required_label', '<abbr title="required">*</abbr>' );
|
| 988 |
+
}
|
| 989 |
+
if ( ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) && ( 'submit' !== $type ) && ( 'hidden' !== $type ) ) {
|
| 990 |
+
$markup .= '<span class="' . $label_placement_class . '">';
|
| 991 |
+
$markup .= $this->get_label( $f_id, $name . ' ' . $req_label );
|
| 992 |
+
$markup .= '</span>';
|
| 993 |
+
}
|
| 994 |
+
|
| 995 |
// Provide some CSS class(es).
|
| 996 |
+
$classes = array( 'ctct-' . esc_attr( $type ) );
|
| 997 |
+
$classes[] = $label_placement_class;
|
| 998 |
+
if ( ! empty( $specific_form_styles['input_custom_classes'] ) ) {
|
| 999 |
+
$custom_input_classes = explode( ' ', $specific_form_styles['input_custom_classes'] );
|
| 1000 |
+
$classes = array_merge( $classes, $custom_input_classes );
|
| 1001 |
+
}
|
| 1002 |
|
| 1003 |
/**
|
| 1004 |
* Filter to add classes for the rendering input.
|
| 1018 |
* @param bool $value Whether or not to truncate. Default false.
|
| 1019 |
*/
|
| 1020 |
$truncate_max_length = apply_filters( 'constant_contact_include_custom_field_label', false, $form_id );
|
| 1021 |
+
$max_length = '';
|
| 1022 |
if ( false !== strpos( $id, 'custom___' ) ) {
|
| 1023 |
$max_length = ( $truncate_max_length ) ? $this->get_max_length_attr( $name ) : $this->get_max_length_attr();
|
| 1024 |
}
|
|
|
|
|
|
|
| 1025 |
|
| 1026 |
// If we have an error.
|
| 1027 |
if ( $field_error ) {
|
| 1029 |
$classes[] = 'ctct-invalid';
|
| 1030 |
}
|
| 1031 |
|
| 1032 |
+
$class_attr = '';
|
| 1033 |
// Append classes to our field.
|
| 1034 |
if ( count( $classes ) ) {
|
| 1035 |
+
$class_attr = 'class="' . implode( ' ', $classes ) . '"';
|
| 1036 |
}
|
| 1037 |
|
| 1038 |
// Finish the markup for our field itself.
|
| 1039 |
+
$field = '<input %s type="%s" name="%s" id="%s" %s value="%s" %s placeholder="%s" %s />';
|
| 1040 |
+
$markup .= sprintf(
|
| 1041 |
+
$field,
|
| 1042 |
+
$req_text,
|
| 1043 |
+
$type,
|
| 1044 |
+
$f_id,
|
| 1045 |
+
$f_id,
|
| 1046 |
+
$input_inline_styles,
|
| 1047 |
+
$value,
|
| 1048 |
+
$max_length,
|
| 1049 |
+
$label,
|
| 1050 |
+
$class_attr
|
| 1051 |
+
);
|
| 1052 |
+
// Reassign because if we want "field only", like for hidden inputs, we need to
|
| 1053 |
+
// still pass a value that went through sprintf().
|
| 1054 |
+
$field = $markup;
|
| 1055 |
|
| 1056 |
+
if ( ( 'bottom' === $label_placement || 'right' === $label_placement ) && ( 'submit' !== $type ) && ( 'hidden' !== $type ) ) {
|
| 1057 |
+
$markup .= '<span class="' . $label_placement_class . '">';
|
| 1058 |
+
$markup .= $this->get_label( $f_id, $name . ' ' . $req_label );
|
| 1059 |
+
$markup .= '</span>';
|
| 1060 |
+
}
|
| 1061 |
|
| 1062 |
// If we got an error, add it to the bottom label.
|
| 1063 |
if ( $field_error ) {
|
| 1108 |
*/
|
| 1109 |
$classes = apply_filters( 'constant_contact_input_classes', $classes, $type );
|
| 1110 |
|
| 1111 |
+
$markup = $this->field_top( $type, $name, $f_id, $label, false, false );
|
| 1112 |
$markup .= '<input type="' . $type . '" name="' . $f_id . '" id="' . $f_id . '" value="' . $value . '" class="' . implode( ' ', $classes ) . '" />';
|
| 1113 |
$markup .= $this->field_bottom( $name, ' ' . $label );
|
| 1114 |
|
| 1228 |
// If we aren't showing the field, then we default our checkbox to checked.
|
| 1229 |
$checked = $show ? '' : 'checked';
|
| 1230 |
|
| 1231 |
+
$markup = $this->field_top( 'checkbox', 'ctct-opt-in', 'ctct-opt-in', $label, false, false );
|
| 1232 |
$markup .= '<input type="checkbox" ' . $checked . ' name="ctct-opt-in" id="ctct-opt-in" class="ctct-checkbox ctct-opt-in" value="' . $value . '" />';
|
| 1233 |
$markup .= $this->field_bottom( 'ctct-opt-in', ' ' . wp_kses_post( $label ), false );
|
| 1234 |
|
| 1240 |
*
|
| 1241 |
* @since 1.0.0
|
| 1242 |
*
|
| 1243 |
+
* @param string $name Name of fields.
|
| 1244 |
+
* @param string $f_id Form ID name.
|
| 1245 |
+
* @param array $value Values of each field.
|
| 1246 |
+
* @param string $desc Label of field.
|
| 1247 |
+
* @param boolean $req Whether or not required.
|
| 1248 |
+
* @param string $field_error Field error value.
|
| 1249 |
+
* @param string $label_placement Where to put the label.
|
| 1250 |
* @return string field HTML markup.
|
| 1251 |
*/
|
| 1252 |
+
public function address( $name = '', $f_id = '', $value = array(), $desc = '', $req = false, $field_error = '', $label_placement = 'top' ) {
|
| 1253 |
|
| 1254 |
// Set up our text strings.
|
| 1255 |
$street = __( 'Street Address', 'constant-contact-forms' );
|
| 1272 |
*
|
| 1273 |
* @param string $value An `<abbr>` tag with an asterisk indicating required status.
|
| 1274 |
*/
|
| 1275 |
+
$req_label = $req ? ' ' . apply_filters( 'constant_contact_required_label', '<abbr title="required">*</abbr>' ) : '';
|
| 1276 |
+
$req_class = $req ? ' ctct-form-field-required ' : '';
|
| 1277 |
+
$req = $req ? ' required ' : '';
|
| 1278 |
+
$label_placement_class = 'ctct-label-' . $label_placement;
|
| 1279 |
+
|
| 1280 |
+
$label_street1 = sprintf(
|
| 1281 |
+
'<span class="%s"><label for="street_%s">%s</label></span>',
|
| 1282 |
+
esc_attr( $label_placement_class ),
|
| 1283 |
+
esc_attr( $f_id ),
|
| 1284 |
+
esc_attr( $street ) . $req_label
|
| 1285 |
+
);
|
| 1286 |
+
$input_street1 = sprintf(
|
| 1287 |
+
'<input %stype="text" class="ctct-text ctct-address-street %s" name="street_%s" id="street_%s" value="%s">',
|
| 1288 |
+
$req,
|
| 1289 |
+
esc_attr( $label_placement_class ),
|
| 1290 |
+
esc_attr( $f_id ),
|
| 1291 |
+
esc_attr( $f_id ),
|
| 1292 |
+
esc_attr( $v_street )
|
| 1293 |
+
);
|
| 1294 |
|
| 1295 |
+
$input_street1_whole = '';
|
| 1296 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1297 |
+
$input_street1_whole = $label_street1 . $input_street1;
|
| 1298 |
+
}
|
| 1299 |
+
if ( 'bottom' === $label_placement || 'right' === $label_placement ) {
|
| 1300 |
+
$input_street1_whole = $input_street1 . $label_street1;
|
| 1301 |
+
}
|
| 1302 |
+
|
| 1303 |
+
$label_street2 = sprintf(
|
| 1304 |
+
'<span class="%s"><label for="line_2_%s">%s</label></span>',
|
| 1305 |
+
$label_placement_class,
|
| 1306 |
+
esc_attr( $f_id ),
|
| 1307 |
+
esc_attr( $line_2 )
|
| 1308 |
+
);
|
| 1309 |
// Address Line 2 is not required, note the missing $req inclusion.
|
| 1310 |
+
$input_street2 = sprintf(
|
| 1311 |
+
'<input type="text" class="ctct-text ctct-address-line-2 %s" name="line_2_%s" id="line_2_%s" value="%s">',
|
| 1312 |
+
esc_attr( $label_placement_class ),
|
| 1313 |
+
esc_attr( $f_id ),
|
| 1314 |
+
esc_attr( $f_id ),
|
| 1315 |
+
esc_attr( $v_line_2 )
|
| 1316 |
+
);
|
| 1317 |
+
|
| 1318 |
+
$input_street2_whole = '';
|
| 1319 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1320 |
+
$input_street2_whole = $label_street2 . $input_street2;
|
| 1321 |
+
}
|
| 1322 |
+
if ( 'bottom' === $label_placement || 'right' === $label_placement ) {
|
| 1323 |
+
$input_street2_whole = $input_street2 . $label_street2;
|
| 1324 |
+
}
|
| 1325 |
+
|
| 1326 |
+
$label_city = sprintf(
|
| 1327 |
+
'<span class="%s"><label for="city_%s">%s</label></span>',
|
| 1328 |
+
$label_placement_class,
|
| 1329 |
+
esc_attr( $f_id ),
|
| 1330 |
+
esc_attr( $city ) . $req_label
|
| 1331 |
+
);
|
| 1332 |
+
$input_city = sprintf(
|
| 1333 |
+
'<input %stype="text" class="ctct-text ctct-address-city %s" name="city_%s" id="city_%s" value="%s">',
|
| 1334 |
+
$req,
|
| 1335 |
+
esc_attr( $label_placement_class ),
|
| 1336 |
+
esc_attr( $f_id ),
|
| 1337 |
+
esc_attr( $f_id ),
|
| 1338 |
+
esc_attr( $v_city )
|
| 1339 |
+
);
|
| 1340 |
+
|
| 1341 |
+
$input_city_whole = '';
|
| 1342 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1343 |
+
$input_city_whole = $label_city . $input_city;
|
| 1344 |
+
}
|
| 1345 |
+
if ( 'bottom' === $label_placement || 'right' === $label_placement ) {
|
| 1346 |
+
$input_city_whole = $input_city . $label_city;
|
| 1347 |
+
}
|
| 1348 |
+
|
| 1349 |
+
$label_state = sprintf(
|
| 1350 |
+
'<span class="%s"><label for="state_%s">%s</label></span>',
|
| 1351 |
+
$label_placement_class,
|
| 1352 |
+
esc_attr( $f_id ),
|
| 1353 |
+
esc_attr( $state ) . $req_label
|
| 1354 |
+
);
|
| 1355 |
+
$input_state = sprintf(
|
| 1356 |
+
'<input %stype="text" class="ctct-text ctct-address-state %s" name="state_%s" id="state_%s" value="%s">',
|
| 1357 |
+
$req,
|
| 1358 |
+
esc_attr( $label_placement_class ),
|
| 1359 |
+
esc_attr( $f_id ),
|
| 1360 |
+
esc_attr( $f_id ),
|
| 1361 |
+
esc_attr( $v_state )
|
| 1362 |
+
);
|
| 1363 |
+
|
| 1364 |
+
$input_state_whole = '';
|
| 1365 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1366 |
+
$input_state_whole = $label_state . $input_state;
|
| 1367 |
+
}
|
| 1368 |
+
if ( 'bottom' === $label_placement || 'right' === $label_placement ) {
|
| 1369 |
+
$input_state_whole = $input_state . $label_state;
|
| 1370 |
+
}
|
| 1371 |
+
|
| 1372 |
+
$label_zip = sprintf(
|
| 1373 |
+
'<span class="%s"><label for="zip_%s">%s</label></span>',
|
| 1374 |
+
$label_placement_class,
|
| 1375 |
+
esc_attr( $f_id ),
|
| 1376 |
+
esc_attr( $zip ) . $req_label
|
| 1377 |
+
);
|
| 1378 |
+
$input_zip = sprintf(
|
| 1379 |
+
'<input %stype="text" class="ctct-text ctct-address-zip %s" name="zip_%s" id="zip_%s" value="%s">',
|
| 1380 |
+
$req,
|
| 1381 |
+
esc_attr( $label_placement_class ),
|
| 1382 |
+
esc_attr( $f_id ),
|
| 1383 |
+
esc_attr( $f_id ),
|
| 1384 |
+
esc_attr( $v_zip )
|
| 1385 |
+
);
|
| 1386 |
+
|
| 1387 |
+
$input_zip_whole = '';
|
| 1388 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1389 |
+
$input_zip_whole = $label_zip . $input_zip;
|
| 1390 |
+
}
|
| 1391 |
+
if ( 'bottom' === $label_placement || 'right' === $label_placement ) {
|
| 1392 |
+
$input_zip_whole = $input_zip . $label_zip;
|
| 1393 |
+
}
|
| 1394 |
+
|
| 1395 |
+
// Build our field.
|
| 1396 |
+
$return = '<fieldset class="ctct-address"><legend>%s</legend>';
|
| 1397 |
+
$return .= '<div class="ctct-form-field ctct-field-full address-line-1%s">%s</div>';
|
| 1398 |
+
$return .= '<div class="ctct-form-field ctct-field-full address-line-2%s" id="input_2_1_2_container">%s</div>';
|
| 1399 |
+
$return .= '<div class="ctct-form-field ctct-field-third address-city%s" id="input_2_1_3_container">%s</div>';
|
| 1400 |
+
$return .= '<div class="ctct-form-field ctct-field-third address-state%s" id="input_2_1_4_container">%s</div>';
|
| 1401 |
+
$return .= '<div class="ctct-form-field ctct-field-third address-zip%s" id="input_2_1_5_container">%s</div>';
|
| 1402 |
$return .= '</fieldset>';
|
| 1403 |
|
| 1404 |
+
return sprintf(
|
| 1405 |
+
$return,
|
| 1406 |
+
esc_html( $name ),
|
| 1407 |
+
$req_class,
|
| 1408 |
+
$input_street1_whole,
|
| 1409 |
+
$req_class,
|
| 1410 |
+
$input_street2_whole,
|
| 1411 |
+
$req_class,
|
| 1412 |
+
$input_city_whole,
|
| 1413 |
+
$req_class,
|
| 1414 |
+
$input_state_whole,
|
| 1415 |
+
$req_class,
|
| 1416 |
+
$input_zip_whole
|
| 1417 |
+
);
|
| 1418 |
}
|
| 1419 |
|
| 1420 |
/**
|
| 1638 |
*
|
| 1639 |
* @since 1.0.0
|
| 1640 |
*
|
| 1641 |
+
* @param string $name Name of field.
|
| 1642 |
+
* @param string $map ID of field.
|
| 1643 |
+
* @param string $value Previous value of field.
|
| 1644 |
+
* @param string $desc Description/label of field.
|
| 1645 |
+
* @param boolean $req If is required.
|
| 1646 |
+
* @param string $field_error Error from field.
|
| 1647 |
+
* @param string $extra_attrs Extra attributes to append.
|
| 1648 |
+
* @param string $label_placement Where to place the label.
|
| 1649 |
* @return string HTML markup.
|
| 1650 |
*/
|
| 1651 |
+
public function textarea( $name = '', $map = '', $value = '', $desc = '', $req = false, $field_error = '', $extra_attrs = '', $label_placement = 'top' ) {
|
| 1652 |
+
|
| 1653 |
+
$classes = array( 'ctct-form-field' );
|
| 1654 |
+
$textarea_classes = array( 'ctct-textarea' );
|
| 1655 |
|
|
|
|
| 1656 |
// Set our required text.
|
| 1657 |
$req_text = $req ? 'required' : '';
|
| 1658 |
if ( $req ) {
|
| 1659 |
$classes[] = 'ctct-form-field-required';
|
| 1660 |
}
|
| 1661 |
+
$label_placement_class = 'ctct-label-' . $label_placement;
|
| 1662 |
+
$textarea_classes[] = $label_placement_class;
|
| 1663 |
|
| 1664 |
// If required, get our label.
|
| 1665 |
$req_label = '';
|
| 1675 |
$req_label = apply_filters( 'constant_contact_required_label', '<abbr title="required">*</abbr>' );
|
| 1676 |
}
|
| 1677 |
|
| 1678 |
+
$return = '<p class="' . implode( ' ', $classes ) . '">';
|
| 1679 |
+
$label = '<span class="' . $label_placement_class . '"><label for="' . esc_attr( $map ) . '">' . esc_attr( $name ) . ' ' . $req_label . '</label></span>';
|
| 1680 |
+
$textarea = '<textarea class="' . esc_attr( implode( ' ', $textarea_classes ) ) . '" ' . $req_text . ' name="' . esc_attr( $map ) . '" placeholder="' . esc_attr( $desc ) . '" ' . $extra_attrs . '>' . esc_html( $value ) . '</textarea>';
|
| 1681 |
|
| 1682 |
+
if ( 'top' === $label_placement || 'left' === $label_placement || 'hidden' === $label_placement ) {
|
| 1683 |
+
$return .= $label . $textarea;
|
| 1684 |
+
}
|
| 1685 |
+
if ( 'right' === $label_placement || 'bottom' === $label_placement ) {
|
| 1686 |
+
$return .= $textarea . $label;
|
| 1687 |
+
}
|
| 1688 |
if ( $field_error ) {
|
| 1689 |
$return .= '<span class="ctct-field-error"><label for="' . esc_attr( $map ) . '">' . esc_attr( __( 'Error: Please correct your entry.', 'constant-contact-forms' ) ) . '</label></span>';
|
| 1690 |
}
|
| 1693 |
}
|
| 1694 |
|
| 1695 |
/**
|
| 1696 |
+
* Maybe display the disclosure notice.
|
| 1697 |
*
|
| 1698 |
* @since 1.0.0
|
| 1699 |
*
|
| 1775 |
}
|
| 1776 |
return 'maxlength="' . $length . '"';
|
| 1777 |
}
|
| 1778 |
+
|
| 1779 |
+
|
| 1780 |
}
|
| 1781 |
|
includes/class-lists.php
CHANGED
|
@@ -51,9 +51,6 @@ class ConstantContact_Lists {
|
|
| 51 |
add_action( 'save_post_ctct_lists', array( $this, 'save_or_update_list' ), 10, 1 );
|
| 52 |
add_action( 'transition_post_status', array( $this, 'post_status_transition' ), 11, 3 );
|
| 53 |
|
| 54 |
-
// Show duplicate notices for lists.
|
| 55 |
-
add_action( 'admin_notices', array( $this, 'show_duplicate_list_message' ) );
|
| 56 |
-
|
| 57 |
// On deletion, verify the list is handled correctly.
|
| 58 |
add_action( 'wp_trash_post', array( $this, 'delete_list' ) );
|
| 59 |
|
|
@@ -67,6 +64,8 @@ class ConstantContact_Lists {
|
|
| 67 |
|
| 68 |
// Remove quick edit.
|
| 69 |
add_filter( 'post_row_actions', array( $this, 'remove_quick_edit_from_lists' ) );
|
|
|
|
|
|
|
| 70 |
}
|
| 71 |
|
| 72 |
/**
|
|
@@ -177,7 +176,7 @@ class ConstantContact_Lists {
|
|
| 177 |
* @since 1.0.0
|
| 178 |
*/
|
| 179 |
public function add_form_css() {
|
| 180 |
-
wp_enqueue_style( 'constant-contact-forms' );
|
| 181 |
}
|
| 182 |
|
| 183 |
/**
|
|
@@ -206,7 +205,7 @@ class ConstantContact_Lists {
|
|
| 206 |
//
|
| 207 |
// Currently, the rate limit for this is a refresh every 2 minutes. This can be filtered to be
|
| 208 |
// less or more time.
|
| 209 |
-
$last_synced = get_option( 'constant_contact_lists_last_synced',
|
| 210 |
|
| 211 |
/**
|
| 212 |
* Filters the rate limit to use for syncing lists.
|
|
@@ -220,7 +219,7 @@ class ConstantContact_Lists {
|
|
| 220 |
// If our last synced time plus our rate limit is less than or equal to right now,
|
| 221 |
// then we don't want to refresh. If we refreshed less than 15 minutes ago, we do not want to
|
| 222 |
// redo it. Also allow forcing a bypass of this check.
|
| 223 |
-
if ( ( ! $force ) && ( $last_synced + $sync_rate_limit_time ) >=
|
| 224 |
return;
|
| 225 |
}
|
| 226 |
|
|
@@ -383,7 +382,7 @@ class ConstantContact_Lists {
|
|
| 383 |
}
|
| 384 |
|
| 385 |
// Update our last synced option to prevent doing this too often.
|
| 386 |
-
update_option( 'constant_contact_lists_last_synced',
|
| 387 |
|
| 388 |
/**
|
| 389 |
* Hook when a ctct list is updated.
|
|
@@ -476,7 +475,7 @@ class ConstantContact_Lists {
|
|
| 476 |
$this->sync_lists( true );
|
| 477 |
|
| 478 |
// Set our last synced time to now, so we don't re-add our new/removed list right away.
|
| 479 |
-
update_option( 'constant_contact_lists_last_synced',
|
| 480 |
|
| 481 |
return $return;
|
| 482 |
|
|
@@ -803,12 +802,11 @@ class ConstantContact_Lists {
|
|
| 803 |
}
|
| 804 |
|
| 805 |
/**
|
| 806 |
-
*
|
| 807 |
*
|
| 808 |
-
* @since 1.
|
| 809 |
*/
|
| 810 |
-
public function
|
| 811 |
-
|
| 812 |
// Make sure we're on the correct page.
|
| 813 |
global $pagenow, $post;
|
| 814 |
if ( $pagenow || ( ! in_array( $pagenow, array( 'post.php' ), true ) ) ) {
|
|
@@ -825,14 +823,20 @@ class ConstantContact_Lists {
|
|
| 825 |
get_post_meta( $post->ID, 'ctct_duplicate_list', true )
|
| 826 |
) {
|
| 827 |
|
| 828 |
-
|
| 829 |
-
|
| 830 |
-
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 836 |
background: url( "<?php echo esc_url_raw( $this->plugin->url . 'assets/images/error.svg' ); ?>" ) no-repeat;
|
| 837 |
background-color: fade-out( #FF4136, 0.98);
|
| 838 |
background-position: 8px 50%;
|
|
@@ -840,9 +844,21 @@ class ConstantContact_Lists {
|
|
| 840 |
border-color: #FF4136;
|
| 841 |
padding-left: 40px;
|
| 842 |
}
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 846 |
}
|
| 847 |
|
| 848 |
/**
|
|
@@ -879,7 +895,7 @@ class ConstantContact_Lists {
|
|
| 879 |
current_user_can( 'manage_options' )
|
| 880 |
) {
|
| 881 |
// Force our last updated time to be in the past, so we trigger the auto-refresh
|
| 882 |
-
update_option( 'constant_contact_lists_last_synced',
|
| 883 |
|
| 884 |
// Get our url with our custom query args removed
|
| 885 |
$url = remove_query_arg( array( 'ctct_resyncing', 'ctct_list_sync' ) );
|
| 51 |
add_action( 'save_post_ctct_lists', array( $this, 'save_or_update_list' ), 10, 1 );
|
| 52 |
add_action( 'transition_post_status', array( $this, 'post_status_transition' ), 11, 3 );
|
| 53 |
|
|
|
|
|
|
|
|
|
|
| 54 |
// On deletion, verify the list is handled correctly.
|
| 55 |
add_action( 'wp_trash_post', array( $this, 'delete_list' ) );
|
| 56 |
|
| 64 |
|
| 65 |
// Remove quick edit.
|
| 66 |
add_filter( 'post_row_actions', array( $this, 'remove_quick_edit_from_lists' ) );
|
| 67 |
+
|
| 68 |
+
add_action( 'admin_init', array( $this, 'maybe_display_duplicate_list_error' ) );
|
| 69 |
}
|
| 70 |
|
| 71 |
/**
|
| 176 |
* @since 1.0.0
|
| 177 |
*/
|
| 178 |
public function add_form_css() {
|
| 179 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
| 180 |
}
|
| 181 |
|
| 182 |
/**
|
| 205 |
//
|
| 206 |
// Currently, the rate limit for this is a refresh every 2 minutes. This can be filtered to be
|
| 207 |
// less or more time.
|
| 208 |
+
$last_synced = get_option( 'constant_contact_lists_last_synced', current_time( 'timestamp' ) - DAY_IN_SECONDS );
|
| 209 |
|
| 210 |
/**
|
| 211 |
* Filters the rate limit to use for syncing lists.
|
| 219 |
// If our last synced time plus our rate limit is less than or equal to right now,
|
| 220 |
// then we don't want to refresh. If we refreshed less than 15 minutes ago, we do not want to
|
| 221 |
// redo it. Also allow forcing a bypass of this check.
|
| 222 |
+
if ( ( ! $force ) && ( $last_synced + $sync_rate_limit_time ) >= current_time( 'timestamp' ) ) {
|
| 223 |
return;
|
| 224 |
}
|
| 225 |
|
| 382 |
}
|
| 383 |
|
| 384 |
// Update our last synced option to prevent doing this too often.
|
| 385 |
+
update_option( 'constant_contact_lists_last_synced', current_time( 'timestamp' ) );
|
| 386 |
|
| 387 |
/**
|
| 388 |
* Hook when a ctct list is updated.
|
| 475 |
$this->sync_lists( true );
|
| 476 |
|
| 477 |
// Set our last synced time to now, so we don't re-add our new/removed list right away.
|
| 478 |
+
update_option( 'constant_contact_lists_last_synced', current_time( 'timestamp' ) );
|
| 479 |
|
| 480 |
return $return;
|
| 481 |
|
| 802 |
}
|
| 803 |
|
| 804 |
/**
|
| 805 |
+
* Maybe show some information about duplicate list errors.
|
| 806 |
*
|
| 807 |
+
* @since 1.4.0
|
| 808 |
*/
|
| 809 |
+
public function maybe_display_duplicate_list_error() {
|
|
|
|
| 810 |
// Make sure we're on the correct page.
|
| 811 |
global $pagenow, $post;
|
| 812 |
if ( $pagenow || ( ! in_array( $pagenow, array( 'post.php' ), true ) ) ) {
|
| 823 |
get_post_meta( $post->ID, 'ctct_duplicate_list', true )
|
| 824 |
) {
|
| 825 |
|
| 826 |
+
add_action( 'admin_head', array( $this, 'list_css' ) );
|
| 827 |
+
add_action( 'admin_notices', array( $this, 'show_duplicate_list_message' ) );
|
| 828 |
+
}
|
| 829 |
+
}
|
| 830 |
+
|
| 831 |
+
/**
|
| 832 |
+
* Output some embedded CSS for our error.
|
| 833 |
+
*
|
| 834 |
+
* @since 1.4.0
|
| 835 |
+
*/
|
| 836 |
+
public function list_css() {
|
| 837 |
+
?>
|
| 838 |
+
<style>
|
| 839 |
+
.post-type-ctct_lists #titlediv #title {
|
| 840 |
background: url( "<?php echo esc_url_raw( $this->plugin->url . 'assets/images/error.svg' ); ?>" ) no-repeat;
|
| 841 |
background-color: fade-out( #FF4136, 0.98);
|
| 842 |
background-position: 8px 50%;
|
| 844 |
border-color: #FF4136;
|
| 845 |
padding-left: 40px;
|
| 846 |
}
|
| 847 |
+
</style>
|
| 848 |
+
<?php
|
| 849 |
+
}
|
| 850 |
+
|
| 851 |
+
/**
|
| 852 |
+
* Hooked into admin_notices, show our duplicate list message if we have one.
|
| 853 |
+
*
|
| 854 |
+
* @since 1.0.0
|
| 855 |
+
*/
|
| 856 |
+
public function show_duplicate_list_message() {
|
| 857 |
+
?>
|
| 858 |
+
<div class="notice notice-error">
|
| 859 |
+
<p><?php esc_attr_e( 'You already have a list with that name.', 'constant-contact-forms' ); ?></p>
|
| 860 |
+
</div>
|
| 861 |
+
<?php
|
| 862 |
}
|
| 863 |
|
| 864 |
/**
|
| 895 |
current_user_can( 'manage_options' )
|
| 896 |
) {
|
| 897 |
// Force our last updated time to be in the past, so we trigger the auto-refresh
|
| 898 |
+
update_option( 'constant_contact_lists_last_synced', current_time( 'timestamp' ) - HOUR_IN_SECONDS );
|
| 899 |
|
| 900 |
// Get our url with our custom query args removed
|
| 901 |
$url = remove_query_arg( array( 'ctct_resyncing', 'ctct_list_sync' ) );
|
includes/class-logging.php
CHANGED
|
@@ -94,7 +94,7 @@ class ConstantContact_Logging {
|
|
| 94 |
*/
|
| 95 |
public function add_options_page() {
|
| 96 |
|
| 97 |
-
$debugging_enabled = ctct_get_settings_option( '_ctct_logging' );
|
| 98 |
|
| 99 |
if ( 'on' !== $debugging_enabled ) {
|
| 100 |
return;
|
|
@@ -123,7 +123,7 @@ class ConstantContact_Logging {
|
|
| 123 |
*/
|
| 124 |
public function admin_page_display() {
|
| 125 |
|
| 126 |
-
wp_enqueue_style( 'constant-contact-
|
| 127 |
|
| 128 |
?>
|
| 129 |
<div class="wrap <?php echo esc_attr( $this->key ); ?>">
|
| 94 |
*/
|
| 95 |
public function add_options_page() {
|
| 96 |
|
| 97 |
+
$debugging_enabled = ctct_get_settings_option( '_ctct_logging', '' );
|
| 98 |
|
| 99 |
if ( 'on' !== $debugging_enabled ) {
|
| 100 |
return;
|
| 123 |
*/
|
| 124 |
public function admin_page_display() {
|
| 125 |
|
| 126 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
| 127 |
|
| 128 |
?>
|
| 129 |
<div class="wrap <?php echo esc_attr( $this->key ); ?>">
|
includes/class-mail.php
CHANGED
|
@@ -80,7 +80,7 @@ class ConstantContact_Mail {
|
|
| 80 |
* @param int $schedule_delay The time to add to `time()` for the event.
|
| 81 |
*/
|
| 82 |
$schedule_delay = apply_filters( 'constant_contact_opt_in_delay', MINUTE_IN_SECONDS );
|
| 83 |
-
wp_schedule_single_event(
|
| 84 |
}
|
| 85 |
}
|
| 86 |
|
|
@@ -95,14 +95,14 @@ class ConstantContact_Mail {
|
|
| 95 |
$values = constant_contact()->process_form->pretty_values( $values );
|
| 96 |
|
| 97 |
// Format them.
|
| 98 |
-
$email_values = $this->format_values_for_email( $values );
|
| 99 |
$was_forced = false; // Set a value regardless of status.
|
| 100 |
|
| 101 |
// Increment our counter for processed form entries.
|
| 102 |
constant_contact()->process_form->increment_processed_form_count();
|
| 103 |
|
| 104 |
// Skip sending e-mail if we're connected, the site owner has opted out of notification emails, and the user has opted in
|
| 105 |
-
if ( constant_contact()->api->is_connected() &&
|
| 106 |
if ( $add_to_opt_in ) {
|
| 107 |
return true;
|
| 108 |
}
|
|
@@ -119,7 +119,7 @@ class ConstantContact_Mail {
|
|
| 119 |
// Checks if we have a list
|
| 120 |
if (
|
| 121 |
( ! constant_contact()->api->is_connected() || empty( $has_list ) ) &&
|
| 122 |
-
(
|
| 123 |
) { // If we're not connected or have no list set AND we've disabled. Override.
|
| 124 |
|
| 125 |
$submission_details['list-available'] = 'no';
|
|
@@ -129,14 +129,14 @@ class ConstantContact_Mail {
|
|
| 129 |
if (
|
| 130 |
! empty( $_POST['ctct_must_opt_in'] ) &&
|
| 131 |
empty( $opt_in_details ) &&
|
| 132 |
-
(
|
| 133 |
) {
|
| 134 |
$submission_details['opted-in'] = 'no';
|
| 135 |
$was_forced = true;
|
| 136 |
}
|
| 137 |
|
| 138 |
// Send the mail.
|
| 139 |
-
return $this->mail( $this->get_email(), $email_values, $submission_details, $was_forced );
|
| 140 |
}
|
| 141 |
|
| 142 |
/**
|
|
@@ -188,23 +188,36 @@ class ConstantContact_Mail {
|
|
| 188 |
* Formats values for email.
|
| 189 |
*
|
| 190 |
* @since 1.0.0
|
|
|
|
| 191 |
*
|
| 192 |
-
* @param array
|
|
|
|
| 193 |
* @return string HTML content for email.
|
| 194 |
*/
|
| 195 |
-
public function format_values_for_email( $pretty_vals ) {
|
| 196 |
|
| 197 |
$return = '';
|
|
|
|
|
|
|
|
|
|
| 198 |
foreach ( $pretty_vals as $val ) {
|
| 199 |
|
| 200 |
$label = isset( $val['orig_key'] ) ? $val['orig_key'] : false;
|
| 201 |
|
| 202 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 203 |
// Break out our unique key.
|
| 204 |
$label = explode( '___', $label );
|
| 205 |
|
| 206 |
// Uppercase and format to be human readable.
|
| 207 |
$label = ucwords( str_replace( '_', ' ', $label[0] ) );
|
|
|
|
|
|
|
| 208 |
}
|
| 209 |
$value = isset( $val['post'] ) ? $val['post'] : ' ';
|
| 210 |
|
|
@@ -218,10 +231,13 @@ class ConstantContact_Mail {
|
|
| 218 |
* Get the email address to send to.
|
| 219 |
*
|
| 220 |
* @since 1.0.0
|
|
|
|
|
|
|
|
|
|
| 221 |
*
|
| 222 |
* @return string Email address to send to.
|
| 223 |
*/
|
| 224 |
-
public function get_email() {
|
| 225 |
|
| 226 |
$email = get_option( 'admin_email' );
|
| 227 |
|
|
@@ -229,10 +245,12 @@ class ConstantContact_Mail {
|
|
| 229 |
* Filters the email to send Constant Contact Forms admin emails to.
|
| 230 |
*
|
| 231 |
* @since 1.3.0
|
|
|
|
| 232 |
*
|
| 233 |
* @param string $email Email address to send to. Default admin_email option.
|
|
|
|
| 234 |
*/
|
| 235 |
-
return apply_filters( 'constant_contact_destination_email', $email );
|
| 236 |
}
|
| 237 |
|
| 238 |
/**
|
|
@@ -258,8 +276,28 @@ class ConstantContact_Mail {
|
|
| 258 |
$screen = get_current_screen();
|
| 259 |
}
|
| 260 |
|
| 261 |
-
|
| 262 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 263 |
|
| 264 |
// If we already have sent this e-mail, don't send it again.
|
| 265 |
if ( $last_sent === $mail_key ) {
|
|
@@ -278,10 +316,18 @@ class ConstantContact_Mail {
|
|
| 278 |
return true;
|
| 279 |
}
|
| 280 |
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 285 |
}
|
| 286 |
|
| 287 |
// Filter to allow sending HTML for our message body.
|
| 80 |
* @param int $schedule_delay The time to add to `time()` for the event.
|
| 81 |
*/
|
| 82 |
$schedule_delay = apply_filters( 'constant_contact_opt_in_delay', MINUTE_IN_SECONDS );
|
| 83 |
+
wp_schedule_single_event( current_time( 'timestamp' ) + absint( $schedule_delay ), 'ctct_schedule_form_opt_in', array( $values ) );
|
| 84 |
}
|
| 85 |
}
|
| 86 |
|
| 95 |
$values = constant_contact()->process_form->pretty_values( $values );
|
| 96 |
|
| 97 |
// Format them.
|
| 98 |
+
$email_values = $this->format_values_for_email( $values, $submission_details['form_id'] );
|
| 99 |
$was_forced = false; // Set a value regardless of status.
|
| 100 |
|
| 101 |
// Increment our counter for processed form entries.
|
| 102 |
constant_contact()->process_form->increment_processed_form_count();
|
| 103 |
|
| 104 |
// Skip sending e-mail if we're connected, the site owner has opted out of notification emails, and the user has opted in
|
| 105 |
+
if ( constant_contact()->api->is_connected() && constant_contact_emails_disabled( $submission_details['form_id'] ) ) {
|
| 106 |
if ( $add_to_opt_in ) {
|
| 107 |
return true;
|
| 108 |
}
|
| 119 |
// Checks if we have a list
|
| 120 |
if (
|
| 121 |
( ! constant_contact()->api->is_connected() || empty( $has_list ) ) &&
|
| 122 |
+
( constant_contact_emails_disabled( $submission_details['form_id'] ) )
|
| 123 |
) { // If we're not connected or have no list set AND we've disabled. Override.
|
| 124 |
|
| 125 |
$submission_details['list-available'] = 'no';
|
| 129 |
if (
|
| 130 |
! empty( $_POST['ctct_must_opt_in'] ) &&
|
| 131 |
empty( $opt_in_details ) &&
|
| 132 |
+
( constant_contact_emails_disabled( $submission_details['form_id'] ) )
|
| 133 |
) {
|
| 134 |
$submission_details['opted-in'] = 'no';
|
| 135 |
$was_forced = true;
|
| 136 |
}
|
| 137 |
|
| 138 |
// Send the mail.
|
| 139 |
+
return $this->mail( $this->get_email( $submission_details['form_id'] ), $email_values, $submission_details, $was_forced );
|
| 140 |
}
|
| 141 |
|
| 142 |
/**
|
| 188 |
* Formats values for email.
|
| 189 |
*
|
| 190 |
* @since 1.0.0
|
| 191 |
+
* @since 1.4.0 Added form_id parameter.
|
| 192 |
*
|
| 193 |
+
* @param array $pretty_vals Values to format.
|
| 194 |
+
* @param string $form_id Form ID being submitted to.
|
| 195 |
* @return string HTML content for email.
|
| 196 |
*/
|
| 197 |
+
public function format_values_for_email( $pretty_vals, $form_id ) {
|
| 198 |
|
| 199 |
$return = '';
|
| 200 |
+
|
| 201 |
+
// Retrieve our original label to send with API request.
|
| 202 |
+
$original_field_data = $this->plugin->process_form->get_original_fields( $form_id );
|
| 203 |
foreach ( $pretty_vals as $val ) {
|
| 204 |
|
| 205 |
$label = isset( $val['orig_key'] ) ? $val['orig_key'] : false;
|
| 206 |
|
| 207 |
+
$custom_field_name = '';
|
| 208 |
+
if ( false !== strpos( $label, 'custom___' ) ) {
|
| 209 |
+
$custom_field = ( $original_field_data[ $val['orig_key'] ] );
|
| 210 |
+
$custom_field_name .= $custom_field['name'];
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
if ( $label && empty( $custom_field_name ) ) {
|
| 214 |
// Break out our unique key.
|
| 215 |
$label = explode( '___', $label );
|
| 216 |
|
| 217 |
// Uppercase and format to be human readable.
|
| 218 |
$label = ucwords( str_replace( '_', ' ', $label[0] ) );
|
| 219 |
+
} else {
|
| 220 |
+
$label = $custom_field_name;
|
| 221 |
}
|
| 222 |
$value = isset( $val['post'] ) ? $val['post'] : ' ';
|
| 223 |
|
| 231 |
* Get the email address to send to.
|
| 232 |
*
|
| 233 |
* @since 1.0.0
|
| 234 |
+
* @since 1.4.0 Added form ID parameter.
|
| 235 |
+
*
|
| 236 |
+
* @param string $form_id Current form ID being submitted to.
|
| 237 |
*
|
| 238 |
* @return string Email address to send to.
|
| 239 |
*/
|
| 240 |
+
public function get_email( $form_id ) {
|
| 241 |
|
| 242 |
$email = get_option( 'admin_email' );
|
| 243 |
|
| 245 |
* Filters the email to send Constant Contact Forms admin emails to.
|
| 246 |
*
|
| 247 |
* @since 1.3.0
|
| 248 |
+
* @since 1.4.0 Added form ID parameter.
|
| 249 |
*
|
| 250 |
* @param string $email Email address to send to. Default admin_email option.
|
| 251 |
+
* @param string $form_id Current form ID being submitted to.
|
| 252 |
*/
|
| 253 |
+
return apply_filters( 'constant_contact_destination_email', $email, $form_id );
|
| 254 |
}
|
| 255 |
|
| 256 |
/**
|
| 276 |
$screen = get_current_screen();
|
| 277 |
}
|
| 278 |
|
| 279 |
+
if ( is_array( $destination_email ) ) {
|
| 280 |
+
$temp_destination_email = implode( ',', $destination_email );
|
| 281 |
+
} else {
|
| 282 |
+
$temp_destination_email = $destination_email;
|
| 283 |
+
}
|
| 284 |
+
// Implode for the sake of $mail_key and md5 usage.
|
| 285 |
+
$mail_key = md5( "{$temp_destination_email}:{$content}:" . ( isset( $screen->id ) ? $screen->id : '' ) );
|
| 286 |
+
|
| 287 |
+
if ( is_array( $destination_email ) ) {
|
| 288 |
+
$partial_email = array_map( array( $this, 'get_email_part' ), $destination_email );
|
| 289 |
+
$partial_email = implode( ',', $partial_email );
|
| 290 |
+
} else {
|
| 291 |
+
if ( false !== strpos( $destination_email, ',' ) ) {
|
| 292 |
+
// Use trim to handle cases of ", "
|
| 293 |
+
$partials = array_map( 'trim', explode( ',', $destination_email ) );
|
| 294 |
+
// Collect our parts and re-implode.
|
| 295 |
+
$partial_email = array_map( array( $this, 'get_email_part' ), $partials );
|
| 296 |
+
$partial_email = implode( ',', $partial_email );
|
| 297 |
+
} else {
|
| 298 |
+
$partial_email = $this->get_email_part( $destination_email );
|
| 299 |
+
}
|
| 300 |
+
}
|
| 301 |
|
| 302 |
// If we already have sent this e-mail, don't send it again.
|
| 303 |
if ( $last_sent === $mail_key ) {
|
| 316 |
return true;
|
| 317 |
}
|
| 318 |
|
| 319 |
+
if ( is_array( $destination_email ) ) {
|
| 320 |
+
$destination_email = array_map( 'sanitize_email', $destination_email );
|
| 321 |
+
$destination_email = implode( ',', $destination_email );
|
| 322 |
+
} else {
|
| 323 |
+
if ( false !== strpos( $destination_email, ',' ) ) {
|
| 324 |
+
// Use trim to handle cases of ", "
|
| 325 |
+
$partials = array_map( 'trim', explode( ',', $destination_email ) );
|
| 326 |
+
$partials = array_map( 'sanitize_email', $partials );
|
| 327 |
+
$destination_email = implode( ',', $partials );
|
| 328 |
+
} else {
|
| 329 |
+
$destination_email = sanitize_email( $destination_email );
|
| 330 |
+
}
|
| 331 |
}
|
| 332 |
|
| 333 |
// Filter to allow sending HTML for our message body.
|
includes/class-notifications.php
CHANGED
|
@@ -395,12 +395,7 @@ class ConstantContact_Notifications {
|
|
| 395 |
// If we haven't shown styles yet, enqueue em.
|
| 396 |
if ( ! $have_styles ) {
|
| 397 |
|
| 398 |
-
wp_enqueue_style(
|
| 399 |
-
'constant-contact-admin-notices',
|
| 400 |
-
constant_contact()->url() . 'assets/css/admin-notices.css',
|
| 401 |
-
array(),
|
| 402 |
-
Constant_Contact::VERSION
|
| 403 |
-
);
|
| 404 |
|
| 405 |
$have_styles = true;
|
| 406 |
}
|
| 395 |
// If we haven't shown styles yet, enqueue em.
|
| 396 |
if ( ! $have_styles ) {
|
| 397 |
|
| 398 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 399 |
|
| 400 |
$have_styles = true;
|
| 401 |
}
|
includes/class-process-form.php
CHANGED
|
@@ -115,7 +115,11 @@ class ConstantContact_Process_Form {
|
|
| 115 |
switch ( $status ) {
|
| 116 |
|
| 117 |
case 'success':
|
| 118 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 119 |
break;
|
| 120 |
|
| 121 |
// Generic error.
|
|
@@ -211,7 +215,7 @@ class ConstantContact_Process_Form {
|
|
| 211 |
}
|
| 212 |
|
| 213 |
if ( isset( $data['g-recaptcha-response'] ) ) {
|
| 214 |
-
$secret = ctct_get_settings_option( '_ctct_recaptcha_secret_key' );
|
| 215 |
$method = null;
|
| 216 |
if ( ! ini_get( 'allow_url_fopen' ) ) {
|
| 217 |
$method = new \ReCaptcha\RequestMethod\CurlPost();
|
|
@@ -222,7 +226,6 @@ class ConstantContact_Process_Form {
|
|
| 222 |
|
| 223 |
if ( ! $resp->isSuccess() ) {
|
| 224 |
constant_contact_maybe_log_it( 'reCAPTCHA', 'Failed to verify with Google reCAPTCHA', array( $resp->getErrorCodes() ) );
|
| 225 |
-
// @todo Utilize the error message(s) that come back from Google, if any.
|
| 226 |
return array(
|
| 227 |
'status' => 'named_error',
|
| 228 |
'error' => __( 'Failed reCAPTCHA check', 'constant-contact-forms' ),
|
|
@@ -676,6 +679,9 @@ class ConstantContact_Process_Form {
|
|
| 676 |
* Filters the message for the successful processed form.
|
| 677 |
*
|
| 678 |
* @since 1.3.0
|
|
|
|
|
|
|
|
|
|
| 679 |
*/
|
| 680 |
$message = apply_filters( 'ctct_process_form_success', __( 'Your information has been submitted.', 'constant-contact-forms' ), $form_id );
|
| 681 |
break;
|
|
@@ -722,6 +728,15 @@ class ConstantContact_Process_Form {
|
|
| 722 |
update_option( 'ctct-processed-forms', $count );
|
| 723 |
}
|
| 724 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 725 |
public function has_all_required_fields( $form_id, $form_data ) {
|
| 726 |
$original = $this->get_original_fields( $form_id );
|
| 727 |
|
| 115 |
switch ( $status ) {
|
| 116 |
|
| 117 |
case 'success':
|
| 118 |
+
|
| 119 |
+
/** This filter is documented in includes/class-process-form.php */
|
| 120 |
+
$message = apply_filters( 'ctct_process_form_success',
|
| 121 |
+
__( 'Your information has been submitted.', 'constant-contact-forms' ),
|
| 122 |
+
intval( $json_data['ctct-id'] ) );
|
| 123 |
break;
|
| 124 |
|
| 125 |
// Generic error.
|
| 215 |
}
|
| 216 |
|
| 217 |
if ( isset( $data['g-recaptcha-response'] ) ) {
|
| 218 |
+
$secret = ctct_get_settings_option( '_ctct_recaptcha_secret_key', '' );
|
| 219 |
$method = null;
|
| 220 |
if ( ! ini_get( 'allow_url_fopen' ) ) {
|
| 221 |
$method = new \ReCaptcha\RequestMethod\CurlPost();
|
| 226 |
|
| 227 |
if ( ! $resp->isSuccess() ) {
|
| 228 |
constant_contact_maybe_log_it( 'reCAPTCHA', 'Failed to verify with Google reCAPTCHA', array( $resp->getErrorCodes() ) );
|
|
|
|
| 229 |
return array(
|
| 230 |
'status' => 'named_error',
|
| 231 |
'error' => __( 'Failed reCAPTCHA check', 'constant-contact-forms' ),
|
| 679 |
* Filters the message for the successful processed form.
|
| 680 |
*
|
| 681 |
* @since 1.3.0
|
| 682 |
+
*
|
| 683 |
+
* @param string $value Success message.
|
| 684 |
+
* @param string/int $form_id ID of the Constant Contact form being submitted to.
|
| 685 |
*/
|
| 686 |
$message = apply_filters( 'ctct_process_form_success', __( 'Your information has been submitted.', 'constant-contact-forms' ), $form_id );
|
| 687 |
break;
|
| 728 |
update_option( 'ctct-processed-forms', $count );
|
| 729 |
}
|
| 730 |
|
| 731 |
+
/**
|
| 732 |
+
* Check if we have all the required fields for a given form.
|
| 733 |
+
*
|
| 734 |
+
* @since 1.3.5
|
| 735 |
+
*
|
| 736 |
+
* @param int $form_id
|
| 737 |
+
* @param array $form_data
|
| 738 |
+
* @return bool
|
| 739 |
+
*/
|
| 740 |
public function has_all_required_fields( $form_id, $form_data ) {
|
| 741 |
$original = $this->get_original_fields( $form_id );
|
| 742 |
|
includes/class-settings.php
CHANGED
|
@@ -149,7 +149,7 @@ class ConstantContact_Settings {
|
|
| 149 |
* @since 1.0.0
|
| 150 |
*/
|
| 151 |
public function scripts() {
|
| 152 |
-
wp_enqueue_style( 'constant-contact-forms' );
|
| 153 |
}
|
| 154 |
|
| 155 |
/**
|
|
@@ -352,16 +352,50 @@ class ConstantContact_Settings {
|
|
| 352 |
'<div class="discover-recaptcha">' . __( 'Learn more and get an <a href="https://www.google.com/recaptcha/intro/" target="_blank">API site key</a>', 'constant-contact-forms' ) . '</div>'
|
| 353 |
);
|
| 354 |
$cmb->add_field( array(
|
| 355 |
-
'name'
|
| 356 |
-
'id'
|
| 357 |
-
'type'
|
| 358 |
'before_row' => $before_recaptcha,
|
| 359 |
) );
|
| 360 |
|
| 361 |
$cmb->add_field( array(
|
| 362 |
-
'name'
|
| 363 |
-
'id'
|
| 364 |
-
'type'
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 365 |
) );
|
| 366 |
|
| 367 |
$before_debugging = sprintf(
|
|
@@ -413,7 +447,7 @@ class ConstantContact_Settings {
|
|
| 413 |
public function check_if_optin_should_show( $type ) {
|
| 414 |
|
| 415 |
// Get all our settings.
|
| 416 |
-
$available_areas = ctct_get_settings_option( '_ctct_optin_forms' );
|
| 417 |
|
| 418 |
// If our settings aren't an array, bail out.
|
| 419 |
if ( ! is_array( $available_areas ) ) {
|
|
@@ -479,8 +513,8 @@ class ConstantContact_Settings {
|
|
| 479 |
}
|
| 480 |
|
| 481 |
// Get our label, based on our settings if they're available.
|
| 482 |
-
$saved_label = ctct_get_settings_option( '_ctct_optin_label' );
|
| 483 |
-
$list = ctct_get_settings_option( '_ctct_optin_list' );
|
| 484 |
|
| 485 |
// Otherwise, use our default.
|
| 486 |
$label = $saved_label ? $saved_label : esc_html__( 'Sign up to our newsletter.', 'constant-contact-forms' );
|
|
@@ -847,7 +881,7 @@ function ctct_get_settings_option( $key = '', $default = null ) {
|
|
| 847 |
|
| 848 |
if ( 'all' === $key ) {
|
| 849 |
$val = $opts;
|
| 850 |
-
} elseif ( array_key_exists( $key, $opts ) && false !== $opts[ $key ] ) {
|
| 851 |
$val = $opts[ $key ];
|
| 852 |
}
|
| 853 |
|
| 149 |
* @since 1.0.0
|
| 150 |
*/
|
| 151 |
public function scripts() {
|
| 152 |
+
wp_enqueue_style( 'constant-contact-forms-admin' );
|
| 153 |
}
|
| 154 |
|
| 155 |
/**
|
| 352 |
'<div class="discover-recaptcha">' . __( 'Learn more and get an <a href="https://www.google.com/recaptcha/intro/" target="_blank">API site key</a>', 'constant-contact-forms' ) . '</div>'
|
| 353 |
);
|
| 354 |
$cmb->add_field( array(
|
| 355 |
+
'name' => esc_html__( 'Site Key', 'constant-contact-forms' ),
|
| 356 |
+
'id' => '_ctct_recaptcha_site_key',
|
| 357 |
+
'type' => 'text',
|
| 358 |
'before_row' => $before_recaptcha,
|
| 359 |
) );
|
| 360 |
|
| 361 |
$cmb->add_field( array(
|
| 362 |
+
'name' => esc_html__( 'Secret Key', 'constant-contact-forms' ),
|
| 363 |
+
'id' => '_ctct_recaptcha_secret_key',
|
| 364 |
+
'type' => 'text',
|
| 365 |
+
) );
|
| 366 |
+
|
| 367 |
+
$before_global_css = sprintf(
|
| 368 |
+
'<hr /><h2>%s</h2>',
|
| 369 |
+
esc_html__( 'Global Form CSS Settings', 'constant-contact-forms' )
|
| 370 |
+
);
|
| 371 |
+
|
| 372 |
+
$cmb->add_field( array(
|
| 373 |
+
'name' => esc_html__( 'CSS Classes', 'constant-contact_forms' ),
|
| 374 |
+
'id' => '_ctct_form_custom_classes',
|
| 375 |
+
'type' => 'text',
|
| 376 |
+
'description' => esc_html__(
|
| 377 |
+
'Provide custom classes for the form separated by a single space.',
|
| 378 |
+
'constant-contact-forms'
|
| 379 |
+
),
|
| 380 |
+
'before_row' => $before_global_css,
|
| 381 |
+
) );
|
| 382 |
+
|
| 383 |
+
$cmb->add_field( array(
|
| 384 |
+
'name' => esc_html__( 'Label Placement' ),
|
| 385 |
+
'id' => '_ctct_form_label_placement',
|
| 386 |
+
'type' => 'select',
|
| 387 |
+
'default' => 'top',
|
| 388 |
+
'show_option_none' => false,
|
| 389 |
+
'options' => array(
|
| 390 |
+
'top' => 'Top',
|
| 391 |
+
'left' => 'Left',
|
| 392 |
+
'right' => 'Right',
|
| 393 |
+
'hidden' => 'Hidden',
|
| 394 |
+
),
|
| 395 |
+
'description' => esc_html__(
|
| 396 |
+
'Choose the position for the labels of the form elements.',
|
| 397 |
+
'constant-contact-forms'
|
| 398 |
+
),
|
| 399 |
) );
|
| 400 |
|
| 401 |
$before_debugging = sprintf(
|
| 447 |
public function check_if_optin_should_show( $type ) {
|
| 448 |
|
| 449 |
// Get all our settings.
|
| 450 |
+
$available_areas = ctct_get_settings_option( '_ctct_optin_forms', [] );
|
| 451 |
|
| 452 |
// If our settings aren't an array, bail out.
|
| 453 |
if ( ! is_array( $available_areas ) ) {
|
| 513 |
}
|
| 514 |
|
| 515 |
// Get our label, based on our settings if they're available.
|
| 516 |
+
$saved_label = ctct_get_settings_option( '_ctct_optin_label', '' );
|
| 517 |
+
$list = ctct_get_settings_option( '_ctct_optin_list', '' );
|
| 518 |
|
| 519 |
// Otherwise, use our default.
|
| 520 |
$label = $saved_label ? $saved_label : esc_html__( 'Sign up to our newsletter.', 'constant-contact-forms' );
|
| 881 |
|
| 882 |
if ( 'all' === $key ) {
|
| 883 |
$val = $opts;
|
| 884 |
+
} elseif ( is_array( $opts ) && array_key_exists( $key, $opts ) && false !== $opts[ $key ] ) {
|
| 885 |
$val = $opts[ $key ];
|
| 886 |
}
|
| 887 |
|
includes/class-user-customizations.php
CHANGED
|
@@ -38,6 +38,7 @@ class ConstantContact_User_Customizations {
|
|
| 38 |
public function hooks() {
|
| 39 |
add_filter( 'ctct_process_form_success', array( $this, 'process_form_success' ), 10, 2 );
|
| 40 |
add_filter( 'constant_contact_front_form_action', array( $this, 'custom_redirect' ), 10, 2 );
|
|
|
|
| 41 |
}
|
| 42 |
|
| 43 |
/**
|
|
@@ -75,4 +76,32 @@ class ConstantContact_User_Customizations {
|
|
| 75 |
|
| 76 |
return constant_contact_clean_url( $custom );
|
| 77 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 78 |
}
|
| 38 |
public function hooks() {
|
| 39 |
add_filter( 'ctct_process_form_success', array( $this, 'process_form_success' ), 10, 2 );
|
| 40 |
add_filter( 'constant_contact_front_form_action', array( $this, 'custom_redirect' ), 10, 2 );
|
| 41 |
+
add_filter( 'constant_contact_destination_email', array( $this, 'custom_email' ), 10, 2 );
|
| 42 |
}
|
| 43 |
|
| 44 |
/**
|
| 76 |
|
| 77 |
return constant_contact_clean_url( $custom );
|
| 78 |
}
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* Conditionally return a custom email destination value to our mail filter.
|
| 82 |
+
*
|
| 83 |
+
* @since 1.4.0
|
| 84 |
+
*
|
| 85 |
+
* @param $form_id
|
| 86 |
+
* @return mixed|string
|
| 87 |
+
*/
|
| 88 |
+
public function custom_email( $destination_email, $form_id ) {
|
| 89 |
+
$custom_email = get_post_meta( $form_id, '_ctct_email_destination', true );
|
| 90 |
+
|
| 91 |
+
if ( empty( $custom_email ) ) {
|
| 92 |
+
return $destination_email;
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
// @todo Potentially using this type of code in many places in 1.4.0. Worthy of a helper function.
|
| 96 |
+
if ( false !== strpos( $custom_email, ',' ) ) {
|
| 97 |
+
// Use trim to handle cases of ", "
|
| 98 |
+
$partials = array_map( 'trim', explode( ',', $custom_email ) );
|
| 99 |
+
$partials = array_map( 'sanitize_email', $partials );
|
| 100 |
+
$custom_email = implode( ',', $partials );
|
| 101 |
+
} else {
|
| 102 |
+
$custom_email = sanitize_email( $custom_email );
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
return $custom_email;
|
| 106 |
+
}
|
| 107 |
}
|
includes/compatibility.php
ADDED
|
@@ -0,0 +1,39 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Fixes for compatibility issues with other plug-ins.
|
| 4 |
+
*
|
| 5 |
+
* @package ConstantContact
|
| 6 |
+
* @author Constant Contact
|
| 7 |
+
* @since NEXT
|
| 8 |
+
*/
|
| 9 |
+
|
| 10 |
+
/**
|
| 11 |
+
* Add the Constant Contact post type to an array of excluded post types.
|
| 12 |
+
*
|
| 13 |
+
* @since NEXT
|
| 14 |
+
*
|
| 15 |
+
* @param array $excluded The post types to exclude.
|
| 16 |
+
* @return array
|
| 17 |
+
*/
|
| 18 |
+
function constant_contact_exclude_ctct_forms( $excluded ) {
|
| 19 |
+
$excluded[] = 'ctct_forms';
|
| 20 |
+
return $excluded;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
// If the WordPress Calls to Action plug-in is installed, exclude our post type to conflict.
|
| 24 |
+
add_filter( 'cta_excluded_post_types', 'constant_contact_exclude_ctct_forms' );
|
| 25 |
+
|
| 26 |
+
/**
|
| 27 |
+
* Ignore the field added by Popup Maker from being processed by Constant Contact.
|
| 28 |
+
*
|
| 29 |
+
* @since 1.4.0
|
| 30 |
+
*
|
| 31 |
+
* @param array $ignored The array of fields that Constant Contact should ignore.
|
| 32 |
+
* @return array
|
| 33 |
+
*/
|
| 34 |
+
function constant_contact_exclude_pum( $ignored ) {
|
| 35 |
+
$ignored[] = 'pum_form_popup_id';
|
| 36 |
+
|
| 37 |
+
return $ignored;
|
| 38 |
+
}
|
| 39 |
+
add_filter( 'constant_contact_ignored_post_form_values', 'constant_contact_exclude_pum' );
|
includes/helper-functions.php
CHANGED
|
@@ -228,7 +228,7 @@ function constant_contact_review_ajax_handler() {
|
|
| 228 |
switch ( $action ) {
|
| 229 |
case 'dismissed':
|
| 230 |
$dismissed = get_option( 'ctct-review-dismissed', array() );
|
| 231 |
-
$dismissed['time'] =
|
| 232 |
if ( empty( $dismissed['count'] ) ) {
|
| 233 |
$dismissed['count'] = '1';
|
| 234 |
} elseif ( isset( $dismissed['count'] ) && '2' === $dismissed['count'] ) {
|
|
@@ -313,7 +313,7 @@ function constant_contact_has_redirect_uri( $form_id = 0 ) {
|
|
| 313 |
* @return bool
|
| 314 |
*/
|
| 315 |
function constant_contact_check_timestamps( $maybe_spam, $data ) {
|
| 316 |
-
$current =
|
| 317 |
$difference = $current - $data['ctct_time'];
|
| 318 |
if ( $difference <= 5 ) {
|
| 319 |
return true;
|
|
@@ -351,7 +351,7 @@ function constant_contact_clean_url( $url = '' ) {
|
|
| 351 |
* @return bool
|
| 352 |
*/
|
| 353 |
function constant_contact_debugging_enabled() {
|
| 354 |
-
$debugging_enabled = ctct_get_settings_option( '_ctct_logging' );
|
| 355 |
|
| 356 |
return (
|
| 357 |
( defined( 'CONSTANT_CONTACT_DEBUG_MAIL' ) && CONSTANT_CONTACT_DEBUG_MAIL ) ||
|
|
@@ -383,3 +383,210 @@ function constant_contact_maybe_log_it( $log_name, $error, $extra_data = '' ) {
|
|
| 383 |
// Log status of error.
|
| 384 |
$logger->addInfo( $error, $extra );
|
| 385 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 228 |
switch ( $action ) {
|
| 229 |
case 'dismissed':
|
| 230 |
$dismissed = get_option( 'ctct-review-dismissed', array() );
|
| 231 |
+
$dismissed['time'] = current_time( 'timestamp' );
|
| 232 |
if ( empty( $dismissed['count'] ) ) {
|
| 233 |
$dismissed['count'] = '1';
|
| 234 |
} elseif ( isset( $dismissed['count'] ) && '2' === $dismissed['count'] ) {
|
| 313 |
* @return bool
|
| 314 |
*/
|
| 315 |
function constant_contact_check_timestamps( $maybe_spam, $data ) {
|
| 316 |
+
$current = current_time( 'timestamp' );
|
| 317 |
$difference = $current - $data['ctct_time'];
|
| 318 |
if ( $difference <= 5 ) {
|
| 319 |
return true;
|
| 351 |
* @return bool
|
| 352 |
*/
|
| 353 |
function constant_contact_debugging_enabled() {
|
| 354 |
+
$debugging_enabled = ctct_get_settings_option( '_ctct_logging', '' );
|
| 355 |
|
| 356 |
return (
|
| 357 |
( defined( 'CONSTANT_CONTACT_DEBUG_MAIL' ) && CONSTANT_CONTACT_DEBUG_MAIL ) ||
|
| 383 |
// Log status of error.
|
| 384 |
$logger->addInfo( $error, $extra );
|
| 385 |
}
|
| 386 |
+
|
| 387 |
+
/**
|
| 388 |
+
* Check spam through Akismet.
|
| 389 |
+
* It will build Akismet query string and call Akismet API.
|
| 390 |
+
* Akismet response return 'true' for spam submission.
|
| 391 |
+
*
|
| 392 |
+
* Akismet integration props to GiveWP. We appreciate the initial work.
|
| 393 |
+
*
|
| 394 |
+
* @since 1.4.0
|
| 395 |
+
*
|
| 396 |
+
* @param bool $is_spam Current status of the submission.
|
| 397 |
+
* @param array $data Array of submission data.
|
| 398 |
+
* @return bool
|
| 399 |
+
*/
|
| 400 |
+
function constant_contact_akismet( $is_spam, $data ) {
|
| 401 |
+
|
| 402 |
+
// Bail out, If spam.
|
| 403 |
+
if ( $is_spam ) {
|
| 404 |
+
return $is_spam;
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
$email = false;
|
| 408 |
+
$fname = $lname = $name = '';
|
| 409 |
+
foreach ( $data as $key => $value ) {
|
| 410 |
+
if ( 'email' === substr( $key, 0, 5 ) ) {
|
| 411 |
+
$email = $value;
|
| 412 |
+
}
|
| 413 |
+
if ( 'first_name' === substr( $key, 0, 10 ) ) {
|
| 414 |
+
$fname = $value;
|
| 415 |
+
}
|
| 416 |
+
if ( 'last_name' === substr( $key, 0, 9 ) ) {
|
| 417 |
+
$lname = $value;
|
| 418 |
+
}
|
| 419 |
+
}
|
| 420 |
+
|
| 421 |
+
if ( $fname ) {
|
| 422 |
+
$name = $fname;
|
| 423 |
+
}
|
| 424 |
+
if ( $lname ) {
|
| 425 |
+
$name .= ' ' . $lname;
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
// Bail out, if Akismet key not exist.
|
| 429 |
+
if ( ! constant_contact_check_akismet_key() ) {
|
| 430 |
+
return $is_spam;
|
| 431 |
+
}
|
| 432 |
+
|
| 433 |
+
// Build args array.
|
| 434 |
+
$args = array();
|
| 435 |
+
|
| 436 |
+
$args['comment_author'] = $name;
|
| 437 |
+
$args['comment_author_email'] = $email;
|
| 438 |
+
$args['blog'] = get_option( 'home' );
|
| 439 |
+
$args['blog_lang'] = get_locale();
|
| 440 |
+
$args['blog_charset'] = get_option( 'blog_charset' );
|
| 441 |
+
$args['user_ip'] = $_SERVER['REMOTE_ADDR'];
|
| 442 |
+
$args['user_agent'] = $_SERVER['HTTP_USER_AGENT'];
|
| 443 |
+
$args['referrer'] = $_SERVER['HTTP_REFERER'];
|
| 444 |
+
$args['comment_type'] = 'contact-form';
|
| 445 |
+
|
| 446 |
+
$ignore = array( 'HTTP_COOKIE', 'HTTP_COOKIE2', 'PHP_AUTH_PW' );
|
| 447 |
+
|
| 448 |
+
foreach ( $_SERVER as $key => $value ) {
|
| 449 |
+
if ( ! in_array( $key, (array) $ignore ) ) {
|
| 450 |
+
$args[ "{$key}" ] = $value;
|
| 451 |
+
}
|
| 452 |
+
}
|
| 453 |
+
|
| 454 |
+
// It will return Akismet spam detect API response.
|
| 455 |
+
$is_spam = constant_contact_akismet_spam_check( $args );
|
| 456 |
+
|
| 457 |
+
return $is_spam;
|
| 458 |
+
}
|
| 459 |
+
add_filter( 'constant_contact_maybe_spam', 'constant_contact_akismet', 10, 2 );
|
| 460 |
+
|
| 461 |
+
/**
|
| 462 |
+
* Check Akismet API Key.
|
| 463 |
+
*
|
| 464 |
+
* @since 1.4.0
|
| 465 |
+
*
|
| 466 |
+
* @return bool
|
| 467 |
+
*/
|
| 468 |
+
function constant_contact_check_akismet_key() {
|
| 469 |
+
if ( is_callable( array( 'Akismet', 'get_api_key' ) ) ) { // Akismet v3.0
|
| 470 |
+
return (bool) Akismet::get_api_key();
|
| 471 |
+
}
|
| 472 |
+
|
| 473 |
+
if ( function_exists( 'akismet_get_key' ) ) {
|
| 474 |
+
return (bool) akismet_get_key();
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
return false;
|
| 478 |
+
}
|
| 479 |
+
|
| 480 |
+
/**
|
| 481 |
+
* Detect spam through Akismet Comment API.
|
| 482 |
+
*
|
| 483 |
+
* @since 1.4.0
|
| 484 |
+
*
|
| 485 |
+
* @param array $args
|
| 486 |
+
* @return bool|mixed
|
| 487 |
+
*/
|
| 488 |
+
function constant_contact_akismet_spam_check( $args ) {
|
| 489 |
+
global $akismet_api_host, $akismet_api_port;
|
| 490 |
+
|
| 491 |
+
$spam = false;
|
| 492 |
+
$query_string = http_build_query( $args );
|
| 493 |
+
|
| 494 |
+
if ( is_callable( array( 'Akismet', 'http_post' ) ) ) { // Akismet v3.0
|
| 495 |
+
$response = Akismet::http_post( $query_string, 'comment-check' );
|
| 496 |
+
} else {
|
| 497 |
+
$response = akismet_http_post( $query_string, $akismet_api_host,
|
| 498 |
+
'/1.1/comment-check', $akismet_api_port );
|
| 499 |
+
}
|
| 500 |
+
|
| 501 |
+
// It's spam if response status is true.
|
| 502 |
+
if ( 'true' === $response[1] ) {
|
| 503 |
+
$spam = true;
|
| 504 |
+
}
|
| 505 |
+
|
| 506 |
+
return $spam;
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
/**
|
| 510 |
+
* Check whether or not emails should be disabled.
|
| 511 |
+
*
|
| 512 |
+
* @since 1.4.0
|
| 513 |
+
*
|
| 514 |
+
* @param int $form_id Current form ID being submitted to.
|
| 515 |
+
*
|
| 516 |
+
* @return mixed|void
|
| 517 |
+
*/
|
| 518 |
+
function constant_contact_emails_disabled( $form_id = 0 ) {
|
| 519 |
+
|
| 520 |
+
// Assume we can.
|
| 521 |
+
$disabled = false;
|
| 522 |
+
|
| 523 |
+
// Check for a setting for the form itself.
|
| 524 |
+
$form_disabled = get_post_meta( $form_id, '_ctct_disable_emails_for_form', true );
|
| 525 |
+
if ( 'on' === $form_disabled ) {
|
| 526 |
+
$disabled = true;
|
| 527 |
+
}
|
| 528 |
+
|
| 529 |
+
// Check for our global setting.
|
| 530 |
+
$global_form_disabled = ctct_get_settings_option( '_ctct_disable_email_notifications', '' );
|
| 531 |
+
if ( 'on' === $global_form_disabled ) {
|
| 532 |
+
$disabled = true;
|
| 533 |
+
}
|
| 534 |
+
|
| 535 |
+
/**
|
| 536 |
+
* Filters whether or not emails should be disabled.
|
| 537 |
+
*
|
| 538 |
+
* @since 1.4.0
|
| 539 |
+
*
|
| 540 |
+
* @param bool $disabled Whether or not emails are disabled.
|
| 541 |
+
* @param int $form_id Form ID being submitted to.
|
| 542 |
+
*/
|
| 543 |
+
return apply_filters( 'constant_contact_emails_disabled', $disabled, $form_id );
|
| 544 |
+
}
|
| 545 |
+
|
| 546 |
+
/**
|
| 547 |
+
* Get a list of font sizes to use in a dropdown menu for user customization.
|
| 548 |
+
*
|
| 549 |
+
* @since 1.4.0
|
| 550 |
+
*
|
| 551 |
+
* @return array The font sizes to use in a dropdown.
|
| 552 |
+
*/
|
| 553 |
+
function constant_contact_get_font_dropdown_sizes() {
|
| 554 |
+
return array(
|
| 555 |
+
'12px' => '12 pixels',
|
| 556 |
+
'13px' => '13 pixels',
|
| 557 |
+
'14px' => '14 pixels',
|
| 558 |
+
'15px' => '15 pixels',
|
| 559 |
+
'16px' => '16 pixels',
|
| 560 |
+
'17px' => '17 pixels',
|
| 561 |
+
'18px' => '18 pixels',
|
| 562 |
+
'19px' => '19 pixels',
|
| 563 |
+
'20px' => '20 pixels',
|
| 564 |
+
);
|
| 565 |
+
}
|
| 566 |
+
|
| 567 |
+
/**
|
| 568 |
+
* Retrieve a CSS customization setting for a given form.
|
| 569 |
+
*
|
| 570 |
+
* Provide the post meta key or global setting key to retrieve.
|
| 571 |
+
*
|
| 572 |
+
* @since 1.4.0
|
| 573 |
+
*
|
| 574 |
+
* @param int $form_id Form ID to fetch data for.
|
| 575 |
+
* @param string $customization_key Key to fetch value for.
|
| 576 |
+
* @return string.
|
| 577 |
+
*/
|
| 578 |
+
function constant_contact_get_css_customization( $form_id, $customization_key = '' ) {
|
| 579 |
+
|
| 580 |
+
$form_id = absint( $form_id );
|
| 581 |
+
$form_css = get_post_meta( $form_id );
|
| 582 |
+
|
| 583 |
+
if ( is_array( $form_css ) && array_key_exists( $customization_key, $form_css ) ) {
|
| 584 |
+
if ( ! empty( $form_css[ $customization_key ][0] ) ) {
|
| 585 |
+
return $form_css[ $customization_key ][0];
|
| 586 |
+
}
|
| 587 |
+
}
|
| 588 |
+
|
| 589 |
+
$global_setting = ctct_get_settings_option( $customization_key );
|
| 590 |
+
|
| 591 |
+
return ( ! empty( $global_setting ) ) ? $global_setting : '';
|
| 592 |
+
}
|
languages/constant-contact-forms.pot
CHANGED
|
@@ -3,7 +3,7 @@ msgid ""
|
|
| 3 |
msgstr ""
|
| 4 |
"Plural-Forms: nplurals=INTEGER; plural=EXPRESSION;\n"
|
| 5 |
"Project-Id-Version: Constant Contact Forms for WordPress\n"
|
| 6 |
-
"POT-Creation-Date: 2018-
|
| 7 |
"PO-Revision-Date: 2017-01-12 14:46-0600\n"
|
| 8 |
"Last-Translator: Michael Beckwith <michael.d.beckwith@gmail.com>\n"
|
| 9 |
"Language-Team: Constant Contact\n"
|
|
@@ -29,162 +29,162 @@ msgstr ""
|
|
| 29 |
msgid "Constant Contact"
|
| 30 |
msgstr ""
|
| 31 |
|
| 32 |
-
#: constant-contact-forms.php:
|
| 33 |
msgid ""
|
| 34 |
"Constant Contact Forms requires PHP 5.4 or higher. Your hosting provider or "
|
| 35 |
"website administrator should be able to assist in updating your PHP version."
|
| 36 |
msgstr ""
|
| 37 |
|
| 38 |
-
#: constant-contact-forms.php:
|
| 39 |
msgid "Error loading license."
|
| 40 |
msgstr ""
|
| 41 |
|
| 42 |
-
#: includes/class-admin-pages.php:
|
| 43 |
msgid "This is a sample help header"
|
| 44 |
msgstr ""
|
| 45 |
|
| 46 |
-
#: includes/class-admin-pages.php:
|
| 47 |
msgid "This is some sample help text."
|
| 48 |
msgstr ""
|
| 49 |
|
| 50 |
-
#: includes/class-admin-pages.php:
|
| 51 |
msgid "This is another sample header"
|
| 52 |
msgstr ""
|
| 53 |
|
| 54 |
-
#: includes/class-admin-pages.php:
|
| 55 |
msgid "This is also some sample help text."
|
| 56 |
msgstr ""
|
| 57 |
|
| 58 |
-
#: includes/class-admin-pages.php:
|
| 59 |
msgid "Is this a sample question?"
|
| 60 |
msgstr ""
|
| 61 |
|
| 62 |
-
#: includes/class-admin-pages.php:
|
| 63 |
msgid "This is a sample answer"
|
| 64 |
msgstr ""
|
| 65 |
|
| 66 |
-
#: includes/class-admin-pages.php:
|
| 67 |
msgid "This is also a sample question"
|
| 68 |
msgstr ""
|
| 69 |
|
| 70 |
-
#: includes/class-admin-pages.php:
|
| 71 |
msgid "This is another sample answer"
|
| 72 |
msgstr ""
|
| 73 |
|
| 74 |
-
#: includes/class-admin-pages.php:
|
| 75 |
msgid "Help / FAQ"
|
| 76 |
msgstr ""
|
| 77 |
|
| 78 |
-
#: includes/class-admin-pages.php:
|
| 79 |
msgid "Help"
|
| 80 |
msgstr ""
|
| 81 |
|
| 82 |
-
#: includes/class-admin-pages.php:
|
| 83 |
msgid "FAQ"
|
| 84 |
msgstr ""
|
| 85 |
|
| 86 |
-
#: includes/class-admin-pages.php:
|
| 87 |
#: includes/class-notification-content.php:53
|
| 88 |
msgid "Constant Contact Forms"
|
| 89 |
msgstr ""
|
| 90 |
|
| 91 |
-
#: includes/class-admin-pages.php:
|
| 92 |
msgid ""
|
| 93 |
"This plugin makes it fast and easy to capture all kinds of visitor "
|
| 94 |
"information right from your WordPress site—even if you don't have a Constant "
|
| 95 |
"Contact account."
|
| 96 |
msgstr ""
|
| 97 |
|
| 98 |
-
#: includes/class-admin-pages.php:
|
| 99 |
msgid ""
|
| 100 |
"Whether you're looking to collect email addresses, contact info, or visitor "
|
| 101 |
"feedback, you can customize your forms with data fields that work best for "
|
| 102 |
"you."
|
| 103 |
msgstr ""
|
| 104 |
|
| 105 |
-
#: includes/class-admin-pages.php:
|
| 106 |
msgid ""
|
| 107 |
"Quickly create different types of forms that are clear, simple, and mobile-"
|
| 108 |
"optimized."
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
-
#: includes/class-admin-pages.php:
|
| 112 |
msgid ""
|
| 113 |
"Choose forms that automatically select the theme and style of your WordPress "
|
| 114 |
"site."
|
| 115 |
msgstr ""
|
| 116 |
|
| 117 |
-
#: includes/class-admin-pages.php:
|
| 118 |
msgid ""
|
| 119 |
"Customize the form data fields, so you can tailor the type of information "
|
| 120 |
"you collect."
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
-
#: includes/class-admin-pages.php:
|
| 124 |
msgid "Collecting email addresses with the plugin?"
|
| 125 |
msgstr ""
|
| 126 |
|
| 127 |
-
#: includes/class-admin-pages.php:
|
| 128 |
msgid "Turn those contacts into customers."
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
-
#: includes/class-admin-pages.php:
|
| 132 |
msgid ""
|
| 133 |
"Nurture your new contacts with a Constant Contact email marketing account "
|
| 134 |
"even after they've left your website. Sign up for a 60-day trial account* "
|
| 135 |
"and you can:"
|
| 136 |
msgstr ""
|
| 137 |
|
| 138 |
-
#: includes/class-admin-pages.php:
|
| 139 |
msgid "Seamlessly add new contacts to mailing lists."
|
| 140 |
msgstr ""
|
| 141 |
|
| 142 |
-
#: includes/class-admin-pages.php:
|
| 143 |
msgid "Create and send professional emails."
|
| 144 |
msgstr ""
|
| 145 |
|
| 146 |
-
#: includes/class-admin-pages.php:
|
| 147 |
msgid "Get expert marketing help and support."
|
| 148 |
msgstr ""
|
| 149 |
|
| 150 |
-
#: includes/class-admin-pages.php:
|
| 151 |
msgid "Try us Free"
|
| 152 |
msgstr ""
|
| 153 |
|
| 154 |
-
#: includes/class-admin-pages.php:
|
| 155 |
msgid "Already have a Constant Contact account?"
|
| 156 |
msgstr ""
|
| 157 |
|
| 158 |
-
#: includes/class-admin-pages.php:
|
| 159 |
msgid "Connect the plugin."
|
| 160 |
msgstr ""
|
| 161 |
|
| 162 |
-
#: includes/class-admin-pages.php:
|
| 163 |
msgid ""
|
| 164 |
"NOTE: You can use the Constant Contact Form plugin without a Constant "
|
| 165 |
"Contact account. All information collected by the forms will be individually "
|
| 166 |
"emailed to your site admin."
|
| 167 |
msgstr ""
|
| 168 |
|
| 169 |
-
#: includes/class-admin-pages.php:
|
| 170 |
msgid "Sign Up"
|
| 171 |
msgstr ""
|
| 172 |
|
| 173 |
-
#: includes/class-admin-pages.php:
|
| 174 |
msgid "Email marketing tips delivered to your inbox."
|
| 175 |
msgstr ""
|
| 176 |
|
| 177 |
-
#: includes/class-admin-pages.php:
|
| 178 |
msgid ""
|
| 179 |
"Ready to grow with email marketing? Subscribe now for the latest tips and "
|
| 180 |
"industry best practices to create great-looking emails that work."
|
| 181 |
msgstr ""
|
| 182 |
|
| 183 |
-
#: includes/class-admin-pages.php:
|
| 184 |
msgid "Enter your email address"
|
| 185 |
msgstr ""
|
| 186 |
|
| 187 |
-
#: includes/class-admin-pages.php:
|
| 188 |
#, php-format
|
| 189 |
msgid ""
|
| 190 |
"By submitting this form, you agree to receive periodic product announcements "
|
|
@@ -193,15 +193,15 @@ msgid ""
|
|
| 193 |
"email. Constant Contact, Inc, 1601 Trapelo Road, Waltham, MA 02451, %s"
|
| 194 |
msgstr ""
|
| 195 |
|
| 196 |
-
#: includes/class-admin-pages.php:
|
| 197 |
msgid "Powerful Email Marketing, Made Simple."
|
| 198 |
msgstr ""
|
| 199 |
|
| 200 |
-
#: includes/class-admin-pages.php:
|
| 201 |
msgid "Create professional emails that bring customers to your door"
|
| 202 |
msgstr ""
|
| 203 |
|
| 204 |
-
#: includes/class-admin-pages.php:
|
| 205 |
msgid ""
|
| 206 |
"Email marketing is good for your business. $44-back-for-every-$1-spent kind "
|
| 207 |
"of good.* And with the Constant Contact for WordPress plugin, you can "
|
|
@@ -209,64 +209,64 @@ msgid ""
|
|
| 209 |
"visitors long after they've left."
|
| 210 |
msgstr ""
|
| 211 |
|
| 212 |
-
#: includes/class-admin-pages.php:
|
| 213 |
msgid "GPLv3 license"
|
| 214 |
msgstr ""
|
| 215 |
|
| 216 |
-
#: includes/class-admin-pages.php:
|
| 217 |
#, php-format
|
| 218 |
msgid "This software is released under a modified %s."
|
| 219 |
msgstr ""
|
| 220 |
|
| 221 |
-
#: includes/class-admin-pages.php:
|
| 222 |
msgid "*Direct Marketing Association 2013 Statistical Fact Book"
|
| 223 |
msgstr ""
|
| 224 |
|
| 225 |
-
#: includes/class-admin-pages.php:
|
| 226 |
msgid "Easily Add Forms"
|
| 227 |
msgstr ""
|
| 228 |
|
| 229 |
-
#: includes/class-admin-pages.php:
|
| 230 |
msgctxt "add forms alt text"
|
| 231 |
msgid "add forms screenshot"
|
| 232 |
msgstr ""
|
| 233 |
|
| 234 |
-
#: includes/class-admin-pages.php:
|
| 235 |
msgid ""
|
| 236 |
"Create forms that automatically select the theme and styling of your "
|
| 237 |
"WordPress site for a perfect match. "
|
| 238 |
msgstr ""
|
| 239 |
|
| 240 |
-
#: includes/class-admin-pages.php:
|
| 241 |
msgid "Stay Connected With Your WordPress Visitors"
|
| 242 |
msgstr ""
|
| 243 |
|
| 244 |
-
#: includes/class-admin-pages.php:
|
| 245 |
msgctxt "stay connected alt text"
|
| 246 |
msgid "stay connected screenshot"
|
| 247 |
msgstr ""
|
| 248 |
|
| 249 |
-
#: includes/class-admin-pages.php:
|
| 250 |
msgid ""
|
| 251 |
"Form completions from site visitors are conveniently added to your Constant "
|
| 252 |
"Contact email list."
|
| 253 |
msgstr ""
|
| 254 |
|
| 255 |
-
#: includes/class-admin-pages.php:
|
| 256 |
msgid "Constant Contact Forms - License"
|
| 257 |
msgstr ""
|
| 258 |
|
| 259 |
#: includes/class-admin.php:116 includes/class-admin.php:117
|
| 260 |
-
#: includes/class-admin.php:
|
| 261 |
msgid "About"
|
| 262 |
msgstr ""
|
| 263 |
|
| 264 |
#: includes/class-admin.php:125 includes/class-admin.php:126
|
| 265 |
-
#: includes/class-admin.php:
|
| 266 |
msgid "License"
|
| 267 |
msgstr ""
|
| 268 |
|
| 269 |
-
#: includes/class-admin.php:210 includes/class-settings.php:
|
| 270 |
msgid "Settings updated."
|
| 271 |
msgstr ""
|
| 272 |
|
|
@@ -274,7 +274,7 @@ msgstr ""
|
|
| 274 |
msgid "Description"
|
| 275 |
msgstr ""
|
| 276 |
|
| 277 |
-
#: includes/class-admin.php:249 includes/class-builder-fields.php:
|
| 278 |
msgid "Shortcode"
|
| 279 |
msgstr ""
|
| 280 |
|
|
@@ -283,7 +283,7 @@ msgid "Associated List"
|
|
| 283 |
msgstr ""
|
| 284 |
|
| 285 |
#: includes/class-admin.php:293
|
| 286 |
-
msgid "No associated
|
| 287 |
msgstr ""
|
| 288 |
|
| 289 |
#: includes/class-admin.php:309
|
|
@@ -294,23 +294,23 @@ msgstr ""
|
|
| 294 |
msgid "None available"
|
| 295 |
msgstr ""
|
| 296 |
|
| 297 |
-
#: includes/class-admin.php:
|
| 298 |
msgid "Check out the official WordPress plugin from @constantcontact :"
|
| 299 |
msgstr ""
|
| 300 |
|
| 301 |
-
#: includes/class-admin.php:
|
| 302 |
msgid "Spread the word!"
|
| 303 |
msgstr ""
|
| 304 |
|
| 305 |
-
#: includes/class-admin.php:
|
| 306 |
msgid "You have unsaved changes."
|
| 307 |
msgstr ""
|
| 308 |
|
| 309 |
-
#: includes/class-admin.php:
|
| 310 |
msgid "move up"
|
| 311 |
msgstr ""
|
| 312 |
|
| 313 |
-
#: includes/class-admin.php:
|
| 314 |
msgid "move down"
|
| 315 |
msgstr ""
|
| 316 |
|
|
@@ -328,23 +328,23 @@ msgid ""
|
|
| 328 |
"new token."
|
| 329 |
msgstr ""
|
| 330 |
|
| 331 |
-
#: includes/class-builder-fields.php:
|
| 332 |
msgid "Constant Contact List"
|
| 333 |
msgstr ""
|
| 334 |
|
| 335 |
-
#: includes/class-builder-fields.php:
|
| 336 |
msgid "Add subscribers to"
|
| 337 |
msgstr ""
|
| 338 |
|
| 339 |
-
#: includes/class-builder-fields.php:
|
| 340 |
msgid "No List Selected"
|
| 341 |
msgstr ""
|
| 342 |
|
| 343 |
-
#: includes/class-builder-fields.php:
|
| 344 |
msgid "Form Description"
|
| 345 |
msgstr ""
|
| 346 |
|
| 347 |
-
#: includes/class-builder-fields.php:
|
| 348 |
msgid ""
|
| 349 |
"This message will display above the form fields, so use it as an opportunity "
|
| 350 |
"to pitch your email list. Tell visitors why they should subscribe to your "
|
|
@@ -352,241 +352,343 @@ msgid ""
|
|
| 352 |
"coupons, and more."
|
| 353 |
msgstr ""
|
| 354 |
|
| 355 |
-
#: includes/class-builder-fields.php:
|
| 356 |
msgid "Form Options"
|
| 357 |
msgstr ""
|
| 358 |
|
| 359 |
-
#: includes/class-builder-fields.php:
|
| 360 |
msgid "Button text"
|
| 361 |
msgstr ""
|
| 362 |
|
| 363 |
-
#: includes/class-builder-fields.php:
|
| 364 |
msgid "Sign up"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
-
#: includes/class-builder-fields.php:
|
| 368 |
msgid "Success message"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
-
#: includes/class-builder-fields.php:
|
| 372 |
msgid "Your information has been submitted"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
-
#: includes/class-builder-fields.php:
|
| 376 |
msgid "Submission behavior"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
-
#: includes/class-builder-fields.php:
|
| 380 |
msgid "Redirect URL"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
-
#: includes/class-builder-fields.php:
|
| 384 |
msgid "Leave blank to keep users on the current page."
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
-
#: includes/class-builder-fields.php:
|
| 388 |
msgid "No page refresh"
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
-
#: includes/class-builder-fields.php:
|
| 392 |
msgid ""
|
| 393 |
"Enable form submission without a page refresh. This option overrides the "
|
| 394 |
"Redirect URL choice above."
|
| 395 |
msgstr ""
|
| 396 |
|
| 397 |
-
#: includes/class-builder-fields.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 398 |
msgid ""
|
| 399 |
"Enabling this option will require users to check a box to be added to your "
|
| 400 |
"list."
|
| 401 |
msgstr ""
|
| 402 |
|
| 403 |
-
#: includes/class-builder-fields.php:
|
| 404 |
msgid "Learn more"
|
| 405 |
msgstr ""
|
| 406 |
|
| 407 |
-
#: includes/class-builder-fields.php:
|
| 408 |
msgid "Email opt-in"
|
| 409 |
msgstr ""
|
| 410 |
|
| 411 |
-
#: includes/class-builder-fields.php:
|
| 412 |
msgid "Enable email subscriber opt-in"
|
| 413 |
msgstr ""
|
| 414 |
|
| 415 |
-
#: includes/class-builder-fields.php:
|
| 416 |
msgid "Adds an opt-in to the bottom of your form."
|
| 417 |
msgstr ""
|
| 418 |
|
| 419 |
-
#: includes/class-builder-fields.php:
|
| 420 |
msgid "Add a checkbox so subscribers can opt-in to your email list."
|
| 421 |
msgstr ""
|
| 422 |
|
| 423 |
-
#: includes/class-builder-fields.php:
|
| 424 |
msgid "(For use with Contact Us form)"
|
| 425 |
msgstr ""
|
| 426 |
|
| 427 |
-
#: includes/class-builder-fields.php:
|
| 428 |
msgid "Opt-in checkbox"
|
| 429 |
msgstr ""
|
| 430 |
|
| 431 |
-
#: includes/class-builder-fields.php:
|
| 432 |
msgid "Your Business Name"
|
| 433 |
msgstr ""
|
| 434 |
|
| 435 |
-
#: includes/class-builder-fields.php:
|
| 436 |
msgid "Opt-in Affirmation"
|
| 437 |
msgstr ""
|
| 438 |
|
| 439 |
-
#: includes/class-builder-fields.php:
|
| 440 |
#, php-format
|
| 441 |
msgid ""
|
| 442 |
"Example: Yes, I would like to receive emails from %s. (You can unsubscribe "
|
| 443 |
"anytime)"
|
| 444 |
msgstr ""
|
| 445 |
|
| 446 |
-
#: includes/class-builder-fields.php:
|
| 447 |
msgid "Form Fields"
|
| 448 |
msgstr ""
|
| 449 |
|
| 450 |
-
#: includes/class-builder-fields.php:
|
| 451 |
msgid "Add Fields"
|
| 452 |
msgstr ""
|
| 453 |
|
| 454 |
-
#: includes/class-builder-fields.php:
|
| 455 |
msgid ""
|
| 456 |
"Create a field for each piece of information you want to collect. Good "
|
| 457 |
"basics include email address, first name, and last name."
|
| 458 |
msgstr ""
|
| 459 |
|
| 460 |
-
#: includes/class-builder-fields.php:
|
| 461 |
msgid "Field {#}"
|
| 462 |
msgstr ""
|
| 463 |
|
| 464 |
-
#: includes/class-builder-fields.php:
|
| 465 |
msgid "Add Another Field"
|
| 466 |
msgstr ""
|
| 467 |
|
| 468 |
-
#: includes/class-builder-fields.php:
|
| 469 |
msgid "Remove Field"
|
| 470 |
msgstr ""
|
| 471 |
|
| 472 |
-
#: includes/class-builder-fields.php:
|
| 473 |
msgid "A brief description of this field (optional)"
|
| 474 |
msgstr ""
|
| 475 |
|
| 476 |
-
#: includes/class-builder-fields.php:
|
| 477 |
msgid "Email (required)"
|
| 478 |
msgstr ""
|
| 479 |
|
| 480 |
-
#: includes/class-builder-fields.php:
|
| 481 |
msgid "c.contact@example.com"
|
| 482 |
msgstr ""
|
| 483 |
|
| 484 |
-
#: includes/class-builder-fields.php:
|
| 485 |
msgid "First Name"
|
| 486 |
msgstr ""
|
| 487 |
|
| 488 |
-
#: includes/class-builder-fields.php:
|
| 489 |
msgid "John"
|
| 490 |
msgstr ""
|
| 491 |
|
| 492 |
-
#: includes/class-builder-fields.php:
|
| 493 |
msgid "Last Name"
|
| 494 |
msgstr ""
|
| 495 |
|
| 496 |
-
#: includes/class-builder-fields.php:
|
| 497 |
msgid "Smith"
|
| 498 |
msgstr ""
|
| 499 |
|
| 500 |
-
#: includes/class-builder-fields.php:
|
| 501 |
msgid "Phone Number"
|
| 502 |
msgstr ""
|
| 503 |
|
| 504 |
-
#: includes/class-builder-fields.php:
|
| 505 |
msgid "(555) 272-3342"
|
| 506 |
msgstr ""
|
| 507 |
|
| 508 |
-
#: includes/class-builder-fields.php:
|
| 509 |
msgid "Address"
|
| 510 |
msgstr ""
|
| 511 |
|
| 512 |
-
#: includes/class-builder-fields.php:
|
| 513 |
msgid "4115 S. Main Rd."
|
| 514 |
msgstr ""
|
| 515 |
|
| 516 |
-
#: includes/class-builder-fields.php:
|
| 517 |
msgid "Job Title"
|
| 518 |
msgstr ""
|
| 519 |
|
| 520 |
-
#: includes/class-builder-fields.php:
|
| 521 |
msgid "Project Manager"
|
| 522 |
msgstr ""
|
| 523 |
|
| 524 |
-
#: includes/class-builder-fields.php:
|
| 525 |
msgid "Company"
|
| 526 |
msgstr ""
|
| 527 |
|
| 528 |
-
#: includes/class-builder-fields.php:
|
| 529 |
msgid "Acme Manufacturing"
|
| 530 |
msgstr ""
|
| 531 |
|
| 532 |
-
#: includes/class-builder-fields.php:
|
| 533 |
msgid "Website"
|
| 534 |
msgstr ""
|
| 535 |
|
| 536 |
-
#: includes/class-builder-fields.php:
|
| 537 |
msgid "http://www.example.com"
|
| 538 |
msgstr ""
|
| 539 |
|
| 540 |
-
#: includes/class-builder-fields.php:
|
| 541 |
msgid "Custom Text Field"
|
| 542 |
msgstr ""
|
| 543 |
|
| 544 |
-
#: includes/class-builder-fields.php:
|
| 545 |
msgid "A custom text field"
|
| 546 |
msgstr ""
|
| 547 |
|
| 548 |
-
#: includes/class-builder-fields.php:
|
| 549 |
msgid "Custom Text Area"
|
| 550 |
msgstr ""
|
| 551 |
|
| 552 |
-
#: includes/class-builder-fields.php:
|
| 553 |
msgid "A large custom text field"
|
| 554 |
msgstr ""
|
| 555 |
|
| 556 |
-
#: includes/class-builder-fields.php:
|
| 557 |
msgid "Select a Field"
|
| 558 |
msgstr ""
|
| 559 |
|
| 560 |
-
#: includes/class-builder-fields.php:
|
| 561 |
msgid "Field Label"
|
| 562 |
msgstr ""
|
| 563 |
|
| 564 |
-
#: includes/class-builder-fields.php:
|
| 565 |
msgid "Email"
|
| 566 |
msgstr ""
|
| 567 |
|
| 568 |
-
#: includes/class-builder-fields.php:
|
| 569 |
msgid "Field Description"
|
| 570 |
msgstr ""
|
| 571 |
|
| 572 |
-
#: includes/class-builder-fields.php:
|
| 573 |
msgid "Ex: Enter email address"
|
| 574 |
msgstr ""
|
| 575 |
|
| 576 |
-
#: includes/class-builder-fields.php:
|
| 577 |
msgid "Required"
|
| 578 |
msgstr ""
|
| 579 |
|
| 580 |
-
#: includes/class-builder-fields.php:
|
| 581 |
msgid "Shortcode to use"
|
| 582 |
msgstr ""
|
| 583 |
|
| 584 |
-
#: includes/class-builder-fields.php:
|
| 585 |
msgid ""
|
| 586 |
"Shortcode to embed - <em><small>You can copy and paste this in a post to "
|
| 587 |
"display your form.</small></em>"
|
| 588 |
msgstr ""
|
| 589 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 590 |
#: includes/class-builder.php:200
|
| 591 |
msgid "Please add an email field to continue."
|
| 592 |
msgstr ""
|
|
@@ -646,7 +748,7 @@ msgid ""
|
|
| 646 |
msgstr ""
|
| 647 |
|
| 648 |
#: includes/class-builder.php:360 includes/class-builder.php:361
|
| 649 |
-
#: includes/class-connect.php:
|
| 650 |
msgid "Connect Plugin"
|
| 651 |
msgstr ""
|
| 652 |
|
|
@@ -727,7 +829,7 @@ msgstr ""
|
|
| 727 |
msgid "Cron spawn ok"
|
| 728 |
msgstr ""
|
| 729 |
|
| 730 |
-
#: includes/class-connect.php:133 includes/class-connect.php:
|
| 731 |
msgid "Disconnect"
|
| 732 |
msgstr ""
|
| 733 |
|
|
@@ -735,34 +837,34 @@ msgstr ""
|
|
| 735 |
msgid "Connect Now"
|
| 736 |
msgstr ""
|
| 737 |
|
| 738 |
-
#: includes/class-connect.php:
|
| 739 |
msgid "Are you sure you want to disconnect?"
|
| 740 |
msgstr ""
|
| 741 |
|
| 742 |
-
#: includes/class-connect.php:
|
| 743 |
#: includes/class-notification-content.php:109
|
| 744 |
#: includes/class-notification-content.php:139 includes/class-optin.php:129
|
| 745 |
-
#: includes/class-settings.php:
|
| 746 |
msgid "Constant Contact logo"
|
| 747 |
msgstr ""
|
| 748 |
|
| 749 |
-
#: includes/class-connect.php:
|
| 750 |
msgid "Account connected."
|
| 751 |
msgstr ""
|
| 752 |
|
| 753 |
-
#: includes/class-connect.php:
|
| 754 |
msgid "Plugin connected to Constant Contact."
|
| 755 |
msgstr ""
|
| 756 |
|
| 757 |
-
#: includes/class-connect.php:
|
| 758 |
msgid "Your account is connected! Now, add a new form."
|
| 759 |
msgstr ""
|
| 760 |
|
| 761 |
-
#: includes/class-connect.php:
|
| 762 |
msgid "Please help to improve this plugin."
|
| 763 |
msgstr ""
|
| 764 |
|
| 765 |
-
#: includes/class-connect.php:
|
| 766 |
#, php-format
|
| 767 |
msgid ""
|
| 768 |
"Allow Constant Contact to use Google Analytics™ to track your usage "
|
|
@@ -770,52 +872,52 @@ msgid ""
|
|
| 770 |
"Settings page. See our %s."
|
| 771 |
msgstr ""
|
| 772 |
|
| 773 |
-
#: includes/class-connect.php:
|
| 774 |
msgid "Privacy Statement"
|
| 775 |
msgstr ""
|
| 776 |
|
| 777 |
-
#: includes/class-connect.php:
|
| 778 |
msgid "Allow"
|
| 779 |
msgstr ""
|
| 780 |
|
| 781 |
-
#: includes/class-connect.php:
|
| 782 |
msgid "Dismiss"
|
| 783 |
msgstr ""
|
| 784 |
|
| 785 |
-
#: includes/class-connect.php:
|
| 786 |
msgid "There was an error connecting your account. Please try again."
|
| 787 |
msgstr ""
|
| 788 |
|
| 789 |
-
#: includes/class-connect.php:
|
| 790 |
msgid ""
|
| 791 |
"Get the most out of this plugin — use it with an active Constant "
|
| 792 |
"Contact account. By connecting to an account, you'll be able to engage "
|
| 793 |
"visitors through email marketing and turn more of them into customers."
|
| 794 |
msgstr ""
|
| 795 |
|
| 796 |
-
#: includes/class-connect.php:
|
| 797 |
msgid "Connect your Constant Contact account."
|
| 798 |
msgstr ""
|
| 799 |
|
| 800 |
-
#: includes/class-connect.php:
|
| 801 |
msgid "By connecting, you authorize this plugin to access your account."
|
| 802 |
msgstr ""
|
| 803 |
|
| 804 |
-
#: includes/class-connect.php:
|
| 805 |
msgid "No Constant Contact account? Try us out."
|
| 806 |
msgstr ""
|
| 807 |
|
| 808 |
-
#: includes/class-connect.php:
|
| 809 |
msgid ""
|
| 810 |
"Create professional emails so you can nurture great relationships with new "
|
| 811 |
"contacts even after they leave your website. Sign up for a free 60-day trial."
|
| 812 |
msgstr ""
|
| 813 |
|
| 814 |
-
#: includes/class-connect.php:
|
| 815 |
msgid "NOTE: "
|
| 816 |
msgstr ""
|
| 817 |
|
| 818 |
-
#: includes/class-connect.php:
|
| 819 |
msgid ""
|
| 820 |
"It's possible to use the plugin without connecting to a Constant Contact "
|
| 821 |
"account. In this case, all information collected by the forms will be "
|
|
@@ -856,7 +958,7 @@ msgstr ""
|
|
| 856 |
msgid "New Form"
|
| 857 |
msgstr ""
|
| 858 |
|
| 859 |
-
#: includes/class-cpts.php:70 includes/class-display.php:
|
| 860 |
msgid "Edit Form"
|
| 861 |
msgstr ""
|
| 862 |
|
|
@@ -1087,103 +1189,103 @@ msgstr ""
|
|
| 1087 |
msgid "%1$s (last modified %2$s ago)"
|
| 1088 |
msgstr ""
|
| 1089 |
|
| 1090 |
-
#: includes/class-display.php:
|
| 1091 |
msgid "Constant Contact Use."
|
| 1092 |
msgstr ""
|
| 1093 |
|
| 1094 |
-
#: includes/class-display.php:
|
| 1095 |
msgid "Error: Please correct your entry."
|
| 1096 |
msgstr ""
|
| 1097 |
|
| 1098 |
-
#: includes/class-display.php:
|
| 1099 |
msgid " Error: Please fill out this field."
|
| 1100 |
msgstr ""
|
| 1101 |
|
| 1102 |
-
#: includes/class-display.php:
|
| 1103 |
msgid "Send"
|
| 1104 |
msgstr ""
|
| 1105 |
|
| 1106 |
-
#: includes/class-display.php:
|
| 1107 |
msgid "Street Address"
|
| 1108 |
msgstr ""
|
| 1109 |
|
| 1110 |
-
#: includes/class-display.php:
|
| 1111 |
msgid "Address Line 2"
|
| 1112 |
msgstr ""
|
| 1113 |
|
| 1114 |
-
#: includes/class-display.php:
|
| 1115 |
msgid "City"
|
| 1116 |
msgstr ""
|
| 1117 |
|
| 1118 |
-
#: includes/class-display.php:
|
| 1119 |
msgid "State"
|
| 1120 |
msgstr ""
|
| 1121 |
|
| 1122 |
-
#: includes/class-display.php:
|
| 1123 |
msgid "ZIP Code"
|
| 1124 |
msgstr ""
|
| 1125 |
|
| 1126 |
-
#: includes/class-display.php:
|
| 1127 |
msgid "Month"
|
| 1128 |
msgstr ""
|
| 1129 |
|
| 1130 |
-
#: includes/class-display.php:
|
| 1131 |
msgid "Day"
|
| 1132 |
msgstr ""
|
| 1133 |
|
| 1134 |
-
#: includes/class-display.php:
|
| 1135 |
msgid "Year"
|
| 1136 |
msgstr ""
|
| 1137 |
|
| 1138 |
-
#: includes/class-display.php:
|
| 1139 |
msgid "January"
|
| 1140 |
msgstr ""
|
| 1141 |
|
| 1142 |
-
#: includes/class-display.php:
|
| 1143 |
msgid "February"
|
| 1144 |
msgstr ""
|
| 1145 |
|
| 1146 |
-
#: includes/class-display.php:
|
| 1147 |
msgid "March"
|
| 1148 |
msgstr ""
|
| 1149 |
|
| 1150 |
-
#: includes/class-display.php:
|
| 1151 |
msgid "April"
|
| 1152 |
msgstr ""
|
| 1153 |
|
| 1154 |
-
#: includes/class-display.php:
|
| 1155 |
msgid "May"
|
| 1156 |
msgstr ""
|
| 1157 |
|
| 1158 |
-
#: includes/class-display.php:
|
| 1159 |
msgid "June"
|
| 1160 |
msgstr ""
|
| 1161 |
|
| 1162 |
-
#: includes/class-display.php:
|
| 1163 |
msgid "July "
|
| 1164 |
msgstr ""
|
| 1165 |
|
| 1166 |
-
#: includes/class-display.php:
|
| 1167 |
msgid "August"
|
| 1168 |
msgstr ""
|
| 1169 |
|
| 1170 |
-
#: includes/class-display.php:
|
| 1171 |
msgid "September"
|
| 1172 |
msgstr ""
|
| 1173 |
|
| 1174 |
-
#: includes/class-display.php:
|
| 1175 |
msgid "October"
|
| 1176 |
msgstr ""
|
| 1177 |
|
| 1178 |
-
#: includes/class-display.php:
|
| 1179 |
msgid "November"
|
| 1180 |
msgstr ""
|
| 1181 |
|
| 1182 |
-
#: includes/class-display.php:
|
| 1183 |
msgid "December"
|
| 1184 |
msgstr ""
|
| 1185 |
|
| 1186 |
-
#: includes/class-display.php:
|
| 1187 |
#, php-format
|
| 1188 |
msgid ""
|
| 1189 |
"By submitting this form, you are consenting to receive marketing emails "
|
|
@@ -1191,23 +1293,23 @@ msgid ""
|
|
| 1191 |
"the SafeUnsubscribe® link, found at the bottom of every email. %s"
|
| 1192 |
msgstr ""
|
| 1193 |
|
| 1194 |
-
#: includes/class-display.php:
|
| 1195 |
msgid "Emails are serviced by Constant Contact"
|
| 1196 |
msgstr ""
|
| 1197 |
|
| 1198 |
-
#: includes/class-lists.php:
|
| 1199 |
msgid "List Information"
|
| 1200 |
msgstr ""
|
| 1201 |
|
| 1202 |
-
#: includes/class-lists.php:
|
| 1203 |
msgid "List information will populate upon saving."
|
| 1204 |
msgstr ""
|
| 1205 |
|
| 1206 |
-
#: includes/class-lists.php:
|
| 1207 |
msgid "You already have a list with that name."
|
| 1208 |
msgstr ""
|
| 1209 |
|
| 1210 |
-
#: includes/class-lists.php:
|
| 1211 |
msgid "Sync Lists with Constant Contact"
|
| 1212 |
msgstr ""
|
| 1213 |
|
|
@@ -1255,24 +1357,24 @@ msgstr ""
|
|
| 1255 |
msgid "Delete logs"
|
| 1256 |
msgstr ""
|
| 1257 |
|
| 1258 |
-
#: includes/class-mail.php:
|
| 1259 |
#, php-format
|
| 1260 |
msgid "Duplicate send mail for: %1$s and: %2$s"
|
| 1261 |
msgstr ""
|
| 1262 |
|
| 1263 |
-
#: includes/class-mail.php:
|
| 1264 |
msgid "Your Constant Contact Forms plugin has captured new information."
|
| 1265 |
msgstr ""
|
| 1266 |
|
| 1267 |
-
#: includes/class-mail.php:
|
| 1268 |
msgid "Form title: "
|
| 1269 |
msgstr ""
|
| 1270 |
|
| 1271 |
-
#: includes/class-mail.php:
|
| 1272 |
msgid "Form information: "
|
| 1273 |
msgstr ""
|
| 1274 |
|
| 1275 |
-
#: includes/class-mail.php:
|
| 1276 |
#, php-format
|
| 1277 |
msgid ""
|
| 1278 |
"Email marketing is a great way to stay connected and engage with visitors "
|
|
@@ -1280,30 +1382,30 @@ msgid ""
|
|
| 1280 |
"pn=miwordpress%s to sign up for a Free Trial."
|
| 1281 |
msgstr ""
|
| 1282 |
|
| 1283 |
-
#: includes/class-mail.php:
|
| 1284 |
msgid "Constant Contact Forms Notification"
|
| 1285 |
msgstr ""
|
| 1286 |
|
| 1287 |
-
#: includes/class-mail.php:
|
| 1288 |
#, php-format
|
| 1289 |
msgid ""
|
| 1290 |
"%sNote:%s You have disabled admin email notifications under the plugin "
|
| 1291 |
"settings, but are receiving this email because of the following reason."
|
| 1292 |
msgstr ""
|
| 1293 |
|
| 1294 |
-
#: includes/class-mail.php:
|
| 1295 |
msgid "Submitted to Constant Contact:"
|
| 1296 |
msgstr ""
|
| 1297 |
|
| 1298 |
-
#: includes/class-mail.php:
|
| 1299 |
msgid "NO (Constant Contact list not selected for this form)"
|
| 1300 |
msgstr ""
|
| 1301 |
|
| 1302 |
-
#: includes/class-mail.php:
|
| 1303 |
msgid "NO (User did not select the Email Opt-in checkbox)"
|
| 1304 |
msgstr ""
|
| 1305 |
|
| 1306 |
-
#: includes/class-mail.php:
|
| 1307 |
msgid ""
|
| 1308 |
"You can disable this under Form options. Email Opt-in isn't required to add "
|
| 1309 |
"subscribers into your account"
|
|
@@ -1362,55 +1464,55 @@ msgid ""
|
|
| 1362 |
"implement via <a href=\"%s\">Settings</a>"
|
| 1363 |
msgstr ""
|
| 1364 |
|
| 1365 |
-
#: includes/class-notifications.php:
|
| 1366 |
msgid "Dismiss this notice."
|
| 1367 |
msgstr ""
|
| 1368 |
|
| 1369 |
-
#: includes/class-optin.php:137 includes/class-settings.php:
|
| 1370 |
msgid "Agree"
|
| 1371 |
msgstr ""
|
| 1372 |
|
| 1373 |
-
#: includes/class-optin.php:138 includes/class-settings.php:
|
| 1374 |
msgid "Disagree"
|
| 1375 |
msgstr ""
|
| 1376 |
|
| 1377 |
-
#: includes/class-process-form.php:107 includes/class-process-form.php:
|
| 1378 |
msgid "There was an error sending your form."
|
| 1379 |
msgstr ""
|
| 1380 |
|
| 1381 |
-
#: includes/class-process-form.php:
|
| 1382 |
msgid "Your information has been submitted."
|
| 1383 |
msgstr ""
|
| 1384 |
|
| 1385 |
-
#: includes/class-process-form.php:
|
| 1386 |
-
#: includes/class-process-form.php:
|
| 1387 |
msgid ""
|
| 1388 |
"We had trouble processing your submission. Please review your entries and "
|
| 1389 |
"try again."
|
| 1390 |
msgstr ""
|
| 1391 |
|
| 1392 |
-
#: includes/class-process-form.php:
|
| 1393 |
msgid "No Constant Contact Forms form ID provided"
|
| 1394 |
msgstr ""
|
| 1395 |
|
| 1396 |
-
#: includes/class-process-form.php:
|
| 1397 |
msgid "No form verify value provided"
|
| 1398 |
msgstr ""
|
| 1399 |
|
| 1400 |
-
#: includes/class-process-form.php:
|
| 1401 |
msgid "We do no think you are human"
|
| 1402 |
msgstr ""
|
| 1403 |
|
| 1404 |
-
#: includes/class-process-form.php:
|
| 1405 |
msgid "Please properly fill out all required fields"
|
| 1406 |
msgstr ""
|
| 1407 |
|
| 1408 |
-
#: includes/class-process-form.php:
|
| 1409 |
msgid "Failed reCAPTCHA check"
|
| 1410 |
msgstr ""
|
| 1411 |
|
| 1412 |
-
#: includes/class-process-form.php:
|
| 1413 |
-
#: includes/class-process-form.php:
|
| 1414 |
msgid ""
|
| 1415 |
"We had trouble processing your submission. Make sure you haven't changed the "
|
| 1416 |
"required Form ID and try again."
|
|
@@ -1507,32 +1609,48 @@ msgid "Secret Key"
|
|
| 1507 |
msgstr ""
|
| 1508 |
|
| 1509 |
#: includes/class-settings.php:369
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1510 |
msgid "Support"
|
| 1511 |
msgstr ""
|
| 1512 |
|
| 1513 |
-
#: includes/class-settings.php:
|
| 1514 |
msgid "Enable logging for debugging purposes."
|
| 1515 |
msgstr ""
|
| 1516 |
|
| 1517 |
-
#: includes/class-settings.php:
|
| 1518 |
msgid ""
|
| 1519 |
"This option will turn on some logging functionality that can be used to "
|
| 1520 |
"deduce sources of issues with the use of Constant Contact Forms plugin."
|
| 1521 |
msgstr ""
|
| 1522 |
|
| 1523 |
-
#: includes/class-settings.php:
|
| 1524 |
msgid "Add a checkbox to the comment field in your posts"
|
| 1525 |
msgstr ""
|
| 1526 |
|
| 1527 |
-
#: includes/class-settings.php:
|
| 1528 |
msgid "Add a checkbox to the main WordPress login page"
|
| 1529 |
msgstr ""
|
| 1530 |
|
| 1531 |
-
#: includes/class-settings.php:
|
| 1532 |
msgid "Add a checkbox to the WordPress user registration page"
|
| 1533 |
msgstr ""
|
| 1534 |
|
| 1535 |
-
#: includes/class-settings.php:
|
| 1536 |
msgid "Sign up to our newsletter."
|
| 1537 |
msgstr ""
|
| 1538 |
|
| 3 |
msgstr ""
|
| 4 |
"Plural-Forms: nplurals=INTEGER; plural=EXPRESSION;\n"
|
| 5 |
"Project-Id-Version: Constant Contact Forms for WordPress\n"
|
| 6 |
+
"POT-Creation-Date: 2018-07-27 11:19-0500\n"
|
| 7 |
"PO-Revision-Date: 2017-01-12 14:46-0600\n"
|
| 8 |
"Last-Translator: Michael Beckwith <michael.d.beckwith@gmail.com>\n"
|
| 9 |
"Language-Team: Constant Contact\n"
|
| 29 |
msgid "Constant Contact"
|
| 30 |
msgstr ""
|
| 31 |
|
| 32 |
+
#: constant-contact-forms.php:393
|
| 33 |
msgid ""
|
| 34 |
"Constant Contact Forms requires PHP 5.4 or higher. Your hosting provider or "
|
| 35 |
"website administrator should be able to assist in updating your PHP version."
|
| 36 |
msgstr ""
|
| 37 |
|
| 38 |
+
#: constant-contact-forms.php:725
|
| 39 |
msgid "Error loading license."
|
| 40 |
msgstr ""
|
| 41 |
|
| 42 |
+
#: includes/class-admin-pages.php:74
|
| 43 |
msgid "This is a sample help header"
|
| 44 |
msgstr ""
|
| 45 |
|
| 46 |
+
#: includes/class-admin-pages.php:75
|
| 47 |
msgid "This is some sample help text."
|
| 48 |
msgstr ""
|
| 49 |
|
| 50 |
+
#: includes/class-admin-pages.php:78
|
| 51 |
msgid "This is another sample header"
|
| 52 |
msgstr ""
|
| 53 |
|
| 54 |
+
#: includes/class-admin-pages.php:79
|
| 55 |
msgid "This is also some sample help text."
|
| 56 |
msgstr ""
|
| 57 |
|
| 58 |
+
#: includes/class-admin-pages.php:102
|
| 59 |
msgid "Is this a sample question?"
|
| 60 |
msgstr ""
|
| 61 |
|
| 62 |
+
#: includes/class-admin-pages.php:103
|
| 63 |
msgid "This is a sample answer"
|
| 64 |
msgstr ""
|
| 65 |
|
| 66 |
+
#: includes/class-admin-pages.php:106
|
| 67 |
msgid "This is also a sample question"
|
| 68 |
msgstr ""
|
| 69 |
|
| 70 |
+
#: includes/class-admin-pages.php:107
|
| 71 |
msgid "This is another sample answer"
|
| 72 |
msgstr ""
|
| 73 |
|
| 74 |
+
#: includes/class-admin-pages.php:120
|
| 75 |
msgid "Help / FAQ"
|
| 76 |
msgstr ""
|
| 77 |
|
| 78 |
+
#: includes/class-admin-pages.php:127
|
| 79 |
msgid "Help"
|
| 80 |
msgstr ""
|
| 81 |
|
| 82 |
+
#: includes/class-admin-pages.php:161
|
| 83 |
msgid "FAQ"
|
| 84 |
msgstr ""
|
| 85 |
|
| 86 |
+
#: includes/class-admin-pages.php:225
|
| 87 |
#: includes/class-notification-content.php:53
|
| 88 |
msgid "Constant Contact Forms"
|
| 89 |
msgstr ""
|
| 90 |
|
| 91 |
+
#: includes/class-admin-pages.php:227
|
| 92 |
msgid ""
|
| 93 |
"This plugin makes it fast and easy to capture all kinds of visitor "
|
| 94 |
"information right from your WordPress site—even if you don't have a Constant "
|
| 95 |
"Contact account."
|
| 96 |
msgstr ""
|
| 97 |
|
| 98 |
+
#: includes/class-admin-pages.php:230
|
| 99 |
msgid ""
|
| 100 |
"Whether you're looking to collect email addresses, contact info, or visitor "
|
| 101 |
"feedback, you can customize your forms with data fields that work best for "
|
| 102 |
"you."
|
| 103 |
msgstr ""
|
| 104 |
|
| 105 |
+
#: includes/class-admin-pages.php:233
|
| 106 |
msgid ""
|
| 107 |
"Quickly create different types of forms that are clear, simple, and mobile-"
|
| 108 |
"optimized."
|
| 109 |
msgstr ""
|
| 110 |
|
| 111 |
+
#: includes/class-admin-pages.php:234
|
| 112 |
msgid ""
|
| 113 |
"Choose forms that automatically select the theme and style of your WordPress "
|
| 114 |
"site."
|
| 115 |
msgstr ""
|
| 116 |
|
| 117 |
+
#: includes/class-admin-pages.php:235
|
| 118 |
msgid ""
|
| 119 |
"Customize the form data fields, so you can tailor the type of information "
|
| 120 |
"you collect."
|
| 121 |
msgstr ""
|
| 122 |
|
| 123 |
+
#: includes/class-admin-pages.php:242
|
| 124 |
msgid "Collecting email addresses with the plugin?"
|
| 125 |
msgstr ""
|
| 126 |
|
| 127 |
+
#: includes/class-admin-pages.php:243
|
| 128 |
msgid "Turn those contacts into customers."
|
| 129 |
msgstr ""
|
| 130 |
|
| 131 |
+
#: includes/class-admin-pages.php:246
|
| 132 |
msgid ""
|
| 133 |
"Nurture your new contacts with a Constant Contact email marketing account "
|
| 134 |
"even after they've left your website. Sign up for a 60-day trial account* "
|
| 135 |
"and you can:"
|
| 136 |
msgstr ""
|
| 137 |
|
| 138 |
+
#: includes/class-admin-pages.php:249
|
| 139 |
msgid "Seamlessly add new contacts to mailing lists."
|
| 140 |
msgstr ""
|
| 141 |
|
| 142 |
+
#: includes/class-admin-pages.php:250
|
| 143 |
msgid "Create and send professional emails."
|
| 144 |
msgstr ""
|
| 145 |
|
| 146 |
+
#: includes/class-admin-pages.php:251
|
| 147 |
msgid "Get expert marketing help and support."
|
| 148 |
msgstr ""
|
| 149 |
|
| 150 |
+
#: includes/class-admin-pages.php:256 includes/class-connect.php:254
|
| 151 |
msgid "Try us Free"
|
| 152 |
msgstr ""
|
| 153 |
|
| 154 |
+
#: includes/class-admin-pages.php:259
|
| 155 |
msgid "Already have a Constant Contact account?"
|
| 156 |
msgstr ""
|
| 157 |
|
| 158 |
+
#: includes/class-admin-pages.php:261
|
| 159 |
msgid "Connect the plugin."
|
| 160 |
msgstr ""
|
| 161 |
|
| 162 |
+
#: includes/class-admin-pages.php:265
|
| 163 |
msgid ""
|
| 164 |
"NOTE: You can use the Constant Contact Form plugin without a Constant "
|
| 165 |
"Contact account. All information collected by the forms will be individually "
|
| 166 |
"emailed to your site admin."
|
| 167 |
msgstr ""
|
| 168 |
|
| 169 |
+
#: includes/class-admin-pages.php:272 includes/class-connect.php:272
|
| 170 |
msgid "Sign Up"
|
| 171 |
msgstr ""
|
| 172 |
|
| 173 |
+
#: includes/class-admin-pages.php:273 includes/class-connect.php:260
|
| 174 |
msgid "Email marketing tips delivered to your inbox."
|
| 175 |
msgstr ""
|
| 176 |
|
| 177 |
+
#: includes/class-admin-pages.php:274 includes/class-connect.php:261
|
| 178 |
msgid ""
|
| 179 |
"Ready to grow with email marketing? Subscribe now for the latest tips and "
|
| 180 |
"industry best practices to create great-looking emails that work."
|
| 181 |
msgstr ""
|
| 182 |
|
| 183 |
+
#: includes/class-admin-pages.php:275 includes/class-connect.php:262
|
| 184 |
msgid "Enter your email address"
|
| 185 |
msgstr ""
|
| 186 |
|
| 187 |
+
#: includes/class-admin-pages.php:282 includes/class-connect.php:269
|
| 188 |
#, php-format
|
| 189 |
msgid ""
|
| 190 |
"By submitting this form, you agree to receive periodic product announcements "
|
| 193 |
"email. Constant Contact, Inc, 1601 Trapelo Road, Waltham, MA 02451, %s"
|
| 194 |
msgstr ""
|
| 195 |
|
| 196 |
+
#: includes/class-admin-pages.php:292
|
| 197 |
msgid "Powerful Email Marketing, Made Simple."
|
| 198 |
msgstr ""
|
| 199 |
|
| 200 |
+
#: includes/class-admin-pages.php:295
|
| 201 |
msgid "Create professional emails that bring customers to your door"
|
| 202 |
msgstr ""
|
| 203 |
|
| 204 |
+
#: includes/class-admin-pages.php:299
|
| 205 |
msgid ""
|
| 206 |
"Email marketing is good for your business. $44-back-for-every-$1-spent kind "
|
| 207 |
"of good.* And with the Constant Contact for WordPress plugin, you can "
|
| 209 |
"visitors long after they've left."
|
| 210 |
msgstr ""
|
| 211 |
|
| 212 |
+
#: includes/class-admin-pages.php:303
|
| 213 |
msgid "GPLv3 license"
|
| 214 |
msgstr ""
|
| 215 |
|
| 216 |
+
#: includes/class-admin-pages.php:307
|
| 217 |
#, php-format
|
| 218 |
msgid "This software is released under a modified %s."
|
| 219 |
msgstr ""
|
| 220 |
|
| 221 |
+
#: includes/class-admin-pages.php:313
|
| 222 |
msgid "*Direct Marketing Association 2013 Statistical Fact Book"
|
| 223 |
msgstr ""
|
| 224 |
|
| 225 |
+
#: includes/class-admin-pages.php:321
|
| 226 |
msgid "Easily Add Forms"
|
| 227 |
msgstr ""
|
| 228 |
|
| 229 |
+
#: includes/class-admin-pages.php:324
|
| 230 |
msgctxt "add forms alt text"
|
| 231 |
msgid "add forms screenshot"
|
| 232 |
msgstr ""
|
| 233 |
|
| 234 |
+
#: includes/class-admin-pages.php:327
|
| 235 |
msgid ""
|
| 236 |
"Create forms that automatically select the theme and styling of your "
|
| 237 |
"WordPress site for a perfect match. "
|
| 238 |
msgstr ""
|
| 239 |
|
| 240 |
+
#: includes/class-admin-pages.php:333
|
| 241 |
msgid "Stay Connected With Your WordPress Visitors"
|
| 242 |
msgstr ""
|
| 243 |
|
| 244 |
+
#: includes/class-admin-pages.php:336
|
| 245 |
msgctxt "stay connected alt text"
|
| 246 |
msgid "stay connected screenshot"
|
| 247 |
msgstr ""
|
| 248 |
|
| 249 |
+
#: includes/class-admin-pages.php:339
|
| 250 |
msgid ""
|
| 251 |
"Form completions from site visitors are conveniently added to your Constant "
|
| 252 |
"Contact email list."
|
| 253 |
msgstr ""
|
| 254 |
|
| 255 |
+
#: includes/class-admin-pages.php:359
|
| 256 |
msgid "Constant Contact Forms - License"
|
| 257 |
msgstr ""
|
| 258 |
|
| 259 |
#: includes/class-admin.php:116 includes/class-admin.php:117
|
| 260 |
+
#: includes/class-admin.php:366
|
| 261 |
msgid "About"
|
| 262 |
msgstr ""
|
| 263 |
|
| 264 |
#: includes/class-admin.php:125 includes/class-admin.php:126
|
| 265 |
+
#: includes/class-admin.php:367
|
| 266 |
msgid "License"
|
| 267 |
msgstr ""
|
| 268 |
|
| 269 |
+
#: includes/class-admin.php:210 includes/class-settings.php:731
|
| 270 |
msgid "Settings updated."
|
| 271 |
msgstr ""
|
| 272 |
|
| 274 |
msgid "Description"
|
| 275 |
msgstr ""
|
| 276 |
|
| 277 |
+
#: includes/class-admin.php:249 includes/class-builder-fields.php:667
|
| 278 |
msgid "Shortcode"
|
| 279 |
msgstr ""
|
| 280 |
|
| 283 |
msgstr ""
|
| 284 |
|
| 285 |
#: includes/class-admin.php:293
|
| 286 |
+
msgid "No associated list"
|
| 287 |
msgstr ""
|
| 288 |
|
| 289 |
#: includes/class-admin.php:309
|
| 294 |
msgid "None available"
|
| 295 |
msgstr ""
|
| 296 |
|
| 297 |
+
#: includes/class-admin.php:363
|
| 298 |
msgid "Check out the official WordPress plugin from @constantcontact :"
|
| 299 |
msgstr ""
|
| 300 |
|
| 301 |
+
#: includes/class-admin.php:379
|
| 302 |
msgid "Spread the word!"
|
| 303 |
msgstr ""
|
| 304 |
|
| 305 |
+
#: includes/class-admin.php:455
|
| 306 |
msgid "You have unsaved changes."
|
| 307 |
msgstr ""
|
| 308 |
|
| 309 |
+
#: includes/class-admin.php:456
|
| 310 |
msgid "move up"
|
| 311 |
msgstr ""
|
| 312 |
|
| 313 |
+
#: includes/class-admin.php:457
|
| 314 |
msgid "move down"
|
| 315 |
msgstr ""
|
| 316 |
|
| 328 |
"new token."
|
| 329 |
msgstr ""
|
| 330 |
|
| 331 |
+
#: includes/class-builder-fields.php:95
|
| 332 |
msgid "Constant Contact List"
|
| 333 |
msgstr ""
|
| 334 |
|
| 335 |
+
#: includes/class-builder-fields.php:110 includes/class-settings.php:301
|
| 336 |
msgid "Add subscribers to"
|
| 337 |
msgstr ""
|
| 338 |
|
| 339 |
+
#: includes/class-builder-fields.php:113
|
| 340 |
msgid "No List Selected"
|
| 341 |
msgstr ""
|
| 342 |
|
| 343 |
+
#: includes/class-builder-fields.php:133 includes/class-builder-fields.php:234
|
| 344 |
msgid "Form Description"
|
| 345 |
msgstr ""
|
| 346 |
|
| 347 |
+
#: includes/class-builder-fields.php:141
|
| 348 |
msgid ""
|
| 349 |
"This message will display above the form fields, so use it as an opportunity "
|
| 350 |
"to pitch your email list. Tell visitors why they should subscribe to your "
|
| 352 |
"coupons, and more."
|
| 353 |
msgstr ""
|
| 354 |
|
| 355 |
+
#: includes/class-builder-fields.php:161
|
| 356 |
msgid "Form Options"
|
| 357 |
msgstr ""
|
| 358 |
|
| 359 |
+
#: includes/class-builder-fields.php:169
|
| 360 |
msgid "Button text"
|
| 361 |
msgstr ""
|
| 362 |
|
| 363 |
+
#: includes/class-builder-fields.php:172
|
| 364 |
msgid "Sign up"
|
| 365 |
msgstr ""
|
| 366 |
|
| 367 |
+
#: includes/class-builder-fields.php:176
|
| 368 |
msgid "Success message"
|
| 369 |
msgstr ""
|
| 370 |
|
| 371 |
+
#: includes/class-builder-fields.php:179
|
| 372 |
msgid "Your information has been submitted"
|
| 373 |
msgstr ""
|
| 374 |
|
| 375 |
+
#: includes/class-builder-fields.php:183
|
| 376 |
msgid "Submission behavior"
|
| 377 |
msgstr ""
|
| 378 |
|
| 379 |
+
#: includes/class-builder-fields.php:190
|
| 380 |
msgid "Redirect URL"
|
| 381 |
msgstr ""
|
| 382 |
|
| 383 |
+
#: includes/class-builder-fields.php:193
|
| 384 |
msgid "Leave blank to keep users on the current page."
|
| 385 |
msgstr ""
|
| 386 |
|
| 387 |
+
#: includes/class-builder-fields.php:198
|
| 388 |
msgid "No page refresh"
|
| 389 |
msgstr ""
|
| 390 |
|
| 391 |
+
#: includes/class-builder-fields.php:201
|
| 392 |
msgid ""
|
| 393 |
"Enable form submission without a page refresh. This option overrides the "
|
| 394 |
"Redirect URL choice above."
|
| 395 |
msgstr ""
|
| 396 |
|
| 397 |
+
#: includes/class-builder-fields.php:217
|
| 398 |
+
msgid "Form Design"
|
| 399 |
+
msgstr ""
|
| 400 |
+
|
| 401 |
+
#: includes/class-builder-fields.php:224 includes/class-builder-fields.php:278
|
| 402 |
+
msgid "Background Color"
|
| 403 |
+
msgstr ""
|
| 404 |
+
|
| 405 |
+
#: includes/class-builder-fields.php:228
|
| 406 |
+
msgid "Applies to the whole form."
|
| 407 |
+
msgstr ""
|
| 408 |
+
|
| 409 |
+
#: includes/class-builder-fields.php:240 includes/class-builder-fields.php:260
|
| 410 |
+
msgid "Font Size"
|
| 411 |
+
msgstr ""
|
| 412 |
+
|
| 413 |
+
#: includes/class-builder-fields.php:248 includes/class-builder-fields.php:268
|
| 414 |
+
msgid "Font Color"
|
| 415 |
+
msgstr ""
|
| 416 |
+
|
| 417 |
+
#: includes/class-builder-fields.php:254
|
| 418 |
+
msgid "Form Submit Button"
|
| 419 |
+
msgstr ""
|
| 420 |
+
|
| 421 |
+
#: includes/class-builder-fields.php:272
|
| 422 |
+
msgid "Choose a color for the submit button text."
|
| 423 |
+
msgstr ""
|
| 424 |
+
|
| 425 |
+
#: includes/class-builder-fields.php:282
|
| 426 |
+
msgid "Choose a color for the submit button background."
|
| 427 |
+
msgstr ""
|
| 428 |
+
|
| 429 |
+
#: includes/class-builder-fields.php:296
|
| 430 |
+
msgid "Input Design"
|
| 431 |
+
msgstr ""
|
| 432 |
+
|
| 433 |
+
#: includes/class-builder-fields.php:303
|
| 434 |
+
msgid "Form Padding"
|
| 435 |
+
msgstr ""
|
| 436 |
+
|
| 437 |
+
#: includes/class-builder-fields.php:307
|
| 438 |
+
msgid ""
|
| 439 |
+
"Enter padding values in number of pixels. Padding will be applied to four "
|
| 440 |
+
"sides of the form."
|
| 441 |
+
msgstr ""
|
| 442 |
+
|
| 443 |
+
#: includes/class-builder-fields.php:312
|
| 444 |
+
msgid "Top"
|
| 445 |
+
msgstr ""
|
| 446 |
+
|
| 447 |
+
#: includes/class-builder-fields.php:322
|
| 448 |
+
msgid "Right"
|
| 449 |
+
msgstr ""
|
| 450 |
+
|
| 451 |
+
#: includes/class-builder-fields.php:332
|
| 452 |
+
msgid "Bottom"
|
| 453 |
+
msgstr ""
|
| 454 |
+
|
| 455 |
+
#: includes/class-builder-fields.php:342
|
| 456 |
+
msgid "Left"
|
| 457 |
+
msgstr ""
|
| 458 |
+
|
| 459 |
+
#: includes/class-builder-fields.php:352
|
| 460 |
+
msgid "Custom Classes"
|
| 461 |
+
msgstr ""
|
| 462 |
+
|
| 463 |
+
#: includes/class-builder-fields.php:356
|
| 464 |
+
msgid ""
|
| 465 |
+
"Set custom CSS class(es) for inputs. Separate multiple classes with spaces."
|
| 466 |
+
msgstr ""
|
| 467 |
+
|
| 468 |
+
#: includes/class-builder-fields.php:362 includes/class-settings.php:384
|
| 469 |
+
msgid "Label Placement"
|
| 470 |
+
msgstr ""
|
| 471 |
+
|
| 472 |
+
#: includes/class-builder-fields.php:373
|
| 473 |
+
msgid "Set the position for labels for inputs."
|
| 474 |
+
msgstr ""
|
| 475 |
+
|
| 476 |
+
#: includes/class-builder-fields.php:391
|
| 477 |
msgid ""
|
| 478 |
"Enabling this option will require users to check a box to be added to your "
|
| 479 |
"list."
|
| 480 |
msgstr ""
|
| 481 |
|
| 482 |
+
#: includes/class-builder-fields.php:397
|
| 483 |
msgid "Learn more"
|
| 484 |
msgstr ""
|
| 485 |
|
| 486 |
+
#: includes/class-builder-fields.php:402
|
| 487 |
msgid "Email opt-in"
|
| 488 |
msgstr ""
|
| 489 |
|
| 490 |
+
#: includes/class-builder-fields.php:425
|
| 491 |
msgid "Enable email subscriber opt-in"
|
| 492 |
msgstr ""
|
| 493 |
|
| 494 |
+
#: includes/class-builder-fields.php:427
|
| 495 |
msgid "Adds an opt-in to the bottom of your form."
|
| 496 |
msgstr ""
|
| 497 |
|
| 498 |
+
#: includes/class-builder-fields.php:447
|
| 499 |
msgid "Add a checkbox so subscribers can opt-in to your email list."
|
| 500 |
msgstr ""
|
| 501 |
|
| 502 |
+
#: includes/class-builder-fields.php:449
|
| 503 |
msgid "(For use with Contact Us form)"
|
| 504 |
msgstr ""
|
| 505 |
|
| 506 |
+
#: includes/class-builder-fields.php:452
|
| 507 |
msgid "Opt-in checkbox"
|
| 508 |
msgstr ""
|
| 509 |
|
| 510 |
+
#: includes/class-builder-fields.php:470
|
| 511 |
msgid "Your Business Name"
|
| 512 |
msgstr ""
|
| 513 |
|
| 514 |
+
#: includes/class-builder-fields.php:473 includes/class-settings.php:322
|
| 515 |
msgid "Opt-in Affirmation"
|
| 516 |
msgstr ""
|
| 517 |
|
| 518 |
+
#: includes/class-builder-fields.php:477
|
| 519 |
#, php-format
|
| 520 |
msgid ""
|
| 521 |
"Example: Yes, I would like to receive emails from %s. (You can unsubscribe "
|
| 522 |
"anytime)"
|
| 523 |
msgstr ""
|
| 524 |
|
| 525 |
+
#: includes/class-builder-fields.php:493
|
| 526 |
msgid "Form Fields"
|
| 527 |
msgstr ""
|
| 528 |
|
| 529 |
+
#: includes/class-builder-fields.php:502
|
| 530 |
msgid "Add Fields"
|
| 531 |
msgstr ""
|
| 532 |
|
| 533 |
+
#: includes/class-builder-fields.php:508
|
| 534 |
msgid ""
|
| 535 |
"Create a field for each piece of information you want to collect. Good "
|
| 536 |
"basics include email address, first name, and last name."
|
| 537 |
msgstr ""
|
| 538 |
|
| 539 |
+
#: includes/class-builder-fields.php:519
|
| 540 |
msgid "Field {#}"
|
| 541 |
msgstr ""
|
| 542 |
|
| 543 |
+
#: includes/class-builder-fields.php:520
|
| 544 |
msgid "Add Another Field"
|
| 545 |
msgstr ""
|
| 546 |
|
| 547 |
+
#: includes/class-builder-fields.php:521
|
| 548 |
msgid "Remove Field"
|
| 549 |
msgstr ""
|
| 550 |
|
| 551 |
+
#: includes/class-builder-fields.php:533
|
| 552 |
msgid "A brief description of this field (optional)"
|
| 553 |
msgstr ""
|
| 554 |
|
| 555 |
+
#: includes/class-builder-fields.php:538
|
| 556 |
msgid "Email (required)"
|
| 557 |
msgstr ""
|
| 558 |
|
| 559 |
+
#: includes/class-builder-fields.php:539
|
| 560 |
msgid "c.contact@example.com"
|
| 561 |
msgstr ""
|
| 562 |
|
| 563 |
+
#: includes/class-builder-fields.php:542
|
| 564 |
msgid "First Name"
|
| 565 |
msgstr ""
|
| 566 |
|
| 567 |
+
#: includes/class-builder-fields.php:543
|
| 568 |
msgid "John"
|
| 569 |
msgstr ""
|
| 570 |
|
| 571 |
+
#: includes/class-builder-fields.php:546
|
| 572 |
msgid "Last Name"
|
| 573 |
msgstr ""
|
| 574 |
|
| 575 |
+
#: includes/class-builder-fields.php:547
|
| 576 |
msgid "Smith"
|
| 577 |
msgstr ""
|
| 578 |
|
| 579 |
+
#: includes/class-builder-fields.php:550
|
| 580 |
msgid "Phone Number"
|
| 581 |
msgstr ""
|
| 582 |
|
| 583 |
+
#: includes/class-builder-fields.php:551
|
| 584 |
msgid "(555) 272-3342"
|
| 585 |
msgstr ""
|
| 586 |
|
| 587 |
+
#: includes/class-builder-fields.php:554
|
| 588 |
msgid "Address"
|
| 589 |
msgstr ""
|
| 590 |
|
| 591 |
+
#: includes/class-builder-fields.php:555
|
| 592 |
msgid "4115 S. Main Rd."
|
| 593 |
msgstr ""
|
| 594 |
|
| 595 |
+
#: includes/class-builder-fields.php:558
|
| 596 |
msgid "Job Title"
|
| 597 |
msgstr ""
|
| 598 |
|
| 599 |
+
#: includes/class-builder-fields.php:559
|
| 600 |
msgid "Project Manager"
|
| 601 |
msgstr ""
|
| 602 |
|
| 603 |
+
#: includes/class-builder-fields.php:562
|
| 604 |
msgid "Company"
|
| 605 |
msgstr ""
|
| 606 |
|
| 607 |
+
#: includes/class-builder-fields.php:563
|
| 608 |
msgid "Acme Manufacturing"
|
| 609 |
msgstr ""
|
| 610 |
|
| 611 |
+
#: includes/class-builder-fields.php:566
|
| 612 |
msgid "Website"
|
| 613 |
msgstr ""
|
| 614 |
|
| 615 |
+
#: includes/class-builder-fields.php:567
|
| 616 |
msgid "http://www.example.com"
|
| 617 |
msgstr ""
|
| 618 |
|
| 619 |
+
#: includes/class-builder-fields.php:582
|
| 620 |
msgid "Custom Text Field"
|
| 621 |
msgstr ""
|
| 622 |
|
| 623 |
+
#: includes/class-builder-fields.php:583
|
| 624 |
msgid "A custom text field"
|
| 625 |
msgstr ""
|
| 626 |
|
| 627 |
+
#: includes/class-builder-fields.php:586
|
| 628 |
msgid "Custom Text Area"
|
| 629 |
msgstr ""
|
| 630 |
|
| 631 |
+
#: includes/class-builder-fields.php:587
|
| 632 |
msgid "A large custom text field"
|
| 633 |
msgstr ""
|
| 634 |
|
| 635 |
+
#: includes/class-builder-fields.php:622
|
| 636 |
msgid "Select a Field"
|
| 637 |
msgstr ""
|
| 638 |
|
| 639 |
+
#: includes/class-builder-fields.php:633
|
| 640 |
msgid "Field Label"
|
| 641 |
msgstr ""
|
| 642 |
|
| 643 |
+
#: includes/class-builder-fields.php:636
|
| 644 |
msgid "Email"
|
| 645 |
msgstr ""
|
| 646 |
|
| 647 |
+
#: includes/class-builder-fields.php:641
|
| 648 |
msgid "Field Description"
|
| 649 |
msgstr ""
|
| 650 |
|
| 651 |
+
#: includes/class-builder-fields.php:645
|
| 652 |
msgid "Ex: Enter email address"
|
| 653 |
msgstr ""
|
| 654 |
|
| 655 |
+
#: includes/class-builder-fields.php:651
|
| 656 |
msgid "Required"
|
| 657 |
msgstr ""
|
| 658 |
|
| 659 |
+
#: includes/class-builder-fields.php:675
|
| 660 |
msgid "Shortcode to use"
|
| 661 |
msgstr ""
|
| 662 |
|
| 663 |
+
#: includes/class-builder-fields.php:678
|
| 664 |
msgid ""
|
| 665 |
"Shortcode to embed - <em><small>You can copy and paste this in a post to "
|
| 666 |
"display your form.</small></em>"
|
| 667 |
msgstr ""
|
| 668 |
|
| 669 |
+
#: includes/class-builder-fields.php:695
|
| 670 |
+
msgid "Email settings"
|
| 671 |
+
msgstr ""
|
| 672 |
+
|
| 673 |
+
#: includes/class-builder-fields.php:702
|
| 674 |
+
msgid "Email destination"
|
| 675 |
+
msgstr ""
|
| 676 |
+
|
| 677 |
+
#: includes/class-builder-fields.php:703
|
| 678 |
+
msgid ""
|
| 679 |
+
"Who should receive email notifications for this form. Separate multiple "
|
| 680 |
+
"emails by a comma. Leave blank to default to admin email."
|
| 681 |
+
msgstr ""
|
| 682 |
+
|
| 683 |
+
#: includes/class-builder-fields.php:709
|
| 684 |
+
msgid "Disable email notifications for this form?"
|
| 685 |
+
msgstr ""
|
| 686 |
+
|
| 687 |
+
#: includes/class-builder-fields.php:710
|
| 688 |
+
msgid ""
|
| 689 |
+
"Check this option to disable emails for this Constant Contact Forms form."
|
| 690 |
+
msgstr ""
|
| 691 |
+
|
| 692 |
#: includes/class-builder.php:200
|
| 693 |
msgid "Please add an email field to continue."
|
| 694 |
msgstr ""
|
| 748 |
msgstr ""
|
| 749 |
|
| 750 |
#: includes/class-builder.php:360 includes/class-builder.php:361
|
| 751 |
+
#: includes/class-connect.php:244
|
| 752 |
msgid "Connect Plugin"
|
| 753 |
msgstr ""
|
| 754 |
|
| 829 |
msgid "Cron spawn ok"
|
| 830 |
msgstr ""
|
| 831 |
|
| 832 |
+
#: includes/class-connect.php:133 includes/class-connect.php:187
|
| 833 |
msgid "Disconnect"
|
| 834 |
msgstr ""
|
| 835 |
|
| 837 |
msgid "Connect Now"
|
| 838 |
msgstr ""
|
| 839 |
|
| 840 |
+
#: includes/class-connect.php:167
|
| 841 |
msgid "Are you sure you want to disconnect?"
|
| 842 |
msgstr ""
|
| 843 |
|
| 844 |
+
#: includes/class-connect.php:172 includes/class-logging.php:130
|
| 845 |
#: includes/class-notification-content.php:109
|
| 846 |
#: includes/class-notification-content.php:139 includes/class-optin.php:129
|
| 847 |
+
#: includes/class-settings.php:815
|
| 848 |
msgid "Constant Contact logo"
|
| 849 |
msgstr ""
|
| 850 |
|
| 851 |
+
#: includes/class-connect.php:179
|
| 852 |
msgid "Account connected."
|
| 853 |
msgstr ""
|
| 854 |
|
| 855 |
+
#: includes/class-connect.php:181
|
| 856 |
msgid "Plugin connected to Constant Contact."
|
| 857 |
msgstr ""
|
| 858 |
|
| 859 |
+
#: includes/class-connect.php:193
|
| 860 |
msgid "Your account is connected! Now, add a new form."
|
| 861 |
msgstr ""
|
| 862 |
|
| 863 |
+
#: includes/class-connect.php:201
|
| 864 |
msgid "Please help to improve this plugin."
|
| 865 |
msgstr ""
|
| 866 |
|
| 867 |
+
#: includes/class-connect.php:204
|
| 868 |
#, php-format
|
| 869 |
msgid ""
|
| 870 |
"Allow Constant Contact to use Google Analytics™ to track your usage "
|
| 872 |
"Settings page. See our %s."
|
| 873 |
msgstr ""
|
| 874 |
|
| 875 |
+
#: includes/class-connect.php:204
|
| 876 |
msgid "Privacy Statement"
|
| 877 |
msgstr ""
|
| 878 |
|
| 879 |
+
#: includes/class-connect.php:206
|
| 880 |
msgid "Allow"
|
| 881 |
msgstr ""
|
| 882 |
|
| 883 |
+
#: includes/class-connect.php:207 includes/class-notification-content.php:148
|
| 884 |
msgid "Dismiss"
|
| 885 |
msgstr ""
|
| 886 |
|
| 887 |
+
#: includes/class-connect.php:219
|
| 888 |
msgid "There was an error connecting your account. Please try again."
|
| 889 |
msgstr ""
|
| 890 |
|
| 891 |
+
#: includes/class-connect.php:225
|
| 892 |
msgid ""
|
| 893 |
"Get the most out of this plugin — use it with an active Constant "
|
| 894 |
"Contact account. By connecting to an account, you'll be able to engage "
|
| 895 |
"visitors through email marketing and turn more of them into customers."
|
| 896 |
msgstr ""
|
| 897 |
|
| 898 |
+
#: includes/class-connect.php:230
|
| 899 |
msgid "Connect your Constant Contact account."
|
| 900 |
msgstr ""
|
| 901 |
|
| 902 |
+
#: includes/class-connect.php:231
|
| 903 |
msgid "By connecting, you authorize this plugin to access your account."
|
| 904 |
msgstr ""
|
| 905 |
|
| 906 |
+
#: includes/class-connect.php:251
|
| 907 |
msgid "No Constant Contact account? Try us out."
|
| 908 |
msgstr ""
|
| 909 |
|
| 910 |
+
#: includes/class-connect.php:252
|
| 911 |
msgid ""
|
| 912 |
"Create professional emails so you can nurture great relationships with new "
|
| 913 |
"contacts even after they leave your website. Sign up for a free 60-day trial."
|
| 914 |
msgstr ""
|
| 915 |
|
| 916 |
+
#: includes/class-connect.php:277
|
| 917 |
msgid "NOTE: "
|
| 918 |
msgstr ""
|
| 919 |
|
| 920 |
+
#: includes/class-connect.php:277
|
| 921 |
msgid ""
|
| 922 |
"It's possible to use the plugin without connecting to a Constant Contact "
|
| 923 |
"account. In this case, all information collected by the forms will be "
|
| 958 |
msgid "New Form"
|
| 959 |
msgstr ""
|
| 960 |
|
| 961 |
+
#: includes/class-cpts.php:70 includes/class-display.php:821
|
| 962 |
msgid "Edit Form"
|
| 963 |
msgstr ""
|
| 964 |
|
| 1189 |
msgid "%1$s (last modified %2$s ago)"
|
| 1190 |
msgstr ""
|
| 1191 |
|
| 1192 |
+
#: includes/class-display.php:490
|
| 1193 |
msgid "Constant Contact Use."
|
| 1194 |
msgstr ""
|
| 1195 |
|
| 1196 |
+
#: includes/class-display.php:617 includes/class-display.php:1689
|
| 1197 |
msgid "Error: Please correct your entry."
|
| 1198 |
msgstr ""
|
| 1199 |
|
| 1200 |
+
#: includes/class-display.php:619
|
| 1201 |
msgid " Error: Please fill out this field."
|
| 1202 |
msgstr ""
|
| 1203 |
|
| 1204 |
+
#: includes/class-display.php:1139
|
| 1205 |
msgid "Send"
|
| 1206 |
msgstr ""
|
| 1207 |
|
| 1208 |
+
#: includes/class-display.php:1255
|
| 1209 |
msgid "Street Address"
|
| 1210 |
msgstr ""
|
| 1211 |
|
| 1212 |
+
#: includes/class-display.php:1256
|
| 1213 |
msgid "Address Line 2"
|
| 1214 |
msgstr ""
|
| 1215 |
|
| 1216 |
+
#: includes/class-display.php:1257
|
| 1217 |
msgid "City"
|
| 1218 |
msgstr ""
|
| 1219 |
|
| 1220 |
+
#: includes/class-display.php:1258
|
| 1221 |
msgid "State"
|
| 1222 |
msgstr ""
|
| 1223 |
|
| 1224 |
+
#: includes/class-display.php:1259
|
| 1225 |
msgid "ZIP Code"
|
| 1226 |
msgstr ""
|
| 1227 |
|
| 1228 |
+
#: includes/class-display.php:1436
|
| 1229 |
msgid "Month"
|
| 1230 |
msgstr ""
|
| 1231 |
|
| 1232 |
+
#: includes/class-display.php:1437
|
| 1233 |
msgid "Day"
|
| 1234 |
msgstr ""
|
| 1235 |
|
| 1236 |
+
#: includes/class-display.php:1438
|
| 1237 |
msgid "Year"
|
| 1238 |
msgstr ""
|
| 1239 |
|
| 1240 |
+
#: includes/class-display.php:1562
|
| 1241 |
msgid "January"
|
| 1242 |
msgstr ""
|
| 1243 |
|
| 1244 |
+
#: includes/class-display.php:1563
|
| 1245 |
msgid "February"
|
| 1246 |
msgstr ""
|
| 1247 |
|
| 1248 |
+
#: includes/class-display.php:1564
|
| 1249 |
msgid "March"
|
| 1250 |
msgstr ""
|
| 1251 |
|
| 1252 |
+
#: includes/class-display.php:1565
|
| 1253 |
msgid "April"
|
| 1254 |
msgstr ""
|
| 1255 |
|
| 1256 |
+
#: includes/class-display.php:1566
|
| 1257 |
msgid "May"
|
| 1258 |
msgstr ""
|
| 1259 |
|
| 1260 |
+
#: includes/class-display.php:1567
|
| 1261 |
msgid "June"
|
| 1262 |
msgstr ""
|
| 1263 |
|
| 1264 |
+
#: includes/class-display.php:1568
|
| 1265 |
msgid "July "
|
| 1266 |
msgstr ""
|
| 1267 |
|
| 1268 |
+
#: includes/class-display.php:1569
|
| 1269 |
msgid "August"
|
| 1270 |
msgstr ""
|
| 1271 |
|
| 1272 |
+
#: includes/class-display.php:1570
|
| 1273 |
msgid "September"
|
| 1274 |
msgstr ""
|
| 1275 |
|
| 1276 |
+
#: includes/class-display.php:1571
|
| 1277 |
msgid "October"
|
| 1278 |
msgstr ""
|
| 1279 |
|
| 1280 |
+
#: includes/class-display.php:1572
|
| 1281 |
msgid "November"
|
| 1282 |
msgstr ""
|
| 1283 |
|
| 1284 |
+
#: includes/class-display.php:1573
|
| 1285 |
msgid "December"
|
| 1286 |
msgstr ""
|
| 1287 |
|
| 1288 |
+
#: includes/class-display.php:1756
|
| 1289 |
#, php-format
|
| 1290 |
msgid ""
|
| 1291 |
"By submitting this form, you are consenting to receive marketing emails "
|
| 1293 |
"the SafeUnsubscribe® link, found at the bottom of every email. %s"
|
| 1294 |
msgstr ""
|
| 1295 |
|
| 1296 |
+
#: includes/class-display.php:1762
|
| 1297 |
msgid "Emails are serviced by Constant Contact"
|
| 1298 |
msgstr ""
|
| 1299 |
|
| 1300 |
+
#: includes/class-lists.php:80
|
| 1301 |
msgid "List Information"
|
| 1302 |
msgstr ""
|
| 1303 |
|
| 1304 |
+
#: includes/class-lists.php:170
|
| 1305 |
msgid "List information will populate upon saving."
|
| 1306 |
msgstr ""
|
| 1307 |
|
| 1308 |
+
#: includes/class-lists.php:859
|
| 1309 |
msgid "You already have a list with that name."
|
| 1310 |
msgstr ""
|
| 1311 |
|
| 1312 |
+
#: includes/class-lists.php:878
|
| 1313 |
msgid "Sync Lists with Constant Contact"
|
| 1314 |
msgstr ""
|
| 1315 |
|
| 1357 |
msgid "Delete logs"
|
| 1358 |
msgstr ""
|
| 1359 |
|
| 1360 |
+
#: includes/class-mail.php:307
|
| 1361 |
#, php-format
|
| 1362 |
msgid "Duplicate send mail for: %1$s and: %2$s"
|
| 1363 |
msgstr ""
|
| 1364 |
|
| 1365 |
+
#: includes/class-mail.php:339
|
| 1366 |
msgid "Your Constant Contact Forms plugin has captured new information."
|
| 1367 |
msgstr ""
|
| 1368 |
|
| 1369 |
+
#: includes/class-mail.php:343
|
| 1370 |
msgid "Form title: "
|
| 1371 |
msgstr ""
|
| 1372 |
|
| 1373 |
+
#: includes/class-mail.php:344
|
| 1374 |
msgid "Form information: "
|
| 1375 |
msgstr ""
|
| 1376 |
|
| 1377 |
+
#: includes/class-mail.php:350
|
| 1378 |
#, php-format
|
| 1379 |
msgid ""
|
| 1380 |
"Email marketing is a great way to stay connected and engage with visitors "
|
| 1382 |
"pn=miwordpress%s to sign up for a Free Trial."
|
| 1383 |
msgstr ""
|
| 1384 |
|
| 1385 |
+
#: includes/class-mail.php:387
|
| 1386 |
msgid "Constant Contact Forms Notification"
|
| 1387 |
msgstr ""
|
| 1388 |
|
| 1389 |
+
#: includes/class-mail.php:475
|
| 1390 |
#, php-format
|
| 1391 |
msgid ""
|
| 1392 |
"%sNote:%s You have disabled admin email notifications under the plugin "
|
| 1393 |
"settings, but are receiving this email because of the following reason."
|
| 1394 |
msgstr ""
|
| 1395 |
|
| 1396 |
+
#: includes/class-mail.php:498
|
| 1397 |
msgid "Submitted to Constant Contact:"
|
| 1398 |
msgstr ""
|
| 1399 |
|
| 1400 |
+
#: includes/class-mail.php:504
|
| 1401 |
msgid "NO (Constant Contact list not selected for this form)"
|
| 1402 |
msgstr ""
|
| 1403 |
|
| 1404 |
+
#: includes/class-mail.php:510
|
| 1405 |
msgid "NO (User did not select the Email Opt-in checkbox)"
|
| 1406 |
msgstr ""
|
| 1407 |
|
| 1408 |
+
#: includes/class-mail.php:510
|
| 1409 |
msgid ""
|
| 1410 |
"You can disable this under Form options. Email Opt-in isn't required to add "
|
| 1411 |
"subscribers into your account"
|
| 1464 |
"implement via <a href=\"%s\">Settings</a>"
|
| 1465 |
msgstr ""
|
| 1466 |
|
| 1467 |
+
#: includes/class-notifications.php:415
|
| 1468 |
msgid "Dismiss this notice."
|
| 1469 |
msgstr ""
|
| 1470 |
|
| 1471 |
+
#: includes/class-optin.php:137 includes/class-settings.php:823
|
| 1472 |
msgid "Agree"
|
| 1473 |
msgstr ""
|
| 1474 |
|
| 1475 |
+
#: includes/class-optin.php:138 includes/class-settings.php:824
|
| 1476 |
msgid "Disagree"
|
| 1477 |
msgstr ""
|
| 1478 |
|
| 1479 |
+
#: includes/class-process-form.php:107 includes/class-process-form.php:663
|
| 1480 |
msgid "There was an error sending your form."
|
| 1481 |
msgstr ""
|
| 1482 |
|
| 1483 |
+
#: includes/class-process-form.php:121 includes/class-process-form.php:686
|
| 1484 |
msgid "Your information has been submitted."
|
| 1485 |
msgstr ""
|
| 1486 |
|
| 1487 |
+
#: includes/class-process-form.php:139 includes/class-process-form.php:259
|
| 1488 |
+
#: includes/class-process-form.php:703
|
| 1489 |
msgid ""
|
| 1490 |
"We had trouble processing your submission. Please review your entries and "
|
| 1491 |
"try again."
|
| 1492 |
msgstr ""
|
| 1493 |
|
| 1494 |
+
#: includes/class-process-form.php:190
|
| 1495 |
msgid "No Constant Contact Forms form ID provided"
|
| 1496 |
msgstr ""
|
| 1497 |
|
| 1498 |
+
#: includes/class-process-form.php:198
|
| 1499 |
msgid "No form verify value provided"
|
| 1500 |
msgstr ""
|
| 1501 |
|
| 1502 |
+
#: includes/class-process-form.php:206 includes/class-process-form.php:247
|
| 1503 |
msgid "We do no think you are human"
|
| 1504 |
msgstr ""
|
| 1505 |
|
| 1506 |
+
#: includes/class-process-form.php:213
|
| 1507 |
msgid "Please properly fill out all required fields"
|
| 1508 |
msgstr ""
|
| 1509 |
|
| 1510 |
+
#: includes/class-process-form.php:231
|
| 1511 |
msgid "Failed reCAPTCHA check"
|
| 1512 |
msgstr ""
|
| 1513 |
|
| 1514 |
+
#: includes/class-process-form.php:268 includes/class-process-form.php:277
|
| 1515 |
+
#: includes/class-process-form.php:286
|
| 1516 |
msgid ""
|
| 1517 |
"We had trouble processing your submission. Make sure you haven't changed the "
|
| 1518 |
"required Form ID and try again."
|
| 1609 |
msgstr ""
|
| 1610 |
|
| 1611 |
#: includes/class-settings.php:369
|
| 1612 |
+
msgid "Global Form CSS Settings"
|
| 1613 |
+
msgstr ""
|
| 1614 |
+
|
| 1615 |
+
#: includes/class-settings.php:373
|
| 1616 |
+
msgid "CSS Classes"
|
| 1617 |
+
msgstr ""
|
| 1618 |
+
|
| 1619 |
+
#: includes/class-settings.php:377
|
| 1620 |
+
msgid "Provide custom classes for the form separated by a single space."
|
| 1621 |
+
msgstr ""
|
| 1622 |
+
|
| 1623 |
+
#: includes/class-settings.php:396
|
| 1624 |
+
msgid "Choose the position for the labels of the form elements."
|
| 1625 |
+
msgstr ""
|
| 1626 |
+
|
| 1627 |
+
#: includes/class-settings.php:403
|
| 1628 |
msgid "Support"
|
| 1629 |
msgstr ""
|
| 1630 |
|
| 1631 |
+
#: includes/class-settings.php:406
|
| 1632 |
msgid "Enable logging for debugging purposes."
|
| 1633 |
msgstr ""
|
| 1634 |
|
| 1635 |
+
#: includes/class-settings.php:407
|
| 1636 |
msgid ""
|
| 1637 |
"This option will turn on some logging functionality that can be used to "
|
| 1638 |
"deduce sources of issues with the use of Constant Contact Forms plugin."
|
| 1639 |
msgstr ""
|
| 1640 |
|
| 1641 |
+
#: includes/class-settings.php:425
|
| 1642 |
msgid "Add a checkbox to the comment field in your posts"
|
| 1643 |
msgstr ""
|
| 1644 |
|
| 1645 |
+
#: includes/class-settings.php:426
|
| 1646 |
msgid "Add a checkbox to the main WordPress login page"
|
| 1647 |
msgstr ""
|
| 1648 |
|
| 1649 |
+
#: includes/class-settings.php:431
|
| 1650 |
msgid "Add a checkbox to the WordPress user registration page"
|
| 1651 |
msgstr ""
|
| 1652 |
|
| 1653 |
+
#: includes/class-settings.php:520
|
| 1654 |
msgid "Sign up to our newsletter."
|
| 1655 |
msgstr ""
|
| 1656 |
|
readme.txt
CHANGED
|
@@ -2,10 +2,10 @@
|
|
| 2 |
Contributors: constantcontact
|
| 3 |
Tags: capture, contacts, constant contact, constant contact form, constant contact newsletter, constant contact official, contact forms, email, form, forms, marketing, mobile, newsletter, opt-in, plugin, signup, subscribe, subscription, widget
|
| 4 |
Requires at least: 4.0.0
|
| 5 |
-
Tested up to: 4.9.
|
| 6 |
-
Stable tag: 1.
|
| 7 |
-
License:
|
| 8 |
-
License URI: http://www.gnu.org/licenses/gpl-
|
| 9 |
Requires PHP: 5.4
|
| 10 |
|
| 11 |
The official Constant Contact plugin adds a contact form to your WordPress site to quickly capture information from visitors.
|
|
@@ -34,6 +34,27 @@ BONUS: If you have a Constant Contact account, all new email addresses that you
|
|
| 34 |
5. Basic Form
|
| 35 |
|
| 36 |
== Changelog ==
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 37 |
= 1.3.7 =
|
| 38 |
* Added: Logging functionality to help aid with debugging and the plugin not working as needed or expected.
|
| 39 |
* Added: Passed form ID to filters related to including labels for custom fields.
|
| 2 |
Contributors: constantcontact
|
| 3 |
Tags: capture, contacts, constant contact, constant contact form, constant contact newsletter, constant contact official, contact forms, email, form, forms, marketing, mobile, newsletter, opt-in, plugin, signup, subscribe, subscription, widget
|
| 4 |
Requires at least: 4.0.0
|
| 5 |
+
Tested up to: 4.9.7
|
| 6 |
+
Stable tag: 1.4.0
|
| 7 |
+
License: GPLv3
|
| 8 |
+
License URI: http://www.gnu.org/licenses/gpl-3.0.html
|
| 9 |
Requires PHP: 5.4
|
| 10 |
|
| 11 |
The official Constant Contact plugin adds a contact form to your WordPress site to quickly capture information from visitors.
|
| 34 |
5. Basic Form
|
| 35 |
|
| 36 |
== Changelog ==
|
| 37 |
+
|
| 38 |
+
= 1.4.0 =
|
| 39 |
+
* Added: Various styling options during the form building process.
|
| 40 |
+
* Added: Initial Akismet integration to help aid with spam submissions.
|
| 41 |
+
* Added: Clear form fields after successful AJAX-based form submissions.
|
| 42 |
+
* Added: Clear success/error message after small delay, for AJAX-based form submissions.
|
| 43 |
+
* Added: WordPress action hooks before and after form output. Useful to add your own output for a given form.
|
| 44 |
+
* Added: Compatibility with "Call To Action" plugin.
|
| 45 |
+
* Added: Include custom field labels in email notifications.
|
| 46 |
+
* Added: Ability to customize who receives email notifications, per form.
|
| 47 |
+
* Added: Frontend form submit button disabled if hidden honeypot field has changed.
|
| 48 |
+
* Fixed: Consistently applied ctct_process_form_success filter to AJAX form submission success messages.
|
| 49 |
+
* Fixed: Prevent errors with Constant Contact social links and array_merge issues.
|
| 50 |
+
* Fixed: Prevent errors with array_key_exists() and the ctct_get_settings_option function.
|
| 51 |
+
* Fixed: Wording around associated lists for a form, in the WordPress admin.
|
| 52 |
+
* Fixed: Removed .gitignore files from /vendor folders.
|
| 53 |
+
* Fixed: Prevent potential PHP warnings and notices in various areas.
|
| 54 |
+
* Updated: Better support for emailing notifications to multiple recipiants.
|
| 55 |
+
* Updated: Better disabling of submit button during AJAX-based submissions.
|
| 56 |
+
* Updated: Tightened up form builder screen to not use so much space.
|
| 57 |
+
|
| 58 |
= 1.3.7 =
|
| 59 |
* Added: Logging functionality to help aid with debugging and the plugin not working as needed or expected.
|
| 60 |
* Added: Passed form ID to filters related to including labels for custom fields.
|
vendor/constantcontact/constantcontact/.gitignore
ADDED
|
@@ -0,0 +1,25 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Created by .gitignore support plugin (hsz.mobi)
|
| 2 |
+
|
| 3 |
+
## Directory-based project format
|
| 4 |
+
.idea/
|
| 5 |
+
/*.iml
|
| 6 |
+
|
| 7 |
+
## File-based project format
|
| 8 |
+
*.ipr
|
| 9 |
+
*.iws
|
| 10 |
+
|
| 11 |
+
## Additional for IntelliJ
|
| 12 |
+
out/
|
| 13 |
+
|
| 14 |
+
# generated by mpeltonen/sbt-idea plugin
|
| 15 |
+
.idea_modules/
|
| 16 |
+
|
| 17 |
+
# generated by JIRA plugin
|
| 18 |
+
atlassian-ide-plugin.xml
|
| 19 |
+
|
| 20 |
+
### Composer template
|
| 21 |
+
composer.lock
|
| 22 |
+
composer.phar
|
| 23 |
+
vendor/
|
| 24 |
+
|
| 25 |
+
devFile.php
|
vendor/constantcontact/constantcontact/.travis.yml
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
language: php
|
| 2 |
+
|
| 3 |
+
php:
|
| 4 |
+
- 5.4
|
| 5 |
+
- 5.5
|
| 6 |
+
- 5.6
|
| 7 |
+
- hhvm
|
| 8 |
+
|
| 9 |
+
env:
|
| 10 |
+
- GUZZLE_VERSION="5.1.0"
|
| 11 |
+
|
| 12 |
+
before_script: composer install
|
| 13 |
+
|
| 14 |
+
install:
|
| 15 |
+
- composer require guzzlehttp/guzzle:${GUZZLE_VERSION}
|
| 16 |
+
|
| 17 |
+
matrix:
|
| 18 |
+
allow_failures:
|
| 19 |
+
- php: hhvm
|
| 20 |
+
fast_finish: true
|
vendor/constantcontact/constantcontact/constantcontact/phpunit.xml
DELETED
|
@@ -1,8 +0,0 @@
|
|
| 1 |
-
<phpunit bootstrap="test/bootstrap.php">
|
| 2 |
-
<testsuites>
|
| 3 |
-
<testsuite name="UnitTests">
|
| 4 |
-
<directory>test/Services</directory>
|
| 5 |
-
<directory>test/Auth</directory>
|
| 6 |
-
</testsuite>
|
| 7 |
-
</testsuites>
|
| 8 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Auth/CtctOAuth2UnitTest.php
DELETED
|
@@ -1,140 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Auth\CtctOAuth2;
|
| 4 |
-
use Ctct\Util\Config;
|
| 5 |
-
use GuzzleHttp\Client;
|
| 6 |
-
use GuzzleHttp\Message\Response;
|
| 7 |
-
use GuzzleHttp\Stream\Stream;
|
| 8 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 9 |
-
|
| 10 |
-
class CtctOAuth2UnitTest extends PHPUnit_Framework_TestCase
|
| 11 |
-
{
|
| 12 |
-
/**
|
| 13 |
-
* @var Client
|
| 14 |
-
*/
|
| 15 |
-
private static $client;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @var CtctOAuth2
|
| 19 |
-
*/
|
| 20 |
-
private $ctctOAuth2;
|
| 21 |
-
|
| 22 |
-
private $apiKey = "apiKey";
|
| 23 |
-
private $clientSecret = "clientSecret";
|
| 24 |
-
private $redirectUri = "redirectUri";
|
| 25 |
-
|
| 26 |
-
public static function setUpBeforeClass()
|
| 27 |
-
{
|
| 28 |
-
self::$client = new Client();
|
| 29 |
-
$tokenInfoStream = Stream::factory(JsonLoader::getTokenInfoJson());
|
| 30 |
-
$accessTokenStream = Stream::factory(JsonLoader::getAccessTokenJson());
|
| 31 |
-
$mock = new Mock([
|
| 32 |
-
new Response(200, array(), $tokenInfoStream),
|
| 33 |
-
new Response(200, array(), $accessTokenStream)
|
| 34 |
-
]);
|
| 35 |
-
self::$client->getEmitter()->attach($mock);
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
public function setUp()
|
| 39 |
-
{
|
| 40 |
-
$this->ctctOAuth2 = new CtctOAuth2($this->apiKey, $this->clientSecret, $this->redirectUri);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
public function testGetTokenInfo()
|
| 44 |
-
{
|
| 45 |
-
$response = self::$client->post('/');
|
| 46 |
-
|
| 47 |
-
$token = $response->json();
|
| 48 |
-
|
| 49 |
-
$this->assertEquals("f98b207c-ta99b-4938-b523-3cc2895f5420", $token['client_id']);
|
| 50 |
-
$this->assertEquals("ctcttest", $token['user_name']);
|
| 51 |
-
$this->assertEquals("315110295", $token['expires_in']);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function testGetAccessToken()
|
| 55 |
-
{
|
| 56 |
-
$response = self::$client->post('/');
|
| 57 |
-
|
| 58 |
-
$token = $response->json();
|
| 59 |
-
|
| 60 |
-
$this->assertEquals("v6574b42-a5bc-4574-a87f-5c9d1202e316", $token['access_token']);
|
| 61 |
-
$this->assertEquals("308874923", $token['expires_in']);
|
| 62 |
-
$this->assertEquals("Bearer", $token['token_type']);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* @dataProvider authorizationUrlProvider
|
| 67 |
-
*/
|
| 68 |
-
public function testGetAuthorizationUrl($server, $expectedResponse)
|
| 69 |
-
{
|
| 70 |
-
$this->assertEquals($expectedResponse, $this->ctctOAuth2->getAuthorizationUrl($server));
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
public function testGetAuthorizationUrlServer()
|
| 74 |
-
{
|
| 75 |
-
$authUrl = $this->ctctOAuth2->getAuthorizationUrl();
|
| 76 |
-
$baseUrl = Config::get('auth.base_url') . Config::get('auth.authorization_endpoint');
|
| 77 |
-
$params = array(
|
| 78 |
-
'response_type' => 'code',
|
| 79 |
-
'client_id' => $this->apiKey,
|
| 80 |
-
'redirect_uri' => $this->redirectUri
|
| 81 |
-
);
|
| 82 |
-
$expectedUrl = $baseUrl . '?' . http_build_query($params);
|
| 83 |
-
$this->assertEquals($expectedUrl, $authUrl);
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
public function testGetAuthorizationUrlClient()
|
| 87 |
-
{
|
| 88 |
-
$authUrl = $this->ctctOAuth2->getAuthorizationUrl(false);
|
| 89 |
-
$baseUrl = Config::get('auth.base_url') . Config::get('auth.authorization_endpoint');
|
| 90 |
-
$params = array(
|
| 91 |
-
'response_type' => 'token',
|
| 92 |
-
'client_id' => $this->apiKey,
|
| 93 |
-
'redirect_uri' => $this->redirectUri
|
| 94 |
-
);
|
| 95 |
-
$expectedUrl = $baseUrl . '?' . http_build_query($params);
|
| 96 |
-
$this->assertEquals($expectedUrl, $authUrl);
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
public function testGetAuthorizationUrlServerWithState()
|
| 100 |
-
{
|
| 101 |
-
$state = 'this is my state';
|
| 102 |
-
$authUrl = $this->ctctOAuth2->getAuthorizationUrl(true, $state);
|
| 103 |
-
$baseUrl = Config::get('auth.base_url') . Config::get('auth.authorization_endpoint');
|
| 104 |
-
$params = array(
|
| 105 |
-
'response_type' => 'code',
|
| 106 |
-
'client_id' => $this->apiKey,
|
| 107 |
-
'redirect_uri' => $this->redirectUri,
|
| 108 |
-
'state' => $state
|
| 109 |
-
);
|
| 110 |
-
$expectedUrl = $baseUrl . '?' . http_build_query($params, '', '&', PHP_QUERY_RFC3986);
|
| 111 |
-
$this->assertEquals($expectedUrl, $authUrl);
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
public function testGetAuthorizationUrlClientWithState()
|
| 115 |
-
{
|
| 116 |
-
$state = 'this is my state';
|
| 117 |
-
$authUrl = $this->ctctOAuth2->getAuthorizationUrl(false, $state);
|
| 118 |
-
$baseUrl = Config::get('auth.base_url') . Config::get('auth.authorization_endpoint');
|
| 119 |
-
$params = array(
|
| 120 |
-
'response_type' => 'token',
|
| 121 |
-
'client_id' => $this->apiKey,
|
| 122 |
-
'redirect_uri' => $this->redirectUri,
|
| 123 |
-
'state' => $state
|
| 124 |
-
);
|
| 125 |
-
$expectedUrl = $baseUrl . '?' . http_build_query($params, '', '&', PHP_QUERY_RFC3986);
|
| 126 |
-
$this->assertEquals($expectedUrl, $authUrl);
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
public function authorizationUrlProvider()
|
| 130 |
-
{
|
| 131 |
-
$requestParams = "&client_id=apiKey&redirect_uri=redirectUri";
|
| 132 |
-
$serverParams = "?response_type=" . Config::get('auth.response_type_code') . $requestParams;
|
| 133 |
-
$clientParams = "?response_type=" . Config::get('auth.response_type_token') . $requestParams;
|
| 134 |
-
|
| 135 |
-
return array(
|
| 136 |
-
array(true, Config::get('auth.base_url') . Config::get('auth.authorization_endpoint') . $serverParams),
|
| 137 |
-
array(false, Config::get('auth.base_url') . Config::get('auth.authorization_endpoint') . $clientParams)
|
| 138 |
-
);
|
| 139 |
-
}
|
| 140 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Account/get_account_info.json
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"website":"http://www.example.com",
|
| 3 |
-
"organization_name":"My Company",
|
| 4 |
-
"time_zone":"US/Eastern",
|
| 5 |
-
"first_name":"Mary Jane",
|
| 6 |
-
"last_name":"Doe",
|
| 7 |
-
"email":"mjdoe@example.com",
|
| 8 |
-
"phone":"5555555555",
|
| 9 |
-
"company_logo":"https://ih.constantcontact.com/fs137/1100371573368/img/90.jpg",
|
| 10 |
-
"country_code":"US",
|
| 11 |
-
"state_code":"MA",
|
| 12 |
-
"organization_addresses":[
|
| 13 |
-
{
|
| 14 |
-
"city": "Anytown",
|
| 15 |
-
"line1":"123 Maple Street",
|
| 16 |
-
"postal_code":"11111",
|
| 17 |
-
"country_code":"US",
|
| 18 |
-
"state_code":"MA"
|
| 19 |
-
}
|
| 20 |
-
]
|
| 21 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Account/get_verified_email_addresses.json
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
[
|
| 2 |
-
{
|
| 3 |
-
"email_address": "test123@roving.com",
|
| 4 |
-
"status": "CONFIRMED"
|
| 5 |
-
}
|
| 6 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/get_activities.json
DELETED
|
@@ -1,52 +0,0 @@
|
|
| 1 |
-
[
|
| 2 |
-
{
|
| 3 |
-
"id": "a07e1ikxwuphd4nwjxl",
|
| 4 |
-
"type": "EXPORT_CONTACTS",
|
| 5 |
-
"status": "COMPLETE",
|
| 6 |
-
"start_date": "2013-02-13T15:57:03.627Z",
|
| 7 |
-
"finish_date": "2013-02-13T15:57:03.649Z",
|
| 8 |
-
"created_date": "2013-02-13T15:56:14.697Z",
|
| 9 |
-
"error_count": 0,
|
| 10 |
-
"contact_count": 0
|
| 11 |
-
},
|
| 12 |
-
{
|
| 13 |
-
"id": "a07e1ikxwuohd4ni3no",
|
| 14 |
-
"type": "EXPORT_CONTACTS",
|
| 15 |
-
"status": "COMPLETE",
|
| 16 |
-
"start_date": "2013-02-13T15:45:02.959Z",
|
| 17 |
-
"finish_date": "2013-02-13T15:45:03.146Z",
|
| 18 |
-
"created_date": "2013-02-13T15:45:00.420Z",
|
| 19 |
-
"error_count": 0,
|
| 20 |
-
"contact_count": 0
|
| 21 |
-
},
|
| 22 |
-
{
|
| 23 |
-
"id": "a07e1ikxyomhd4la0o9",
|
| 24 |
-
"type": "REMOVE_CONTACTS_FROM_LISTS",
|
| 25 |
-
"status": "COMPLETE",
|
| 26 |
-
"start_date": "2013-02-13T14:43:01.635Z",
|
| 27 |
-
"finish_date": "2013-02-13T14:43:01.662Z",
|
| 28 |
-
"created_date": "2013-02-13T14:42:44.073Z",
|
| 29 |
-
"error_count": 2,
|
| 30 |
-
"contact_count": 2
|
| 31 |
-
},
|
| 32 |
-
{
|
| 33 |
-
"id": "a07e1ikxwujhd4j5dpm",
|
| 34 |
-
"type": "CLEAR_CONTACTS_FROM_LISTS",
|
| 35 |
-
"status": "COMPLETE",
|
| 36 |
-
"start_date": "2013-02-13T13:44:01.186Z",
|
| 37 |
-
"finish_date": "2013-02-13T13:44:03.330Z",
|
| 38 |
-
"created_date": "2013-02-13T13:43:08.458Z",
|
| 39 |
-
"error_count": 0,
|
| 40 |
-
"contact_count": 352
|
| 41 |
-
},
|
| 42 |
-
{
|
| 43 |
-
"id": "a07e1ikqlv6hcxbe11w",
|
| 44 |
-
"type": "REMOVE_CONTACTS_FROM_LISTS",
|
| 45 |
-
"status": "COMPLETE",
|
| 46 |
-
"start_date": "2013-02-08T12:31:56.472Z",
|
| 47 |
-
"finish_date": "2013-02-08T12:31:56.525Z",
|
| 48 |
-
"created_date": "2013-02-08T12:31:31.796Z",
|
| 49 |
-
"error_count": 2,
|
| 50 |
-
"contact_count": 2
|
| 51 |
-
}
|
| 52 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/get_activity.json
DELETED
|
@@ -1,24 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "a07e1ikxyomhd4la0o9",
|
| 3 |
-
"type": "REMOVE_CONTACTS_FROM_LISTS",
|
| 4 |
-
"status": "COMPLETE",
|
| 5 |
-
"errors": [
|
| 6 |
-
{
|
| 7 |
-
"message": "test@roving.com (not found in subscriber list)",
|
| 8 |
-
"line_number": 0,
|
| 9 |
-
"email_address": ""
|
| 10 |
-
},
|
| 11 |
-
{
|
| 12 |
-
"message": "test1@roving.com (not found in subscriber list)",
|
| 13 |
-
"line_number": 0,
|
| 14 |
-
"email_address": ""
|
| 15 |
-
}
|
| 16 |
-
],
|
| 17 |
-
"warnings": [],
|
| 18 |
-
"file_name": "",
|
| 19 |
-
"start_date": "2013-02-13T14:43:01.635Z",
|
| 20 |
-
"finish_date": "2013-02-13T14:43:01.662Z",
|
| 21 |
-
"created_date": "2013-02-13T14:42:44.073Z",
|
| 22 |
-
"error_count": 2,
|
| 23 |
-
"contact_count": 2
|
| 24 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_add_contacts.json
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "a07e1il69qzhdby44ro",
|
| 3 |
-
"type": "ADD_CONTACTS",
|
| 4 |
-
"error_count": 0,
|
| 5 |
-
"contact_count": 1
|
| 6 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_clear_lists.json
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "a07e1il69fwhd7uan9h",
|
| 3 |
-
"type": "CLEAR_CONTACTS_FROM_LISTS",
|
| 4 |
-
"error_count": 0,
|
| 5 |
-
"contact_count": 0
|
| 6 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_export_contacts.json
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "a07e1i5nqamhcfeuu0h",
|
| 3 |
-
"type": "EXPORT_CONTACTS",
|
| 4 |
-
"error_count": 0,
|
| 5 |
-
"contacts_count": 0
|
| 6 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Activities/post_remove_contacts_from_lists.json
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "a07e1i5nqamhcfeuu0h",
|
| 3 |
-
"type": "REMOVE_CONTACTS_FROM_LISTS",
|
| 4 |
-
"error_count": 0,
|
| 5 |
-
"contacts_count": 0
|
| 6 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Auth/get_access_token.json
DELETED
|
@@ -1,5 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"access_token": "v6574b42-a5bc-4574-a87f-5c9d1202e316",
|
| 3 |
-
"expires_in": "308874923",
|
| 4 |
-
"token_type": "Bearer"
|
| 5 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Auth/token_info.json
DELETED
|
@@ -1,5 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"client_id": "f98b207c-ta99b-4938-b523-3cc2895f5420",
|
| 3 |
-
"user_name": "ctcttest",
|
| 4 |
-
"expires_in": "315110295"
|
| 5 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_campaign.json
DELETED
|
@@ -1,63 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "1100394165290",
|
| 3 |
-
"name": "CampaignName-05965ddb-12d2-43e5-b8f3-0c22ca487c3a",
|
| 4 |
-
"subject": "CampaignSubject",
|
| 5 |
-
"status": "SENT",
|
| 6 |
-
"from_name": "From WSPI",
|
| 7 |
-
"from_email": "wiz-20121206130519@l1.snoopy.roving.com",
|
| 8 |
-
"reply_to_email": "wiz-20121206130519@l1.snoopy.roving.com",
|
| 9 |
-
"template_type": "CUSTOM",
|
| 10 |
-
"created_date": "2012-12-06T18:06:05.255Z",
|
| 11 |
-
"last_edit_date": "2012-12-06T18:06:05.255Z",
|
| 12 |
-
"last_run_date": "2012-12-06T18:06:40.342Z",
|
| 13 |
-
"is_permission_reminder_enabled": false,
|
| 14 |
-
"permission_reminder_text": "",
|
| 15 |
-
"permalink_url": "http://www.constantcontact.com",
|
| 16 |
-
"is_view_as_webpage_enabled": false,
|
| 17 |
-
"view_as_web_page_text": "Having trouble viewing this email?",
|
| 18 |
-
"view_as_web_page_link_text": "Click Here",
|
| 19 |
-
"greeting_salutations": "Hi",
|
| 20 |
-
"greeting_name": "FIRST_NAME",
|
| 21 |
-
"greeting_string": "",
|
| 22 |
-
"email_content": "<html><body>Hi <a href=\"http://www.constantcontact.com\">Visit ConstantContact.com!</a> </body></html>",
|
| 23 |
-
"text_content": "<text>Something to test</text>",
|
| 24 |
-
"email_content_format": "HTML",
|
| 25 |
-
"style_sheet": "",
|
| 26 |
-
"message_footer": {
|
| 27 |
-
"city": "Waltham",
|
| 28 |
-
"state": "MA",
|
| 29 |
-
"country": "US",
|
| 30 |
-
"organization_name": "WSPIOrgName",
|
| 31 |
-
"address_line_1": "1601 Trapelo RD",
|
| 32 |
-
"address_line_2": "suite 2",
|
| 33 |
-
"address_line_3": "box 4",
|
| 34 |
-
"international_state": "",
|
| 35 |
-
"postal_code": "02451",
|
| 36 |
-
"include_forward_email": true,
|
| 37 |
-
"forward_email_link_text": "WSPIForwardThisEmail",
|
| 38 |
-
"include_subscribe_link": true,
|
| 39 |
-
"subscribe_link_text": "WSPISubscribeLinkText"
|
| 40 |
-
},
|
| 41 |
-
"tracking_summary": {
|
| 42 |
-
"sends": 15,
|
| 43 |
-
"opens": 10,
|
| 44 |
-
"clicks": 10,
|
| 45 |
-
"forwards": 3,
|
| 46 |
-
"unsubscribes": 2,
|
| 47 |
-
"bounces": 18,
|
| 48 |
-
"spam_count": 1
|
| 49 |
-
},
|
| 50 |
-
"is_visible_in_ui": false,
|
| 51 |
-
"sent_to_contact_lists": [
|
| 52 |
-
{
|
| 53 |
-
"id": 3
|
| 54 |
-
}
|
| 55 |
-
],
|
| 56 |
-
"click_through_details": [
|
| 57 |
-
{
|
| 58 |
-
"url": "http://www.constantcontact.com",
|
| 59 |
-
"url_uid": "1100394163874",
|
| 60 |
-
"click_count": 10
|
| 61 |
-
}
|
| 62 |
-
]
|
| 63 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_campaigns.json
DELETED
|
@@ -1,57 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns?next=cGFnZU51bT0yJnBhZ2VTaXplPTM"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"id": "1100371240640",
|
| 10 |
-
"name": "Email Created 2012/11/29, 4:13 PM",
|
| 11 |
-
"status": "SENT",
|
| 12 |
-
"modified_date": "2012-11-29T16:15:17.468Z"
|
| 13 |
-
},
|
| 14 |
-
{
|
| 15 |
-
"id": "1100368835463",
|
| 16 |
-
"name": "CampaignNdddasdsdme2",
|
| 17 |
-
"status": "DRAFT",
|
| 18 |
-
"modified_date": "2012-10-16T16:14:34.221Z"
|
| 19 |
-
},
|
| 20 |
-
{
|
| 21 |
-
"id": "1100368834956",
|
| 22 |
-
"name": "CampaignNasdsdme2",
|
| 23 |
-
"status": "DRAFT",
|
| 24 |
-
"modified_date": "2012-10-16T15:44:45.341Z"
|
| 25 |
-
},
|
| 26 |
-
{
|
| 27 |
-
"id": "1100368605465",
|
| 28 |
-
"name": "CampaignName2dddfdf",
|
| 29 |
-
"status": "DRAFT",
|
| 30 |
-
"modified_date": "2012-10-10T12:34:33.702Z"
|
| 31 |
-
},
|
| 32 |
-
{
|
| 33 |
-
"id": "1100368605462",
|
| 34 |
-
"name": "CampaignName2dfdf",
|
| 35 |
-
"status": "DRAFT",
|
| 36 |
-
"modified_date": "2012-10-10T12:33:39.402Z"
|
| 37 |
-
},
|
| 38 |
-
{
|
| 39 |
-
"id": "1100367933663",
|
| 40 |
-
"name": "CampaignName-cfd9b733-a4a3-40b0-ab92-8ad66d954c7f",
|
| 41 |
-
"status": "DRAFT",
|
| 42 |
-
"modified_date": "2012-09-25T18:29:43.259Z"
|
| 43 |
-
},
|
| 44 |
-
{
|
| 45 |
-
"id": "1100367567199",
|
| 46 |
-
"name": "u8cf32jeirb2",
|
| 47 |
-
"status": "DRAFT",
|
| 48 |
-
"modified_date": "2012-09-19T14:03:06.774Z"
|
| 49 |
-
},
|
| 50 |
-
{
|
| 51 |
-
"id": "1100367567187",
|
| 52 |
-
"name": "6qgk3d0opqgb",
|
| 53 |
-
"status": "DRAFT",
|
| 54 |
-
"modified_date": "2012-09-19T13:54:15.316Z"
|
| 55 |
-
}
|
| 56 |
-
]
|
| 57 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_preview.json
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"subject":"Subject Test",
|
| 3 |
-
"from_email":"myemail@example.com",
|
| 4 |
-
"reply_to_email":"myemail@example.com",
|
| 5 |
-
"preview_email_content":"<head ><meta /></head><body><center><table bgcolor=\"#ffffff\" id=\"VWPLINK\" width=\"595\"><tr><td style=\"font-size: 8pt; font-family: Verdana, Arial, Helvetica, sans-serif; color: #000000;\" width=\"100%\">View this message as a web page\n<a >Click here\n</a></td></tr></table></center><center ><table bgcolor=\"#ffffff\" width=\"595\" ><tr ><td width=\"100%\" ><font color=\"#000000\" face=\"verdana,arial\" size=\"1\" ><div >As a reminder, you're receiving this email because you have expressed an interest in MyCompany. Don't forget to add from_email@example.com to your address book so we'll be sure to land in your inbox! You may unsubscribe if you no longer wish to receive our emails. <div > </div><div >You may <a >unsubscribe</a> if you no longer wish to receive our emails.</div></div></font></td></tr></table></center><img /><p>This is text of the email message.</p><br />\n<table bgcolor=\"#ffffff\" padding=\"0\" width=\"100%\" ><tr align=\"center\" ><td ><table bgcolor=\"#ffffff\" width=\"595\" ><tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><b ><a >Click here to forward this message</a></b></font><br />\n<br />\n</td></tr>\n<tr ><td ><FooterContent ><a ><img /></a></FooterContent></td><td align=\"right\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><FooterLogo ><a ><img /></a></FooterLogo></font>\n</td>\n</tr><tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><FooterContent ><div >This email was sent to {Email Address} by <a >rmarcucella@constantcontact.com</a> <span style=\"color: #bababa;\" > | </span> </div>\n<div ><a >Update Profile/Email Address</a> <span style=\"color: #bababa;\" >|</span> Instant removal with <a >SafeUnsubscribe</a>™ <span style=\"color: #bababa;\" >|</span> <a >Privacy Policy</a>.</div></FooterContent></font>\n</td>\n</tr>\n<tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><br />My Organization | 123 Maple Street | Suite 1 | Anytown | MA | 01444</font>\n</td>\n</tr>\n</table>\n</td>\n</tr>\n</table>\n<br />\n</body>",
|
| 6 |
-
"preview_text_content":"View this message as a web page\nClick here\nhttp://campaign.r20.l1.constantcontact.com/render?ca=025eff86-6378-4f53-9301-5897ecf50b30&c={Contact Id}&ch={Contact Id}\n\nAs a reminder, you're receiving this email because you have expressed an interest in MyCompany. Don't forget to add from_email@example.com to your address book so we'll be sure to land in your inbox! You may unsubscribe if you no longer wish to receive our emails. You may unsubscribe\nhttp://visitor.l1.constantcontact.com/do?p=un&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n if you no longer wish to receive our emails.\n------------------------------------------------------------\nThis is the text of the email message.\n\nClick here to forward this message\nhttp://ui.l1.constantcontact.com/sa/fwtf.jsp?llr=cqmhk9aab&m=1100394770946&ea=rmarcucella%40constantcontact.com&a=1100400205633\n\n\n\n\n\nThis email was sent to {Email Address} by rmarcucella@constantcontact.com.\n\nUpdate Profile/Email Address\nhttp://visitor.l1.constantcontact.com/do?p=oo&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n\n\nInstant removal with SafeUnsubscribe(TM)\nhttp://visitor.l1.constantcontact.com/do?p=un&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n\n\nPrivacy Policy:\nhttp://ui.l1.constantcontact.com/roving/CCPrivacyPolicy.jsp\n\n\n\n\n\nOnline Marketing by\nhttp://img.l1.constantcontact.com/letters/images/cc-logo-color-sm.gif\nhttp://www.constantcontact.com\n\n\n\nMy Organization | 123 Maple Street | Suite 1 | Anytown | MA | 01444\n\n\n\n\n\n\n\n\n"
|
| 7 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_schedule.json
DELETED
|
@@ -1,4 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": 1,
|
| 3 |
-
"scheduled_date": "2012-12-16T11:07:43.626Z"
|
| 4 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/get_schedules.json
DELETED
|
@@ -1,10 +0,0 @@
|
|
| 1 |
-
[
|
| 2 |
-
{
|
| 3 |
-
"id": 1,
|
| 4 |
-
"scheduled_date": "2012-12-16T11:07:43.626Z"
|
| 5 |
-
},
|
| 6 |
-
{
|
| 7 |
-
"id": 2,
|
| 8 |
-
"scheduled_date": "2012-12-17T11:08:00.000Z"
|
| 9 |
-
}
|
| 10 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Campaigns/post_test_send.json
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"format": "HTML",
|
| 3 |
-
"personal_message": "oh hai there",
|
| 4 |
-
"email_addresses": [
|
| 5 |
-
"test@roving.com"
|
| 6 |
-
]
|
| 7 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contact.json
DELETED
|
@@ -1,63 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": 238,
|
| 3 |
-
"status": "ACTIVE",
|
| 4 |
-
"fax": "555-1212",
|
| 5 |
-
"addresses": [
|
| 6 |
-
{
|
| 7 |
-
"line1": "1601 Trapelo Rd",
|
| 8 |
-
"line2": "Suite 329",
|
| 9 |
-
"line3": "Line 3",
|
| 10 |
-
"city": "Waltham",
|
| 11 |
-
"address_type": "PERSONAL",
|
| 12 |
-
"state_code": "MA",
|
| 13 |
-
"country_code": "us",
|
| 14 |
-
"postal_code": "01720",
|
| 15 |
-
"sub_postal_code": "7885"
|
| 16 |
-
}
|
| 17 |
-
],
|
| 18 |
-
"notes": [
|
| 19 |
-
{
|
| 20 |
-
"id": 1,
|
| 21 |
-
"note": "Here are some cool notes to add",
|
| 22 |
-
"created_date": "2012-12-03T17:09:22.702Z"
|
| 23 |
-
}
|
| 24 |
-
],
|
| 25 |
-
"confirmed": false,
|
| 26 |
-
"lists": [
|
| 27 |
-
{
|
| 28 |
-
"id": 9,
|
| 29 |
-
"status": "ACTIVE"
|
| 30 |
-
}
|
| 31 |
-
],
|
| 32 |
-
"source": "API",
|
| 33 |
-
"email_addresses": [
|
| 34 |
-
{
|
| 35 |
-
"status": "ACTIVE",
|
| 36 |
-
"confirm_status": "NO_CONFIRMATION_REQUIRED",
|
| 37 |
-
"opt_in_source": "ACTION_BY_VISITOR",
|
| 38 |
-
"opt_in_date": "2012-09-17T14:40:41.271Z",
|
| 39 |
-
"opt_out_date": "2012-03-29T14:59:25.427Z",
|
| 40 |
-
"email_address": "john+smith@gmail.com"
|
| 41 |
-
}
|
| 42 |
-
],
|
| 43 |
-
"prefix_name": "Mr.",
|
| 44 |
-
"first_name": "John",
|
| 45 |
-
"last_name": "Smith",
|
| 46 |
-
"job_title": "Software Engineer",
|
| 47 |
-
"company_name": "Constant Contact",
|
| 48 |
-
"home_phone": "555-1212",
|
| 49 |
-
"work_phone": "555-1213",
|
| 50 |
-
"cell_phone": "555-1214",
|
| 51 |
-
"custom_fields": [
|
| 52 |
-
{
|
| 53 |
-
"name": "CustomField1",
|
| 54 |
-
"value": "3/28/2011 11:09 AM EDT"
|
| 55 |
-
},
|
| 56 |
-
{
|
| 57 |
-
"name": "CustomField2",
|
| 58 |
-
"value": "Site owner"
|
| 59 |
-
}
|
| 60 |
-
],
|
| 61 |
-
"source_details": "69f9d72b-0a5e-479d-b844-722b1da9595f",
|
| 62 |
-
"source_is_url": false
|
| 63 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contacts.json
DELETED
|
@@ -1,111 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/contacts?next=c3RhcnRBdD0zJmxpbWl0PTI"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"id": 230,
|
| 10 |
-
"status": "REMOVED",
|
| 11 |
-
"fax": "",
|
| 12 |
-
"addresses": [
|
| 13 |
-
{
|
| 14 |
-
"line1": "Addr1",
|
| 15 |
-
"line2": "",
|
| 16 |
-
"line3": "",
|
| 17 |
-
"city": "Boston",
|
| 18 |
-
"address_type": "PERSONAL",
|
| 19 |
-
"state_code": "MA",
|
| 20 |
-
"country_code": "us",
|
| 21 |
-
"postal_code": "00112",
|
| 22 |
-
"sub_postal_code": ""
|
| 23 |
-
},
|
| 24 |
-
{
|
| 25 |
-
"line1": "",
|
| 26 |
-
"line2": "",
|
| 27 |
-
"line3": "",
|
| 28 |
-
"city": "",
|
| 29 |
-
"address_type": "BUSINESS",
|
| 30 |
-
"state_code": "",
|
| 31 |
-
"country_code": "",
|
| 32 |
-
"postal_code": "",
|
| 33 |
-
"sub_postal_code": ""
|
| 34 |
-
}
|
| 35 |
-
],
|
| 36 |
-
"notes": [],
|
| 37 |
-
"confirmed": false,
|
| 38 |
-
"lists": [],
|
| 39 |
-
"source": "",
|
| 40 |
-
"email_addresses": [
|
| 41 |
-
{
|
| 42 |
-
"status": "REMOVED",
|
| 43 |
-
"confirm_status": "NO_CONFIRMATION_REQUIRED",
|
| 44 |
-
"opt_in_source": "ACTION_BY_VISITOR",
|
| 45 |
-
"opt_in_date": "2012-05-29T16:26:36.915Z",
|
| 46 |
-
"opt_out_date": "2012-06-18T13:13:46.974Z",
|
| 47 |
-
"email_address": "test@roving.com"
|
| 48 |
-
}
|
| 49 |
-
],
|
| 50 |
-
"prefix_name": "",
|
| 51 |
-
"first_name": "",
|
| 52 |
-
"last_name": "",
|
| 53 |
-
"job_title": "",
|
| 54 |
-
"department_name": "",
|
| 55 |
-
"company_name": "",
|
| 56 |
-
"custom_fields": [],
|
| 57 |
-
"source_details": "",
|
| 58 |
-
"action_by": "ACTION_BY_VISITOR"
|
| 59 |
-
},
|
| 60 |
-
{
|
| 61 |
-
"id": 231,
|
| 62 |
-
"status": "ACTIVE",
|
| 63 |
-
"fax": "",
|
| 64 |
-
"addresses": [
|
| 65 |
-
{
|
| 66 |
-
"line1": "Suite 101",
|
| 67 |
-
"line2": "line2",
|
| 68 |
-
"line3": "line3",
|
| 69 |
-
"city": "Brookfield",
|
| 70 |
-
"address_type": "PERSONAL",
|
| 71 |
-
"state_code": "WI",
|
| 72 |
-
"country_code": "us",
|
| 73 |
-
"postal_code": "53027",
|
| 74 |
-
"sub_postal_code": ""
|
| 75 |
-
}
|
| 76 |
-
],
|
| 77 |
-
"notes": [],
|
| 78 |
-
"confirmed": false,
|
| 79 |
-
"lists": [
|
| 80 |
-
{
|
| 81 |
-
"id": 1,
|
| 82 |
-
"status": "ACTIVE"
|
| 83 |
-
}
|
| 84 |
-
],
|
| 85 |
-
"source": "",
|
| 86 |
-
"email_addresses": [
|
| 87 |
-
{
|
| 88 |
-
"status": "ACTIVE",
|
| 89 |
-
"confirm_status": "NO_CONFIRMATION_REQUIRED",
|
| 90 |
-
"opt_in_source": "ACTION_BY_OWNER",
|
| 91 |
-
"opt_in_date": "2012-06-22T10:29:09.976Z",
|
| 92 |
-
"opt_out_date": "",
|
| 93 |
-
"email_address": "anothertest@roving.com"
|
| 94 |
-
}
|
| 95 |
-
],
|
| 96 |
-
"prefix_name": "",
|
| 97 |
-
"first_name": "Jimmy",
|
| 98 |
-
"last_name": "Roving",
|
| 99 |
-
"job_title": "Bear Tamer",
|
| 100 |
-
"department_name": "Animals",
|
| 101 |
-
"company_name": "Animal Trainer Pro",
|
| 102 |
-
"custom_fields": [
|
| 103 |
-
{
|
| 104 |
-
"name": "CustomField1",
|
| 105 |
-
"value": "1"
|
| 106 |
-
}
|
| 107 |
-
],
|
| 108 |
-
"source_details": "details"
|
| 109 |
-
}
|
| 110 |
-
]
|
| 111 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Contacts/get_contacts_no_next.json
DELETED
|
@@ -1,108 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {}
|
| 4 |
-
},
|
| 5 |
-
"results": [
|
| 6 |
-
{
|
| 7 |
-
"id": 230,
|
| 8 |
-
"status": "REMOVED",
|
| 9 |
-
"fax": "",
|
| 10 |
-
"addresses": [
|
| 11 |
-
{
|
| 12 |
-
"line1": "Addr1",
|
| 13 |
-
"line2": "",
|
| 14 |
-
"line3": "",
|
| 15 |
-
"city": "Boston",
|
| 16 |
-
"address_type": "PERSONAL",
|
| 17 |
-
"state_code": "MA",
|
| 18 |
-
"country_code": "us",
|
| 19 |
-
"postal_code": "00112",
|
| 20 |
-
"sub_postal_code": ""
|
| 21 |
-
},
|
| 22 |
-
{
|
| 23 |
-
"line1": "",
|
| 24 |
-
"line2": "",
|
| 25 |
-
"line3": "",
|
| 26 |
-
"city": "",
|
| 27 |
-
"address_type": "BUSINESS",
|
| 28 |
-
"state_code": "",
|
| 29 |
-
"country_code": "",
|
| 30 |
-
"postal_code": "",
|
| 31 |
-
"sub_postal_code": ""
|
| 32 |
-
}
|
| 33 |
-
],
|
| 34 |
-
"notes": [],
|
| 35 |
-
"confirmed": false,
|
| 36 |
-
"lists": [],
|
| 37 |
-
"source": "",
|
| 38 |
-
"email_addresses": [
|
| 39 |
-
{
|
| 40 |
-
"status": "REMOVED",
|
| 41 |
-
"confirm_status": "NO_CONFIRMATION_REQUIRED",
|
| 42 |
-
"opt_in_source": "ACTION_BY_VISITOR",
|
| 43 |
-
"opt_in_date": "2012-05-29T16:26:36.915Z",
|
| 44 |
-
"opt_out_date": "2012-06-18T13:13:46.974Z",
|
| 45 |
-
"email_address": "test@roving.com"
|
| 46 |
-
}
|
| 47 |
-
],
|
| 48 |
-
"prefix_name": "",
|
| 49 |
-
"first_name": "",
|
| 50 |
-
"last_name": "",
|
| 51 |
-
"job_title": "",
|
| 52 |
-
"department_name": "",
|
| 53 |
-
"company_name": "",
|
| 54 |
-
"custom_fields": [],
|
| 55 |
-
"source_details": ""
|
| 56 |
-
},
|
| 57 |
-
{
|
| 58 |
-
"id": 231,
|
| 59 |
-
"status": "ACTIVE",
|
| 60 |
-
"fax": "",
|
| 61 |
-
"addresses": [
|
| 62 |
-
{
|
| 63 |
-
"line1": "Suite 101",
|
| 64 |
-
"line2": "line2",
|
| 65 |
-
"line3": "line3",
|
| 66 |
-
"city": "Brookfield",
|
| 67 |
-
"address_type": "PERSONAL",
|
| 68 |
-
"state_code": "WI",
|
| 69 |
-
"country_code": "us",
|
| 70 |
-
"postal_code": "53027",
|
| 71 |
-
"sub_postal_code": ""
|
| 72 |
-
}
|
| 73 |
-
],
|
| 74 |
-
"notes": [],
|
| 75 |
-
"confirmed": false,
|
| 76 |
-
"lists": [
|
| 77 |
-
{
|
| 78 |
-
"id": 1,
|
| 79 |
-
"status": "ACTIVE"
|
| 80 |
-
}
|
| 81 |
-
],
|
| 82 |
-
"source": "",
|
| 83 |
-
"email_addresses": [
|
| 84 |
-
{
|
| 85 |
-
"status": "ACTIVE",
|
| 86 |
-
"confirm_status": "NO_CONFIRMATION_REQUIRED",
|
| 87 |
-
"opt_in_source": "ACTION_BY_OWNER",
|
| 88 |
-
"opt_in_date": "2012-06-22T10:29:09.976Z",
|
| 89 |
-
"opt_out_date": "",
|
| 90 |
-
"email_address": "anothertest@roving.com"
|
| 91 |
-
}
|
| 92 |
-
],
|
| 93 |
-
"prefix_name": "",
|
| 94 |
-
"first_name": "Jimmy",
|
| 95 |
-
"last_name": "Roving",
|
| 96 |
-
"job_title": "Bear Tamer",
|
| 97 |
-
"department_name": "Animals",
|
| 98 |
-
"company_name": "Animal Trainer Pro",
|
| 99 |
-
"custom_fields": [
|
| 100 |
-
{
|
| 101 |
-
"name": "CustomField1",
|
| 102 |
-
"value": "1"
|
| 103 |
-
}
|
| 104 |
-
],
|
| 105 |
-
"source_details": "details"
|
| 106 |
-
}
|
| 107 |
-
]
|
| 108 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/JsonLoader.php
DELETED
|
@@ -1,177 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
class JsonLoader
|
| 4 |
-
{
|
| 5 |
-
const CONTACTS_FOLDER = "/Contacts";
|
| 6 |
-
const LISTS_FOLDER = "/Lists";
|
| 7 |
-
const CAMPAIGNS_FOLDER = "/Campaigns";
|
| 8 |
-
const CAMPAIGN_TRACKING_FOLDER = "/Tracking";
|
| 9 |
-
const ACTIVITIES_FOLDER = "/Activities";
|
| 10 |
-
const ACCOUNT_FOLDER = "/Account";
|
| 11 |
-
const AUTH_FOLDER = "/Auth";
|
| 12 |
-
const LIBRARY_FOLDER = "/Library";
|
| 13 |
-
|
| 14 |
-
public static function getTokenInfoJson()
|
| 15 |
-
{
|
| 16 |
-
return file_get_contents(__DIR__ . self::AUTH_FOLDER . "/token_info.json");
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public static function getAccessTokenJson()
|
| 20 |
-
{
|
| 21 |
-
return file_get_contents(__DIR__ . self::AUTH_FOLDER . "/get_access_token.json");
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public static function getVerifiedAddressesJson()
|
| 25 |
-
{
|
| 26 |
-
return file_get_contents(__DIR__ . self::ACCOUNT_FOLDER . "/get_verified_email_addresses.json");
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
public static function getAccountInfoJson()
|
| 30 |
-
{
|
| 31 |
-
return file_get_contents(__DIR__ . self::ACCOUNT_FOLDER . "/get_account_info.json");
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public static function getLibraryFileJson()
|
| 35 |
-
{
|
| 36 |
-
return file_get_contents(__DIR__ . self::LIBRARY_FOLDER . "/get_library_file.json");
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
public static function getLibraryFilesJson()
|
| 40 |
-
{
|
| 41 |
-
return file_get_contents(__DIR__ . self::LIBRARY_FOLDER . "/get_library_files.json");
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
public static function getLibraryFolderJson()
|
| 45 |
-
{
|
| 46 |
-
return file_get_contents(__DIR__ . self::LIBRARY_FOLDER . "/get_library_folder.json");
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public static function getLibraryFoldersJson()
|
| 50 |
-
{
|
| 51 |
-
return file_get_contents(__DIR__ . self::LIBRARY_FOLDER . "/get_library_folders.json");
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public static function getFileUploadStatusJson()
|
| 55 |
-
{
|
| 56 |
-
return file_get_contents(__DIR__ . self::LIBRARY_FOLDER . "/get_file_upload_status.json");
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
public static function getContactJson()
|
| 60 |
-
{
|
| 61 |
-
return file_get_contents(__DIR__ . self::CONTACTS_FOLDER . "/get_contact.json");
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
public static function getContactsJson()
|
| 65 |
-
{
|
| 66 |
-
return file_get_contents(__DIR__ . self::CONTACTS_FOLDER . "/get_contacts.json");
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
public static function getContactsNoNextJson()
|
| 70 |
-
{
|
| 71 |
-
return file_get_contents(__DIR__ . self::CONTACTS_FOLDER . "/get_contacts_no_next.json");
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public static function getListsJson()
|
| 75 |
-
{
|
| 76 |
-
return file_get_contents(__DIR__ . self::LISTS_FOLDER . "/get_lists.json");
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public static function getListJson()
|
| 80 |
-
{
|
| 81 |
-
return file_get_contents(__DIR__ . self::LISTS_FOLDER . "/get_list.json");
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public static function getCampaignJson()
|
| 85 |
-
{
|
| 86 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/get_campaign.json");
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
public static function getCampaignsJson()
|
| 90 |
-
{
|
| 91 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/get_campaigns.json");
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
public static function getCampaignScheduleJson()
|
| 95 |
-
{
|
| 96 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/get_schedule.json");
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
public static function getCampaignSchedulesJson()
|
| 100 |
-
{
|
| 101 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/get_schedules.json");
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
public static function getTestSendJson()
|
| 105 |
-
{
|
| 106 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/post_test_send.json");
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
public static function getPreviewJson() {
|
| 110 |
-
return file_get_contents(__DIR__ . self::CAMPAIGNS_FOLDER . "/get_preview.json");
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
public static function getClicks()
|
| 114 |
-
{
|
| 115 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_clicks.json");
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
public static function getBounces()
|
| 119 |
-
{
|
| 120 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_bounces.json");
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
public static function getForwards()
|
| 124 |
-
{
|
| 125 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_forwards.json");
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
public static function getOptOuts()
|
| 129 |
-
{
|
| 130 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_opt_outs.json");
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
public static function getSends()
|
| 134 |
-
{
|
| 135 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_sends.json");
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
public static function getOpens()
|
| 139 |
-
{
|
| 140 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_opens.json");
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
public static function getSummary()
|
| 144 |
-
{
|
| 145 |
-
return file_get_contents(__DIR__ . self::CAMPAIGN_TRACKING_FOLDER . "/get_summary.json");
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
public static function getActivities()
|
| 149 |
-
{
|
| 150 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/get_activities.json");
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
public static function getActivity()
|
| 154 |
-
{
|
| 155 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/get_activity.json");
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
public static function getClearListsActivity()
|
| 159 |
-
{
|
| 160 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/post_clear_lists.json");
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
public static function getExportContactsActivity()
|
| 164 |
-
{
|
| 165 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/post_export_contacts.json");
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
public static function getRemoveContactsFromListsActivity()
|
| 169 |
-
{
|
| 170 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/post_remove_contacts_from_lists.json");
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
public static function getAddContactsActivity()
|
| 174 |
-
{
|
| 175 |
-
return file_get_contents(__DIR__ . self::ACTIVITIES_FOLDER . "/post_add_contacts.json");
|
| 176 |
-
}
|
| 177 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_file_upload_status.json
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
[
|
| 2 |
-
{
|
| 3 |
-
"file_id": "9",
|
| 4 |
-
"status": "Active",
|
| 5 |
-
"description":"Active"
|
| 6 |
-
}
|
| 7 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_file.json
DELETED
|
@@ -1,22 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "IMG_0261.JPG",
|
| 3 |
-
"id": "4",
|
| 4 |
-
"description": "chocolates",
|
| 5 |
-
"folder": "Images",
|
| 6 |
-
"height": 600,
|
| 7 |
-
"width": 800,
|
| 8 |
-
"size": 68825,
|
| 9 |
-
"url": "https://origin.ih.l1.constantcontact.com/fs115/1100310339939/img/4.jpg",
|
| 10 |
-
"source": "MyComputer",
|
| 11 |
-
"status": "Active",
|
| 12 |
-
"thumbnail": {
|
| 13 |
-
"url": "https://origin.ih.l1.constantcontact.com/fs115/1100310339939/img/4.jpg",
|
| 14 |
-
"height": 150,
|
| 15 |
-
"width": 200
|
| 16 |
-
},
|
| 17 |
-
"created_date": "2013-06-19T11:36:43.000-04:00",
|
| 18 |
-
"modified_date": "2013-08-23T12:54:17.000-04:00",
|
| 19 |
-
"folder_id": null,
|
| 20 |
-
"is_image": true,
|
| 21 |
-
"file_type": "JPG"
|
| 22 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_files.json
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/library/files?next=c023cmNlPUFsbCUiUmZzZXQ9MTgyIcV5cGU9QWxsJmxpbWl0PTE"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [{
|
| 8 |
-
"name": "Test_card.png",
|
| 9 |
-
"id": "182",
|
| 10 |
-
"description": "descriptionssss",
|
| 11 |
-
"folder": "Images",
|
| 12 |
-
"height": 360,
|
| 13 |
-
"width": 640,
|
| 14 |
-
"size": 26271,
|
| 15 |
-
"url": "https://mlsvc01-prod.s3.amazonaws.com/489270ef001/d738eefc-8e8e-4a69-8e7d-8e7217d22a0a.png",
|
| 16 |
-
"source": "MyComputer",
|
| 17 |
-
"status": "Active",
|
| 18 |
-
"thumbnail": {
|
| 19 |
-
"url": "https://mlsvc01-prod.s3.amazonaws.com/489270ef001/d738eefc-8e8e-4a69-8e7d-8e7217d22a0a.png",
|
| 20 |
-
"height": 112,
|
| 21 |
-
"width": 200
|
| 22 |
-
},
|
| 23 |
-
"created_date": "2015-01-09T00:14:08.000-05:00",
|
| 24 |
-
"modified_date": "2015-01-09T00:14:08.000-05:00",
|
| 25 |
-
"folder_id": null,
|
| 26 |
-
"is_image": true,
|
| 27 |
-
"file_type": "PNG"
|
| 28 |
-
}]
|
| 29 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_folder.json
DELETED
|
@@ -1,27 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": "-5",
|
| 3 |
-
"name": "Folder",
|
| 4 |
-
"level": 1,
|
| 5 |
-
"children": [{
|
| 6 |
-
"id": "-7",
|
| 7 |
-
"name": "SubFolder",
|
| 8 |
-
"level": 2,
|
| 9 |
-
"children": [],
|
| 10 |
-
"item_count": 0,
|
| 11 |
-
"parent_id": "-5",
|
| 12 |
-
"modified_date": "2014-08-04T11:40:36.000-04:00",
|
| 13 |
-
"created_date": "2014-08-04T11:40:36.000-04:00"
|
| 14 |
-
}, {
|
| 15 |
-
"id": "-6",
|
| 16 |
-
"name": "Sub-Folder",
|
| 17 |
-
"level": 2,
|
| 18 |
-
"children": [],
|
| 19 |
-
"item_count": 0,
|
| 20 |
-
"parent_id": "-5",
|
| 21 |
-
"modified_date": "2014-08-04T11:40:42.000-04:00",
|
| 22 |
-
"created_date": "2014-08-04T11:40:27.000-04:00"
|
| 23 |
-
}],
|
| 24 |
-
"item_count": 3,
|
| 25 |
-
"modified_date": "2013-09-09T14:25:44.000-04:00",
|
| 26 |
-
"created_date": "2013-09-09T14:25:44.000-04:00"
|
| 27 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Library/get_library_folders.json
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/library/folders?next=b2Zmc1V0PTzmbGltaJE9Mo"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [{
|
| 8 |
-
"id": "-5",
|
| 9 |
-
"name": "Folder",
|
| 10 |
-
"level": 1,
|
| 11 |
-
"children": [{
|
| 12 |
-
"id": "-7",
|
| 13 |
-
"name": "SubFolder",
|
| 14 |
-
"level": 2,
|
| 15 |
-
"children": [],
|
| 16 |
-
"item_count": 0,
|
| 17 |
-
"parent_id": "-5",
|
| 18 |
-
"modified_date": "2014-08-04T11:40:36.000-04:00",
|
| 19 |
-
"created_date": "2014-08-04T11:40:36.000-04:00"
|
| 20 |
-
}, {
|
| 21 |
-
"id": "-6",
|
| 22 |
-
"name": "Sub-Folder",
|
| 23 |
-
"level": 2,
|
| 24 |
-
"children": [],
|
| 25 |
-
"item_count": 0,
|
| 26 |
-
"parent_id": "-5",
|
| 27 |
-
"modified_date": "2014-08-04T11:40:42.000-04:00",
|
| 28 |
-
"created_date": "2014-08-04T11:40:27.000-04:00"
|
| 29 |
-
}],
|
| 30 |
-
"item_count": 3,
|
| 31 |
-
"modified_date": "2013-09-09T14:25:44.000-04:00",
|
| 32 |
-
"created_date": "2013-09-09T14:25:44.000-04:00"
|
| 33 |
-
}]
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Lists/get_list.json
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"id": 6,
|
| 3 |
-
"name": "Test List 4",
|
| 4 |
-
"status": "HIDDEN",
|
| 5 |
-
"contact_count": 19,
|
| 6 |
-
"opt_in_default": false
|
| 7 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Lists/get_lists.json
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
[
|
| 2 |
-
{
|
| 3 |
-
"id": 1,
|
| 4 |
-
"name": "General Interest",
|
| 5 |
-
"status": "ACTIVE",
|
| 6 |
-
"contact_count": 17,
|
| 7 |
-
"opt_in_default": false
|
| 8 |
-
},
|
| 9 |
-
{
|
| 10 |
-
"id": 3,
|
| 11 |
-
"name": "mod_Test List 1",
|
| 12 |
-
"status": "HIDDEN",
|
| 13 |
-
"contact_count": 18,
|
| 14 |
-
"opt_in_default": false
|
| 15 |
-
}
|
| 16 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_bounces.json
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/bounces?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_BOUNCE",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "2",
|
| 12 |
-
"email_address": "wizpie9dedde9dd27644bdb3d9be134b7294f71354817123188401000@snoopy.roving.com",
|
| 13 |
-
"bounce_code": "B",
|
| 14 |
-
"bounce_description": "Non-existent address",
|
| 15 |
-
"bounce_message": "",
|
| 16 |
-
"bounce_date": "2012-12-06T13:05:24.844Z"
|
| 17 |
-
},
|
| 18 |
-
{
|
| 19 |
-
"activity_type": "EMAIL_BOUNCE",
|
| 20 |
-
"campaign_id": 1100394165290,
|
| 21 |
-
"contact_id": "3",
|
| 22 |
-
"email_address": "wizpief9ed91eb16d84ecf84bd90317fceffdb1354817123188144000@snoopy.roving.com",
|
| 23 |
-
"bounce_code": "B",
|
| 24 |
-
"bounce_description": "Non-existent address",
|
| 25 |
-
"bounce_message": "",
|
| 26 |
-
"bounce_date": "2012-12-06T13:05:24.845Z"
|
| 27 |
-
}
|
| 28 |
-
]
|
| 29 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_clicks.json
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/clicks?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_CLICK",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "69",
|
| 12 |
-
"email_address": "wizpie00375ca0a11346a89aea4b8f5991d0d91354817217769892000@snoopy.roving.com",
|
| 13 |
-
"link_id": 0,
|
| 14 |
-
"click_date": "2012-12-06T13:07:01.701Z"
|
| 15 |
-
},
|
| 16 |
-
{
|
| 17 |
-
"activity_type": "EMAIL_CLICK",
|
| 18 |
-
"campaign_id": 1100394165290,
|
| 19 |
-
"contact_id": "68",
|
| 20 |
-
"email_address": "wizpiebfb0852b90d44412892276b68b949b7a1354817217770057000@snoopy.roving.com",
|
| 21 |
-
"link_id": 0,
|
| 22 |
-
"click_date": "2012-12-06T13:07:01.599Z"
|
| 23 |
-
}
|
| 24 |
-
]
|
| 25 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_forwards.json
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/forwards?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_FORWARD",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "74",
|
| 12 |
-
"email_address": "wizpie2ca3455df5c34a26806f519f01f8a22e1354817223114268000@snoopy.roving.com",
|
| 13 |
-
"forward_date": "2012-12-06T13:07:06.810Z"
|
| 14 |
-
},
|
| 15 |
-
{
|
| 16 |
-
"activity_type": "EMAIL_FORWARD",
|
| 17 |
-
"campaign_id": 1100394165290,
|
| 18 |
-
"contact_id": "74",
|
| 19 |
-
"email_address": "wizpie2ca3455df5c34a26806f519f01f8a22e1354817223114268000@snoopy.roving.com",
|
| 20 |
-
"forward_date": "2012-12-06T13:07:06.701Z"
|
| 21 |
-
}
|
| 22 |
-
]
|
| 23 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_opens.json
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/opens?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_OPEN",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "86",
|
| 12 |
-
"email_address": "wizpie9e19a6d35ec249efa8fc3085721aa61d1354817227762990000@snoopy.roving.com",
|
| 13 |
-
"open_date": "2012-12-06T13:07:11.839Z"
|
| 14 |
-
},
|
| 15 |
-
{
|
| 16 |
-
"activity_type": "EMAIL_OPEN",
|
| 17 |
-
"campaign_id": 1100394165290,
|
| 18 |
-
"contact_id": "85",
|
| 19 |
-
"email_address": "wizpie5b9fc124727546eeb8123d646acdb77d1354817227763138000@snoopy.roving.com",
|
| 20 |
-
"open_date": "2012-12-06T13:07:11.729Z"
|
| 21 |
-
}
|
| 22 |
-
]
|
| 23 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_opt_outs.json
DELETED
|
@@ -1,27 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/unsubscribes?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_UNSUBSCRIBE",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "58",
|
| 12 |
-
"email_address": "wizpieabd7817c1d0d4f08bb05f16f6681221c1354817211855027000@snoopy.roving.com",
|
| 13 |
-
"unsubscribe_date": "2012-12-06T13:06:53.440Z",
|
| 14 |
-
"unsubscribe_source": "ACTION_BY_CUSTOMER",
|
| 15 |
-
"unsubscribe_reason": ""
|
| 16 |
-
},
|
| 17 |
-
{
|
| 18 |
-
"activity_type": "EMAIL_UNSUBSCRIBE",
|
| 19 |
-
"campaign_id": 1100394165290,
|
| 20 |
-
"contact_id": "57",
|
| 21 |
-
"email_address": "wizpiebf0717c7ce95455fb7fa9bbfb1812a4e1354817211855058000@snoopy.roving.com",
|
| 22 |
-
"unsubscribe_date": "2012-12-06T13:06:53.333Z",
|
| 23 |
-
"unsubscribe_source": "ACTION_BY_CUSTOMER",
|
| 24 |
-
"unsubscribe_reason": ""
|
| 25 |
-
}
|
| 26 |
-
]
|
| 27 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_sends.json
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"meta": {
|
| 3 |
-
"pagination": {
|
| 4 |
-
"next_link": "/v2/emailcampaigns/1100394165290/tracking/sends?next=bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA"
|
| 5 |
-
}
|
| 6 |
-
},
|
| 7 |
-
"results": [
|
| 8 |
-
{
|
| 9 |
-
"activity_type": "EMAIL_SEND",
|
| 10 |
-
"campaign_id": 1100394165290,
|
| 11 |
-
"contact_id": "55",
|
| 12 |
-
"email_address": "wizpiea298d1c2500b4f2d8294300de4b29fe31354817207606824000@snoopy.roving.com",
|
| 13 |
-
"send_date": "2012-12-06T18:06:50.650Z"
|
| 14 |
-
},
|
| 15 |
-
{
|
| 16 |
-
"activity_type": "EMAIL_SEND",
|
| 17 |
-
"campaign_id": 1100394165290,
|
| 18 |
-
"contact_id": "56",
|
| 19 |
-
"email_address": "wizpie0d703ea133b1451c951c105aeb3190741354817207606848000@snoopy.roving.com",
|
| 20 |
-
"send_date": "2012-12-06T18:06:50.533Z"
|
| 21 |
-
},
|
| 22 |
-
{
|
| 23 |
-
"activity_type": "EMAIL_SEND",
|
| 24 |
-
"campaign_id": 1100394165290,
|
| 25 |
-
"contact_id": "53",
|
| 26 |
-
"email_address": "wizpie10262bf020494ad89b298d45a89b10b61354817207606880000@snoopy.roving.com",
|
| 27 |
-
"send_date": "2012-12-06T18:06:50.430Z"
|
| 28 |
-
}
|
| 29 |
-
]
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Json/Tracking/get_summary.json
DELETED
|
@@ -1,9 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"sends": 15,
|
| 3 |
-
"opens": 10,
|
| 4 |
-
"clicks": 10,
|
| 5 |
-
"forwards": 3,
|
| 6 |
-
"unsubscribes": 2,
|
| 7 |
-
"bounces": 18,
|
| 8 |
-
"campaign_id": 1100394165290
|
| 9 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/AccountServiceUnitTest.php
DELETED
|
@@ -1,62 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\Account\AccountInfo;
|
| 4 |
-
use Ctct\Components\Account\VerifiedEmailAddress;
|
| 5 |
-
use GuzzleHttp\Client;
|
| 6 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 7 |
-
use GuzzleHttp\Stream\Stream;
|
| 8 |
-
use GuzzleHttp\Message\Response;
|
| 9 |
-
|
| 10 |
-
class AccountServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 11 |
-
{
|
| 12 |
-
/**
|
| 13 |
-
* @var Client
|
| 14 |
-
*/
|
| 15 |
-
private static $client;
|
| 16 |
-
|
| 17 |
-
public static function setUpBeforeClass()
|
| 18 |
-
{
|
| 19 |
-
self::$client = new Client();
|
| 20 |
-
$verifiedAddressStream = Stream::factory(JsonLoader::getVerifiedAddressesJson());
|
| 21 |
-
$accountInfoStream = Stream::factory(JsonLoader::getAccountInfoJson());
|
| 22 |
-
$mock = new Mock([
|
| 23 |
-
new Response(200, array(), $verifiedAddressStream),
|
| 24 |
-
new Response(200, array(), $accountInfoStream)
|
| 25 |
-
]);
|
| 26 |
-
self::$client->getEmitter()->attach($mock);
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
public function testGetVerifiedAddresses() {
|
| 30 |
-
$response = self::$client->get('/');
|
| 31 |
-
$verifiedAddresses = array();
|
| 32 |
-
foreach ($response->json() as $verifiedAddress) {
|
| 33 |
-
$verifiedAddresses[] = VerifiedEmailAddress::create($verifiedAddress);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
foreach ($verifiedAddresses as $verifiedAddress) {
|
| 37 |
-
$this->assertInstanceOf('Ctct\Components\Account\VerifiedEmailAddress', $verifiedAddress);
|
| 38 |
-
$this->assertEquals("test123@roving.com", $verifiedAddress->email_address);
|
| 39 |
-
$this->assertEquals("CONFIRMED", $verifiedAddress->status);
|
| 40 |
-
}
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
public function testGetAccountInfo()
|
| 44 |
-
{
|
| 45 |
-
$response = self::$client->get('/');
|
| 46 |
-
$result = AccountInfo::create($response->json());
|
| 47 |
-
|
| 48 |
-
$this->assertInstanceOf('Ctct\Components\Account\AccountInfo', $result);
|
| 49 |
-
$this->assertEquals("http://www.example.com", $result->website);
|
| 50 |
-
$this->assertEquals("My Company", $result->organization_name);
|
| 51 |
-
$this->assertEquals("http://www.example.com", $result->website);
|
| 52 |
-
$this->assertEquals("My Company", $result->organization_name);
|
| 53 |
-
$this->assertEquals("US/Eastern", $result->time_zone);
|
| 54 |
-
$this->assertEquals("Mary Jane", $result->first_name);
|
| 55 |
-
$this->assertEquals("Doe", $result->last_name);
|
| 56 |
-
$this->assertEquals("mjdoe@example.com", $result->email);
|
| 57 |
-
$this->assertEquals("5555555555", $result->phone);
|
| 58 |
-
$this->assertEquals("https://ih.constantcontact.com/fs137/1100371573368/img/90.jpg", $result->company_logo);
|
| 59 |
-
$this->assertEquals("US", $result->country_code);
|
| 60 |
-
$this->assertEquals("MA", $result->state_code);
|
| 61 |
-
}
|
| 62 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/ActivityServiceUnitTest.php
DELETED
|
@@ -1,119 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
use Ctct\Components\Activities\Activity;
|
| 3 |
-
use GuzzleHttp\Client;
|
| 4 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
use GuzzleHttp\Message\Response;
|
| 7 |
-
|
| 8 |
-
class ActivityServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 9 |
-
{
|
| 10 |
-
/**
|
| 11 |
-
* @var Client
|
| 12 |
-
*/
|
| 13 |
-
private static $client;
|
| 14 |
-
|
| 15 |
-
public static function setUpBeforeClass()
|
| 16 |
-
{
|
| 17 |
-
self::$client = new Client();
|
| 18 |
-
$activityStream = Stream::factory(JsonLoader::getActivity());
|
| 19 |
-
$activitiesStream = Stream::factory(JsonLoader::getActivities());
|
| 20 |
-
$clearListActivityStream = Stream::factory(JsonLoader::getClearListsActivity());
|
| 21 |
-
$exportActivityStream = Stream::factory(JsonLoader::getExportContactsActivity());
|
| 22 |
-
$removeContactsFromListStream = Stream::factory(JsonLoader::getRemoveContactsFromListsActivity());
|
| 23 |
-
$addContactsStream = Stream::factory(JsonLoader::getAddContactsActivity());
|
| 24 |
-
$mock = new Mock([
|
| 25 |
-
new Response(200, array(), $activityStream),
|
| 26 |
-
new Response(200, array(), $activitiesStream),
|
| 27 |
-
new Response(201, array(), $clearListActivityStream),
|
| 28 |
-
new Response(201, array(), $exportActivityStream),
|
| 29 |
-
new Response(201, array(), $removeContactsFromListStream),
|
| 30 |
-
new Response(201, array(), $addContactsStream)
|
| 31 |
-
]);
|
| 32 |
-
self::$client->getEmitter()->attach($mock);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function testGetActivity()
|
| 36 |
-
{
|
| 37 |
-
$response = self::$client->get('/');
|
| 38 |
-
|
| 39 |
-
$activity = Activity::create($response->json());
|
| 40 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 41 |
-
$this->assertEquals("a07e1ikxyomhd4la0o9", $activity->id);
|
| 42 |
-
$this->assertEquals("REMOVE_CONTACTS_FROM_LISTS", $activity->type);
|
| 43 |
-
$this->assertEquals("COMPLETE", $activity->status);
|
| 44 |
-
$this->assertEquals("2013-02-13T14:43:01.635Z", $activity->start_date);
|
| 45 |
-
$this->assertEquals("2013-02-13T14:43:01.662Z", $activity->finish_date);
|
| 46 |
-
$this->assertEquals("2013-02-13T14:42:44.073Z", $activity->created_date);
|
| 47 |
-
$this->assertEquals(2, $activity->error_count);
|
| 48 |
-
$this->assertEquals(2, $activity->contact_count);
|
| 49 |
-
$this->assertEquals("test@roving.com (not found in subscriber list)", $activity->errors[0]->message);
|
| 50 |
-
$this->assertEquals(0, $activity->errors[0]->line_number);
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function testGetActivities()
|
| 54 |
-
{
|
| 55 |
-
$response = self::$client->get('/');
|
| 56 |
-
$activities = array();
|
| 57 |
-
foreach ($response->json() as $activityResponse) {
|
| 58 |
-
$activities[] = Activity::create($activityResponse);
|
| 59 |
-
}
|
| 60 |
-
$activity = $activities[0];
|
| 61 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 62 |
-
$this->assertEquals("a07e1ikxwuphd4nwjxl", $activity->id);
|
| 63 |
-
$this->assertEquals("EXPORT_CONTACTS", $activity->type);
|
| 64 |
-
$this->assertEquals("COMPLETE", $activity->status);
|
| 65 |
-
$this->assertEquals("2013-02-13T15:57:03.627Z", $activity->start_date);
|
| 66 |
-
$this->assertEquals("2013-02-13T15:57:03.649Z", $activity->finish_date);
|
| 67 |
-
$this->assertEquals("2013-02-13T15:56:14.697Z", $activity->created_date);
|
| 68 |
-
$this->assertEquals(0, $activity->error_count);
|
| 69 |
-
$this->assertEquals(0, $activity->contact_count);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function testAddClearListsActivity()
|
| 73 |
-
{
|
| 74 |
-
$response = self::$client->post('/');
|
| 75 |
-
|
| 76 |
-
$activity = Activity::create($response->json());
|
| 77 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 78 |
-
$this->assertEquals("a07e1il69fwhd7uan9h", $activity->id);
|
| 79 |
-
$this->assertEquals("CLEAR_CONTACTS_FROM_LISTS", $activity->type);
|
| 80 |
-
$this->assertEquals(0, $activity->error_count);
|
| 81 |
-
$this->assertEquals(0, $activity->contact_count);
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public function testAddExportContactsActivity()
|
| 85 |
-
{
|
| 86 |
-
$response = self::$client->post('/');
|
| 87 |
-
|
| 88 |
-
$activity = Activity::create($response->json());
|
| 89 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 90 |
-
$this->assertEquals("a07e1i5nqamhcfeuu0h", $activity->id);
|
| 91 |
-
$this->assertEquals("EXPORT_CONTACTS", $activity->type);
|
| 92 |
-
$this->assertEquals(0, $activity->error_count);
|
| 93 |
-
$this->assertEquals(0, $activity->contact_count);
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
public function testAddRemoveContactsFromListsActivity()
|
| 97 |
-
{
|
| 98 |
-
$response = self::$client->post('/');
|
| 99 |
-
|
| 100 |
-
$activity = Activity::create($response->json());
|
| 101 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 102 |
-
$this->assertEquals("a07e1i5nqamhcfeuu0h", $activity->id);
|
| 103 |
-
$this->assertEquals("REMOVE_CONTACTS_FROM_LISTS", $activity->type);
|
| 104 |
-
$this->assertEquals(0, $activity->error_count);
|
| 105 |
-
$this->assertEquals(0, $activity->contact_count);
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
public function testAddCreateContactsActivity()
|
| 109 |
-
{
|
| 110 |
-
$response = self::$client->post('/');
|
| 111 |
-
|
| 112 |
-
$activity = Activity::create($response->json());
|
| 113 |
-
$this->assertInstanceOf('Ctct\Components\Activities\Activity', $activity);
|
| 114 |
-
$this->assertEquals("a07e1il69qzhdby44ro", $activity->id);
|
| 115 |
-
$this->assertEquals("ADD_CONTACTS", $activity->type);
|
| 116 |
-
$this->assertEquals(0, $activity->error_count);
|
| 117 |
-
$this->assertEquals(1, $activity->contact_count);
|
| 118 |
-
}
|
| 119 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/CampaignScheduleServiceUnitTest.php
DELETED
|
@@ -1,113 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\EmailMarketing\Schedule;
|
| 4 |
-
use Ctct\Components\EmailMarketing\TestSend;
|
| 5 |
-
|
| 6 |
-
use GuzzleHttp\Client;
|
| 7 |
-
use GuzzleHttp\Exception\ClientException;
|
| 8 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 9 |
-
use GuzzleHttp\Stream\Stream;
|
| 10 |
-
use GuzzleHttp\Message\Response;
|
| 11 |
-
|
| 12 |
-
class CampaignScheduleServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 13 |
-
{
|
| 14 |
-
/**
|
| 15 |
-
* @var Client
|
| 16 |
-
*/
|
| 17 |
-
private static $client;
|
| 18 |
-
|
| 19 |
-
public static function setUpBeforeClass()
|
| 20 |
-
{
|
| 21 |
-
self::$client = new Client();
|
| 22 |
-
$schedulesStream = Stream::factory(JsonLoader::getCampaignSchedulesJson());
|
| 23 |
-
$scheduleStream = Stream::factory(JsonLoader::getCampaignScheduleJson());
|
| 24 |
-
$testSendStream = Stream::factory(JsonLoader::getTestSendJson());
|
| 25 |
-
$mock = new Mock([
|
| 26 |
-
new Response(200, array(), $schedulesStream),
|
| 27 |
-
new Response(200, array(), $scheduleStream),
|
| 28 |
-
new Response(201, array(), $scheduleStream),
|
| 29 |
-
new Response(200, array(), $scheduleStream),
|
| 30 |
-
new Response(204, array()),
|
| 31 |
-
new Response(400, array()),
|
| 32 |
-
new Response(200, array(), $testSendStream)
|
| 33 |
-
]);
|
| 34 |
-
self::$client->getEmitter()->attach($mock);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function testGetSchedules()
|
| 38 |
-
{
|
| 39 |
-
$response = self::$client->get('/');
|
| 40 |
-
|
| 41 |
-
$schedules = array();
|
| 42 |
-
foreach ($response->json() as $responseSchedule) {
|
| 43 |
-
$schedules[] = $responseSchedule;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
$schedule1 = Schedule::create($schedules[0]);
|
| 47 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Schedule', $schedule1);
|
| 48 |
-
$this->assertEquals(1, $schedule1->id);
|
| 49 |
-
$this->assertEquals("2012-12-16T11:07:43.626Z", $schedule1->scheduled_date);
|
| 50 |
-
|
| 51 |
-
$schedule2 = Schedule::create($schedules[1]);
|
| 52 |
-
$this->assertEquals(2, $schedule2->id);
|
| 53 |
-
$this->assertEquals("2012-12-17T11:08:00.000Z", $schedule2->scheduled_date);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
public function testGetSchedule()
|
| 57 |
-
{
|
| 58 |
-
$response = self::$client->get('/');
|
| 59 |
-
|
| 60 |
-
$schedule = Schedule::create($response->json());
|
| 61 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Schedule', $schedule);
|
| 62 |
-
$this->assertEquals(1, $schedule->id);
|
| 63 |
-
$this->assertEquals("2012-12-16T11:07:43.626Z", $schedule->scheduled_date);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testAddSchedule()
|
| 67 |
-
{
|
| 68 |
-
$response = self::$client->post('/');
|
| 69 |
-
|
| 70 |
-
$createdSchedule = Schedule::create($response->json());
|
| 71 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Schedule', $createdSchedule);
|
| 72 |
-
$this->assertEquals(1, $createdSchedule->id);
|
| 73 |
-
$this->assertEquals("2012-12-16T11:07:43.626Z", $createdSchedule->scheduled_date);
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function testUpdateSchedule()
|
| 77 |
-
{
|
| 78 |
-
$response = self::$client->put('/');
|
| 79 |
-
|
| 80 |
-
$updatedSchedule = Schedule::create($response->json());
|
| 81 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Schedule', $updatedSchedule);
|
| 82 |
-
$this->assertEquals(1, $updatedSchedule->id);
|
| 83 |
-
$this->assertEquals("2012-12-16T11:07:43.626Z", $updatedSchedule->scheduled_date);
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
public function testDeleteSchedule()
|
| 87 |
-
{
|
| 88 |
-
$response = self::$client->delete('/');
|
| 89 |
-
|
| 90 |
-
$this->assertEquals(204, $response->getStatusCode());
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
public function testDeleteScheduleFailed()
|
| 94 |
-
{
|
| 95 |
-
try {
|
| 96 |
-
self::$client->delete('/');
|
| 97 |
-
$this->fail("Call did not fail");
|
| 98 |
-
} catch (ClientException $e) {
|
| 99 |
-
$this->assertEquals(400, $e->getCode());
|
| 100 |
-
}
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
public function testSendTest()
|
| 104 |
-
{
|
| 105 |
-
$response = self::$client->post('/');
|
| 106 |
-
|
| 107 |
-
$testSend = TestSend::create($response->json());
|
| 108 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\TestSend', $testSend);
|
| 109 |
-
$this->assertEquals("HTML", $testSend->format);
|
| 110 |
-
$this->assertEquals("oh hai there", $testSend->personal_message);
|
| 111 |
-
$this->assertEquals("test@roving.com", $testSend->email_addresses[0]);
|
| 112 |
-
}
|
| 113 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/CampaignTrackingServiceUnitTest.php
DELETED
|
@@ -1,203 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\Tracking\BounceActivity;
|
| 5 |
-
use Ctct\Components\Tracking\ClickActivity;
|
| 6 |
-
use Ctct\Components\Tracking\ForwardActivity;
|
| 7 |
-
use Ctct\Components\Tracking\OpenActivity;
|
| 8 |
-
use Ctct\Components\Tracking\SendActivity;
|
| 9 |
-
use Ctct\Components\Tracking\TrackingSummary;
|
| 10 |
-
use Ctct\Components\Tracking\UnsubscribeActivity;
|
| 11 |
-
|
| 12 |
-
use GuzzleHttp\Client;
|
| 13 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 14 |
-
use GuzzleHttp\Stream\Stream;
|
| 15 |
-
use GuzzleHttp\Message\Response;
|
| 16 |
-
|
| 17 |
-
class CampaignTrackingServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @var Client
|
| 21 |
-
*/
|
| 22 |
-
private static $client;
|
| 23 |
-
|
| 24 |
-
public static function setUpBeforeClass()
|
| 25 |
-
{
|
| 26 |
-
self::$client = new Client();
|
| 27 |
-
$bouncesStream = Stream::factory(JsonLoader::getBounces());
|
| 28 |
-
$clicksStream = Stream::factory(JsonLoader::getClicks());
|
| 29 |
-
$forwardsStream = Stream::factory(JsonLoader::getForwards());
|
| 30 |
-
$unsubscribesStream = Stream::factory(JsonLoader::getOptOuts());
|
| 31 |
-
$sendsStream = Stream::factory(JsonLoader::getSends());
|
| 32 |
-
$opensStream = Stream::factory(JsonLoader::getOpens());
|
| 33 |
-
$summaryStream = Stream::factory(JsonLoader::getSummary());
|
| 34 |
-
$mock = new Mock([
|
| 35 |
-
new Response(200, array(), $bouncesStream),
|
| 36 |
-
new Response(200, array(), $clicksStream),
|
| 37 |
-
new Response(200, array(), $forwardsStream),
|
| 38 |
-
new Response(200, array(), $unsubscribesStream),
|
| 39 |
-
new Response(200, array(), $sendsStream),
|
| 40 |
-
new Response(200, array(), $opensStream),
|
| 41 |
-
new Response(200, array(), $summaryStream)
|
| 42 |
-
]);
|
| 43 |
-
self::$client->getEmitter()->attach($mock);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function testGetBounces()
|
| 47 |
-
{
|
| 48 |
-
$response = self::$client->get('/');
|
| 49 |
-
|
| 50 |
-
$responseJson = $response->json();
|
| 51 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 52 |
-
|
| 53 |
-
$bounceActivity = BounceActivity::create($resultSet->results[0]);
|
| 54 |
-
|
| 55 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 56 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\BounceActivity', $bounceActivity);
|
| 57 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 58 |
-
$this->assertEquals("EMAIL_BOUNCE", $bounceActivity->activity_type);
|
| 59 |
-
$this->assertEquals(1100394165290, $bounceActivity->campaign_id);
|
| 60 |
-
$this->assertEquals("2", $bounceActivity->contact_id);
|
| 61 |
-
$this->assertEquals(
|
| 62 |
-
"wizpie9dedde9dd27644bdb3d9be134b7294f71354817123188401000@snoopy.roving.com",
|
| 63 |
-
$bounceActivity->email_address
|
| 64 |
-
);
|
| 65 |
-
|
| 66 |
-
$this->assertEquals("B", $bounceActivity->bounce_code);
|
| 67 |
-
$this->assertEquals("Non-existent address", $bounceActivity->bounce_description);
|
| 68 |
-
$this->assertEquals("", $bounceActivity->bounce_message);
|
| 69 |
-
$this->assertEquals("2012-12-06T13:05:24.844Z", $bounceActivity->bounce_date);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function testGetClicks()
|
| 73 |
-
{
|
| 74 |
-
$response = self::$client->get('/');
|
| 75 |
-
|
| 76 |
-
$responseJson = $response->json();
|
| 77 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 78 |
-
|
| 79 |
-
$clickActivity = ClickActivity::create($resultSet->results[0]);
|
| 80 |
-
|
| 81 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 82 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\ClickActivity', $clickActivity);
|
| 83 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 84 |
-
$this->assertEquals("EMAIL_CLICK", $clickActivity->activity_type);
|
| 85 |
-
$this->assertEquals(1100394165290, $clickActivity->campaign_id);
|
| 86 |
-
$this->assertEquals("69", $clickActivity->contact_id);
|
| 87 |
-
$this->assertEquals(
|
| 88 |
-
"wizpie00375ca0a11346a89aea4b8f5991d0d91354817217769892000@snoopy.roving.com",
|
| 89 |
-
$clickActivity->email_address
|
| 90 |
-
);
|
| 91 |
-
|
| 92 |
-
$this->assertEquals(0, $clickActivity->link_id);
|
| 93 |
-
$this->assertEquals("2012-12-06T13:07:01.701Z", $clickActivity->click_date);
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
public function testGetForwards()
|
| 97 |
-
{
|
| 98 |
-
$response = self::$client->get('/');
|
| 99 |
-
|
| 100 |
-
$responseJson = $response->json();
|
| 101 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 102 |
-
|
| 103 |
-
$forwardActivity = ForwardActivity::create($resultSet->results[0]);
|
| 104 |
-
|
| 105 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 106 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\ForwardActivity', $forwardActivity);
|
| 107 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 108 |
-
$this->assertEquals("EMAIL_FORWARD", $forwardActivity->activity_type);
|
| 109 |
-
$this->assertEquals(1100394165290, $forwardActivity->campaign_id);
|
| 110 |
-
$this->assertEquals("74", $forwardActivity->contact_id);
|
| 111 |
-
$this->assertEquals(
|
| 112 |
-
"wizpie2ca3455df5c34a26806f519f01f8a22e1354817223114268000@snoopy.roving.com",
|
| 113 |
-
$forwardActivity->email_address
|
| 114 |
-
);
|
| 115 |
-
|
| 116 |
-
$this->assertEquals("2012-12-06T13:07:06.810Z", $forwardActivity->forward_date);
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
public function testGetUnsubscribes()
|
| 120 |
-
{
|
| 121 |
-
$response = self::$client->get('/');
|
| 122 |
-
|
| 123 |
-
$responseJson = $response->json();
|
| 124 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 125 |
-
|
| 126 |
-
$unsubscribeActivity = UnsubscribeActivity::create($resultSet->results[0]);
|
| 127 |
-
|
| 128 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 129 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\UnsubscribeActivity', $unsubscribeActivity);
|
| 130 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 131 |
-
$this->assertEquals("EMAIL_UNSUBSCRIBE", $unsubscribeActivity->activity_type);
|
| 132 |
-
$this->assertEquals(1100394165290, $unsubscribeActivity->campaign_id);
|
| 133 |
-
$this->assertEquals("58", $unsubscribeActivity->contact_id);
|
| 134 |
-
$this->assertEquals(
|
| 135 |
-
"wizpieabd7817c1d0d4f08bb05f16f6681221c1354817211855027000@snoopy.roving.com",
|
| 136 |
-
$unsubscribeActivity->email_address
|
| 137 |
-
);
|
| 138 |
-
|
| 139 |
-
$this->assertEquals("2012-12-06T13:06:53.440Z", $unsubscribeActivity->unsubscribe_date);
|
| 140 |
-
$this->assertEquals("ACTION_BY_CUSTOMER", $unsubscribeActivity->unsubscribe_source);
|
| 141 |
-
$this->assertEquals("", $unsubscribeActivity->unsubscribe_reason);
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
public function testGetSends()
|
| 145 |
-
{
|
| 146 |
-
$response = self::$client->get('/');
|
| 147 |
-
|
| 148 |
-
$responseJson = $response->json();
|
| 149 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 150 |
-
|
| 151 |
-
$sendActivity = SendActivity::create($resultSet->results[0]);
|
| 152 |
-
|
| 153 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 154 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\SendActivity', $sendActivity);
|
| 155 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 156 |
-
$this->assertEquals("EMAIL_SEND", $sendActivity->activity_type);
|
| 157 |
-
$this->assertEquals(1100394165290, $sendActivity->campaign_id);
|
| 158 |
-
$this->assertEquals("55", $sendActivity->contact_id);
|
| 159 |
-
$this->assertEquals(
|
| 160 |
-
"wizpiea298d1c2500b4f2d8294300de4b29fe31354817207606824000@snoopy.roving.com",
|
| 161 |
-
$sendActivity->email_address
|
| 162 |
-
);
|
| 163 |
-
|
| 164 |
-
$this->assertEquals("2012-12-06T18:06:50.650Z", $sendActivity->send_date);
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
public function testGetOpens()
|
| 168 |
-
{
|
| 169 |
-
$response = self::$client->get('/');
|
| 170 |
-
|
| 171 |
-
$responseJson = $response->json();
|
| 172 |
-
$resultSet = new ResultSet($responseJson['results'], $responseJson['meta']);
|
| 173 |
-
|
| 174 |
-
$openActivity = OpenActivity::create($resultSet->results[0]);
|
| 175 |
-
|
| 176 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 177 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\OpenActivity', $openActivity);
|
| 178 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 179 |
-
$this->assertEquals("EMAIL_OPEN", $openActivity->activity_type);
|
| 180 |
-
$this->assertEquals(1100394165290, $openActivity->campaign_id);
|
| 181 |
-
$this->assertEquals("86", $openActivity->contact_id);
|
| 182 |
-
$this->assertEquals(
|
| 183 |
-
"wizpie9e19a6d35ec249efa8fc3085721aa61d1354817227762990000@snoopy.roving.com",
|
| 184 |
-
$openActivity->email_address
|
| 185 |
-
);
|
| 186 |
-
|
| 187 |
-
$this->assertEquals("2012-12-06T13:07:11.839Z", $openActivity->open_date);
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
public function testGetSummary()
|
| 191 |
-
{
|
| 192 |
-
$response = self::$client->get('/');
|
| 193 |
-
|
| 194 |
-
$summary = TrackingSummary::create($response->json());
|
| 195 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\TrackingSummary', $summary);
|
| 196 |
-
$this->assertEquals(15, $summary->sends);
|
| 197 |
-
$this->assertEquals(10, $summary->opens);
|
| 198 |
-
$this->assertEquals(10, $summary->clicks);
|
| 199 |
-
$this->assertEquals(3, $summary->forwards);
|
| 200 |
-
$this->assertEquals(2, $summary->unsubscribes);
|
| 201 |
-
$this->assertEquals(18, $summary->bounces);
|
| 202 |
-
}
|
| 203 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/ContactServiceUnitTest.php
DELETED
|
@@ -1,353 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\Contacts\Contact;
|
| 5 |
-
|
| 6 |
-
use GuzzleHttp\Client;
|
| 7 |
-
use GuzzleHttp\Exception\ClientException;
|
| 8 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 9 |
-
use GuzzleHttp\Stream\Stream;
|
| 10 |
-
use GuzzleHttp\Message\Response;
|
| 11 |
-
|
| 12 |
-
class ContactServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 13 |
-
{
|
| 14 |
-
/**
|
| 15 |
-
* @var Client
|
| 16 |
-
*/
|
| 17 |
-
private static $client;
|
| 18 |
-
|
| 19 |
-
public static function setUpBeforeClass()
|
| 20 |
-
{
|
| 21 |
-
self::$client = new Client();
|
| 22 |
-
$contactsStream = Stream::factory(JsonLoader::getContactsJson());
|
| 23 |
-
$contactsNoNextStream = Stream::factory(JsonLoader::getContactsNoNextJson());
|
| 24 |
-
$contactStream = Stream::factory(JsonLoader::getContactJson());
|
| 25 |
-
$mock = new Mock([
|
| 26 |
-
new Response(200, array(), $contactsStream),
|
| 27 |
-
new Response(200, array(), $contactsNoNextStream),
|
| 28 |
-
new Response(200, array(), $contactStream),
|
| 29 |
-
new Response(201, array(), $contactStream),
|
| 30 |
-
new Response(204, array()),
|
| 31 |
-
new Response(400, array()),
|
| 32 |
-
new Response(200, array(), $contactStream)
|
| 33 |
-
]);
|
| 34 |
-
self::$client->getEmitter()->attach($mock);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function testGetContacts()
|
| 38 |
-
{
|
| 39 |
-
$response = self::$client->get('/')->json();
|
| 40 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 41 |
-
|
| 42 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 43 |
-
$this->assertEquals('c3RhcnRBdD0zJmxpbWl0PTI', $result->next);
|
| 44 |
-
|
| 45 |
-
$contact = Contact::create($result->results[1]);
|
| 46 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 47 |
-
$this->assertEquals(231, $contact->id);
|
| 48 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 49 |
-
$this->assertEquals("", $contact->fax);
|
| 50 |
-
$this->assertEquals("", $contact->prefix_name);
|
| 51 |
-
$this->assertEquals("Jimmy", $contact->first_name);
|
| 52 |
-
$this->assertEquals("Roving", $contact->last_name);
|
| 53 |
-
$this->assertEquals("Bear Tamer", $contact->job_title);
|
| 54 |
-
$this->assertEquals("Animal Trainer Pro", $contact->company_name);
|
| 55 |
-
$this->assertEquals("details", $contact->source_details);
|
| 56 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 57 |
-
$this->assertEquals("", $contact->source);
|
| 58 |
-
|
| 59 |
-
// custom fields
|
| 60 |
-
$customField = $contact->custom_fields[0];
|
| 61 |
-
$this->assertEquals("CustomField1", $customField->name);
|
| 62 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $customField);
|
| 63 |
-
$this->assertEquals("1", $customField->value);
|
| 64 |
-
|
| 65 |
-
//addresses
|
| 66 |
-
$address = $contact->addresses[0];
|
| 67 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $address);
|
| 68 |
-
$this->assertEquals("Suite 101", $address->line1);
|
| 69 |
-
$this->assertEquals("line2", $address->line2);
|
| 70 |
-
$this->assertEquals("line3", $address->line3);
|
| 71 |
-
$this->assertEquals("Brookfield", $address->city);
|
| 72 |
-
$this->assertEquals("PERSONAL", $address->address_type);
|
| 73 |
-
$this->assertEquals("WI", $address->state_code);
|
| 74 |
-
$this->assertEquals("us", $address->country_code);
|
| 75 |
-
$this->assertEquals("53027", $address->postal_code);
|
| 76 |
-
$this->assertEquals("", $address->sub_postal_code);
|
| 77 |
-
|
| 78 |
-
//notes
|
| 79 |
-
$this->assertEquals(0, count($contact->notes));
|
| 80 |
-
|
| 81 |
-
//lists
|
| 82 |
-
$this->assertEquals(1, $contact->lists[0]->id);
|
| 83 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 84 |
-
|
| 85 |
-
// EmailAddress
|
| 86 |
-
$emailAddress = $contact->email_addresses[0];
|
| 87 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $emailAddress);
|
| 88 |
-
$this->assertEquals("ACTIVE", $emailAddress->status);
|
| 89 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $emailAddress->confirm_status);
|
| 90 |
-
$this->assertEquals("ACTION_BY_OWNER", $emailAddress->opt_in_source);
|
| 91 |
-
$this->assertEquals("2012-06-22T10:29:09.976Z", $emailAddress->opt_in_date);
|
| 92 |
-
$this->assertEquals("", $emailAddress->opt_out_date);
|
| 93 |
-
$this->assertEquals("anothertest@roving.com", $emailAddress->email_address);
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
public function testGetContactsNoNextLink()
|
| 97 |
-
{
|
| 98 |
-
$response = self::$client->get('/')->json();
|
| 99 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 100 |
-
|
| 101 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 102 |
-
$this->assertEquals(null, $result->next);
|
| 103 |
-
|
| 104 |
-
$contact = Contact::create($result->results[1]);
|
| 105 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 106 |
-
$this->assertEquals(231, $contact->id);
|
| 107 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 108 |
-
$this->assertEquals("", $contact->fax);
|
| 109 |
-
$this->assertEquals("", $contact->prefix_name);
|
| 110 |
-
$this->assertEquals("Jimmy", $contact->first_name);
|
| 111 |
-
$this->assertEquals("Roving", $contact->last_name);
|
| 112 |
-
$this->assertEquals("Bear Tamer", $contact->job_title);
|
| 113 |
-
$this->assertEquals("Animal Trainer Pro", $contact->company_name);
|
| 114 |
-
$this->assertEquals("details", $contact->source_details);
|
| 115 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 116 |
-
$this->assertEquals("", $contact->source);
|
| 117 |
-
|
| 118 |
-
// custom fields
|
| 119 |
-
$customField = $contact->custom_fields[0];
|
| 120 |
-
$this->assertEquals("CustomField1", $customField->name);
|
| 121 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $customField);
|
| 122 |
-
$this->assertEquals("1", $customField->value);
|
| 123 |
-
|
| 124 |
-
//addresses
|
| 125 |
-
$address = $contact->addresses[0];
|
| 126 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $address);
|
| 127 |
-
$this->assertEquals("Suite 101", $address->line1);
|
| 128 |
-
$this->assertEquals("line2", $address->line2);
|
| 129 |
-
$this->assertEquals("line3", $address->line3);
|
| 130 |
-
$this->assertEquals("Brookfield", $address->city);
|
| 131 |
-
$this->assertEquals("PERSONAL", $address->address_type);
|
| 132 |
-
$this->assertEquals("WI", $address->state_code);
|
| 133 |
-
$this->assertEquals("us", $address->country_code);
|
| 134 |
-
$this->assertEquals("53027", $address->postal_code);
|
| 135 |
-
$this->assertEquals("", $address->sub_postal_code);
|
| 136 |
-
|
| 137 |
-
//notes
|
| 138 |
-
$this->assertEquals(0, count($contact->notes));
|
| 139 |
-
|
| 140 |
-
//lists
|
| 141 |
-
$this->assertEquals(1, $contact->lists[0]->id);
|
| 142 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 143 |
-
|
| 144 |
-
// EmailAddress
|
| 145 |
-
$emailAddress = $contact->email_addresses[0];
|
| 146 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $emailAddress);
|
| 147 |
-
$this->assertEquals("ACTIVE", $emailAddress->status);
|
| 148 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $emailAddress->confirm_status);
|
| 149 |
-
$this->assertEquals("ACTION_BY_OWNER", $emailAddress->opt_in_source);
|
| 150 |
-
$this->assertEquals("2012-06-22T10:29:09.976Z", $emailAddress->opt_in_date);
|
| 151 |
-
$this->assertEquals("", $emailAddress->opt_out_date);
|
| 152 |
-
$this->assertEquals("anothertest@roving.com", $emailAddress->email_address);
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
public function testGetContact()
|
| 156 |
-
{
|
| 157 |
-
$response = self::$client->get('/');
|
| 158 |
-
|
| 159 |
-
$contact = Contact::create($response->json());
|
| 160 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 161 |
-
$this->assertEquals(238, $contact->id);
|
| 162 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 163 |
-
$this->assertEquals("555-1212", $contact->fax);
|
| 164 |
-
$this->assertEquals("Mr.", $contact->prefix_name);
|
| 165 |
-
$this->assertEquals("John", $contact->first_name);
|
| 166 |
-
$this->assertEquals("Smith", $contact->last_name);
|
| 167 |
-
$this->assertEquals("Software Engineer", $contact->job_title);
|
| 168 |
-
$this->assertEquals("Constant Contact", $contact->company_name);
|
| 169 |
-
$this->assertEquals("555-1212", $contact->home_phone);
|
| 170 |
-
$this->assertEquals("555-1213", $contact->work_phone);
|
| 171 |
-
$this->assertEquals("555-1214", $contact->cell_phone);
|
| 172 |
-
$this->assertEquals("69f9d72b-0a5e-479d-b844-722b1da9595f", $contact->source_details);
|
| 173 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 174 |
-
$this->assertEquals("API", $contact->source);
|
| 175 |
-
|
| 176 |
-
// custom fields
|
| 177 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $contact->custom_fields[0]);
|
| 178 |
-
$this->assertEquals("CustomField1", $contact->custom_fields[0]->name);
|
| 179 |
-
$this->assertEquals("3/28/2011 11:09 AM EDT", $contact->custom_fields[0]->value);
|
| 180 |
-
$this->assertEquals("CustomField2", $contact->custom_fields[1]->name);
|
| 181 |
-
$this->assertEquals("Site owner", $contact->custom_fields[1]->value);
|
| 182 |
-
|
| 183 |
-
//addresses
|
| 184 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $contact->addresses[0]);
|
| 185 |
-
$this->assertEquals("1601 Trapelo Rd", $contact->addresses[0]->line1);
|
| 186 |
-
$this->assertEquals("Suite 329", $contact->addresses[0]->line2);
|
| 187 |
-
$this->assertEquals("Line 3", $contact->addresses[0]->line3);
|
| 188 |
-
$this->assertEquals("Waltham", $contact->addresses[0]->city);
|
| 189 |
-
$this->assertEquals("PERSONAL", $contact->addresses[0]->address_type);
|
| 190 |
-
$this->assertEquals("MA", $contact->addresses[0]->state_code);
|
| 191 |
-
$this->assertEquals("us", $contact->addresses[0]->country_code);
|
| 192 |
-
$this->assertEquals("01720", $contact->addresses[0]->postal_code);
|
| 193 |
-
$this->assertEquals("7885", $contact->addresses[0]->sub_postal_code);
|
| 194 |
-
|
| 195 |
-
//notes
|
| 196 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Note', $contact->notes[0]);
|
| 197 |
-
$this->assertEquals(1, $contact->notes[0]->id);
|
| 198 |
-
$this->assertEquals("Here are some cool notes to add", $contact->notes[0]->note);
|
| 199 |
-
$this->assertEquals("2012-12-03T17:09:22.702Z", $contact->notes[0]->created_date);
|
| 200 |
-
|
| 201 |
-
//lists
|
| 202 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $contact->lists[0]);
|
| 203 |
-
$this->assertEquals(9, $contact->lists[0]->id);
|
| 204 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 205 |
-
|
| 206 |
-
// EmailAddress
|
| 207 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $contact->email_addresses[0]);
|
| 208 |
-
$this->assertEquals("ACTIVE", $contact->email_addresses[0]->status);
|
| 209 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $contact->email_addresses[0]->confirm_status);
|
| 210 |
-
$this->assertEquals("ACTION_BY_VISITOR", $contact->email_addresses[0]->opt_in_source);
|
| 211 |
-
$this->assertEquals("2012-09-17T14:40:41.271Z", $contact->email_addresses[0]->opt_in_date);
|
| 212 |
-
$this->assertEquals("2012-03-29T14:59:25.427Z", $contact->email_addresses[0]->opt_out_date);
|
| 213 |
-
$this->assertEquals("john+smith@gmail.com", $contact->email_addresses[0]->email_address);
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
public function testAddContact()
|
| 217 |
-
{
|
| 218 |
-
$response = self::$client->post('/');
|
| 219 |
-
|
| 220 |
-
$contact = Contact::create($response->json());
|
| 221 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 222 |
-
$this->assertEquals(238, $contact->id);
|
| 223 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 224 |
-
$this->assertEquals("555-1212", $contact->fax);
|
| 225 |
-
$this->assertEquals("Mr.", $contact->prefix_name);
|
| 226 |
-
$this->assertEquals("John", $contact->first_name);
|
| 227 |
-
$this->assertEquals("Smith", $contact->last_name);
|
| 228 |
-
$this->assertEquals("Software Engineer", $contact->job_title);
|
| 229 |
-
$this->assertEquals("Constant Contact", $contact->company_name);
|
| 230 |
-
$this->assertEquals("555-1212", $contact->home_phone);
|
| 231 |
-
$this->assertEquals("555-1213", $contact->work_phone);
|
| 232 |
-
$this->assertEquals("555-1214", $contact->cell_phone);
|
| 233 |
-
$this->assertEquals("69f9d72b-0a5e-479d-b844-722b1da9595f", $contact->source_details);
|
| 234 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 235 |
-
$this->assertEquals("API", $contact->source);
|
| 236 |
-
|
| 237 |
-
// custom fields
|
| 238 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $contact->custom_fields[0]);
|
| 239 |
-
$this->assertEquals("CustomField1", $contact->custom_fields[0]->name);
|
| 240 |
-
$this->assertEquals("3/28/2011 11:09 AM EDT", $contact->custom_fields[0]->value);
|
| 241 |
-
$this->assertEquals("CustomField2", $contact->custom_fields[1]->name);
|
| 242 |
-
$this->assertEquals("Site owner", $contact->custom_fields[1]->value);
|
| 243 |
-
|
| 244 |
-
//addresses
|
| 245 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $contact->addresses[0]);
|
| 246 |
-
$this->assertEquals("1601 Trapelo Rd", $contact->addresses[0]->line1);
|
| 247 |
-
$this->assertEquals("Suite 329", $contact->addresses[0]->line2);
|
| 248 |
-
$this->assertEquals("Line 3", $contact->addresses[0]->line3);
|
| 249 |
-
$this->assertEquals("Waltham", $contact->addresses[0]->city);
|
| 250 |
-
$this->assertEquals("PERSONAL", $contact->addresses[0]->address_type);
|
| 251 |
-
$this->assertEquals("MA", $contact->addresses[0]->state_code);
|
| 252 |
-
$this->assertEquals("us", $contact->addresses[0]->country_code);
|
| 253 |
-
$this->assertEquals("01720", $contact->addresses[0]->postal_code);
|
| 254 |
-
$this->assertEquals("7885", $contact->addresses[0]->sub_postal_code);
|
| 255 |
-
|
| 256 |
-
//notes
|
| 257 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Note', $contact->notes[0]);
|
| 258 |
-
$this->assertEquals(1, $contact->notes[0]->id);
|
| 259 |
-
$this->assertEquals("Here are some cool notes to add", $contact->notes[0]->note);
|
| 260 |
-
$this->assertEquals("2012-12-03T17:09:22.702Z", $contact->notes[0]->created_date);
|
| 261 |
-
|
| 262 |
-
//lists
|
| 263 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $contact->lists[0]);
|
| 264 |
-
$this->assertEquals(9, $contact->lists[0]->id);
|
| 265 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 266 |
-
|
| 267 |
-
// EmailAddress
|
| 268 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $contact->email_addresses[0]);
|
| 269 |
-
$this->assertEquals("ACTIVE", $contact->email_addresses[0]->status);
|
| 270 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $contact->email_addresses[0]->confirm_status);
|
| 271 |
-
$this->assertEquals("ACTION_BY_VISITOR", $contact->email_addresses[0]->opt_in_source);
|
| 272 |
-
$this->assertEquals("2012-09-17T14:40:41.271Z", $contact->email_addresses[0]->opt_in_date);
|
| 273 |
-
$this->assertEquals("2012-03-29T14:59:25.427Z", $contact->email_addresses[0]->opt_out_date);
|
| 274 |
-
$this->assertEquals("john+smith@gmail.com", $contact->email_addresses[0]->email_address);
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
public function testDeleteContact()
|
| 278 |
-
{
|
| 279 |
-
$response = self::$client->delete('/');
|
| 280 |
-
|
| 281 |
-
$this->assertEquals(204, $response->getStatusCode());
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
public function testDeleteContactFailed() {
|
| 285 |
-
try {
|
| 286 |
-
self::$client->delete('/');
|
| 287 |
-
$this->fail("Delete call didn't fail");
|
| 288 |
-
} catch (ClientException $e) {
|
| 289 |
-
$this->assertEquals(400, $e->getCode());
|
| 290 |
-
}
|
| 291 |
-
}
|
| 292 |
-
|
| 293 |
-
public function testUpdateContact()
|
| 294 |
-
{
|
| 295 |
-
$response = self::$client->put('/');
|
| 296 |
-
|
| 297 |
-
$contact = Contact::create($response->json());
|
| 298 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 299 |
-
$this->assertEquals(238, $contact->id);
|
| 300 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 301 |
-
$this->assertEquals("555-1212", $contact->fax);
|
| 302 |
-
$this->assertEquals("Mr.", $contact->prefix_name);
|
| 303 |
-
$this->assertEquals("John", $contact->first_name);
|
| 304 |
-
$this->assertEquals("Smith", $contact->last_name);
|
| 305 |
-
$this->assertEquals("Software Engineer", $contact->job_title);
|
| 306 |
-
$this->assertEquals("Constant Contact", $contact->company_name);
|
| 307 |
-
$this->assertEquals("555-1212", $contact->home_phone);
|
| 308 |
-
$this->assertEquals("555-1213", $contact->work_phone);
|
| 309 |
-
$this->assertEquals("555-1214", $contact->cell_phone);
|
| 310 |
-
$this->assertEquals("69f9d72b-0a5e-479d-b844-722b1da9595f", $contact->source_details);
|
| 311 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 312 |
-
$this->assertEquals("API", $contact->source);
|
| 313 |
-
|
| 314 |
-
// custom fields
|
| 315 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $contact->custom_fields[0]);
|
| 316 |
-
$this->assertEquals("CustomField1", $contact->custom_fields[0]->name);
|
| 317 |
-
$this->assertEquals("3/28/2011 11:09 AM EDT", $contact->custom_fields[0]->value);
|
| 318 |
-
$this->assertEquals("CustomField2", $contact->custom_fields[1]->name);
|
| 319 |
-
$this->assertEquals("Site owner", $contact->custom_fields[1]->value);
|
| 320 |
-
|
| 321 |
-
//addresses
|
| 322 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $contact->addresses[0]);
|
| 323 |
-
$this->assertEquals("1601 Trapelo Rd", $contact->addresses[0]->line1);
|
| 324 |
-
$this->assertEquals("Suite 329", $contact->addresses[0]->line2);
|
| 325 |
-
$this->assertEquals("Line 3", $contact->addresses[0]->line3);
|
| 326 |
-
$this->assertEquals("Waltham", $contact->addresses[0]->city);
|
| 327 |
-
$this->assertEquals("PERSONAL", $contact->addresses[0]->address_type);
|
| 328 |
-
$this->assertEquals("MA", $contact->addresses[0]->state_code);
|
| 329 |
-
$this->assertEquals("us", $contact->addresses[0]->country_code);
|
| 330 |
-
$this->assertEquals("01720", $contact->addresses[0]->postal_code);
|
| 331 |
-
$this->assertEquals("7885", $contact->addresses[0]->sub_postal_code);
|
| 332 |
-
|
| 333 |
-
//notes
|
| 334 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Note', $contact->notes[0]);
|
| 335 |
-
$this->assertEquals(1, $contact->notes[0]->id);
|
| 336 |
-
$this->assertEquals("Here are some cool notes to add", $contact->notes[0]->note);
|
| 337 |
-
$this->assertEquals("2012-12-03T17:09:22.702Z", $contact->notes[0]->created_date);
|
| 338 |
-
|
| 339 |
-
//lists
|
| 340 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $contact->lists[0]);
|
| 341 |
-
$this->assertEquals(9, $contact->lists[0]->id);
|
| 342 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 343 |
-
|
| 344 |
-
// EmailAddress
|
| 345 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $contact->email_addresses[0]);
|
| 346 |
-
$this->assertEquals("ACTIVE", $contact->email_addresses[0]->status);
|
| 347 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $contact->email_addresses[0]->confirm_status);
|
| 348 |
-
$this->assertEquals("ACTION_BY_VISITOR", $contact->email_addresses[0]->opt_in_source);
|
| 349 |
-
$this->assertEquals("2012-09-17T14:40:41.271Z", $contact->email_addresses[0]->opt_in_date);
|
| 350 |
-
$this->assertEquals("2012-03-29T14:59:25.427Z", $contact->email_addresses[0]->opt_out_date);
|
| 351 |
-
$this->assertEquals("john+smith@gmail.com", $contact->email_addresses[0]->email_address);
|
| 352 |
-
}
|
| 353 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/ContactTrackingServiceUnitTest.php
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\Tracking\BounceActivity;
|
| 5 |
-
use Ctct\Components\Tracking\ClickActivity;
|
| 6 |
-
use Ctct\Components\Tracking\ForwardActivity;
|
| 7 |
-
use Ctct\Components\Tracking\UnsubscribeActivity;
|
| 8 |
-
use Ctct\Components\Tracking\SendActivity;
|
| 9 |
-
use Ctct\Components\Tracking\OpenActivity;
|
| 10 |
-
use Ctct\Components\Tracking\TrackingSummary;
|
| 11 |
-
|
| 12 |
-
use GuzzleHttp\Client;
|
| 13 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 14 |
-
use GuzzleHttp\Stream\Stream;
|
| 15 |
-
use GuzzleHttp\Message\Response;
|
| 16 |
-
|
| 17 |
-
class ContactTrackingServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @var Client
|
| 21 |
-
*/
|
| 22 |
-
private static $client;
|
| 23 |
-
|
| 24 |
-
public static function setUpBeforeClass()
|
| 25 |
-
{
|
| 26 |
-
self::$client = new Client();
|
| 27 |
-
$getBouncesStream = Stream::factory(JsonLoader::getBounces());
|
| 28 |
-
$getClicksStream = Stream::factory(JsonLoader::getClicks());
|
| 29 |
-
$getForwardsStream = Stream::factory(JsonLoader::getForwards());
|
| 30 |
-
$getUnsubscribesStream = Stream::factory(JsonLoader::getOptOuts());
|
| 31 |
-
$getSendsStream = Stream::factory(JsonLoader::getSends());
|
| 32 |
-
$getOpensStream = Stream::factory(JsonLoader::getOpens());
|
| 33 |
-
$getSummaryStream = Stream::factory(JsonLoader::getSummary());
|
| 34 |
-
$mock = new Mock([
|
| 35 |
-
new Response(200, array(), $getBouncesStream),
|
| 36 |
-
new Response(200, array(), $getClicksStream),
|
| 37 |
-
new Response(200, array(), $getForwardsStream),
|
| 38 |
-
new Response(200, array(), $getUnsubscribesStream),
|
| 39 |
-
new Response(200, array(), $getSendsStream),
|
| 40 |
-
new Response(200, array(), $getOpensStream),
|
| 41 |
-
new Response(200, array(), $getSummaryStream)
|
| 42 |
-
]);
|
| 43 |
-
self::$client->getEmitter()->attach($mock);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function testGetBounces()
|
| 47 |
-
{
|
| 48 |
-
$response = self::$client->get('/')->json();
|
| 49 |
-
|
| 50 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 51 |
-
$bounceActivity = BounceActivity::create($resultSet->results[0]);
|
| 52 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 53 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\BounceActivity', $bounceActivity);
|
| 54 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 55 |
-
$this->assertEquals("EMAIL_BOUNCE", $bounceActivity->activity_type);
|
| 56 |
-
$this->assertEquals(1100394165290, $bounceActivity->campaign_id);
|
| 57 |
-
$this->assertEquals("2", $bounceActivity->contact_id);
|
| 58 |
-
$this->assertEquals(
|
| 59 |
-
"wizpie9dedde9dd27644bdb3d9be134b7294f71354817123188401000@snoopy.roving.com",
|
| 60 |
-
$bounceActivity->email_address
|
| 61 |
-
);
|
| 62 |
-
|
| 63 |
-
$this->assertEquals("B", $bounceActivity->bounce_code);
|
| 64 |
-
$this->assertEquals("Non-existent address", $bounceActivity->bounce_description);
|
| 65 |
-
$this->assertEquals("", $bounceActivity->bounce_message);
|
| 66 |
-
$this->assertEquals("2012-12-06T13:05:24.844Z", $bounceActivity->bounce_date);
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
public function testGetClicks()
|
| 70 |
-
{
|
| 71 |
-
$response = self::$client->get('/')->json();
|
| 72 |
-
|
| 73 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 74 |
-
$clickActivity = ClickActivity::create($resultSet->results[0]);
|
| 75 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 76 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\ClickActivity', $clickActivity);
|
| 77 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 78 |
-
$this->assertEquals("EMAIL_CLICK", $clickActivity->activity_type);
|
| 79 |
-
$this->assertEquals(1100394165290, $clickActivity->campaign_id);
|
| 80 |
-
$this->assertEquals("69", $clickActivity->contact_id);
|
| 81 |
-
$this->assertEquals(
|
| 82 |
-
"wizpie00375ca0a11346a89aea4b8f5991d0d91354817217769892000@snoopy.roving.com",
|
| 83 |
-
$clickActivity->email_address
|
| 84 |
-
);
|
| 85 |
-
|
| 86 |
-
$this->assertEquals(0, $clickActivity->link_id);
|
| 87 |
-
$this->assertEquals("2012-12-06T13:07:01.701Z", $clickActivity->click_date);
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
public function testGetForwards()
|
| 91 |
-
{
|
| 92 |
-
$response = self::$client->get('/')->json();
|
| 93 |
-
|
| 94 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 95 |
-
$forwardActivity = ForwardActivity::create($resultSet->results[0]);
|
| 96 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 97 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\ForwardActivity', $forwardActivity);
|
| 98 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 99 |
-
$this->assertEquals("EMAIL_FORWARD", $forwardActivity->activity_type);
|
| 100 |
-
$this->assertEquals(1100394165290, $forwardActivity->campaign_id);
|
| 101 |
-
$this->assertEquals("74", $forwardActivity->contact_id);
|
| 102 |
-
$this->assertEquals(
|
| 103 |
-
"wizpie2ca3455df5c34a26806f519f01f8a22e1354817223114268000@snoopy.roving.com",
|
| 104 |
-
$forwardActivity->email_address
|
| 105 |
-
);
|
| 106 |
-
|
| 107 |
-
$this->assertEquals("2012-12-06T13:07:06.810Z", $forwardActivity->forward_date);
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
public function testGetUnsubscribes()
|
| 111 |
-
{
|
| 112 |
-
$response = self::$client->get('/')->json();
|
| 113 |
-
|
| 114 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 115 |
-
$unsubscribeActivity = UnsubscribeActivity::create($resultSet->results[0]);
|
| 116 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 117 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\UnsubscribeActivity', $unsubscribeActivity);
|
| 118 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 119 |
-
$this->assertEquals("EMAIL_UNSUBSCRIBE", $unsubscribeActivity->activity_type);
|
| 120 |
-
$this->assertEquals(1100394165290, $unsubscribeActivity->campaign_id);
|
| 121 |
-
$this->assertEquals("58", $unsubscribeActivity->contact_id);
|
| 122 |
-
$this->assertEquals(
|
| 123 |
-
"wizpieabd7817c1d0d4f08bb05f16f6681221c1354817211855027000@snoopy.roving.com",
|
| 124 |
-
$unsubscribeActivity->email_address
|
| 125 |
-
);
|
| 126 |
-
|
| 127 |
-
$this->assertEquals("2012-12-06T13:06:53.440Z", $unsubscribeActivity->unsubscribe_date);
|
| 128 |
-
$this->assertEquals("ACTION_BY_CUSTOMER", $unsubscribeActivity->unsubscribe_source);
|
| 129 |
-
$this->assertEquals("", $unsubscribeActivity->unsubscribe_reason);
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
public function testGetSends()
|
| 133 |
-
{
|
| 134 |
-
$response = self::$client->get('/')->json();
|
| 135 |
-
|
| 136 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 137 |
-
$sendActivity = SendActivity::create($resultSet->results[0]);
|
| 138 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 139 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\SendActivity', $sendActivity);
|
| 140 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 141 |
-
$this->assertEquals("EMAIL_SEND", $sendActivity->activity_type);
|
| 142 |
-
$this->assertEquals(1100394165290, $sendActivity->campaign_id);
|
| 143 |
-
$this->assertEquals("55", $sendActivity->contact_id);
|
| 144 |
-
$this->assertEquals(
|
| 145 |
-
"wizpiea298d1c2500b4f2d8294300de4b29fe31354817207606824000@snoopy.roving.com",
|
| 146 |
-
$sendActivity->email_address
|
| 147 |
-
);
|
| 148 |
-
|
| 149 |
-
$this->assertEquals("2012-12-06T18:06:50.650Z", $sendActivity->send_date);
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
public function testGetOpens()
|
| 153 |
-
{
|
| 154 |
-
$response = self::$client->get('/')->json();
|
| 155 |
-
|
| 156 |
-
$resultSet = new ResultSet($response['results'], $response['meta']);
|
| 157 |
-
$openActivity = OpenActivity::create($resultSet->results[0]);
|
| 158 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $resultSet);
|
| 159 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\OpenActivity', $openActivity);
|
| 160 |
-
$this->assertEquals("bGltaXQ9MyZuZXh0PTEzNTQ4MTcyMTA0MzA", $resultSet->next);
|
| 161 |
-
$this->assertEquals("EMAIL_OPEN", $openActivity->activity_type);
|
| 162 |
-
$this->assertEquals(1100394165290, $openActivity->campaign_id);
|
| 163 |
-
$this->assertEquals("86", $openActivity->contact_id);
|
| 164 |
-
$this->assertEquals(
|
| 165 |
-
"wizpie9e19a6d35ec249efa8fc3085721aa61d1354817227762990000@snoopy.roving.com",
|
| 166 |
-
$openActivity->email_address
|
| 167 |
-
);
|
| 168 |
-
|
| 169 |
-
$this->assertEquals("2012-12-06T13:07:11.839Z", $openActivity->open_date);
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
public function testGetSummary()
|
| 173 |
-
{
|
| 174 |
-
$response = self::$client->get('/');
|
| 175 |
-
|
| 176 |
-
$summary = TrackingSummary::create($response->json());
|
| 177 |
-
$this->assertInstanceOf('Ctct\Components\Tracking\TrackingSummary', $summary);
|
| 178 |
-
$this->assertEquals(15, $summary->sends);
|
| 179 |
-
$this->assertEquals(10, $summary->opens);
|
| 180 |
-
$this->assertEquals(10, $summary->clicks);
|
| 181 |
-
$this->assertEquals(3, $summary->forwards);
|
| 182 |
-
$this->assertEquals(2, $summary->unsubscribes);
|
| 183 |
-
$this->assertEquals(18, $summary->bounces);
|
| 184 |
-
}
|
| 185 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/EmailCampaignServiceUnitTest.php
DELETED
|
@@ -1,291 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\EmailMarketing\Campaign;
|
| 5 |
-
use Ctct\Components\EmailMarketing\CampaignPreview;
|
| 6 |
-
|
| 7 |
-
use GuzzleHttp\Client;
|
| 8 |
-
use GuzzleHttp\Exception\ClientException;
|
| 9 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 10 |
-
use GuzzleHttp\Stream\Stream;
|
| 11 |
-
use GuzzleHttp\Message\Response;
|
| 12 |
-
|
| 13 |
-
class EmailMarketingServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 14 |
-
{
|
| 15 |
-
/**
|
| 16 |
-
* @var Client
|
| 17 |
-
*/
|
| 18 |
-
private static $client;
|
| 19 |
-
|
| 20 |
-
public static function setUpBeforeClass()
|
| 21 |
-
{
|
| 22 |
-
self::$client = new Client();
|
| 23 |
-
$getCampaignsStream = Stream::factory(JsonLoader::getCampaignsJson());
|
| 24 |
-
$getCampaignStream = Stream::factory(JsonLoader::getCampaignJson());
|
| 25 |
-
$getPreviewStream = Stream::factory(JsonLoader::getPreviewJson());
|
| 26 |
-
$mock = new Mock([
|
| 27 |
-
new Response(200, array(), $getCampaignsStream),
|
| 28 |
-
new Response(204, array()),
|
| 29 |
-
new Response(400, array()),
|
| 30 |
-
new Response(200, array(), $getCampaignStream),
|
| 31 |
-
new Response(201, array(), $getCampaignStream),
|
| 32 |
-
new Response(200, array(), $getCampaignStream),
|
| 33 |
-
new Response(200, array(), $getPreviewStream)
|
| 34 |
-
]);
|
| 35 |
-
self::$client->getEmitter()->attach($mock);
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
public function testGetCampaigns()
|
| 39 |
-
{
|
| 40 |
-
$response = self::$client->get('/')->json();
|
| 41 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 42 |
-
$campaigns = array();
|
| 43 |
-
foreach ($result->results as $campaign) {
|
| 44 |
-
$campaigns[] = Campaign::create($campaign);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 48 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Campaign', $campaigns[0]);
|
| 49 |
-
$this->assertEquals("cGFnZU51bT0yJnBhZ2VTaXplPTM", $result->next);
|
| 50 |
-
$this->assertEquals("1100371240640", $campaigns[0]->id);
|
| 51 |
-
$this->assertEquals("Email Created 2012/11/29, 4:13 PM", $campaigns[0]->name);
|
| 52 |
-
$this->assertEquals("SENT", $campaigns[0]->status);
|
| 53 |
-
$this->assertEquals("2012-11-29T16:15:17.468Z", $campaigns[0]->modified_date);
|
| 54 |
-
|
| 55 |
-
$this->assertEquals("1100368835463", $campaigns[1]->id);
|
| 56 |
-
$this->assertEquals("CampaignNdddasdsdme2", $campaigns[1]->name);
|
| 57 |
-
$this->assertEquals("DRAFT", $campaigns[1]->status);
|
| 58 |
-
$this->assertEquals("2012-10-16T16:14:34.221Z", $campaigns[1]->modified_date);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
public function testDeleteCampaign()
|
| 62 |
-
{
|
| 63 |
-
$response = self::$client->delete('/');
|
| 64 |
-
$this->assertEquals(204, $response->getStatusCode());
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
public function testDeleteCampaignFailed()
|
| 68 |
-
{
|
| 69 |
-
try {
|
| 70 |
-
self::$client->delete('/');
|
| 71 |
-
$this->fail("Delete did not fail");
|
| 72 |
-
} catch (ClientException $e) {
|
| 73 |
-
$this->assertEquals(400, $e->getCode());
|
| 74 |
-
}
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
public function testGetCampaign()
|
| 78 |
-
{
|
| 79 |
-
$response = self::$client->get('/');
|
| 80 |
-
|
| 81 |
-
$campaign = Campaign::create($response->json());
|
| 82 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Campaign', $campaign);
|
| 83 |
-
$this->assertEquals("1100394165290", $campaign->id);
|
| 84 |
-
$this->assertEquals("CampaignName-05965ddb-12d2-43e5-b8f3-0c22ca487c3a", $campaign->name);
|
| 85 |
-
$this->assertEquals("CampaignSubject", $campaign->subject);
|
| 86 |
-
$this->assertEquals("SENT", $campaign->status);
|
| 87 |
-
$this->assertEquals("From WSPI", $campaign->from_name);
|
| 88 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->from_email);
|
| 89 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->reply_to_email);
|
| 90 |
-
$this->assertEquals("CUSTOM", $campaign->template_type);
|
| 91 |
-
$this->assertEquals("2012-12-06T18:06:05.255Z", $campaign->created_date);
|
| 92 |
-
$this->assertEquals("2012-12-06T18:06:40.342Z", $campaign->last_run_date);
|
| 93 |
-
$this->assertEquals(false, $campaign->is_permission_reminder_enabled);
|
| 94 |
-
$this->assertEquals("", $campaign->permission_reminder_text);
|
| 95 |
-
$this->assertEquals(false, $campaign->is_view_as_webpage_enabled);
|
| 96 |
-
$this->assertEquals("Having trouble viewing this email?", $campaign->view_as_web_page_text);
|
| 97 |
-
$this->assertEquals("Click Here", $campaign->view_as_web_page_link_text);
|
| 98 |
-
$this->assertEquals("Hi", $campaign->greeting_salutations);
|
| 99 |
-
$this->assertEquals("FIRST_NAME", $campaign->greeting_name);
|
| 100 |
-
$this->assertEquals("", $campaign->greeting_string);
|
| 101 |
-
$this->assertEquals("http://www.constantcontact.com", $campaign->permalink_url);
|
| 102 |
-
|
| 103 |
-
$this->assertEquals(
|
| 104 |
-
"<html><body>Hi <a href=\"http://www.constantcontact.com\">Visit ConstantContact.com!</a> </body></html>",
|
| 105 |
-
$campaign->email_content
|
| 106 |
-
);
|
| 107 |
-
$this->assertEqualS("HTML", $campaign->email_content_format);
|
| 108 |
-
$this->assertEquals("", $campaign->style_sheet);
|
| 109 |
-
$this->assertEquals("<text>Something to test</text>", $campaign->text_content);
|
| 110 |
-
|
| 111 |
-
// message footer
|
| 112 |
-
$this->assertEquals("Waltham", $campaign->message_footer->city);
|
| 113 |
-
$this->assertEquals("MA", $campaign->message_footer->state);
|
| 114 |
-
$this->assertEquals("US", $campaign->message_footer->country);
|
| 115 |
-
$this->assertEquals("WSPIOrgName", $campaign->message_footer->organization_name);
|
| 116 |
-
$this->assertEquals("1601 Trapelo RD", $campaign->message_footer->address_line_1);
|
| 117 |
-
$this->assertEquals("suite 2", $campaign->message_footer->address_line_2);
|
| 118 |
-
$this->assertEquals("box 4", $campaign->message_footer->address_line_3);
|
| 119 |
-
$this->assertEquals("", $campaign->message_footer->international_state);
|
| 120 |
-
$this->assertEquals("02451", $campaign->message_footer->postal_code);
|
| 121 |
-
$this->assertEquals(true, $campaign->message_footer->include_forward_email);
|
| 122 |
-
$this->assertEquals("WSPIForwardThisEmail", $campaign->message_footer->forward_email_link_text);
|
| 123 |
-
$this->assertEquals(true, $campaign->message_footer->include_subscribe_link);
|
| 124 |
-
$this->assertEquals("WSPISubscribeLinkText", $campaign->message_footer->subscribe_link_text);
|
| 125 |
-
|
| 126 |
-
// tracking summary
|
| 127 |
-
$this->assertEquals(15, $campaign->tracking_summary->sends);
|
| 128 |
-
$this->assertEquals(10, $campaign->tracking_summary->opens);
|
| 129 |
-
$this->assertEquals(10, $campaign->tracking_summary->clicks);
|
| 130 |
-
$this->assertEquals(3, $campaign->tracking_summary->forwards);
|
| 131 |
-
$this->assertEquals(2, $campaign->tracking_summary->unsubscribes);
|
| 132 |
-
$this->assertEquals(18, $campaign->tracking_summary->bounces);
|
| 133 |
-
$this->assertEquals(1, $campaign->tracking_summary->spam_count);
|
| 134 |
-
|
| 135 |
-
// sent to contact lists
|
| 136 |
-
$this->assertEquals(1, count($campaign->sent_to_contact_lists));
|
| 137 |
-
$this->assertEquals(3, $campaign->sent_to_contact_lists[0]->id);
|
| 138 |
-
|
| 139 |
-
//click through details
|
| 140 |
-
$this->assertEquals("http://www.constantcontact.com", $campaign->click_through_details[0]->url);
|
| 141 |
-
$this->assertEquals("1100394163874", $campaign->click_through_details[0]->url_uid);
|
| 142 |
-
$this->assertEquals(10, $campaign->click_through_details[0]->click_count);
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
public function testAddCampaign()
|
| 146 |
-
{
|
| 147 |
-
$response = self::$client->post('/');
|
| 148 |
-
|
| 149 |
-
$campaign = Campaign::create($response->json());
|
| 150 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Campaign', $campaign);
|
| 151 |
-
$this->assertEquals("1100394165290", $campaign->id);
|
| 152 |
-
$this->assertEquals("CampaignName-05965ddb-12d2-43e5-b8f3-0c22ca487c3a", $campaign->name);
|
| 153 |
-
$this->assertEquals("CampaignSubject", $campaign->subject);
|
| 154 |
-
$this->assertEquals("SENT", $campaign->status);
|
| 155 |
-
$this->assertEquals("From WSPI", $campaign->from_name);
|
| 156 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->from_email);
|
| 157 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->reply_to_email);
|
| 158 |
-
$this->assertEquals("CUSTOM", $campaign->template_type);
|
| 159 |
-
$this->assertEquals("2012-12-06T18:06:05.255Z", $campaign->created_date);
|
| 160 |
-
$this->assertEquals("2012-12-06T18:06:40.342Z", $campaign->last_run_date);
|
| 161 |
-
$this->assertEquals(false, $campaign->is_permission_reminder_enabled);
|
| 162 |
-
$this->assertEquals("", $campaign->permission_reminder_text);
|
| 163 |
-
$this->assertEquals(false, $campaign->is_view_as_webpage_enabled);
|
| 164 |
-
$this->assertEquals("Having trouble viewing this email?", $campaign->view_as_web_page_text);
|
| 165 |
-
$this->assertEquals("Click Here", $campaign->view_as_web_page_link_text);
|
| 166 |
-
$this->assertEquals("Hi", $campaign->greeting_salutations);
|
| 167 |
-
$this->assertEquals("FIRST_NAME", $campaign->greeting_name);
|
| 168 |
-
$this->assertEquals("", $campaign->greeting_string);
|
| 169 |
-
|
| 170 |
-
$this->assertEquals(
|
| 171 |
-
"<html><body>Hi <a href=\"http://www.constantcontact.com\">Visit ConstantContact.com!</a> </body></html>",
|
| 172 |
-
$campaign->email_content
|
| 173 |
-
);
|
| 174 |
-
|
| 175 |
-
$this->assertEqualS("HTML", $campaign->email_content_format);
|
| 176 |
-
$this->assertEquals("", $campaign->style_sheet);
|
| 177 |
-
$this->assertEquals("<text>Something to test</text>", $campaign->text_content);
|
| 178 |
-
|
| 179 |
-
// message footer
|
| 180 |
-
$this->assertEquals("Waltham", $campaign->message_footer->city);
|
| 181 |
-
$this->assertEquals("MA", $campaign->message_footer->state);
|
| 182 |
-
$this->assertEquals("US", $campaign->message_footer->country);
|
| 183 |
-
$this->assertEquals("WSPIOrgName", $campaign->message_footer->organization_name);
|
| 184 |
-
$this->assertEquals("1601 Trapelo RD", $campaign->message_footer->address_line_1);
|
| 185 |
-
$this->assertEquals("suite 2", $campaign->message_footer->address_line_2);
|
| 186 |
-
$this->assertEquals("box 4", $campaign->message_footer->address_line_3);
|
| 187 |
-
$this->assertEquals("", $campaign->message_footer->international_state);
|
| 188 |
-
$this->assertEquals("02451", $campaign->message_footer->postal_code);
|
| 189 |
-
$this->assertEquals(true, $campaign->message_footer->include_forward_email);
|
| 190 |
-
$this->assertEquals("WSPIForwardThisEmail", $campaign->message_footer->forward_email_link_text);
|
| 191 |
-
$this->assertEquals(true, $campaign->message_footer->include_subscribe_link);
|
| 192 |
-
$this->assertEquals("WSPISubscribeLinkText", $campaign->message_footer->subscribe_link_text);
|
| 193 |
-
|
| 194 |
-
// tracking summary
|
| 195 |
-
$this->assertEquals(15, $campaign->tracking_summary->sends);
|
| 196 |
-
$this->assertEquals(10, $campaign->tracking_summary->opens);
|
| 197 |
-
$this->assertEquals(10, $campaign->tracking_summary->clicks);
|
| 198 |
-
$this->assertEquals(3, $campaign->tracking_summary->forwards);
|
| 199 |
-
$this->assertEquals(2, $campaign->tracking_summary->unsubscribes);
|
| 200 |
-
$this->assertEquals(18, $campaign->tracking_summary->bounces);
|
| 201 |
-
|
| 202 |
-
// sent to contact lists
|
| 203 |
-
$this->assertEquals(1, count($campaign->sent_to_contact_lists));
|
| 204 |
-
$this->assertEquals(3, $campaign->sent_to_contact_lists[0]->id);
|
| 205 |
-
|
| 206 |
-
//click through details
|
| 207 |
-
$this->assertEquals("http://www.constantcontact.com", $campaign->click_through_details[0]->url);
|
| 208 |
-
$this->assertEquals("1100394163874", $campaign->click_through_details[0]->url_uid);
|
| 209 |
-
$this->assertEquals(10, $campaign->click_through_details[0]->click_count);
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
public function testUpdateCampaign()
|
| 213 |
-
{
|
| 214 |
-
$response = self::$client->put('/');
|
| 215 |
-
|
| 216 |
-
$campaign = Campaign::create($response->json());
|
| 217 |
-
$this->assertInstanceOf('Ctct\Components\EmailMarketing\Campaign', $campaign);
|
| 218 |
-
$this->assertEquals("1100394165290", $campaign->id);
|
| 219 |
-
$this->assertEquals("CampaignName-05965ddb-12d2-43e5-b8f3-0c22ca487c3a", $campaign->name);
|
| 220 |
-
$this->assertEquals("CampaignSubject", $campaign->subject);
|
| 221 |
-
$this->assertEquals("SENT", $campaign->status);
|
| 222 |
-
$this->assertEquals("From WSPI", $campaign->from_name);
|
| 223 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->from_email);
|
| 224 |
-
$this->assertEquals("wiz-20121206130519@l1.snoopy.roving.com", $campaign->reply_to_email);
|
| 225 |
-
$this->assertEquals("CUSTOM", $campaign->template_type);
|
| 226 |
-
$this->assertEquals("2012-12-06T18:06:05.255Z", $campaign->created_date);
|
| 227 |
-
$this->assertEquals("2012-12-06T18:06:40.342Z", $campaign->last_run_date);
|
| 228 |
-
$this->assertEquals(false, $campaign->is_permission_reminder_enabled);
|
| 229 |
-
$this->assertEquals("", $campaign->permission_reminder_text);
|
| 230 |
-
$this->assertEquals(false, $campaign->is_view_as_webpage_enabled);
|
| 231 |
-
$this->assertEquals("Having trouble viewing this email?", $campaign->view_as_web_page_text);
|
| 232 |
-
$this->assertEquals("Click Here", $campaign->view_as_web_page_link_text);
|
| 233 |
-
$this->assertEquals("Hi", $campaign->greeting_salutations);
|
| 234 |
-
$this->assertEquals("FIRST_NAME", $campaign->greeting_name);
|
| 235 |
-
$this->assertEquals("", $campaign->greeting_string);
|
| 236 |
-
|
| 237 |
-
$this->assertEquals(
|
| 238 |
-
"<html><body>Hi <a href=\"http://www.constantcontact.com\">Visit ConstantContact.com!</a> </body></html>",
|
| 239 |
-
$campaign->email_content
|
| 240 |
-
);
|
| 241 |
-
|
| 242 |
-
$this->assertEquals("HTML", $campaign->email_content_format);
|
| 243 |
-
$this->assertEquals("", $campaign->style_sheet);
|
| 244 |
-
$this->assertEquals("<text>Something to test</text>", $campaign->text_content);
|
| 245 |
-
|
| 246 |
-
// message footer
|
| 247 |
-
$this->assertEquals("Waltham", $campaign->message_footer->city);
|
| 248 |
-
$this->assertEquals("MA", $campaign->message_footer->state);
|
| 249 |
-
$this->assertEquals("US", $campaign->message_footer->country);
|
| 250 |
-
$this->assertEquals("WSPIOrgName", $campaign->message_footer->organization_name);
|
| 251 |
-
$this->assertEquals("1601 Trapelo RD", $campaign->message_footer->address_line_1);
|
| 252 |
-
$this->assertEquals("suite 2", $campaign->message_footer->address_line_2);
|
| 253 |
-
$this->assertEquals("box 4", $campaign->message_footer->address_line_3);
|
| 254 |
-
$this->assertEquals("", $campaign->message_footer->international_state);
|
| 255 |
-
$this->assertEquals("02451", $campaign->message_footer->postal_code);
|
| 256 |
-
$this->assertEquals(true, $campaign->message_footer->include_forward_email);
|
| 257 |
-
$this->assertEquals("WSPIForwardThisEmail", $campaign->message_footer->forward_email_link_text);
|
| 258 |
-
$this->assertEquals(true, $campaign->message_footer->include_subscribe_link);
|
| 259 |
-
$this->assertEquals("WSPISubscribeLinkText", $campaign->message_footer->subscribe_link_text);
|
| 260 |
-
|
| 261 |
-
// tracking summary
|
| 262 |
-
$this->assertEquals(15, $campaign->tracking_summary->sends);
|
| 263 |
-
$this->assertEquals(10, $campaign->tracking_summary->opens);
|
| 264 |
-
$this->assertEquals(10, $campaign->tracking_summary->clicks);
|
| 265 |
-
$this->assertEquals(3, $campaign->tracking_summary->forwards);
|
| 266 |
-
$this->assertEquals(2, $campaign->tracking_summary->unsubscribes);
|
| 267 |
-
$this->assertEquals(18, $campaign->tracking_summary->bounces);
|
| 268 |
-
|
| 269 |
-
// sent to contact lists
|
| 270 |
-
$this->assertEquals(1, count($campaign->sent_to_contact_lists));
|
| 271 |
-
$this->assertEquals(3, $campaign->sent_to_contact_lists[0]->id);
|
| 272 |
-
|
| 273 |
-
//click through details
|
| 274 |
-
$this->assertEquals("http://www.constantcontact.com", $campaign->click_through_details[0]->url);
|
| 275 |
-
$this->assertEquals("1100394163874", $campaign->click_through_details[0]->url_uid);
|
| 276 |
-
$this->assertEquals(10, $campaign->click_through_details[0]->click_count);
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
public function testGetPreview() {
|
| 280 |
-
$response = self::$client->get('/');
|
| 281 |
-
|
| 282 |
-
$preview = CampaignPreview::create($response->json());
|
| 283 |
-
$this->assertEquals("Subject Test", $preview->subject);
|
| 284 |
-
$this->assertEquals("myemail@example.com", $preview->fromEmail);
|
| 285 |
-
$this->assertEquals("myemail@example.com", $preview->replyToEmail);
|
| 286 |
-
$htmlContent = "<head ><meta /></head><body><center><table bgcolor=\"#ffffff\" id=\"VWPLINK\" width=\"595\"><tr><td style=\"font-size: 8pt; font-family: Verdana, Arial, Helvetica, sans-serif; color: #000000;\" width=\"100%\">View this message as a web page\n<a >Click here\n</a></td></tr></table></center><center ><table bgcolor=\"#ffffff\" width=\"595\" ><tr ><td width=\"100%\" ><font color=\"#000000\" face=\"verdana,arial\" size=\"1\" ><div >As a reminder, you're receiving this email because you have expressed an interest in MyCompany. Don't forget to add from_email@example.com to your address book so we'll be sure to land in your inbox! You may unsubscribe if you no longer wish to receive our emails. <div > </div><div >You may <a >unsubscribe</a> if you no longer wish to receive our emails.</div></div></font></td></tr></table></center><img /><p>This is text of the email message.</p><br />\n<table bgcolor=\"#ffffff\" padding=\"0\" width=\"100%\" ><tr align=\"center\" ><td ><table bgcolor=\"#ffffff\" width=\"595\" ><tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><b ><a >Click here to forward this message</a></b></font><br />\n<br />\n</td></tr>\n<tr ><td ><FooterContent ><a ><img /></a></FooterContent></td><td align=\"right\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><FooterLogo ><a ><img /></a></FooterLogo></font>\n</td>\n</tr><tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><FooterContent ><div >This email was sent to {Email Address} by <a >rmarcucella@constantcontact.com</a> <span style=\"color: #bababa;\" > | </span> </div>\n<div ><a >Update Profile/Email Address</a> <span style=\"color: #bababa;\" >|</span> Instant removal with <a >SafeUnsubscribe</a>™ <span style=\"color: #bababa;\" >|</span> <a >Privacy Policy</a>.</div></FooterContent></font>\n</td>\n</tr>\n<tr ><td colspan=\"2\" ><font face=\"tahoma,sans-serif\" size=\"1\" ><br />My Organization | 123 Maple Street | Suite 1 | Anytown | MA | 01444</font>\n</td>\n</tr>\n</table>\n</td>\n</tr>\n</table>\n<br />\n</body>";
|
| 287 |
-
$this->assertEquals($htmlContent, $preview->htmlContent);
|
| 288 |
-
$textContent = "View this message as a web page\nClick here\nhttp://campaign.r20.l1.constantcontact.com/render?ca=025eff86-6378-4f53-9301-5897ecf50b30&c={Contact Id}&ch={Contact Id}\n\nAs a reminder, you're receiving this email because you have expressed an interest in MyCompany. Don't forget to add from_email@example.com to your address book so we'll be sure to land in your inbox! You may unsubscribe if you no longer wish to receive our emails. You may unsubscribe\nhttp://visitor.l1.constantcontact.com/do?p=un&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n if you no longer wish to receive our emails.\n------------------------------------------------------------\nThis is the text of the email message.\n\nClick here to forward this message\nhttp://ui.l1.constantcontact.com/sa/fwtf.jsp?llr=cqmhk9aab&m=1100394770946&ea=rmarcucella%40constantcontact.com&a=1100400205633\n\n\n\n\n\nThis email was sent to {Email Address} by rmarcucella@constantcontact.com.\n\nUpdate Profile/Email Address\nhttp://visitor.l1.constantcontact.com/do?p=oo&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n\n\nInstant removal with SafeUnsubscribe(TM)\nhttp://visitor.l1.constantcontact.com/do?p=un&m=001JZtDyxcvPiye1EthMqSLGA%3D%3D&ch={Contact Id}&ca=025eff86-6378-4f53-9301-5897ecf50b30\n\n\nPrivacy Policy:\nhttp://ui.l1.constantcontact.com/roving/CCPrivacyPolicy.jsp\n\n\n\n\n\nOnline Marketing by\nhttp://img.l1.constantcontact.com/letters/images/cc-logo-color-sm.gif\nhttp://www.constantcontact.com\n\n\n\nMy Organization | 123 Maple Street | Suite 1 | Anytown | MA | 01444\n\n\n\n\n\n\n\n\n";
|
| 289 |
-
$this->assertEquals($textContent, $preview->textContent);
|
| 290 |
-
}
|
| 291 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/LibraryServiceUnitTest.php
DELETED
|
@@ -1,195 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\Library\File;
|
| 5 |
-
use Ctct\Components\Library\Folder;
|
| 6 |
-
use Ctct\Components\Library\FileUploadStatus;
|
| 7 |
-
|
| 8 |
-
use GuzzleHttp\Client;
|
| 9 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 10 |
-
use GuzzleHttp\Stream\Stream;
|
| 11 |
-
use GuzzleHttp\Message\Response;
|
| 12 |
-
|
| 13 |
-
class LibraryServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 14 |
-
{
|
| 15 |
-
/**
|
| 16 |
-
* @var Client
|
| 17 |
-
*/
|
| 18 |
-
private static $client;
|
| 19 |
-
|
| 20 |
-
public static function setUpBeforeClass()
|
| 21 |
-
{
|
| 22 |
-
self::$client = new Client();
|
| 23 |
-
$getFileStream = Stream::factory(JsonLoader::getLibraryFileJson());
|
| 24 |
-
$getFilesStream = Stream::factory(JsonLoader::getLibraryFilesJson());
|
| 25 |
-
$getFolderStream = Stream::factory(JsonLoader::getLibraryFolderJson());
|
| 26 |
-
$getFoldersStream = Stream::factory(JsonLoader::getLibraryFoldersJson());
|
| 27 |
-
$getFileUploadStream = Stream::factory(JsonLoader::getFileUploadStatusJson());
|
| 28 |
-
$mock = new Mock([
|
| 29 |
-
new Response(200, array(), $getFileStream),
|
| 30 |
-
new Response(200, array(), $getFilesStream),
|
| 31 |
-
new Response(200, array(), $getFolderStream),
|
| 32 |
-
new Response(200, array(), $getFoldersStream),
|
| 33 |
-
new Response(201, array("Id" => 1)),
|
| 34 |
-
new Response(200, array(), $getFileUploadStream)
|
| 35 |
-
]);
|
| 36 |
-
self::$client->getEmitter()->attach($mock);
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
public function testGetLibraryFile()
|
| 40 |
-
{
|
| 41 |
-
$response = self::$client->get('/');
|
| 42 |
-
|
| 43 |
-
$file = File::create($response->json());
|
| 44 |
-
$this->assertInstanceOf('Ctct\Components\Library\File', $file);
|
| 45 |
-
$this->assertEquals("IMG_0261.JPG", $file->name);
|
| 46 |
-
$this->assertEquals("4", $file->id);
|
| 47 |
-
$this->assertEquals("chocolates", $file->description);
|
| 48 |
-
$this->assertEquals("Images", $file->folder);
|
| 49 |
-
$this->assertEquals(600, $file->height);
|
| 50 |
-
$this->assertEquals(800, $file->width);
|
| 51 |
-
$this->assertEquals(68825, $file->size);
|
| 52 |
-
$this->assertEquals("https://origin.ih.l1.constantcontact.com/fs115/1100310339939/img/4.jpg", $file->url);
|
| 53 |
-
$this->assertEquals("MyComputer", $file->source);
|
| 54 |
-
$this->assertEquals("Active", $file->status);
|
| 55 |
-
|
| 56 |
-
$this->assertInstanceOf('Ctct\Components\Library\Thumbnail', $file->thumbnail);
|
| 57 |
-
$this->assertEquals("https://origin.ih.l1.constantcontact.com/fs115/1100310339939/img/4.jpg", $file->thumbnail->url);
|
| 58 |
-
$this->assertEquals(200, $file->thumbnail->width);
|
| 59 |
-
$this->assertEquals(150, $file->thumbnail->height);
|
| 60 |
-
|
| 61 |
-
$this->assertEquals("2013-06-19T11:36:43.000-04:00", $file->created_date);
|
| 62 |
-
$this->assertEquals("2013-08-23T12:54:17.000-04:00", $file->modified_date);
|
| 63 |
-
$this->assertEquals(null, $file->folder_id);
|
| 64 |
-
$this->assertEquals(true, $file->is_image);
|
| 65 |
-
$this->assertEquals("JPG", $file->type);
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
public function testGetLibraryFiles()
|
| 69 |
-
{
|
| 70 |
-
$response = self::$client->get('/')->json();
|
| 71 |
-
|
| 72 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 73 |
-
$files = array();
|
| 74 |
-
foreach ($result->results as $file) {
|
| 75 |
-
$files[] = File::create($file);
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 79 |
-
$this->assertEquals('c023cmNlPUFsbCUiUmZzZXQ9MTgyIcV5cGU9QWxsJmxpbWl0PTE', $result->next);
|
| 80 |
-
$this->assertInstanceOf('Ctct\Components\Library\File', $files[0]);
|
| 81 |
-
$this->assertEquals("Test_card.png", $files[0]->name);
|
| 82 |
-
$this->assertEquals("182", $files[0]->id);
|
| 83 |
-
$this->assertEquals("descriptionssss", $files[0]->description);
|
| 84 |
-
$this->assertEquals("Images", $files[0]->folder);
|
| 85 |
-
$this->assertEquals(360, $files[0]->height);
|
| 86 |
-
$this->assertEquals(640, $files[0]->width);
|
| 87 |
-
$this->assertEquals(26271, $files[0]->size);
|
| 88 |
-
$this->assertEquals("https://mlsvc01-prod.s3.amazonaws.com/489270ef001/d738eefc-8e8e-4a69-8e7d-8e7217d22a0a.png", $files[0]->url);
|
| 89 |
-
$this->assertEquals("MyComputer", $files[0]->source);
|
| 90 |
-
$this->assertEquals("Active", $files[0]->status);
|
| 91 |
-
|
| 92 |
-
$this->assertInstanceOf('Ctct\Components\Library\Thumbnail', $files[0]->thumbnail);
|
| 93 |
-
$this->assertEquals("https://mlsvc01-prod.s3.amazonaws.com/489270ef001/d738eefc-8e8e-4a69-8e7d-8e7217d22a0a.png", $files[0]->thumbnail->url);
|
| 94 |
-
$this->assertEquals(112, $files[0]->thumbnail->height);
|
| 95 |
-
$this->assertEquals(200, $files[0]->thumbnail->width);
|
| 96 |
-
|
| 97 |
-
$this->assertEquals("2015-01-09T00:14:08.000-05:00", $files[0]->created_date);
|
| 98 |
-
$this->assertEquals("2015-01-09T00:14:08.000-05:00", $files[0]->modified_date);
|
| 99 |
-
$this->assertEquals(null, $files[0]->folder_id);
|
| 100 |
-
$this->assertEquals(true, $files[0]->is_image);
|
| 101 |
-
$this->assertEquals("PNG", $files[0]->file_type);
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
public function testGetLibraryFolder()
|
| 105 |
-
{
|
| 106 |
-
$response = self::$client->get('/');
|
| 107 |
-
|
| 108 |
-
$folder = Folder::create($response->json());
|
| 109 |
-
$this->assertInstanceOf('Ctct\Components\Library\Folder', $folder);
|
| 110 |
-
$this->assertEquals("-5", $folder->id);
|
| 111 |
-
$this->assertEquals("Folder", $folder->name);
|
| 112 |
-
$this->assertEquals(1, $folder->level);
|
| 113 |
-
|
| 114 |
-
$childrenCount = 0;
|
| 115 |
-
foreach ($folder->children as $child) {
|
| 116 |
-
$this->assertInstanceOf('Ctct\Components\Library\Folder', $child);
|
| 117 |
-
$childrenCount++;
|
| 118 |
-
}
|
| 119 |
-
$this->assertEquals(2, $childrenCount);
|
| 120 |
-
$this->assertEquals("-7", $folder->children[0]->id);
|
| 121 |
-
$this->assertEquals("SubFolder", $folder->children[0]->name);
|
| 122 |
-
$this->assertEquals(2, $folder->children[0]->level);
|
| 123 |
-
$this->assertEquals(null, $folder->children[0]->children);
|
| 124 |
-
$this->assertEquals(0, $folder->children[0]->item_count);
|
| 125 |
-
$this->assertEquals("-5", $folder->children[0]->parent_id);
|
| 126 |
-
$this->assertEquals("2014-08-04T11:40:36.000-04:00", $folder->children[0]->modified_date);
|
| 127 |
-
$this->assertEquals("2014-08-04T11:40:36.000-04:00", $folder->children[0]->created_date);
|
| 128 |
-
|
| 129 |
-
$this->assertEquals(3, $folder->item_count);
|
| 130 |
-
$this->assertEquals("2013-09-09T14:25:44.000-04:00", $folder->modified_date);
|
| 131 |
-
$this->assertEquals("2013-09-09T14:25:44.000-04:00", $folder->created_date);
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
public function testGetLibraryFolders()
|
| 135 |
-
{
|
| 136 |
-
$response = self::$client->get('/')->json();
|
| 137 |
-
|
| 138 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 139 |
-
$folders = array();
|
| 140 |
-
foreach ($result->results as $folder) {
|
| 141 |
-
$folders[] = Folder::create($folder);
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 145 |
-
$this->assertEquals("b2Zmc1V0PTzmbGltaJE9Mo", $result->next);
|
| 146 |
-
$this->assertInstanceOf('Ctct\Components\Library\Folder', $folders[0]);
|
| 147 |
-
$this->assertEquals("-5", $folders[0]->id);
|
| 148 |
-
$this->assertEquals("Folder", $folders[0]->name);
|
| 149 |
-
$this->assertEquals(1, $folders[0]->level);
|
| 150 |
-
|
| 151 |
-
$childrenCount = 0;
|
| 152 |
-
foreach ($folders[0]->children as $child) {
|
| 153 |
-
$this->assertInstanceOf('Ctct\Components\Library\Folder', $child);
|
| 154 |
-
$childrenCount++;
|
| 155 |
-
}
|
| 156 |
-
$this->assertEquals(2, $childrenCount);
|
| 157 |
-
$this->assertEquals("-7", $folders[0]->children[0]->id);
|
| 158 |
-
$this->assertEquals("SubFolder", $folders[0]->children[0]->name);
|
| 159 |
-
$this->assertEquals(2, $folders[0]->children[0]->level);
|
| 160 |
-
$this->assertEquals(null, $folders[0]->children[0]->children);
|
| 161 |
-
$this->assertEquals(0, $folders[0]->children[0]->item_count);
|
| 162 |
-
$this->assertEquals("-5", $folders[0]->children[0]->parent_id);
|
| 163 |
-
$this->assertEquals("2014-08-04T11:40:36.000-04:00", $folders[0]->children[0]->modified_date);
|
| 164 |
-
$this->assertEquals("2014-08-04T11:40:36.000-04:00", $folders[0]->children[0]->created_date);
|
| 165 |
-
|
| 166 |
-
$this->assertEquals(3, $folders[0]->item_count);
|
| 167 |
-
$this->assertEquals("2013-09-09T14:25:44.000-04:00", $folders[0]->modified_date);
|
| 168 |
-
$this->assertEquals("2013-09-09T14:25:44.000-04:00", $folders[0]->created_date);
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
public function testUploadFile()
|
| 172 |
-
{
|
| 173 |
-
$response = self::$client->post('/');
|
| 174 |
-
|
| 175 |
-
$id = $response->getHeader("Id");
|
| 176 |
-
$code = $response->getStatusCode();
|
| 177 |
-
$this->assertEquals("1", $id);
|
| 178 |
-
$this->assertEquals(201, $code);
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
public function testGetFileUploadStatus()
|
| 182 |
-
{
|
| 183 |
-
$response = self::$client->get('/');
|
| 184 |
-
|
| 185 |
-
$statuses = array();
|
| 186 |
-
foreach ($response->json() as $result) {
|
| 187 |
-
$statuses[] = FileUploadStatus::create($result);
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
$fileUploadStatus = $statuses[0];
|
| 191 |
-
$this->assertEquals("9", $fileUploadStatus->file_id);
|
| 192 |
-
$this->assertEquals("Active", $fileUploadStatus->description);
|
| 193 |
-
$this->assertEquals("Active", $fileUploadStatus->status);
|
| 194 |
-
}
|
| 195 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/Services/ListServiceUnitTest.php
DELETED
|
@@ -1,143 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
use Ctct\Components\ResultSet;
|
| 4 |
-
use Ctct\Components\Contacts\Contact;
|
| 5 |
-
use Ctct\Components\Contacts\ContactList;
|
| 6 |
-
|
| 7 |
-
use GuzzleHttp\Client;
|
| 8 |
-
use GuzzleHttp\Subscriber\Mock;
|
| 9 |
-
use GuzzleHttp\Stream\Stream;
|
| 10 |
-
use GuzzleHttp\Message\Response;
|
| 11 |
-
|
| 12 |
-
class ListServiceUnitTest extends PHPUnit_Framework_TestCase
|
| 13 |
-
{
|
| 14 |
-
/**
|
| 15 |
-
* @var Client
|
| 16 |
-
*/
|
| 17 |
-
private static $client;
|
| 18 |
-
|
| 19 |
-
public static function setUpBeforeClass()
|
| 20 |
-
{
|
| 21 |
-
self::$client = new Client();
|
| 22 |
-
$getListsStream = Stream::factory(JsonLoader::getListsJson());
|
| 23 |
-
$getListStream = Stream::factory(JsonLoader::getListJson());
|
| 24 |
-
$getContactsStream = Stream::factory(JsonLoader::getContactsJson());
|
| 25 |
-
$mock = new Mock([
|
| 26 |
-
new Response(200, array(), $getListsStream),
|
| 27 |
-
new Response(200, array(), $getListStream),
|
| 28 |
-
new Response(201, array(), $getListStream),
|
| 29 |
-
new Response(200, array(), $getListStream),
|
| 30 |
-
new Response(200, array(), $getContactsStream)
|
| 31 |
-
]);
|
| 32 |
-
self::$client->getEmitter()->attach($mock);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function testGetLists()
|
| 36 |
-
{
|
| 37 |
-
$response = self::$client->get('/');
|
| 38 |
-
|
| 39 |
-
$lists = array();
|
| 40 |
-
foreach ($response->json() as $list) {
|
| 41 |
-
$lists[] = ContactList::create($list);
|
| 42 |
-
}
|
| 43 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $lists[0]);
|
| 44 |
-
$this->assertEquals(1, $lists[0]->id);
|
| 45 |
-
$this->assertEquals("General Interest", $lists[0]->name);
|
| 46 |
-
$this->assertEquals("ACTIVE", $lists[0]->status);
|
| 47 |
-
$this->assertEquals(17, $lists[0]->contact_count);
|
| 48 |
-
|
| 49 |
-
$this->assertEquals(3, $lists[1]->id);
|
| 50 |
-
$this->assertEquals("mod_Test List 1", $lists[1]->name);
|
| 51 |
-
$this->assertEquals("HIDDEN", $lists[1]->status);
|
| 52 |
-
$this->assertEquals(18, $lists[1]->contact_count);
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
public function testGetList()
|
| 56 |
-
{
|
| 57 |
-
$response = self::$client->get('/');
|
| 58 |
-
$list = ContactList::create($response->json());
|
| 59 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $list);
|
| 60 |
-
$this->assertEquals(6, $list->id);
|
| 61 |
-
$this->assertEquals("Test List 4", $list->name);
|
| 62 |
-
$this->assertEquals("HIDDEN", $list->status);
|
| 63 |
-
$this->assertEquals(19, $list->contact_count);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testAddList()
|
| 67 |
-
{
|
| 68 |
-
$response = self::$client->post('/');
|
| 69 |
-
$list = ContactList::create($response->json());
|
| 70 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $list);
|
| 71 |
-
$this->assertEquals(6, $list->id);
|
| 72 |
-
$this->assertEquals("Test List 4", $list->name);
|
| 73 |
-
$this->assertEquals("HIDDEN", $list->status);
|
| 74 |
-
$this->assertEquals(19, $list->contact_count);
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
public function testUpdateList()
|
| 78 |
-
{
|
| 79 |
-
$response = self::$client->put('/');
|
| 80 |
-
$list = ContactList::create($response->json());
|
| 81 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $list);
|
| 82 |
-
$this->assertEquals(6, $list->id);
|
| 83 |
-
$this->assertEquals("Test List 4", $list->name);
|
| 84 |
-
$this->assertEquals("HIDDEN", $list->status);
|
| 85 |
-
$this->assertEquals(19, $list->contact_count);
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
public function testGetContactsFromList()
|
| 89 |
-
{
|
| 90 |
-
$response = self::$client->get('/')->json();
|
| 91 |
-
$result = new ResultSet($response['results'], $response['meta']);
|
| 92 |
-
$this->assertInstanceOf('Ctct\Components\ResultSet', $result);
|
| 93 |
-
|
| 94 |
-
$contact = Contact::create($result->results[1]);
|
| 95 |
-
|
| 96 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Contact', $contact);
|
| 97 |
-
$this->assertEquals(231, $contact->id);
|
| 98 |
-
$this->assertEquals("ACTIVE", $contact->status);
|
| 99 |
-
$this->assertEquals("", $contact->fax);
|
| 100 |
-
$this->assertEquals("", $contact->prefix_name);
|
| 101 |
-
$this->assertEquals("Jimmy", $contact->first_name);
|
| 102 |
-
$this->assertEquals("Roving", $contact->last_name);
|
| 103 |
-
$this->assertEquals("Bear Tamer", $contact->job_title);
|
| 104 |
-
$this->assertEquals("Animal Trainer Pro", $contact->company_name);
|
| 105 |
-
$this->assertEquals("details", $contact->source_details);
|
| 106 |
-
$this->assertEquals(false, $contact->confirmed);
|
| 107 |
-
$this->assertEquals("", $contact->source);
|
| 108 |
-
|
| 109 |
-
// custom fields
|
| 110 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\CustomField', $contact->custom_fields[0]);
|
| 111 |
-
$this->assertEquals("CustomField1", $contact->custom_fields[0]->name);
|
| 112 |
-
$this->assertEquals("1", $contact->custom_fields[0]->value);
|
| 113 |
-
|
| 114 |
-
//addresses
|
| 115 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\Address', $contact->addresses[0]);
|
| 116 |
-
$this->assertEquals("Suite 101", $contact->addresses[0]->line1);
|
| 117 |
-
$this->assertEquals("line2", $contact->addresses[0]->line2);
|
| 118 |
-
$this->assertEquals("line3", $contact->addresses[0]->line3);
|
| 119 |
-
$this->assertEquals("Brookfield", $contact->addresses[0]->city);
|
| 120 |
-
$this->assertEquals("PERSONAL", $contact->addresses[0]->address_type);
|
| 121 |
-
$this->assertEquals("WI", $contact->addresses[0]->state_code);
|
| 122 |
-
$this->assertEquals("us", $contact->addresses[0]->country_code);
|
| 123 |
-
$this->assertEquals("53027", $contact->addresses[0]->postal_code);
|
| 124 |
-
$this->assertEquals("", $contact->addresses[0]->sub_postal_code);
|
| 125 |
-
|
| 126 |
-
//notes
|
| 127 |
-
$this->assertEquals(0, count($contact->notes));
|
| 128 |
-
|
| 129 |
-
//lists
|
| 130 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\ContactList', $contact->lists[0]);
|
| 131 |
-
$this->assertEquals(1, $contact->lists[0]->id);
|
| 132 |
-
$this->assertEquals("ACTIVE", $contact->lists[0]->status);
|
| 133 |
-
|
| 134 |
-
// EmailAddress
|
| 135 |
-
$this->assertInstanceOf('Ctct\Components\Contacts\EmailAddress', $contact->email_addresses[0]);
|
| 136 |
-
$this->assertEquals("ACTIVE", $contact->email_addresses[0]->status);
|
| 137 |
-
$this->assertEquals("NO_CONFIRMATION_REQUIRED", $contact->email_addresses[0]->confirm_status);
|
| 138 |
-
$this->assertEquals("ACTION_BY_OWNER", $contact->email_addresses[0]->opt_in_source);
|
| 139 |
-
$this->assertEquals("2012-06-22T10:29:09.976Z", $contact->email_addresses[0]->opt_in_date);
|
| 140 |
-
$this->assertEquals("", $contact->email_addresses[0]->opt_out_date);
|
| 141 |
-
$this->assertEquals("anothertest@roving.com", $contact->email_addresses[0]->email_address);
|
| 142 |
-
}
|
| 143 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/constantcontact/constantcontact/test/bootstrap.php
DELETED
|
@@ -1,9 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
// autoloader for the SDK
|
| 3 |
-
require_once(realpath(dirname(__FILE__) . '/../') . "/src/Ctct/autoload.php");
|
| 4 |
-
|
| 5 |
-
// load the JsonLoader
|
| 6 |
-
require_once(__DIR__ . "/Json/JsonLoader.php");
|
| 7 |
-
|
| 8 |
-
// autoload composer dependencies
|
| 9 |
-
require_once(realpath(dirname(__FILE__) . '/../') . "/vendor/autoload.php");
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/Makefile
DELETED
|
@@ -1,153 +0,0 @@
|
|
| 1 |
-
# Makefile for Sphinx documentation
|
| 2 |
-
#
|
| 3 |
-
|
| 4 |
-
# You can set these variables from the command line.
|
| 5 |
-
SPHINXOPTS =
|
| 6 |
-
SPHINXBUILD = sphinx-build
|
| 7 |
-
PAPER =
|
| 8 |
-
BUILDDIR = _build
|
| 9 |
-
|
| 10 |
-
# Internal variables.
|
| 11 |
-
PAPEROPT_a4 = -D latex_paper_size=a4
|
| 12 |
-
PAPEROPT_letter = -D latex_paper_size=letter
|
| 13 |
-
ALLSPHINXOPTS = -d $(BUILDDIR)/doctrees $(PAPEROPT_$(PAPER)) $(SPHINXOPTS) .
|
| 14 |
-
# the i18n builder cannot share the environment and doctrees with the others
|
| 15 |
-
I18NSPHINXOPTS = $(PAPEROPT_$(PAPER)) $(SPHINXOPTS) .
|
| 16 |
-
|
| 17 |
-
.PHONY: help clean html dirhtml singlehtml pickle json htmlhelp qthelp devhelp epub latex latexpdf text man changes linkcheck doctest gettext
|
| 18 |
-
|
| 19 |
-
help:
|
| 20 |
-
@echo "Please use \`make <target>' where <target> is one of"
|
| 21 |
-
@echo " html to make standalone HTML files"
|
| 22 |
-
@echo " dirhtml to make HTML files named index.html in directories"
|
| 23 |
-
@echo " singlehtml to make a single large HTML file"
|
| 24 |
-
@echo " pickle to make pickle files"
|
| 25 |
-
@echo " json to make JSON files"
|
| 26 |
-
@echo " htmlhelp to make HTML files and a HTML help project"
|
| 27 |
-
@echo " qthelp to make HTML files and a qthelp project"
|
| 28 |
-
@echo " devhelp to make HTML files and a Devhelp project"
|
| 29 |
-
@echo " epub to make an epub"
|
| 30 |
-
@echo " latex to make LaTeX files, you can set PAPER=a4 or PAPER=letter"
|
| 31 |
-
@echo " latexpdf to make LaTeX files and run them through pdflatex"
|
| 32 |
-
@echo " text to make text files"
|
| 33 |
-
@echo " man to make manual pages"
|
| 34 |
-
@echo " texinfo to make Texinfo files"
|
| 35 |
-
@echo " info to make Texinfo files and run them through makeinfo"
|
| 36 |
-
@echo " gettext to make PO message catalogs"
|
| 37 |
-
@echo " changes to make an overview of all changed/added/deprecated items"
|
| 38 |
-
@echo " linkcheck to check all external links for integrity"
|
| 39 |
-
@echo " doctest to run all doctests embedded in the documentation (if enabled)"
|
| 40 |
-
|
| 41 |
-
clean:
|
| 42 |
-
-rm -rf $(BUILDDIR)/*
|
| 43 |
-
|
| 44 |
-
html:
|
| 45 |
-
$(SPHINXBUILD) -b html $(ALLSPHINXOPTS) $(BUILDDIR)/html
|
| 46 |
-
@echo
|
| 47 |
-
@echo "Build finished. The HTML pages are in $(BUILDDIR)/html."
|
| 48 |
-
|
| 49 |
-
dirhtml:
|
| 50 |
-
$(SPHINXBUILD) -b dirhtml $(ALLSPHINXOPTS) $(BUILDDIR)/dirhtml
|
| 51 |
-
@echo
|
| 52 |
-
@echo "Build finished. The HTML pages are in $(BUILDDIR)/dirhtml."
|
| 53 |
-
|
| 54 |
-
singlehtml:
|
| 55 |
-
$(SPHINXBUILD) -b singlehtml $(ALLSPHINXOPTS) $(BUILDDIR)/singlehtml
|
| 56 |
-
@echo
|
| 57 |
-
@echo "Build finished. The HTML page is in $(BUILDDIR)/singlehtml."
|
| 58 |
-
|
| 59 |
-
pickle:
|
| 60 |
-
$(SPHINXBUILD) -b pickle $(ALLSPHINXOPTS) $(BUILDDIR)/pickle
|
| 61 |
-
@echo
|
| 62 |
-
@echo "Build finished; now you can process the pickle files."
|
| 63 |
-
|
| 64 |
-
json:
|
| 65 |
-
$(SPHINXBUILD) -b json $(ALLSPHINXOPTS) $(BUILDDIR)/json
|
| 66 |
-
@echo
|
| 67 |
-
@echo "Build finished; now you can process the JSON files."
|
| 68 |
-
|
| 69 |
-
htmlhelp:
|
| 70 |
-
$(SPHINXBUILD) -b htmlhelp $(ALLSPHINXOPTS) $(BUILDDIR)/htmlhelp
|
| 71 |
-
@echo
|
| 72 |
-
@echo "Build finished; now you can run HTML Help Workshop with the" \
|
| 73 |
-
".hhp project file in $(BUILDDIR)/htmlhelp."
|
| 74 |
-
|
| 75 |
-
qthelp:
|
| 76 |
-
$(SPHINXBUILD) -b qthelp $(ALLSPHINXOPTS) $(BUILDDIR)/qthelp
|
| 77 |
-
@echo
|
| 78 |
-
@echo "Build finished; now you can run "qcollectiongenerator" with the" \
|
| 79 |
-
".qhcp project file in $(BUILDDIR)/qthelp, like this:"
|
| 80 |
-
@echo "# qcollectiongenerator $(BUILDDIR)/qthelp/GuzzleRing.qhcp"
|
| 81 |
-
@echo "To view the help file:"
|
| 82 |
-
@echo "# assistant -collectionFile $(BUILDDIR)/qthelp/GuzzleRing.qhc"
|
| 83 |
-
|
| 84 |
-
devhelp:
|
| 85 |
-
$(SPHINXBUILD) -b devhelp $(ALLSPHINXOPTS) $(BUILDDIR)/devhelp
|
| 86 |
-
@echo
|
| 87 |
-
@echo "Build finished."
|
| 88 |
-
@echo "To view the help file:"
|
| 89 |
-
@echo "# mkdir -p $$HOME/.local/share/devhelp/GuzzleRing"
|
| 90 |
-
@echo "# ln -s $(BUILDDIR)/devhelp $$HOME/.local/share/devhelp/GuzzleRing"
|
| 91 |
-
@echo "# devhelp"
|
| 92 |
-
|
| 93 |
-
epub:
|
| 94 |
-
$(SPHINXBUILD) -b epub $(ALLSPHINXOPTS) $(BUILDDIR)/epub
|
| 95 |
-
@echo
|
| 96 |
-
@echo "Build finished. The epub file is in $(BUILDDIR)/epub."
|
| 97 |
-
|
| 98 |
-
latex:
|
| 99 |
-
$(SPHINXBUILD) -b latex $(ALLSPHINXOPTS) $(BUILDDIR)/latex
|
| 100 |
-
@echo
|
| 101 |
-
@echo "Build finished; the LaTeX files are in $(BUILDDIR)/latex."
|
| 102 |
-
@echo "Run \`make' in that directory to run these through (pdf)latex" \
|
| 103 |
-
"(use \`make latexpdf' here to do that automatically)."
|
| 104 |
-
|
| 105 |
-
latexpdf:
|
| 106 |
-
$(SPHINXBUILD) -b latex $(ALLSPHINXOPTS) $(BUILDDIR)/latex
|
| 107 |
-
@echo "Running LaTeX files through pdflatex..."
|
| 108 |
-
$(MAKE) -C $(BUILDDIR)/latex all-pdf
|
| 109 |
-
@echo "pdflatex finished; the PDF files are in $(BUILDDIR)/latex."
|
| 110 |
-
|
| 111 |
-
text:
|
| 112 |
-
$(SPHINXBUILD) -b text $(ALLSPHINXOPTS) $(BUILDDIR)/text
|
| 113 |
-
@echo
|
| 114 |
-
@echo "Build finished. The text files are in $(BUILDDIR)/text."
|
| 115 |
-
|
| 116 |
-
man:
|
| 117 |
-
$(SPHINXBUILD) -b man $(ALLSPHINXOPTS) $(BUILDDIR)/man
|
| 118 |
-
@echo
|
| 119 |
-
@echo "Build finished. The manual pages are in $(BUILDDIR)/man."
|
| 120 |
-
|
| 121 |
-
texinfo:
|
| 122 |
-
$(SPHINXBUILD) -b texinfo $(ALLSPHINXOPTS) $(BUILDDIR)/texinfo
|
| 123 |
-
@echo
|
| 124 |
-
@echo "Build finished. The Texinfo files are in $(BUILDDIR)/texinfo."
|
| 125 |
-
@echo "Run \`make' in that directory to run these through makeinfo" \
|
| 126 |
-
"(use \`make info' here to do that automatically)."
|
| 127 |
-
|
| 128 |
-
info:
|
| 129 |
-
$(SPHINXBUILD) -b texinfo $(ALLSPHINXOPTS) $(BUILDDIR)/texinfo
|
| 130 |
-
@echo "Running Texinfo files through makeinfo..."
|
| 131 |
-
make -C $(BUILDDIR)/texinfo info
|
| 132 |
-
@echo "makeinfo finished; the Info files are in $(BUILDDIR)/texinfo."
|
| 133 |
-
|
| 134 |
-
gettext:
|
| 135 |
-
$(SPHINXBUILD) -b gettext $(I18NSPHINXOPTS) $(BUILDDIR)/locale
|
| 136 |
-
@echo
|
| 137 |
-
@echo "Build finished. The message catalogs are in $(BUILDDIR)/locale."
|
| 138 |
-
|
| 139 |
-
changes:
|
| 140 |
-
$(SPHINXBUILD) -b changes $(ALLSPHINXOPTS) $(BUILDDIR)/changes
|
| 141 |
-
@echo
|
| 142 |
-
@echo "The overview file is in $(BUILDDIR)/changes."
|
| 143 |
-
|
| 144 |
-
linkcheck:
|
| 145 |
-
$(SPHINXBUILD) -b linkcheck $(ALLSPHINXOPTS) $(BUILDDIR)/linkcheck
|
| 146 |
-
@echo
|
| 147 |
-
@echo "Link check complete; look for any errors in the above output " \
|
| 148 |
-
"or in $(BUILDDIR)/linkcheck/output.txt."
|
| 149 |
-
|
| 150 |
-
doctest:
|
| 151 |
-
$(SPHINXBUILD) -b doctest $(ALLSPHINXOPTS) $(BUILDDIR)/doctest
|
| 152 |
-
@echo "Testing of doctests in the sources finished, look at the " \
|
| 153 |
-
"results in $(BUILDDIR)/doctest/output.txt."
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/client_handlers.rst
DELETED
|
@@ -1,173 +0,0 @@
|
|
| 1 |
-
===============
|
| 2 |
-
Client Handlers
|
| 3 |
-
===============
|
| 4 |
-
|
| 5 |
-
Client handlers accept a request array and return a future response array that
|
| 6 |
-
can be used synchronously as an array or asynchronously using a promise.
|
| 7 |
-
|
| 8 |
-
Built-In Handlers
|
| 9 |
-
-----------------
|
| 10 |
-
|
| 11 |
-
RingPHP comes with three built-in client handlers.
|
| 12 |
-
|
| 13 |
-
Stream Handler
|
| 14 |
-
~~~~~~~~~~~~~~
|
| 15 |
-
|
| 16 |
-
The ``GuzzleHttp\Ring\Client\StreamHandler`` uses PHP's
|
| 17 |
-
`http stream wrapper <http://php.net/manual/en/wrappers.http.php>`_ to send
|
| 18 |
-
requests.
|
| 19 |
-
|
| 20 |
-
.. note::
|
| 21 |
-
|
| 22 |
-
This handler cannot send requests concurrently.
|
| 23 |
-
|
| 24 |
-
You can provide an associative array of custom stream context options to the
|
| 25 |
-
StreamHandler using the ``stream_context`` key of the ``client`` request
|
| 26 |
-
option.
|
| 27 |
-
|
| 28 |
-
.. code-block:: php
|
| 29 |
-
|
| 30 |
-
use GuzzleHttp\Ring\Client\StreamHandler;
|
| 31 |
-
|
| 32 |
-
$response = $handler([
|
| 33 |
-
'http_method' => 'GET',
|
| 34 |
-
'uri' => '/',
|
| 35 |
-
'headers' => ['host' => ['httpbin.org']],
|
| 36 |
-
'client' => [
|
| 37 |
-
'stream_context' => [
|
| 38 |
-
'http' => [
|
| 39 |
-
'request_fulluri' => true,
|
| 40 |
-
'method' => 'HEAD'
|
| 41 |
-
],
|
| 42 |
-
'socket' => [
|
| 43 |
-
'bindto' => '127.0.0.1:0'
|
| 44 |
-
],
|
| 45 |
-
'ssl' => [
|
| 46 |
-
'verify_peer' => false
|
| 47 |
-
]
|
| 48 |
-
]
|
| 49 |
-
]
|
| 50 |
-
]);
|
| 51 |
-
|
| 52 |
-
// Even though it's already completed, you can still use a promise
|
| 53 |
-
$response->then(function ($response) {
|
| 54 |
-
echo $response['status']; // 200
|
| 55 |
-
});
|
| 56 |
-
|
| 57 |
-
// Or access the response using the future interface
|
| 58 |
-
echo $response['status']; // 200
|
| 59 |
-
|
| 60 |
-
cURL Handler
|
| 61 |
-
~~~~~~~~~~~~
|
| 62 |
-
|
| 63 |
-
The ``GuzzleHttp\Ring\Client\CurlHandler`` can be used with PHP 5.5+ to send
|
| 64 |
-
requests using cURL easy handles. This handler is great for sending requests
|
| 65 |
-
one at a time because the execute and select loop is implemented in C code
|
| 66 |
-
which executes faster and consumes less memory than using PHP's
|
| 67 |
-
``curl_multi_*`` interface.
|
| 68 |
-
|
| 69 |
-
.. note::
|
| 70 |
-
|
| 71 |
-
This handler cannot send requests concurrently.
|
| 72 |
-
|
| 73 |
-
When using the CurlHandler, custom curl options can be specified as an
|
| 74 |
-
associative array of `cURL option constants <http://php.net/manual/en/curl.constants.php>`_
|
| 75 |
-
mapping to values in the ``client`` option of a requst using the **curl** key.
|
| 76 |
-
|
| 77 |
-
.. code-block:: php
|
| 78 |
-
|
| 79 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 80 |
-
|
| 81 |
-
$handler = new CurlHandler();
|
| 82 |
-
|
| 83 |
-
$request = [
|
| 84 |
-
'http_method' => 'GET',
|
| 85 |
-
'headers' => ['host' => [Server::$host]],
|
| 86 |
-
'client' => ['curl' => [CURLOPT_LOW_SPEED_LIMIT => 10]]
|
| 87 |
-
];
|
| 88 |
-
|
| 89 |
-
$response = $handler($request);
|
| 90 |
-
|
| 91 |
-
// The response can be used directly as an array.
|
| 92 |
-
echo $response['status']; // 200
|
| 93 |
-
|
| 94 |
-
// Or, it can be used as a promise (that has already fulfilled).
|
| 95 |
-
$response->then(function ($response) {
|
| 96 |
-
echo $response['status']; // 200
|
| 97 |
-
});
|
| 98 |
-
|
| 99 |
-
cURL Multi Handler
|
| 100 |
-
~~~~~~~~~~~~~~~~~~
|
| 101 |
-
|
| 102 |
-
The ``GuzzleHttp\Ring\Client\CurlMultiHandler`` transfers requests using
|
| 103 |
-
cURL's `multi API <http://curl.haxx.se/libcurl/c/libcurl-multi.html>`_. The
|
| 104 |
-
``CurlMultiHandler`` is great for sending requests concurrently.
|
| 105 |
-
|
| 106 |
-
.. code-block:: php
|
| 107 |
-
|
| 108 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 109 |
-
|
| 110 |
-
$handler = new CurlMultiHandler();
|
| 111 |
-
|
| 112 |
-
$request = [
|
| 113 |
-
'http_method' => 'GET',
|
| 114 |
-
'headers' => ['host' => [Server::$host]]
|
| 115 |
-
];
|
| 116 |
-
|
| 117 |
-
// this call returns a future array immediately.
|
| 118 |
-
$response = $handler($request);
|
| 119 |
-
|
| 120 |
-
// Ideally, you should use the promise API to not block.
|
| 121 |
-
$response
|
| 122 |
-
->then(function ($response) {
|
| 123 |
-
// Got the response at some point in the future
|
| 124 |
-
echo $response['status']; // 200
|
| 125 |
-
// Don't break the chain
|
| 126 |
-
return $response;
|
| 127 |
-
})->then(function ($response) {
|
| 128 |
-
// ...
|
| 129 |
-
});
|
| 130 |
-
|
| 131 |
-
// If you really need to block, then you can use the response as an
|
| 132 |
-
// associative array. This will block until it has completed.
|
| 133 |
-
echo $response['status']; // 200
|
| 134 |
-
|
| 135 |
-
Just like the ``CurlHandler``, the ``CurlMultiHandler`` accepts custom curl
|
| 136 |
-
option in the ``curl`` key of the ``client`` request option.
|
| 137 |
-
|
| 138 |
-
Mock Handler
|
| 139 |
-
~~~~~~~~~~~~
|
| 140 |
-
|
| 141 |
-
The ``GuzzleHttp\Ring\Client\MockHandler`` is used to return mock responses.
|
| 142 |
-
When constructed, the handler can be configured to return the same response
|
| 143 |
-
array over and over, a future response, or a the evaluation of a callback
|
| 144 |
-
function.
|
| 145 |
-
|
| 146 |
-
.. code-block:: php
|
| 147 |
-
|
| 148 |
-
use GuzzleHttp\Ring\Client\MockHandler;
|
| 149 |
-
|
| 150 |
-
// Return a canned response.
|
| 151 |
-
$mock = new MockHandler(['status' => 200]);
|
| 152 |
-
$response = $mock([]);
|
| 153 |
-
assert(200 == $response['status']);
|
| 154 |
-
assert([] == $response['headers']);
|
| 155 |
-
|
| 156 |
-
Implementing Handlers
|
| 157 |
-
---------------------
|
| 158 |
-
|
| 159 |
-
Client handlers are just PHP callables (functions or classes that have the
|
| 160 |
-
``__invoke`` magic method). The callable accepts a request array and MUST
|
| 161 |
-
return an instance of ``GuzzleHttp\Ring\Future\FutureArrayInterface`` so that
|
| 162 |
-
the response can be used by both blocking and non-blocking consumers.
|
| 163 |
-
|
| 164 |
-
Handlers need to follow a few simple rules:
|
| 165 |
-
|
| 166 |
-
1. Do not throw exceptions. If an error is encountered, return an array that
|
| 167 |
-
contains the ``error`` key that maps to an ``\Exception`` value.
|
| 168 |
-
2. If the request has a ``delay`` client option, then the handler should only
|
| 169 |
-
send the request after the specified delay time in seconds. Blocking
|
| 170 |
-
handlers may find it convenient to just let the
|
| 171 |
-
``GuzzleHttp\Ring\Core::doSleep($request)`` function handle this for them.
|
| 172 |
-
3. Always return an instance of ``GuzzleHttp\Ring\Future\FutureArrayInterface``.
|
| 173 |
-
4. Complete any outstanding requests when the handler is destructed.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/client_middleware.rst
DELETED
|
@@ -1,165 +0,0 @@
|
|
| 1 |
-
=================
|
| 2 |
-
Client Middleware
|
| 3 |
-
=================
|
| 4 |
-
|
| 5 |
-
Middleware intercepts requests before they are sent over the wire and can be
|
| 6 |
-
used to add functionality to handlers.
|
| 7 |
-
|
| 8 |
-
Modifying Requests
|
| 9 |
-
------------------
|
| 10 |
-
|
| 11 |
-
Let's say you wanted to modify requests before they are sent over the wire
|
| 12 |
-
so that they always add specific headers. This can be accomplished by creating
|
| 13 |
-
a function that accepts a handler and returns a new function that adds the
|
| 14 |
-
composed behavior.
|
| 15 |
-
|
| 16 |
-
.. code-block:: php
|
| 17 |
-
|
| 18 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 19 |
-
|
| 20 |
-
$handler = new CurlHandler();
|
| 21 |
-
|
| 22 |
-
$addHeaderHandler = function (callable $handler, array $headers = []) {
|
| 23 |
-
return function (array $request) use ($handler, $headers) {
|
| 24 |
-
// Add our custom headers
|
| 25 |
-
foreach ($headers as $key => $value) {
|
| 26 |
-
$request['headers'][$key] = $value;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
// Send the request using the handler and return the response.
|
| 30 |
-
return $handler($request);
|
| 31 |
-
}
|
| 32 |
-
};
|
| 33 |
-
|
| 34 |
-
// Create a new handler that adds headers to each request.
|
| 35 |
-
$handler = $addHeaderHandler($handler, [
|
| 36 |
-
'X-AddMe' => 'hello',
|
| 37 |
-
'Authorization' => 'Basic xyz'
|
| 38 |
-
]);
|
| 39 |
-
|
| 40 |
-
$response = $handler([
|
| 41 |
-
'http_method' => 'GET',
|
| 42 |
-
'headers' => ['Host' => ['httpbin.org']]
|
| 43 |
-
]);
|
| 44 |
-
|
| 45 |
-
Modifying Responses
|
| 46 |
-
-------------------
|
| 47 |
-
|
| 48 |
-
You can change a response as it's returned from a middleware. Remember that
|
| 49 |
-
responses returned from an handler (including middleware) must implement
|
| 50 |
-
``GuzzleHttp\Ring\Future\FutureArrayInterface``. In order to be a good citizen,
|
| 51 |
-
you should not expect that the responses returned through your middleware will
|
| 52 |
-
be completed synchronously. Instead, you should use the
|
| 53 |
-
``GuzzleHttp\Ring\Core::proxy()`` function to modify the response when the
|
| 54 |
-
underlying promise is resolved. This function is a helper function that makes it
|
| 55 |
-
easy to create a new instance of ``FutureArrayInterface`` that wraps an existing
|
| 56 |
-
``FutureArrayInterface`` object.
|
| 57 |
-
|
| 58 |
-
Let's say you wanted to add headers to a response as they are returned from
|
| 59 |
-
your middleware, but you want to make sure you aren't causing future
|
| 60 |
-
responses to be dereferenced right away. You can achieve this by modifying the
|
| 61 |
-
incoming request and using the ``Core::proxy`` function.
|
| 62 |
-
|
| 63 |
-
.. code-block:: php
|
| 64 |
-
|
| 65 |
-
use GuzzleHttp\Ring\Core;
|
| 66 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 67 |
-
|
| 68 |
-
$handler = new CurlHandler();
|
| 69 |
-
|
| 70 |
-
$responseHeaderHandler = function (callable $handler, array $headers) {
|
| 71 |
-
return function (array $request) use ($handler, $headers) {
|
| 72 |
-
// Send the request using the wrapped handler.
|
| 73 |
-
return Core::proxy($handler($request), function ($response) use ($headers) {
|
| 74 |
-
// Add the headers to the response when it is available.
|
| 75 |
-
foreach ($headers as $key => $value) {
|
| 76 |
-
$response['headers'][$key] = (array) $value;
|
| 77 |
-
}
|
| 78 |
-
// Note that you can return a regular response array when using
|
| 79 |
-
// the proxy method.
|
| 80 |
-
return $response;
|
| 81 |
-
});
|
| 82 |
-
}
|
| 83 |
-
};
|
| 84 |
-
|
| 85 |
-
// Create a new handler that adds headers to each response.
|
| 86 |
-
$handler = $responseHeaderHandler($handler, ['X-Header' => 'hello!']);
|
| 87 |
-
|
| 88 |
-
$response = $handler([
|
| 89 |
-
'http_method' => 'GET',
|
| 90 |
-
'headers' => ['Host' => ['httpbin.org']]
|
| 91 |
-
]);
|
| 92 |
-
|
| 93 |
-
assert($response['headers']['X-Header'] == 'hello!');
|
| 94 |
-
|
| 95 |
-
Built-In Middleware
|
| 96 |
-
-------------------
|
| 97 |
-
|
| 98 |
-
RingPHP comes with a few basic client middlewares that modify requests
|
| 99 |
-
and responses.
|
| 100 |
-
|
| 101 |
-
Streaming Middleware
|
| 102 |
-
~~~~~~~~~~~~~~~~~~~~
|
| 103 |
-
|
| 104 |
-
If you want to send all requests with the ``streaming`` option to a specific
|
| 105 |
-
handler but other requests to a different handler, then use the streaming
|
| 106 |
-
middleware.
|
| 107 |
-
|
| 108 |
-
.. code-block:: php
|
| 109 |
-
|
| 110 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 111 |
-
use GuzzleHttp\Ring\Client\StreamHandler;
|
| 112 |
-
use GuzzleHttp\Ring\Client\Middleware;
|
| 113 |
-
|
| 114 |
-
$defaultHandler = new CurlHandler();
|
| 115 |
-
$streamingHandler = new StreamHandler();
|
| 116 |
-
$streamingHandler = Middleware::wrapStreaming(
|
| 117 |
-
$defaultHandler,
|
| 118 |
-
$streamingHandler
|
| 119 |
-
);
|
| 120 |
-
|
| 121 |
-
// Send the request using the streaming handler.
|
| 122 |
-
$response = $streamingHandler([
|
| 123 |
-
'http_method' => 'GET',
|
| 124 |
-
'headers' => ['Host' => ['www.google.com']],
|
| 125 |
-
'stream' => true
|
| 126 |
-
]);
|
| 127 |
-
|
| 128 |
-
// Send the request using the default handler.
|
| 129 |
-
$response = $streamingHandler([
|
| 130 |
-
'http_method' => 'GET',
|
| 131 |
-
'headers' => ['Host' => ['www.google.com']]
|
| 132 |
-
]);
|
| 133 |
-
|
| 134 |
-
Future Middleware
|
| 135 |
-
~~~~~~~~~~~~~~~~~
|
| 136 |
-
|
| 137 |
-
If you want to send all requests with the ``future`` option to a specific
|
| 138 |
-
handler but other requests to a different handler, then use the future
|
| 139 |
-
middleware.
|
| 140 |
-
|
| 141 |
-
.. code-block:: php
|
| 142 |
-
|
| 143 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 144 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 145 |
-
use GuzzleHttp\Ring\Client\Middleware;
|
| 146 |
-
|
| 147 |
-
$defaultHandler = new CurlHandler();
|
| 148 |
-
$futureHandler = new CurlMultiHandler();
|
| 149 |
-
$futureHandler = Middleware::wrapFuture(
|
| 150 |
-
$defaultHandler,
|
| 151 |
-
$futureHandler
|
| 152 |
-
);
|
| 153 |
-
|
| 154 |
-
// Send the request using the blocking CurlHandler.
|
| 155 |
-
$response = $futureHandler([
|
| 156 |
-
'http_method' => 'GET',
|
| 157 |
-
'headers' => ['Host' => ['www.google.com']]
|
| 158 |
-
]);
|
| 159 |
-
|
| 160 |
-
// Send the request using the non-blocking CurlMultiHandler.
|
| 161 |
-
$response = $futureHandler([
|
| 162 |
-
'http_method' => 'GET',
|
| 163 |
-
'headers' => ['Host' => ['www.google.com']],
|
| 164 |
-
'future' => true
|
| 165 |
-
]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/conf.py
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
import sys, os
|
| 2 |
-
import sphinx_rtd_theme
|
| 3 |
-
from sphinx.highlighting import lexers
|
| 4 |
-
from pygments.lexers.web import PhpLexer
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
lexers['php'] = PhpLexer(startinline=True, linenos=1)
|
| 8 |
-
lexers['php-annotations'] = PhpLexer(startinline=True, linenos=1)
|
| 9 |
-
primary_domain = 'php'
|
| 10 |
-
|
| 11 |
-
extensions = []
|
| 12 |
-
templates_path = ['_templates']
|
| 13 |
-
source_suffix = '.rst'
|
| 14 |
-
master_doc = 'index'
|
| 15 |
-
project = u'RingPHP'
|
| 16 |
-
copyright = u'2014, Michael Dowling'
|
| 17 |
-
version = '1.0.0-alpha'
|
| 18 |
-
exclude_patterns = ['_build']
|
| 19 |
-
|
| 20 |
-
html_title = "RingPHP"
|
| 21 |
-
html_short_title = "RingPHP"
|
| 22 |
-
html_theme = "sphinx_rtd_theme"
|
| 23 |
-
html_theme_path = [sphinx_rtd_theme.get_html_theme_path()]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/futures.rst
DELETED
|
@@ -1,164 +0,0 @@
|
|
| 1 |
-
=======
|
| 2 |
-
Futures
|
| 3 |
-
=======
|
| 4 |
-
|
| 5 |
-
Futures represent a computation that may have not yet completed. RingPHP
|
| 6 |
-
uses hybrid of futures and promises to provide a consistent API that can be
|
| 7 |
-
used for both blocking and non-blocking consumers.
|
| 8 |
-
|
| 9 |
-
Promises
|
| 10 |
-
--------
|
| 11 |
-
|
| 12 |
-
You can get the result of a future when it is ready using the promise interface
|
| 13 |
-
of a future. Futures expose a promise API via a ``then()`` method that utilizes
|
| 14 |
-
`React's promise library <https://github.com/reactphp/promise>`_. You should
|
| 15 |
-
use this API when you do not wish to block.
|
| 16 |
-
|
| 17 |
-
.. code-block:: php
|
| 18 |
-
|
| 19 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 20 |
-
|
| 21 |
-
$request = [
|
| 22 |
-
'http_method' => 'GET',
|
| 23 |
-
'uri' => '/',
|
| 24 |
-
'headers' => ['host' => ['httpbin.org']]
|
| 25 |
-
];
|
| 26 |
-
|
| 27 |
-
$response = $handler($request);
|
| 28 |
-
|
| 29 |
-
// Use the then() method to use the promise API of the future.
|
| 30 |
-
$response->then(function ($response) {
|
| 31 |
-
echo $response['status'];
|
| 32 |
-
});
|
| 33 |
-
|
| 34 |
-
You can get the promise used by a future, an instance of
|
| 35 |
-
``React\Promise\PromiseInterface``, by calling the ``promise()`` method.
|
| 36 |
-
|
| 37 |
-
.. code-block:: php
|
| 38 |
-
|
| 39 |
-
$response = $handler($request);
|
| 40 |
-
$promise = $response->promise();
|
| 41 |
-
$promise->then(function ($response) {
|
| 42 |
-
echo $response['status'];
|
| 43 |
-
});
|
| 44 |
-
|
| 45 |
-
This promise value can be used with React's
|
| 46 |
-
`aggregate promise functions <https://github.com/reactphp/promise#functions>`_.
|
| 47 |
-
|
| 48 |
-
Waiting
|
| 49 |
-
-------
|
| 50 |
-
|
| 51 |
-
You can wait on a future to complete and retrieve the value, or *dereference*
|
| 52 |
-
the future, using the ``wait()`` method. Calling the ``wait()`` method of a
|
| 53 |
-
future will block until the result is available. The result is then returned or
|
| 54 |
-
an exception is thrown if and exception was encountered while waiting on the
|
| 55 |
-
the result. Subsequent calls to dereference a future will return the previously
|
| 56 |
-
completed result or throw the previously encountered exception. Futures can be
|
| 57 |
-
cancelled, which stops the computation if possible.
|
| 58 |
-
|
| 59 |
-
.. code-block:: php
|
| 60 |
-
|
| 61 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 62 |
-
|
| 63 |
-
$response = $handler([
|
| 64 |
-
'http_method' => 'GET',
|
| 65 |
-
'uri' => '/',
|
| 66 |
-
'headers' => ['host' => ['httpbin.org']]
|
| 67 |
-
]);
|
| 68 |
-
|
| 69 |
-
// You can explicitly call block to wait on a result.
|
| 70 |
-
$realizedResponse = $response->wait();
|
| 71 |
-
|
| 72 |
-
// Future responses can be used like a regular PHP array.
|
| 73 |
-
echo $response['status'];
|
| 74 |
-
|
| 75 |
-
In addition to explicitly calling the ``wait()`` function, using a future like
|
| 76 |
-
a normal value will implicitly trigger the ``wait()`` function.
|
| 77 |
-
|
| 78 |
-
Future Responses
|
| 79 |
-
----------------
|
| 80 |
-
|
| 81 |
-
RingPHP uses futures to return asynchronous responses immediately. Client
|
| 82 |
-
handlers always return future responses that implement
|
| 83 |
-
``GuzzleHttp\Ring\Future\ArrayFutureInterface``. These future responses act
|
| 84 |
-
just like normal PHP associative arrays for blocking access and provide a
|
| 85 |
-
promise interface for non-blocking access.
|
| 86 |
-
|
| 87 |
-
.. code-block:: php
|
| 88 |
-
|
| 89 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 90 |
-
|
| 91 |
-
$handler = new CurlMultiHandler();
|
| 92 |
-
|
| 93 |
-
$request = [
|
| 94 |
-
'http_method' => 'GET',
|
| 95 |
-
'uri' => '/',
|
| 96 |
-
'headers' => ['Host' => ['www.google.com']]
|
| 97 |
-
];
|
| 98 |
-
|
| 99 |
-
$response = $handler($request);
|
| 100 |
-
|
| 101 |
-
// Use the promise API for non-blocking access to the response. The actual
|
| 102 |
-
// response value will be delivered to the promise.
|
| 103 |
-
$response->then(function ($response) {
|
| 104 |
-
echo $response['status'];
|
| 105 |
-
});
|
| 106 |
-
|
| 107 |
-
// You can wait (block) until the future is completed.
|
| 108 |
-
$response->wait();
|
| 109 |
-
|
| 110 |
-
// This will implicitly call wait(), and will block too!
|
| 111 |
-
$response['status'];
|
| 112 |
-
|
| 113 |
-
.. important::
|
| 114 |
-
|
| 115 |
-
Futures that are not completed by the time the underlying handler is
|
| 116 |
-
destructed will be completed when the handler is shutting down.
|
| 117 |
-
|
| 118 |
-
Cancelling
|
| 119 |
-
----------
|
| 120 |
-
|
| 121 |
-
Futures can be cancelled if they have not already been dereferenced.
|
| 122 |
-
|
| 123 |
-
RingPHP futures are typically implemented with the
|
| 124 |
-
``GuzzleHttp\Ring\Future\BaseFutureTrait``. This trait provides the cancellation
|
| 125 |
-
functionality that should be common to most implementations. Cancelling a
|
| 126 |
-
future response will try to prevent the request from sending over the wire.
|
| 127 |
-
|
| 128 |
-
When a future is cancelled, the cancellation function is invoked and performs
|
| 129 |
-
the actual work needed to cancel the request from sending if possible
|
| 130 |
-
(e.g., telling an event loop to stop sending a request or to close a socket).
|
| 131 |
-
If no cancellation function is provided, then a request cannot be cancelled. If
|
| 132 |
-
a cancel function is provided, then it should accept the future as an argument
|
| 133 |
-
and return true if the future was successfully cancelled or false if it could
|
| 134 |
-
not be cancelled.
|
| 135 |
-
|
| 136 |
-
Wrapping an existing Promise
|
| 137 |
-
----------------------------
|
| 138 |
-
|
| 139 |
-
You can easily create a future from any existing promise using the
|
| 140 |
-
``GuzzleHttp\Ring\Future\FutureValue`` class. This class's constructor
|
| 141 |
-
accepts a promise as the first argument, a wait function as the second
|
| 142 |
-
argument, and a cancellation function as the third argument. The dereference
|
| 143 |
-
function is used to force the promise to resolve (for example, manually ticking
|
| 144 |
-
an event loop). The cancel function is optional and is used to tell the thing
|
| 145 |
-
that created the promise that it can stop computing the result (for example,
|
| 146 |
-
telling an event loop to stop transferring a request).
|
| 147 |
-
|
| 148 |
-
.. code-block:: php
|
| 149 |
-
|
| 150 |
-
use GuzzleHttp\Ring\Future\FutureValue;
|
| 151 |
-
use React\Promise\Deferred;
|
| 152 |
-
|
| 153 |
-
$deferred = new Deferred();
|
| 154 |
-
$promise = $deferred->promise();
|
| 155 |
-
|
| 156 |
-
$f = new FutureValue(
|
| 157 |
-
$promise,
|
| 158 |
-
function () use ($deferred) {
|
| 159 |
-
// This function is responsible for blocking and resolving the
|
| 160 |
-
// promise. Here we pass in a reference to the deferred so that
|
| 161 |
-
// it can be resolved or rejected.
|
| 162 |
-
$deferred->resolve('foo');
|
| 163 |
-
}
|
| 164 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/index.rst
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
=======
|
| 2 |
-
RingPHP
|
| 3 |
-
=======
|
| 4 |
-
|
| 5 |
-
Provides a simple API and specification that abstracts away the details of HTTP
|
| 6 |
-
into a single PHP function. RingPHP be used to power HTTP clients and servers
|
| 7 |
-
through a PHP function that accepts a request hash and returns a response hash
|
| 8 |
-
that is fulfilled using a `promise <https://github.com/reactphp/promise>`_,
|
| 9 |
-
allowing RingPHP to support both synchronous and asynchronous workflows.
|
| 10 |
-
|
| 11 |
-
By abstracting the implementation details of different HTTP clients and
|
| 12 |
-
servers, RingPHP allows you to utilize pluggable HTTP clients and servers
|
| 13 |
-
without tying your application to a specific implementation.
|
| 14 |
-
|
| 15 |
-
.. toctree::
|
| 16 |
-
:maxdepth: 2
|
| 17 |
-
|
| 18 |
-
spec
|
| 19 |
-
futures
|
| 20 |
-
client_middleware
|
| 21 |
-
client_handlers
|
| 22 |
-
testing
|
| 23 |
-
|
| 24 |
-
.. code-block:: php
|
| 25 |
-
|
| 26 |
-
<?php
|
| 27 |
-
require 'vendor/autoload.php';
|
| 28 |
-
|
| 29 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 30 |
-
|
| 31 |
-
$handler = new CurlHandler();
|
| 32 |
-
$response = $handler([
|
| 33 |
-
'http_method' => 'GET',
|
| 34 |
-
'uri' => '/',
|
| 35 |
-
'headers' => [
|
| 36 |
-
'host' => ['www.google.com'],
|
| 37 |
-
'x-foo' => ['baz']
|
| 38 |
-
]
|
| 39 |
-
]);
|
| 40 |
-
|
| 41 |
-
$response->then(function (array $response) {
|
| 42 |
-
echo $response['status'];
|
| 43 |
-
});
|
| 44 |
-
|
| 45 |
-
$response->wait();
|
| 46 |
-
|
| 47 |
-
RingPHP is inspired by Clojure's `Ring <https://github.com/ring-clojure/ring>`_,
|
| 48 |
-
which, in turn, was inspired by Python's WSGI and Ruby's Rack. RingPHP is
|
| 49 |
-
utilized as the handler layer in `Guzzle <http://guzzlephp.org>`_ 5.0+ to send
|
| 50 |
-
HTTP requests.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/requirements.txt
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
sphinx_rtd_theme
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/spec.rst
DELETED
|
@@ -1,311 +0,0 @@
|
|
| 1 |
-
=============
|
| 2 |
-
Specification
|
| 3 |
-
=============
|
| 4 |
-
|
| 5 |
-
RingPHP applications consist of handlers, requests, responses, and
|
| 6 |
-
middleware.
|
| 7 |
-
|
| 8 |
-
Handlers
|
| 9 |
-
--------
|
| 10 |
-
|
| 11 |
-
Handlers are implemented as a PHP ``callable`` that accept a request array
|
| 12 |
-
and return a response array (``GuzzleHttp\Ring\Future\FutureArrayInterface``).
|
| 13 |
-
|
| 14 |
-
For example:
|
| 15 |
-
|
| 16 |
-
.. code-block:: php
|
| 17 |
-
|
| 18 |
-
use GuzzleHttp\Ring\Future\CompletedFutureArray;
|
| 19 |
-
|
| 20 |
-
$mockHandler = function (array $request) {
|
| 21 |
-
return new CompletedFutureArray([
|
| 22 |
-
'status' => 200,
|
| 23 |
-
'headers' => ['X-Foo' => ['Bar']],
|
| 24 |
-
'body' => 'Hello!'
|
| 25 |
-
]);
|
| 26 |
-
};
|
| 27 |
-
|
| 28 |
-
This handler returns the same response each time it is invoked. All RingPHP
|
| 29 |
-
handlers must return a ``GuzzleHttp\Ring\Future\FutureArrayInterface``. Use
|
| 30 |
-
``GuzzleHttp\Ring\Future\CompletedFutureArray`` when returning a response that
|
| 31 |
-
has already completed.
|
| 32 |
-
|
| 33 |
-
Requests
|
| 34 |
-
--------
|
| 35 |
-
|
| 36 |
-
A request array is a PHP associative array that contains the configuration
|
| 37 |
-
settings need to send a request.
|
| 38 |
-
|
| 39 |
-
.. code-block:: php
|
| 40 |
-
|
| 41 |
-
$request = [
|
| 42 |
-
'http_method' => 'GET',
|
| 43 |
-
'scheme' => 'http',
|
| 44 |
-
'uri' => '/',
|
| 45 |
-
'body' => 'hello!',
|
| 46 |
-
'client' => ['timeout' => 1.0],
|
| 47 |
-
'headers' => [
|
| 48 |
-
'host' => ['httpbin.org'],
|
| 49 |
-
'X-Foo' => ['baz', 'bar']
|
| 50 |
-
]
|
| 51 |
-
];
|
| 52 |
-
|
| 53 |
-
The request array contains the following key value pairs:
|
| 54 |
-
|
| 55 |
-
request_method
|
| 56 |
-
(string, required) The HTTP request method, must be all caps corresponding
|
| 57 |
-
to a HTTP request method, such as ``GET`` or ``POST``.
|
| 58 |
-
|
| 59 |
-
scheme
|
| 60 |
-
(string) The transport protocol, must be one of ``http`` or ``https``.
|
| 61 |
-
Defaults to ``http``.
|
| 62 |
-
|
| 63 |
-
uri
|
| 64 |
-
(string, required) The request URI excluding the query string. Must
|
| 65 |
-
start with "/".
|
| 66 |
-
|
| 67 |
-
query_string
|
| 68 |
-
(string) The query string, if present (e.g., ``foo=bar``).
|
| 69 |
-
|
| 70 |
-
version
|
| 71 |
-
(string) HTTP protocol version. Defaults to ``1.1``.
|
| 72 |
-
|
| 73 |
-
headers
|
| 74 |
-
(required, array) Associative array of headers. Each key represents the
|
| 75 |
-
header name. Each value contains an array of strings where each entry of
|
| 76 |
-
the array SHOULD be sent over the wire on a separate header line.
|
| 77 |
-
|
| 78 |
-
body
|
| 79 |
-
(string, fopen resource, ``Iterator``, ``GuzzleHttp\Stream\StreamInterface``)
|
| 80 |
-
The body of the request, if present. Can be a string, resource returned
|
| 81 |
-
from fopen, an ``Iterator`` that yields chunks of data, an object that
|
| 82 |
-
implemented ``__toString``, or a ``GuzzleHttp\Stream\StreamInterface``.
|
| 83 |
-
|
| 84 |
-
future
|
| 85 |
-
(bool, string) Controls the asynchronous behavior of a response.
|
| 86 |
-
|
| 87 |
-
Set to ``true`` or omit the ``future`` option to *request* that a request
|
| 88 |
-
will be completed asynchronously. Keep in mind that your request might not
|
| 89 |
-
necessarily be completed asynchronously based on the handler you are using.
|
| 90 |
-
Set the ``future`` option to ``false`` to request that a synchronous
|
| 91 |
-
response be provided.
|
| 92 |
-
|
| 93 |
-
You can provide a string value to specify fine-tuned future behaviors that
|
| 94 |
-
may be specific to the underlying handlers you are using. There are,
|
| 95 |
-
however, some common future options that handlers should implement if
|
| 96 |
-
possible.
|
| 97 |
-
|
| 98 |
-
lazy
|
| 99 |
-
Requests that the handler does not open and send the request
|
| 100 |
-
immediately, but rather only opens and sends the request once the
|
| 101 |
-
future is dereferenced. This option is often useful for sending a large
|
| 102 |
-
number of requests concurrently to allow handlers to take better
|
| 103 |
-
advantage of non-blocking transfers by first building up a pool of
|
| 104 |
-
requests.
|
| 105 |
-
|
| 106 |
-
If an handler does not implement or understand a provided string value,
|
| 107 |
-
then the request MUST be treated as if the user provided ``true`` rather
|
| 108 |
-
than the string value.
|
| 109 |
-
|
| 110 |
-
Future responses created by asynchronous handlers MUST attempt to complete
|
| 111 |
-
any outstanding future responses when they are destructed. Asynchronous
|
| 112 |
-
handlers MAY choose to automatically complete responses when the number
|
| 113 |
-
of outstanding requests reaches an handler-specific threshold.
|
| 114 |
-
|
| 115 |
-
Client Specific Options
|
| 116 |
-
~~~~~~~~~~~~~~~~~~~~~~~
|
| 117 |
-
|
| 118 |
-
The following options are only used in ring client handlers.
|
| 119 |
-
|
| 120 |
-
.. _client-options:
|
| 121 |
-
|
| 122 |
-
client
|
| 123 |
-
(array) Associative array of client specific transfer options. The
|
| 124 |
-
``client`` request key value pair can contain the following keys:
|
| 125 |
-
|
| 126 |
-
cert
|
| 127 |
-
(string, array) Set to a string to specify the path to a file
|
| 128 |
-
containing a PEM formatted SSL client side certificate. If a password
|
| 129 |
-
is required, then set ``cert`` to an array containing the path to the
|
| 130 |
-
PEM file in the first array element followed by the certificate
|
| 131 |
-
password in the second array element.
|
| 132 |
-
|
| 133 |
-
connect_timeout
|
| 134 |
-
(float) Float describing the number of seconds to wait while trying to
|
| 135 |
-
connect to a server. Use ``0`` to wait indefinitely (the default
|
| 136 |
-
behavior).
|
| 137 |
-
|
| 138 |
-
debug
|
| 139 |
-
(bool, fopen() resource) Set to true or set to a PHP stream returned by
|
| 140 |
-
fopen() to enable debug output with the handler used to send a request.
|
| 141 |
-
If set to ``true``, the output is written to PHP's STDOUT. If a PHP
|
| 142 |
-
``fopen`` resource handle is provided, the output is written to the
|
| 143 |
-
stream.
|
| 144 |
-
|
| 145 |
-
"Debug output" is handler specific: different handlers will yield
|
| 146 |
-
different output and various various level of detail. For example, when
|
| 147 |
-
using cURL to transfer requests, cURL's `CURLOPT_VERBOSE <http://curl.haxx.se/libcurl/c/CURLOPT_VERBOSE.html>`_
|
| 148 |
-
will be used. When using the PHP stream wrapper, `stream notifications <http://php.net/manual/en/function.stream-notification-callback.php>`_
|
| 149 |
-
will be emitted.
|
| 150 |
-
|
| 151 |
-
decode_content
|
| 152 |
-
(bool) Specify whether or not ``Content-Encoding`` responses
|
| 153 |
-
(gzip, deflate, etc.) are automatically decoded. Set to ``true`` to
|
| 154 |
-
automatically decode encoded responses. Set to ``false`` to not decode
|
| 155 |
-
responses. By default, content is *not* decoded automatically.
|
| 156 |
-
|
| 157 |
-
delay
|
| 158 |
-
(int) The number of milliseconds to delay before sending the request.
|
| 159 |
-
This is often used for delaying before retrying a request. Handlers
|
| 160 |
-
SHOULD implement this if possible, but it is not a strict requirement.
|
| 161 |
-
|
| 162 |
-
progress
|
| 163 |
-
(function) Defines a function to invoke when transfer progress is made.
|
| 164 |
-
The function accepts the following arguments:
|
| 165 |
-
|
| 166 |
-
1. The total number of bytes expected to be downloaded
|
| 167 |
-
2. The number of bytes downloaded so far
|
| 168 |
-
3. The number of bytes expected to be uploaded
|
| 169 |
-
4. The number of bytes uploaded so far
|
| 170 |
-
|
| 171 |
-
proxy
|
| 172 |
-
(string, array) Pass a string to specify an HTTP proxy, or an
|
| 173 |
-
associative array to specify different proxies for different protocols
|
| 174 |
-
where the scheme is the key and the value is the proxy address.
|
| 175 |
-
|
| 176 |
-
.. code-block:: php
|
| 177 |
-
|
| 178 |
-
$request = [
|
| 179 |
-
'http_method' => 'GET',
|
| 180 |
-
'headers' => ['host' => ['httpbin.org']],
|
| 181 |
-
'client' => [
|
| 182 |
-
// Use different proxies for different URI schemes.
|
| 183 |
-
'proxy' => [
|
| 184 |
-
'http' => 'http://proxy.example.com:5100',
|
| 185 |
-
'https' => 'https://proxy.example.com:6100'
|
| 186 |
-
]
|
| 187 |
-
]
|
| 188 |
-
];
|
| 189 |
-
|
| 190 |
-
ssl_key
|
| 191 |
-
(string, array) Specify the path to a file containing a private SSL key
|
| 192 |
-
in PEM format. If a password is required, then set to an array
|
| 193 |
-
containing the path to the SSL key in the first array element followed
|
| 194 |
-
by the password required for the certificate in the second element.
|
| 195 |
-
|
| 196 |
-
save_to
|
| 197 |
-
(string, fopen resource, ``GuzzleHttp\Stream\StreamInterface``)
|
| 198 |
-
Specifies where the body of the response is downloaded. Pass a string to
|
| 199 |
-
open a local file on disk and save the output to the file. Pass an fopen
|
| 200 |
-
resource to save the output to a PHP stream resource. Pass a
|
| 201 |
-
``GuzzleHttp\Stream\StreamInterface`` to save the output to a Guzzle
|
| 202 |
-
StreamInterface. Omitting this option will typically save the body of a
|
| 203 |
-
response to a PHP temp stream.
|
| 204 |
-
|
| 205 |
-
stream
|
| 206 |
-
(bool) Set to true to stream a response rather than download it all
|
| 207 |
-
up-front. This option will only be utilized when the corresponding
|
| 208 |
-
handler supports it.
|
| 209 |
-
|
| 210 |
-
timeout
|
| 211 |
-
(float) Float describing the timeout of the request in seconds. Use 0 to
|
| 212 |
-
wait indefinitely (the default behavior).
|
| 213 |
-
|
| 214 |
-
verify
|
| 215 |
-
(bool, string) Describes the SSL certificate verification behavior of a
|
| 216 |
-
request. Set to true to enable SSL certificate verification using the
|
| 217 |
-
system CA bundle when available (the default). Set to false to disable
|
| 218 |
-
certificate verification (this is insecure!). Set to a string to provide
|
| 219 |
-
the path to a CA bundle on disk to enable verification using a custom
|
| 220 |
-
certificate.
|
| 221 |
-
|
| 222 |
-
version
|
| 223 |
-
(string) HTTP protocol version to use with the request.
|
| 224 |
-
|
| 225 |
-
Server Specific Options
|
| 226 |
-
~~~~~~~~~~~~~~~~~~~~~~~
|
| 227 |
-
|
| 228 |
-
The following options are only used in ring server handlers.
|
| 229 |
-
|
| 230 |
-
server_port
|
| 231 |
-
(integer) The port on which the request is being handled. This is only
|
| 232 |
-
used with ring servers, and is required.
|
| 233 |
-
|
| 234 |
-
server_name
|
| 235 |
-
(string) The resolved server name, or the server IP address. Required when
|
| 236 |
-
using a Ring server.
|
| 237 |
-
|
| 238 |
-
remote_addr
|
| 239 |
-
(string) The IP address of the client or the last proxy that sent the
|
| 240 |
-
request. Required when using a Ring server.
|
| 241 |
-
|
| 242 |
-
Responses
|
| 243 |
-
---------
|
| 244 |
-
|
| 245 |
-
A response is an array-like object that implements
|
| 246 |
-
``GuzzleHttp\Ring\Future\FutureArrayInterface``. Responses contain the
|
| 247 |
-
following key value pairs:
|
| 248 |
-
|
| 249 |
-
body
|
| 250 |
-
(string, fopen resource, ``Iterator``, ``GuzzleHttp\Stream\StreamInterface``)
|
| 251 |
-
The body of the response, if present. Can be a string, resource returned
|
| 252 |
-
from fopen, an ``Iterator`` that yields chunks of data, an object that
|
| 253 |
-
implemented ``__toString``, or a ``GuzzleHttp\Stream\StreamInterface``.
|
| 254 |
-
|
| 255 |
-
effective_url
|
| 256 |
-
(string) The URL that returned the resulting response.
|
| 257 |
-
|
| 258 |
-
error
|
| 259 |
-
(``\Exception``) Contains an exception describing any errors that were
|
| 260 |
-
encountered during the transfer.
|
| 261 |
-
|
| 262 |
-
headers
|
| 263 |
-
(Required, array) Associative array of headers. Each key represents the
|
| 264 |
-
header name. Each value contains an array of strings where each entry of
|
| 265 |
-
the array is a header line. The headers array MAY be an empty array in the
|
| 266 |
-
event an error occurred before a response was received.
|
| 267 |
-
|
| 268 |
-
reason
|
| 269 |
-
(string) Optional reason phrase. This option should be provided when the
|
| 270 |
-
reason phrase does not match the typical reason phrase associated with the
|
| 271 |
-
``status`` code. See `RFC 7231 <http://tools.ietf.org/html/rfc7231#section-6.1>`_
|
| 272 |
-
for a list of HTTP reason phrases mapped to status codes.
|
| 273 |
-
|
| 274 |
-
status
|
| 275 |
-
(Required, integer) The HTTP status code. The status code MAY be set to
|
| 276 |
-
``null`` in the event an error occurred before a response was received
|
| 277 |
-
(e.g., a networking error).
|
| 278 |
-
|
| 279 |
-
transfer_stats
|
| 280 |
-
(array) Provides an associative array of arbitrary transfer statistics if
|
| 281 |
-
provided by the underlying handler.
|
| 282 |
-
|
| 283 |
-
version
|
| 284 |
-
(string) HTTP protocol version. Defaults to ``1.1``.
|
| 285 |
-
|
| 286 |
-
Middleware
|
| 287 |
-
----------
|
| 288 |
-
|
| 289 |
-
Ring middleware augments the functionality of handlers by invoking them in the
|
| 290 |
-
process of generating responses. Middleware is typically implemented as a
|
| 291 |
-
higher-order function that takes one or more handlers as arguments followed by
|
| 292 |
-
an optional associative array of options as the last argument, returning a new
|
| 293 |
-
handler with the desired compound behavior.
|
| 294 |
-
|
| 295 |
-
Here's an example of a middleware that adds a Content-Type header to each
|
| 296 |
-
request.
|
| 297 |
-
|
| 298 |
-
.. code-block:: php
|
| 299 |
-
|
| 300 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 301 |
-
use GuzzleHttp\Ring\Core;
|
| 302 |
-
|
| 303 |
-
$contentTypeHandler = function(callable $handler, $contentType) {
|
| 304 |
-
return function (array $request) use ($handler, $contentType) {
|
| 305 |
-
return $handler(Core::setHeader('Content-Type', $contentType));
|
| 306 |
-
};
|
| 307 |
-
};
|
| 308 |
-
|
| 309 |
-
$baseHandler = new CurlHandler();
|
| 310 |
-
$wrappedHandler = $contentTypeHandler($baseHandler, 'text/html');
|
| 311 |
-
$response = $wrappedHandler([/** request hash **/]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/docs/testing.rst
DELETED
|
@@ -1,74 +0,0 @@
|
|
| 1 |
-
=======
|
| 2 |
-
Testing
|
| 3 |
-
=======
|
| 4 |
-
|
| 5 |
-
RingPHP tests client handlers using `PHPUnit <https://phpunit.de/>`_ and a
|
| 6 |
-
built-in node.js web server.
|
| 7 |
-
|
| 8 |
-
Running Tests
|
| 9 |
-
-------------
|
| 10 |
-
|
| 11 |
-
First, install the dependencies using `Composer <https://getcomposer.org>`_.
|
| 12 |
-
|
| 13 |
-
composer.phar install
|
| 14 |
-
|
| 15 |
-
Next, run the unit tests using ``Make``.
|
| 16 |
-
|
| 17 |
-
make test
|
| 18 |
-
|
| 19 |
-
The tests are also run on Travis-CI on each commit: https://travis-ci.org/guzzle/guzzle-ring
|
| 20 |
-
|
| 21 |
-
Test Server
|
| 22 |
-
-----------
|
| 23 |
-
|
| 24 |
-
Testing client handlers usually involves actually sending HTTP requests.
|
| 25 |
-
RingPHP provides a node.js web server that returns canned responses and
|
| 26 |
-
keep a list of the requests that have been received. The server can then
|
| 27 |
-
be queried to get a list of the requests that were sent by the client so that
|
| 28 |
-
you can ensure that the client serialized and transferred requests as intended.
|
| 29 |
-
|
| 30 |
-
The server keeps a list of queued responses and returns responses that are
|
| 31 |
-
popped off of the queue as HTTP requests are received. When there are not
|
| 32 |
-
more responses to serve, the server returns a 500 error response.
|
| 33 |
-
|
| 34 |
-
The test server uses the ``GuzzleHttp\Tests\Ring\Client\Server`` class to
|
| 35 |
-
control the server.
|
| 36 |
-
|
| 37 |
-
.. code-block:: php
|
| 38 |
-
|
| 39 |
-
use GuzzleHttp\Ring\Client\StreamHandler;
|
| 40 |
-
use GuzzleHttp\Tests\Ring\Client\Server;
|
| 41 |
-
|
| 42 |
-
// First return a 200 followed by a 404 response.
|
| 43 |
-
Server::enqueue([
|
| 44 |
-
['status' => 200],
|
| 45 |
-
['status' => 404]
|
| 46 |
-
]);
|
| 47 |
-
|
| 48 |
-
$handler = new StreamHandler();
|
| 49 |
-
|
| 50 |
-
$response = $handler([
|
| 51 |
-
'http_method' => 'GET',
|
| 52 |
-
'headers' => ['host' => [Server::$host]],
|
| 53 |
-
'uri' => '/'
|
| 54 |
-
]);
|
| 55 |
-
|
| 56 |
-
assert(200 == $response['status']);
|
| 57 |
-
|
| 58 |
-
$response = $handler([
|
| 59 |
-
'http_method' => 'HEAD',
|
| 60 |
-
'headers' => ['host' => [Server::$host]],
|
| 61 |
-
'uri' => '/'
|
| 62 |
-
]);
|
| 63 |
-
|
| 64 |
-
assert(404 == $response['status']);
|
| 65 |
-
|
| 66 |
-
After requests have been sent, you can get a list of the requests as they
|
| 67 |
-
were sent over the wire to ensure they were sent correctly.
|
| 68 |
-
|
| 69 |
-
.. code-block:: php
|
| 70 |
-
|
| 71 |
-
$received = Server::received();
|
| 72 |
-
|
| 73 |
-
assert('GET' == $received[0]['http_method']);
|
| 74 |
-
assert('HEAD' == $received[1]['http_method']);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/phpunit.xml.dist
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
<phpunit bootstrap="./tests/bootstrap.php"
|
| 3 |
-
colors="true">
|
| 4 |
-
<testsuites>
|
| 5 |
-
<testsuite>
|
| 6 |
-
<directory>tests</directory>
|
| 7 |
-
</testsuite>
|
| 8 |
-
</testsuites>
|
| 9 |
-
<filter>
|
| 10 |
-
<whitelist>
|
| 11 |
-
<directory suffix=".php">src</directory>
|
| 12 |
-
</whitelist>
|
| 13 |
-
</filter>
|
| 14 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlFactoryTest.php
DELETED
|
@@ -1,821 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
// Override curl_setopt_array() to get the last set curl options
|
| 3 |
-
namespace GuzzleHttp\Ring\Client {
|
| 4 |
-
function curl_setopt_array($handle, array $options) {
|
| 5 |
-
if (!empty($_SERVER['curl_test'])) {
|
| 6 |
-
$_SERVER['_curl'] = $options;
|
| 7 |
-
} else {
|
| 8 |
-
unset($_SERVER['_curl']);
|
| 9 |
-
}
|
| 10 |
-
\curl_setopt_array($handle, $options);
|
| 11 |
-
}
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
namespace GuzzleHttp\Tests\Ring\Client {
|
| 15 |
-
|
| 16 |
-
use GuzzleHttp\Ring\Client\CurlFactory;
|
| 17 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 18 |
-
use GuzzleHttp\Ring\Client\MockHandler;
|
| 19 |
-
use GuzzleHttp\Ring\Core;
|
| 20 |
-
use GuzzleHttp\Stream\FnStream;
|
| 21 |
-
use GuzzleHttp\Stream\NoSeekStream;
|
| 22 |
-
use GuzzleHttp\Stream\Stream;
|
| 23 |
-
|
| 24 |
-
class CurlFactoryTest extends \PHPUnit_Framework_TestCase
|
| 25 |
-
{
|
| 26 |
-
public static function setUpBeforeClass()
|
| 27 |
-
{
|
| 28 |
-
$_SERVER['curl_test'] = true;
|
| 29 |
-
unset($_SERVER['_curl']);
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public static function tearDownAfterClass()
|
| 33 |
-
{
|
| 34 |
-
unset($_SERVER['_curl'], $_SERVER['curl_test']);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function testCreatesCurlHandle()
|
| 38 |
-
{
|
| 39 |
-
Server::flush();
|
| 40 |
-
Server::enqueue([[
|
| 41 |
-
'status' => 200,
|
| 42 |
-
'headers' => [
|
| 43 |
-
'Foo' => ['Bar'],
|
| 44 |
-
'Baz' => ['bam'],
|
| 45 |
-
'Content-Length' => [2],
|
| 46 |
-
],
|
| 47 |
-
'body' => 'hi',
|
| 48 |
-
]]);
|
| 49 |
-
|
| 50 |
-
$stream = Stream::factory();
|
| 51 |
-
|
| 52 |
-
$request = [
|
| 53 |
-
'http_method' => 'PUT',
|
| 54 |
-
'headers' => [
|
| 55 |
-
'host' => [Server::$url],
|
| 56 |
-
'Hi' => [' 123'],
|
| 57 |
-
],
|
| 58 |
-
'body' => 'testing',
|
| 59 |
-
'client' => ['save_to' => $stream],
|
| 60 |
-
];
|
| 61 |
-
|
| 62 |
-
$f = new CurlFactory();
|
| 63 |
-
$result = $f($request);
|
| 64 |
-
$this->assertInternalType('array', $result);
|
| 65 |
-
$this->assertCount(3, $result);
|
| 66 |
-
$this->assertInternalType('resource', $result[0]);
|
| 67 |
-
$this->assertInternalType('array', $result[1]);
|
| 68 |
-
$this->assertSame($stream, $result[2]);
|
| 69 |
-
curl_close($result[0]);
|
| 70 |
-
|
| 71 |
-
$this->assertEquals('PUT', $_SERVER['_curl'][CURLOPT_CUSTOMREQUEST]);
|
| 72 |
-
$this->assertEquals(
|
| 73 |
-
'http://http://127.0.0.1:8125/',
|
| 74 |
-
$_SERVER['_curl'][CURLOPT_URL]
|
| 75 |
-
);
|
| 76 |
-
// Sends via post fields when the request is small enough
|
| 77 |
-
$this->assertEquals('testing', $_SERVER['_curl'][CURLOPT_POSTFIELDS]);
|
| 78 |
-
$this->assertEquals(0, $_SERVER['_curl'][CURLOPT_RETURNTRANSFER]);
|
| 79 |
-
$this->assertEquals(0, $_SERVER['_curl'][CURLOPT_HEADER]);
|
| 80 |
-
$this->assertEquals(150, $_SERVER['_curl'][CURLOPT_CONNECTTIMEOUT]);
|
| 81 |
-
$this->assertInstanceOf('Closure', $_SERVER['_curl'][CURLOPT_HEADERFUNCTION]);
|
| 82 |
-
|
| 83 |
-
if (defined('CURLOPT_PROTOCOLS')) {
|
| 84 |
-
$this->assertEquals(
|
| 85 |
-
CURLPROTO_HTTP | CURLPROTO_HTTPS,
|
| 86 |
-
$_SERVER['_curl'][CURLOPT_PROTOCOLS]
|
| 87 |
-
);
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
$this->assertContains('Expect:', $_SERVER['_curl'][CURLOPT_HTTPHEADER]);
|
| 91 |
-
$this->assertContains('Accept:', $_SERVER['_curl'][CURLOPT_HTTPHEADER]);
|
| 92 |
-
$this->assertContains('Content-Type:', $_SERVER['_curl'][CURLOPT_HTTPHEADER]);
|
| 93 |
-
$this->assertContains('Hi: 123', $_SERVER['_curl'][CURLOPT_HTTPHEADER]);
|
| 94 |
-
$this->assertContains('host: http://127.0.0.1:8125/', $_SERVER['_curl'][CURLOPT_HTTPHEADER]);
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
public function testSendsHeadRequests()
|
| 98 |
-
{
|
| 99 |
-
Server::flush();
|
| 100 |
-
Server::enqueue([['status' => 200]]);
|
| 101 |
-
$a = new CurlMultiHandler();
|
| 102 |
-
$response = $a([
|
| 103 |
-
'http_method' => 'HEAD',
|
| 104 |
-
'headers' => ['host' => [Server::$host]],
|
| 105 |
-
]);
|
| 106 |
-
$response->wait();
|
| 107 |
-
$this->assertEquals(true, $_SERVER['_curl'][CURLOPT_NOBODY]);
|
| 108 |
-
$checks = [CURLOPT_WRITEFUNCTION, CURLOPT_READFUNCTION, CURLOPT_FILE, CURLOPT_INFILE];
|
| 109 |
-
foreach ($checks as $check) {
|
| 110 |
-
$this->assertArrayNotHasKey($check, $_SERVER['_curl']);
|
| 111 |
-
}
|
| 112 |
-
$this->assertEquals('HEAD', Server::received()[0]['http_method']);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
public function testCanAddCustomCurlOptions()
|
| 116 |
-
{
|
| 117 |
-
Server::flush();
|
| 118 |
-
Server::enqueue([['status' => 200]]);
|
| 119 |
-
$a = new CurlMultiHandler();
|
| 120 |
-
$a([
|
| 121 |
-
'http_method' => 'GET',
|
| 122 |
-
'headers' => ['host' => [Server::$host]],
|
| 123 |
-
'client' => ['curl' => [CURLOPT_LOW_SPEED_LIMIT => 10]],
|
| 124 |
-
]);
|
| 125 |
-
$this->assertEquals(10, $_SERVER['_curl'][CURLOPT_LOW_SPEED_LIMIT]);
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
/**
|
| 129 |
-
* @expectedException \InvalidArgumentException
|
| 130 |
-
* @expectedExceptionMessage SSL CA bundle not found: /does/not/exist
|
| 131 |
-
*/
|
| 132 |
-
public function testValidatesVerify()
|
| 133 |
-
{
|
| 134 |
-
$f = new CurlFactory();
|
| 135 |
-
$f([
|
| 136 |
-
'http_method' => 'GET',
|
| 137 |
-
'headers' => ['host' => ['foo.com']],
|
| 138 |
-
'client' => ['verify' => '/does/not/exist'],
|
| 139 |
-
]);
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
public function testCanSetVerifyToFile()
|
| 143 |
-
{
|
| 144 |
-
$f = new CurlFactory();
|
| 145 |
-
$f([
|
| 146 |
-
'http_method' => 'GET',
|
| 147 |
-
'headers' => ['host' => ['foo.com']],
|
| 148 |
-
'client' => ['verify' => __FILE__],
|
| 149 |
-
]);
|
| 150 |
-
$this->assertEquals(__FILE__, $_SERVER['_curl'][CURLOPT_CAINFO]);
|
| 151 |
-
$this->assertEquals(2, $_SERVER['_curl'][CURLOPT_SSL_VERIFYHOST]);
|
| 152 |
-
$this->assertEquals(true, $_SERVER['_curl'][CURLOPT_SSL_VERIFYPEER]);
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
public function testAddsVerifyAsTrue()
|
| 156 |
-
{
|
| 157 |
-
$f = new CurlFactory();
|
| 158 |
-
$f([
|
| 159 |
-
'http_method' => 'GET',
|
| 160 |
-
'headers' => ['host' => ['foo.com']],
|
| 161 |
-
'client' => ['verify' => true],
|
| 162 |
-
]);
|
| 163 |
-
$this->assertEquals(2, $_SERVER['_curl'][CURLOPT_SSL_VERIFYHOST]);
|
| 164 |
-
$this->assertEquals(true, $_SERVER['_curl'][CURLOPT_SSL_VERIFYPEER]);
|
| 165 |
-
$this->assertArrayNotHasKey(CURLOPT_CAINFO, $_SERVER['_curl']);
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
public function testCanDisableVerify()
|
| 169 |
-
{
|
| 170 |
-
$f = new CurlFactory();
|
| 171 |
-
$f([
|
| 172 |
-
'http_method' => 'GET',
|
| 173 |
-
'headers' => ['host' => ['foo.com']],
|
| 174 |
-
'client' => ['verify' => false],
|
| 175 |
-
]);
|
| 176 |
-
$this->assertEquals(0, $_SERVER['_curl'][CURLOPT_SSL_VERIFYHOST]);
|
| 177 |
-
$this->assertEquals(false, $_SERVER['_curl'][CURLOPT_SSL_VERIFYPEER]);
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
public function testAddsProxy()
|
| 181 |
-
{
|
| 182 |
-
$f = new CurlFactory();
|
| 183 |
-
$f([
|
| 184 |
-
'http_method' => 'GET',
|
| 185 |
-
'headers' => ['host' => ['foo.com']],
|
| 186 |
-
'client' => ['proxy' => 'http://bar.com'],
|
| 187 |
-
]);
|
| 188 |
-
$this->assertEquals('http://bar.com', $_SERVER['_curl'][CURLOPT_PROXY]);
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
public function testAddsViaScheme()
|
| 192 |
-
{
|
| 193 |
-
$f = new CurlFactory();
|
| 194 |
-
$f([
|
| 195 |
-
'http_method' => 'GET',
|
| 196 |
-
'scheme' => 'http',
|
| 197 |
-
'headers' => ['host' => ['foo.com']],
|
| 198 |
-
'client' => [
|
| 199 |
-
'proxy' => ['http' => 'http://bar.com', 'https' => 'https://t'],
|
| 200 |
-
],
|
| 201 |
-
]);
|
| 202 |
-
$this->assertEquals('http://bar.com', $_SERVER['_curl'][CURLOPT_PROXY]);
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
/**
|
| 206 |
-
* @expectedException \InvalidArgumentException
|
| 207 |
-
* @expectedExceptionMessage SSL private key not found: /does/not/exist
|
| 208 |
-
*/
|
| 209 |
-
public function testValidatesSslKey()
|
| 210 |
-
{
|
| 211 |
-
$f = new CurlFactory();
|
| 212 |
-
$f([
|
| 213 |
-
'http_method' => 'GET',
|
| 214 |
-
'headers' => ['host' => ['foo.com']],
|
| 215 |
-
'client' => ['ssl_key' => '/does/not/exist'],
|
| 216 |
-
]);
|
| 217 |
-
}
|
| 218 |
-
|
| 219 |
-
public function testAddsSslKey()
|
| 220 |
-
{
|
| 221 |
-
$f = new CurlFactory();
|
| 222 |
-
$f([
|
| 223 |
-
'http_method' => 'GET',
|
| 224 |
-
'headers' => ['host' => ['foo.com']],
|
| 225 |
-
'client' => ['ssl_key' => __FILE__],
|
| 226 |
-
]);
|
| 227 |
-
$this->assertEquals(__FILE__, $_SERVER['_curl'][CURLOPT_SSLKEY]);
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
public function testAddsSslKeyWithPassword()
|
| 231 |
-
{
|
| 232 |
-
$f = new CurlFactory();
|
| 233 |
-
$f([
|
| 234 |
-
'http_method' => 'GET',
|
| 235 |
-
'headers' => ['host' => ['foo.com']],
|
| 236 |
-
'client' => ['ssl_key' => [__FILE__, 'test']],
|
| 237 |
-
]);
|
| 238 |
-
$this->assertEquals(__FILE__, $_SERVER['_curl'][CURLOPT_SSLKEY]);
|
| 239 |
-
$this->assertEquals('test', $_SERVER['_curl'][CURLOPT_SSLKEYPASSWD]);
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
/**
|
| 243 |
-
* @expectedException \InvalidArgumentException
|
| 244 |
-
* @expectedExceptionMessage SSL certificate not found: /does/not/exist
|
| 245 |
-
*/
|
| 246 |
-
public function testValidatesCert()
|
| 247 |
-
{
|
| 248 |
-
$f = new CurlFactory();
|
| 249 |
-
$f([
|
| 250 |
-
'http_method' => 'GET',
|
| 251 |
-
'headers' => ['host' => ['foo.com']],
|
| 252 |
-
'client' => ['cert' => '/does/not/exist'],
|
| 253 |
-
]);
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
public function testAddsCert()
|
| 257 |
-
{
|
| 258 |
-
$f = new CurlFactory();
|
| 259 |
-
$f([
|
| 260 |
-
'http_method' => 'GET',
|
| 261 |
-
'headers' => ['host' => ['foo.com']],
|
| 262 |
-
'client' => ['cert' => __FILE__],
|
| 263 |
-
]);
|
| 264 |
-
$this->assertEquals(__FILE__, $_SERVER['_curl'][CURLOPT_SSLCERT]);
|
| 265 |
-
}
|
| 266 |
-
|
| 267 |
-
public function testAddsCertWithPassword()
|
| 268 |
-
{
|
| 269 |
-
$f = new CurlFactory();
|
| 270 |
-
$f([
|
| 271 |
-
'http_method' => 'GET',
|
| 272 |
-
'headers' => ['host' => ['foo.com']],
|
| 273 |
-
'client' => ['cert' => [__FILE__, 'test']],
|
| 274 |
-
]);
|
| 275 |
-
$this->assertEquals(__FILE__, $_SERVER['_curl'][CURLOPT_SSLCERT]);
|
| 276 |
-
$this->assertEquals('test', $_SERVER['_curl'][CURLOPT_SSLCERTPASSWD]);
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
/**
|
| 280 |
-
* @expectedException \InvalidArgumentException
|
| 281 |
-
* @expectedExceptionMessage progress client option must be callable
|
| 282 |
-
*/
|
| 283 |
-
public function testValidatesProgress()
|
| 284 |
-
{
|
| 285 |
-
$f = new CurlFactory();
|
| 286 |
-
$f([
|
| 287 |
-
'http_method' => 'GET',
|
| 288 |
-
'headers' => ['host' => ['foo.com']],
|
| 289 |
-
'client' => ['progress' => 'foo'],
|
| 290 |
-
]);
|
| 291 |
-
}
|
| 292 |
-
|
| 293 |
-
public function testEmitsDebugInfoToStream()
|
| 294 |
-
{
|
| 295 |
-
$res = fopen('php://memory', 'r+');
|
| 296 |
-
Server::flush();
|
| 297 |
-
Server::enqueue([['status' => 200]]);
|
| 298 |
-
$a = new CurlMultiHandler();
|
| 299 |
-
$response = $a([
|
| 300 |
-
'http_method' => 'HEAD',
|
| 301 |
-
'headers' => ['host' => [Server::$host]],
|
| 302 |
-
'client' => ['debug' => $res],
|
| 303 |
-
]);
|
| 304 |
-
$response->wait();
|
| 305 |
-
rewind($res);
|
| 306 |
-
$output = str_replace("\r", '', stream_get_contents($res));
|
| 307 |
-
$this->assertContains(
|
| 308 |
-
"> HEAD / HTTP/1.1\nhost: 127.0.0.1:8125\n\n",
|
| 309 |
-
$output
|
| 310 |
-
);
|
| 311 |
-
$this->assertContains("< HTTP/1.1 200", $output);
|
| 312 |
-
fclose($res);
|
| 313 |
-
}
|
| 314 |
-
|
| 315 |
-
public function testEmitsProgressToFunction()
|
| 316 |
-
{
|
| 317 |
-
Server::flush();
|
| 318 |
-
Server::enqueue([['status' => 200]]);
|
| 319 |
-
$a = new CurlMultiHandler();
|
| 320 |
-
$called = [];
|
| 321 |
-
$response = $a([
|
| 322 |
-
'http_method' => 'HEAD',
|
| 323 |
-
'headers' => ['host' => [Server::$host]],
|
| 324 |
-
'client' => [
|
| 325 |
-
'progress' => function () use (&$called) {
|
| 326 |
-
$called[] = func_get_args();
|
| 327 |
-
},
|
| 328 |
-
],
|
| 329 |
-
]);
|
| 330 |
-
$response->wait();
|
| 331 |
-
$this->assertNotEmpty($called);
|
| 332 |
-
foreach ($called as $call) {
|
| 333 |
-
$this->assertCount(4, $call);
|
| 334 |
-
}
|
| 335 |
-
}
|
| 336 |
-
|
| 337 |
-
private function addDecodeResponse($withEncoding = true)
|
| 338 |
-
{
|
| 339 |
-
$content = gzencode('test');
|
| 340 |
-
$response = [
|
| 341 |
-
'status' => 200,
|
| 342 |
-
'reason' => 'OK',
|
| 343 |
-
'headers' => ['Content-Length' => [strlen($content)]],
|
| 344 |
-
'body' => $content,
|
| 345 |
-
];
|
| 346 |
-
|
| 347 |
-
if ($withEncoding) {
|
| 348 |
-
$response['headers']['Content-Encoding'] = ['gzip'];
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
Server::flush();
|
| 352 |
-
Server::enqueue([$response]);
|
| 353 |
-
|
| 354 |
-
return $content;
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
public function testDecodesGzippedResponses()
|
| 358 |
-
{
|
| 359 |
-
$this->addDecodeResponse();
|
| 360 |
-
$handler = new CurlMultiHandler();
|
| 361 |
-
$response = $handler([
|
| 362 |
-
'http_method' => 'GET',
|
| 363 |
-
'headers' => ['host' => [Server::$host]],
|
| 364 |
-
'client' => ['decode_content' => true],
|
| 365 |
-
]);
|
| 366 |
-
$response->wait();
|
| 367 |
-
$this->assertEquals('test', Core::body($response));
|
| 368 |
-
$this->assertEquals('', $_SERVER['_curl'][CURLOPT_ENCODING]);
|
| 369 |
-
$sent = Server::received()[0];
|
| 370 |
-
$this->assertNull(Core::header($sent, 'Accept-Encoding'));
|
| 371 |
-
}
|
| 372 |
-
|
| 373 |
-
public function testDecodesGzippedResponsesWithHeader()
|
| 374 |
-
{
|
| 375 |
-
$this->addDecodeResponse();
|
| 376 |
-
$handler = new CurlMultiHandler();
|
| 377 |
-
$response = $handler([
|
| 378 |
-
'http_method' => 'GET',
|
| 379 |
-
'headers' => [
|
| 380 |
-
'host' => [Server::$host],
|
| 381 |
-
'Accept-Encoding' => ['gzip'],
|
| 382 |
-
],
|
| 383 |
-
'client' => ['decode_content' => true],
|
| 384 |
-
]);
|
| 385 |
-
$response->wait();
|
| 386 |
-
$this->assertEquals('gzip', $_SERVER['_curl'][CURLOPT_ENCODING]);
|
| 387 |
-
$sent = Server::received()[0];
|
| 388 |
-
$this->assertEquals('gzip', Core::header($sent, 'Accept-Encoding'));
|
| 389 |
-
$this->assertEquals('test', Core::body($response));
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
public function testDoesNotForceDecode()
|
| 393 |
-
{
|
| 394 |
-
$content = $this->addDecodeResponse();
|
| 395 |
-
$handler = new CurlMultiHandler();
|
| 396 |
-
$response = $handler([
|
| 397 |
-
'http_method' => 'GET',
|
| 398 |
-
'headers' => ['host' => [Server::$host]],
|
| 399 |
-
'client' => ['decode_content' => false],
|
| 400 |
-
]);
|
| 401 |
-
$response->wait();
|
| 402 |
-
$sent = Server::received()[0];
|
| 403 |
-
$this->assertNull(Core::header($sent, 'Accept-Encoding'));
|
| 404 |
-
$this->assertEquals($content, Core::body($response));
|
| 405 |
-
}
|
| 406 |
-
|
| 407 |
-
public function testProtocolVersion()
|
| 408 |
-
{
|
| 409 |
-
Server::flush();
|
| 410 |
-
Server::enqueue([['status' => 200]]);
|
| 411 |
-
$a = new CurlMultiHandler();
|
| 412 |
-
$a([
|
| 413 |
-
'http_method' => 'GET',
|
| 414 |
-
'headers' => ['host' => [Server::$host]],
|
| 415 |
-
'version' => 1.0,
|
| 416 |
-
]);
|
| 417 |
-
$this->assertEquals(CURL_HTTP_VERSION_1_0, $_SERVER['_curl'][CURLOPT_HTTP_VERSION]);
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
/**
|
| 421 |
-
* @expectedException \InvalidArgumentException
|
| 422 |
-
*/
|
| 423 |
-
public function testValidatesSaveTo()
|
| 424 |
-
{
|
| 425 |
-
$handler = new CurlMultiHandler();
|
| 426 |
-
$handler([
|
| 427 |
-
'http_method' => 'GET',
|
| 428 |
-
'headers' => ['host' => [Server::$host]],
|
| 429 |
-
'client' => ['save_to' => true],
|
| 430 |
-
]);
|
| 431 |
-
}
|
| 432 |
-
|
| 433 |
-
public function testSavesToStream()
|
| 434 |
-
{
|
| 435 |
-
$stream = fopen('php://memory', 'r+');
|
| 436 |
-
$this->addDecodeResponse();
|
| 437 |
-
$handler = new CurlMultiHandler();
|
| 438 |
-
$response = $handler([
|
| 439 |
-
'http_method' => 'GET',
|
| 440 |
-
'headers' => ['host' => [Server::$host]],
|
| 441 |
-
'client' => [
|
| 442 |
-
'decode_content' => true,
|
| 443 |
-
'save_to' => $stream,
|
| 444 |
-
],
|
| 445 |
-
]);
|
| 446 |
-
$response->wait();
|
| 447 |
-
rewind($stream);
|
| 448 |
-
$this->assertEquals('test', stream_get_contents($stream));
|
| 449 |
-
}
|
| 450 |
-
|
| 451 |
-
public function testSavesToGuzzleStream()
|
| 452 |
-
{
|
| 453 |
-
$stream = Stream::factory();
|
| 454 |
-
$this->addDecodeResponse();
|
| 455 |
-
$handler = new CurlMultiHandler();
|
| 456 |
-
$response = $handler([
|
| 457 |
-
'http_method' => 'GET',
|
| 458 |
-
'headers' => ['host' => [Server::$host]],
|
| 459 |
-
'client' => [
|
| 460 |
-
'decode_content' => true,
|
| 461 |
-
'save_to' => $stream,
|
| 462 |
-
],
|
| 463 |
-
]);
|
| 464 |
-
$response->wait();
|
| 465 |
-
$this->assertEquals('test', (string) $stream);
|
| 466 |
-
}
|
| 467 |
-
|
| 468 |
-
public function testSavesToFileOnDisk()
|
| 469 |
-
{
|
| 470 |
-
$tmpfile = tempnam(sys_get_temp_dir(), 'testfile');
|
| 471 |
-
$this->addDecodeResponse();
|
| 472 |
-
$handler = new CurlMultiHandler();
|
| 473 |
-
$response = $handler([
|
| 474 |
-
'http_method' => 'GET',
|
| 475 |
-
'headers' => ['host' => [Server::$host]],
|
| 476 |
-
'client' => [
|
| 477 |
-
'decode_content' => true,
|
| 478 |
-
'save_to' => $tmpfile,
|
| 479 |
-
],
|
| 480 |
-
]);
|
| 481 |
-
$response->wait();
|
| 482 |
-
$this->assertEquals('test', file_get_contents($tmpfile));
|
| 483 |
-
unlink($tmpfile);
|
| 484 |
-
}
|
| 485 |
-
|
| 486 |
-
/**
|
| 487 |
-
* @expectedException \InvalidArgumentException
|
| 488 |
-
*/
|
| 489 |
-
public function testValidatesBody()
|
| 490 |
-
{
|
| 491 |
-
$handler = new CurlMultiHandler();
|
| 492 |
-
$handler([
|
| 493 |
-
'http_method' => 'GET',
|
| 494 |
-
'headers' => ['host' => [Server::$host]],
|
| 495 |
-
'body' => false,
|
| 496 |
-
]);
|
| 497 |
-
}
|
| 498 |
-
|
| 499 |
-
public function testAddsLargePayloadFromStreamWithNoSizeUsingChunked()
|
| 500 |
-
{
|
| 501 |
-
$stream = Stream::factory('foo');
|
| 502 |
-
$stream = FnStream::decorate($stream, [
|
| 503 |
-
'getSize' => function () {
|
| 504 |
-
return null;
|
| 505 |
-
}
|
| 506 |
-
]);
|
| 507 |
-
$this->addDecodeResponse();
|
| 508 |
-
$handler = new CurlMultiHandler();
|
| 509 |
-
$response = $handler([
|
| 510 |
-
'http_method' => 'GET',
|
| 511 |
-
'headers' => ['host' => [Server::$host]],
|
| 512 |
-
'body' => $stream,
|
| 513 |
-
]);
|
| 514 |
-
$response->wait();
|
| 515 |
-
$sent = Server::received()[0];
|
| 516 |
-
$this->assertEquals('chunked', Core::header($sent, 'Transfer-Encoding'));
|
| 517 |
-
$this->assertNull(Core::header($sent, 'Content-Length'));
|
| 518 |
-
$this->assertEquals('foo', $sent['body']);
|
| 519 |
-
}
|
| 520 |
-
|
| 521 |
-
public function testAddsPayloadFromIterator()
|
| 522 |
-
{
|
| 523 |
-
$iter = new \ArrayIterator(['f', 'o', 'o']);
|
| 524 |
-
$this->addDecodeResponse();
|
| 525 |
-
$handler = new CurlMultiHandler();
|
| 526 |
-
$response = $handler([
|
| 527 |
-
'http_method' => 'GET',
|
| 528 |
-
'headers' => ['host' => [Server::$host]],
|
| 529 |
-
'body' => $iter,
|
| 530 |
-
]);
|
| 531 |
-
$response->wait();
|
| 532 |
-
$sent = Server::received()[0];
|
| 533 |
-
$this->assertEquals('chunked', Core::header($sent, 'Transfer-Encoding'));
|
| 534 |
-
$this->assertNull(Core::header($sent, 'Content-Length'));
|
| 535 |
-
$this->assertEquals('foo', $sent['body']);
|
| 536 |
-
}
|
| 537 |
-
|
| 538 |
-
public function testAddsPayloadFromResource()
|
| 539 |
-
{
|
| 540 |
-
$res = fopen('php://memory', 'r+');
|
| 541 |
-
$data = str_repeat('.', 1000000);
|
| 542 |
-
fwrite($res, $data);
|
| 543 |
-
rewind($res);
|
| 544 |
-
$this->addDecodeResponse();
|
| 545 |
-
$handler = new CurlMultiHandler();
|
| 546 |
-
$response = $handler([
|
| 547 |
-
'http_method' => 'GET',
|
| 548 |
-
'headers' => [
|
| 549 |
-
'host' => [Server::$host],
|
| 550 |
-
'content-length' => [1000000],
|
| 551 |
-
],
|
| 552 |
-
'body' => $res,
|
| 553 |
-
]);
|
| 554 |
-
$response->wait();
|
| 555 |
-
$sent = Server::received()[0];
|
| 556 |
-
$this->assertNull(Core::header($sent, 'Transfer-Encoding'));
|
| 557 |
-
$this->assertEquals(1000000, Core::header($sent, 'Content-Length'));
|
| 558 |
-
$this->assertEquals($data, $sent['body']);
|
| 559 |
-
}
|
| 560 |
-
|
| 561 |
-
public function testAddsContentLengthFromStream()
|
| 562 |
-
{
|
| 563 |
-
$stream = Stream::factory('foo');
|
| 564 |
-
$this->addDecodeResponse();
|
| 565 |
-
$handler = new CurlMultiHandler();
|
| 566 |
-
$response = $handler([
|
| 567 |
-
'http_method' => 'GET',
|
| 568 |
-
'headers' => ['host' => [Server::$host]],
|
| 569 |
-
'body' => $stream,
|
| 570 |
-
]);
|
| 571 |
-
$response->wait();
|
| 572 |
-
$sent = Server::received()[0];
|
| 573 |
-
$this->assertEquals(3, Core::header($sent, 'Content-Length'));
|
| 574 |
-
$this->assertNull(Core::header($sent, 'Transfer-Encoding'));
|
| 575 |
-
$this->assertEquals('foo', $sent['body']);
|
| 576 |
-
}
|
| 577 |
-
|
| 578 |
-
public function testDoesNotAddMultipleContentLengthHeaders()
|
| 579 |
-
{
|
| 580 |
-
$this->addDecodeResponse();
|
| 581 |
-
$handler = new CurlMultiHandler();
|
| 582 |
-
$response = $handler([
|
| 583 |
-
'http_method' => 'GET',
|
| 584 |
-
'headers' => [
|
| 585 |
-
'host' => [Server::$host],
|
| 586 |
-
'content-length' => [3],
|
| 587 |
-
],
|
| 588 |
-
'body' => 'foo',
|
| 589 |
-
]);
|
| 590 |
-
$response->wait();
|
| 591 |
-
$sent = Server::received()[0];
|
| 592 |
-
$this->assertEquals(3, Core::header($sent, 'Content-Length'));
|
| 593 |
-
$this->assertNull(Core::header($sent, 'Transfer-Encoding'));
|
| 594 |
-
$this->assertEquals('foo', $sent['body']);
|
| 595 |
-
}
|
| 596 |
-
|
| 597 |
-
public function testSendsPostWithNoBodyOrDefaultContentType()
|
| 598 |
-
{
|
| 599 |
-
Server::flush();
|
| 600 |
-
Server::enqueue([['status' => 200]]);
|
| 601 |
-
$handler = new CurlMultiHandler();
|
| 602 |
-
$response = $handler([
|
| 603 |
-
'http_method' => 'POST',
|
| 604 |
-
'uri' => '/',
|
| 605 |
-
'headers' => ['host' => [Server::$host]],
|
| 606 |
-
]);
|
| 607 |
-
$response->wait();
|
| 608 |
-
$received = Server::received()[0];
|
| 609 |
-
$this->assertEquals('POST', $received['http_method']);
|
| 610 |
-
$this->assertNull(Core::header($received, 'content-type'));
|
| 611 |
-
$this->assertSame('0', Core::firstHeader($received, 'content-length'));
|
| 612 |
-
}
|
| 613 |
-
|
| 614 |
-
public function testParseProtocolVersion()
|
| 615 |
-
{
|
| 616 |
-
$res = CurlFactory::createResponse(
|
| 617 |
-
function () {},
|
| 618 |
-
[],
|
| 619 |
-
['curl' => ['errno' => null]],
|
| 620 |
-
['HTTP/1.1 200 Ok'],
|
| 621 |
-
null
|
| 622 |
-
);
|
| 623 |
-
|
| 624 |
-
$this->assertSame('1.1', $res['version']);
|
| 625 |
-
}
|
| 626 |
-
|
| 627 |
-
public function testFailsWhenNoResponseAndNoBody()
|
| 628 |
-
{
|
| 629 |
-
$res = CurlFactory::createResponse(function () {}, [], [], [], null);
|
| 630 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Exception\RingException', $res['error']);
|
| 631 |
-
$this->assertContains(
|
| 632 |
-
'No response was received for a request with no body',
|
| 633 |
-
$res['error']->getMessage()
|
| 634 |
-
);
|
| 635 |
-
}
|
| 636 |
-
|
| 637 |
-
public function testFailsWhenCannotRewindRetry()
|
| 638 |
-
{
|
| 639 |
-
$res = CurlFactory::createResponse(function () {}, [
|
| 640 |
-
'body' => new NoSeekStream(Stream::factory('foo'))
|
| 641 |
-
], [], [], null);
|
| 642 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Exception\RingException', $res['error']);
|
| 643 |
-
$this->assertContains(
|
| 644 |
-
'rewind the request body failed',
|
| 645 |
-
$res['error']->getMessage()
|
| 646 |
-
);
|
| 647 |
-
}
|
| 648 |
-
|
| 649 |
-
public function testRetriesWhenBodyCanBeRewound()
|
| 650 |
-
{
|
| 651 |
-
$callHandler = $called = false;
|
| 652 |
-
$res = CurlFactory::createResponse(function () use (&$callHandler) {
|
| 653 |
-
$callHandler = true;
|
| 654 |
-
return ['status' => 200];
|
| 655 |
-
}, [
|
| 656 |
-
'body' => FnStream::decorate(Stream::factory('test'), [
|
| 657 |
-
'seek' => function () use (&$called) {
|
| 658 |
-
$called = true;
|
| 659 |
-
return true;
|
| 660 |
-
}
|
| 661 |
-
])
|
| 662 |
-
], [], [], null);
|
| 663 |
-
|
| 664 |
-
$this->assertTrue($callHandler);
|
| 665 |
-
$this->assertTrue($called);
|
| 666 |
-
$this->assertEquals('200', $res['status']);
|
| 667 |
-
}
|
| 668 |
-
|
| 669 |
-
public function testFailsWhenRetryMoreThanThreeTimes()
|
| 670 |
-
{
|
| 671 |
-
$call = 0;
|
| 672 |
-
$mock = new MockHandler(function (array $request) use (&$mock, &$call) {
|
| 673 |
-
$call++;
|
| 674 |
-
return CurlFactory::createResponse($mock, $request, [], [], null);
|
| 675 |
-
});
|
| 676 |
-
$response = $mock([
|
| 677 |
-
'http_method' => 'GET',
|
| 678 |
-
'body' => 'test',
|
| 679 |
-
]);
|
| 680 |
-
$this->assertEquals(3, $call);
|
| 681 |
-
$this->assertArrayHasKey('error', $response);
|
| 682 |
-
$this->assertContains(
|
| 683 |
-
'The cURL request was retried 3 times',
|
| 684 |
-
$response['error']->getMessage()
|
| 685 |
-
);
|
| 686 |
-
}
|
| 687 |
-
|
| 688 |
-
public function testHandles100Continue()
|
| 689 |
-
{
|
| 690 |
-
Server::flush();
|
| 691 |
-
Server::enqueue([
|
| 692 |
-
[
|
| 693 |
-
'status' => '200',
|
| 694 |
-
'reason' => 'OK',
|
| 695 |
-
'headers' => [
|
| 696 |
-
'Test' => ['Hello'],
|
| 697 |
-
'Content-Length' => ['4'],
|
| 698 |
-
],
|
| 699 |
-
'body' => 'test',
|
| 700 |
-
],
|
| 701 |
-
]);
|
| 702 |
-
|
| 703 |
-
$request = [
|
| 704 |
-
'http_method' => 'PUT',
|
| 705 |
-
'headers' => [
|
| 706 |
-
'Host' => [Server::$host],
|
| 707 |
-
'Expect' => ['100-Continue'],
|
| 708 |
-
],
|
| 709 |
-
'body' => 'test',
|
| 710 |
-
];
|
| 711 |
-
|
| 712 |
-
$handler = new CurlMultiHandler();
|
| 713 |
-
$response = $handler($request)->wait();
|
| 714 |
-
$this->assertEquals(200, $response['status']);
|
| 715 |
-
$this->assertEquals('OK', $response['reason']);
|
| 716 |
-
$this->assertEquals(['Hello'], $response['headers']['Test']);
|
| 717 |
-
$this->assertEquals(['4'], $response['headers']['Content-Length']);
|
| 718 |
-
$this->assertEquals('test', Core::body($response));
|
| 719 |
-
}
|
| 720 |
-
|
| 721 |
-
public function testCreatesConnectException()
|
| 722 |
-
{
|
| 723 |
-
$m = new \ReflectionMethod('GuzzleHttp\Ring\Client\CurlFactory', 'createErrorResponse');
|
| 724 |
-
$m->setAccessible(true);
|
| 725 |
-
$response = $m->invoke(
|
| 726 |
-
null,
|
| 727 |
-
function () {},
|
| 728 |
-
[],
|
| 729 |
-
[
|
| 730 |
-
'err_message' => 'foo',
|
| 731 |
-
'curl' => [
|
| 732 |
-
'errno' => CURLE_COULDNT_CONNECT,
|
| 733 |
-
]
|
| 734 |
-
]
|
| 735 |
-
);
|
| 736 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Exception\ConnectException', $response['error']);
|
| 737 |
-
}
|
| 738 |
-
|
| 739 |
-
public function testParsesLastResponseOnly()
|
| 740 |
-
{
|
| 741 |
-
$response1 = [
|
| 742 |
-
'status' => 301,
|
| 743 |
-
'headers' => [
|
| 744 |
-
'Content-Length' => ['0'],
|
| 745 |
-
'Location' => ['/foo']
|
| 746 |
-
]
|
| 747 |
-
];
|
| 748 |
-
|
| 749 |
-
$response2 = [
|
| 750 |
-
'status' => 200,
|
| 751 |
-
'headers' => [
|
| 752 |
-
'Content-Length' => ['0'],
|
| 753 |
-
'Foo' => ['bar']
|
| 754 |
-
]
|
| 755 |
-
];
|
| 756 |
-
|
| 757 |
-
Server::flush();
|
| 758 |
-
Server::enqueue([$response1, $response2]);
|
| 759 |
-
|
| 760 |
-
$a = new CurlMultiHandler();
|
| 761 |
-
$response = $a([
|
| 762 |
-
'http_method' => 'GET',
|
| 763 |
-
'headers' => ['Host' => [Server::$host]],
|
| 764 |
-
'client' => [
|
| 765 |
-
'curl' => [
|
| 766 |
-
CURLOPT_FOLLOWLOCATION => true
|
| 767 |
-
]
|
| 768 |
-
]
|
| 769 |
-
])->wait();
|
| 770 |
-
|
| 771 |
-
$this->assertEquals(1, $response['transfer_stats']['redirect_count']);
|
| 772 |
-
$this->assertEquals('http://127.0.0.1:8125/foo', $response['effective_url']);
|
| 773 |
-
$this->assertEquals(['bar'], $response['headers']['Foo']);
|
| 774 |
-
$this->assertEquals(200, $response['status']);
|
| 775 |
-
$this->assertFalse(Core::hasHeader($response, 'Location'));
|
| 776 |
-
}
|
| 777 |
-
|
| 778 |
-
public function testMaintainsMultiHeaderOrder()
|
| 779 |
-
{
|
| 780 |
-
Server::flush();
|
| 781 |
-
Server::enqueue([
|
| 782 |
-
[
|
| 783 |
-
'status' => 200,
|
| 784 |
-
'headers' => [
|
| 785 |
-
'Content-Length' => ['0'],
|
| 786 |
-
'Foo' => ['a', 'b'],
|
| 787 |
-
'foo' => ['c', 'd'],
|
| 788 |
-
]
|
| 789 |
-
]
|
| 790 |
-
]);
|
| 791 |
-
|
| 792 |
-
$a = new CurlMultiHandler();
|
| 793 |
-
$response = $a([
|
| 794 |
-
'http_method' => 'GET',
|
| 795 |
-
'headers' => ['Host' => [Server::$host]]
|
| 796 |
-
])->wait();
|
| 797 |
-
|
| 798 |
-
$this->assertEquals(
|
| 799 |
-
['a', 'b', 'c', 'd'],
|
| 800 |
-
Core::headerLines($response, 'Foo')
|
| 801 |
-
);
|
| 802 |
-
}
|
| 803 |
-
|
| 804 |
-
/**
|
| 805 |
-
* @expectedException \RuntimeException
|
| 806 |
-
* @expectedExceptionMessage Directory /path/to/does/not does not exist for save_to value of /path/to/does/not/exist.txt
|
| 807 |
-
*/
|
| 808 |
-
public function testThrowsWhenDirNotFound()
|
| 809 |
-
{
|
| 810 |
-
$request = [
|
| 811 |
-
'http_method' => 'GET',
|
| 812 |
-
'headers' => ['host' => [Server::$url]],
|
| 813 |
-
'client' => ['save_to' => '/path/to/does/not/exist.txt'],
|
| 814 |
-
];
|
| 815 |
-
|
| 816 |
-
$f = new CurlFactory();
|
| 817 |
-
$f($request);
|
| 818 |
-
}
|
| 819 |
-
}
|
| 820 |
-
|
| 821 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlHandlerTest.php
DELETED
|
@@ -1,96 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\CurlHandler;
|
| 5 |
-
|
| 6 |
-
class CurlHandlerTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
protected function setUp()
|
| 9 |
-
{
|
| 10 |
-
if (!function_exists('curl_reset')) {
|
| 11 |
-
$this->markTestSkipped('curl_reset() is not available');
|
| 12 |
-
}
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
protected function getHandler($factory = null, $options = [])
|
| 16 |
-
{
|
| 17 |
-
return new CurlHandler($options);
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
public function testCanSetMaxHandles()
|
| 21 |
-
{
|
| 22 |
-
$a = new CurlHandler(['max_handles' => 10]);
|
| 23 |
-
$this->assertEquals(10, $this->readAttribute($a, 'maxHandles'));
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testCreatesCurlErrors()
|
| 27 |
-
{
|
| 28 |
-
$handler = new CurlHandler();
|
| 29 |
-
$response = $handler([
|
| 30 |
-
'http_method' => 'GET',
|
| 31 |
-
'uri' => '/',
|
| 32 |
-
'headers' => ['host' => ['localhost:123']],
|
| 33 |
-
'client' => ['timeout' => 0.001, 'connect_timeout' => 0.001],
|
| 34 |
-
]);
|
| 35 |
-
$this->assertNull($response['status']);
|
| 36 |
-
$this->assertNull($response['reason']);
|
| 37 |
-
$this->assertEquals([], $response['headers']);
|
| 38 |
-
$this->assertInstanceOf(
|
| 39 |
-
'GuzzleHttp\Ring\Exception\RingException',
|
| 40 |
-
$response['error']
|
| 41 |
-
);
|
| 42 |
-
|
| 43 |
-
$this->assertEquals(
|
| 44 |
-
1,
|
| 45 |
-
preg_match('/^cURL error \d+: .*$/', $response['error']->getMessage())
|
| 46 |
-
);
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function testReleasesAdditionalEasyHandles()
|
| 50 |
-
{
|
| 51 |
-
Server::flush();
|
| 52 |
-
$response = [
|
| 53 |
-
'status' => 200,
|
| 54 |
-
'headers' => ['Content-Length' => [4]],
|
| 55 |
-
'body' => 'test',
|
| 56 |
-
];
|
| 57 |
-
|
| 58 |
-
Server::enqueue([$response, $response, $response, $response]);
|
| 59 |
-
$a = new CurlHandler(['max_handles' => 2]);
|
| 60 |
-
|
| 61 |
-
$fn = function () use (&$calls, $a, &$fn) {
|
| 62 |
-
if (++$calls < 4) {
|
| 63 |
-
$a([
|
| 64 |
-
'http_method' => 'GET',
|
| 65 |
-
'headers' => ['host' => [Server::$host]],
|
| 66 |
-
'client' => ['progress' => $fn],
|
| 67 |
-
]);
|
| 68 |
-
}
|
| 69 |
-
};
|
| 70 |
-
|
| 71 |
-
$request = [
|
| 72 |
-
'http_method' => 'GET',
|
| 73 |
-
'headers' => ['host' => [Server::$host]],
|
| 74 |
-
'client' => [
|
| 75 |
-
'progress' => $fn,
|
| 76 |
-
],
|
| 77 |
-
];
|
| 78 |
-
|
| 79 |
-
$a($request);
|
| 80 |
-
$this->assertCount(2, $this->readAttribute($a, 'handles'));
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
public function testReusesHandles()
|
| 84 |
-
{
|
| 85 |
-
Server::flush();
|
| 86 |
-
$response = ['status' => 200];
|
| 87 |
-
Server::enqueue([$response, $response]);
|
| 88 |
-
$a = new CurlHandler();
|
| 89 |
-
$request = [
|
| 90 |
-
'http_method' => 'GET',
|
| 91 |
-
'headers' => ['host' => [Server::$host]],
|
| 92 |
-
];
|
| 93 |
-
$a($request);
|
| 94 |
-
$a($request);
|
| 95 |
-
}
|
| 96 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/CurlMultiHandlerTest.php
DELETED
|
@@ -1,165 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\CurlMultiHandler;
|
| 5 |
-
|
| 6 |
-
class CurlMultiHandlerTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
public function testSendsRequest()
|
| 9 |
-
{
|
| 10 |
-
Server::enqueue([['status' => 200]]);
|
| 11 |
-
$a = new CurlMultiHandler();
|
| 12 |
-
$response = $a([
|
| 13 |
-
'http_method' => 'GET',
|
| 14 |
-
'headers' => ['host' => [Server::$host]],
|
| 15 |
-
]);
|
| 16 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 17 |
-
$this->assertEquals(200, $response['status']);
|
| 18 |
-
$this->assertArrayHasKey('transfer_stats', $response);
|
| 19 |
-
$realUrl = trim($response['transfer_stats']['url'], '/');
|
| 20 |
-
$this->assertEquals(trim(Server::$url, '/'), $realUrl);
|
| 21 |
-
$this->assertArrayHasKey('effective_url', $response);
|
| 22 |
-
$this->assertEquals(
|
| 23 |
-
trim(Server::$url, '/'),
|
| 24 |
-
trim($response['effective_url'], '/')
|
| 25 |
-
);
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function testCreatesErrorResponses()
|
| 29 |
-
{
|
| 30 |
-
$url = 'http://localhost:123/';
|
| 31 |
-
$a = new CurlMultiHandler();
|
| 32 |
-
$response = $a([
|
| 33 |
-
'http_method' => 'GET',
|
| 34 |
-
'headers' => ['host' => ['localhost:123']],
|
| 35 |
-
]);
|
| 36 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 37 |
-
$this->assertNull($response['status']);
|
| 38 |
-
$this->assertNull($response['reason']);
|
| 39 |
-
$this->assertEquals([], $response['headers']);
|
| 40 |
-
$this->assertArrayHasKey('error', $response);
|
| 41 |
-
$this->assertContains('cURL error ', $response['error']->getMessage());
|
| 42 |
-
$this->assertArrayHasKey('transfer_stats', $response);
|
| 43 |
-
$this->assertEquals(
|
| 44 |
-
trim($url, '/'),
|
| 45 |
-
trim($response['transfer_stats']['url'], '/')
|
| 46 |
-
);
|
| 47 |
-
$this->assertArrayHasKey('effective_url', $response);
|
| 48 |
-
$this->assertEquals(
|
| 49 |
-
trim($url, '/'),
|
| 50 |
-
trim($response['effective_url'], '/')
|
| 51 |
-
);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function testSendsFuturesWhenDestructed()
|
| 55 |
-
{
|
| 56 |
-
Server::enqueue([['status' => 200]]);
|
| 57 |
-
$a = new CurlMultiHandler();
|
| 58 |
-
$response = $a([
|
| 59 |
-
'http_method' => 'GET',
|
| 60 |
-
'headers' => ['host' => [Server::$host]],
|
| 61 |
-
]);
|
| 62 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 63 |
-
$a->__destruct();
|
| 64 |
-
$this->assertEquals(200, $response['status']);
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
public function testCanSetMaxHandles()
|
| 68 |
-
{
|
| 69 |
-
$a = new CurlMultiHandler(['max_handles' => 2]);
|
| 70 |
-
$this->assertEquals(2, $this->readAttribute($a, 'maxHandles'));
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
public function testCanSetSelectTimeout()
|
| 74 |
-
{
|
| 75 |
-
$a = new CurlMultiHandler(['select_timeout' => 2]);
|
| 76 |
-
$this->assertEquals(2, $this->readAttribute($a, 'selectTimeout'));
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testSendsFuturesWhenMaxHandlesIsReached()
|
| 80 |
-
{
|
| 81 |
-
$request = [
|
| 82 |
-
'http_method' => 'PUT',
|
| 83 |
-
'headers' => ['host' => [Server::$host]],
|
| 84 |
-
'future' => 'lazy', // passing this to control the test
|
| 85 |
-
];
|
| 86 |
-
$response = ['status' => 200];
|
| 87 |
-
Server::flush();
|
| 88 |
-
Server::enqueue([$response, $response, $response]);
|
| 89 |
-
$a = new CurlMultiHandler(['max_handles' => 3]);
|
| 90 |
-
for ($i = 0; $i < 5; $i++) {
|
| 91 |
-
$responses[] = $a($request);
|
| 92 |
-
}
|
| 93 |
-
$this->assertCount(3, Server::received());
|
| 94 |
-
$responses[3]->cancel();
|
| 95 |
-
$responses[4]->cancel();
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
public function testCanCancel()
|
| 99 |
-
{
|
| 100 |
-
Server::flush();
|
| 101 |
-
$response = ['status' => 200];
|
| 102 |
-
Server::enqueue(array_fill_keys(range(0, 10), $response));
|
| 103 |
-
$a = new CurlMultiHandler();
|
| 104 |
-
$responses = [];
|
| 105 |
-
|
| 106 |
-
for ($i = 0; $i < 10; $i++) {
|
| 107 |
-
$response = $a([
|
| 108 |
-
'http_method' => 'GET',
|
| 109 |
-
'headers' => ['host' => [Server::$host]],
|
| 110 |
-
'future' => 'lazy',
|
| 111 |
-
]);
|
| 112 |
-
$response->cancel();
|
| 113 |
-
$responses[] = $response;
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
$this->assertCount(0, Server::received());
|
| 117 |
-
|
| 118 |
-
foreach ($responses as $response) {
|
| 119 |
-
$this->assertTrue($this->readAttribute($response, 'isRealized'));
|
| 120 |
-
}
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
public function testCannotCancelFinished()
|
| 124 |
-
{
|
| 125 |
-
Server::flush();
|
| 126 |
-
Server::enqueue([['status' => 200]]);
|
| 127 |
-
$a = new CurlMultiHandler();
|
| 128 |
-
$response = $a([
|
| 129 |
-
'http_method' => 'GET',
|
| 130 |
-
'headers' => ['host' => [Server::$host]],
|
| 131 |
-
]);
|
| 132 |
-
$response->wait();
|
| 133 |
-
$response->cancel();
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
public function testDelaysInParallel()
|
| 137 |
-
{
|
| 138 |
-
Server::flush();
|
| 139 |
-
Server::enqueue([['status' => 200]]);
|
| 140 |
-
$a = new CurlMultiHandler();
|
| 141 |
-
$expected = microtime(true) + (100 / 1000);
|
| 142 |
-
$response = $a([
|
| 143 |
-
'http_method' => 'GET',
|
| 144 |
-
'headers' => ['host' => [Server::$host]],
|
| 145 |
-
'client' => ['delay' => 100],
|
| 146 |
-
]);
|
| 147 |
-
$response->wait();
|
| 148 |
-
$this->assertGreaterThanOrEqual($expected, microtime(true));
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
public function testSendsNonLazyFutures()
|
| 152 |
-
{
|
| 153 |
-
$request = [
|
| 154 |
-
'http_method' => 'GET',
|
| 155 |
-
'headers' => ['host' => [Server::$host]],
|
| 156 |
-
'future' => true,
|
| 157 |
-
];
|
| 158 |
-
Server::flush();
|
| 159 |
-
Server::enqueue([['status' => 202]]);
|
| 160 |
-
$a = new CurlMultiHandler();
|
| 161 |
-
$response = $a($request);
|
| 162 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 163 |
-
$this->assertEquals(202, $response['status']);
|
| 164 |
-
}
|
| 165 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/MiddlewareTest.php
DELETED
|
@@ -1,65 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\Middleware;
|
| 5 |
-
use GuzzleHttp\Ring\Future\CompletedFutureArray;
|
| 6 |
-
|
| 7 |
-
class MiddlewareTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testFutureCallsDefaultHandler()
|
| 10 |
-
{
|
| 11 |
-
$future = new CompletedFutureArray(['status' => 200]);
|
| 12 |
-
$calledA = false;
|
| 13 |
-
$a = function (array $req) use (&$calledA, $future) {
|
| 14 |
-
$calledA = true;
|
| 15 |
-
return $future;
|
| 16 |
-
};
|
| 17 |
-
$calledB = false;
|
| 18 |
-
$b = function (array $req) use (&$calledB) { $calledB = true; };
|
| 19 |
-
$s = Middleware::wrapFuture($a, $b);
|
| 20 |
-
$s([]);
|
| 21 |
-
$this->assertTrue($calledA);
|
| 22 |
-
$this->assertFalse($calledB);
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
public function testFutureCallsStreamingHandler()
|
| 26 |
-
{
|
| 27 |
-
$future = new CompletedFutureArray(['status' => 200]);
|
| 28 |
-
$calledA = false;
|
| 29 |
-
$a = function (array $req) use (&$calledA) { $calledA = true; };
|
| 30 |
-
$calledB = false;
|
| 31 |
-
$b = function (array $req) use (&$calledB, $future) {
|
| 32 |
-
$calledB = true;
|
| 33 |
-
return $future;
|
| 34 |
-
};
|
| 35 |
-
$s = Middleware::wrapFuture($a, $b);
|
| 36 |
-
$result = $s(['client' => ['future' => true]]);
|
| 37 |
-
$this->assertFalse($calledA);
|
| 38 |
-
$this->assertTrue($calledB);
|
| 39 |
-
$this->assertSame($future, $result);
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
public function testStreamingCallsDefaultHandler()
|
| 43 |
-
{
|
| 44 |
-
$calledA = false;
|
| 45 |
-
$a = function (array $req) use (&$calledA) { $calledA = true; };
|
| 46 |
-
$calledB = false;
|
| 47 |
-
$b = function (array $req) use (&$calledB) { $calledB = true; };
|
| 48 |
-
$s = Middleware::wrapStreaming($a, $b);
|
| 49 |
-
$s([]);
|
| 50 |
-
$this->assertTrue($calledA);
|
| 51 |
-
$this->assertFalse($calledB);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function testStreamingCallsStreamingHandler()
|
| 55 |
-
{
|
| 56 |
-
$calledA = false;
|
| 57 |
-
$a = function (array $req) use (&$calledA) { $calledA = true; };
|
| 58 |
-
$calledB = false;
|
| 59 |
-
$b = function (array $req) use (&$calledB) { $calledB = true; };
|
| 60 |
-
$s = Middleware::wrapStreaming($a, $b);
|
| 61 |
-
$s(['client' => ['stream' => true]]);
|
| 62 |
-
$this->assertFalse($calledA);
|
| 63 |
-
$this->assertTrue($calledB);
|
| 64 |
-
}
|
| 65 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/MockHandlerTest.php
DELETED
|
@@ -1,86 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\MockHandler;
|
| 5 |
-
use GuzzleHttp\Ring\Future\FutureArray;
|
| 6 |
-
use React\Promise\Deferred;
|
| 7 |
-
|
| 8 |
-
class MockHandlerTest extends \PHPUnit_Framework_TestCase
|
| 9 |
-
{
|
| 10 |
-
public function testReturnsArray()
|
| 11 |
-
{
|
| 12 |
-
$mock = new MockHandler(['status' => 200]);
|
| 13 |
-
$response = $mock([]);
|
| 14 |
-
$this->assertEquals(200, $response['status']);
|
| 15 |
-
$this->assertEquals([], $response['headers']);
|
| 16 |
-
$this->assertNull($response['body']);
|
| 17 |
-
$this->assertNull($response['reason']);
|
| 18 |
-
$this->assertNull($response['effective_url']);
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
public function testReturnsFutures()
|
| 22 |
-
{
|
| 23 |
-
$deferred = new Deferred();
|
| 24 |
-
$future = new FutureArray(
|
| 25 |
-
$deferred->promise(),
|
| 26 |
-
function () use ($deferred) {
|
| 27 |
-
$deferred->resolve(['status' => 200]);
|
| 28 |
-
}
|
| 29 |
-
);
|
| 30 |
-
$mock = new MockHandler($future);
|
| 31 |
-
$response = $mock([]);
|
| 32 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 33 |
-
$this->assertEquals(200, $response['status']);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function testReturnsFuturesWithThenCall()
|
| 37 |
-
{
|
| 38 |
-
$deferred = new Deferred();
|
| 39 |
-
$future = new FutureArray(
|
| 40 |
-
$deferred->promise(),
|
| 41 |
-
function () use ($deferred) {
|
| 42 |
-
$deferred->resolve(['status' => 200]);
|
| 43 |
-
}
|
| 44 |
-
);
|
| 45 |
-
$mock = new MockHandler($future);
|
| 46 |
-
$response = $mock([]);
|
| 47 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 48 |
-
$this->assertEquals(200, $response['status']);
|
| 49 |
-
$req = null;
|
| 50 |
-
$promise = $response->then(function ($value) use (&$req) {
|
| 51 |
-
$req = $value;
|
| 52 |
-
$this->assertEquals(200, $req['status']);
|
| 53 |
-
});
|
| 54 |
-
$this->assertInstanceOf('React\Promise\PromiseInterface', $promise);
|
| 55 |
-
$this->assertEquals(200, $req['status']);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
public function testReturnsFuturesAndProxiesCancel()
|
| 59 |
-
{
|
| 60 |
-
$c = null;
|
| 61 |
-
$deferred = new Deferred();
|
| 62 |
-
$future = new FutureArray(
|
| 63 |
-
$deferred->promise(),
|
| 64 |
-
function () {},
|
| 65 |
-
function () use (&$c) {
|
| 66 |
-
$c = true;
|
| 67 |
-
return true;
|
| 68 |
-
}
|
| 69 |
-
);
|
| 70 |
-
$mock = new MockHandler($future);
|
| 71 |
-
$response = $mock([]);
|
| 72 |
-
$this->assertInstanceOf('GuzzleHttp\Ring\Future\FutureArray', $response);
|
| 73 |
-
$response->cancel();
|
| 74 |
-
$this->assertTrue($c);
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
/**
|
| 78 |
-
* @expectedException \InvalidArgumentException
|
| 79 |
-
* @expectedExceptionMessage Response must be an array or FutureArrayInterface. Found
|
| 80 |
-
*/
|
| 81 |
-
public function testEnsuresMockIsValid()
|
| 82 |
-
{
|
| 83 |
-
$mock = new MockHandler('foo');
|
| 84 |
-
$mock([]);
|
| 85 |
-
}
|
| 86 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/Server.php
DELETED
|
@@ -1,183 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\StreamHandler;
|
| 5 |
-
use GuzzleHttp\Ring\Core;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* Class uses to control the test webserver.
|
| 9 |
-
*
|
| 10 |
-
* Queued responses will be served to requests using a FIFO order. All requests
|
| 11 |
-
* received by the server are stored on the node.js server and can be retrieved
|
| 12 |
-
* by calling {@see Server::received()}.
|
| 13 |
-
*
|
| 14 |
-
* Mock responses that don't require data to be transmitted over HTTP a great
|
| 15 |
-
* for testing. Mock response, however, cannot test the actual sending of an
|
| 16 |
-
* HTTP request using cURL. This test server allows the simulation of any
|
| 17 |
-
* number of HTTP request response transactions to test the actual sending of
|
| 18 |
-
* requests over the wire without having to leave an internal network.
|
| 19 |
-
*/
|
| 20 |
-
class Server
|
| 21 |
-
{
|
| 22 |
-
public static $started;
|
| 23 |
-
public static $url = 'http://127.0.0.1:8125/';
|
| 24 |
-
public static $host = '127.0.0.1:8125';
|
| 25 |
-
public static $port = 8125;
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Flush the received requests from the server
|
| 29 |
-
* @throws \RuntimeException
|
| 30 |
-
*/
|
| 31 |
-
public static function flush()
|
| 32 |
-
{
|
| 33 |
-
self::send('DELETE', '/guzzle-server/requests');
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Queue an array of responses or a single response on the server.
|
| 38 |
-
*
|
| 39 |
-
* Any currently queued responses will be overwritten. Subsequent requests
|
| 40 |
-
* on the server will return queued responses in FIFO order.
|
| 41 |
-
*
|
| 42 |
-
* @param array $responses An array of responses. The shape of a response
|
| 43 |
-
* is the shape described in the RingPHP spec.
|
| 44 |
-
* @throws \Exception
|
| 45 |
-
*/
|
| 46 |
-
public static function enqueue(array $responses)
|
| 47 |
-
{
|
| 48 |
-
$data = [];
|
| 49 |
-
|
| 50 |
-
foreach ($responses as $response) {
|
| 51 |
-
if (!is_array($response)) {
|
| 52 |
-
throw new \Exception('Each response must be an array');
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
if (isset($response['body'])) {
|
| 56 |
-
$response['body'] = base64_encode($response['body']);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
$response += ['headers' => [], 'reason' => '', 'body' => ''];
|
| 60 |
-
$data[] = $response;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
self::send('PUT', '/guzzle-server/responses', json_encode($data));
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
/**
|
| 67 |
-
* Get all of the received requests as a RingPHP request structure.
|
| 68 |
-
*
|
| 69 |
-
* @return array
|
| 70 |
-
* @throws \RuntimeException
|
| 71 |
-
*/
|
| 72 |
-
public static function received()
|
| 73 |
-
{
|
| 74 |
-
if (!self::$started) {
|
| 75 |
-
return [];
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
$response = self::send('GET', '/guzzle-server/requests');
|
| 79 |
-
$body = Core::body($response);
|
| 80 |
-
$result = json_decode($body, true);
|
| 81 |
-
if ($result === false) {
|
| 82 |
-
throw new \RuntimeException('Error decoding response: '
|
| 83 |
-
. json_last_error());
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
foreach ($result as &$res) {
|
| 87 |
-
if (isset($res['uri'])) {
|
| 88 |
-
$res['resource'] = $res['uri'];
|
| 89 |
-
}
|
| 90 |
-
if (isset($res['query_string'])) {
|
| 91 |
-
$res['resource'] .= '?' . $res['query_string'];
|
| 92 |
-
}
|
| 93 |
-
if (!isset($res['resource'])) {
|
| 94 |
-
$res['resource'] = '';
|
| 95 |
-
}
|
| 96 |
-
// Ensure that headers are all arrays
|
| 97 |
-
if (isset($res['headers'])) {
|
| 98 |
-
foreach ($res['headers'] as &$h) {
|
| 99 |
-
$h = (array) $h;
|
| 100 |
-
}
|
| 101 |
-
unset($h);
|
| 102 |
-
}
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
unset($res);
|
| 106 |
-
return $result;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* Stop running the node.js server
|
| 111 |
-
*/
|
| 112 |
-
public static function stop()
|
| 113 |
-
{
|
| 114 |
-
if (self::$started) {
|
| 115 |
-
self::send('DELETE', '/guzzle-server');
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
self::$started = false;
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
public static function wait($maxTries = 20)
|
| 122 |
-
{
|
| 123 |
-
$tries = 0;
|
| 124 |
-
while (!self::isListening() && ++$tries < $maxTries) {
|
| 125 |
-
usleep(100000);
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
if (!self::isListening()) {
|
| 129 |
-
throw new \RuntimeException('Unable to contact node.js server');
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
public static function start()
|
| 134 |
-
{
|
| 135 |
-
if (self::$started) {
|
| 136 |
-
return;
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
try {
|
| 140 |
-
self::wait();
|
| 141 |
-
} catch (\Exception $e) {
|
| 142 |
-
exec('node ' . __DIR__ . \DIRECTORY_SEPARATOR . 'server.js '
|
| 143 |
-
. self::$port . ' >> /tmp/server.log 2>&1 &');
|
| 144 |
-
self::wait();
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
self::$started = true;
|
| 148 |
-
}
|
| 149 |
-
|
| 150 |
-
private static function isListening()
|
| 151 |
-
{
|
| 152 |
-
$response = self::send('GET', '/guzzle-server/perf', null, [
|
| 153 |
-
'connect_timeout' => 1,
|
| 154 |
-
'timeout' => 1
|
| 155 |
-
]);
|
| 156 |
-
|
| 157 |
-
return !isset($response['error']);
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
private static function send(
|
| 161 |
-
$method,
|
| 162 |
-
$path,
|
| 163 |
-
$body = null,
|
| 164 |
-
array $client = []
|
| 165 |
-
) {
|
| 166 |
-
$handler = new StreamHandler();
|
| 167 |
-
|
| 168 |
-
$request = [
|
| 169 |
-
'http_method' => $method,
|
| 170 |
-
'uri' => $path,
|
| 171 |
-
'request_port' => 8125,
|
| 172 |
-
'headers' => ['host' => ['127.0.0.1:8125']],
|
| 173 |
-
'body' => $body,
|
| 174 |
-
'client' => $client,
|
| 175 |
-
];
|
| 176 |
-
|
| 177 |
-
if ($body) {
|
| 178 |
-
$request['headers']['content-length'] = [strlen($body)];
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
return $handler($request);
|
| 182 |
-
}
|
| 183 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/StreamHandlerTest.php
DELETED
|
@@ -1,480 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Client;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Client\ClientUtils;
|
| 5 |
-
use GuzzleHttp\Ring\Core;
|
| 6 |
-
use GuzzleHttp\Ring\Client\StreamHandler;
|
| 7 |
-
|
| 8 |
-
class StreamHandlerTest extends \PHPUnit_Framework_TestCase
|
| 9 |
-
{
|
| 10 |
-
public function testReturnsResponseForSuccessfulRequest()
|
| 11 |
-
{
|
| 12 |
-
$this->queueRes();
|
| 13 |
-
$handler = new StreamHandler();
|
| 14 |
-
$response = $handler([
|
| 15 |
-
'http_method' => 'GET',
|
| 16 |
-
'uri' => '/',
|
| 17 |
-
'headers' => [
|
| 18 |
-
'host' => [Server::$host],
|
| 19 |
-
'Foo' => ['Bar'],
|
| 20 |
-
],
|
| 21 |
-
]);
|
| 22 |
-
|
| 23 |
-
$this->assertEquals('1.1', $response['version']);
|
| 24 |
-
$this->assertEquals(200, $response['status']);
|
| 25 |
-
$this->assertEquals('OK', $response['reason']);
|
| 26 |
-
$this->assertEquals(['Bar'], $response['headers']['Foo']);
|
| 27 |
-
$this->assertEquals(['8'], $response['headers']['Content-Length']);
|
| 28 |
-
$this->assertEquals('hi there', Core::body($response));
|
| 29 |
-
|
| 30 |
-
$sent = Server::received()[0];
|
| 31 |
-
$this->assertEquals('GET', $sent['http_method']);
|
| 32 |
-
$this->assertEquals('/', $sent['resource']);
|
| 33 |
-
$this->assertEquals(['127.0.0.1:8125'], $sent['headers']['host']);
|
| 34 |
-
$this->assertEquals('Bar', Core::header($sent, 'foo'));
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function testAddsErrorToResponse()
|
| 38 |
-
{
|
| 39 |
-
$handler = new StreamHandler();
|
| 40 |
-
$result = $handler([
|
| 41 |
-
'http_method' => 'GET',
|
| 42 |
-
'headers' => ['host' => ['localhost:123']],
|
| 43 |
-
'client' => ['timeout' => 0.01],
|
| 44 |
-
]);
|
| 45 |
-
$this->assertInstanceOf(
|
| 46 |
-
'GuzzleHttp\Ring\Future\CompletedFutureArray',
|
| 47 |
-
$result
|
| 48 |
-
);
|
| 49 |
-
$this->assertNull($result['status']);
|
| 50 |
-
$this->assertNull($result['body']);
|
| 51 |
-
$this->assertEquals([], $result['headers']);
|
| 52 |
-
$this->assertInstanceOf(
|
| 53 |
-
'GuzzleHttp\Ring\Exception\RingException',
|
| 54 |
-
$result['error']
|
| 55 |
-
);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
public function testEnsuresTheHttpProtocol()
|
| 59 |
-
{
|
| 60 |
-
$handler = new StreamHandler();
|
| 61 |
-
$result = $handler([
|
| 62 |
-
'http_method' => 'GET',
|
| 63 |
-
'url' => 'ftp://localhost:123',
|
| 64 |
-
]);
|
| 65 |
-
$this->assertArrayHasKey('error', $result);
|
| 66 |
-
$this->assertContains(
|
| 67 |
-
'URL is invalid: ftp://localhost:123',
|
| 68 |
-
$result['error']->getMessage()
|
| 69 |
-
);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function testStreamAttributeKeepsStreamOpen()
|
| 73 |
-
{
|
| 74 |
-
$this->queueRes();
|
| 75 |
-
$handler = new StreamHandler();
|
| 76 |
-
$response = $handler([
|
| 77 |
-
'http_method' => 'PUT',
|
| 78 |
-
'uri' => '/foo',
|
| 79 |
-
'query_string' => 'baz=bar',
|
| 80 |
-
'headers' => [
|
| 81 |
-
'host' => [Server::$host],
|
| 82 |
-
'Foo' => ['Bar'],
|
| 83 |
-
],
|
| 84 |
-
'body' => 'test',
|
| 85 |
-
'client' => ['stream' => true],
|
| 86 |
-
]);
|
| 87 |
-
|
| 88 |
-
$this->assertEquals(200, $response['status']);
|
| 89 |
-
$this->assertEquals('OK', $response['reason']);
|
| 90 |
-
$this->assertEquals('8', Core::header($response, 'Content-Length'));
|
| 91 |
-
$body = $response['body'];
|
| 92 |
-
$this->assertTrue(is_resource($body));
|
| 93 |
-
$this->assertEquals('http', stream_get_meta_data($body)['wrapper_type']);
|
| 94 |
-
$this->assertEquals('hi there', stream_get_contents($body));
|
| 95 |
-
fclose($body);
|
| 96 |
-
$sent = Server::received()[0];
|
| 97 |
-
$this->assertEquals('PUT', $sent['http_method']);
|
| 98 |
-
$this->assertEquals('/foo', $sent['uri']);
|
| 99 |
-
$this->assertEquals('baz=bar', $sent['query_string']);
|
| 100 |
-
$this->assertEquals('/foo?baz=bar', $sent['resource']);
|
| 101 |
-
$this->assertEquals('127.0.0.1:8125', Core::header($sent, 'host'));
|
| 102 |
-
$this->assertEquals('Bar', Core::header($sent, 'foo'));
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
public function testDrainsResponseIntoTempStream()
|
| 106 |
-
{
|
| 107 |
-
$this->queueRes();
|
| 108 |
-
$handler = new StreamHandler();
|
| 109 |
-
$response = $handler([
|
| 110 |
-
'http_method' => 'GET',
|
| 111 |
-
'uri' => '/',
|
| 112 |
-
'headers' => ['host' => [Server::$host]],
|
| 113 |
-
]);
|
| 114 |
-
$body = $response['body'];
|
| 115 |
-
$this->assertEquals('php://temp', stream_get_meta_data($body)['uri']);
|
| 116 |
-
$this->assertEquals('hi', fread($body, 2));
|
| 117 |
-
fclose($body);
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
public function testDrainsResponseIntoSaveToBody()
|
| 121 |
-
{
|
| 122 |
-
$r = fopen('php://temp', 'r+');
|
| 123 |
-
$this->queueRes();
|
| 124 |
-
$handler = new StreamHandler();
|
| 125 |
-
$response = $handler([
|
| 126 |
-
'http_method' => 'GET',
|
| 127 |
-
'uri' => '/',
|
| 128 |
-
'headers' => ['host' => [Server::$host]],
|
| 129 |
-
'client' => ['save_to' => $r],
|
| 130 |
-
]);
|
| 131 |
-
$body = $response['body'];
|
| 132 |
-
$this->assertEquals('php://temp', stream_get_meta_data($body)['uri']);
|
| 133 |
-
$this->assertEquals('hi', fread($body, 2));
|
| 134 |
-
$this->assertEquals(' there', stream_get_contents($r));
|
| 135 |
-
fclose($r);
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
public function testDrainsResponseIntoSaveToBodyAtPath()
|
| 139 |
-
{
|
| 140 |
-
$tmpfname = tempnam('/tmp', 'save_to_path');
|
| 141 |
-
$this->queueRes();
|
| 142 |
-
$handler = new StreamHandler();
|
| 143 |
-
$response = $handler([
|
| 144 |
-
'http_method' => 'GET',
|
| 145 |
-
'uri' => '/',
|
| 146 |
-
'headers' => ['host' => [Server::$host]],
|
| 147 |
-
'client' => ['save_to' => $tmpfname],
|
| 148 |
-
]);
|
| 149 |
-
$body = $response['body'];
|
| 150 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\StreamInterface', $body);
|
| 151 |
-
$this->assertEquals($tmpfname, $body->getMetadata('uri'));
|
| 152 |
-
$this->assertEquals('hi', $body->read(2));
|
| 153 |
-
$body->close();
|
| 154 |
-
unlink($tmpfname);
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
public function testAutomaticallyDecompressGzip()
|
| 158 |
-
{
|
| 159 |
-
Server::flush();
|
| 160 |
-
$content = gzencode('test');
|
| 161 |
-
Server::enqueue([
|
| 162 |
-
[
|
| 163 |
-
'status' => 200,
|
| 164 |
-
'reason' => 'OK',
|
| 165 |
-
'headers' => [
|
| 166 |
-
'Content-Encoding' => ['gzip'],
|
| 167 |
-
'Content-Length' => [strlen($content)],
|
| 168 |
-
],
|
| 169 |
-
'body' => $content,
|
| 170 |
-
],
|
| 171 |
-
]);
|
| 172 |
-
|
| 173 |
-
$handler = new StreamHandler();
|
| 174 |
-
$response = $handler([
|
| 175 |
-
'http_method' => 'GET',
|
| 176 |
-
'headers' => ['host' => [Server::$host]],
|
| 177 |
-
'uri' => '/',
|
| 178 |
-
'client' => ['decode_content' => true],
|
| 179 |
-
]);
|
| 180 |
-
$this->assertEquals('test', Core::body($response));
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
public function testDoesNotForceGzipDecode()
|
| 184 |
-
{
|
| 185 |
-
Server::flush();
|
| 186 |
-
$content = gzencode('test');
|
| 187 |
-
Server::enqueue([
|
| 188 |
-
[
|
| 189 |
-
'status' => 200,
|
| 190 |
-
'reason' => 'OK',
|
| 191 |
-
'headers' => [
|
| 192 |
-
'Content-Encoding' => ['gzip'],
|
| 193 |
-
'Content-Length' => [strlen($content)],
|
| 194 |
-
],
|
| 195 |
-
'body' => $content,
|
| 196 |
-
],
|
| 197 |
-
]);
|
| 198 |
-
|
| 199 |
-
$handler = new StreamHandler();
|
| 200 |
-
$response = $handler([
|
| 201 |
-
'http_method' => 'GET',
|
| 202 |
-
'headers' => ['host' => [Server::$host]],
|
| 203 |
-
'uri' => '/',
|
| 204 |
-
'client' => ['stream' => true, 'decode_content' => false],
|
| 205 |
-
]);
|
| 206 |
-
$this->assertSame($content, Core::body($response));
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
public function testProtocolVersion()
|
| 210 |
-
{
|
| 211 |
-
$this->queueRes();
|
| 212 |
-
$handler = new StreamHandler();
|
| 213 |
-
$handler([
|
| 214 |
-
'http_method' => 'GET',
|
| 215 |
-
'uri' => '/',
|
| 216 |
-
'headers' => ['host' => [Server::$host]],
|
| 217 |
-
'version' => 1.0,
|
| 218 |
-
]);
|
| 219 |
-
|
| 220 |
-
$this->assertEquals(1.0, Server::received()[0]['version']);
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
protected function getSendResult(array $opts)
|
| 224 |
-
{
|
| 225 |
-
$this->queueRes();
|
| 226 |
-
$handler = new StreamHandler();
|
| 227 |
-
$opts['stream'] = true;
|
| 228 |
-
return $handler([
|
| 229 |
-
'http_method' => 'GET',
|
| 230 |
-
'uri' => '/',
|
| 231 |
-
'headers' => ['host' => [Server::$host]],
|
| 232 |
-
'client' => $opts,
|
| 233 |
-
]);
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
public function testAddsProxy()
|
| 237 |
-
{
|
| 238 |
-
$res = $this->getSendResult(['stream' => true, 'proxy' => '127.0.0.1:8125']);
|
| 239 |
-
$opts = stream_context_get_options($res['body']);
|
| 240 |
-
$this->assertEquals('127.0.0.1:8125', $opts['http']['proxy']);
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
public function testAddsTimeout()
|
| 244 |
-
{
|
| 245 |
-
$res = $this->getSendResult(['stream' => true, 'timeout' => 200]);
|
| 246 |
-
$opts = stream_context_get_options($res['body']);
|
| 247 |
-
$this->assertEquals(200, $opts['http']['timeout']);
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
public function testVerifiesVerifyIsValidIfPath()
|
| 251 |
-
{
|
| 252 |
-
$res = $this->getSendResult(['verify' => '/does/not/exist']);
|
| 253 |
-
$this->assertContains(
|
| 254 |
-
'SSL CA bundle not found: /does/not/exist',
|
| 255 |
-
(string) $res['error']
|
| 256 |
-
);
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
public function testVerifyCanBeDisabled()
|
| 260 |
-
{
|
| 261 |
-
$res = $this->getSendResult(['verify' => false]);
|
| 262 |
-
$this->assertArrayNotHasKey('error', $res);
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
public function testVerifiesCertIfValidPath()
|
| 266 |
-
{
|
| 267 |
-
$res = $this->getSendResult(['cert' => '/does/not/exist']);
|
| 268 |
-
$this->assertContains(
|
| 269 |
-
'SSL certificate not found: /does/not/exist',
|
| 270 |
-
(string) $res['error']
|
| 271 |
-
);
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
public function testVerifyCanBeSetToPath()
|
| 275 |
-
{
|
| 276 |
-
$path = $path = ClientUtils::getDefaultCaBundle();
|
| 277 |
-
$res = $this->getSendResult(['verify' => $path]);
|
| 278 |
-
$this->assertArrayNotHasKey('error', $res);
|
| 279 |
-
$opts = stream_context_get_options($res['body']);
|
| 280 |
-
$this->assertEquals(true, $opts['ssl']['verify_peer']);
|
| 281 |
-
$this->assertEquals($path, $opts['ssl']['cafile']);
|
| 282 |
-
$this->assertTrue(file_exists($opts['ssl']['cafile']));
|
| 283 |
-
}
|
| 284 |
-
|
| 285 |
-
public function testUsesSystemDefaultBundle()
|
| 286 |
-
{
|
| 287 |
-
$path = $path = ClientUtils::getDefaultCaBundle();
|
| 288 |
-
$res = $this->getSendResult(['verify' => true]);
|
| 289 |
-
$this->assertArrayNotHasKey('error', $res);
|
| 290 |
-
$opts = stream_context_get_options($res['body']);
|
| 291 |
-
if (PHP_VERSION_ID < 50600) {
|
| 292 |
-
$this->assertEquals($path, $opts['ssl']['cafile']);
|
| 293 |
-
}
|
| 294 |
-
}
|
| 295 |
-
|
| 296 |
-
public function testEnsuresVerifyOptionIsValid()
|
| 297 |
-
{
|
| 298 |
-
$res = $this->getSendResult(['verify' => 10]);
|
| 299 |
-
$this->assertContains(
|
| 300 |
-
'Invalid verify request option',
|
| 301 |
-
(string) $res['error']
|
| 302 |
-
);
|
| 303 |
-
}
|
| 304 |
-
|
| 305 |
-
public function testCanSetPasswordWhenSettingCert()
|
| 306 |
-
{
|
| 307 |
-
$path = __FILE__;
|
| 308 |
-
$res = $this->getSendResult(['cert' => [$path, 'foo']]);
|
| 309 |
-
$opts = stream_context_get_options($res['body']);
|
| 310 |
-
$this->assertEquals($path, $opts['ssl']['local_cert']);
|
| 311 |
-
$this->assertEquals('foo', $opts['ssl']['passphrase']);
|
| 312 |
-
}
|
| 313 |
-
|
| 314 |
-
public function testDebugAttributeWritesToStream()
|
| 315 |
-
{
|
| 316 |
-
$this->queueRes();
|
| 317 |
-
$f = fopen('php://temp', 'w+');
|
| 318 |
-
$this->getSendResult(['debug' => $f]);
|
| 319 |
-
fseek($f, 0);
|
| 320 |
-
$contents = stream_get_contents($f);
|
| 321 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [CONNECT]', $contents);
|
| 322 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [FILE_SIZE_IS]', $contents);
|
| 323 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [PROGRESS]', $contents);
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
public function testDebugAttributeWritesStreamInfoToBuffer()
|
| 327 |
-
{
|
| 328 |
-
$called = false;
|
| 329 |
-
$this->queueRes();
|
| 330 |
-
$buffer = fopen('php://temp', 'r+');
|
| 331 |
-
$this->getSendResult([
|
| 332 |
-
'progress' => function () use (&$called) { $called = true; },
|
| 333 |
-
'debug' => $buffer,
|
| 334 |
-
]);
|
| 335 |
-
fseek($buffer, 0);
|
| 336 |
-
$contents = stream_get_contents($buffer);
|
| 337 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [CONNECT]', $contents);
|
| 338 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [FILE_SIZE_IS] message: "Content-Length: 8"', $contents);
|
| 339 |
-
$this->assertContains('<GET http://127.0.0.1:8125/> [PROGRESS] bytes_max: "8"', $contents);
|
| 340 |
-
$this->assertTrue($called);
|
| 341 |
-
}
|
| 342 |
-
|
| 343 |
-
public function testEmitsProgressInformation()
|
| 344 |
-
{
|
| 345 |
-
$called = [];
|
| 346 |
-
$this->queueRes();
|
| 347 |
-
$this->getSendResult([
|
| 348 |
-
'progress' => function () use (&$called) {
|
| 349 |
-
$called[] = func_get_args();
|
| 350 |
-
},
|
| 351 |
-
]);
|
| 352 |
-
$this->assertNotEmpty($called);
|
| 353 |
-
$this->assertEquals(8, $called[0][0]);
|
| 354 |
-
$this->assertEquals(0, $called[0][1]);
|
| 355 |
-
}
|
| 356 |
-
|
| 357 |
-
public function testEmitsProgressInformationAndDebugInformation()
|
| 358 |
-
{
|
| 359 |
-
$called = [];
|
| 360 |
-
$this->queueRes();
|
| 361 |
-
$buffer = fopen('php://memory', 'w+');
|
| 362 |
-
$this->getSendResult([
|
| 363 |
-
'debug' => $buffer,
|
| 364 |
-
'progress' => function () use (&$called) {
|
| 365 |
-
$called[] = func_get_args();
|
| 366 |
-
},
|
| 367 |
-
]);
|
| 368 |
-
$this->assertNotEmpty($called);
|
| 369 |
-
$this->assertEquals(8, $called[0][0]);
|
| 370 |
-
$this->assertEquals(0, $called[0][1]);
|
| 371 |
-
rewind($buffer);
|
| 372 |
-
$this->assertNotEmpty(stream_get_contents($buffer));
|
| 373 |
-
fclose($buffer);
|
| 374 |
-
}
|
| 375 |
-
|
| 376 |
-
public function testAddsProxyByProtocol()
|
| 377 |
-
{
|
| 378 |
-
$url = str_replace('http', 'tcp', Server::$url);
|
| 379 |
-
$res = $this->getSendResult(['proxy' => ['http' => $url]]);
|
| 380 |
-
$opts = stream_context_get_options($res['body']);
|
| 381 |
-
$this->assertEquals($url, $opts['http']['proxy']);
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
public function testPerformsShallowMergeOfCustomContextOptions()
|
| 385 |
-
{
|
| 386 |
-
$res = $this->getSendResult([
|
| 387 |
-
'stream_context' => [
|
| 388 |
-
'http' => [
|
| 389 |
-
'request_fulluri' => true,
|
| 390 |
-
'method' => 'HEAD',
|
| 391 |
-
],
|
| 392 |
-
'socket' => [
|
| 393 |
-
'bindto' => '127.0.0.1:0',
|
| 394 |
-
],
|
| 395 |
-
'ssl' => [
|
| 396 |
-
'verify_peer' => false,
|
| 397 |
-
],
|
| 398 |
-
],
|
| 399 |
-
]);
|
| 400 |
-
|
| 401 |
-
$opts = stream_context_get_options($res['body']);
|
| 402 |
-
$this->assertEquals('HEAD', $opts['http']['method']);
|
| 403 |
-
$this->assertTrue($opts['http']['request_fulluri']);
|
| 404 |
-
$this->assertFalse($opts['ssl']['verify_peer']);
|
| 405 |
-
$this->assertEquals('127.0.0.1:0', $opts['socket']['bindto']);
|
| 406 |
-
}
|
| 407 |
-
|
| 408 |
-
public function testEnsuresThatStreamContextIsAnArray()
|
| 409 |
-
{
|
| 410 |
-
$res = $this->getSendResult(['stream_context' => 'foo']);
|
| 411 |
-
$this->assertContains(
|
| 412 |
-
'stream_context must be an array',
|
| 413 |
-
(string) $res['error']
|
| 414 |
-
);
|
| 415 |
-
}
|
| 416 |
-
|
| 417 |
-
public function testDoesNotAddContentTypeByDefault()
|
| 418 |
-
{
|
| 419 |
-
$this->queueRes();
|
| 420 |
-
$handler = new StreamHandler();
|
| 421 |
-
$handler([
|
| 422 |
-
'http_method' => 'PUT',
|
| 423 |
-
'uri' => '/',
|
| 424 |
-
'headers' => ['host' => [Server::$host], 'content-length' => [3]],
|
| 425 |
-
'body' => 'foo',
|
| 426 |
-
]);
|
| 427 |
-
$req = Server::received()[0];
|
| 428 |
-
$this->assertEquals('', Core::header($req, 'Content-Type'));
|
| 429 |
-
$this->assertEquals(3, Core::header($req, 'Content-Length'));
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
private function queueRes()
|
| 433 |
-
{
|
| 434 |
-
Server::flush();
|
| 435 |
-
Server::enqueue([
|
| 436 |
-
[
|
| 437 |
-
'status' => 200,
|
| 438 |
-
'reason' => 'OK',
|
| 439 |
-
'headers' => [
|
| 440 |
-
'Foo' => ['Bar'],
|
| 441 |
-
'Content-Length' => [8],
|
| 442 |
-
],
|
| 443 |
-
'body' => 'hi there',
|
| 444 |
-
],
|
| 445 |
-
]);
|
| 446 |
-
}
|
| 447 |
-
|
| 448 |
-
public function testSupports100Continue()
|
| 449 |
-
{
|
| 450 |
-
Server::flush();
|
| 451 |
-
Server::enqueue([
|
| 452 |
-
[
|
| 453 |
-
'status' => '200',
|
| 454 |
-
'reason' => 'OK',
|
| 455 |
-
'headers' => [
|
| 456 |
-
'Test' => ['Hello'],
|
| 457 |
-
'Content-Length' => ['4'],
|
| 458 |
-
],
|
| 459 |
-
'body' => 'test',
|
| 460 |
-
],
|
| 461 |
-
]);
|
| 462 |
-
|
| 463 |
-
$request = [
|
| 464 |
-
'http_method' => 'PUT',
|
| 465 |
-
'headers' => [
|
| 466 |
-
'Host' => [Server::$host],
|
| 467 |
-
'Expect' => ['100-Continue'],
|
| 468 |
-
],
|
| 469 |
-
'body' => 'test',
|
| 470 |
-
];
|
| 471 |
-
|
| 472 |
-
$handler = new StreamHandler();
|
| 473 |
-
$response = $handler($request);
|
| 474 |
-
$this->assertEquals(200, $response['status']);
|
| 475 |
-
$this->assertEquals('OK', $response['reason']);
|
| 476 |
-
$this->assertEquals(['Hello'], $response['headers']['Test']);
|
| 477 |
-
$this->assertEquals(['4'], $response['headers']['Content-Length']);
|
| 478 |
-
$this->assertEquals('test', Core::body($response));
|
| 479 |
-
}
|
| 480 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Client/server.js
DELETED
|
@@ -1,241 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Guzzle node.js test server to return queued responses to HTTP requests and
|
| 3 |
-
* expose a RESTful API for enqueueing responses and retrieving the requests
|
| 4 |
-
* that have been received.
|
| 5 |
-
*
|
| 6 |
-
* - Delete all requests that have been received:
|
| 7 |
-
* > DELETE /guzzle-server/requests
|
| 8 |
-
* > Host: 127.0.0.1:8125
|
| 9 |
-
*
|
| 10 |
-
* - Enqueue responses
|
| 11 |
-
* > PUT /guzzle-server/responses
|
| 12 |
-
* > Host: 127.0.0.1:8125
|
| 13 |
-
* >
|
| 14 |
-
* > [{'status': 200, 'reason': 'OK', 'headers': {}, 'body': '' }]
|
| 15 |
-
*
|
| 16 |
-
* - Get the received requests
|
| 17 |
-
* > GET /guzzle-server/requests
|
| 18 |
-
* > Host: 127.0.0.1:8125
|
| 19 |
-
*
|
| 20 |
-
* < HTTP/1.1 200 OK
|
| 21 |
-
* <
|
| 22 |
-
* < [{'http_method': 'GET', 'uri': '/', 'headers': {}, 'body': 'string'}]
|
| 23 |
-
*
|
| 24 |
-
* - Attempt access to the secure area
|
| 25 |
-
* > GET /secure/by-digest/qop-auth/guzzle-server/requests
|
| 26 |
-
* > Host: 127.0.0.1:8125
|
| 27 |
-
*
|
| 28 |
-
* < HTTP/1.1 401 Unauthorized
|
| 29 |
-
* < WWW-Authenticate: Digest realm="Digest Test", qop="auth", nonce="0796e98e1aeef43141fab2a66bf4521a", algorithm="MD5", stale="false"
|
| 30 |
-
* <
|
| 31 |
-
* < 401 Unauthorized
|
| 32 |
-
*
|
| 33 |
-
* - Shutdown the server
|
| 34 |
-
* > DELETE /guzzle-server
|
| 35 |
-
* > Host: 127.0.0.1:8125
|
| 36 |
-
*
|
| 37 |
-
* @package Guzzle PHP <http://www.guzzlephp.org>
|
| 38 |
-
* @license See the LICENSE file that was distributed with this source code.
|
| 39 |
-
*/
|
| 40 |
-
|
| 41 |
-
var http = require('http');
|
| 42 |
-
var url = require('url');
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* Guzzle node.js server
|
| 46 |
-
* @class
|
| 47 |
-
*/
|
| 48 |
-
var GuzzleServer = function(port, log) {
|
| 49 |
-
|
| 50 |
-
this.port = port;
|
| 51 |
-
this.log = log;
|
| 52 |
-
this.responses = [];
|
| 53 |
-
this.requests = [];
|
| 54 |
-
var that = this;
|
| 55 |
-
|
| 56 |
-
var md5 = function(input) {
|
| 57 |
-
var crypto = require('crypto');
|
| 58 |
-
var hasher = crypto.createHash('md5');
|
| 59 |
-
hasher.update(input);
|
| 60 |
-
return hasher.digest('hex');
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* Node.js HTTP server authentication module.
|
| 65 |
-
*
|
| 66 |
-
* It is only initialized on demand (by loadAuthentifier). This avoids
|
| 67 |
-
* requiring the dependency to http-auth on standard operations, and the
|
| 68 |
-
* performance hit at startup.
|
| 69 |
-
*/
|
| 70 |
-
var auth;
|
| 71 |
-
|
| 72 |
-
/**
|
| 73 |
-
* Provides authentication handlers (Basic, Digest).
|
| 74 |
-
*/
|
| 75 |
-
var loadAuthentifier = function(type, options) {
|
| 76 |
-
var typeId = type;
|
| 77 |
-
if (type == 'digest') {
|
| 78 |
-
typeId += '.'+(options && options.qop ? options.qop : 'none');
|
| 79 |
-
}
|
| 80 |
-
if (!loadAuthentifier[typeId]) {
|
| 81 |
-
if (!auth) {
|
| 82 |
-
try {
|
| 83 |
-
auth = require('http-auth');
|
| 84 |
-
} catch (e) {
|
| 85 |
-
if (e.code == 'MODULE_NOT_FOUND') {
|
| 86 |
-
return;
|
| 87 |
-
}
|
| 88 |
-
}
|
| 89 |
-
}
|
| 90 |
-
switch (type) {
|
| 91 |
-
case 'digest':
|
| 92 |
-
var digestParams = {
|
| 93 |
-
realm: 'Digest Test',
|
| 94 |
-
login: 'me',
|
| 95 |
-
password: 'test'
|
| 96 |
-
};
|
| 97 |
-
if (options && options.qop) {
|
| 98 |
-
digestParams.qop = options.qop;
|
| 99 |
-
}
|
| 100 |
-
loadAuthentifier[typeId] = auth.digest(digestParams, function(username, callback) {
|
| 101 |
-
callback(md5(digestParams.login + ':' + digestParams.realm + ':' + digestParams.password));
|
| 102 |
-
});
|
| 103 |
-
break
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
return loadAuthentifier[typeId];
|
| 107 |
-
};
|
| 108 |
-
|
| 109 |
-
var firewallRequest = function(request, req, res, requestHandlerCallback) {
|
| 110 |
-
var securedAreaUriParts = request.uri.match(/^\/secure\/by-(digest)(\/qop-([^\/]*))?(\/.*)$/);
|
| 111 |
-
if (securedAreaUriParts) {
|
| 112 |
-
var authentifier = loadAuthentifier(securedAreaUriParts[1], { qop: securedAreaUriParts[2] });
|
| 113 |
-
if (!authentifier) {
|
| 114 |
-
res.writeHead(501, 'HTTP authentication not implemented', { 'Content-Length': 0 });
|
| 115 |
-
res.end();
|
| 116 |
-
return;
|
| 117 |
-
}
|
| 118 |
-
authentifier.check(req, res, function(req, res) {
|
| 119 |
-
req.url = securedAreaUriParts[4];
|
| 120 |
-
requestHandlerCallback(request, req, res);
|
| 121 |
-
});
|
| 122 |
-
} else {
|
| 123 |
-
requestHandlerCallback(request, req, res);
|
| 124 |
-
}
|
| 125 |
-
};
|
| 126 |
-
|
| 127 |
-
var controlRequest = function(request, req, res) {
|
| 128 |
-
if (req.url == '/guzzle-server/perf') {
|
| 129 |
-
res.writeHead(200, 'OK', {'Content-Length': 16});
|
| 130 |
-
res.end('Body of response');
|
| 131 |
-
} else if (req.method == 'DELETE') {
|
| 132 |
-
if (req.url == '/guzzle-server/requests') {
|
| 133 |
-
// Clear the received requests
|
| 134 |
-
that.requests = [];
|
| 135 |
-
res.writeHead(200, 'OK', { 'Content-Length': 0 });
|
| 136 |
-
res.end();
|
| 137 |
-
if (that.log) {
|
| 138 |
-
console.log('Flushing requests');
|
| 139 |
-
}
|
| 140 |
-
} else if (req.url == '/guzzle-server') {
|
| 141 |
-
// Shutdown the server
|
| 142 |
-
res.writeHead(200, 'OK', { 'Content-Length': 0, 'Connection': 'close' });
|
| 143 |
-
res.end();
|
| 144 |
-
if (that.log) {
|
| 145 |
-
console.log('Shutting down');
|
| 146 |
-
}
|
| 147 |
-
that.server.close();
|
| 148 |
-
}
|
| 149 |
-
} else if (req.method == 'GET') {
|
| 150 |
-
if (req.url === '/guzzle-server/requests') {
|
| 151 |
-
if (that.log) {
|
| 152 |
-
console.log('Sending received requests');
|
| 153 |
-
}
|
| 154 |
-
// Get received requests
|
| 155 |
-
var body = JSON.stringify(that.requests);
|
| 156 |
-
res.writeHead(200, 'OK', { 'Content-Length': body.length });
|
| 157 |
-
res.end(body);
|
| 158 |
-
}
|
| 159 |
-
} else if (req.method == 'PUT' && req.url == '/guzzle-server/responses') {
|
| 160 |
-
if (that.log) {
|
| 161 |
-
console.log('Adding responses...');
|
| 162 |
-
}
|
| 163 |
-
if (!request.body) {
|
| 164 |
-
if (that.log) {
|
| 165 |
-
console.log('No response data was provided');
|
| 166 |
-
}
|
| 167 |
-
res.writeHead(400, 'NO RESPONSES IN REQUEST', { 'Content-Length': 0 });
|
| 168 |
-
} else {
|
| 169 |
-
that.responses = eval('(' + request.body + ')');
|
| 170 |
-
for (var i = 0; i < that.responses.length; i++) {
|
| 171 |
-
if (that.responses[i].body) {
|
| 172 |
-
that.responses[i].body = new Buffer(that.responses[i].body, 'base64');
|
| 173 |
-
}
|
| 174 |
-
}
|
| 175 |
-
if (that.log) {
|
| 176 |
-
console.log(that.responses);
|
| 177 |
-
}
|
| 178 |
-
res.writeHead(200, 'OK', { 'Content-Length': 0 });
|
| 179 |
-
}
|
| 180 |
-
res.end();
|
| 181 |
-
}
|
| 182 |
-
};
|
| 183 |
-
|
| 184 |
-
var receivedRequest = function(request, req, res) {
|
| 185 |
-
if (req.url.indexOf('/guzzle-server') === 0) {
|
| 186 |
-
controlRequest(request, req, res);
|
| 187 |
-
} else if (req.url.indexOf('/guzzle-server') == -1 && !that.responses.length) {
|
| 188 |
-
res.writeHead(500);
|
| 189 |
-
res.end('No responses in queue');
|
| 190 |
-
} else {
|
| 191 |
-
if (that.log) {
|
| 192 |
-
console.log('Returning response from queue and adding request');
|
| 193 |
-
}
|
| 194 |
-
that.requests.push(request);
|
| 195 |
-
var response = that.responses.shift();
|
| 196 |
-
res.writeHead(response.status, response.reason, response.headers);
|
| 197 |
-
res.end(response.body);
|
| 198 |
-
}
|
| 199 |
-
};
|
| 200 |
-
|
| 201 |
-
this.start = function() {
|
| 202 |
-
|
| 203 |
-
that.server = http.createServer(function(req, res) {
|
| 204 |
-
|
| 205 |
-
var parts = url.parse(req.url, false);
|
| 206 |
-
var request = {
|
| 207 |
-
http_method: req.method,
|
| 208 |
-
scheme: parts.scheme,
|
| 209 |
-
uri: parts.pathname,
|
| 210 |
-
query_string: parts.query,
|
| 211 |
-
headers: req.headers,
|
| 212 |
-
version: req.httpVersion,
|
| 213 |
-
body: ''
|
| 214 |
-
};
|
| 215 |
-
|
| 216 |
-
// Receive each chunk of the request body
|
| 217 |
-
req.addListener('data', function(chunk) {
|
| 218 |
-
request.body += chunk;
|
| 219 |
-
});
|
| 220 |
-
|
| 221 |
-
// Called when the request completes
|
| 222 |
-
req.addListener('end', function() {
|
| 223 |
-
firewallRequest(request, req, res, receivedRequest);
|
| 224 |
-
});
|
| 225 |
-
});
|
| 226 |
-
|
| 227 |
-
that.server.listen(this.port, '127.0.0.1');
|
| 228 |
-
|
| 229 |
-
if (this.log) {
|
| 230 |
-
console.log('Server running at http://127.0.0.1:8125/');
|
| 231 |
-
}
|
| 232 |
-
};
|
| 233 |
-
};
|
| 234 |
-
|
| 235 |
-
// Get the port from the arguments
|
| 236 |
-
port = process.argv.length >= 3 ? process.argv[2] : 8125;
|
| 237 |
-
log = process.argv.length >= 4 ? process.argv[3] : false;
|
| 238 |
-
|
| 239 |
-
// Start the server
|
| 240 |
-
server = new GuzzleServer(port, log);
|
| 241 |
-
server.start();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/CoreTest.php
DELETED
|
@@ -1,336 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Core;
|
| 5 |
-
use GuzzleHttp\Ring\Future\CompletedFutureArray;
|
| 6 |
-
use GuzzleHttp\Ring\Future\FutureArray;
|
| 7 |
-
use GuzzleHttp\Stream\Stream;
|
| 8 |
-
use React\Promise\Deferred;
|
| 9 |
-
|
| 10 |
-
class CoreTest extends \PHPUnit_Framework_TestCase
|
| 11 |
-
{
|
| 12 |
-
public function testReturnsNullNoHeadersAreSet()
|
| 13 |
-
{
|
| 14 |
-
$this->assertNull(Core::header([], 'Foo'));
|
| 15 |
-
$this->assertNull(Core::firstHeader([], 'Foo'));
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
public function testChecksIfHasHeader()
|
| 19 |
-
{
|
| 20 |
-
$message = [
|
| 21 |
-
'headers' => [
|
| 22 |
-
'Foo' => ['Bar', 'Baz'],
|
| 23 |
-
'foo' => ['hello'],
|
| 24 |
-
'bar' => ['1']
|
| 25 |
-
]
|
| 26 |
-
];
|
| 27 |
-
$this->assertTrue(Core::hasHeader($message, 'Foo'));
|
| 28 |
-
$this->assertTrue(Core::hasHeader($message, 'foo'));
|
| 29 |
-
$this->assertTrue(Core::hasHeader($message, 'FoO'));
|
| 30 |
-
$this->assertTrue(Core::hasHeader($message, 'bar'));
|
| 31 |
-
$this->assertFalse(Core::hasHeader($message, 'barr'));
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function testReturnsFirstHeaderWhenSimple()
|
| 35 |
-
{
|
| 36 |
-
$this->assertEquals('Bar', Core::firstHeader([
|
| 37 |
-
'headers' => ['Foo' => ['Bar', 'Baz']],
|
| 38 |
-
], 'Foo'));
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function testReturnsFirstHeaderWhenMultiplePerLine()
|
| 42 |
-
{
|
| 43 |
-
$this->assertEquals('Bar', Core::firstHeader([
|
| 44 |
-
'headers' => ['Foo' => ['Bar, Baz']],
|
| 45 |
-
], 'Foo'));
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
public function testExtractsCaseInsensitiveHeader()
|
| 49 |
-
{
|
| 50 |
-
$this->assertEquals(
|
| 51 |
-
'hello',
|
| 52 |
-
Core::header(['headers' => ['foo' => ['hello']]], 'FoO')
|
| 53 |
-
);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
public function testExtractsCaseInsensitiveHeaderLines()
|
| 57 |
-
{
|
| 58 |
-
$this->assertEquals(
|
| 59 |
-
['a', 'b', 'c', 'd'],
|
| 60 |
-
Core::headerLines([
|
| 61 |
-
'headers' => [
|
| 62 |
-
'foo' => ['a', 'b'],
|
| 63 |
-
'Foo' => ['c', 'd']
|
| 64 |
-
]
|
| 65 |
-
], 'foo')
|
| 66 |
-
);
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
public function testExtractsHeaderLines()
|
| 70 |
-
{
|
| 71 |
-
$this->assertEquals(
|
| 72 |
-
['bar', 'baz'],
|
| 73 |
-
Core::headerLines([
|
| 74 |
-
'headers' => [
|
| 75 |
-
'Foo' => ['bar', 'baz'],
|
| 76 |
-
],
|
| 77 |
-
], 'Foo')
|
| 78 |
-
);
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
public function testExtractsHeaderAsString()
|
| 82 |
-
{
|
| 83 |
-
$this->assertEquals(
|
| 84 |
-
'bar, baz',
|
| 85 |
-
Core::header([
|
| 86 |
-
'headers' => [
|
| 87 |
-
'Foo' => ['bar', 'baz'],
|
| 88 |
-
],
|
| 89 |
-
], 'Foo', true)
|
| 90 |
-
);
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
public function testReturnsNullWhenHeaderNotFound()
|
| 94 |
-
{
|
| 95 |
-
$this->assertNull(Core::header(['headers' => []], 'Foo'));
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
public function testRemovesHeaders()
|
| 99 |
-
{
|
| 100 |
-
$message = [
|
| 101 |
-
'headers' => [
|
| 102 |
-
'foo' => ['bar'],
|
| 103 |
-
'Foo' => ['bam'],
|
| 104 |
-
'baz' => ['123'],
|
| 105 |
-
],
|
| 106 |
-
];
|
| 107 |
-
|
| 108 |
-
$this->assertSame($message, Core::removeHeader($message, 'bam'));
|
| 109 |
-
$this->assertEquals([
|
| 110 |
-
'headers' => ['baz' => ['123']],
|
| 111 |
-
], Core::removeHeader($message, 'foo'));
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
public function testCreatesUrl()
|
| 115 |
-
{
|
| 116 |
-
$req = [
|
| 117 |
-
'scheme' => 'http',
|
| 118 |
-
'headers' => ['host' => ['foo.com']],
|
| 119 |
-
'uri' => '/',
|
| 120 |
-
];
|
| 121 |
-
|
| 122 |
-
$this->assertEquals('http://foo.com/', Core::url($req));
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* @expectedException \InvalidArgumentException
|
| 127 |
-
* @expectedExceptionMessage No Host header was provided
|
| 128 |
-
*/
|
| 129 |
-
public function testEnsuresHostIsAvailableWhenCreatingUrls()
|
| 130 |
-
{
|
| 131 |
-
Core::url([]);
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
public function testCreatesUrlWithQueryString()
|
| 135 |
-
{
|
| 136 |
-
$req = [
|
| 137 |
-
'scheme' => 'http',
|
| 138 |
-
'headers' => ['host' => ['foo.com']],
|
| 139 |
-
'uri' => '/',
|
| 140 |
-
'query_string' => 'foo=baz',
|
| 141 |
-
];
|
| 142 |
-
|
| 143 |
-
$this->assertEquals('http://foo.com/?foo=baz', Core::url($req));
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
public function testUsesUrlIfSet()
|
| 147 |
-
{
|
| 148 |
-
$req = ['url' => 'http://foo.com'];
|
| 149 |
-
$this->assertEquals('http://foo.com', Core::url($req));
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
public function testReturnsNullWhenNoBody()
|
| 153 |
-
{
|
| 154 |
-
$this->assertNull(Core::body([]));
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
public function testReturnsStreamAsString()
|
| 158 |
-
{
|
| 159 |
-
$this->assertEquals(
|
| 160 |
-
'foo',
|
| 161 |
-
Core::body(['body' => Stream::factory('foo')])
|
| 162 |
-
);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
public function testReturnsString()
|
| 166 |
-
{
|
| 167 |
-
$this->assertEquals('foo', Core::body(['body' => 'foo']));
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
public function testReturnsResourceContent()
|
| 171 |
-
{
|
| 172 |
-
$r = fopen('php://memory', 'w+');
|
| 173 |
-
fwrite($r, 'foo');
|
| 174 |
-
rewind($r);
|
| 175 |
-
$this->assertEquals('foo', Core::body(['body' => $r]));
|
| 176 |
-
fclose($r);
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
public function testReturnsIteratorContent()
|
| 180 |
-
{
|
| 181 |
-
$a = new \ArrayIterator(['a', 'b', 'cd', '']);
|
| 182 |
-
$this->assertEquals('abcd', Core::body(['body' => $a]));
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
public function testReturnsObjectToString()
|
| 186 |
-
{
|
| 187 |
-
$this->assertEquals('foo', Core::body(['body' => new StrClass]));
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* @expectedException \InvalidArgumentException
|
| 192 |
-
*/
|
| 193 |
-
public function testEnsuresBodyIsValid()
|
| 194 |
-
{
|
| 195 |
-
Core::body(['body' => false]);
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
public function testParsesHeadersFromLines()
|
| 199 |
-
{
|
| 200 |
-
$lines = ['Foo: bar', 'Foo: baz', 'Abc: 123', 'Def: a, b'];
|
| 201 |
-
$this->assertEquals([
|
| 202 |
-
'Foo' => ['bar', 'baz'],
|
| 203 |
-
'Abc' => ['123'],
|
| 204 |
-
'Def' => ['a, b'],
|
| 205 |
-
], Core::headersFromLines($lines));
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
public function testParsesHeadersFromLinesWithMultipleLines()
|
| 209 |
-
{
|
| 210 |
-
$lines = ['Foo: bar', 'Foo: baz', 'Foo: 123'];
|
| 211 |
-
$this->assertEquals([
|
| 212 |
-
'Foo' => ['bar', 'baz', '123'],
|
| 213 |
-
], Core::headersFromLines($lines));
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
public function testCreatesArrayCallFunctions()
|
| 217 |
-
{
|
| 218 |
-
$called = [];
|
| 219 |
-
$a = function ($a, $b) use (&$called) {
|
| 220 |
-
$called['a'] = func_get_args();
|
| 221 |
-
};
|
| 222 |
-
$b = function ($a, $b) use (&$called) {
|
| 223 |
-
$called['b'] = func_get_args();
|
| 224 |
-
};
|
| 225 |
-
$c = Core::callArray([$a, $b]);
|
| 226 |
-
$c(1, 2);
|
| 227 |
-
$this->assertEquals([1, 2], $called['a']);
|
| 228 |
-
$this->assertEquals([1, 2], $called['b']);
|
| 229 |
-
}
|
| 230 |
-
|
| 231 |
-
public function testRewindsGuzzleStreams()
|
| 232 |
-
{
|
| 233 |
-
$str = Stream::factory('foo');
|
| 234 |
-
$this->assertTrue(Core::rewindBody(['body' => $str]));
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
public function testRewindsStreams()
|
| 238 |
-
{
|
| 239 |
-
$str = Stream::factory('foo')->detach();
|
| 240 |
-
$this->assertTrue(Core::rewindBody(['body' => $str]));
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
public function testRewindsIterators()
|
| 244 |
-
{
|
| 245 |
-
$iter = new \ArrayIterator(['foo']);
|
| 246 |
-
$this->assertTrue(Core::rewindBody(['body' => $iter]));
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
public function testRewindsStrings()
|
| 250 |
-
{
|
| 251 |
-
$this->assertTrue(Core::rewindBody(['body' => 'hi']));
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
public function testRewindsToStrings()
|
| 255 |
-
{
|
| 256 |
-
$this->assertTrue(Core::rewindBody(['body' => new StrClass()]));
|
| 257 |
-
}
|
| 258 |
-
|
| 259 |
-
public function typeProvider()
|
| 260 |
-
{
|
| 261 |
-
return [
|
| 262 |
-
['foo', 'string(3) "foo"'],
|
| 263 |
-
[true, 'bool(true)'],
|
| 264 |
-
[false, 'bool(false)'],
|
| 265 |
-
[10, 'int(10)'],
|
| 266 |
-
[1.0, 'float(1)'],
|
| 267 |
-
[new StrClass(), 'object(GuzzleHttp\Tests\Ring\StrClass)'],
|
| 268 |
-
[['foo'], 'array(1)']
|
| 269 |
-
];
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
/**
|
| 273 |
-
* @dataProvider typeProvider
|
| 274 |
-
*/
|
| 275 |
-
public function testDescribesType($input, $output)
|
| 276 |
-
{
|
| 277 |
-
$this->assertEquals($output, Core::describeType($input));
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
public function testDoesSleep()
|
| 281 |
-
{
|
| 282 |
-
$t = microtime(true);
|
| 283 |
-
$expected = $t + (100 / 1000);
|
| 284 |
-
Core::doSleep(['client' => ['delay' => 100]]);
|
| 285 |
-
$this->assertGreaterThanOrEqual($expected, microtime(true));
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
public function testProxiesFuture()
|
| 289 |
-
{
|
| 290 |
-
$f = new CompletedFutureArray(['status' => 200]);
|
| 291 |
-
$res = null;
|
| 292 |
-
$proxied = Core::proxy($f, function ($value) use (&$res) {
|
| 293 |
-
$value['foo'] = 'bar';
|
| 294 |
-
$res = $value;
|
| 295 |
-
return $value;
|
| 296 |
-
});
|
| 297 |
-
$this->assertNotSame($f, $proxied);
|
| 298 |
-
$this->assertEquals(200, $f->wait()['status']);
|
| 299 |
-
$this->assertArrayNotHasKey('foo', $f->wait());
|
| 300 |
-
$this->assertEquals('bar', $proxied->wait()['foo']);
|
| 301 |
-
$this->assertEquals(200, $proxied->wait()['status']);
|
| 302 |
-
}
|
| 303 |
-
|
| 304 |
-
public function testProxiesDeferredFuture()
|
| 305 |
-
{
|
| 306 |
-
$d = new Deferred();
|
| 307 |
-
$f = new FutureArray($d->promise());
|
| 308 |
-
$f2 = Core::proxy($f);
|
| 309 |
-
$d->resolve(['foo' => 'bar']);
|
| 310 |
-
$this->assertEquals('bar', $f['foo']);
|
| 311 |
-
$this->assertEquals('bar', $f2['foo']);
|
| 312 |
-
}
|
| 313 |
-
|
| 314 |
-
public function testProxiesDeferredFutureFailure()
|
| 315 |
-
{
|
| 316 |
-
$d = new Deferred();
|
| 317 |
-
$f = new FutureArray($d->promise());
|
| 318 |
-
$f2 = Core::proxy($f);
|
| 319 |
-
$d->reject(new \Exception('foo'));
|
| 320 |
-
try {
|
| 321 |
-
$f2['hello?'];
|
| 322 |
-
$this->fail('did not throw');
|
| 323 |
-
} catch (\Exception $e) {
|
| 324 |
-
$this->assertEquals('foo', $e->getMessage());
|
| 325 |
-
}
|
| 326 |
-
|
| 327 |
-
}
|
| 328 |
-
}
|
| 329 |
-
|
| 330 |
-
final class StrClass
|
| 331 |
-
{
|
| 332 |
-
public function __toString()
|
| 333 |
-
{
|
| 334 |
-
return 'foo';
|
| 335 |
-
}
|
| 336 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Future/CompletedFutureArrayTest.php
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Future;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Future\CompletedFutureArray;
|
| 5 |
-
|
| 6 |
-
class CompletedFutureArrayTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
public function testReturnsAsArray()
|
| 9 |
-
{
|
| 10 |
-
$f = new CompletedFutureArray(['foo' => 'bar']);
|
| 11 |
-
$this->assertEquals('bar', $f['foo']);
|
| 12 |
-
$this->assertFalse(isset($f['baz']));
|
| 13 |
-
$f['abc'] = '123';
|
| 14 |
-
$this->assertTrue(isset($f['abc']));
|
| 15 |
-
$this->assertEquals(['foo' => 'bar', 'abc' => '123'], iterator_to_array($f));
|
| 16 |
-
$this->assertEquals(2, count($f));
|
| 17 |
-
unset($f['abc']);
|
| 18 |
-
$this->assertEquals(1, count($f));
|
| 19 |
-
$this->assertEquals(['foo' => 'bar'], iterator_to_array($f));
|
| 20 |
-
}
|
| 21 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Future/CompletedFutureValueTest.php
DELETED
|
@@ -1,46 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Future;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Exception\CancelledFutureAccessException;
|
| 5 |
-
use GuzzleHttp\Ring\Future\CompletedFutureValue;
|
| 6 |
-
|
| 7 |
-
class CompletedFutureValueTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testReturnsValue()
|
| 10 |
-
{
|
| 11 |
-
$f = new CompletedFutureValue('hi');
|
| 12 |
-
$this->assertEquals('hi', $f->wait());
|
| 13 |
-
$f->cancel();
|
| 14 |
-
|
| 15 |
-
$a = null;
|
| 16 |
-
$f->then(function ($v) use (&$a) {
|
| 17 |
-
$a = $v;
|
| 18 |
-
});
|
| 19 |
-
$this->assertSame('hi', $a);
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
public function testThrows()
|
| 23 |
-
{
|
| 24 |
-
$ex = new \Exception('foo');
|
| 25 |
-
$f = new CompletedFutureValue(null, $ex);
|
| 26 |
-
$f->cancel();
|
| 27 |
-
try {
|
| 28 |
-
$f->wait();
|
| 29 |
-
$this->fail('did not throw');
|
| 30 |
-
} catch (\Exception $e) {
|
| 31 |
-
$this->assertSame($e, $ex);
|
| 32 |
-
}
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function testMarksAsCancelled()
|
| 36 |
-
{
|
| 37 |
-
$ex = new CancelledFutureAccessException();
|
| 38 |
-
$f = new CompletedFutureValue(null, $ex);
|
| 39 |
-
try {
|
| 40 |
-
$f->wait();
|
| 41 |
-
$this->fail('did not throw');
|
| 42 |
-
} catch (\Exception $e) {
|
| 43 |
-
$this->assertSame($e, $ex);
|
| 44 |
-
}
|
| 45 |
-
}
|
| 46 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Future/FutureArrayTest.php
DELETED
|
@@ -1,56 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Future;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Future\FutureArray;
|
| 5 |
-
use React\Promise\Deferred;
|
| 6 |
-
|
| 7 |
-
class FutureArrayTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testLazilyCallsDeref()
|
| 10 |
-
{
|
| 11 |
-
$c = false;
|
| 12 |
-
$deferred = new Deferred();
|
| 13 |
-
$f = new FutureArray(
|
| 14 |
-
$deferred->promise(),
|
| 15 |
-
function () use (&$c, $deferred) {
|
| 16 |
-
$c = true;
|
| 17 |
-
$deferred->resolve(['status' => 200]);
|
| 18 |
-
}
|
| 19 |
-
);
|
| 20 |
-
$this->assertFalse($c);
|
| 21 |
-
$this->assertFalse($this->readAttribute($f, 'isRealized'));
|
| 22 |
-
$this->assertEquals(200, $f['status']);
|
| 23 |
-
$this->assertTrue($c);
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testActsLikeArray()
|
| 27 |
-
{
|
| 28 |
-
$deferred = new Deferred();
|
| 29 |
-
$f = new FutureArray(
|
| 30 |
-
$deferred->promise(),
|
| 31 |
-
function () use (&$c, $deferred) {
|
| 32 |
-
$deferred->resolve(['status' => 200]);
|
| 33 |
-
}
|
| 34 |
-
);
|
| 35 |
-
|
| 36 |
-
$this->assertTrue(isset($f['status']));
|
| 37 |
-
$this->assertEquals(200, $f['status']);
|
| 38 |
-
$this->assertEquals(['status' => 200], $f->wait());
|
| 39 |
-
$this->assertEquals(1, count($f));
|
| 40 |
-
$f['baz'] = 10;
|
| 41 |
-
$this->assertEquals(10, $f['baz']);
|
| 42 |
-
unset($f['baz']);
|
| 43 |
-
$this->assertFalse(isset($f['baz']));
|
| 44 |
-
$this->assertEquals(['status' => 200], iterator_to_array($f));
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* @expectedException \RuntimeException
|
| 49 |
-
*/
|
| 50 |
-
public function testThrowsWhenAccessingInvalidProperty()
|
| 51 |
-
{
|
| 52 |
-
$deferred = new Deferred();
|
| 53 |
-
$f = new FutureArray($deferred->promise(), function () {});
|
| 54 |
-
$f->foo;
|
| 55 |
-
}
|
| 56 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/Future/FutureValueTest.php
DELETED
|
@@ -1,109 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Ring\Future;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Ring\Exception\CancelledFutureAccessException;
|
| 5 |
-
use GuzzleHttp\Ring\Future\FutureValue;
|
| 6 |
-
use React\Promise\Deferred;
|
| 7 |
-
|
| 8 |
-
class FutureValueTest extends \PHPUnit_Framework_TestCase
|
| 9 |
-
{
|
| 10 |
-
public function testDerefReturnsValue()
|
| 11 |
-
{
|
| 12 |
-
$called = 0;
|
| 13 |
-
$deferred = new Deferred();
|
| 14 |
-
|
| 15 |
-
$f = new FutureValue(
|
| 16 |
-
$deferred->promise(),
|
| 17 |
-
function () use ($deferred, &$called) {
|
| 18 |
-
$called++;
|
| 19 |
-
$deferred->resolve('foo');
|
| 20 |
-
}
|
| 21 |
-
);
|
| 22 |
-
|
| 23 |
-
$this->assertEquals('foo', $f->wait());
|
| 24 |
-
$this->assertEquals(1, $called);
|
| 25 |
-
$this->assertEquals('foo', $f->wait());
|
| 26 |
-
$this->assertEquals(1, $called);
|
| 27 |
-
$f->cancel();
|
| 28 |
-
$this->assertTrue($this->readAttribute($f, 'isRealized'));
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* @expectedException \GuzzleHttp\Ring\Exception\CancelledFutureAccessException
|
| 33 |
-
*/
|
| 34 |
-
public function testThrowsWhenAccessingCancelled()
|
| 35 |
-
{
|
| 36 |
-
$f = new FutureValue(
|
| 37 |
-
(new Deferred())->promise(),
|
| 38 |
-
function () {},
|
| 39 |
-
function () { return true; }
|
| 40 |
-
);
|
| 41 |
-
$f->cancel();
|
| 42 |
-
$f->wait();
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* @expectedException \OutOfBoundsException
|
| 47 |
-
*/
|
| 48 |
-
public function testThrowsWhenDerefFailure()
|
| 49 |
-
{
|
| 50 |
-
$called = false;
|
| 51 |
-
$deferred = new Deferred();
|
| 52 |
-
$f = new FutureValue(
|
| 53 |
-
$deferred->promise(),
|
| 54 |
-
function () use(&$called) {
|
| 55 |
-
$called = true;
|
| 56 |
-
}
|
| 57 |
-
);
|
| 58 |
-
$deferred->reject(new \OutOfBoundsException());
|
| 59 |
-
$f->wait();
|
| 60 |
-
$this->assertFalse($called);
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* @expectedException \GuzzleHttp\Ring\Exception\RingException
|
| 65 |
-
* @expectedExceptionMessage Waiting did not resolve future
|
| 66 |
-
*/
|
| 67 |
-
public function testThrowsWhenDerefDoesNotResolve()
|
| 68 |
-
{
|
| 69 |
-
$deferred = new Deferred();
|
| 70 |
-
$f = new FutureValue(
|
| 71 |
-
$deferred->promise(),
|
| 72 |
-
function () use(&$called) {
|
| 73 |
-
$called = true;
|
| 74 |
-
}
|
| 75 |
-
);
|
| 76 |
-
$f->wait();
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testThrowingCancelledFutureAccessExceptionCancels()
|
| 80 |
-
{
|
| 81 |
-
$deferred = new Deferred();
|
| 82 |
-
$f = new FutureValue(
|
| 83 |
-
$deferred->promise(),
|
| 84 |
-
function () use ($deferred) {
|
| 85 |
-
throw new CancelledFutureAccessException();
|
| 86 |
-
}
|
| 87 |
-
);
|
| 88 |
-
try {
|
| 89 |
-
$f->wait();
|
| 90 |
-
$this->fail('did not throw');
|
| 91 |
-
} catch (CancelledFutureAccessException $e) {}
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* @expectedException \Exception
|
| 96 |
-
* @expectedExceptionMessage foo
|
| 97 |
-
*/
|
| 98 |
-
public function testThrowingExceptionInDerefMarksAsFailed()
|
| 99 |
-
{
|
| 100 |
-
$deferred = new Deferred();
|
| 101 |
-
$f = new FutureValue(
|
| 102 |
-
$deferred->promise(),
|
| 103 |
-
function () {
|
| 104 |
-
throw new \Exception('foo');
|
| 105 |
-
}
|
| 106 |
-
);
|
| 107 |
-
$f->wait();
|
| 108 |
-
}
|
| 109 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/ringphp/tests/bootstrap.php
DELETED
|
@@ -1,11 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
require __DIR__ . '/../vendor/autoload.php';
|
| 3 |
-
require __DIR__ . '/Client/Server.php';
|
| 4 |
-
|
| 5 |
-
use GuzzleHttp\Tests\Ring\Client\Server;
|
| 6 |
-
|
| 7 |
-
Server::start();
|
| 8 |
-
|
| 9 |
-
register_shutdown_function(function () {
|
| 10 |
-
Server::stop();
|
| 11 |
-
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/phpunit.xml.dist
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
<phpunit bootstrap="./vendor/autoload.php"
|
| 3 |
-
colors="true">
|
| 4 |
-
<testsuites>
|
| 5 |
-
<testsuite>
|
| 6 |
-
<directory>tests</directory>
|
| 7 |
-
</testsuite>
|
| 8 |
-
</testsuites>
|
| 9 |
-
<filter>
|
| 10 |
-
<whitelist>
|
| 11 |
-
<directory suffix=".php">src</directory>
|
| 12 |
-
<exclude>
|
| 13 |
-
<file>src/functions.php</file>
|
| 14 |
-
</exclude>
|
| 15 |
-
</whitelist>
|
| 16 |
-
</filter>
|
| 17 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/AppendStreamTest.php
DELETED
|
@@ -1,178 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\AppendStream;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
|
| 7 |
-
class AppendStreamTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* @expectedException \InvalidArgumentException
|
| 11 |
-
* @expectedExceptionMessage Each stream must be readable
|
| 12 |
-
*/
|
| 13 |
-
public function testValidatesStreamsAreReadable()
|
| 14 |
-
{
|
| 15 |
-
$a = new AppendStream();
|
| 16 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 17 |
-
->setMethods(['isReadable'])
|
| 18 |
-
->getMockForAbstractClass();
|
| 19 |
-
$s->expects($this->once())
|
| 20 |
-
->method('isReadable')
|
| 21 |
-
->will($this->returnValue(false));
|
| 22 |
-
$a->addStream($s);
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
public function testValidatesSeekType()
|
| 26 |
-
{
|
| 27 |
-
$a = new AppendStream();
|
| 28 |
-
$this->assertFalse($a->seek(100, SEEK_CUR));
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function testTriesToRewindOnSeek()
|
| 32 |
-
{
|
| 33 |
-
$a = new AppendStream();
|
| 34 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 35 |
-
->setMethods(['isReadable', 'seek', 'isSeekable'])
|
| 36 |
-
->getMockForAbstractClass();
|
| 37 |
-
$s->expects($this->once())
|
| 38 |
-
->method('isReadable')
|
| 39 |
-
->will($this->returnValue(true));
|
| 40 |
-
$s->expects($this->once())
|
| 41 |
-
->method('isSeekable')
|
| 42 |
-
->will($this->returnValue(true));
|
| 43 |
-
$s->expects($this->once())
|
| 44 |
-
->method('seek')
|
| 45 |
-
->will($this->returnValue(false));
|
| 46 |
-
$a->addStream($s);
|
| 47 |
-
$this->assertFalse($a->seek(10));
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
public function testSeeksToPositionByReading()
|
| 51 |
-
{
|
| 52 |
-
$a = new AppendStream([
|
| 53 |
-
Stream::factory('foo'),
|
| 54 |
-
Stream::factory('bar'),
|
| 55 |
-
Stream::factory('baz'),
|
| 56 |
-
]);
|
| 57 |
-
|
| 58 |
-
$this->assertTrue($a->seek(3));
|
| 59 |
-
$this->assertEquals(3, $a->tell());
|
| 60 |
-
$this->assertEquals('bar', $a->read(3));
|
| 61 |
-
$a->seek(6);
|
| 62 |
-
$this->assertEquals(6, $a->tell());
|
| 63 |
-
$this->assertEquals('baz', $a->read(3));
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testDetachesEachStream()
|
| 67 |
-
{
|
| 68 |
-
$s1 = Stream::factory('foo');
|
| 69 |
-
$s2 = Stream::factory('foo');
|
| 70 |
-
$a = new AppendStream([$s1, $s2]);
|
| 71 |
-
$this->assertSame('foofoo', (string) $a);
|
| 72 |
-
$a->detach();
|
| 73 |
-
$this->assertSame('', (string) $a);
|
| 74 |
-
$this->assertSame(0, $a->getSize());
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
public function testClosesEachStream()
|
| 78 |
-
{
|
| 79 |
-
$s1 = Stream::factory('foo');
|
| 80 |
-
$a = new AppendStream([$s1]);
|
| 81 |
-
$a->close();
|
| 82 |
-
$this->assertSame('', (string) $a);
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
public function testIsNotWritable()
|
| 86 |
-
{
|
| 87 |
-
$a = new AppendStream([Stream::factory('foo')]);
|
| 88 |
-
$this->assertFalse($a->isWritable());
|
| 89 |
-
$this->assertTrue($a->isSeekable());
|
| 90 |
-
$this->assertTrue($a->isReadable());
|
| 91 |
-
$this->assertFalse($a->write('foo'));
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
public function testDoesNotNeedStreams()
|
| 95 |
-
{
|
| 96 |
-
$a = new AppendStream();
|
| 97 |
-
$this->assertEquals('', (string) $a);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
public function testCanReadFromMultipleStreams()
|
| 101 |
-
{
|
| 102 |
-
$a = new AppendStream([
|
| 103 |
-
Stream::factory('foo'),
|
| 104 |
-
Stream::factory('bar'),
|
| 105 |
-
Stream::factory('baz'),
|
| 106 |
-
]);
|
| 107 |
-
$this->assertFalse($a->eof());
|
| 108 |
-
$this->assertSame(0, $a->tell());
|
| 109 |
-
$this->assertEquals('foo', $a->read(3));
|
| 110 |
-
$this->assertEquals('bar', $a->read(3));
|
| 111 |
-
$this->assertEquals('baz', $a->read(3));
|
| 112 |
-
$this->assertTrue($a->eof());
|
| 113 |
-
$this->assertSame(9, $a->tell());
|
| 114 |
-
$this->assertEquals('foobarbaz', (string) $a);
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
public function testCanDetermineSizeFromMultipleStreams()
|
| 118 |
-
{
|
| 119 |
-
$a = new AppendStream([
|
| 120 |
-
Stream::factory('foo'),
|
| 121 |
-
Stream::factory('bar')
|
| 122 |
-
]);
|
| 123 |
-
$this->assertEquals(6, $a->getSize());
|
| 124 |
-
|
| 125 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 126 |
-
->setMethods(['isSeekable', 'isReadable'])
|
| 127 |
-
->getMockForAbstractClass();
|
| 128 |
-
$s->expects($this->once())
|
| 129 |
-
->method('isSeekable')
|
| 130 |
-
->will($this->returnValue(null));
|
| 131 |
-
$s->expects($this->once())
|
| 132 |
-
->method('isReadable')
|
| 133 |
-
->will($this->returnValue(true));
|
| 134 |
-
$a->addStream($s);
|
| 135 |
-
$this->assertNull($a->getSize());
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
public function testCatchesExceptionsWhenCastingToString()
|
| 139 |
-
{
|
| 140 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 141 |
-
->setMethods(['read', 'isReadable', 'eof'])
|
| 142 |
-
->getMockForAbstractClass();
|
| 143 |
-
$s->expects($this->once())
|
| 144 |
-
->method('read')
|
| 145 |
-
->will($this->throwException(new \RuntimeException('foo')));
|
| 146 |
-
$s->expects($this->once())
|
| 147 |
-
->method('isReadable')
|
| 148 |
-
->will($this->returnValue(true));
|
| 149 |
-
$s->expects($this->any())
|
| 150 |
-
->method('eof')
|
| 151 |
-
->will($this->returnValue(false));
|
| 152 |
-
$a = new AppendStream([$s]);
|
| 153 |
-
$this->assertFalse($a->eof());
|
| 154 |
-
$this->assertSame('', (string) $a);
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
public function testCanDetach()
|
| 158 |
-
{
|
| 159 |
-
$s = new AppendStream();
|
| 160 |
-
$s->detach();
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
public function testReturnsEmptyMetadata()
|
| 164 |
-
{
|
| 165 |
-
$s = new AppendStream();
|
| 166 |
-
$this->assertEquals([], $s->getMetadata());
|
| 167 |
-
$this->assertNull($s->getMetadata('foo'));
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
/**
|
| 171 |
-
* @expectedException \GuzzleHttp\Stream\Exception\CannotAttachException
|
| 172 |
-
*/
|
| 173 |
-
public function testCannotAttach()
|
| 174 |
-
{
|
| 175 |
-
$p = new AppendStream();
|
| 176 |
-
$p->attach('a');
|
| 177 |
-
}
|
| 178 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/AsyncReadStreamTest.php
DELETED
|
@@ -1,186 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\AsyncReadStream;
|
| 5 |
-
use GuzzleHttp\Stream\BufferStream;
|
| 6 |
-
use GuzzleHttp\Stream\FnStream;
|
| 7 |
-
use GuzzleHttp\Stream\Stream;
|
| 8 |
-
|
| 9 |
-
class AsyncReadStreamTest extends \PHPUnit_Framework_TestCase
|
| 10 |
-
{
|
| 11 |
-
/**
|
| 12 |
-
* @expectedException \InvalidArgumentException
|
| 13 |
-
* @expectedExceptionMessage Buffer must be readable and writable
|
| 14 |
-
*/
|
| 15 |
-
public function testValidatesReadableBuffer()
|
| 16 |
-
{
|
| 17 |
-
new AsyncReadStream(FnStream::decorate(
|
| 18 |
-
Stream::factory(),
|
| 19 |
-
['isReadable' => function () { return false; }]
|
| 20 |
-
));
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* @expectedException \InvalidArgumentException
|
| 25 |
-
* @expectedExceptionMessage Buffer must be readable and writable
|
| 26 |
-
*/
|
| 27 |
-
public function testValidatesWritableBuffer()
|
| 28 |
-
{
|
| 29 |
-
new AsyncReadStream(FnStream::decorate(
|
| 30 |
-
Stream::factory(),
|
| 31 |
-
['isWritable' => function () { return false; }]
|
| 32 |
-
));
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function testValidatesHwmMetadata()
|
| 36 |
-
{
|
| 37 |
-
$a = new AsyncReadStream(Stream::factory(), [
|
| 38 |
-
'drain' => function() {}
|
| 39 |
-
]);
|
| 40 |
-
$this->assertNull($this->readAttribute($a, 'drain'));
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* @expectedException \InvalidArgumentException
|
| 45 |
-
* @expectedExceptionMessage pump must be callable
|
| 46 |
-
*/
|
| 47 |
-
public function testValidatesPumpIsCallable()
|
| 48 |
-
{
|
| 49 |
-
new AsyncReadStream(new BufferStream(), ['pump' => true]);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/**
|
| 53 |
-
* @expectedException \InvalidArgumentException
|
| 54 |
-
* @expectedExceptionMessage drain must be callable
|
| 55 |
-
*/
|
| 56 |
-
public function testValidatesDrainIsCallable()
|
| 57 |
-
{
|
| 58 |
-
new AsyncReadStream(new BufferStream(), ['drain' => true]);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
public function testCanInitialize()
|
| 62 |
-
{
|
| 63 |
-
$buffer = new BufferStream();
|
| 64 |
-
$a = new AsyncReadStream($buffer, [
|
| 65 |
-
'size' => 10,
|
| 66 |
-
'drain' => function () {},
|
| 67 |
-
'pump' => function () {},
|
| 68 |
-
]);
|
| 69 |
-
$this->assertSame($buffer, $this->readAttribute($a, 'stream'));
|
| 70 |
-
$this->assertTrue(is_callable($this->readAttribute($a, 'drain')));
|
| 71 |
-
$this->assertTrue(is_callable($this->readAttribute($a, 'pump')));
|
| 72 |
-
$this->assertTrue($a->isReadable());
|
| 73 |
-
$this->assertFalse($a->isSeekable());
|
| 74 |
-
$this->assertFalse($a->isWritable());
|
| 75 |
-
$this->assertFalse($a->write('foo'));
|
| 76 |
-
$this->assertEquals(10, $a->getSize());
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testReadsFromBufferWithNoDrainOrPump()
|
| 80 |
-
{
|
| 81 |
-
$buffer = new BufferStream();
|
| 82 |
-
$a = new AsyncReadStream($buffer);
|
| 83 |
-
$buffer->write('foo');
|
| 84 |
-
$this->assertNull($a->getSize());
|
| 85 |
-
$this->assertEquals('foo', $a->read(10));
|
| 86 |
-
$this->assertEquals('', $a->read(10));
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
public function testCallsPumpForMoreDataWhenRequested()
|
| 90 |
-
{
|
| 91 |
-
$called = 0;
|
| 92 |
-
$buffer = new BufferStream();
|
| 93 |
-
$a = new AsyncReadStream($buffer, [
|
| 94 |
-
'pump' => function ($size) use (&$called) {
|
| 95 |
-
$called++;
|
| 96 |
-
return str_repeat('.', $size);
|
| 97 |
-
}
|
| 98 |
-
]);
|
| 99 |
-
$buffer->write('foobar');
|
| 100 |
-
$this->assertEquals('foo', $a->read(3));
|
| 101 |
-
$this->assertEquals(0, $called);
|
| 102 |
-
$this->assertEquals('bar.....', $a->read(8));
|
| 103 |
-
$this->assertEquals(1, $called);
|
| 104 |
-
$this->assertEquals('..', $a->read(2));
|
| 105 |
-
$this->assertEquals(2, $called);
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
public function testCallsDrainWhenNeeded()
|
| 109 |
-
{
|
| 110 |
-
$called = 0;
|
| 111 |
-
$buffer = new BufferStream(5);
|
| 112 |
-
$a = new AsyncReadStream($buffer, [
|
| 113 |
-
'drain' => function (BufferStream $b) use (&$called, $buffer) {
|
| 114 |
-
$this->assertSame($b, $buffer);
|
| 115 |
-
$called++;
|
| 116 |
-
}
|
| 117 |
-
]);
|
| 118 |
-
|
| 119 |
-
$buffer->write('foobar');
|
| 120 |
-
$this->assertEquals(6, $buffer->getSize());
|
| 121 |
-
$this->assertEquals(0, $called);
|
| 122 |
-
|
| 123 |
-
$a->read(3);
|
| 124 |
-
$this->assertTrue($this->readAttribute($a, 'needsDrain'));
|
| 125 |
-
$this->assertEquals(3, $buffer->getSize());
|
| 126 |
-
$this->assertEquals(0, $called);
|
| 127 |
-
|
| 128 |
-
$a->read(3);
|
| 129 |
-
$this->assertEquals(0, $buffer->getSize());
|
| 130 |
-
$this->assertFalse($this->readAttribute($a, 'needsDrain'));
|
| 131 |
-
$this->assertEquals(1, $called);
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
public function testCreatesBufferWithNoConfig()
|
| 135 |
-
{
|
| 136 |
-
list($buffer, $async) = AsyncReadStream::create();
|
| 137 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\BufferStream', $buffer);
|
| 138 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\AsyncReadStream', $async);
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
public function testCreatesBufferWithSpecifiedBuffer()
|
| 142 |
-
{
|
| 143 |
-
$buf = new BufferStream();
|
| 144 |
-
list($buffer, $async) = AsyncReadStream::create(['buffer' => $buf]);
|
| 145 |
-
$this->assertSame($buf, $buffer);
|
| 146 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\AsyncReadStream', $async);
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
public function testCreatesNullStream()
|
| 150 |
-
{
|
| 151 |
-
list($buffer, $async) = AsyncReadStream::create(['max_buffer' => 0]);
|
| 152 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\NullStream', $buffer);
|
| 153 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\AsyncReadStream', $async);
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
public function testCreatesDroppingStream()
|
| 157 |
-
{
|
| 158 |
-
list($buffer, $async) = AsyncReadStream::create(['max_buffer' => 5]);
|
| 159 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\DroppingStream', $buffer);
|
| 160 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\AsyncReadStream', $async);
|
| 161 |
-
$buffer->write('12345678910');
|
| 162 |
-
$this->assertEquals(5, $buffer->getSize());
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
public function testCreatesOnWriteStream()
|
| 166 |
-
{
|
| 167 |
-
$c = 0;
|
| 168 |
-
$b = new BufferStream();
|
| 169 |
-
list($buffer, $async) = AsyncReadStream::create([
|
| 170 |
-
'buffer' => $b,
|
| 171 |
-
'write' => function (BufferStream $buf, $data) use (&$c, $b) {
|
| 172 |
-
$this->assertSame($buf, $b);
|
| 173 |
-
$this->assertEquals('foo', $data);
|
| 174 |
-
$c++;
|
| 175 |
-
}
|
| 176 |
-
]);
|
| 177 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\FnStream', $buffer);
|
| 178 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\AsyncReadStream', $async);
|
| 179 |
-
$this->assertEquals(0, $c);
|
| 180 |
-
$this->assertEquals(3, $buffer->write('foo'));
|
| 181 |
-
$this->assertEquals(1, $c);
|
| 182 |
-
$this->assertEquals(3, $buffer->write('foo'));
|
| 183 |
-
$this->assertEquals(2, $c);
|
| 184 |
-
$this->assertEquals('foofoo', (string) $buffer);
|
| 185 |
-
}
|
| 186 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/BufferStreamTest.php
DELETED
|
@@ -1,69 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\BufferStream;
|
| 5 |
-
|
| 6 |
-
class BufferStreamTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
public function testHasMetadata()
|
| 9 |
-
{
|
| 10 |
-
$b = new BufferStream(10);
|
| 11 |
-
$this->assertTrue($b->isReadable());
|
| 12 |
-
$this->assertTrue($b->isWritable());
|
| 13 |
-
$this->assertFalse($b->isSeekable());
|
| 14 |
-
$this->assertEquals(null, $b->getMetadata('foo'));
|
| 15 |
-
$this->assertEquals(10, $b->getMetadata('hwm'));
|
| 16 |
-
$this->assertEquals([], $b->getMetadata());
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function testRemovesReadDataFromBuffer()
|
| 20 |
-
{
|
| 21 |
-
$b = new BufferStream();
|
| 22 |
-
$this->assertEquals(3, $b->write('foo'));
|
| 23 |
-
$this->assertEquals(3, $b->getSize());
|
| 24 |
-
$this->assertFalse($b->eof());
|
| 25 |
-
$this->assertEquals('foo', $b->read(10));
|
| 26 |
-
$this->assertTrue($b->eof());
|
| 27 |
-
$this->assertEquals('', $b->read(10));
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function testCanCastToStringOrGetContents()
|
| 31 |
-
{
|
| 32 |
-
$b = new BufferStream();
|
| 33 |
-
$b->write('foo');
|
| 34 |
-
$b->write('baz');
|
| 35 |
-
$this->assertEquals('foo', $b->read(3));
|
| 36 |
-
$b->write('bar');
|
| 37 |
-
$this->assertEquals('bazbar', (string) $b);
|
| 38 |
-
$this->assertFalse($b->tell());
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function testDetachClearsBuffer()
|
| 42 |
-
{
|
| 43 |
-
$b = new BufferStream();
|
| 44 |
-
$b->write('foo');
|
| 45 |
-
$b->detach();
|
| 46 |
-
$this->assertEquals(0, $b->tell());
|
| 47 |
-
$this->assertTrue($b->eof());
|
| 48 |
-
$this->assertEquals(3, $b->write('abc'));
|
| 49 |
-
$this->assertEquals('abc', $b->read(10));
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
public function testExceedingHighwaterMarkReturnsFalseButStillBuffers()
|
| 53 |
-
{
|
| 54 |
-
$b = new BufferStream(5);
|
| 55 |
-
$this->assertEquals(3, $b->write('hi '));
|
| 56 |
-
$this->assertFalse($b->write('hello'));
|
| 57 |
-
$this->assertEquals('hi hello', (string) $b);
|
| 58 |
-
$this->assertEquals(4, $b->write('test'));
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* @expectedException \GuzzleHttp\Stream\Exception\CannotAttachException
|
| 63 |
-
*/
|
| 64 |
-
public function testCannotAttach()
|
| 65 |
-
{
|
| 66 |
-
$p = new BufferStream();
|
| 67 |
-
$p->attach('a');
|
| 68 |
-
}
|
| 69 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/CachingStreamTest.php
DELETED
|
@@ -1,136 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\Stream;
|
| 5 |
-
use GuzzleHttp\Stream\CachingStream;
|
| 6 |
-
use GuzzleHttp\Stream\Utils;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* @covers GuzzleHttp\Stream\CachingStream
|
| 10 |
-
*/
|
| 11 |
-
class CachingStreamTest extends \PHPUnit_Framework_TestCase
|
| 12 |
-
{
|
| 13 |
-
/** @var CachingStream */
|
| 14 |
-
protected $body;
|
| 15 |
-
|
| 16 |
-
/** @var Stream */
|
| 17 |
-
protected $decorated;
|
| 18 |
-
|
| 19 |
-
public function setUp()
|
| 20 |
-
{
|
| 21 |
-
$this->decorated = Stream::factory('testing');
|
| 22 |
-
$this->body = new CachingStream($this->decorated);
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
public function tearDown()
|
| 26 |
-
{
|
| 27 |
-
$this->decorated->close();
|
| 28 |
-
$this->body->close();
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function testUsesRemoteSizeIfPossible()
|
| 32 |
-
{
|
| 33 |
-
$body = Stream::factory('test');
|
| 34 |
-
$caching = new CachingStream($body);
|
| 35 |
-
$this->assertEquals(4, $caching->getSize());
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* @expectedException \RuntimeException
|
| 40 |
-
* @expectedExceptionMessage Cannot seek to byte 10
|
| 41 |
-
*/
|
| 42 |
-
public function testCannotSeekPastWhatHasBeenRead()
|
| 43 |
-
{
|
| 44 |
-
$this->body->seek(10);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testCannotUseSeekEnd()
|
| 48 |
-
{
|
| 49 |
-
$this->assertFalse($this->body->seek(2, SEEK_END));
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
public function testRewindUsesSeek()
|
| 53 |
-
{
|
| 54 |
-
$a = Stream::factory('foo');
|
| 55 |
-
$d = $this->getMockBuilder('GuzzleHttp\Stream\CachingStream')
|
| 56 |
-
->setMethods(array('seek'))
|
| 57 |
-
->setConstructorArgs(array($a))
|
| 58 |
-
->getMock();
|
| 59 |
-
$d->expects($this->once())
|
| 60 |
-
->method('seek')
|
| 61 |
-
->with(0)
|
| 62 |
-
->will($this->returnValue(true));
|
| 63 |
-
$d->seek(0);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testCanSeekToReadBytes()
|
| 67 |
-
{
|
| 68 |
-
$this->assertEquals('te', $this->body->read(2));
|
| 69 |
-
$this->body->seek(0);
|
| 70 |
-
$this->assertEquals('test', $this->body->read(4));
|
| 71 |
-
$this->assertEquals(4, $this->body->tell());
|
| 72 |
-
$this->body->seek(2);
|
| 73 |
-
$this->assertEquals(2, $this->body->tell());
|
| 74 |
-
$this->body->seek(2, SEEK_CUR);
|
| 75 |
-
$this->assertEquals(4, $this->body->tell());
|
| 76 |
-
$this->assertEquals('ing', $this->body->read(3));
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testWritesToBufferStream()
|
| 80 |
-
{
|
| 81 |
-
$this->body->read(2);
|
| 82 |
-
$this->body->write('hi');
|
| 83 |
-
$this->body->seek(0);
|
| 84 |
-
$this->assertEquals('tehiing', (string) $this->body);
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
public function testSkipsOverwrittenBytes()
|
| 88 |
-
{
|
| 89 |
-
$decorated = Stream::factory(
|
| 90 |
-
implode("\n", array_map(function ($n) {
|
| 91 |
-
return str_pad($n, 4, '0', STR_PAD_LEFT);
|
| 92 |
-
}, range(0, 25)))
|
| 93 |
-
);
|
| 94 |
-
|
| 95 |
-
$body = new CachingStream($decorated);
|
| 96 |
-
|
| 97 |
-
$this->assertEquals("0000\n", Utils::readline($body));
|
| 98 |
-
$this->assertEquals("0001\n", Utils::readline($body));
|
| 99 |
-
// Write over part of the body yet to be read, so skip some bytes
|
| 100 |
-
$this->assertEquals(5, $body->write("TEST\n"));
|
| 101 |
-
$this->assertEquals(5, $this->readAttribute($body, 'skipReadBytes'));
|
| 102 |
-
// Read, which skips bytes, then reads
|
| 103 |
-
$this->assertEquals("0003\n", Utils::readline($body));
|
| 104 |
-
$this->assertEquals(0, $this->readAttribute($body, 'skipReadBytes'));
|
| 105 |
-
$this->assertEquals("0004\n", Utils::readline($body));
|
| 106 |
-
$this->assertEquals("0005\n", Utils::readline($body));
|
| 107 |
-
|
| 108 |
-
// Overwrite part of the cached body (so don't skip any bytes)
|
| 109 |
-
$body->seek(5);
|
| 110 |
-
$this->assertEquals(5, $body->write("ABCD\n"));
|
| 111 |
-
$this->assertEquals(0, $this->readAttribute($body, 'skipReadBytes'));
|
| 112 |
-
$this->assertEquals("TEST\n", Utils::readline($body));
|
| 113 |
-
$this->assertEquals("0003\n", Utils::readline($body));
|
| 114 |
-
$this->assertEquals("0004\n", Utils::readline($body));
|
| 115 |
-
$this->assertEquals("0005\n", Utils::readline($body));
|
| 116 |
-
$this->assertEquals("0006\n", Utils::readline($body));
|
| 117 |
-
$this->assertEquals(5, $body->write("1234\n"));
|
| 118 |
-
$this->assertEquals(5, $this->readAttribute($body, 'skipReadBytes'));
|
| 119 |
-
|
| 120 |
-
// Seek to 0 and ensure the overwritten bit is replaced
|
| 121 |
-
$body->seek(0);
|
| 122 |
-
$this->assertEquals("0000\nABCD\nTEST\n0003\n0004\n0005\n0006\n1234\n0008\n0009\n", $body->read(50));
|
| 123 |
-
|
| 124 |
-
// Ensure that casting it to a string does not include the bit that was overwritten
|
| 125 |
-
$this->assertContains("0000\nABCD\nTEST\n0003\n0004\n0005\n0006\n1234\n0008\n0009\n", (string) $body);
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
public function testClosesBothStreams()
|
| 129 |
-
{
|
| 130 |
-
$s = fopen('php://temp', 'r');
|
| 131 |
-
$a = Stream::factory($s);
|
| 132 |
-
$d = new CachingStream($a);
|
| 133 |
-
$d->close();
|
| 134 |
-
$this->assertFalse(is_resource($s));
|
| 135 |
-
}
|
| 136 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/DroppingStreamTest.php
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\BufferStream;
|
| 5 |
-
use GuzzleHttp\Stream\DroppingStream;
|
| 6 |
-
|
| 7 |
-
class DroppingStreamTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testBeginsDroppingWhenSizeExceeded()
|
| 10 |
-
{
|
| 11 |
-
$stream = new BufferStream();
|
| 12 |
-
$drop = new DroppingStream($stream, 5);
|
| 13 |
-
$this->assertEquals(3, $drop->write('hel'));
|
| 14 |
-
$this->assertFalse($drop->write('lo'));
|
| 15 |
-
$this->assertEquals(5, $drop->getSize());
|
| 16 |
-
$this->assertEquals('hello', $drop->read(5));
|
| 17 |
-
$this->assertEquals(0, $drop->getSize());
|
| 18 |
-
$drop->write('12345678910');
|
| 19 |
-
$this->assertEquals(5, $stream->getSize());
|
| 20 |
-
$this->assertEquals(5, $drop->getSize());
|
| 21 |
-
$this->assertEquals('12345', (string) $drop);
|
| 22 |
-
$this->assertEquals(0, $drop->getSize());
|
| 23 |
-
$drop->write('hello');
|
| 24 |
-
$this->assertFalse($drop->write('test'));
|
| 25 |
-
}
|
| 26 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/Exception/SeekExceptionTest.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream\Exception;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\Exception\SeekException;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
|
| 7 |
-
class SeekExceptionTest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testHasStream()
|
| 10 |
-
{
|
| 11 |
-
$s = Stream::factory('foo');
|
| 12 |
-
$e = new SeekException($s, 10);
|
| 13 |
-
$this->assertSame($s, $e->getStream());
|
| 14 |
-
$this->assertContains('10', $e->getMessage());
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/FnStreamTest.php
DELETED
|
@@ -1,89 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\Stream;
|
| 5 |
-
use GuzzleHttp\Stream\FnStream;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* @covers GuzzleHttp\Stream\FnStream
|
| 9 |
-
*/
|
| 10 |
-
class FnStreamTest extends \PHPUnit_Framework_TestCase
|
| 11 |
-
{
|
| 12 |
-
/**
|
| 13 |
-
* @expectedException \BadMethodCallException
|
| 14 |
-
* @expectedExceptionMessage seek() is not implemented in the FnStream
|
| 15 |
-
*/
|
| 16 |
-
public function testThrowsWhenNotImplemented()
|
| 17 |
-
{
|
| 18 |
-
(new FnStream([]))->seek(1);
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
public function testProxiesToFunction()
|
| 22 |
-
{
|
| 23 |
-
$s = new FnStream([
|
| 24 |
-
'read' => function ($len) {
|
| 25 |
-
$this->assertEquals(3, $len);
|
| 26 |
-
return 'foo';
|
| 27 |
-
}
|
| 28 |
-
]);
|
| 29 |
-
|
| 30 |
-
$this->assertEquals('foo', $s->read(3));
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testCanCloseOnDestruct()
|
| 34 |
-
{
|
| 35 |
-
$called = false;
|
| 36 |
-
$s = new FnStream([
|
| 37 |
-
'close' => function () use (&$called) {
|
| 38 |
-
$called = true;
|
| 39 |
-
}
|
| 40 |
-
]);
|
| 41 |
-
unset($s);
|
| 42 |
-
$this->assertTrue($called);
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
public function testDoesNotRequireClose()
|
| 46 |
-
{
|
| 47 |
-
$s = new FnStream([]);
|
| 48 |
-
unset($s);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testDecoratesStream()
|
| 52 |
-
{
|
| 53 |
-
$a = Stream::factory('foo');
|
| 54 |
-
$b = FnStream::decorate($a, []);
|
| 55 |
-
$this->assertEquals(3, $b->getSize());
|
| 56 |
-
$this->assertEquals($b->isWritable(), true);
|
| 57 |
-
$this->assertEquals($b->isReadable(), true);
|
| 58 |
-
$this->assertEquals($b->isSeekable(), true);
|
| 59 |
-
$this->assertEquals($b->read(3), 'foo');
|
| 60 |
-
$this->assertEquals($b->tell(), 3);
|
| 61 |
-
$this->assertEquals($a->tell(), 3);
|
| 62 |
-
$this->assertEquals($b->eof(), true);
|
| 63 |
-
$this->assertEquals($a->eof(), true);
|
| 64 |
-
$b->seek(0);
|
| 65 |
-
$this->assertEquals('foo', (string) $b);
|
| 66 |
-
$b->seek(0);
|
| 67 |
-
$this->assertEquals('foo', $b->getContents());
|
| 68 |
-
$this->assertEquals($a->getMetadata(), $b->getMetadata());
|
| 69 |
-
$b->seek(0, SEEK_END);
|
| 70 |
-
$b->write('bar');
|
| 71 |
-
$this->assertEquals('foobar', (string) $b);
|
| 72 |
-
$this->assertInternalType('resource', $b->detach());
|
| 73 |
-
$b->close();
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function testDecoratesWithCustomizations()
|
| 77 |
-
{
|
| 78 |
-
$called = false;
|
| 79 |
-
$a = Stream::factory('foo');
|
| 80 |
-
$b = FnStream::decorate($a, [
|
| 81 |
-
'read' => function ($len) use (&$called, $a) {
|
| 82 |
-
$called = true;
|
| 83 |
-
return $a->read($len);
|
| 84 |
-
}
|
| 85 |
-
]);
|
| 86 |
-
$this->assertEquals('foo', $b->read(3));
|
| 87 |
-
$this->assertTrue($called);
|
| 88 |
-
}
|
| 89 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/GuzzleStreamWrapperTest.php
DELETED
|
@@ -1,99 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\GuzzleStreamWrapper;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* @covers GuzzleHttp\Stream\GuzzleStreamWrapper
|
| 9 |
-
*/
|
| 10 |
-
class GuzzleStreamWrapperTest extends \PHPUnit_Framework_TestCase
|
| 11 |
-
{
|
| 12 |
-
public function testResource()
|
| 13 |
-
{
|
| 14 |
-
$stream = Stream::factory('foo');
|
| 15 |
-
$handle = GuzzleStreamWrapper::getResource($stream);
|
| 16 |
-
$this->assertSame('foo', fread($handle, 3));
|
| 17 |
-
$this->assertSame(3, ftell($handle));
|
| 18 |
-
$this->assertSame(3, fwrite($handle, 'bar'));
|
| 19 |
-
$this->assertSame(0, fseek($handle, 0));
|
| 20 |
-
$this->assertSame('foobar', fread($handle, 6));
|
| 21 |
-
$this->assertTrue(feof($handle));
|
| 22 |
-
|
| 23 |
-
// This fails on HHVM for some reason
|
| 24 |
-
if (!defined('HHVM_VERSION')) {
|
| 25 |
-
$this->assertEquals([
|
| 26 |
-
'dev' => 0,
|
| 27 |
-
'ino' => 0,
|
| 28 |
-
'mode' => 33206,
|
| 29 |
-
'nlink' => 0,
|
| 30 |
-
'uid' => 0,
|
| 31 |
-
'gid' => 0,
|
| 32 |
-
'rdev' => 0,
|
| 33 |
-
'size' => 6,
|
| 34 |
-
'atime' => 0,
|
| 35 |
-
'mtime' => 0,
|
| 36 |
-
'ctime' => 0,
|
| 37 |
-
'blksize' => 0,
|
| 38 |
-
'blocks' => 0,
|
| 39 |
-
0 => 0,
|
| 40 |
-
1 => 0,
|
| 41 |
-
2 => 33206,
|
| 42 |
-
3 => 0,
|
| 43 |
-
4 => 0,
|
| 44 |
-
5 => 0,
|
| 45 |
-
6 => 0,
|
| 46 |
-
7 => 6,
|
| 47 |
-
8 => 0,
|
| 48 |
-
9 => 0,
|
| 49 |
-
10 => 0,
|
| 50 |
-
11 => 0,
|
| 51 |
-
12 => 0,
|
| 52 |
-
], fstat($handle));
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
$this->assertTrue(fclose($handle));
|
| 56 |
-
$this->assertSame('foobar', (string) $stream);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* @expectedException \InvalidArgumentException
|
| 61 |
-
*/
|
| 62 |
-
public function testValidatesStream()
|
| 63 |
-
{
|
| 64 |
-
$stream = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 65 |
-
->setMethods(['isReadable', 'isWritable'])
|
| 66 |
-
->getMockForAbstractClass();
|
| 67 |
-
$stream->expects($this->once())
|
| 68 |
-
->method('isReadable')
|
| 69 |
-
->will($this->returnValue(false));
|
| 70 |
-
$stream->expects($this->once())
|
| 71 |
-
->method('isWritable')
|
| 72 |
-
->will($this->returnValue(false));
|
| 73 |
-
GuzzleStreamWrapper::getResource($stream);
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* @expectedException \PHPUnit_Framework_Error_Warning
|
| 78 |
-
*/
|
| 79 |
-
public function testReturnsFalseWhenStreamDoesNotExist()
|
| 80 |
-
{
|
| 81 |
-
fopen('guzzle://foo', 'r');
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public function testCanOpenReadonlyStream()
|
| 85 |
-
{
|
| 86 |
-
$stream = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 87 |
-
->setMethods(['isReadable', 'isWritable'])
|
| 88 |
-
->getMockForAbstractClass();
|
| 89 |
-
$stream->expects($this->once())
|
| 90 |
-
->method('isReadable')
|
| 91 |
-
->will($this->returnValue(false));
|
| 92 |
-
$stream->expects($this->once())
|
| 93 |
-
->method('isWritable')
|
| 94 |
-
->will($this->returnValue(true));
|
| 95 |
-
$r = GuzzleStreamWrapper::getResource($stream);
|
| 96 |
-
$this->assertInternalType('resource', $r);
|
| 97 |
-
fclose($r);
|
| 98 |
-
}
|
| 99 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/InflateStreamTest.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\InflateStream;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
|
| 7 |
-
class InflateStreamtest extends \PHPUnit_Framework_TestCase
|
| 8 |
-
{
|
| 9 |
-
public function testInflatesStreams()
|
| 10 |
-
{
|
| 11 |
-
$content = gzencode('test');
|
| 12 |
-
$a = Stream::factory($content);
|
| 13 |
-
$b = new InflateStream($a);
|
| 14 |
-
$this->assertEquals('test', (string) $b);
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/LazyOpenStreamTest.php
DELETED
|
@@ -1,64 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\LazyOpenStream;
|
| 5 |
-
|
| 6 |
-
class LazyOpenStreamTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
private $fname;
|
| 9 |
-
|
| 10 |
-
public function setup()
|
| 11 |
-
{
|
| 12 |
-
$this->fname = tempnam('/tmp', 'tfile');
|
| 13 |
-
|
| 14 |
-
if (file_exists($this->fname)) {
|
| 15 |
-
unlink($this->fname);
|
| 16 |
-
}
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function tearDown()
|
| 20 |
-
{
|
| 21 |
-
if (file_exists($this->fname)) {
|
| 22 |
-
unlink($this->fname);
|
| 23 |
-
}
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testOpensLazily()
|
| 27 |
-
{
|
| 28 |
-
$l = new LazyOpenStream($this->fname, 'w+');
|
| 29 |
-
$l->write('foo');
|
| 30 |
-
$this->assertInternalType('array', $l->getMetadata());
|
| 31 |
-
$this->assertFileExists($this->fname);
|
| 32 |
-
$this->assertEquals('foo', file_get_contents($this->fname));
|
| 33 |
-
$this->assertEquals('foo', (string) $l);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function testProxiesToFile()
|
| 37 |
-
{
|
| 38 |
-
file_put_contents($this->fname, 'foo');
|
| 39 |
-
$l = new LazyOpenStream($this->fname, 'r');
|
| 40 |
-
$this->assertEquals('foo', $l->read(4));
|
| 41 |
-
$this->assertTrue($l->eof());
|
| 42 |
-
$this->assertEquals(3, $l->tell());
|
| 43 |
-
$this->assertTrue($l->isReadable());
|
| 44 |
-
$this->assertTrue($l->isSeekable());
|
| 45 |
-
$this->assertFalse($l->isWritable());
|
| 46 |
-
$l->seek(1);
|
| 47 |
-
$this->assertEquals('oo', $l->getContents());
|
| 48 |
-
$this->assertEquals('foo', (string) $l);
|
| 49 |
-
$this->assertEquals(3, $l->getSize());
|
| 50 |
-
$this->assertInternalType('array', $l->getMetadata());
|
| 51 |
-
$l->close();
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function testDetachesUnderlyingStream()
|
| 55 |
-
{
|
| 56 |
-
file_put_contents($this->fname, 'foo');
|
| 57 |
-
$l = new LazyOpenStream($this->fname, 'r');
|
| 58 |
-
$r = $l->detach();
|
| 59 |
-
$this->assertInternalType('resource', $r);
|
| 60 |
-
fseek($r, 0);
|
| 61 |
-
$this->assertEquals('foo', stream_get_contents($r));
|
| 62 |
-
fclose($r);
|
| 63 |
-
}
|
| 64 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/LimitStreamTest.php
DELETED
|
@@ -1,133 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Http;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\FnStream;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
use GuzzleHttp\Stream\LimitStream;
|
| 7 |
-
use GuzzleHttp\Stream\NoSeekStream;
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* @covers GuzzleHttp\Stream\LimitStream
|
| 11 |
-
*/
|
| 12 |
-
class LimitStreamTest extends \PHPUnit_Framework_TestCase
|
| 13 |
-
{
|
| 14 |
-
/** @var LimitStream */
|
| 15 |
-
protected $body;
|
| 16 |
-
|
| 17 |
-
/** @var Stream */
|
| 18 |
-
protected $decorated;
|
| 19 |
-
|
| 20 |
-
public function setUp()
|
| 21 |
-
{
|
| 22 |
-
$this->decorated = Stream::factory(fopen(__FILE__, 'r'));
|
| 23 |
-
$this->body = new LimitStream($this->decorated, 10, 3);
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testReturnsSubset()
|
| 27 |
-
{
|
| 28 |
-
$body = new LimitStream(Stream::factory('foo'), -1, 1);
|
| 29 |
-
$this->assertEquals('oo', (string) $body);
|
| 30 |
-
$this->assertTrue($body->eof());
|
| 31 |
-
$body->seek(0);
|
| 32 |
-
$this->assertFalse($body->eof());
|
| 33 |
-
$this->assertEquals('oo', $body->read(100));
|
| 34 |
-
$this->assertTrue($body->eof());
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function testReturnsSubsetWhenCastToString()
|
| 38 |
-
{
|
| 39 |
-
$body = Stream::factory('foo_baz_bar');
|
| 40 |
-
$limited = new LimitStream($body, 3, 4);
|
| 41 |
-
$this->assertEquals('baz', (string) $limited);
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
public function testReturnsSubsetOfEmptyBodyWhenCastToString()
|
| 45 |
-
{
|
| 46 |
-
$body = Stream::factory('');
|
| 47 |
-
$limited = new LimitStream($body, 0, 10);
|
| 48 |
-
$this->assertEquals('', (string) $limited);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testSeeksWhenConstructed()
|
| 52 |
-
{
|
| 53 |
-
$this->assertEquals(0, $this->body->tell());
|
| 54 |
-
$this->assertEquals(3, $this->decorated->tell());
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
public function testAllowsBoundedSeek()
|
| 58 |
-
{
|
| 59 |
-
$this->assertEquals(true, $this->body->seek(100));
|
| 60 |
-
$this->assertEquals(10, $this->body->tell());
|
| 61 |
-
$this->assertEquals(13, $this->decorated->tell());
|
| 62 |
-
$this->assertEquals(true, $this->body->seek(0));
|
| 63 |
-
$this->assertEquals(0, $this->body->tell());
|
| 64 |
-
$this->assertEquals(3, $this->decorated->tell());
|
| 65 |
-
$this->assertEquals(false, $this->body->seek(-10));
|
| 66 |
-
$this->assertEquals(0, $this->body->tell());
|
| 67 |
-
$this->assertEquals(3, $this->decorated->tell());
|
| 68 |
-
$this->assertEquals(true, $this->body->seek(5));
|
| 69 |
-
$this->assertEquals(5, $this->body->tell());
|
| 70 |
-
$this->assertEquals(8, $this->decorated->tell());
|
| 71 |
-
$this->assertEquals(false, $this->body->seek(1000, SEEK_END));
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public function testReadsOnlySubsetOfData()
|
| 75 |
-
{
|
| 76 |
-
$data = $this->body->read(100);
|
| 77 |
-
$this->assertEquals(10, strlen($data));
|
| 78 |
-
$this->assertFalse($this->body->read(1000));
|
| 79 |
-
|
| 80 |
-
$this->body->setOffset(10);
|
| 81 |
-
$newData = $this->body->read(100);
|
| 82 |
-
$this->assertEquals(10, strlen($newData));
|
| 83 |
-
$this->assertNotSame($data, $newData);
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* @expectedException \GuzzleHttp\Stream\Exception\SeekException
|
| 88 |
-
* @expectedExceptionMessage Could not seek the stream to position 2
|
| 89 |
-
*/
|
| 90 |
-
public function testThrowsWhenCurrentGreaterThanOffsetSeek()
|
| 91 |
-
{
|
| 92 |
-
$a = Stream::factory('foo_bar');
|
| 93 |
-
$b = new NoSeekStream($a);
|
| 94 |
-
$c = new LimitStream($b);
|
| 95 |
-
$a->getContents();
|
| 96 |
-
$c->setOffset(2);
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
public function testClaimsConsumedWhenReadLimitIsReached()
|
| 100 |
-
{
|
| 101 |
-
$this->assertFalse($this->body->eof());
|
| 102 |
-
$this->body->read(1000);
|
| 103 |
-
$this->assertTrue($this->body->eof());
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
public function testContentLengthIsBounded()
|
| 107 |
-
{
|
| 108 |
-
$this->assertEquals(10, $this->body->getSize());
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
public function testGetContentsIsBasedOnSubset()
|
| 112 |
-
{
|
| 113 |
-
$body = new LimitStream(Stream::factory('foobazbar'), 3, 3);
|
| 114 |
-
$this->assertEquals('baz', $body->getContents());
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
public function testReturnsNullIfSizeCannotBeDetermined()
|
| 118 |
-
{
|
| 119 |
-
$a = new FnStream([
|
| 120 |
-
'getSize' => function () { return null; },
|
| 121 |
-
'tell' => function () { return 0; },
|
| 122 |
-
]);
|
| 123 |
-
$b = new LimitStream($a);
|
| 124 |
-
$this->assertNull($b->getSize());
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
public function testLengthLessOffsetWhenNoLimitSize()
|
| 128 |
-
{
|
| 129 |
-
$a = Stream::factory('foo_bar');
|
| 130 |
-
$b = new LimitStream($a, -1, 4);
|
| 131 |
-
$this->assertEquals(3, $b->getSize());
|
| 132 |
-
}
|
| 133 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/NoSeekStreamTest.php
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\Stream;
|
| 5 |
-
use GuzzleHttp\Stream\NoSeekStream;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* @covers GuzzleHttp\Stream\NoSeekStream
|
| 9 |
-
* @covers GuzzleHttp\Stream\StreamDecoratorTrait
|
| 10 |
-
*/
|
| 11 |
-
class NoSeekStreamTest extends \PHPUnit_Framework_TestCase
|
| 12 |
-
{
|
| 13 |
-
public function testCannotSeek()
|
| 14 |
-
{
|
| 15 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 16 |
-
->setMethods(['isSeekable', 'seek'])
|
| 17 |
-
->getMockForAbstractClass();
|
| 18 |
-
$s->expects($this->never())->method('seek');
|
| 19 |
-
$s->expects($this->never())->method('isSeekable');
|
| 20 |
-
$wrapped = new NoSeekStream($s);
|
| 21 |
-
$this->assertFalse($wrapped->isSeekable());
|
| 22 |
-
$this->assertFalse($wrapped->seek(2));
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
public function testHandlesClose()
|
| 26 |
-
{
|
| 27 |
-
$s = Stream::factory('foo');
|
| 28 |
-
$wrapped = new NoSeekStream($s);
|
| 29 |
-
$wrapped->close();
|
| 30 |
-
$this->assertFalse($wrapped->write('foo'));
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testCanAttach()
|
| 34 |
-
{
|
| 35 |
-
$s1 = Stream::factory('foo');
|
| 36 |
-
$s2 = Stream::factory('bar');
|
| 37 |
-
$wrapped = new NoSeekStream($s1);
|
| 38 |
-
$wrapped->attach($s2->detach());
|
| 39 |
-
$this->assertEquals('bar', (string) $wrapped);
|
| 40 |
-
}
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/NullStreamTest.php
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\NullStream;
|
| 5 |
-
|
| 6 |
-
class NullStreamTest extends \PHPUnit_Framework_TestCase
|
| 7 |
-
{
|
| 8 |
-
public function testDoesNothing()
|
| 9 |
-
{
|
| 10 |
-
$b = new NullStream();
|
| 11 |
-
$this->assertEquals('', $b->read(10));
|
| 12 |
-
$this->assertEquals(4, $b->write('test'));
|
| 13 |
-
$this->assertEquals('', (string) $b);
|
| 14 |
-
$this->assertNull($b->getMetadata('a'));
|
| 15 |
-
$this->assertEquals([], $b->getMetadata());
|
| 16 |
-
$this->assertEquals(0, $b->getSize());
|
| 17 |
-
$this->assertEquals('', $b->getContents());
|
| 18 |
-
$this->assertEquals(0, $b->tell());
|
| 19 |
-
|
| 20 |
-
$this->assertTrue($b->isReadable());
|
| 21 |
-
$this->assertTrue($b->isWritable());
|
| 22 |
-
$this->assertTrue($b->isSeekable());
|
| 23 |
-
$this->assertFalse($b->seek(10));
|
| 24 |
-
|
| 25 |
-
$this->assertTrue($b->eof());
|
| 26 |
-
$b->detach();
|
| 27 |
-
$this->assertTrue($b->eof());
|
| 28 |
-
$b->close();
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* @expectedException \GuzzleHttp\Stream\Exception\CannotAttachException
|
| 33 |
-
*/
|
| 34 |
-
public function testCannotAttach()
|
| 35 |
-
{
|
| 36 |
-
$p = new NullStream();
|
| 37 |
-
$p->attach('a');
|
| 38 |
-
}
|
| 39 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/PumpStreamTest.php
DELETED
|
@@ -1,77 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\LimitStream;
|
| 5 |
-
use GuzzleHttp\Stream\PumpStream;
|
| 6 |
-
use GuzzleHttp\Stream\Stream;
|
| 7 |
-
|
| 8 |
-
class PumpStreamTest extends \PHPUnit_Framework_TestCase
|
| 9 |
-
{
|
| 10 |
-
public function testHasMetadataAndSize()
|
| 11 |
-
{
|
| 12 |
-
$p = new PumpStream(function () {}, [
|
| 13 |
-
'metadata' => ['foo' => 'bar'],
|
| 14 |
-
'size' => 100
|
| 15 |
-
]);
|
| 16 |
-
|
| 17 |
-
$this->assertEquals('bar', $p->getMetadata('foo'));
|
| 18 |
-
$this->assertEquals(['foo' => 'bar'], $p->getMetadata());
|
| 19 |
-
$this->assertEquals(100, $p->getSize());
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
public function testCanReadFromCallable()
|
| 23 |
-
{
|
| 24 |
-
$p = Stream::factory(function ($size) {
|
| 25 |
-
return 'a';
|
| 26 |
-
});
|
| 27 |
-
$this->assertEquals('a', $p->read(1));
|
| 28 |
-
$this->assertEquals(1, $p->tell());
|
| 29 |
-
$this->assertEquals('aaaaa', $p->read(5));
|
| 30 |
-
$this->assertEquals(6, $p->tell());
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testStoresExcessDataInBuffer()
|
| 34 |
-
{
|
| 35 |
-
$called = [];
|
| 36 |
-
$p = Stream::factory(function ($size) use (&$called) {
|
| 37 |
-
$called[] = $size;
|
| 38 |
-
return 'abcdef';
|
| 39 |
-
});
|
| 40 |
-
$this->assertEquals('a', $p->read(1));
|
| 41 |
-
$this->assertEquals('b', $p->read(1));
|
| 42 |
-
$this->assertEquals('cdef', $p->read(4));
|
| 43 |
-
$this->assertEquals('abcdefabc', $p->read(9));
|
| 44 |
-
$this->assertEquals([1, 9, 3], $called);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testInifiniteStreamWrappedInLimitStream()
|
| 48 |
-
{
|
| 49 |
-
$p = Stream::factory(function () { return 'a'; });
|
| 50 |
-
$s = new LimitStream($p, 5);
|
| 51 |
-
$this->assertEquals('aaaaa', (string) $s);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function testDescribesCapabilities()
|
| 55 |
-
{
|
| 56 |
-
$p = Stream::factory(function () {});
|
| 57 |
-
$this->assertTrue($p->isReadable());
|
| 58 |
-
$this->assertFalse($p->isSeekable());
|
| 59 |
-
$this->assertFalse($p->isWritable());
|
| 60 |
-
$this->assertNull($p->getSize());
|
| 61 |
-
$this->assertFalse($p->write('aa'));
|
| 62 |
-
$this->assertEquals('', $p->getContents());
|
| 63 |
-
$this->assertEquals('', (string) $p);
|
| 64 |
-
$p->close();
|
| 65 |
-
$this->assertEquals('', $p->read(10));
|
| 66 |
-
$this->assertTrue($p->eof());
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
/**
|
| 70 |
-
* @expectedException \GuzzleHttp\Stream\Exception\CannotAttachException
|
| 71 |
-
*/
|
| 72 |
-
public function testCannotAttach()
|
| 73 |
-
{
|
| 74 |
-
$p = Stream::factory(function () {});
|
| 75 |
-
$p->attach('a');
|
| 76 |
-
}
|
| 77 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/StreamDecoratorTraitTest.php
DELETED
|
@@ -1,147 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\StreamInterface;
|
| 5 |
-
use GuzzleHttp\Stream\Stream;
|
| 6 |
-
use GuzzleHttp\Stream\StreamDecoratorTrait;
|
| 7 |
-
|
| 8 |
-
class Str implements StreamInterface
|
| 9 |
-
{
|
| 10 |
-
use StreamDecoratorTrait;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* @covers GuzzleHttp\Stream\StreamDecoratorTrait
|
| 15 |
-
*/
|
| 16 |
-
class StreamDecoratorTraitTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
private $a;
|
| 19 |
-
private $b;
|
| 20 |
-
private $c;
|
| 21 |
-
|
| 22 |
-
public function setUp()
|
| 23 |
-
{
|
| 24 |
-
$this->c = fopen('php://temp', 'r+');
|
| 25 |
-
fwrite($this->c, 'foo');
|
| 26 |
-
fseek($this->c, 0);
|
| 27 |
-
$this->a = Stream::factory($this->c);
|
| 28 |
-
$this->b = new Str($this->a);
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function testCatchesExceptionsWhenCastingToString()
|
| 32 |
-
{
|
| 33 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\StreamInterface')
|
| 34 |
-
->setMethods(['read'])
|
| 35 |
-
->getMockForAbstractClass();
|
| 36 |
-
$s->expects($this->once())
|
| 37 |
-
->method('read')
|
| 38 |
-
->will($this->throwException(new \Exception('foo')));
|
| 39 |
-
$msg = '';
|
| 40 |
-
set_error_handler(function ($errNo, $str) use (&$msg) { $msg = $str; });
|
| 41 |
-
echo new Str($s);
|
| 42 |
-
restore_error_handler();
|
| 43 |
-
$this->assertContains('foo', $msg);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function testToString()
|
| 47 |
-
{
|
| 48 |
-
$this->assertEquals('foo', (string) $this->b);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testHasSize()
|
| 52 |
-
{
|
| 53 |
-
$this->assertEquals(3, $this->b->getSize());
|
| 54 |
-
$this->assertSame($this->b, $this->b->setSize(2));
|
| 55 |
-
$this->assertEquals(2, $this->b->getSize());
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
public function testReads()
|
| 59 |
-
{
|
| 60 |
-
$this->assertEquals('foo', $this->b->read(10));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
public function testCheckMethods()
|
| 64 |
-
{
|
| 65 |
-
$this->assertEquals($this->a->isReadable(), $this->b->isReadable());
|
| 66 |
-
$this->assertEquals($this->a->isWritable(), $this->b->isWritable());
|
| 67 |
-
$this->assertEquals($this->a->isSeekable(), $this->b->isSeekable());
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
public function testSeeksAndTells()
|
| 71 |
-
{
|
| 72 |
-
$this->assertTrue($this->b->seek(1));
|
| 73 |
-
$this->assertEquals(1, $this->a->tell());
|
| 74 |
-
$this->assertEquals(1, $this->b->tell());
|
| 75 |
-
$this->assertTrue($this->b->seek(0));
|
| 76 |
-
$this->assertEquals(0, $this->a->tell());
|
| 77 |
-
$this->assertEquals(0, $this->b->tell());
|
| 78 |
-
$this->assertTrue($this->b->seek(0, SEEK_END));
|
| 79 |
-
$this->assertEquals(3, $this->a->tell());
|
| 80 |
-
$this->assertEquals(3, $this->b->tell());
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
public function testGetsContents()
|
| 84 |
-
{
|
| 85 |
-
$this->assertEquals('foo', $this->b->getContents());
|
| 86 |
-
$this->assertEquals('', $this->b->getContents());
|
| 87 |
-
$this->b->seek(1);
|
| 88 |
-
$this->assertEquals('oo', $this->b->getContents(1));
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
public function testCloses()
|
| 92 |
-
{
|
| 93 |
-
$this->b->close();
|
| 94 |
-
$this->assertFalse(is_resource($this->c));
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
public function testDetaches()
|
| 98 |
-
{
|
| 99 |
-
$this->b->detach();
|
| 100 |
-
$this->assertFalse($this->b->isReadable());
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
/**
|
| 104 |
-
* @expectedException \GuzzleHttp\Stream\Exception\CannotAttachException
|
| 105 |
-
*/
|
| 106 |
-
public function testCannotAttachByDefault()
|
| 107 |
-
{
|
| 108 |
-
$this->b->attach('a');
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
public function testWrapsMetadata()
|
| 112 |
-
{
|
| 113 |
-
$this->assertSame($this->b->getMetadata(), $this->a->getMetadata());
|
| 114 |
-
$this->assertSame($this->b->getMetadata('uri'), $this->a->getMetadata('uri'));
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
public function testWrapsWrites()
|
| 118 |
-
{
|
| 119 |
-
$this->b->seek(0, SEEK_END);
|
| 120 |
-
$this->b->write('foo');
|
| 121 |
-
$this->assertEquals('foofoo', (string) $this->a);
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
/**
|
| 125 |
-
* @expectedException \UnexpectedValueException
|
| 126 |
-
*/
|
| 127 |
-
public function testThrowsWithInvalidGetter()
|
| 128 |
-
{
|
| 129 |
-
$this->b->foo;
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* @expectedException \BadMethodCallException
|
| 134 |
-
*/
|
| 135 |
-
public function testThrowsWhenGetterNotImplemented()
|
| 136 |
-
{
|
| 137 |
-
$s = new BadStream();
|
| 138 |
-
$s->stream;
|
| 139 |
-
}
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
class BadStream
|
| 143 |
-
{
|
| 144 |
-
use StreamDecoratorTrait;
|
| 145 |
-
|
| 146 |
-
public function __construct() {}
|
| 147 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/StreamTest.php
DELETED
|
@@ -1,252 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\Stream;
|
| 5 |
-
|
| 6 |
-
/**
|
| 7 |
-
* @covers GuzzleHttp\Stream\Stream
|
| 8 |
-
*/
|
| 9 |
-
class StreamTest extends \PHPUnit_Framework_TestCase
|
| 10 |
-
{
|
| 11 |
-
/**
|
| 12 |
-
* @expectedException \InvalidArgumentException
|
| 13 |
-
*/
|
| 14 |
-
public function testConstructorThrowsExceptionOnInvalidArgument()
|
| 15 |
-
{
|
| 16 |
-
new Stream(true);
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function testConstructorInitializesProperties()
|
| 20 |
-
{
|
| 21 |
-
$handle = fopen('php://temp', 'r+');
|
| 22 |
-
fwrite($handle, 'data');
|
| 23 |
-
$stream = new Stream($handle);
|
| 24 |
-
$this->assertTrue($stream->isReadable());
|
| 25 |
-
$this->assertTrue($stream->isWritable());
|
| 26 |
-
$this->assertTrue($stream->isSeekable());
|
| 27 |
-
$this->assertEquals('php://temp', $stream->getMetadata('uri'));
|
| 28 |
-
$this->assertInternalType('array', $stream->getMetadata());
|
| 29 |
-
$this->assertEquals(4, $stream->getSize());
|
| 30 |
-
$this->assertFalse($stream->eof());
|
| 31 |
-
$stream->close();
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function testStreamClosesHandleOnDestruct()
|
| 35 |
-
{
|
| 36 |
-
$handle = fopen('php://temp', 'r');
|
| 37 |
-
$stream = new Stream($handle);
|
| 38 |
-
unset($stream);
|
| 39 |
-
$this->assertFalse(is_resource($handle));
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
public function testConvertsToString()
|
| 43 |
-
{
|
| 44 |
-
$handle = fopen('php://temp', 'w+');
|
| 45 |
-
fwrite($handle, 'data');
|
| 46 |
-
$stream = new Stream($handle);
|
| 47 |
-
$this->assertEquals('data', (string) $stream);
|
| 48 |
-
$this->assertEquals('data', (string) $stream);
|
| 49 |
-
$stream->close();
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
public function testGetsContents()
|
| 53 |
-
{
|
| 54 |
-
$handle = fopen('php://temp', 'w+');
|
| 55 |
-
fwrite($handle, 'data');
|
| 56 |
-
$stream = new Stream($handle);
|
| 57 |
-
$this->assertEquals('', $stream->getContents());
|
| 58 |
-
$stream->seek(0);
|
| 59 |
-
$this->assertEquals('data', $stream->getContents());
|
| 60 |
-
$this->assertEquals('', $stream->getContents());
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
public function testChecksEof()
|
| 64 |
-
{
|
| 65 |
-
$handle = fopen('php://temp', 'w+');
|
| 66 |
-
fwrite($handle, 'data');
|
| 67 |
-
$stream = new Stream($handle);
|
| 68 |
-
$this->assertFalse($stream->eof());
|
| 69 |
-
$stream->read(4);
|
| 70 |
-
$this->assertTrue($stream->eof());
|
| 71 |
-
$stream->close();
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public function testAllowsSettingManualSize()
|
| 75 |
-
{
|
| 76 |
-
$handle = fopen('php://temp', 'w+');
|
| 77 |
-
fwrite($handle, 'data');
|
| 78 |
-
$stream = new Stream($handle);
|
| 79 |
-
$stream->setSize(10);
|
| 80 |
-
$this->assertEquals(10, $stream->getSize());
|
| 81 |
-
$stream->close();
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public function testGetSize()
|
| 85 |
-
{
|
| 86 |
-
$size = filesize(__FILE__);
|
| 87 |
-
$handle = fopen(__FILE__, 'r');
|
| 88 |
-
$stream = new Stream($handle);
|
| 89 |
-
$this->assertEquals($size, $stream->getSize());
|
| 90 |
-
// Load from cache
|
| 91 |
-
$this->assertEquals($size, $stream->getSize());
|
| 92 |
-
$stream->close();
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
public function testEnsuresSizeIsConsistent()
|
| 96 |
-
{
|
| 97 |
-
$h = fopen('php://temp', 'w+');
|
| 98 |
-
$this->assertEquals(3, fwrite($h, 'foo'));
|
| 99 |
-
$stream = new Stream($h);
|
| 100 |
-
$this->assertEquals(3, $stream->getSize());
|
| 101 |
-
$this->assertEquals(4, $stream->write('test'));
|
| 102 |
-
$this->assertEquals(7, $stream->getSize());
|
| 103 |
-
$this->assertEquals(7, $stream->getSize());
|
| 104 |
-
$stream->close();
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
public function testProvidesStreamPosition()
|
| 108 |
-
{
|
| 109 |
-
$handle = fopen('php://temp', 'w+');
|
| 110 |
-
$stream = new Stream($handle);
|
| 111 |
-
$this->assertEquals(0, $stream->tell());
|
| 112 |
-
$stream->write('foo');
|
| 113 |
-
$this->assertEquals(3, $stream->tell());
|
| 114 |
-
$stream->seek(1);
|
| 115 |
-
$this->assertEquals(1, $stream->tell());
|
| 116 |
-
$this->assertSame(ftell($handle), $stream->tell());
|
| 117 |
-
$stream->close();
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
public function testKeepsPositionOfResource()
|
| 121 |
-
{
|
| 122 |
-
$h = fopen(__FILE__, 'r');
|
| 123 |
-
fseek($h, 10);
|
| 124 |
-
$stream = Stream::factory($h);
|
| 125 |
-
$this->assertEquals(10, $stream->tell());
|
| 126 |
-
$stream->close();
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
public function testCanDetachAndAttachStream()
|
| 130 |
-
{
|
| 131 |
-
$r = fopen('php://temp', 'w+');
|
| 132 |
-
$stream = new Stream($r);
|
| 133 |
-
$stream->write('foo');
|
| 134 |
-
$this->assertTrue($stream->isReadable());
|
| 135 |
-
$this->assertSame($r, $stream->detach());
|
| 136 |
-
$this->assertNull($stream->detach());
|
| 137 |
-
|
| 138 |
-
$this->assertFalse($stream->isReadable());
|
| 139 |
-
$this->assertFalse($stream->read(10));
|
| 140 |
-
$this->assertFalse($stream->isWritable());
|
| 141 |
-
$this->assertFalse($stream->write('bar'));
|
| 142 |
-
$this->assertFalse($stream->isSeekable());
|
| 143 |
-
$this->assertFalse($stream->seek(10));
|
| 144 |
-
$this->assertFalse($stream->tell());
|
| 145 |
-
$this->assertTrue($stream->eof());
|
| 146 |
-
$this->assertNull($stream->getSize());
|
| 147 |
-
$this->assertSame('', (string) $stream);
|
| 148 |
-
$this->assertSame('', $stream->getContents());
|
| 149 |
-
|
| 150 |
-
$stream->attach($r);
|
| 151 |
-
$stream->seek(0);
|
| 152 |
-
$this->assertEquals('foo', $stream->getContents());
|
| 153 |
-
$this->assertTrue($stream->isReadable());
|
| 154 |
-
$this->assertTrue($stream->isWritable());
|
| 155 |
-
$this->assertTrue($stream->isSeekable());
|
| 156 |
-
|
| 157 |
-
$stream->close();
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
public function testCloseClearProperties()
|
| 161 |
-
{
|
| 162 |
-
$handle = fopen('php://temp', 'r+');
|
| 163 |
-
$stream = new Stream($handle);
|
| 164 |
-
$stream->close();
|
| 165 |
-
|
| 166 |
-
$this->assertEmpty($stream->getMetadata());
|
| 167 |
-
$this->assertFalse($stream->isSeekable());
|
| 168 |
-
$this->assertFalse($stream->isReadable());
|
| 169 |
-
$this->assertFalse($stream->isWritable());
|
| 170 |
-
$this->assertNull($stream->getSize());
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
public function testCreatesWithFactory()
|
| 174 |
-
{
|
| 175 |
-
$stream = Stream::factory('foo');
|
| 176 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\Stream', $stream);
|
| 177 |
-
$this->assertEquals('foo', $stream->getContents());
|
| 178 |
-
$stream->close();
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
public function testFactoryCreatesFromEmptyString()
|
| 182 |
-
{
|
| 183 |
-
$s = Stream::factory();
|
| 184 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\Stream', $s);
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
public function testFactoryCreatesFromResource()
|
| 188 |
-
{
|
| 189 |
-
$r = fopen(__FILE__, 'r');
|
| 190 |
-
$s = Stream::factory($r);
|
| 191 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\Stream', $s);
|
| 192 |
-
$this->assertSame(file_get_contents(__FILE__), (string) $s);
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
public function testFactoryCreatesFromObjectWithToString()
|
| 196 |
-
{
|
| 197 |
-
$r = new HasToString();
|
| 198 |
-
$s = Stream::factory($r);
|
| 199 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\Stream', $s);
|
| 200 |
-
$this->assertEquals('foo', (string) $s);
|
| 201 |
-
}
|
| 202 |
-
|
| 203 |
-
public function testCreatePassesThrough()
|
| 204 |
-
{
|
| 205 |
-
$s = Stream::factory('foo');
|
| 206 |
-
$this->assertSame($s, Stream::factory($s));
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
/**
|
| 210 |
-
* @expectedException \InvalidArgumentException
|
| 211 |
-
*/
|
| 212 |
-
public function testThrowsExceptionForUnknown()
|
| 213 |
-
{
|
| 214 |
-
Stream::factory(new \stdClass());
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
public function testReturnsCustomMetadata()
|
| 218 |
-
{
|
| 219 |
-
$s = Stream::factory('foo', ['metadata' => ['hwm' => 3]]);
|
| 220 |
-
$this->assertEquals(3, $s->getMetadata('hwm'));
|
| 221 |
-
$this->assertArrayHasKey('hwm', $s->getMetadata());
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
public function testCanSetSize()
|
| 225 |
-
{
|
| 226 |
-
$s = Stream::factory('', ['size' => 10]);
|
| 227 |
-
$this->assertEquals(10, $s->getSize());
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
public function testCanCreateIteratorBasedStream()
|
| 231 |
-
{
|
| 232 |
-
$a = new \ArrayIterator(['foo', 'bar', '123']);
|
| 233 |
-
$p = Stream::factory($a);
|
| 234 |
-
$this->assertInstanceOf('GuzzleHttp\Stream\PumpStream', $p);
|
| 235 |
-
$this->assertEquals('foo', $p->read(3));
|
| 236 |
-
$this->assertFalse($p->eof());
|
| 237 |
-
$this->assertEquals('b', $p->read(1));
|
| 238 |
-
$this->assertEquals('a', $p->read(1));
|
| 239 |
-
$this->assertEquals('r12', $p->read(3));
|
| 240 |
-
$this->assertFalse($p->eof());
|
| 241 |
-
$this->assertEquals('3', $p->getContents());
|
| 242 |
-
$this->assertTrue($p->eof());
|
| 243 |
-
$this->assertEquals(9, $p->tell());
|
| 244 |
-
}
|
| 245 |
-
}
|
| 246 |
-
|
| 247 |
-
class HasToString
|
| 248 |
-
{
|
| 249 |
-
public function __toString() {
|
| 250 |
-
return 'foo';
|
| 251 |
-
}
|
| 252 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/guzzlehttp/streams/tests/UtilsTest.php
DELETED
|
@@ -1,155 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
namespace GuzzleHttp\Tests\Stream;
|
| 3 |
-
|
| 4 |
-
use GuzzleHttp\Stream\FnStream;
|
| 5 |
-
use GuzzleHttp\Stream\NoSeekStream;
|
| 6 |
-
use GuzzleHttp\Stream\Stream;
|
| 7 |
-
use GuzzleHttp\Stream\Utils;
|
| 8 |
-
|
| 9 |
-
class UtilsTest extends \PHPUnit_Framework_TestCase
|
| 10 |
-
{
|
| 11 |
-
public function testCopiesToString()
|
| 12 |
-
{
|
| 13 |
-
$s = Stream::factory('foobaz');
|
| 14 |
-
$this->assertEquals('foobaz', Utils::copyToString($s));
|
| 15 |
-
$s->seek(0);
|
| 16 |
-
$this->assertEquals('foo', Utils::copyToString($s, 3));
|
| 17 |
-
$this->assertEquals('baz', Utils::copyToString($s, 3));
|
| 18 |
-
$this->assertEquals('', Utils::copyToString($s));
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
public function testCopiesToStringStopsWhenReadFails()
|
| 22 |
-
{
|
| 23 |
-
$s1 = Stream::factory('foobaz');
|
| 24 |
-
$s1 = FnStream::decorate($s1, [
|
| 25 |
-
'read' => function () {
|
| 26 |
-
return false;
|
| 27 |
-
}
|
| 28 |
-
]);
|
| 29 |
-
$result = Utils::copyToString($s1);
|
| 30 |
-
$this->assertEquals('', $result);
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testCopiesToStream()
|
| 34 |
-
{
|
| 35 |
-
$s1 = Stream::factory('foobaz');
|
| 36 |
-
$s2 = Stream::factory('');
|
| 37 |
-
Utils::copyToStream($s1, $s2);
|
| 38 |
-
$this->assertEquals('foobaz', (string) $s2);
|
| 39 |
-
$s2 = Stream::factory('');
|
| 40 |
-
$s1->seek(0);
|
| 41 |
-
Utils::copyToStream($s1, $s2, 3);
|
| 42 |
-
$this->assertEquals('foo', (string) $s2);
|
| 43 |
-
Utils::copyToStream($s1, $s2, 3);
|
| 44 |
-
$this->assertEquals('foobaz', (string) $s2);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testStopsCopyToStreamWhenWriteFails()
|
| 48 |
-
{
|
| 49 |
-
$s1 = Stream::factory('foobaz');
|
| 50 |
-
$s2 = Stream::factory('');
|
| 51 |
-
$s2 = FnStream::decorate($s2, ['write' => function () { return 0; }]);
|
| 52 |
-
Utils::copyToStream($s1, $s2);
|
| 53 |
-
$this->assertEquals('', (string) $s2);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
public function testStopsCopyToSteamWhenWriteFailsWithMaxLen()
|
| 57 |
-
{
|
| 58 |
-
$s1 = Stream::factory('foobaz');
|
| 59 |
-
$s2 = Stream::factory('');
|
| 60 |
-
$s2 = FnStream::decorate($s2, ['write' => function () { return 0; }]);
|
| 61 |
-
Utils::copyToStream($s1, $s2, 10);
|
| 62 |
-
$this->assertEquals('', (string) $s2);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
public function testStopsCopyToSteamWhenReadFailsWithMaxLen()
|
| 66 |
-
{
|
| 67 |
-
$s1 = Stream::factory('foobaz');
|
| 68 |
-
$s1 = FnStream::decorate($s1, ['read' => function () { return ''; }]);
|
| 69 |
-
$s2 = Stream::factory('');
|
| 70 |
-
Utils::copyToStream($s1, $s2, 10);
|
| 71 |
-
$this->assertEquals('', (string) $s2);
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public function testReadsLines()
|
| 75 |
-
{
|
| 76 |
-
$s = Stream::factory("foo\nbaz\nbar");
|
| 77 |
-
$this->assertEquals("foo\n", Utils::readline($s));
|
| 78 |
-
$this->assertEquals("baz\n", Utils::readline($s));
|
| 79 |
-
$this->assertEquals("bar", Utils::readline($s));
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
public function testReadsLinesUpToMaxLength()
|
| 83 |
-
{
|
| 84 |
-
$s = Stream::factory("12345\n");
|
| 85 |
-
$this->assertEquals("123", Utils::readline($s, 4));
|
| 86 |
-
$this->assertEquals("45\n", Utils::readline($s));
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
public function testReadsLineUntilFalseReturnedFromRead()
|
| 90 |
-
{
|
| 91 |
-
$s = $this->getMockBuilder('GuzzleHttp\Stream\Stream')
|
| 92 |
-
->setMethods(['read', 'eof'])
|
| 93 |
-
->disableOriginalConstructor()
|
| 94 |
-
->getMock();
|
| 95 |
-
$s->expects($this->exactly(2))
|
| 96 |
-
->method('read')
|
| 97 |
-
->will($this->returnCallback(function () {
|
| 98 |
-
static $c = false;
|
| 99 |
-
if ($c) {
|
| 100 |
-
return false;
|
| 101 |
-
}
|
| 102 |
-
$c = true;
|
| 103 |
-
return 'h';
|
| 104 |
-
}));
|
| 105 |
-
$s->expects($this->exactly(2))
|
| 106 |
-
->method('eof')
|
| 107 |
-
->will($this->returnValue(false));
|
| 108 |
-
$this->assertEquals("h", Utils::readline($s));
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
public function testCalculatesHash()
|
| 112 |
-
{
|
| 113 |
-
$s = Stream::factory('foobazbar');
|
| 114 |
-
$this->assertEquals(md5('foobazbar'), Utils::hash($s, 'md5'));
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
/**
|
| 118 |
-
* @expectedException \GuzzleHttp\Stream\Exception\SeekException
|
| 119 |
-
*/
|
| 120 |
-
public function testCalculatesHashThrowsWhenSeekFails()
|
| 121 |
-
{
|
| 122 |
-
$s = new NoSeekStream(Stream::factory('foobazbar'));
|
| 123 |
-
$s->read(2);
|
| 124 |
-
Utils::hash($s, 'md5');
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
public function testCalculatesHashSeeksToOriginalPosition()
|
| 128 |
-
{
|
| 129 |
-
$s = Stream::factory('foobazbar');
|
| 130 |
-
$s->seek(4);
|
| 131 |
-
$this->assertEquals(md5('foobazbar'), Utils::hash($s, 'md5'));
|
| 132 |
-
$this->assertEquals(4, $s->tell());
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
public function testOpensFilesSuccessfully()
|
| 136 |
-
{
|
| 137 |
-
$r = Utils::open(__FILE__, 'r');
|
| 138 |
-
$this->assertInternalType('resource', $r);
|
| 139 |
-
fclose($r);
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* @expectedException \RuntimeException
|
| 144 |
-
* @expectedExceptionMessage Unable to open /path/to/does/not/exist using mode r
|
| 145 |
-
*/
|
| 146 |
-
public function testThrowsExceptionNotWarning()
|
| 147 |
-
{
|
| 148 |
-
Utils::open('/path/to/does/not/exist', 'r');
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
public function testProxiesToFactory()
|
| 152 |
-
{
|
| 153 |
-
$this->assertEquals('foo', (string) Utils::create('foo'));
|
| 154 |
-
}
|
| 155 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/phpunit.xml.dist
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
|
| 3 |
-
<phpunit backupGlobals="false"
|
| 4 |
-
backupStaticAttributes="false"
|
| 5 |
-
colors="true"
|
| 6 |
-
convertErrorsToExceptions="true"
|
| 7 |
-
convertNoticesToExceptions="true"
|
| 8 |
-
convertWarningsToExceptions="true"
|
| 9 |
-
processIsolation="false"
|
| 10 |
-
stopOnFailure="false"
|
| 11 |
-
syntaxCheck="false"
|
| 12 |
-
bootstrap="tests/bootstrap.php"
|
| 13 |
-
>
|
| 14 |
-
<testsuites>
|
| 15 |
-
<testsuite name="Promise Test Suite">
|
| 16 |
-
<directory>./tests/</directory>
|
| 17 |
-
</testsuite>
|
| 18 |
-
</testsuites>
|
| 19 |
-
|
| 20 |
-
<filter>
|
| 21 |
-
<whitelist>
|
| 22 |
-
<directory>./src/</directory>
|
| 23 |
-
</whitelist>
|
| 24 |
-
</filter>
|
| 25 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/DeferredTest.php
DELETED
|
@@ -1,42 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
use React\Promise\PromiseAdapter\CallbackPromiseAdapter;
|
| 6 |
-
|
| 7 |
-
class DeferredTest extends TestCase
|
| 8 |
-
{
|
| 9 |
-
use PromiseTest\FullTestTrait;
|
| 10 |
-
|
| 11 |
-
public function getPromiseTestAdapter(callable $canceller = null)
|
| 12 |
-
{
|
| 13 |
-
$d = new Deferred($canceller);
|
| 14 |
-
|
| 15 |
-
return new CallbackPromiseAdapter([
|
| 16 |
-
'promise' => [$d, 'promise'],
|
| 17 |
-
'resolve' => [$d, 'resolve'],
|
| 18 |
-
'reject' => [$d, 'reject'],
|
| 19 |
-
'notify' => [$d, 'progress'],
|
| 20 |
-
'settle' => [$d, 'resolve'],
|
| 21 |
-
]);
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
/** @test */
|
| 25 |
-
public function progressIsAnAliasForNotify()
|
| 26 |
-
{
|
| 27 |
-
$deferred = new Deferred();
|
| 28 |
-
|
| 29 |
-
$sentinel = new \stdClass();
|
| 30 |
-
|
| 31 |
-
$mock = $this->createCallableMock();
|
| 32 |
-
$mock
|
| 33 |
-
->expects($this->once())
|
| 34 |
-
->method('__invoke')
|
| 35 |
-
->with($sentinel);
|
| 36 |
-
|
| 37 |
-
$deferred->promise()
|
| 38 |
-
->then($this->expectCallableNever(), $this->expectCallableNever(), $mock);
|
| 39 |
-
|
| 40 |
-
$deferred->progress($sentinel);
|
| 41 |
-
}
|
| 42 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FulfilledPromiseTest.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
use React\Promise\PromiseAdapter\CallbackPromiseAdapter;
|
| 6 |
-
|
| 7 |
-
class FulfilledPromiseTest extends TestCase
|
| 8 |
-
{
|
| 9 |
-
use PromiseTest\PromiseSettledTestTrait,
|
| 10 |
-
PromiseTest\PromiseFulfilledTestTrait;
|
| 11 |
-
|
| 12 |
-
public function getPromiseTestAdapter(callable $canceller = null)
|
| 13 |
-
{
|
| 14 |
-
$promise = null;
|
| 15 |
-
|
| 16 |
-
return new CallbackPromiseAdapter([
|
| 17 |
-
'promise' => function () use (&$promise) {
|
| 18 |
-
if (!$promise) {
|
| 19 |
-
throw new \LogicException('FulfilledPromise must be resolved before obtaining the promise');
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
return $promise;
|
| 23 |
-
},
|
| 24 |
-
'resolve' => function ($value = null) use (&$promise) {
|
| 25 |
-
if (!$promise) {
|
| 26 |
-
$promise = new FulfilledPromise($value);
|
| 27 |
-
}
|
| 28 |
-
},
|
| 29 |
-
'reject' => function () {
|
| 30 |
-
throw new \LogicException('You cannot call reject() for React\Promise\FulfilledPromise');
|
| 31 |
-
},
|
| 32 |
-
'notify' => function () {
|
| 33 |
-
// no-op
|
| 34 |
-
},
|
| 35 |
-
'settle' => function ($value = null) use (&$promise) {
|
| 36 |
-
if (!$promise) {
|
| 37 |
-
$promise = new FulfilledPromise($value);
|
| 38 |
-
}
|
| 39 |
-
},
|
| 40 |
-
]);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/** @test */
|
| 44 |
-
public function shouldThrowExceptionIfConstructedWithAPromise()
|
| 45 |
-
{
|
| 46 |
-
$this->setExpectedException('\InvalidArgumentException');
|
| 47 |
-
|
| 48 |
-
return new FulfilledPromise(new FulfilledPromise());
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionAllTest.php
DELETED
|
@@ -1,97 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionAllTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldResolveEmptyInput()
|
| 9 |
-
{
|
| 10 |
-
$mock = $this->createCallableMock();
|
| 11 |
-
$mock
|
| 12 |
-
->expects($this->once())
|
| 13 |
-
->method('__invoke')
|
| 14 |
-
->with($this->identicalTo([]));
|
| 15 |
-
|
| 16 |
-
all([])
|
| 17 |
-
->then($mock);
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
/** @test */
|
| 21 |
-
public function shouldResolveValuesArray()
|
| 22 |
-
{
|
| 23 |
-
$mock = $this->createCallableMock();
|
| 24 |
-
$mock
|
| 25 |
-
->expects($this->once())
|
| 26 |
-
->method('__invoke')
|
| 27 |
-
->with($this->identicalTo([1, 2, 3]));
|
| 28 |
-
|
| 29 |
-
all([1, 2, 3])
|
| 30 |
-
->then($mock);
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
/** @test */
|
| 34 |
-
public function shouldResolvePromisesArray()
|
| 35 |
-
{
|
| 36 |
-
$mock = $this->createCallableMock();
|
| 37 |
-
$mock
|
| 38 |
-
->expects($this->once())
|
| 39 |
-
->method('__invoke')
|
| 40 |
-
->with($this->identicalTo([1, 2, 3]));
|
| 41 |
-
|
| 42 |
-
all([resolve(1), resolve(2), resolve(3)])
|
| 43 |
-
->then($mock);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/** @test */
|
| 47 |
-
public function shouldResolveSparseArrayInput()
|
| 48 |
-
{
|
| 49 |
-
$mock = $this->createCallableMock();
|
| 50 |
-
$mock
|
| 51 |
-
->expects($this->once())
|
| 52 |
-
->method('__invoke')
|
| 53 |
-
->with($this->identicalTo([null, 1, null, 1, 1]));
|
| 54 |
-
|
| 55 |
-
all([null, 1, null, 1, 1])
|
| 56 |
-
->then($mock);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/** @test */
|
| 60 |
-
public function shouldRejectIfAnyInputPromiseRejects()
|
| 61 |
-
{
|
| 62 |
-
$mock = $this->createCallableMock();
|
| 63 |
-
$mock
|
| 64 |
-
->expects($this->once())
|
| 65 |
-
->method('__invoke')
|
| 66 |
-
->with($this->identicalTo(2));
|
| 67 |
-
|
| 68 |
-
all([resolve(1), reject(2), resolve(3)])
|
| 69 |
-
->then($this->expectCallableNever(), $mock);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/** @test */
|
| 73 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 74 |
-
{
|
| 75 |
-
$mock = $this->createCallableMock();
|
| 76 |
-
$mock
|
| 77 |
-
->expects($this->once())
|
| 78 |
-
->method('__invoke')
|
| 79 |
-
->with($this->identicalTo([1, 2, 3]));
|
| 80 |
-
|
| 81 |
-
all(resolve([1, 2, 3]))
|
| 82 |
-
->then($mock);
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
/** @test */
|
| 86 |
-
public function shouldResolveToEmptyArrayWhenInputPromiseDoesNotResolveToArray()
|
| 87 |
-
{
|
| 88 |
-
$mock = $this->createCallableMock();
|
| 89 |
-
$mock
|
| 90 |
-
->expects($this->once())
|
| 91 |
-
->method('__invoke')
|
| 92 |
-
->with($this->identicalTo([]));
|
| 93 |
-
|
| 94 |
-
all(resolve(1))
|
| 95 |
-
->then($mock);
|
| 96 |
-
}
|
| 97 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionAnyTest.php
DELETED
|
@@ -1,116 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionAnyTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldResolveToNullWithEmptyInputArray()
|
| 9 |
-
{
|
| 10 |
-
$mock = $this->createCallableMock();
|
| 11 |
-
$mock
|
| 12 |
-
->expects($this->once())
|
| 13 |
-
->method('__invoke')
|
| 14 |
-
->with($this->identicalTo(null));
|
| 15 |
-
|
| 16 |
-
any([])
|
| 17 |
-
->then($mock);
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
/** @test */
|
| 21 |
-
public function shouldResolveWithAnInputValue()
|
| 22 |
-
{
|
| 23 |
-
$mock = $this->createCallableMock();
|
| 24 |
-
$mock
|
| 25 |
-
->expects($this->once())
|
| 26 |
-
->method('__invoke')
|
| 27 |
-
->with($this->identicalTo(1));
|
| 28 |
-
|
| 29 |
-
any([1, 2, 3])
|
| 30 |
-
->then($mock);
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
/** @test */
|
| 34 |
-
public function shouldResolveWithAPromisedInputValue()
|
| 35 |
-
{
|
| 36 |
-
$mock = $this->createCallableMock();
|
| 37 |
-
$mock
|
| 38 |
-
->expects($this->once())
|
| 39 |
-
->method('__invoke')
|
| 40 |
-
->with($this->identicalTo(1));
|
| 41 |
-
|
| 42 |
-
any([resolve(1), resolve(2), resolve(3)])
|
| 43 |
-
->then($mock);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/** @test */
|
| 47 |
-
public function shouldRejectWithAllRejectedInputValuesIfAllInputsAreRejected()
|
| 48 |
-
{
|
| 49 |
-
$mock = $this->createCallableMock();
|
| 50 |
-
$mock
|
| 51 |
-
->expects($this->once())
|
| 52 |
-
->method('__invoke')
|
| 53 |
-
->with($this->identicalTo([0 => 1, 1 => 2, 2 => 3]));
|
| 54 |
-
|
| 55 |
-
any([reject(1), reject(2), reject(3)])
|
| 56 |
-
->then($this->expectCallableNever(), $mock);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/** @test */
|
| 60 |
-
public function shouldResolveWhenFirstInputPromiseResolves()
|
| 61 |
-
{
|
| 62 |
-
$mock = $this->createCallableMock();
|
| 63 |
-
$mock
|
| 64 |
-
->expects($this->once())
|
| 65 |
-
->method('__invoke')
|
| 66 |
-
->with($this->identicalTo(1));
|
| 67 |
-
|
| 68 |
-
any([resolve(1), reject(2), reject(3)])
|
| 69 |
-
->then($mock);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/** @test */
|
| 73 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 74 |
-
{
|
| 75 |
-
$mock = $this->createCallableMock();
|
| 76 |
-
$mock
|
| 77 |
-
->expects($this->once())
|
| 78 |
-
->method('__invoke')
|
| 79 |
-
->with($this->identicalTo(1));
|
| 80 |
-
|
| 81 |
-
any(resolve([1, 2, 3]))
|
| 82 |
-
->then($mock);
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
/** @test */
|
| 86 |
-
public function shouldResolveToNullArrayWhenInputPromiseDoesNotResolveToArray()
|
| 87 |
-
{
|
| 88 |
-
$mock = $this->createCallableMock();
|
| 89 |
-
$mock
|
| 90 |
-
->expects($this->once())
|
| 91 |
-
->method('__invoke')
|
| 92 |
-
->with($this->identicalTo(null));
|
| 93 |
-
|
| 94 |
-
any(resolve(1))
|
| 95 |
-
->then($mock);
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/** @test */
|
| 99 |
-
public function shouldNotRelyOnArryIndexesWhenUnwrappingToASingleResolutionValue()
|
| 100 |
-
{
|
| 101 |
-
$mock = $this->createCallableMock();
|
| 102 |
-
$mock
|
| 103 |
-
->expects($this->once())
|
| 104 |
-
->method('__invoke')
|
| 105 |
-
->with($this->identicalTo(2));
|
| 106 |
-
|
| 107 |
-
$d1 = new Deferred();
|
| 108 |
-
$d2 = new Deferred();
|
| 109 |
-
|
| 110 |
-
any(['abc' => $d1->promise(), 1 => $d2->promise()])
|
| 111 |
-
->then($mock);
|
| 112 |
-
|
| 113 |
-
$d2->resolve(2);
|
| 114 |
-
$d1->resolve(1);
|
| 115 |
-
}
|
| 116 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionCheckTypehintTest.php
DELETED
|
@@ -1,118 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionCheckTypehintTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldAcceptClosureCallbackWithTypehint()
|
| 9 |
-
{
|
| 10 |
-
$this->assertTrue(_checkTypehint(function (\InvalidArgumentException $e) {
|
| 11 |
-
}, new \InvalidArgumentException()));
|
| 12 |
-
$this->assertfalse(_checkTypehint(function (\InvalidArgumentException $e) {
|
| 13 |
-
}, new \Exception()));
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
/** @test */
|
| 17 |
-
public function shouldAcceptFunctionStringCallbackWithTypehint()
|
| 18 |
-
{
|
| 19 |
-
$this->assertTrue(_checkTypehint('React\Promise\testCallbackWithTypehint', new \InvalidArgumentException()));
|
| 20 |
-
$this->assertfalse(_checkTypehint('React\Promise\testCallbackWithTypehint', new \Exception()));
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
/** @test */
|
| 24 |
-
public function shouldAcceptInvokableObjectCallbackWithTypehint()
|
| 25 |
-
{
|
| 26 |
-
$this->assertTrue(_checkTypehint(new TestCallbackWithTypehintClass(), new \InvalidArgumentException()));
|
| 27 |
-
$this->assertfalse(_checkTypehint(new TestCallbackWithTypehintClass(), new \Exception()));
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/** @test */
|
| 31 |
-
public function shouldAcceptObjectMethodCallbackWithTypehint()
|
| 32 |
-
{
|
| 33 |
-
$this->assertTrue(_checkTypehint([new TestCallbackWithTypehintClass(), 'testCallback'], new \InvalidArgumentException()));
|
| 34 |
-
$this->assertfalse(_checkTypehint([new TestCallbackWithTypehintClass(), 'testCallback'], new \Exception()));
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/** @test */
|
| 38 |
-
public function shouldAcceptStaticClassCallbackWithTypehint()
|
| 39 |
-
{
|
| 40 |
-
$this->assertTrue(_checkTypehint(['React\Promise\TestCallbackWithTypehintClass', 'testCallbackStatic'], new \InvalidArgumentException()));
|
| 41 |
-
$this->assertfalse(_checkTypehint(['React\Promise\TestCallbackWithTypehintClass', 'testCallbackStatic'], new \Exception()));
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/** @test */
|
| 45 |
-
public function shouldAcceptClosureCallbackWithoutTypehint()
|
| 46 |
-
{
|
| 47 |
-
$this->assertTrue(_checkTypehint(function (\InvalidArgumentException $e) {
|
| 48 |
-
}, new \InvalidArgumentException()));
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/** @test */
|
| 52 |
-
public function shouldAcceptFunctionStringCallbackWithoutTypehint()
|
| 53 |
-
{
|
| 54 |
-
$this->assertTrue(_checkTypehint('React\Promise\testCallbackWithoutTypehint', new \InvalidArgumentException()));
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
/** @test */
|
| 58 |
-
public function shouldAcceptInvokableObjectCallbackWithoutTypehint()
|
| 59 |
-
{
|
| 60 |
-
$this->assertTrue(_checkTypehint(new TestCallbackWithoutTypehintClass(), new \InvalidArgumentException()));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/** @test */
|
| 64 |
-
public function shouldAcceptObjectMethodCallbackWithoutTypehint()
|
| 65 |
-
{
|
| 66 |
-
$this->assertTrue(_checkTypehint([new TestCallbackWithoutTypehintClass(), 'testCallback'], new \InvalidArgumentException()));
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
/** @test */
|
| 70 |
-
public function shouldAcceptStaticClassCallbackWithoutTypehint()
|
| 71 |
-
{
|
| 72 |
-
$this->assertTrue(_checkTypehint(['React\Promise\TestCallbackWithoutTypehintClass', 'testCallbackStatic'], new \InvalidArgumentException()));
|
| 73 |
-
}
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
function testCallbackWithTypehint(\InvalidArgumentException $e)
|
| 77 |
-
{
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
function testCallbackWithoutTypehint()
|
| 81 |
-
{
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
class TestCallbackWithTypehintClass
|
| 85 |
-
{
|
| 86 |
-
public function __invoke(\InvalidArgumentException $e)
|
| 87 |
-
{
|
| 88 |
-
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
public function testCallback(\InvalidArgumentException $e)
|
| 92 |
-
{
|
| 93 |
-
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
public static function testCallbackStatic(\InvalidArgumentException $e)
|
| 97 |
-
{
|
| 98 |
-
|
| 99 |
-
}
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
class TestCallbackWithoutTypehintClass
|
| 103 |
-
{
|
| 104 |
-
public function __invoke()
|
| 105 |
-
{
|
| 106 |
-
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
public function testCallback()
|
| 110 |
-
{
|
| 111 |
-
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
public static function testCallbackStatic()
|
| 115 |
-
{
|
| 116 |
-
|
| 117 |
-
}
|
| 118 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionMapTest.php
DELETED
|
@@ -1,125 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionMapTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
protected function mapper()
|
| 8 |
-
{
|
| 9 |
-
return function ($val) {
|
| 10 |
-
return $val * 2;
|
| 11 |
-
};
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
protected function promiseMapper()
|
| 15 |
-
{
|
| 16 |
-
return function ($val) {
|
| 17 |
-
return resolve($val * 2);
|
| 18 |
-
};
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
/** @test */
|
| 22 |
-
public function shouldMapInputValuesArray()
|
| 23 |
-
{
|
| 24 |
-
$mock = $this->createCallableMock();
|
| 25 |
-
$mock
|
| 26 |
-
->expects($this->once())
|
| 27 |
-
->method('__invoke')
|
| 28 |
-
->with($this->identicalTo([2, 4, 6]));
|
| 29 |
-
|
| 30 |
-
map(
|
| 31 |
-
[1, 2, 3],
|
| 32 |
-
$this->mapper()
|
| 33 |
-
)->then($mock);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/** @test */
|
| 37 |
-
public function shouldMapInputPromisesArray()
|
| 38 |
-
{
|
| 39 |
-
$mock = $this->createCallableMock();
|
| 40 |
-
$mock
|
| 41 |
-
->expects($this->once())
|
| 42 |
-
->method('__invoke')
|
| 43 |
-
->with($this->identicalTo([2, 4, 6]));
|
| 44 |
-
|
| 45 |
-
map(
|
| 46 |
-
[resolve(1), resolve(2), resolve(3)],
|
| 47 |
-
$this->mapper()
|
| 48 |
-
)->then($mock);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/** @test */
|
| 52 |
-
public function shouldMapMixedInputArray()
|
| 53 |
-
{
|
| 54 |
-
$mock = $this->createCallableMock();
|
| 55 |
-
$mock
|
| 56 |
-
->expects($this->once())
|
| 57 |
-
->method('__invoke')
|
| 58 |
-
->with($this->identicalTo([2, 4, 6]));
|
| 59 |
-
|
| 60 |
-
map(
|
| 61 |
-
[1, resolve(2), 3],
|
| 62 |
-
$this->mapper()
|
| 63 |
-
)->then($mock);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
/** @test */
|
| 67 |
-
public function shouldMapInputWhenMapperReturnsAPromise()
|
| 68 |
-
{
|
| 69 |
-
$mock = $this->createCallableMock();
|
| 70 |
-
$mock
|
| 71 |
-
->expects($this->once())
|
| 72 |
-
->method('__invoke')
|
| 73 |
-
->with($this->identicalTo([2, 4, 6]));
|
| 74 |
-
|
| 75 |
-
map(
|
| 76 |
-
[1, 2, 3],
|
| 77 |
-
$this->promiseMapper()
|
| 78 |
-
)->then($mock);
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
/** @test */
|
| 82 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 83 |
-
{
|
| 84 |
-
$mock = $this->createCallableMock();
|
| 85 |
-
$mock
|
| 86 |
-
->expects($this->once())
|
| 87 |
-
->method('__invoke')
|
| 88 |
-
->with($this->identicalTo([2, 4, 6]));
|
| 89 |
-
|
| 90 |
-
map(
|
| 91 |
-
resolve([1, resolve(2), 3]),
|
| 92 |
-
$this->mapper()
|
| 93 |
-
)->then($mock);
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
/** @test */
|
| 97 |
-
public function shouldResolveToEmptyArrayWhenInputPromiseDoesNotResolveToArray()
|
| 98 |
-
{
|
| 99 |
-
$mock = $this->createCallableMock();
|
| 100 |
-
$mock
|
| 101 |
-
->expects($this->once())
|
| 102 |
-
->method('__invoke')
|
| 103 |
-
->with($this->identicalTo([]));
|
| 104 |
-
|
| 105 |
-
map(
|
| 106 |
-
resolve(1),
|
| 107 |
-
$this->mapper()
|
| 108 |
-
)->then($mock);
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
/** @test */
|
| 112 |
-
public function shouldRejectWhenInputContainsRejection()
|
| 113 |
-
{
|
| 114 |
-
$mock = $this->createCallableMock();
|
| 115 |
-
$mock
|
| 116 |
-
->expects($this->once())
|
| 117 |
-
->method('__invoke')
|
| 118 |
-
->with($this->identicalTo(2));
|
| 119 |
-
|
| 120 |
-
map(
|
| 121 |
-
[resolve(1), reject(2), resolve(3)],
|
| 122 |
-
$this->mapper()
|
| 123 |
-
)->then($this->expectCallableNever(), $mock);
|
| 124 |
-
}
|
| 125 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionRaceTest.php
DELETED
|
@@ -1,122 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionRaceTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldResolveEmptyInput()
|
| 9 |
-
{
|
| 10 |
-
$mock = $this->createCallableMock();
|
| 11 |
-
$mock
|
| 12 |
-
->expects($this->once())
|
| 13 |
-
->method('__invoke')
|
| 14 |
-
->with($this->identicalTo(null));
|
| 15 |
-
|
| 16 |
-
race(
|
| 17 |
-
[]
|
| 18 |
-
)->then($mock);
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
/** @test */
|
| 22 |
-
public function shouldResolveValuesArray()
|
| 23 |
-
{
|
| 24 |
-
$mock = $this->createCallableMock();
|
| 25 |
-
$mock
|
| 26 |
-
->expects($this->once())
|
| 27 |
-
->method('__invoke')
|
| 28 |
-
->with($this->identicalTo(1));
|
| 29 |
-
|
| 30 |
-
race(
|
| 31 |
-
[1, 2, 3]
|
| 32 |
-
)->then($mock);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
/** @test */
|
| 36 |
-
public function shouldResolvePromisesArray()
|
| 37 |
-
{
|
| 38 |
-
$mock = $this->createCallableMock();
|
| 39 |
-
$mock
|
| 40 |
-
->expects($this->once())
|
| 41 |
-
->method('__invoke')
|
| 42 |
-
->with($this->identicalTo(2));
|
| 43 |
-
|
| 44 |
-
$d1 = new Deferred();
|
| 45 |
-
$d2 = new Deferred();
|
| 46 |
-
$d3 = new Deferred();
|
| 47 |
-
|
| 48 |
-
race(
|
| 49 |
-
[$d1->promise(), $d2->promise(), $d3->promise()]
|
| 50 |
-
)->then($mock);
|
| 51 |
-
|
| 52 |
-
$d2->resolve(2);
|
| 53 |
-
|
| 54 |
-
$d1->resolve(1);
|
| 55 |
-
$d3->resolve(3);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
/** @test */
|
| 59 |
-
public function shouldResolveSparseArrayInput()
|
| 60 |
-
{
|
| 61 |
-
$mock = $this->createCallableMock();
|
| 62 |
-
$mock
|
| 63 |
-
->expects($this->once())
|
| 64 |
-
->method('__invoke')
|
| 65 |
-
->with($this->identicalTo(null));
|
| 66 |
-
|
| 67 |
-
race(
|
| 68 |
-
[null, 1, null, 2, 3]
|
| 69 |
-
)->then($mock);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/** @test */
|
| 73 |
-
public function shouldRejectIfFirstSettledPromiseRejects()
|
| 74 |
-
{
|
| 75 |
-
$mock = $this->createCallableMock();
|
| 76 |
-
$mock
|
| 77 |
-
->expects($this->once())
|
| 78 |
-
->method('__invoke')
|
| 79 |
-
->with($this->identicalTo(2));
|
| 80 |
-
|
| 81 |
-
$d1 = new Deferred();
|
| 82 |
-
$d2 = new Deferred();
|
| 83 |
-
$d3 = new Deferred();
|
| 84 |
-
|
| 85 |
-
race(
|
| 86 |
-
[$d1->promise(), $d2->promise(), $d3->promise()]
|
| 87 |
-
)->then($this->expectCallableNever(), $mock);
|
| 88 |
-
|
| 89 |
-
$d2->reject(2);
|
| 90 |
-
|
| 91 |
-
$d1->resolve(1);
|
| 92 |
-
$d3->resolve(3);
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
/** @test */
|
| 96 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 97 |
-
{
|
| 98 |
-
$mock = $this->createCallableMock();
|
| 99 |
-
$mock
|
| 100 |
-
->expects($this->once())
|
| 101 |
-
->method('__invoke')
|
| 102 |
-
->with($this->identicalTo(1));
|
| 103 |
-
|
| 104 |
-
race(
|
| 105 |
-
resolve([1, 2, 3])
|
| 106 |
-
)->then($mock);
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/** @test */
|
| 110 |
-
public function shouldResolveToNullWhenInputPromiseDoesNotResolveToArray()
|
| 111 |
-
{
|
| 112 |
-
$mock = $this->createCallableMock();
|
| 113 |
-
$mock
|
| 114 |
-
->expects($this->once())
|
| 115 |
-
->method('__invoke')
|
| 116 |
-
->with($this->identicalTo(null));
|
| 117 |
-
|
| 118 |
-
race(
|
| 119 |
-
resolve(1)
|
| 120 |
-
)->then($mock);
|
| 121 |
-
}
|
| 122 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionReduceTest.php
DELETED
|
@@ -1,290 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionReduceTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
protected function plus()
|
| 8 |
-
{
|
| 9 |
-
return function ($sum, $val) {
|
| 10 |
-
return $sum + $val;
|
| 11 |
-
};
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
protected function append()
|
| 15 |
-
{
|
| 16 |
-
return function ($sum, $val) {
|
| 17 |
-
return $sum . $val;
|
| 18 |
-
};
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
/** @test */
|
| 22 |
-
public function shouldReduceValuesWithoutInitialValue()
|
| 23 |
-
{
|
| 24 |
-
$mock = $this->createCallableMock();
|
| 25 |
-
$mock
|
| 26 |
-
->expects($this->once())
|
| 27 |
-
->method('__invoke')
|
| 28 |
-
->with($this->identicalTo(6));
|
| 29 |
-
|
| 30 |
-
reduce(
|
| 31 |
-
[1, 2, 3],
|
| 32 |
-
$this->plus()
|
| 33 |
-
)->then($mock);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/** @test */
|
| 37 |
-
public function shouldReduceValuesWithInitialValue()
|
| 38 |
-
{
|
| 39 |
-
$mock = $this->createCallableMock();
|
| 40 |
-
$mock
|
| 41 |
-
->expects($this->once())
|
| 42 |
-
->method('__invoke')
|
| 43 |
-
->with($this->identicalTo(7));
|
| 44 |
-
|
| 45 |
-
reduce(
|
| 46 |
-
[1, 2, 3],
|
| 47 |
-
$this->plus(),
|
| 48 |
-
1
|
| 49 |
-
)->then($mock);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/** @test */
|
| 53 |
-
public function shouldReduceValuesWithInitialPromise()
|
| 54 |
-
{
|
| 55 |
-
$mock = $this->createCallableMock();
|
| 56 |
-
$mock
|
| 57 |
-
->expects($this->once())
|
| 58 |
-
->method('__invoke')
|
| 59 |
-
->with($this->identicalTo(7));
|
| 60 |
-
|
| 61 |
-
reduce(
|
| 62 |
-
[1, 2, 3],
|
| 63 |
-
$this->plus(),
|
| 64 |
-
resolve(1)
|
| 65 |
-
)->then($mock);
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/** @test */
|
| 69 |
-
public function shouldReducePromisedValuesWithoutInitialValue()
|
| 70 |
-
{
|
| 71 |
-
$mock = $this->createCallableMock();
|
| 72 |
-
$mock
|
| 73 |
-
->expects($this->once())
|
| 74 |
-
->method('__invoke')
|
| 75 |
-
->with($this->identicalTo(6));
|
| 76 |
-
|
| 77 |
-
reduce(
|
| 78 |
-
[resolve(1), resolve(2), resolve(3)],
|
| 79 |
-
$this->plus()
|
| 80 |
-
)->then($mock);
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
/** @test */
|
| 84 |
-
public function shouldReducePromisedValuesWithInitialValue()
|
| 85 |
-
{
|
| 86 |
-
$mock = $this->createCallableMock();
|
| 87 |
-
$mock
|
| 88 |
-
->expects($this->once())
|
| 89 |
-
->method('__invoke')
|
| 90 |
-
->with($this->identicalTo(7));
|
| 91 |
-
|
| 92 |
-
reduce(
|
| 93 |
-
[resolve(1), resolve(2), resolve(3)],
|
| 94 |
-
$this->plus(),
|
| 95 |
-
1
|
| 96 |
-
)->then($mock);
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
/** @test */
|
| 100 |
-
public function shouldReducePromisedValuesWithInitialPromise()
|
| 101 |
-
{
|
| 102 |
-
$mock = $this->createCallableMock();
|
| 103 |
-
$mock
|
| 104 |
-
->expects($this->once())
|
| 105 |
-
->method('__invoke')
|
| 106 |
-
->with($this->identicalTo(7));
|
| 107 |
-
|
| 108 |
-
reduce(
|
| 109 |
-
[resolve(1), resolve(2), resolve(3)],
|
| 110 |
-
$this->plus(),
|
| 111 |
-
resolve(1)
|
| 112 |
-
)->then($mock);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
/** @test */
|
| 116 |
-
public function shouldReduceEmptyInputWithInitialValue()
|
| 117 |
-
{
|
| 118 |
-
$mock = $this->createCallableMock();
|
| 119 |
-
$mock
|
| 120 |
-
->expects($this->once())
|
| 121 |
-
->method('__invoke')
|
| 122 |
-
->with($this->identicalTo(1));
|
| 123 |
-
|
| 124 |
-
reduce(
|
| 125 |
-
[],
|
| 126 |
-
$this->plus(),
|
| 127 |
-
1
|
| 128 |
-
)->then($mock);
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
/** @test */
|
| 132 |
-
public function shouldReduceEmptyInputWithInitialPromise()
|
| 133 |
-
{
|
| 134 |
-
$mock = $this->createCallableMock();
|
| 135 |
-
$mock
|
| 136 |
-
->expects($this->once())
|
| 137 |
-
->method('__invoke')
|
| 138 |
-
->with($this->identicalTo(1));
|
| 139 |
-
|
| 140 |
-
reduce(
|
| 141 |
-
[],
|
| 142 |
-
$this->plus(),
|
| 143 |
-
resolve(1)
|
| 144 |
-
)->then($mock);
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
/** @test */
|
| 148 |
-
public function shouldRejectWhenInputContainsRejection()
|
| 149 |
-
{
|
| 150 |
-
$mock = $this->createCallableMock();
|
| 151 |
-
$mock
|
| 152 |
-
->expects($this->once())
|
| 153 |
-
->method('__invoke')
|
| 154 |
-
->with($this->identicalTo(2));
|
| 155 |
-
|
| 156 |
-
reduce(
|
| 157 |
-
[resolve(1), reject(2), resolve(3)],
|
| 158 |
-
$this->plus(),
|
| 159 |
-
resolve(1)
|
| 160 |
-
)->then($this->expectCallableNever(), $mock);
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
/** @test */
|
| 164 |
-
public function shouldResolveWithNullWhenInputIsEmptyAndNoInitialValueOrPromiseProvided()
|
| 165 |
-
{
|
| 166 |
-
// Note: this is different from when.js's behavior!
|
| 167 |
-
// In when.reduce(), this rejects with a TypeError exception (following
|
| 168 |
-
// JavaScript's [].reduce behavior.
|
| 169 |
-
// We're following PHP's array_reduce behavior and resolve with NULL.
|
| 170 |
-
$mock = $this->createCallableMock();
|
| 171 |
-
$mock
|
| 172 |
-
->expects($this->once())
|
| 173 |
-
->method('__invoke')
|
| 174 |
-
->with($this->identicalTo(null));
|
| 175 |
-
|
| 176 |
-
reduce(
|
| 177 |
-
[],
|
| 178 |
-
$this->plus()
|
| 179 |
-
)->then($mock);
|
| 180 |
-
}
|
| 181 |
-
|
| 182 |
-
/** @test */
|
| 183 |
-
public function shouldAllowSparseArrayInputWithoutInitialValue()
|
| 184 |
-
{
|
| 185 |
-
$mock = $this->createCallableMock();
|
| 186 |
-
$mock
|
| 187 |
-
->expects($this->once())
|
| 188 |
-
->method('__invoke')
|
| 189 |
-
->with($this->identicalTo(3));
|
| 190 |
-
|
| 191 |
-
reduce(
|
| 192 |
-
[null, null, 1, null, 1, 1],
|
| 193 |
-
$this->plus()
|
| 194 |
-
)->then($mock);
|
| 195 |
-
}
|
| 196 |
-
|
| 197 |
-
/** @test */
|
| 198 |
-
public function shouldAllowSparseArrayInputWithInitialValue()
|
| 199 |
-
{
|
| 200 |
-
$mock = $this->createCallableMock();
|
| 201 |
-
$mock
|
| 202 |
-
->expects($this->once())
|
| 203 |
-
->method('__invoke')
|
| 204 |
-
->with($this->identicalTo(4));
|
| 205 |
-
|
| 206 |
-
reduce(
|
| 207 |
-
[null, null, 1, null, 1, 1],
|
| 208 |
-
$this->plus(),
|
| 209 |
-
1
|
| 210 |
-
)->then($mock);
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
/** @test */
|
| 214 |
-
public function shouldReduceInInputOrder()
|
| 215 |
-
{
|
| 216 |
-
$mock = $this->createCallableMock();
|
| 217 |
-
$mock
|
| 218 |
-
->expects($this->once())
|
| 219 |
-
->method('__invoke')
|
| 220 |
-
->with($this->identicalTo('123'));
|
| 221 |
-
|
| 222 |
-
reduce(
|
| 223 |
-
[1, 2, 3],
|
| 224 |
-
$this->append(),
|
| 225 |
-
''
|
| 226 |
-
)->then($mock);
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
/** @test */
|
| 230 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 231 |
-
{
|
| 232 |
-
$mock = $this->createCallableMock();
|
| 233 |
-
$mock
|
| 234 |
-
->expects($this->once())
|
| 235 |
-
->method('__invoke')
|
| 236 |
-
->with($this->identicalTo('123'));
|
| 237 |
-
|
| 238 |
-
reduce(
|
| 239 |
-
resolve([1, 2, 3]),
|
| 240 |
-
$this->append(),
|
| 241 |
-
''
|
| 242 |
-
)->then($mock);
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
/** @test */
|
| 246 |
-
public function shouldResolveToInitialValueWhenInputPromiseDoesNotResolveToAnArray()
|
| 247 |
-
{
|
| 248 |
-
$mock = $this->createCallableMock();
|
| 249 |
-
$mock
|
| 250 |
-
->expects($this->once())
|
| 251 |
-
->method('__invoke')
|
| 252 |
-
->with($this->identicalTo(1));
|
| 253 |
-
|
| 254 |
-
reduce(
|
| 255 |
-
resolve(1),
|
| 256 |
-
$this->plus(),
|
| 257 |
-
1
|
| 258 |
-
)->then($mock);
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
/** @test */
|
| 262 |
-
public function shouldProvideCorrectBasisValue()
|
| 263 |
-
{
|
| 264 |
-
$insertIntoArray = function ($arr, $val, $i) {
|
| 265 |
-
$arr[$i] = $val;
|
| 266 |
-
|
| 267 |
-
return $arr;
|
| 268 |
-
};
|
| 269 |
-
|
| 270 |
-
$d1 = new Deferred();
|
| 271 |
-
$d2 = new Deferred();
|
| 272 |
-
$d3 = new Deferred();
|
| 273 |
-
|
| 274 |
-
$mock = $this->createCallableMock();
|
| 275 |
-
$mock
|
| 276 |
-
->expects($this->once())
|
| 277 |
-
->method('__invoke')
|
| 278 |
-
->with($this->identicalTo([1, 2, 3]));
|
| 279 |
-
|
| 280 |
-
reduce(
|
| 281 |
-
[$d1->promise(), $d2->promise(), $d3->promise()],
|
| 282 |
-
$insertIntoArray,
|
| 283 |
-
[]
|
| 284 |
-
)->then($mock);
|
| 285 |
-
|
| 286 |
-
$d3->resolve(3);
|
| 287 |
-
$d1->resolve(1);
|
| 288 |
-
$d2->resolve(2);
|
| 289 |
-
}
|
| 290 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionRejectTest.php
DELETED
|
@@ -1,64 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionRejectTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldRejectAnImmediateValue()
|
| 9 |
-
{
|
| 10 |
-
$expected = 123;
|
| 11 |
-
|
| 12 |
-
$mock = $this->createCallableMock();
|
| 13 |
-
$mock
|
| 14 |
-
->expects($this->once())
|
| 15 |
-
->method('__invoke')
|
| 16 |
-
->with($this->identicalTo($expected));
|
| 17 |
-
|
| 18 |
-
reject($expected)
|
| 19 |
-
->then(
|
| 20 |
-
$this->expectCallableNever(),
|
| 21 |
-
$mock
|
| 22 |
-
);
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/** @test */
|
| 26 |
-
public function shouldRejectAFulfilledPromise()
|
| 27 |
-
{
|
| 28 |
-
$expected = 123;
|
| 29 |
-
|
| 30 |
-
$resolved = new FulfilledPromise($expected);
|
| 31 |
-
|
| 32 |
-
$mock = $this->createCallableMock();
|
| 33 |
-
$mock
|
| 34 |
-
->expects($this->once())
|
| 35 |
-
->method('__invoke')
|
| 36 |
-
->with($this->identicalTo($expected));
|
| 37 |
-
|
| 38 |
-
reject($resolved)
|
| 39 |
-
->then(
|
| 40 |
-
$this->expectCallableNever(),
|
| 41 |
-
$mock
|
| 42 |
-
);
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/** @test */
|
| 46 |
-
public function shouldRejectARejectedPromise()
|
| 47 |
-
{
|
| 48 |
-
$expected = 123;
|
| 49 |
-
|
| 50 |
-
$resolved = new RejectedPromise($expected);
|
| 51 |
-
|
| 52 |
-
$mock = $this->createCallableMock();
|
| 53 |
-
$mock
|
| 54 |
-
->expects($this->once())
|
| 55 |
-
->method('__invoke')
|
| 56 |
-
->with($this->identicalTo($expected));
|
| 57 |
-
|
| 58 |
-
reject($resolved)
|
| 59 |
-
->then(
|
| 60 |
-
$this->expectCallableNever(),
|
| 61 |
-
$mock
|
| 62 |
-
);
|
| 63 |
-
}
|
| 64 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionResolveTest.php
DELETED
|
@@ -1,102 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionResolveTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldResolveAnImmediateValue()
|
| 9 |
-
{
|
| 10 |
-
$expected = 123;
|
| 11 |
-
|
| 12 |
-
$mock = $this->createCallableMock();
|
| 13 |
-
$mock
|
| 14 |
-
->expects($this->once())
|
| 15 |
-
->method('__invoke')
|
| 16 |
-
->with($this->identicalTo($expected));
|
| 17 |
-
|
| 18 |
-
resolve($expected)
|
| 19 |
-
->then(
|
| 20 |
-
$mock,
|
| 21 |
-
$this->expectCallableNever()
|
| 22 |
-
);
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/** @test */
|
| 26 |
-
public function shouldResolveAFulfilledPromise()
|
| 27 |
-
{
|
| 28 |
-
$expected = 123;
|
| 29 |
-
|
| 30 |
-
$resolved = new FulfilledPromise($expected);
|
| 31 |
-
|
| 32 |
-
$mock = $this->createCallableMock();
|
| 33 |
-
$mock
|
| 34 |
-
->expects($this->once())
|
| 35 |
-
->method('__invoke')
|
| 36 |
-
->with($this->identicalTo($expected));
|
| 37 |
-
|
| 38 |
-
resolve($resolved)
|
| 39 |
-
->then(
|
| 40 |
-
$mock,
|
| 41 |
-
$this->expectCallableNever()
|
| 42 |
-
);
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/** @test */
|
| 46 |
-
public function shouldRejectARejectedPromise()
|
| 47 |
-
{
|
| 48 |
-
$expected = 123;
|
| 49 |
-
|
| 50 |
-
$resolved = new RejectedPromise($expected);
|
| 51 |
-
|
| 52 |
-
$mock = $this->createCallableMock();
|
| 53 |
-
$mock
|
| 54 |
-
->expects($this->once())
|
| 55 |
-
->method('__invoke')
|
| 56 |
-
->with($this->identicalTo($expected));
|
| 57 |
-
|
| 58 |
-
resolve($resolved)
|
| 59 |
-
->then(
|
| 60 |
-
$this->expectCallableNever(),
|
| 61 |
-
$mock
|
| 62 |
-
);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/** @test */
|
| 66 |
-
public function shouldSupportDeepNestingInPromiseChains()
|
| 67 |
-
{
|
| 68 |
-
$d = new Deferred();
|
| 69 |
-
$d->resolve(false);
|
| 70 |
-
|
| 71 |
-
$result = resolve(resolve($d->promise()->then(function ($val) {
|
| 72 |
-
$d = new Deferred();
|
| 73 |
-
$d->resolve($val);
|
| 74 |
-
|
| 75 |
-
$identity = function ($val) {
|
| 76 |
-
return $val;
|
| 77 |
-
};
|
| 78 |
-
|
| 79 |
-
return resolve($d->promise()->then($identity))->then(
|
| 80 |
-
function ($val) {
|
| 81 |
-
return !$val;
|
| 82 |
-
}
|
| 83 |
-
);
|
| 84 |
-
})));
|
| 85 |
-
|
| 86 |
-
$mock = $this->createCallableMock();
|
| 87 |
-
$mock
|
| 88 |
-
->expects($this->once())
|
| 89 |
-
->method('__invoke')
|
| 90 |
-
->with($this->identicalTo(true));
|
| 91 |
-
|
| 92 |
-
$result->then($mock);
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
/** @test */
|
| 96 |
-
public function returnsExtendePromiseForSimplePromise()
|
| 97 |
-
{
|
| 98 |
-
$promise = $this->getMock('React\Promise\PromiseInterface');
|
| 99 |
-
|
| 100 |
-
$this->assertInstanceOf('React\Promise\ExtendedPromiseInterface', resolve($promise));
|
| 101 |
-
}
|
| 102 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/FunctionSomeTest.php
DELETED
|
@@ -1,126 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class FunctionSomeTest extends TestCase
|
| 6 |
-
{
|
| 7 |
-
/** @test */
|
| 8 |
-
public function shouldResolveEmptyInput()
|
| 9 |
-
{
|
| 10 |
-
$mock = $this->createCallableMock();
|
| 11 |
-
$mock
|
| 12 |
-
->expects($this->once())
|
| 13 |
-
->method('__invoke')
|
| 14 |
-
->with($this->identicalTo([]));
|
| 15 |
-
|
| 16 |
-
some(
|
| 17 |
-
[],
|
| 18 |
-
1
|
| 19 |
-
)->then($mock);
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
/** @test */
|
| 23 |
-
public function shouldResolveValuesArray()
|
| 24 |
-
{
|
| 25 |
-
$mock = $this->createCallableMock();
|
| 26 |
-
$mock
|
| 27 |
-
->expects($this->once())
|
| 28 |
-
->method('__invoke')
|
| 29 |
-
->with($this->identicalTo([1, 2]));
|
| 30 |
-
|
| 31 |
-
some(
|
| 32 |
-
[1, 2, 3],
|
| 33 |
-
2
|
| 34 |
-
)->then($mock);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/** @test */
|
| 38 |
-
public function shouldResolvePromisesArray()
|
| 39 |
-
{
|
| 40 |
-
$mock = $this->createCallableMock();
|
| 41 |
-
$mock
|
| 42 |
-
->expects($this->once())
|
| 43 |
-
->method('__invoke')
|
| 44 |
-
->with($this->identicalTo([1, 2]));
|
| 45 |
-
|
| 46 |
-
some(
|
| 47 |
-
[resolve(1), resolve(2), resolve(3)],
|
| 48 |
-
2
|
| 49 |
-
)->then($mock);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/** @test */
|
| 53 |
-
public function shouldResolveSparseArrayInput()
|
| 54 |
-
{
|
| 55 |
-
$mock = $this->createCallableMock();
|
| 56 |
-
$mock
|
| 57 |
-
->expects($this->once())
|
| 58 |
-
->method('__invoke')
|
| 59 |
-
->with($this->identicalTo([null, 1]));
|
| 60 |
-
|
| 61 |
-
some(
|
| 62 |
-
[null, 1, null, 2, 3],
|
| 63 |
-
2
|
| 64 |
-
)->then($mock);
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
/** @test */
|
| 68 |
-
public function shouldRejectIfAnyInputPromiseRejectsBeforeDesiredNumberOfInputsAreResolved()
|
| 69 |
-
{
|
| 70 |
-
$mock = $this->createCallableMock();
|
| 71 |
-
$mock
|
| 72 |
-
->expects($this->once())
|
| 73 |
-
->method('__invoke')
|
| 74 |
-
->with($this->identicalTo([1 => 2, 2 => 3]));
|
| 75 |
-
|
| 76 |
-
some(
|
| 77 |
-
[resolve(1), reject(2), reject(3)],
|
| 78 |
-
2
|
| 79 |
-
)->then($this->expectCallableNever(), $mock);
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/** @test */
|
| 83 |
-
public function shouldAcceptAPromiseForAnArray()
|
| 84 |
-
{
|
| 85 |
-
$mock = $this->createCallableMock();
|
| 86 |
-
$mock
|
| 87 |
-
->expects($this->once())
|
| 88 |
-
->method('__invoke')
|
| 89 |
-
->with($this->identicalTo([1, 2]));
|
| 90 |
-
|
| 91 |
-
some(
|
| 92 |
-
resolve([1, 2, 3]),
|
| 93 |
-
2
|
| 94 |
-
)->then($mock);
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
/** @test */
|
| 98 |
-
public function shouldResolveWithEmptyArrayIfHowManyIsLessThanOne()
|
| 99 |
-
{
|
| 100 |
-
$mock = $this->createCallableMock();
|
| 101 |
-
$mock
|
| 102 |
-
->expects($this->once())
|
| 103 |
-
->method('__invoke')
|
| 104 |
-
->with($this->identicalTo([]));
|
| 105 |
-
|
| 106 |
-
some(
|
| 107 |
-
[1],
|
| 108 |
-
0
|
| 109 |
-
)->then($mock);
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
/** @test */
|
| 113 |
-
public function shouldResolveToEmptyArrayWhenInputPromiseDoesNotResolveToArray()
|
| 114 |
-
{
|
| 115 |
-
$mock = $this->createCallableMock();
|
| 116 |
-
$mock
|
| 117 |
-
->expects($this->once())
|
| 118 |
-
->method('__invoke')
|
| 119 |
-
->with($this->identicalTo([]));
|
| 120 |
-
|
| 121 |
-
some(
|
| 122 |
-
resolve(1),
|
| 123 |
-
1
|
| 124 |
-
)->then($mock);
|
| 125 |
-
}
|
| 126 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/LazyPromiseTest.php
DELETED
|
@@ -1,107 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
use React\Promise\PromiseAdapter\CallbackPromiseAdapter;
|
| 6 |
-
|
| 7 |
-
class LazyPromiseTest extends TestCase
|
| 8 |
-
{
|
| 9 |
-
use PromiseTest\FullTestTrait;
|
| 10 |
-
|
| 11 |
-
public function getPromiseTestAdapter(callable $canceller = null)
|
| 12 |
-
{
|
| 13 |
-
$d = new Deferred($canceller);
|
| 14 |
-
|
| 15 |
-
$factory = function () use ($d) {
|
| 16 |
-
return $d->promise();
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
return new CallbackPromiseAdapter([
|
| 20 |
-
'promise' => function () use ($factory) {
|
| 21 |
-
return new LazyPromise($factory);
|
| 22 |
-
},
|
| 23 |
-
'resolve' => [$d, 'resolve'],
|
| 24 |
-
'reject' => [$d, 'reject'],
|
| 25 |
-
'notify' => [$d, 'progress'],
|
| 26 |
-
'settle' => [$d, 'resolve'],
|
| 27 |
-
]);
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/** @test */
|
| 31 |
-
public function shouldNotCallFactoryIfThenIsNotInvoked()
|
| 32 |
-
{
|
| 33 |
-
$factory = $this->createCallableMock();
|
| 34 |
-
$factory
|
| 35 |
-
->expects($this->never())
|
| 36 |
-
->method('__invoke');
|
| 37 |
-
|
| 38 |
-
new LazyPromise($factory);
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/** @test */
|
| 42 |
-
public function shouldCallFactoryIfThenIsInvoked()
|
| 43 |
-
{
|
| 44 |
-
$factory = $this->createCallableMock();
|
| 45 |
-
$factory
|
| 46 |
-
->expects($this->once())
|
| 47 |
-
->method('__invoke');
|
| 48 |
-
|
| 49 |
-
$p = new LazyPromise($factory);
|
| 50 |
-
$p->then();
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/** @test */
|
| 54 |
-
public function shouldReturnPromiseFromFactory()
|
| 55 |
-
{
|
| 56 |
-
$factory = $this->createCallableMock();
|
| 57 |
-
$factory
|
| 58 |
-
->expects($this->once())
|
| 59 |
-
->method('__invoke')
|
| 60 |
-
->will($this->returnValue(new FulfilledPromise(1)));
|
| 61 |
-
|
| 62 |
-
$onFulfilled = $this->createCallableMock();
|
| 63 |
-
$onFulfilled
|
| 64 |
-
->expects($this->once())
|
| 65 |
-
->method('__invoke')
|
| 66 |
-
->with($this->identicalTo(1));
|
| 67 |
-
|
| 68 |
-
$p = new LazyPromise($factory);
|
| 69 |
-
|
| 70 |
-
$p->then($onFulfilled);
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/** @test */
|
| 74 |
-
public function shouldReturnPromiseIfFactoryReturnsNull()
|
| 75 |
-
{
|
| 76 |
-
$factory = $this->createCallableMock();
|
| 77 |
-
$factory
|
| 78 |
-
->expects($this->once())
|
| 79 |
-
->method('__invoke')
|
| 80 |
-
->will($this->returnValue(null));
|
| 81 |
-
|
| 82 |
-
$p = new LazyPromise($factory);
|
| 83 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $p->then());
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/** @test */
|
| 87 |
-
public function shouldReturnRejectedPromiseIfFactoryThrowsException()
|
| 88 |
-
{
|
| 89 |
-
$exception = new \Exception();
|
| 90 |
-
|
| 91 |
-
$factory = $this->createCallableMock();
|
| 92 |
-
$factory
|
| 93 |
-
->expects($this->once())
|
| 94 |
-
->method('__invoke')
|
| 95 |
-
->will($this->throwException($exception));
|
| 96 |
-
|
| 97 |
-
$onRejected = $this->createCallableMock();
|
| 98 |
-
$onRejected
|
| 99 |
-
->expects($this->once())
|
| 100 |
-
->method('__invoke')
|
| 101 |
-
->with($this->identicalTo($exception));
|
| 102 |
-
|
| 103 |
-
$p = new LazyPromise($factory);
|
| 104 |
-
|
| 105 |
-
$p->then($this->expectCallableNever(), $onRejected);
|
| 106 |
-
}
|
| 107 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseAdapter/CallbackPromiseAdapter.php
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseAdapter;
|
| 4 |
-
|
| 5 |
-
use React\Promise;
|
| 6 |
-
|
| 7 |
-
class CallbackPromiseAdapter implements PromiseAdapterInterface
|
| 8 |
-
{
|
| 9 |
-
private $callbacks;
|
| 10 |
-
|
| 11 |
-
public function __construct(array $callbacks)
|
| 12 |
-
{
|
| 13 |
-
$this->callbacks = $callbacks;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
public function promise()
|
| 17 |
-
{
|
| 18 |
-
return call_user_func_array($this->callbacks['promise'], func_get_args());
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
public function resolve()
|
| 22 |
-
{
|
| 23 |
-
return call_user_func_array($this->callbacks['resolve'], func_get_args());
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function reject()
|
| 27 |
-
{
|
| 28 |
-
return call_user_func_array($this->callbacks['reject'], func_get_args());
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function notify()
|
| 32 |
-
{
|
| 33 |
-
return call_user_func_array($this->callbacks['notify'], func_get_args());
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function settle()
|
| 37 |
-
{
|
| 38 |
-
return call_user_func_array($this->callbacks['settle'], func_get_args());
|
| 39 |
-
}
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseAdapter/PromiseAdapterInterface.php
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseAdapter;
|
| 4 |
-
|
| 5 |
-
use React\Promise;
|
| 6 |
-
|
| 7 |
-
interface PromiseAdapterInterface
|
| 8 |
-
{
|
| 9 |
-
public function promise();
|
| 10 |
-
public function resolve();
|
| 11 |
-
public function reject();
|
| 12 |
-
public function notify();
|
| 13 |
-
public function settle();
|
| 14 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest.php
DELETED
|
@@ -1,116 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
use React\Promise\PromiseAdapter\CallbackPromiseAdapter;
|
| 6 |
-
|
| 7 |
-
class PromiseTest extends TestCase
|
| 8 |
-
{
|
| 9 |
-
use PromiseTest\FullTestTrait;
|
| 10 |
-
|
| 11 |
-
public function getPromiseTestAdapter(callable $canceller = null)
|
| 12 |
-
{
|
| 13 |
-
$resolveCallback = $rejectCallback = $progressCallback = null;
|
| 14 |
-
|
| 15 |
-
$promise = new Promise(function ($resolve, $reject, $progress) use (&$resolveCallback, &$rejectCallback, &$progressCallback) {
|
| 16 |
-
$resolveCallback = $resolve;
|
| 17 |
-
$rejectCallback = $reject;
|
| 18 |
-
$progressCallback = $progress;
|
| 19 |
-
}, $canceller);
|
| 20 |
-
|
| 21 |
-
return new CallbackPromiseAdapter([
|
| 22 |
-
'promise' => function () use ($promise) {
|
| 23 |
-
return $promise;
|
| 24 |
-
},
|
| 25 |
-
'resolve' => $resolveCallback,
|
| 26 |
-
'reject' => $rejectCallback,
|
| 27 |
-
'notify' => $progressCallback,
|
| 28 |
-
'settle' => $resolveCallback,
|
| 29 |
-
]);
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/** @test */
|
| 33 |
-
public function shouldRejectIfResolverThrowsException()
|
| 34 |
-
{
|
| 35 |
-
$exception = new \Exception('foo');
|
| 36 |
-
|
| 37 |
-
$promise = new Promise(function () use ($exception) {
|
| 38 |
-
throw $exception;
|
| 39 |
-
});
|
| 40 |
-
|
| 41 |
-
$mock = $this->createCallableMock();
|
| 42 |
-
$mock
|
| 43 |
-
->expects($this->once())
|
| 44 |
-
->method('__invoke')
|
| 45 |
-
->with($this->identicalTo($exception));
|
| 46 |
-
|
| 47 |
-
$promise
|
| 48 |
-
->then($this->expectCallableNever(), $mock);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/** @test */
|
| 52 |
-
public function shouldFulfillIfFullfilledWithSimplePromise()
|
| 53 |
-
{
|
| 54 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 55 |
-
|
| 56 |
-
$mock = $this->createCallableMock();
|
| 57 |
-
$mock
|
| 58 |
-
->expects($this->once())
|
| 59 |
-
->method('__invoke')
|
| 60 |
-
->with($this->identicalTo('foo'));
|
| 61 |
-
|
| 62 |
-
$adapter->promise()
|
| 63 |
-
->then($mock);
|
| 64 |
-
|
| 65 |
-
$adapter->resolve(new SimpleFulfilledTestPromise());
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/** @test */
|
| 69 |
-
public function shouldRejectIfRejectedWithSimplePromise()
|
| 70 |
-
{
|
| 71 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 72 |
-
|
| 73 |
-
$mock = $this->createCallableMock();
|
| 74 |
-
$mock
|
| 75 |
-
->expects($this->once())
|
| 76 |
-
->method('__invoke')
|
| 77 |
-
->with($this->identicalTo('foo'));
|
| 78 |
-
|
| 79 |
-
$adapter->promise()
|
| 80 |
-
->then($this->expectCallableNever(), $mock);
|
| 81 |
-
|
| 82 |
-
$adapter->resolve(new SimpleRejectedTestPromise());
|
| 83 |
-
}
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
class SimpleFulfilledTestPromise implements PromiseInterface
|
| 87 |
-
{
|
| 88 |
-
public function then(callable $onFulfilled = null, callable $onRejected = null, callable $onProgress = null)
|
| 89 |
-
{
|
| 90 |
-
try {
|
| 91 |
-
if ($onFulfilled) {
|
| 92 |
-
$onFulfilled('foo');
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
return new self('foo');
|
| 96 |
-
} catch (\Exception $exception) {
|
| 97 |
-
return new RejectedPromise($exception);
|
| 98 |
-
}
|
| 99 |
-
}
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
class SimpleRejectedTestPromise implements PromiseInterface
|
| 103 |
-
{
|
| 104 |
-
public function then(callable $onFulfilled = null, callable $onRejected = null, callable $onProgress = null)
|
| 105 |
-
{
|
| 106 |
-
try {
|
| 107 |
-
if ($onRejected) {
|
| 108 |
-
$onRejected('foo');
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
return new self('foo');
|
| 112 |
-
} catch (\Exception $exception) {
|
| 113 |
-
return new RejectedPromise($exception);
|
| 114 |
-
}
|
| 115 |
-
}
|
| 116 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/CancelTestTrait.php
DELETED
|
@@ -1,206 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
use React\Promise;
|
| 6 |
-
|
| 7 |
-
trait CancelTestTrait
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 11 |
-
*/
|
| 12 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 13 |
-
|
| 14 |
-
/** @test */
|
| 15 |
-
public function cancelShouldCallCancellerWithResolverArguments()
|
| 16 |
-
{
|
| 17 |
-
$mock = $this->createCallableMock();
|
| 18 |
-
$mock
|
| 19 |
-
->expects($this->once())
|
| 20 |
-
->method('__invoke')
|
| 21 |
-
->with($this->isType('callable'), $this->isType('callable'), $this->isType('callable'));
|
| 22 |
-
|
| 23 |
-
$adapter = $this->getPromiseTestAdapter($mock);
|
| 24 |
-
|
| 25 |
-
$adapter->promise()->cancel();
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/** @test */
|
| 29 |
-
public function cancelShouldFulfillPromiseIfCancellerFulfills()
|
| 30 |
-
{
|
| 31 |
-
$adapter = $this->getPromiseTestAdapter(function ($resolve) {
|
| 32 |
-
$resolve(1);
|
| 33 |
-
});
|
| 34 |
-
|
| 35 |
-
$mock = $this->createCallableMock();
|
| 36 |
-
$mock
|
| 37 |
-
->expects($this->once())
|
| 38 |
-
->method('__invoke')
|
| 39 |
-
->with($this->identicalTo(1));
|
| 40 |
-
|
| 41 |
-
$adapter->promise()
|
| 42 |
-
->then($mock, $this->expectCallableNever());
|
| 43 |
-
|
| 44 |
-
$adapter->promise()->cancel();
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/** @test */
|
| 48 |
-
public function cancelShouldRejectPromiseIfCancellerRejects()
|
| 49 |
-
{
|
| 50 |
-
$adapter = $this->getPromiseTestAdapter(function ($resolve, $reject) {
|
| 51 |
-
$reject(1);
|
| 52 |
-
});
|
| 53 |
-
|
| 54 |
-
$mock = $this->createCallableMock();
|
| 55 |
-
$mock
|
| 56 |
-
->expects($this->once())
|
| 57 |
-
->method('__invoke')
|
| 58 |
-
->with($this->identicalTo(1));
|
| 59 |
-
|
| 60 |
-
$adapter->promise()
|
| 61 |
-
->then($this->expectCallableNever(), $mock);
|
| 62 |
-
|
| 63 |
-
$adapter->promise()->cancel();
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
/** @test */
|
| 67 |
-
public function cancelShouldRejectPromiseWithExceptionIfCancellerThrows()
|
| 68 |
-
{
|
| 69 |
-
$e = new \Exception();
|
| 70 |
-
|
| 71 |
-
$adapter = $this->getPromiseTestAdapter(function () use ($e) {
|
| 72 |
-
throw $e;
|
| 73 |
-
});
|
| 74 |
-
|
| 75 |
-
$mock = $this->createCallableMock();
|
| 76 |
-
$mock
|
| 77 |
-
->expects($this->once())
|
| 78 |
-
->method('__invoke')
|
| 79 |
-
->with($this->identicalTo($e));
|
| 80 |
-
|
| 81 |
-
$adapter->promise()
|
| 82 |
-
->then($this->expectCallableNever(), $mock);
|
| 83 |
-
|
| 84 |
-
$adapter->promise()->cancel();
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/** @test */
|
| 88 |
-
public function cancelShouldProgressPromiseIfCancellerNotifies()
|
| 89 |
-
{
|
| 90 |
-
$adapter = $this->getPromiseTestAdapter(function ($resolve, $reject, $progress) {
|
| 91 |
-
$progress(1);
|
| 92 |
-
});
|
| 93 |
-
|
| 94 |
-
$mock = $this->createCallableMock();
|
| 95 |
-
$mock
|
| 96 |
-
->expects($this->once())
|
| 97 |
-
->method('__invoke')
|
| 98 |
-
->with($this->identicalTo(1));
|
| 99 |
-
|
| 100 |
-
$adapter->promise()
|
| 101 |
-
->then($this->expectCallableNever(), $this->expectCallableNever(), $mock);
|
| 102 |
-
|
| 103 |
-
$adapter->promise()->cancel();
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
/** @test */
|
| 107 |
-
public function cancelShouldCallCancellerOnlyOnceIfCancellerResolves()
|
| 108 |
-
{
|
| 109 |
-
$mock = $this->createCallableMock();
|
| 110 |
-
$mock
|
| 111 |
-
->expects($this->once())
|
| 112 |
-
->method('__invoke')
|
| 113 |
-
->will($this->returnCallback(function ($resolve) {
|
| 114 |
-
$resolve();
|
| 115 |
-
}));
|
| 116 |
-
|
| 117 |
-
$adapter = $this->getPromiseTestAdapter($mock);
|
| 118 |
-
|
| 119 |
-
$adapter->promise()->cancel();
|
| 120 |
-
$adapter->promise()->cancel();
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/** @test */
|
| 124 |
-
public function cancelShouldHaveNoEffectIfCancellerDoesNothing()
|
| 125 |
-
{
|
| 126 |
-
$adapter = $this->getPromiseTestAdapter(function () {});
|
| 127 |
-
|
| 128 |
-
$adapter->promise()
|
| 129 |
-
->then($this->expectCallableNever(), $this->expectCallableNever());
|
| 130 |
-
|
| 131 |
-
$adapter->promise()->cancel();
|
| 132 |
-
$adapter->promise()->cancel();
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/** @test */
|
| 136 |
-
public function cancelShouldCallCancellerFromDeepNestedPromiseChain()
|
| 137 |
-
{
|
| 138 |
-
$mock = $this->createCallableMock();
|
| 139 |
-
$mock
|
| 140 |
-
->expects($this->once())
|
| 141 |
-
->method('__invoke');
|
| 142 |
-
|
| 143 |
-
$adapter = $this->getPromiseTestAdapter($mock);
|
| 144 |
-
|
| 145 |
-
$promise = $adapter->promise()
|
| 146 |
-
->then(function () {
|
| 147 |
-
return new Promise\Promise(function () {});
|
| 148 |
-
})
|
| 149 |
-
->then(function () {
|
| 150 |
-
$d = new Promise\Deferred();
|
| 151 |
-
|
| 152 |
-
return $d->promise();
|
| 153 |
-
})
|
| 154 |
-
->then(function () {
|
| 155 |
-
return new Promise\Promise(function () {});
|
| 156 |
-
});
|
| 157 |
-
|
| 158 |
-
$promise->cancel();
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
/** @test */
|
| 162 |
-
public function cancelCalledOnChildrenSouldOnlyCancelWhenAllChildrenCancelled()
|
| 163 |
-
{
|
| 164 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableNever());
|
| 165 |
-
|
| 166 |
-
$child1 = $adapter->promise()
|
| 167 |
-
->then()
|
| 168 |
-
->then();
|
| 169 |
-
|
| 170 |
-
$adapter->promise()
|
| 171 |
-
->then();
|
| 172 |
-
|
| 173 |
-
$child1->cancel();
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
/** @test */
|
| 177 |
-
public function cancelShouldTriggerCancellerWhenAllChildrenCancel()
|
| 178 |
-
{
|
| 179 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableOnce());
|
| 180 |
-
|
| 181 |
-
$child1 = $adapter->promise()
|
| 182 |
-
->then()
|
| 183 |
-
->then();
|
| 184 |
-
|
| 185 |
-
$child2 = $adapter->promise()
|
| 186 |
-
->then();
|
| 187 |
-
|
| 188 |
-
$child1->cancel();
|
| 189 |
-
$child2->cancel();
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
/** @test */
|
| 193 |
-
public function cancelShouldAlwaysTriggerCancellerWhenCalledOnRootPromise()
|
| 194 |
-
{
|
| 195 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableOnce());
|
| 196 |
-
|
| 197 |
-
$adapter->promise()
|
| 198 |
-
->then()
|
| 199 |
-
->then();
|
| 200 |
-
|
| 201 |
-
$adapter->promise()
|
| 202 |
-
->then();
|
| 203 |
-
|
| 204 |
-
$adapter->promise()->cancel();
|
| 205 |
-
}
|
| 206 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/FullTestTrait.php
DELETED
|
@@ -1,15 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
trait FullTestTrait
|
| 6 |
-
{
|
| 7 |
-
use PromisePendingTestTrait,
|
| 8 |
-
PromiseSettledTestTrait,
|
| 9 |
-
PromiseFulfilledTestTrait,
|
| 10 |
-
PromiseRejectedTestTrait,
|
| 11 |
-
ResolveTestTrait,
|
| 12 |
-
RejectTestTrait,
|
| 13 |
-
NotifyTestTrait,
|
| 14 |
-
CancelTestTrait;
|
| 15 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/NotifyTestTrait.php
DELETED
|
@@ -1,336 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
trait NotifyTestTrait
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 9 |
-
*/
|
| 10 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 11 |
-
|
| 12 |
-
/** @test */
|
| 13 |
-
public function notifyShouldProgress()
|
| 14 |
-
{
|
| 15 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 16 |
-
|
| 17 |
-
$sentinel = new \stdClass();
|
| 18 |
-
|
| 19 |
-
$mock = $this->createCallableMock();
|
| 20 |
-
$mock
|
| 21 |
-
->expects($this->once())
|
| 22 |
-
->method('__invoke')
|
| 23 |
-
->with($sentinel);
|
| 24 |
-
|
| 25 |
-
$adapter->promise()
|
| 26 |
-
->then($this->expectCallableNever(), $this->expectCallableNever(), $mock);
|
| 27 |
-
|
| 28 |
-
$adapter->notify($sentinel);
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/** @test */
|
| 32 |
-
public function notifyShouldPropagateProgressToDownstreamPromises()
|
| 33 |
-
{
|
| 34 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 35 |
-
|
| 36 |
-
$sentinel = new \stdClass();
|
| 37 |
-
|
| 38 |
-
$mock = $this->createCallableMock();
|
| 39 |
-
$mock
|
| 40 |
-
->expects($this->once())
|
| 41 |
-
->method('__invoke')
|
| 42 |
-
->will($this->returnArgument(0));
|
| 43 |
-
|
| 44 |
-
$mock2 = $this->createCallableMock();
|
| 45 |
-
$mock2
|
| 46 |
-
->expects($this->once())
|
| 47 |
-
->method('__invoke')
|
| 48 |
-
->with($sentinel);
|
| 49 |
-
|
| 50 |
-
$adapter->promise()
|
| 51 |
-
->then(
|
| 52 |
-
$this->expectCallableNever(),
|
| 53 |
-
$this->expectCallableNever(),
|
| 54 |
-
$mock
|
| 55 |
-
)
|
| 56 |
-
->then(
|
| 57 |
-
$this->expectCallableNever(),
|
| 58 |
-
$this->expectCallableNever(),
|
| 59 |
-
$mock2
|
| 60 |
-
);
|
| 61 |
-
|
| 62 |
-
$adapter->notify($sentinel);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/** @test */
|
| 66 |
-
public function notifyShouldPropagateTransformedProgressToDownstreamPromises()
|
| 67 |
-
{
|
| 68 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 69 |
-
|
| 70 |
-
$sentinel = new \stdClass();
|
| 71 |
-
|
| 72 |
-
$mock = $this->createCallableMock();
|
| 73 |
-
$mock
|
| 74 |
-
->expects($this->once())
|
| 75 |
-
->method('__invoke')
|
| 76 |
-
->will($this->returnValue($sentinel));
|
| 77 |
-
|
| 78 |
-
$mock2 = $this->createCallableMock();
|
| 79 |
-
$mock2
|
| 80 |
-
->expects($this->once())
|
| 81 |
-
->method('__invoke')
|
| 82 |
-
->with($sentinel);
|
| 83 |
-
|
| 84 |
-
$adapter->promise()
|
| 85 |
-
->then(
|
| 86 |
-
$this->expectCallableNever(),
|
| 87 |
-
$this->expectCallableNever(),
|
| 88 |
-
$mock
|
| 89 |
-
)
|
| 90 |
-
->then(
|
| 91 |
-
$this->expectCallableNever(),
|
| 92 |
-
$this->expectCallableNever(),
|
| 93 |
-
$mock2
|
| 94 |
-
);
|
| 95 |
-
|
| 96 |
-
$adapter->notify(1);
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
/** @test */
|
| 100 |
-
public function notifyShouldPropagateCaughtExceptionValueAsProgress()
|
| 101 |
-
{
|
| 102 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 103 |
-
|
| 104 |
-
$exception = new \Exception();
|
| 105 |
-
|
| 106 |
-
$mock = $this->createCallableMock();
|
| 107 |
-
$mock
|
| 108 |
-
->expects($this->once())
|
| 109 |
-
->method('__invoke')
|
| 110 |
-
->will($this->throwException($exception));
|
| 111 |
-
|
| 112 |
-
$mock2 = $this->createCallableMock();
|
| 113 |
-
$mock2
|
| 114 |
-
->expects($this->once())
|
| 115 |
-
->method('__invoke')
|
| 116 |
-
->with($this->identicalTo($exception));
|
| 117 |
-
|
| 118 |
-
$adapter->promise()
|
| 119 |
-
->then(
|
| 120 |
-
$this->expectCallableNever(),
|
| 121 |
-
$this->expectCallableNever(),
|
| 122 |
-
$mock
|
| 123 |
-
)
|
| 124 |
-
->then(
|
| 125 |
-
$this->expectCallableNever(),
|
| 126 |
-
$this->expectCallableNever(),
|
| 127 |
-
$mock2
|
| 128 |
-
);
|
| 129 |
-
|
| 130 |
-
$adapter->notify(1);
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
/** @test */
|
| 134 |
-
public function notifyShouldForwardProgressEventsWhenIntermediaryCallbackTiedToAResolvedPromiseReturnsAPromise()
|
| 135 |
-
{
|
| 136 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 137 |
-
$adapter2 = $this->getPromiseTestAdapter();
|
| 138 |
-
|
| 139 |
-
$promise2 = $adapter2->promise();
|
| 140 |
-
|
| 141 |
-
$sentinel = new \stdClass();
|
| 142 |
-
|
| 143 |
-
$mock = $this->createCallableMock();
|
| 144 |
-
$mock
|
| 145 |
-
->expects($this->once())
|
| 146 |
-
->method('__invoke')
|
| 147 |
-
->with($sentinel);
|
| 148 |
-
|
| 149 |
-
// resolve BEFORE attaching progress handler
|
| 150 |
-
$adapter->resolve();
|
| 151 |
-
|
| 152 |
-
$adapter->promise()
|
| 153 |
-
->then(function () use ($promise2) {
|
| 154 |
-
return $promise2;
|
| 155 |
-
})
|
| 156 |
-
->then(
|
| 157 |
-
$this->expectCallableNever(),
|
| 158 |
-
$this->expectCallableNever(),
|
| 159 |
-
$mock
|
| 160 |
-
);
|
| 161 |
-
|
| 162 |
-
$adapter2->notify($sentinel);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
/** @test */
|
| 166 |
-
public function notifyShouldForwardProgressEventsWhenIntermediaryCallbackTiedToAnUnresolvedPromiseReturnsAPromise()
|
| 167 |
-
{
|
| 168 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 169 |
-
$adapter2 = $this->getPromiseTestAdapter();
|
| 170 |
-
|
| 171 |
-
$promise2 = $adapter2->promise();
|
| 172 |
-
|
| 173 |
-
$sentinel = new \stdClass();
|
| 174 |
-
|
| 175 |
-
$mock = $this->createCallableMock();
|
| 176 |
-
$mock
|
| 177 |
-
->expects($this->once())
|
| 178 |
-
->method('__invoke')
|
| 179 |
-
->with($sentinel);
|
| 180 |
-
|
| 181 |
-
$adapter->promise()
|
| 182 |
-
->then(function () use ($promise2) {
|
| 183 |
-
return $promise2;
|
| 184 |
-
})
|
| 185 |
-
->then(
|
| 186 |
-
$this->expectCallableNever(),
|
| 187 |
-
$this->expectCallableNever(),
|
| 188 |
-
$mock
|
| 189 |
-
);
|
| 190 |
-
|
| 191 |
-
// resolve AFTER attaching progress handler
|
| 192 |
-
$adapter->resolve();
|
| 193 |
-
$adapter2->notify($sentinel);
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
/** @test */
|
| 197 |
-
public function notifyShouldForwardProgressWhenResolvedWithAnotherPromise()
|
| 198 |
-
{
|
| 199 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 200 |
-
$adapter2 = $this->getPromiseTestAdapter();
|
| 201 |
-
|
| 202 |
-
$sentinel = new \stdClass();
|
| 203 |
-
|
| 204 |
-
$mock = $this->createCallableMock();
|
| 205 |
-
$mock
|
| 206 |
-
->expects($this->once())
|
| 207 |
-
->method('__invoke')
|
| 208 |
-
->will($this->returnValue($sentinel));
|
| 209 |
-
|
| 210 |
-
$mock2 = $this->createCallableMock();
|
| 211 |
-
$mock2
|
| 212 |
-
->expects($this->once())
|
| 213 |
-
->method('__invoke')
|
| 214 |
-
->with($sentinel);
|
| 215 |
-
|
| 216 |
-
$adapter->promise()
|
| 217 |
-
->then(
|
| 218 |
-
$this->expectCallableNever(),
|
| 219 |
-
$this->expectCallableNever(),
|
| 220 |
-
$mock
|
| 221 |
-
)
|
| 222 |
-
->then(
|
| 223 |
-
$this->expectCallableNever(),
|
| 224 |
-
$this->expectCallableNever(),
|
| 225 |
-
$mock2
|
| 226 |
-
);
|
| 227 |
-
|
| 228 |
-
$adapter->resolve($adapter2->promise());
|
| 229 |
-
$adapter2->notify($sentinel);
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
/** @test */
|
| 233 |
-
public function notifyShouldAllowResolveAfterProgress()
|
| 234 |
-
{
|
| 235 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 236 |
-
|
| 237 |
-
$mock = $this->createCallableMock();
|
| 238 |
-
$mock
|
| 239 |
-
->expects($this->at(0))
|
| 240 |
-
->method('__invoke')
|
| 241 |
-
->with($this->identicalTo(1));
|
| 242 |
-
$mock
|
| 243 |
-
->expects($this->at(1))
|
| 244 |
-
->method('__invoke')
|
| 245 |
-
->with($this->identicalTo(2));
|
| 246 |
-
|
| 247 |
-
$adapter->promise()
|
| 248 |
-
->then(
|
| 249 |
-
$mock,
|
| 250 |
-
$this->expectCallableNever(),
|
| 251 |
-
$mock
|
| 252 |
-
);
|
| 253 |
-
|
| 254 |
-
$adapter->notify(1);
|
| 255 |
-
$adapter->resolve(2);
|
| 256 |
-
}
|
| 257 |
-
|
| 258 |
-
/** @test */
|
| 259 |
-
public function notifyShouldAllowRejectAfterProgress()
|
| 260 |
-
{
|
| 261 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 262 |
-
|
| 263 |
-
$mock = $this->createCallableMock();
|
| 264 |
-
$mock
|
| 265 |
-
->expects($this->at(0))
|
| 266 |
-
->method('__invoke')
|
| 267 |
-
->with($this->identicalTo(1));
|
| 268 |
-
$mock
|
| 269 |
-
->expects($this->at(1))
|
| 270 |
-
->method('__invoke')
|
| 271 |
-
->with($this->identicalTo(2));
|
| 272 |
-
|
| 273 |
-
$adapter->promise()
|
| 274 |
-
->then(
|
| 275 |
-
$this->expectCallableNever(),
|
| 276 |
-
$mock,
|
| 277 |
-
$mock
|
| 278 |
-
);
|
| 279 |
-
|
| 280 |
-
$adapter->notify(1);
|
| 281 |
-
$adapter->reject(2);
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
/** @test */
|
| 285 |
-
public function notifyShouldReturnSilentlyOnProgressWhenAlreadyRejected()
|
| 286 |
-
{
|
| 287 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 288 |
-
|
| 289 |
-
$adapter->reject(1);
|
| 290 |
-
|
| 291 |
-
$this->assertNull($adapter->notify());
|
| 292 |
-
}
|
| 293 |
-
|
| 294 |
-
/** @test */
|
| 295 |
-
public function notifyShouldInvokeProgressHandler()
|
| 296 |
-
{
|
| 297 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 298 |
-
|
| 299 |
-
$mock = $this->createCallableMock();
|
| 300 |
-
$mock
|
| 301 |
-
->expects($this->once())
|
| 302 |
-
->method('__invoke')
|
| 303 |
-
->with($this->identicalTo(1));
|
| 304 |
-
|
| 305 |
-
$adapter->promise()->progress($mock);
|
| 306 |
-
$adapter->notify(1);
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
/** @test */
|
| 310 |
-
public function notifyShouldInvokeProgressHandlerFromDone()
|
| 311 |
-
{
|
| 312 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 313 |
-
|
| 314 |
-
$mock = $this->createCallableMock();
|
| 315 |
-
$mock
|
| 316 |
-
->expects($this->once())
|
| 317 |
-
->method('__invoke')
|
| 318 |
-
->with($this->identicalTo(1));
|
| 319 |
-
|
| 320 |
-
$this->assertNull($adapter->promise()->done(null, null, $mock));
|
| 321 |
-
$adapter->notify(1);
|
| 322 |
-
}
|
| 323 |
-
|
| 324 |
-
/** @test */
|
| 325 |
-
public function notifyShouldThrowExceptionThrownProgressHandlerFromDone()
|
| 326 |
-
{
|
| 327 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 328 |
-
|
| 329 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 330 |
-
|
| 331 |
-
$this->assertNull($adapter->promise()->done(null, null, function () {
|
| 332 |
-
throw new \Exception('UnhandledRejectionException');
|
| 333 |
-
}));
|
| 334 |
-
$adapter->notify(1);
|
| 335 |
-
}
|
| 336 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/PromiseFulfilledTestTrait.php
DELETED
|
@@ -1,351 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
trait PromiseFulfilledTestTrait
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 9 |
-
*/
|
| 10 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 11 |
-
|
| 12 |
-
/** @test */
|
| 13 |
-
public function fulfilledPromiseShouldBeImmutable()
|
| 14 |
-
{
|
| 15 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 16 |
-
|
| 17 |
-
$mock = $this->createCallableMock();
|
| 18 |
-
$mock
|
| 19 |
-
->expects($this->once())
|
| 20 |
-
->method('__invoke')
|
| 21 |
-
->with($this->identicalTo(1));
|
| 22 |
-
|
| 23 |
-
$adapter->resolve(1);
|
| 24 |
-
$adapter->resolve(2);
|
| 25 |
-
|
| 26 |
-
$adapter->promise()
|
| 27 |
-
->then(
|
| 28 |
-
$mock,
|
| 29 |
-
$this->expectCallableNever()
|
| 30 |
-
);
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
/** @test */
|
| 34 |
-
public function fulfilledPromiseShouldInvokeNewlyAddedCallback()
|
| 35 |
-
{
|
| 36 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 37 |
-
|
| 38 |
-
$adapter->resolve(1);
|
| 39 |
-
|
| 40 |
-
$mock = $this->createCallableMock();
|
| 41 |
-
$mock
|
| 42 |
-
->expects($this->once())
|
| 43 |
-
->method('__invoke')
|
| 44 |
-
->with($this->identicalTo(1));
|
| 45 |
-
|
| 46 |
-
$adapter->promise()
|
| 47 |
-
->then($mock, $this->expectCallableNever());
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/** @test */
|
| 51 |
-
public function thenShouldForwardResultWhenCallbackIsNull()
|
| 52 |
-
{
|
| 53 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 54 |
-
|
| 55 |
-
$mock = $this->createCallableMock();
|
| 56 |
-
$mock
|
| 57 |
-
->expects($this->once())
|
| 58 |
-
->method('__invoke')
|
| 59 |
-
->with($this->identicalTo(1));
|
| 60 |
-
|
| 61 |
-
$adapter->resolve(1);
|
| 62 |
-
$adapter->promise()
|
| 63 |
-
->then(
|
| 64 |
-
null,
|
| 65 |
-
$this->expectCallableNever()
|
| 66 |
-
)
|
| 67 |
-
->then(
|
| 68 |
-
$mock,
|
| 69 |
-
$this->expectCallableNever()
|
| 70 |
-
);
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/** @test */
|
| 74 |
-
public function thenShouldForwardCallbackResultToNextCallback()
|
| 75 |
-
{
|
| 76 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 77 |
-
|
| 78 |
-
$mock = $this->createCallableMock();
|
| 79 |
-
$mock
|
| 80 |
-
->expects($this->once())
|
| 81 |
-
->method('__invoke')
|
| 82 |
-
->with($this->identicalTo(2));
|
| 83 |
-
|
| 84 |
-
$adapter->resolve(1);
|
| 85 |
-
$adapter->promise()
|
| 86 |
-
->then(
|
| 87 |
-
function ($val) {
|
| 88 |
-
return $val + 1;
|
| 89 |
-
},
|
| 90 |
-
$this->expectCallableNever()
|
| 91 |
-
)
|
| 92 |
-
->then(
|
| 93 |
-
$mock,
|
| 94 |
-
$this->expectCallableNever()
|
| 95 |
-
);
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/** @test */
|
| 99 |
-
public function thenShouldForwardPromisedCallbackResultValueToNextCallback()
|
| 100 |
-
{
|
| 101 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 102 |
-
|
| 103 |
-
$mock = $this->createCallableMock();
|
| 104 |
-
$mock
|
| 105 |
-
->expects($this->once())
|
| 106 |
-
->method('__invoke')
|
| 107 |
-
->with($this->identicalTo(2));
|
| 108 |
-
|
| 109 |
-
$adapter->resolve(1);
|
| 110 |
-
$adapter->promise()
|
| 111 |
-
->then(
|
| 112 |
-
function ($val) {
|
| 113 |
-
return \React\Promise\resolve($val + 1);
|
| 114 |
-
},
|
| 115 |
-
$this->expectCallableNever()
|
| 116 |
-
)
|
| 117 |
-
->then(
|
| 118 |
-
$mock,
|
| 119 |
-
$this->expectCallableNever()
|
| 120 |
-
);
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/** @test */
|
| 124 |
-
public function thenShouldSwitchFromCallbacksToErrbacksWhenCallbackReturnsARejection()
|
| 125 |
-
{
|
| 126 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 127 |
-
|
| 128 |
-
$mock = $this->createCallableMock();
|
| 129 |
-
$mock
|
| 130 |
-
->expects($this->once())
|
| 131 |
-
->method('__invoke')
|
| 132 |
-
->with($this->identicalTo(2));
|
| 133 |
-
|
| 134 |
-
$adapter->resolve(1);
|
| 135 |
-
$adapter->promise()
|
| 136 |
-
->then(
|
| 137 |
-
function ($val) {
|
| 138 |
-
return \React\Promise\reject($val + 1);
|
| 139 |
-
},
|
| 140 |
-
$this->expectCallableNever()
|
| 141 |
-
)
|
| 142 |
-
->then(
|
| 143 |
-
$this->expectCallableNever(),
|
| 144 |
-
$mock
|
| 145 |
-
);
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
/** @test */
|
| 149 |
-
public function thenShouldSwitchFromCallbacksToErrbacksWhenCallbackThrows()
|
| 150 |
-
{
|
| 151 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 152 |
-
|
| 153 |
-
$exception = new \Exception();
|
| 154 |
-
|
| 155 |
-
$mock = $this->createCallableMock();
|
| 156 |
-
$mock
|
| 157 |
-
->expects($this->once())
|
| 158 |
-
->method('__invoke')
|
| 159 |
-
->will($this->throwException($exception));
|
| 160 |
-
|
| 161 |
-
$mock2 = $this->createCallableMock();
|
| 162 |
-
$mock2
|
| 163 |
-
->expects($this->once())
|
| 164 |
-
->method('__invoke')
|
| 165 |
-
->with($this->identicalTo($exception));
|
| 166 |
-
|
| 167 |
-
$adapter->resolve(1);
|
| 168 |
-
$adapter->promise()
|
| 169 |
-
->then(
|
| 170 |
-
$mock,
|
| 171 |
-
$this->expectCallableNever()
|
| 172 |
-
)
|
| 173 |
-
->then(
|
| 174 |
-
$this->expectCallableNever(),
|
| 175 |
-
$mock2
|
| 176 |
-
);
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
/** @test */
|
| 180 |
-
public function cancelShouldReturnNullForFulfilledPromise()
|
| 181 |
-
{
|
| 182 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 183 |
-
|
| 184 |
-
$adapter->resolve();
|
| 185 |
-
|
| 186 |
-
$this->assertNull($adapter->promise()->cancel());
|
| 187 |
-
}
|
| 188 |
-
|
| 189 |
-
/** @test */
|
| 190 |
-
public function cancelShouldHaveNoEffectForFulfilledPromise()
|
| 191 |
-
{
|
| 192 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableNever());
|
| 193 |
-
|
| 194 |
-
$adapter->resolve();
|
| 195 |
-
|
| 196 |
-
$adapter->promise()->cancel();
|
| 197 |
-
}
|
| 198 |
-
|
| 199 |
-
/** @test */
|
| 200 |
-
public function doneShouldInvokeFulfillmentHandlerForFulfilledPromise()
|
| 201 |
-
{
|
| 202 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 203 |
-
|
| 204 |
-
$mock = $this->createCallableMock();
|
| 205 |
-
$mock
|
| 206 |
-
->expects($this->once())
|
| 207 |
-
->method('__invoke')
|
| 208 |
-
->with($this->identicalTo(1));
|
| 209 |
-
|
| 210 |
-
$adapter->resolve(1);
|
| 211 |
-
$this->assertNull($adapter->promise()->done($mock));
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
/** @test */
|
| 215 |
-
public function doneShouldThrowExceptionThrownFulfillmentHandlerForFulfilledPromise()
|
| 216 |
-
{
|
| 217 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 218 |
-
|
| 219 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 220 |
-
|
| 221 |
-
$adapter->resolve(1);
|
| 222 |
-
$this->assertNull($adapter->promise()->done(function () {
|
| 223 |
-
throw new \Exception('UnhandledRejectionException');
|
| 224 |
-
}));
|
| 225 |
-
}
|
| 226 |
-
|
| 227 |
-
/** @test */
|
| 228 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenFulfillmentHandlerRejectsForFulfilledPromise()
|
| 229 |
-
{
|
| 230 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 231 |
-
|
| 232 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 233 |
-
|
| 234 |
-
$adapter->resolve(1);
|
| 235 |
-
$this->assertNull($adapter->promise()->done(function () {
|
| 236 |
-
return \React\Promise\reject();
|
| 237 |
-
}));
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
/** @test */
|
| 241 |
-
public function otherwiseShouldNotInvokeRejectionHandlerForFulfilledPromise()
|
| 242 |
-
{
|
| 243 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 244 |
-
|
| 245 |
-
$adapter->resolve(1);
|
| 246 |
-
$adapter->promise()->otherwise($this->expectCallableNever());
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
/** @test */
|
| 250 |
-
public function alwaysShouldNotSuppressValueForFulfilledPromise()
|
| 251 |
-
{
|
| 252 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 253 |
-
|
| 254 |
-
$value = new \stdClass();
|
| 255 |
-
|
| 256 |
-
$mock = $this->createCallableMock();
|
| 257 |
-
$mock
|
| 258 |
-
->expects($this->once())
|
| 259 |
-
->method('__invoke')
|
| 260 |
-
->with($this->identicalTo($value));
|
| 261 |
-
|
| 262 |
-
$adapter->resolve($value);
|
| 263 |
-
$adapter->promise()
|
| 264 |
-
->always(function () {})
|
| 265 |
-
->then($mock);
|
| 266 |
-
}
|
| 267 |
-
|
| 268 |
-
/** @test */
|
| 269 |
-
public function alwaysShouldNotSuppressValueWhenHandlerReturnsANonPromiseForFulfilledPromise()
|
| 270 |
-
{
|
| 271 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 272 |
-
|
| 273 |
-
$value = new \stdClass();
|
| 274 |
-
|
| 275 |
-
$mock = $this->createCallableMock();
|
| 276 |
-
$mock
|
| 277 |
-
->expects($this->once())
|
| 278 |
-
->method('__invoke')
|
| 279 |
-
->with($this->identicalTo($value));
|
| 280 |
-
|
| 281 |
-
$adapter->resolve($value);
|
| 282 |
-
$adapter->promise()
|
| 283 |
-
->always(function () {
|
| 284 |
-
return 1;
|
| 285 |
-
})
|
| 286 |
-
->then($mock);
|
| 287 |
-
}
|
| 288 |
-
|
| 289 |
-
/** @test */
|
| 290 |
-
public function alwaysShouldNotSuppressValueWhenHandlerReturnsAPromiseForFulfilledPromise()
|
| 291 |
-
{
|
| 292 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 293 |
-
|
| 294 |
-
$value = new \stdClass();
|
| 295 |
-
|
| 296 |
-
$mock = $this->createCallableMock();
|
| 297 |
-
$mock
|
| 298 |
-
->expects($this->once())
|
| 299 |
-
->method('__invoke')
|
| 300 |
-
->with($this->identicalTo($value));
|
| 301 |
-
|
| 302 |
-
$adapter->resolve($value);
|
| 303 |
-
$adapter->promise()
|
| 304 |
-
->always(function () {
|
| 305 |
-
return \React\Promise\resolve(1);
|
| 306 |
-
})
|
| 307 |
-
->then($mock);
|
| 308 |
-
}
|
| 309 |
-
|
| 310 |
-
/** @test */
|
| 311 |
-
public function alwaysShouldRejectWhenHandlerThrowsForFulfilledPromise()
|
| 312 |
-
{
|
| 313 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 314 |
-
|
| 315 |
-
$exception = new \Exception();
|
| 316 |
-
|
| 317 |
-
$mock = $this->createCallableMock();
|
| 318 |
-
$mock
|
| 319 |
-
->expects($this->once())
|
| 320 |
-
->method('__invoke')
|
| 321 |
-
->with($this->identicalTo($exception));
|
| 322 |
-
|
| 323 |
-
$adapter->resolve(1);
|
| 324 |
-
$adapter->promise()
|
| 325 |
-
->always(function () use ($exception) {
|
| 326 |
-
throw $exception;
|
| 327 |
-
})
|
| 328 |
-
->then(null, $mock);
|
| 329 |
-
}
|
| 330 |
-
|
| 331 |
-
/** @test */
|
| 332 |
-
public function alwaysShouldRejectWhenHandlerRejectsForFulfilledPromise()
|
| 333 |
-
{
|
| 334 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 335 |
-
|
| 336 |
-
$exception = new \Exception();
|
| 337 |
-
|
| 338 |
-
$mock = $this->createCallableMock();
|
| 339 |
-
$mock
|
| 340 |
-
->expects($this->once())
|
| 341 |
-
->method('__invoke')
|
| 342 |
-
->with($this->identicalTo($exception));
|
| 343 |
-
|
| 344 |
-
$adapter->resolve(1);
|
| 345 |
-
$adapter->promise()
|
| 346 |
-
->always(function () use ($exception) {
|
| 347 |
-
return \React\Promise\reject($exception);
|
| 348 |
-
})
|
| 349 |
-
->then(null, $mock);
|
| 350 |
-
}
|
| 351 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/PromisePendingTestTrait.php
DELETED
|
@@ -1,68 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
trait PromisePendingTestTrait
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 9 |
-
*/
|
| 10 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 11 |
-
|
| 12 |
-
/** @test */
|
| 13 |
-
public function thenShouldReturnAPromiseForPendingPromise()
|
| 14 |
-
{
|
| 15 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 16 |
-
|
| 17 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->then());
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
/** @test */
|
| 21 |
-
public function thenShouldReturnAllowNullForPendingPromise()
|
| 22 |
-
{
|
| 23 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 24 |
-
|
| 25 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->then(null, null, null));
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/** @test */
|
| 29 |
-
public function cancelShouldReturnNullForPendingPromise()
|
| 30 |
-
{
|
| 31 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 32 |
-
|
| 33 |
-
$this->assertNull($adapter->promise()->cancel());
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/** @test */
|
| 37 |
-
public function doneShouldReturnNullForPendingPromise()
|
| 38 |
-
{
|
| 39 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 40 |
-
|
| 41 |
-
$this->assertNull($adapter->promise()->done());
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/** @test */
|
| 45 |
-
public function doneShouldReturnAllowNullForPendingPromise()
|
| 46 |
-
{
|
| 47 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 48 |
-
|
| 49 |
-
$this->assertNull($adapter->promise()->done(null, null, null));
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/** @test */
|
| 53 |
-
public function otherwiseShouldNotInvokeRejectionHandlerForPendingPromise()
|
| 54 |
-
{
|
| 55 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 56 |
-
|
| 57 |
-
$adapter->settle();
|
| 58 |
-
$adapter->promise()->otherwise($this->expectCallableNever());
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/** @test */
|
| 62 |
-
public function alwaysShouldReturnAPromiseForPendingPromise()
|
| 63 |
-
{
|
| 64 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 65 |
-
|
| 66 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->always(function () {}));
|
| 67 |
-
}
|
| 68 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/PromiseRejectedTestTrait.php
DELETED
|
@@ -1,492 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
use React\Promise\Deferred;
|
| 6 |
-
|
| 7 |
-
trait PromiseRejectedTestTrait
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 11 |
-
*/
|
| 12 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 13 |
-
|
| 14 |
-
/** @test */
|
| 15 |
-
public function rejectedPromiseShouldBeImmutable()
|
| 16 |
-
{
|
| 17 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 18 |
-
|
| 19 |
-
$mock = $this->createCallableMock();
|
| 20 |
-
$mock
|
| 21 |
-
->expects($this->once())
|
| 22 |
-
->method('__invoke')
|
| 23 |
-
->with($this->identicalTo(1));
|
| 24 |
-
|
| 25 |
-
$adapter->reject(1);
|
| 26 |
-
$adapter->reject(2);
|
| 27 |
-
|
| 28 |
-
$adapter->promise()
|
| 29 |
-
->then(
|
| 30 |
-
$this->expectCallableNever(),
|
| 31 |
-
$mock
|
| 32 |
-
);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
/** @test */
|
| 36 |
-
public function rejectedPromiseShouldInvokeNewlyAddedCallback()
|
| 37 |
-
{
|
| 38 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 39 |
-
|
| 40 |
-
$adapter->reject(1);
|
| 41 |
-
|
| 42 |
-
$mock = $this->createCallableMock();
|
| 43 |
-
$mock
|
| 44 |
-
->expects($this->once())
|
| 45 |
-
->method('__invoke')
|
| 46 |
-
->with($this->identicalTo(1));
|
| 47 |
-
|
| 48 |
-
$adapter->promise()
|
| 49 |
-
->then($this->expectCallableNever(), $mock);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/** @test */
|
| 53 |
-
public function shouldForwardUndefinedRejectionValue()
|
| 54 |
-
{
|
| 55 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 56 |
-
|
| 57 |
-
$mock = $this->createCallableMock();
|
| 58 |
-
$mock
|
| 59 |
-
->expects($this->once())
|
| 60 |
-
->method('__invoke')
|
| 61 |
-
->with(null);
|
| 62 |
-
|
| 63 |
-
$adapter->reject(1);
|
| 64 |
-
$adapter->promise()
|
| 65 |
-
->then(
|
| 66 |
-
$this->expectCallableNever(),
|
| 67 |
-
function () {
|
| 68 |
-
// Presence of rejection handler is enough to switch back
|
| 69 |
-
// to resolve mode, even though it returns undefined.
|
| 70 |
-
// The ONLY way to propagate a rejection is to re-throw or
|
| 71 |
-
// return a rejected promise;
|
| 72 |
-
}
|
| 73 |
-
)
|
| 74 |
-
->then(
|
| 75 |
-
$mock,
|
| 76 |
-
$this->expectCallableNever()
|
| 77 |
-
);
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
/** @test */
|
| 81 |
-
public function shouldSwitchFromErrbacksToCallbacksWhenErrbackDoesNotExplicitlyPropagate()
|
| 82 |
-
{
|
| 83 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 84 |
-
|
| 85 |
-
$mock = $this->createCallableMock();
|
| 86 |
-
$mock
|
| 87 |
-
->expects($this->once())
|
| 88 |
-
->method('__invoke')
|
| 89 |
-
->with($this->identicalTo(2));
|
| 90 |
-
|
| 91 |
-
$adapter->reject(1);
|
| 92 |
-
$adapter->promise()
|
| 93 |
-
->then(
|
| 94 |
-
$this->expectCallableNever(),
|
| 95 |
-
function ($val) {
|
| 96 |
-
return $val + 1;
|
| 97 |
-
}
|
| 98 |
-
)
|
| 99 |
-
->then(
|
| 100 |
-
$mock,
|
| 101 |
-
$this->expectCallableNever()
|
| 102 |
-
);
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
/** @test */
|
| 106 |
-
public function shouldSwitchFromErrbacksToCallbacksWhenErrbackReturnsAResolution()
|
| 107 |
-
{
|
| 108 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 109 |
-
|
| 110 |
-
$mock = $this->createCallableMock();
|
| 111 |
-
$mock
|
| 112 |
-
->expects($this->once())
|
| 113 |
-
->method('__invoke')
|
| 114 |
-
->with($this->identicalTo(2));
|
| 115 |
-
|
| 116 |
-
$adapter->reject(1);
|
| 117 |
-
$adapter->promise()
|
| 118 |
-
->then(
|
| 119 |
-
$this->expectCallableNever(),
|
| 120 |
-
function ($val) {
|
| 121 |
-
return \React\Promise\resolve($val + 1);
|
| 122 |
-
}
|
| 123 |
-
)
|
| 124 |
-
->then(
|
| 125 |
-
$mock,
|
| 126 |
-
$this->expectCallableNever()
|
| 127 |
-
);
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/** @test */
|
| 131 |
-
public function shouldPropagateRejectionsWhenErrbackThrows()
|
| 132 |
-
{
|
| 133 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 134 |
-
|
| 135 |
-
$exception = new \Exception();
|
| 136 |
-
|
| 137 |
-
$mock = $this->createCallableMock();
|
| 138 |
-
$mock
|
| 139 |
-
->expects($this->once())
|
| 140 |
-
->method('__invoke')
|
| 141 |
-
->will($this->throwException($exception));
|
| 142 |
-
|
| 143 |
-
$mock2 = $this->createCallableMock();
|
| 144 |
-
$mock2
|
| 145 |
-
->expects($this->once())
|
| 146 |
-
->method('__invoke')
|
| 147 |
-
->with($this->identicalTo($exception));
|
| 148 |
-
|
| 149 |
-
$adapter->reject(1);
|
| 150 |
-
$adapter->promise()
|
| 151 |
-
->then(
|
| 152 |
-
$this->expectCallableNever(),
|
| 153 |
-
$mock
|
| 154 |
-
)
|
| 155 |
-
->then(
|
| 156 |
-
$this->expectCallableNever(),
|
| 157 |
-
$mock2
|
| 158 |
-
);
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
/** @test */
|
| 162 |
-
public function shouldPropagateRejectionsWhenErrbackReturnsARejection()
|
| 163 |
-
{
|
| 164 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 165 |
-
|
| 166 |
-
$mock = $this->createCallableMock();
|
| 167 |
-
$mock
|
| 168 |
-
->expects($this->once())
|
| 169 |
-
->method('__invoke')
|
| 170 |
-
->with($this->identicalTo(2));
|
| 171 |
-
|
| 172 |
-
$adapter->reject(1);
|
| 173 |
-
$adapter->promise()
|
| 174 |
-
->then(
|
| 175 |
-
$this->expectCallableNever(),
|
| 176 |
-
function ($val) {
|
| 177 |
-
return \React\Promise\reject($val + 1);
|
| 178 |
-
}
|
| 179 |
-
)
|
| 180 |
-
->then(
|
| 181 |
-
$this->expectCallableNever(),
|
| 182 |
-
$mock
|
| 183 |
-
);
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
/** @test */
|
| 187 |
-
public function doneShouldInvokeRejectionHandlerForRejectedPromise()
|
| 188 |
-
{
|
| 189 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 190 |
-
|
| 191 |
-
$mock = $this->createCallableMock();
|
| 192 |
-
$mock
|
| 193 |
-
->expects($this->once())
|
| 194 |
-
->method('__invoke')
|
| 195 |
-
->with($this->identicalTo(1));
|
| 196 |
-
|
| 197 |
-
$adapter->reject(1);
|
| 198 |
-
$this->assertNull($adapter->promise()->done(null, $mock));
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
/** @test */
|
| 202 |
-
public function doneShouldThrowExceptionThrownByRejectionHandlerForRejectedPromise()
|
| 203 |
-
{
|
| 204 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 205 |
-
|
| 206 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 207 |
-
|
| 208 |
-
$adapter->reject(1);
|
| 209 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 210 |
-
throw new \Exception('UnhandledRejectionException');
|
| 211 |
-
}));
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
/** @test */
|
| 215 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenRejectedWithNonExceptionForRejectedPromise()
|
| 216 |
-
{
|
| 217 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 218 |
-
|
| 219 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 220 |
-
|
| 221 |
-
$adapter->reject(1);
|
| 222 |
-
$this->assertNull($adapter->promise()->done());
|
| 223 |
-
}
|
| 224 |
-
|
| 225 |
-
/** @test */
|
| 226 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenRejectionHandlerRejectsForRejectedPromise()
|
| 227 |
-
{
|
| 228 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 229 |
-
|
| 230 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 231 |
-
|
| 232 |
-
$adapter->reject(1);
|
| 233 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 234 |
-
return \React\Promise\reject();
|
| 235 |
-
}));
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
/** @test */
|
| 239 |
-
public function doneShouldThrowRejectionExceptionWhenRejectionHandlerRejectsWithExceptionForRejectedPromise()
|
| 240 |
-
{
|
| 241 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 242 |
-
|
| 243 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 244 |
-
|
| 245 |
-
$adapter->reject(1);
|
| 246 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 247 |
-
return \React\Promise\reject(new \Exception('UnhandledRejectionException'));
|
| 248 |
-
}));
|
| 249 |
-
}
|
| 250 |
-
|
| 251 |
-
/** @test */
|
| 252 |
-
public function doneShouldThrowExceptionProvidedAsRejectionValueForRejectedPromise()
|
| 253 |
-
{
|
| 254 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 255 |
-
|
| 256 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 257 |
-
|
| 258 |
-
$adapter->reject(new \Exception('UnhandledRejectionException'));
|
| 259 |
-
$this->assertNull($adapter->promise()->done());
|
| 260 |
-
}
|
| 261 |
-
|
| 262 |
-
/** @test */
|
| 263 |
-
public function doneShouldThrowWithDeepNestingPromiseChainsForRejectedPromise()
|
| 264 |
-
{
|
| 265 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 266 |
-
|
| 267 |
-
$exception = new \Exception('UnhandledRejectionException');
|
| 268 |
-
|
| 269 |
-
$d = new Deferred();
|
| 270 |
-
$d->resolve();
|
| 271 |
-
|
| 272 |
-
$result = \React\Promise\resolve(\React\Promise\resolve($d->promise()->then(function () use ($exception) {
|
| 273 |
-
$d = new Deferred();
|
| 274 |
-
$d->resolve();
|
| 275 |
-
|
| 276 |
-
return \React\Promise\resolve($d->promise()->then(function () {}))->then(
|
| 277 |
-
function () use ($exception) {
|
| 278 |
-
throw $exception;
|
| 279 |
-
}
|
| 280 |
-
);
|
| 281 |
-
})));
|
| 282 |
-
|
| 283 |
-
$result->done();
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
/** @test */
|
| 287 |
-
public function doneShouldRecoverWhenRejectionHandlerCatchesExceptionForRejectedPromise()
|
| 288 |
-
{
|
| 289 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 290 |
-
|
| 291 |
-
$adapter->reject(new \Exception('UnhandledRejectionException'));
|
| 292 |
-
$this->assertNull($adapter->promise()->done(null, function (\Exception $e) {
|
| 293 |
-
|
| 294 |
-
}));
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
/** @test */
|
| 298 |
-
public function otherwiseShouldInvokeRejectionHandlerForRejectedPromise()
|
| 299 |
-
{
|
| 300 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 301 |
-
|
| 302 |
-
$mock = $this->createCallableMock();
|
| 303 |
-
$mock
|
| 304 |
-
->expects($this->once())
|
| 305 |
-
->method('__invoke')
|
| 306 |
-
->with($this->identicalTo(1));
|
| 307 |
-
|
| 308 |
-
$adapter->reject(1);
|
| 309 |
-
$adapter->promise()->otherwise($mock);
|
| 310 |
-
}
|
| 311 |
-
|
| 312 |
-
/** @test */
|
| 313 |
-
public function otherwiseShouldInvokeNonTypeHintedRejectionHandlerIfReasonIsAnExceptionForRejectedPromise()
|
| 314 |
-
{
|
| 315 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 316 |
-
|
| 317 |
-
$exception = new \Exception();
|
| 318 |
-
|
| 319 |
-
$mock = $this->createCallableMock();
|
| 320 |
-
$mock
|
| 321 |
-
->expects($this->once())
|
| 322 |
-
->method('__invoke')
|
| 323 |
-
->with($this->identicalTo($exception));
|
| 324 |
-
|
| 325 |
-
$adapter->reject($exception);
|
| 326 |
-
$adapter->promise()
|
| 327 |
-
->otherwise(function ($reason) use ($mock) {
|
| 328 |
-
$mock($reason);
|
| 329 |
-
});
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
/** @test */
|
| 333 |
-
public function otherwiseShouldInvokeRejectionHandlerIfReasonMatchesTypehintForRejectedPromise()
|
| 334 |
-
{
|
| 335 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 336 |
-
|
| 337 |
-
$exception = new \InvalidArgumentException();
|
| 338 |
-
|
| 339 |
-
$mock = $this->createCallableMock();
|
| 340 |
-
$mock
|
| 341 |
-
->expects($this->once())
|
| 342 |
-
->method('__invoke')
|
| 343 |
-
->with($this->identicalTo($exception));
|
| 344 |
-
|
| 345 |
-
$adapter->reject($exception);
|
| 346 |
-
$adapter->promise()
|
| 347 |
-
->otherwise(function (\InvalidArgumentException $reason) use ($mock) {
|
| 348 |
-
$mock($reason);
|
| 349 |
-
});
|
| 350 |
-
}
|
| 351 |
-
|
| 352 |
-
/** @test */
|
| 353 |
-
public function otherwiseShouldNotInvokeRejectionHandlerIfReaonsDoesNotMatchTypehintForRejectedPromise()
|
| 354 |
-
{
|
| 355 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 356 |
-
|
| 357 |
-
$exception = new \Exception();
|
| 358 |
-
|
| 359 |
-
$mock = $this->expectCallableNever();
|
| 360 |
-
|
| 361 |
-
$adapter->reject($exception);
|
| 362 |
-
$adapter->promise()
|
| 363 |
-
->otherwise(function (\InvalidArgumentException $reason) use ($mock) {
|
| 364 |
-
$mock($reason);
|
| 365 |
-
});
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
/** @test */
|
| 369 |
-
public function alwaysShouldNotSuppressRejectionForRejectedPromise()
|
| 370 |
-
{
|
| 371 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 372 |
-
|
| 373 |
-
$exception = new \Exception();
|
| 374 |
-
|
| 375 |
-
$mock = $this->createCallableMock();
|
| 376 |
-
$mock
|
| 377 |
-
->expects($this->once())
|
| 378 |
-
->method('__invoke')
|
| 379 |
-
->with($this->identicalTo($exception));
|
| 380 |
-
|
| 381 |
-
$adapter->reject($exception);
|
| 382 |
-
$adapter->promise()
|
| 383 |
-
->always(function () {})
|
| 384 |
-
->then(null, $mock);
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
/** @test */
|
| 388 |
-
public function alwaysShouldNotSuppressRejectionWhenHandlerReturnsANonPromiseForRejectedPromise()
|
| 389 |
-
{
|
| 390 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 391 |
-
|
| 392 |
-
$exception = new \Exception();
|
| 393 |
-
|
| 394 |
-
$mock = $this->createCallableMock();
|
| 395 |
-
$mock
|
| 396 |
-
->expects($this->once())
|
| 397 |
-
->method('__invoke')
|
| 398 |
-
->with($this->identicalTo($exception));
|
| 399 |
-
|
| 400 |
-
$adapter->reject($exception);
|
| 401 |
-
$adapter->promise()
|
| 402 |
-
->always(function () {
|
| 403 |
-
return 1;
|
| 404 |
-
})
|
| 405 |
-
->then(null, $mock);
|
| 406 |
-
}
|
| 407 |
-
|
| 408 |
-
/** @test */
|
| 409 |
-
public function alwaysShouldNotSuppressRejectionWhenHandlerReturnsAPromiseForRejectedPromise()
|
| 410 |
-
{
|
| 411 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 412 |
-
|
| 413 |
-
$exception = new \Exception();
|
| 414 |
-
|
| 415 |
-
$mock = $this->createCallableMock();
|
| 416 |
-
$mock
|
| 417 |
-
->expects($this->once())
|
| 418 |
-
->method('__invoke')
|
| 419 |
-
->with($this->identicalTo($exception));
|
| 420 |
-
|
| 421 |
-
$adapter->reject($exception);
|
| 422 |
-
$adapter->promise()
|
| 423 |
-
->always(function () {
|
| 424 |
-
return \React\Promise\resolve(1);
|
| 425 |
-
})
|
| 426 |
-
->then(null, $mock);
|
| 427 |
-
}
|
| 428 |
-
|
| 429 |
-
/** @test */
|
| 430 |
-
public function alwaysShouldRejectWhenHandlerThrowsForRejectedPromise()
|
| 431 |
-
{
|
| 432 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 433 |
-
|
| 434 |
-
$exception1 = new \Exception();
|
| 435 |
-
$exception2 = new \Exception();
|
| 436 |
-
|
| 437 |
-
$mock = $this->createCallableMock();
|
| 438 |
-
$mock
|
| 439 |
-
->expects($this->once())
|
| 440 |
-
->method('__invoke')
|
| 441 |
-
->with($this->identicalTo($exception2));
|
| 442 |
-
|
| 443 |
-
$adapter->reject($exception1);
|
| 444 |
-
$adapter->promise()
|
| 445 |
-
->always(function () use ($exception2) {
|
| 446 |
-
throw $exception2;
|
| 447 |
-
})
|
| 448 |
-
->then(null, $mock);
|
| 449 |
-
}
|
| 450 |
-
|
| 451 |
-
/** @test */
|
| 452 |
-
public function alwaysShouldRejectWhenHandlerRejectsForRejectedPromise()
|
| 453 |
-
{
|
| 454 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 455 |
-
|
| 456 |
-
$exception1 = new \Exception();
|
| 457 |
-
$exception2 = new \Exception();
|
| 458 |
-
|
| 459 |
-
$mock = $this->createCallableMock();
|
| 460 |
-
$mock
|
| 461 |
-
->expects($this->once())
|
| 462 |
-
->method('__invoke')
|
| 463 |
-
->with($this->identicalTo($exception2));
|
| 464 |
-
|
| 465 |
-
$adapter->reject($exception1);
|
| 466 |
-
$adapter->promise()
|
| 467 |
-
->always(function () use ($exception2) {
|
| 468 |
-
return \React\Promise\reject($exception2);
|
| 469 |
-
})
|
| 470 |
-
->then(null, $mock);
|
| 471 |
-
}
|
| 472 |
-
|
| 473 |
-
/** @test */
|
| 474 |
-
public function cancelShouldReturnNullForRejectedPromise()
|
| 475 |
-
{
|
| 476 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 477 |
-
|
| 478 |
-
$adapter->reject();
|
| 479 |
-
|
| 480 |
-
$this->assertNull($adapter->promise()->cancel());
|
| 481 |
-
}
|
| 482 |
-
|
| 483 |
-
/** @test */
|
| 484 |
-
public function cancelShouldHaveNoEffectForRejectedPromise()
|
| 485 |
-
{
|
| 486 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableNever());
|
| 487 |
-
|
| 488 |
-
$adapter->reject();
|
| 489 |
-
|
| 490 |
-
$adapter->promise()->cancel();
|
| 491 |
-
}
|
| 492 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/PromiseSettledTestTrait.php
DELETED
|
@@ -1,86 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
trait PromiseSettledTestTrait
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 9 |
-
*/
|
| 10 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 11 |
-
|
| 12 |
-
/** @test */
|
| 13 |
-
public function thenShouldReturnAPromiseForSettledPromise()
|
| 14 |
-
{
|
| 15 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 16 |
-
|
| 17 |
-
$adapter->settle();
|
| 18 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->then());
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
/** @test */
|
| 22 |
-
public function thenShouldReturnAllowNullForSettledPromise()
|
| 23 |
-
{
|
| 24 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 25 |
-
|
| 26 |
-
$adapter->settle();
|
| 27 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->then(null, null, null));
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/** @test */
|
| 31 |
-
public function cancelShouldReturnNullForSettledPromise()
|
| 32 |
-
{
|
| 33 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 34 |
-
|
| 35 |
-
$adapter->settle();
|
| 36 |
-
|
| 37 |
-
$this->assertNull($adapter->promise()->cancel());
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/** @test */
|
| 41 |
-
public function cancelShouldHaveNoEffectForSettledPromise()
|
| 42 |
-
{
|
| 43 |
-
$adapter = $this->getPromiseTestAdapter($this->expectCallableNever());
|
| 44 |
-
|
| 45 |
-
$adapter->settle();
|
| 46 |
-
|
| 47 |
-
$adapter->promise()->cancel();
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/** @test */
|
| 51 |
-
public function doneShouldReturnNullForSettledPromise()
|
| 52 |
-
{
|
| 53 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 54 |
-
|
| 55 |
-
$adapter->settle();
|
| 56 |
-
$this->assertNull($adapter->promise()->done(null, function () {}));
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/** @test */
|
| 60 |
-
public function doneShouldReturnAllowNullForSettledPromise()
|
| 61 |
-
{
|
| 62 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 63 |
-
|
| 64 |
-
$adapter->settle();
|
| 65 |
-
$this->assertNull($adapter->promise()->done(null, function () {}, null));
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/** @test */
|
| 69 |
-
public function progressShouldNotInvokeProgressHandlerForSettledPromise()
|
| 70 |
-
{
|
| 71 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 72 |
-
|
| 73 |
-
$adapter->settle();
|
| 74 |
-
$adapter->promise()->progress($this->expectCallableNever());
|
| 75 |
-
$adapter->notify();
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/** @test */
|
| 79 |
-
public function alwaysShouldReturnAPromiseForSettledPromise()
|
| 80 |
-
{
|
| 81 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 82 |
-
|
| 83 |
-
$adapter->settle();
|
| 84 |
-
$this->assertInstanceOf('React\\Promise\\PromiseInterface', $adapter->promise()->always(function () {}));
|
| 85 |
-
}
|
| 86 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/RejectTestTrait.php
DELETED
|
@@ -1,368 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
use React\Promise;
|
| 6 |
-
use React\Promise\Deferred;
|
| 7 |
-
|
| 8 |
-
trait RejectTestTrait
|
| 9 |
-
{
|
| 10 |
-
/**
|
| 11 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 12 |
-
*/
|
| 13 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 14 |
-
|
| 15 |
-
/** @test */
|
| 16 |
-
public function rejectShouldRejectWithAnImmediateValue()
|
| 17 |
-
{
|
| 18 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 19 |
-
|
| 20 |
-
$mock = $this->createCallableMock();
|
| 21 |
-
$mock
|
| 22 |
-
->expects($this->once())
|
| 23 |
-
->method('__invoke')
|
| 24 |
-
->with($this->identicalTo(1));
|
| 25 |
-
|
| 26 |
-
$adapter->promise()
|
| 27 |
-
->then($this->expectCallableNever(), $mock);
|
| 28 |
-
|
| 29 |
-
$adapter->reject(1);
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/** @test */
|
| 33 |
-
public function rejectShouldRejectWithFulfilledPromise()
|
| 34 |
-
{
|
| 35 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 36 |
-
|
| 37 |
-
$mock = $this->createCallableMock();
|
| 38 |
-
$mock
|
| 39 |
-
->expects($this->once())
|
| 40 |
-
->method('__invoke')
|
| 41 |
-
->with($this->identicalTo(1));
|
| 42 |
-
|
| 43 |
-
$adapter->promise()
|
| 44 |
-
->then($this->expectCallableNever(), $mock);
|
| 45 |
-
|
| 46 |
-
$adapter->reject(Promise\resolve(1));
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/** @test */
|
| 50 |
-
public function rejectShouldRejectWithRejectedPromise()
|
| 51 |
-
{
|
| 52 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 53 |
-
|
| 54 |
-
$mock = $this->createCallableMock();
|
| 55 |
-
$mock
|
| 56 |
-
->expects($this->once())
|
| 57 |
-
->method('__invoke')
|
| 58 |
-
->with($this->identicalTo(1));
|
| 59 |
-
|
| 60 |
-
$adapter->promise()
|
| 61 |
-
->then($this->expectCallableNever(), $mock);
|
| 62 |
-
|
| 63 |
-
$adapter->reject(Promise\reject(1));
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
/** @test */
|
| 67 |
-
public function rejectShouldForwardReasonWhenCallbackIsNull()
|
| 68 |
-
{
|
| 69 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 70 |
-
|
| 71 |
-
$mock = $this->createCallableMock();
|
| 72 |
-
$mock
|
| 73 |
-
->expects($this->once())
|
| 74 |
-
->method('__invoke')
|
| 75 |
-
->with($this->identicalTo(1));
|
| 76 |
-
|
| 77 |
-
$adapter->promise()
|
| 78 |
-
->then(
|
| 79 |
-
$this->expectCallableNever()
|
| 80 |
-
)
|
| 81 |
-
->then(
|
| 82 |
-
$this->expectCallableNever(),
|
| 83 |
-
$mock
|
| 84 |
-
);
|
| 85 |
-
|
| 86 |
-
$adapter->reject(1);
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
/** @test */
|
| 90 |
-
public function rejectShouldMakePromiseImmutable()
|
| 91 |
-
{
|
| 92 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 93 |
-
|
| 94 |
-
$mock = $this->createCallableMock();
|
| 95 |
-
$mock
|
| 96 |
-
->expects($this->once())
|
| 97 |
-
->method('__invoke')
|
| 98 |
-
->with($this->identicalTo(1));
|
| 99 |
-
|
| 100 |
-
$adapter->promise()
|
| 101 |
-
->then(null, function ($value) use ($adapter) {
|
| 102 |
-
$adapter->reject(3);
|
| 103 |
-
|
| 104 |
-
return Promise\reject($value);
|
| 105 |
-
})
|
| 106 |
-
->then(
|
| 107 |
-
$this->expectCallableNever(),
|
| 108 |
-
$mock
|
| 109 |
-
);
|
| 110 |
-
|
| 111 |
-
$adapter->reject(1);
|
| 112 |
-
$adapter->reject(2);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
/** @test */
|
| 116 |
-
public function notifyShouldInvokeOtherwiseHandler()
|
| 117 |
-
{
|
| 118 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 119 |
-
|
| 120 |
-
$mock = $this->createCallableMock();
|
| 121 |
-
$mock
|
| 122 |
-
->expects($this->once())
|
| 123 |
-
->method('__invoke')
|
| 124 |
-
->with($this->identicalTo(1));
|
| 125 |
-
|
| 126 |
-
$adapter->promise()
|
| 127 |
-
->otherwise($mock);
|
| 128 |
-
|
| 129 |
-
$adapter->reject(1);
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
/** @test */
|
| 133 |
-
public function doneShouldInvokeRejectionHandler()
|
| 134 |
-
{
|
| 135 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 136 |
-
|
| 137 |
-
$mock = $this->createCallableMock();
|
| 138 |
-
$mock
|
| 139 |
-
->expects($this->once())
|
| 140 |
-
->method('__invoke')
|
| 141 |
-
->with($this->identicalTo(1));
|
| 142 |
-
|
| 143 |
-
$this->assertNull($adapter->promise()->done(null, $mock));
|
| 144 |
-
$adapter->reject(1);
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
/** @test */
|
| 148 |
-
public function doneShouldThrowExceptionThrownByRejectionHandler()
|
| 149 |
-
{
|
| 150 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 151 |
-
|
| 152 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 153 |
-
|
| 154 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 155 |
-
throw new \Exception('UnhandledRejectionException');
|
| 156 |
-
}));
|
| 157 |
-
$adapter->reject(1);
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
/** @test */
|
| 161 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenRejectedWithNonException()
|
| 162 |
-
{
|
| 163 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 164 |
-
|
| 165 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 166 |
-
|
| 167 |
-
$this->assertNull($adapter->promise()->done());
|
| 168 |
-
$adapter->reject(1);
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
/** @test */
|
| 172 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenRejectionHandlerRejects()
|
| 173 |
-
{
|
| 174 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 175 |
-
|
| 176 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 177 |
-
|
| 178 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 179 |
-
return \React\Promise\reject();
|
| 180 |
-
}));
|
| 181 |
-
$adapter->reject(1);
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
/** @test */
|
| 185 |
-
public function doneShouldThrowRejectionExceptionWhenRejectionHandlerRejectsWithException()
|
| 186 |
-
{
|
| 187 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 188 |
-
|
| 189 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 190 |
-
|
| 191 |
-
$this->assertNull($adapter->promise()->done(null, function () {
|
| 192 |
-
return \React\Promise\reject(new \Exception('UnhandledRejectionException'));
|
| 193 |
-
}));
|
| 194 |
-
$adapter->reject(1);
|
| 195 |
-
}
|
| 196 |
-
|
| 197 |
-
/** @test */
|
| 198 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenRejectionHandlerRetunsPendingPromiseWhichRejectsLater()
|
| 199 |
-
{
|
| 200 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 201 |
-
|
| 202 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 203 |
-
|
| 204 |
-
$d = new Deferred();
|
| 205 |
-
$promise = $d->promise();
|
| 206 |
-
|
| 207 |
-
$this->assertNull($adapter->promise()->done(null, function () use ($promise) {
|
| 208 |
-
return $promise;
|
| 209 |
-
}));
|
| 210 |
-
$adapter->reject(1);
|
| 211 |
-
$d->reject(1);
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
/** @test */
|
| 215 |
-
public function doneShouldThrowExceptionProvidedAsRejectionValue()
|
| 216 |
-
{
|
| 217 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 218 |
-
|
| 219 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 220 |
-
|
| 221 |
-
$this->assertNull($adapter->promise()->done());
|
| 222 |
-
$adapter->reject(new \Exception('UnhandledRejectionException'));
|
| 223 |
-
}
|
| 224 |
-
|
| 225 |
-
/** @test */
|
| 226 |
-
public function doneShouldThrowWithDeepNestingPromiseChains()
|
| 227 |
-
{
|
| 228 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 229 |
-
|
| 230 |
-
$exception = new \Exception('UnhandledRejectionException');
|
| 231 |
-
|
| 232 |
-
$d = new Deferred();
|
| 233 |
-
|
| 234 |
-
$result = \React\Promise\resolve(\React\Promise\resolve($d->promise()->then(function () use ($exception) {
|
| 235 |
-
$d = new Deferred();
|
| 236 |
-
$d->resolve();
|
| 237 |
-
|
| 238 |
-
return \React\Promise\resolve($d->promise()->then(function () {}))->then(
|
| 239 |
-
function () use ($exception) {
|
| 240 |
-
throw $exception;
|
| 241 |
-
}
|
| 242 |
-
);
|
| 243 |
-
})));
|
| 244 |
-
|
| 245 |
-
$result->done();
|
| 246 |
-
|
| 247 |
-
$d->resolve();
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
/** @test */
|
| 251 |
-
public function doneShouldRecoverWhenRejectionHandlerCatchesException()
|
| 252 |
-
{
|
| 253 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 254 |
-
|
| 255 |
-
$this->assertNull($adapter->promise()->done(null, function (\Exception $e) {
|
| 256 |
-
|
| 257 |
-
}));
|
| 258 |
-
$adapter->reject(new \Exception('UnhandledRejectionException'));
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
/** @test */
|
| 262 |
-
public function alwaysShouldNotSuppressRejection()
|
| 263 |
-
{
|
| 264 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 265 |
-
|
| 266 |
-
$exception = new \Exception();
|
| 267 |
-
|
| 268 |
-
$mock = $this->createCallableMock();
|
| 269 |
-
$mock
|
| 270 |
-
->expects($this->once())
|
| 271 |
-
->method('__invoke')
|
| 272 |
-
->with($this->identicalTo($exception));
|
| 273 |
-
|
| 274 |
-
$adapter->promise()
|
| 275 |
-
->always(function () {})
|
| 276 |
-
->then(null, $mock);
|
| 277 |
-
|
| 278 |
-
$adapter->reject($exception);
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
/** @test */
|
| 282 |
-
public function alwaysShouldNotSuppressRejectionWhenHandlerReturnsANonPromise()
|
| 283 |
-
{
|
| 284 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 285 |
-
|
| 286 |
-
$exception = new \Exception();
|
| 287 |
-
|
| 288 |
-
$mock = $this->createCallableMock();
|
| 289 |
-
$mock
|
| 290 |
-
->expects($this->once())
|
| 291 |
-
->method('__invoke')
|
| 292 |
-
->with($this->identicalTo($exception));
|
| 293 |
-
|
| 294 |
-
$adapter->promise()
|
| 295 |
-
->always(function () {
|
| 296 |
-
return 1;
|
| 297 |
-
})
|
| 298 |
-
->then(null, $mock);
|
| 299 |
-
|
| 300 |
-
$adapter->reject($exception);
|
| 301 |
-
}
|
| 302 |
-
|
| 303 |
-
/** @test */
|
| 304 |
-
public function alwaysShouldNotSuppressRejectionWhenHandlerReturnsAPromise()
|
| 305 |
-
{
|
| 306 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 307 |
-
|
| 308 |
-
$exception = new \Exception();
|
| 309 |
-
|
| 310 |
-
$mock = $this->createCallableMock();
|
| 311 |
-
$mock
|
| 312 |
-
->expects($this->once())
|
| 313 |
-
->method('__invoke')
|
| 314 |
-
->with($this->identicalTo($exception));
|
| 315 |
-
|
| 316 |
-
$adapter->promise()
|
| 317 |
-
->always(function () {
|
| 318 |
-
return \React\Promise\resolve(1);
|
| 319 |
-
})
|
| 320 |
-
->then(null, $mock);
|
| 321 |
-
|
| 322 |
-
$adapter->reject($exception);
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
/** @test */
|
| 326 |
-
public function alwaysShouldRejectWhenHandlerThrowsForRejection()
|
| 327 |
-
{
|
| 328 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 329 |
-
|
| 330 |
-
$exception = new \Exception();
|
| 331 |
-
|
| 332 |
-
$mock = $this->createCallableMock();
|
| 333 |
-
$mock
|
| 334 |
-
->expects($this->once())
|
| 335 |
-
->method('__invoke')
|
| 336 |
-
->with($this->identicalTo($exception));
|
| 337 |
-
|
| 338 |
-
$adapter->promise()
|
| 339 |
-
->always(function () use ($exception) {
|
| 340 |
-
throw $exception;
|
| 341 |
-
})
|
| 342 |
-
->then(null, $mock);
|
| 343 |
-
|
| 344 |
-
$adapter->reject($exception);
|
| 345 |
-
}
|
| 346 |
-
|
| 347 |
-
/** @test */
|
| 348 |
-
public function alwaysShouldRejectWhenHandlerRejectsForRejection()
|
| 349 |
-
{
|
| 350 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 351 |
-
|
| 352 |
-
$exception = new \Exception();
|
| 353 |
-
|
| 354 |
-
$mock = $this->createCallableMock();
|
| 355 |
-
$mock
|
| 356 |
-
->expects($this->once())
|
| 357 |
-
->method('__invoke')
|
| 358 |
-
->with($this->identicalTo($exception));
|
| 359 |
-
|
| 360 |
-
$adapter->promise()
|
| 361 |
-
->always(function () use ($exception) {
|
| 362 |
-
return \React\Promise\reject($exception);
|
| 363 |
-
})
|
| 364 |
-
->then(null, $mock);
|
| 365 |
-
|
| 366 |
-
$adapter->reject($exception);
|
| 367 |
-
}
|
| 368 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/PromiseTest/ResolveTestTrait.php
DELETED
|
@@ -1,263 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\PromiseTest;
|
| 4 |
-
|
| 5 |
-
use React\Promise;
|
| 6 |
-
|
| 7 |
-
trait ResolveTestTrait
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* @return \React\Promise\PromiseAdapter\PromiseAdapterInterface
|
| 11 |
-
*/
|
| 12 |
-
abstract public function getPromiseTestAdapter(callable $canceller = null);
|
| 13 |
-
|
| 14 |
-
/** @test */
|
| 15 |
-
public function resolveShouldResolve()
|
| 16 |
-
{
|
| 17 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 18 |
-
|
| 19 |
-
$mock = $this->createCallableMock();
|
| 20 |
-
$mock
|
| 21 |
-
->expects($this->once())
|
| 22 |
-
->method('__invoke')
|
| 23 |
-
->with($this->identicalTo(1));
|
| 24 |
-
|
| 25 |
-
$adapter->promise()
|
| 26 |
-
->then($mock);
|
| 27 |
-
|
| 28 |
-
$adapter->resolve(1);
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/** @test */
|
| 32 |
-
public function resolveShouldResolveWithPromisedValue()
|
| 33 |
-
{
|
| 34 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 35 |
-
|
| 36 |
-
$mock = $this->createCallableMock();
|
| 37 |
-
$mock
|
| 38 |
-
->expects($this->once())
|
| 39 |
-
->method('__invoke')
|
| 40 |
-
->with($this->identicalTo(1));
|
| 41 |
-
|
| 42 |
-
$adapter->promise()
|
| 43 |
-
->then($mock);
|
| 44 |
-
|
| 45 |
-
$adapter->resolve(Promise\resolve(1));
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/** @test */
|
| 49 |
-
public function resolveShouldRejectWhenResolvedWithRejectedPromise()
|
| 50 |
-
{
|
| 51 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 52 |
-
|
| 53 |
-
$mock = $this->createCallableMock();
|
| 54 |
-
$mock
|
| 55 |
-
->expects($this->once())
|
| 56 |
-
->method('__invoke')
|
| 57 |
-
->with($this->identicalTo(1));
|
| 58 |
-
|
| 59 |
-
$adapter->promise()
|
| 60 |
-
->then($this->expectCallableNever(), $mock);
|
| 61 |
-
|
| 62 |
-
$adapter->resolve(Promise\reject(1));
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/** @test */
|
| 66 |
-
public function resolveShouldForwardValueWhenCallbackIsNull()
|
| 67 |
-
{
|
| 68 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 69 |
-
|
| 70 |
-
$mock = $this->createCallableMock();
|
| 71 |
-
$mock
|
| 72 |
-
->expects($this->once())
|
| 73 |
-
->method('__invoke')
|
| 74 |
-
->with($this->identicalTo(1));
|
| 75 |
-
|
| 76 |
-
$adapter->promise()
|
| 77 |
-
->then(
|
| 78 |
-
null,
|
| 79 |
-
$this->expectCallableNever()
|
| 80 |
-
)
|
| 81 |
-
->then(
|
| 82 |
-
$mock,
|
| 83 |
-
$this->expectCallableNever()
|
| 84 |
-
);
|
| 85 |
-
|
| 86 |
-
$adapter->resolve(1);
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
/** @test */
|
| 90 |
-
public function resolveShouldMakePromiseImmutable()
|
| 91 |
-
{
|
| 92 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 93 |
-
|
| 94 |
-
$mock = $this->createCallableMock();
|
| 95 |
-
$mock
|
| 96 |
-
->expects($this->once())
|
| 97 |
-
->method('__invoke')
|
| 98 |
-
->with($this->identicalTo(1));
|
| 99 |
-
|
| 100 |
-
$adapter->promise()
|
| 101 |
-
->then(function ($value) use ($adapter) {
|
| 102 |
-
$adapter->resolve(3);
|
| 103 |
-
|
| 104 |
-
return $value;
|
| 105 |
-
})
|
| 106 |
-
->then(
|
| 107 |
-
$mock,
|
| 108 |
-
$this->expectCallableNever()
|
| 109 |
-
);
|
| 110 |
-
|
| 111 |
-
$adapter->resolve(1);
|
| 112 |
-
$adapter->resolve(2);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
/** @test */
|
| 116 |
-
public function doneShouldInvokeFulfillmentHandler()
|
| 117 |
-
{
|
| 118 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 119 |
-
|
| 120 |
-
$mock = $this->createCallableMock();
|
| 121 |
-
$mock
|
| 122 |
-
->expects($this->once())
|
| 123 |
-
->method('__invoke')
|
| 124 |
-
->with($this->identicalTo(1));
|
| 125 |
-
|
| 126 |
-
$this->assertNull($adapter->promise()->done($mock));
|
| 127 |
-
$adapter->resolve(1);
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/** @test */
|
| 131 |
-
public function doneShouldThrowExceptionThrownFulfillmentHandler()
|
| 132 |
-
{
|
| 133 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 134 |
-
|
| 135 |
-
$this->setExpectedException('\Exception', 'UnhandledRejectionException');
|
| 136 |
-
|
| 137 |
-
$this->assertNull($adapter->promise()->done(function () {
|
| 138 |
-
throw new \Exception('UnhandledRejectionException');
|
| 139 |
-
}));
|
| 140 |
-
$adapter->resolve(1);
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
/** @test */
|
| 144 |
-
public function doneShouldThrowUnhandledRejectionExceptionWhenFulfillmentHandlerRejects()
|
| 145 |
-
{
|
| 146 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 147 |
-
|
| 148 |
-
$this->setExpectedException('React\\Promise\\UnhandledRejectionException');
|
| 149 |
-
|
| 150 |
-
$this->assertNull($adapter->promise()->done(function () {
|
| 151 |
-
return \React\Promise\reject();
|
| 152 |
-
}));
|
| 153 |
-
$adapter->resolve(1);
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/** @test */
|
| 157 |
-
public function alwaysShouldNotSuppressValue()
|
| 158 |
-
{
|
| 159 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 160 |
-
|
| 161 |
-
$value = new \stdClass();
|
| 162 |
-
|
| 163 |
-
$mock = $this->createCallableMock();
|
| 164 |
-
$mock
|
| 165 |
-
->expects($this->once())
|
| 166 |
-
->method('__invoke')
|
| 167 |
-
->with($this->identicalTo($value));
|
| 168 |
-
|
| 169 |
-
$adapter->promise()
|
| 170 |
-
->always(function () {})
|
| 171 |
-
->then($mock);
|
| 172 |
-
|
| 173 |
-
$adapter->resolve($value);
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
/** @test */
|
| 177 |
-
public function alwaysShouldNotSuppressValueWhenHandlerReturnsANonPromise()
|
| 178 |
-
{
|
| 179 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 180 |
-
|
| 181 |
-
$value = new \stdClass();
|
| 182 |
-
|
| 183 |
-
$mock = $this->createCallableMock();
|
| 184 |
-
$mock
|
| 185 |
-
->expects($this->once())
|
| 186 |
-
->method('__invoke')
|
| 187 |
-
->with($this->identicalTo($value));
|
| 188 |
-
|
| 189 |
-
$adapter->promise()
|
| 190 |
-
->always(function () {
|
| 191 |
-
return 1;
|
| 192 |
-
})
|
| 193 |
-
->then($mock);
|
| 194 |
-
|
| 195 |
-
$adapter->resolve($value);
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
/** @test */
|
| 199 |
-
public function alwaysShouldNotSuppressValueWhenHandlerReturnsAPromise()
|
| 200 |
-
{
|
| 201 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 202 |
-
|
| 203 |
-
$value = new \stdClass();
|
| 204 |
-
|
| 205 |
-
$mock = $this->createCallableMock();
|
| 206 |
-
$mock
|
| 207 |
-
->expects($this->once())
|
| 208 |
-
->method('__invoke')
|
| 209 |
-
->with($this->identicalTo($value));
|
| 210 |
-
|
| 211 |
-
$adapter->promise()
|
| 212 |
-
->always(function () {
|
| 213 |
-
return \React\Promise\resolve(1);
|
| 214 |
-
})
|
| 215 |
-
->then($mock);
|
| 216 |
-
|
| 217 |
-
$adapter->resolve($value);
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
/** @test */
|
| 221 |
-
public function alwaysShouldRejectWhenHandlerThrowsForFulfillment()
|
| 222 |
-
{
|
| 223 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 224 |
-
|
| 225 |
-
$exception = new \Exception();
|
| 226 |
-
|
| 227 |
-
$mock = $this->createCallableMock();
|
| 228 |
-
$mock
|
| 229 |
-
->expects($this->once())
|
| 230 |
-
->method('__invoke')
|
| 231 |
-
->with($this->identicalTo($exception));
|
| 232 |
-
|
| 233 |
-
$adapter->promise()
|
| 234 |
-
->always(function () use ($exception) {
|
| 235 |
-
throw $exception;
|
| 236 |
-
})
|
| 237 |
-
->then(null, $mock);
|
| 238 |
-
|
| 239 |
-
$adapter->resolve(1);
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
/** @test */
|
| 243 |
-
public function alwaysShouldRejectWhenHandlerRejectsForFulfillment()
|
| 244 |
-
{
|
| 245 |
-
$adapter = $this->getPromiseTestAdapter();
|
| 246 |
-
|
| 247 |
-
$exception = new \Exception();
|
| 248 |
-
|
| 249 |
-
$mock = $this->createCallableMock();
|
| 250 |
-
$mock
|
| 251 |
-
->expects($this->once())
|
| 252 |
-
->method('__invoke')
|
| 253 |
-
->with($this->identicalTo($exception));
|
| 254 |
-
|
| 255 |
-
$adapter->promise()
|
| 256 |
-
->always(function () use ($exception) {
|
| 257 |
-
return \React\Promise\reject($exception);
|
| 258 |
-
})
|
| 259 |
-
->then(null, $mock);
|
| 260 |
-
|
| 261 |
-
$adapter->resolve(1);
|
| 262 |
-
}
|
| 263 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/RejectedPromiseTest.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
use React\Promise\PromiseAdapter\CallbackPromiseAdapter;
|
| 6 |
-
|
| 7 |
-
class RejectedPromiseTest extends TestCase
|
| 8 |
-
{
|
| 9 |
-
use PromiseTest\PromiseSettledTestTrait,
|
| 10 |
-
PromiseTest\PromiseRejectedTestTrait;
|
| 11 |
-
|
| 12 |
-
public function getPromiseTestAdapter(callable $canceller = null)
|
| 13 |
-
{
|
| 14 |
-
$promise = null;
|
| 15 |
-
|
| 16 |
-
return new CallbackPromiseAdapter([
|
| 17 |
-
'promise' => function () use (&$promise) {
|
| 18 |
-
if (!$promise) {
|
| 19 |
-
throw new \LogicException('RejectedPromise must be rejected before obtaining the promise');
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
return $promise;
|
| 23 |
-
},
|
| 24 |
-
'resolve' => function () {
|
| 25 |
-
throw new \LogicException('You cannot call resolve() for React\Promise\RejectedPromise');
|
| 26 |
-
},
|
| 27 |
-
'reject' => function ($reason = null) use (&$promise) {
|
| 28 |
-
if (!$promise) {
|
| 29 |
-
$promise = new RejectedPromise($reason);
|
| 30 |
-
}
|
| 31 |
-
},
|
| 32 |
-
'notify' => function () {
|
| 33 |
-
// no-op
|
| 34 |
-
},
|
| 35 |
-
'settle' => function ($reason = null) use (&$promise) {
|
| 36 |
-
if (!$promise) {
|
| 37 |
-
$promise = new RejectedPromise($reason);
|
| 38 |
-
}
|
| 39 |
-
},
|
| 40 |
-
]);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/** @test */
|
| 44 |
-
public function shouldThrowExceptionIfConstructedWithAPromise()
|
| 45 |
-
{
|
| 46 |
-
$this->setExpectedException('\InvalidArgumentException');
|
| 47 |
-
|
| 48 |
-
return new RejectedPromise(new RejectedPromise());
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/Stub/CallableStub.php
DELETED
|
@@ -1,10 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise\Stub;
|
| 4 |
-
|
| 5 |
-
class CallableStub
|
| 6 |
-
{
|
| 7 |
-
public function __invoke()
|
| 8 |
-
{
|
| 9 |
-
}
|
| 10 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/TestCase.php
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace React\Promise;
|
| 4 |
-
|
| 5 |
-
class TestCase extends \PHPUnit_Framework_TestCase
|
| 6 |
-
{
|
| 7 |
-
public function expectCallableExactly($amount)
|
| 8 |
-
{
|
| 9 |
-
$mock = $this->createCallableMock();
|
| 10 |
-
$mock
|
| 11 |
-
->expects($this->exactly($amount))
|
| 12 |
-
->method('__invoke');
|
| 13 |
-
|
| 14 |
-
return $mock;
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
public function expectCallableOnce()
|
| 18 |
-
{
|
| 19 |
-
$mock = $this->createCallableMock();
|
| 20 |
-
$mock
|
| 21 |
-
->expects($this->once())
|
| 22 |
-
->method('__invoke');
|
| 23 |
-
|
| 24 |
-
return $mock;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function expectCallableNever()
|
| 28 |
-
{
|
| 29 |
-
$mock = $this->createCallableMock();
|
| 30 |
-
$mock
|
| 31 |
-
->expects($this->never())
|
| 32 |
-
->method('__invoke');
|
| 33 |
-
|
| 34 |
-
return $mock;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function createCallableMock()
|
| 38 |
-
{
|
| 39 |
-
return $this->getMock('React\\Promise\Stub\CallableStub');
|
| 40 |
-
}
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/constantcontact/react/promise/tests/bootstrap.php
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
$loader = @include __DIR__.'/../vendor/autoload.php';
|
| 4 |
-
if (!$loader) {
|
| 5 |
-
$loader = require __DIR__.'/../../../../vendor/autoload.php';
|
| 6 |
-
}
|
| 7 |
-
$loader->addPsr4('React\\Promise\\', __DIR__);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/{CHANGELOG.mdown → CHANGELOG.md}
RENAMED
|
@@ -1,3 +1,28 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
### 1.21.0 (2016-07-29)
|
| 2 |
|
| 3 |
* Break: Reverted the addition of $context when the ErrorHandler handles regular php errors from 1.20.0 as it was causing issues
|
| 1 |
+
### 1.23.0 (2017-06-19)
|
| 2 |
+
|
| 3 |
+
* Improved SyslogUdpHandler's support for RFC5424 and added optional `$ident` argument
|
| 4 |
+
* Fixed GelfHandler truncation to be per field and not per message
|
| 5 |
+
* Fixed compatibility issue with PHP <5.3.6
|
| 6 |
+
* Fixed support for headless Chrome in ChromePHPHandler
|
| 7 |
+
* Fixed support for latest Aws SDK in DynamoDbHandler
|
| 8 |
+
* Fixed support for SwiftMailer 6.0+ in SwiftMailerHandler
|
| 9 |
+
|
| 10 |
+
### 1.22.1 (2017-03-13)
|
| 11 |
+
|
| 12 |
+
* Fixed lots of minor issues in the new Slack integrations
|
| 13 |
+
* Fixed support for allowInlineLineBreaks in LineFormatter when formatting exception backtraces
|
| 14 |
+
|
| 15 |
+
### 1.22.0 (2016-11-26)
|
| 16 |
+
|
| 17 |
+
* Added SlackbotHandler and SlackWebhookHandler to set up Slack integration more easily
|
| 18 |
+
* Added MercurialProcessor to add mercurial revision and branch names to log records
|
| 19 |
+
* Added support for AWS SDK v3 in DynamoDbHandler
|
| 20 |
+
* Fixed fatal errors occuring when normalizing generators that have been fully consumed
|
| 21 |
+
* Fixed RollbarHandler to include a level (rollbar level), monolog_level (original name), channel and datetime (unix)
|
| 22 |
+
* Fixed RollbarHandler not flushing records automatically, calling close() explicitly is not necessary anymore
|
| 23 |
+
* Fixed SyslogUdpHandler to avoid sending empty frames
|
| 24 |
+
* Fixed a few PHP 7.0 and 7.1 compatibility issues
|
| 25 |
+
|
| 26 |
### 1.21.0 (2016-07-29)
|
| 27 |
|
| 28 |
* Break: Reverted the addition of $context when the ErrorHandler handles regular php errors from 1.20.0 as it was causing issues
|
vendor/monolog/monolog/{README.mdown → README.md}
RENAMED
|
File without changes
|
vendor/monolog/monolog/doc/01-usage.md
DELETED
|
@@ -1,231 +0,0 @@
|
|
| 1 |
-
# Using Monolog
|
| 2 |
-
|
| 3 |
-
- [Installation](#installation)
|
| 4 |
-
- [Core Concepts](#core-concepts)
|
| 5 |
-
- [Log Levels](#log-levels)
|
| 6 |
-
- [Configuring a logger](#configuring-a-logger)
|
| 7 |
-
- [Adding extra data in the records](#adding-extra-data-in-the-records)
|
| 8 |
-
- [Leveraging channels](#leveraging-channels)
|
| 9 |
-
- [Customizing the log format](#customizing-the-log-format)
|
| 10 |
-
|
| 11 |
-
## Installation
|
| 12 |
-
|
| 13 |
-
Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog))
|
| 14 |
-
and as such installable via [Composer](http://getcomposer.org/).
|
| 15 |
-
|
| 16 |
-
```bash
|
| 17 |
-
composer require monolog/monolog
|
| 18 |
-
```
|
| 19 |
-
|
| 20 |
-
If you do not use Composer, you can grab the code from GitHub, and use any
|
| 21 |
-
PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader))
|
| 22 |
-
to load Monolog classes.
|
| 23 |
-
|
| 24 |
-
## Core Concepts
|
| 25 |
-
|
| 26 |
-
Every `Logger` instance has a channel (name) and a stack of handlers. Whenever
|
| 27 |
-
you add a record to the logger, it traverses the handler stack. Each handler
|
| 28 |
-
decides whether it fully handled the record, and if so, the propagation of the
|
| 29 |
-
record ends there.
|
| 30 |
-
|
| 31 |
-
This allows for flexible logging setups, for example having a `StreamHandler` at
|
| 32 |
-
the bottom of the stack that will log anything to disk, and on top of that add
|
| 33 |
-
a `MailHandler` that will send emails only when an error message is logged.
|
| 34 |
-
Handlers also have a `$bubble` property which defines whether they block the
|
| 35 |
-
record or not if they handled it. In this example, setting the `MailHandler`'s
|
| 36 |
-
`$bubble` argument to false means that records handled by the `MailHandler` will
|
| 37 |
-
not propagate to the `StreamHandler` anymore.
|
| 38 |
-
|
| 39 |
-
You can create many `Logger`s, each defining a channel (e.g.: db, request,
|
| 40 |
-
router, ..) and each of them combining various handlers, which can be shared
|
| 41 |
-
or not. The channel is reflected in the logs and allows you to easily see or
|
| 42 |
-
filter records.
|
| 43 |
-
|
| 44 |
-
Each Handler also has a Formatter, a default one with settings that make sense
|
| 45 |
-
will be created if you don't set one. The formatters normalize and format
|
| 46 |
-
incoming records so that they can be used by the handlers to output useful
|
| 47 |
-
information.
|
| 48 |
-
|
| 49 |
-
Custom severity levels are not available. Only the eight
|
| 50 |
-
[RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice,
|
| 51 |
-
warning, error, critical, alert, emergency) are present for basic filtering
|
| 52 |
-
purposes, but for sorting and other use cases that would require
|
| 53 |
-
flexibility, you should add Processors to the Logger that can add extra
|
| 54 |
-
information (tags, user ip, ..) to the records before they are handled.
|
| 55 |
-
|
| 56 |
-
## Log Levels
|
| 57 |
-
|
| 58 |
-
Monolog supports the logging levels described by [RFC 5424](http://tools.ietf.org/html/rfc5424).
|
| 59 |
-
|
| 60 |
-
- **DEBUG** (100): Detailed debug information.
|
| 61 |
-
|
| 62 |
-
- **INFO** (200): Interesting events. Examples: User logs in, SQL logs.
|
| 63 |
-
|
| 64 |
-
- **NOTICE** (250): Normal but significant events.
|
| 65 |
-
|
| 66 |
-
- **WARNING** (300): Exceptional occurrences that are not errors. Examples:
|
| 67 |
-
Use of deprecated APIs, poor use of an API, undesirable things that are not
|
| 68 |
-
necessarily wrong.
|
| 69 |
-
|
| 70 |
-
- **ERROR** (400): Runtime errors that do not require immediate action but
|
| 71 |
-
should typically be logged and monitored.
|
| 72 |
-
|
| 73 |
-
- **CRITICAL** (500): Critical conditions. Example: Application component
|
| 74 |
-
unavailable, unexpected exception.
|
| 75 |
-
|
| 76 |
-
- **ALERT** (550): Action must be taken immediately. Example: Entire website
|
| 77 |
-
down, database unavailable, etc. This should trigger the SMS alerts and wake
|
| 78 |
-
you up.
|
| 79 |
-
|
| 80 |
-
- **EMERGENCY** (600): Emergency: system is unusable.
|
| 81 |
-
|
| 82 |
-
## Configuring a logger
|
| 83 |
-
|
| 84 |
-
Here is a basic setup to log to a file and to firephp on the DEBUG level:
|
| 85 |
-
|
| 86 |
-
```php
|
| 87 |
-
<?php
|
| 88 |
-
|
| 89 |
-
use Monolog\Logger;
|
| 90 |
-
use Monolog\Handler\StreamHandler;
|
| 91 |
-
use Monolog\Handler\FirePHPHandler;
|
| 92 |
-
|
| 93 |
-
// Create the logger
|
| 94 |
-
$logger = new Logger('my_logger');
|
| 95 |
-
// Now add some handlers
|
| 96 |
-
$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG));
|
| 97 |
-
$logger->pushHandler(new FirePHPHandler());
|
| 98 |
-
|
| 99 |
-
// You can now use your logger
|
| 100 |
-
$logger->addInfo('My logger is now ready');
|
| 101 |
-
```
|
| 102 |
-
|
| 103 |
-
Let's explain it. The first step is to create the logger instance which will
|
| 104 |
-
be used in your code. The argument is a channel name, which is useful when
|
| 105 |
-
you use several loggers (see below for more details about it).
|
| 106 |
-
|
| 107 |
-
The logger itself does not know how to handle a record. It delegates it to
|
| 108 |
-
some handlers. The code above registers two handlers in the stack to allow
|
| 109 |
-
handling records in two different ways.
|
| 110 |
-
|
| 111 |
-
Note that the FirePHPHandler is called first as it is added on top of the
|
| 112 |
-
stack. This allows you to temporarily add a logger with bubbling disabled if
|
| 113 |
-
you want to override other configured loggers.
|
| 114 |
-
|
| 115 |
-
> If you use Monolog standalone and are looking for an easy way to
|
| 116 |
-
> configure many handlers, the [theorchard/monolog-cascade](https://github.com/theorchard/monolog-cascade)
|
| 117 |
-
> can help you build complex logging configs via PHP arrays, yaml or json configs.
|
| 118 |
-
|
| 119 |
-
## Adding extra data in the records
|
| 120 |
-
|
| 121 |
-
Monolog provides two different ways to add extra informations along the simple
|
| 122 |
-
textual message.
|
| 123 |
-
|
| 124 |
-
### Using the logging context
|
| 125 |
-
|
| 126 |
-
The first way is the context, allowing to pass an array of data along the
|
| 127 |
-
record:
|
| 128 |
-
|
| 129 |
-
```php
|
| 130 |
-
<?php
|
| 131 |
-
|
| 132 |
-
$logger->addInfo('Adding a new user', array('username' => 'Seldaek'));
|
| 133 |
-
```
|
| 134 |
-
|
| 135 |
-
Simple handlers (like the StreamHandler for instance) will simply format
|
| 136 |
-
the array to a string but richer handlers can take advantage of the context
|
| 137 |
-
(FirePHP is able to display arrays in pretty way for instance).
|
| 138 |
-
|
| 139 |
-
### Using processors
|
| 140 |
-
|
| 141 |
-
The second way is to add extra data for all records by using a processor.
|
| 142 |
-
Processors can be any callable. They will get the record as parameter and
|
| 143 |
-
must return it after having eventually changed the `extra` part of it. Let's
|
| 144 |
-
write a processor adding some dummy data in the record:
|
| 145 |
-
|
| 146 |
-
```php
|
| 147 |
-
<?php
|
| 148 |
-
|
| 149 |
-
$logger->pushProcessor(function ($record) {
|
| 150 |
-
$record['extra']['dummy'] = 'Hello world!';
|
| 151 |
-
|
| 152 |
-
return $record;
|
| 153 |
-
});
|
| 154 |
-
```
|
| 155 |
-
|
| 156 |
-
Monolog provides some built-in processors that can be used in your project.
|
| 157 |
-
Look at the [dedicated chapter](https://github.com/Seldaek/monolog/blob/master/doc/02-handlers-formatters-processors.md#processors) for the list.
|
| 158 |
-
|
| 159 |
-
> Tip: processors can also be registered on a specific handler instead of
|
| 160 |
-
the logger to apply only for this handler.
|
| 161 |
-
|
| 162 |
-
## Leveraging channels
|
| 163 |
-
|
| 164 |
-
Channels are a great way to identify to which part of the application a record
|
| 165 |
-
is related. This is useful in big applications (and is leveraged by
|
| 166 |
-
MonologBundle in Symfony2).
|
| 167 |
-
|
| 168 |
-
Picture two loggers sharing a handler that writes to a single log file.
|
| 169 |
-
Channels would allow you to identify the logger that issued every record.
|
| 170 |
-
You can easily grep through the log files filtering this or that channel.
|
| 171 |
-
|
| 172 |
-
```php
|
| 173 |
-
<?php
|
| 174 |
-
|
| 175 |
-
use Monolog\Logger;
|
| 176 |
-
use Monolog\Handler\StreamHandler;
|
| 177 |
-
use Monolog\Handler\FirePHPHandler;
|
| 178 |
-
|
| 179 |
-
// Create some handlers
|
| 180 |
-
$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
|
| 181 |
-
$firephp = new FirePHPHandler();
|
| 182 |
-
|
| 183 |
-
// Create the main logger of the app
|
| 184 |
-
$logger = new Logger('my_logger');
|
| 185 |
-
$logger->pushHandler($stream);
|
| 186 |
-
$logger->pushHandler($firephp);
|
| 187 |
-
|
| 188 |
-
// Create a logger for the security-related stuff with a different channel
|
| 189 |
-
$securityLogger = new Logger('security');
|
| 190 |
-
$securityLogger->pushHandler($stream);
|
| 191 |
-
$securityLogger->pushHandler($firephp);
|
| 192 |
-
|
| 193 |
-
// Or clone the first one to only change the channel
|
| 194 |
-
$securityLogger = $logger->withName('security');
|
| 195 |
-
```
|
| 196 |
-
|
| 197 |
-
## Customizing the log format
|
| 198 |
-
|
| 199 |
-
In Monolog it's easy to customize the format of the logs written into files,
|
| 200 |
-
sockets, mails, databases and other handlers. Most of the handlers use the
|
| 201 |
-
|
| 202 |
-
```php
|
| 203 |
-
$record['formatted']
|
| 204 |
-
```
|
| 205 |
-
|
| 206 |
-
value to be automatically put into the log device. This value depends on the
|
| 207 |
-
formatter settings. You can choose between predefined formatter classes or
|
| 208 |
-
write your own (e.g. a multiline text file for human-readable output).
|
| 209 |
-
|
| 210 |
-
To configure a predefined formatter class, just set it as the handler's field:
|
| 211 |
-
|
| 212 |
-
```php
|
| 213 |
-
// the default date format is "Y-m-d H:i:s"
|
| 214 |
-
$dateFormat = "Y n j, g:i a";
|
| 215 |
-
// the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"
|
| 216 |
-
$output = "%datetime% > %level_name% > %message% %context% %extra%\n";
|
| 217 |
-
// finally, create a formatter
|
| 218 |
-
$formatter = new LineFormatter($output, $dateFormat);
|
| 219 |
-
|
| 220 |
-
// Create a handler
|
| 221 |
-
$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
|
| 222 |
-
$stream->setFormatter($formatter);
|
| 223 |
-
// bind it to a logger object
|
| 224 |
-
$securityLogger = new Logger('security');
|
| 225 |
-
$securityLogger->pushHandler($stream);
|
| 226 |
-
```
|
| 227 |
-
|
| 228 |
-
You may also reuse the same formatter between multiple handlers and share those
|
| 229 |
-
handlers between multiple loggers.
|
| 230 |
-
|
| 231 |
-
[Handlers, Formatters and Processors](02-handlers-formatters-processors.md) →
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/doc/02-handlers-formatters-processors.md
DELETED
|
@@ -1,155 +0,0 @@
|
|
| 1 |
-
# Handlers, Formatters and Processors
|
| 2 |
-
|
| 3 |
-
- [Handlers](#handlers)
|
| 4 |
-
- [Log to files and syslog](#log-to-files-and-syslog)
|
| 5 |
-
- [Send alerts and emails](#send-alerts-and-emails)
|
| 6 |
-
- [Log specific servers and networked logging](#log-specific-servers-and-networked-logging)
|
| 7 |
-
- [Logging in development](#logging-in-development)
|
| 8 |
-
- [Log to databases](#log-to-databases)
|
| 9 |
-
- [Wrappers / Special Handlers](#wrappers--special-handlers)
|
| 10 |
-
- [Formatters](#formatters)
|
| 11 |
-
- [Processors](#processors)
|
| 12 |
-
- [Third Party Packages](#third-party-packages)
|
| 13 |
-
|
| 14 |
-
## Handlers
|
| 15 |
-
|
| 16 |
-
### Log to files and syslog
|
| 17 |
-
|
| 18 |
-
- _StreamHandler_: Logs records into any PHP stream, use this for log files.
|
| 19 |
-
- _RotatingFileHandler_: Logs records to a file and creates one logfile per day.
|
| 20 |
-
It will also delete files older than `$maxFiles`. You should use
|
| 21 |
-
[logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile
|
| 22 |
-
setups though, this is just meant as a quick and dirty solution.
|
| 23 |
-
- _SyslogHandler_: Logs records to the syslog.
|
| 24 |
-
- _ErrorLogHandler_: Logs records to PHP's
|
| 25 |
-
[`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function.
|
| 26 |
-
|
| 27 |
-
### Send alerts and emails
|
| 28 |
-
|
| 29 |
-
- _NativeMailerHandler_: Sends emails using PHP's
|
| 30 |
-
[`mail()`](http://php.net/manual/en/function.mail.php) function.
|
| 31 |
-
- _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance.
|
| 32 |
-
- _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API.
|
| 33 |
-
- _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API.
|
| 34 |
-
- _FlowdockHandler_: Logs records to a [Flowdock](https://www.flowdock.com/) account.
|
| 35 |
-
- _SlackHandler_: Logs records to a [Slack](https://www.slack.com/) account.
|
| 36 |
-
- _MandrillHandler_: Sends emails via the Mandrill API using a [`Swift_Message`](http://swiftmailer.org/) instance.
|
| 37 |
-
- _FleepHookHandler_: Logs records to a [Fleep](https://fleep.io/) conversation using Webhooks.
|
| 38 |
-
- _IFTTTHandler_: Notifies an [IFTTT](https://ifttt.com/maker) trigger with the log channel, level name and message.
|
| 39 |
-
|
| 40 |
-
### Log specific servers and networked logging
|
| 41 |
-
|
| 42 |
-
- _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this
|
| 43 |
-
for UNIX and TCP sockets. See an [example](sockets.md).
|
| 44 |
-
- _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible
|
| 45 |
-
server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+).
|
| 46 |
-
- _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server.
|
| 47 |
-
- _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server.
|
| 48 |
-
- _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using
|
| 49 |
-
[raven](https://packagist.org/packages/raven/raven).
|
| 50 |
-
- _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server.
|
| 51 |
-
- _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application.
|
| 52 |
-
- _LogglyHandler_: Logs records to a [Loggly](http://www.loggly.com/) account.
|
| 53 |
-
- _RollbarHandler_: Logs records to a [Rollbar](https://rollbar.com/) account.
|
| 54 |
-
- _SyslogUdpHandler_: Logs records to a remote [Syslogd](http://www.rsyslog.com/) server.
|
| 55 |
-
- _LogEntriesHandler_: Logs records to a [LogEntries](http://logentries.com/) account.
|
| 56 |
-
|
| 57 |
-
### Logging in development
|
| 58 |
-
|
| 59 |
-
- _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing
|
| 60 |
-
inline `console` messages within [FireBug](http://getfirebug.com/).
|
| 61 |
-
- _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing
|
| 62 |
-
inline `console` messages within Chrome.
|
| 63 |
-
- _BrowserConsoleHandler_: Handler to send logs to browser's Javascript `console` with
|
| 64 |
-
no browser extension required. Most browsers supporting `console` API are supported.
|
| 65 |
-
- _PHPConsoleHandler_: Handler for [PHP Console](https://chrome.google.com/webstore/detail/php-console/nfhmhhlpfleoednkpnnnkolmclajemef), providing
|
| 66 |
-
inline `console` and notification popup messages within Chrome.
|
| 67 |
-
|
| 68 |
-
### Log to databases
|
| 69 |
-
|
| 70 |
-
- _RedisHandler_: Logs records to a [redis](http://redis.io) server.
|
| 71 |
-
- _MongoDBHandler_: Handler to write records in MongoDB via a
|
| 72 |
-
[Mongo](http://pecl.php.net/package/mongo) extension connection.
|
| 73 |
-
- _CouchDBHandler_: Logs records to a CouchDB server.
|
| 74 |
-
- _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM.
|
| 75 |
-
- _ElasticSearchHandler_: Logs records to an Elastic Search server.
|
| 76 |
-
- _DynamoDbHandler_: Logs records to a DynamoDB table with the [AWS SDK](https://github.com/aws/aws-sdk-php).
|
| 77 |
-
|
| 78 |
-
### Wrappers / Special Handlers
|
| 79 |
-
|
| 80 |
-
- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as
|
| 81 |
-
parameter and will accumulate log records of all levels until a record
|
| 82 |
-
exceeds the defined severity level. At which point it delivers all records,
|
| 83 |
-
including those of lower severity, to the handler it wraps. This means that
|
| 84 |
-
until an error actually happens you will not see anything in your logs, but
|
| 85 |
-
when it happens you will have the full information, including debug and info
|
| 86 |
-
records. This provides you with all the information you need, but only when
|
| 87 |
-
you need it.
|
| 88 |
-
- _DeduplicationHandler_: Useful if you are sending notifications or emails
|
| 89 |
-
when critical errors occur. It takes a logger as parameter and will
|
| 90 |
-
accumulate log records of all levels until the end of the request (or
|
| 91 |
-
`flush()` is called). At that point it delivers all records to the handler
|
| 92 |
-
it wraps, but only if the records are unique over a given time period
|
| 93 |
-
(60seconds by default). If the records are duplicates they are simply
|
| 94 |
-
discarded. The main use of this is in case of critical failure like if your
|
| 95 |
-
database is unreachable for example all your requests will fail and that
|
| 96 |
-
can result in a lot of notifications being sent. Adding this handler reduces
|
| 97 |
-
the amount of notifications to a manageable level.
|
| 98 |
-
- _WhatFailureGroupHandler_: This handler extends the _GroupHandler_ ignoring
|
| 99 |
-
exceptions raised by each child handler. This allows you to ignore issues
|
| 100 |
-
where a remote tcp connection may have died but you do not want your entire
|
| 101 |
-
application to crash and may wish to continue to log to other handlers.
|
| 102 |
-
- _BufferHandler_: This handler will buffer all the log records it receives
|
| 103 |
-
until `close()` is called at which point it will call `handleBatch()` on the
|
| 104 |
-
handler it wraps with all the log messages at once. This is very useful to
|
| 105 |
-
send an email with all records at once for example instead of having one mail
|
| 106 |
-
for every log record.
|
| 107 |
-
- _GroupHandler_: This handler groups other handlers. Every record received is
|
| 108 |
-
sent to all the handlers it is configured with.
|
| 109 |
-
- _FilterHandler_: This handler only lets records of the given levels through
|
| 110 |
-
to the wrapped handler.
|
| 111 |
-
- _SamplingHandler_: Wraps around another handler and lets you sample records
|
| 112 |
-
if you only want to store some of them.
|
| 113 |
-
- _NullHandler_: Any record it can handle will be thrown away. This can be used
|
| 114 |
-
to put on top of an existing handler stack to disable it temporarily.
|
| 115 |
-
- _PsrHandler_: Can be used to forward log records to an existing PSR-3 logger
|
| 116 |
-
- _TestHandler_: Used for testing, it records everything that is sent to it and
|
| 117 |
-
has accessors to read out the information.
|
| 118 |
-
- _HandlerWrapper_: A simple handler wrapper you can inherit from to create
|
| 119 |
-
your own wrappers easily.
|
| 120 |
-
|
| 121 |
-
## Formatters
|
| 122 |
-
|
| 123 |
-
- _LineFormatter_: Formats a log record into a one-line string.
|
| 124 |
-
- _HtmlFormatter_: Used to format log records into a human readable html table, mainly suitable for emails.
|
| 125 |
-
- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded.
|
| 126 |
-
- _ScalarFormatter_: Used to format log records into an associative array of scalar values.
|
| 127 |
-
- _JsonFormatter_: Encodes a log record into json.
|
| 128 |
-
- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler.
|
| 129 |
-
- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler.
|
| 130 |
-
- _GelfMessageFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler.
|
| 131 |
-
- _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/latest).
|
| 132 |
-
- _ElasticaFormatter_: Used to format log records into an Elastica\Document object, only useful for the ElasticSearchHandler.
|
| 133 |
-
- _LogglyFormatter_: Used to format log records into Loggly messages, only useful for the LogglyHandler.
|
| 134 |
-
- _FlowdockFormatter_: Used to format log records into Flowdock messages, only useful for the FlowdockHandler.
|
| 135 |
-
- _MongoDBFormatter_: Converts \DateTime instances to \MongoDate and objects recursively to arrays, only useful with the MongoDBHandler.
|
| 136 |
-
|
| 137 |
-
## Processors
|
| 138 |
-
|
| 139 |
-
- _PsrLogMessageProcessor_: Processes a log record's message according to PSR-3 rules, replacing `{foo}` with the value from `$context['foo']`.
|
| 140 |
-
- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated.
|
| 141 |
-
- _WebProcessor_: Adds the current request URI, request method and client IP to a log record.
|
| 142 |
-
- _MemoryUsageProcessor_: Adds the current memory usage to a log record.
|
| 143 |
-
- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record.
|
| 144 |
-
- _ProcessIdProcessor_: Adds the process id to a log record.
|
| 145 |
-
- _UidProcessor_: Adds a unique identifier to a log record.
|
| 146 |
-
- _GitProcessor_: Adds the current git branch and commit to a log record.
|
| 147 |
-
- _TagProcessor_: Adds an array of predefined tags to a log record.
|
| 148 |
-
|
| 149 |
-
## Third Party Packages
|
| 150 |
-
|
| 151 |
-
Third party handlers, formatters and processors are
|
| 152 |
-
[listed in the wiki](https://github.com/Seldaek/monolog/wiki/Third-Party-Packages). You
|
| 153 |
-
can also add your own there if you publish one.
|
| 154 |
-
|
| 155 |
-
← [Usage](01-usage.md) | [Utility classes](03-utilities.md) →
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/doc/03-utilities.md
DELETED
|
@@ -1,13 +0,0 @@
|
|
| 1 |
-
# Utilities
|
| 2 |
-
|
| 3 |
-
- _Registry_: The `Monolog\Registry` class lets you configure global loggers that you
|
| 4 |
-
can then statically access from anywhere. It is not really a best practice but can
|
| 5 |
-
help in some older codebases or for ease of use.
|
| 6 |
-
- _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register
|
| 7 |
-
a Logger instance as an exception handler, error handler or fatal error handler.
|
| 8 |
-
- _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log
|
| 9 |
-
level is reached.
|
| 10 |
-
- _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain
|
| 11 |
-
log level is reached, depending on which channel received the log record.
|
| 12 |
-
|
| 13 |
-
← [Handlers, Formatters and Processors](02-handlers-formatters-processors.md) | [Extending Monolog](04-extending.md) →
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/doc/04-extending.md
DELETED
|
@@ -1,76 +0,0 @@
|
|
| 1 |
-
# Extending Monolog
|
| 2 |
-
|
| 3 |
-
Monolog is fully extensible, allowing you to adapt your logger to your needs.
|
| 4 |
-
|
| 5 |
-
## Writing your own handler
|
| 6 |
-
|
| 7 |
-
Monolog provides many built-in handlers. But if the one you need does not
|
| 8 |
-
exist, you can write it and use it in your logger. The only requirement is
|
| 9 |
-
to implement `Monolog\Handler\HandlerInterface`.
|
| 10 |
-
|
| 11 |
-
Let's write a PDOHandler to log records to a database. We will extend the
|
| 12 |
-
abstract class provided by Monolog to keep things DRY.
|
| 13 |
-
|
| 14 |
-
```php
|
| 15 |
-
<?php
|
| 16 |
-
|
| 17 |
-
use Monolog\Logger;
|
| 18 |
-
use Monolog\Handler\AbstractProcessingHandler;
|
| 19 |
-
|
| 20 |
-
class PDOHandler extends AbstractProcessingHandler
|
| 21 |
-
{
|
| 22 |
-
private $initialized = false;
|
| 23 |
-
private $pdo;
|
| 24 |
-
private $statement;
|
| 25 |
-
|
| 26 |
-
public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true)
|
| 27 |
-
{
|
| 28 |
-
$this->pdo = $pdo;
|
| 29 |
-
parent::__construct($level, $bubble);
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
protected function write(array $record)
|
| 33 |
-
{
|
| 34 |
-
if (!$this->initialized) {
|
| 35 |
-
$this->initialize();
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
$this->statement->execute(array(
|
| 39 |
-
'channel' => $record['channel'],
|
| 40 |
-
'level' => $record['level'],
|
| 41 |
-
'message' => $record['formatted'],
|
| 42 |
-
'time' => $record['datetime']->format('U'),
|
| 43 |
-
));
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
private function initialize()
|
| 47 |
-
{
|
| 48 |
-
$this->pdo->exec(
|
| 49 |
-
'CREATE TABLE IF NOT EXISTS monolog '
|
| 50 |
-
.'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)'
|
| 51 |
-
);
|
| 52 |
-
$this->statement = $this->pdo->prepare(
|
| 53 |
-
'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)'
|
| 54 |
-
);
|
| 55 |
-
|
| 56 |
-
$this->initialized = true;
|
| 57 |
-
}
|
| 58 |
-
}
|
| 59 |
-
```
|
| 60 |
-
|
| 61 |
-
You can now use this handler in your logger:
|
| 62 |
-
|
| 63 |
-
```php
|
| 64 |
-
<?php
|
| 65 |
-
|
| 66 |
-
$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite')));
|
| 67 |
-
|
| 68 |
-
// You can now use your logger
|
| 69 |
-
$logger->addInfo('My logger is now ready');
|
| 70 |
-
```
|
| 71 |
-
|
| 72 |
-
The `Monolog\Handler\AbstractProcessingHandler` class provides most of the
|
| 73 |
-
logic needed for the handler, including the use of processors and the formatting
|
| 74 |
-
of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``).
|
| 75 |
-
|
| 76 |
-
← [Utility classes](03-utilities.md)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/doc/sockets.md
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
Sockets Handler
|
| 2 |
-
===============
|
| 3 |
-
|
| 4 |
-
This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen)
|
| 5 |
-
or [pfsockopen](http://php.net/pfsockopen).
|
| 6 |
-
|
| 7 |
-
Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening
|
| 8 |
-
the connections between requests.
|
| 9 |
-
|
| 10 |
-
You can use a `unix://` prefix to access unix sockets and `udp://` to open UDP sockets instead of the default TCP.
|
| 11 |
-
|
| 12 |
-
Basic Example
|
| 13 |
-
-------------
|
| 14 |
-
|
| 15 |
-
```php
|
| 16 |
-
<?php
|
| 17 |
-
|
| 18 |
-
use Monolog\Logger;
|
| 19 |
-
use Monolog\Handler\SocketHandler;
|
| 20 |
-
|
| 21 |
-
// Create the logger
|
| 22 |
-
$logger = new Logger('my_logger');
|
| 23 |
-
|
| 24 |
-
// Create the handler
|
| 25 |
-
$handler = new SocketHandler('unix:///var/log/httpd_app_log.socket');
|
| 26 |
-
$handler->setPersistent(true);
|
| 27 |
-
|
| 28 |
-
// Now add the handler
|
| 29 |
-
$logger->pushHandler($handler, Logger::DEBUG);
|
| 30 |
-
|
| 31 |
-
// You can now use your logger
|
| 32 |
-
$logger->addInfo('My logger is now ready');
|
| 33 |
-
|
| 34 |
-
```
|
| 35 |
-
|
| 36 |
-
In this example, using syslog-ng, you should see the log on the log server:
|
| 37 |
-
|
| 38 |
-
cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] []
|
| 39 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/phpunit.xml.dist
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" encoding="UTF-8"?>
|
| 2 |
-
|
| 3 |
-
<phpunit bootstrap="vendor/autoload.php" colors="true">
|
| 4 |
-
<testsuites>
|
| 5 |
-
<testsuite name="Monolog Test Suite">
|
| 6 |
-
<directory>tests/Monolog/</directory>
|
| 7 |
-
</testsuite>
|
| 8 |
-
</testsuites>
|
| 9 |
-
|
| 10 |
-
<filter>
|
| 11 |
-
<whitelist>
|
| 12 |
-
<directory suffix=".php">src/Monolog/</directory>
|
| 13 |
-
</whitelist>
|
| 14 |
-
</filter>
|
| 15 |
-
|
| 16 |
-
<php>
|
| 17 |
-
<ini name="date.timezone" value="UTC"/>
|
| 18 |
-
</php>
|
| 19 |
-
</phpunit>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/src/Monolog/Handler/Slack/SlackRecord.php
ADDED
|
@@ -0,0 +1,294 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler\Slack;
|
| 13 |
+
|
| 14 |
+
use Monolog\Logger;
|
| 15 |
+
use Monolog\Formatter\NormalizerFormatter;
|
| 16 |
+
use Monolog\Formatter\FormatterInterface;
|
| 17 |
+
|
| 18 |
+
/**
|
| 19 |
+
* Slack record utility helping to log to Slack webhooks or API.
|
| 20 |
+
*
|
| 21 |
+
* @author Greg Kedzierski <greg@gregkedzierski.com>
|
| 22 |
+
* @author Haralan Dobrev <hkdobrev@gmail.com>
|
| 23 |
+
* @see https://api.slack.com/incoming-webhooks
|
| 24 |
+
* @see https://api.slack.com/docs/message-attachments
|
| 25 |
+
*/
|
| 26 |
+
class SlackRecord
|
| 27 |
+
{
|
| 28 |
+
const COLOR_DANGER = 'danger';
|
| 29 |
+
|
| 30 |
+
const COLOR_WARNING = 'warning';
|
| 31 |
+
|
| 32 |
+
const COLOR_GOOD = 'good';
|
| 33 |
+
|
| 34 |
+
const COLOR_DEFAULT = '#e3e4e6';
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* Slack channel (encoded ID or name)
|
| 38 |
+
* @var string|null
|
| 39 |
+
*/
|
| 40 |
+
private $channel;
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* Name of a bot
|
| 44 |
+
* @var string|null
|
| 45 |
+
*/
|
| 46 |
+
private $username;
|
| 47 |
+
|
| 48 |
+
/**
|
| 49 |
+
* User icon e.g. 'ghost', 'http://example.com/user.png'
|
| 50 |
+
* @var string
|
| 51 |
+
*/
|
| 52 |
+
private $userIcon;
|
| 53 |
+
|
| 54 |
+
/**
|
| 55 |
+
* Whether the message should be added to Slack as attachment (plain text otherwise)
|
| 56 |
+
* @var bool
|
| 57 |
+
*/
|
| 58 |
+
private $useAttachment;
|
| 59 |
+
|
| 60 |
+
/**
|
| 61 |
+
* Whether the the context/extra messages added to Slack as attachments are in a short style
|
| 62 |
+
* @var bool
|
| 63 |
+
*/
|
| 64 |
+
private $useShortAttachment;
|
| 65 |
+
|
| 66 |
+
/**
|
| 67 |
+
* Whether the attachment should include context and extra data
|
| 68 |
+
* @var bool
|
| 69 |
+
*/
|
| 70 |
+
private $includeContextAndExtra;
|
| 71 |
+
|
| 72 |
+
/**
|
| 73 |
+
* Dot separated list of fields to exclude from slack message. E.g. ['context.field1', 'extra.field2']
|
| 74 |
+
* @var array
|
| 75 |
+
*/
|
| 76 |
+
private $excludeFields;
|
| 77 |
+
|
| 78 |
+
/**
|
| 79 |
+
* @var FormatterInterface
|
| 80 |
+
*/
|
| 81 |
+
private $formatter;
|
| 82 |
+
|
| 83 |
+
/**
|
| 84 |
+
* @var NormalizerFormatter
|
| 85 |
+
*/
|
| 86 |
+
private $normalizerFormatter;
|
| 87 |
+
|
| 88 |
+
public function __construct($channel = null, $username = null, $useAttachment = true, $userIcon = null, $useShortAttachment = false, $includeContextAndExtra = false, array $excludeFields = array(), FormatterInterface $formatter = null)
|
| 89 |
+
{
|
| 90 |
+
$this->channel = $channel;
|
| 91 |
+
$this->username = $username;
|
| 92 |
+
$this->userIcon = trim($userIcon, ':');
|
| 93 |
+
$this->useAttachment = $useAttachment;
|
| 94 |
+
$this->useShortAttachment = $useShortAttachment;
|
| 95 |
+
$this->includeContextAndExtra = $includeContextAndExtra;
|
| 96 |
+
$this->excludeFields = $excludeFields;
|
| 97 |
+
$this->formatter = $formatter;
|
| 98 |
+
|
| 99 |
+
if ($this->includeContextAndExtra) {
|
| 100 |
+
$this->normalizerFormatter = new NormalizerFormatter();
|
| 101 |
+
}
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
public function getSlackData(array $record)
|
| 105 |
+
{
|
| 106 |
+
$dataArray = array();
|
| 107 |
+
$record = $this->excludeFields($record);
|
| 108 |
+
|
| 109 |
+
if ($this->username) {
|
| 110 |
+
$dataArray['username'] = $this->username;
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
if ($this->channel) {
|
| 114 |
+
$dataArray['channel'] = $this->channel;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
if ($this->formatter && !$this->useAttachment) {
|
| 118 |
+
$message = $this->formatter->format($record);
|
| 119 |
+
} else {
|
| 120 |
+
$message = $record['message'];
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
if ($this->useAttachment) {
|
| 124 |
+
$attachment = array(
|
| 125 |
+
'fallback' => $message,
|
| 126 |
+
'text' => $message,
|
| 127 |
+
'color' => $this->getAttachmentColor($record['level']),
|
| 128 |
+
'fields' => array(),
|
| 129 |
+
'mrkdwn_in' => array('fields'),
|
| 130 |
+
'ts' => $record['datetime']->getTimestamp()
|
| 131 |
+
);
|
| 132 |
+
|
| 133 |
+
if ($this->useShortAttachment) {
|
| 134 |
+
$attachment['title'] = $record['level_name'];
|
| 135 |
+
} else {
|
| 136 |
+
$attachment['title'] = 'Message';
|
| 137 |
+
$attachment['fields'][] = $this->generateAttachmentField('Level', $record['level_name']);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
if ($this->includeContextAndExtra) {
|
| 142 |
+
foreach (array('extra', 'context') as $key) {
|
| 143 |
+
if (empty($record[$key])) {
|
| 144 |
+
continue;
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
if ($this->useShortAttachment) {
|
| 148 |
+
$attachment['fields'][] = $this->generateAttachmentField(
|
| 149 |
+
ucfirst($key),
|
| 150 |
+
$record[$key]
|
| 151 |
+
);
|
| 152 |
+
} else {
|
| 153 |
+
// Add all extra fields as individual fields in attachment
|
| 154 |
+
$attachment['fields'] = array_merge(
|
| 155 |
+
$attachment['fields'],
|
| 156 |
+
$this->generateAttachmentFields($record[$key])
|
| 157 |
+
);
|
| 158 |
+
}
|
| 159 |
+
}
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
$dataArray['attachments'] = array($attachment);
|
| 163 |
+
} else {
|
| 164 |
+
$dataArray['text'] = $message;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
if ($this->userIcon) {
|
| 168 |
+
if (filter_var($this->userIcon, FILTER_VALIDATE_URL)) {
|
| 169 |
+
$dataArray['icon_url'] = $this->userIcon;
|
| 170 |
+
} else {
|
| 171 |
+
$dataArray['icon_emoji'] = ":{$this->userIcon}:";
|
| 172 |
+
}
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
return $dataArray;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
/**
|
| 179 |
+
* Returned a Slack message attachment color associated with
|
| 180 |
+
* provided level.
|
| 181 |
+
*
|
| 182 |
+
* @param int $level
|
| 183 |
+
* @return string
|
| 184 |
+
*/
|
| 185 |
+
public function getAttachmentColor($level)
|
| 186 |
+
{
|
| 187 |
+
switch (true) {
|
| 188 |
+
case $level >= Logger::ERROR:
|
| 189 |
+
return self::COLOR_DANGER;
|
| 190 |
+
case $level >= Logger::WARNING:
|
| 191 |
+
return self::COLOR_WARNING;
|
| 192 |
+
case $level >= Logger::INFO:
|
| 193 |
+
return self::COLOR_GOOD;
|
| 194 |
+
default:
|
| 195 |
+
return self::COLOR_DEFAULT;
|
| 196 |
+
}
|
| 197 |
+
}
|
| 198 |
+
|
| 199 |
+
/**
|
| 200 |
+
* Stringifies an array of key/value pairs to be used in attachment fields
|
| 201 |
+
*
|
| 202 |
+
* @param array $fields
|
| 203 |
+
*
|
| 204 |
+
* @return string
|
| 205 |
+
*/
|
| 206 |
+
public function stringify($fields)
|
| 207 |
+
{
|
| 208 |
+
$normalized = $this->normalizerFormatter->format($fields);
|
| 209 |
+
$prettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128;
|
| 210 |
+
|
| 211 |
+
$hasSecondDimension = count(array_filter($normalized, 'is_array'));
|
| 212 |
+
$hasNonNumericKeys = !count(array_filter(array_keys($normalized), 'is_numeric'));
|
| 213 |
+
|
| 214 |
+
return $hasSecondDimension || $hasNonNumericKeys
|
| 215 |
+
? json_encode($normalized, $prettyPrintFlag)
|
| 216 |
+
: json_encode($normalized);
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
/**
|
| 220 |
+
* Sets the formatter
|
| 221 |
+
*
|
| 222 |
+
* @param FormatterInterface $formatter
|
| 223 |
+
*/
|
| 224 |
+
public function setFormatter(FormatterInterface $formatter)
|
| 225 |
+
{
|
| 226 |
+
$this->formatter = $formatter;
|
| 227 |
+
}
|
| 228 |
+
|
| 229 |
+
/**
|
| 230 |
+
* Generates attachment field
|
| 231 |
+
*
|
| 232 |
+
* @param string $title
|
| 233 |
+
* @param string|array $value\
|
| 234 |
+
*
|
| 235 |
+
* @return array
|
| 236 |
+
*/
|
| 237 |
+
private function generateAttachmentField($title, $value)
|
| 238 |
+
{
|
| 239 |
+
$value = is_array($value)
|
| 240 |
+
? sprintf('```%s```', $this->stringify($value))
|
| 241 |
+
: $value;
|
| 242 |
+
|
| 243 |
+
return array(
|
| 244 |
+
'title' => $title,
|
| 245 |
+
'value' => $value,
|
| 246 |
+
'short' => false
|
| 247 |
+
);
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
/**
|
| 251 |
+
* Generates a collection of attachment fields from array
|
| 252 |
+
*
|
| 253 |
+
* @param array $data
|
| 254 |
+
*
|
| 255 |
+
* @return array
|
| 256 |
+
*/
|
| 257 |
+
private function generateAttachmentFields(array $data)
|
| 258 |
+
{
|
| 259 |
+
$fields = array();
|
| 260 |
+
foreach ($data as $key => $value) {
|
| 261 |
+
$fields[] = $this->generateAttachmentField($key, $value);
|
| 262 |
+
}
|
| 263 |
+
|
| 264 |
+
return $fields;
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
/**
|
| 268 |
+
* Get a copy of record with fields excluded according to $this->excludeFields
|
| 269 |
+
*
|
| 270 |
+
* @param array $record
|
| 271 |
+
*
|
| 272 |
+
* @return array
|
| 273 |
+
*/
|
| 274 |
+
private function excludeFields(array $record)
|
| 275 |
+
{
|
| 276 |
+
foreach ($this->excludeFields as $field) {
|
| 277 |
+
$keys = explode('.', $field);
|
| 278 |
+
$node = &$record;
|
| 279 |
+
$lastKey = end($keys);
|
| 280 |
+
foreach ($keys as $key) {
|
| 281 |
+
if (!isset($node[$key])) {
|
| 282 |
+
break;
|
| 283 |
+
}
|
| 284 |
+
if ($lastKey === $key) {
|
| 285 |
+
unset($node[$key]);
|
| 286 |
+
break;
|
| 287 |
+
}
|
| 288 |
+
$node = &$node[$key];
|
| 289 |
+
}
|
| 290 |
+
}
|
| 291 |
+
|
| 292 |
+
return $record;
|
| 293 |
+
}
|
| 294 |
+
}
|
vendor/monolog/monolog/src/Monolog/Handler/SlackWebhookHandler.php
ADDED
|
@@ -0,0 +1,115 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler;
|
| 13 |
+
|
| 14 |
+
use Monolog\Formatter\FormatterInterface;
|
| 15 |
+
use Monolog\Logger;
|
| 16 |
+
use Monolog\Handler\Slack\SlackRecord;
|
| 17 |
+
|
| 18 |
+
/**
|
| 19 |
+
* Sends notifications through Slack Webhooks
|
| 20 |
+
*
|
| 21 |
+
* @author Haralan Dobrev <hkdobrev@gmail.com>
|
| 22 |
+
* @see https://api.slack.com/incoming-webhooks
|
| 23 |
+
*/
|
| 24 |
+
class SlackWebhookHandler extends AbstractProcessingHandler
|
| 25 |
+
{
|
| 26 |
+
/**
|
| 27 |
+
* Slack Webhook token
|
| 28 |
+
* @var string
|
| 29 |
+
*/
|
| 30 |
+
private $webhookUrl;
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* Instance of the SlackRecord util class preparing data for Slack API.
|
| 34 |
+
* @var SlackRecord
|
| 35 |
+
*/
|
| 36 |
+
private $slackRecord;
|
| 37 |
+
|
| 38 |
+
/**
|
| 39 |
+
* @param string $webhookUrl Slack Webhook URL
|
| 40 |
+
* @param string|null $channel Slack channel (encoded ID or name)
|
| 41 |
+
* @param string|null $username Name of a bot
|
| 42 |
+
* @param bool $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise)
|
| 43 |
+
* @param string|null $iconEmoji The emoji name to use (or null)
|
| 44 |
+
* @param bool $useShortAttachment Whether the the context/extra messages added to Slack as attachments are in a short style
|
| 45 |
+
* @param bool $includeContextAndExtra Whether the attachment should include context and extra data
|
| 46 |
+
* @param int $level The minimum logging level at which this handler will be triggered
|
| 47 |
+
* @param bool $bubble Whether the messages that are handled can bubble up the stack or not
|
| 48 |
+
* @param array $excludeFields Dot separated list of fields to exclude from slack message. E.g. ['context.field1', 'extra.field2']
|
| 49 |
+
*/
|
| 50 |
+
public function __construct($webhookUrl, $channel = null, $username = null, $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeContextAndExtra = false, $level = Logger::CRITICAL, $bubble = true, array $excludeFields = array())
|
| 51 |
+
{
|
| 52 |
+
parent::__construct($level, $bubble);
|
| 53 |
+
|
| 54 |
+
$this->webhookUrl = $webhookUrl;
|
| 55 |
+
|
| 56 |
+
$this->slackRecord = new SlackRecord(
|
| 57 |
+
$channel,
|
| 58 |
+
$username,
|
| 59 |
+
$useAttachment,
|
| 60 |
+
$iconEmoji,
|
| 61 |
+
$useShortAttachment,
|
| 62 |
+
$includeContextAndExtra,
|
| 63 |
+
$excludeFields,
|
| 64 |
+
$this->formatter
|
| 65 |
+
);
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
public function getSlackRecord()
|
| 69 |
+
{
|
| 70 |
+
return $this->slackRecord;
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
/**
|
| 74 |
+
* {@inheritdoc}
|
| 75 |
+
*
|
| 76 |
+
* @param array $record
|
| 77 |
+
*/
|
| 78 |
+
protected function write(array $record)
|
| 79 |
+
{
|
| 80 |
+
$postData = $this->slackRecord->getSlackData($record);
|
| 81 |
+
$postString = json_encode($postData);
|
| 82 |
+
|
| 83 |
+
$ch = curl_init();
|
| 84 |
+
$options = array(
|
| 85 |
+
CURLOPT_URL => $this->webhookUrl,
|
| 86 |
+
CURLOPT_POST => true,
|
| 87 |
+
CURLOPT_RETURNTRANSFER => true,
|
| 88 |
+
CURLOPT_HTTPHEADER => array('Content-type: application/json'),
|
| 89 |
+
CURLOPT_POSTFIELDS => $postString
|
| 90 |
+
);
|
| 91 |
+
if (defined('CURLOPT_SAFE_UPLOAD')) {
|
| 92 |
+
$options[CURLOPT_SAFE_UPLOAD] = true;
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
curl_setopt_array($ch, $options);
|
| 96 |
+
|
| 97 |
+
Curl\Util::execute($ch);
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
public function setFormatter(FormatterInterface $formatter)
|
| 101 |
+
{
|
| 102 |
+
parent::setFormatter($formatter);
|
| 103 |
+
$this->slackRecord->setFormatter($formatter);
|
| 104 |
+
|
| 105 |
+
return $this;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
public function getFormatter()
|
| 109 |
+
{
|
| 110 |
+
$formatter = parent::getFormatter();
|
| 111 |
+
$this->slackRecord->setFormatter($formatter);
|
| 112 |
+
|
| 113 |
+
return $formatter;
|
| 114 |
+
}
|
| 115 |
+
}
|
vendor/monolog/monolog/src/Monolog/Handler/SlackbotHandler.php
ADDED
|
@@ -0,0 +1,80 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler;
|
| 13 |
+
|
| 14 |
+
use Monolog\Logger;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* Sends notifications through Slack's Slackbot
|
| 18 |
+
*
|
| 19 |
+
* @author Haralan Dobrev <hkdobrev@gmail.com>
|
| 20 |
+
* @see https://slack.com/apps/A0F81R8ET-slackbot
|
| 21 |
+
*/
|
| 22 |
+
class SlackbotHandler extends AbstractProcessingHandler
|
| 23 |
+
{
|
| 24 |
+
/**
|
| 25 |
+
* The slug of the Slack team
|
| 26 |
+
* @var string
|
| 27 |
+
*/
|
| 28 |
+
private $slackTeam;
|
| 29 |
+
|
| 30 |
+
/**
|
| 31 |
+
* Slackbot token
|
| 32 |
+
* @var string
|
| 33 |
+
*/
|
| 34 |
+
private $token;
|
| 35 |
+
|
| 36 |
+
/**
|
| 37 |
+
* Slack channel name
|
| 38 |
+
* @var string
|
| 39 |
+
*/
|
| 40 |
+
private $channel;
|
| 41 |
+
|
| 42 |
+
/**
|
| 43 |
+
* @param string $slackTeam Slack team slug
|
| 44 |
+
* @param string $token Slackbot token
|
| 45 |
+
* @param string $channel Slack channel (encoded ID or name)
|
| 46 |
+
* @param int $level The minimum logging level at which this handler will be triggered
|
| 47 |
+
* @param bool $bubble Whether the messages that are handled can bubble up the stack or not
|
| 48 |
+
*/
|
| 49 |
+
public function __construct($slackTeam, $token, $channel, $level = Logger::CRITICAL, $bubble = true)
|
| 50 |
+
{
|
| 51 |
+
parent::__construct($level, $bubble);
|
| 52 |
+
|
| 53 |
+
$this->slackTeam = $slackTeam;
|
| 54 |
+
$this->token = $token;
|
| 55 |
+
$this->channel = $channel;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* {@inheritdoc}
|
| 60 |
+
*
|
| 61 |
+
* @param array $record
|
| 62 |
+
*/
|
| 63 |
+
protected function write(array $record)
|
| 64 |
+
{
|
| 65 |
+
$slackbotUrl = sprintf(
|
| 66 |
+
'https://%s.slack.com/services/hooks/slackbot?token=%s&channel=%s',
|
| 67 |
+
$this->slackTeam,
|
| 68 |
+
$this->token,
|
| 69 |
+
$this->channel
|
| 70 |
+
);
|
| 71 |
+
|
| 72 |
+
$ch = curl_init();
|
| 73 |
+
curl_setopt($ch, CURLOPT_URL, $slackbotUrl);
|
| 74 |
+
curl_setopt($ch, CURLOPT_POST, true);
|
| 75 |
+
curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
|
| 76 |
+
curl_setopt($ch, CURLOPT_POSTFIELDS, $record['message']);
|
| 77 |
+
|
| 78 |
+
Curl\Util::execute($ch);
|
| 79 |
+
}
|
| 80 |
+
}
|
vendor/monolog/monolog/src/Monolog/Processor/MercurialProcessor.php
ADDED
|
@@ -0,0 +1,63 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jonathan A. Schweder <jonathanschweder@gmail.com>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Processor;
|
| 13 |
+
|
| 14 |
+
use Monolog\Logger;
|
| 15 |
+
|
| 16 |
+
/**
|
| 17 |
+
* Injects Hg branch and Hg revision number in all records
|
| 18 |
+
*
|
| 19 |
+
* @author Jonathan A. Schweder <jonathanschweder@gmail.com>
|
| 20 |
+
*/
|
| 21 |
+
class MercurialProcessor
|
| 22 |
+
{
|
| 23 |
+
private $level;
|
| 24 |
+
private static $cache;
|
| 25 |
+
|
| 26 |
+
public function __construct($level = Logger::DEBUG)
|
| 27 |
+
{
|
| 28 |
+
$this->level = Logger::toMonologLevel($level);
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
* @param array $record
|
| 33 |
+
* @return array
|
| 34 |
+
*/
|
| 35 |
+
public function __invoke(array $record)
|
| 36 |
+
{
|
| 37 |
+
// return if the level is not high enough
|
| 38 |
+
if ($record['level'] < $this->level) {
|
| 39 |
+
return $record;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
$record['extra']['hg'] = self::getMercurialInfo();
|
| 43 |
+
|
| 44 |
+
return $record;
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
private static function getMercurialInfo()
|
| 48 |
+
{
|
| 49 |
+
if (self::$cache) {
|
| 50 |
+
return self::$cache;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
$result = explode(' ', trim(`hg id -nb`));
|
| 54 |
+
if (count($result) >= 3) {
|
| 55 |
+
return self::$cache = array(
|
| 56 |
+
'branch' => $result[1],
|
| 57 |
+
'revision' => $result[2],
|
| 58 |
+
);
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
return self::$cache = array();
|
| 62 |
+
}
|
| 63 |
+
}
|
vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog;
|
| 13 |
-
|
| 14 |
-
use Monolog\Handler\TestHandler;
|
| 15 |
-
|
| 16 |
-
class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
public function testHandleError()
|
| 19 |
-
{
|
| 20 |
-
$logger = new Logger('test', array($handler = new TestHandler));
|
| 21 |
-
$errHandler = new ErrorHandler($logger);
|
| 22 |
-
|
| 23 |
-
$errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
|
| 24 |
-
trigger_error('Foo', E_USER_ERROR);
|
| 25 |
-
$this->assertCount(1, $handler->getRecords());
|
| 26 |
-
$this->assertTrue($handler->hasErrorRecords());
|
| 27 |
-
trigger_error('Foo', E_USER_NOTICE);
|
| 28 |
-
$this->assertCount(2, $handler->getRecords());
|
| 29 |
-
$this->assertTrue($handler->hasEmergencyRecords());
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
DELETED
|
@@ -1,158 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
/**
|
| 19 |
-
* @covers Monolog\Formatter\ChromePHPFormatter::format
|
| 20 |
-
*/
|
| 21 |
-
public function testDefaultFormat()
|
| 22 |
-
{
|
| 23 |
-
$formatter = new ChromePHPFormatter();
|
| 24 |
-
$record = array(
|
| 25 |
-
'level' => Logger::ERROR,
|
| 26 |
-
'level_name' => 'ERROR',
|
| 27 |
-
'channel' => 'meh',
|
| 28 |
-
'context' => array('from' => 'logger'),
|
| 29 |
-
'datetime' => new \DateTime("@0"),
|
| 30 |
-
'extra' => array('ip' => '127.0.0.1'),
|
| 31 |
-
'message' => 'log',
|
| 32 |
-
);
|
| 33 |
-
|
| 34 |
-
$message = $formatter->format($record);
|
| 35 |
-
|
| 36 |
-
$this->assertEquals(
|
| 37 |
-
array(
|
| 38 |
-
'meh',
|
| 39 |
-
array(
|
| 40 |
-
'message' => 'log',
|
| 41 |
-
'context' => array('from' => 'logger'),
|
| 42 |
-
'extra' => array('ip' => '127.0.0.1'),
|
| 43 |
-
),
|
| 44 |
-
'unknown',
|
| 45 |
-
'error',
|
| 46 |
-
),
|
| 47 |
-
$message
|
| 48 |
-
);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* @covers Monolog\Formatter\ChromePHPFormatter::format
|
| 53 |
-
*/
|
| 54 |
-
public function testFormatWithFileAndLine()
|
| 55 |
-
{
|
| 56 |
-
$formatter = new ChromePHPFormatter();
|
| 57 |
-
$record = array(
|
| 58 |
-
'level' => Logger::CRITICAL,
|
| 59 |
-
'level_name' => 'CRITICAL',
|
| 60 |
-
'channel' => 'meh',
|
| 61 |
-
'context' => array('from' => 'logger'),
|
| 62 |
-
'datetime' => new \DateTime("@0"),
|
| 63 |
-
'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
|
| 64 |
-
'message' => 'log',
|
| 65 |
-
);
|
| 66 |
-
|
| 67 |
-
$message = $formatter->format($record);
|
| 68 |
-
|
| 69 |
-
$this->assertEquals(
|
| 70 |
-
array(
|
| 71 |
-
'meh',
|
| 72 |
-
array(
|
| 73 |
-
'message' => 'log',
|
| 74 |
-
'context' => array('from' => 'logger'),
|
| 75 |
-
'extra' => array('ip' => '127.0.0.1'),
|
| 76 |
-
),
|
| 77 |
-
'test : 14',
|
| 78 |
-
'error',
|
| 79 |
-
),
|
| 80 |
-
$message
|
| 81 |
-
);
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* @covers Monolog\Formatter\ChromePHPFormatter::format
|
| 86 |
-
*/
|
| 87 |
-
public function testFormatWithoutContext()
|
| 88 |
-
{
|
| 89 |
-
$formatter = new ChromePHPFormatter();
|
| 90 |
-
$record = array(
|
| 91 |
-
'level' => Logger::DEBUG,
|
| 92 |
-
'level_name' => 'DEBUG',
|
| 93 |
-
'channel' => 'meh',
|
| 94 |
-
'context' => array(),
|
| 95 |
-
'datetime' => new \DateTime("@0"),
|
| 96 |
-
'extra' => array(),
|
| 97 |
-
'message' => 'log',
|
| 98 |
-
);
|
| 99 |
-
|
| 100 |
-
$message = $formatter->format($record);
|
| 101 |
-
|
| 102 |
-
$this->assertEquals(
|
| 103 |
-
array(
|
| 104 |
-
'meh',
|
| 105 |
-
'log',
|
| 106 |
-
'unknown',
|
| 107 |
-
'log',
|
| 108 |
-
),
|
| 109 |
-
$message
|
| 110 |
-
);
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
|
| 115 |
-
*/
|
| 116 |
-
public function testBatchFormatThrowException()
|
| 117 |
-
{
|
| 118 |
-
$formatter = new ChromePHPFormatter();
|
| 119 |
-
$records = array(
|
| 120 |
-
array(
|
| 121 |
-
'level' => Logger::INFO,
|
| 122 |
-
'level_name' => 'INFO',
|
| 123 |
-
'channel' => 'meh',
|
| 124 |
-
'context' => array(),
|
| 125 |
-
'datetime' => new \DateTime("@0"),
|
| 126 |
-
'extra' => array(),
|
| 127 |
-
'message' => 'log',
|
| 128 |
-
),
|
| 129 |
-
array(
|
| 130 |
-
'level' => Logger::WARNING,
|
| 131 |
-
'level_name' => 'WARNING',
|
| 132 |
-
'channel' => 'foo',
|
| 133 |
-
'context' => array(),
|
| 134 |
-
'datetime' => new \DateTime("@0"),
|
| 135 |
-
'extra' => array(),
|
| 136 |
-
'message' => 'log2',
|
| 137 |
-
),
|
| 138 |
-
);
|
| 139 |
-
|
| 140 |
-
$this->assertEquals(
|
| 141 |
-
array(
|
| 142 |
-
array(
|
| 143 |
-
'meh',
|
| 144 |
-
'log',
|
| 145 |
-
'unknown',
|
| 146 |
-
'info',
|
| 147 |
-
),
|
| 148 |
-
array(
|
| 149 |
-
'foo',
|
| 150 |
-
'log2',
|
| 151 |
-
'unknown',
|
| 152 |
-
'warn',
|
| 153 |
-
),
|
| 154 |
-
),
|
| 155 |
-
$formatter->formatBatch($records)
|
| 156 |
-
);
|
| 157 |
-
}
|
| 158 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
DELETED
|
@@ -1,79 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
public function setUp()
|
| 19 |
-
{
|
| 20 |
-
if (!class_exists("Elastica\Document")) {
|
| 21 |
-
$this->markTestSkipped("ruflin/elastica not installed");
|
| 22 |
-
}
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* @covers Monolog\Formatter\ElasticaFormatter::__construct
|
| 27 |
-
* @covers Monolog\Formatter\ElasticaFormatter::format
|
| 28 |
-
* @covers Monolog\Formatter\ElasticaFormatter::getDocument
|
| 29 |
-
*/
|
| 30 |
-
public function testFormat()
|
| 31 |
-
{
|
| 32 |
-
// test log message
|
| 33 |
-
$msg = array(
|
| 34 |
-
'level' => Logger::ERROR,
|
| 35 |
-
'level_name' => 'ERROR',
|
| 36 |
-
'channel' => 'meh',
|
| 37 |
-
'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
|
| 38 |
-
'datetime' => new \DateTime("@0"),
|
| 39 |
-
'extra' => array(),
|
| 40 |
-
'message' => 'log',
|
| 41 |
-
);
|
| 42 |
-
|
| 43 |
-
// expected values
|
| 44 |
-
$expected = $msg;
|
| 45 |
-
$expected['datetime'] = '1970-01-01T00:00:00.000000+00:00';
|
| 46 |
-
$expected['context'] = array(
|
| 47 |
-
'class' => '[object] (stdClass: {})',
|
| 48 |
-
'foo' => 7,
|
| 49 |
-
0 => 'bar',
|
| 50 |
-
);
|
| 51 |
-
|
| 52 |
-
// format log message
|
| 53 |
-
$formatter = new ElasticaFormatter('my_index', 'doc_type');
|
| 54 |
-
$doc = $formatter->format($msg);
|
| 55 |
-
$this->assertInstanceOf('Elastica\Document', $doc);
|
| 56 |
-
|
| 57 |
-
// Document parameters
|
| 58 |
-
$params = $doc->getParams();
|
| 59 |
-
$this->assertEquals('my_index', $params['_index']);
|
| 60 |
-
$this->assertEquals('doc_type', $params['_type']);
|
| 61 |
-
|
| 62 |
-
// Document data values
|
| 63 |
-
$data = $doc->getData();
|
| 64 |
-
foreach (array_keys($expected) as $key) {
|
| 65 |
-
$this->assertEquals($expected[$key], $data[$key]);
|
| 66 |
-
}
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
/**
|
| 70 |
-
* @covers Monolog\Formatter\ElasticaFormatter::getIndex
|
| 71 |
-
* @covers Monolog\Formatter\ElasticaFormatter::getType
|
| 72 |
-
*/
|
| 73 |
-
public function testGetters()
|
| 74 |
-
{
|
| 75 |
-
$formatter = new ElasticaFormatter('my_index', 'doc_type');
|
| 76 |
-
$this->assertEquals('my_index', $formatter->getIndex());
|
| 77 |
-
$this->assertEquals('doc_type', $formatter->getType());
|
| 78 |
-
}
|
| 79 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
DELETED
|
@@ -1,55 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class FlowdockFormatterTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Formatter\FlowdockFormatter::format
|
| 21 |
-
*/
|
| 22 |
-
public function testFormat()
|
| 23 |
-
{
|
| 24 |
-
$formatter = new FlowdockFormatter('test_source', 'source@test.com');
|
| 25 |
-
$record = $this->getRecord();
|
| 26 |
-
|
| 27 |
-
$expected = array(
|
| 28 |
-
'source' => 'test_source',
|
| 29 |
-
'from_address' => 'source@test.com',
|
| 30 |
-
'subject' => 'in test_source: WARNING - test',
|
| 31 |
-
'content' => 'test',
|
| 32 |
-
'tags' => array('#logs', '#warning', '#test'),
|
| 33 |
-
'project' => 'test_source',
|
| 34 |
-
);
|
| 35 |
-
$formatted = $formatter->format($record);
|
| 36 |
-
|
| 37 |
-
$this->assertEquals($expected, $formatted['flowdock']);
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
|
| 42 |
-
*/
|
| 43 |
-
public function testFormatBatch()
|
| 44 |
-
{
|
| 45 |
-
$formatter = new FlowdockFormatter('test_source', 'source@test.com');
|
| 46 |
-
$records = array(
|
| 47 |
-
$this->getRecord(Logger::WARNING),
|
| 48 |
-
$this->getRecord(Logger::DEBUG),
|
| 49 |
-
);
|
| 50 |
-
$formatted = $formatter->formatBatch($records);
|
| 51 |
-
|
| 52 |
-
$this->assertArrayHasKey('flowdock', $formatted[0]);
|
| 53 |
-
$this->assertArrayHasKey('flowdock', $formatted[1]);
|
| 54 |
-
}
|
| 55 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php
DELETED
|
@@ -1,62 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class FluentdFormatterTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Formatter\FluentdFormatter::__construct
|
| 21 |
-
* @covers Monolog\Formatter\FluentdFormatter::isUsingLevelsInTag
|
| 22 |
-
*/
|
| 23 |
-
public function testConstruct()
|
| 24 |
-
{
|
| 25 |
-
$formatter = new FluentdFormatter();
|
| 26 |
-
$this->assertEquals(false, $formatter->isUsingLevelsInTag());
|
| 27 |
-
$formatter = new FluentdFormatter(false);
|
| 28 |
-
$this->assertEquals(false, $formatter->isUsingLevelsInTag());
|
| 29 |
-
$formatter = new FluentdFormatter(true);
|
| 30 |
-
$this->assertEquals(true, $formatter->isUsingLevelsInTag());
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
/**
|
| 34 |
-
* @covers Monolog\Formatter\FluentdFormatter::format
|
| 35 |
-
*/
|
| 36 |
-
public function testFormat()
|
| 37 |
-
{
|
| 38 |
-
$record = $this->getRecord(Logger::WARNING);
|
| 39 |
-
$record['datetime'] = new \DateTime("@0");
|
| 40 |
-
|
| 41 |
-
$formatter = new FluentdFormatter();
|
| 42 |
-
$this->assertEquals(
|
| 43 |
-
'["test",0,{"message":"test","extra":[],"level":300,"level_name":"WARNING"}]',
|
| 44 |
-
$formatter->format($record)
|
| 45 |
-
);
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* @covers Monolog\Formatter\FluentdFormatter::format
|
| 50 |
-
*/
|
| 51 |
-
public function testFormatWithTag()
|
| 52 |
-
{
|
| 53 |
-
$record = $this->getRecord(Logger::ERROR);
|
| 54 |
-
$record['datetime'] = new \DateTime("@0");
|
| 55 |
-
|
| 56 |
-
$formatter = new FluentdFormatter(true);
|
| 57 |
-
$this->assertEquals(
|
| 58 |
-
'["test.error",0,{"message":"test","extra":[]}]',
|
| 59 |
-
$formatter->format($record)
|
| 60 |
-
);
|
| 61 |
-
}
|
| 62 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
DELETED
|
@@ -1,234 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
public function setUp()
|
| 19 |
-
{
|
| 20 |
-
if (!class_exists('\Gelf\Message')) {
|
| 21 |
-
$this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
|
| 22 |
-
}
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 27 |
-
*/
|
| 28 |
-
public function testDefaultFormatter()
|
| 29 |
-
{
|
| 30 |
-
$formatter = new GelfMessageFormatter();
|
| 31 |
-
$record = array(
|
| 32 |
-
'level' => Logger::ERROR,
|
| 33 |
-
'level_name' => 'ERROR',
|
| 34 |
-
'channel' => 'meh',
|
| 35 |
-
'context' => array(),
|
| 36 |
-
'datetime' => new \DateTime("@0"),
|
| 37 |
-
'extra' => array(),
|
| 38 |
-
'message' => 'log',
|
| 39 |
-
);
|
| 40 |
-
|
| 41 |
-
$message = $formatter->format($record);
|
| 42 |
-
|
| 43 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 44 |
-
$this->assertEquals(0, $message->getTimestamp());
|
| 45 |
-
$this->assertEquals('log', $message->getShortMessage());
|
| 46 |
-
$this->assertEquals('meh', $message->getFacility());
|
| 47 |
-
$this->assertEquals(null, $message->getLine());
|
| 48 |
-
$this->assertEquals(null, $message->getFile());
|
| 49 |
-
$this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
|
| 50 |
-
$this->assertNotEmpty($message->getHost());
|
| 51 |
-
|
| 52 |
-
$formatter = new GelfMessageFormatter('mysystem');
|
| 53 |
-
|
| 54 |
-
$message = $formatter->format($record);
|
| 55 |
-
|
| 56 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 57 |
-
$this->assertEquals('mysystem', $message->getHost());
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 62 |
-
*/
|
| 63 |
-
public function testFormatWithFileAndLine()
|
| 64 |
-
{
|
| 65 |
-
$formatter = new GelfMessageFormatter();
|
| 66 |
-
$record = array(
|
| 67 |
-
'level' => Logger::ERROR,
|
| 68 |
-
'level_name' => 'ERROR',
|
| 69 |
-
'channel' => 'meh',
|
| 70 |
-
'context' => array('from' => 'logger'),
|
| 71 |
-
'datetime' => new \DateTime("@0"),
|
| 72 |
-
'extra' => array('file' => 'test', 'line' => 14),
|
| 73 |
-
'message' => 'log',
|
| 74 |
-
);
|
| 75 |
-
|
| 76 |
-
$message = $formatter->format($record);
|
| 77 |
-
|
| 78 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 79 |
-
$this->assertEquals('test', $message->getFile());
|
| 80 |
-
$this->assertEquals(14, $message->getLine());
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 85 |
-
* @expectedException InvalidArgumentException
|
| 86 |
-
*/
|
| 87 |
-
public function testFormatInvalidFails()
|
| 88 |
-
{
|
| 89 |
-
$formatter = new GelfMessageFormatter();
|
| 90 |
-
$record = array(
|
| 91 |
-
'level' => Logger::ERROR,
|
| 92 |
-
'level_name' => 'ERROR',
|
| 93 |
-
);
|
| 94 |
-
|
| 95 |
-
$formatter->format($record);
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/**
|
| 99 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 100 |
-
*/
|
| 101 |
-
public function testFormatWithContext()
|
| 102 |
-
{
|
| 103 |
-
$formatter = new GelfMessageFormatter();
|
| 104 |
-
$record = array(
|
| 105 |
-
'level' => Logger::ERROR,
|
| 106 |
-
'level_name' => 'ERROR',
|
| 107 |
-
'channel' => 'meh',
|
| 108 |
-
'context' => array('from' => 'logger'),
|
| 109 |
-
'datetime' => new \DateTime("@0"),
|
| 110 |
-
'extra' => array('key' => 'pair'),
|
| 111 |
-
'message' => 'log',
|
| 112 |
-
);
|
| 113 |
-
|
| 114 |
-
$message = $formatter->format($record);
|
| 115 |
-
|
| 116 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 117 |
-
|
| 118 |
-
$message_array = $message->toArray();
|
| 119 |
-
|
| 120 |
-
$this->assertArrayHasKey('_ctxt_from', $message_array);
|
| 121 |
-
$this->assertEquals('logger', $message_array['_ctxt_from']);
|
| 122 |
-
|
| 123 |
-
// Test with extraPrefix
|
| 124 |
-
$formatter = new GelfMessageFormatter(null, null, 'CTX');
|
| 125 |
-
$message = $formatter->format($record);
|
| 126 |
-
|
| 127 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 128 |
-
|
| 129 |
-
$message_array = $message->toArray();
|
| 130 |
-
|
| 131 |
-
$this->assertArrayHasKey('_CTXfrom', $message_array);
|
| 132 |
-
$this->assertEquals('logger', $message_array['_CTXfrom']);
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/**
|
| 136 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 137 |
-
*/
|
| 138 |
-
public function testFormatWithContextContainingException()
|
| 139 |
-
{
|
| 140 |
-
$formatter = new GelfMessageFormatter();
|
| 141 |
-
$record = array(
|
| 142 |
-
'level' => Logger::ERROR,
|
| 143 |
-
'level_name' => 'ERROR',
|
| 144 |
-
'channel' => 'meh',
|
| 145 |
-
'context' => array('from' => 'logger', 'exception' => array(
|
| 146 |
-
'class' => '\Exception',
|
| 147 |
-
'file' => '/some/file/in/dir.php:56',
|
| 148 |
-
'trace' => array('/some/file/1.php:23', '/some/file/2.php:3'),
|
| 149 |
-
)),
|
| 150 |
-
'datetime' => new \DateTime("@0"),
|
| 151 |
-
'extra' => array(),
|
| 152 |
-
'message' => 'log',
|
| 153 |
-
);
|
| 154 |
-
|
| 155 |
-
$message = $formatter->format($record);
|
| 156 |
-
|
| 157 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 158 |
-
|
| 159 |
-
$this->assertEquals("/some/file/in/dir.php", $message->getFile());
|
| 160 |
-
$this->assertEquals("56", $message->getLine());
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
/**
|
| 164 |
-
* @covers Monolog\Formatter\GelfMessageFormatter::format
|
| 165 |
-
*/
|
| 166 |
-
public function testFormatWithExtra()
|
| 167 |
-
{
|
| 168 |
-
$formatter = new GelfMessageFormatter();
|
| 169 |
-
$record = array(
|
| 170 |
-
'level' => Logger::ERROR,
|
| 171 |
-
'level_name' => 'ERROR',
|
| 172 |
-
'channel' => 'meh',
|
| 173 |
-
'context' => array('from' => 'logger'),
|
| 174 |
-
'datetime' => new \DateTime("@0"),
|
| 175 |
-
'extra' => array('key' => 'pair'),
|
| 176 |
-
'message' => 'log',
|
| 177 |
-
);
|
| 178 |
-
|
| 179 |
-
$message = $formatter->format($record);
|
| 180 |
-
|
| 181 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 182 |
-
|
| 183 |
-
$message_array = $message->toArray();
|
| 184 |
-
|
| 185 |
-
$this->assertArrayHasKey('_key', $message_array);
|
| 186 |
-
$this->assertEquals('pair', $message_array['_key']);
|
| 187 |
-
|
| 188 |
-
// Test with extraPrefix
|
| 189 |
-
$formatter = new GelfMessageFormatter(null, 'EXT');
|
| 190 |
-
$message = $formatter->format($record);
|
| 191 |
-
|
| 192 |
-
$this->assertInstanceOf('Gelf\Message', $message);
|
| 193 |
-
|
| 194 |
-
$message_array = $message->toArray();
|
| 195 |
-
|
| 196 |
-
$this->assertArrayHasKey('_EXTkey', $message_array);
|
| 197 |
-
$this->assertEquals('pair', $message_array['_EXTkey']);
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
public function testFormatWithLargeData()
|
| 201 |
-
{
|
| 202 |
-
$formatter = new GelfMessageFormatter();
|
| 203 |
-
$record = array(
|
| 204 |
-
'level' => Logger::ERROR,
|
| 205 |
-
'level_name' => 'ERROR',
|
| 206 |
-
'channel' => 'meh',
|
| 207 |
-
'context' => array('exception' => str_repeat(' ', 32767)),
|
| 208 |
-
'datetime' => new \DateTime("@0"),
|
| 209 |
-
'extra' => array('key' => str_repeat(' ', 32767)),
|
| 210 |
-
'message' => 'log'
|
| 211 |
-
);
|
| 212 |
-
$message = $formatter->format($record);
|
| 213 |
-
$messageArray = $message->toArray();
|
| 214 |
-
|
| 215 |
-
// 200 for padding + metadata
|
| 216 |
-
$length = 200;
|
| 217 |
-
|
| 218 |
-
foreach ($messageArray as $key => $value) {
|
| 219 |
-
if (!in_array($key, array('level', 'timestamp'))) {
|
| 220 |
-
$length += strlen($value);
|
| 221 |
-
}
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
// in graylog2/gelf-php before 1.4.1 empty strings are filtered and won't be included in the message
|
| 225 |
-
// though it should be sufficient to ensure that the entire message length does not exceed the maximum
|
| 226 |
-
// length being allowed
|
| 227 |
-
$this->assertLessThanOrEqual(32766, $length, 'The message length is no longer than the maximum allowed length');
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
private function isLegacy()
|
| 231 |
-
{
|
| 232 |
-
return interface_exists('\Gelf\IMessagePublisher');
|
| 233 |
-
}
|
| 234 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
DELETED
|
@@ -1,122 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class JsonFormatterTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Formatter\JsonFormatter::__construct
|
| 21 |
-
* @covers Monolog\Formatter\JsonFormatter::getBatchMode
|
| 22 |
-
* @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
|
| 23 |
-
*/
|
| 24 |
-
public function testConstruct()
|
| 25 |
-
{
|
| 26 |
-
$formatter = new JsonFormatter();
|
| 27 |
-
$this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
|
| 28 |
-
$this->assertEquals(true, $formatter->isAppendingNewlines());
|
| 29 |
-
$formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
|
| 30 |
-
$this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
|
| 31 |
-
$this->assertEquals(false, $formatter->isAppendingNewlines());
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* @covers Monolog\Formatter\JsonFormatter::format
|
| 36 |
-
*/
|
| 37 |
-
public function testFormat()
|
| 38 |
-
{
|
| 39 |
-
$formatter = new JsonFormatter();
|
| 40 |
-
$record = $this->getRecord();
|
| 41 |
-
$this->assertEquals(json_encode($record)."\n", $formatter->format($record));
|
| 42 |
-
|
| 43 |
-
$formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
|
| 44 |
-
$record = $this->getRecord();
|
| 45 |
-
$this->assertEquals(json_encode($record), $formatter->format($record));
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* @covers Monolog\Formatter\JsonFormatter::formatBatch
|
| 50 |
-
* @covers Monolog\Formatter\JsonFormatter::formatBatchJson
|
| 51 |
-
*/
|
| 52 |
-
public function testFormatBatch()
|
| 53 |
-
{
|
| 54 |
-
$formatter = new JsonFormatter();
|
| 55 |
-
$records = array(
|
| 56 |
-
$this->getRecord(Logger::WARNING),
|
| 57 |
-
$this->getRecord(Logger::DEBUG),
|
| 58 |
-
);
|
| 59 |
-
$this->assertEquals(json_encode($records), $formatter->formatBatch($records));
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
/**
|
| 63 |
-
* @covers Monolog\Formatter\JsonFormatter::formatBatch
|
| 64 |
-
* @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
|
| 65 |
-
*/
|
| 66 |
-
public function testFormatBatchNewlines()
|
| 67 |
-
{
|
| 68 |
-
$formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
|
| 69 |
-
$records = $expected = array(
|
| 70 |
-
$this->getRecord(Logger::WARNING),
|
| 71 |
-
$this->getRecord(Logger::DEBUG),
|
| 72 |
-
);
|
| 73 |
-
array_walk($expected, function (&$value, $key) {
|
| 74 |
-
$value = json_encode($value);
|
| 75 |
-
});
|
| 76 |
-
$this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testDefFormatWithException()
|
| 80 |
-
{
|
| 81 |
-
$formatter = new JsonFormatter();
|
| 82 |
-
$exception = new \RuntimeException('Foo');
|
| 83 |
-
$message = $formatter->format(array(
|
| 84 |
-
'level_name' => 'CRITICAL',
|
| 85 |
-
'channel' => 'core',
|
| 86 |
-
'context' => array('exception' => $exception),
|
| 87 |
-
'datetime' => new \DateTime(),
|
| 88 |
-
'extra' => array(),
|
| 89 |
-
'message' => 'foobar',
|
| 90 |
-
));
|
| 91 |
-
|
| 92 |
-
if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
|
| 93 |
-
$path = substr(json_encode($exception->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
|
| 94 |
-
} else {
|
| 95 |
-
$path = substr(json_encode($exception->getFile()), 1, -1);
|
| 96 |
-
}
|
| 97 |
-
$this->assertEquals('{"level_name":"CRITICAL","channel":"core","context":{"exception":{"class":"RuntimeException","message":"'.$exception->getMessage().'","code":'.$exception->getCode().',"file":"'.$path.':'.$exception->getLine().'"}},"datetime":'.json_encode(new \DateTime()).',"extra":[],"message":"foobar"}'."\n", $message);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
public function testDefFormatWithPreviousException()
|
| 101 |
-
{
|
| 102 |
-
$formatter = new JsonFormatter();
|
| 103 |
-
$exception = new \RuntimeException('Foo', 0, new \LogicException('Wut?'));
|
| 104 |
-
$message = $formatter->format(array(
|
| 105 |
-
'level_name' => 'CRITICAL',
|
| 106 |
-
'channel' => 'core',
|
| 107 |
-
'context' => array('exception' => $exception),
|
| 108 |
-
'datetime' => new \DateTime(),
|
| 109 |
-
'extra' => array(),
|
| 110 |
-
'message' => 'foobar',
|
| 111 |
-
));
|
| 112 |
-
|
| 113 |
-
if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
|
| 114 |
-
$pathPrevious = substr(json_encode($exception->getPrevious()->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
|
| 115 |
-
$pathException = substr(json_encode($exception->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
|
| 116 |
-
} else {
|
| 117 |
-
$pathPrevious = substr(json_encode($exception->getPrevious()->getFile()), 1, -1);
|
| 118 |
-
$pathException = substr(json_encode($exception->getFile()), 1, -1);
|
| 119 |
-
}
|
| 120 |
-
$this->assertEquals('{"level_name":"CRITICAL","channel":"core","context":{"exception":{"class":"RuntimeException","message":"'.$exception->getMessage().'","code":'.$exception->getCode().',"file":"'.$pathException.':'.$exception->getLine().'","previous":{"class":"LogicException","message":"'.$exception->getPrevious()->getMessage().'","code":'.$exception->getPrevious()->getCode().',"file":"'.$pathPrevious.':'.$exception->getPrevious()->getLine().'"}}},"datetime":'.json_encode(new \DateTime()).',"extra":[],"message":"foobar"}'."\n", $message);
|
| 121 |
-
}
|
| 122 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
DELETED
|
@@ -1,222 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* @covers Monolog\Formatter\LineFormatter
|
| 16 |
-
*/
|
| 17 |
-
class LineFormatterTest extends \PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
public function testDefFormatWithString()
|
| 20 |
-
{
|
| 21 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 22 |
-
$message = $formatter->format(array(
|
| 23 |
-
'level_name' => 'WARNING',
|
| 24 |
-
'channel' => 'log',
|
| 25 |
-
'context' => array(),
|
| 26 |
-
'message' => 'foo',
|
| 27 |
-
'datetime' => new \DateTime,
|
| 28 |
-
'extra' => array(),
|
| 29 |
-
));
|
| 30 |
-
$this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testDefFormatWithArrayContext()
|
| 34 |
-
{
|
| 35 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 36 |
-
$message = $formatter->format(array(
|
| 37 |
-
'level_name' => 'ERROR',
|
| 38 |
-
'channel' => 'meh',
|
| 39 |
-
'message' => 'foo',
|
| 40 |
-
'datetime' => new \DateTime,
|
| 41 |
-
'extra' => array(),
|
| 42 |
-
'context' => array(
|
| 43 |
-
'foo' => 'bar',
|
| 44 |
-
'baz' => 'qux',
|
| 45 |
-
'bool' => false,
|
| 46 |
-
'null' => null,
|
| 47 |
-
),
|
| 48 |
-
));
|
| 49 |
-
$this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
public function testDefFormatExtras()
|
| 53 |
-
{
|
| 54 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 55 |
-
$message = $formatter->format(array(
|
| 56 |
-
'level_name' => 'ERROR',
|
| 57 |
-
'channel' => 'meh',
|
| 58 |
-
'context' => array(),
|
| 59 |
-
'datetime' => new \DateTime,
|
| 60 |
-
'extra' => array('ip' => '127.0.0.1'),
|
| 61 |
-
'message' => 'log',
|
| 62 |
-
));
|
| 63 |
-
$this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testFormatExtras()
|
| 67 |
-
{
|
| 68 |
-
$formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
|
| 69 |
-
$message = $formatter->format(array(
|
| 70 |
-
'level_name' => 'ERROR',
|
| 71 |
-
'channel' => 'meh',
|
| 72 |
-
'context' => array(),
|
| 73 |
-
'datetime' => new \DateTime,
|
| 74 |
-
'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
|
| 75 |
-
'message' => 'log',
|
| 76 |
-
));
|
| 77 |
-
$this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
public function testContextAndExtraOptionallyNotShownIfEmpty()
|
| 81 |
-
{
|
| 82 |
-
$formatter = new LineFormatter(null, 'Y-m-d', false, true);
|
| 83 |
-
$message = $formatter->format(array(
|
| 84 |
-
'level_name' => 'ERROR',
|
| 85 |
-
'channel' => 'meh',
|
| 86 |
-
'context' => array(),
|
| 87 |
-
'datetime' => new \DateTime,
|
| 88 |
-
'extra' => array(),
|
| 89 |
-
'message' => 'log',
|
| 90 |
-
));
|
| 91 |
-
$this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message);
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
public function testContextAndExtraReplacement()
|
| 95 |
-
{
|
| 96 |
-
$formatter = new LineFormatter('%context.foo% => %extra.foo%');
|
| 97 |
-
$message = $formatter->format(array(
|
| 98 |
-
'level_name' => 'ERROR',
|
| 99 |
-
'channel' => 'meh',
|
| 100 |
-
'context' => array('foo' => 'bar'),
|
| 101 |
-
'datetime' => new \DateTime,
|
| 102 |
-
'extra' => array('foo' => 'xbar'),
|
| 103 |
-
'message' => 'log',
|
| 104 |
-
));
|
| 105 |
-
$this->assertEquals('bar => xbar', $message);
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
public function testDefFormatWithObject()
|
| 109 |
-
{
|
| 110 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 111 |
-
$message = $formatter->format(array(
|
| 112 |
-
'level_name' => 'ERROR',
|
| 113 |
-
'channel' => 'meh',
|
| 114 |
-
'context' => array(),
|
| 115 |
-
'datetime' => new \DateTime,
|
| 116 |
-
'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
|
| 117 |
-
'message' => 'foobar',
|
| 118 |
-
));
|
| 119 |
-
|
| 120 |
-
$this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource] (stream)"}'."\n", $message);
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
public function testDefFormatWithException()
|
| 124 |
-
{
|
| 125 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 126 |
-
$message = $formatter->format(array(
|
| 127 |
-
'level_name' => 'CRITICAL',
|
| 128 |
-
'channel' => 'core',
|
| 129 |
-
'context' => array('exception' => new \RuntimeException('Foo')),
|
| 130 |
-
'datetime' => new \DateTime,
|
| 131 |
-
'extra' => array(),
|
| 132 |
-
'message' => 'foobar',
|
| 133 |
-
));
|
| 134 |
-
|
| 135 |
-
$path = str_replace('\\/', '/', json_encode(__FILE__));
|
| 136 |
-
|
| 137 |
-
$this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).')"} []'."\n", $message);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
public function testDefFormatWithPreviousException()
|
| 141 |
-
{
|
| 142 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 143 |
-
$previous = new \LogicException('Wut?');
|
| 144 |
-
$message = $formatter->format(array(
|
| 145 |
-
'level_name' => 'CRITICAL',
|
| 146 |
-
'channel' => 'core',
|
| 147 |
-
'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
|
| 148 |
-
'datetime' => new \DateTime,
|
| 149 |
-
'extra' => array(),
|
| 150 |
-
'message' => 'foobar',
|
| 151 |
-
));
|
| 152 |
-
|
| 153 |
-
$path = str_replace('\\/', '/', json_encode(__FILE__));
|
| 154 |
-
|
| 155 |
-
$this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__ - 12).')"} []'."\n", $message);
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
public function testBatchFormat()
|
| 159 |
-
{
|
| 160 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 161 |
-
$message = $formatter->formatBatch(array(
|
| 162 |
-
array(
|
| 163 |
-
'level_name' => 'CRITICAL',
|
| 164 |
-
'channel' => 'test',
|
| 165 |
-
'message' => 'bar',
|
| 166 |
-
'context' => array(),
|
| 167 |
-
'datetime' => new \DateTime,
|
| 168 |
-
'extra' => array(),
|
| 169 |
-
),
|
| 170 |
-
array(
|
| 171 |
-
'level_name' => 'WARNING',
|
| 172 |
-
'channel' => 'log',
|
| 173 |
-
'message' => 'foo',
|
| 174 |
-
'context' => array(),
|
| 175 |
-
'datetime' => new \DateTime,
|
| 176 |
-
'extra' => array(),
|
| 177 |
-
),
|
| 178 |
-
));
|
| 179 |
-
$this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
|
| 180 |
-
}
|
| 181 |
-
|
| 182 |
-
public function testFormatShouldStripInlineLineBreaks()
|
| 183 |
-
{
|
| 184 |
-
$formatter = new LineFormatter(null, 'Y-m-d');
|
| 185 |
-
$message = $formatter->format(
|
| 186 |
-
array(
|
| 187 |
-
'message' => "foo\nbar",
|
| 188 |
-
'context' => array(),
|
| 189 |
-
'extra' => array(),
|
| 190 |
-
)
|
| 191 |
-
);
|
| 192 |
-
|
| 193 |
-
$this->assertRegExp('/foo bar/', $message);
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
|
| 197 |
-
{
|
| 198 |
-
$formatter = new LineFormatter(null, 'Y-m-d', true);
|
| 199 |
-
$message = $formatter->format(
|
| 200 |
-
array(
|
| 201 |
-
'message' => "foo\nbar",
|
| 202 |
-
'context' => array(),
|
| 203 |
-
'extra' => array(),
|
| 204 |
-
)
|
| 205 |
-
);
|
| 206 |
-
|
| 207 |
-
$this->assertRegExp('/foo\nbar/', $message);
|
| 208 |
-
}
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
class TestFoo
|
| 212 |
-
{
|
| 213 |
-
public $foo = 'foo';
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
class TestBar
|
| 217 |
-
{
|
| 218 |
-
public function __toString()
|
| 219 |
-
{
|
| 220 |
-
return 'bar';
|
| 221 |
-
}
|
| 222 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
|
| 16 |
-
class LogglyFormatterTest extends TestCase
|
| 17 |
-
{
|
| 18 |
-
/**
|
| 19 |
-
* @covers Monolog\Formatter\LogglyFormatter::__construct
|
| 20 |
-
*/
|
| 21 |
-
public function testConstruct()
|
| 22 |
-
{
|
| 23 |
-
$formatter = new LogglyFormatter();
|
| 24 |
-
$this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
|
| 25 |
-
$formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
|
| 26 |
-
$this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @covers Monolog\Formatter\LogglyFormatter::format
|
| 31 |
-
*/
|
| 32 |
-
public function testFormat()
|
| 33 |
-
{
|
| 34 |
-
$formatter = new LogglyFormatter();
|
| 35 |
-
$record = $this->getRecord();
|
| 36 |
-
$formatted_decoded = json_decode($formatter->format($record), true);
|
| 37 |
-
$this->assertArrayHasKey("timestamp", $formatted_decoded);
|
| 38 |
-
$this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
|
| 39 |
-
}
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
DELETED
|
@@ -1,333 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
public function tearDown()
|
| 19 |
-
{
|
| 20 |
-
\PHPUnit_Framework_Error_Warning::$enabled = true;
|
| 21 |
-
|
| 22 |
-
return parent::tearDown();
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 27 |
-
*/
|
| 28 |
-
public function testDefaultFormatter()
|
| 29 |
-
{
|
| 30 |
-
$formatter = new LogstashFormatter('test', 'hostname');
|
| 31 |
-
$record = array(
|
| 32 |
-
'level' => Logger::ERROR,
|
| 33 |
-
'level_name' => 'ERROR',
|
| 34 |
-
'channel' => 'meh',
|
| 35 |
-
'context' => array(),
|
| 36 |
-
'datetime' => new \DateTime("@0"),
|
| 37 |
-
'extra' => array(),
|
| 38 |
-
'message' => 'log',
|
| 39 |
-
);
|
| 40 |
-
|
| 41 |
-
$message = json_decode($formatter->format($record), true);
|
| 42 |
-
|
| 43 |
-
$this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
|
| 44 |
-
$this->assertEquals('log', $message['@message']);
|
| 45 |
-
$this->assertEquals('meh', $message['@fields']['channel']);
|
| 46 |
-
$this->assertContains('meh', $message['@tags']);
|
| 47 |
-
$this->assertEquals(Logger::ERROR, $message['@fields']['level']);
|
| 48 |
-
$this->assertEquals('test', $message['@type']);
|
| 49 |
-
$this->assertEquals('hostname', $message['@source']);
|
| 50 |
-
|
| 51 |
-
$formatter = new LogstashFormatter('mysystem');
|
| 52 |
-
|
| 53 |
-
$message = json_decode($formatter->format($record), true);
|
| 54 |
-
|
| 55 |
-
$this->assertEquals('mysystem', $message['@type']);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 60 |
-
*/
|
| 61 |
-
public function testFormatWithFileAndLine()
|
| 62 |
-
{
|
| 63 |
-
$formatter = new LogstashFormatter('test');
|
| 64 |
-
$record = array(
|
| 65 |
-
'level' => Logger::ERROR,
|
| 66 |
-
'level_name' => 'ERROR',
|
| 67 |
-
'channel' => 'meh',
|
| 68 |
-
'context' => array('from' => 'logger'),
|
| 69 |
-
'datetime' => new \DateTime("@0"),
|
| 70 |
-
'extra' => array('file' => 'test', 'line' => 14),
|
| 71 |
-
'message' => 'log',
|
| 72 |
-
);
|
| 73 |
-
|
| 74 |
-
$message = json_decode($formatter->format($record), true);
|
| 75 |
-
|
| 76 |
-
$this->assertEquals('test', $message['@fields']['file']);
|
| 77 |
-
$this->assertEquals(14, $message['@fields']['line']);
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 82 |
-
*/
|
| 83 |
-
public function testFormatWithContext()
|
| 84 |
-
{
|
| 85 |
-
$formatter = new LogstashFormatter('test');
|
| 86 |
-
$record = array(
|
| 87 |
-
'level' => Logger::ERROR,
|
| 88 |
-
'level_name' => 'ERROR',
|
| 89 |
-
'channel' => 'meh',
|
| 90 |
-
'context' => array('from' => 'logger'),
|
| 91 |
-
'datetime' => new \DateTime("@0"),
|
| 92 |
-
'extra' => array('key' => 'pair'),
|
| 93 |
-
'message' => 'log',
|
| 94 |
-
);
|
| 95 |
-
|
| 96 |
-
$message = json_decode($formatter->format($record), true);
|
| 97 |
-
|
| 98 |
-
$message_array = $message['@fields'];
|
| 99 |
-
|
| 100 |
-
$this->assertArrayHasKey('ctxt_from', $message_array);
|
| 101 |
-
$this->assertEquals('logger', $message_array['ctxt_from']);
|
| 102 |
-
|
| 103 |
-
// Test with extraPrefix
|
| 104 |
-
$formatter = new LogstashFormatter('test', null, null, 'CTX');
|
| 105 |
-
$message = json_decode($formatter->format($record), true);
|
| 106 |
-
|
| 107 |
-
$message_array = $message['@fields'];
|
| 108 |
-
|
| 109 |
-
$this->assertArrayHasKey('CTXfrom', $message_array);
|
| 110 |
-
$this->assertEquals('logger', $message_array['CTXfrom']);
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 115 |
-
*/
|
| 116 |
-
public function testFormatWithExtra()
|
| 117 |
-
{
|
| 118 |
-
$formatter = new LogstashFormatter('test');
|
| 119 |
-
$record = array(
|
| 120 |
-
'level' => Logger::ERROR,
|
| 121 |
-
'level_name' => 'ERROR',
|
| 122 |
-
'channel' => 'meh',
|
| 123 |
-
'context' => array('from' => 'logger'),
|
| 124 |
-
'datetime' => new \DateTime("@0"),
|
| 125 |
-
'extra' => array('key' => 'pair'),
|
| 126 |
-
'message' => 'log',
|
| 127 |
-
);
|
| 128 |
-
|
| 129 |
-
$message = json_decode($formatter->format($record), true);
|
| 130 |
-
|
| 131 |
-
$message_array = $message['@fields'];
|
| 132 |
-
|
| 133 |
-
$this->assertArrayHasKey('key', $message_array);
|
| 134 |
-
$this->assertEquals('pair', $message_array['key']);
|
| 135 |
-
|
| 136 |
-
// Test with extraPrefix
|
| 137 |
-
$formatter = new LogstashFormatter('test', null, 'EXT');
|
| 138 |
-
$message = json_decode($formatter->format($record), true);
|
| 139 |
-
|
| 140 |
-
$message_array = $message['@fields'];
|
| 141 |
-
|
| 142 |
-
$this->assertArrayHasKey('EXTkey', $message_array);
|
| 143 |
-
$this->assertEquals('pair', $message_array['EXTkey']);
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
public function testFormatWithApplicationName()
|
| 147 |
-
{
|
| 148 |
-
$formatter = new LogstashFormatter('app', 'test');
|
| 149 |
-
$record = array(
|
| 150 |
-
'level' => Logger::ERROR,
|
| 151 |
-
'level_name' => 'ERROR',
|
| 152 |
-
'channel' => 'meh',
|
| 153 |
-
'context' => array('from' => 'logger'),
|
| 154 |
-
'datetime' => new \DateTime("@0"),
|
| 155 |
-
'extra' => array('key' => 'pair'),
|
| 156 |
-
'message' => 'log',
|
| 157 |
-
);
|
| 158 |
-
|
| 159 |
-
$message = json_decode($formatter->format($record), true);
|
| 160 |
-
|
| 161 |
-
$this->assertArrayHasKey('@type', $message);
|
| 162 |
-
$this->assertEquals('app', $message['@type']);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
/**
|
| 166 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 167 |
-
*/
|
| 168 |
-
public function testDefaultFormatterV1()
|
| 169 |
-
{
|
| 170 |
-
$formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
|
| 171 |
-
$record = array(
|
| 172 |
-
'level' => Logger::ERROR,
|
| 173 |
-
'level_name' => 'ERROR',
|
| 174 |
-
'channel' => 'meh',
|
| 175 |
-
'context' => array(),
|
| 176 |
-
'datetime' => new \DateTime("@0"),
|
| 177 |
-
'extra' => array(),
|
| 178 |
-
'message' => 'log',
|
| 179 |
-
);
|
| 180 |
-
|
| 181 |
-
$message = json_decode($formatter->format($record), true);
|
| 182 |
-
|
| 183 |
-
$this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
|
| 184 |
-
$this->assertEquals("1", $message['@version']);
|
| 185 |
-
$this->assertEquals('log', $message['message']);
|
| 186 |
-
$this->assertEquals('meh', $message['channel']);
|
| 187 |
-
$this->assertEquals('ERROR', $message['level']);
|
| 188 |
-
$this->assertEquals('test', $message['type']);
|
| 189 |
-
$this->assertEquals('hostname', $message['host']);
|
| 190 |
-
|
| 191 |
-
$formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
|
| 192 |
-
|
| 193 |
-
$message = json_decode($formatter->format($record), true);
|
| 194 |
-
|
| 195 |
-
$this->assertEquals('mysystem', $message['type']);
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
/**
|
| 199 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 200 |
-
*/
|
| 201 |
-
public function testFormatWithFileAndLineV1()
|
| 202 |
-
{
|
| 203 |
-
$formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
|
| 204 |
-
$record = array(
|
| 205 |
-
'level' => Logger::ERROR,
|
| 206 |
-
'level_name' => 'ERROR',
|
| 207 |
-
'channel' => 'meh',
|
| 208 |
-
'context' => array('from' => 'logger'),
|
| 209 |
-
'datetime' => new \DateTime("@0"),
|
| 210 |
-
'extra' => array('file' => 'test', 'line' => 14),
|
| 211 |
-
'message' => 'log',
|
| 212 |
-
);
|
| 213 |
-
|
| 214 |
-
$message = json_decode($formatter->format($record), true);
|
| 215 |
-
|
| 216 |
-
$this->assertEquals('test', $message['file']);
|
| 217 |
-
$this->assertEquals(14, $message['line']);
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
/**
|
| 221 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 222 |
-
*/
|
| 223 |
-
public function testFormatWithContextV1()
|
| 224 |
-
{
|
| 225 |
-
$formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
|
| 226 |
-
$record = array(
|
| 227 |
-
'level' => Logger::ERROR,
|
| 228 |
-
'level_name' => 'ERROR',
|
| 229 |
-
'channel' => 'meh',
|
| 230 |
-
'context' => array('from' => 'logger'),
|
| 231 |
-
'datetime' => new \DateTime("@0"),
|
| 232 |
-
'extra' => array('key' => 'pair'),
|
| 233 |
-
'message' => 'log',
|
| 234 |
-
);
|
| 235 |
-
|
| 236 |
-
$message = json_decode($formatter->format($record), true);
|
| 237 |
-
|
| 238 |
-
$this->assertArrayHasKey('ctxt_from', $message);
|
| 239 |
-
$this->assertEquals('logger', $message['ctxt_from']);
|
| 240 |
-
|
| 241 |
-
// Test with extraPrefix
|
| 242 |
-
$formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
|
| 243 |
-
$message = json_decode($formatter->format($record), true);
|
| 244 |
-
|
| 245 |
-
$this->assertArrayHasKey('CTXfrom', $message);
|
| 246 |
-
$this->assertEquals('logger', $message['CTXfrom']);
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
/**
|
| 250 |
-
* @covers Monolog\Formatter\LogstashFormatter::format
|
| 251 |
-
*/
|
| 252 |
-
public function testFormatWithExtraV1()
|
| 253 |
-
{
|
| 254 |
-
$formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
|
| 255 |
-
$record = array(
|
| 256 |
-
'level' => Logger::ERROR,
|
| 257 |
-
'level_name' => 'ERROR',
|
| 258 |
-
'channel' => 'meh',
|
| 259 |
-
'context' => array('from' => 'logger'),
|
| 260 |
-
'datetime' => new \DateTime("@0"),
|
| 261 |
-
'extra' => array('key' => 'pair'),
|
| 262 |
-
'message' => 'log',
|
| 263 |
-
);
|
| 264 |
-
|
| 265 |
-
$message = json_decode($formatter->format($record), true);
|
| 266 |
-
|
| 267 |
-
$this->assertArrayHasKey('key', $message);
|
| 268 |
-
$this->assertEquals('pair', $message['key']);
|
| 269 |
-
|
| 270 |
-
// Test with extraPrefix
|
| 271 |
-
$formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
|
| 272 |
-
$message = json_decode($formatter->format($record), true);
|
| 273 |
-
|
| 274 |
-
$this->assertArrayHasKey('EXTkey', $message);
|
| 275 |
-
$this->assertEquals('pair', $message['EXTkey']);
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
-
public function testFormatWithApplicationNameV1()
|
| 279 |
-
{
|
| 280 |
-
$formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
|
| 281 |
-
$record = array(
|
| 282 |
-
'level' => Logger::ERROR,
|
| 283 |
-
'level_name' => 'ERROR',
|
| 284 |
-
'channel' => 'meh',
|
| 285 |
-
'context' => array('from' => 'logger'),
|
| 286 |
-
'datetime' => new \DateTime("@0"),
|
| 287 |
-
'extra' => array('key' => 'pair'),
|
| 288 |
-
'message' => 'log',
|
| 289 |
-
);
|
| 290 |
-
|
| 291 |
-
$message = json_decode($formatter->format($record), true);
|
| 292 |
-
|
| 293 |
-
$this->assertArrayHasKey('type', $message);
|
| 294 |
-
$this->assertEquals('app', $message['type']);
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
public function testFormatWithLatin9Data()
|
| 298 |
-
{
|
| 299 |
-
if (version_compare(PHP_VERSION, '5.5.0', '<')) {
|
| 300 |
-
// Ignore the warning that will be emitted by PHP <5.5.0
|
| 301 |
-
\PHPUnit_Framework_Error_Warning::$enabled = false;
|
| 302 |
-
}
|
| 303 |
-
$formatter = new LogstashFormatter('test', 'hostname');
|
| 304 |
-
$record = array(
|
| 305 |
-
'level' => Logger::ERROR,
|
| 306 |
-
'level_name' => 'ERROR',
|
| 307 |
-
'channel' => '¯\_(ツ)_/¯',
|
| 308 |
-
'context' => array(),
|
| 309 |
-
'datetime' => new \DateTime("@0"),
|
| 310 |
-
'extra' => array(
|
| 311 |
-
'user_agent' => "\xD6WN; FBCR/OrangeEspa\xF1a; Vers\xE3o/4.0; F\xE4rist",
|
| 312 |
-
),
|
| 313 |
-
'message' => 'log',
|
| 314 |
-
);
|
| 315 |
-
|
| 316 |
-
$message = json_decode($formatter->format($record), true);
|
| 317 |
-
|
| 318 |
-
$this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
|
| 319 |
-
$this->assertEquals('log', $message['@message']);
|
| 320 |
-
$this->assertEquals('¯\_(ツ)_/¯', $message['@fields']['channel']);
|
| 321 |
-
$this->assertContains('¯\_(ツ)_/¯', $message['@tags']);
|
| 322 |
-
$this->assertEquals(Logger::ERROR, $message['@fields']['level']);
|
| 323 |
-
$this->assertEquals('test', $message['@type']);
|
| 324 |
-
$this->assertEquals('hostname', $message['@source']);
|
| 325 |
-
if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
|
| 326 |
-
$this->assertEquals('ÖWN; FBCR/OrangeEspaña; Versão/4.0; Färist', $message['@fields']['user_agent']);
|
| 327 |
-
} else {
|
| 328 |
-
// PHP <5.5 does not return false for an element encoding failure,
|
| 329 |
-
// instead it emits a warning (possibly) and nulls the value.
|
| 330 |
-
$this->assertEquals(null, $message['@fields']['user_agent']);
|
| 331 |
-
}
|
| 332 |
-
}
|
| 333 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
DELETED
|
@@ -1,262 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* @author Florian Plattner <me@florianplattner.de>
|
| 18 |
-
*/
|
| 19 |
-
class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
|
| 20 |
-
{
|
| 21 |
-
public function setUp()
|
| 22 |
-
{
|
| 23 |
-
if (!class_exists('MongoDate')) {
|
| 24 |
-
$this->markTestSkipped('mongo extension not installed');
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function constructArgumentProvider()
|
| 29 |
-
{
|
| 30 |
-
return array(
|
| 31 |
-
array(1, true, 1, true),
|
| 32 |
-
array(0, false, 0, false),
|
| 33 |
-
);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* @param $traceDepth
|
| 38 |
-
* @param $traceAsString
|
| 39 |
-
* @param $expectedTraceDepth
|
| 40 |
-
* @param $expectedTraceAsString
|
| 41 |
-
*
|
| 42 |
-
* @dataProvider constructArgumentProvider
|
| 43 |
-
*/
|
| 44 |
-
public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
|
| 45 |
-
{
|
| 46 |
-
$formatter = new MongoDBFormatter($traceDepth, $traceAsString);
|
| 47 |
-
|
| 48 |
-
$reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
|
| 49 |
-
$reflTrace->setAccessible(true);
|
| 50 |
-
$this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
|
| 51 |
-
|
| 52 |
-
$reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
|
| 53 |
-
$reflDepth->setAccessible(true);
|
| 54 |
-
$this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
public function testSimpleFormat()
|
| 58 |
-
{
|
| 59 |
-
$record = array(
|
| 60 |
-
'message' => 'some log message',
|
| 61 |
-
'context' => array(),
|
| 62 |
-
'level' => Logger::WARNING,
|
| 63 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 64 |
-
'channel' => 'test',
|
| 65 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 66 |
-
'extra' => array(),
|
| 67 |
-
);
|
| 68 |
-
|
| 69 |
-
$formatter = new MongoDBFormatter();
|
| 70 |
-
$formattedRecord = $formatter->format($record);
|
| 71 |
-
|
| 72 |
-
$this->assertCount(7, $formattedRecord);
|
| 73 |
-
$this->assertEquals('some log message', $formattedRecord['message']);
|
| 74 |
-
$this->assertEquals(array(), $formattedRecord['context']);
|
| 75 |
-
$this->assertEquals(Logger::WARNING, $formattedRecord['level']);
|
| 76 |
-
$this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
|
| 77 |
-
$this->assertEquals('test', $formattedRecord['channel']);
|
| 78 |
-
$this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
|
| 79 |
-
$this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
|
| 80 |
-
$this->assertEquals(array(), $formattedRecord['extra']);
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
public function testRecursiveFormat()
|
| 84 |
-
{
|
| 85 |
-
$someObject = new \stdClass();
|
| 86 |
-
$someObject->foo = 'something';
|
| 87 |
-
$someObject->bar = 'stuff';
|
| 88 |
-
|
| 89 |
-
$record = array(
|
| 90 |
-
'message' => 'some log message',
|
| 91 |
-
'context' => array(
|
| 92 |
-
'stuff' => new \DateTime('2014-02-01 02:31:33'),
|
| 93 |
-
'some_object' => $someObject,
|
| 94 |
-
'context_string' => 'some string',
|
| 95 |
-
'context_int' => 123456,
|
| 96 |
-
'except' => new \Exception('exception message', 987),
|
| 97 |
-
),
|
| 98 |
-
'level' => Logger::WARNING,
|
| 99 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 100 |
-
'channel' => 'test',
|
| 101 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 102 |
-
'extra' => array(),
|
| 103 |
-
);
|
| 104 |
-
|
| 105 |
-
$formatter = new MongoDBFormatter();
|
| 106 |
-
$formattedRecord = $formatter->format($record);
|
| 107 |
-
|
| 108 |
-
$this->assertCount(5, $formattedRecord['context']);
|
| 109 |
-
$this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
|
| 110 |
-
$this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
|
| 111 |
-
$this->assertEquals(
|
| 112 |
-
array(
|
| 113 |
-
'foo' => 'something',
|
| 114 |
-
'bar' => 'stuff',
|
| 115 |
-
'class' => 'stdClass',
|
| 116 |
-
),
|
| 117 |
-
$formattedRecord['context']['some_object']
|
| 118 |
-
);
|
| 119 |
-
$this->assertEquals('some string', $formattedRecord['context']['context_string']);
|
| 120 |
-
$this->assertEquals(123456, $formattedRecord['context']['context_int']);
|
| 121 |
-
|
| 122 |
-
$this->assertCount(5, $formattedRecord['context']['except']);
|
| 123 |
-
$this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
|
| 124 |
-
$this->assertEquals(987, $formattedRecord['context']['except']['code']);
|
| 125 |
-
$this->assertInternalType('string', $formattedRecord['context']['except']['file']);
|
| 126 |
-
$this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
|
| 127 |
-
$this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
|
| 128 |
-
$this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
public function testFormatDepthArray()
|
| 132 |
-
{
|
| 133 |
-
$record = array(
|
| 134 |
-
'message' => 'some log message',
|
| 135 |
-
'context' => array(
|
| 136 |
-
'nest2' => array(
|
| 137 |
-
'property' => 'anything',
|
| 138 |
-
'nest3' => array(
|
| 139 |
-
'nest4' => 'value',
|
| 140 |
-
'property' => 'nothing',
|
| 141 |
-
),
|
| 142 |
-
),
|
| 143 |
-
),
|
| 144 |
-
'level' => Logger::WARNING,
|
| 145 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 146 |
-
'channel' => 'test',
|
| 147 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 148 |
-
'extra' => array(),
|
| 149 |
-
);
|
| 150 |
-
|
| 151 |
-
$formatter = new MongoDBFormatter(2);
|
| 152 |
-
$formattedResult = $formatter->format($record);
|
| 153 |
-
|
| 154 |
-
$this->assertEquals(
|
| 155 |
-
array(
|
| 156 |
-
'nest2' => array(
|
| 157 |
-
'property' => 'anything',
|
| 158 |
-
'nest3' => '[...]',
|
| 159 |
-
),
|
| 160 |
-
),
|
| 161 |
-
$formattedResult['context']
|
| 162 |
-
);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
public function testFormatDepthArrayInfiniteNesting()
|
| 166 |
-
{
|
| 167 |
-
$record = array(
|
| 168 |
-
'message' => 'some log message',
|
| 169 |
-
'context' => array(
|
| 170 |
-
'nest2' => array(
|
| 171 |
-
'property' => 'something',
|
| 172 |
-
'nest3' => array(
|
| 173 |
-
'property' => 'anything',
|
| 174 |
-
'nest4' => array(
|
| 175 |
-
'property' => 'nothing',
|
| 176 |
-
),
|
| 177 |
-
),
|
| 178 |
-
),
|
| 179 |
-
),
|
| 180 |
-
'level' => Logger::WARNING,
|
| 181 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 182 |
-
'channel' => 'test',
|
| 183 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 184 |
-
'extra' => array(),
|
| 185 |
-
);
|
| 186 |
-
|
| 187 |
-
$formatter = new MongoDBFormatter(0);
|
| 188 |
-
$formattedResult = $formatter->format($record);
|
| 189 |
-
|
| 190 |
-
$this->assertEquals(
|
| 191 |
-
array(
|
| 192 |
-
'nest2' => array(
|
| 193 |
-
'property' => 'something',
|
| 194 |
-
'nest3' => array(
|
| 195 |
-
'property' => 'anything',
|
| 196 |
-
'nest4' => array(
|
| 197 |
-
'property' => 'nothing',
|
| 198 |
-
),
|
| 199 |
-
),
|
| 200 |
-
),
|
| 201 |
-
),
|
| 202 |
-
$formattedResult['context']
|
| 203 |
-
);
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
public function testFormatDepthObjects()
|
| 207 |
-
{
|
| 208 |
-
$someObject = new \stdClass();
|
| 209 |
-
$someObject->property = 'anything';
|
| 210 |
-
$someObject->nest3 = new \stdClass();
|
| 211 |
-
$someObject->nest3->property = 'nothing';
|
| 212 |
-
$someObject->nest3->nest4 = 'invisible';
|
| 213 |
-
|
| 214 |
-
$record = array(
|
| 215 |
-
'message' => 'some log message',
|
| 216 |
-
'context' => array(
|
| 217 |
-
'nest2' => $someObject,
|
| 218 |
-
),
|
| 219 |
-
'level' => Logger::WARNING,
|
| 220 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 221 |
-
'channel' => 'test',
|
| 222 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 223 |
-
'extra' => array(),
|
| 224 |
-
);
|
| 225 |
-
|
| 226 |
-
$formatter = new MongoDBFormatter(2, true);
|
| 227 |
-
$formattedResult = $formatter->format($record);
|
| 228 |
-
|
| 229 |
-
$this->assertEquals(
|
| 230 |
-
array(
|
| 231 |
-
'nest2' => array(
|
| 232 |
-
'property' => 'anything',
|
| 233 |
-
'nest3' => '[...]',
|
| 234 |
-
'class' => 'stdClass',
|
| 235 |
-
),
|
| 236 |
-
),
|
| 237 |
-
$formattedResult['context']
|
| 238 |
-
);
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
public function testFormatDepthException()
|
| 242 |
-
{
|
| 243 |
-
$record = array(
|
| 244 |
-
'message' => 'some log message',
|
| 245 |
-
'context' => array(
|
| 246 |
-
'nest2' => new \Exception('exception message', 987),
|
| 247 |
-
),
|
| 248 |
-
'level' => Logger::WARNING,
|
| 249 |
-
'level_name' => Logger::getLevelName(Logger::WARNING),
|
| 250 |
-
'channel' => 'test',
|
| 251 |
-
'datetime' => new \DateTime('2014-02-01 00:00:00'),
|
| 252 |
-
'extra' => array(),
|
| 253 |
-
);
|
| 254 |
-
|
| 255 |
-
$formatter = new MongoDBFormatter(2, false);
|
| 256 |
-
$formattedRecord = $formatter->format($record);
|
| 257 |
-
|
| 258 |
-
$this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
|
| 259 |
-
$this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
|
| 260 |
-
$this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
|
| 261 |
-
}
|
| 262 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
DELETED
|
@@ -1,405 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* @covers Monolog\Formatter\NormalizerFormatter
|
| 16 |
-
*/
|
| 17 |
-
class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
public function tearDown()
|
| 20 |
-
{
|
| 21 |
-
\PHPUnit_Framework_Error_Warning::$enabled = true;
|
| 22 |
-
|
| 23 |
-
return parent::tearDown();
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testFormat()
|
| 27 |
-
{
|
| 28 |
-
$formatter = new NormalizerFormatter('Y-m-d');
|
| 29 |
-
$formatted = $formatter->format(array(
|
| 30 |
-
'level_name' => 'ERROR',
|
| 31 |
-
'channel' => 'meh',
|
| 32 |
-
'message' => 'foo',
|
| 33 |
-
'datetime' => new \DateTime,
|
| 34 |
-
'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
|
| 35 |
-
'context' => array(
|
| 36 |
-
'foo' => 'bar',
|
| 37 |
-
'baz' => 'qux',
|
| 38 |
-
'inf' => INF,
|
| 39 |
-
'-inf' => -INF,
|
| 40 |
-
'nan' => acos(4),
|
| 41 |
-
),
|
| 42 |
-
));
|
| 43 |
-
|
| 44 |
-
$this->assertEquals(array(
|
| 45 |
-
'level_name' => 'ERROR',
|
| 46 |
-
'channel' => 'meh',
|
| 47 |
-
'message' => 'foo',
|
| 48 |
-
'datetime' => date('Y-m-d'),
|
| 49 |
-
'extra' => array(
|
| 50 |
-
'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
|
| 51 |
-
'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)',
|
| 52 |
-
'baz' => array(),
|
| 53 |
-
'res' => '[resource] (stream)',
|
| 54 |
-
),
|
| 55 |
-
'context' => array(
|
| 56 |
-
'foo' => 'bar',
|
| 57 |
-
'baz' => 'qux',
|
| 58 |
-
'inf' => 'INF',
|
| 59 |
-
'-inf' => '-INF',
|
| 60 |
-
'nan' => 'NaN',
|
| 61 |
-
),
|
| 62 |
-
), $formatted);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
public function testFormatExceptions()
|
| 66 |
-
{
|
| 67 |
-
$formatter = new NormalizerFormatter('Y-m-d');
|
| 68 |
-
$e = new \LogicException('bar');
|
| 69 |
-
$e2 = new \RuntimeException('foo', 0, $e);
|
| 70 |
-
$formatted = $formatter->format(array(
|
| 71 |
-
'exception' => $e2,
|
| 72 |
-
));
|
| 73 |
-
|
| 74 |
-
$this->assertGreaterThan(5, count($formatted['exception']['trace']));
|
| 75 |
-
$this->assertTrue(isset($formatted['exception']['previous']));
|
| 76 |
-
unset($formatted['exception']['trace'], $formatted['exception']['previous']);
|
| 77 |
-
|
| 78 |
-
$this->assertEquals(array(
|
| 79 |
-
'exception' => array(
|
| 80 |
-
'class' => get_class($e2),
|
| 81 |
-
'message' => $e2->getMessage(),
|
| 82 |
-
'code' => $e2->getCode(),
|
| 83 |
-
'file' => $e2->getFile().':'.$e2->getLine(),
|
| 84 |
-
),
|
| 85 |
-
), $formatted);
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
public function testFormatSoapFaultException()
|
| 89 |
-
{
|
| 90 |
-
if (!class_exists('SoapFault')) {
|
| 91 |
-
$this->markTestSkipped('Requires the soap extension');
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
$formatter = new NormalizerFormatter('Y-m-d');
|
| 95 |
-
$e = new \SoapFault('foo', 'bar', 'hello', 'world');
|
| 96 |
-
$formatted = $formatter->format(array(
|
| 97 |
-
'exception' => $e,
|
| 98 |
-
));
|
| 99 |
-
|
| 100 |
-
unset($formatted['exception']['trace']);
|
| 101 |
-
|
| 102 |
-
$this->assertEquals(array(
|
| 103 |
-
'exception' => array(
|
| 104 |
-
'class' => 'SoapFault',
|
| 105 |
-
'message' => 'bar',
|
| 106 |
-
'code' => 0,
|
| 107 |
-
'file' => $e->getFile().':'.$e->getLine(),
|
| 108 |
-
'faultcode' => 'foo',
|
| 109 |
-
'faultactor' => 'hello',
|
| 110 |
-
'detail' => 'world',
|
| 111 |
-
),
|
| 112 |
-
), $formatted);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
public function testFormatToStringExceptionHandle()
|
| 116 |
-
{
|
| 117 |
-
$formatter = new NormalizerFormatter('Y-m-d');
|
| 118 |
-
$this->setExpectedException('RuntimeException', 'Could not convert to string');
|
| 119 |
-
$formatter->format(array(
|
| 120 |
-
'myObject' => new TestToStringError(),
|
| 121 |
-
));
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
public function testBatchFormat()
|
| 125 |
-
{
|
| 126 |
-
$formatter = new NormalizerFormatter('Y-m-d');
|
| 127 |
-
$formatted = $formatter->formatBatch(array(
|
| 128 |
-
array(
|
| 129 |
-
'level_name' => 'CRITICAL',
|
| 130 |
-
'channel' => 'test',
|
| 131 |
-
'message' => 'bar',
|
| 132 |
-
'context' => array(),
|
| 133 |
-
'datetime' => new \DateTime,
|
| 134 |
-
'extra' => array(),
|
| 135 |
-
),
|
| 136 |
-
array(
|
| 137 |
-
'level_name' => 'WARNING',
|
| 138 |
-
'channel' => 'log',
|
| 139 |
-
'message' => 'foo',
|
| 140 |
-
'context' => array(),
|
| 141 |
-
'datetime' => new \DateTime,
|
| 142 |
-
'extra' => array(),
|
| 143 |
-
),
|
| 144 |
-
));
|
| 145 |
-
$this->assertEquals(array(
|
| 146 |
-
array(
|
| 147 |
-
'level_name' => 'CRITICAL',
|
| 148 |
-
'channel' => 'test',
|
| 149 |
-
'message' => 'bar',
|
| 150 |
-
'context' => array(),
|
| 151 |
-
'datetime' => date('Y-m-d'),
|
| 152 |
-
'extra' => array(),
|
| 153 |
-
),
|
| 154 |
-
array(
|
| 155 |
-
'level_name' => 'WARNING',
|
| 156 |
-
'channel' => 'log',
|
| 157 |
-
'message' => 'foo',
|
| 158 |
-
'context' => array(),
|
| 159 |
-
'datetime' => date('Y-m-d'),
|
| 160 |
-
'extra' => array(),
|
| 161 |
-
),
|
| 162 |
-
), $formatted);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
/**
|
| 166 |
-
* Test issue #137
|
| 167 |
-
*/
|
| 168 |
-
public function testIgnoresRecursiveObjectReferences()
|
| 169 |
-
{
|
| 170 |
-
// set up the recursion
|
| 171 |
-
$foo = new \stdClass();
|
| 172 |
-
$bar = new \stdClass();
|
| 173 |
-
|
| 174 |
-
$foo->bar = $bar;
|
| 175 |
-
$bar->foo = $foo;
|
| 176 |
-
|
| 177 |
-
// set an error handler to assert that the error is not raised anymore
|
| 178 |
-
$that = $this;
|
| 179 |
-
set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
|
| 180 |
-
if (error_reporting() & $level) {
|
| 181 |
-
restore_error_handler();
|
| 182 |
-
$that->fail("$message should not be raised");
|
| 183 |
-
}
|
| 184 |
-
});
|
| 185 |
-
|
| 186 |
-
$formatter = new NormalizerFormatter();
|
| 187 |
-
$reflMethod = new \ReflectionMethod($formatter, 'toJson');
|
| 188 |
-
$reflMethod->setAccessible(true);
|
| 189 |
-
$res = $reflMethod->invoke($formatter, array($foo, $bar), true);
|
| 190 |
-
|
| 191 |
-
restore_error_handler();
|
| 192 |
-
|
| 193 |
-
$this->assertEquals(@json_encode(array($foo, $bar)), $res);
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
public function testIgnoresInvalidTypes()
|
| 197 |
-
{
|
| 198 |
-
// set up the recursion
|
| 199 |
-
$resource = fopen(__FILE__, 'r');
|
| 200 |
-
|
| 201 |
-
// set an error handler to assert that the error is not raised anymore
|
| 202 |
-
$that = $this;
|
| 203 |
-
set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
|
| 204 |
-
if (error_reporting() & $level) {
|
| 205 |
-
restore_error_handler();
|
| 206 |
-
$that->fail("$message should not be raised");
|
| 207 |
-
}
|
| 208 |
-
});
|
| 209 |
-
|
| 210 |
-
$formatter = new NormalizerFormatter();
|
| 211 |
-
$reflMethod = new \ReflectionMethod($formatter, 'toJson');
|
| 212 |
-
$reflMethod->setAccessible(true);
|
| 213 |
-
$res = $reflMethod->invoke($formatter, array($resource), true);
|
| 214 |
-
|
| 215 |
-
restore_error_handler();
|
| 216 |
-
|
| 217 |
-
$this->assertEquals(@json_encode(array($resource)), $res);
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
/**
|
| 221 |
-
* @expectedException RuntimeException
|
| 222 |
-
*/
|
| 223 |
-
public function testThrowsOnInvalidEncoding()
|
| 224 |
-
{
|
| 225 |
-
if (version_compare(PHP_VERSION, '5.5.0', '<')) {
|
| 226 |
-
// Ignore the warning that will be emitted by PHP <5.5.0
|
| 227 |
-
\PHPUnit_Framework_Error_Warning::$enabled = false;
|
| 228 |
-
}
|
| 229 |
-
$formatter = new NormalizerFormatter();
|
| 230 |
-
$reflMethod = new \ReflectionMethod($formatter, 'toJson');
|
| 231 |
-
$reflMethod->setAccessible(true);
|
| 232 |
-
|
| 233 |
-
// send an invalid unicode sequence as a object that can't be cleaned
|
| 234 |
-
$record = new \stdClass;
|
| 235 |
-
$record->message = "\xB1\x31";
|
| 236 |
-
$res = $reflMethod->invoke($formatter, $record);
|
| 237 |
-
if (PHP_VERSION_ID < 50500 && $res === '{"message":null}') {
|
| 238 |
-
throw new \RuntimeException('PHP 5.3/5.4 throw a warning and null the value instead of returning false entirely');
|
| 239 |
-
}
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
public function testConvertsInvalidEncodingAsLatin9()
|
| 243 |
-
{
|
| 244 |
-
if (version_compare(PHP_VERSION, '5.5.0', '<')) {
|
| 245 |
-
// Ignore the warning that will be emitted by PHP <5.5.0
|
| 246 |
-
\PHPUnit_Framework_Error_Warning::$enabled = false;
|
| 247 |
-
}
|
| 248 |
-
$formatter = new NormalizerFormatter();
|
| 249 |
-
$reflMethod = new \ReflectionMethod($formatter, 'toJson');
|
| 250 |
-
$reflMethod->setAccessible(true);
|
| 251 |
-
|
| 252 |
-
$res = $reflMethod->invoke($formatter, array('message' => "\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE"));
|
| 253 |
-
|
| 254 |
-
if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
|
| 255 |
-
$this->assertSame('{"message":"€ŠšŽžŒœŸ"}', $res);
|
| 256 |
-
} else {
|
| 257 |
-
// PHP <5.5 does not return false for an element encoding failure,
|
| 258 |
-
// instead it emits a warning (possibly) and nulls the value.
|
| 259 |
-
$this->assertSame('{"message":null}', $res);
|
| 260 |
-
}
|
| 261 |
-
}
|
| 262 |
-
|
| 263 |
-
/**
|
| 264 |
-
* @param mixed $in Input
|
| 265 |
-
* @param mixed $expect Expected output
|
| 266 |
-
* @covers Monolog\Formatter\NormalizerFormatter::detectAndCleanUtf8
|
| 267 |
-
* @dataProvider providesDetectAndCleanUtf8
|
| 268 |
-
*/
|
| 269 |
-
public function testDetectAndCleanUtf8($in, $expect)
|
| 270 |
-
{
|
| 271 |
-
$formatter = new NormalizerFormatter();
|
| 272 |
-
$formatter->detectAndCleanUtf8($in);
|
| 273 |
-
$this->assertSame($expect, $in);
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
public function providesDetectAndCleanUtf8()
|
| 277 |
-
{
|
| 278 |
-
$obj = new \stdClass;
|
| 279 |
-
|
| 280 |
-
return array(
|
| 281 |
-
'null' => array(null, null),
|
| 282 |
-
'int' => array(123, 123),
|
| 283 |
-
'float' => array(123.45, 123.45),
|
| 284 |
-
'bool false' => array(false, false),
|
| 285 |
-
'bool true' => array(true, true),
|
| 286 |
-
'ascii string' => array('abcdef', 'abcdef'),
|
| 287 |
-
'latin9 string' => array("\xB1\x31\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE\xFF", '±1€ŠšŽžŒœŸÿ'),
|
| 288 |
-
'unicode string' => array('¤¦¨´¸¼½¾€ŠšŽžŒœŸ', '¤¦¨´¸¼½¾€ŠšŽžŒœŸ'),
|
| 289 |
-
'empty array' => array(array(), array()),
|
| 290 |
-
'array' => array(array('abcdef'), array('abcdef')),
|
| 291 |
-
'object' => array($obj, $obj),
|
| 292 |
-
);
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
/**
|
| 296 |
-
* @param int $code
|
| 297 |
-
* @param string $msg
|
| 298 |
-
* @dataProvider providesHandleJsonErrorFailure
|
| 299 |
-
*/
|
| 300 |
-
public function testHandleJsonErrorFailure($code, $msg)
|
| 301 |
-
{
|
| 302 |
-
$formatter = new NormalizerFormatter();
|
| 303 |
-
$reflMethod = new \ReflectionMethod($formatter, 'handleJsonError');
|
| 304 |
-
$reflMethod->setAccessible(true);
|
| 305 |
-
|
| 306 |
-
$this->setExpectedException('RuntimeException', $msg);
|
| 307 |
-
$reflMethod->invoke($formatter, $code, 'faked');
|
| 308 |
-
}
|
| 309 |
-
|
| 310 |
-
public function providesHandleJsonErrorFailure()
|
| 311 |
-
{
|
| 312 |
-
return array(
|
| 313 |
-
'depth' => array(JSON_ERROR_DEPTH, 'Maximum stack depth exceeded'),
|
| 314 |
-
'state' => array(JSON_ERROR_STATE_MISMATCH, 'Underflow or the modes mismatch'),
|
| 315 |
-
'ctrl' => array(JSON_ERROR_CTRL_CHAR, 'Unexpected control character found'),
|
| 316 |
-
'default' => array(-1, 'Unknown error'),
|
| 317 |
-
);
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
public function testExceptionTraceWithArgs()
|
| 321 |
-
{
|
| 322 |
-
if (defined('HHVM_VERSION')) {
|
| 323 |
-
$this->markTestSkipped('Not supported in HHVM since it detects errors differently');
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
// This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
|
| 327 |
-
// and no file or line are included in the trace because it's treated as internal function
|
| 328 |
-
set_error_handler(function ($errno, $errstr, $errfile, $errline) {
|
| 329 |
-
throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
|
| 330 |
-
});
|
| 331 |
-
|
| 332 |
-
try {
|
| 333 |
-
// This will contain $resource and $wrappedResource as arguments in the trace item
|
| 334 |
-
$resource = fopen('php://memory', 'rw+');
|
| 335 |
-
fwrite($resource, 'test_resource');
|
| 336 |
-
$wrappedResource = new TestFooNorm;
|
| 337 |
-
$wrappedResource->foo = $resource;
|
| 338 |
-
// Just do something stupid with a resource/wrapped resource as argument
|
| 339 |
-
array_keys($wrappedResource);
|
| 340 |
-
} catch (\Exception $e) {
|
| 341 |
-
restore_error_handler();
|
| 342 |
-
}
|
| 343 |
-
|
| 344 |
-
$formatter = new NormalizerFormatter();
|
| 345 |
-
$record = array('context' => array('exception' => $e));
|
| 346 |
-
$result = $formatter->format($record);
|
| 347 |
-
|
| 348 |
-
$this->assertRegExp(
|
| 349 |
-
'%"resource":"\[resource\] \(stream\)"%',
|
| 350 |
-
$result['context']['exception']['trace'][0]
|
| 351 |
-
);
|
| 352 |
-
|
| 353 |
-
if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
|
| 354 |
-
$pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%';
|
| 355 |
-
} else {
|
| 356 |
-
$pattern = '%\\\\"foo\\\\":null%';
|
| 357 |
-
}
|
| 358 |
-
|
| 359 |
-
// Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
|
| 360 |
-
$this->assertRegExp(
|
| 361 |
-
$pattern,
|
| 362 |
-
$result['context']['exception']['trace'][0]
|
| 363 |
-
);
|
| 364 |
-
}
|
| 365 |
-
}
|
| 366 |
-
|
| 367 |
-
class TestFooNorm
|
| 368 |
-
{
|
| 369 |
-
public $foo = 'foo';
|
| 370 |
-
}
|
| 371 |
-
|
| 372 |
-
class TestBarNorm
|
| 373 |
-
{
|
| 374 |
-
public function __toString()
|
| 375 |
-
{
|
| 376 |
-
return 'bar';
|
| 377 |
-
}
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
class TestStreamFoo
|
| 381 |
-
{
|
| 382 |
-
public $foo;
|
| 383 |
-
public $resource;
|
| 384 |
-
|
| 385 |
-
public function __construct($resource)
|
| 386 |
-
{
|
| 387 |
-
$this->resource = $resource;
|
| 388 |
-
$this->foo = 'BAR';
|
| 389 |
-
}
|
| 390 |
-
|
| 391 |
-
public function __toString()
|
| 392 |
-
{
|
| 393 |
-
fseek($this->resource, 0);
|
| 394 |
-
|
| 395 |
-
return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
|
| 396 |
-
}
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
class TestToStringError
|
| 400 |
-
{
|
| 401 |
-
public function __toString()
|
| 402 |
-
{
|
| 403 |
-
throw new \RuntimeException('Could not convert to string');
|
| 404 |
-
}
|
| 405 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
DELETED
|
@@ -1,110 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
|
| 15 |
-
{
|
| 16 |
-
private $formatter;
|
| 17 |
-
|
| 18 |
-
public function setUp()
|
| 19 |
-
{
|
| 20 |
-
$this->formatter = new ScalarFormatter();
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function buildTrace(\Exception $e)
|
| 24 |
-
{
|
| 25 |
-
$data = array();
|
| 26 |
-
$trace = $e->getTrace();
|
| 27 |
-
foreach ($trace as $frame) {
|
| 28 |
-
if (isset($frame['file'])) {
|
| 29 |
-
$data[] = $frame['file'].':'.$frame['line'];
|
| 30 |
-
} else {
|
| 31 |
-
$data[] = json_encode($frame);
|
| 32 |
-
}
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
return $data;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
public function encodeJson($data)
|
| 39 |
-
{
|
| 40 |
-
if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
|
| 41 |
-
return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
return json_encode($data);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testFormat()
|
| 48 |
-
{
|
| 49 |
-
$exception = new \Exception('foo');
|
| 50 |
-
$formatted = $this->formatter->format(array(
|
| 51 |
-
'foo' => 'string',
|
| 52 |
-
'bar' => 1,
|
| 53 |
-
'baz' => false,
|
| 54 |
-
'bam' => array(1, 2, 3),
|
| 55 |
-
'bat' => array('foo' => 'bar'),
|
| 56 |
-
'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
|
| 57 |
-
'ban' => $exception,
|
| 58 |
-
));
|
| 59 |
-
|
| 60 |
-
$this->assertSame(array(
|
| 61 |
-
'foo' => 'string',
|
| 62 |
-
'bar' => 1,
|
| 63 |
-
'baz' => false,
|
| 64 |
-
'bam' => $this->encodeJson(array(1, 2, 3)),
|
| 65 |
-
'bat' => $this->encodeJson(array('foo' => 'bar')),
|
| 66 |
-
'bap' => '1970-01-01 00:00:00',
|
| 67 |
-
'ban' => $this->encodeJson(array(
|
| 68 |
-
'class' => get_class($exception),
|
| 69 |
-
'message' => $exception->getMessage(),
|
| 70 |
-
'code' => $exception->getCode(),
|
| 71 |
-
'file' => $exception->getFile() . ':' . $exception->getLine(),
|
| 72 |
-
'trace' => $this->buildTrace($exception),
|
| 73 |
-
)),
|
| 74 |
-
), $formatted);
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
public function testFormatWithErrorContext()
|
| 78 |
-
{
|
| 79 |
-
$context = array('file' => 'foo', 'line' => 1);
|
| 80 |
-
$formatted = $this->formatter->format(array(
|
| 81 |
-
'context' => $context,
|
| 82 |
-
));
|
| 83 |
-
|
| 84 |
-
$this->assertSame(array(
|
| 85 |
-
'context' => $this->encodeJson($context),
|
| 86 |
-
), $formatted);
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
public function testFormatWithExceptionContext()
|
| 90 |
-
{
|
| 91 |
-
$exception = new \Exception('foo');
|
| 92 |
-
$formatted = $this->formatter->format(array(
|
| 93 |
-
'context' => array(
|
| 94 |
-
'exception' => $exception,
|
| 95 |
-
),
|
| 96 |
-
));
|
| 97 |
-
|
| 98 |
-
$this->assertSame(array(
|
| 99 |
-
'context' => $this->encodeJson(array(
|
| 100 |
-
'exception' => array(
|
| 101 |
-
'class' => get_class($exception),
|
| 102 |
-
'message' => $exception->getMessage(),
|
| 103 |
-
'code' => $exception->getCode(),
|
| 104 |
-
'file' => $exception->getFile() . ':' . $exception->getLine(),
|
| 105 |
-
'trace' => $this->buildTrace($exception),
|
| 106 |
-
),
|
| 107 |
-
)),
|
| 108 |
-
), $formatted);
|
| 109 |
-
}
|
| 110 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
DELETED
|
@@ -1,142 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Formatter;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
/**
|
| 19 |
-
* @covers Monolog\Formatter\WildfireFormatter::format
|
| 20 |
-
*/
|
| 21 |
-
public function testDefaultFormat()
|
| 22 |
-
{
|
| 23 |
-
$wildfire = new WildfireFormatter();
|
| 24 |
-
$record = array(
|
| 25 |
-
'level' => Logger::ERROR,
|
| 26 |
-
'level_name' => 'ERROR',
|
| 27 |
-
'channel' => 'meh',
|
| 28 |
-
'context' => array('from' => 'logger'),
|
| 29 |
-
'datetime' => new \DateTime("@0"),
|
| 30 |
-
'extra' => array('ip' => '127.0.0.1'),
|
| 31 |
-
'message' => 'log',
|
| 32 |
-
);
|
| 33 |
-
|
| 34 |
-
$message = $wildfire->format($record);
|
| 35 |
-
|
| 36 |
-
$this->assertEquals(
|
| 37 |
-
'125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
|
| 38 |
-
.'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
|
| 39 |
-
$message
|
| 40 |
-
);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* @covers Monolog\Formatter\WildfireFormatter::format
|
| 45 |
-
*/
|
| 46 |
-
public function testFormatWithFileAndLine()
|
| 47 |
-
{
|
| 48 |
-
$wildfire = new WildfireFormatter();
|
| 49 |
-
$record = array(
|
| 50 |
-
'level' => Logger::ERROR,
|
| 51 |
-
'level_name' => 'ERROR',
|
| 52 |
-
'channel' => 'meh',
|
| 53 |
-
'context' => array('from' => 'logger'),
|
| 54 |
-
'datetime' => new \DateTime("@0"),
|
| 55 |
-
'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
|
| 56 |
-
'message' => 'log',
|
| 57 |
-
);
|
| 58 |
-
|
| 59 |
-
$message = $wildfire->format($record);
|
| 60 |
-
|
| 61 |
-
$this->assertEquals(
|
| 62 |
-
'129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
|
| 63 |
-
.'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
|
| 64 |
-
$message
|
| 65 |
-
);
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* @covers Monolog\Formatter\WildfireFormatter::format
|
| 70 |
-
*/
|
| 71 |
-
public function testFormatWithoutContext()
|
| 72 |
-
{
|
| 73 |
-
$wildfire = new WildfireFormatter();
|
| 74 |
-
$record = array(
|
| 75 |
-
'level' => Logger::ERROR,
|
| 76 |
-
'level_name' => 'ERROR',
|
| 77 |
-
'channel' => 'meh',
|
| 78 |
-
'context' => array(),
|
| 79 |
-
'datetime' => new \DateTime("@0"),
|
| 80 |
-
'extra' => array(),
|
| 81 |
-
'message' => 'log',
|
| 82 |
-
);
|
| 83 |
-
|
| 84 |
-
$message = $wildfire->format($record);
|
| 85 |
-
|
| 86 |
-
$this->assertEquals(
|
| 87 |
-
'58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
|
| 88 |
-
$message
|
| 89 |
-
);
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
/**
|
| 93 |
-
* @covers Monolog\Formatter\WildfireFormatter::formatBatch
|
| 94 |
-
* @expectedException BadMethodCallException
|
| 95 |
-
*/
|
| 96 |
-
public function testBatchFormatThrowException()
|
| 97 |
-
{
|
| 98 |
-
$wildfire = new WildfireFormatter();
|
| 99 |
-
$record = array(
|
| 100 |
-
'level' => Logger::ERROR,
|
| 101 |
-
'level_name' => 'ERROR',
|
| 102 |
-
'channel' => 'meh',
|
| 103 |
-
'context' => array(),
|
| 104 |
-
'datetime' => new \DateTime("@0"),
|
| 105 |
-
'extra' => array(),
|
| 106 |
-
'message' => 'log',
|
| 107 |
-
);
|
| 108 |
-
|
| 109 |
-
$wildfire->formatBatch(array($record));
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
/**
|
| 113 |
-
* @covers Monolog\Formatter\WildfireFormatter::format
|
| 114 |
-
*/
|
| 115 |
-
public function testTableFormat()
|
| 116 |
-
{
|
| 117 |
-
$wildfire = new WildfireFormatter();
|
| 118 |
-
$record = array(
|
| 119 |
-
'level' => Logger::ERROR,
|
| 120 |
-
'level_name' => 'ERROR',
|
| 121 |
-
'channel' => 'table-channel',
|
| 122 |
-
'context' => array(
|
| 123 |
-
WildfireFormatter::TABLE => array(
|
| 124 |
-
array('col1', 'col2', 'col3'),
|
| 125 |
-
array('val1', 'val2', 'val3'),
|
| 126 |
-
array('foo1', 'foo2', 'foo3'),
|
| 127 |
-
array('bar1', 'bar2', 'bar3'),
|
| 128 |
-
),
|
| 129 |
-
),
|
| 130 |
-
'datetime' => new \DateTime("@0"),
|
| 131 |
-
'extra' => array(),
|
| 132 |
-
'message' => 'table-message',
|
| 133 |
-
);
|
| 134 |
-
|
| 135 |
-
$message = $wildfire->format($record);
|
| 136 |
-
|
| 137 |
-
$this->assertEquals(
|
| 138 |
-
'171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
|
| 139 |
-
$message
|
| 140 |
-
);
|
| 141 |
-
}
|
| 142 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
DELETED
|
@@ -1,115 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Formatter\LineFormatter;
|
| 17 |
-
use Monolog\Processor\WebProcessor;
|
| 18 |
-
|
| 19 |
-
class AbstractHandlerTest extends TestCase
|
| 20 |
-
{
|
| 21 |
-
/**
|
| 22 |
-
* @covers Monolog\Handler\AbstractHandler::__construct
|
| 23 |
-
* @covers Monolog\Handler\AbstractHandler::getLevel
|
| 24 |
-
* @covers Monolog\Handler\AbstractHandler::setLevel
|
| 25 |
-
* @covers Monolog\Handler\AbstractHandler::getBubble
|
| 26 |
-
* @covers Monolog\Handler\AbstractHandler::setBubble
|
| 27 |
-
* @covers Monolog\Handler\AbstractHandler::getFormatter
|
| 28 |
-
* @covers Monolog\Handler\AbstractHandler::setFormatter
|
| 29 |
-
*/
|
| 30 |
-
public function testConstructAndGetSet()
|
| 31 |
-
{
|
| 32 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
|
| 33 |
-
$this->assertEquals(Logger::WARNING, $handler->getLevel());
|
| 34 |
-
$this->assertEquals(false, $handler->getBubble());
|
| 35 |
-
|
| 36 |
-
$handler->setLevel(Logger::ERROR);
|
| 37 |
-
$handler->setBubble(true);
|
| 38 |
-
$handler->setFormatter($formatter = new LineFormatter);
|
| 39 |
-
$this->assertEquals(Logger::ERROR, $handler->getLevel());
|
| 40 |
-
$this->assertEquals(true, $handler->getBubble());
|
| 41 |
-
$this->assertSame($formatter, $handler->getFormatter());
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* @covers Monolog\Handler\AbstractHandler::handleBatch
|
| 46 |
-
*/
|
| 47 |
-
public function testHandleBatch()
|
| 48 |
-
{
|
| 49 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
|
| 50 |
-
$handler->expects($this->exactly(2))
|
| 51 |
-
->method('handle');
|
| 52 |
-
$handler->handleBatch(array($this->getRecord(), $this->getRecord()));
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* @covers Monolog\Handler\AbstractHandler::isHandling
|
| 57 |
-
*/
|
| 58 |
-
public function testIsHandling()
|
| 59 |
-
{
|
| 60 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
|
| 61 |
-
$this->assertTrue($handler->isHandling($this->getRecord()));
|
| 62 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* @covers Monolog\Handler\AbstractHandler::__construct
|
| 67 |
-
*/
|
| 68 |
-
public function testHandlesPsrStyleLevels()
|
| 69 |
-
{
|
| 70 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
|
| 71 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 72 |
-
$handler->setLevel('debug');
|
| 73 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* @covers Monolog\Handler\AbstractHandler::getFormatter
|
| 78 |
-
* @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
|
| 79 |
-
*/
|
| 80 |
-
public function testGetFormatterInitializesDefault()
|
| 81 |
-
{
|
| 82 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
|
| 83 |
-
$this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* @covers Monolog\Handler\AbstractHandler::pushProcessor
|
| 88 |
-
* @covers Monolog\Handler\AbstractHandler::popProcessor
|
| 89 |
-
* @expectedException LogicException
|
| 90 |
-
*/
|
| 91 |
-
public function testPushPopProcessor()
|
| 92 |
-
{
|
| 93 |
-
$logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
|
| 94 |
-
$processor1 = new WebProcessor;
|
| 95 |
-
$processor2 = new WebProcessor;
|
| 96 |
-
|
| 97 |
-
$logger->pushProcessor($processor1);
|
| 98 |
-
$logger->pushProcessor($processor2);
|
| 99 |
-
|
| 100 |
-
$this->assertEquals($processor2, $logger->popProcessor());
|
| 101 |
-
$this->assertEquals($processor1, $logger->popProcessor());
|
| 102 |
-
$logger->popProcessor();
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
/**
|
| 106 |
-
* @covers Monolog\Handler\AbstractHandler::pushProcessor
|
| 107 |
-
* @expectedException InvalidArgumentException
|
| 108 |
-
*/
|
| 109 |
-
public function testPushProcessorWithNonCallable()
|
| 110 |
-
{
|
| 111 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
|
| 112 |
-
|
| 113 |
-
$handler->pushProcessor(new \stdClass());
|
| 114 |
-
}
|
| 115 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
DELETED
|
@@ -1,80 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Processor\WebProcessor;
|
| 17 |
-
|
| 18 |
-
class AbstractProcessingHandlerTest extends TestCase
|
| 19 |
-
{
|
| 20 |
-
/**
|
| 21 |
-
* @covers Monolog\Handler\AbstractProcessingHandler::handle
|
| 22 |
-
*/
|
| 23 |
-
public function testHandleLowerLevelMessage()
|
| 24 |
-
{
|
| 25 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
|
| 26 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @covers Monolog\Handler\AbstractProcessingHandler::handle
|
| 31 |
-
*/
|
| 32 |
-
public function testHandleBubbling()
|
| 33 |
-
{
|
| 34 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
|
| 35 |
-
$this->assertFalse($handler->handle($this->getRecord()));
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* @covers Monolog\Handler\AbstractProcessingHandler::handle
|
| 40 |
-
*/
|
| 41 |
-
public function testHandleNotBubbling()
|
| 42 |
-
{
|
| 43 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
|
| 44 |
-
$this->assertTrue($handler->handle($this->getRecord()));
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* @covers Monolog\Handler\AbstractProcessingHandler::handle
|
| 49 |
-
*/
|
| 50 |
-
public function testHandleIsFalseWhenNotHandled()
|
| 51 |
-
{
|
| 52 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
|
| 53 |
-
$this->assertTrue($handler->handle($this->getRecord()));
|
| 54 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
/**
|
| 58 |
-
* @covers Monolog\Handler\AbstractProcessingHandler::processRecord
|
| 59 |
-
*/
|
| 60 |
-
public function testProcessRecord()
|
| 61 |
-
{
|
| 62 |
-
$handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
|
| 63 |
-
$handler->pushProcessor(new WebProcessor(array(
|
| 64 |
-
'REQUEST_URI' => '',
|
| 65 |
-
'REQUEST_METHOD' => '',
|
| 66 |
-
'REMOTE_ADDR' => '',
|
| 67 |
-
'SERVER_NAME' => '',
|
| 68 |
-
'UNIQUE_ID' => '',
|
| 69 |
-
)));
|
| 70 |
-
$handledRecord = null;
|
| 71 |
-
$handler->expects($this->once())
|
| 72 |
-
->method('write')
|
| 73 |
-
->will($this->returnCallback(function ($record) use (&$handledRecord) {
|
| 74 |
-
$handledRecord = $record;
|
| 75 |
-
}))
|
| 76 |
-
;
|
| 77 |
-
$handler->handle($this->getRecord());
|
| 78 |
-
$this->assertEquals(6, count($handledRecord['extra']));
|
| 79 |
-
}
|
| 80 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
DELETED
|
@@ -1,136 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use PhpAmqpLib\Message\AMQPMessage;
|
| 17 |
-
use PhpAmqpLib\Connection\AMQPConnection;
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\RotatingFileHandler
|
| 21 |
-
*/
|
| 22 |
-
class AmqpHandlerTest extends TestCase
|
| 23 |
-
{
|
| 24 |
-
public function testHandleAmqpExt()
|
| 25 |
-
{
|
| 26 |
-
if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
|
| 27 |
-
$this->markTestSkipped("amqp-php not installed");
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
if (!class_exists('AMQPChannel')) {
|
| 31 |
-
$this->markTestSkipped("Please update AMQP to version >= 1.0");
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
$messages = array();
|
| 35 |
-
|
| 36 |
-
$exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
|
| 37 |
-
$exchange->expects($this->once())
|
| 38 |
-
->method('setName')
|
| 39 |
-
->with('log')
|
| 40 |
-
;
|
| 41 |
-
$exchange->expects($this->any())
|
| 42 |
-
->method('publish')
|
| 43 |
-
->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
|
| 44 |
-
$messages[] = array($message, $routing_key, $flags, $attributes);
|
| 45 |
-
}))
|
| 46 |
-
;
|
| 47 |
-
|
| 48 |
-
$handler = new AmqpHandler($exchange, 'log');
|
| 49 |
-
|
| 50 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 51 |
-
|
| 52 |
-
$expected = array(
|
| 53 |
-
array(
|
| 54 |
-
'message' => 'test',
|
| 55 |
-
'context' => array(
|
| 56 |
-
'data' => array(),
|
| 57 |
-
'foo' => 34,
|
| 58 |
-
),
|
| 59 |
-
'level' => 300,
|
| 60 |
-
'level_name' => 'WARNING',
|
| 61 |
-
'channel' => 'test',
|
| 62 |
-
'extra' => array(),
|
| 63 |
-
),
|
| 64 |
-
'warn.test',
|
| 65 |
-
0,
|
| 66 |
-
array(
|
| 67 |
-
'delivery_mode' => 2,
|
| 68 |
-
'content_type' => 'application/json',
|
| 69 |
-
),
|
| 70 |
-
);
|
| 71 |
-
|
| 72 |
-
$handler->handle($record);
|
| 73 |
-
|
| 74 |
-
$this->assertCount(1, $messages);
|
| 75 |
-
$messages[0][0] = json_decode($messages[0][0], true);
|
| 76 |
-
unset($messages[0][0]['datetime']);
|
| 77 |
-
$this->assertEquals($expected, $messages[0]);
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
public function testHandlePhpAmqpLib()
|
| 81 |
-
{
|
| 82 |
-
if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
|
| 83 |
-
$this->markTestSkipped("php-amqplib not installed");
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
$messages = array();
|
| 87 |
-
|
| 88 |
-
$exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
|
| 89 |
-
|
| 90 |
-
$exchange->expects($this->any())
|
| 91 |
-
->method('basic_publish')
|
| 92 |
-
->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
|
| 93 |
-
$messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
|
| 94 |
-
}))
|
| 95 |
-
;
|
| 96 |
-
|
| 97 |
-
$handler = new AmqpHandler($exchange, 'log');
|
| 98 |
-
|
| 99 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 100 |
-
|
| 101 |
-
$expected = array(
|
| 102 |
-
array(
|
| 103 |
-
'message' => 'test',
|
| 104 |
-
'context' => array(
|
| 105 |
-
'data' => array(),
|
| 106 |
-
'foo' => 34,
|
| 107 |
-
),
|
| 108 |
-
'level' => 300,
|
| 109 |
-
'level_name' => 'WARNING',
|
| 110 |
-
'channel' => 'test',
|
| 111 |
-
'extra' => array(),
|
| 112 |
-
),
|
| 113 |
-
'log',
|
| 114 |
-
'warn.test',
|
| 115 |
-
false,
|
| 116 |
-
false,
|
| 117 |
-
null,
|
| 118 |
-
array(
|
| 119 |
-
'delivery_mode' => 2,
|
| 120 |
-
'content_type' => 'application/json',
|
| 121 |
-
),
|
| 122 |
-
);
|
| 123 |
-
|
| 124 |
-
$handler->handle($record);
|
| 125 |
-
|
| 126 |
-
$this->assertCount(1, $messages);
|
| 127 |
-
|
| 128 |
-
/* @var $msg AMQPMessage */
|
| 129 |
-
$msg = $messages[0][0];
|
| 130 |
-
$messages[0][0] = json_decode($msg->body, true);
|
| 131 |
-
$messages[0][] = $msg->get_properties();
|
| 132 |
-
unset($messages[0][0]['datetime']);
|
| 133 |
-
|
| 134 |
-
$this->assertEquals($expected, $messages[0]);
|
| 135 |
-
}
|
| 136 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
DELETED
|
@@ -1,130 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\BrowserConsoleHandlerTest
|
| 19 |
-
*/
|
| 20 |
-
class BrowserConsoleHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
protected function setUp()
|
| 23 |
-
{
|
| 24 |
-
BrowserConsoleHandler::reset();
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
protected function generateScript()
|
| 28 |
-
{
|
| 29 |
-
$reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
|
| 30 |
-
$reflMethod->setAccessible(true);
|
| 31 |
-
|
| 32 |
-
return $reflMethod->invoke(null);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function testStyling()
|
| 36 |
-
{
|
| 37 |
-
$handler = new BrowserConsoleHandler();
|
| 38 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 39 |
-
|
| 40 |
-
$handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
|
| 41 |
-
|
| 42 |
-
$expected = <<<EOF
|
| 43 |
-
(function (c) {if (c && c.groupCollapsed) {
|
| 44 |
-
c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal");
|
| 45 |
-
}})(console);
|
| 46 |
-
EOF;
|
| 47 |
-
|
| 48 |
-
$this->assertEquals($expected, $this->generateScript());
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testEscaping()
|
| 52 |
-
{
|
| 53 |
-
$handler = new BrowserConsoleHandler();
|
| 54 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 55 |
-
|
| 56 |
-
$handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
|
| 57 |
-
|
| 58 |
-
$expected = <<<EOF
|
| 59 |
-
(function (c) {if (c && c.groupCollapsed) {
|
| 60 |
-
c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal");
|
| 61 |
-
}})(console);
|
| 62 |
-
EOF;
|
| 63 |
-
|
| 64 |
-
$this->assertEquals($expected, $this->generateScript());
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
public function testAutolabel()
|
| 68 |
-
{
|
| 69 |
-
$handler = new BrowserConsoleHandler();
|
| 70 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 71 |
-
|
| 72 |
-
$handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
|
| 73 |
-
$handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}'));
|
| 74 |
-
$handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
|
| 75 |
-
|
| 76 |
-
$expected = <<<EOF
|
| 77 |
-
(function (c) {if (c && c.groupCollapsed) {
|
| 78 |
-
c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
|
| 79 |
-
c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
|
| 80 |
-
c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
|
| 81 |
-
}})(console);
|
| 82 |
-
EOF;
|
| 83 |
-
|
| 84 |
-
$this->assertEquals($expected, $this->generateScript());
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
public function testContext()
|
| 88 |
-
{
|
| 89 |
-
$handler = new BrowserConsoleHandler();
|
| 90 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 91 |
-
|
| 92 |
-
$handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar')));
|
| 93 |
-
|
| 94 |
-
$expected = <<<EOF
|
| 95 |
-
(function (c) {if (c && c.groupCollapsed) {
|
| 96 |
-
c.groupCollapsed("%ctest", "font-weight: normal");
|
| 97 |
-
c.log("%c%s", "font-weight: bold", "Context");
|
| 98 |
-
c.log("%s: %o", "foo", "bar");
|
| 99 |
-
c.groupEnd();
|
| 100 |
-
}})(console);
|
| 101 |
-
EOF;
|
| 102 |
-
|
| 103 |
-
$this->assertEquals($expected, $this->generateScript());
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
public function testConcurrentHandlers()
|
| 107 |
-
{
|
| 108 |
-
$handler1 = new BrowserConsoleHandler();
|
| 109 |
-
$handler1->setFormatter($this->getIdentityFormatter());
|
| 110 |
-
|
| 111 |
-
$handler2 = new BrowserConsoleHandler();
|
| 112 |
-
$handler2->setFormatter($this->getIdentityFormatter());
|
| 113 |
-
|
| 114 |
-
$handler1->handle($this->getRecord(Logger::DEBUG, 'test1'));
|
| 115 |
-
$handler2->handle($this->getRecord(Logger::DEBUG, 'test2'));
|
| 116 |
-
$handler1->handle($this->getRecord(Logger::DEBUG, 'test3'));
|
| 117 |
-
$handler2->handle($this->getRecord(Logger::DEBUG, 'test4'));
|
| 118 |
-
|
| 119 |
-
$expected = <<<EOF
|
| 120 |
-
(function (c) {if (c && c.groupCollapsed) {
|
| 121 |
-
c.log("%ctest1", "font-weight: normal");
|
| 122 |
-
c.log("%ctest2", "font-weight: normal");
|
| 123 |
-
c.log("%ctest3", "font-weight: normal");
|
| 124 |
-
c.log("%ctest4", "font-weight: normal");
|
| 125 |
-
}})(console);
|
| 126 |
-
EOF;
|
| 127 |
-
|
| 128 |
-
$this->assertEquals($expected, $this->generateScript());
|
| 129 |
-
}
|
| 130 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
DELETED
|
@@ -1,158 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class BufferHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
private $shutdownCheckHandler;
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* @covers Monolog\Handler\BufferHandler::__construct
|
| 23 |
-
* @covers Monolog\Handler\BufferHandler::handle
|
| 24 |
-
* @covers Monolog\Handler\BufferHandler::close
|
| 25 |
-
*/
|
| 26 |
-
public function testHandleBuffers()
|
| 27 |
-
{
|
| 28 |
-
$test = new TestHandler();
|
| 29 |
-
$handler = new BufferHandler($test);
|
| 30 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 31 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 32 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 33 |
-
$this->assertFalse($test->hasInfoRecords());
|
| 34 |
-
$handler->close();
|
| 35 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 36 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* @covers Monolog\Handler\BufferHandler::close
|
| 41 |
-
* @covers Monolog\Handler\BufferHandler::flush
|
| 42 |
-
*/
|
| 43 |
-
public function testPropagatesRecordsAtEndOfRequest()
|
| 44 |
-
{
|
| 45 |
-
$test = new TestHandler();
|
| 46 |
-
$handler = new BufferHandler($test);
|
| 47 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 48 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 49 |
-
$this->shutdownCheckHandler = $test;
|
| 50 |
-
register_shutdown_function(array($this, 'checkPropagation'));
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function checkPropagation()
|
| 54 |
-
{
|
| 55 |
-
if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) {
|
| 56 |
-
echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL;
|
| 57 |
-
exit(1);
|
| 58 |
-
}
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* @covers Monolog\Handler\BufferHandler::handle
|
| 63 |
-
*/
|
| 64 |
-
public function testHandleBufferLimit()
|
| 65 |
-
{
|
| 66 |
-
$test = new TestHandler();
|
| 67 |
-
$handler = new BufferHandler($test, 2);
|
| 68 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 69 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 70 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 71 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 72 |
-
$handler->close();
|
| 73 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 74 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 75 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* @covers Monolog\Handler\BufferHandler::handle
|
| 80 |
-
*/
|
| 81 |
-
public function testHandleBufferLimitWithFlushOnOverflow()
|
| 82 |
-
{
|
| 83 |
-
$test = new TestHandler();
|
| 84 |
-
$handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
|
| 85 |
-
|
| 86 |
-
// send two records
|
| 87 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 88 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 89 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 90 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 91 |
-
$this->assertCount(0, $test->getRecords());
|
| 92 |
-
|
| 93 |
-
// overflow
|
| 94 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 95 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 96 |
-
$this->assertCount(3, $test->getRecords());
|
| 97 |
-
|
| 98 |
-
// should buffer again
|
| 99 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 100 |
-
$this->assertCount(3, $test->getRecords());
|
| 101 |
-
|
| 102 |
-
$handler->close();
|
| 103 |
-
$this->assertCount(5, $test->getRecords());
|
| 104 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 105 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
/**
|
| 109 |
-
* @covers Monolog\Handler\BufferHandler::handle
|
| 110 |
-
*/
|
| 111 |
-
public function testHandleLevel()
|
| 112 |
-
{
|
| 113 |
-
$test = new TestHandler();
|
| 114 |
-
$handler = new BufferHandler($test, 0, Logger::INFO);
|
| 115 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 116 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 117 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 118 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 119 |
-
$handler->close();
|
| 120 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 121 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 122 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* @covers Monolog\Handler\BufferHandler::flush
|
| 127 |
-
*/
|
| 128 |
-
public function testFlush()
|
| 129 |
-
{
|
| 130 |
-
$test = new TestHandler();
|
| 131 |
-
$handler = new BufferHandler($test, 0);
|
| 132 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 133 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 134 |
-
$handler->flush();
|
| 135 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 136 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 137 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* @covers Monolog\Handler\BufferHandler::handle
|
| 142 |
-
*/
|
| 143 |
-
public function testHandleUsesProcessors()
|
| 144 |
-
{
|
| 145 |
-
$test = new TestHandler();
|
| 146 |
-
$handler = new BufferHandler($test);
|
| 147 |
-
$handler->pushProcessor(function ($record) {
|
| 148 |
-
$record['extra']['foo'] = true;
|
| 149 |
-
|
| 150 |
-
return $record;
|
| 151 |
-
});
|
| 152 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 153 |
-
$handler->flush();
|
| 154 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 155 |
-
$records = $test->getRecords();
|
| 156 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 157 |
-
}
|
| 158 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
DELETED
|
@@ -1,141 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\ChromePHPHandler
|
| 19 |
-
*/
|
| 20 |
-
class ChromePHPHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
protected function setUp()
|
| 23 |
-
{
|
| 24 |
-
TestChromePHPHandler::reset();
|
| 25 |
-
$_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0';
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function testHeaders()
|
| 29 |
-
{
|
| 30 |
-
$handler = new TestChromePHPHandler();
|
| 31 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 32 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 33 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 34 |
-
|
| 35 |
-
$expected = array(
|
| 36 |
-
'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
|
| 37 |
-
'version' => ChromePHPHandler::VERSION,
|
| 38 |
-
'columns' => array('label', 'log', 'backtrace', 'type'),
|
| 39 |
-
'rows' => array(
|
| 40 |
-
'test',
|
| 41 |
-
'test',
|
| 42 |
-
),
|
| 43 |
-
'request_uri' => '',
|
| 44 |
-
)))),
|
| 45 |
-
);
|
| 46 |
-
|
| 47 |
-
$this->assertEquals($expected, $handler->getHeaders());
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
public function testHeadersOverflow()
|
| 51 |
-
{
|
| 52 |
-
$handler = new TestChromePHPHandler();
|
| 53 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 54 |
-
$handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150 * 1024)));
|
| 55 |
-
|
| 56 |
-
// overflow chrome headers limit
|
| 57 |
-
$handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100 * 1024)));
|
| 58 |
-
|
| 59 |
-
$expected = array(
|
| 60 |
-
'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
|
| 61 |
-
'version' => ChromePHPHandler::VERSION,
|
| 62 |
-
'columns' => array('label', 'log', 'backtrace', 'type'),
|
| 63 |
-
'rows' => array(
|
| 64 |
-
array(
|
| 65 |
-
'test',
|
| 66 |
-
'test',
|
| 67 |
-
'unknown',
|
| 68 |
-
'log',
|
| 69 |
-
),
|
| 70 |
-
array(
|
| 71 |
-
'test',
|
| 72 |
-
str_repeat('a', 150 * 1024),
|
| 73 |
-
'unknown',
|
| 74 |
-
'warn',
|
| 75 |
-
),
|
| 76 |
-
array(
|
| 77 |
-
'monolog',
|
| 78 |
-
'Incomplete logs, chrome header size limit reached',
|
| 79 |
-
'unknown',
|
| 80 |
-
'warn',
|
| 81 |
-
),
|
| 82 |
-
),
|
| 83 |
-
'request_uri' => '',
|
| 84 |
-
)))),
|
| 85 |
-
);
|
| 86 |
-
|
| 87 |
-
$this->assertEquals($expected, $handler->getHeaders());
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
public function testConcurrentHandlers()
|
| 91 |
-
{
|
| 92 |
-
$handler = new TestChromePHPHandler();
|
| 93 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 94 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 95 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 96 |
-
|
| 97 |
-
$handler2 = new TestChromePHPHandler();
|
| 98 |
-
$handler2->setFormatter($this->getIdentityFormatter());
|
| 99 |
-
$handler2->handle($this->getRecord(Logger::DEBUG));
|
| 100 |
-
$handler2->handle($this->getRecord(Logger::WARNING));
|
| 101 |
-
|
| 102 |
-
$expected = array(
|
| 103 |
-
'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
|
| 104 |
-
'version' => ChromePHPHandler::VERSION,
|
| 105 |
-
'columns' => array('label', 'log', 'backtrace', 'type'),
|
| 106 |
-
'rows' => array(
|
| 107 |
-
'test',
|
| 108 |
-
'test',
|
| 109 |
-
'test',
|
| 110 |
-
'test',
|
| 111 |
-
),
|
| 112 |
-
'request_uri' => '',
|
| 113 |
-
)))),
|
| 114 |
-
);
|
| 115 |
-
|
| 116 |
-
$this->assertEquals($expected, $handler2->getHeaders());
|
| 117 |
-
}
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
class TestChromePHPHandler extends ChromePHPHandler
|
| 121 |
-
{
|
| 122 |
-
protected $headers = array();
|
| 123 |
-
|
| 124 |
-
public static function reset()
|
| 125 |
-
{
|
| 126 |
-
self::$initialized = false;
|
| 127 |
-
self::$overflowed = false;
|
| 128 |
-
self::$sendHeaders = true;
|
| 129 |
-
self::$json['rows'] = array();
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
protected function sendHeader($header, $content)
|
| 133 |
-
{
|
| 134 |
-
$this->headers[$header] = $content;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
public function getHeaders()
|
| 138 |
-
{
|
| 139 |
-
return $this->headers;
|
| 140 |
-
}
|
| 141 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class CouchDBHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
public function testHandle()
|
| 20 |
-
{
|
| 21 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 22 |
-
|
| 23 |
-
$handler = new CouchDBHandler();
|
| 24 |
-
|
| 25 |
-
try {
|
| 26 |
-
$handler->handle($record);
|
| 27 |
-
} catch (\RuntimeException $e) {
|
| 28 |
-
$this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
|
| 29 |
-
}
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php
DELETED
|
@@ -1,165 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class DeduplicationHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\DeduplicationHandler::flush
|
| 21 |
-
*/
|
| 22 |
-
public function testFlushPassthruIfAllRecordsUnderTrigger()
|
| 23 |
-
{
|
| 24 |
-
$test = new TestHandler();
|
| 25 |
-
@unlink(sys_get_temp_dir().'/monolog_dedup.log');
|
| 26 |
-
$handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
|
| 27 |
-
|
| 28 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 29 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 30 |
-
|
| 31 |
-
$handler->flush();
|
| 32 |
-
|
| 33 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 34 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 35 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* @covers Monolog\Handler\DeduplicationHandler::flush
|
| 40 |
-
* @covers Monolog\Handler\DeduplicationHandler::appendRecord
|
| 41 |
-
*/
|
| 42 |
-
public function testFlushPassthruIfEmptyLog()
|
| 43 |
-
{
|
| 44 |
-
$test = new TestHandler();
|
| 45 |
-
@unlink(sys_get_temp_dir().'/monolog_dedup.log');
|
| 46 |
-
$handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
|
| 47 |
-
|
| 48 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
|
| 49 |
-
$handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
|
| 50 |
-
|
| 51 |
-
$handler->flush();
|
| 52 |
-
|
| 53 |
-
$this->assertTrue($test->hasErrorRecords());
|
| 54 |
-
$this->assertTrue($test->hasCriticalRecords());
|
| 55 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* @covers Monolog\Handler\DeduplicationHandler::flush
|
| 60 |
-
* @covers Monolog\Handler\DeduplicationHandler::appendRecord
|
| 61 |
-
* @covers Monolog\Handler\DeduplicationHandler::isDuplicate
|
| 62 |
-
* @depends testFlushPassthruIfEmptyLog
|
| 63 |
-
*/
|
| 64 |
-
public function testFlushSkipsIfLogExists()
|
| 65 |
-
{
|
| 66 |
-
$test = new TestHandler();
|
| 67 |
-
$handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
|
| 68 |
-
|
| 69 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
|
| 70 |
-
$handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
|
| 71 |
-
|
| 72 |
-
$handler->flush();
|
| 73 |
-
|
| 74 |
-
$this->assertFalse($test->hasErrorRecords());
|
| 75 |
-
$this->assertFalse($test->hasCriticalRecords());
|
| 76 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
/**
|
| 80 |
-
* @covers Monolog\Handler\DeduplicationHandler::flush
|
| 81 |
-
* @covers Monolog\Handler\DeduplicationHandler::appendRecord
|
| 82 |
-
* @covers Monolog\Handler\DeduplicationHandler::isDuplicate
|
| 83 |
-
* @depends testFlushPassthruIfEmptyLog
|
| 84 |
-
*/
|
| 85 |
-
public function testFlushPassthruIfLogTooOld()
|
| 86 |
-
{
|
| 87 |
-
$test = new TestHandler();
|
| 88 |
-
$handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
|
| 89 |
-
|
| 90 |
-
$record = $this->getRecord(Logger::ERROR);
|
| 91 |
-
$record['datetime']->modify('+62seconds');
|
| 92 |
-
$handler->handle($record);
|
| 93 |
-
$record = $this->getRecord(Logger::CRITICAL);
|
| 94 |
-
$record['datetime']->modify('+62seconds');
|
| 95 |
-
$handler->handle($record);
|
| 96 |
-
|
| 97 |
-
$handler->flush();
|
| 98 |
-
|
| 99 |
-
$this->assertTrue($test->hasErrorRecords());
|
| 100 |
-
$this->assertTrue($test->hasCriticalRecords());
|
| 101 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
* @covers Monolog\Handler\DeduplicationHandler::flush
|
| 106 |
-
* @covers Monolog\Handler\DeduplicationHandler::appendRecord
|
| 107 |
-
* @covers Monolog\Handler\DeduplicationHandler::isDuplicate
|
| 108 |
-
* @covers Monolog\Handler\DeduplicationHandler::collectLogs
|
| 109 |
-
*/
|
| 110 |
-
public function testGcOldLogs()
|
| 111 |
-
{
|
| 112 |
-
$test = new TestHandler();
|
| 113 |
-
@unlink(sys_get_temp_dir().'/monolog_dedup.log');
|
| 114 |
-
$handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
|
| 115 |
-
|
| 116 |
-
// handle two records from yesterday, and one recent
|
| 117 |
-
$record = $this->getRecord(Logger::ERROR);
|
| 118 |
-
$record['datetime']->modify('-1day -10seconds');
|
| 119 |
-
$handler->handle($record);
|
| 120 |
-
$record2 = $this->getRecord(Logger::CRITICAL);
|
| 121 |
-
$record2['datetime']->modify('-1day -10seconds');
|
| 122 |
-
$handler->handle($record2);
|
| 123 |
-
$record3 = $this->getRecord(Logger::CRITICAL);
|
| 124 |
-
$record3['datetime']->modify('-30seconds');
|
| 125 |
-
$handler->handle($record3);
|
| 126 |
-
|
| 127 |
-
// log is written as none of them are duplicate
|
| 128 |
-
$handler->flush();
|
| 129 |
-
$this->assertSame(
|
| 130 |
-
$record['datetime']->getTimestamp() . ":ERROR:test\n" .
|
| 131 |
-
$record2['datetime']->getTimestamp() . ":CRITICAL:test\n" .
|
| 132 |
-
$record3['datetime']->getTimestamp() . ":CRITICAL:test\n",
|
| 133 |
-
file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
|
| 134 |
-
);
|
| 135 |
-
$this->assertTrue($test->hasErrorRecords());
|
| 136 |
-
$this->assertTrue($test->hasCriticalRecords());
|
| 137 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 138 |
-
|
| 139 |
-
// clear test handler
|
| 140 |
-
$test->clear();
|
| 141 |
-
$this->assertFalse($test->hasErrorRecords());
|
| 142 |
-
$this->assertFalse($test->hasCriticalRecords());
|
| 143 |
-
|
| 144 |
-
// log new records, duplicate log gets GC'd at the end of this flush call
|
| 145 |
-
$handler->handle($record = $this->getRecord(Logger::ERROR));
|
| 146 |
-
$handler->handle($record2 = $this->getRecord(Logger::CRITICAL));
|
| 147 |
-
$handler->flush();
|
| 148 |
-
|
| 149 |
-
// log should now contain the new errors and the previous one that was recent enough
|
| 150 |
-
$this->assertSame(
|
| 151 |
-
$record3['datetime']->getTimestamp() . ":CRITICAL:test\n" .
|
| 152 |
-
$record['datetime']->getTimestamp() . ":ERROR:test\n" .
|
| 153 |
-
$record2['datetime']->getTimestamp() . ":CRITICAL:test\n",
|
| 154 |
-
file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
|
| 155 |
-
);
|
| 156 |
-
$this->assertTrue($test->hasErrorRecords());
|
| 157 |
-
$this->assertTrue($test->hasCriticalRecords());
|
| 158 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
public static function tearDownAfterClass()
|
| 162 |
-
{
|
| 163 |
-
@unlink(sys_get_temp_dir().'/monolog_dedup.log');
|
| 164 |
-
}
|
| 165 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
DELETED
|
@@ -1,52 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class DoctrineCouchDBHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
protected function setup()
|
| 20 |
-
{
|
| 21 |
-
if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
|
| 22 |
-
$this->markTestSkipped('The "doctrine/couchdb" package is not installed');
|
| 23 |
-
}
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function testHandle()
|
| 27 |
-
{
|
| 28 |
-
$client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
|
| 29 |
-
->setMethods(array('postDocument'))
|
| 30 |
-
->disableOriginalConstructor()
|
| 31 |
-
->getMock();
|
| 32 |
-
|
| 33 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 34 |
-
|
| 35 |
-
$expected = array(
|
| 36 |
-
'message' => 'test',
|
| 37 |
-
'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
|
| 38 |
-
'level' => Logger::WARNING,
|
| 39 |
-
'level_name' => 'WARNING',
|
| 40 |
-
'channel' => 'test',
|
| 41 |
-
'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
|
| 42 |
-
'extra' => array(),
|
| 43 |
-
);
|
| 44 |
-
|
| 45 |
-
$client->expects($this->once())
|
| 46 |
-
->method('postDocument')
|
| 47 |
-
->with($expected);
|
| 48 |
-
|
| 49 |
-
$handler = new DoctrineCouchDBHandler($client);
|
| 50 |
-
$handler->handle($record);
|
| 51 |
-
}
|
| 52 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
DELETED
|
@@ -1,75 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
|
| 16 |
-
class DynamoDbHandlerTest extends TestCase
|
| 17 |
-
{
|
| 18 |
-
private $client;
|
| 19 |
-
|
| 20 |
-
public function setUp()
|
| 21 |
-
{
|
| 22 |
-
if (!class_exists('Aws\DynamoDb\DynamoDbClient')) {
|
| 23 |
-
$this->markTestSkipped('aws/aws-sdk-php not installed');
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
$this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient')
|
| 27 |
-
->setMethods(array('formatAttributes', '__call'))
|
| 28 |
-
->disableOriginalConstructor()->getMock();
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function testConstruct()
|
| 32 |
-
{
|
| 33 |
-
$this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo'));
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function testInterface()
|
| 37 |
-
{
|
| 38 |
-
$this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo'));
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function testGetFormatter()
|
| 42 |
-
{
|
| 43 |
-
$handler = new DynamoDbHandler($this->client, 'foo');
|
| 44 |
-
$this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter());
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testHandle()
|
| 48 |
-
{
|
| 49 |
-
$record = $this->getRecord();
|
| 50 |
-
$formatter = $this->getMock('Monolog\Formatter\FormatterInterface');
|
| 51 |
-
$formatted = array('foo' => 1, 'bar' => 2);
|
| 52 |
-
$handler = new DynamoDbHandler($this->client, 'foo');
|
| 53 |
-
$handler->setFormatter($formatter);
|
| 54 |
-
|
| 55 |
-
$formatter
|
| 56 |
-
->expects($this->once())
|
| 57 |
-
->method('format')
|
| 58 |
-
->with($record)
|
| 59 |
-
->will($this->returnValue($formatted));
|
| 60 |
-
$this->client
|
| 61 |
-
->expects($this->once())
|
| 62 |
-
->method('formatAttributes')
|
| 63 |
-
->with($this->isType('array'))
|
| 64 |
-
->will($this->returnValue($formatted));
|
| 65 |
-
$this->client
|
| 66 |
-
->expects($this->once())
|
| 67 |
-
->method('__call')
|
| 68 |
-
->with('putItem', array(array(
|
| 69 |
-
'TableName' => 'foo',
|
| 70 |
-
'Item' => $formatted,
|
| 71 |
-
)));
|
| 72 |
-
|
| 73 |
-
$handler->handle($record);
|
| 74 |
-
}
|
| 75 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
DELETED
|
@@ -1,239 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Formatter\ElasticaFormatter;
|
| 15 |
-
use Monolog\Formatter\NormalizerFormatter;
|
| 16 |
-
use Monolog\TestCase;
|
| 17 |
-
use Monolog\Logger;
|
| 18 |
-
use Elastica\Client;
|
| 19 |
-
use Elastica\Request;
|
| 20 |
-
use Elastica\Response;
|
| 21 |
-
|
| 22 |
-
class ElasticSearchHandlerTest extends TestCase
|
| 23 |
-
{
|
| 24 |
-
/**
|
| 25 |
-
* @var Client mock
|
| 26 |
-
*/
|
| 27 |
-
protected $client;
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @var array Default handler options
|
| 31 |
-
*/
|
| 32 |
-
protected $options = array(
|
| 33 |
-
'index' => 'my_index',
|
| 34 |
-
'type' => 'doc_type',
|
| 35 |
-
);
|
| 36 |
-
|
| 37 |
-
public function setUp()
|
| 38 |
-
{
|
| 39 |
-
// Elastica lib required
|
| 40 |
-
if (!class_exists("Elastica\Client")) {
|
| 41 |
-
$this->markTestSkipped("ruflin/elastica not installed");
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
// base mock Elastica Client object
|
| 45 |
-
$this->client = $this->getMockBuilder('Elastica\Client')
|
| 46 |
-
->setMethods(array('addDocuments'))
|
| 47 |
-
->disableOriginalConstructor()
|
| 48 |
-
->getMock();
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* @covers Monolog\Handler\ElasticSearchHandler::write
|
| 53 |
-
* @covers Monolog\Handler\ElasticSearchHandler::handleBatch
|
| 54 |
-
* @covers Monolog\Handler\ElasticSearchHandler::bulkSend
|
| 55 |
-
* @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
|
| 56 |
-
*/
|
| 57 |
-
public function testHandle()
|
| 58 |
-
{
|
| 59 |
-
// log message
|
| 60 |
-
$msg = array(
|
| 61 |
-
'level' => Logger::ERROR,
|
| 62 |
-
'level_name' => 'ERROR',
|
| 63 |
-
'channel' => 'meh',
|
| 64 |
-
'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
|
| 65 |
-
'datetime' => new \DateTime("@0"),
|
| 66 |
-
'extra' => array(),
|
| 67 |
-
'message' => 'log',
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
// format expected result
|
| 71 |
-
$formatter = new ElasticaFormatter($this->options['index'], $this->options['type']);
|
| 72 |
-
$expected = array($formatter->format($msg));
|
| 73 |
-
|
| 74 |
-
// setup ES client mock
|
| 75 |
-
$this->client->expects($this->any())
|
| 76 |
-
->method('addDocuments')
|
| 77 |
-
->with($expected);
|
| 78 |
-
|
| 79 |
-
// perform tests
|
| 80 |
-
$handler = new ElasticSearchHandler($this->client, $this->options);
|
| 81 |
-
$handler->handle($msg);
|
| 82 |
-
$handler->handleBatch(array($msg));
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* @covers Monolog\Handler\ElasticSearchHandler::setFormatter
|
| 87 |
-
*/
|
| 88 |
-
public function testSetFormatter()
|
| 89 |
-
{
|
| 90 |
-
$handler = new ElasticSearchHandler($this->client);
|
| 91 |
-
$formatter = new ElasticaFormatter('index_new', 'type_new');
|
| 92 |
-
$handler->setFormatter($formatter);
|
| 93 |
-
$this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter());
|
| 94 |
-
$this->assertEquals('index_new', $handler->getFormatter()->getIndex());
|
| 95 |
-
$this->assertEquals('type_new', $handler->getFormatter()->getType());
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/**
|
| 99 |
-
* @covers Monolog\Handler\ElasticSearchHandler::setFormatter
|
| 100 |
-
* @expectedException InvalidArgumentException
|
| 101 |
-
* @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter
|
| 102 |
-
*/
|
| 103 |
-
public function testSetFormatterInvalid()
|
| 104 |
-
{
|
| 105 |
-
$handler = new ElasticSearchHandler($this->client);
|
| 106 |
-
$formatter = new NormalizerFormatter();
|
| 107 |
-
$handler->setFormatter($formatter);
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
/**
|
| 111 |
-
* @covers Monolog\Handler\ElasticSearchHandler::__construct
|
| 112 |
-
* @covers Monolog\Handler\ElasticSearchHandler::getOptions
|
| 113 |
-
*/
|
| 114 |
-
public function testOptions()
|
| 115 |
-
{
|
| 116 |
-
$expected = array(
|
| 117 |
-
'index' => $this->options['index'],
|
| 118 |
-
'type' => $this->options['type'],
|
| 119 |
-
'ignore_error' => false,
|
| 120 |
-
);
|
| 121 |
-
$handler = new ElasticSearchHandler($this->client, $this->options);
|
| 122 |
-
$this->assertEquals($expected, $handler->getOptions());
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* @covers Monolog\Handler\ElasticSearchHandler::bulkSend
|
| 127 |
-
* @dataProvider providerTestConnectionErrors
|
| 128 |
-
*/
|
| 129 |
-
public function testConnectionErrors($ignore, $expectedError)
|
| 130 |
-
{
|
| 131 |
-
$clientOpts = array('host' => '127.0.0.1', 'port' => 1);
|
| 132 |
-
$client = new Client($clientOpts);
|
| 133 |
-
$handlerOpts = array('ignore_error' => $ignore);
|
| 134 |
-
$handler = new ElasticSearchHandler($client, $handlerOpts);
|
| 135 |
-
|
| 136 |
-
if ($expectedError) {
|
| 137 |
-
$this->setExpectedException($expectedError[0], $expectedError[1]);
|
| 138 |
-
$handler->handle($this->getRecord());
|
| 139 |
-
} else {
|
| 140 |
-
$this->assertFalse($handler->handle($this->getRecord()));
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
/**
|
| 145 |
-
* @return array
|
| 146 |
-
*/
|
| 147 |
-
public function providerTestConnectionErrors()
|
| 148 |
-
{
|
| 149 |
-
return array(
|
| 150 |
-
array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')),
|
| 151 |
-
array(true, false),
|
| 152 |
-
);
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
/**
|
| 156 |
-
* Integration test using localhost Elastic Search server
|
| 157 |
-
*
|
| 158 |
-
* @covers Monolog\Handler\ElasticSearchHandler::__construct
|
| 159 |
-
* @covers Monolog\Handler\ElasticSearchHandler::handleBatch
|
| 160 |
-
* @covers Monolog\Handler\ElasticSearchHandler::bulkSend
|
| 161 |
-
* @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
|
| 162 |
-
*/
|
| 163 |
-
public function testHandleIntegration()
|
| 164 |
-
{
|
| 165 |
-
$msg = array(
|
| 166 |
-
'level' => Logger::ERROR,
|
| 167 |
-
'level_name' => 'ERROR',
|
| 168 |
-
'channel' => 'meh',
|
| 169 |
-
'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
|
| 170 |
-
'datetime' => new \DateTime("@0"),
|
| 171 |
-
'extra' => array(),
|
| 172 |
-
'message' => 'log',
|
| 173 |
-
);
|
| 174 |
-
|
| 175 |
-
$expected = $msg;
|
| 176 |
-
$expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601);
|
| 177 |
-
$expected['context'] = array(
|
| 178 |
-
'class' => '[object] (stdClass: {})',
|
| 179 |
-
'foo' => 7,
|
| 180 |
-
0 => 'bar',
|
| 181 |
-
);
|
| 182 |
-
|
| 183 |
-
$client = new Client();
|
| 184 |
-
$handler = new ElasticSearchHandler($client, $this->options);
|
| 185 |
-
try {
|
| 186 |
-
$handler->handleBatch(array($msg));
|
| 187 |
-
} catch (\RuntimeException $e) {
|
| 188 |
-
$this->markTestSkipped("Cannot connect to Elastic Search server on localhost");
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
// check document id from ES server response
|
| 192 |
-
$documentId = $this->getCreatedDocId($client->getLastResponse());
|
| 193 |
-
$this->assertNotEmpty($documentId, 'No elastic document id received');
|
| 194 |
-
|
| 195 |
-
// retrieve document source from ES and validate
|
| 196 |
-
$document = $this->getDocSourceFromElastic(
|
| 197 |
-
$client,
|
| 198 |
-
$this->options['index'],
|
| 199 |
-
$this->options['type'],
|
| 200 |
-
$documentId
|
| 201 |
-
);
|
| 202 |
-
$this->assertEquals($expected, $document);
|
| 203 |
-
|
| 204 |
-
// remove test index from ES
|
| 205 |
-
$client->request("/{$this->options['index']}", Request::DELETE);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
/**
|
| 209 |
-
* Return last created document id from ES response
|
| 210 |
-
* @param Response $response Elastica Response object
|
| 211 |
-
* @return string|null
|
| 212 |
-
*/
|
| 213 |
-
protected function getCreatedDocId(Response $response)
|
| 214 |
-
{
|
| 215 |
-
$data = $response->getData();
|
| 216 |
-
if (!empty($data['items'][0]['create']['_id'])) {
|
| 217 |
-
return $data['items'][0]['create']['_id'];
|
| 218 |
-
}
|
| 219 |
-
}
|
| 220 |
-
|
| 221 |
-
/**
|
| 222 |
-
* Retrieve document by id from Elasticsearch
|
| 223 |
-
* @param Client $client Elastica client
|
| 224 |
-
* @param string $index
|
| 225 |
-
* @param string $type
|
| 226 |
-
* @param string $documentId
|
| 227 |
-
* @return array
|
| 228 |
-
*/
|
| 229 |
-
protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId)
|
| 230 |
-
{
|
| 231 |
-
$resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET);
|
| 232 |
-
$data = $resp->getData();
|
| 233 |
-
if (!empty($data['_source'])) {
|
| 234 |
-
return $data['_source'];
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
return array();
|
| 238 |
-
}
|
| 239 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
DELETED
|
@@ -1,66 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Formatter\LineFormatter;
|
| 17 |
-
|
| 18 |
-
function error_log()
|
| 19 |
-
{
|
| 20 |
-
$GLOBALS['error_log'][] = func_get_args();
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
class ErrorLogHandlerTest extends TestCase
|
| 24 |
-
{
|
| 25 |
-
protected function setUp()
|
| 26 |
-
{
|
| 27 |
-
$GLOBALS['error_log'] = array();
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* @covers Monolog\Handler\ErrorLogHandler::__construct
|
| 32 |
-
* @expectedException InvalidArgumentException
|
| 33 |
-
* @expectedExceptionMessage The given message type "42" is not supported
|
| 34 |
-
*/
|
| 35 |
-
public function testShouldNotAcceptAnInvalidTypeOnContructor()
|
| 36 |
-
{
|
| 37 |
-
new ErrorLogHandler(42);
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* @covers Monolog\Handler\ErrorLogHandler::write
|
| 42 |
-
*/
|
| 43 |
-
public function testShouldLogMessagesUsingErrorLogFuncion()
|
| 44 |
-
{
|
| 45 |
-
$type = ErrorLogHandler::OPERATING_SYSTEM;
|
| 46 |
-
$handler = new ErrorLogHandler($type);
|
| 47 |
-
$handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true));
|
| 48 |
-
$handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
|
| 49 |
-
|
| 50 |
-
$this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]);
|
| 51 |
-
$this->assertSame($GLOBALS['error_log'][0][1], $type);
|
| 52 |
-
|
| 53 |
-
$handler = new ErrorLogHandler($type, Logger::DEBUG, true, true);
|
| 54 |
-
$handler->setFormatter(new LineFormatter(null, null, true));
|
| 55 |
-
$handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
|
| 56 |
-
|
| 57 |
-
$this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]);
|
| 58 |
-
$this->assertSame($GLOBALS['error_log'][1][1], $type);
|
| 59 |
-
|
| 60 |
-
$this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]);
|
| 61 |
-
$this->assertSame($GLOBALS['error_log'][2][1], $type);
|
| 62 |
-
|
| 63 |
-
$this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]);
|
| 64 |
-
$this->assertSame($GLOBALS['error_log'][3][1], $type);
|
| 65 |
-
}
|
| 66 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
DELETED
|
@@ -1,170 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class FilterHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\FilterHandler::isHandling
|
| 21 |
-
*/
|
| 22 |
-
public function testIsHandling()
|
| 23 |
-
{
|
| 24 |
-
$test = new TestHandler();
|
| 25 |
-
$handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
|
| 26 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 27 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO)));
|
| 28 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE)));
|
| 29 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING)));
|
| 30 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR)));
|
| 31 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL)));
|
| 32 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT)));
|
| 33 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY)));
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* @covers Monolog\Handler\FilterHandler::handle
|
| 38 |
-
* @covers Monolog\Handler\FilterHandler::setAcceptedLevels
|
| 39 |
-
* @covers Monolog\Handler\FilterHandler::isHandling
|
| 40 |
-
*/
|
| 41 |
-
public function testHandleProcessOnlyNeededLevels()
|
| 42 |
-
{
|
| 43 |
-
$test = new TestHandler();
|
| 44 |
-
$handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
|
| 45 |
-
|
| 46 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 47 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 48 |
-
|
| 49 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 50 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 51 |
-
$handler->handle($this->getRecord(Logger::NOTICE));
|
| 52 |
-
$this->assertTrue($test->hasNoticeRecords());
|
| 53 |
-
|
| 54 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 55 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 56 |
-
$handler->handle($this->getRecord(Logger::ERROR));
|
| 57 |
-
$this->assertFalse($test->hasErrorRecords());
|
| 58 |
-
$handler->handle($this->getRecord(Logger::CRITICAL));
|
| 59 |
-
$this->assertFalse($test->hasCriticalRecords());
|
| 60 |
-
$handler->handle($this->getRecord(Logger::ALERT));
|
| 61 |
-
$this->assertFalse($test->hasAlertRecords());
|
| 62 |
-
$handler->handle($this->getRecord(Logger::EMERGENCY));
|
| 63 |
-
$this->assertFalse($test->hasEmergencyRecords());
|
| 64 |
-
|
| 65 |
-
$test = new TestHandler();
|
| 66 |
-
$handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR));
|
| 67 |
-
|
| 68 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 69 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 70 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 71 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 72 |
-
$handler->handle($this->getRecord(Logger::NOTICE));
|
| 73 |
-
$this->assertFalse($test->hasNoticeRecords());
|
| 74 |
-
$handler->handle($this->getRecord(Logger::ERROR));
|
| 75 |
-
$this->assertTrue($test->hasErrorRecords());
|
| 76 |
-
$handler->handle($this->getRecord(Logger::CRITICAL));
|
| 77 |
-
$this->assertFalse($test->hasCriticalRecords());
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* @covers Monolog\Handler\FilterHandler::setAcceptedLevels
|
| 82 |
-
* @covers Monolog\Handler\FilterHandler::getAcceptedLevels
|
| 83 |
-
*/
|
| 84 |
-
public function testAcceptedLevelApi()
|
| 85 |
-
{
|
| 86 |
-
$test = new TestHandler();
|
| 87 |
-
$handler = new FilterHandler($test);
|
| 88 |
-
|
| 89 |
-
$levels = array(Logger::INFO, Logger::ERROR);
|
| 90 |
-
$handler->setAcceptedLevels($levels);
|
| 91 |
-
$this->assertSame($levels, $handler->getAcceptedLevels());
|
| 92 |
-
|
| 93 |
-
$handler->setAcceptedLevels(array('info', 'error'));
|
| 94 |
-
$this->assertSame($levels, $handler->getAcceptedLevels());
|
| 95 |
-
|
| 96 |
-
$levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY);
|
| 97 |
-
$handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY);
|
| 98 |
-
$this->assertSame($levels, $handler->getAcceptedLevels());
|
| 99 |
-
|
| 100 |
-
$handler->setAcceptedLevels('critical', 'emergency');
|
| 101 |
-
$this->assertSame($levels, $handler->getAcceptedLevels());
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
* @covers Monolog\Handler\FilterHandler::handle
|
| 106 |
-
*/
|
| 107 |
-
public function testHandleUsesProcessors()
|
| 108 |
-
{
|
| 109 |
-
$test = new TestHandler();
|
| 110 |
-
$handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY);
|
| 111 |
-
$handler->pushProcessor(
|
| 112 |
-
function ($record) {
|
| 113 |
-
$record['extra']['foo'] = true;
|
| 114 |
-
|
| 115 |
-
return $record;
|
| 116 |
-
}
|
| 117 |
-
);
|
| 118 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 119 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 120 |
-
$records = $test->getRecords();
|
| 121 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
/**
|
| 125 |
-
* @covers Monolog\Handler\FilterHandler::handle
|
| 126 |
-
*/
|
| 127 |
-
public function testHandleRespectsBubble()
|
| 128 |
-
{
|
| 129 |
-
$test = new TestHandler();
|
| 130 |
-
|
| 131 |
-
$handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false);
|
| 132 |
-
$this->assertTrue($handler->handle($this->getRecord(Logger::INFO)));
|
| 133 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
|
| 134 |
-
|
| 135 |
-
$handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true);
|
| 136 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::INFO)));
|
| 137 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
/**
|
| 141 |
-
* @covers Monolog\Handler\FilterHandler::handle
|
| 142 |
-
*/
|
| 143 |
-
public function testHandleWithCallback()
|
| 144 |
-
{
|
| 145 |
-
$test = new TestHandler();
|
| 146 |
-
$handler = new FilterHandler(
|
| 147 |
-
function ($record, $handler) use ($test) {
|
| 148 |
-
return $test;
|
| 149 |
-
}, Logger::INFO, Logger::NOTICE, false
|
| 150 |
-
);
|
| 151 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 152 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 153 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 154 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 155 |
-
}
|
| 156 |
-
|
| 157 |
-
/**
|
| 158 |
-
* @covers Monolog\Handler\FilterHandler::handle
|
| 159 |
-
* @expectedException \RuntimeException
|
| 160 |
-
*/
|
| 161 |
-
public function testHandleWithBadCallbackThrowsException()
|
| 162 |
-
{
|
| 163 |
-
$handler = new FilterHandler(
|
| 164 |
-
function ($record, $handler) {
|
| 165 |
-
return 'foo';
|
| 166 |
-
}
|
| 167 |
-
);
|
| 168 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 169 |
-
}
|
| 170 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
DELETED
|
@@ -1,279 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
|
| 17 |
-
use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
|
| 18 |
-
use Psr\Log\LogLevel;
|
| 19 |
-
|
| 20 |
-
class FingersCrossedHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
/**
|
| 23 |
-
* @covers Monolog\Handler\FingersCrossedHandler::__construct
|
| 24 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 25 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 26 |
-
*/
|
| 27 |
-
public function testHandleBuffers()
|
| 28 |
-
{
|
| 29 |
-
$test = new TestHandler();
|
| 30 |
-
$handler = new FingersCrossedHandler($test);
|
| 31 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 32 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 33 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 34 |
-
$this->assertFalse($test->hasInfoRecords());
|
| 35 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 36 |
-
$handler->close();
|
| 37 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 38 |
-
$this->assertTrue(count($test->getRecords()) === 3);
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 43 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 44 |
-
*/
|
| 45 |
-
public function testHandleStopsBufferingAfterTrigger()
|
| 46 |
-
{
|
| 47 |
-
$test = new TestHandler();
|
| 48 |
-
$handler = new FingersCrossedHandler($test);
|
| 49 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 50 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 51 |
-
$handler->close();
|
| 52 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 53 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 58 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 59 |
-
* @covers Monolog\Handler\FingersCrossedHandler::reset
|
| 60 |
-
*/
|
| 61 |
-
public function testHandleRestartBufferingAfterReset()
|
| 62 |
-
{
|
| 63 |
-
$test = new TestHandler();
|
| 64 |
-
$handler = new FingersCrossedHandler($test);
|
| 65 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 66 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 67 |
-
$handler->reset();
|
| 68 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 69 |
-
$handler->close();
|
| 70 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 71 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 72 |
-
$this->assertFalse($test->hasInfoRecords());
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 77 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 78 |
-
*/
|
| 79 |
-
public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
|
| 80 |
-
{
|
| 81 |
-
$test = new TestHandler();
|
| 82 |
-
$handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
|
| 83 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 84 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 85 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 86 |
-
$handler->close();
|
| 87 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 88 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 89 |
-
$this->assertFalse($test->hasInfoRecords());
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
/**
|
| 93 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 94 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 95 |
-
*/
|
| 96 |
-
public function testHandleBufferLimit()
|
| 97 |
-
{
|
| 98 |
-
$test = new TestHandler();
|
| 99 |
-
$handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
|
| 100 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 101 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 102 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 103 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 104 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 105 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 106 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 111 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 112 |
-
*/
|
| 113 |
-
public function testHandleWithCallback()
|
| 114 |
-
{
|
| 115 |
-
$test = new TestHandler();
|
| 116 |
-
$handler = new FingersCrossedHandler(function ($record, $handler) use ($test) {
|
| 117 |
-
return $test;
|
| 118 |
-
});
|
| 119 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 120 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 121 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 122 |
-
$this->assertFalse($test->hasInfoRecords());
|
| 123 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 124 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 125 |
-
$this->assertTrue(count($test->getRecords()) === 3);
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
/**
|
| 129 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 130 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 131 |
-
* @expectedException RuntimeException
|
| 132 |
-
*/
|
| 133 |
-
public function testHandleWithBadCallbackThrowsException()
|
| 134 |
-
{
|
| 135 |
-
$handler = new FingersCrossedHandler(function ($record, $handler) {
|
| 136 |
-
return 'foo';
|
| 137 |
-
});
|
| 138 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
/**
|
| 142 |
-
* @covers Monolog\Handler\FingersCrossedHandler::isHandling
|
| 143 |
-
*/
|
| 144 |
-
public function testIsHandlingAlways()
|
| 145 |
-
{
|
| 146 |
-
$test = new TestHandler();
|
| 147 |
-
$handler = new FingersCrossedHandler($test, Logger::ERROR);
|
| 148 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
/**
|
| 152 |
-
* @covers Monolog\Handler\FingersCrossedHandler::__construct
|
| 153 |
-
* @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
|
| 154 |
-
* @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
|
| 155 |
-
*/
|
| 156 |
-
public function testErrorLevelActivationStrategy()
|
| 157 |
-
{
|
| 158 |
-
$test = new TestHandler();
|
| 159 |
-
$handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
|
| 160 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 161 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 162 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 163 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 164 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
/**
|
| 168 |
-
* @covers Monolog\Handler\FingersCrossedHandler::__construct
|
| 169 |
-
* @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
|
| 170 |
-
* @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
|
| 171 |
-
*/
|
| 172 |
-
public function testErrorLevelActivationStrategyWithPsrLevel()
|
| 173 |
-
{
|
| 174 |
-
$test = new TestHandler();
|
| 175 |
-
$handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
|
| 176 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 177 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 178 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 179 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 180 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
/**
|
| 184 |
-
* @covers Monolog\Handler\FingersCrossedHandler::__construct
|
| 185 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 186 |
-
*/
|
| 187 |
-
public function testOverrideActivationStrategy()
|
| 188 |
-
{
|
| 189 |
-
$test = new TestHandler();
|
| 190 |
-
$handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
|
| 191 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 192 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 193 |
-
$handler->activate();
|
| 194 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 195 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 196 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 197 |
-
}
|
| 198 |
-
|
| 199 |
-
/**
|
| 200 |
-
* @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
|
| 201 |
-
* @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
|
| 202 |
-
*/
|
| 203 |
-
public function testChannelLevelActivationStrategy()
|
| 204 |
-
{
|
| 205 |
-
$test = new TestHandler();
|
| 206 |
-
$handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
|
| 207 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 208 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 209 |
-
$record = $this->getRecord(Logger::DEBUG);
|
| 210 |
-
$record['channel'] = 'othertest';
|
| 211 |
-
$handler->handle($record);
|
| 212 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 213 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
/**
|
| 217 |
-
* @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
|
| 218 |
-
* @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
|
| 219 |
-
*/
|
| 220 |
-
public function testChannelLevelActivationStrategyWithPsrLevels()
|
| 221 |
-
{
|
| 222 |
-
$test = new TestHandler();
|
| 223 |
-
$handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug')));
|
| 224 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 225 |
-
$this->assertFalse($test->hasWarningRecords());
|
| 226 |
-
$record = $this->getRecord(Logger::DEBUG);
|
| 227 |
-
$record['channel'] = 'othertest';
|
| 228 |
-
$handler->handle($record);
|
| 229 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 230 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
/**
|
| 234 |
-
* @covers Monolog\Handler\FingersCrossedHandler::handle
|
| 235 |
-
* @covers Monolog\Handler\FingersCrossedHandler::activate
|
| 236 |
-
*/
|
| 237 |
-
public function testHandleUsesProcessors()
|
| 238 |
-
{
|
| 239 |
-
$test = new TestHandler();
|
| 240 |
-
$handler = new FingersCrossedHandler($test, Logger::INFO);
|
| 241 |
-
$handler->pushProcessor(function ($record) {
|
| 242 |
-
$record['extra']['foo'] = true;
|
| 243 |
-
|
| 244 |
-
return $record;
|
| 245 |
-
});
|
| 246 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 247 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 248 |
-
$records = $test->getRecords();
|
| 249 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 250 |
-
}
|
| 251 |
-
|
| 252 |
-
/**
|
| 253 |
-
* @covers Monolog\Handler\FingersCrossedHandler::close
|
| 254 |
-
*/
|
| 255 |
-
public function testPassthruOnClose()
|
| 256 |
-
{
|
| 257 |
-
$test = new TestHandler();
|
| 258 |
-
$handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO);
|
| 259 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 260 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 261 |
-
$handler->close();
|
| 262 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 263 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
/**
|
| 267 |
-
* @covers Monolog\Handler\FingersCrossedHandler::close
|
| 268 |
-
*/
|
| 269 |
-
public function testPsrLevelPassthruOnClose()
|
| 270 |
-
{
|
| 271 |
-
$test = new TestHandler();
|
| 272 |
-
$handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO);
|
| 273 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 274 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 275 |
-
$handler->close();
|
| 276 |
-
$this->assertFalse($test->hasDebugRecords());
|
| 277 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 278 |
-
}
|
| 279 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
DELETED
|
@@ -1,96 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\FirePHPHandler
|
| 19 |
-
*/
|
| 20 |
-
class FirePHPHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
public function setUp()
|
| 23 |
-
{
|
| 24 |
-
TestFirePHPHandler::reset();
|
| 25 |
-
$_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0';
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function testHeaders()
|
| 29 |
-
{
|
| 30 |
-
$handler = new TestFirePHPHandler;
|
| 31 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 32 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 33 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 34 |
-
|
| 35 |
-
$expected = array(
|
| 36 |
-
'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
|
| 37 |
-
'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
|
| 38 |
-
'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
|
| 39 |
-
'X-Wf-1-1-1-1' => 'test',
|
| 40 |
-
'X-Wf-1-1-1-2' => 'test',
|
| 41 |
-
);
|
| 42 |
-
|
| 43 |
-
$this->assertEquals($expected, $handler->getHeaders());
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function testConcurrentHandlers()
|
| 47 |
-
{
|
| 48 |
-
$handler = new TestFirePHPHandler;
|
| 49 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 50 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 51 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 52 |
-
|
| 53 |
-
$handler2 = new TestFirePHPHandler;
|
| 54 |
-
$handler2->setFormatter($this->getIdentityFormatter());
|
| 55 |
-
$handler2->handle($this->getRecord(Logger::DEBUG));
|
| 56 |
-
$handler2->handle($this->getRecord(Logger::WARNING));
|
| 57 |
-
|
| 58 |
-
$expected = array(
|
| 59 |
-
'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
|
| 60 |
-
'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
|
| 61 |
-
'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
|
| 62 |
-
'X-Wf-1-1-1-1' => 'test',
|
| 63 |
-
'X-Wf-1-1-1-2' => 'test',
|
| 64 |
-
);
|
| 65 |
-
|
| 66 |
-
$expected2 = array(
|
| 67 |
-
'X-Wf-1-1-1-3' => 'test',
|
| 68 |
-
'X-Wf-1-1-1-4' => 'test',
|
| 69 |
-
);
|
| 70 |
-
|
| 71 |
-
$this->assertEquals($expected, $handler->getHeaders());
|
| 72 |
-
$this->assertEquals($expected2, $handler2->getHeaders());
|
| 73 |
-
}
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
class TestFirePHPHandler extends FirePHPHandler
|
| 77 |
-
{
|
| 78 |
-
protected $headers = array();
|
| 79 |
-
|
| 80 |
-
public static function reset()
|
| 81 |
-
{
|
| 82 |
-
self::$initialized = false;
|
| 83 |
-
self::$sendHeaders = true;
|
| 84 |
-
self::$messageIndex = 1;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
protected function sendHeader($header, $content)
|
| 88 |
-
{
|
| 89 |
-
$this->headers[$header] = $content;
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
public function getHeaders()
|
| 93 |
-
{
|
| 94 |
-
return $this->headers;
|
| 95 |
-
}
|
| 96 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep
DELETED
|
File without changes
|
vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
DELETED
|
@@ -1,85 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Formatter\LineFormatter;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\TestCase;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* @coversDefaultClass \Monolog\Handler\FleepHookHandler
|
| 20 |
-
*/
|
| 21 |
-
class FleepHookHandlerTest extends TestCase
|
| 22 |
-
{
|
| 23 |
-
/**
|
| 24 |
-
* Default token to use in tests
|
| 25 |
-
*/
|
| 26 |
-
const TOKEN = '123abc';
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* @var FleepHookHandler
|
| 30 |
-
*/
|
| 31 |
-
private $handler;
|
| 32 |
-
|
| 33 |
-
public function setUp()
|
| 34 |
-
{
|
| 35 |
-
parent::setUp();
|
| 36 |
-
|
| 37 |
-
if (!extension_loaded('openssl')) {
|
| 38 |
-
$this->markTestSkipped('This test requires openssl extension to run');
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
// Create instances of the handler and logger for convenience
|
| 42 |
-
$this->handler = new FleepHookHandler(self::TOKEN);
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* @covers ::__construct
|
| 47 |
-
*/
|
| 48 |
-
public function testConstructorSetsExpectedDefaults()
|
| 49 |
-
{
|
| 50 |
-
$this->assertEquals(Logger::DEBUG, $this->handler->getLevel());
|
| 51 |
-
$this->assertEquals(true, $this->handler->getBubble());
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* @covers ::getDefaultFormatter
|
| 56 |
-
*/
|
| 57 |
-
public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays()
|
| 58 |
-
{
|
| 59 |
-
$record = array(
|
| 60 |
-
'message' => 'msg',
|
| 61 |
-
'context' => array(),
|
| 62 |
-
'level' => Logger::DEBUG,
|
| 63 |
-
'level_name' => Logger::getLevelName(Logger::DEBUG),
|
| 64 |
-
'channel' => 'channel',
|
| 65 |
-
'datetime' => new \DateTime(),
|
| 66 |
-
'extra' => array(),
|
| 67 |
-
);
|
| 68 |
-
|
| 69 |
-
$expectedFormatter = new LineFormatter(null, null, true, true);
|
| 70 |
-
$expected = $expectedFormatter->format($record);
|
| 71 |
-
|
| 72 |
-
$handlerFormatter = $this->handler->getFormatter();
|
| 73 |
-
$actual = $handlerFormatter->format($record);
|
| 74 |
-
|
| 75 |
-
$this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered');
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* @covers ::__construct
|
| 80 |
-
*/
|
| 81 |
-
public function testConnectionStringisConstructedCorrectly()
|
| 82 |
-
{
|
| 83 |
-
$this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString());
|
| 84 |
-
}
|
| 85 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
DELETED
|
@@ -1,88 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Formatter\FlowdockFormatter;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
use Monolog\Logger;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* @author Dominik Liebler <liebler.dominik@gmail.com>
|
| 20 |
-
* @see https://www.hipchat.com/docs/api
|
| 21 |
-
*/
|
| 22 |
-
class FlowdockHandlerTest extends TestCase
|
| 23 |
-
{
|
| 24 |
-
/**
|
| 25 |
-
* @var resource
|
| 26 |
-
*/
|
| 27 |
-
private $res;
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @var FlowdockHandler
|
| 31 |
-
*/
|
| 32 |
-
private $handler;
|
| 33 |
-
|
| 34 |
-
public function setUp()
|
| 35 |
-
{
|
| 36 |
-
if (!extension_loaded('openssl')) {
|
| 37 |
-
$this->markTestSkipped('This test requires openssl to run');
|
| 38 |
-
}
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function testWriteHeader()
|
| 42 |
-
{
|
| 43 |
-
$this->createHandler();
|
| 44 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 45 |
-
fseek($this->res, 0);
|
| 46 |
-
$content = fread($this->res, 1024);
|
| 47 |
-
|
| 48 |
-
$this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 49 |
-
|
| 50 |
-
return $content;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* @depends testWriteHeader
|
| 55 |
-
*/
|
| 56 |
-
public function testWriteContent($content)
|
| 57 |
-
{
|
| 58 |
-
$this->assertRegexp('/"source":"test_source"/', $content);
|
| 59 |
-
$this->assertRegexp('/"from_address":"source@test\.com"/', $content);
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
private function createHandler($token = 'myToken')
|
| 63 |
-
{
|
| 64 |
-
$constructorArgs = array($token, Logger::DEBUG);
|
| 65 |
-
$this->res = fopen('php://memory', 'a');
|
| 66 |
-
$this->handler = $this->getMock(
|
| 67 |
-
'\Monolog\Handler\FlowdockHandler',
|
| 68 |
-
array('fsockopen', 'streamSetTimeout', 'closeSocket'),
|
| 69 |
-
$constructorArgs
|
| 70 |
-
);
|
| 71 |
-
|
| 72 |
-
$reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
|
| 73 |
-
$reflectionProperty->setAccessible(true);
|
| 74 |
-
$reflectionProperty->setValue($this->handler, 'localhost:1234');
|
| 75 |
-
|
| 76 |
-
$this->handler->expects($this->any())
|
| 77 |
-
->method('fsockopen')
|
| 78 |
-
->will($this->returnValue($this->res));
|
| 79 |
-
$this->handler->expects($this->any())
|
| 80 |
-
->method('streamSetTimeout')
|
| 81 |
-
->will($this->returnValue(true));
|
| 82 |
-
$this->handler->expects($this->any())
|
| 83 |
-
->method('closeSocket')
|
| 84 |
-
->will($this->returnValue(true));
|
| 85 |
-
|
| 86 |
-
$this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com'));
|
| 87 |
-
}
|
| 88 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
DELETED
|
@@ -1,95 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Gelf\Message;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
use Monolog\Logger;
|
| 17 |
-
use Monolog\Formatter\GelfMessageFormatter;
|
| 18 |
-
|
| 19 |
-
class GelfHandlerLegacyTest extends TestCase
|
| 20 |
-
{
|
| 21 |
-
public function setUp()
|
| 22 |
-
{
|
| 23 |
-
if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) {
|
| 24 |
-
$this->markTestSkipped("mlehner/gelf-php not installed");
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
require_once __DIR__ . '/GelfMockMessagePublisher.php';
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* @covers Monolog\Handler\GelfHandler::__construct
|
| 32 |
-
*/
|
| 33 |
-
public function testConstruct()
|
| 34 |
-
{
|
| 35 |
-
$handler = new GelfHandler($this->getMessagePublisher());
|
| 36 |
-
$this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
protected function getHandler($messagePublisher)
|
| 40 |
-
{
|
| 41 |
-
$handler = new GelfHandler($messagePublisher);
|
| 42 |
-
|
| 43 |
-
return $handler;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
protected function getMessagePublisher()
|
| 47 |
-
{
|
| 48 |
-
return new GelfMockMessagePublisher('localhost');
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testDebug()
|
| 52 |
-
{
|
| 53 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 54 |
-
$handler = $this->getHandler($messagePublisher);
|
| 55 |
-
|
| 56 |
-
$record = $this->getRecord(Logger::DEBUG, "A test debug message");
|
| 57 |
-
$handler->handle($record);
|
| 58 |
-
|
| 59 |
-
$this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
|
| 60 |
-
$this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
|
| 61 |
-
$this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
|
| 62 |
-
$this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
public function testWarning()
|
| 66 |
-
{
|
| 67 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 68 |
-
$handler = $this->getHandler($messagePublisher);
|
| 69 |
-
|
| 70 |
-
$record = $this->getRecord(Logger::WARNING, "A test warning message");
|
| 71 |
-
$handler->handle($record);
|
| 72 |
-
|
| 73 |
-
$this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
|
| 74 |
-
$this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
|
| 75 |
-
$this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
|
| 76 |
-
$this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
public function testInjectedGelfMessageFormatter()
|
| 80 |
-
{
|
| 81 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 82 |
-
$handler = $this->getHandler($messagePublisher);
|
| 83 |
-
|
| 84 |
-
$handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
|
| 85 |
-
|
| 86 |
-
$record = $this->getRecord(Logger::WARNING, "A test warning message");
|
| 87 |
-
$record['extra']['blarg'] = 'yep';
|
| 88 |
-
$record['context']['from'] = 'logger';
|
| 89 |
-
$handler->handle($record);
|
| 90 |
-
|
| 91 |
-
$this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
|
| 92 |
-
$this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
|
| 93 |
-
$this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
|
| 94 |
-
}
|
| 95 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
DELETED
|
@@ -1,117 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Gelf\Message;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
use Monolog\Logger;
|
| 17 |
-
use Monolog\Formatter\GelfMessageFormatter;
|
| 18 |
-
|
| 19 |
-
class GelfHandlerTest extends TestCase
|
| 20 |
-
{
|
| 21 |
-
public function setUp()
|
| 22 |
-
{
|
| 23 |
-
if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) {
|
| 24 |
-
$this->markTestSkipped("graylog2/gelf-php not installed");
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* @covers Monolog\Handler\GelfHandler::__construct
|
| 30 |
-
*/
|
| 31 |
-
public function testConstruct()
|
| 32 |
-
{
|
| 33 |
-
$handler = new GelfHandler($this->getMessagePublisher());
|
| 34 |
-
$this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
protected function getHandler($messagePublisher)
|
| 38 |
-
{
|
| 39 |
-
$handler = new GelfHandler($messagePublisher);
|
| 40 |
-
|
| 41 |
-
return $handler;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
protected function getMessagePublisher()
|
| 45 |
-
{
|
| 46 |
-
return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false);
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function testDebug()
|
| 50 |
-
{
|
| 51 |
-
$record = $this->getRecord(Logger::DEBUG, "A test debug message");
|
| 52 |
-
$expectedMessage = new Message();
|
| 53 |
-
$expectedMessage
|
| 54 |
-
->setLevel(7)
|
| 55 |
-
->setFacility("test")
|
| 56 |
-
->setShortMessage($record['message'])
|
| 57 |
-
->setTimestamp($record['datetime'])
|
| 58 |
-
;
|
| 59 |
-
|
| 60 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 61 |
-
$messagePublisher->expects($this->once())
|
| 62 |
-
->method('publish')
|
| 63 |
-
->with($expectedMessage);
|
| 64 |
-
|
| 65 |
-
$handler = $this->getHandler($messagePublisher);
|
| 66 |
-
|
| 67 |
-
$handler->handle($record);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
public function testWarning()
|
| 71 |
-
{
|
| 72 |
-
$record = $this->getRecord(Logger::WARNING, "A test warning message");
|
| 73 |
-
$expectedMessage = new Message();
|
| 74 |
-
$expectedMessage
|
| 75 |
-
->setLevel(4)
|
| 76 |
-
->setFacility("test")
|
| 77 |
-
->setShortMessage($record['message'])
|
| 78 |
-
->setTimestamp($record['datetime'])
|
| 79 |
-
;
|
| 80 |
-
|
| 81 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 82 |
-
$messagePublisher->expects($this->once())
|
| 83 |
-
->method('publish')
|
| 84 |
-
->with($expectedMessage);
|
| 85 |
-
|
| 86 |
-
$handler = $this->getHandler($messagePublisher);
|
| 87 |
-
|
| 88 |
-
$handler->handle($record);
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
public function testInjectedGelfMessageFormatter()
|
| 92 |
-
{
|
| 93 |
-
$record = $this->getRecord(Logger::WARNING, "A test warning message");
|
| 94 |
-
$record['extra']['blarg'] = 'yep';
|
| 95 |
-
$record['context']['from'] = 'logger';
|
| 96 |
-
|
| 97 |
-
$expectedMessage = new Message();
|
| 98 |
-
$expectedMessage
|
| 99 |
-
->setLevel(4)
|
| 100 |
-
->setFacility("test")
|
| 101 |
-
->setHost("mysystem")
|
| 102 |
-
->setShortMessage($record['message'])
|
| 103 |
-
->setTimestamp($record['datetime'])
|
| 104 |
-
->setAdditional("EXTblarg", 'yep')
|
| 105 |
-
->setAdditional("CTXfrom", 'logger')
|
| 106 |
-
;
|
| 107 |
-
|
| 108 |
-
$messagePublisher = $this->getMessagePublisher();
|
| 109 |
-
$messagePublisher->expects($this->once())
|
| 110 |
-
->method('publish')
|
| 111 |
-
->with($expectedMessage);
|
| 112 |
-
|
| 113 |
-
$handler = $this->getHandler($messagePublisher);
|
| 114 |
-
$handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
|
| 115 |
-
$handler->handle($record);
|
| 116 |
-
}
|
| 117 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Gelf\MessagePublisher;
|
| 15 |
-
use Gelf\Message;
|
| 16 |
-
|
| 17 |
-
class GelfMockMessagePublisher extends MessagePublisher
|
| 18 |
-
{
|
| 19 |
-
public function publish(Message $message)
|
| 20 |
-
{
|
| 21 |
-
$this->lastMessage = $message;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public $lastMessage = null;
|
| 25 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
DELETED
|
@@ -1,112 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class GroupHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\GroupHandler::__construct
|
| 21 |
-
* @expectedException InvalidArgumentException
|
| 22 |
-
*/
|
| 23 |
-
public function testConstructorOnlyTakesHandler()
|
| 24 |
-
{
|
| 25 |
-
new GroupHandler(array(new TestHandler(), "foo"));
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* @covers Monolog\Handler\GroupHandler::__construct
|
| 30 |
-
* @covers Monolog\Handler\GroupHandler::handle
|
| 31 |
-
*/
|
| 32 |
-
public function testHandle()
|
| 33 |
-
{
|
| 34 |
-
$testHandlers = array(new TestHandler(), new TestHandler());
|
| 35 |
-
$handler = new GroupHandler($testHandlers);
|
| 36 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 37 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 38 |
-
foreach ($testHandlers as $test) {
|
| 39 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 40 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 41 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 42 |
-
}
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* @covers Monolog\Handler\GroupHandler::handleBatch
|
| 47 |
-
*/
|
| 48 |
-
public function testHandleBatch()
|
| 49 |
-
{
|
| 50 |
-
$testHandlers = array(new TestHandler(), new TestHandler());
|
| 51 |
-
$handler = new GroupHandler($testHandlers);
|
| 52 |
-
$handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
|
| 53 |
-
foreach ($testHandlers as $test) {
|
| 54 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 55 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 56 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 57 |
-
}
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* @covers Monolog\Handler\GroupHandler::isHandling
|
| 62 |
-
*/
|
| 63 |
-
public function testIsHandling()
|
| 64 |
-
{
|
| 65 |
-
$testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
|
| 66 |
-
$handler = new GroupHandler($testHandlers);
|
| 67 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
|
| 68 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
|
| 69 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/**
|
| 73 |
-
* @covers Monolog\Handler\GroupHandler::handle
|
| 74 |
-
*/
|
| 75 |
-
public function testHandleUsesProcessors()
|
| 76 |
-
{
|
| 77 |
-
$test = new TestHandler();
|
| 78 |
-
$handler = new GroupHandler(array($test));
|
| 79 |
-
$handler->pushProcessor(function ($record) {
|
| 80 |
-
$record['extra']['foo'] = true;
|
| 81 |
-
|
| 82 |
-
return $record;
|
| 83 |
-
});
|
| 84 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 85 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 86 |
-
$records = $test->getRecords();
|
| 87 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
* @covers Monolog\Handler\GroupHandler::handle
|
| 92 |
-
*/
|
| 93 |
-
public function testHandleBatchUsesProcessors()
|
| 94 |
-
{
|
| 95 |
-
$testHandlers = array(new TestHandler(), new TestHandler());
|
| 96 |
-
$handler = new GroupHandler($testHandlers);
|
| 97 |
-
$handler->pushProcessor(function ($record) {
|
| 98 |
-
$record['extra']['foo'] = true;
|
| 99 |
-
|
| 100 |
-
return $record;
|
| 101 |
-
});
|
| 102 |
-
$handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
|
| 103 |
-
foreach ($testHandlers as $test) {
|
| 104 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 105 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 106 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 107 |
-
$records = $test->getRecords();
|
| 108 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 109 |
-
$this->assertTrue($records[1]['extra']['foo']);
|
| 110 |
-
}
|
| 111 |
-
}
|
| 112 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php
DELETED
|
@@ -1,130 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* @author Alexey Karapetov <alexey@karapetov.com>
|
| 18 |
-
*/
|
| 19 |
-
class HandlerWrapperTest extends TestCase
|
| 20 |
-
{
|
| 21 |
-
/**
|
| 22 |
-
* @var HandlerWrapper
|
| 23 |
-
*/
|
| 24 |
-
private $wrapper;
|
| 25 |
-
|
| 26 |
-
private $handler;
|
| 27 |
-
|
| 28 |
-
public function setUp()
|
| 29 |
-
{
|
| 30 |
-
parent::setUp();
|
| 31 |
-
$this->handler = $this->getMock('Monolog\\Handler\\HandlerInterface');
|
| 32 |
-
$this->wrapper = new HandlerWrapper($this->handler);
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
/**
|
| 36 |
-
* @return array
|
| 37 |
-
*/
|
| 38 |
-
public function trueFalseDataProvider()
|
| 39 |
-
{
|
| 40 |
-
return array(
|
| 41 |
-
array(true),
|
| 42 |
-
array(false),
|
| 43 |
-
);
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* @param $result
|
| 48 |
-
* @dataProvider trueFalseDataProvider
|
| 49 |
-
*/
|
| 50 |
-
public function testIsHandling($result)
|
| 51 |
-
{
|
| 52 |
-
$record = $this->getRecord();
|
| 53 |
-
$this->handler->expects($this->once())
|
| 54 |
-
->method('isHandling')
|
| 55 |
-
->with($record)
|
| 56 |
-
->willReturn($result);
|
| 57 |
-
|
| 58 |
-
$this->assertEquals($result, $this->wrapper->isHandling($record));
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* @param $result
|
| 63 |
-
* @dataProvider trueFalseDataProvider
|
| 64 |
-
*/
|
| 65 |
-
public function testHandle($result)
|
| 66 |
-
{
|
| 67 |
-
$record = $this->getRecord();
|
| 68 |
-
$this->handler->expects($this->once())
|
| 69 |
-
->method('handle')
|
| 70 |
-
->with($record)
|
| 71 |
-
->willReturn($result);
|
| 72 |
-
|
| 73 |
-
$this->assertEquals($result, $this->wrapper->handle($record));
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* @param $result
|
| 78 |
-
* @dataProvider trueFalseDataProvider
|
| 79 |
-
*/
|
| 80 |
-
public function testHandleBatch($result)
|
| 81 |
-
{
|
| 82 |
-
$records = $this->getMultipleRecords();
|
| 83 |
-
$this->handler->expects($this->once())
|
| 84 |
-
->method('handleBatch')
|
| 85 |
-
->with($records)
|
| 86 |
-
->willReturn($result);
|
| 87 |
-
|
| 88 |
-
$this->assertEquals($result, $this->wrapper->handleBatch($records));
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
public function testPushProcessor()
|
| 92 |
-
{
|
| 93 |
-
$processor = function () {};
|
| 94 |
-
$this->handler->expects($this->once())
|
| 95 |
-
->method('pushProcessor')
|
| 96 |
-
->with($processor);
|
| 97 |
-
|
| 98 |
-
$this->assertEquals($this->wrapper, $this->wrapper->pushProcessor($processor));
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
public function testPopProcessor()
|
| 102 |
-
{
|
| 103 |
-
$processor = function () {};
|
| 104 |
-
$this->handler->expects($this->once())
|
| 105 |
-
->method('popProcessor')
|
| 106 |
-
->willReturn($processor);
|
| 107 |
-
|
| 108 |
-
$this->assertEquals($processor, $this->wrapper->popProcessor());
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
public function testSetFormatter()
|
| 112 |
-
{
|
| 113 |
-
$formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 114 |
-
$this->handler->expects($this->once())
|
| 115 |
-
->method('setFormatter')
|
| 116 |
-
->with($formatter);
|
| 117 |
-
|
| 118 |
-
$this->assertEquals($this->wrapper, $this->wrapper->setFormatter($formatter));
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
public function testGetFormatter()
|
| 122 |
-
{
|
| 123 |
-
$formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 124 |
-
$this->handler->expects($this->once())
|
| 125 |
-
->method('getFormatter')
|
| 126 |
-
->willReturn($formatter);
|
| 127 |
-
|
| 128 |
-
$this->assertEquals($formatter, $this->wrapper->getFormatter());
|
| 129 |
-
}
|
| 130 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
DELETED
|
@@ -1,279 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @author Rafael Dohms <rafael@doh.ms>
|
| 19 |
-
* @see https://www.hipchat.com/docs/api
|
| 20 |
-
*/
|
| 21 |
-
class HipChatHandlerTest extends TestCase
|
| 22 |
-
{
|
| 23 |
-
private $res;
|
| 24 |
-
/** @var HipChatHandler */
|
| 25 |
-
private $handler;
|
| 26 |
-
|
| 27 |
-
public function testWriteHeader()
|
| 28 |
-
{
|
| 29 |
-
$this->createHandler();
|
| 30 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 31 |
-
fseek($this->res, 0);
|
| 32 |
-
$content = fread($this->res, 1024);
|
| 33 |
-
|
| 34 |
-
$this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 35 |
-
|
| 36 |
-
return $content;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
public function testWriteCustomHostHeader()
|
| 40 |
-
{
|
| 41 |
-
$this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar');
|
| 42 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 43 |
-
fseek($this->res, 0);
|
| 44 |
-
$content = fread($this->res, 1024);
|
| 45 |
-
|
| 46 |
-
$this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 47 |
-
|
| 48 |
-
return $content;
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testWriteV2()
|
| 52 |
-
{
|
| 53 |
-
$this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2');
|
| 54 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 55 |
-
fseek($this->res, 0);
|
| 56 |
-
$content = fread($this->res, 1024);
|
| 57 |
-
|
| 58 |
-
$this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 59 |
-
|
| 60 |
-
return $content;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
public function testWriteV2Notify()
|
| 64 |
-
{
|
| 65 |
-
$this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2');
|
| 66 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 67 |
-
fseek($this->res, 0);
|
| 68 |
-
$content = fread($this->res, 1024);
|
| 69 |
-
|
| 70 |
-
$this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 71 |
-
|
| 72 |
-
return $content;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
public function testRoomSpaces()
|
| 76 |
-
{
|
| 77 |
-
$this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2');
|
| 78 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 79 |
-
fseek($this->res, 0);
|
| 80 |
-
$content = fread($this->res, 1024);
|
| 81 |
-
|
| 82 |
-
$this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 83 |
-
|
| 84 |
-
return $content;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* @depends testWriteHeader
|
| 89 |
-
*/
|
| 90 |
-
public function testWriteContent($content)
|
| 91 |
-
{
|
| 92 |
-
$this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
public function testWriteContentV1WithoutName()
|
| 96 |
-
{
|
| 97 |
-
$this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v1');
|
| 98 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 99 |
-
fseek($this->res, 0);
|
| 100 |
-
$content = fread($this->res, 1024);
|
| 101 |
-
|
| 102 |
-
$this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=$/', $content);
|
| 103 |
-
|
| 104 |
-
return $content;
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
/**
|
| 108 |
-
* @depends testWriteCustomHostHeader
|
| 109 |
-
*/
|
| 110 |
-
public function testWriteContentNotify($content)
|
| 111 |
-
{
|
| 112 |
-
$this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
/**
|
| 116 |
-
* @depends testWriteV2
|
| 117 |
-
*/
|
| 118 |
-
public function testWriteContentV2($content)
|
| 119 |
-
{
|
| 120 |
-
$this->assertRegexp('/notify=false&message=test1&message_format=text&color=red&from=Monolog$/', $content);
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* @depends testWriteV2Notify
|
| 125 |
-
*/
|
| 126 |
-
public function testWriteContentV2Notify($content)
|
| 127 |
-
{
|
| 128 |
-
$this->assertRegexp('/notify=true&message=test1&message_format=text&color=red&from=Monolog$/', $content);
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
public function testWriteContentV2WithoutName()
|
| 132 |
-
{
|
| 133 |
-
$this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v2');
|
| 134 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 135 |
-
fseek($this->res, 0);
|
| 136 |
-
$content = fread($this->res, 1024);
|
| 137 |
-
|
| 138 |
-
$this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content);
|
| 139 |
-
|
| 140 |
-
return $content;
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
public function testWriteWithComplexMessage()
|
| 144 |
-
{
|
| 145 |
-
$this->createHandler();
|
| 146 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
|
| 147 |
-
fseek($this->res, 0);
|
| 148 |
-
$content = fread($this->res, 1024);
|
| 149 |
-
|
| 150 |
-
$this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
public function testWriteTruncatesLongMessage()
|
| 154 |
-
{
|
| 155 |
-
$this->createHandler();
|
| 156 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, str_repeat('abcde', 2000)));
|
| 157 |
-
fseek($this->res, 0);
|
| 158 |
-
$content = fread($this->res, 12000);
|
| 159 |
-
|
| 160 |
-
$this->assertRegexp('/message='.str_repeat('abcde', 1900).'\+%5Btruncated%5D/', $content);
|
| 161 |
-
}
|
| 162 |
-
|
| 163 |
-
/**
|
| 164 |
-
* @dataProvider provideLevelColors
|
| 165 |
-
*/
|
| 166 |
-
public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
|
| 167 |
-
{
|
| 168 |
-
$this->createHandler();
|
| 169 |
-
$this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
|
| 170 |
-
fseek($this->res, 0);
|
| 171 |
-
$content = fread($this->res, 1024);
|
| 172 |
-
|
| 173 |
-
$this->assertRegexp('/color='.$expectedColor.'/', $content);
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
public function provideLevelColors()
|
| 177 |
-
{
|
| 178 |
-
return array(
|
| 179 |
-
array(Logger::DEBUG, 'gray'),
|
| 180 |
-
array(Logger::INFO, 'green'),
|
| 181 |
-
array(Logger::WARNING, 'yellow'),
|
| 182 |
-
array(Logger::ERROR, 'red'),
|
| 183 |
-
array(Logger::CRITICAL, 'red'),
|
| 184 |
-
array(Logger::ALERT, 'red'),
|
| 185 |
-
array(Logger::EMERGENCY,'red'),
|
| 186 |
-
array(Logger::NOTICE, 'green'),
|
| 187 |
-
);
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* @dataProvider provideBatchRecords
|
| 192 |
-
*/
|
| 193 |
-
public function testHandleBatch($records, $expectedColor)
|
| 194 |
-
{
|
| 195 |
-
$this->createHandler();
|
| 196 |
-
|
| 197 |
-
$this->handler->handleBatch($records);
|
| 198 |
-
|
| 199 |
-
fseek($this->res, 0);
|
| 200 |
-
$content = fread($this->res, 1024);
|
| 201 |
-
|
| 202 |
-
$this->assertRegexp('/color='.$expectedColor.'/', $content);
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
public function provideBatchRecords()
|
| 206 |
-
{
|
| 207 |
-
return array(
|
| 208 |
-
array(
|
| 209 |
-
array(
|
| 210 |
-
array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
|
| 211 |
-
array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
|
| 212 |
-
array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()),
|
| 213 |
-
),
|
| 214 |
-
'red',
|
| 215 |
-
),
|
| 216 |
-
array(
|
| 217 |
-
array(
|
| 218 |
-
array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
|
| 219 |
-
array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
|
| 220 |
-
),
|
| 221 |
-
'yellow',
|
| 222 |
-
),
|
| 223 |
-
array(
|
| 224 |
-
array(
|
| 225 |
-
array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
|
| 226 |
-
array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
|
| 227 |
-
),
|
| 228 |
-
'green',
|
| 229 |
-
),
|
| 230 |
-
array(
|
| 231 |
-
array(
|
| 232 |
-
array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
|
| 233 |
-
),
|
| 234 |
-
'gray',
|
| 235 |
-
),
|
| 236 |
-
);
|
| 237 |
-
}
|
| 238 |
-
|
| 239 |
-
private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1')
|
| 240 |
-
{
|
| 241 |
-
$constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version);
|
| 242 |
-
$this->res = fopen('php://memory', 'a');
|
| 243 |
-
$this->handler = $this->getMock(
|
| 244 |
-
'\Monolog\Handler\HipChatHandler',
|
| 245 |
-
array('fsockopen', 'streamSetTimeout', 'closeSocket'),
|
| 246 |
-
$constructorArgs
|
| 247 |
-
);
|
| 248 |
-
|
| 249 |
-
$reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
|
| 250 |
-
$reflectionProperty->setAccessible(true);
|
| 251 |
-
$reflectionProperty->setValue($this->handler, 'localhost:1234');
|
| 252 |
-
|
| 253 |
-
$this->handler->expects($this->any())
|
| 254 |
-
->method('fsockopen')
|
| 255 |
-
->will($this->returnValue($this->res));
|
| 256 |
-
$this->handler->expects($this->any())
|
| 257 |
-
->method('streamSetTimeout')
|
| 258 |
-
->will($this->returnValue(true));
|
| 259 |
-
$this->handler->expects($this->any())
|
| 260 |
-
->method('closeSocket')
|
| 261 |
-
->will($this->returnValue(true));
|
| 262 |
-
|
| 263 |
-
$this->handler->setFormatter($this->getIdentityFormatter());
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
/**
|
| 267 |
-
* @expectedException InvalidArgumentException
|
| 268 |
-
*/
|
| 269 |
-
public function testCreateWithTooLongName()
|
| 270 |
-
{
|
| 271 |
-
$hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere');
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
public function testCreateWithTooLongNameV2()
|
| 275 |
-
{
|
| 276 |
-
// creating a handler with too long of a name but using the v2 api doesn't matter.
|
| 277 |
-
$hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2');
|
| 278 |
-
}
|
| 279 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
DELETED
|
@@ -1,84 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @author Robert Kaufmann III <rok3@rok3.me>
|
| 19 |
-
*/
|
| 20 |
-
class LogEntriesHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
/**
|
| 23 |
-
* @var resource
|
| 24 |
-
*/
|
| 25 |
-
private $res;
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* @var LogEntriesHandler
|
| 29 |
-
*/
|
| 30 |
-
private $handler;
|
| 31 |
-
|
| 32 |
-
public function testWriteContent()
|
| 33 |
-
{
|
| 34 |
-
$this->createHandler();
|
| 35 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
|
| 36 |
-
|
| 37 |
-
fseek($this->res, 0);
|
| 38 |
-
$content = fread($this->res, 1024);
|
| 39 |
-
|
| 40 |
-
$this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
public function testWriteBatchContent()
|
| 44 |
-
{
|
| 45 |
-
$records = array(
|
| 46 |
-
$this->getRecord(),
|
| 47 |
-
$this->getRecord(),
|
| 48 |
-
$this->getRecord(),
|
| 49 |
-
);
|
| 50 |
-
$this->createHandler();
|
| 51 |
-
$this->handler->handleBatch($records);
|
| 52 |
-
|
| 53 |
-
fseek($this->res, 0);
|
| 54 |
-
$content = fread($this->res, 1024);
|
| 55 |
-
|
| 56 |
-
$this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
private function createHandler()
|
| 60 |
-
{
|
| 61 |
-
$useSSL = extension_loaded('openssl');
|
| 62 |
-
$args = array('testToken', $useSSL, Logger::DEBUG, true);
|
| 63 |
-
$this->res = fopen('php://memory', 'a');
|
| 64 |
-
$this->handler = $this->getMock(
|
| 65 |
-
'\Monolog\Handler\LogEntriesHandler',
|
| 66 |
-
array('fsockopen', 'streamSetTimeout', 'closeSocket'),
|
| 67 |
-
$args
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
$reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
|
| 71 |
-
$reflectionProperty->setAccessible(true);
|
| 72 |
-
$reflectionProperty->setValue($this->handler, 'localhost:1234');
|
| 73 |
-
|
| 74 |
-
$this->handler->expects($this->any())
|
| 75 |
-
->method('fsockopen')
|
| 76 |
-
->will($this->returnValue($this->res));
|
| 77 |
-
$this->handler->expects($this->any())
|
| 78 |
-
->method('streamSetTimeout')
|
| 79 |
-
->will($this->returnValue(true));
|
| 80 |
-
$this->handler->expects($this->any())
|
| 81 |
-
->method('closeSocket')
|
| 82 |
-
->will($this->returnValue(true));
|
| 83 |
-
}
|
| 84 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
DELETED
|
@@ -1,75 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class MailHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\MailHandler::handleBatch
|
| 21 |
-
*/
|
| 22 |
-
public function testHandleBatch()
|
| 23 |
-
{
|
| 24 |
-
$formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 25 |
-
$formatter->expects($this->once())
|
| 26 |
-
->method('formatBatch'); // Each record is formatted
|
| 27 |
-
|
| 28 |
-
$handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
|
| 29 |
-
$handler->expects($this->once())
|
| 30 |
-
->method('send');
|
| 31 |
-
$handler->expects($this->never())
|
| 32 |
-
->method('write'); // write is for individual records
|
| 33 |
-
|
| 34 |
-
$handler->setFormatter($formatter);
|
| 35 |
-
|
| 36 |
-
$handler->handleBatch($this->getMultipleRecords());
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* @covers Monolog\Handler\MailHandler::handleBatch
|
| 41 |
-
*/
|
| 42 |
-
public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
|
| 43 |
-
{
|
| 44 |
-
$records = array(
|
| 45 |
-
$this->getRecord(Logger::DEBUG, 'debug message 1'),
|
| 46 |
-
$this->getRecord(Logger::DEBUG, 'debug message 2'),
|
| 47 |
-
$this->getRecord(Logger::INFO, 'information'),
|
| 48 |
-
);
|
| 49 |
-
|
| 50 |
-
$handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
|
| 51 |
-
$handler->expects($this->never())
|
| 52 |
-
->method('send');
|
| 53 |
-
$handler->setLevel(Logger::ERROR);
|
| 54 |
-
|
| 55 |
-
$handler->handleBatch($records);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* @covers Monolog\Handler\MailHandler::write
|
| 60 |
-
*/
|
| 61 |
-
public function testHandle()
|
| 62 |
-
{
|
| 63 |
-
$handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
|
| 64 |
-
|
| 65 |
-
$record = $this->getRecord();
|
| 66 |
-
$records = array($record);
|
| 67 |
-
$records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
|
| 68 |
-
|
| 69 |
-
$handler->expects($this->once())
|
| 70 |
-
->method('send')
|
| 71 |
-
->with($records[0]['formatted'], $records);
|
| 72 |
-
|
| 73 |
-
$handler->handle($record);
|
| 74 |
-
}
|
| 75 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
DELETED
|
@@ -1,27 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Raven_Client;
|
| 15 |
-
|
| 16 |
-
class MockRavenClient extends Raven_Client
|
| 17 |
-
{
|
| 18 |
-
public function capture($data, $stack, $vars = null)
|
| 19 |
-
{
|
| 20 |
-
$data = array_merge($this->get_user_data(), $data);
|
| 21 |
-
$this->lastData = $data;
|
| 22 |
-
$this->lastStack = $stack;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
public $lastData;
|
| 26 |
-
public $lastStack;
|
| 27 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
DELETED
|
@@ -1,65 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class MongoDBHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @expectedException InvalidArgumentException
|
| 21 |
-
*/
|
| 22 |
-
public function testConstructorShouldThrowExceptionForInvalidMongo()
|
| 23 |
-
{
|
| 24 |
-
new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function testHandle()
|
| 28 |
-
{
|
| 29 |
-
$mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false);
|
| 30 |
-
$collection = $this->getMock('stdClass', array('save'));
|
| 31 |
-
|
| 32 |
-
$mongo->expects($this->once())
|
| 33 |
-
->method('selectCollection')
|
| 34 |
-
->with('DB', 'Collection')
|
| 35 |
-
->will($this->returnValue($collection));
|
| 36 |
-
|
| 37 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 38 |
-
|
| 39 |
-
$expected = array(
|
| 40 |
-
'message' => 'test',
|
| 41 |
-
'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
|
| 42 |
-
'level' => Logger::WARNING,
|
| 43 |
-
'level_name' => 'WARNING',
|
| 44 |
-
'channel' => 'test',
|
| 45 |
-
'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
|
| 46 |
-
'extra' => array(),
|
| 47 |
-
);
|
| 48 |
-
|
| 49 |
-
$collection->expects($this->once())
|
| 50 |
-
->method('save')
|
| 51 |
-
->with($expected);
|
| 52 |
-
|
| 53 |
-
$handler = new MongoDBHandler($mongo, 'DB', 'Collection');
|
| 54 |
-
$handler->handle($record);
|
| 55 |
-
}
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
if (!class_exists('Mongo')) {
|
| 59 |
-
class Mongo
|
| 60 |
-
{
|
| 61 |
-
public function selectCollection()
|
| 62 |
-
{
|
| 63 |
-
}
|
| 64 |
-
}
|
| 65 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
DELETED
|
@@ -1,111 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use InvalidArgumentException;
|
| 17 |
-
|
| 18 |
-
function mail($to, $subject, $message, $additional_headers = null, $additional_parameters = null)
|
| 19 |
-
{
|
| 20 |
-
$GLOBALS['mail'][] = func_get_args();
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
class NativeMailerHandlerTest extends TestCase
|
| 24 |
-
{
|
| 25 |
-
protected function setUp()
|
| 26 |
-
{
|
| 27 |
-
$GLOBALS['mail'] = array();
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* @expectedException InvalidArgumentException
|
| 32 |
-
*/
|
| 33 |
-
public function testConstructorHeaderInjection()
|
| 34 |
-
{
|
| 35 |
-
$mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* @expectedException InvalidArgumentException
|
| 40 |
-
*/
|
| 41 |
-
public function testSetterHeaderInjection()
|
| 42 |
-
{
|
| 43 |
-
$mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
|
| 44 |
-
$mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* @expectedException InvalidArgumentException
|
| 49 |
-
*/
|
| 50 |
-
public function testSetterArrayHeaderInjection()
|
| 51 |
-
{
|
| 52 |
-
$mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
|
| 53 |
-
$mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* @expectedException InvalidArgumentException
|
| 58 |
-
*/
|
| 59 |
-
public function testSetterContentTypeInjection()
|
| 60 |
-
{
|
| 61 |
-
$mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
|
| 62 |
-
$mailer->setContentType("text/html\r\nFrom: faked@attacker.org");
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* @expectedException InvalidArgumentException
|
| 67 |
-
*/
|
| 68 |
-
public function testSetterEncodingInjection()
|
| 69 |
-
{
|
| 70 |
-
$mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
|
| 71 |
-
$mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org");
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
public function testSend()
|
| 75 |
-
{
|
| 76 |
-
$to = 'spammer@example.org';
|
| 77 |
-
$subject = 'dear victim';
|
| 78 |
-
$from = 'receiver@example.org';
|
| 79 |
-
|
| 80 |
-
$mailer = new NativeMailerHandler($to, $subject, $from);
|
| 81 |
-
$mailer->handleBatch(array());
|
| 82 |
-
|
| 83 |
-
// batch is empty, nothing sent
|
| 84 |
-
$this->assertEmpty($GLOBALS['mail']);
|
| 85 |
-
|
| 86 |
-
// non-empty batch
|
| 87 |
-
$mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
|
| 88 |
-
$this->assertNotEmpty($GLOBALS['mail']);
|
| 89 |
-
$this->assertInternalType('array', $GLOBALS['mail']);
|
| 90 |
-
$this->assertArrayHasKey('0', $GLOBALS['mail']);
|
| 91 |
-
$params = $GLOBALS['mail'][0];
|
| 92 |
-
$this->assertCount(5, $params);
|
| 93 |
-
$this->assertSame($to, $params[0]);
|
| 94 |
-
$this->assertSame($subject, $params[1]);
|
| 95 |
-
$this->assertStringEndsWith(" test.ERROR: Foo Bar Baz [] []\n", $params[2]);
|
| 96 |
-
$this->assertSame("From: $from\r\nContent-type: text/plain; charset=utf-8\r\n", $params[3]);
|
| 97 |
-
$this->assertSame('', $params[4]);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
public function testMessageSubjectFormatting()
|
| 101 |
-
{
|
| 102 |
-
$mailer = new NativeMailerHandler('to@example.org', 'Alert: %level_name% %message%', 'from@example.org');
|
| 103 |
-
$mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
|
| 104 |
-
$this->assertNotEmpty($GLOBALS['mail']);
|
| 105 |
-
$this->assertInternalType('array', $GLOBALS['mail']);
|
| 106 |
-
$this->assertArrayHasKey('0', $GLOBALS['mail']);
|
| 107 |
-
$params = $GLOBALS['mail'][0];
|
| 108 |
-
$this->assertCount(5, $params);
|
| 109 |
-
$this->assertSame('Alert: ERROR Foo Bar Baz', $params[1]);
|
| 110 |
-
}
|
| 111 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
DELETED
|
@@ -1,200 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Formatter\LineFormatter;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
use Monolog\Logger;
|
| 17 |
-
|
| 18 |
-
class NewRelicHandlerTest extends TestCase
|
| 19 |
-
{
|
| 20 |
-
public static $appname;
|
| 21 |
-
public static $customParameters;
|
| 22 |
-
public static $transactionName;
|
| 23 |
-
|
| 24 |
-
public function setUp()
|
| 25 |
-
{
|
| 26 |
-
self::$appname = null;
|
| 27 |
-
self::$customParameters = array();
|
| 28 |
-
self::$transactionName = null;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* @expectedException Monolog\Handler\MissingExtensionException
|
| 33 |
-
*/
|
| 34 |
-
public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
|
| 35 |
-
{
|
| 36 |
-
$handler = new StubNewRelicHandlerWithoutExtension();
|
| 37 |
-
$handler->handle($this->getRecord(Logger::ERROR));
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function testThehandlerCanHandleTheRecord()
|
| 41 |
-
{
|
| 42 |
-
$handler = new StubNewRelicHandler();
|
| 43 |
-
$handler->handle($this->getRecord(Logger::ERROR));
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function testThehandlerCanAddContextParamsToTheNewRelicTrace()
|
| 47 |
-
{
|
| 48 |
-
$handler = new StubNewRelicHandler();
|
| 49 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
|
| 50 |
-
$this->assertEquals(array('context_a' => 'b'), self::$customParameters);
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace()
|
| 54 |
-
{
|
| 55 |
-
$handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
|
| 56 |
-
$handler->handle($this->getRecord(
|
| 57 |
-
Logger::ERROR,
|
| 58 |
-
'log message',
|
| 59 |
-
array('a' => array('key1' => 'value1', 'key2' => 'value2'))
|
| 60 |
-
));
|
| 61 |
-
$this->assertEquals(
|
| 62 |
-
array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'),
|
| 63 |
-
self::$customParameters
|
| 64 |
-
);
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
public function testThehandlerCanAddExtraParamsToTheNewRelicTrace()
|
| 68 |
-
{
|
| 69 |
-
$record = $this->getRecord(Logger::ERROR, 'log message');
|
| 70 |
-
$record['extra'] = array('c' => 'd');
|
| 71 |
-
|
| 72 |
-
$handler = new StubNewRelicHandler();
|
| 73 |
-
$handler->handle($record);
|
| 74 |
-
|
| 75 |
-
$this->assertEquals(array('extra_c' => 'd'), self::$customParameters);
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace()
|
| 79 |
-
{
|
| 80 |
-
$record = $this->getRecord(Logger::ERROR, 'log message');
|
| 81 |
-
$record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2'));
|
| 82 |
-
|
| 83 |
-
$handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
|
| 84 |
-
$handler->handle($record);
|
| 85 |
-
|
| 86 |
-
$this->assertEquals(
|
| 87 |
-
array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'),
|
| 88 |
-
self::$customParameters
|
| 89 |
-
);
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace()
|
| 93 |
-
{
|
| 94 |
-
$record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'));
|
| 95 |
-
$record['extra'] = array('c' => 'd');
|
| 96 |
-
|
| 97 |
-
$handler = new StubNewRelicHandler();
|
| 98 |
-
$handler->handle($record);
|
| 99 |
-
|
| 100 |
-
$expected = array(
|
| 101 |
-
'context_a' => 'b',
|
| 102 |
-
'extra_c' => 'd',
|
| 103 |
-
);
|
| 104 |
-
|
| 105 |
-
$this->assertEquals($expected, self::$customParameters);
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
public function testThehandlerCanHandleTheRecordsFormattedUsingTheLineFormatter()
|
| 109 |
-
{
|
| 110 |
-
$handler = new StubNewRelicHandler();
|
| 111 |
-
$handler->setFormatter(new LineFormatter());
|
| 112 |
-
$handler->handle($this->getRecord(Logger::ERROR));
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
public function testTheAppNameIsNullByDefault()
|
| 116 |
-
{
|
| 117 |
-
$handler = new StubNewRelicHandler();
|
| 118 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message'));
|
| 119 |
-
|
| 120 |
-
$this->assertEquals(null, self::$appname);
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
public function testTheAppNameCanBeInjectedFromtheConstructor()
|
| 124 |
-
{
|
| 125 |
-
$handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
|
| 126 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message'));
|
| 127 |
-
|
| 128 |
-
$this->assertEquals('myAppName', self::$appname);
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
public function testTheAppNameCanBeOverriddenFromEachLog()
|
| 132 |
-
{
|
| 133 |
-
$handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
|
| 134 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
|
| 135 |
-
|
| 136 |
-
$this->assertEquals('logAppName', self::$appname);
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
public function testTheTransactionNameIsNullByDefault()
|
| 140 |
-
{
|
| 141 |
-
$handler = new StubNewRelicHandler();
|
| 142 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message'));
|
| 143 |
-
|
| 144 |
-
$this->assertEquals(null, self::$transactionName);
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
public function testTheTransactionNameCanBeInjectedFromTheConstructor()
|
| 148 |
-
{
|
| 149 |
-
$handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
|
| 150 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message'));
|
| 151 |
-
|
| 152 |
-
$this->assertEquals('myTransaction', self::$transactionName);
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
public function testTheTransactionNameCanBeOverriddenFromEachLog()
|
| 156 |
-
{
|
| 157 |
-
$handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
|
| 158 |
-
$handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName')));
|
| 159 |
-
|
| 160 |
-
$this->assertEquals('logTransactName', self::$transactionName);
|
| 161 |
-
}
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
|
| 165 |
-
{
|
| 166 |
-
protected function isNewRelicEnabled()
|
| 167 |
-
{
|
| 168 |
-
return false;
|
| 169 |
-
}
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
class StubNewRelicHandler extends NewRelicHandler
|
| 173 |
-
{
|
| 174 |
-
protected function isNewRelicEnabled()
|
| 175 |
-
{
|
| 176 |
-
return true;
|
| 177 |
-
}
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function newrelic_notice_error()
|
| 181 |
-
{
|
| 182 |
-
return true;
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
function newrelic_set_appname($appname)
|
| 186 |
-
{
|
| 187 |
-
return NewRelicHandlerTest::$appname = $appname;
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
function newrelic_name_transaction($transactionName)
|
| 191 |
-
{
|
| 192 |
-
return NewRelicHandlerTest::$transactionName = $transactionName;
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
function newrelic_add_custom_parameter($key, $value)
|
| 196 |
-
{
|
| 197 |
-
NewRelicHandlerTest::$customParameters[$key] = $value;
|
| 198 |
-
|
| 199 |
-
return true;
|
| 200 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
DELETED
|
@@ -1,33 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\NullHandler::handle
|
| 19 |
-
*/
|
| 20 |
-
class NullHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
public function testHandle()
|
| 23 |
-
{
|
| 24 |
-
$handler = new NullHandler();
|
| 25 |
-
$this->assertTrue($handler->handle($this->getRecord()));
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function testHandleLowerLevelRecord()
|
| 29 |
-
{
|
| 30 |
-
$handler = new NullHandler(Logger::WARNING);
|
| 31 |
-
$this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
|
| 32 |
-
}
|
| 33 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php
DELETED
|
@@ -1,273 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Exception;
|
| 15 |
-
use Monolog\ErrorHandler;
|
| 16 |
-
use Monolog\Logger;
|
| 17 |
-
use Monolog\TestCase;
|
| 18 |
-
use PhpConsole\Connector;
|
| 19 |
-
use PhpConsole\Dispatcher\Debug as DebugDispatcher;
|
| 20 |
-
use PhpConsole\Dispatcher\Errors as ErrorDispatcher;
|
| 21 |
-
use PhpConsole\Handler;
|
| 22 |
-
use PHPUnit_Framework_MockObject_MockObject;
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* @covers Monolog\Handler\PHPConsoleHandler
|
| 26 |
-
* @author Sergey Barbushin https://www.linkedin.com/in/barbushin
|
| 27 |
-
*/
|
| 28 |
-
class PHPConsoleHandlerTest extends TestCase
|
| 29 |
-
{
|
| 30 |
-
/** @var Connector|PHPUnit_Framework_MockObject_MockObject */
|
| 31 |
-
protected $connector;
|
| 32 |
-
/** @var DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */
|
| 33 |
-
protected $debugDispatcher;
|
| 34 |
-
/** @var ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */
|
| 35 |
-
protected $errorDispatcher;
|
| 36 |
-
|
| 37 |
-
protected function setUp()
|
| 38 |
-
{
|
| 39 |
-
if (!class_exists('PhpConsole\Connector')) {
|
| 40 |
-
$this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation');
|
| 41 |
-
}
|
| 42 |
-
$this->connector = $this->initConnectorMock();
|
| 43 |
-
|
| 44 |
-
$this->debugDispatcher = $this->initDebugDispatcherMock($this->connector);
|
| 45 |
-
$this->connector->setDebugDispatcher($this->debugDispatcher);
|
| 46 |
-
|
| 47 |
-
$this->errorDispatcher = $this->initErrorDispatcherMock($this->connector);
|
| 48 |
-
$this->connector->setErrorsDispatcher($this->errorDispatcher);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
protected function initDebugDispatcherMock(Connector $connector)
|
| 52 |
-
{
|
| 53 |
-
return $this->getMockBuilder('PhpConsole\Dispatcher\Debug')
|
| 54 |
-
->disableOriginalConstructor()
|
| 55 |
-
->setMethods(array('dispatchDebug'))
|
| 56 |
-
->setConstructorArgs(array($connector, $connector->getDumper()))
|
| 57 |
-
->getMock();
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
protected function initErrorDispatcherMock(Connector $connector)
|
| 61 |
-
{
|
| 62 |
-
return $this->getMockBuilder('PhpConsole\Dispatcher\Errors')
|
| 63 |
-
->disableOriginalConstructor()
|
| 64 |
-
->setMethods(array('dispatchError', 'dispatchException'))
|
| 65 |
-
->setConstructorArgs(array($connector, $connector->getDumper()))
|
| 66 |
-
->getMock();
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
protected function initConnectorMock()
|
| 70 |
-
{
|
| 71 |
-
$connector = $this->getMockBuilder('PhpConsole\Connector')
|
| 72 |
-
->disableOriginalConstructor()
|
| 73 |
-
->setMethods(array(
|
| 74 |
-
'sendMessage',
|
| 75 |
-
'onShutDown',
|
| 76 |
-
'isActiveClient',
|
| 77 |
-
'setSourcesBasePath',
|
| 78 |
-
'setServerEncoding',
|
| 79 |
-
'setPassword',
|
| 80 |
-
'enableSslOnlyMode',
|
| 81 |
-
'setAllowedIpMasks',
|
| 82 |
-
'setHeadersLimit',
|
| 83 |
-
'startEvalRequestsListener',
|
| 84 |
-
))
|
| 85 |
-
->getMock();
|
| 86 |
-
|
| 87 |
-
$connector->expects($this->any())
|
| 88 |
-
->method('isActiveClient')
|
| 89 |
-
->will($this->returnValue(true));
|
| 90 |
-
|
| 91 |
-
return $connector;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
protected function getHandlerDefaultOption($name)
|
| 95 |
-
{
|
| 96 |
-
$handler = new PHPConsoleHandler(array(), $this->connector);
|
| 97 |
-
$options = $handler->getOptions();
|
| 98 |
-
|
| 99 |
-
return $options[$name];
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG)
|
| 103 |
-
{
|
| 104 |
-
return new Logger('test', array(
|
| 105 |
-
new PHPConsoleHandler($handlerOptions, $this->connector, $level),
|
| 106 |
-
));
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
public function testInitWithDefaultConnector()
|
| 110 |
-
{
|
| 111 |
-
$handler = new PHPConsoleHandler();
|
| 112 |
-
$this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector()));
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
public function testInitWithCustomConnector()
|
| 116 |
-
{
|
| 117 |
-
$handler = new PHPConsoleHandler(array(), $this->connector);
|
| 118 |
-
$this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector()));
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
public function testDebug()
|
| 122 |
-
{
|
| 123 |
-
$this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test'));
|
| 124 |
-
$this->initLogger()->addDebug('test');
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
public function testDebugContextInMessage()
|
| 128 |
-
{
|
| 129 |
-
$message = 'test';
|
| 130 |
-
$tag = 'tag';
|
| 131 |
-
$context = array($tag, 'custom' => mt_rand());
|
| 132 |
-
$expectedMessage = $message . ' ' . json_encode(array_slice($context, 1));
|
| 133 |
-
$this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
|
| 134 |
-
$this->equalTo($expectedMessage),
|
| 135 |
-
$this->equalTo($tag)
|
| 136 |
-
);
|
| 137 |
-
$this->initLogger()->addDebug($message, $context);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
public function testDebugTags($tagsContextKeys = null)
|
| 141 |
-
{
|
| 142 |
-
$expectedTags = mt_rand();
|
| 143 |
-
$logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array());
|
| 144 |
-
if (!$tagsContextKeys) {
|
| 145 |
-
$tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext');
|
| 146 |
-
}
|
| 147 |
-
foreach ($tagsContextKeys as $key) {
|
| 148 |
-
$debugDispatcher = $this->initDebugDispatcherMock($this->connector);
|
| 149 |
-
$debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
|
| 150 |
-
$this->anything(),
|
| 151 |
-
$this->equalTo($expectedTags)
|
| 152 |
-
);
|
| 153 |
-
$this->connector->setDebugDispatcher($debugDispatcher);
|
| 154 |
-
$logger->addDebug('test', array($key => $expectedTags));
|
| 155 |
-
}
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
public function testError($classesPartialsTraceIgnore = null)
|
| 159 |
-
{
|
| 160 |
-
$code = E_USER_NOTICE;
|
| 161 |
-
$message = 'message';
|
| 162 |
-
$file = __FILE__;
|
| 163 |
-
$line = __LINE__;
|
| 164 |
-
$this->errorDispatcher->expects($this->once())->method('dispatchError')->with(
|
| 165 |
-
$this->equalTo($code),
|
| 166 |
-
$this->equalTo($message),
|
| 167 |
-
$this->equalTo($file),
|
| 168 |
-
$this->equalTo($line),
|
| 169 |
-
$classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore'))
|
| 170 |
-
);
|
| 171 |
-
$errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false);
|
| 172 |
-
$errorHandler->registerErrorHandler(array(), false, E_USER_WARNING);
|
| 173 |
-
$errorHandler->handleError($code, $message, $file, $line);
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
public function testException()
|
| 177 |
-
{
|
| 178 |
-
$e = new Exception();
|
| 179 |
-
$this->errorDispatcher->expects($this->once())->method('dispatchException')->with(
|
| 180 |
-
$this->equalTo($e)
|
| 181 |
-
);
|
| 182 |
-
$handler = $this->initLogger();
|
| 183 |
-
$handler->log(
|
| 184 |
-
\Psr\Log\LogLevel::ERROR,
|
| 185 |
-
sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()),
|
| 186 |
-
array('exception' => $e)
|
| 187 |
-
);
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* @expectedException Exception
|
| 192 |
-
*/
|
| 193 |
-
public function testWrongOptionsThrowsException()
|
| 194 |
-
{
|
| 195 |
-
new PHPConsoleHandler(array('xxx' => 1));
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
public function testOptionEnabled()
|
| 199 |
-
{
|
| 200 |
-
$this->debugDispatcher->expects($this->never())->method('dispatchDebug');
|
| 201 |
-
$this->initLogger(array('enabled' => false))->addDebug('test');
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
public function testOptionClassesPartialsTraceIgnore()
|
| 205 |
-
{
|
| 206 |
-
$this->testError(array('Class', 'Namespace\\'));
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
public function testOptionDebugTagsKeysInContext()
|
| 210 |
-
{
|
| 211 |
-
$this->testDebugTags(array('key1', 'key2'));
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
public function testOptionUseOwnErrorsAndExceptionsHandler()
|
| 215 |
-
{
|
| 216 |
-
$this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true));
|
| 217 |
-
$this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () {
|
| 218 |
-
}));
|
| 219 |
-
$this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () {
|
| 220 |
-
}));
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
public static function provideConnectorMethodsOptionsSets()
|
| 224 |
-
{
|
| 225 |
-
return array(
|
| 226 |
-
array('sourcesBasePath', 'setSourcesBasePath', __DIR__),
|
| 227 |
-
array('serverEncoding', 'setServerEncoding', 'cp1251'),
|
| 228 |
-
array('password', 'setPassword', '******'),
|
| 229 |
-
array('enableSslOnlyMode', 'enableSslOnlyMode', true, false),
|
| 230 |
-
array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')),
|
| 231 |
-
array('headersLimit', 'setHeadersLimit', 2500),
|
| 232 |
-
array('enableEvalListener', 'startEvalRequestsListener', true, false),
|
| 233 |
-
);
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
/**
|
| 237 |
-
* @dataProvider provideConnectorMethodsOptionsSets
|
| 238 |
-
*/
|
| 239 |
-
public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true)
|
| 240 |
-
{
|
| 241 |
-
$expectCall = $this->connector->expects($this->once())->method($method);
|
| 242 |
-
if ($isArgument) {
|
| 243 |
-
$expectCall->with($value);
|
| 244 |
-
}
|
| 245 |
-
new PHPConsoleHandler(array($option => $value), $this->connector);
|
| 246 |
-
}
|
| 247 |
-
|
| 248 |
-
public function testOptionDetectDumpTraceAndSource()
|
| 249 |
-
{
|
| 250 |
-
new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector);
|
| 251 |
-
$this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource);
|
| 252 |
-
}
|
| 253 |
-
|
| 254 |
-
public static function provideDumperOptionsValues()
|
| 255 |
-
{
|
| 256 |
-
return array(
|
| 257 |
-
array('dumperLevelLimit', 'levelLimit', 1001),
|
| 258 |
-
array('dumperItemsCountLimit', 'itemsCountLimit', 1002),
|
| 259 |
-
array('dumperItemSizeLimit', 'itemSizeLimit', 1003),
|
| 260 |
-
array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004),
|
| 261 |
-
array('dumperDetectCallbacks', 'detectCallbacks', true),
|
| 262 |
-
);
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
/**
|
| 266 |
-
* @dataProvider provideDumperOptionsValues
|
| 267 |
-
*/
|
| 268 |
-
public function testDumperOptions($option, $dumperProperty, $value)
|
| 269 |
-
{
|
| 270 |
-
new PHPConsoleHandler(array($option => $value), $this->connector);
|
| 271 |
-
$this->assertEquals($value, $this->connector->getDumper()->$dumperProperty);
|
| 272 |
-
}
|
| 273 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\PsrHandler::handle
|
| 19 |
-
*/
|
| 20 |
-
class PsrHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
public function logLevelProvider()
|
| 23 |
-
{
|
| 24 |
-
$levels = array();
|
| 25 |
-
$monologLogger = new Logger('');
|
| 26 |
-
|
| 27 |
-
foreach ($monologLogger->getLevels() as $levelName => $level) {
|
| 28 |
-
$levels[] = array($levelName, $level);
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
return $levels;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* @dataProvider logLevelProvider
|
| 36 |
-
*/
|
| 37 |
-
public function testHandlesAllLevels($levelName, $level)
|
| 38 |
-
{
|
| 39 |
-
$message = 'Hello, world! ' . $level;
|
| 40 |
-
$context = array('foo' => 'bar', 'level' => $level);
|
| 41 |
-
|
| 42 |
-
$psrLogger = $this->getMock('Psr\Log\NullLogger');
|
| 43 |
-
$psrLogger->expects($this->once())
|
| 44 |
-
->method('log')
|
| 45 |
-
->with(strtolower($levelName), $message, $context);
|
| 46 |
-
|
| 47 |
-
$handler = new PsrHandler($psrLogger);
|
| 48 |
-
$handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context));
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
DELETED
|
@@ -1,141 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Almost all examples (expected header, titles, messages) taken from
|
| 19 |
-
* https://www.pushover.net/api
|
| 20 |
-
* @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
|
| 21 |
-
* @see https://www.pushover.net/api
|
| 22 |
-
*/
|
| 23 |
-
class PushoverHandlerTest extends TestCase
|
| 24 |
-
{
|
| 25 |
-
private $res;
|
| 26 |
-
private $handler;
|
| 27 |
-
|
| 28 |
-
public function testWriteHeader()
|
| 29 |
-
{
|
| 30 |
-
$this->createHandler();
|
| 31 |
-
$this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
|
| 32 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 33 |
-
fseek($this->res, 0);
|
| 34 |
-
$content = fread($this->res, 1024);
|
| 35 |
-
|
| 36 |
-
$this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 37 |
-
|
| 38 |
-
return $content;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* @depends testWriteHeader
|
| 43 |
-
*/
|
| 44 |
-
public function testWriteContent($content)
|
| 45 |
-
{
|
| 46 |
-
$this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content);
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function testWriteWithComplexTitle()
|
| 50 |
-
{
|
| 51 |
-
$this->createHandler('myToken', 'myUser', 'Backup finished - SQL1');
|
| 52 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 53 |
-
fseek($this->res, 0);
|
| 54 |
-
$content = fread($this->res, 1024);
|
| 55 |
-
|
| 56 |
-
$this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
public function testWriteWithComplexMessage()
|
| 60 |
-
{
|
| 61 |
-
$this->createHandler();
|
| 62 |
-
$this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
|
| 63 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
|
| 64 |
-
fseek($this->res, 0);
|
| 65 |
-
$content = fread($this->res, 1024);
|
| 66 |
-
|
| 67 |
-
$this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
public function testWriteWithTooLongMessage()
|
| 71 |
-
{
|
| 72 |
-
$message = str_pad('test', 520, 'a');
|
| 73 |
-
$this->createHandler();
|
| 74 |
-
$this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
|
| 75 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
|
| 76 |
-
fseek($this->res, 0);
|
| 77 |
-
$content = fread($this->res, 1024);
|
| 78 |
-
|
| 79 |
-
$expectedMessage = substr($message, 0, 505);
|
| 80 |
-
|
| 81 |
-
$this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public function testWriteWithHighPriority()
|
| 85 |
-
{
|
| 86 |
-
$this->createHandler();
|
| 87 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 88 |
-
fseek($this->res, 0);
|
| 89 |
-
$content = fread($this->res, 1024);
|
| 90 |
-
|
| 91 |
-
$this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content);
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
public function testWriteWithEmergencyPriority()
|
| 95 |
-
{
|
| 96 |
-
$this->createHandler();
|
| 97 |
-
$this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
|
| 98 |
-
fseek($this->res, 0);
|
| 99 |
-
$content = fread($this->res, 1024);
|
| 100 |
-
|
| 101 |
-
$this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
public function testWriteToMultipleUsers()
|
| 105 |
-
{
|
| 106 |
-
$this->createHandler('myToken', array('userA', 'userB'));
|
| 107 |
-
$this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
|
| 108 |
-
fseek($this->res, 0);
|
| 109 |
-
$content = fread($this->res, 1024);
|
| 110 |
-
|
| 111 |
-
$this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
|
| 112 |
-
$this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
|
| 116 |
-
{
|
| 117 |
-
$constructorArgs = array($token, $user, $title);
|
| 118 |
-
$this->res = fopen('php://memory', 'a');
|
| 119 |
-
$this->handler = $this->getMock(
|
| 120 |
-
'\Monolog\Handler\PushoverHandler',
|
| 121 |
-
array('fsockopen', 'streamSetTimeout', 'closeSocket'),
|
| 122 |
-
$constructorArgs
|
| 123 |
-
);
|
| 124 |
-
|
| 125 |
-
$reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
|
| 126 |
-
$reflectionProperty->setAccessible(true);
|
| 127 |
-
$reflectionProperty->setValue($this->handler, 'localhost:1234');
|
| 128 |
-
|
| 129 |
-
$this->handler->expects($this->any())
|
| 130 |
-
->method('fsockopen')
|
| 131 |
-
->will($this->returnValue($this->res));
|
| 132 |
-
$this->handler->expects($this->any())
|
| 133 |
-
->method('streamSetTimeout')
|
| 134 |
-
->will($this->returnValue(true));
|
| 135 |
-
$this->handler->expects($this->any())
|
| 136 |
-
->method('closeSocket')
|
| 137 |
-
->will($this->returnValue(true));
|
| 138 |
-
|
| 139 |
-
$this->handler->setFormatter($this->getIdentityFormatter());
|
| 140 |
-
}
|
| 141 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
DELETED
|
@@ -1,227 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Formatter\LineFormatter;
|
| 17 |
-
|
| 18 |
-
class RavenHandlerTest extends TestCase
|
| 19 |
-
{
|
| 20 |
-
public function setUp()
|
| 21 |
-
{
|
| 22 |
-
if (!class_exists('Raven_Client')) {
|
| 23 |
-
$this->markTestSkipped('raven/raven not installed');
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
require_once __DIR__ . '/MockRavenClient.php';
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @covers Monolog\Handler\RavenHandler::__construct
|
| 31 |
-
*/
|
| 32 |
-
public function testConstruct()
|
| 33 |
-
{
|
| 34 |
-
$handler = new RavenHandler($this->getRavenClient());
|
| 35 |
-
$this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
protected function getHandler($ravenClient)
|
| 39 |
-
{
|
| 40 |
-
$handler = new RavenHandler($ravenClient);
|
| 41 |
-
|
| 42 |
-
return $handler;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
protected function getRavenClient()
|
| 46 |
-
{
|
| 47 |
-
$dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
|
| 48 |
-
|
| 49 |
-
return new MockRavenClient($dsn);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
public function testDebug()
|
| 53 |
-
{
|
| 54 |
-
$ravenClient = $this->getRavenClient();
|
| 55 |
-
$handler = $this->getHandler($ravenClient);
|
| 56 |
-
|
| 57 |
-
$record = $this->getRecord(Logger::DEBUG, 'A test debug message');
|
| 58 |
-
$handler->handle($record);
|
| 59 |
-
|
| 60 |
-
$this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
|
| 61 |
-
$this->assertContains($record['message'], $ravenClient->lastData['message']);
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
public function testWarning()
|
| 65 |
-
{
|
| 66 |
-
$ravenClient = $this->getRavenClient();
|
| 67 |
-
$handler = $this->getHandler($ravenClient);
|
| 68 |
-
|
| 69 |
-
$record = $this->getRecord(Logger::WARNING, 'A test warning message');
|
| 70 |
-
$handler->handle($record);
|
| 71 |
-
|
| 72 |
-
$this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
|
| 73 |
-
$this->assertContains($record['message'], $ravenClient->lastData['message']);
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function testTag()
|
| 77 |
-
{
|
| 78 |
-
$ravenClient = $this->getRavenClient();
|
| 79 |
-
$handler = $this->getHandler($ravenClient);
|
| 80 |
-
|
| 81 |
-
$tags = array(1, 2, 'foo');
|
| 82 |
-
$record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags));
|
| 83 |
-
$handler->handle($record);
|
| 84 |
-
|
| 85 |
-
$this->assertEquals($tags, $ravenClient->lastData['tags']);
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
public function testExtraParameters()
|
| 89 |
-
{
|
| 90 |
-
$ravenClient = $this->getRavenClient();
|
| 91 |
-
$handler = $this->getHandler($ravenClient);
|
| 92 |
-
|
| 93 |
-
$checksum = '098f6bcd4621d373cade4e832627b4f6';
|
| 94 |
-
$release = '05a671c66aefea124cc08b76ea6d30bb';
|
| 95 |
-
$record = $this->getRecord(Logger::INFO, 'test', array('checksum' => $checksum, 'release' => $release));
|
| 96 |
-
$handler->handle($record);
|
| 97 |
-
|
| 98 |
-
$this->assertEquals($checksum, $ravenClient->lastData['checksum']);
|
| 99 |
-
$this->assertEquals($release, $ravenClient->lastData['release']);
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
public function testFingerprint()
|
| 103 |
-
{
|
| 104 |
-
$ravenClient = $this->getRavenClient();
|
| 105 |
-
$handler = $this->getHandler($ravenClient);
|
| 106 |
-
|
| 107 |
-
$fingerprint = array('{{ default }}', 'other value');
|
| 108 |
-
$record = $this->getRecord(Logger::INFO, 'test', array('fingerprint' => $fingerprint));
|
| 109 |
-
$handler->handle($record);
|
| 110 |
-
|
| 111 |
-
$this->assertEquals($fingerprint, $ravenClient->lastData['fingerprint']);
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
public function testUserContext()
|
| 115 |
-
{
|
| 116 |
-
$ravenClient = $this->getRavenClient();
|
| 117 |
-
$handler = $this->getHandler($ravenClient);
|
| 118 |
-
|
| 119 |
-
$recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context');
|
| 120 |
-
// set user context 'externally'
|
| 121 |
-
|
| 122 |
-
$user = array(
|
| 123 |
-
'id' => '123',
|
| 124 |
-
'email' => 'test@test.com',
|
| 125 |
-
);
|
| 126 |
-
|
| 127 |
-
$recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user));
|
| 128 |
-
|
| 129 |
-
$ravenClient->user_context(array('id' => 'test_user_id'));
|
| 130 |
-
// handle context
|
| 131 |
-
$handler->handle($recordWithContext);
|
| 132 |
-
$this->assertEquals($user, $ravenClient->lastData['user']);
|
| 133 |
-
|
| 134 |
-
// check to see if its reset
|
| 135 |
-
$handler->handle($recordWithNoContext);
|
| 136 |
-
$this->assertInternalType('array', $ravenClient->context->user);
|
| 137 |
-
$this->assertSame('test_user_id', $ravenClient->context->user['id']);
|
| 138 |
-
|
| 139 |
-
// handle with null context
|
| 140 |
-
$ravenClient->user_context(null);
|
| 141 |
-
$handler->handle($recordWithContext);
|
| 142 |
-
$this->assertEquals($user, $ravenClient->lastData['user']);
|
| 143 |
-
|
| 144 |
-
// check to see if its reset
|
| 145 |
-
$handler->handle($recordWithNoContext);
|
| 146 |
-
$this->assertNull($ravenClient->context->user);
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
public function testException()
|
| 150 |
-
{
|
| 151 |
-
$ravenClient = $this->getRavenClient();
|
| 152 |
-
$handler = $this->getHandler($ravenClient);
|
| 153 |
-
|
| 154 |
-
try {
|
| 155 |
-
$this->methodThatThrowsAnException();
|
| 156 |
-
} catch (\Exception $e) {
|
| 157 |
-
$record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
|
| 158 |
-
$handler->handle($record);
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
$this->assertEquals($record['message'], $ravenClient->lastData['message']);
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
public function testHandleBatch()
|
| 165 |
-
{
|
| 166 |
-
$records = $this->getMultipleRecords();
|
| 167 |
-
$records[] = $this->getRecord(Logger::WARNING, 'warning');
|
| 168 |
-
$records[] = $this->getRecord(Logger::WARNING, 'warning');
|
| 169 |
-
|
| 170 |
-
$logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 171 |
-
$logFormatter->expects($this->once())->method('formatBatch');
|
| 172 |
-
|
| 173 |
-
$formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 174 |
-
$formatter->expects($this->once())->method('format')->with($this->callback(function ($record) {
|
| 175 |
-
return $record['level'] == 400;
|
| 176 |
-
}));
|
| 177 |
-
|
| 178 |
-
$handler = $this->getHandler($this->getRavenClient());
|
| 179 |
-
$handler->setBatchFormatter($logFormatter);
|
| 180 |
-
$handler->setFormatter($formatter);
|
| 181 |
-
$handler->handleBatch($records);
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
|
| 185 |
-
{
|
| 186 |
-
$records = array(
|
| 187 |
-
$this->getRecord(Logger::DEBUG, 'debug message 1'),
|
| 188 |
-
$this->getRecord(Logger::DEBUG, 'debug message 2'),
|
| 189 |
-
$this->getRecord(Logger::INFO, 'information'),
|
| 190 |
-
);
|
| 191 |
-
|
| 192 |
-
$handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
|
| 193 |
-
$handler->expects($this->never())->method('handle');
|
| 194 |
-
$handler->setLevel(Logger::ERROR);
|
| 195 |
-
$handler->handleBatch($records);
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
public function testGetSetBatchFormatter()
|
| 199 |
-
{
|
| 200 |
-
$ravenClient = $this->getRavenClient();
|
| 201 |
-
$handler = $this->getHandler($ravenClient);
|
| 202 |
-
|
| 203 |
-
$handler->setBatchFormatter($formatter = new LineFormatter());
|
| 204 |
-
$this->assertSame($formatter, $handler->getBatchFormatter());
|
| 205 |
-
}
|
| 206 |
-
|
| 207 |
-
public function testRelease()
|
| 208 |
-
{
|
| 209 |
-
$ravenClient = $this->getRavenClient();
|
| 210 |
-
$handler = $this->getHandler($ravenClient);
|
| 211 |
-
$release = 'v42.42.42';
|
| 212 |
-
$handler->setRelease($release);
|
| 213 |
-
$record = $this->getRecord(Logger::INFO, 'test');
|
| 214 |
-
$handler->handle($record);
|
| 215 |
-
$this->assertEquals($release, $ravenClient->lastData['release']);
|
| 216 |
-
|
| 217 |
-
$localRelease = 'v41.41.41';
|
| 218 |
-
$record = $this->getRecord(Logger::INFO, 'test', array('release' => $localRelease));
|
| 219 |
-
$handler->handle($record);
|
| 220 |
-
$this->assertEquals($localRelease, $ravenClient->lastData['release']);
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
private function methodThatThrowsAnException()
|
| 224 |
-
{
|
| 225 |
-
throw new \Exception('This is an exception');
|
| 226 |
-
}
|
| 227 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
DELETED
|
@@ -1,127 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Formatter\LineFormatter;
|
| 17 |
-
|
| 18 |
-
class RedisHandlerTest extends TestCase
|
| 19 |
-
{
|
| 20 |
-
/**
|
| 21 |
-
* @expectedException InvalidArgumentException
|
| 22 |
-
*/
|
| 23 |
-
public function testConstructorShouldThrowExceptionForInvalidRedis()
|
| 24 |
-
{
|
| 25 |
-
new RedisHandler(new \stdClass(), 'key');
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function testConstructorShouldWorkWithPredis()
|
| 29 |
-
{
|
| 30 |
-
$redis = $this->getMock('Predis\Client');
|
| 31 |
-
$this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function testConstructorShouldWorkWithRedis()
|
| 35 |
-
{
|
| 36 |
-
$redis = $this->getMock('Redis');
|
| 37 |
-
$this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function testPredisHandle()
|
| 41 |
-
{
|
| 42 |
-
$redis = $this->getMock('Predis\Client', array('rpush'));
|
| 43 |
-
|
| 44 |
-
// Predis\Client uses rpush
|
| 45 |
-
$redis->expects($this->once())
|
| 46 |
-
->method('rpush')
|
| 47 |
-
->with('key', 'test');
|
| 48 |
-
|
| 49 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 50 |
-
|
| 51 |
-
$handler = new RedisHandler($redis, 'key');
|
| 52 |
-
$handler->setFormatter(new LineFormatter("%message%"));
|
| 53 |
-
$handler->handle($record);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
public function testRedisHandle()
|
| 57 |
-
{
|
| 58 |
-
$redis = $this->getMock('Redis', array('rpush'));
|
| 59 |
-
|
| 60 |
-
// Redis uses rPush
|
| 61 |
-
$redis->expects($this->once())
|
| 62 |
-
->method('rPush')
|
| 63 |
-
->with('key', 'test');
|
| 64 |
-
|
| 65 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 66 |
-
|
| 67 |
-
$handler = new RedisHandler($redis, 'key');
|
| 68 |
-
$handler->setFormatter(new LineFormatter("%message%"));
|
| 69 |
-
$handler->handle($record);
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function testRedisHandleCapped()
|
| 73 |
-
{
|
| 74 |
-
$redis = $this->getMock('Redis', array('multi', 'rpush', 'ltrim', 'exec'));
|
| 75 |
-
|
| 76 |
-
// Redis uses multi
|
| 77 |
-
$redis->expects($this->once())
|
| 78 |
-
->method('multi')
|
| 79 |
-
->will($this->returnSelf());
|
| 80 |
-
|
| 81 |
-
$redis->expects($this->once())
|
| 82 |
-
->method('rpush')
|
| 83 |
-
->will($this->returnSelf());
|
| 84 |
-
|
| 85 |
-
$redis->expects($this->once())
|
| 86 |
-
->method('ltrim')
|
| 87 |
-
->will($this->returnSelf());
|
| 88 |
-
|
| 89 |
-
$redis->expects($this->once())
|
| 90 |
-
->method('exec')
|
| 91 |
-
->will($this->returnSelf());
|
| 92 |
-
|
| 93 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 94 |
-
|
| 95 |
-
$handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
|
| 96 |
-
$handler->setFormatter(new LineFormatter("%message%"));
|
| 97 |
-
$handler->handle($record);
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
public function testPredisHandleCapped()
|
| 101 |
-
{
|
| 102 |
-
$redis = $this->getMock('Predis\Client', array('transaction'));
|
| 103 |
-
|
| 104 |
-
$redisTransaction = $this->getMock('Predis\Client', array('rpush', 'ltrim'));
|
| 105 |
-
|
| 106 |
-
$redisTransaction->expects($this->once())
|
| 107 |
-
->method('rpush')
|
| 108 |
-
->will($this->returnSelf());
|
| 109 |
-
|
| 110 |
-
$redisTransaction->expects($this->once())
|
| 111 |
-
->method('ltrim')
|
| 112 |
-
->will($this->returnSelf());
|
| 113 |
-
|
| 114 |
-
// Redis uses multi
|
| 115 |
-
$redis->expects($this->once())
|
| 116 |
-
->method('transaction')
|
| 117 |
-
->will($this->returnCallback(function ($cb) use ($redisTransaction) {
|
| 118 |
-
$cb($redisTransaction);
|
| 119 |
-
}));
|
| 120 |
-
|
| 121 |
-
$record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
|
| 122 |
-
|
| 123 |
-
$handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
|
| 124 |
-
$handler->setFormatter(new LineFormatter("%message%"));
|
| 125 |
-
$handler->handle($record);
|
| 126 |
-
}
|
| 127 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php
ADDED
|
@@ -0,0 +1,84 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler;
|
| 13 |
+
|
| 14 |
+
use Exception;
|
| 15 |
+
use Monolog\TestCase;
|
| 16 |
+
use Monolog\Logger;
|
| 17 |
+
use PHPUnit_Framework_MockObject_MockObject as MockObject;
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* @author Erik Johansson <erik.pm.johansson@gmail.com>
|
| 21 |
+
* @see https://rollbar.com/docs/notifier/rollbar-php/
|
| 22 |
+
*
|
| 23 |
+
* @coversDefaultClass Monolog\Handler\RollbarHandler
|
| 24 |
+
*/
|
| 25 |
+
class RollbarHandlerTest extends TestCase
|
| 26 |
+
{
|
| 27 |
+
/**
|
| 28 |
+
* @var MockObject
|
| 29 |
+
*/
|
| 30 |
+
private $rollbarNotifier;
|
| 31 |
+
|
| 32 |
+
/**
|
| 33 |
+
* @var array
|
| 34 |
+
*/
|
| 35 |
+
public $reportedExceptionArguments = null;
|
| 36 |
+
|
| 37 |
+
protected function setUp()
|
| 38 |
+
{
|
| 39 |
+
parent::setUp();
|
| 40 |
+
|
| 41 |
+
$this->setupRollbarNotifierMock();
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
/**
|
| 45 |
+
* When reporting exceptions to Rollbar the
|
| 46 |
+
* level has to be set in the payload data
|
| 47 |
+
*/
|
| 48 |
+
public function testExceptionLogLevel()
|
| 49 |
+
{
|
| 50 |
+
$handler = $this->createHandler();
|
| 51 |
+
|
| 52 |
+
$handler->handle($this->createExceptionRecord(Logger::DEBUG));
|
| 53 |
+
|
| 54 |
+
$this->assertEquals('debug', $this->reportedExceptionArguments['payload']['level']);
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
private function setupRollbarNotifierMock()
|
| 58 |
+
{
|
| 59 |
+
$this->rollbarNotifier = $this->getMockBuilder('RollbarNotifier')
|
| 60 |
+
->setMethods(array('report_message', 'report_exception', 'flush'))
|
| 61 |
+
->getMock();
|
| 62 |
+
|
| 63 |
+
$that = $this;
|
| 64 |
+
|
| 65 |
+
$this->rollbarNotifier
|
| 66 |
+
->expects($this->any())
|
| 67 |
+
->method('report_exception')
|
| 68 |
+
->willReturnCallback(function ($exception, $context, $payload) use ($that) {
|
| 69 |
+
$that->reportedExceptionArguments = compact('exception', 'context', 'payload');
|
| 70 |
+
});
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
private function createHandler()
|
| 74 |
+
{
|
| 75 |
+
return new RollbarHandler($this->rollbarNotifier, Logger::DEBUG);
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
private function createExceptionRecord($level = Logger::DEBUG, $message = 'test', $exception = null)
|
| 79 |
+
{
|
| 80 |
+
return $this->getRecord($level, $message, array(
|
| 81 |
+
'exception' => $exception ?: new Exception()
|
| 82 |
+
));
|
| 83 |
+
}
|
| 84 |
+
}
|
vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
DELETED
|
@@ -1,211 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use PHPUnit_Framework_Error_Deprecated;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\RotatingFileHandler
|
| 19 |
-
*/
|
| 20 |
-
class RotatingFileHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
/**
|
| 23 |
-
* This var should be private but then the anonymous function
|
| 24 |
-
* in the `setUp` method won't be able to set it. `$this` cant't
|
| 25 |
-
* be used in the anonymous function in `setUp` because PHP 5.3
|
| 26 |
-
* does not support it.
|
| 27 |
-
*/
|
| 28 |
-
public $lastError;
|
| 29 |
-
|
| 30 |
-
public function setUp()
|
| 31 |
-
{
|
| 32 |
-
$dir = __DIR__.'/Fixtures';
|
| 33 |
-
chmod($dir, 0777);
|
| 34 |
-
if (!is_writable($dir)) {
|
| 35 |
-
$this->markTestSkipped($dir.' must be writable to test the RotatingFileHandler.');
|
| 36 |
-
}
|
| 37 |
-
$this->lastError = null;
|
| 38 |
-
$self = $this;
|
| 39 |
-
// workaround with &$self used for PHP 5.3
|
| 40 |
-
set_error_handler(function($code, $message) use (&$self) {
|
| 41 |
-
$self->lastError = array(
|
| 42 |
-
'code' => $code,
|
| 43 |
-
'message' => $message,
|
| 44 |
-
);
|
| 45 |
-
});
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
private function assertErrorWasTriggered($code, $message)
|
| 49 |
-
{
|
| 50 |
-
if (empty($this->lastError)) {
|
| 51 |
-
$this->fail(
|
| 52 |
-
sprintf(
|
| 53 |
-
'Failed asserting that error with code `%d` and message `%s` was triggered',
|
| 54 |
-
$code,
|
| 55 |
-
$message
|
| 56 |
-
)
|
| 57 |
-
);
|
| 58 |
-
}
|
| 59 |
-
$this->assertEquals($code, $this->lastError['code'], sprintf('Expected an error with code %d to be triggered, got `%s` instead', $code, $this->lastError['code']));
|
| 60 |
-
$this->assertEquals($message, $this->lastError['message'], sprintf('Expected an error with message `%d` to be triggered, got `%s` instead', $message, $this->lastError['message']));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
public function testRotationCreatesNewFile()
|
| 64 |
-
{
|
| 65 |
-
touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
|
| 66 |
-
|
| 67 |
-
$handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
|
| 68 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 69 |
-
$handler->handle($this->getRecord());
|
| 70 |
-
|
| 71 |
-
$log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
|
| 72 |
-
$this->assertTrue(file_exists($log));
|
| 73 |
-
$this->assertEquals('test', file_get_contents($log));
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* @dataProvider rotationTests
|
| 78 |
-
*/
|
| 79 |
-
public function testRotation($createFile, $dateFormat, $timeCallback)
|
| 80 |
-
{
|
| 81 |
-
touch($old1 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-1)).'.rot');
|
| 82 |
-
touch($old2 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-2)).'.rot');
|
| 83 |
-
touch($old3 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-3)).'.rot');
|
| 84 |
-
touch($old4 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-4)).'.rot');
|
| 85 |
-
|
| 86 |
-
$log = __DIR__.'/Fixtures/foo-'.date($dateFormat).'.rot';
|
| 87 |
-
|
| 88 |
-
if ($createFile) {
|
| 89 |
-
touch($log);
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
$handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
|
| 93 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 94 |
-
$handler->setFilenameFormat('{filename}-{date}', $dateFormat);
|
| 95 |
-
$handler->handle($this->getRecord());
|
| 96 |
-
|
| 97 |
-
$handler->close();
|
| 98 |
-
|
| 99 |
-
$this->assertTrue(file_exists($log));
|
| 100 |
-
$this->assertTrue(file_exists($old1));
|
| 101 |
-
$this->assertEquals($createFile, file_exists($old2));
|
| 102 |
-
$this->assertEquals($createFile, file_exists($old3));
|
| 103 |
-
$this->assertEquals($createFile, file_exists($old4));
|
| 104 |
-
$this->assertEquals('test', file_get_contents($log));
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
public function rotationTests()
|
| 108 |
-
{
|
| 109 |
-
$now = time();
|
| 110 |
-
$dayCallback = function($ago) use ($now) {
|
| 111 |
-
return $now + 86400 * $ago;
|
| 112 |
-
};
|
| 113 |
-
$monthCallback = function($ago) {
|
| 114 |
-
return gmmktime(0, 0, 0, date('n') + $ago, date('d'), date('Y'));
|
| 115 |
-
};
|
| 116 |
-
$yearCallback = function($ago) {
|
| 117 |
-
return gmmktime(0, 0, 0, date('n'), date('d'), date('Y') + $ago);
|
| 118 |
-
};
|
| 119 |
-
|
| 120 |
-
return array(
|
| 121 |
-
'Rotation is triggered when the file of the current day is not present'
|
| 122 |
-
=> array(true, RotatingFileHandler::FILE_PER_DAY, $dayCallback),
|
| 123 |
-
'Rotation is not triggered when the file of the current day is already present'
|
| 124 |
-
=> array(false, RotatingFileHandler::FILE_PER_DAY, $dayCallback),
|
| 125 |
-
|
| 126 |
-
'Rotation is triggered when the file of the current month is not present'
|
| 127 |
-
=> array(true, RotatingFileHandler::FILE_PER_MONTH, $monthCallback),
|
| 128 |
-
'Rotation is not triggered when the file of the current month is already present'
|
| 129 |
-
=> array(false, RotatingFileHandler::FILE_PER_MONTH, $monthCallback),
|
| 130 |
-
|
| 131 |
-
'Rotation is triggered when the file of the current year is not present'
|
| 132 |
-
=> array(true, RotatingFileHandler::FILE_PER_YEAR, $yearCallback),
|
| 133 |
-
'Rotation is not triggered when the file of the current year is already present'
|
| 134 |
-
=> array(false, RotatingFileHandler::FILE_PER_YEAR, $yearCallback),
|
| 135 |
-
);
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
* @dataProvider dateFormatProvider
|
| 140 |
-
*/
|
| 141 |
-
public function testAllowOnlyFixedDefinedDateFormats($dateFormat, $valid)
|
| 142 |
-
{
|
| 143 |
-
$handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
|
| 144 |
-
$handler->setFilenameFormat('{filename}-{date}', $dateFormat);
|
| 145 |
-
if (!$valid) {
|
| 146 |
-
$this->assertErrorWasTriggered(
|
| 147 |
-
E_USER_DEPRECATED,
|
| 148 |
-
'Invalid date format - format must be one of RotatingFileHandler::FILE_PER_DAY ("Y-m-d"), '.
|
| 149 |
-
'RotatingFileHandler::FILE_PER_MONTH ("Y-m") or RotatingFileHandler::FILE_PER_YEAR ("Y"), '.
|
| 150 |
-
'or you can set one of the date formats using slashes, underscores and/or dots instead of dashes.'
|
| 151 |
-
);
|
| 152 |
-
}
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
public function dateFormatProvider()
|
| 156 |
-
{
|
| 157 |
-
return array(
|
| 158 |
-
array(RotatingFileHandler::FILE_PER_DAY, true),
|
| 159 |
-
array(RotatingFileHandler::FILE_PER_MONTH, true),
|
| 160 |
-
array(RotatingFileHandler::FILE_PER_YEAR, true),
|
| 161 |
-
array('m-d-Y', false),
|
| 162 |
-
array('Y-m-d-h-i', false)
|
| 163 |
-
);
|
| 164 |
-
}
|
| 165 |
-
|
| 166 |
-
/**
|
| 167 |
-
* @dataProvider filenameFormatProvider
|
| 168 |
-
*/
|
| 169 |
-
public function testDisallowFilenameFormatsWithoutDate($filenameFormat, $valid)
|
| 170 |
-
{
|
| 171 |
-
$handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
|
| 172 |
-
$handler->setFilenameFormat($filenameFormat, RotatingFileHandler::FILE_PER_DAY);
|
| 173 |
-
if (!$valid) {
|
| 174 |
-
$this->assertErrorWasTriggered(
|
| 175 |
-
E_USER_DEPRECATED,
|
| 176 |
-
'Invalid filename format - format should contain at least `{date}`, because otherwise rotating is impossible.'
|
| 177 |
-
);
|
| 178 |
-
}
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
public function filenameFormatProvider()
|
| 182 |
-
{
|
| 183 |
-
return array(
|
| 184 |
-
array('{filename}', false),
|
| 185 |
-
array('{filename}-{date}', true),
|
| 186 |
-
array('{date}', true),
|
| 187 |
-
array('foobar-{date}', true),
|
| 188 |
-
array('foo-{date}-bar', true),
|
| 189 |
-
array('{date}-foobar', true),
|
| 190 |
-
array('foobar', false),
|
| 191 |
-
);
|
| 192 |
-
}
|
| 193 |
-
|
| 194 |
-
public function testReuseCurrentFile()
|
| 195 |
-
{
|
| 196 |
-
$log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
|
| 197 |
-
file_put_contents($log, "foo");
|
| 198 |
-
$handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
|
| 199 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 200 |
-
$handler->handle($this->getRecord());
|
| 201 |
-
$this->assertEquals('footest', file_get_contents($log));
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
public function tearDown()
|
| 205 |
-
{
|
| 206 |
-
foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
|
| 207 |
-
unlink($file);
|
| 208 |
-
}
|
| 209 |
-
restore_error_handler();
|
| 210 |
-
}
|
| 211 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
DELETED
|
@@ -1,33 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* @covers Monolog\Handler\SamplingHandler::handle
|
| 18 |
-
*/
|
| 19 |
-
class SamplingHandlerTest extends TestCase
|
| 20 |
-
{
|
| 21 |
-
public function testHandle()
|
| 22 |
-
{
|
| 23 |
-
$testHandler = new TestHandler();
|
| 24 |
-
$handler = new SamplingHandler($testHandler, 2);
|
| 25 |
-
for ($i = 0; $i < 10000; $i++) {
|
| 26 |
-
$handler->handle($this->getRecord());
|
| 27 |
-
}
|
| 28 |
-
$count = count($testHandler->getRecords());
|
| 29 |
-
// $count should be half of 10k, so between 4k and 6k
|
| 30 |
-
$this->assertLessThan(6000, $count);
|
| 31 |
-
$this->assertGreaterThan(4000, $count);
|
| 32 |
-
}
|
| 33 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php
ADDED
|
@@ -0,0 +1,387 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler\Slack;
|
| 13 |
+
|
| 14 |
+
use Monolog\Logger;
|
| 15 |
+
use Monolog\TestCase;
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* @coversDefaultClass Monolog\Handler\Slack\SlackRecord
|
| 19 |
+
*/
|
| 20 |
+
class SlackRecordTest extends TestCase
|
| 21 |
+
{
|
| 22 |
+
private $jsonPrettyPrintFlag;
|
| 23 |
+
|
| 24 |
+
protected function setUp()
|
| 25 |
+
{
|
| 26 |
+
$this->jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
public function dataGetAttachmentColor()
|
| 30 |
+
{
|
| 31 |
+
return array(
|
| 32 |
+
array(Logger::DEBUG, SlackRecord::COLOR_DEFAULT),
|
| 33 |
+
array(Logger::INFO, SlackRecord::COLOR_GOOD),
|
| 34 |
+
array(Logger::NOTICE, SlackRecord::COLOR_GOOD),
|
| 35 |
+
array(Logger::WARNING, SlackRecord::COLOR_WARNING),
|
| 36 |
+
array(Logger::ERROR, SlackRecord::COLOR_DANGER),
|
| 37 |
+
array(Logger::CRITICAL, SlackRecord::COLOR_DANGER),
|
| 38 |
+
array(Logger::ALERT, SlackRecord::COLOR_DANGER),
|
| 39 |
+
array(Logger::EMERGENCY, SlackRecord::COLOR_DANGER),
|
| 40 |
+
);
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
/**
|
| 44 |
+
* @dataProvider dataGetAttachmentColor
|
| 45 |
+
* @param int $logLevel
|
| 46 |
+
* @param string $expectedColour RGB hex color or name of Slack color
|
| 47 |
+
* @covers ::getAttachmentColor
|
| 48 |
+
*/
|
| 49 |
+
public function testGetAttachmentColor($logLevel, $expectedColour)
|
| 50 |
+
{
|
| 51 |
+
$slackRecord = new SlackRecord();
|
| 52 |
+
$this->assertSame(
|
| 53 |
+
$expectedColour,
|
| 54 |
+
$slackRecord->getAttachmentColor($logLevel)
|
| 55 |
+
);
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
public function testAddsChannel()
|
| 59 |
+
{
|
| 60 |
+
$channel = '#test';
|
| 61 |
+
$record = new SlackRecord($channel);
|
| 62 |
+
$data = $record->getSlackData($this->getRecord());
|
| 63 |
+
|
| 64 |
+
$this->assertArrayHasKey('channel', $data);
|
| 65 |
+
$this->assertSame($channel, $data['channel']);
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
public function testNoUsernameByDefault()
|
| 69 |
+
{
|
| 70 |
+
$record = new SlackRecord();
|
| 71 |
+
$data = $record->getSlackData($this->getRecord());
|
| 72 |
+
|
| 73 |
+
$this->assertArrayNotHasKey('username', $data);
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
/**
|
| 77 |
+
* @return array
|
| 78 |
+
*/
|
| 79 |
+
public function dataStringify()
|
| 80 |
+
{
|
| 81 |
+
$jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128;
|
| 82 |
+
|
| 83 |
+
$multipleDimensions = array(array(1, 2));
|
| 84 |
+
$numericKeys = array('library' => 'monolog');
|
| 85 |
+
$singleDimension = array(1, 'Hello', 'Jordi');
|
| 86 |
+
|
| 87 |
+
return array(
|
| 88 |
+
array(array(), '[]'),
|
| 89 |
+
array($multipleDimensions, json_encode($multipleDimensions, $jsonPrettyPrintFlag)),
|
| 90 |
+
array($numericKeys, json_encode($numericKeys, $jsonPrettyPrintFlag)),
|
| 91 |
+
array($singleDimension, json_encode($singleDimension))
|
| 92 |
+
);
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
/**
|
| 96 |
+
* @dataProvider dataStringify
|
| 97 |
+
*/
|
| 98 |
+
public function testStringify($fields, $expectedResult)
|
| 99 |
+
{
|
| 100 |
+
$slackRecord = new SlackRecord(
|
| 101 |
+
'#test',
|
| 102 |
+
'test',
|
| 103 |
+
true,
|
| 104 |
+
null,
|
| 105 |
+
true,
|
| 106 |
+
true
|
| 107 |
+
);
|
| 108 |
+
|
| 109 |
+
$this->assertSame($expectedResult, $slackRecord->stringify($fields));
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
public function testAddsCustomUsername()
|
| 113 |
+
{
|
| 114 |
+
$username = 'Monolog bot';
|
| 115 |
+
$record = new SlackRecord(null, $username);
|
| 116 |
+
$data = $record->getSlackData($this->getRecord());
|
| 117 |
+
|
| 118 |
+
$this->assertArrayHasKey('username', $data);
|
| 119 |
+
$this->assertSame($username, $data['username']);
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
public function testNoIcon()
|
| 123 |
+
{
|
| 124 |
+
$record = new SlackRecord();
|
| 125 |
+
$data = $record->getSlackData($this->getRecord());
|
| 126 |
+
|
| 127 |
+
$this->assertArrayNotHasKey('icon_emoji', $data);
|
| 128 |
+
}
|
| 129 |
+
|
| 130 |
+
public function testAddsIcon()
|
| 131 |
+
{
|
| 132 |
+
$record = $this->getRecord();
|
| 133 |
+
$slackRecord = new SlackRecord(null, null, false, 'ghost');
|
| 134 |
+
$data = $slackRecord->getSlackData($record);
|
| 135 |
+
|
| 136 |
+
$slackRecord2 = new SlackRecord(null, null, false, 'http://github.com/Seldaek/monolog');
|
| 137 |
+
$data2 = $slackRecord2->getSlackData($record);
|
| 138 |
+
|
| 139 |
+
$this->assertArrayHasKey('icon_emoji', $data);
|
| 140 |
+
$this->assertSame(':ghost:', $data['icon_emoji']);
|
| 141 |
+
$this->assertArrayHasKey('icon_url', $data2);
|
| 142 |
+
$this->assertSame('http://github.com/Seldaek/monolog', $data2['icon_url']);
|
| 143 |
+
}
|
| 144 |
+
|
| 145 |
+
public function testAttachmentsNotPresentIfNoAttachment()
|
| 146 |
+
{
|
| 147 |
+
$record = new SlackRecord(null, null, false);
|
| 148 |
+
$data = $record->getSlackData($this->getRecord());
|
| 149 |
+
|
| 150 |
+
$this->assertArrayNotHasKey('attachments', $data);
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
public function testAddsOneAttachment()
|
| 154 |
+
{
|
| 155 |
+
$record = new SlackRecord();
|
| 156 |
+
$data = $record->getSlackData($this->getRecord());
|
| 157 |
+
|
| 158 |
+
$this->assertArrayHasKey('attachments', $data);
|
| 159 |
+
$this->assertArrayHasKey(0, $data['attachments']);
|
| 160 |
+
$this->assertInternalType('array', $data['attachments'][0]);
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
public function testTextEqualsMessageIfNoAttachment()
|
| 164 |
+
{
|
| 165 |
+
$message = 'Test message';
|
| 166 |
+
$record = new SlackRecord(null, null, false);
|
| 167 |
+
$data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
|
| 168 |
+
|
| 169 |
+
$this->assertArrayHasKey('text', $data);
|
| 170 |
+
$this->assertSame($message, $data['text']);
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
public function testTextEqualsFormatterOutput()
|
| 174 |
+
{
|
| 175 |
+
$formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 176 |
+
$formatter
|
| 177 |
+
->expects($this->any())
|
| 178 |
+
->method('format')
|
| 179 |
+
->will($this->returnCallback(function ($record) { return $record['message'] . 'test'; }));
|
| 180 |
+
|
| 181 |
+
$formatter2 = $this->getMock('Monolog\\Formatter\\FormatterInterface');
|
| 182 |
+
$formatter2
|
| 183 |
+
->expects($this->any())
|
| 184 |
+
->method('format')
|
| 185 |
+
->will($this->returnCallback(function ($record) { return $record['message'] . 'test1'; }));
|
| 186 |
+
|
| 187 |
+
$message = 'Test message';
|
| 188 |
+
$record = new SlackRecord(null, null, false, null, false, false, array(), $formatter);
|
| 189 |
+
$data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
|
| 190 |
+
|
| 191 |
+
$this->assertArrayHasKey('text', $data);
|
| 192 |
+
$this->assertSame($message . 'test', $data['text']);
|
| 193 |
+
|
| 194 |
+
$record->setFormatter($formatter2);
|
| 195 |
+
$data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
|
| 196 |
+
|
| 197 |
+
$this->assertArrayHasKey('text', $data);
|
| 198 |
+
$this->assertSame($message . 'test1', $data['text']);
|
| 199 |
+
}
|
| 200 |
+
|
| 201 |
+
public function testAddsFallbackAndTextToAttachment()
|
| 202 |
+
{
|
| 203 |
+
$message = 'Test message';
|
| 204 |
+
$record = new SlackRecord(null);
|
| 205 |
+
$data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
|
| 206 |
+
|
| 207 |
+
$this->assertSame($message, $data['attachments'][0]['text']);
|
| 208 |
+
$this->assertSame($message, $data['attachments'][0]['fallback']);
|
| 209 |
+
}
|
| 210 |
+
|
| 211 |
+
public function testMapsLevelToColorAttachmentColor()
|
| 212 |
+
{
|
| 213 |
+
$record = new SlackRecord(null);
|
| 214 |
+
$errorLoggerRecord = $this->getRecord(Logger::ERROR);
|
| 215 |
+
$emergencyLoggerRecord = $this->getRecord(Logger::EMERGENCY);
|
| 216 |
+
$warningLoggerRecord = $this->getRecord(Logger::WARNING);
|
| 217 |
+
$infoLoggerRecord = $this->getRecord(Logger::INFO);
|
| 218 |
+
$debugLoggerRecord = $this->getRecord(Logger::DEBUG);
|
| 219 |
+
|
| 220 |
+
$data = $record->getSlackData($errorLoggerRecord);
|
| 221 |
+
$this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']);
|
| 222 |
+
|
| 223 |
+
$data = $record->getSlackData($emergencyLoggerRecord);
|
| 224 |
+
$this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']);
|
| 225 |
+
|
| 226 |
+
$data = $record->getSlackData($warningLoggerRecord);
|
| 227 |
+
$this->assertSame(SlackRecord::COLOR_WARNING, $data['attachments'][0]['color']);
|
| 228 |
+
|
| 229 |
+
$data = $record->getSlackData($infoLoggerRecord);
|
| 230 |
+
$this->assertSame(SlackRecord::COLOR_GOOD, $data['attachments'][0]['color']);
|
| 231 |
+
|
| 232 |
+
$data = $record->getSlackData($debugLoggerRecord);
|
| 233 |
+
$this->assertSame(SlackRecord::COLOR_DEFAULT, $data['attachments'][0]['color']);
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
public function testAddsShortAttachmentWithoutContextAndExtra()
|
| 237 |
+
{
|
| 238 |
+
$level = Logger::ERROR;
|
| 239 |
+
$levelName = Logger::getLevelName($level);
|
| 240 |
+
$record = new SlackRecord(null, null, true, null, true);
|
| 241 |
+
$data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1)));
|
| 242 |
+
|
| 243 |
+
$attachment = $data['attachments'][0];
|
| 244 |
+
$this->assertArrayHasKey('title', $attachment);
|
| 245 |
+
$this->assertArrayHasKey('fields', $attachment);
|
| 246 |
+
$this->assertSame($levelName, $attachment['title']);
|
| 247 |
+
$this->assertSame(array(), $attachment['fields']);
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
public function testAddsShortAttachmentWithContextAndExtra()
|
| 251 |
+
{
|
| 252 |
+
$level = Logger::ERROR;
|
| 253 |
+
$levelName = Logger::getLevelName($level);
|
| 254 |
+
$context = array('test' => 1);
|
| 255 |
+
$extra = array('tags' => array('web'));
|
| 256 |
+
$record = new SlackRecord(null, null, true, null, true, true);
|
| 257 |
+
$loggerRecord = $this->getRecord($level, 'test', $context);
|
| 258 |
+
$loggerRecord['extra'] = $extra;
|
| 259 |
+
$data = $record->getSlackData($loggerRecord);
|
| 260 |
+
|
| 261 |
+
$attachment = $data['attachments'][0];
|
| 262 |
+
$this->assertArrayHasKey('title', $attachment);
|
| 263 |
+
$this->assertArrayHasKey('fields', $attachment);
|
| 264 |
+
$this->assertCount(2, $attachment['fields']);
|
| 265 |
+
$this->assertSame($levelName, $attachment['title']);
|
| 266 |
+
$this->assertSame(
|
| 267 |
+
array(
|
| 268 |
+
array(
|
| 269 |
+
'title' => 'Extra',
|
| 270 |
+
'value' => sprintf('```%s```', json_encode($extra, $this->jsonPrettyPrintFlag)),
|
| 271 |
+
'short' => false
|
| 272 |
+
),
|
| 273 |
+
array(
|
| 274 |
+
'title' => 'Context',
|
| 275 |
+
'value' => sprintf('```%s```', json_encode($context, $this->jsonPrettyPrintFlag)),
|
| 276 |
+
'short' => false
|
| 277 |
+
)
|
| 278 |
+
),
|
| 279 |
+
$attachment['fields']
|
| 280 |
+
);
|
| 281 |
+
}
|
| 282 |
+
|
| 283 |
+
public function testAddsLongAttachmentWithoutContextAndExtra()
|
| 284 |
+
{
|
| 285 |
+
$level = Logger::ERROR;
|
| 286 |
+
$levelName = Logger::getLevelName($level);
|
| 287 |
+
$record = new SlackRecord(null, null, true, null);
|
| 288 |
+
$data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1)));
|
| 289 |
+
|
| 290 |
+
$attachment = $data['attachments'][0];
|
| 291 |
+
$this->assertArrayHasKey('title', $attachment);
|
| 292 |
+
$this->assertArrayHasKey('fields', $attachment);
|
| 293 |
+
$this->assertCount(1, $attachment['fields']);
|
| 294 |
+
$this->assertSame('Message', $attachment['title']);
|
| 295 |
+
$this->assertSame(
|
| 296 |
+
array(array(
|
| 297 |
+
'title' => 'Level',
|
| 298 |
+
'value' => $levelName,
|
| 299 |
+
'short' => false
|
| 300 |
+
)),
|
| 301 |
+
$attachment['fields']
|
| 302 |
+
);
|
| 303 |
+
}
|
| 304 |
+
|
| 305 |
+
public function testAddsLongAttachmentWithContextAndExtra()
|
| 306 |
+
{
|
| 307 |
+
$level = Logger::ERROR;
|
| 308 |
+
$levelName = Logger::getLevelName($level);
|
| 309 |
+
$context = array('test' => 1);
|
| 310 |
+
$extra = array('tags' => array('web'));
|
| 311 |
+
$record = new SlackRecord(null, null, true, null, false, true);
|
| 312 |
+
$loggerRecord = $this->getRecord($level, 'test', $context);
|
| 313 |
+
$loggerRecord['extra'] = $extra;
|
| 314 |
+
$data = $record->getSlackData($loggerRecord);
|
| 315 |
+
|
| 316 |
+
$expectedFields = array(
|
| 317 |
+
array(
|
| 318 |
+
'title' => 'Level',
|
| 319 |
+
'value' => $levelName,
|
| 320 |
+
'short' => false,
|
| 321 |
+
),
|
| 322 |
+
array(
|
| 323 |
+
'title' => 'tags',
|
| 324 |
+
'value' => sprintf('```%s```', json_encode($extra['tags'])),
|
| 325 |
+
'short' => false
|
| 326 |
+
),
|
| 327 |
+
array(
|
| 328 |
+
'title' => 'test',
|
| 329 |
+
'value' => $context['test'],
|
| 330 |
+
'short' => false
|
| 331 |
+
)
|
| 332 |
+
);
|
| 333 |
+
|
| 334 |
+
$attachment = $data['attachments'][0];
|
| 335 |
+
$this->assertArrayHasKey('title', $attachment);
|
| 336 |
+
$this->assertArrayHasKey('fields', $attachment);
|
| 337 |
+
$this->assertCount(3, $attachment['fields']);
|
| 338 |
+
$this->assertSame('Message', $attachment['title']);
|
| 339 |
+
$this->assertSame(
|
| 340 |
+
$expectedFields,
|
| 341 |
+
$attachment['fields']
|
| 342 |
+
);
|
| 343 |
+
}
|
| 344 |
+
|
| 345 |
+
public function testAddsTimestampToAttachment()
|
| 346 |
+
{
|
| 347 |
+
$record = $this->getRecord();
|
| 348 |
+
$slackRecord = new SlackRecord();
|
| 349 |
+
$data = $slackRecord->getSlackData($this->getRecord());
|
| 350 |
+
|
| 351 |
+
$attachment = $data['attachments'][0];
|
| 352 |
+
$this->assertArrayHasKey('ts', $attachment);
|
| 353 |
+
$this->assertSame($record['datetime']->getTimestamp(), $attachment['ts']);
|
| 354 |
+
}
|
| 355 |
+
|
| 356 |
+
public function testExcludeExtraAndContextFields()
|
| 357 |
+
{
|
| 358 |
+
$record = $this->getRecord(
|
| 359 |
+
Logger::WARNING,
|
| 360 |
+
'test',
|
| 361 |
+
array('info' => array('library' => 'monolog', 'author' => 'Jordi'))
|
| 362 |
+
);
|
| 363 |
+
$record['extra'] = array('tags' => array('web', 'cli'));
|
| 364 |
+
|
| 365 |
+
$slackRecord = new SlackRecord(null, null, true, null, false, true, array('context.info.library', 'extra.tags.1'));
|
| 366 |
+
$data = $slackRecord->getSlackData($record);
|
| 367 |
+
$attachment = $data['attachments'][0];
|
| 368 |
+
|
| 369 |
+
$expected = array(
|
| 370 |
+
array(
|
| 371 |
+
'title' => 'info',
|
| 372 |
+
'value' => sprintf('```%s```', json_encode(array('author' => 'Jordi'), $this->jsonPrettyPrintFlag)),
|
| 373 |
+
'short' => false
|
| 374 |
+
),
|
| 375 |
+
array(
|
| 376 |
+
'title' => 'tags',
|
| 377 |
+
'value' => sprintf('```%s```', json_encode(array('web'))),
|
| 378 |
+
'short' => false
|
| 379 |
+
),
|
| 380 |
+
);
|
| 381 |
+
|
| 382 |
+
foreach ($expected as $field) {
|
| 383 |
+
$this->assertNotFalse(array_search($field, $attachment['fields']));
|
| 384 |
+
break;
|
| 385 |
+
}
|
| 386 |
+
}
|
| 387 |
+
}
|
vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
DELETED
|
@@ -1,151 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
use Monolog\Formatter\LineFormatter;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* @author Greg Kedzierski <greg@gregkedzierski.com>
|
| 20 |
-
* @see https://api.slack.com/
|
| 21 |
-
*/
|
| 22 |
-
class SlackHandlerTest extends TestCase
|
| 23 |
-
{
|
| 24 |
-
/**
|
| 25 |
-
* @var resource
|
| 26 |
-
*/
|
| 27 |
-
private $res;
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* @var SlackHandler
|
| 31 |
-
*/
|
| 32 |
-
private $handler;
|
| 33 |
-
|
| 34 |
-
public function setUp()
|
| 35 |
-
{
|
| 36 |
-
if (!extension_loaded('openssl')) {
|
| 37 |
-
$this->markTestSkipped('This test requires openssl to run');
|
| 38 |
-
}
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function testWriteHeader()
|
| 42 |
-
{
|
| 43 |
-
$this->createHandler();
|
| 44 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 45 |
-
fseek($this->res, 0);
|
| 46 |
-
$content = fread($this->res, 1024);
|
| 47 |
-
|
| 48 |
-
$this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function testWriteContent()
|
| 52 |
-
{
|
| 53 |
-
$this->createHandler();
|
| 54 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 55 |
-
fseek($this->res, 0);
|
| 56 |
-
$content = fread($this->res, 1024);
|
| 57 |
-
|
| 58 |
-
$this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
public function testWriteContentUsesFormatterIfProvided()
|
| 62 |
-
{
|
| 63 |
-
$this->createHandler('myToken', 'channel1', 'Monolog', false);
|
| 64 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 65 |
-
fseek($this->res, 0);
|
| 66 |
-
$content = fread($this->res, 1024);
|
| 67 |
-
|
| 68 |
-
$this->createHandler('myToken', 'channel1', 'Monolog', false);
|
| 69 |
-
$this->handler->setFormatter(new LineFormatter('foo--%message%'));
|
| 70 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test2'));
|
| 71 |
-
fseek($this->res, 0);
|
| 72 |
-
$content2 = fread($this->res, 1024);
|
| 73 |
-
|
| 74 |
-
$this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=test1.*$/', $content);
|
| 75 |
-
$this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=foo--test2.*$/', $content2);
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
public function testWriteContentWithEmoji()
|
| 79 |
-
{
|
| 80 |
-
$this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien');
|
| 81 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 82 |
-
fseek($this->res, 0);
|
| 83 |
-
$content = fread($this->res, 1024);
|
| 84 |
-
|
| 85 |
-
$this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content);
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
/**
|
| 89 |
-
* @dataProvider provideLevelColors
|
| 90 |
-
*/
|
| 91 |
-
public function testWriteContentWithColors($level, $expectedColor)
|
| 92 |
-
{
|
| 93 |
-
$this->createHandler();
|
| 94 |
-
$this->handler->handle($this->getRecord($level, 'test1'));
|
| 95 |
-
fseek($this->res, 0);
|
| 96 |
-
$content = fread($this->res, 1024);
|
| 97 |
-
|
| 98 |
-
$this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content);
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
public function testWriteContentWithPlainTextMessage()
|
| 102 |
-
{
|
| 103 |
-
$this->createHandler('myToken', 'channel1', 'Monolog', false);
|
| 104 |
-
$this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
|
| 105 |
-
fseek($this->res, 0);
|
| 106 |
-
$content = fread($this->res, 1024);
|
| 107 |
-
|
| 108 |
-
$this->assertRegexp('/text=test1/', $content);
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
public function provideLevelColors()
|
| 112 |
-
{
|
| 113 |
-
return array(
|
| 114 |
-
array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6
|
| 115 |
-
array(Logger::INFO, 'good'),
|
| 116 |
-
array(Logger::NOTICE, 'good'),
|
| 117 |
-
array(Logger::WARNING, 'warning'),
|
| 118 |
-
array(Logger::ERROR, 'danger'),
|
| 119 |
-
array(Logger::CRITICAL, 'danger'),
|
| 120 |
-
array(Logger::ALERT, 'danger'),
|
| 121 |
-
array(Logger::EMERGENCY,'danger'),
|
| 122 |
-
);
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false)
|
| 126 |
-
{
|
| 127 |
-
$constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra);
|
| 128 |
-
$this->res = fopen('php://memory', 'a');
|
| 129 |
-
$this->handler = $this->getMock(
|
| 130 |
-
'\Monolog\Handler\SlackHandler',
|
| 131 |
-
array('fsockopen', 'streamSetTimeout', 'closeSocket'),
|
| 132 |
-
$constructorArgs
|
| 133 |
-
);
|
| 134 |
-
|
| 135 |
-
$reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
|
| 136 |
-
$reflectionProperty->setAccessible(true);
|
| 137 |
-
$reflectionProperty->setValue($this->handler, 'localhost:1234');
|
| 138 |
-
|
| 139 |
-
$this->handler->expects($this->any())
|
| 140 |
-
->method('fsockopen')
|
| 141 |
-
->will($this->returnValue($this->res));
|
| 142 |
-
$this->handler->expects($this->any())
|
| 143 |
-
->method('streamSetTimeout')
|
| 144 |
-
->will($this->returnValue(true));
|
| 145 |
-
$this->handler->expects($this->any())
|
| 146 |
-
->method('closeSocket')
|
| 147 |
-
->will($this->returnValue(true));
|
| 148 |
-
|
| 149 |
-
$this->handler->setFormatter($this->getIdentityFormatter());
|
| 150 |
-
}
|
| 151 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php
ADDED
|
@@ -0,0 +1,107 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler;
|
| 13 |
+
|
| 14 |
+
use Monolog\TestCase;
|
| 15 |
+
use Monolog\Logger;
|
| 16 |
+
use Monolog\Formatter\LineFormatter;
|
| 17 |
+
use Monolog\Handler\Slack\SlackRecord;
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* @author Haralan Dobrev <hkdobrev@gmail.com>
|
| 21 |
+
* @see https://api.slack.com/incoming-webhooks
|
| 22 |
+
* @coversDefaultClass Monolog\Handler\SlackWebhookHandler
|
| 23 |
+
*/
|
| 24 |
+
class SlackWebhookHandlerTest extends TestCase
|
| 25 |
+
{
|
| 26 |
+
const WEBHOOK_URL = 'https://hooks.slack.com/services/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E';
|
| 27 |
+
|
| 28 |
+
/**
|
| 29 |
+
* @covers ::__construct
|
| 30 |
+
* @covers ::getSlackRecord
|
| 31 |
+
*/
|
| 32 |
+
public function testConstructorMinimal()
|
| 33 |
+
{
|
| 34 |
+
$handler = new SlackWebhookHandler(self::WEBHOOK_URL);
|
| 35 |
+
$record = $this->getRecord();
|
| 36 |
+
$slackRecord = $handler->getSlackRecord();
|
| 37 |
+
$this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord);
|
| 38 |
+
$this->assertEquals(array(
|
| 39 |
+
'attachments' => array(
|
| 40 |
+
array(
|
| 41 |
+
'fallback' => 'test',
|
| 42 |
+
'text' => 'test',
|
| 43 |
+
'color' => SlackRecord::COLOR_WARNING,
|
| 44 |
+
'fields' => array(
|
| 45 |
+
array(
|
| 46 |
+
'title' => 'Level',
|
| 47 |
+
'value' => 'WARNING',
|
| 48 |
+
'short' => false,
|
| 49 |
+
),
|
| 50 |
+
),
|
| 51 |
+
'title' => 'Message',
|
| 52 |
+
'mrkdwn_in' => array('fields'),
|
| 53 |
+
'ts' => $record['datetime']->getTimestamp(),
|
| 54 |
+
),
|
| 55 |
+
),
|
| 56 |
+
), $slackRecord->getSlackData($record));
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
/**
|
| 60 |
+
* @covers ::__construct
|
| 61 |
+
* @covers ::getSlackRecord
|
| 62 |
+
*/
|
| 63 |
+
public function testConstructorFull()
|
| 64 |
+
{
|
| 65 |
+
$handler = new SlackWebhookHandler(
|
| 66 |
+
self::WEBHOOK_URL,
|
| 67 |
+
'test-channel',
|
| 68 |
+
'test-username',
|
| 69 |
+
false,
|
| 70 |
+
':ghost:',
|
| 71 |
+
false,
|
| 72 |
+
false,
|
| 73 |
+
Logger::DEBUG,
|
| 74 |
+
false
|
| 75 |
+
);
|
| 76 |
+
|
| 77 |
+
$slackRecord = $handler->getSlackRecord();
|
| 78 |
+
$this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord);
|
| 79 |
+
$this->assertEquals(array(
|
| 80 |
+
'username' => 'test-username',
|
| 81 |
+
'text' => 'test',
|
| 82 |
+
'channel' => 'test-channel',
|
| 83 |
+
'icon_emoji' => ':ghost:',
|
| 84 |
+
), $slackRecord->getSlackData($this->getRecord()));
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
/**
|
| 88 |
+
* @covers ::getFormatter
|
| 89 |
+
*/
|
| 90 |
+
public function testGetFormatter()
|
| 91 |
+
{
|
| 92 |
+
$handler = new SlackWebhookHandler(self::WEBHOOK_URL);
|
| 93 |
+
$formatter = $handler->getFormatter();
|
| 94 |
+
$this->assertInstanceOf('Monolog\Formatter\FormatterInterface', $formatter);
|
| 95 |
+
}
|
| 96 |
+
|
| 97 |
+
/**
|
| 98 |
+
* @covers ::setFormatter
|
| 99 |
+
*/
|
| 100 |
+
public function testSetFormatter()
|
| 101 |
+
{
|
| 102 |
+
$handler = new SlackWebhookHandler(self::WEBHOOK_URL);
|
| 103 |
+
$formatter = new LineFormatter();
|
| 104 |
+
$handler->setFormatter($formatter);
|
| 105 |
+
$this->assertSame($formatter, $handler->getFormatter());
|
| 106 |
+
}
|
| 107 |
+
}
|
vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php
ADDED
|
@@ -0,0 +1,47 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* This file is part of the Monolog package.
|
| 5 |
+
*
|
| 6 |
+
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
+
*
|
| 8 |
+
* For the full copyright and license information, please view the LICENSE
|
| 9 |
+
* file that was distributed with this source code.
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
namespace Monolog\Handler;
|
| 13 |
+
|
| 14 |
+
use Monolog\TestCase;
|
| 15 |
+
use Monolog\Logger;
|
| 16 |
+
|
| 17 |
+
/**
|
| 18 |
+
* @author Haralan Dobrev <hkdobrev@gmail.com>
|
| 19 |
+
* @see https://slack.com/apps/A0F81R8ET-slackbot
|
| 20 |
+
* @coversDefaultClass Monolog\Handler\SlackbotHandler
|
| 21 |
+
*/
|
| 22 |
+
class SlackbotHandlerTest extends TestCase
|
| 23 |
+
{
|
| 24 |
+
/**
|
| 25 |
+
* @covers ::__construct
|
| 26 |
+
*/
|
| 27 |
+
public function testConstructorMinimal()
|
| 28 |
+
{
|
| 29 |
+
$handler = new SlackbotHandler('test-team', 'test-token', 'test-channel');
|
| 30 |
+
$this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler);
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
/**
|
| 34 |
+
* @covers ::__construct
|
| 35 |
+
*/
|
| 36 |
+
public function testConstructorFull()
|
| 37 |
+
{
|
| 38 |
+
$handler = new SlackbotHandler(
|
| 39 |
+
'test-team',
|
| 40 |
+
'test-token',
|
| 41 |
+
'test-channel',
|
| 42 |
+
Logger::DEBUG,
|
| 43 |
+
false
|
| 44 |
+
);
|
| 45 |
+
$this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler);
|
| 46 |
+
}
|
| 47 |
+
}
|
vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
DELETED
|
@@ -1,309 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @author Pablo de Leon Belloc <pablolb@gmail.com>
|
| 19 |
-
*/
|
| 20 |
-
class SocketHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
/**
|
| 23 |
-
* @var Monolog\Handler\SocketHandler
|
| 24 |
-
*/
|
| 25 |
-
private $handler;
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* @var resource
|
| 29 |
-
*/
|
| 30 |
-
private $res;
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* @expectedException UnexpectedValueException
|
| 34 |
-
*/
|
| 35 |
-
public function testInvalidHostname()
|
| 36 |
-
{
|
| 37 |
-
$this->createHandler('garbage://here');
|
| 38 |
-
$this->writeRecord('data');
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* @expectedException \InvalidArgumentException
|
| 43 |
-
*/
|
| 44 |
-
public function testBadConnectionTimeout()
|
| 45 |
-
{
|
| 46 |
-
$this->createHandler('localhost:1234');
|
| 47 |
-
$this->handler->setConnectionTimeout(-1);
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
public function testSetConnectionTimeout()
|
| 51 |
-
{
|
| 52 |
-
$this->createHandler('localhost:1234');
|
| 53 |
-
$this->handler->setConnectionTimeout(10.1);
|
| 54 |
-
$this->assertEquals(10.1, $this->handler->getConnectionTimeout());
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
/**
|
| 58 |
-
* @expectedException \InvalidArgumentException
|
| 59 |
-
*/
|
| 60 |
-
public function testBadTimeout()
|
| 61 |
-
{
|
| 62 |
-
$this->createHandler('localhost:1234');
|
| 63 |
-
$this->handler->setTimeout(-1);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function testSetTimeout()
|
| 67 |
-
{
|
| 68 |
-
$this->createHandler('localhost:1234');
|
| 69 |
-
$this->handler->setTimeout(10.25);
|
| 70 |
-
$this->assertEquals(10.25, $this->handler->getTimeout());
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
public function testSetWritingTimeout()
|
| 74 |
-
{
|
| 75 |
-
$this->createHandler('localhost:1234');
|
| 76 |
-
$this->handler->setWritingTimeout(10.25);
|
| 77 |
-
$this->assertEquals(10.25, $this->handler->getWritingTimeout());
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
public function testSetConnectionString()
|
| 81 |
-
{
|
| 82 |
-
$this->createHandler('tcp://localhost:9090');
|
| 83 |
-
$this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* @expectedException UnexpectedValueException
|
| 88 |
-
*/
|
| 89 |
-
public function testExceptionIsThrownOnFsockopenError()
|
| 90 |
-
{
|
| 91 |
-
$this->setMockHandler(array('fsockopen'));
|
| 92 |
-
$this->handler->expects($this->once())
|
| 93 |
-
->method('fsockopen')
|
| 94 |
-
->will($this->returnValue(false));
|
| 95 |
-
$this->writeRecord('Hello world');
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/**
|
| 99 |
-
* @expectedException UnexpectedValueException
|
| 100 |
-
*/
|
| 101 |
-
public function testExceptionIsThrownOnPfsockopenError()
|
| 102 |
-
{
|
| 103 |
-
$this->setMockHandler(array('pfsockopen'));
|
| 104 |
-
$this->handler->expects($this->once())
|
| 105 |
-
->method('pfsockopen')
|
| 106 |
-
->will($this->returnValue(false));
|
| 107 |
-
$this->handler->setPersistent(true);
|
| 108 |
-
$this->writeRecord('Hello world');
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
/**
|
| 112 |
-
* @expectedException UnexpectedValueException
|
| 113 |
-
*/
|
| 114 |
-
public function testExceptionIsThrownIfCannotSetTimeout()
|
| 115 |
-
{
|
| 116 |
-
$this->setMockHandler(array('streamSetTimeout'));
|
| 117 |
-
$this->handler->expects($this->once())
|
| 118 |
-
->method('streamSetTimeout')
|
| 119 |
-
->will($this->returnValue(false));
|
| 120 |
-
$this->writeRecord('Hello world');
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* @expectedException RuntimeException
|
| 125 |
-
*/
|
| 126 |
-
public function testWriteFailsOnIfFwriteReturnsFalse()
|
| 127 |
-
{
|
| 128 |
-
$this->setMockHandler(array('fwrite'));
|
| 129 |
-
|
| 130 |
-
$callback = function ($arg) {
|
| 131 |
-
$map = array(
|
| 132 |
-
'Hello world' => 6,
|
| 133 |
-
'world' => false,
|
| 134 |
-
);
|
| 135 |
-
|
| 136 |
-
return $map[$arg];
|
| 137 |
-
};
|
| 138 |
-
|
| 139 |
-
$this->handler->expects($this->exactly(2))
|
| 140 |
-
->method('fwrite')
|
| 141 |
-
->will($this->returnCallback($callback));
|
| 142 |
-
|
| 143 |
-
$this->writeRecord('Hello world');
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* @expectedException RuntimeException
|
| 148 |
-
*/
|
| 149 |
-
public function testWriteFailsIfStreamTimesOut()
|
| 150 |
-
{
|
| 151 |
-
$this->setMockHandler(array('fwrite', 'streamGetMetadata'));
|
| 152 |
-
|
| 153 |
-
$callback = function ($arg) {
|
| 154 |
-
$map = array(
|
| 155 |
-
'Hello world' => 6,
|
| 156 |
-
'world' => 5,
|
| 157 |
-
);
|
| 158 |
-
|
| 159 |
-
return $map[$arg];
|
| 160 |
-
};
|
| 161 |
-
|
| 162 |
-
$this->handler->expects($this->exactly(1))
|
| 163 |
-
->method('fwrite')
|
| 164 |
-
->will($this->returnCallback($callback));
|
| 165 |
-
$this->handler->expects($this->exactly(1))
|
| 166 |
-
->method('streamGetMetadata')
|
| 167 |
-
->will($this->returnValue(array('timed_out' => true)));
|
| 168 |
-
|
| 169 |
-
$this->writeRecord('Hello world');
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
/**
|
| 173 |
-
* @expectedException RuntimeException
|
| 174 |
-
*/
|
| 175 |
-
public function testWriteFailsOnIncompleteWrite()
|
| 176 |
-
{
|
| 177 |
-
$this->setMockHandler(array('fwrite', 'streamGetMetadata'));
|
| 178 |
-
|
| 179 |
-
$res = $this->res;
|
| 180 |
-
$callback = function ($string) use ($res) {
|
| 181 |
-
fclose($res);
|
| 182 |
-
|
| 183 |
-
return strlen('Hello');
|
| 184 |
-
};
|
| 185 |
-
|
| 186 |
-
$this->handler->expects($this->exactly(1))
|
| 187 |
-
->method('fwrite')
|
| 188 |
-
->will($this->returnCallback($callback));
|
| 189 |
-
$this->handler->expects($this->exactly(1))
|
| 190 |
-
->method('streamGetMetadata')
|
| 191 |
-
->will($this->returnValue(array('timed_out' => false)));
|
| 192 |
-
|
| 193 |
-
$this->writeRecord('Hello world');
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
public function testWriteWithMemoryFile()
|
| 197 |
-
{
|
| 198 |
-
$this->setMockHandler();
|
| 199 |
-
$this->writeRecord('test1');
|
| 200 |
-
$this->writeRecord('test2');
|
| 201 |
-
$this->writeRecord('test3');
|
| 202 |
-
fseek($this->res, 0);
|
| 203 |
-
$this->assertEquals('test1test2test3', fread($this->res, 1024));
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
public function testWriteWithMock()
|
| 207 |
-
{
|
| 208 |
-
$this->setMockHandler(array('fwrite'));
|
| 209 |
-
|
| 210 |
-
$callback = function ($arg) {
|
| 211 |
-
$map = array(
|
| 212 |
-
'Hello world' => 6,
|
| 213 |
-
'world' => 5,
|
| 214 |
-
);
|
| 215 |
-
|
| 216 |
-
return $map[$arg];
|
| 217 |
-
};
|
| 218 |
-
|
| 219 |
-
$this->handler->expects($this->exactly(2))
|
| 220 |
-
->method('fwrite')
|
| 221 |
-
->will($this->returnCallback($callback));
|
| 222 |
-
|
| 223 |
-
$this->writeRecord('Hello world');
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
public function testClose()
|
| 227 |
-
{
|
| 228 |
-
$this->setMockHandler();
|
| 229 |
-
$this->writeRecord('Hello world');
|
| 230 |
-
$this->assertInternalType('resource', $this->res);
|
| 231 |
-
$this->handler->close();
|
| 232 |
-
$this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
|
| 233 |
-
}
|
| 234 |
-
|
| 235 |
-
public function testCloseDoesNotClosePersistentSocket()
|
| 236 |
-
{
|
| 237 |
-
$this->setMockHandler();
|
| 238 |
-
$this->handler->setPersistent(true);
|
| 239 |
-
$this->writeRecord('Hello world');
|
| 240 |
-
$this->assertTrue(is_resource($this->res));
|
| 241 |
-
$this->handler->close();
|
| 242 |
-
$this->assertTrue(is_resource($this->res));
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
/**
|
| 246 |
-
* @expectedException \RuntimeException
|
| 247 |
-
*/
|
| 248 |
-
public function testAvoidInfiniteLoopWhenNoDataIsWrittenForAWritingTimeoutSeconds()
|
| 249 |
-
{
|
| 250 |
-
$this->setMockHandler(array('fwrite', 'streamGetMetadata'));
|
| 251 |
-
|
| 252 |
-
$this->handler->expects($this->any())
|
| 253 |
-
->method('fwrite')
|
| 254 |
-
->will($this->returnValue(0));
|
| 255 |
-
|
| 256 |
-
$this->handler->expects($this->any())
|
| 257 |
-
->method('streamGetMetadata')
|
| 258 |
-
->will($this->returnValue(array('timed_out' => false)));
|
| 259 |
-
|
| 260 |
-
$this->handler->setWritingTimeout(1);
|
| 261 |
-
|
| 262 |
-
$this->writeRecord('Hello world');
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
private function createHandler($connectionString)
|
| 266 |
-
{
|
| 267 |
-
$this->handler = new SocketHandler($connectionString);
|
| 268 |
-
$this->handler->setFormatter($this->getIdentityFormatter());
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
private function writeRecord($string)
|
| 272 |
-
{
|
| 273 |
-
$this->handler->handle($this->getRecord(Logger::WARNING, $string));
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
private function setMockHandler(array $methods = array())
|
| 277 |
-
{
|
| 278 |
-
$this->res = fopen('php://memory', 'a');
|
| 279 |
-
|
| 280 |
-
$defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
|
| 281 |
-
$newMethods = array_diff($methods, $defaultMethods);
|
| 282 |
-
|
| 283 |
-
$finalMethods = array_merge($defaultMethods, $newMethods);
|
| 284 |
-
|
| 285 |
-
$this->handler = $this->getMock(
|
| 286 |
-
'\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
|
| 287 |
-
);
|
| 288 |
-
|
| 289 |
-
if (!in_array('fsockopen', $methods)) {
|
| 290 |
-
$this->handler->expects($this->any())
|
| 291 |
-
->method('fsockopen')
|
| 292 |
-
->will($this->returnValue($this->res));
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
if (!in_array('pfsockopen', $methods)) {
|
| 296 |
-
$this->handler->expects($this->any())
|
| 297 |
-
->method('pfsockopen')
|
| 298 |
-
->will($this->returnValue($this->res));
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
if (!in_array('streamSetTimeout', $methods)) {
|
| 302 |
-
$this->handler->expects($this->any())
|
| 303 |
-
->method('streamSetTimeout')
|
| 304 |
-
->will($this->returnValue(true));
|
| 305 |
-
}
|
| 306 |
-
|
| 307 |
-
$this->handler->setFormatter($this->getIdentityFormatter());
|
| 308 |
-
}
|
| 309 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
DELETED
|
@@ -1,184 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class StreamHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 21 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 22 |
-
*/
|
| 23 |
-
public function testWrite()
|
| 24 |
-
{
|
| 25 |
-
$handle = fopen('php://memory', 'a+');
|
| 26 |
-
$handler = new StreamHandler($handle);
|
| 27 |
-
$handler->setFormatter($this->getIdentityFormatter());
|
| 28 |
-
$handler->handle($this->getRecord(Logger::WARNING, 'test'));
|
| 29 |
-
$handler->handle($this->getRecord(Logger::WARNING, 'test2'));
|
| 30 |
-
$handler->handle($this->getRecord(Logger::WARNING, 'test3'));
|
| 31 |
-
fseek($handle, 0);
|
| 32 |
-
$this->assertEquals('testtest2test3', fread($handle, 100));
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
/**
|
| 36 |
-
* @covers Monolog\Handler\StreamHandler::close
|
| 37 |
-
*/
|
| 38 |
-
public function testCloseKeepsExternalHandlersOpen()
|
| 39 |
-
{
|
| 40 |
-
$handle = fopen('php://memory', 'a+');
|
| 41 |
-
$handler = new StreamHandler($handle);
|
| 42 |
-
$this->assertTrue(is_resource($handle));
|
| 43 |
-
$handler->close();
|
| 44 |
-
$this->assertTrue(is_resource($handle));
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* @covers Monolog\Handler\StreamHandler::close
|
| 49 |
-
*/
|
| 50 |
-
public function testClose()
|
| 51 |
-
{
|
| 52 |
-
$handler = new StreamHandler('php://memory');
|
| 53 |
-
$handler->handle($this->getRecord(Logger::WARNING, 'test'));
|
| 54 |
-
$streamProp = new \ReflectionProperty('Monolog\Handler\StreamHandler', 'stream');
|
| 55 |
-
$streamProp->setAccessible(true);
|
| 56 |
-
$handle = $streamProp->getValue($handler);
|
| 57 |
-
|
| 58 |
-
$this->assertTrue(is_resource($handle));
|
| 59 |
-
$handler->close();
|
| 60 |
-
$this->assertFalse(is_resource($handle));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 65 |
-
*/
|
| 66 |
-
public function testWriteCreatesTheStreamResource()
|
| 67 |
-
{
|
| 68 |
-
$handler = new StreamHandler('php://memory');
|
| 69 |
-
$handler->handle($this->getRecord());
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/**
|
| 73 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 74 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 75 |
-
*/
|
| 76 |
-
public function testWriteLocking()
|
| 77 |
-
{
|
| 78 |
-
$temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log';
|
| 79 |
-
$handler = new StreamHandler($temp, Logger::DEBUG, true, null, true);
|
| 80 |
-
$handler->handle($this->getRecord());
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* @expectedException LogicException
|
| 85 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 86 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 87 |
-
*/
|
| 88 |
-
public function testWriteMissingResource()
|
| 89 |
-
{
|
| 90 |
-
$handler = new StreamHandler(null);
|
| 91 |
-
$handler->handle($this->getRecord());
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
public function invalidArgumentProvider()
|
| 95 |
-
{
|
| 96 |
-
return array(
|
| 97 |
-
array(1),
|
| 98 |
-
array(array()),
|
| 99 |
-
array(array('bogus://url')),
|
| 100 |
-
);
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
/**
|
| 104 |
-
* @dataProvider invalidArgumentProvider
|
| 105 |
-
* @expectedException InvalidArgumentException
|
| 106 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 107 |
-
*/
|
| 108 |
-
public function testWriteInvalidArgument($invalidArgument)
|
| 109 |
-
{
|
| 110 |
-
$handler = new StreamHandler($invalidArgument);
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
/**
|
| 114 |
-
* @expectedException UnexpectedValueException
|
| 115 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 116 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 117 |
-
*/
|
| 118 |
-
public function testWriteInvalidResource()
|
| 119 |
-
{
|
| 120 |
-
$handler = new StreamHandler('bogus://url');
|
| 121 |
-
$handler->handle($this->getRecord());
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
/**
|
| 125 |
-
* @expectedException UnexpectedValueException
|
| 126 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 127 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 128 |
-
*/
|
| 129 |
-
public function testWriteNonExistingResource()
|
| 130 |
-
{
|
| 131 |
-
$handler = new StreamHandler('ftp://foo/bar/baz/'.rand(0, 10000));
|
| 132 |
-
$handler->handle($this->getRecord());
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/**
|
| 136 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 137 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 138 |
-
*/
|
| 139 |
-
public function testWriteNonExistingPath()
|
| 140 |
-
{
|
| 141 |
-
$handler = new StreamHandler(sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
|
| 142 |
-
$handler->handle($this->getRecord());
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
/**
|
| 146 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 147 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 148 |
-
*/
|
| 149 |
-
public function testWriteNonExistingFileResource()
|
| 150 |
-
{
|
| 151 |
-
$handler = new StreamHandler('file://'.sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
|
| 152 |
-
$handler->handle($this->getRecord());
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
/**
|
| 156 |
-
* @expectedException Exception
|
| 157 |
-
* @expectedExceptionMessageRegExp /There is no existing directory at/
|
| 158 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 159 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 160 |
-
*/
|
| 161 |
-
public function testWriteNonExistingAndNotCreatablePath()
|
| 162 |
-
{
|
| 163 |
-
if (defined('PHP_WINDOWS_VERSION_BUILD')) {
|
| 164 |
-
$this->markTestSkipped('Permissions checks can not run on windows');
|
| 165 |
-
}
|
| 166 |
-
$handler = new StreamHandler('/foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
|
| 167 |
-
$handler->handle($this->getRecord());
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
/**
|
| 171 |
-
* @expectedException Exception
|
| 172 |
-
* @expectedExceptionMessageRegExp /There is no existing directory at/
|
| 173 |
-
* @covers Monolog\Handler\StreamHandler::__construct
|
| 174 |
-
* @covers Monolog\Handler\StreamHandler::write
|
| 175 |
-
*/
|
| 176 |
-
public function testWriteNonExistingAndNotCreatableFileResource()
|
| 177 |
-
{
|
| 178 |
-
if (defined('PHP_WINDOWS_VERSION_BUILD')) {
|
| 179 |
-
$this->markTestSkipped('Permissions checks can not run on windows');
|
| 180 |
-
}
|
| 181 |
-
$handler = new StreamHandler('file:///foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
|
| 182 |
-
$handler->handle($this->getRecord());
|
| 183 |
-
}
|
| 184 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php
DELETED
|
@@ -1,113 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
use Monolog\TestCase;
|
| 16 |
-
|
| 17 |
-
class SwiftMailerHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */
|
| 20 |
-
private $mailer;
|
| 21 |
-
|
| 22 |
-
public function setUp()
|
| 23 |
-
{
|
| 24 |
-
$this->mailer = $this
|
| 25 |
-
->getMockBuilder('Swift_Mailer')
|
| 26 |
-
->disableOriginalConstructor()
|
| 27 |
-
->getMock();
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function testMessageCreationIsLazyWhenUsingCallback()
|
| 31 |
-
{
|
| 32 |
-
$this->mailer->expects($this->never())
|
| 33 |
-
->method('send');
|
| 34 |
-
|
| 35 |
-
$callback = function () {
|
| 36 |
-
throw new \RuntimeException('Swift_Message creation callback should not have been called in this test');
|
| 37 |
-
};
|
| 38 |
-
$handler = new SwiftMailerHandler($this->mailer, $callback);
|
| 39 |
-
|
| 40 |
-
$records = array(
|
| 41 |
-
$this->getRecord(Logger::DEBUG),
|
| 42 |
-
$this->getRecord(Logger::INFO),
|
| 43 |
-
);
|
| 44 |
-
$handler->handleBatch($records);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function testMessageCanBeCustomizedGivenLoggedData()
|
| 48 |
-
{
|
| 49 |
-
// Wire Mailer to expect a specific Swift_Message with a customized Subject
|
| 50 |
-
$expectedMessage = new \Swift_Message();
|
| 51 |
-
$this->mailer->expects($this->once())
|
| 52 |
-
->method('send')
|
| 53 |
-
->with($this->callback(function ($value) use ($expectedMessage) {
|
| 54 |
-
return $value instanceof \Swift_Message
|
| 55 |
-
&& $value->getSubject() === 'Emergency'
|
| 56 |
-
&& $value === $expectedMessage;
|
| 57 |
-
}));
|
| 58 |
-
|
| 59 |
-
// Callback dynamically changes subject based on number of logged records
|
| 60 |
-
$callback = function ($content, array $records) use ($expectedMessage) {
|
| 61 |
-
$subject = count($records) > 0 ? 'Emergency' : 'Normal';
|
| 62 |
-
$expectedMessage->setSubject($subject);
|
| 63 |
-
|
| 64 |
-
return $expectedMessage;
|
| 65 |
-
};
|
| 66 |
-
$handler = new SwiftMailerHandler($this->mailer, $callback);
|
| 67 |
-
|
| 68 |
-
// Logging 1 record makes this an Emergency
|
| 69 |
-
$records = array(
|
| 70 |
-
$this->getRecord(Logger::EMERGENCY),
|
| 71 |
-
);
|
| 72 |
-
$handler->handleBatch($records);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
public function testMessageSubjectFormatting()
|
| 76 |
-
{
|
| 77 |
-
// Wire Mailer to expect a specific Swift_Message with a customized Subject
|
| 78 |
-
$messageTemplate = new \Swift_Message();
|
| 79 |
-
$messageTemplate->setSubject('Alert: %level_name% %message%');
|
| 80 |
-
$receivedMessage = null;
|
| 81 |
-
|
| 82 |
-
$this->mailer->expects($this->once())
|
| 83 |
-
->method('send')
|
| 84 |
-
->with($this->callback(function ($value) use (&$receivedMessage) {
|
| 85 |
-
$receivedMessage = $value;
|
| 86 |
-
return true;
|
| 87 |
-
}));
|
| 88 |
-
|
| 89 |
-
$handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
|
| 90 |
-
|
| 91 |
-
$records = array(
|
| 92 |
-
$this->getRecord(Logger::EMERGENCY),
|
| 93 |
-
);
|
| 94 |
-
$handler->handleBatch($records);
|
| 95 |
-
|
| 96 |
-
$this->assertEquals('Alert: EMERGENCY test', $receivedMessage->getSubject());
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
public function testMessageHaveUniqueId()
|
| 100 |
-
{
|
| 101 |
-
$messageTemplate = \Swift_Message::newInstance();
|
| 102 |
-
$handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
|
| 103 |
-
|
| 104 |
-
$method = new \ReflectionMethod('Monolog\Handler\SwiftMailerHandler', 'buildMessage');
|
| 105 |
-
$method->setAccessible(true);
|
| 106 |
-
$method->invokeArgs($handler, array($messageTemplate, array()));
|
| 107 |
-
|
| 108 |
-
$builtMessage1 = $method->invoke($handler, $messageTemplate, array());
|
| 109 |
-
$builtMessage2 = $method->invoke($handler, $messageTemplate, array());
|
| 110 |
-
|
| 111 |
-
$this->assertFalse($builtMessage1->getId() === $builtMessage2->getId(), 'Two different messages have the same id');
|
| 112 |
-
}
|
| 113 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
DELETED
|
@@ -1,44 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\Logger;
|
| 15 |
-
|
| 16 |
-
class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
|
| 17 |
-
{
|
| 18 |
-
/**
|
| 19 |
-
* @covers Monolog\Handler\SyslogHandler::__construct
|
| 20 |
-
*/
|
| 21 |
-
public function testConstruct()
|
| 22 |
-
{
|
| 23 |
-
$handler = new SyslogHandler('test');
|
| 24 |
-
$this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
|
| 25 |
-
|
| 26 |
-
$handler = new SyslogHandler('test', LOG_USER);
|
| 27 |
-
$this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
|
| 28 |
-
|
| 29 |
-
$handler = new SyslogHandler('test', 'user');
|
| 30 |
-
$this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
|
| 31 |
-
|
| 32 |
-
$handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
|
| 33 |
-
$this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* @covers Monolog\Handler\SyslogHandler::__construct
|
| 38 |
-
*/
|
| 39 |
-
public function testConstructInvalidFacility()
|
| 40 |
-
{
|
| 41 |
-
$this->setExpectedException('UnexpectedValueException');
|
| 42 |
-
$handler = new SyslogHandler('test', 'unknown');
|
| 43 |
-
}
|
| 44 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
DELETED
|
@@ -1,49 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* @requires extension sockets
|
| 16 |
-
*/
|
| 17 |
-
class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @expectedException UnexpectedValueException
|
| 21 |
-
*/
|
| 22 |
-
public function testWeValidateFacilities()
|
| 23 |
-
{
|
| 24 |
-
$handler = new SyslogUdpHandler("ip", null, "invalidFacility");
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function testWeSplitIntoLines()
|
| 28 |
-
{
|
| 29 |
-
$handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv");
|
| 30 |
-
$handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter());
|
| 31 |
-
|
| 32 |
-
$socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
|
| 33 |
-
$socket->expects($this->at(0))
|
| 34 |
-
->method('write')
|
| 35 |
-
->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
|
| 36 |
-
$socket->expects($this->at(1))
|
| 37 |
-
->method('write')
|
| 38 |
-
->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
|
| 39 |
-
|
| 40 |
-
$handler->setSocket($socket);
|
| 41 |
-
|
| 42 |
-
$handler->handle($this->getRecordWithMessage("hej\nlol"));
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
protected function getRecordWithMessage($msg)
|
| 46 |
-
{
|
| 47 |
-
return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol');
|
| 48 |
-
}
|
| 49 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
DELETED
|
@@ -1,66 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @covers Monolog\Handler\TestHandler
|
| 19 |
-
*/
|
| 20 |
-
class TestHandlerTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
/**
|
| 23 |
-
* @dataProvider methodProvider
|
| 24 |
-
*/
|
| 25 |
-
public function testHandler($method, $level)
|
| 26 |
-
{
|
| 27 |
-
$handler = new TestHandler;
|
| 28 |
-
$record = $this->getRecord($level, 'test'.$method);
|
| 29 |
-
$this->assertFalse($handler->{'has'.$method}($record), 'has'.$method);
|
| 30 |
-
$this->assertFalse($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
|
| 31 |
-
$this->assertFalse($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
|
| 32 |
-
return true;
|
| 33 |
-
}), 'has'.$method.'ThatPasses');
|
| 34 |
-
$this->assertFalse($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
|
| 35 |
-
$this->assertFalse($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
|
| 36 |
-
$handler->handle($record);
|
| 37 |
-
|
| 38 |
-
$this->assertFalse($handler->{'has'.$method}('bar'), 'has'.$method);
|
| 39 |
-
$this->assertTrue($handler->{'has'.$method}($record), 'has'.$method);
|
| 40 |
-
$this->assertTrue($handler->{'has'.$method}('test'.$method), 'has'.$method);
|
| 41 |
-
$this->assertTrue($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
|
| 42 |
-
$this->assertTrue($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
|
| 43 |
-
return true;
|
| 44 |
-
}), 'has'.$method.'ThatPasses');
|
| 45 |
-
$this->assertTrue($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
|
| 46 |
-
$this->assertTrue($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
|
| 47 |
-
|
| 48 |
-
$records = $handler->getRecords();
|
| 49 |
-
unset($records[0]['formatted']);
|
| 50 |
-
$this->assertEquals(array($record), $records);
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function methodProvider()
|
| 54 |
-
{
|
| 55 |
-
return array(
|
| 56 |
-
array('Emergency', Logger::EMERGENCY),
|
| 57 |
-
array('Alert' , Logger::ALERT),
|
| 58 |
-
array('Critical' , Logger::CRITICAL),
|
| 59 |
-
array('Error' , Logger::ERROR),
|
| 60 |
-
array('Warning' , Logger::WARNING),
|
| 61 |
-
array('Info' , Logger::INFO),
|
| 62 |
-
array('Notice' , Logger::NOTICE),
|
| 63 |
-
array('Debug' , Logger::DEBUG),
|
| 64 |
-
);
|
| 65 |
-
}
|
| 66 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
DELETED
|
@@ -1,64 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Handler\SyslogUdp\UdpSocket;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @requires extension sockets
|
| 19 |
-
*/
|
| 20 |
-
class UdpSocketTest extends TestCase
|
| 21 |
-
{
|
| 22 |
-
public function testWeDoNotTruncateShortMessages()
|
| 23 |
-
{
|
| 24 |
-
$socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
|
| 25 |
-
|
| 26 |
-
$socket->expects($this->at(0))
|
| 27 |
-
->method('send')
|
| 28 |
-
->with("HEADER: The quick brown fox jumps over the lazy dog");
|
| 29 |
-
|
| 30 |
-
$socket->write("The quick brown fox jumps over the lazy dog", "HEADER: ");
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function testLongMessagesAreTruncated()
|
| 34 |
-
{
|
| 35 |
-
$socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
|
| 36 |
-
|
| 37 |
-
$truncatedString = str_repeat("derp", 16254).'d';
|
| 38 |
-
|
| 39 |
-
$socket->expects($this->exactly(1))
|
| 40 |
-
->method('send')
|
| 41 |
-
->with("HEADER" . $truncatedString);
|
| 42 |
-
|
| 43 |
-
$longString = str_repeat("derp", 20000);
|
| 44 |
-
|
| 45 |
-
$socket->write($longString, "HEADER");
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
public function testDoubleCloseDoesNotError()
|
| 49 |
-
{
|
| 50 |
-
$socket = new UdpSocket('127.0.0.1', 514);
|
| 51 |
-
$socket->close();
|
| 52 |
-
$socket->close();
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* @expectedException LogicException
|
| 57 |
-
*/
|
| 58 |
-
public function testWriteAfterCloseErrors()
|
| 59 |
-
{
|
| 60 |
-
$socket = new UdpSocket('127.0.0.1', 514);
|
| 61 |
-
$socket->close();
|
| 62 |
-
$socket->write('foo', "HEADER");
|
| 63 |
-
}
|
| 64 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
DELETED
|
@@ -1,121 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog\Handler;
|
| 13 |
-
|
| 14 |
-
use Monolog\TestCase;
|
| 15 |
-
use Monolog\Logger;
|
| 16 |
-
|
| 17 |
-
class WhatFailureGroupHandlerTest extends TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::__construct
|
| 21 |
-
* @expectedException InvalidArgumentException
|
| 22 |
-
*/
|
| 23 |
-
public function testConstructorOnlyTakesHandler()
|
| 24 |
-
{
|
| 25 |
-
new WhatFailureGroupHandler(array(new TestHandler(), "foo"));
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::__construct
|
| 30 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::handle
|
| 31 |
-
*/
|
| 32 |
-
public function testHandle()
|
| 33 |
-
{
|
| 34 |
-
$testHandlers = array(new TestHandler(), new TestHandler());
|
| 35 |
-
$handler = new WhatFailureGroupHandler($testHandlers);
|
| 36 |
-
$handler->handle($this->getRecord(Logger::DEBUG));
|
| 37 |
-
$handler->handle($this->getRecord(Logger::INFO));
|
| 38 |
-
foreach ($testHandlers as $test) {
|
| 39 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 40 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 41 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 42 |
-
}
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
|
| 47 |
-
*/
|
| 48 |
-
public function testHandleBatch()
|
| 49 |
-
{
|
| 50 |
-
$testHandlers = array(new TestHandler(), new TestHandler());
|
| 51 |
-
$handler = new WhatFailureGroupHandler($testHandlers);
|
| 52 |
-
$handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
|
| 53 |
-
foreach ($testHandlers as $test) {
|
| 54 |
-
$this->assertTrue($test->hasDebugRecords());
|
| 55 |
-
$this->assertTrue($test->hasInfoRecords());
|
| 56 |
-
$this->assertTrue(count($test->getRecords()) === 2);
|
| 57 |
-
}
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::isHandling
|
| 62 |
-
*/
|
| 63 |
-
public function testIsHandling()
|
| 64 |
-
{
|
| 65 |
-
$testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
|
| 66 |
-
$handler = new WhatFailureGroupHandler($testHandlers);
|
| 67 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
|
| 68 |
-
$this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
|
| 69 |
-
$this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
/**
|
| 73 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::handle
|
| 74 |
-
*/
|
| 75 |
-
public function testHandleUsesProcessors()
|
| 76 |
-
{
|
| 77 |
-
$test = new TestHandler();
|
| 78 |
-
$handler = new WhatFailureGroupHandler(array($test));
|
| 79 |
-
$handler->pushProcessor(function ($record) {
|
| 80 |
-
$record['extra']['foo'] = true;
|
| 81 |
-
|
| 82 |
-
return $record;
|
| 83 |
-
});
|
| 84 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 85 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 86 |
-
$records = $test->getRecords();
|
| 87 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
* @covers Monolog\Handler\WhatFailureGroupHandler::handle
|
| 92 |
-
*/
|
| 93 |
-
public function testHandleException()
|
| 94 |
-
{
|
| 95 |
-
$test = new TestHandler();
|
| 96 |
-
$exception = new ExceptionTestHandler();
|
| 97 |
-
$handler = new WhatFailureGroupHandler(array($exception, $test, $exception));
|
| 98 |
-
$handler->pushProcessor(function ($record) {
|
| 99 |
-
$record['extra']['foo'] = true;
|
| 100 |
-
|
| 101 |
-
return $record;
|
| 102 |
-
});
|
| 103 |
-
$handler->handle($this->getRecord(Logger::WARNING));
|
| 104 |
-
$this->assertTrue($test->hasWarningRecords());
|
| 105 |
-
$records = $test->getRecords();
|
| 106 |
-
$this->assertTrue($records[0]['extra']['foo']);
|
| 107 |
-
}
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
class ExceptionTestHandler extends TestHandler
|
| 111 |
-
{
|
| 112 |
-
/**
|
| 113 |
-
* {@inheritdoc}
|
| 114 |
-
*/
|
| 115 |
-
public function handle(array $record)
|
| 116 |
-
{
|
| 117 |
-
parent::handle($record);
|
| 118 |
-
|
| 119 |
-
throw new \Exception("ExceptionTestHandler::handle");
|
| 120 |
-
}
|
| 121 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
DELETED
|
@@ -1,69 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/*
|
| 3 |
-
* This file is part of the Monolog package.
|
| 4 |
-
*
|
| 5 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 6 |
-
*
|
| 7 |
-
* For the full copyright and license information, please view the LICENSE
|
| 8 |
-
* file that was distributed with this source code.
|
| 9 |
-
*/
|
| 10 |
-
|
| 11 |
-
namespace Monolog\Handler;
|
| 12 |
-
|
| 13 |
-
use Monolog\TestCase;
|
| 14 |
-
|
| 15 |
-
class ZendMonitorHandlerTest extends TestCase
|
| 16 |
-
{
|
| 17 |
-
protected $zendMonitorHandler;
|
| 18 |
-
|
| 19 |
-
public function setUp()
|
| 20 |
-
{
|
| 21 |
-
if (!function_exists('zend_monitor_custom_event')) {
|
| 22 |
-
$this->markTestSkipped('ZendServer is not installed');
|
| 23 |
-
}
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* @covers Monolog\Handler\ZendMonitorHandler::write
|
| 28 |
-
*/
|
| 29 |
-
public function testWrite()
|
| 30 |
-
{
|
| 31 |
-
$record = $this->getRecord();
|
| 32 |
-
$formatterResult = array(
|
| 33 |
-
'message' => $record['message'],
|
| 34 |
-
);
|
| 35 |
-
|
| 36 |
-
$zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
|
| 37 |
-
->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
|
| 38 |
-
->getMock();
|
| 39 |
-
|
| 40 |
-
$formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
|
| 41 |
-
->disableOriginalConstructor()
|
| 42 |
-
->getMock();
|
| 43 |
-
|
| 44 |
-
$formatterMock->expects($this->once())
|
| 45 |
-
->method('format')
|
| 46 |
-
->will($this->returnValue($formatterResult));
|
| 47 |
-
|
| 48 |
-
$zendMonitor->expects($this->once())
|
| 49 |
-
->method('getDefaultFormatter')
|
| 50 |
-
->will($this->returnValue($formatterMock));
|
| 51 |
-
|
| 52 |
-
$levelMap = $zendMonitor->getLevelMap();
|
| 53 |
-
|
| 54 |
-
$zendMonitor->expects($this->once())
|
| 55 |
-
->method('writeZendMonitorCustomEvent')
|
| 56 |
-
->with($levelMap[$record['level']], $record['message'], $formatterResult);
|
| 57 |
-
|
| 58 |
-
$zendMonitor->handle($record);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
|
| 63 |
-
*/
|
| 64 |
-
public function testGetDefaultFormatterReturnsNormalizerFormatter()
|
| 65 |
-
{
|
| 66 |
-
$zendMonitor = new ZendMonitorHandler();
|
| 67 |
-
$this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
|
| 68 |
-
}
|
| 69 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/monolog/monolog/tests/Monolog/LoggerTest.php
DELETED
|
@@ -1,548 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
/*
|
| 4 |
-
* This file is part of the Monolog package.
|
| 5 |
-
*
|
| 6 |
-
* (c) Jordi Boggiano <j.boggiano@seld.be>
|
| 7 |
-
*
|
| 8 |
-
* For the full copyright and license information, please view the LICENSE
|
| 9 |
-
* file that was distributed with this source code.
|
| 10 |
-
*/
|
| 11 |
-
|
| 12 |
-
namespace Monolog;
|
| 13 |
-
|
| 14 |
-
use Monolog\Processor\WebProcessor;
|
| 15 |
-
use Monolog\Handler\TestHandler;
|
| 16 |
-
|
| 17 |
-
class LoggerTest extends \PHPUnit_Framework_TestCase
|
| 18 |
-
{
|
| 19 |
-
/**
|
| 20 |
-
* @covers Monolog\Logger::getName
|
| 21 |
-
*/
|
| 22 |
-
public function testGetName()
|
| 23 |
-
{
|
| 24 |
-
$logger = new Logger('foo');
|
| 25 |
-
$this->assertEquals('foo', $logger->getName());
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* @covers Monolog\Logger::getLevelName
|
| 30 |
-
*/
|
| 31 |
-
public function testGetLevelName()
|
| 32 |
-
{
|
| 33 |
-
$this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR));
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* @covers Monolog\Logger::withName
|
| 38 |
-
*/
|
| 39 |
-
public function testWithName()
|
| 40 |
-
{
|
| 41 |
-
$first = new Logger('first', array($handler = new TestHandler()));
|
| 42 |
-
$second = $first->withName('second');
|
| 43 |
-
|
| 44 |
-
$this->assertSame('first', $first->getName());
|
| 45 |
-
$this->assertSame('second', $second->getName());
|
| 46 |
-
$this->assertSame($handler, $second->popHandler());
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* @covers Monolog\Logger::toMonologLevel
|
| 51 |
-
*/
|
| 52 |
-
public function testConvertPSR3ToMonologLevel()
|
| 53 |
-
{
|
| 54 |
-
$this->assertEquals(Logger::toMonologLevel('debug'), 100);
|
| 55 |
-
$this->assertEquals(Logger::toMonologLevel('info'), 200);
|
| 56 |
-
$this->assertEquals(Logger::toMonologLevel('notice'), 250);
|
| 57 |
-
$this->assertEquals(Logger::toMonologLevel('warning'), 300);
|
| 58 |
-
$this->assertEquals(Logger::toMonologLevel('error'), 400);
|
| 59 |
-
$this->assertEquals(Logger::toMonologLevel('critical'), 500);
|
| 60 |
-
$this->assertEquals(Logger::toMonologLevel('alert'), 550);
|
| 61 |
-
$this->assertEquals(Logger::toMonologLevel('emergency'), 600);
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* @covers Monolog\Logger::getLevelName
|
| 66 |
-
* @expectedException InvalidArgumentException
|
| 67 |
-
*/
|
| 68 |
-
public function testGetLevelNameThrows()
|
| 69 |
-
{
|
| 70 |
-
Logger::getLevelName(5);
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* @covers Monolog\Logger::__construct
|
| 75 |
-
*/
|
| 76 |
-
public function testChannel()
|
| 77 |
-
{
|
| 78 |
-
$logger = new Logger('foo');
|
| 79 |
-
$handler = new TestHandler;
|
| 80 |
-
$logger->pushHandler($handler);
|
| 81 |
-
$logger->addWarning('test');
|
| 82 |
-
list($record) = $handler->getRecords();
|
| 83 |
-
$this->assertEquals('foo', $record['channel']);
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* @covers Monolog\Logger::addRecord
|
| 88 |
-
*/
|
| 89 |
-
public function testLog()
|
| 90 |
-
{
|
| 91 |
-
$logger = new Logger(__METHOD__);
|
| 92 |
-
|
| 93 |
-
$handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
|
| 94 |
-
$handler->expects($this->once())
|
| 95 |
-
->method('handle');
|
| 96 |
-
$logger->pushHandler($handler);
|
| 97 |
-
|
| 98 |
-
$this->assertTrue($logger->addWarning('test'));
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
/**
|
| 102 |
-
* @covers Monolog\Logger::addRecord
|
| 103 |
-
*/
|
| 104 |
-
public function testLogNotHandled()
|
| 105 |
-
{
|
| 106 |
-
$logger = new Logger(__METHOD__);
|
| 107 |
-
|
| 108 |
-
$handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
|
| 109 |
-
$handler->expects($this->never())
|
| 110 |
-
->method('handle');
|
| 111 |
-
$logger->pushHandler($handler);
|
| 112 |
-
|
| 113 |
-
$this->assertFalse($logger->addWarning('test'));
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
public function testHandlersInCtor()
|
| 117 |
-
{
|
| 118 |
-
$handler1 = new TestHandler;
|
| 119 |
-
$handler2 = new TestHandler;
|
| 120 |
-
$logger = new Logger(__METHOD__, array($handler1, $handler2));
|
| 121 |
-
|
| 122 |
-
$this->assertEquals($handler1, $logger->popHandler());
|
| 123 |
-
$this->assertEquals($handler2, $logger->popHandler());
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
public function testProcessorsInCtor()
|
| 127 |
-
{
|
| 128 |
-
$processor1 = new WebProcessor;
|
| 129 |
-
$processor2 = new WebProcessor;
|
| 130 |
-
$logger = new Logger(__METHOD__, array(), array($processor1, $processor2));
|
| 131 |
-
|
| 132 |
-
$this->assertEquals($processor1, $logger->popProcessor());
|
| 133 |
-
$this->assertEquals($processor2, $logger->popProcessor());
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
/**
|
| 137 |
-
* @covers Monolog\Logger::pushHandler
|
| 138 |
-
* @covers Monolog\Logger::popHandler
|
| 139 |
-
* @expectedException LogicException
|
| 140 |
-
*/
|
| 141 |
-
public function testPushPopHandler()
|
| 142 |
-
{
|
| 143 |
-
$logger = new Logger(__METHOD__);
|
| 144 |
-
$handler1 = new TestHandler;
|
| 145 |
-
$handler2 = new TestHandler;
|
| 146 |
-
|
| 147 |
-
$logger->pushHandler($handler1);
|
| 148 |
-
$logger->pushHandler($handler2);
|
| 149 |
-
|
| 150 |
-
$this->assertEquals($handler2, $logger->popHandler());
|
| 151 |
-
$this->assertEquals($handler1, $logger->popHandler());
|
| 152 |
-
$logger->popHandler();
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
/**
|
| 156 |
-
* @covers Monolog\Logger::setHandlers
|
| 157 |
-
*/
|
| 158 |
-
public function testSetHandlers()
|
| 159 |
-
{
|
| 160 |
-
$logger = new Logger(__METHOD__);
|
| 161 |
-
$handler1 = new TestHandler;
|
| 162 |
-
$handler2 = new TestHandler;
|
| 163 |
-
|
| 164 |
-
$logger->pushHandler($handler1);
|
| 165 |
-
$logger->setHandlers(array($handler2));
|
| 166 |
-
|
| 167 |
-
// handler1 has been removed
|
| 168 |
-
$this->assertEquals(array($handler2), $logger->getHandlers());
|
| 169 |
-
|
| 170 |
-
$logger->setHandlers(array(
|
| 171 |
-
"AMapKey" => $handler1,
|
| 172 |
-
"Woop" => $handler2,
|
| 173 |
-
));
|
| 174 |
-
|
| 175 |
-
// Keys have been scrubbed
|
| 176 |
-
$this->assertEquals(array($handler1, $handler2), $logger->getHandlers());
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
/**
|
| 180 |
-
* @covers Monolog\Logger::pushProcessor
|
| 181 |
-
* @covers Monolog\Logger::popProcessor
|
| 182 |
-
* @expectedException LogicException
|
| 183 |
-
*/
|
| 184 |
-
public function testPushPopProcessor()
|
| 185 |
-
{
|
| 186 |
-
$logger = new Logger(__METHOD__);
|
| 187 |
-
$processor1 = new WebProcessor;
|
| 188 |
-
$processor2 = new WebProcessor;
|
| 189 |
-
|
| 190 |
-
$logger->pushProcessor($processor1);
|
| 191 |
-
$logger->pushProcessor($processor2);
|
| 192 |
-
|
| 193 |
-
$this->assertEquals($processor2, $logger->popProcessor());
|
| 194 |
-
$this->assertEquals($processor1, $logger->popProcessor());
|
| 195 |
-
$logger->popProcessor();
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
/**
|
| 199 |
-
* @covers Monolog\Logger::pushProcessor
|
| 200 |
-
* @expectedException InvalidArgumentException
|
| 201 |
-
*/
|
| 202 |
-
public function testPushProcessorWithNonCallable()
|
| 203 |
-
{
|
| 204 |
-
$logger = new Logger(__METHOD__);
|
| 205 |
-
|
| 206 |
-
$logger->pushProcessor(new \stdClass());
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
/**
|
| 210 |
-
* @covers Monolog\Logger::addRecord
|
| 211 |
-
*/
|
| 212 |
-
public function testProcessorsAreExecuted()
|
| 213 |
-
{
|
| 214 |
-
$logger = new Logger(__METHOD__);
|
| 215 |
-
$handler = new TestHandler;
|
| 216 |
-
$logger->pushHandler($handler);
|
| 217 |
-
$logger->pushProcessor(function ($record) {
|
| 218 |
-
$record['extra']['win'] = true;
|
| 219 |
-
|
| 220 |
-
return $record;
|
| 221 |
-
});
|
| 222 |
-
$logger->addError('test');
|
| 223 |
-
list($record) = $handler->getRecords();
|
| 224 |
-
$this->assertTrue($record['extra']['win']);
|
| 225 |
-
}
|
| 226 |
-
|
| 227 |
-
/**
|
| 228 |
-
* @covers Monolog\Logger::addRecord
|
| 229 |
-
*/
|
| 230 |
-
public function testProcessorsAreCalledOnlyOnce()
|
| 231 |
-
{
|
| 232 |
-
$logger = new Logger(__METHOD__);
|
| 233 |
-
$handler = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 234 |
-
$handler->expects($this->any())
|
| 235 |
-
->method('isHandling')
|
| 236 |
-
->will($this->returnValue(true))
|
| 237 |
-
;
|
| 238 |
-
$handler->expects($this->any())
|
| 239 |
-
->method('handle')
|
| 240 |
-
->will($this->returnValue(true))
|
| 241 |
-
;
|
| 242 |
-
$logger->pushHandler($handler);
|
| 243 |
-
|
| 244 |
-
$processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
|
| 245 |
-
->disableOriginalConstructor()
|
| 246 |
-
->setMethods(array('__invoke'))
|
| 247 |
-
->getMock()
|
| 248 |
-
;
|
| 249 |
-
$processor->expects($this->once())
|
| 250 |
-
->method('__invoke')
|
| 251 |
-
->will($this->returnArgument(0))
|
| 252 |
-
;
|
| 253 |
-
$logger->pushProcessor($processor);
|
| 254 |
-
|
| 255 |
-
$logger->addError('test');
|
| 256 |
-
}
|
| 257 |
-
|
| 258 |
-
/**
|
| 259 |
-
* @covers Monolog\Logger::addRecord
|
| 260 |
-
*/
|
| 261 |
-
public function testProcessorsNotCalledWhenNotHandled()
|
| 262 |
-
{
|
| 263 |
-
$logger = new Logger(__METHOD__);
|
| 264 |
-
$handler = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 265 |
-
$handler->expects($this->once())
|
| 266 |
-
->method('isHandling')
|
| 267 |
-
->will($this->returnValue(false))
|
| 268 |
-
;
|
| 269 |
-
$logger->pushHandler($handler);
|
| 270 |
-
$that = $this;
|
| 271 |
-
$logger->pushProcessor(function ($record) use ($that) {
|
| 272 |
-
$that->fail('The processor should not be called');
|
| 273 |
-
});
|
| 274 |
-
$logger->addAlert('test');
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
/**
|
| 278 |
-
* @covers Monolog\Logger::addRecord
|
| 279 |
-
*/
|
| 280 |
-
public function testHandlersNotCalledBeforeFirstHandling()
|
| 281 |
-
{
|
| 282 |
-
$logger = new Logger(__METHOD__);
|
| 283 |
-
|
| 284 |
-
$handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 285 |
-
$handler1->expects($this->never())
|
| 286 |
-
->method('isHandling')
|
| 287 |
-
->will($this->returnValue(false))
|
| 288 |
-
;
|
| 289 |
-
$handler1->expects($this->once())
|
| 290 |
-
->method('handle')
|
| 291 |
-
->will($this->returnValue(false))
|
| 292 |
-
;
|
| 293 |
-
$logger->pushHandler($handler1);
|
| 294 |
-
|
| 295 |
-
$handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 296 |
-
$handler2->expects($this->once())
|
| 297 |
-
->method('isHandling')
|
| 298 |
-
->will($this->returnValue(true))
|
| 299 |
-
;
|
| 300 |
-
$handler2->expects($this->once())
|
| 301 |
-
->method('handle')
|
| 302 |
-
->will($this->returnValue(false))
|
| 303 |
-
;
|
| 304 |
-
$logger->pushHandler($handler2);
|
| 305 |
-
|
| 306 |
-
$handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 307 |
-
$handler3->expects($this->once())
|
| 308 |
-
->method('isHandling')
|
| 309 |
-
->will($this->returnValue(false))
|
| 310 |
-
;
|
| 311 |
-
$handler3->expects($this->never())
|
| 312 |
-
->method('handle')
|
| 313 |
-
;
|
| 314 |
-
$logger->pushHandler($handler3);
|
| 315 |
-
|
| 316 |
-
$logger->debug('test');
|
| 317 |
-
}
|
| 318 |
-
|
| 319 |
-
/**
|
| 320 |
-
* @covers Monolog\Logger::addRecord
|
| 321 |
-
*/
|
| 322 |
-
public function testHandlersNotCalledBeforeFirstHandlingWithAssocArray()
|
| 323 |
-
{
|
| 324 |
-
$handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 325 |
-
$handler1->expects($this->never())
|
| 326 |
-
->method('isHandling')
|
| 327 |
-
->will($this->returnValue(false))
|
| 328 |
-
;
|
| 329 |
-
$handler1->expects($this->once())
|
| 330 |
-
->method('handle')
|
| 331 |
-
->will($this->returnValue(false))
|
| 332 |
-
;
|
| 333 |
-
|
| 334 |
-
$handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 335 |
-
$handler2->expects($this->once())
|
| 336 |
-
->method('isHandling')
|
| 337 |
-
->will($this->returnValue(true))
|
| 338 |
-
;
|
| 339 |
-
$handler2->expects($this->once())
|
| 340 |
-
->method('handle')
|
| 341 |
-
->will($this->returnValue(false))
|
| 342 |
-
;
|
| 343 |
-
|
| 344 |
-
$handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 345 |
-
$handler3->expects($this->once())
|
| 346 |
-
->method('isHandling')
|
| 347 |
-
->will($this->returnValue(false))
|
| 348 |
-
;
|
| 349 |
-
$handler3->expects($this->never())
|
| 350 |
-
->method('handle')
|
| 351 |
-
;
|
| 352 |
-
|
| 353 |
-
$logger = new Logger(__METHOD__, array('last' => $handler3, 'second' => $handler2, 'first' => $handler1));
|
| 354 |
-
|
| 355 |
-
$logger->debug('test');
|
| 356 |
-
}
|
| 357 |
-
|
| 358 |
-
/**
|
| 359 |
-
* @covers Monolog\Logger::addRecord
|
| 360 |
-
*/
|
| 361 |
-
public function testBubblingWhenTheHandlerReturnsFalse()
|
| 362 |
-
{
|
| 363 |
-
$logger = new Logger(__METHOD__);
|
| 364 |
-
|
| 365 |
-
$handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 366 |
-
$handler1->expects($this->any())
|
| 367 |
-
->method('isHandling')
|
| 368 |
-
->will($this->returnValue(true))
|
| 369 |
-
;
|
| 370 |
-
$handler1->expects($this->once())
|
| 371 |
-
->method('handle')
|
| 372 |
-
->will($this->returnValue(false))
|
| 373 |
-
;
|
| 374 |
-
$logger->pushHandler($handler1);
|
| 375 |
-
|
| 376 |
-
$handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
|
| 377 |
-
$handler2->expects($this->any())
|
| 378 |
-
->method('isHandling')
|
| 379 |
-
->will($this->returnValue(true))
|
| 380 |
-
;
|
| 381 |
-
$handler2->expects($this->once())
|
| 382 |
-
->method('handle')
|
| 383 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
