Version Description
2018-08-13 =
FIX: Prevent JavaScript conflict with Yoast SEO
Download this release
Release Info
Developer | buzztone |
Plugin | Contact Form 7 Skins |
Version | 2.0.1 |
Comparing to | |
See all releases |
Code changes from version 2.0 to 2.0.1
- index.php +2 -2
- js/visual.js +7234 -18578
index.php
CHANGED
@@ -3,7 +3,7 @@
|
|
3 |
* Plugin Name: Contact Form 7 Skins
|
4 |
* Plugin URI: http://cf7skins.com
|
5 |
* Description: Adds drag & drop Visual Editor with Templates & Styles to Contact Form 7. Requires Contact Form 7.
|
6 |
-
* Version: 2.0
|
7 |
* Author: Neil Murray
|
8 |
* Author URI: http://cf7skins.com
|
9 |
* License: GPL-2.0+
|
@@ -30,7 +30,7 @@ if ( ! defined( 'ABSPATH' ) ) {
|
|
30 |
*
|
31 |
* @since 0.1.0
|
32 |
*/
|
33 |
-
define( 'CF7SKINS_VERSION', '2.0' );
|
34 |
define( 'CF7SKINS_OPTIONS', 'cf7skins' ); // Database option names
|
35 |
define( 'CF7SKINS_TEXTDOMAIN', 'contact-form-7-skins' );
|
36 |
define( 'CF7SKINS_FEATURE_FILTER', false ); // @since 0.4.0
|
3 |
* Plugin Name: Contact Form 7 Skins
|
4 |
* Plugin URI: http://cf7skins.com
|
5 |
* Description: Adds drag & drop Visual Editor with Templates & Styles to Contact Form 7. Requires Contact Form 7.
|
6 |
+
* Version: 2.0.1
|
7 |
* Author: Neil Murray
|
8 |
* Author URI: http://cf7skins.com
|
9 |
* License: GPL-2.0+
|
30 |
*
|
31 |
* @since 0.1.0
|
32 |
*/
|
33 |
+
define( 'CF7SKINS_VERSION', '2.0.1' );
|
34 |
define( 'CF7SKINS_OPTIONS', 'cf7skins' ); // Database option names
|
35 |
define( 'CF7SKINS_TEXTDOMAIN', 'contact-form-7-skins' );
|
36 |
define( 'CF7SKINS_FEATURE_FILTER', false ); // @since 0.4.0
|
js/visual.js
CHANGED
@@ -1,19044 +1,16571 @@
|
|
1 |
-
/******/ (function(modules) { // webpackBootstrap
|
2 |
-
/******/ // install a JSONP callback for chunk loading
|
3 |
-
/******/ var parentJsonpFunction = window["webpackJsonp"];
|
4 |
-
/******/ window["webpackJsonp"] = function webpackJsonpCallback(chunkIds, moreModules, executeModules) {
|
5 |
-
/******/ // add "moreModules" to the modules object,
|
6 |
-
/******/ // then flag all "chunkIds" as loaded and fire callback
|
7 |
-
/******/ var moduleId, chunkId, i = 0, resolves = [], result;
|
8 |
-
/******/ for(;i < chunkIds.length; i++) {
|
9 |
-
/******/ chunkId = chunkIds[i];
|
10 |
-
/******/ if(installedChunks[chunkId]) {
|
11 |
-
/******/ resolves.push(installedChunks[chunkId][0]);
|
12 |
-
/******/ }
|
13 |
-
/******/ installedChunks[chunkId] = 0;
|
14 |
-
/******/ }
|
15 |
-
/******/ for(moduleId in moreModules) {
|
16 |
-
/******/ if(Object.prototype.hasOwnProperty.call(moreModules, moduleId)) {
|
17 |
-
/******/ modules[moduleId] = moreModules[moduleId];
|
18 |
-
/******/ }
|
19 |
-
/******/ }
|
20 |
-
/******/ if(parentJsonpFunction) parentJsonpFunction(chunkIds, moreModules, executeModules);
|
21 |
-
/******/ while(resolves.length) {
|
22 |
-
/******/ resolves.shift()();
|
23 |
-
/******/ }
|
24 |
-
/******/ if(executeModules) {
|
25 |
-
/******/ for(i=0; i < executeModules.length; i++) {
|
26 |
-
/******/ result = __webpack_require__(__webpack_require__.s = executeModules[i]);
|
27 |
-
/******/ }
|
28 |
-
/******/ }
|
29 |
-
/******/ return result;
|
30 |
-
/******/ };
|
31 |
-
/******/
|
32 |
-
/******/ // The module cache
|
33 |
-
/******/ var installedModules = {};
|
34 |
-
/******/
|
35 |
-
/******/ // objects to store loaded and loading chunks
|
36 |
-
/******/ var installedChunks = {
|
37 |
-
/******/ 1: 0
|
38 |
-
/******/ };
|
39 |
-
/******/
|
40 |
-
/******/ // The require function
|
41 |
-
/******/ function __webpack_require__(moduleId) {
|
42 |
-
/******/
|
43 |
-
/******/ // Check if module is in cache
|
44 |
-
/******/ if(installedModules[moduleId]) {
|
45 |
-
/******/ return installedModules[moduleId].exports;
|
46 |
-
/******/ }
|
47 |
-
/******/ // Create a new module (and put it into the cache)
|
48 |
-
/******/ var module = installedModules[moduleId] = {
|
49 |
-
/******/ i: moduleId,
|
50 |
-
/******/ l: false,
|
51 |
-
/******/ exports: {}
|
52 |
-
/******/ };
|
53 |
-
/******/
|
54 |
-
/******/ // Execute the module function
|
55 |
-
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
56 |
-
/******/
|
57 |
-
/******/ // Flag the module as loaded
|
58 |
-
/******/ module.l = true;
|
59 |
-
/******/
|
60 |
-
/******/ // Return the exports of the module
|
61 |
-
/******/ return module.exports;
|
62 |
-
/******/ }
|
63 |
-
/******/
|
64 |
-
/******/ // This file contains only the entry chunk.
|
65 |
-
/******/ // The chunk loading function for additional chunks
|
66 |
-
/******/ __webpack_require__.e = function requireEnsure(chunkId) {
|
67 |
-
/******/ var installedChunkData = installedChunks[chunkId];
|
68 |
-
/******/ if(installedChunkData === 0) {
|
69 |
-
/******/ return new Promise(function(resolve) { resolve(); });
|
70 |
-
/******/ }
|
71 |
-
/******/
|
72 |
-
/******/ // a Promise means "currently loading".
|
73 |
-
/******/ if(installedChunkData) {
|
74 |
-
/******/ return installedChunkData[2];
|
75 |
-
/******/ }
|
76 |
-
/******/
|
77 |
-
/******/ // setup Promise in chunk cache
|
78 |
-
/******/ var promise = new Promise(function(resolve, reject) {
|
79 |
-
/******/ installedChunkData = installedChunks[chunkId] = [resolve, reject];
|
80 |
-
/******/ });
|
81 |
-
/******/ installedChunkData[2] = promise;
|
82 |
-
/******/
|
83 |
-
/******/ // start chunk loading
|
84 |
-
/******/ var head = document.getElementsByTagName('head')[0];
|
85 |
-
/******/ var script = document.createElement('script');
|
86 |
-
/******/ script.type = 'text/javascript';
|
87 |
-
/******/ script.charset = 'utf-8';
|
88 |
-
/******/ script.async = true;
|
89 |
-
/******/ script.timeout = 120000;
|
90 |
-
/******/
|
91 |
-
/******/ if (__webpack_require__.nc) {
|
92 |
-
/******/ script.setAttribute("nonce", __webpack_require__.nc);
|
93 |
-
/******/ }
|
94 |
-
/******/ script.src = __webpack_require__.p + "dist/" + chunkId + ".js";
|
95 |
-
/******/ var timeout = setTimeout(onScriptComplete, 120000);
|
96 |
-
/******/ script.onerror = script.onload = onScriptComplete;
|
97 |
-
/******/ function onScriptComplete() {
|
98 |
-
/******/ // avoid mem leaks in IE.
|
99 |
-
/******/ script.onerror = script.onload = null;
|
100 |
-
/******/ clearTimeout(timeout);
|
101 |
-
/******/ var chunk = installedChunks[chunkId];
|
102 |
-
/******/ if(chunk !== 0) {
|
103 |
-
/******/ if(chunk) {
|
104 |
-
/******/ chunk[1](new Error('Loading chunk ' + chunkId + ' failed.'));
|
105 |
-
/******/ }
|
106 |
-
/******/ installedChunks[chunkId] = undefined;
|
107 |
-
/******/ }
|
108 |
-
/******/ };
|
109 |
-
/******/ head.appendChild(script);
|
110 |
-
/******/
|
111 |
-
/******/ return promise;
|
112 |
-
/******/ };
|
113 |
-
/******/
|
114 |
-
/******/ // expose the modules object (__webpack_modules__)
|
115 |
-
/******/ __webpack_require__.m = modules;
|
116 |
-
/******/
|
117 |
-
/******/ // expose the module cache
|
118 |
-
/******/ __webpack_require__.c = installedModules;
|
119 |
-
/******/
|
120 |
-
/******/ // define getter function for harmony exports
|
121 |
-
/******/ __webpack_require__.d = function(exports, name, getter) {
|
122 |
-
/******/ if(!__webpack_require__.o(exports, name)) {
|
123 |
-
/******/ Object.defineProperty(exports, name, {
|
124 |
-
/******/ configurable: false,
|
125 |
-
/******/ enumerable: true,
|
126 |
-
/******/ get: getter
|
127 |
-
/******/ });
|
128 |
-
/******/ }
|
129 |
-
/******/ };
|
130 |
-
/******/
|
131 |
-
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
132 |
-
/******/ __webpack_require__.n = function(module) {
|
133 |
-
/******/ var getter = module && module.__esModule ?
|
134 |
-
/******/ function getDefault() { return module['default']; } :
|
135 |
-
/******/ function getModuleExports() { return module; };
|
136 |
-
/******/ __webpack_require__.d(getter, 'a', getter);
|
137 |
-
/******/ return getter;
|
138 |
-
/******/ };
|
139 |
-
/******/
|
140 |
-
/******/ // Object.prototype.hasOwnProperty.call
|
141 |
-
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
|
142 |
-
/******/
|
143 |
-
/******/ // __webpack_public_path__
|
144 |
-
/******/ __webpack_require__.p = "";
|
145 |
-
/******/
|
146 |
-
/******/ // on error function for async loading
|
147 |
-
/******/ __webpack_require__.oe = function(err) { console.error(err); throw err; };
|
148 |
-
/******/
|
149 |
-
/******/ // Load entry module and return exports
|
150 |
-
/******/ return __webpack_require__(__webpack_require__.s =
|
151 |
-
/******/ })
|
152 |
-
/************************************************************************/
|
153 |
-
/******/ ([
|
154 |
-
/* 0 */
|
155 |
-
/***/ (function(module, exports, __webpack_require__) {
|
156 |
-
|
157 |
-
/* WEBPACK VAR INJECTION */(function(process) {/**
|
158 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
159 |
-
*
|
160 |
-
* This source code is licensed under the MIT license found in the
|
161 |
-
* LICENSE file in the root directory of this source tree.
|
162 |
-
*/
|
163 |
-
|
164 |
-
if (process.env.NODE_ENV !== 'production') {
|
165 |
-
var REACT_ELEMENT_TYPE = (typeof Symbol === 'function' &&
|
166 |
-
Symbol.for &&
|
167 |
-
Symbol.for('react.element')) ||
|
168 |
-
0xeac7;
|
169 |
-
|
170 |
-
var isValidElement = function(object) {
|
171 |
-
return typeof object === 'object' &&
|
172 |
-
object !== null &&
|
173 |
-
object.$$typeof === REACT_ELEMENT_TYPE;
|
174 |
-
};
|
175 |
-
|
176 |
-
// By explicitly using `prop-types` you are opting into new development behavior.
|
177 |
-
// http://fb.me/prop-types-in-prod
|
178 |
-
var throwOnDirectAccess = true;
|
179 |
-
module.exports = __webpack_require__(
|
180 |
-
} else {
|
181 |
-
// By explicitly using `prop-types` you are opting into new production behavior.
|
182 |
-
// http://fb.me/prop-types-in-prod
|
183 |
-
module.exports = __webpack_require__(
|
184 |
-
}
|
185 |
-
|
186 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
187 |
-
|
188 |
-
/***/ }),
|
189 |
-
/* 1 */
|
190 |
-
/***/ (function(module, exports, __webpack_require__) {
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
|
209 |
-
|
210 |
-
|
211 |
-
|
212 |
-
|
213 |
-
|
214 |
-
|
215 |
-
|
216 |
-
|
217 |
-
|
218 |
-
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
}
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
var
|
269 |
-
|
270 |
-
|
271 |
-
|
272 |
-
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
-
|
297 |
-
|
298 |
-
|
299 |
-
|
300 |
-
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
|
325 |
-
|
326 |
-
|
327 |
-
|
328 |
-
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
|
335 |
-
|
336 |
-
|
337 |
-
}
|
338 |
-
|
339 |
-
|
340 |
-
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
|
348 |
-
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
}
|
363 |
-
function
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
}
|
373 |
-
try {
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
|
404 |
-
}
|
405 |
-
|
406 |
-
|
407 |
-
|
408 |
-
|
409 |
-
|
410 |
-
|
411 |
-
|
412 |
-
|
413 |
-
|
414 |
-
|
415 |
-
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
-
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
}
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
|
450 |
-
|
451 |
-
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
|
469 |
-
|
470 |
-
|
471 |
-
|
472 |
-
|
473 |
-
|
474 |
-
|
475 |
-
|
476 |
-
|
477 |
-
|
478 |
-
|
479 |
-
|
480 |
-
|
481 |
-
|
482 |
-
|
483 |
-
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
|
503 |
-
|
504 |
-
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
510 |
-
|
511 |
-
|
512 |
-
|
513 |
-
|
514 |
-
|
515 |
-
|
516 |
-
|
517 |
-
|
518 |
-
|
519 |
-
|
520 |
-
|
521 |
-
|
522 |
-
|
523 |
-
|
524 |
-
|
525 |
-
|
526 |
-
|
527 |
-
|
528 |
-
|
529 |
-
|
530 |
-
|
531 |
-
|
532 |
-
|
533 |
-
|
534 |
-
|
535 |
-
|
536 |
-
|
537 |
-
|
538 |
-
|
539 |
-
|
540 |
-
|
541 |
-
|
542 |
-
|
543 |
-
|
544 |
-
|
545 |
-
|
546 |
-
|
547 |
-
|
548 |
-
|
549 |
-
|
550 |
-
|
551 |
-
|
552 |
-
|
553 |
-
|
554 |
-
|
555 |
-
|
556 |
-
|
557 |
-
|
558 |
-
|
559 |
-
|
560 |
-
|
561 |
-
|
562 |
-
|
563 |
-
|
564 |
-
|
565 |
-
|
566 |
-
|
567 |
-
|
568 |
-
|
569 |
-
|
570 |
-
|
571 |
-
|
572 |
-
var
|
573 |
-
|
574 |
-
|
575 |
-
|
576 |
-
|
577 |
-
|
578 |
-
|
579 |
-
|
580 |
-
|
581 |
-
|
582 |
-
|
583 |
-
|
584 |
-
|
585 |
-
|
586 |
-
|
587 |
-
|
588 |
-
|
589 |
-
|
590 |
-
|
591 |
-
|
592 |
-
|
593 |
-
|
594 |
-
|
595 |
-
|
596 |
-
|
597 |
-
|
598 |
-
|
599 |
-
|
600 |
-
|
601 |
-
|
602 |
-
|
603 |
-
|
604 |
-
|
605 |
-
|
606 |
-
|
607 |
-
|
608 |
-
|
609 |
-
|
610 |
-
|
611 |
-
|
612 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, '
|
613 |
-
value:
|
614 |
-
configurable: true
|
615 |
-
});
|
616 |
-
|
617 |
-
var
|
618 |
-
|
619 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, '
|
620 |
-
value:
|
621 |
-
configurable: true
|
622 |
-
});
|
623 |
-
|
624 |
-
var
|
625 |
-
|
626 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, '
|
627 |
-
value:
|
628 |
-
configurable: true
|
629 |
-
});
|
630 |
-
|
631 |
-
|
632 |
-
|
633 |
-
|
634 |
-
|
635 |
-
|
636 |
-
|
637 |
-
|
638 |
-
|
639 |
-
|
640 |
-
|
641 |
-
|
642 |
-
|
643 |
-
|
644 |
-
|
645 |
-
|
646 |
-
|
647 |
-
|
648 |
-
|
649 |
-
|
650 |
-
|
651 |
-
|
652 |
-
|
653 |
-
|
654 |
-
|
655 |
-
|
656 |
-
|
657 |
-
|
658 |
-
|
659 |
-
|
660 |
-
};
|
661 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, '
|
662 |
-
value:
|
663 |
-
configurable: true
|
664 |
-
});
|
665 |
-
var
|
666 |
-
|
667 |
-
|
668 |
-
|
669 |
-
|
670 |
-
|
671 |
-
|
672 |
-
|
673 |
-
|
674 |
-
|
675 |
-
|
676 |
-
|
677 |
-
|
678 |
-
|
679 |
-
|
680 |
-
|
681 |
-
|
682 |
-
|
683 |
-
|
684 |
-
|
685 |
-
|
686 |
-
|
687 |
-
|
688 |
-
|
689 |
-
|
690 |
-
|
691 |
-
|
692 |
-
|
693 |
-
|
694 |
-
|
695 |
-
|
696 |
-
|
697 |
-
|
698 |
-
|
699 |
-
|
700 |
-
|
701 |
-
|
702 |
-
|
703 |
-
|
704 |
-
|
705 |
-
|
706 |
-
|
707 |
-
|
708 |
-
|
709 |
-
|
710 |
-
|
711 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, '
|
712 |
-
value:
|
713 |
-
configurable: true
|
714 |
-
});
|
715 |
-
|
716 |
-
|
717 |
-
|
718 |
-
|
719 |
-
|
720 |
-
|
721 |
-
|
722 |
-
|
723 |
-
|
724 |
-
|
725 |
-
|
726 |
-
|
727 |
-
|
728 |
-
}
|
729 |
-
|
730 |
-
|
731 |
-
|
732 |
-
}
|
733 |
-
|
734 |
-
|
735 |
-
|
736 |
-
|
737 |
-
|
738 |
-
|
739 |
-
|
740 |
-
|
741 |
-
|
742 |
-
|
743 |
-
|
744 |
-
|
745 |
-
|
746 |
-
|
747 |
-
|
748 |
-
|
749 |
-
|
750 |
-
|
751 |
-
|
752 |
-
|
753 |
-
|
754 |
-
|
755 |
-
throw new
|
756 |
-
}
|
757 |
-
|
758 |
-
|
759 |
-
|
760 |
-
|
761 |
-
|
762 |
-
|
763 |
-
|
764 |
-
|
765 |
-
|
766 |
-
|
767 |
-
|
768 |
-
|
769 |
-
|
770 |
-
|
771 |
-
|
772 |
-
|
773 |
-
|
774 |
-
|
775 |
-
|
776 |
-
|
777 |
-
|
778 |
-
|
779 |
-
|
780 |
-
|
781 |
-
|
782 |
-
|
783 |
-
|
784 |
-
|
785 |
-
|
786 |
-
|
787 |
-
|
788 |
-
|
789 |
-
|
790 |
-
|
791 |
-
|
792 |
-
|
793 |
-
|
794 |
-
|
795 |
-
|
796 |
-
|
797 |
-
|
798 |
-
|
799 |
-
|
800 |
-
|
801 |
-
/*
|
802 |
-
|
803 |
-
|
804 |
-
|
805 |
-
|
806 |
-
|
807 |
-
});
|
808 |
-
|
809 |
-
|
810 |
-
|
811 |
-
|
812 |
-
|
813 |
-
|
814 |
-
|
815 |
-
|
816 |
-
|
817 |
-
|
818 |
-
|
819 |
-
|
820 |
-
|
821 |
-
|
822 |
-
|
823 |
-
|
824 |
-
|
825 |
-
|
826 |
-
|
827 |
-
|
828 |
-
|
829 |
-
|
830 |
-
|
831 |
-
|
832 |
-
|
833 |
-
|
834 |
-
|
835 |
-
|
836 |
-
|
837 |
-
|
838 |
-
|
839 |
-
|
840 |
-
|
841 |
-
|
842 |
-
|
843 |
-
|
844 |
-
|
845 |
-
|
846 |
-
|
847 |
-
|
848 |
-
|
849 |
-
|
850 |
-
|
851 |
-
|
852 |
-
|
853 |
-
|
854 |
-
|
855 |
-
|
856 |
-
|
857 |
-
|
858 |
-
|
859 |
-
|
860 |
-
|
861 |
-
|
862 |
-
|
863 |
-
|
864 |
-
|
865 |
-
|
866 |
-
|
867 |
-
|
868 |
-
|
869 |
-
|
870 |
-
|
871 |
-
|
872 |
-
|
873 |
-
|
874 |
-
|
875 |
-
|
876 |
-
|
877 |
-
|
878 |
-
|
879 |
-
|
880 |
-
|
881 |
-
|
882 |
-
|
883 |
-
|
884 |
-
|
885 |
-
|
886 |
-
|
887 |
-
|
888 |
-
|
889 |
-
|
890 |
-
|
891 |
-
|
892 |
-
|
893 |
-
|
894 |
-
|
895 |
-
|
896 |
-
|
897 |
-
|
898 |
-
|
899 |
-
|
900 |
-
|
901 |
-
|
902 |
-
|
903 |
-
|
904 |
-
|
905 |
-
|
906 |
-
|
907 |
-
|
908 |
-
|
909 |
-
|
910 |
-
|
911 |
-
|
912 |
-
|
913 |
-
|
914 |
-
|
915 |
-
|
916 |
-
|
917 |
-
|
918 |
-
|
919 |
-
|
920 |
-
|
921 |
-
|
922 |
-
|
923 |
-
|
924 |
-
|
925 |
-
|
926 |
-
|
927 |
-
|
928 |
-
|
929 |
-
|
930 |
-
|
931 |
-
|
932 |
-
|
933 |
-
|
934 |
-
|
935 |
-
|
936 |
-
|
937 |
-
}
|
938 |
-
|
939 |
-
|
940 |
-
|
941 |
-
|
942 |
-
|
943 |
-
|
944 |
-
|
945 |
-
|
946 |
-
|
947 |
-
|
948 |
-
|
949 |
-
|
950 |
-
|
951 |
-
|
952 |
-
|
953 |
-
|
954 |
-
|
955 |
-
|
956 |
-
|
957 |
-
|
958 |
-
|
959 |
-
|
960 |
-
|
961 |
-
|
962 |
-
|
963 |
-
|
964 |
-
|
965 |
-
|
966 |
-
|
967 |
-
|
968 |
-
|
969 |
-
|
970 |
-
|
971 |
-
|
972 |
-
|
973 |
-
|
974 |
-
|
975 |
-
|
976 |
-
|
977 |
-
|
978 |
-
|
979 |
-
|
980 |
-
|
981 |
-
|
982 |
-
|
983 |
-
|
984 |
-
|
985 |
-
|
986 |
-
|
987 |
-
|
988 |
-
|
989 |
-
|
990 |
-
|
991 |
-
|
992 |
-
var
|
993 |
-
|
994 |
-
|
995 |
-
|
996 |
-
|
997 |
-
|
998 |
-
|
999 |
-
};
|
1000 |
-
|
1001 |
-
|
1002 |
-
|
1003 |
-
|
1004 |
-
|
1005 |
-
|
1006 |
-
var
|
1007 |
-
|
1008 |
-
|
1009 |
-
|
1010 |
-
|
1011 |
-
|
1012 |
-
|
1013 |
-
|
1014 |
-
|
1015 |
-
|
1016 |
-
}
|
1017 |
-
|
1018 |
-
|
1019 |
-
|
1020 |
-
|
1021 |
-
|
1022 |
-
|
1023 |
-
|
1024 |
-
|
1025 |
-
|
1026 |
-
|
1027 |
-
|
1028 |
-
|
1029 |
-
|
1030 |
-
|
1031 |
-
|
1032 |
-
|
1033 |
-
|
1034 |
-
}
|
1035 |
-
|
1036 |
-
}
|
1037 |
-
|
1038 |
-
|
1039 |
-
|
1040 |
-
|
1041 |
-
|
1042 |
-
|
1043 |
-
|
1044 |
-
|
1045 |
-
|
1046 |
-
|
1047 |
-
//
|
1048 |
-
|
1049 |
-
|
1050 |
-
|
1051 |
-
|
1052 |
-
|
1053 |
-
|
1054 |
-
|
1055 |
-
|
1056 |
-
|
1057 |
-
|
1058 |
-
|
1059 |
-
|
1060 |
-
|
1061 |
-
|
1062 |
-
|
1063 |
-
|
1064 |
-
|
1065 |
-
|
1066 |
-
|
1067 |
-
|
1068 |
-
|
1069 |
-
|
1070 |
-
|
1071 |
-
|
1072 |
-
|
1073 |
-
|
1074 |
-
|
1075 |
-
|
1076 |
-
|
1077 |
-
|
1078 |
-
|
1079 |
-
|
1080 |
-
|
1081 |
-
|
1082 |
-
|
1083 |
-
|
1084 |
-
|
1085 |
-
|
1086 |
-
|
1087 |
-
|
1088 |
-
|
1089 |
-
|
1090 |
-
|
1091 |
-
|
1092 |
-
|
1093 |
-
|
1094 |
-
|
1095 |
-
|
1096 |
-
|
1097 |
-
|
1098 |
-
|
1099 |
-
|
1100 |
-
|
1101 |
-
|
1102 |
-
|
1103 |
-
|
1104 |
-
|
1105 |
-
|
1106 |
-
|
1107 |
-
|
1108 |
-
|
1109 |
-
|
1110 |
-
|
1111 |
-
|
1112 |
-
|
1113 |
-
|
1114 |
-
|
1115 |
-
|
1116 |
-
|
1117 |
-
|
1118 |
-
|
1119 |
-
|
1120 |
-
|
1121 |
-
|
1122 |
-
|
1123 |
-
|
1124 |
-
|
1125 |
-
|
1126 |
-
|
1127 |
-
|
1128 |
-
|
1129 |
-
var
|
1130 |
-
|
1131 |
-
|
1132 |
-
|
1133 |
-
|
1134 |
-
|
1135 |
-
|
1136 |
-
|
1137 |
-
|
1138 |
-
|
1139 |
-
|
1140 |
-
|
1141 |
-
|
1142 |
-
|
1143 |
-
|
1144 |
-
|
1145 |
-
|
1146 |
-
|
1147 |
-
|
1148 |
-
|
1149 |
-
|
1150 |
-
|
1151 |
-
|
1152 |
-
|
1153 |
-
|
1154 |
-
}
|
1155 |
-
|
1156 |
-
|
1157 |
-
|
1158 |
-
|
1159 |
-
|
1160 |
-
|
1161 |
-
|
1162 |
-
|
1163 |
-
|
1164 |
-
|
1165 |
-
|
1166 |
-
|
1167 |
-
|
1168 |
-
|
1169 |
-
|
1170 |
-
|
1171 |
-
|
1172 |
-
|
1173 |
-
|
1174 |
-
|
1175 |
-
|
1176 |
-
|
1177 |
-
|
1178 |
-
|
1179 |
-
|
1180 |
-
|
1181 |
-
|
1182 |
-
|
1183 |
-
|
1184 |
-
|
1185 |
-
|
1186 |
-
|
1187 |
-
|
1188 |
-
|
1189 |
-
|
1190 |
-
|
1191 |
-
|
1192 |
-
|
1193 |
-
|
1194 |
-
|
1195 |
-
|
1196 |
-
|
1197 |
-
|
1198 |
-
|
1199 |
-
|
1200 |
-
|
1201 |
-
|
1202 |
-
|
1203 |
-
|
1204 |
-
|
1205 |
-
|
1206 |
-
|
1207 |
-
|
1208 |
-
|
1209 |
-
|
1210 |
-
|
1211 |
-
|
1212 |
-
|
1213 |
-
|
1214 |
-
|
1215 |
-
|
1216 |
-
|
1217 |
-
|
1218 |
-
|
1219 |
-
|
1220 |
-
|
1221 |
-
|
1222 |
-
|
1223 |
-
|
1224 |
-
|
1225 |
-
|
1226 |
-
|
1227 |
-
|
1228 |
-
|
1229 |
-
|
1230 |
-
|
1231 |
-
|
1232 |
-
|
1233 |
-
|
1234 |
-
|
1235 |
-
|
1236 |
-
|
1237 |
-
|
1238 |
-
|
1239 |
-
|
1240 |
-
|
1241 |
-
|
1242 |
-
|
1243 |
-
|
1244 |
-
|
1245 |
-
|
1246 |
-
|
1247 |
-
|
1248 |
-
|
1249 |
-
|
1250 |
-
|
1251 |
-
|
1252 |
-
|
1253 |
-
|
1254 |
-
|
1255 |
-
|
1256 |
-
|
1257 |
-
|
1258 |
-
|
1259 |
-
|
1260 |
-
|
1261 |
-
|
1262 |
-
|
1263 |
-
|
1264 |
-
|
1265 |
-
|
1266 |
-
|
1267 |
-
|
1268 |
-
|
1269 |
-
|
1270 |
-
|
1271 |
-
|
1272 |
-
|
1273 |
-
|
1274 |
-
|
1275 |
-
|
1276 |
-
|
1277 |
-
|
1278 |
-
|
1279 |
-
|
1280 |
-
|
1281 |
-
|
1282 |
-
|
1283 |
-
|
1284 |
-
|
1285 |
-
|
1286 |
-
|
1287 |
-
|
1288 |
-
|
1289 |
-
|
1290 |
-
|
1291 |
-
|
1292 |
-
|
1293 |
-
|
1294 |
-
|
1295 |
-
|
1296 |
-
|
1297 |
-
|
1298 |
-
|
1299 |
-
|
1300 |
-
|
1301 |
-
|
1302 |
-
|
1303 |
-
|
1304 |
-
|
1305 |
-
|
1306 |
-
|
1307 |
-
}
|
1308 |
-
|
1309 |
-
|
1310 |
-
|
1311 |
-
|
1312 |
-
|
1313 |
-
|
1314 |
-
|
1315 |
-
var
|
1316 |
-
|
1317 |
-
|
1318 |
-
|
1319 |
-
|
1320 |
-
|
1321 |
-
|
1322 |
-
|
1323 |
-
|
1324 |
-
|
1325 |
-
|
1326 |
-
|
1327 |
-
|
1328 |
-
|
1329 |
-
|
1330 |
-
|
1331 |
-
|
1332 |
-
|
1333 |
-
|
1334 |
-
|
1335 |
-
|
1336 |
-
var
|
1337 |
-
|
1338 |
-
|
1339 |
-
|
1340 |
-
|
1341 |
-
|
1342 |
-
|
1343 |
-
|
1344 |
-
|
1345 |
-
|
1346 |
-
|
1347 |
-
|
1348 |
-
|
1349 |
-
|
1350 |
-
|
1351 |
-
|
1352 |
-
|
1353 |
-
|
1354 |
-
|
1355 |
-
|
1356 |
-
|
1357 |
-
|
1358 |
-
|
1359 |
-
|
1360 |
-
|
1361 |
-
|
1362 |
-
|
1363 |
-
|
1364 |
-
|
1365 |
-
|
1366 |
-
|
1367 |
-
|
1368 |
-
|
1369 |
-
|
1370 |
-
|
1371 |
-
|
1372 |
-
|
1373 |
-
|
1374 |
-
|
1375 |
-
|
1376 |
-
|
1377 |
-
|
1378 |
-
|
1379 |
-
|
1380 |
-
|
1381 |
-
|
1382 |
-
|
1383 |
-
|
1384 |
-
|
1385 |
-
|
1386 |
-
|
1387 |
-
|
1388 |
-
|
1389 |
-
|
1390 |
-
|
1391 |
-
|
1392 |
-
|
1393 |
-
}
|
1394 |
-
|
1395 |
-
|
1396 |
-
|
1397 |
-
|
1398 |
-
|
1399 |
-
|
1400 |
-
|
1401 |
-
|
1402 |
-
|
1403 |
-
|
1404 |
-
|
1405 |
-
|
1406 |
-
|
1407 |
-
|
1408 |
-
|
1409 |
-
|
1410 |
-
|
1411 |
-
|
1412 |
-
|
1413 |
-
|
1414 |
-
|
1415 |
-
|
1416 |
-
|
1417 |
-
|
1418 |
-
|
1419 |
-
|
1420 |
-
|
1421 |
-
|
1422 |
-
|
1423 |
-
|
1424 |
-
|
1425 |
-
|
1426 |
-
|
1427 |
-
|
1428 |
-
|
1429 |
-
|
1430 |
-
|
1431 |
-
|
1432 |
-
|
1433 |
-
|
1434 |
-
|
1435 |
-
|
1436 |
-
|
1437 |
-
|
1438 |
-
|
1439 |
-
|
1440 |
-
}
|
1441 |
-
|
1442 |
-
|
1443 |
-
|
1444 |
-
|
1445 |
-
|
1446 |
-
|
1447 |
-
|
1448 |
-
|
1449 |
-
|
1450 |
-
|
1451 |
-
|
1452 |
-
|
1453 |
-
|
1454 |
-
|
1455 |
-
|
1456 |
-
|
1457 |
-
|
1458 |
-
|
1459 |
-
|
1460 |
-
|
1461 |
-
|
1462 |
-
|
1463 |
-
|
1464 |
-
|
1465 |
-
|
1466 |
-
|
1467 |
-
|
1468 |
-
|
1469 |
-
|
1470 |
-
|
1471 |
-
|
1472 |
-
|
1473 |
-
|
1474 |
-
|
1475 |
-
|
1476 |
-
|
1477 |
-
|
1478 |
-
|
1479 |
-
|
1480 |
-
|
1481 |
-
|
1482 |
-
|
1483 |
-
|
1484 |
-
|
1485 |
-
|
1486 |
-
|
1487 |
-
|
1488 |
-
|
1489 |
-
|
1490 |
-
|
1491 |
-
|
1492 |
-
|
1493 |
-
|
1494 |
-
|
1495 |
-
|
1496 |
-
|
1497 |
-
|
1498 |
-
|
1499 |
-
|
1500 |
-
|
1501 |
-
|
1502 |
-
|
1503 |
-
|
1504 |
-
|
1505 |
-
|
1506 |
-
|
1507 |
-
|
1508 |
-
|
1509 |
-
|
1510 |
-
|
1511 |
-
|
1512 |
-
|
1513 |
-
|
1514 |
-
|
1515 |
-
|
1516 |
-
|
1517 |
-
|
1518 |
-
|
1519 |
-
|
1520 |
-
|
1521 |
-
|
1522 |
-
|
1523 |
-
|
1524 |
-
}
|
1525 |
-
|
1526 |
-
|
1527 |
-
|
1528 |
-
|
1529 |
-
|
1530 |
-
|
1531 |
-
|
1532 |
-
|
1533 |
-
|
1534 |
-
|
1535 |
-
|
1536 |
-
|
1537 |
-
|
1538 |
-
|
1539 |
-
|
1540 |
-
|
1541 |
-
|
1542 |
-
|
1543 |
-
|
1544 |
-
|
1545 |
-
|
1546 |
-
|
1547 |
-
|
1548 |
-
|
1549 |
-
|
1550 |
-
|
1551 |
-
|
1552 |
-
|
1553 |
-
|
1554 |
-
|
1555 |
-
|
1556 |
-
|
1557 |
-
|
1558 |
-
|
1559 |
-
|
1560 |
-
|
1561 |
-
|
1562 |
-
|
1563 |
-
|
1564 |
-
|
1565 |
-
|
1566 |
-
|
1567 |
-
|
1568 |
-
|
1569 |
-
|
1570 |
-
|
1571 |
-
|
1572 |
-
|
1573 |
-
|
1574 |
-
|
1575 |
-
|
1576 |
-
|
1577 |
-
|
1578 |
-
|
1579 |
-
|
1580 |
-
|
1581 |
-
|
1582 |
-
|
1583 |
-
|
1584 |
-
|
1585 |
-
|
1586 |
-
|
1587 |
-
|
1588 |
-
|
1589 |
-
|
1590 |
-
|
1591 |
-
|
1592 |
-
|
1593 |
-
|
1594 |
-
|
1595 |
-
|
1596 |
-
|
1597 |
-
|
1598 |
-
|
1599 |
-
|
1600 |
-
|
1601 |
-
|
1602 |
-
|
1603 |
-
|
1604 |
-
|
1605 |
-
|
1606 |
-
|
1607 |
-
|
1608 |
-
|
1609 |
-
|
1610 |
-
|
1611 |
-
|
1612 |
-
|
1613 |
-
|
1614 |
-
|
1615 |
-
|
1616 |
-
|
1617 |
-
|
1618 |
-
|
1619 |
-
|
1620 |
-
|
1621 |
-
|
1622 |
-
|
1623 |
-
|
1624 |
-
|
1625 |
-
|
1626 |
-
|
1627 |
-
|
1628 |
-
|
1629 |
-
|
1630 |
-
|
1631 |
-
|
1632 |
-
|
1633 |
-
|
1634 |
-
|
1635 |
-
|
1636 |
-
|
1637 |
-
|
1638 |
-
|
1639 |
-
}
|
1640 |
-
|
1641 |
-
|
1642 |
-
|
1643 |
-
|
1644 |
-
|
1645 |
-
|
1646 |
-
|
1647 |
-
|
1648 |
-
|
1649 |
-
|
1650 |
-
|
1651 |
-
|
1652 |
-
|
1653 |
-
|
1654 |
-
|
1655 |
-
|
1656 |
-
|
1657 |
-
|
1658 |
-
/*
|
1659 |
-
|
1660 |
-
|
1661 |
-
|
1662 |
-
|
1663 |
-
|
1664 |
-
|
1665 |
-
|
1666 |
-
|
1667 |
-
|
1668 |
-
|
1669 |
-
|
1670 |
-
|
1671 |
-
|
1672 |
-
|
1673 |
-
|
1674 |
-
|
1675 |
-
|
1676 |
-
|
1677 |
-
|
1678 |
-
|
1679 |
-
|
1680 |
-
};
|
1681 |
-
|
1682 |
-
|
1683 |
-
|
1684 |
-
|
1685 |
-
|
1686 |
-
|
1687 |
-
|
1688 |
-
|
1689 |
-
|
1690 |
-
|
1691 |
-
|
1692 |
-
|
1693 |
-
|
1694 |
-
|
1695 |
-
|
1696 |
-
|
1697 |
-
|
1698 |
-
|
1699 |
-
|
1700 |
-
var
|
1701 |
-
|
1702 |
-
|
1703 |
-
|
1704 |
-
|
1705 |
-
|
1706 |
-
|
1707 |
-
}
|
1708 |
-
|
1709 |
-
|
1710 |
-
|
1711 |
-
|
1712 |
-
|
1713 |
-
|
1714 |
-
|
1715 |
-
|
1716 |
-
|
1717 |
-
|
1718 |
-
|
1719 |
-
|
1720 |
-
|
1721 |
-
|
1722 |
-
|
1723 |
-
var
|
1724 |
-
|
1725 |
-
|
1726 |
-
|
1727 |
-
|
1728 |
-
|
1729 |
-
|
1730 |
-
|
1731 |
-
|
1732 |
-
|
1733 |
-
}
|
1734 |
-
|
1735 |
-
|
1736 |
-
|
1737 |
-
|
1738 |
-
|
1739 |
-
|
1740 |
-
|
1741 |
-
|
1742 |
-
|
1743 |
-
|
1744 |
-
|
1745 |
-
|
1746 |
-
|
1747 |
-
|
1748 |
-
|
1749 |
-
|
1750 |
-
|
1751 |
-
|
1752 |
-
|
1753 |
-
|
1754 |
-
|
1755 |
-
|
1756 |
-
|
1757 |
-
|
1758 |
-
|
1759 |
-
|
1760 |
-
|
1761 |
-
/***/
|
1762 |
-
|
1763 |
-
|
1764 |
-
|
1765 |
-
var
|
1766 |
-
|
1767 |
-
|
1768 |
-
|
1769 |
-
|
1770 |
-
|
1771 |
-
|
1772 |
-
|
1773 |
-
|
1774 |
-
|
1775 |
-
|
1776 |
-
|
1777 |
-
|
1778 |
-
|
1779 |
-
|
1780 |
-
|
1781 |
-
|
1782 |
-
|
1783 |
-
|
1784 |
-
|
1785 |
-
|
1786 |
-
|
1787 |
-
|
1788 |
-
|
1789 |
-
|
1790 |
-
|
1791 |
-
|
1792 |
-
|
1793 |
-
|
1794 |
-
|
1795 |
-
|
1796 |
-
|
1797 |
-
|
1798 |
-
|
1799 |
-
|
1800 |
-
|
1801 |
-
|
1802 |
-
|
1803 |
-
|
1804 |
-
|
1805 |
-
|
1806 |
-
|
1807 |
-
|
1808 |
-
|
1809 |
-
|
1810 |
-
|
1811 |
-
|
1812 |
-
|
1813 |
-
|
1814 |
-
|
1815 |
-
|
1816 |
-
|
1817 |
-
|
1818 |
-
|
1819 |
-
|
1820 |
-
|
1821 |
-
|
1822 |
-
|
1823 |
-
|
1824 |
-
|
1825 |
-
|
1826 |
-
|
1827 |
-
|
1828 |
-
|
1829 |
-
|
1830 |
-
|
1831 |
-
|
1832 |
-
|
1833 |
-
|
1834 |
-
|
1835 |
-
|
1836 |
-
|
1837 |
-
|
1838 |
-
|
1839 |
-
|
1840 |
-
|
1841 |
-
|
1842 |
-
|
1843 |
-
|
1844 |
-
|
1845 |
-
|
1846 |
-
|
1847 |
-
|
1848 |
-
|
1849 |
-
|
1850 |
-
|
1851 |
-
|
1852 |
-
|
1853 |
-
|
1854 |
-
|
1855 |
-
|
1856 |
-
|
1857 |
-
|
1858 |
-
|
1859 |
-
|
1860 |
-
|
1861 |
-
|
1862 |
-
|
1863 |
-
|
1864 |
-
|
1865 |
-
|
1866 |
-
|
1867 |
-
|
1868 |
-
|
1869 |
-
|
1870 |
-
|
1871 |
-
|
1872 |
-
|
1873 |
-
|
1874 |
-
|
1875 |
-
|
1876 |
-
|
1877 |
-
|
1878 |
-
|
1879 |
-
|
1880 |
-
|
1881 |
-
|
1882 |
-
|
1883 |
-
|
1884 |
-
|
1885 |
-
|
1886 |
-
|
1887 |
-
|
1888 |
-
|
1889 |
-
|
1890 |
-
|
1891 |
-
|
1892 |
-
|
1893 |
-
|
1894 |
-
|
1895 |
-
|
1896 |
-
|
1897 |
-
|
1898 |
-
|
1899 |
-
|
1900 |
-
|
1901 |
-
|
1902 |
-
|
1903 |
-
|
1904 |
-
|
1905 |
-
|
1906 |
-
|
1907 |
-
|
1908 |
-
|
1909 |
-
|
1910 |
-
|
1911 |
-
|
1912 |
-
|
1913 |
-
|
1914 |
-
|
1915 |
-
|
1916 |
-
|
1917 |
-
|
1918 |
-
|
1919 |
-
|
1920 |
-
|
1921 |
-
|
1922 |
-
|
1923 |
-
|
1924 |
-
|
1925 |
-
|
1926 |
-
|
1927 |
-
|
1928 |
-
|
1929 |
-
|
1930 |
-
|
1931 |
-
|
1932 |
-
|
1933 |
-
|
1934 |
-
|
1935 |
-
|
1936 |
-
|
1937 |
-
|
1938 |
-
|
1939 |
-
|
1940 |
-
|
1941 |
-
|
1942 |
-
|
1943 |
-
|
1944 |
-
|
1945 |
-
|
1946 |
-
|
1947 |
-
|
1948 |
-
|
1949 |
-
|
1950 |
-
|
1951 |
-
|
1952 |
-
|
1953 |
-
|
1954 |
-
|
1955 |
-
|
1956 |
-
|
1957 |
-
|
1958 |
-
|
1959 |
-
|
1960 |
-
|
1961 |
-
|
1962 |
-
|
1963 |
-
|
1964 |
-
|
1965 |
-
|
1966 |
-
|
1967 |
-
|
1968 |
-
|
1969 |
-
|
1970 |
-
|
1971 |
-
|
1972 |
-
|
1973 |
-
|
1974 |
-
|
1975 |
-
|
1976 |
-
|
1977 |
-
|
1978 |
-
|
1979 |
-
|
1980 |
-
|
1981 |
-
|
1982 |
-
|
1983 |
-
|
1984 |
-
|
1985 |
-
|
1986 |
-
|
1987 |
-
|
1988 |
-
|
1989 |
-
|
1990 |
-
|
1991 |
-
|
1992 |
-
|
1993 |
-
|
1994 |
-
|
1995 |
-
|
1996 |
-
|
1997 |
-
|
1998 |
-
|
1999 |
-
|
2000 |
-
|
2001 |
-
|
2002 |
-
|
2003 |
-
|
2004 |
-
|
2005 |
-
|
2006 |
-
|
2007 |
-
|
2008 |
-
|
2009 |
-
|
2010 |
-
|
2011 |
-
|
2012 |
-
|
2013 |
-
|
2014 |
-
|
2015 |
-
|
2016 |
-
|
2017 |
-
|
2018 |
-
|
2019 |
-
|
2020 |
-
|
2021 |
-
|
2022 |
-
|
2023 |
-
|
2024 |
-
|
2025 |
-
|
2026 |
-
|
2027 |
-
|
2028 |
-
|
2029 |
-
|
2030 |
-
|
2031 |
-
|
2032 |
-
|
2033 |
-
|
2034 |
-
|
2035 |
-
|
2036 |
-
|
2037 |
-
|
2038 |
-
|
2039 |
-
|
2040 |
-
|
2041 |
-
|
2042 |
-
|
2043 |
-
|
2044 |
-
|
2045 |
-
}
|
2046 |
-
|
2047 |
-
|
2048 |
-
|
2049 |
-
|
2050 |
-
|
2051 |
-
|
2052 |
-
|
2053 |
-
|
2054 |
-
|
2055 |
-
|
2056 |
-
|
2057 |
-
|
2058 |
-
|
2059 |
-
|
2060 |
-
|
2061 |
-
|
2062 |
-
|
2063 |
-
|
2064 |
-
|
2065 |
-
|
2066 |
-
|
2067 |
-
|
2068 |
-
|
2069 |
-
|
2070 |
-
|
2071 |
-
|
2072 |
-
|
2073 |
-
|
2074 |
-
|
2075 |
-
|
2076 |
-
|
2077 |
-
|
2078 |
-
|
2079 |
-
|
2080 |
-
|
2081 |
-
|
2082 |
-
|
2083 |
-
|
2084 |
-
|
2085 |
-
|
2086 |
-
|
2087 |
-
|
2088 |
-
|
2089 |
-
|
2090 |
-
|
2091 |
-
|
2092 |
-
|
2093 |
-
|
2094 |
-
|
2095 |
-
|
2096 |
-
|
2097 |
-
|
2098 |
-
|
2099 |
-
|
2100 |
-
|
2101 |
-
|
2102 |
-
|
2103 |
-
|
2104 |
-
|
2105 |
-
|
2106 |
-
|
2107 |
-
|
2108 |
-
|
2109 |
-
|
2110 |
-
|
2111 |
-
|
2112 |
-
|
2113 |
-
|
2114 |
-
|
2115 |
-
|
2116 |
-
|
2117 |
-
|
2118 |
-
|
2119 |
-
|
2120 |
-
|
2121 |
-
|
2122 |
-
|
2123 |
-
|
2124 |
-
|
2125 |
-
|
2126 |
-
|
2127 |
-
|
2128 |
-
|
2129 |
-
|
2130 |
-
|
2131 |
-
|
2132 |
-
|
2133 |
-
|
2134 |
-
|
2135 |
-
|
2136 |
-
|
2137 |
-
|
2138 |
-
|
2139 |
-
|
2140 |
-
|
2141 |
-
|
2142 |
-
|
2143 |
-
|
2144 |
-
|
2145 |
-
|
2146 |
-
|
2147 |
-
|
2148 |
-
|
2149 |
-
|
2150 |
-
|
2151 |
-
|
2152 |
-
|
2153 |
-
|
2154 |
-
|
2155 |
-
|
2156 |
-
|
2157 |
-
|
2158 |
-
|
2159 |
-
|
2160 |
-
|
2161 |
-
|
2162 |
-
|
2163 |
-
|
2164 |
-
|
2165 |
-
|
2166 |
-
|
2167 |
-
|
2168 |
-
|
2169 |
-
|
2170 |
-
|
2171 |
-
|
2172 |
-
|
2173 |
-
|
2174 |
-
|
2175 |
-
|
2176 |
-
|
2177 |
-
|
2178 |
-
|
2179 |
-
|
2180 |
-
|
2181 |
-
|
2182 |
-
|
2183 |
-
|
2184 |
-
|
2185 |
-
|
2186 |
-
|
2187 |
-
|
2188 |
-
|
2189 |
-
|
2190 |
-
|
2191 |
-
|
2192 |
-
|
2193 |
-
|
2194 |
-
|
2195 |
-
|
2196 |
-
|
2197 |
-
|
2198 |
-
|
2199 |
-
|
2200 |
-
|
2201 |
-
|
2202 |
-
|
2203 |
-
|
2204 |
-
|
2205 |
-
|
2206 |
-
|
2207 |
-
|
2208 |
-
|
2209 |
-
|
2210 |
-
|
2211 |
-
|
2212 |
-
|
2213 |
-
|
2214 |
-
|
2215 |
-
|
2216 |
-
|
2217 |
-
|
2218 |
-
|
2219 |
-
|
2220 |
-
|
2221 |
-
|
2222 |
-
|
2223 |
-
|
2224 |
-
|
2225 |
-
|
2226 |
-
|
2227 |
-
|
2228 |
-
|
2229 |
-
|
2230 |
-
|
2231 |
-
|
2232 |
-
|
2233 |
-
|
2234 |
-
|
2235 |
-
|
2236 |
-
|
2237 |
-
|
2238 |
-
|
2239 |
-
|
2240 |
-
|
2241 |
-
|
2242 |
-
|
2243 |
-
|
2244 |
-
|
2245 |
-
|
2246 |
-
|
2247 |
-
|
2248 |
-
|
2249 |
-
|
2250 |
-
|
2251 |
-
|
2252 |
-
|
2253 |
-
|
2254 |
-
|
2255 |
-
|
2256 |
-
|
2257 |
-
|
2258 |
-
|
2259 |
-
|
2260 |
-
|
2261 |
-
|
2262 |
-
|
2263 |
-
|
2264 |
-
|
2265 |
-
|
2266 |
-
|
2267 |
-
|
2268 |
-
|
2269 |
-
|
2270 |
-
|
2271 |
-
|
2272 |
-
|
2273 |
-
|
2274 |
-
|
2275 |
-
|
2276 |
-
|
2277 |
-
|
2278 |
-
|
2279 |
-
|
2280 |
-
|
2281 |
-
|
2282 |
-
|
2283 |
-
|
2284 |
-
|
2285 |
-
|
2286 |
-
|
2287 |
-
|
2288 |
-
|
2289 |
-
|
2290 |
-
|
2291 |
-
|
2292 |
-
|
2293 |
-
|
2294 |
-
|
2295 |
-
|
2296 |
-
|
2297 |
-
|
2298 |
-
|
2299 |
-
|
2300 |
-
|
2301 |
-
|
2302 |
-
|
2303 |
-
|
2304 |
-
|
2305 |
-
|
2306 |
-
|
2307 |
-
|
2308 |
-
|
2309 |
-
|
2310 |
-
|
2311 |
-
|
2312 |
-
|
2313 |
-
|
2314 |
-
|
2315 |
-
|
2316 |
-
|
2317 |
-
|
2318 |
-
|
2319 |
-
|
2320 |
-
|
2321 |
-
|
2322 |
-
|
2323 |
-
|
2324 |
-
|
2325 |
-
|
2326 |
-
|
2327 |
-
|
2328 |
-
|
2329 |
-
|
2330 |
-
|
2331 |
-
|
2332 |
-
}
|
2333 |
-
|
2334 |
-
|
2335 |
-
|
2336 |
-
|
2337 |
-
var
|
2338 |
-
|
2339 |
-
|
2340 |
-
|
2341 |
-
var
|
2342 |
-
|
2343 |
-
|
2344 |
-
|
2345 |
-
|
2346 |
-
|
2347 |
-
|
2348 |
-
|
2349 |
-
|
2350 |
-
|
2351 |
-
|
2352 |
-
|
2353 |
-
|
2354 |
-
|
2355 |
-
|
2356 |
-
|
2357 |
-
|
2358 |
-
|
2359 |
-
|
2360 |
-
|
2361 |
-
|
2362 |
-
|
2363 |
-
|
2364 |
-
|
2365 |
-
|
2366 |
-
|
2367 |
-
|
2368 |
-
|
2369 |
-
|
2370 |
-
|
2371 |
-
|
2372 |
-
|
2373 |
-
|
2374 |
-
|
2375 |
-
|
2376 |
-
|
2377 |
-
|
2378 |
-
|
2379 |
-
|
2380 |
-
|
2381 |
-
}
|
2382 |
-
|
2383 |
-
|
2384 |
-
|
2385 |
-
|
2386 |
-
|
2387 |
-
|
2388 |
-
|
2389 |
-
|
2390 |
-
|
2391 |
-
|
2392 |
-
|
2393 |
-
|
2394 |
-
|
2395 |
-
|
2396 |
-
|
2397 |
-
|
2398 |
-
|
2399 |
-
|
2400 |
-
|
2401 |
-
|
2402 |
-
|
2403 |
-
|
2404 |
-
|
2405 |
-
|
2406 |
-
|
2407 |
-
|
2408 |
-
|
2409 |
-
|
2410 |
-
|
2411 |
-
|
2412 |
-
|
2413 |
-
|
2414 |
-
|
2415 |
-
|
2416 |
-
|
2417 |
-
|
2418 |
-
|
2419 |
-
|
2420 |
-
|
2421 |
-
|
2422 |
-
|
2423 |
-
|
2424 |
-
|
2425 |
-
|
2426 |
-
|
2427 |
-
|
2428 |
-
|
2429 |
-
|
2430 |
-
|
2431 |
-
|
2432 |
-
|
2433 |
-
|
2434 |
-
|
2435 |
-
|
2436 |
-
|
2437 |
-
|
2438 |
-
|
2439 |
-
|
2440 |
-
|
2441 |
-
|
2442 |
-
|
2443 |
-
|
2444 |
-
|
2445 |
-
var
|
2446 |
-
|
2447 |
-
|
2448 |
-
|
2449 |
-
|
2450 |
-
|
2451 |
-
|
2452 |
-
|
2453 |
-
|
2454 |
-
|
2455 |
-
|
2456 |
-
|
2457 |
-
|
2458 |
-
|
2459 |
-
|
2460 |
-
|
2461 |
-
|
2462 |
-
|
2463 |
-
|
2464 |
-
|
2465 |
-
|
2466 |
-
|
2467 |
-
|
2468 |
-
|
2469 |
-
|
2470 |
-
|
2471 |
-
|
2472 |
-
|
2473 |
-
|
2474 |
-
|
2475 |
-
|
2476 |
-
if (
|
2477 |
-
|
2478 |
-
|
2479 |
-
|
2480 |
-
|
2481 |
-
|
2482 |
-
|
2483 |
-
|
2484 |
-
|
2485 |
-
|
2486 |
-
|
2487 |
-
var
|
2488 |
-
|
2489 |
-
|
2490 |
-
};
|
2491 |
-
var
|
2492 |
-
|
2493 |
-
|
2494 |
-
|
2495 |
-
|
2496 |
-
|
2497 |
-
|
2498 |
-
|
2499 |
-
|
2500 |
-
|
2501 |
-
|
2502 |
-
|
2503 |
-
|
2504 |
-
|
2505 |
-
|
2506 |
-
|
2507 |
-
|
2508 |
-
|
2509 |
-
|
2510 |
-
|
2511 |
-
|
2512 |
-
|
2513 |
-
|
2514 |
-
|
2515 |
-
|
2516 |
-
|
2517 |
-
|
2518 |
-
|
2519 |
-
|
2520 |
-
|
2521 |
-
|
2522 |
-
|
2523 |
-
|
2524 |
-
|
2525 |
-
|
2526 |
-
|
2527 |
-
|
2528 |
-
|
2529 |
-
function
|
2530 |
-
|
2531 |
-
|
2532 |
-
|
2533 |
-
|
2534 |
-
|
2535 |
-
|
2536 |
-
|
2537 |
-
|
2538 |
-
|
2539 |
-
|
2540 |
-
|
2541 |
-
|
2542 |
-
|
2543 |
-
|
2544 |
-
|
2545 |
-
|
2546 |
-
|
2547 |
-
|
2548 |
-
|
2549 |
-
|
2550 |
-
|
2551 |
-
|
2552 |
-
|
2553 |
-
|
2554 |
-
|
2555 |
-
|
2556 |
-
|
2557 |
-
|
2558 |
-
|
2559 |
-
|
2560 |
-
|
2561 |
-
|
2562 |
-
|
2563 |
-
:
|
2564 |
-
|
2565 |
-
|
2566 |
-
|
2567 |
-
|
2568 |
-
|
2569 |
-
|
2570 |
-
|
2571 |
-
|
2572 |
-
|
2573 |
-
|
2574 |
-
|
2575 |
-
|
2576 |
-
|
2577 |
-
|
2578 |
-
|
2579 |
-
|
2580 |
-
|
2581 |
-
|
2582 |
-
|
2583 |
-
|
2584 |
-
|
2585 |
-
|
2586 |
-
|
2587 |
-
|
2588 |
-
|
2589 |
-
|
2590 |
-
|
2591 |
-
|
2592 |
-
|
2593 |
-
|
2594 |
-
|
2595 |
-
|
2596 |
-
|
2597 |
-
|
2598 |
-
|
2599 |
-
|
2600 |
-
|
2601 |
-
|
2602 |
-
|
2603 |
-
|
2604 |
-
|
2605 |
-
|
2606 |
-
|
2607 |
-
|
2608 |
-
|
2609 |
-
|
2610 |
-
|
2611 |
-
|
2612 |
-
|
2613 |
-
|
2614 |
-
|
2615 |
-
|
2616 |
-
|
2617 |
-
|
2618 |
-
|
2619 |
-
|
2620 |
-
|
2621 |
-
|
2622 |
-
|
2623 |
-
|
2624 |
-
|
2625 |
-
|
2626 |
-
|
2627 |
-
|
2628 |
-
|
2629 |
-
|
2630 |
-
|
2631 |
-
|
2632 |
-
|
2633 |
-
|
2634 |
-
|
2635 |
-
|
2636 |
-
|
2637 |
-
|
2638 |
-
|
2639 |
-
var
|
2640 |
-
|
2641 |
-
|
2642 |
-
|
2643 |
-
|
2644 |
-
|
2645 |
-
|
2646 |
-
|
2647 |
-
|
2648 |
-
|
2649 |
-
|
2650 |
-
|
2651 |
-
|
2652 |
-
|
2653 |
-
|
2654 |
-
|
2655 |
-
|
2656 |
-
|
2657 |
-
|
2658 |
-
|
2659 |
-
|
2660 |
-
|
2661 |
-
|
2662 |
-
|
2663 |
-
|
2664 |
-
//
|
2665 |
-
|
2666 |
-
|
2667 |
-
|
2668 |
-
var
|
2669 |
-
|
2670 |
-
|
2671 |
-
|
2672 |
-
|
2673 |
-
|
2674 |
-
|
2675 |
-
|
2676 |
-
|
2677 |
-
|
2678 |
-
|
2679 |
-
|
2680 |
-
|
2681 |
-
|
2682 |
-
|
2683 |
-
|
2684 |
-
|
2685 |
-
|
2686 |
-
|
2687 |
-
|
2688 |
-
|
2689 |
-
|
2690 |
-
|
2691 |
-
|
2692 |
-
|
2693 |
-
|
2694 |
-
|
2695 |
-
|
2696 |
-
|
2697 |
-
|
2698 |
-
|
2699 |
-
|
2700 |
-
|
2701 |
-
|
2702 |
-
|
2703 |
-
|
2704 |
-
|
2705 |
-
|
2706 |
-
|
2707 |
-
/***/ }),
|
2708 |
-
/*
|
2709 |
-
/***/ (function(module, exports, __webpack_require__) {
|
2710 |
-
|
2711 |
-
//
|
2712 |
-
var
|
2713 |
-
|
2714 |
-
|
2715 |
-
|
2716 |
-
|
2717 |
-
|
2718 |
-
|
2719 |
-
|
2720 |
-
|
2721 |
-
|
2722 |
-
|
2723 |
-
|
2724 |
-
|
2725 |
-
|
2726 |
-
|
2727 |
-
|
2728 |
-
|
2729 |
-
|
2730 |
-
|
2731 |
-
|
2732 |
-
|
2733 |
-
|
2734 |
-
|
2735 |
-
|
2736 |
-
|
2737 |
-
|
2738 |
-
|
2739 |
-
|
2740 |
-
|
2741 |
-
|
2742 |
-
|
2743 |
-
|
2744 |
-
|
2745 |
-
|
2746 |
-
|
2747 |
-
|
2748 |
-
|
2749 |
-
|
2750 |
-
|
2751 |
-
|
2752 |
-
|
2753 |
-
|
2754 |
-
|
2755 |
-
|
2756 |
-
|
2757 |
-
|
2758 |
-
|
2759 |
-
|
2760 |
-
|
2761 |
-
|
2762 |
-
|
2763 |
-
|
2764 |
-
|
2765 |
-
|
2766 |
-
|
2767 |
-
|
2768 |
-
|
2769 |
-
|
2770 |
-
|
2771 |
-
|
2772 |
-
|
2773 |
-
|
2774 |
-
|
2775 |
-
|
2776 |
-
|
2777 |
-
|
2778 |
-
|
2779 |
-
|
2780 |
-
|
2781 |
-
|
2782 |
-
|
2783 |
-
|
2784 |
-
/***/
|
2785 |
-
|
2786 |
-
|
2787 |
-
|
2788 |
-
|
2789 |
-
|
2790 |
-
};
|
2791 |
-
|
2792 |
-
|
2793 |
-
|
2794 |
-
|
2795 |
-
|
2796 |
-
|
2797 |
-
|
2798 |
-
|
2799 |
-
|
2800 |
-
|
2801 |
-
|
2802 |
-
|
2803 |
-
|
2804 |
-
|
2805 |
-
/*
|
2806 |
-
|
2807 |
-
|
2808 |
-
|
2809 |
-
|
2810 |
-
function
|
2811 |
-
|
2812 |
-
|
2813 |
-
|
2814 |
-
|
2815 |
-
|
2816 |
-
|
2817 |
-
|
2818 |
-
|
2819 |
-
|
2820 |
-
|
2821 |
-
|
2822 |
-
|
2823 |
-
|
2824 |
-
|
2825 |
-
|
2826 |
-
|
2827 |
-
|
2828 |
-
|
2829 |
-
|
2830 |
-
|
2831 |
-
|
2832 |
-
|
2833 |
-
|
2834 |
-
|
2835 |
-
|
2836 |
-
|
2837 |
-
|
2838 |
-
|
2839 |
-
|
2840 |
-
|
2841 |
-
|
2842 |
-
|
2843 |
-
|
2844 |
-
|
2845 |
-
|
2846 |
-
|
2847 |
-
|
2848 |
-
|
2849 |
-
|
2850 |
-
|
2851 |
-
|
2852 |
-
|
2853 |
-
|
2854 |
-
|
2855 |
-
|
2856 |
-
|
2857 |
-
|
2858 |
-
|
2859 |
-
|
2860 |
-
|
2861 |
-
|
2862 |
-
|
2863 |
-
|
2864 |
-
|
2865 |
-
|
2866 |
-
|
2867 |
-
|
2868 |
-
|
2869 |
-
|
2870 |
-
|
2871 |
-
|
2872 |
-
|
2873 |
-
|
2874 |
-
|
2875 |
-
|
2876 |
-
|
2877 |
-
|
2878 |
-
|
2879 |
-
|
2880 |
-
|
2881 |
-
|
2882 |
-
|
2883 |
-
|
2884 |
-
|
2885 |
-
|
2886 |
-
|
2887 |
-
|
2888 |
-
|
2889 |
-
|
2890 |
-
|
2891 |
-
|
2892 |
-
|
2893 |
-
|
2894 |
-
|
2895 |
-
|
2896 |
-
|
2897 |
-
|
2898 |
-
|
2899 |
-
|
2900 |
-
|
2901 |
-
|
2902 |
-
|
2903 |
-
|
2904 |
-
|
2905 |
-
|
2906 |
-
|
2907 |
-
|
2908 |
-
|
2909 |
-
|
2910 |
-
|
2911 |
-
|
2912 |
-
|
2913 |
-
|
2914 |
-
|
2915 |
-
|
2916 |
-
|
2917 |
-
|
2918 |
-
|
2919 |
-
|
2920 |
-
|
2921 |
-
|
2922 |
-
|
2923 |
-
|
2924 |
-
|
2925 |
-
|
2926 |
-
|
2927 |
-
|
2928 |
-
|
2929 |
-
|
2930 |
-
|
2931 |
-
|
2932 |
-
|
2933 |
-
|
2934 |
-
|
2935 |
-
|
2936 |
-
|
2937 |
-
|
2938 |
-
|
2939 |
-
|
2940 |
-
|
2941 |
-
|
2942 |
-
|
2943 |
-
|
2944 |
-
|
2945 |
-
|
2946 |
-
|
2947 |
-
|
2948 |
-
|
2949 |
-
|
2950 |
-
|
2951 |
-
|
2952 |
-
|
2953 |
-
|
2954 |
-
|
2955 |
-
|
2956 |
-
|
2957 |
-
|
2958 |
-
|
2959 |
-
|
2960 |
-
|
2961 |
-
|
2962 |
-
|
2963 |
-
|
2964 |
-
|
2965 |
-
|
2966 |
-
|
2967 |
-
|
2968 |
-
|
2969 |
-
|
2970 |
-
|
2971 |
-
|
2972 |
-
|
2973 |
-
|
2974 |
-
|
2975 |
-
|
2976 |
-
|
2977 |
-
|
2978 |
-
|
2979 |
-
|
2980 |
-
|
2981 |
-
|
2982 |
-
|
2983 |
-
|
2984 |
-
|
2985 |
-
|
2986 |
-
|
2987 |
-
|
2988 |
-
|
2989 |
-
|
2990 |
-
|
2991 |
-
|
2992 |
-
|
2993 |
-
|
2994 |
-
|
2995 |
-
|
2996 |
-
|
2997 |
-
|
2998 |
-
|
2999 |
-
|
3000 |
-
|
3001 |
-
|
3002 |
-
|
3003 |
-
|
3004 |
-
|
3005 |
-
|
3006 |
-
|
3007 |
-
|
3008 |
-
|
3009 |
-
|
3010 |
-
|
3011 |
-
|
3012 |
-
|
3013 |
-
|
3014 |
-
|
3015 |
-
|
3016 |
-
|
3017 |
-
|
3018 |
-
|
3019 |
-
|
3020 |
-
|
3021 |
-
|
3022 |
-
|
3023 |
-
|
3024 |
-
|
3025 |
-
|
3026 |
-
|
3027 |
-
|
3028 |
-
|
3029 |
-
|
3030 |
-
|
3031 |
-
|
3032 |
-
|
3033 |
-
|
3034 |
-
|
3035 |
-
|
3036 |
-
|
3037 |
-
|
3038 |
-
|
3039 |
-
|
3040 |
-
|
3041 |
-
|
3042 |
-
|
3043 |
-
|
3044 |
-
|
3045 |
-
|
3046 |
-
|
3047 |
-
|
3048 |
-
|
3049 |
-
|
3050 |
-
|
3051 |
-
|
3052 |
-
|
3053 |
-
|
3054 |
-
|
3055 |
-
|
3056 |
-
|
3057 |
-
|
3058 |
-
|
3059 |
-
|
3060 |
-
|
3061 |
-
|
3062 |
-
|
3063 |
-
|
3064 |
-
|
3065 |
-
|
3066 |
-
|
3067 |
-
|
3068 |
-
|
3069 |
-
|
3070 |
-
|
3071 |
-
|
3072 |
-
|
3073 |
-
|
3074 |
-
|
3075 |
-
|
3076 |
-
|
3077 |
-
|
3078 |
-
|
3079 |
-
|
3080 |
-
|
3081 |
-
|
3082 |
-
|
3083 |
-
|
3084 |
-
|
3085 |
-
|
3086 |
-
|
3087 |
-
|
3088 |
-
|
3089 |
-
|
3090 |
-
|
3091 |
-
|
3092 |
-
|
3093 |
-
|
3094 |
-
|
3095 |
-
|
3096 |
-
|
3097 |
-
|
3098 |
-
|
3099 |
-
|
3100 |
-
|
3101 |
-
|
3102 |
-
|
3103 |
-
|
3104 |
-
|
3105 |
-
|
3106 |
-
|
3107 |
-
|
3108 |
-
|
3109 |
-
|
3110 |
-
|
3111 |
-
|
3112 |
-
|
3113 |
-
|
3114 |
-
|
3115 |
-
|
3116 |
-
|
3117 |
-
|
3118 |
-
|
3119 |
-
|
3120 |
-
|
3121 |
-
|
3122 |
-
|
3123 |
-
|
3124 |
-
|
3125 |
-
|
3126 |
-
|
3127 |
-
|
3128 |
-
|
3129 |
-
var
|
3130 |
-
|
3131 |
-
|
3132 |
-
|
3133 |
-
|
3134 |
-
|
3135 |
-
var
|
3136 |
-
|
3137 |
-
var
|
3138 |
-
var
|
3139 |
-
|
3140 |
-
|
3141 |
-
|
3142 |
-
|
3143 |
-
|
3144 |
-
|
3145 |
-
|
3146 |
-
|
3147 |
-
|
3148 |
-
|
3149 |
-
|
3150 |
-
|
3151 |
-
|
3152 |
-
|
3153 |
-
|
3154 |
-
|
3155 |
-
|
3156 |
-
|
3157 |
-
|
3158 |
-
|
3159 |
-
|
3160 |
-
|
3161 |
-
|
3162 |
-
|
3163 |
-
|
3164 |
-
|
3165 |
-
|
3166 |
-
|
3167 |
-
|
3168 |
-
|
3169 |
-
|
3170 |
-
|
3171 |
-
|
3172 |
-
|
3173 |
-
|
3174 |
-
|
3175 |
-
|
3176 |
-
|
3177 |
-
|
3178 |
-
|
3179 |
-
|
3180 |
-
|
3181 |
-
|
3182 |
-
|
3183 |
-
|
3184 |
-
|
3185 |
-
|
3186 |
-
|
3187 |
-
|
3188 |
-
*
|
3189 |
-
|
3190 |
-
|
3191 |
-
|
3192 |
-
|
3193 |
-
|
3194 |
-
|
3195 |
-
|
3196 |
-
|
3197 |
-
|
3198 |
-
|
3199 |
-
|
3200 |
-
|
3201 |
-
|
3202 |
-
|
3203 |
-
|
3204 |
-
|
3205 |
-
|
3206 |
-
|
3207 |
-
|
3208 |
-
|
3209 |
-
|
3210 |
-
|
3211 |
-
|
3212 |
-
|
3213 |
-
|
3214 |
-
|
3215 |
-
|
3216 |
-
|
3217 |
-
|
3218 |
-
|
3219 |
-
|
3220 |
-
|
3221 |
-
|
3222 |
-
|
3223 |
-
|
3224 |
-
|
3225 |
-
|
3226 |
-
|
3227 |
-
|
3228 |
-
|
3229 |
-
|
3230 |
-
|
3231 |
-
|
3232 |
-
|
3233 |
-
|
3234 |
-
|
3235 |
-
|
3236 |
-
|
3237 |
-
|
3238 |
-
|
3239 |
-
|
3240 |
-
|
3241 |
-
|
3242 |
-
|
3243 |
-
|
3244 |
-
|
3245 |
-
|
3246 |
-
|
3247 |
-
|
3248 |
-
|
3249 |
-
|
3250 |
-
|
3251 |
-
|
3252 |
-
|
3253 |
-
|
3254 |
-
|
3255 |
-
|
3256 |
-
|
3257 |
-
|
3258 |
-
|
3259 |
-
|
3260 |
-
|
3261 |
-
|
3262 |
-
|
3263 |
-
|
3264 |
-
|
3265 |
-
|
3266 |
-
|
3267 |
-
|
3268 |
-
|
3269 |
-
|
3270 |
-
|
3271 |
-
|
3272 |
-
|
3273 |
-
|
3274 |
-
|
3275 |
-
|
3276 |
-
|
3277 |
-
|
3278 |
-
|
3279 |
-
|
3280 |
-
|
3281 |
-
|
3282 |
-
|
3283 |
-
|
3284 |
-
|
3285 |
-
|
3286 |
-
|
3287 |
-
|
3288 |
-
|
3289 |
-
var
|
3290 |
-
|
3291 |
-
|
3292 |
-
|
3293 |
-
|
3294 |
-
|
3295 |
-
|
3296 |
-
|
3297 |
-
|
3298 |
-
|
3299 |
-
}
|
3300 |
-
|
3301 |
-
|
3302 |
-
|
3303 |
-
|
3304 |
-
|
3305 |
-
|
3306 |
-
|
3307 |
-
};
|
3308 |
-
|
3309 |
-
|
3310 |
-
|
3311 |
-
}
|
3312 |
-
|
3313 |
-
|
3314 |
-
|
3315 |
-
|
3316 |
-
|
3317 |
-
|
3318 |
-
|
3319 |
-
|
3320 |
-
|
3321 |
-
|
3322 |
-
|
3323 |
-
|
3324 |
-
|
3325 |
-
|
3326 |
-
|
3327 |
-
|
3328 |
-
|
3329 |
-
|
3330 |
-
|
3331 |
-
|
3332 |
-
|
3333 |
-
|
3334 |
-
|
3335 |
-
|
3336 |
-
|
3337 |
-
|
3338 |
-
|
3339 |
-
|
3340 |
-
|
3341 |
-
|
3342 |
-
|
3343 |
-
|
3344 |
-
|
3345 |
-
|
3346 |
-
|
3347 |
-
|
3348 |
-
|
3349 |
-
|
3350 |
-
|
3351 |
-
|
3352 |
-
|
3353 |
-
|
3354 |
-
|
3355 |
-
|
3356 |
-
|
3357 |
-
|
3358 |
-
|
3359 |
-
|
3360 |
-
var
|
3361 |
-
|
3362 |
-
|
3363 |
-
|
3364 |
-
var
|
3365 |
-
|
3366 |
-
|
3367 |
-
|
3368 |
-
|
3369 |
-
|
3370 |
-
|
3371 |
-
|
3372 |
-
|
3373 |
-
|
3374 |
-
|
3375 |
-
|
3376 |
-
|
3377 |
-
|
3378 |
-
|
3379 |
-
|
3380 |
-
|
3381 |
-
|
3382 |
-
|
3383 |
-
|
3384 |
-
|
3385 |
-
|
3386 |
-
|
3387 |
-
|
3388 |
-
|
3389 |
-
|
3390 |
-
|
3391 |
-
|
3392 |
-
|
3393 |
-
|
3394 |
-
|
3395 |
-
|
3396 |
-
|
3397 |
-
|
3398 |
-
|
3399 |
-
|
3400 |
-
|
3401 |
-
|
3402 |
-
|
3403 |
-
|
3404 |
-
|
3405 |
-
|
3406 |
-
|
3407 |
-
|
3408 |
-
|
3409 |
-
|
3410 |
-
|
3411 |
-
|
3412 |
-
|
3413 |
-
|
3414 |
-
|
3415 |
-
|
3416 |
-
|
3417 |
-
|
3418 |
-
|
3419 |
-
|
3420 |
-
|
3421 |
-
|
3422 |
-
|
3423 |
-
|
3424 |
-
|
3425 |
-
|
3426 |
-
|
3427 |
-
|
3428 |
-
|
3429 |
-
|
3430 |
-
|
3431 |
-
|
3432 |
-
|
3433 |
-
|
3434 |
-
|
3435 |
-
|
3436 |
-
|
3437 |
-
|
3438 |
-
|
3439 |
-
|
3440 |
-
|
3441 |
-
|
3442 |
-
|
3443 |
-
|
3444 |
-
|
3445 |
-
|
3446 |
-
|
3447 |
-
|
3448 |
-
|
3449 |
-
|
3450 |
-
|
3451 |
-
|
3452 |
-
|
3453 |
-
|
3454 |
-
|
3455 |
-
|
3456 |
-
|
3457 |
-
|
3458 |
-
return
|
3459 |
-
}
|
3460 |
-
|
3461 |
-
|
3462 |
-
|
3463 |
-
|
3464 |
-
|
3465 |
-
|
3466 |
-
|
3467 |
-
|
3468 |
-
|
3469 |
-
|
3470 |
-
|
3471 |
-
|
3472 |
-
|
3473 |
-
|
3474 |
-
|
3475 |
-
*
|
3476 |
-
* @
|
3477 |
-
|
3478 |
-
|
3479 |
-
|
3480 |
-
|
3481 |
-
|
3482 |
-
}
|
3483 |
-
|
3484 |
-
|
3485 |
-
|
3486 |
-
|
3487 |
-
|
3488 |
-
|
3489 |
-
|
3490 |
-
|
3491 |
-
|
3492 |
-
|
3493 |
-
|
3494 |
-
|
3495 |
-
|
3496 |
-
|
3497 |
-
|
3498 |
-
|
3499 |
-
|
3500 |
-
|
3501 |
-
|
3502 |
-
|
3503 |
-
|
3504 |
-
|
3505 |
-
|
3506 |
-
|
3507 |
-
|
3508 |
-
|
3509 |
-
|
3510 |
-
|
3511 |
-
var
|
3512 |
-
|
3513 |
-
|
3514 |
-
|
3515 |
-
|
3516 |
-
|
3517 |
-
|
3518 |
-
|
3519 |
-
|
3520 |
-
|
3521 |
-
|
3522 |
-
|
3523 |
-
|
3524 |
-
|
3525 |
-
|
3526 |
-
|
3527 |
-
|
3528 |
-
|
3529 |
-
|
3530 |
-
|
3531 |
-
|
3532 |
-
|
3533 |
-
|
3534 |
-
|
3535 |
-
|
3536 |
-
|
3537 |
-
|
3538 |
-
|
3539 |
-
|
3540 |
-
|
3541 |
-
|
3542 |
-
|
3543 |
-
|
3544 |
-
|
3545 |
-
|
3546 |
-
|
3547 |
-
|
3548 |
-
|
3549 |
-
|
3550 |
-
|
3551 |
-
|
3552 |
-
|
3553 |
-
|
3554 |
-
|
3555 |
-
|
3556 |
-
|
3557 |
-
|
3558 |
-
|
3559 |
-
|
3560 |
-
|
3561 |
-
|
3562 |
-
|
3563 |
-
|
3564 |
-
|
3565 |
-
|
3566 |
-
|
3567 |
-
|
3568 |
-
|
3569 |
-
|
3570 |
-
|
3571 |
-
|
3572 |
-
|
3573 |
-
|
3574 |
-
|
3575 |
-
|
3576 |
-
|
3577 |
-
|
3578 |
-
|
3579 |
-
|
3580 |
-
|
3581 |
-
|
3582 |
-
|
3583 |
-
|
3584 |
-
|
3585 |
-
|
3586 |
-
|
3587 |
-
|
3588 |
-
|
3589 |
-
|
3590 |
-
|
3591 |
-
|
3592 |
-
|
3593 |
-
|
3594 |
-
|
3595 |
-
|
3596 |
-
|
3597 |
-
|
3598 |
-
|
3599 |
-
|
3600 |
-
|
3601 |
-
|
3602 |
-
|
3603 |
-
|
3604 |
-
|
3605 |
-
|
3606 |
-
|
3607 |
-
|
3608 |
-
|
3609 |
-
|
3610 |
-
|
3611 |
-
|
3612 |
-
|
3613 |
-
|
3614 |
-
|
3615 |
-
|
3616 |
-
|
3617 |
-
|
3618 |
-
|
3619 |
-
|
3620 |
-
|
3621 |
-
|
3622 |
-
|
3623 |
-
|
3624 |
-
|
3625 |
-
|
3626 |
-
|
3627 |
-
|
3628 |
-
|
3629 |
-
|
3630 |
-
|
3631 |
-
|
3632 |
-
|
3633 |
-
|
3634 |
-
|
3635 |
-
|
3636 |
-
|
3637 |
-
|
3638 |
-
|
3639 |
-
|
3640 |
-
|
3641 |
-
|
3642 |
-
|
3643 |
-
|
3644 |
-
|
3645 |
-
|
3646 |
-
|
3647 |
-
|
3648 |
-
|
3649 |
-
|
3650 |
-
|
3651 |
-
|
3652 |
-
|
3653 |
-
|
3654 |
-
|
3655 |
-
|
3656 |
-
|
3657 |
-
|
3658 |
-
|
3659 |
-
|
3660 |
-
|
3661 |
-
|
3662 |
-
|
3663 |
-
|
3664 |
-
|
3665 |
-
|
3666 |
-
|
3667 |
-
|
3668 |
-
|
3669 |
-
|
3670 |
-
|
3671 |
-
|
3672 |
-
|
3673 |
-
|
3674 |
-
|
3675 |
-
|
3676 |
-
|
3677 |
-
|
3678 |
-
|
3679 |
-
|
3680 |
-
|
3681 |
-
|
3682 |
-
|
3683 |
-
|
3684 |
-
|
3685 |
-
|
3686 |
-
|
3687 |
-
|
3688 |
-
|
3689 |
-
|
3690 |
-
|
3691 |
-
|
3692 |
-
|
3693 |
-
|
3694 |
-
|
3695 |
-
|
3696 |
-
|
3697 |
-
|
3698 |
-
|
3699 |
-
|
3700 |
-
|
3701 |
-
|
3702 |
-
|
3703 |
-
|
3704 |
-
|
3705 |
-
|
3706 |
-
|
3707 |
-
|
3708 |
-
|
3709 |
-
|
3710 |
-
|
3711 |
-
|
3712 |
-
|
3713 |
-
|
3714 |
-
|
3715 |
-
|
3716 |
-
|
3717 |
-
|
3718 |
-
|
3719 |
-
|
3720 |
-
|
3721 |
-
|
3722 |
-
|
3723 |
-
|
3724 |
-
|
3725 |
-
|
3726 |
-
|
3727 |
-
}
|
3728 |
-
|
3729 |
-
|
3730 |
-
|
3731 |
-
|
3732 |
-
|
3733 |
-
var
|
3734 |
-
|
3735 |
-
|
3736 |
-
|
3737 |
-
|
3738 |
-
|
3739 |
-
|
3740 |
-
|
3741 |
-
|
3742 |
-
|
3743 |
-
|
3744 |
-
|
3745 |
-
|
3746 |
-
|
3747 |
-
|
3748 |
-
|
3749 |
-
|
3750 |
-
|
3751 |
-
|
3752 |
-
|
3753 |
-
|
3754 |
-
|
3755 |
-
|
3756 |
-
|
3757 |
-
|
3758 |
-
|
3759 |
-
|
3760 |
-
|
3761 |
-
|
3762 |
-
|
3763 |
-
|
3764 |
-
|
3765 |
-
|
3766 |
-
|
3767 |
-
|
3768 |
-
|
3769 |
-
|
3770 |
-
|
3771 |
-
|
3772 |
-
|
3773 |
-
|
3774 |
-
|
3775 |
-
|
3776 |
-
|
3777 |
-
|
3778 |
-
|
3779 |
-
|
3780 |
-
|
3781 |
-
|
3782 |
-
|
3783 |
-
|
3784 |
-
|
3785 |
-
|
3786 |
-
|
3787 |
-
|
3788 |
-
|
3789 |
-
|
3790 |
-
|
3791 |
-
|
3792 |
-
|
3793 |
-
|
3794 |
-
|
3795 |
-
|
3796 |
-
|
3797 |
-
|
3798 |
-
|
3799 |
-
|
3800 |
-
|
3801 |
-
|
3802 |
-
|
3803 |
-
|
3804 |
-
|
3805 |
-
|
3806 |
-
|
3807 |
-
|
3808 |
-
}
|
3809 |
-
|
3810 |
-
|
3811 |
-
|
3812 |
-
|
3813 |
-
|
3814 |
-
|
3815 |
-
|
3816 |
-
|
3817 |
-
|
3818 |
-
|
3819 |
-
|
3820 |
-
|
3821 |
-
|
3822 |
-
|
3823 |
-
|
3824 |
-
|
3825 |
-
|
3826 |
-
|
3827 |
-
|
3828 |
-
|
3829 |
-
|
3830 |
-
|
3831 |
-
var
|
3832 |
-
|
3833 |
-
|
3834 |
-
|
3835 |
-
|
3836 |
-
|
3837 |
-
|
3838 |
-
|
3839 |
-
|
3840 |
-
|
3841 |
-
|
3842 |
-
|
3843 |
-
|
3844 |
-
|
3845 |
-
|
3846 |
-
|
3847 |
-
|
3848 |
-
|
3849 |
-
|
3850 |
-
|
3851 |
-
|
3852 |
-
|
3853 |
-
|
3854 |
-
|
3855 |
-
|
3856 |
-
|
3857 |
-
|
3858 |
-
|
3859 |
-
|
3860 |
-
|
3861 |
-
|
3862 |
-
|
3863 |
-
|
3864 |
-
|
3865 |
-
|
3866 |
-
|
3867 |
-
|
3868 |
-
|
3869 |
-
|
3870 |
-
|
3871 |
-
|
3872 |
-
|
3873 |
-
|
3874 |
-
|
3875 |
-
|
3876 |
-
|
3877 |
-
|
3878 |
-
|
3879 |
-
|
3880 |
-
|
3881 |
-
|
3882 |
-
|
3883 |
-
|
3884 |
-
|
3885 |
-
|
3886 |
-
|
3887 |
-
|
3888 |
-
|
3889 |
-
|
3890 |
-
|
3891 |
-
|
3892 |
-
|
3893 |
-
|
3894 |
-
|
3895 |
-
|
3896 |
-
|
3897 |
-
|
3898 |
-
|
3899 |
-
|
3900 |
-
|
3901 |
-
|
3902 |
-
|
3903 |
-
|
3904 |
-
|
3905 |
-
|
3906 |
-
|
3907 |
-
|
3908 |
-
|
3909 |
-
|
3910 |
-
|
3911 |
-
|
3912 |
-
|
3913 |
-
|
3914 |
-
|
3915 |
-
|
3916 |
-
|
3917 |
-
|
3918 |
-
|
3919 |
-
|
3920 |
-
|
3921 |
-
|
3922 |
-
|
3923 |
-
|
3924 |
-
|
3925 |
-
|
3926 |
-
|
3927 |
-
|
3928 |
-
|
3929 |
-
|
3930 |
-
|
3931 |
-
|
3932 |
-
|
3933 |
-
|
3934 |
-
|
3935 |
-
|
3936 |
-
var
|
3937 |
-
|
3938 |
-
|
3939 |
-
|
3940 |
-
|
3941 |
-
|
3942 |
-
|
3943 |
-
/***/
|
3944 |
-
|
3945 |
-
|
3946 |
-
|
3947 |
-
|
3948 |
-
|
3949 |
-
|
3950 |
-
/***/
|
3951 |
-
|
3952 |
-
|
3953 |
-
|
3954 |
-
|
3955 |
-
var
|
3956 |
-
var
|
3957 |
-
|
3958 |
-
var
|
3959 |
-
|
3960 |
-
|
3961 |
-
|
3962 |
-
|
3963 |
-
|
3964 |
-
|
3965 |
-
}
|
3966 |
-
|
3967 |
-
|
3968 |
-
|
3969 |
-
|
3970 |
-
|
3971 |
-
|
3972 |
-
|
3973 |
-
|
3974 |
-
|
3975 |
-
|
3976 |
-
|
3977 |
-
|
3978 |
-
|
3979 |
-
|
3980 |
-
|
3981 |
-
|
3982 |
-
|
3983 |
-
|
3984 |
-
|
3985 |
-
|
3986 |
-
|
3987 |
-
|
3988 |
-
|
3989 |
-
|
3990 |
-
|
3991 |
-
|
3992 |
-
|
3993 |
-
|
3994 |
-
|
3995 |
-
|
3996 |
-
|
3997 |
-
|
3998 |
-
|
3999 |
-
|
4000 |
-
|
4001 |
-
|
4002 |
-
|
4003 |
-
|
4004 |
-
|
4005 |
-
|
4006 |
-
|
4007 |
-
|
4008 |
-
|
4009 |
-
|
4010 |
-
|
4011 |
-
|
4012 |
-
|
4013 |
-
|
4014 |
-
|
4015 |
-
|
4016 |
-
|
4017 |
-
|
4018 |
-
|
4019 |
-
|
4020 |
-
|
4021 |
-
|
4022 |
-
|
4023 |
-
|
4024 |
-
|
4025 |
-
|
4026 |
-
|
4027 |
-
|
4028 |
-
|
4029 |
-
|
4030 |
-
|
4031 |
-
|
4032 |
-
|
4033 |
-
|
4034 |
-
|
4035 |
-
|
4036 |
-
|
4037 |
-
|
4038 |
-
|
4039 |
-
|
4040 |
-
|
4041 |
-
|
4042 |
-
|
4043 |
-
|
4044 |
-
|
4045 |
-
|
4046 |
-
|
4047 |
-
|
4048 |
-
|
4049 |
-
|
4050 |
-
|
4051 |
-
|
4052 |
-
|
4053 |
-
|
4054 |
-
|
4055 |
-
|
4056 |
-
|
4057 |
-
|
4058 |
-
|
4059 |
-
|
4060 |
-
|
4061 |
-
|
4062 |
-
|
4063 |
-
|
4064 |
-
|
4065 |
-
|
4066 |
-
|
4067 |
-
|
4068 |
-
|
4069 |
-
|
4070 |
-
|
4071 |
-
|
4072 |
-
|
4073 |
-
|
4074 |
-
|
4075 |
-
|
4076 |
-
|
4077 |
-
|
4078 |
-
|
4079 |
-
|
4080 |
-
|
4081 |
-
|
4082 |
-
|
4083 |
-
|
4084 |
-
|
4085 |
-
|
4086 |
-
|
4087 |
-
|
4088 |
-
|
4089 |
-
|
4090 |
-
|
4091 |
-
|
4092 |
-
|
4093 |
-
|
4094 |
-
|
4095 |
-
|
4096 |
-
|
4097 |
-
|
4098 |
-
|
4099 |
-
|
4100 |
-
|
4101 |
-
|
4102 |
-
|
4103 |
-
|
4104 |
-
|
4105 |
-
|
4106 |
-
|
4107 |
-
|
4108 |
-
|
4109 |
-
|
4110 |
-
|
4111 |
-
|
4112 |
-
|
4113 |
-
|
4114 |
-
|
4115 |
-
|
4116 |
-
|
4117 |
-
|
4118 |
-
|
4119 |
-
|
4120 |
-
|
4121 |
-
|
4122 |
-
|
4123 |
-
|
4124 |
-
|
4125 |
-
|
4126 |
-
|
4127 |
-
|
4128 |
-
|
4129 |
-
|
4130 |
-
|
4131 |
-
|
4132 |
-
|
4133 |
-
|
4134 |
-
|
4135 |
-
|
4136 |
-
|
4137 |
-
|
4138 |
-
|
4139 |
-
|
4140 |
-
|
4141 |
-
|
4142 |
-
|
4143 |
-
|
4144 |
-
|
4145 |
-
|
4146 |
-
|
4147 |
-
|
4148 |
-
|
4149 |
-
|
4150 |
-
|
4151 |
-
|
4152 |
-
|
4153 |
-
|
4154 |
-
|
4155 |
-
|
4156 |
-
|
4157 |
-
|
4158 |
-
|
4159 |
-
|
4160 |
-
|
4161 |
-
|
4162 |
-
|
4163 |
-
|
4164 |
-
|
4165 |
-
|
4166 |
-
|
4167 |
-
|
4168 |
-
|
4169 |
-
|
4170 |
-
|
4171 |
-
|
4172 |
-
|
4173 |
-
|
4174 |
-
|
4175 |
-
|
4176 |
-
|
4177 |
-
|
4178 |
-
|
4179 |
-
|
4180 |
-
|
4181 |
-
|
4182 |
-
|
4183 |
-
|
4184 |
-
}
|
4185 |
-
|
4186 |
-
|
4187 |
-
|
4188 |
-
|
4189 |
-
|
4190 |
-
|
4191 |
-
|
4192 |
-
}
|
4193 |
-
|
4194 |
-
|
4195 |
-
|
4196 |
-
}
|
4197 |
-
|
4198 |
-
|
4199 |
-
|
4200 |
-
|
4201 |
-
|
4202 |
-
|
4203 |
-
|
4204 |
-
|
4205 |
-
|
4206 |
-
|
4207 |
-
|
4208 |
-
|
4209 |
-
|
4210 |
-
|
4211 |
-
|
4212 |
-
|
4213 |
-
|
4214 |
-
|
4215 |
-
|
4216 |
-
|
4217 |
-
|
4218 |
-
|
4219 |
-
|
4220 |
-
|
4221 |
-
|
4222 |
-
|
4223 |
-
|
4224 |
-
|
4225 |
-
|
4226 |
-
|
4227 |
-
|
4228 |
-
|
4229 |
-
|
4230 |
-
|
4231 |
-
|
4232 |
-
|
4233 |
-
|
4234 |
-
|
4235 |
-
|
4236 |
-
|
4237 |
-
|
4238 |
-
|
4239 |
-
|
4240 |
-
|
4241 |
-
|
4242 |
-
|
4243 |
-
|
4244 |
-
|
4245 |
-
|
4246 |
-
|
4247 |
-
}
|
4248 |
-
|
4249 |
-
|
4250 |
-
|
4251 |
-
|
4252 |
-
|
4253 |
-
|
4254 |
-
|
4255 |
-
|
4256 |
-
|
4257 |
-
|
4258 |
-
|
4259 |
-
|
4260 |
-
|
4261 |
-
|
4262 |
-
|
4263 |
-
|
4264 |
-
|
4265 |
-
|
4266 |
-
|
4267 |
-
|
4268 |
-
|
4269 |
-
|
4270 |
-
|
4271 |
-
|
4272 |
-
|
4273 |
-
|
4274 |
-
|
4275 |
-
|
4276 |
-
|
4277 |
-
|
4278 |
-
|
4279 |
-
|
4280 |
-
|
4281 |
-
|
4282 |
-
|
4283 |
-
|
4284 |
-
|
4285 |
-
|
4286 |
-
*
|
4287 |
-
*
|
4288 |
-
*
|
4289 |
-
*
|
4290 |
-
*
|
4291 |
-
|
4292 |
-
|
4293 |
-
function
|
4294 |
-
|
4295 |
-
|
4296 |
-
|
4297 |
-
|
4298 |
-
|
4299 |
-
|
4300 |
-
|
4301 |
-
|
4302 |
-
|
4303 |
-
|
4304 |
-
|
4305 |
-
*
|
4306 |
-
*
|
4307 |
-
*
|
4308 |
-
*
|
4309 |
-
* @
|
4310 |
-
*
|
4311 |
-
*
|
4312 |
-
*
|
4313 |
-
*
|
4314 |
-
|
4315 |
-
|
4316 |
-
|
4317 |
-
|
4318 |
-
|
4319 |
-
|
4320 |
-
|
4321 |
-
|
4322 |
-
|
4323 |
-
|
4324 |
-
|
4325 |
-
|
4326 |
-
|
4327 |
-
|
4328 |
-
|
4329 |
-
|
4330 |
-
|
4331 |
-
|
4332 |
-
}
|
4333 |
-
|
4334 |
-
|
4335 |
-
|
4336 |
-
|
4337 |
-
|
4338 |
-
|
4339 |
-
|
4340 |
-
|
4341 |
-
|
4342 |
-
|
4343 |
-
|
4344 |
-
|
4345 |
-
|
4346 |
-
|
4347 |
-
|
4348 |
-
|
4349 |
-
|
4350 |
-
|
4351 |
-
|
4352 |
-
|
4353 |
-
|
4354 |
-
|
4355 |
-
|
4356 |
-
|
4357 |
-
|
4358 |
-
|
4359 |
-
|
4360 |
-
|
4361 |
-
|
4362 |
-
|
4363 |
-
|
4364 |
-
|
4365 |
-
|
4366 |
-
|
4367 |
-
|
4368 |
-
|
4369 |
-
|
4370 |
-
|
4371 |
-
|
4372 |
-
|
4373 |
-
|
4374 |
-
|
4375 |
-
|
4376 |
-
|
4377 |
-
|
4378 |
-
|
4379 |
-
|
4380 |
-
|
4381 |
-
|
4382 |
-
|
4383 |
-
|
4384 |
-
|
4385 |
-
|
4386 |
-
|
4387 |
-
|
4388 |
-
|
4389 |
-
|
4390 |
-
|
4391 |
-
|
4392 |
-
|
4393 |
-
|
4394 |
-
|
4395 |
-
|
4396 |
-
|
4397 |
-
|
4398 |
-
|
4399 |
-
|
4400 |
-
|
4401 |
-
|
4402 |
-
|
4403 |
-
|
4404 |
-
|
4405 |
-
|
4406 |
-
|
4407 |
-
}
|
4408 |
-
|
4409 |
-
|
4410 |
-
|
4411 |
-
|
4412 |
-
|
4413 |
-
|
4414 |
-
|
4415 |
-
|
4416 |
-
|
4417 |
-
|
4418 |
-
|
4419 |
-
|
4420 |
-
|
4421 |
-
|
4422 |
-
|
4423 |
-
|
4424 |
-
|
4425 |
-
|
4426 |
-
|
4427 |
-
|
4428 |
-
|
4429 |
-
|
4430 |
-
|
4431 |
-
|
4432 |
-
|
4433 |
-
|
4434 |
-
|
4435 |
-
|
4436 |
-
|
4437 |
-
|
4438 |
-
|
4439 |
-
|
4440 |
-
|
4441 |
-
|
4442 |
-
|
4443 |
-
|
4444 |
-
|
4445 |
-
|
4446 |
-
|
4447 |
-
|
4448 |
-
|
4449 |
-
|
4450 |
-
|
4451 |
-
|
4452 |
-
|
4453 |
-
|
4454 |
-
|
4455 |
-
|
4456 |
-
|
4457 |
-
|
4458 |
-
|
4459 |
-
|
4460 |
-
|
4461 |
-
|
4462 |
-
|
4463 |
-
|
4464 |
-
|
4465 |
-
|
4466 |
-
|
4467 |
-
|
4468 |
-
|
4469 |
-
|
4470 |
-
|
4471 |
-
|
4472 |
-
|
4473 |
-
|
4474 |
-
|
4475 |
-
|
4476 |
-
|
4477 |
-
|
4478 |
-
|
4479 |
-
|
4480 |
-
|
4481 |
-
|
4482 |
-
|
4483 |
-
|
4484 |
-
|
4485 |
-
|
4486 |
-
|
4487 |
-
|
4488 |
-
|
4489 |
-
|
4490 |
-
}
|
4491 |
-
|
4492 |
-
|
4493 |
-
|
4494 |
-
|
4495 |
-
|
4496 |
-
|
4497 |
-
|
4498 |
-
|
4499 |
-
|
4500 |
-
|
4501 |
-
|
4502 |
-
|
4503 |
-
|
4504 |
-
|
4505 |
-
|
4506 |
-
|
4507 |
-
|
4508 |
-
|
4509 |
-
|
4510 |
-
|
4511 |
-
|
4512 |
-
|
4513 |
-
|
4514 |
-
|
4515 |
-
|
4516 |
-
|
4517 |
-
|
4518 |
-
|
4519 |
-
|
4520 |
-
|
4521 |
-
|
4522 |
-
|
4523 |
-
|
4524 |
-
var
|
4525 |
-
|
4526 |
-
|
4527 |
-
|
4528 |
-
|
4529 |
-
|
4530 |
-
|
4531 |
-
|
4532 |
-
|
4533 |
-
|
4534 |
-
|
4535 |
-
|
4536 |
-
|
4537 |
-
|
4538 |
-
|
4539 |
-
|
4540 |
-
|
4541 |
-
|
4542 |
-
|
4543 |
-
|
4544 |
-
|
4545 |
-
|
4546 |
-
|
4547 |
-
|
4548 |
-
|
4549 |
-
|
4550 |
-
|
4551 |
-
|
4552 |
-
|
4553 |
-
|
4554 |
-
|
4555 |
-
|
4556 |
-
|
4557 |
-
|
4558 |
-
|
4559 |
-
|
4560 |
-
|
4561 |
-
|
4562 |
-
|
4563 |
-
|
4564 |
-
|
4565 |
-
|
4566 |
-
|
4567 |
-
|
4568 |
-
|
4569 |
-
|
4570 |
-
|
4571 |
-
|
4572 |
-
|
4573 |
-
|
4574 |
-
|
4575 |
-
|
4576 |
-
|
4577 |
-
|
4578 |
-
|
4579 |
-
|
4580 |
-
|
4581 |
-
|
4582 |
-
|
4583 |
-
|
4584 |
-
|
4585 |
-
|
4586 |
-
|
4587 |
-
|
4588 |
-
|
4589 |
-
|
4590 |
-
|
4591 |
-
|
4592 |
-
|
4593 |
-
|
4594 |
-
|
4595 |
-
|
4596 |
-
|
4597 |
-
|
4598 |
-
|
4599 |
-
|
4600 |
-
|
4601 |
-
|
4602 |
-
|
4603 |
-
|
4604 |
-
|
4605 |
-
|
4606 |
-
|
4607 |
-
|
4608 |
-
|
4609 |
-
|
4610 |
-
|
4611 |
-
|
4612 |
-
|
4613 |
-
|
4614 |
-
|
4615 |
-
|
4616 |
-
|
4617 |
-
|
4618 |
-
|
4619 |
-
|
4620 |
-
|
4621 |
-
|
4622 |
-
|
4623 |
-
|
4624 |
-
|
4625 |
-
|
4626 |
-
|
4627 |
-
|
4628 |
-
|
4629 |
-
|
4630 |
-
|
4631 |
-
|
4632 |
-
|
4633 |
-
|
4634 |
-
|
4635 |
-
|
4636 |
-
|
4637 |
-
|
4638 |
-
|
4639 |
-
|
4640 |
-
//
|
4641 |
-
|
4642 |
-
|
4643 |
-
|
4644 |
-
|
4645 |
-
|
4646 |
-
|
4647 |
-
}
|
4648 |
-
|
4649 |
-
|
4650 |
-
|
4651 |
-
|
4652 |
-
|
4653 |
-
|
4654 |
-
|
4655 |
-
|
4656 |
-
|
4657 |
-
|
4658 |
-
|
4659 |
-
|
4660 |
-
|
4661 |
-
|
4662 |
-
|
4663 |
-
|
4664 |
-
|
4665 |
-
|
4666 |
-
|
4667 |
-
|
4668 |
-
|
4669 |
-
|
4670 |
-
|
4671 |
-
|
4672 |
-
|
4673 |
-
|
4674 |
-
|
4675 |
-
|
4676 |
-
|
4677 |
-
|
4678 |
-
|
4679 |
-
|
4680 |
-
|
4681 |
-
|
4682 |
-
|
4683 |
-
|
4684 |
-
|
4685 |
-
|
4686 |
-
|
4687 |
-
|
4688 |
-
|
4689 |
-
|
4690 |
-
|
4691 |
-
|
4692 |
-
|
4693 |
-
|
4694 |
-
|
4695 |
-
|
4696 |
-
|
4697 |
-
|
4698 |
-
|
4699 |
-
|
4700 |
-
|
4701 |
-
}
|
4702 |
-
|
4703 |
-
|
4704 |
-
|
4705 |
-
|
4706 |
-
|
4707 |
-
|
4708 |
-
|
4709 |
-
|
4710 |
-
|
4711 |
-
|
4712 |
-
}
|
4713 |
-
|
4714 |
-
|
4715 |
-
|
4716 |
-
|
4717 |
-
|
4718 |
-
|
4719 |
-
|
4720 |
-
|
4721 |
-
|
4722 |
-
|
4723 |
-
|
4724 |
-
|
4725 |
-
|
4726 |
-
|
4727 |
-
|
4728 |
-
|
4729 |
-
|
4730 |
-
|
4731 |
-
|
4732 |
-
|
4733 |
-
|
4734 |
-
|
4735 |
-
|
4736 |
-
|
4737 |
-
|
4738 |
-
|
4739 |
-
|
4740 |
-
|
4741 |
-
|
4742 |
-
|
4743 |
-
|
4744 |
-
|
4745 |
-
|
4746 |
-
|
4747 |
-
|
4748 |
-
|
4749 |
-
|
4750 |
-
|
4751 |
-
|
4752 |
-
|
4753 |
-
|
4754 |
-
|
4755 |
-
|
4756 |
-
|
4757 |
-
|
4758 |
-
|
4759 |
-
|
4760 |
-
|
4761 |
-
|
4762 |
-
|
4763 |
-
}
|
4764 |
-
|
4765 |
-
|
4766 |
-
|
4767 |
-
|
4768 |
-
|
4769 |
-
|
4770 |
-
|
4771 |
-
|
4772 |
-
|
4773 |
-
|
4774 |
-
|
4775 |
-
|
4776 |
-
|
4777 |
-
|
4778 |
-
|
4779 |
-
|
4780 |
-
|
4781 |
-
|
4782 |
-
|
4783 |
-
|
4784 |
-
|
4785 |
-
|
4786 |
-
|
4787 |
-
|
4788 |
-
|
4789 |
-
|
4790 |
-
|
4791 |
-
|
4792 |
-
|
4793 |
-
|
4794 |
-
|
4795 |
-
|
4796 |
-
|
4797 |
-
|
4798 |
-
|
4799 |
-
|
4800 |
-
|
4801 |
-
|
4802 |
-
|
4803 |
-
|
4804 |
-
|
4805 |
-
|
4806 |
-
|
4807 |
-
|
4808 |
-
|
4809 |
-
|
4810 |
-
|
4811 |
-
|
4812 |
-
}
|
4813 |
-
|
4814 |
-
|
4815 |
-
|
4816 |
-
|
4817 |
-
|
4818 |
-
|
4819 |
-
|
4820 |
-
|
4821 |
-
|
4822 |
-
|
4823 |
-
|
4824 |
-
|
4825 |
-
|
4826 |
-
|
4827 |
-
|
4828 |
-
|
4829 |
-
|
4830 |
-
|
4831 |
-
|
4832 |
-
*
|
4833 |
-
|
4834 |
-
|
4835 |
-
|
4836 |
-
|
4837 |
-
|
4838 |
-
|
4839 |
-
|
4840 |
-
|
4841 |
-
|
4842 |
-
|
4843 |
-
|
4844 |
-
|
4845 |
-
}
|
4846 |
-
|
4847 |
-
|
4848 |
-
|
4849 |
-
|
4850 |
-
|
4851 |
-
|
4852 |
-
|
4853 |
-
|
4854 |
-
|
4855 |
-
|
4856 |
-
|
4857 |
-
|
4858 |
-
|
4859 |
-
|
4860 |
-
|
4861 |
-
|
4862 |
-
|
4863 |
-
|
4864 |
-
|
4865 |
-
|
4866 |
-
|
4867 |
-
|
4868 |
-
|
4869 |
-
|
4870 |
-
|
4871 |
-
|
4872 |
-
|
4873 |
-
|
4874 |
-
|
4875 |
-
|
4876 |
-
|
4877 |
-
|
4878 |
-
|
4879 |
-
|
4880 |
-
|
4881 |
-
|
4882 |
-
|
4883 |
-
|
4884 |
-
|
4885 |
-
|
4886 |
-
|
4887 |
-
|
4888 |
-
|
4889 |
-
|
4890 |
-
|
4891 |
-
|
4892 |
-
|
4893 |
-
|
4894 |
-
|
4895 |
-
|
4896 |
-
|
4897 |
-
|
4898 |
-
|
4899 |
-
|
4900 |
-
|
4901 |
-
|
4902 |
-
|
4903 |
-
|
4904 |
-
|
4905 |
-
|
4906 |
-
|
4907 |
-
|
4908 |
-
|
4909 |
-
|
4910 |
-
|
4911 |
-
|
4912 |
-
|
4913 |
-
|
4914 |
-
|
4915 |
-
|
4916 |
-
|
4917 |
-
|
4918 |
-
|
4919 |
-
|
4920 |
-
|
4921 |
-
|
4922 |
-
|
4923 |
-
|
4924 |
-
|
4925 |
-
|
4926 |
-
|
4927 |
-
|
4928 |
-
|
4929 |
-
|
4930 |
-
|
4931 |
-
|
4932 |
-
|
4933 |
-
|
4934 |
-
|
4935 |
-
|
4936 |
-
|
4937 |
-
|
4938 |
-
|
4939 |
-
|
4940 |
-
|
4941 |
-
|
4942 |
-
|
4943 |
-
|
4944 |
-
|
4945 |
-
|
4946 |
-
|
4947 |
-
|
4948 |
-
|
4949 |
-
|
4950 |
-
|
4951 |
-
|
4952 |
-
|
4953 |
-
|
4954 |
-
function
|
4955 |
-
|
4956 |
-
|
4957 |
-
|
4958 |
-
|
4959 |
-
|
4960 |
-
|
4961 |
-
|
4962 |
-
|
4963 |
-
|
4964 |
-
|
4965 |
-
|
4966 |
-
|
4967 |
-
|
4968 |
-
|
4969 |
-
|
4970 |
-
|
4971 |
-
|
4972 |
-
|
4973 |
-
|
4974 |
-
|
4975 |
-
|
4976 |
-
|
4977 |
-
|
4978 |
-
|
4979 |
-
|
4980 |
-
|
4981 |
-
|
4982 |
-
|
4983 |
-
|
4984 |
-
|
4985 |
-
|
4986 |
-
|
4987 |
-
|
4988 |
-
|
4989 |
-
|
4990 |
-
|
4991 |
-
|
4992 |
-
|
4993 |
-
|
4994 |
-
|
4995 |
-
|
4996 |
-
|
4997 |
-
|
4998 |
-
|
4999 |
-
|
5000 |
-
|
5001 |
-
|
5002 |
-
|
5003 |
-
|
5004 |
-
|
5005 |
-
|
5006 |
-
|
5007 |
-
|
5008 |
-
|
5009 |
-
|
5010 |
-
|
5011 |
-
|
5012 |
-
|
5013 |
-
|
5014 |
-
|
5015 |
-
|
5016 |
-
|
5017 |
-
|
5018 |
-
|
5019 |
-
|
5020 |
-
|
5021 |
-
|
5022 |
-
|
5023 |
-
|
5024 |
-
|
5025 |
-
|
5026 |
-
|
5027 |
-
|
5028 |
-
|
5029 |
-
|
5030 |
-
}
|
5031 |
-
|
5032 |
-
|
5033 |
-
|
5034 |
-
|
5035 |
-
|
5036 |
-
|
5037 |
-
|
5038 |
-
|
5039 |
-
|
5040 |
-
|
5041 |
-
|
5042 |
-
|
5043 |
-
|
5044 |
-
|
5045 |
-
|
5046 |
-
|
5047 |
-
|
5048 |
-
|
5049 |
-
|
5050 |
-
|
5051 |
-
|
5052 |
-
|
5053 |
-
|
5054 |
-
|
5055 |
-
|
5056 |
-
|
5057 |
-
|
5058 |
-
|
5059 |
-
|
5060 |
-
|
5061 |
-
|
5062 |
-
|
5063 |
-
|
5064 |
-
|
5065 |
-
|
5066 |
-
|
5067 |
-
|
5068 |
-
|
5069 |
-
|
5070 |
-
|
5071 |
-
|
5072 |
-
|
5073 |
-
|
5074 |
-
|
5075 |
-
|
5076 |
-
|
5077 |
-
|
5078 |
-
|
5079 |
-
|
5080 |
-
|
5081 |
-
|
5082 |
-
|
5083 |
-
|
5084 |
-
|
5085 |
-
|
5086 |
-
|
5087 |
-
|
5088 |
-
|
5089 |
-
|
5090 |
-
|
5091 |
-
|
5092 |
-
|
5093 |
-
|
5094 |
-
|
5095 |
-
|
5096 |
-
|
5097 |
-
|
5098 |
-
|
5099 |
-
|
5100 |
-
|
5101 |
-
|
5102 |
-
|
5103 |
-
|
5104 |
-
|
5105 |
-
|
5106 |
-
|
5107 |
-
|
5108 |
-
|
5109 |
-
|
5110 |
-
|
5111 |
-
|
5112 |
-
|
5113 |
-
|
5114 |
-
|
5115 |
-
|
5116 |
-
|
5117 |
-
|
5118 |
-
|
5119 |
-
|
5120 |
-
|
5121 |
-
|
5122 |
-
|
5123 |
-
|
5124 |
-
|
5125 |
-
|
5126 |
-
|
5127 |
-
|
5128 |
-
|
5129 |
-
|
5130 |
-
|
5131 |
-
|
5132 |
-
|
5133 |
-
|
5134 |
-
|
5135 |
-
|
5136 |
-
|
5137 |
-
|
5138 |
-
|
5139 |
-
|
5140 |
-
|
5141 |
-
|
5142 |
-
|
5143 |
-
|
5144 |
-
|
5145 |
-
|
5146 |
-
|
5147 |
-
|
5148 |
-
|
5149 |
-
|
5150 |
-
|
5151 |
-
|
5152 |
-
|
5153 |
-
|
5154 |
-
|
5155 |
-
|
5156 |
-
|
5157 |
-
|
5158 |
-
|
5159 |
-
|
5160 |
-
|
5161 |
-
|
5162 |
-
|
5163 |
-
|
5164 |
-
|
5165 |
-
|
5166 |
-
|
5167 |
-
|
5168 |
-
|
5169 |
-
|
5170 |
-
|
5171 |
-
|
5172 |
-
|
5173 |
-
|
5174 |
-
|
5175 |
-
|
5176 |
-
|
5177 |
-
|
5178 |
-
|
5179 |
-
var
|
5180 |
-
|
5181 |
-
|
5182 |
-
|
5183 |
-
|
5184 |
-
|
5185 |
-
|
5186 |
-
|
5187 |
-
|
5188 |
-
|
5189 |
-
|
5190 |
-
|
5191 |
-
|
5192 |
-
|
5193 |
-
|
5194 |
-
|
5195 |
-
|
5196 |
-
|
5197 |
-
|
5198 |
-
|
5199 |
-
|
5200 |
-
|
5201 |
-
|
5202 |
-
|
5203 |
-
|
5204 |
-
|
5205 |
-
|
5206 |
-
|
5207 |
-
|
5208 |
-
|
5209 |
-
|
5210 |
-
|
5211 |
-
|
5212 |
-
|
5213 |
-
|
5214 |
-
|
5215 |
-
|
5216 |
-
|
5217 |
-
|
5218 |
-
|
5219 |
-
|
5220 |
-
|
5221 |
-
|
5222 |
-
|
5223 |
-
|
5224 |
-
exports.
|
5225 |
-
|
5226 |
-
|
5227 |
-
|
5228 |
-
var
|
5229 |
-
|
5230 |
-
|
5231 |
-
|
5232 |
-
|
5233 |
-
function
|
5234 |
-
|
5235 |
-
|
5236 |
-
|
5237 |
-
|
5238 |
-
|
5239 |
-
|
5240 |
-
|
5241 |
-
|
5242 |
-
|
5243 |
-
|
5244 |
-
|
5245 |
-
|
5246 |
-
|
5247 |
-
|
5248 |
-
|
5249 |
-
|
5250 |
-
|
5251 |
-
|
5252 |
-
|
5253 |
-
|
5254 |
-
function
|
5255 |
-
|
5256 |
-
|
5257 |
-
|
5258 |
-
|
5259 |
-
|
5260 |
-
|
5261 |
-
|
5262 |
-
|
5263 |
-
|
5264 |
-
|
5265 |
-
|
5266 |
-
|
5267 |
-
|
5268 |
-
|
5269 |
-
|
5270 |
-
|
5271 |
-
|
5272 |
-
|
5273 |
-
|
5274 |
-
|
5275 |
-
|
5276 |
-
|
5277 |
-
|
5278 |
-
|
5279 |
-
|
5280 |
-
|
5281 |
-
|
5282 |
-
|
5283 |
-
|
5284 |
-
|
5285 |
-
|
5286 |
-
|
5287 |
-
|
5288 |
-
|
5289 |
-
|
5290 |
-
"
|
5291 |
-
|
5292 |
-
|
5293 |
-
|
5294 |
-
|
5295 |
-
|
5296 |
-
|
5297 |
-
|
5298 |
-
|
5299 |
-
|
5300 |
-
|
5301 |
-
|
5302 |
-
|
5303 |
-
|
5304 |
-
|
5305 |
-
|
5306 |
-
|
5307 |
-
|
5308 |
-
|
5309 |
-
|
5310 |
-
|
5311 |
-
|
5312 |
-
|
5313 |
-
|
5314 |
-
|
5315 |
-
|
5316 |
-
|
5317 |
-
|
5318 |
-
|
5319 |
-
}
|
5320 |
-
|
5321 |
-
|
5322 |
-
|
5323 |
-
|
5324 |
-
|
5325 |
-
|
5326 |
-
|
5327 |
-
|
5328 |
-
|
5329 |
-
|
5330 |
-
|
5331 |
-
|
5332 |
-
|
5333 |
-
|
5334 |
-
|
5335 |
-
|
5336 |
-
|
5337 |
-
|
5338 |
-
|
5339 |
-
|
5340 |
-
|
5341 |
-
|
5342 |
-
|
5343 |
-
|
5344 |
-
|
5345 |
-
|
5346 |
-
|
5347 |
-
|
5348 |
-
|
5349 |
-
|
5350 |
-
|
5351 |
-
|
5352 |
-
|
5353 |
-
|
5354 |
-
|
5355 |
-
|
5356 |
-
|
5357 |
-
|
5358 |
-
|
5359 |
-
|
5360 |
-
|
5361 |
-
|
5362 |
-
|
5363 |
-
|
5364 |
-
|
5365 |
-
|
5366 |
-
|
5367 |
-
|
5368 |
-
|
5369 |
-
|
5370 |
-
|
5371 |
-
|
5372 |
-
|
5373 |
-
|
5374 |
-
|
5375 |
-
|
5376 |
-
|
5377 |
-
|
5378 |
-
|
5379 |
-
}
|
5380 |
-
|
5381 |
-
|
5382 |
-
|
5383 |
-
|
5384 |
-
|
5385 |
-
|
5386 |
-
|
5387 |
-
|
5388 |
-
|
5389 |
-
|
5390 |
-
|
5391 |
-
|
5392 |
-
|
5393 |
-
|
5394 |
-
|
5395 |
-
|
5396 |
-
|
5397 |
-
|
5398 |
-
|
5399 |
-
|
5400 |
-
|
5401 |
-
|
5402 |
-
|
5403 |
-
|
5404 |
-
|
5405 |
-
|
5406 |
-
|
5407 |
-
|
5408 |
-
|
5409 |
-
|
5410 |
-
|
5411 |
-
}
|
5412 |
-
|
5413 |
-
|
5414 |
-
|
5415 |
-
|
5416 |
-
|
5417 |
-
|
5418 |
-
|
5419 |
-
|
5420 |
-
|
5421 |
-
|
5422 |
-
|
5423 |
-
|
5424 |
-
|
5425 |
-
|
5426 |
-
|
5427 |
-
|
5428 |
-
}
|
5429 |
-
|
5430 |
-
|
5431 |
-
|
5432 |
-
|
5433 |
-
|
5434 |
-
|
5435 |
-
|
5436 |
-
|
5437 |
-
|
5438 |
-
|
5439 |
-
|
5440 |
-
|
5441 |
-
|
5442 |
-
|
5443 |
-
|
5444 |
-
|
5445 |
-
|
5446 |
-
|
5447 |
-
|
5448 |
-
|
5449 |
-
|
5450 |
-
|
5451 |
-
|
5452 |
-
|
5453 |
-
|
5454 |
-
|
5455 |
-
|
5456 |
-
|
5457 |
-
|
5458 |
-
|
5459 |
-
|
5460 |
-
|
5461 |
-
|
5462 |
-
|
5463 |
-
|
5464 |
-
|
5465 |
-
|
5466 |
-
|
5467 |
-
|
5468 |
-
|
5469 |
-
|
5470 |
-
|
5471 |
-
|
5472 |
-
|
5473 |
-
|
5474 |
-
|
5475 |
-
|
5476 |
-
|
5477 |
-
//
|
5478 |
-
|
5479 |
-
|
5480 |
-
|
5481 |
-
|
5482 |
-
|
5483 |
-
|
5484 |
-
|
5485 |
-
|
5486 |
-
|
5487 |
-
|
5488 |
-
|
5489 |
-
|
5490 |
-
|
5491 |
-
|
5492 |
-
|
5493 |
-
|
5494 |
-
|
5495 |
-
|
5496 |
-
|
5497 |
-
|
5498 |
-
|
5499 |
-
|
5500 |
-
|
5501 |
-
|
5502 |
-
|
5503 |
-
|
5504 |
-
|
5505 |
-
var
|
5506 |
-
|
5507 |
-
|
5508 |
-
|
5509 |
-
|
5510 |
-
|
5511 |
-
|
5512 |
-
|
5513 |
-
|
5514 |
-
|
5515 |
-
|
5516 |
-
|
5517 |
-
|
5518 |
-
|
5519 |
-
|
5520 |
-
|
5521 |
-
|
5522 |
-
|
5523 |
-
|
5524 |
-
|
5525 |
-
|
5526 |
-
|
5527 |
-
|
5528 |
-
|
5529 |
-
|
5530 |
-
|
5531 |
-
|
5532 |
-
|
5533 |
-
|
5534 |
-
|
5535 |
-
|
5536 |
-
|
5537 |
-
|
5538 |
-
|
5539 |
-
|
5540 |
-
|
5541 |
-
|
5542 |
-
|
5543 |
-
|
5544 |
-
var
|
5545 |
-
|
5546 |
-
|
5547 |
-
|
5548 |
-
|
5549 |
-
|
5550 |
-
|
5551 |
-
|
5552 |
-
|
5553 |
-
|
5554 |
-
|
5555 |
-
|
5556 |
-
|
5557 |
-
|
5558 |
-
|
5559 |
-
|
5560 |
-
|
5561 |
-
|
5562 |
-
|
5563 |
-
|
5564 |
-
|
5565 |
-
|
5566 |
-
|
5567 |
-
|
5568 |
-
|
5569 |
-
|
5570 |
-
|
5571 |
-
|
5572 |
-
|
5573 |
-
|
5574 |
-
|
5575 |
-
|
5576 |
-
|
5577 |
-
|
5578 |
-
|
5579 |
-
|
5580 |
-
|
5581 |
-
|
5582 |
-
|
5583 |
-
|
5584 |
-
|
5585 |
-
|
5586 |
-
|
5587 |
-
|
5588 |
-
|
5589 |
-
|
5590 |
-
|
5591 |
-
|
5592 |
-
|
5593 |
-
|
5594 |
-
|
5595 |
-
|
5596 |
-
|
5597 |
-
|
5598 |
-
|
5599 |
-
|
5600 |
-
|
5601 |
-
|
5602 |
-
|
5603 |
-
|
5604 |
-
|
5605 |
-
|
5606 |
-
|
5607 |
-
|
5608 |
-
|
5609 |
-
|
5610 |
-
|
5611 |
-
|
5612 |
-
|
5613 |
-
|
5614 |
-
|
5615 |
-
|
5616 |
-
|
5617 |
-
|
5618 |
-
|
5619 |
-
|
5620 |
-
|
5621 |
-
|
5622 |
-
|
5623 |
-
|
5624 |
-
|
5625 |
-
|
5626 |
-
|
5627 |
-
|
5628 |
-
|
5629 |
-
|
5630 |
-
|
5631 |
-
|
5632 |
-
|
5633 |
-
|
5634 |
-
|
5635 |
-
|
5636 |
-
|
5637 |
-
|
5638 |
-
|
5639 |
-
|
5640 |
-
|
5641 |
-
|
5642 |
-
|
5643 |
-
|
5644 |
-
|
5645 |
-
|
5646 |
-
|
5647 |
-
|
5648 |
-
|
5649 |
-
|
5650 |
-
|
5651 |
-
|
5652 |
-
|
5653 |
-
|
5654 |
-
|
5655 |
-
|
5656 |
-
|
5657 |
-
|
5658 |
-
|
5659 |
-
|
5660 |
-
|
5661 |
-
|
5662 |
-
|
5663 |
-
|
5664 |
-
|
5665 |
-
|
5666 |
-
|
5667 |
-
|
5668 |
-
|
5669 |
-
|
5670 |
-
|
5671 |
-
|
5672 |
-
|
5673 |
-
|
5674 |
-
|
5675 |
-
|
5676 |
-
|
5677 |
-
|
5678 |
-
|
5679 |
-
|
5680 |
-
|
5681 |
-
|
5682 |
-
|
5683 |
-
|
5684 |
-
|
5685 |
-
|
5686 |
-
var
|
5687 |
-
|
5688 |
-
|
5689 |
-
|
5690 |
-
|
5691 |
-
|
5692 |
-
|
5693 |
-
|
5694 |
-
|
5695 |
-
|
5696 |
-
|
5697 |
-
|
5698 |
-
|
5699 |
-
|
5700 |
-
|
5701 |
-
|
5702 |
-
|
5703 |
-
|
5704 |
-
|
5705 |
-
|
5706 |
-
|
5707 |
-
|
5708 |
-
|
5709 |
-
|
5710 |
-
|
5711 |
-
|
5712 |
-
|
5713 |
-
|
5714 |
-
|
5715 |
-
|
5716 |
-
|
5717 |
-
|
5718 |
-
|
5719 |
-
|
5720 |
-
|
5721 |
-
|
5722 |
-
|
5723 |
-
|
5724 |
-
|
5725 |
-
|
5726 |
-
|
5727 |
-
|
5728 |
-
|
5729 |
-
|
5730 |
-
|
5731 |
-
|
5732 |
-
|
5733 |
-
|
5734 |
-
|
5735 |
-
|
5736 |
-
|
5737 |
-
|
5738 |
-
|
5739 |
-
|
5740 |
-
|
5741 |
-
|
5742 |
-
|
5743 |
-
|
5744 |
-
|
5745 |
-
|
5746 |
-
|
5747 |
-
|
5748 |
-
|
5749 |
-
|
5750 |
-
|
5751 |
-
|
5752 |
-
|
5753 |
-
|
5754 |
-
|
5755 |
-
|
5756 |
-
|
5757 |
-
|
5758 |
-
|
5759 |
-
|
5760 |
-
}
|
5761 |
-
|
5762 |
-
|
5763 |
-
|
5764 |
-
|
5765 |
-
|
5766 |
-
|
5767 |
-
|
5768 |
-
|
5769 |
-
|
5770 |
-
|
5771 |
-
|
5772 |
-
|
5773 |
-
|
5774 |
-
|
5775 |
-
|
5776 |
-
|
5777 |
-
|
5778 |
-
|
5779 |
-
|
5780 |
-
|
5781 |
-
|
5782 |
-
|
5783 |
-
|
5784 |
-
|
5785 |
-
|
5786 |
-
|
5787 |
-
|
5788 |
-
|
5789 |
-
|
5790 |
-
|
5791 |
-
|
5792 |
-
|
5793 |
-
|
5794 |
-
|
5795 |
-
|
5796 |
-
|
5797 |
-
|
5798 |
-
|
5799 |
-
|
5800 |
-
//
|
5801 |
-
|
5802 |
-
|
5803 |
-
|
5804 |
-
|
5805 |
-
|
5806 |
-
|
5807 |
-
|
5808 |
-
|
5809 |
-
|
5810 |
-
|
5811 |
-
|
5812 |
-
|
5813 |
-
|
5814 |
-
|
5815 |
-
|
5816 |
-
|
5817 |
-
|
5818 |
-
|
5819 |
-
|
5820 |
-
|
5821 |
-
|
5822 |
-
|
5823 |
-
|
5824 |
-
|
5825 |
-
|
5826 |
-
|
5827 |
-
|
5828 |
-
|
5829 |
-
|
5830 |
-
|
5831 |
-
|
5832 |
-
|
5833 |
-
|
5834 |
-
|
5835 |
-
|
5836 |
-
|
5837 |
-
|
5838 |
-
|
5839 |
-
|
5840 |
-
|
5841 |
-
|
5842 |
-
|
5843 |
-
|
5844 |
-
|
5845 |
-
|
5846 |
-
|
5847 |
-
|
5848 |
-
|
5849 |
-
|
5850 |
-
|
5851 |
-
|
5852 |
-
|
5853 |
-
|
5854 |
-
|
5855 |
-
|
5856 |
-
|
5857 |
-
|
5858 |
-
|
5859 |
-
|
5860 |
-
|
5861 |
-
|
5862 |
-
|
5863 |
-
|
5864 |
-
|
5865 |
-
|
5866 |
-
|
5867 |
-
|
5868 |
-
|
5869 |
-
|
5870 |
-
|
5871 |
-
|
5872 |
-
|
5873 |
-
|
5874 |
-
|
5875 |
-
|
5876 |
-
|
5877 |
-
|
5878 |
-
|
5879 |
-
|
5880 |
-
|
5881 |
-
|
5882 |
-
|
5883 |
-
|
5884 |
-
|
5885 |
-
|
5886 |
-
|
5887 |
-
|
5888 |
-
|
5889 |
-
|
5890 |
-
|
5891 |
-
|
5892 |
-
|
5893 |
-
|
5894 |
-
|
5895 |
-
|
5896 |
-
|
5897 |
-
|
5898 |
-
|
5899 |
-
|
5900 |
-
|
5901 |
-
|
5902 |
-
|
5903 |
-
|
5904 |
-
|
5905 |
-
|
5906 |
-
|
5907 |
-
|
5908 |
-
|
5909 |
-
|
5910 |
-
|
5911 |
-
|
5912 |
-
|
5913 |
-
|
5914 |
-
|
5915 |
-
|
5916 |
-
|
5917 |
-
|
5918 |
-
|
5919 |
-
|
5920 |
-
|
5921 |
-
|
5922 |
-
|
5923 |
-
|
5924 |
-
|
5925 |
-
|
5926 |
-
|
5927 |
-
|
5928 |
-
|
5929 |
-
|
5930 |
-
|
5931 |
-
|
5932 |
-
|
5933 |
-
|
5934 |
-
|
5935 |
-
|
5936 |
-
|
5937 |
-
|
5938 |
-
|
5939 |
-
|
5940 |
-
//
|
5941 |
-
|
5942 |
-
|
5943 |
-
|
5944 |
-
|
5945 |
-
|
5946 |
-
|
5947 |
-
|
5948 |
-
|
5949 |
-
|
5950 |
-
|
5951 |
-
|
5952 |
-
|
5953 |
-
|
5954 |
-
|
5955 |
-
|
5956 |
-
|
5957 |
-
|
5958 |
-
|
5959 |
-
|
5960 |
-
|
5961 |
-
|
5962 |
-
|
5963 |
-
|
5964 |
-
|
5965 |
-
|
5966 |
-
|
5967 |
-
|
5968 |
-
|
5969 |
-
|
5970 |
-
|
5971 |
-
|
5972 |
-
|
5973 |
-
|
5974 |
-
|
5975 |
-
|
5976 |
-
|
5977 |
-
|
5978 |
-
|
5979 |
-
|
5980 |
-
|
5981 |
-
|
5982 |
-
|
5983 |
-
|
5984 |
-
var
|
5985 |
-
|
5986 |
-
|
5987 |
-
|
5988 |
-
var
|
5989 |
-
//
|
5990 |
-
|
5991 |
-
|
5992 |
-
var
|
5993 |
-
|
5994 |
-
|
5995 |
-
|
5996 |
-
|
5997 |
-
|
5998 |
-
|
5999 |
-
|
6000 |
-
var
|
6001 |
-
|
6002 |
-
|
6003 |
-
|
6004 |
-
|
6005 |
-
|
6006 |
-
|
6007 |
-
|
6008 |
-
|
6009 |
-
|
6010 |
-
|
6011 |
-
|
6012 |
-
|
6013 |
-
|
6014 |
-
|
6015 |
-
|
6016 |
-
|
6017 |
-
|
6018 |
-
|
6019 |
-
|
6020 |
-
|
6021 |
-
|
6022 |
-
|
6023 |
-
|
6024 |
-
|
6025 |
-
|
6026 |
-
|
6027 |
-
|
6028 |
-
|
6029 |
-
|
6030 |
-
|
6031 |
-
|
6032 |
-
|
6033 |
-
|
6034 |
-
|
6035 |
-
|
6036 |
-
|
6037 |
-
|
6038 |
-
|
6039 |
-
|
6040 |
-
|
6041 |
-
|
6042 |
-
|
6043 |
-
|
6044 |
-
|
6045 |
-
|
6046 |
-
|
6047 |
-
|
6048 |
-
|
6049 |
-
|
6050 |
-
|
6051 |
-
|
6052 |
-
|
6053 |
-
|
6054 |
-
|
6055 |
-
|
6056 |
-
|
6057 |
-
|
6058 |
-
|
6059 |
-
|
6060 |
-
|
6061 |
-
|
6062 |
-
|
6063 |
-
|
6064 |
-
|
6065 |
-
|
6066 |
-
|
6067 |
-
|
6068 |
-
|
6069 |
-
|
6070 |
-
|
6071 |
-
|
6072 |
-
|
6073 |
-
|
6074 |
-
|
6075 |
-
|
6076 |
-
|
6077 |
-
|
6078 |
-
|
6079 |
-
|
6080 |
-
|
6081 |
-
|
6082 |
-
|
6083 |
-
|
6084 |
-
|
6085 |
-
|
6086 |
-
|
6087 |
-
|
6088 |
-
|
6089 |
-
|
6090 |
-
|
6091 |
-
|
6092 |
-
|
6093 |
-
|
6094 |
-
|
6095 |
-
}
|
6096 |
-
|
6097 |
-
|
6098 |
-
|
6099 |
-
|
6100 |
-
|
6101 |
-
|
6102 |
-
|
6103 |
-
|
6104 |
-
|
6105 |
-
|
6106 |
-
|
6107 |
-
|
6108 |
-
|
6109 |
-
|
6110 |
-
|
6111 |
-
|
6112 |
-
|
6113 |
-
|
6114 |
-
|
6115 |
-
|
6116 |
-
|
6117 |
-
|
6118 |
-
|
6119 |
-
|
6120 |
-
|
6121 |
-
|
6122 |
-
|
6123 |
-
|
6124 |
-
|
6125 |
-
|
6126 |
-
|
6127 |
-
|
6128 |
-
|
6129 |
-
|
6130 |
-
|
6131 |
-
|
6132 |
-
|
6133 |
-
|
6134 |
-
|
6135 |
-
|
6136 |
-
|
6137 |
-
|
6138 |
-
|
6139 |
-
|
6140 |
-
|
6141 |
-
|
6142 |
-
|
6143 |
-
|
6144 |
-
|
6145 |
-
|
6146 |
-
|
6147 |
-
|
6148 |
-
|
6149 |
-
|
6150 |
-
|
6151 |
-
|
6152 |
-
|
6153 |
-
|
6154 |
-
|
6155 |
-
|
6156 |
-
|
6157 |
-
|
6158 |
-
|
6159 |
-
|
6160 |
-
|
6161 |
-
|
6162 |
-
|
6163 |
-
|
6164 |
-
|
6165 |
-
|
6166 |
-
|
6167 |
-
|
6168 |
-
|
6169 |
-
|
6170 |
-
|
6171 |
-
|
6172 |
-
|
6173 |
-
|
6174 |
-
|
6175 |
-
|
6176 |
-
|
6177 |
-
|
6178 |
-
|
6179 |
-
|
6180 |
-
|
6181 |
-
|
6182 |
-
|
6183 |
-
|
6184 |
-
|
6185 |
-
|
6186 |
-
|
6187 |
-
|
6188 |
-
|
6189 |
-
|
6190 |
-
|
6191 |
-
|
6192 |
-
|
6193 |
-
|
6194 |
-
|
6195 |
-
|
6196 |
-
|
6197 |
-
|
6198 |
-
|
6199 |
-
|
6200 |
-
|
6201 |
-
|
6202 |
-
|
6203 |
-
|
6204 |
-
|
6205 |
-
|
6206 |
-
|
6207 |
-
|
6208 |
-
|
6209 |
-
|
6210 |
-
|
6211 |
-
|
6212 |
-
|
6213 |
-
|
6214 |
-
|
6215 |
-
|
6216 |
-
|
6217 |
-
|
6218 |
-
|
6219 |
-
|
6220 |
-
|
6221 |
-
|
6222 |
-
|
6223 |
-
|
6224 |
-
|
6225 |
-
|
6226 |
-
|
6227 |
-
|
6228 |
-
|
6229 |
-
|
6230 |
-
|
6231 |
-
|
6232 |
-
|
6233 |
-
|
6234 |
-
|
6235 |
-
|
6236 |
-
|
6237 |
-
|
6238 |
-
|
6239 |
-
|
6240 |
-
|
6241 |
-
|
6242 |
-
|
6243 |
-
|
6244 |
-
|
6245 |
-
|
6246 |
-
|
6247 |
-
|
6248 |
-
|
6249 |
-
|
6250 |
-
|
6251 |
-
|
6252 |
-
|
6253 |
-
|
6254 |
-
|
6255 |
-
|
6256 |
-
|
6257 |
-
|
6258 |
-
|
6259 |
-
|
6260 |
-
|
6261 |
-
|
6262 |
-
|
6263 |
-
|
6264 |
-
|
6265 |
-
|
6266 |
-
|
6267 |
-
|
6268 |
-
|
6269 |
-
|
6270 |
-
|
6271 |
-
|
6272 |
-
|
6273 |
-
|
6274 |
-
|
6275 |
-
|
6276 |
-
|
6277 |
-
|
6278 |
-
|
6279 |
-
|
6280 |
-
|
6281 |
-
|
6282 |
-
|
6283 |
-
|
6284 |
-
|
6285 |
-
|
6286 |
-
|
6287 |
-
|
6288 |
-
|
6289 |
-
|
6290 |
-
|
6291 |
-
|
6292 |
-
|
6293 |
-
|
6294 |
-
|
6295 |
-
|
6296 |
-
|
6297 |
-
|
6298 |
-
|
6299 |
-
|
6300 |
-
|
6301 |
-
|
6302 |
-
|
6303 |
-
|
6304 |
-
|
6305 |
-
|
6306 |
-
|
6307 |
-
|
6308 |
-
|
6309 |
-
|
6310 |
-
|
6311 |
-
|
6312 |
-
|
6313 |
-
|
6314 |
-
|
6315 |
-
|
6316 |
-
|
6317 |
-
|
6318 |
-
|
6319 |
-
|
6320 |
-
|
6321 |
-
|
6322 |
-
|
6323 |
-
"
|
6324 |
-
|
6325 |
-
|
6326 |
-
|
6327 |
-
|
6328 |
-
|
6329 |
-
|
6330 |
-
|
6331 |
-
|
6332 |
-
|
6333 |
-
|
6334 |
-
|
6335 |
-
|
6336 |
-
|
6337 |
-
|
6338 |
-
|
6339 |
-
|
6340 |
-
|
6341 |
-
|
6342 |
-
|
6343 |
-
|
6344 |
-
|
6345 |
-
|
6346 |
-
|
6347 |
-
|
6348 |
-
|
6349 |
-
|
6350 |
-
|
6351 |
-
|
6352 |
-
|
6353 |
-
|
6354 |
-
|
6355 |
-
|
6356 |
-
|
6357 |
-
|
6358 |
-
|
6359 |
-
|
6360 |
-
|
6361 |
-
|
6362 |
-
|
6363 |
-
|
6364 |
-
|
6365 |
-
|
6366 |
-
|
6367 |
-
|
6368 |
-
|
6369 |
-
|
6370 |
-
|
6371 |
-
|
6372 |
-
|
6373 |
-
|
6374 |
-
|
6375 |
-
|
6376 |
-
|
6377 |
-
|
6378 |
-
|
6379 |
-
|
6380 |
-
|
6381 |
-
|
6382 |
-
|
6383 |
-
|
6384 |
-
|
6385 |
-
|
6386 |
-
|
6387 |
-
|
6388 |
-
|
6389 |
-
|
6390 |
-
|
6391 |
-
|
6392 |
-
|
6393 |
-
|
6394 |
-
|
6395 |
-
|
6396 |
-
|
6397 |
-
|
6398 |
-
|
6399 |
-
|
6400 |
-
|
6401 |
-
|
6402 |
-
|
6403 |
-
|
6404 |
-
|
6405 |
-
|
6406 |
-
|
6407 |
-
|
6408 |
-
|
6409 |
-
|
6410 |
-
|
6411 |
-
|
6412 |
-
|
6413 |
-
|
6414 |
-
|
6415 |
-
|
6416 |
-
|
6417 |
-
|
6418 |
-
|
6419 |
-
|
6420 |
-
|
6421 |
-
|
6422 |
-
|
6423 |
-
|
6424 |
-
|
6425 |
-
|
6426 |
-
|
6427 |
-
|
6428 |
-
|
6429 |
-
|
6430 |
-
|
6431 |
-
|
6432 |
-
|
6433 |
-
|
6434 |
-
|
6435 |
-
|
6436 |
-
function() {
|
6437 |
-
|
6438 |
-
|
6439 |
-
|
6440 |
-
|
6441 |
-
|
6442 |
-
|
6443 |
-
|
6444 |
-
|
6445 |
-
|
6446 |
-
|
6447 |
-
|
6448 |
-
|
6449 |
-
|
6450 |
-
|
6451 |
-
|
6452 |
-
|
6453 |
-
|
6454 |
-
|
6455 |
-
|
6456 |
-
|
6457 |
-
|
6458 |
-
|
6459 |
-
|
6460 |
-
|
6461 |
-
|
6462 |
-
|
6463 |
-
|
6464 |
-
|
6465 |
-
|
6466 |
-
|
6467 |
-
|
6468 |
-
|
6469 |
-
|
6470 |
-
|
6471 |
-
|
6472 |
-
|
6473 |
-
|
6474 |
-
|
6475 |
-
|
6476 |
-
|
6477 |
-
|
6478 |
-
|
6479 |
-
|
6480 |
-
|
6481 |
-
|
6482 |
-
|
6483 |
-
|
6484 |
-
|
6485 |
-
|
6486 |
-
|
6487 |
-
|
6488 |
-
|
6489 |
-
|
6490 |
-
|
6491 |
-
|
6492 |
-
|
6493 |
-
|
6494 |
-
|
6495 |
-
|
6496 |
-
|
6497 |
-
|
6498 |
-
|
6499 |
-
|
6500 |
-
|
6501 |
-
|
6502 |
-
|
6503 |
-
|
6504 |
-
|
6505 |
-
|
6506 |
-
|
6507 |
-
|
6508 |
-
|
6509 |
-
|
6510 |
-
|
6511 |
-
|
6512 |
-
|
6513 |
-
|
6514 |
-
|
6515 |
-
|
6516 |
-
|
6517 |
-
|
6518 |
-
|
6519 |
-
|
6520 |
-
|
6521 |
-
|
6522 |
-
|
6523 |
-
|
6524 |
-
|
6525 |
-
|
6526 |
-
|
6527 |
-
|
6528 |
-
|
6529 |
-
|
6530 |
-
|
6531 |
-
|
6532 |
-
};
|
6533 |
-
|
6534 |
-
|
6535 |
-
|
6536 |
-
|
6537 |
-
|
6538 |
-
|
6539 |
-
//
|
6540 |
-
|
6541 |
-
|
6542 |
-
|
6543 |
-
|
6544 |
-
|
6545 |
-
|
6546 |
-
|
6547 |
-
|
6548 |
-
|
6549 |
-
|
6550 |
-
|
6551 |
-
|
6552 |
-
return
|
6553 |
-
|
6554 |
-
|
6555 |
-
|
6556 |
-
|
6557 |
-
|
6558 |
-
|
6559 |
-
|
6560 |
-
|
6561 |
-
|
6562 |
-
|
6563 |
-
|
6564 |
-
|
6565 |
-
|
6566 |
-
|
6567 |
-
|
6568 |
-
|
6569 |
-
|
6570 |
-
|
6571 |
-
|
6572 |
-
*/
|
6573 |
-
|
6574 |
-
|
6575 |
-
|
6576 |
-
|
6577 |
-
|
6578 |
-
|
6579 |
-
|
6580 |
-
|
6581 |
-
|
6582 |
-
|
6583 |
-
|
6584 |
-
|
6585 |
-
|
6586 |
-
|
6587 |
-
|
6588 |
-
|
6589 |
-
|
6590 |
-
|
6591 |
-
|
6592 |
-
|
6593 |
-
|
6594 |
-
|
6595 |
-
|
6596 |
-
|
6597 |
-
|
6598 |
-
|
6599 |
-
|
6600 |
-
|
6601 |
-
|
6602 |
-
|
6603 |
-
|
6604 |
-
|
6605 |
-
|
6606 |
-
|
6607 |
-
|
6608 |
-
|
6609 |
-
|
6610 |
-
|
6611 |
-
|
6612 |
-
|
6613 |
-
|
6614 |
-
|
6615 |
-
|
6616 |
-
|
6617 |
-
|
6618 |
-
|
6619 |
-
|
6620 |
-
|
6621 |
-
|
6622 |
-
|
6623 |
-
|
6624 |
-
|
6625 |
-
|
6626 |
-
|
6627 |
-
|
6628 |
-
|
6629 |
-
|
6630 |
-
|
6631 |
-
|
6632 |
-
|
6633 |
-
|
6634 |
-
|
6635 |
-
|
6636 |
-
|
6637 |
-
|
6638 |
-
|
6639 |
-
|
6640 |
-
|
6641 |
-
|
6642 |
-
|
6643 |
-
|
6644 |
-
|
6645 |
-
|
6646 |
-
|
6647 |
-
|
6648 |
-
|
6649 |
-
|
6650 |
-
|
6651 |
-
|
6652 |
-
|
6653 |
-
|
6654 |
-
|
6655 |
-
|
6656 |
-
|
6657 |
-
|
6658 |
-
|
6659 |
-
|
6660 |
-
|
6661 |
-
|
6662 |
-
|
6663 |
-
|
6664 |
-
|
6665 |
-
|
6666 |
-
|
6667 |
-
|
6668 |
-
|
6669 |
-
|
6670 |
-
|
6671 |
-
|
6672 |
-
|
6673 |
-
|
6674 |
-
|
6675 |
-
|
6676 |
-
|
6677 |
-
|
6678 |
-
|
6679 |
-
|
6680 |
-
|
6681 |
-
|
6682 |
-
|
6683 |
-
|
6684 |
-
|
6685 |
-
|
6686 |
-
|
6687 |
-
|
6688 |
-
|
6689 |
-
|
6690 |
-
|
6691 |
-
|
6692 |
-
|
6693 |
-
|
6694 |
-
|
6695 |
-
|
6696 |
-
|
6697 |
-
|
6698 |
-
|
6699 |
-
|
6700 |
-
|
6701 |
-
|
6702 |
-
|
6703 |
-
|
6704 |
-
|
6705 |
-
|
6706 |
-
|
6707 |
-
|
6708 |
-
|
6709 |
-
|
6710 |
-
|
6711 |
-
|
6712 |
-
|
6713 |
-
|
6714 |
-
|
6715 |
-
|
6716 |
-
|
6717 |
-
|
6718 |
-
|
6719 |
-
|
6720 |
-
|
6721 |
-
|
6722 |
-
|
6723 |
-
|
6724 |
-
|
6725 |
-
|
6726 |
-
|
6727 |
-
|
6728 |
-
|
6729 |
-
|
6730 |
-
|
6731 |
-
|
6732 |
-
|
6733 |
-
|
6734 |
-
|
6735 |
-
|
6736 |
-
|
6737 |
-
|
6738 |
-
|
6739 |
-
|
6740 |
-
|
6741 |
-
|
6742 |
-
|
6743 |
-
|
6744 |
-
|
6745 |
-
|
6746 |
-
|
6747 |
-
|
6748 |
-
|
6749 |
-
|
6750 |
-
|
6751 |
-
|
6752 |
-
|
6753 |
-
|
6754 |
-
|
6755 |
-
|
6756 |
-
|
6757 |
-
|
6758 |
-
|
6759 |
-
|
6760 |
-
|
6761 |
-
|
6762 |
-
|
6763 |
-
|
6764 |
-
|
6765 |
-
|
6766 |
-
|
6767 |
-
|
6768 |
-
|
6769 |
-
|
6770 |
-
|
6771 |
-
|
6772 |
-
|
6773 |
-
|
6774 |
-
|
6775 |
-
|
6776 |
-
|
6777 |
-
|
6778 |
-
|
6779 |
-
|
6780 |
-
|
6781 |
-
|
6782 |
-
|
6783 |
-
|
6784 |
-
|
6785 |
-
|
6786 |
-
|
6787 |
-
|
6788 |
-
|
6789 |
-
|
6790 |
-
|
6791 |
-
|
6792 |
-
|
6793 |
-
|
6794 |
-
|
6795 |
-
|
6796 |
-
|
6797 |
-
|
6798 |
-
|
6799 |
-
|
6800 |
-
|
6801 |
-
|
6802 |
-
|
6803 |
-
}
|
6804 |
-
|
6805 |
-
|
6806 |
-
|
6807 |
-
|
6808 |
-
|
6809 |
-
|
6810 |
-
|
6811 |
-
|
6812 |
-
|
6813 |
-
|
6814 |
-
|
6815 |
-
|
6816 |
-
|
6817 |
-
|
6818 |
-
|
6819 |
-
|
6820 |
-
|
6821 |
-
|
6822 |
-
|
6823 |
-
|
6824 |
-
|
6825 |
-
|
6826 |
-
|
6827 |
-
|
6828 |
-
|
6829 |
-
|
6830 |
-
|
6831 |
-
|
6832 |
-
|
6833 |
-
|
6834 |
-
|
6835 |
-
|
6836 |
-
|
6837 |
-
|
6838 |
-
|
6839 |
-
|
6840 |
-
|
6841 |
-
|
6842 |
-
|
6843 |
-
|
6844 |
-
|
6845 |
-
|
6846 |
-
|
6847 |
-
|
6848 |
-
|
6849 |
-
|
6850 |
-
|
6851 |
-
|
6852 |
-
|
6853 |
-
|
6854 |
-
|
6855 |
-
|
6856 |
-
|
6857 |
-
|
6858 |
-
|
6859 |
-
|
6860 |
-
|
6861 |
-
|
6862 |
-
|
6863 |
-
|
6864 |
-
|
6865 |
-
|
6866 |
-
|
6867 |
-
|
6868 |
-
|
6869 |
-
|
6870 |
-
|
6871 |
-
|
6872 |
-
|
6873 |
-
|
6874 |
-
|
6875 |
-
|
6876 |
-
|
6877 |
-
|
6878 |
-
|
6879 |
-
|
6880 |
-
|
6881 |
-
|
6882 |
-
|
6883 |
-
|
6884 |
-
|
6885 |
-
|
6886 |
-
|
6887 |
-
|
6888 |
-
|
6889 |
-
|
6890 |
-
|
6891 |
-
|
6892 |
-
|
6893 |
-
|
6894 |
-
|
6895 |
-
|
6896 |
-
|
6897 |
-
|
6898 |
-
|
6899 |
-
|
6900 |
-
|
6901 |
-
|
6902 |
-
|
6903 |
-
|
6904 |
-
|
6905 |
-
|
6906 |
-
|
6907 |
-
|
6908 |
-
|
6909 |
-
|
6910 |
-
|
6911 |
-
|
6912 |
-
|
6913 |
-
|
6914 |
-
|
6915 |
-
|
6916 |
-
|
6917 |
-
|
6918 |
-
|
6919 |
-
|
6920 |
-
|
6921 |
-
|
6922 |
-
|
6923 |
-
|
6924 |
-
|
6925 |
-
|
6926 |
-
|
6927 |
-
|
6928 |
-
|
6929 |
-
|
6930 |
-
|
6931 |
-
|
6932 |
-
|
6933 |
-
|
6934 |
-
|
6935 |
-
|
6936 |
-
|
6937 |
-
|
6938 |
-
|
6939 |
-
|
6940 |
-
|
6941 |
-
|
6942 |
-
|
6943 |
-
|
6944 |
-
|
6945 |
-
|
6946 |
-
|
6947 |
-
|
6948 |
-
|
6949 |
-
|
6950 |
-
|
6951 |
-
|
6952 |
-
|
6953 |
-
|
6954 |
-
|
6955 |
-
|
6956 |
-
|
6957 |
-
|
6958 |
-
|
6959 |
-
|
6960 |
-
|
6961 |
-
|
6962 |
-
|
6963 |
-
|
6964 |
-
|
6965 |
-
|
6966 |
-
|
6967 |
-
|
6968 |
-
|
6969 |
-
|
6970 |
-
|
6971 |
-
|
6972 |
-
|
6973 |
-
|
6974 |
-
|
6975 |
-
|
6976 |
-
|
6977 |
-
|
6978 |
-
|
6979 |
-
|
6980 |
-
|
6981 |
-
|
6982 |
-
|
6983 |
-
|
6984 |
-
|
6985 |
-
|
6986 |
-
|
6987 |
-
|
6988 |
-
|
6989 |
-
|
6990 |
-
|
6991 |
-
|
6992 |
-
|
6993 |
-
|
6994 |
-
|
6995 |
-
|
6996 |
-
|
6997 |
-
|
6998 |
-
|
6999 |
-
|
7000 |
-
|
7001 |
-
|
7002 |
-
|
7003 |
-
|
7004 |
-
|
7005 |
-
|
7006 |
-
|
7007 |
-
|
7008 |
-
|
7009 |
-
|
7010 |
-
|
7011 |
-
|
7012 |
-
|
7013 |
-
|
7014 |
-
|
7015 |
-
|
7016 |
-
|
7017 |
-
|
7018 |
-
|
7019 |
-
|
7020 |
-
|
7021 |
-
|
7022 |
-
|
7023 |
-
|
7024 |
-
|
7025 |
-
|
7026 |
-
|
7027 |
-
|
7028 |
-
|
7029 |
-
|
7030 |
-
|
7031 |
-
|
7032 |
-
|
7033 |
-
|
7034 |
-
|
7035 |
-
|
7036 |
-
|
7037 |
-
|
7038 |
-
|
7039 |
-
|
7040 |
-
|
7041 |
-
|
7042 |
-
|
7043 |
-
|
7044 |
-
|
7045 |
-
|
7046 |
-
|
7047 |
-
|
7048 |
-
|
7049 |
-
|
7050 |
-
|
7051 |
-
|
7052 |
-
|
7053 |
-
|
7054 |
-
|
7055 |
-
|
7056 |
-
|
7057 |
-
|
7058 |
-
|
7059 |
-
|
7060 |
-
|
7061 |
-
|
7062 |
-
|
7063 |
-
|
7064 |
-
|
7065 |
-
|
7066 |
-
|
7067 |
-
|
7068 |
-
|
7069 |
-
|
7070 |
-
|
7071 |
-
|
7072 |
-
|
7073 |
-
|
7074 |
-
|
7075 |
-
|
7076 |
-
|
7077 |
-
|
7078 |
-
|
7079 |
-
|
7080 |
-
|
7081 |
-
|
7082 |
-
|
7083 |
-
|
7084 |
-
|
7085 |
-
|
7086 |
-
|
7087 |
-
|
7088 |
-
|
7089 |
-
|
7090 |
-
|
7091 |
-
|
7092 |
-
|
7093 |
-
|
7094 |
-
|
7095 |
-
|
7096 |
-
|
7097 |
-
|
7098 |
-
|
7099 |
-
|
7100 |
-
|
7101 |
-
|
7102 |
-
|
7103 |
-
|
7104 |
-
|
7105 |
-
|
7106 |
-
|
7107 |
-
|
7108 |
-
|
7109 |
-
|
7110 |
-
|
7111 |
-
|
7112 |
-
|
7113 |
-
|
7114 |
-
|
7115 |
-
|
7116 |
-
|
7117 |
-
|
7118 |
-
|
7119 |
-
|
7120 |
-
|
7121 |
-
|
7122 |
-
|
7123 |
-
|
7124 |
-
|
7125 |
-
|
7126 |
-
|
7127 |
-
|
7128 |
-
|
7129 |
-
|
7130 |
-
|
7131 |
-
|
7132 |
-
|
7133 |
-
|
7134 |
-
|
7135 |
-
|
7136 |
-
|
7137 |
-
|
7138 |
-
|
7139 |
-
|
7140 |
-
|
7141 |
-
|
7142 |
-
|
7143 |
-
|
7144 |
-
|
7145 |
-
|
7146 |
-
|
7147 |
-
|
7148 |
-
|
7149 |
-
|
7150 |
-
|
7151 |
-
|
7152 |
-
|
7153 |
-
|
7154 |
-
|
7155 |
-
|
7156 |
-
|
7157 |
-
|
7158 |
-
|
7159 |
-
|
7160 |
-
|
7161 |
-
|
7162 |
-
|
7163 |
-
|
7164 |
-
|
7165 |
-
|
7166 |
-
|
7167 |
-
|
7168 |
-
|
7169 |
-
|
7170 |
-
|
7171 |
-
|
7172 |
-
|
7173 |
-
|
7174 |
-
|
7175 |
-
|
7176 |
-
|
7177 |
-
|
7178 |
-
|
7179 |
-
|
7180 |
-
|
7181 |
-
|
7182 |
-
|
7183 |
-
|
7184 |
-
|
7185 |
-
|
7186 |
-
|
7187 |
-
|
7188 |
-
|
7189 |
-
|
7190 |
-
|
7191 |
-
|
7192 |
-
|
7193 |
-
|
7194 |
-
|
7195 |
-
|
7196 |
-
|
7197 |
-
|
7198 |
-
|
7199 |
-
|
7200 |
-
|
7201 |
-
|
7202 |
-
|
7203 |
-
|
7204 |
-
|
7205 |
-
|
7206 |
-
|
7207 |
-
|
7208 |
-
|
7209 |
-
|
7210 |
-
|
7211 |
-
|
7212 |
-
|
7213 |
-
|
7214 |
-
|
7215 |
-
|
7216 |
-
|
7217 |
-
|
7218 |
-
|
7219 |
-
|
7220 |
-
|
7221 |
-
|
7222 |
-
|
7223 |
-
|
7224 |
-
|
7225 |
-
|
7226 |
-
|
7227 |
-
|
7228 |
-
|
7229 |
-
|
7230 |
-
|
7231 |
-
|
7232 |
-
|
7233 |
-
|
7234 |
-
|
7235 |
-
node: {
|
7236 |
-
children: treeData
|
7237 |
-
},
|
7238 |
-
isPseudoRoot: !0,
|
7239 |
-
currentIndex: -1
|
7240 |
-
});
|
7241 |
-
return {
|
7242 |
-
matches: result.matches,
|
7243 |
-
treeData: result.node.children
|
7244 |
-
};
|
7245 |
-
}
|
7246 |
-
Object.defineProperty(exports, "__esModule", {
|
7247 |
-
value: !0
|
7248 |
-
});
|
7249 |
-
var _extends = Object.assign || function(target) {
|
7250 |
-
for (var i = 1; i < arguments.length; i++) {
|
7251 |
-
var source = arguments[i];
|
7252 |
-
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
7253 |
-
}
|
7254 |
-
return target;
|
7255 |
-
};
|
7256 |
-
exports.getDescendantCount = getDescendantCount, exports.getVisibleNodeCount = getVisibleNodeCount,
|
7257 |
-
exports.getVisibleNodeInfoAtIndex = getVisibleNodeInfoAtIndex, exports.walk = walk,
|
7258 |
-
exports.map = map, exports.toggleExpandedForAll = toggleExpandedForAll, exports.changeNodeAtPath = changeNodeAtPath,
|
7259 |
-
exports.removeNodeAtPath = removeNodeAtPath, exports.removeNode = removeNode, exports.getNodeAtPath = getNodeAtPath,
|
7260 |
-
exports.addNodeUnderParent = addNodeUnderParent, exports.insertNode = insertNode,
|
7261 |
-
exports.getFlatDataFromTree = getFlatDataFromTree, exports.getTreeFromFlatData = getTreeFromFlatData,
|
7262 |
-
exports.isDescendant = isDescendant, exports.getDepth = getDepth, exports.find = find;
|
7263 |
-
}, /* 1 */
|
7264 |
-
/***/
|
7265 |
-
function(module, exports) {
|
7266 |
-
module.exports = __webpack_require__(2);
|
7267 |
-
}, /* 2 */
|
7268 |
-
/***/
|
7269 |
-
function(module, exports) {
|
7270 |
-
module.exports = __webpack_require__(0);
|
7271 |
-
}, /* 3 */
|
7272 |
-
/***/
|
7273 |
-
function(module, exports) {
|
7274 |
-
function cssWithMappingToString(item, useSourceMap) {
|
7275 |
-
var content = item[1] || "", cssMapping = item[3];
|
7276 |
-
if (!cssMapping) return content;
|
7277 |
-
if (useSourceMap && "function" == typeof btoa) {
|
7278 |
-
var sourceMapping = toComment(cssMapping);
|
7279 |
-
return [ content ].concat(cssMapping.sources.map(function(source) {
|
7280 |
-
return "/*# sourceURL=" + cssMapping.sourceRoot + source + " */";
|
7281 |
-
})).concat([ sourceMapping ]).join("\n");
|
7282 |
-
}
|
7283 |
-
return [ content ].join("\n");
|
7284 |
-
}
|
7285 |
-
// Adapted from convert-source-map (MIT)
|
7286 |
-
function toComment(sourceMap) {
|
7287 |
-
return "/*# sourceMappingURL=data:application/json;charset=utf-8;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))) + " */";
|
7288 |
-
}
|
7289 |
-
/*
|
7290 |
-
MIT License http://www.opensource.org/licenses/mit-license.php
|
7291 |
-
Author Tobias Koppers @sokra
|
7292 |
-
*/
|
7293 |
-
// css base code, injected by the css-loader
|
7294 |
-
module.exports = function(useSourceMap) {
|
7295 |
-
var list = [];
|
7296 |
-
// return the list of modules as css string
|
7297 |
-
// import a list of modules into the list
|
7298 |
-
return list.toString = function() {
|
7299 |
-
return this.map(function(item) {
|
7300 |
-
var content = cssWithMappingToString(item, useSourceMap);
|
7301 |
-
return item[2] ? "@media " + item[2] + "{" + content + "}" : content;
|
7302 |
-
}).join("");
|
7303 |
-
}, list.i = function(modules, mediaQuery) {
|
7304 |
-
"string" == typeof modules && (modules = [ [ null, modules, "" ] ]);
|
7305 |
-
for (var alreadyImportedModules = {}, i = 0; i < this.length; i++) {
|
7306 |
-
var id = this[i][0];
|
7307 |
-
"number" == typeof id && (alreadyImportedModules[id] = !0);
|
7308 |
-
}
|
7309 |
-
for (i = 0; i < modules.length; i++) {
|
7310 |
-
var item = modules[i];
|
7311 |
-
// skip already imported module
|
7312 |
-
// this implementation is not 100% perfect for weird media query combinations
|
7313 |
-
// when a module is imported multiple times with different media queries.
|
7314 |
-
// I hope this will never occur (Hey this way we have smaller bundles)
|
7315 |
-
"number" == typeof item[0] && alreadyImportedModules[item[0]] || (mediaQuery && !item[2] ? item[2] = mediaQuery : mediaQuery && (item[2] = "(" + item[2] + ") and (" + mediaQuery + ")"),
|
7316 |
-
list.push(item));
|
7317 |
-
}
|
7318 |
-
}, list;
|
7319 |
-
};
|
7320 |
-
}, /* 4 */
|
7321 |
-
/***/
|
7322 |
-
function(module, exports, __webpack_require__) {
|
7323 |
-
function addStylesToDom(styles, options) {
|
7324 |
-
for (var i = 0; i < styles.length; i++) {
|
7325 |
-
var item = styles[i], domStyle = stylesInDom[item.id];
|
7326 |
-
if (domStyle) {
|
7327 |
-
domStyle.refs++;
|
7328 |
-
for (var j = 0; j < domStyle.parts.length; j++) domStyle.parts[j](item.parts[j]);
|
7329 |
-
for (;j < item.parts.length; j++) domStyle.parts.push(addStyle(item.parts[j], options));
|
7330 |
-
} else {
|
7331 |
-
for (var parts = [], j = 0; j < item.parts.length; j++) parts.push(addStyle(item.parts[j], options));
|
7332 |
-
stylesInDom[item.id] = {
|
7333 |
-
id: item.id,
|
7334 |
-
refs: 1,
|
7335 |
-
parts: parts
|
7336 |
-
};
|
7337 |
-
}
|
7338 |
-
}
|
7339 |
-
}
|
7340 |
-
function listToStyles(list, options) {
|
7341 |
-
for (var styles = [], newStyles = {}, i = 0; i < list.length; i++) {
|
7342 |
-
var item = list[i], id = options.base ? item[0] + options.base : item[0], css = item[1], media = item[2], sourceMap = item[3], part = {
|
7343 |
-
css: css,
|
7344 |
-
media: media,
|
7345 |
-
sourceMap: sourceMap
|
7346 |
-
};
|
7347 |
-
newStyles[id] ? newStyles[id].parts.push(part) : styles.push(newStyles[id] = {
|
7348 |
-
id: id,
|
7349 |
-
parts: [ part ]
|
7350 |
-
});
|
7351 |
-
}
|
7352 |
-
return styles;
|
7353 |
-
}
|
7354 |
-
function insertStyleElement(options, style) {
|
7355 |
-
var target = getElement(options.insertInto);
|
7356 |
-
if (!target) throw new Error("Couldn't find a style target. This probably means that the value for the 'insertInto' parameter is invalid.");
|
7357 |
-
var lastStyleElementInsertedAtTop = stylesInsertedAtTop[stylesInsertedAtTop.length - 1];
|
7358 |
-
if ("top" === options.insertAt) lastStyleElementInsertedAtTop ? lastStyleElementInsertedAtTop.nextSibling ? target.insertBefore(style, lastStyleElementInsertedAtTop.nextSibling) : target.appendChild(style) : target.insertBefore(style, target.firstChild),
|
7359 |
-
stylesInsertedAtTop.push(style); else if ("bottom" === options.insertAt) target.appendChild(style); else {
|
7360 |
-
if ("object" != typeof options.insertAt || !options.insertAt.before) throw new Error("[Style Loader]\n\n Invalid value for parameter 'insertAt' ('options.insertAt') found.\n Must be 'top', 'bottom', or Object.\n (https://github.com/webpack-contrib/style-loader#insertat)\n");
|
7361 |
-
var nextSibling = getElement(options.insertInto + " " + options.insertAt.before);
|
7362 |
-
target.insertBefore(style, nextSibling);
|
7363 |
-
}
|
7364 |
-
}
|
7365 |
-
function removeStyleElement(style) {
|
7366 |
-
if (null === style.parentNode) return !1;
|
7367 |
-
style.parentNode.removeChild(style);
|
7368 |
-
var idx = stylesInsertedAtTop.indexOf(style);
|
7369 |
-
idx >= 0 && stylesInsertedAtTop.splice(idx, 1);
|
7370 |
-
}
|
7371 |
-
function createStyleElement(options) {
|
7372 |
-
var style = document.createElement("style");
|
7373 |
-
return options.attrs.type = "text/css", addAttrs(style, options.attrs), insertStyleElement(options, style),
|
7374 |
-
style;
|
7375 |
-
}
|
7376 |
-
function createLinkElement(options) {
|
7377 |
-
var link = document.createElement("link");
|
7378 |
-
return options.attrs.type = "text/css", options.attrs.rel = "stylesheet", addAttrs(link, options.attrs),
|
7379 |
-
insertStyleElement(options, link), link;
|
7380 |
-
}
|
7381 |
-
function addAttrs(el, attrs) {
|
7382 |
-
Object.keys(attrs).forEach(function(key) {
|
7383 |
-
el.setAttribute(key, attrs[key]);
|
7384 |
-
});
|
7385 |
-
}
|
7386 |
-
function addStyle(obj, options) {
|
7387 |
-
var style, update, remove, result;
|
7388 |
-
// If a transform function was defined, run it on the css
|
7389 |
-
if (options.transform && obj.css) {
|
7390 |
-
if (!(result = options.transform(obj.css))) // If the transform function returns a falsy value, don't add this css.
|
7391 |
-
// This allows conditional loading of css
|
7392 |
-
return function() {};
|
7393 |
-
// If transform returns a value, use that instead of the original css.
|
7394 |
-
// This allows running runtime transformations on the css.
|
7395 |
-
obj.css = result;
|
7396 |
-
}
|
7397 |
-
if (options.singleton) {
|
7398 |
-
var styleIndex = singletonCounter++;
|
7399 |
-
style = singleton || (singleton = createStyleElement(options)), update = applyToSingletonTag.bind(null, style, styleIndex, !1),
|
7400 |
-
remove = applyToSingletonTag.bind(null, style, styleIndex, !0);
|
7401 |
-
} else obj.sourceMap && "function" == typeof URL && "function" == typeof URL.createObjectURL && "function" == typeof URL.revokeObjectURL && "function" == typeof Blob && "function" == typeof btoa ? (style = createLinkElement(options),
|
7402 |
-
update = updateLink.bind(null, style, options), remove = function() {
|
7403 |
-
removeStyleElement(style), style.href && URL.revokeObjectURL(style.href);
|
7404 |
-
}) : (style = createStyleElement(options), update = applyToTag.bind(null, style),
|
7405 |
-
remove = function() {
|
7406 |
-
removeStyleElement(style);
|
7407 |
-
});
|
7408 |
-
return update(obj), function(newObj) {
|
7409 |
-
if (newObj) {
|
7410 |
-
if (newObj.css === obj.css && newObj.media === obj.media && newObj.sourceMap === obj.sourceMap) return;
|
7411 |
-
update(obj = newObj);
|
7412 |
-
} else remove();
|
7413 |
-
};
|
7414 |
-
}
|
7415 |
-
function applyToSingletonTag(style, index, remove, obj) {
|
7416 |
-
var css = remove ? "" : obj.css;
|
7417 |
-
if (style.styleSheet) style.styleSheet.cssText = replaceText(index, css); else {
|
7418 |
-
var cssNode = document.createTextNode(css), childNodes = style.childNodes;
|
7419 |
-
childNodes[index] && style.removeChild(childNodes[index]), childNodes.length ? style.insertBefore(cssNode, childNodes[index]) : style.appendChild(cssNode);
|
7420 |
-
}
|
7421 |
-
}
|
7422 |
-
function applyToTag(style, obj) {
|
7423 |
-
var css = obj.css, media = obj.media;
|
7424 |
-
if (media && style.setAttribute("media", media), style.styleSheet) style.styleSheet.cssText = css; else {
|
7425 |
-
for (;style.firstChild; ) style.removeChild(style.firstChild);
|
7426 |
-
style.appendChild(document.createTextNode(css));
|
7427 |
-
}
|
7428 |
-
}
|
7429 |
-
function updateLink(link, options, obj) {
|
7430 |
-
var css = obj.css, sourceMap = obj.sourceMap, autoFixUrls = void 0 === options.convertToAbsoluteUrls && sourceMap;
|
7431 |
-
(options.convertToAbsoluteUrls || autoFixUrls) && (css = fixUrls(css)), sourceMap && (// http://stackoverflow.com/a/26603875
|
7432 |
-
css += "\n/*# sourceMappingURL=data:application/json;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))) + " */");
|
7433 |
-
var blob = new Blob([ css ], {
|
7434 |
-
type: "text/css"
|
7435 |
-
}), oldSrc = link.href;
|
7436 |
-
link.href = URL.createObjectURL(blob), oldSrc && URL.revokeObjectURL(oldSrc);
|
7437 |
-
}
|
7438 |
-
/*
|
7439 |
-
MIT License http://www.opensource.org/licenses/mit-license.php
|
7440 |
-
Author Tobias Koppers @sokra
|
7441 |
-
*/
|
7442 |
-
var stylesInDom = {}, isOldIE = function(fn) {
|
7443 |
-
var memo;
|
7444 |
-
return function() {
|
7445 |
-
return void 0 === memo && (memo = fn.apply(this, arguments)), memo;
|
7446 |
-
};
|
7447 |
-
}(function() {
|
7448 |
-
// Test for IE <= 9 as proposed by Browserhacks
|
7449 |
-
// @see http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805
|
7450 |
-
// Tests for existence of standard globals is to allow style-loader
|
7451 |
-
// to operate correctly into non-standard environments
|
7452 |
-
// @see https://github.com/webpack-contrib/style-loader/issues/177
|
7453 |
-
return window && document && document.all && !window.atob;
|
7454 |
-
}), getElement = function(fn) {
|
7455 |
-
var memo = {};
|
7456 |
-
return function(selector) {
|
7457 |
-
if (void 0 === memo[selector]) {
|
7458 |
-
var styleTarget = fn.call(this, selector);
|
7459 |
-
// Special case to return head of iframe instead of iframe itself
|
7460 |
-
if (styleTarget instanceof window.HTMLIFrameElement) try {
|
7461 |
-
// This will throw an exception if access to iframe is blocked
|
7462 |
-
// due to cross-origin restrictions
|
7463 |
-
styleTarget = styleTarget.contentDocument.head;
|
7464 |
-
} catch (e) {
|
7465 |
-
styleTarget = null;
|
7466 |
-
}
|
7467 |
-
memo[selector] = styleTarget;
|
7468 |
-
}
|
7469 |
-
return memo[selector];
|
7470 |
-
};
|
7471 |
-
}(function(target) {
|
7472 |
-
return document.querySelector(target);
|
7473 |
-
}), singleton = null, singletonCounter = 0, stylesInsertedAtTop = [], fixUrls = __webpack_require__(14);
|
7474 |
-
module.exports = function(list, options) {
|
7475 |
-
if ("undefined" != typeof DEBUG && DEBUG && "object" != typeof document) throw new Error("The style-loader cannot be used in a non-browser environment");
|
7476 |
-
options = options || {}, options.attrs = "object" == typeof options.attrs ? options.attrs : {},
|
7477 |
-
// Force single-tag solution on IE6-9, which has a hard limit on the # of <style>
|
7478 |
-
// tags it will allow on a page
|
7479 |
-
options.singleton || "boolean" == typeof options.singleton || (options.singleton = isOldIE()),
|
7480 |
-
// By default, add <style> tags to the <head> element
|
7481 |
-
options.insertInto || (options.insertInto = "head"), // By default, add <style> tags to the bottom of the target
|
7482 |
-
options.insertAt || (options.insertAt = "bottom");
|
7483 |
-
var styles = listToStyles(list, options);
|
7484 |
-
return addStylesToDom(styles, options), function(newList) {
|
7485 |
-
for (var mayRemove = [], i = 0; i < styles.length; i++) {
|
7486 |
-
var item = styles[i], domStyle = stylesInDom[item.id];
|
7487 |
-
domStyle.refs--, mayRemove.push(domStyle);
|
7488 |
-
}
|
7489 |
-
if (newList) {
|
7490 |
-
addStylesToDom(listToStyles(newList, options), options);
|
7491 |
-
}
|
7492 |
-
for (var i = 0; i < mayRemove.length; i++) {
|
7493 |
-
var domStyle = mayRemove[i];
|
7494 |
-
if (0 === domStyle.refs) {
|
7495 |
-
for (var j = 0; j < domStyle.parts.length; j++) domStyle.parts[j]();
|
7496 |
-
delete stylesInDom[domStyle.id];
|
7497 |
-
}
|
7498 |
-
}
|
7499 |
-
};
|
7500 |
-
};
|
7501 |
-
var replaceText = function() {
|
7502 |
-
var textStore = [];
|
7503 |
-
return function(index, replacement) {
|
7504 |
-
return textStore[index] = replacement, textStore.filter(Boolean).join("\n");
|
7505 |
-
};
|
7506 |
-
}();
|
7507 |
-
}, /* 5 */
|
7508 |
-
/***/
|
7509 |
-
function(module, exports, __webpack_require__) {
|
7510 |
-
"use strict";
|
7511 |
-
function defaultGetNodeKey(_ref) {
|
7512 |
-
return _ref.treeIndex;
|
7513 |
-
}
|
7514 |
-
// Cheap hack to get the text of a react object
|
7515 |
-
function getReactElementText(parent) {
|
7516 |
-
return "string" == typeof parent ? parent : "object" !== (void 0 === parent ? "undefined" : _typeof(parent)) || !parent.props || !parent.props.children || "string" != typeof parent.props.children && "object" !== _typeof(parent.props.children) ? "" : "string" == typeof parent.props.children ? parent.props.children : parent.props.children.map(function(child) {
|
7517 |
-
return getReactElementText(child);
|
7518 |
-
}).join("");
|
7519 |
-
}
|
7520 |
-
// Search for a query string inside a node property
|
7521 |
-
function stringSearch(key, searchQuery, node, path, treeIndex) {
|
7522 |
-
return "function" == typeof node[key] ? String(node[key]({
|
7523 |
-
node: node,
|
7524 |
-
path: path,
|
7525 |
-
treeIndex: treeIndex
|
7526 |
-
})).indexOf(searchQuery) > -1 : "object" === _typeof(node[key]) ? getReactElementText(node[key]).indexOf(searchQuery) > -1 : node[key] && String(node[key]).indexOf(searchQuery) > -1;
|
7527 |
-
}
|
7528 |
-
function defaultSearchMethod(_ref2) {
|
7529 |
-
var node = _ref2.node, path = _ref2.path, treeIndex = _ref2.treeIndex, searchQuery = _ref2.searchQuery;
|
7530 |
-
return stringSearch("title", searchQuery, node, path, treeIndex) || stringSearch("subtitle", searchQuery, node, path, treeIndex);
|
7531 |
-
}
|
7532 |
-
Object.defineProperty(exports, "__esModule", {
|
7533 |
-
value: !0
|
7534 |
-
});
|
7535 |
-
var _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function(obj) {
|
7536 |
-
return typeof obj;
|
7537 |
-
} : function(obj) {
|
7538 |
-
return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
|
7539 |
-
};
|
7540 |
-
exports.defaultGetNodeKey = defaultGetNodeKey, exports.defaultSearchMethod = defaultSearchMethod;
|
7541 |
-
}, /* 6 */
|
7542 |
-
/***/
|
7543 |
-
function(module, exports, __webpack_require__) {
|
7544 |
-
"use strict";
|
7545 |
-
Object.defineProperty(exports, "__esModule", {
|
7546 |
-
value: !0
|
7547 |
-
}), exports.memoizedGetDescendantCount = exports.memoizedGetFlatDataFromTree = exports.memoizedInsertNode = void 0;
|
7548 |
-
var _treeDataUtils = __webpack_require__(0), memoize = function(f) {
|
7549 |
-
var savedArgsArray = [], savedKeysArray = [], savedResult = null;
|
7550 |
-
return function(args) {
|
7551 |
-
var keysArray = Object.keys(args).sort(), argsArray = keysArray.map(function(key) {
|
7552 |
-
return args[key];
|
7553 |
-
});
|
7554 |
-
// If the arguments for the last insert operation are different than this time,
|
7555 |
-
// recalculate the result
|
7556 |
-
return (argsArray.length !== savedArgsArray.length || argsArray.some(function(arg, index) {
|
7557 |
-
return arg !== savedArgsArray[index];
|
7558 |
-
}) || keysArray.some(function(key, index) {
|
7559 |
-
return key !== savedKeysArray[index];
|
7560 |
-
})) && (savedArgsArray = argsArray, savedKeysArray = keysArray, savedResult = f(args)),
|
7561 |
-
savedResult;
|
7562 |
-
};
|
7563 |
-
};
|
7564 |
-
exports.memoizedInsertNode = memoize(_treeDataUtils.insertNode), exports.memoizedGetFlatDataFromTree = memoize(_treeDataUtils.getFlatDataFromTree),
|
7565 |
-
exports.memoizedGetDescendantCount = memoize(_treeDataUtils.getDescendantCount);
|
7566 |
-
}, /* 7 */
|
7567 |
-
/***/
|
7568 |
-
function(module, exports, __webpack_require__) {
|
7569 |
-
"use strict";
|
7570 |
-
Object.defineProperty(exports, "__esModule", {
|
7571 |
-
value: !0
|
7572 |
-
}), exports.SortableTreeWithoutDndContext = void 0;
|
7573 |
-
var _defaultHandlers = __webpack_require__(5);
|
7574 |
-
Object.keys(_defaultHandlers).forEach(function(key) {
|
7575 |
-
"default" !== key && "__esModule" !== key && Object.defineProperty(exports, key, {
|
7576 |
-
enumerable: !0,
|
7577 |
-
get: function() {
|
7578 |
-
return _defaultHandlers[key];
|
7579 |
-
}
|
7580 |
-
});
|
7581 |
-
});
|
7582 |
-
var _treeDataUtils = __webpack_require__(0);
|
7583 |
-
Object.keys(_treeDataUtils).forEach(function(key) {
|
7584 |
-
"default" !== key && "__esModule" !== key && Object.defineProperty(exports, key, {
|
7585 |
-
enumerable: !0,
|
7586 |
-
get: function() {
|
7587 |
-
return _treeDataUtils[key];
|
7588 |
-
}
|
7589 |
-
});
|
7590 |
-
});
|
7591 |
-
var _reactSortableTree = __webpack_require__(8), _reactSortableTree2 = function(obj) {
|
7592 |
-
return obj && obj.__esModule ? obj : {
|
7593 |
-
default: obj
|
7594 |
-
};
|
7595 |
-
}(_reactSortableTree);
|
7596 |
-
exports.default = _reactSortableTree2.default, // Export the tree component without the react-dnd DragDropContext,
|
7597 |
-
// for when component is used with other components using react-dnd.
|
7598 |
-
// see: https://github.com/gaearon/react-dnd/issues/186
|
7599 |
-
exports.SortableTreeWithoutDndContext = _reactSortableTree.SortableTreeWithoutDndContext;
|
7600 |
-
}, /* 8 */
|
7601 |
-
/***/
|
7602 |
-
function(module, exports, __webpack_require__) {
|
7603 |
-
"use strict";
|
7604 |
-
function _interopRequireDefault(obj) {
|
7605 |
-
return obj && obj.__esModule ? obj : {
|
7606 |
-
default: obj
|
7607 |
-
};
|
7608 |
-
}
|
7609 |
-
function _classCallCheck(instance, Constructor) {
|
7610 |
-
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
7611 |
-
}
|
7612 |
-
function _possibleConstructorReturn(self, call) {
|
7613 |
-
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
7614 |
-
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
7615 |
-
}
|
7616 |
-
function _inherits(subClass, superClass) {
|
7617 |
-
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
7618 |
-
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
7619 |
-
constructor: {
|
7620 |
-
value: subClass,
|
7621 |
-
enumerable: !1,
|
7622 |
-
writable: !0,
|
7623 |
-
configurable: !0
|
7624 |
-
}
|
7625 |
-
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
7626 |
-
}
|
7627 |
-
Object.defineProperty(exports, "__esModule", {
|
7628 |
-
value: !0
|
7629 |
-
}), exports.SortableTreeWithoutDndContext = void 0;
|
7630 |
-
var _createClass = function() {
|
7631 |
-
function defineProperties(target, props) {
|
7632 |
-
for (var i = 0; i < props.length; i++) {
|
7633 |
-
var descriptor = props[i];
|
7634 |
-
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
7635 |
-
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
7636 |
-
}
|
7637 |
-
}
|
7638 |
-
return function(Constructor, protoProps, staticProps) {
|
7639 |
-
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
7640 |
-
Constructor;
|
7641 |
-
};
|
7642 |
-
}(), _extends = Object.assign || function(target) {
|
7643 |
-
for (var i = 1; i < arguments.length; i++) {
|
7644 |
-
var source = arguments[i];
|
7645 |
-
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
7646 |
-
}
|
7647 |
-
return target;
|
7648 |
-
}, _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _reactVirtualized = __webpack_require__(9), _lodash = __webpack_require__(10), _lodash2 = _interopRequireDefault(_lodash), _reactDndScrollzone = __webpack_require__(11), _reactDndScrollzone2 = _interopRequireDefault(_reactDndScrollzone);
|
7649 |
-
__webpack_require__(12);
|
7650 |
-
var _treeNode = __webpack_require__(15), _treeNode2 = _interopRequireDefault(_treeNode), _nodeRendererDefault = __webpack_require__(18), _nodeRendererDefault2 = _interopRequireDefault(_nodeRendererDefault), _treePlaceholder = __webpack_require__(22), _treePlaceholder2 = _interopRequireDefault(_treePlaceholder), _placeholderRendererDefault = __webpack_require__(23), _placeholderRendererDefault2 = _interopRequireDefault(_placeholderRendererDefault), _treeDataUtils = __webpack_require__(0), _memoizedTreeDataUtils = __webpack_require__(6), _genericUtils = __webpack_require__(26), _defaultHandlers = __webpack_require__(5), _dndManager = __webpack_require__(27), _dndManager2 = _interopRequireDefault(_dndManager), _reactSortableTree = __webpack_require__(31), _reactSortableTree2 = _interopRequireDefault(_reactSortableTree), treeIdCounter = 1, mergeTheme = function(props) {
|
7651 |
-
var merged = _extends({}, props, {
|
7652 |
-
style: _extends({}, props.theme.style, props.style),
|
7653 |
-
innerStyle: _extends({}, props.theme.innerStyle, props.innerStyle),
|
7654 |
-
reactVirtualizedListProps: _extends({}, props.theme.reactVirtualizedListProps, props.reactVirtualizedListProps)
|
7655 |
-
}), overridableDefaults = {
|
7656 |
-
nodeContentRenderer: _nodeRendererDefault2.default,
|
7657 |
-
placeholderRenderer: _placeholderRendererDefault2.default,
|
7658 |
-
rowHeight: 62,
|
7659 |
-
scaffoldBlockPxWidth: 44,
|
7660 |
-
slideRegionSize: 100,
|
7661 |
-
treeNodeRenderer: _treeNode2.default
|
7662 |
-
};
|
7663 |
-
return Object.keys(overridableDefaults).forEach(function(propKey) {
|
7664 |
-
// If prop has been specified, do not change it
|
7665 |
-
// If prop is specified in theme, use the theme setting
|
7666 |
-
// If all else fails, fall back to the default
|
7667 |
-
null === props[propKey] && (merged[propKey] = void 0 !== props.theme[propKey] ? props.theme[propKey] : overridableDefaults[propKey]);
|
7668 |
-
}), merged;
|
7669 |
-
}, ReactSortableTree = function(_Component) {
|
7670 |
-
function ReactSortableTree(props) {
|
7671 |
-
_classCallCheck(this, ReactSortableTree);
|
7672 |
-
var _this = _possibleConstructorReturn(this, (ReactSortableTree.__proto__ || Object.getPrototypeOf(ReactSortableTree)).call(this, props)), _mergeTheme = mergeTheme(props), dndType = _mergeTheme.dndType, nodeContentRenderer = _mergeTheme.nodeContentRenderer, treeNodeRenderer = _mergeTheme.treeNodeRenderer, isVirtualized = _mergeTheme.isVirtualized, slideRegionSize = _mergeTheme.slideRegionSize;
|
7673 |
-
// Wrapping classes for use with react-dnd
|
7674 |
-
// Prepare scroll-on-drag options for this list
|
7675 |
-
return _this.dndManager = new _dndManager2.default(_this), _this.treeId = "rst__" + treeIdCounter,
|
7676 |
-
treeIdCounter += 1, _this.dndType = dndType || _this.treeId, _this.nodeContentRenderer = _this.dndManager.wrapSource(nodeContentRenderer),
|
7677 |
-
_this.treePlaceholderRenderer = _this.dndManager.wrapPlaceholder(_treePlaceholder2.default),
|
7678 |
-
_this.treeNodeRenderer = _this.dndManager.wrapTarget(treeNodeRenderer), isVirtualized && (_this.scrollZoneVirtualList = (0,
|
7679 |
-
_reactDndScrollzone2.default)(_reactVirtualized.List), _this.vStrength = (0, _reactDndScrollzone.createVerticalStrength)(slideRegionSize),
|
7680 |
-
_this.hStrength = (0, _reactDndScrollzone.createHorizontalStrength)(slideRegionSize)),
|
7681 |
-
_this.state = {
|
7682 |
-
draggingTreeData: null,
|
7683 |
-
draggedNode: null,
|
7684 |
-
draggedMinimumTreeIndex: null,
|
7685 |
-
draggedDepth: null,
|
7686 |
-
searchMatches: [],
|
7687 |
-
searchFocusTreeIndex: null,
|
7688 |
-
dragging: !1
|
7689 |
-
}, _this.toggleChildrenVisibility = _this.toggleChildrenVisibility.bind(_this),
|
7690 |
-
_this.moveNode = _this.moveNode.bind(_this), _this.startDrag = _this.startDrag.bind(_this),
|
7691 |
-
_this.dragHover = _this.dragHover.bind(_this), _this.endDrag = _this.endDrag.bind(_this),
|
7692 |
-
_this.drop = _this.drop.bind(_this), _this.handleDndMonitorChange = _this.handleDndMonitorChange.bind(_this),
|
7693 |
-
_this;
|
7694 |
-
}
|
7695 |
-
return _inherits(ReactSortableTree, _Component), _createClass(ReactSortableTree, [ {
|
7696 |
-
key: "componentDidMount",
|
7697 |
-
value: function() {
|
7698 |
-
this.loadLazyChildren(), this.search(this.props), // Hook into react-dnd state changes to detect when the drag ends
|
7699 |
-
// TODO: This is very brittle, so it needs to be replaced if react-dnd
|
7700 |
-
// offers a more official way to detect when a drag ends
|
7701 |
-
this.clearMonitorSubscription = this.context.dragDropManager.getMonitor().subscribeToStateChange(this.handleDndMonitorChange);
|
7702 |
-
}
|
7703 |
-
}, {
|
7704 |
-
key: "componentWillReceiveProps",
|
7705 |
-
value: function(nextProps) {
|
7706 |
-
this.props.treeData !== nextProps.treeData ? (// Ignore updates caused by search, in order to avoid infinite looping
|
7707 |
-
this.ignoreOneTreeUpdate ? this.ignoreOneTreeUpdate = !1 : (// Reset the focused index if the tree has changed
|
7708 |
-
this.setState({
|
7709 |
-
searchFocusTreeIndex: null
|
7710 |
-
}), // Load any children defined by a function
|
7711 |
-
this.loadLazyChildren(nextProps), this.search(nextProps, !1, !1)), // Reset the drag state
|
7712 |
-
this.setState({
|
7713 |
-
draggingTreeData: null,
|
7714 |
-
draggedNode: null,
|
7715 |
-
draggedMinimumTreeIndex: null,
|
7716 |
-
draggedDepth: null,
|
7717 |
-
dragging: !1
|
7718 |
-
})) : (0, _lodash2.default)(this.props.searchQuery, nextProps.searchQuery) ? this.props.searchFocusOffset !== nextProps.searchFocusOffset && this.search(nextProps, !0, !0, !0) : this.search(nextProps);
|
7719 |
-
}
|
7720 |
-
}, {
|
7721 |
-
key: "componentDidUpdate",
|
7722 |
-
value: function(prevProps, prevState) {
|
7723 |
-
// if it is not the same then call the onDragStateChanged
|
7724 |
-
this.state.dragging !== prevState.dragging && this.props.onDragStateChanged && this.props.onDragStateChanged({
|
7725 |
-
isDragging: this.state.dragging,
|
7726 |
-
draggedNode: this.state.draggedNode
|
7727 |
-
});
|
7728 |
-
}
|
7729 |
-
}, {
|
7730 |
-
key: "componentWillUnmount",
|
7731 |
-
value: function() {
|
7732 |
-
this.clearMonitorSubscription();
|
7733 |
-
}
|
7734 |
-
}, {
|
7735 |
-
key: "getRows",
|
7736 |
-
value: function(treeData) {
|
7737 |
-
return (0, _memoizedTreeDataUtils.memoizedGetFlatDataFromTree)({
|
7738 |
-
ignoreCollapsed: !0,
|
7739 |
-
getNodeKey: this.props.getNodeKey,
|
7740 |
-
treeData: treeData
|
7741 |
-
});
|
7742 |
-
}
|
7743 |
-
}, {
|
7744 |
-
key: "handleDndMonitorChange",
|
7745 |
-
value: function() {
|
7746 |
-
// If the drag ends and the tree is still in a mid-drag state,
|
7747 |
-
// it means that the drag was canceled or the dragSource dropped
|
7748 |
-
// elsewhere, and we should reset the state of this tree
|
7749 |
-
!this.context.dragDropManager.getMonitor().isDragging() && this.state.draggingTreeData && this.endDrag();
|
7750 |
-
}
|
7751 |
-
}, {
|
7752 |
-
key: "toggleChildrenVisibility",
|
7753 |
-
value: function(_ref) {
|
7754 |
-
var targetNode = _ref.node, path = _ref.path, treeData = (0, _treeDataUtils.changeNodeAtPath)({
|
7755 |
-
treeData: this.props.treeData,
|
7756 |
-
path: path,
|
7757 |
-
newNode: function(_ref2) {
|
7758 |
-
var node = _ref2.node;
|
7759 |
-
return _extends({}, node, {
|
7760 |
-
expanded: !node.expanded
|
7761 |
-
});
|
7762 |
-
},
|
7763 |
-
getNodeKey: this.props.getNodeKey
|
7764 |
-
});
|
7765 |
-
this.props.onChange(treeData), this.props.onVisibilityToggle({
|
7766 |
-
treeData: treeData,
|
7767 |
-
node: targetNode,
|
7768 |
-
expanded: !targetNode.expanded,
|
7769 |
-
path: path
|
7770 |
-
});
|
7771 |
-
}
|
7772 |
-
}, {
|
7773 |
-
key: "moveNode",
|
7774 |
-
value: function(_ref3) {
|
7775 |
-
var node = _ref3.node, prevPath = _ref3.path, prevTreeIndex = _ref3.treeIndex, depth = _ref3.depth, minimumTreeIndex = _ref3.minimumTreeIndex, _insertNode = (0,
|
7776 |
-
_treeDataUtils.insertNode)({
|
7777 |
-
treeData: this.state.draggingTreeData,
|
7778 |
-
newNode: node,
|
7779 |
-
depth: depth,
|
7780 |
-
minimumTreeIndex: minimumTreeIndex,
|
7781 |
-
expandParent: !0,
|
7782 |
-
getNodeKey: this.props.getNodeKey
|
7783 |
-
}), treeData = _insertNode.treeData, treeIndex = _insertNode.treeIndex, path = _insertNode.path, nextParentNode = _insertNode.parentNode;
|
7784 |
-
this.props.onChange(treeData), this.props.onMoveNode({
|
7785 |
-
treeData: treeData,
|
7786 |
-
node: node,
|
7787 |
-
treeIndex: treeIndex,
|
7788 |
-
path: path,
|
7789 |
-
nextPath: path,
|
7790 |
-
nextTreeIndex: treeIndex,
|
7791 |
-
prevPath: prevPath,
|
7792 |
-
prevTreeIndex: prevTreeIndex,
|
7793 |
-
nextParentNode: nextParentNode
|
7794 |
-
});
|
7795 |
-
}
|
7796 |
-
}, {
|
7797 |
-
key: "search",
|
7798 |
-
value: function() {
|
7799 |
-
var props = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : this.props, seekIndex = !(arguments.length > 1 && void 0 !== arguments[1]) || arguments[1], expand = !(arguments.length > 2 && void 0 !== arguments[2]) || arguments[2], singleSearch = arguments.length > 3 && void 0 !== arguments[3] && arguments[3], treeData = props.treeData, onChange = props.onChange, searchFinishCallback = props.searchFinishCallback, searchQuery = props.searchQuery, searchMethod = props.searchMethod, searchFocusOffset = props.searchFocusOffset;
|
7800 |
-
// Skip search if no conditions are specified
|
7801 |
-
if ((null === searchQuery || void 0 === searchQuery || "" === String(searchQuery)) && !searchMethod) return this.setState({
|
7802 |
-
searchMatches: []
|
7803 |
-
}), void (searchFinishCallback && searchFinishCallback([]));
|
7804 |
-
var _find = (0, _treeDataUtils.find)({
|
7805 |
-
getNodeKey: this.props.getNodeKey,
|
7806 |
-
treeData: treeData,
|
7807 |
-
searchQuery: searchQuery,
|
7808 |
-
searchMethod: searchMethod || _defaultHandlers.defaultSearchMethod,
|
7809 |
-
searchFocusOffset: searchFocusOffset,
|
7810 |
-
expandAllMatchPaths: expand && !singleSearch,
|
7811 |
-
expandFocusMatchPaths: !!expand
|
7812 |
-
}), expandedTreeData = _find.treeData, searchMatches = _find.matches;
|
7813 |
-
// Update the tree with data leaving all paths leading to matching nodes open
|
7814 |
-
expand && (this.ignoreOneTreeUpdate = !0, // Prevents infinite loop
|
7815 |
-
onChange(expandedTreeData)), searchFinishCallback && searchFinishCallback(searchMatches);
|
7816 |
-
var searchFocusTreeIndex = null;
|
7817 |
-
seekIndex && null !== searchFocusOffset && searchFocusOffset < searchMatches.length && (searchFocusTreeIndex = searchMatches[searchFocusOffset].treeIndex),
|
7818 |
-
this.setState({
|
7819 |
-
searchMatches: searchMatches,
|
7820 |
-
searchFocusTreeIndex: searchFocusTreeIndex
|
7821 |
-
});
|
7822 |
-
}
|
7823 |
-
}, {
|
7824 |
-
key: "startDrag",
|
7825 |
-
value: function(_ref4) {
|
7826 |
-
var _this2 = this, path = _ref4.path;
|
7827 |
-
this.setState(function() {
|
7828 |
-
var _removeNode = (0, _treeDataUtils.removeNode)({
|
7829 |
-
treeData: _this2.props.treeData,
|
7830 |
-
path: path,
|
7831 |
-
getNodeKey: _this2.props.getNodeKey
|
7832 |
-
}), draggingTreeData = _removeNode.treeData, draggedNode = _removeNode.node, draggedMinimumTreeIndex = _removeNode.treeIndex;
|
7833 |
-
return {
|
7834 |
-
draggingTreeData: draggingTreeData,
|
7835 |
-
draggedNode: draggedNode,
|
7836 |
-
draggedDepth: path.length - 1,
|
7837 |
-
draggedMinimumTreeIndex: draggedMinimumTreeIndex,
|
7838 |
-
dragging: !0
|
7839 |
-
};
|
7840 |
-
});
|
7841 |
-
}
|
7842 |
-
}, {
|
7843 |
-
key: "dragHover",
|
7844 |
-
value: function(_ref5) {
|
7845 |
-
var draggedNode = _ref5.node, draggedDepth = _ref5.depth, draggedMinimumTreeIndex = _ref5.minimumTreeIndex;
|
7846 |
-
// Ignore this hover if it is at the same position as the last hover
|
7847 |
-
if (this.state.draggedDepth !== draggedDepth || this.state.draggedMinimumTreeIndex !== draggedMinimumTreeIndex) {
|
7848 |
-
// Fall back to the tree data if something is being dragged in from
|
7849 |
-
// an external element
|
7850 |
-
var draggingTreeData = this.state.draggingTreeData || this.props.treeData, addedResult = (0,
|
7851 |
-
_memoizedTreeDataUtils.memoizedInsertNode)({
|
7852 |
-
treeData: draggingTreeData,
|
7853 |
-
newNode: draggedNode,
|
7854 |
-
depth: draggedDepth,
|
7855 |
-
minimumTreeIndex: draggedMinimumTreeIndex,
|
7856 |
-
expandParent: !0,
|
7857 |
-
getNodeKey: this.props.getNodeKey
|
7858 |
-
}), rows = this.getRows(addedResult.treeData), expandedParentPath = rows[addedResult.treeIndex].path;
|
7859 |
-
this.setState({
|
7860 |
-
draggedNode: draggedNode,
|
7861 |
-
draggedDepth: draggedDepth,
|
7862 |
-
draggedMinimumTreeIndex: draggedMinimumTreeIndex,
|
7863 |
-
draggingTreeData: (0, _treeDataUtils.changeNodeAtPath)({
|
7864 |
-
treeData: draggingTreeData,
|
7865 |
-
path: expandedParentPath.slice(0, -1),
|
7866 |
-
newNode: function(_ref6) {
|
7867 |
-
var node = _ref6.node;
|
7868 |
-
return _extends({}, node, {
|
7869 |
-
expanded: !0
|
7870 |
-
});
|
7871 |
-
},
|
7872 |
-
getNodeKey: this.props.getNodeKey
|
7873 |
-
}),
|
7874 |
-
// reset the scroll focus so it doesn't jump back
|
7875 |
-
// to a search result while dragging
|
7876 |
-
searchFocusTreeIndex: null,
|
7877 |
-
dragging: !0
|
7878 |
-
});
|
7879 |
-
}
|
7880 |
-
}
|
7881 |
-
}, {
|
7882 |
-
key: "endDrag",
|
7883 |
-
value: function(dropResult) {
|
7884 |
-
var _this3 = this;
|
7885 |
-
// Drop was cancelled
|
7886 |
-
if (dropResult) {
|
7887 |
-
if (dropResult.treeId !== this.treeId) {
|
7888 |
-
// The node was dropped in an external drop target or tree
|
7889 |
-
var node = dropResult.node, path = dropResult.path, treeIndex = dropResult.treeIndex, shouldCopy = this.props.shouldCopyOnOutsideDrop;
|
7890 |
-
"function" == typeof shouldCopy && (shouldCopy = shouldCopy({
|
7891 |
-
node: node,
|
7892 |
-
prevTreeIndex: treeIndex,
|
7893 |
-
prevPath: path
|
7894 |
-
}));
|
7895 |
-
var treeData = this.state.draggingTreeData || this.props.treeData;
|
7896 |
-
// If copying is enabled, a drop outside leaves behind a copy in the
|
7897 |
-
// source tree
|
7898 |
-
shouldCopy && (treeData = (0, _treeDataUtils.changeNodeAtPath)({
|
7899 |
-
treeData: this.props.treeData,
|
7900 |
-
// use treeData unaltered by the drag operation
|
7901 |
-
path: path,
|
7902 |
-
newNode: function(_ref7) {
|
7903 |
-
var copyNode = _ref7.node;
|
7904 |
-
return _extends({}, copyNode);
|
7905 |
-
},
|
7906 |
-
// create a shallow copy of the node
|
7907 |
-
getNodeKey: this.props.getNodeKey
|
7908 |
-
})), this.props.onChange(treeData), this.props.onMoveNode({
|
7909 |
-
treeData: treeData,
|
7910 |
-
node: node,
|
7911 |
-
treeIndex: null,
|
7912 |
-
path: null,
|
7913 |
-
nextPath: null,
|
7914 |
-
nextTreeIndex: null,
|
7915 |
-
prevPath: path,
|
7916 |
-
prevTreeIndex: treeIndex
|
7917 |
-
});
|
7918 |
-
}
|
7919 |
-
} else !function() {
|
7920 |
-
_this3.setState({
|
7921 |
-
draggingTreeData: null,
|
7922 |
-
draggedNode: null,
|
7923 |
-
draggedMinimumTreeIndex: null,
|
7924 |
-
draggedDepth: null,
|
7925 |
-
dragging: !1
|
7926 |
-
});
|
7927 |
-
}();
|
7928 |
-
}
|
7929 |
-
}, {
|
7930 |
-
key: "drop",
|
7931 |
-
value: function(dropResult) {
|
7932 |
-
this.moveNode(dropResult);
|
7933 |
-
}
|
7934 |
-
}, {
|
7935 |
-
key: "loadLazyChildren",
|
7936 |
-
value: function() {
|
7937 |
-
var _this4 = this, props = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : this.props;
|
7938 |
-
(0, _treeDataUtils.walk)({
|
7939 |
-
treeData: props.treeData,
|
7940 |
-
getNodeKey: this.props.getNodeKey,
|
7941 |
-
callback: function(_ref8) {
|
7942 |
-
var node = _ref8.node, path = _ref8.path, lowerSiblingCounts = _ref8.lowerSiblingCounts, treeIndex = _ref8.treeIndex;
|
7943 |
-
// If the node has children defined by a function, and is either expanded
|
7944 |
-
// or set to load even before expansion, run the function.
|
7945 |
-
node.children && "function" == typeof node.children && (node.expanded || props.loadCollapsedLazyChildren) && // Call the children fetching function
|
7946 |
-
node.children({
|
7947 |
-
node: node,
|
7948 |
-
path: path,
|
7949 |
-
lowerSiblingCounts: lowerSiblingCounts,
|
7950 |
-
treeIndex: treeIndex,
|
7951 |
-
// Provide a helper to append the new data when it is received
|
7952 |
-
done: function(childrenArray) {
|
7953 |
-
return _this4.props.onChange((0, _treeDataUtils.changeNodeAtPath)({
|
7954 |
-
treeData: _this4.props.treeData,
|
7955 |
-
path: path,
|
7956 |
-
newNode: function(_ref9) {
|
7957 |
-
var oldNode = _ref9.node;
|
7958 |
-
// Only replace the old node if it's the one we set off to find children
|
7959 |
-
// for in the first place
|
7960 |
-
return oldNode === node ? _extends({}, oldNode, {
|
7961 |
-
children: childrenArray
|
7962 |
-
}) : oldNode;
|
7963 |
-
},
|
7964 |
-
getNodeKey: _this4.props.getNodeKey
|
7965 |
-
}));
|
7966 |
-
}
|
7967 |
-
});
|
7968 |
-
}
|
7969 |
-
});
|
7970 |
-
}
|
7971 |
-
}, {
|
7972 |
-
key: "renderRow",
|
7973 |
-
value: function(_ref10, _ref11) {
|
7974 |
-
var node = _ref10.node, parentNode = _ref10.parentNode, path = _ref10.path, lowerSiblingCounts = _ref10.lowerSiblingCounts, treeIndex = _ref10.treeIndex, listIndex = _ref11.listIndex, style = _ref11.style, getPrevRow = _ref11.getPrevRow, matchKeys = _ref11.matchKeys, swapFrom = _ref11.swapFrom, swapDepth = _ref11.swapDepth, swapLength = _ref11.swapLength, _mergeTheme2 = mergeTheme(this.props), canDrag = _mergeTheme2.canDrag, generateNodeProps = _mergeTheme2.generateNodeProps, scaffoldBlockPxWidth = _mergeTheme2.scaffoldBlockPxWidth, searchFocusOffset = _mergeTheme2.searchFocusOffset, TreeNodeRenderer = this.treeNodeRenderer, NodeContentRenderer = this.nodeContentRenderer, nodeKey = path[path.length - 1], isSearchMatch = nodeKey in matchKeys, isSearchFocus = isSearchMatch && matchKeys[nodeKey] === searchFocusOffset, callbackParams = {
|
7975 |
-
node: node,
|
7976 |
-
parentNode: parentNode,
|
7977 |
-
path: path,
|
7978 |
-
lowerSiblingCounts: lowerSiblingCounts,
|
7979 |
-
treeIndex: treeIndex,
|
7980 |
-
isSearchMatch: isSearchMatch,
|
7981 |
-
isSearchFocus: isSearchFocus
|
7982 |
-
}, nodeProps = generateNodeProps ? generateNodeProps(callbackParams) : {}, rowCanDrag = "function" != typeof canDrag ? canDrag : canDrag(callbackParams), sharedProps = {
|
7983 |
-
treeIndex: treeIndex,
|
7984 |
-
scaffoldBlockPxWidth: scaffoldBlockPxWidth,
|
7985 |
-
node: node,
|
7986 |
-
path: path,
|
7987 |
-
treeId: this.treeId
|
7988 |
-
};
|
7989 |
-
return _react2.default.createElement(TreeNodeRenderer, _extends({
|
7990 |
-
style: style,
|
7991 |
-
key: nodeKey,
|
7992 |
-
listIndex: listIndex,
|
7993 |
-
getPrevRow: getPrevRow,
|
7994 |
-
lowerSiblingCounts: lowerSiblingCounts,
|
7995 |
-
swapFrom: swapFrom,
|
7996 |
-
swapLength: swapLength,
|
7997 |
-
swapDepth: swapDepth
|
7998 |
-
}, sharedProps), _react2.default.createElement(NodeContentRenderer, _extends({
|
7999 |
-
parentNode: parentNode,
|
8000 |
-
isSearchMatch: isSearchMatch,
|
8001 |
-
isSearchFocus: isSearchFocus,
|
8002 |
-
canDrag: rowCanDrag,
|
8003 |
-
toggleChildrenVisibility: this.toggleChildrenVisibility
|
8004 |
-
}, sharedProps, nodeProps)));
|
8005 |
-
}
|
8006 |
-
}, {
|
8007 |
-
key: "render",
|
8008 |
-
value: function() {
|
8009 |
-
var _this5 = this, _mergeTheme3 = mergeTheme(this.props), style = _mergeTheme3.style, className = _mergeTheme3.className, innerStyle = _mergeTheme3.innerStyle, rowHeight = _mergeTheme3.rowHeight, isVirtualized = _mergeTheme3.isVirtualized, placeholderRenderer = _mergeTheme3.placeholderRenderer, reactVirtualizedListProps = _mergeTheme3.reactVirtualizedListProps, getNodeKey = _mergeTheme3.getNodeKey, _state = this.state, searchMatches = _state.searchMatches, searchFocusTreeIndex = _state.searchFocusTreeIndex, draggedNode = _state.draggedNode, draggedDepth = _state.draggedDepth, draggedMinimumTreeIndex = _state.draggedMinimumTreeIndex, treeData = this.state.draggingTreeData || this.props.treeData, rows = void 0, swapFrom = null, swapLength = null;
|
8010 |
-
if (draggedNode && null !== draggedMinimumTreeIndex) {
|
8011 |
-
var addedResult = (0, _memoizedTreeDataUtils.memoizedInsertNode)({
|
8012 |
-
treeData: treeData,
|
8013 |
-
newNode: draggedNode,
|
8014 |
-
depth: draggedDepth,
|
8015 |
-
minimumTreeIndex: draggedMinimumTreeIndex,
|
8016 |
-
expandParent: !0,
|
8017 |
-
getNodeKey: getNodeKey
|
8018 |
-
}), swapTo = draggedMinimumTreeIndex;
|
8019 |
-
swapFrom = addedResult.treeIndex, swapLength = 1 + (0, _memoizedTreeDataUtils.memoizedGetDescendantCount)({
|
8020 |
-
node: draggedNode
|
8021 |
-
}), rows = (0, _genericUtils.slideRows)(this.getRows(addedResult.treeData), swapFrom, swapTo, swapLength);
|
8022 |
-
} else rows = this.getRows(treeData);
|
8023 |
-
// Get indices for rows that match the search conditions
|
8024 |
-
var matchKeys = {};
|
8025 |
-
searchMatches.forEach(function(_ref12, i) {
|
8026 |
-
var path = _ref12.path;
|
8027 |
-
matchKeys[path[path.length - 1]] = i;
|
8028 |
-
});
|
8029 |
-
// Seek to the focused search result if there is one specified
|
8030 |
-
var scrollToInfo = null !== searchFocusTreeIndex ? {
|
8031 |
-
scrollToIndex: searchFocusTreeIndex
|
8032 |
-
} : {}, containerStyle = style, list = void 0;
|
8033 |
-
if (rows.length < 1) {
|
8034 |
-
var Placeholder = this.treePlaceholderRenderer, PlaceholderContent = placeholderRenderer;
|
8035 |
-
list = _react2.default.createElement(Placeholder, {
|
8036 |
-
treeId: this.treeId,
|
8037 |
-
drop: this.drop
|
8038 |
-
}, _react2.default.createElement(PlaceholderContent, null));
|
8039 |
-
} else if (isVirtualized) {
|
8040 |
-
containerStyle = _extends({
|
8041 |
-
height: "100%"
|
8042 |
-
}, containerStyle);
|
8043 |
-
var ScrollZoneVirtualList = this.scrollZoneVirtualList;
|
8044 |
-
// Render list with react-virtualized
|
8045 |
-
list = _react2.default.createElement(_reactVirtualized.AutoSizer, null, function(_ref13) {
|
8046 |
-
var height = _ref13.height, width = _ref13.width;
|
8047 |
-
return _react2.default.createElement(ScrollZoneVirtualList, _extends({}, scrollToInfo, {
|
8048 |
-
verticalStrength: _this5.vStrength,
|
8049 |
-
horizontalStrength: _this5.hStrength,
|
8050 |
-
speed: 30,
|
8051 |
-
scrollToAlignment: "start",
|
8052 |
-
className: _reactSortableTree2.default.virtualScrollOverride,
|
8053 |
-
width: width,
|
8054 |
-
onScroll: function(_ref14) {
|
8055 |
-
var scrollTop = _ref14.scrollTop;
|
8056 |
-
_this5.scrollTop = scrollTop;
|
8057 |
-
},
|
8058 |
-
height: height,
|
8059 |
-
style: innerStyle,
|
8060 |
-
rowCount: rows.length,
|
8061 |
-
estimatedRowSize: "function" != typeof rowHeight ? rowHeight : void 0,
|
8062 |
-
rowHeight: "function" != typeof rowHeight ? rowHeight : function(_ref15) {
|
8063 |
-
var index = _ref15.index;
|
8064 |
-
return rowHeight({
|
8065 |
-
index: index,
|
8066 |
-
treeIndex: index,
|
8067 |
-
node: rows[index].node,
|
8068 |
-
path: rows[index].path
|
8069 |
-
});
|
8070 |
-
},
|
8071 |
-
rowRenderer: function(_ref16) {
|
8072 |
-
var index = _ref16.index, rowStyle = _ref16.style;
|
8073 |
-
return _this5.renderRow(rows[index], {
|
8074 |
-
listIndex: index,
|
8075 |
-
style: rowStyle,
|
8076 |
-
getPrevRow: function() {
|
8077 |
-
return rows[index - 1] || null;
|
8078 |
-
},
|
8079 |
-
matchKeys: matchKeys,
|
8080 |
-
swapFrom: swapFrom,
|
8081 |
-
swapDepth: draggedDepth,
|
8082 |
-
swapLength: swapLength
|
8083 |
-
});
|
8084 |
-
}
|
8085 |
-
}, reactVirtualizedListProps));
|
8086 |
-
});
|
8087 |
-
} else // Render list without react-virtualized
|
8088 |
-
list = rows.map(function(row, index) {
|
8089 |
-
return _this5.renderRow(row, {
|
8090 |
-
listIndex: index,
|
8091 |
-
style: {
|
8092 |
-
height: "function" != typeof rowHeight ? rowHeight : rowHeight({
|
8093 |
-
index: index,
|
8094 |
-
treeIndex: index,
|
8095 |
-
node: row.node,
|
8096 |
-
path: row.path
|
8097 |
-
})
|
8098 |
-
},
|
8099 |
-
getPrevRow: function() {
|
8100 |
-
return rows[index - 1] || null;
|
8101 |
-
},
|
8102 |
-
matchKeys: matchKeys,
|
8103 |
-
swapFrom: swapFrom,
|
8104 |
-
swapDepth: draggedDepth,
|
8105 |
-
swapLength: swapLength
|
8106 |
-
});
|
8107 |
-
});
|
8108 |
-
return _react2.default.createElement("div", {
|
8109 |
-
className: _reactSortableTree2.default.tree + (className ? " " + className : ""),
|
8110 |
-
style: containerStyle
|
8111 |
-
}, list);
|
8112 |
-
}
|
8113 |
-
} ]), ReactSortableTree;
|
8114 |
-
}(_react.Component);
|
8115 |
-
ReactSortableTree.propTypes = {
|
8116 |
-
// Tree data in the following format:
|
8117 |
-
// [{title: 'main', subtitle: 'sub'}, { title: 'value2', expanded: true, children: [{ title: 'value3') }] }]
|
8118 |
-
// `title` is the primary label for the node
|
8119 |
-
// `subtitle` is a secondary label for the node
|
8120 |
-
// `expanded` shows children of the node if true, or hides them if false. Defaults to false.
|
8121 |
-
// `children` is an array of child nodes belonging to the node.
|
8122 |
-
treeData: _propTypes2.default.arrayOf(_propTypes2.default.object).isRequired,
|
8123 |
-
// Style applied to the container wrapping the tree (style defaults to {height: '100%'})
|
8124 |
-
style: _propTypes2.default.shape({}),
|
8125 |
-
// Class name for the container wrapping the tree
|
8126 |
-
className: _propTypes2.default.string,
|
8127 |
-
// Style applied to the inner, scrollable container (for padding, etc.)
|
8128 |
-
innerStyle: _propTypes2.default.shape({}),
|
8129 |
-
// Used by react-virtualized
|
8130 |
-
// Either a fixed row height (number) or a function that returns the
|
8131 |
-
// height of a row given its index: `({ index: number }): number`
|
8132 |
-
rowHeight: _propTypes2.default.oneOfType([ _propTypes2.default.number, _propTypes2.default.func ]),
|
8133 |
-
// Size in px of the region near the edges that initiates scrolling on dragover
|
8134 |
-
slideRegionSize: _propTypes2.default.number,
|
8135 |
-
// Custom properties to hand to the react-virtualized list
|
8136 |
-
// https://github.com/bvaughn/react-virtualized/blob/master/docs/List.md#prop-types
|
8137 |
-
reactVirtualizedListProps: _propTypes2.default.shape({}),
|
8138 |
-
// The width of the blocks containing the lines representing the structure of the tree.
|
8139 |
-
scaffoldBlockPxWidth: _propTypes2.default.number,
|
8140 |
-
// Maximum depth nodes can be inserted at. Defaults to infinite.
|
8141 |
-
maxDepth: _propTypes2.default.number,
|
8142 |
-
// The method used to search nodes.
|
8143 |
-
// Defaults to a function that uses the `searchQuery` string to search for nodes with
|
8144 |
-
// matching `title` or `subtitle` values.
|
8145 |
-
// NOTE: Changing `searchMethod` will not update the search, but changing the `searchQuery` will.
|
8146 |
-
searchMethod: _propTypes2.default.func,
|
8147 |
-
// Used by the `searchMethod` to highlight and scroll to matched nodes.
|
8148 |
-
// Should be a string for the default `searchMethod`, but can be anything when using a custom search.
|
8149 |
-
searchQuery: _propTypes2.default.any,
|
8150 |
-
// eslint-disable-line react/forbid-prop-types
|
8151 |
-
// Outline the <`searchFocusOffset`>th node and scroll to it.
|
8152 |
-
searchFocusOffset: _propTypes2.default.number,
|
8153 |
-
// Get the nodes that match the search criteria. Used for counting total matches, etc.
|
8154 |
-
searchFinishCallback: _propTypes2.default.func,
|
8155 |
-
// Generate an object with additional props to be passed to the node renderer.
|
8156 |
-
// Use this for adding buttons via the `buttons` key,
|
8157 |
-
// or additional `style` / `className` settings.
|
8158 |
-
generateNodeProps: _propTypes2.default.func,
|
8159 |
-
// Set to false to disable virtualization.
|
8160 |
-
// NOTE: Auto-scrolling while dragging, and scrolling to the `searchFocusOffset` will be disabled.
|
8161 |
-
isVirtualized: _propTypes2.default.bool,
|
8162 |
-
treeNodeRenderer: _propTypes2.default.func,
|
8163 |
-
// Override the default component for rendering nodes (but keep the scaffolding generator)
|
8164 |
-
// This is an advanced option for complete customization of the appearance.
|
8165 |
-
// It is best to copy the component in `node-renderer-default.js` to use as a base, and customize as needed.
|
8166 |
-
nodeContentRenderer: _propTypes2.default.func,
|
8167 |
-
// Override the default component for rendering an empty tree
|
8168 |
-
// This is an advanced option for complete customization of the appearance.
|
8169 |
-
// It is best to copy the component in `placeholder-renderer-default.js` to use as a base,
|
8170 |
-
// and customize as needed.
|
8171 |
-
placeholderRenderer: _propTypes2.default.func,
|
8172 |
-
theme: _propTypes2.default.shape({
|
8173 |
-
style: _propTypes2.default.shape({}),
|
8174 |
-
innerStyle: _propTypes2.default.shape({}),
|
8175 |
-
reactVirtualizedListProps: _propTypes2.default.shape({}),
|
8176 |
-
scaffoldBlockPxWidth: _propTypes2.default.number,
|
8177 |
-
slideRegionSize: _propTypes2.default.number,
|
8178 |
-
rowHeight: _propTypes2.default.oneOfType([ _propTypes2.default.number, _propTypes2.default.func ]),
|
8179 |
-
treeNodeRenderer: _propTypes2.default.func,
|
8180 |
-
nodeContentRenderer: _propTypes2.default.func,
|
8181 |
-
placeholderRenderer: _propTypes2.default.func
|
8182 |
-
}),
|
8183 |
-
// Determine the unique key used to identify each node and
|
8184 |
-
// generate the `path` array passed in callbacks.
|
8185 |
-
// By default, returns the index in the tree (omitting hidden nodes).
|
8186 |
-
getNodeKey: _propTypes2.default.func,
|
8187 |
-
// Called whenever tree data changed.
|
8188 |
-
// Just like with React input elements, you have to update your
|
8189 |
-
// own component's data to see the changes reflected.
|
8190 |
-
onChange: _propTypes2.default.func.isRequired,
|
8191 |
-
// Called after node move operation.
|
8192 |
-
onMoveNode: _propTypes2.default.func,
|
8193 |
-
// Determine whether a node can be dragged. Set to false to disable dragging on all nodes.
|
8194 |
-
canDrag: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.bool ]),
|
8195 |
-
// Determine whether a node can be dropped based on its path and parents'.
|
8196 |
-
canDrop: _propTypes2.default.func,
|
8197 |
-
// When true, or a callback returning true, dropping nodes to react-dnd
|
8198 |
-
// drop targets outside of this tree will not remove them from this tree
|
8199 |
-
shouldCopyOnOutsideDrop: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.bool ]),
|
8200 |
-
// Called after children nodes collapsed or expanded.
|
8201 |
-
onVisibilityToggle: _propTypes2.default.func,
|
8202 |
-
dndType: _propTypes2.default.string,
|
8203 |
-
// Called to track between dropped and dragging
|
8204 |
-
onDragStateChanged: _propTypes2.default.func
|
8205 |
-
}, ReactSortableTree.defaultProps = {
|
8206 |
-
canDrag: !0,
|
8207 |
-
canDrop: null,
|
8208 |
-
className: "",
|
8209 |
-
dndType: null,
|
8210 |
-
generateNodeProps: null,
|
8211 |
-
getNodeKey: _defaultHandlers.defaultGetNodeKey,
|
8212 |
-
innerStyle: {},
|
8213 |
-
isVirtualized: !0,
|
8214 |
-
maxDepth: null,
|
8215 |
-
treeNodeRenderer: null,
|
8216 |
-
nodeContentRenderer: null,
|
8217 |
-
onMoveNode: function() {},
|
8218 |
-
onVisibilityToggle: function() {},
|
8219 |
-
placeholderRenderer: null,
|
8220 |
-
reactVirtualizedListProps: {},
|
8221 |
-
rowHeight: null,
|
8222 |
-
scaffoldBlockPxWidth: null,
|
8223 |
-
searchFinishCallback: null,
|
8224 |
-
searchFocusOffset: null,
|
8225 |
-
searchMethod: null,
|
8226 |
-
searchQuery: null,
|
8227 |
-
shouldCopyOnOutsideDrop: !1,
|
8228 |
-
slideRegionSize: null,
|
8229 |
-
style: {},
|
8230 |
-
theme: {},
|
8231 |
-
onDragStateChanged: function() {}
|
8232 |
-
}, ReactSortableTree.contextTypes = {
|
8233 |
-
dragDropManager: _propTypes2.default.shape({})
|
8234 |
-
}, // Export the tree component without the react-dnd DragDropContext,
|
8235 |
-
// for when component is used with other components using react-dnd.
|
8236 |
-
// see: https://github.com/gaearon/react-dnd/issues/186
|
8237 |
-
exports.SortableTreeWithoutDndContext = ReactSortableTree, exports.default = _dndManager2.default.wrapRoot(ReactSortableTree);
|
8238 |
-
}, /* 9 */
|
8239 |
-
/***/
|
8240 |
-
function(module, exports) {
|
8241 |
-
module.exports = __webpack_require__(520);
|
8242 |
-
}, /* 10 */
|
8243 |
-
/***/
|
8244 |
-
function(module, exports) {
|
8245 |
-
module.exports = __webpack_require__(611);
|
8246 |
-
}, /* 11 */
|
8247 |
-
/***/
|
8248 |
-
function(module, exports) {
|
8249 |
-
module.exports = __webpack_require__(612);
|
8250 |
-
}, /* 12 */
|
8251 |
-
/***/
|
8252 |
-
function(module, exports, __webpack_require__) {
|
8253 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
8254 |
-
// load the styles
|
8255 |
-
var content = __webpack_require__(13);
|
8256 |
-
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
8257 |
-
// Prepare cssTransformation
|
8258 |
-
var options = {
|
8259 |
-
insertAt: "top",
|
8260 |
-
hmr: !0
|
8261 |
-
};
|
8262 |
-
options.transform = void 0;
|
8263 |
-
// add the styles to the DOM
|
8264 |
-
__webpack_require__(4)(content, options);
|
8265 |
-
content.locals && (module.exports = content.locals);
|
8266 |
-
}, /* 13 */
|
8267 |
-
/***/
|
8268 |
-
function(module, exports, __webpack_require__) {
|
8269 |
-
exports = module.exports = __webpack_require__(3)(!1), // imports
|
8270 |
-
// module
|
8271 |
-
exports.push([ module.i, "/* Collection default theme */\n\n._2Ys25aFCIH7ZWp76lcHbjs {\n}\n\n._1wpSOFYFr7x9PMM0KcYTxm {\n}\n\n/* Grid default theme */\n\n._2SUC15-WVgF4XhvHuU81GS {\n}\n\n._3q1PBGJ8fGciELoHlm7I3C {\n}\n\n/* Table default theme */\n\n._1yPBpbwEbdtD7UxLvhZhM {\n}\n\n._1itUjAnMCYR-25x1rmTdtF {\n}\n\n._33g8s-zht4xwLlXSWWWwa3 {\n font-weight: 700;\n text-transform: uppercase;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-orient: horizontal;\n -webkit-box-direction: normal;\n -ms-flex-direction: row;\n flex-direction: row;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n._3ZiV_g6aRjm62hwIWbJU38 {\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-orient: horizontal;\n -webkit-box-direction: normal;\n -ms-flex-direction: row;\n flex-direction: row;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n\n._3eKreK7WxwxtZyKjYLiygd {\n display: inline-block;\n max-width: 100%;\n white-space: nowrap;\n text-overflow: ellipsis;\n overflow: hidden;\n}\n\n._19Z4wAfIa_DTwtOUYjz8t,\n._2TseG-JCD0K5o_VT5VIN_w {\n margin-right: 10px;\n min-width: 0px;\n}\n._2TseG-JCD0K5o_VT5VIN_w {\n text-overflow: ellipsis;\n white-space: nowrap;\n}\n\n._19Z4wAfIa_DTwtOUYjz8t:first-of-type,\n._2TseG-JCD0K5o_VT5VIN_w:first-of-type {\n margin-left: 10px;\n}\n._1RR8EsDxozD7xvl8boaBiB {\n cursor: pointer;\n}\n\n._1u1DZQe3YaUugu3cLrtqng {\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n._15mdGqvC02VcdkTaoIuS06 {\n -webkit-box-flex: 0;\n -ms-flex: 0 0 24px;\n flex: 0 0 24px;\n height: 1em;\n width: 1em;\n fill: currentColor;\n}\n\n/* List default theme */\n\n._3HeSXQaspPzpYJlLHQlyit {\n}", "" ]),
|
8272 |
-
// exports
|
8273 |
-
exports.locals = {
|
8274 |
-
ReactVirtualized__Collection: "_2Ys25aFCIH7ZWp76lcHbjs",
|
8275 |
-
ReactVirtualized__Collection__innerScrollContainer: "_1wpSOFYFr7x9PMM0KcYTxm",
|
8276 |
-
ReactVirtualized__Grid: "_2SUC15-WVgF4XhvHuU81GS",
|
8277 |
-
ReactVirtualized__Grid__innerScrollContainer: "_3q1PBGJ8fGciELoHlm7I3C",
|
8278 |
-
ReactVirtualized__Table: "_1yPBpbwEbdtD7UxLvhZhM",
|
8279 |
-
ReactVirtualized__Table__Grid: "_1itUjAnMCYR-25x1rmTdtF",
|
8280 |
-
ReactVirtualized__Table__headerRow: "_33g8s-zht4xwLlXSWWWwa3",
|
8281 |
-
ReactVirtualized__Table__row: "_3ZiV_g6aRjm62hwIWbJU38",
|
8282 |
-
ReactVirtualized__Table__headerTruncatedText: "_3eKreK7WxwxtZyKjYLiygd",
|
8283 |
-
ReactVirtualized__Table__headerColumn: "_19Z4wAfIa_DTwtOUYjz8t",
|
8284 |
-
ReactVirtualized__Table__rowColumn: "_2TseG-JCD0K5o_VT5VIN_w",
|
8285 |
-
ReactVirtualized__Table__sortableHeaderColumn: "_1RR8EsDxozD7xvl8boaBiB",
|
8286 |
-
ReactVirtualized__Table__sortableHeaderIconContainer: "_1u1DZQe3YaUugu3cLrtqng",
|
8287 |
-
ReactVirtualized__Table__sortableHeaderIcon: "_15mdGqvC02VcdkTaoIuS06",
|
8288 |
-
ReactVirtualized__List: "_3HeSXQaspPzpYJlLHQlyit"
|
8289 |
-
};
|
8290 |
-
}, /* 14 */
|
8291 |
-
/***/
|
8292 |
-
function(module, exports) {
|
8293 |
-
/**
|
8294 |
-
* When source maps are enabled, `style-loader` uses a link element with a data-uri to
|
8295 |
-
* embed the css on the page. This breaks all relative urls because now they are relative to a
|
8296 |
-
* bundle instead of the current page.
|
8297 |
-
*
|
8298 |
-
* One solution is to only use full urls, but that may be impossible.
|
8299 |
-
*
|
8300 |
-
* Instead, this function "fixes" the relative urls to be absolute according to the current page location.
|
8301 |
-
*
|
8302 |
-
* A rudimentary test suite is located at `test/fixUrls.js` and can be run via the `npm test` command.
|
8303 |
-
*
|
8304 |
-
*/
|
8305 |
-
module.exports = function(css) {
|
8306 |
-
// get current location
|
8307 |
-
var location = "undefined" != typeof window && window.location;
|
8308 |
-
if (!location) throw new Error("fixUrls requires window.location");
|
8309 |
-
// blank or null?
|
8310 |
-
if (!css || "string" != typeof css) return css;
|
8311 |
-
var baseUrl = location.protocol + "//" + location.host, currentDir = baseUrl + location.pathname.replace(/\/[^\/]*$/, "/");
|
8312 |
-
// send back the fixed css
|
8313 |
-
return css.replace(/url\s*\(((?:[^)(]|\((?:[^)(]+|\([^)(]*\))*\))*)\)/gi, function(fullMatch, origUrl) {
|
8314 |
-
// strip quotes (if they exist)
|
8315 |
-
var unquotedOrigUrl = origUrl.trim().replace(/^"(.*)"$/, function(o, $1) {
|
8316 |
-
return $1;
|
8317 |
-
}).replace(/^'(.*)'$/, function(o, $1) {
|
8318 |
-
return $1;
|
8319 |
-
});
|
8320 |
-
// already a full url? no change
|
8321 |
-
if (/^(#|data:|http:\/\/|https:\/\/|file:\/\/\/)/i.test(unquotedOrigUrl)) return fullMatch;
|
8322 |
-
// convert the url to a full url
|
8323 |
-
var newUrl;
|
8324 |
-
// send back the fixed url(...)
|
8325 |
-
//TODO: should we add protocol?
|
8326 |
-
return newUrl = 0 === unquotedOrigUrl.indexOf("//") ? unquotedOrigUrl : 0 === unquotedOrigUrl.indexOf("/") ? baseUrl + unquotedOrigUrl : currentDir + unquotedOrigUrl.replace(/^\.\//, ""),
|
8327 |
-
"url(" + JSON.stringify(newUrl) + ")";
|
8328 |
-
});
|
8329 |
-
};
|
8330 |
-
}, /* 15 */
|
8331 |
-
/***/
|
8332 |
-
function(module, exports, __webpack_require__) {
|
8333 |
-
"use strict";
|
8334 |
-
function _interopRequireDefault(obj) {
|
8335 |
-
return obj && obj.__esModule ? obj : {
|
8336 |
-
default: obj
|
8337 |
-
};
|
8338 |
-
}
|
8339 |
-
function _objectWithoutProperties(obj, keys) {
|
8340 |
-
var target = {};
|
8341 |
-
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
8342 |
-
return target;
|
8343 |
-
}
|
8344 |
-
function _classCallCheck(instance, Constructor) {
|
8345 |
-
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
8346 |
-
}
|
8347 |
-
function _possibleConstructorReturn(self, call) {
|
8348 |
-
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
8349 |
-
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
8350 |
-
}
|
8351 |
-
function _inherits(subClass, superClass) {
|
8352 |
-
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
8353 |
-
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
8354 |
-
constructor: {
|
8355 |
-
value: subClass,
|
8356 |
-
enumerable: !1,
|
8357 |
-
writable: !0,
|
8358 |
-
configurable: !0
|
8359 |
-
}
|
8360 |
-
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
8361 |
-
}
|
8362 |
-
Object.defineProperty(exports, "__esModule", {
|
8363 |
-
value: !0
|
8364 |
-
});
|
8365 |
-
var _extends = Object.assign || function(target) {
|
8366 |
-
for (var i = 1; i < arguments.length; i++) {
|
8367 |
-
var source = arguments[i];
|
8368 |
-
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
8369 |
-
}
|
8370 |
-
return target;
|
8371 |
-
}, _createClass = function() {
|
8372 |
-
function defineProperties(target, props) {
|
8373 |
-
for (var i = 0; i < props.length; i++) {
|
8374 |
-
var descriptor = props[i];
|
8375 |
-
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
8376 |
-
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
8377 |
-
}
|
8378 |
-
}
|
8379 |
-
return function(Constructor, protoProps, staticProps) {
|
8380 |
-
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
8381 |
-
Constructor;
|
8382 |
-
};
|
8383 |
-
}(), _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _treeNode = __webpack_require__(16), _treeNode2 = _interopRequireDefault(_treeNode), TreeNode = function(_Component) {
|
8384 |
-
function TreeNode() {
|
8385 |
-
return _classCallCheck(this, TreeNode), _possibleConstructorReturn(this, (TreeNode.__proto__ || Object.getPrototypeOf(TreeNode)).apply(this, arguments));
|
8386 |
-
}
|
8387 |
-
return _inherits(TreeNode, _Component), _createClass(TreeNode, [ {
|
8388 |
-
key: "render",
|
8389 |
-
value: function() {
|
8390 |
-
var _props = this.props, children = _props.children, listIndex = _props.listIndex, swapFrom = _props.swapFrom, swapLength = _props.swapLength, swapDepth = _props.swapDepth, scaffoldBlockPxWidth = _props.scaffoldBlockPxWidth, lowerSiblingCounts = _props.lowerSiblingCounts, connectDropTarget = _props.connectDropTarget, isOver = _props.isOver, draggedNode = _props.draggedNode, canDrop = _props.canDrop, treeIndex = _props.treeIndex, otherProps = (_props.treeId,
|
8391 |
-
_props.getPrevRow, _props.node, _props.path, _objectWithoutProperties(_props, [ "children", "listIndex", "swapFrom", "swapLength", "swapDepth", "scaffoldBlockPxWidth", "lowerSiblingCounts", "connectDropTarget", "isOver", "draggedNode", "canDrop", "treeIndex", "treeId", "getPrevRow", "node", "path" ])), scaffoldBlockCount = lowerSiblingCounts.length, scaffold = [];
|
8392 |
-
return lowerSiblingCounts.forEach(function(lowerSiblingCount, i) {
|
8393 |
-
var lineClass = "";
|
8394 |
-
if (lowerSiblingCount > 0 ? // At this level in the tree, the nodes had sibling nodes further down
|
8395 |
-
// Top-left corner of the tree
|
8396 |
-
// +-----+
|
8397 |
-
// | |
|
8398 |
-
// | +--+
|
8399 |
-
// | | |
|
8400 |
-
// +--+--+
|
8401 |
-
lineClass = 0 === listIndex ? _treeNode2.default.lineHalfHorizontalRight + " " + _treeNode2.default.lineHalfVerticalBottom : i === scaffoldBlockCount - 1 ? _treeNode2.default.lineHalfHorizontalRight + " " + _treeNode2.default.lineFullVertical : _treeNode2.default.lineFullVertical : 0 === listIndex ? // Top-left corner of the tree, but has no siblings
|
8402 |
-
// +-----+
|
8403 |
-
// | |
|
8404 |
-
// | +--+
|
8405 |
-
// | |
|
8406 |
-
// +-----+
|
8407 |
-
lineClass = _treeNode2.default.lineHalfHorizontalRight : i === scaffoldBlockCount - 1 && (// The last or only node in this level of the tree
|
8408 |
-
// +--+--+
|
8409 |
-
// | | |
|
8410 |
-
// | +--+
|
8411 |
-
// | |
|
8412 |
-
// +-----+
|
8413 |
-
lineClass = _treeNode2.default.lineHalfVerticalTop + " " + _treeNode2.default.lineHalfHorizontalRight),
|
8414 |
-
scaffold.push(_react2.default.createElement("div", {
|
8415 |
-
key: "pre_" + (1 + i),
|
8416 |
-
style: {
|
8417 |
-
width: scaffoldBlockPxWidth
|
8418 |
-
},
|
8419 |
-
className: _treeNode2.default.lineBlock + " " + lineClass
|
8420 |
-
})), treeIndex !== listIndex && i === swapDepth) {
|
8421 |
-
// This row has been shifted, and is at the depth of
|
8422 |
-
// the line pointing to the new destination
|
8423 |
-
var highlightLineClass = "";
|
8424 |
-
// This block is on the bottom (target) line
|
8425 |
-
// This block points at the target block (where the row will go when released)
|
8426 |
-
highlightLineClass = listIndex === swapFrom + swapLength - 1 ? _treeNode2.default.highlightBottomLeftCorner : treeIndex === swapFrom ? _treeNode2.default.highlightTopLeftCorner : _treeNode2.default.highlightLineVertical,
|
8427 |
-
scaffold.push(_react2.default.createElement("div", {
|
8428 |
-
// eslint-disable-next-line react/no-array-index-key
|
8429 |
-
key: i,
|
8430 |
-
style: {
|
8431 |
-
width: scaffoldBlockPxWidth,
|
8432 |
-
left: scaffoldBlockPxWidth * i
|
8433 |
-
},
|
8434 |
-
className: _treeNode2.default.absoluteLineBlock + " " + highlightLineClass
|
8435 |
-
}));
|
8436 |
-
}
|
8437 |
-
}), connectDropTarget(_react2.default.createElement("div", _extends({}, otherProps, {
|
8438 |
-
className: _treeNode2.default.node
|
8439 |
-
}), scaffold, _react2.default.createElement("div", {
|
8440 |
-
className: _treeNode2.default.nodeContent,
|
8441 |
-
style: {
|
8442 |
-
left: scaffoldBlockPxWidth * scaffoldBlockCount
|
8443 |
-
}
|
8444 |
-
}, _react.Children.map(children, function(child) {
|
8445 |
-
return (0, _react.cloneElement)(child, {
|
8446 |
-
isOver: isOver,
|
8447 |
-
canDrop: canDrop,
|
8448 |
-
draggedNode: draggedNode
|
8449 |
-
});
|
8450 |
-
}))));
|
8451 |
-
}
|
8452 |
-
} ]), TreeNode;
|
8453 |
-
}(_react.Component);
|
8454 |
-
TreeNode.defaultProps = {
|
8455 |
-
swapFrom: null,
|
8456 |
-
swapDepth: null,
|
8457 |
-
swapLength: null,
|
8458 |
-
canDrop: !1,
|
8459 |
-
draggedNode: null
|
8460 |
-
}, TreeNode.propTypes = {
|
8461 |
-
treeIndex: _propTypes2.default.number.isRequired,
|
8462 |
-
treeId: _propTypes2.default.string.isRequired,
|
8463 |
-
swapFrom: _propTypes2.default.number,
|
8464 |
-
swapDepth: _propTypes2.default.number,
|
8465 |
-
swapLength: _propTypes2.default.number,
|
8466 |
-
scaffoldBlockPxWidth: _propTypes2.default.number.isRequired,
|
8467 |
-
lowerSiblingCounts: _propTypes2.default.arrayOf(_propTypes2.default.number).isRequired,
|
8468 |
-
listIndex: _propTypes2.default.number.isRequired,
|
8469 |
-
children: _propTypes2.default.node.isRequired,
|
8470 |
-
// Drop target
|
8471 |
-
connectDropTarget: _propTypes2.default.func.isRequired,
|
8472 |
-
isOver: _propTypes2.default.bool.isRequired,
|
8473 |
-
canDrop: _propTypes2.default.bool,
|
8474 |
-
draggedNode: _propTypes2.default.shape({}),
|
8475 |
-
// used in dndManager
|
8476 |
-
getPrevRow: _propTypes2.default.func.isRequired,
|
8477 |
-
node: _propTypes2.default.shape({}).isRequired,
|
8478 |
-
path: _propTypes2.default.arrayOf(_propTypes2.default.oneOfType([ _propTypes2.default.string, _propTypes2.default.number ])).isRequired
|
8479 |
-
}, exports.default = TreeNode;
|
8480 |
-
}, /* 16 */
|
8481 |
-
/***/
|
8482 |
-
function(module, exports, __webpack_require__) {
|
8483 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
8484 |
-
// load the styles
|
8485 |
-
var content = __webpack_require__(17);
|
8486 |
-
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
8487 |
-
// Prepare cssTransformation
|
8488 |
-
var options = {
|
8489 |
-
insertAt: "top",
|
8490 |
-
hmr: !0
|
8491 |
-
};
|
8492 |
-
options.transform = void 0;
|
8493 |
-
// add the styles to the DOM
|
8494 |
-
__webpack_require__(4)(content, options);
|
8495 |
-
content.locals && (module.exports = content.locals);
|
8496 |
-
}, /* 17 */
|
8497 |
-
/***/
|
8498 |
-
function(module, exports, __webpack_require__) {
|
8499 |
-
exports = module.exports = __webpack_require__(3)(!1), // imports
|
8500 |
-
// module
|
8501 |
-
exports.push([ module.i, ".rst__node {\n min-width: 100%;\n white-space: nowrap;\n position: relative;\n text-align: left; }\n\n.rst__nodeContent {\n position: absolute;\n top: 0;\n bottom: 0; }\n\n/* ==========================================================================\n Scaffold\n\n Line-overlaid blocks used for showing the tree structure\n ========================================================================== */\n.rst__lineBlock, .rst__absoluteLineBlock {\n height: 100%;\n position: relative;\n display: inline-block; }\n\n.rst__absoluteLineBlock {\n position: absolute;\n top: 0; }\n\n.rst__lineHalfHorizontalRight::before, .rst__lineFullVertical::after, .rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n position: absolute;\n content: '';\n background-color: black; }\n\n/**\n * +-----+\n * | |\n * | +--+\n * | |\n * +-----+\n */\n.rst__lineHalfHorizontalRight::before {\n height: 1px;\n top: 50%;\n right: 0;\n width: 50%; }\n\n/**\n * +--+--+\n * | | |\n * | | |\n * | | |\n * +--+--+\n */\n.rst__lineFullVertical::after, .rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n width: 1px;\n left: 50%;\n top: 0;\n height: 100%; }\n\n/**\n * +-----+\n * | | |\n * | + |\n * | |\n * +-----+\n */\n.rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n top: 0;\n height: 50%; }\n\n/**\n * +-----+\n * | |\n * | + |\n * | | |\n * +-----+\n */\n.rst__lineHalfVerticalBottom::after {\n top: auto;\n bottom: 0; }\n\n/* Highlight line for pointing to dragged row destination\n ========================================================================== */\n/**\n * +--+--+\n * | | |\n * | | |\n * | | |\n * +--+--+\n */\n.rst__highlightLineVertical {\n z-index: 3; }\n .rst__highlightLineVertical::before {\n position: absolute;\n content: '';\n background-color: #36c2f6;\n width: 8px;\n margin-left: -4px;\n left: 50%;\n top: 0;\n height: 100%; }\n\n@-webkit-keyframes rst__arrow-pulse {\n 0% {\n -webkit-transform: translate(0, 0);\n transform: translate(0, 0);\n opacity: 0; }\n 30% {\n -webkit-transform: translate(0, 300%);\n transform: translate(0, 300%);\n opacity: 1; }\n 70% {\n -webkit-transform: translate(0, 700%);\n transform: translate(0, 700%);\n opacity: 1; }\n 100% {\n -webkit-transform: translate(0, 1000%);\n transform: translate(0, 1000%);\n opacity: 0; } }\n\n@keyframes rst__arrow-pulse {\n 0% {\n -webkit-transform: translate(0, 0);\n transform: translate(0, 0);\n opacity: 0; }\n 30% {\n -webkit-transform: translate(0, 300%);\n transform: translate(0, 300%);\n opacity: 1; }\n 70% {\n -webkit-transform: translate(0, 700%);\n transform: translate(0, 700%);\n opacity: 1; }\n 100% {\n -webkit-transform: translate(0, 1000%);\n transform: translate(0, 1000%);\n opacity: 0; } }\n .rst__highlightLineVertical::after {\n content: '';\n position: absolute;\n height: 0;\n margin-left: -4px;\n left: 50%;\n top: 0;\n border-left: 4px solid transparent;\n border-right: 4px solid transparent;\n border-top: 4px solid white;\n -webkit-animation: rst__arrow-pulse 1s infinite linear both;\n animation: rst__arrow-pulse 1s infinite linear both; }\n\n/**\n * +-----+\n * | |\n * | +--+\n * | | |\n * +--+--+\n */\n.rst__highlightTopLeftCorner::before {\n z-index: 3;\n content: '';\n position: absolute;\n border-top: solid 8px #36c2f6;\n border-left: solid 8px #36c2f6;\n -webkit-box-sizing: border-box;\n box-sizing: border-box;\n height: calc(50% + 4px);\n top: 50%;\n margin-top: -4px;\n right: 0;\n width: calc(50% + 4px); }\n\n/**\n * +--+--+\n * | | |\n * | | |\n * | +->|\n * +-----+\n */\n.rst__highlightBottomLeftCorner {\n z-index: 3; }\n .rst__highlightBottomLeftCorner::before {\n content: '';\n position: absolute;\n border-bottom: solid 8px #36c2f6;\n border-left: solid 8px #36c2f6;\n -webkit-box-sizing: border-box;\n box-sizing: border-box;\n height: calc(100% + 4px);\n top: 0;\n right: 12px;\n width: calc(50% - 8px); }\n .rst__highlightBottomLeftCorner::after {\n content: '';\n position: absolute;\n height: 0;\n right: 0;\n top: 100%;\n margin-top: -12px;\n border-top: 12px solid transparent;\n border-bottom: 12px solid transparent;\n border-left: 12px solid #36c2f6; }\n", "" ]),
|
8502 |
-
// exports
|
8503 |
-
exports.locals = {
|
8504 |
-
node: "rst__node",
|
8505 |
-
nodeContent: "rst__nodeContent",
|
8506 |
-
lineBlock: "rst__lineBlock",
|
8507 |
-
absoluteLineBlock: "rst__absoluteLineBlock",
|
8508 |
-
lineHalfHorizontalRight: "rst__lineHalfHorizontalRight",
|
8509 |
-
lineFullVertical: "rst__lineFullVertical",
|
8510 |
-
lineHalfVerticalTop: "rst__lineHalfVerticalTop",
|
8511 |
-
lineHalfVerticalBottom: "rst__lineHalfVerticalBottom",
|
8512 |
-
highlightLineVertical: "rst__highlightLineVertical",
|
8513 |
-
"arrow-pulse": "rst__arrow-pulse",
|
8514 |
-
highlightTopLeftCorner: "rst__highlightTopLeftCorner",
|
8515 |
-
highlightBottomLeftCorner: "rst__highlightBottomLeftCorner"
|
8516 |
-
};
|
8517 |
-
}, /* 18 */
|
8518 |
-
/***/
|
8519 |
-
function(module, exports, __webpack_require__) {
|
8520 |
-
"use strict";
|
8521 |
-
function _interopRequireDefault(obj) {
|
8522 |
-
return obj && obj.__esModule ? obj : {
|
8523 |
-
default: obj
|
8524 |
-
};
|
8525 |
-
}
|
8526 |
-
function _objectWithoutProperties(obj, keys) {
|
8527 |
-
var target = {};
|
8528 |
-
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
8529 |
-
return target;
|
8530 |
-
}
|
8531 |
-
function _classCallCheck(instance, Constructor) {
|
8532 |
-
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
8533 |
-
}
|
8534 |
-
function _possibleConstructorReturn(self, call) {
|
8535 |
-
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
8536 |
-
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
8537 |
-
}
|
8538 |
-
function _inherits(subClass, superClass) {
|
8539 |
-
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
8540 |
-
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
8541 |
-
constructor: {
|
8542 |
-
value: subClass,
|
8543 |
-
enumerable: !1,
|
8544 |
-
writable: !0,
|
8545 |
-
configurable: !0
|
8546 |
-
}
|
8547 |
-
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
8548 |
-
}
|
8549 |
-
Object.defineProperty(exports, "__esModule", {
|
8550 |
-
value: !0
|
8551 |
-
});
|
8552 |
-
var _createClass = function() {
|
8553 |
-
function defineProperties(target, props) {
|
8554 |
-
for (var i = 0; i < props.length; i++) {
|
8555 |
-
var descriptor = props[i];
|
8556 |
-
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
8557 |
-
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
8558 |
-
}
|
8559 |
-
}
|
8560 |
-
return function(Constructor, protoProps, staticProps) {
|
8561 |
-
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
8562 |
-
Constructor;
|
8563 |
-
};
|
8564 |
-
}(), _extends = Object.assign || function(target) {
|
8565 |
-
for (var i = 1; i < arguments.length; i++) {
|
8566 |
-
var source = arguments[i];
|
8567 |
-
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
8568 |
-
}
|
8569 |
-
return target;
|
8570 |
-
}, _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _browserUtils = __webpack_require__(19), _nodeRendererDefault = __webpack_require__(20), _nodeRendererDefault2 = _interopRequireDefault(_nodeRendererDefault), _treeDataUtils = __webpack_require__(0), styles = _nodeRendererDefault2.default;
|
8571 |
-
// Add extra classes in browsers that don't support flex
|
8572 |
-
_browserUtils.getIEVersion < 10 && (styles = _extends({}, _nodeRendererDefault2.default, {
|
8573 |
-
row: styles.row + " " + styles.row_NoFlex,
|
8574 |
-
rowContents: styles.rowContents + " " + styles.rowContents_NoFlex,
|
8575 |
-
rowLabel: styles.rowLabel + " " + styles.rowLabel_NoFlex,
|
8576 |
-
rowToolbar: styles.rowToolbar + " " + styles.rowToolbar_NoFlex
|
8577 |
-
}));
|
8578 |
-
var NodeRendererDefault = function(_Component) {
|
8579 |
-
function NodeRendererDefault() {
|
8580 |
-
return _classCallCheck(this, NodeRendererDefault), _possibleConstructorReturn(this, (NodeRendererDefault.__proto__ || Object.getPrototypeOf(NodeRendererDefault)).apply(this, arguments));
|
8581 |
-
}
|
8582 |
-
return _inherits(NodeRendererDefault, _Component), _createClass(NodeRendererDefault, [ {
|
8583 |
-
key: "render",
|
8584 |
-
value: function() {
|
8585 |
-
var _props = this.props, scaffoldBlockPxWidth = _props.scaffoldBlockPxWidth, toggleChildrenVisibility = _props.toggleChildrenVisibility, connectDragPreview = _props.connectDragPreview, connectDragSource = _props.connectDragSource, isDragging = _props.isDragging, canDrop = _props.canDrop, canDrag = _props.canDrag, node = _props.node, title = _props.title, subtitle = _props.subtitle, draggedNode = _props.draggedNode, path = _props.path, treeIndex = _props.treeIndex, isSearchMatch = _props.isSearchMatch, isSearchFocus = _props.isSearchFocus, buttons = _props.buttons, className = _props.className, style = _props.style, didDrop = _props.didDrop, otherProps = (_props.treeId,
|
8586 |
-
_props.isOver, _props.parentNode, _objectWithoutProperties(_props, [ "scaffoldBlockPxWidth", "toggleChildrenVisibility", "connectDragPreview", "connectDragSource", "isDragging", "canDrop", "canDrag", "node", "title", "subtitle", "draggedNode", "path", "treeIndex", "isSearchMatch", "isSearchFocus", "buttons", "className", "style", "didDrop", "treeId", "isOver", "parentNode" ])), nodeTitle = title || node.title, nodeSubtitle = subtitle || node.subtitle, handle = void 0;
|
8587 |
-
canDrag && (// Show a loading symbol on the handle when the children are expanded
|
8588 |
-
// and yet still defined by a function (a callback to fetch the children)
|
8589 |
-
handle = "function" == typeof node.children && node.expanded ? _react2.default.createElement("div", {
|
8590 |
-
className: styles.loadingHandle
|
8591 |
-
}, _react2.default.createElement("div", {
|
8592 |
-
className: styles.loadingCircle
|
8593 |
-
}, _react2.default.createElement("div", {
|
8594 |
-
className: styles.loadingCirclePoint
|
8595 |
-
}), _react2.default.createElement("div", {
|
8596 |
-
className: styles.loadingCirclePoint
|
8597 |
-
}), _react2.default.createElement("div", {
|
8598 |
-
className: styles.loadingCirclePoint
|
8599 |
-
}), _react2.default.createElement("div", {
|
8600 |
-
className: styles.loadingCirclePoint
|
8601 |
-
}), _react2.default.createElement("div", {
|
8602 |
-
className: styles.loadingCirclePoint
|
8603 |
-
}), _react2.default.createElement("div", {
|
8604 |
-
className: styles.loadingCirclePoint
|
8605 |
-
}), _react2.default.createElement("div", {
|
8606 |
-
className: styles.loadingCirclePoint
|
8607 |
-
}), _react2.default.createElement("div", {
|
8608 |
-
className: styles.loadingCirclePoint
|
8609 |
-
}), _react2.default.createElement("div", {
|
8610 |
-
className: styles.loadingCirclePoint
|
8611 |
-
}), _react2.default.createElement("div", {
|
8612 |
-
className: styles.loadingCirclePoint
|
8613 |
-
}), _react2.default.createElement("div", {
|
8614 |
-
className: styles.loadingCirclePoint
|
8615 |
-
}), _react2.default.createElement("div", {
|
8616 |
-
className: styles.loadingCirclePoint
|
8617 |
-
}))) : connectDragSource(_react2.default.createElement("div", {
|
8618 |
-
className: styles.moveHandle
|
8619 |
-
}), {
|
8620 |
-
dropEffect: "copy"
|
8621 |
-
}));
|
8622 |
-
var isDraggedDescendant = draggedNode && (0, _treeDataUtils.isDescendant)(draggedNode, node), isLandingPadActive = !didDrop && isDragging;
|
8623 |
-
return _react2.default.createElement("div", _extends({
|
8624 |
-
style: {
|
8625 |
-
height: "100%"
|
8626 |
-
}
|
8627 |
-
}, otherProps), toggleChildrenVisibility && node.children && (node.children.length > 0 || "function" == typeof node.children) && _react2.default.createElement("div", null, _react2.default.createElement("button", {
|
8628 |
-
type: "button",
|
8629 |
-
"aria-label": node.expanded ? "Collapse" : "Expand",
|
8630 |
-
className: node.expanded ? styles.collapseButton : styles.expandButton,
|
8631 |
-
style: {
|
8632 |
-
left: -.5 * scaffoldBlockPxWidth
|
8633 |
-
},
|
8634 |
-
onClick: function() {
|
8635 |
-
return toggleChildrenVisibility({
|
8636 |
-
node: node,
|
8637 |
-
path: path,
|
8638 |
-
treeIndex: treeIndex
|
8639 |
-
});
|
8640 |
-
}
|
8641 |
-
}), node.expanded && !isDragging && _react2.default.createElement("div", {
|
8642 |
-
style: {
|
8643 |
-
width: scaffoldBlockPxWidth
|
8644 |
-
},
|
8645 |
-
className: styles.lineChildren
|
8646 |
-
})), _react2.default.createElement("div", {
|
8647 |
-
className: styles.rowWrapper
|
8648 |
-
}, connectDragPreview(_react2.default.createElement("div", {
|
8649 |
-
className: styles.row + (isLandingPadActive ? " " + styles.rowLandingPad : "") + (isLandingPadActive && !canDrop ? " " + styles.rowCancelPad : "") + (isSearchMatch ? " " + styles.rowSearchMatch : "") + (isSearchFocus ? " " + styles.rowSearchFocus : "") + (className ? " " + className : ""),
|
8650 |
-
style: _extends({
|
8651 |
-
opacity: isDraggedDescendant ? .5 : 1
|
8652 |
-
}, style)
|
8653 |
-
}, handle, _react2.default.createElement("div", {
|
8654 |
-
className: styles.rowContents + (canDrag ? "" : " " + styles.rowContentsDragDisabled)
|
8655 |
-
}, _react2.default.createElement("div", {
|
8656 |
-
className: styles.rowLabel
|
8657 |
-
}, _react2.default.createElement("span", {
|
8658 |
-
className: styles.rowTitle + (node.subtitle ? " " + styles.rowTitleWithSubtitle : "")
|
8659 |
-
}, "function" == typeof nodeTitle ? nodeTitle({
|
8660 |
-
node: node,
|
8661 |
-
path: path,
|
8662 |
-
treeIndex: treeIndex
|
8663 |
-
}) : nodeTitle), nodeSubtitle && _react2.default.createElement("span", {
|
8664 |
-
className: styles.rowSubtitle
|
8665 |
-
}, "function" == typeof nodeSubtitle ? nodeSubtitle({
|
8666 |
-
node: node,
|
8667 |
-
path: path,
|
8668 |
-
treeIndex: treeIndex
|
8669 |
-
}) : nodeSubtitle)), _react2.default.createElement("div", {
|
8670 |
-
className: styles.rowToolbar
|
8671 |
-
}, buttons.map(function(btn, index) {
|
8672 |
-
return _react2.default.createElement("div", {
|
8673 |
-
key: index,
|
8674 |
-
className: styles.toolbarButton
|
8675 |
-
}, btn);
|
8676 |
-
})))))));
|
8677 |
-
}
|
8678 |
-
} ]), NodeRendererDefault;
|
8679 |
-
}(_react.Component);
|
8680 |
-
NodeRendererDefault.defaultProps = {
|
8681 |
-
isSearchMatch: !1,
|
8682 |
-
isSearchFocus: !1,
|
8683 |
-
canDrag: !1,
|
8684 |
-
toggleChildrenVisibility: null,
|
8685 |
-
buttons: [],
|
8686 |
-
className: "",
|
8687 |
-
style: {},
|
8688 |
-
parentNode: null,
|
8689 |
-
draggedNode: null,
|
8690 |
-
canDrop: !1,
|
8691 |
-
title: null,
|
8692 |
-
subtitle: null
|
8693 |
-
}, NodeRendererDefault.propTypes = {
|
8694 |
-
node: _propTypes2.default.shape({}).isRequired,
|
8695 |
-
title: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.node ]),
|
8696 |
-
subtitle: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.node ]),
|
8697 |
-
path: _propTypes2.default.arrayOf(_propTypes2.default.oneOfType([ _propTypes2.default.string, _propTypes2.default.number ])).isRequired,
|
8698 |
-
treeIndex: _propTypes2.default.number.isRequired,
|
8699 |
-
treeId: _propTypes2.default.string.isRequired,
|
8700 |
-
isSearchMatch: _propTypes2.default.bool,
|
8701 |
-
isSearchFocus: _propTypes2.default.bool,
|
8702 |
-
canDrag: _propTypes2.default.bool,
|
8703 |
-
scaffoldBlockPxWidth: _propTypes2.default.number.isRequired,
|
8704 |
-
toggleChildrenVisibility: _propTypes2.default.func,
|
8705 |
-
buttons: _propTypes2.default.arrayOf(_propTypes2.default.node),
|
8706 |
-
className: _propTypes2.default.string,
|
8707 |
-
style: _propTypes2.default.shape({}),
|
8708 |
-
// Drag and drop API functions
|
8709 |
-
// Drag source
|
8710 |
-
connectDragPreview: _propTypes2.default.func.isRequired,
|
8711 |
-
connectDragSource: _propTypes2.default.func.isRequired,
|
8712 |
-
parentNode: _propTypes2.default.shape({}),
|
8713 |
-
// Needed for dndManager
|
8714 |
-
isDragging: _propTypes2.default.bool.isRequired,
|
8715 |
-
didDrop: _propTypes2.default.bool.isRequired,
|
8716 |
-
draggedNode: _propTypes2.default.shape({}),
|
8717 |
-
// Drop target
|
8718 |
-
isOver: _propTypes2.default.bool.isRequired,
|
8719 |
-
canDrop: _propTypes2.default.bool
|
8720 |
-
}, exports.default = NodeRendererDefault;
|
8721 |
-
}, /* 19 */
|
8722 |
-
/***/
|
8723 |
-
function(module, exports, __webpack_require__) {
|
8724 |
-
"use strict";
|
8725 |
-
/* eslint-disable import/prefer-default-export */
|
8726 |
-
/**
|
8727 |
-
* Get the version of Internet Explorer in use, or undefined
|
8728 |
-
*
|
8729 |
-
* @return {?number} ieVersion - IE version as an integer, or undefined if not IE
|
8730 |
-
*/
|
8731 |
-
function getIEVersion() {
|
8732 |
-
var match = navigator.userAgent.match(/(?:MSIE |Trident\/.*; rv:)(\d+)/);
|
8733 |
-
return match ? parseInt(match[1], 10) : void 0;
|
8734 |
-
}
|
8735 |
-
Object.defineProperty(exports, "__esModule", {
|
8736 |
-
value: !0
|
8737 |
-
}), exports.getIEVersion = getIEVersion;
|
8738 |
-
}, /* 20 */
|
8739 |
-
/***/
|
8740 |
-
function(module, exports, __webpack_require__) {
|
8741 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
8742 |
-
// load the styles
|
8743 |
-
var content = __webpack_require__(21);
|
8744 |
-
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
8745 |
-
// Prepare cssTransformation
|
8746 |
-
var options = {
|
8747 |
-
insertAt: "top",
|
8748 |
-
hmr: !0
|
8749 |
-
};
|
8750 |
-
options.transform = void 0;
|
8751 |
-
// add the styles to the DOM
|
8752 |
-
__webpack_require__(4)(content, options);
|
8753 |
-
content.locals && (module.exports = content.locals);
|
8754 |
-
}, /* 21 */
|
8755 |
-
/***/
|
8756 |
-
function(module, exports, __webpack_require__) {
|
8757 |
-
exports = module.exports = __webpack_require__(3)(!1), // imports
|
8758 |
-
// module
|
8759 |
-
exports.push([ module.i, ".rst__rowWrapper {\n padding: 10px 10px 10px 0;\n height: 100%;\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n.rst__row {\n height: 100%;\n white-space: nowrap;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex; }\n .rst__row > * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n/**\n * The outline of where the element will go if dropped, displayed while dragging\n */\n.rst__rowLandingPad, .rst__rowCancelPad {\n border: none !important;\n -webkit-box-shadow: none !important;\n box-shadow: none !important;\n outline: none !important; }\n .rst__rowLandingPad > *, .rst__rowCancelPad > * {\n opacity: 0 !important; }\n .rst__rowLandingPad::before, .rst__rowCancelPad::before {\n background-color: lightblue;\n border: 3px dashed white;\n content: '';\n position: absolute;\n top: 0;\n right: 0;\n bottom: 0;\n left: 0;\n z-index: -1; }\n\n/**\n * Alternate appearance of the landing pad when the dragged location is invalid\n */\n.rst__rowCancelPad::before {\n background-color: #e6a8ad; }\n\n/**\n * Nodes matching the search conditions are highlighted\n */\n.rst__rowSearchMatch {\n outline: solid 3px #0080ff; }\n\n/**\n * The node that matches the search conditions and is currently focused\n */\n.rst__rowSearchFocus {\n outline: solid 3px #fc6421; }\n\n.rst__rowContents, .rst__rowLabel, .rst__rowToolbar, .rst__moveHandle, .rst__loadingHandle, .rst__toolbarButton, .rst__rowLabel_NoFlex, .rst__rowToolbar_NoFlex {\n display: inline-block;\n vertical-align: middle; }\n\n.rst__rowContents {\n position: relative;\n height: 100%;\n border: solid #bbb 1px;\n border-left: none;\n -webkit-box-shadow: 0 2px 2px -2px;\n box-shadow: 0 2px 2px -2px;\n padding: 0 5px 0 10px;\n border-radius: 2px;\n min-width: 230px;\n -webkit-box-flex: 1;\n -ms-flex: 1 0 auto;\n flex: 1 0 auto;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n -webkit-box-pack: justify;\n -ms-flex-pack: justify;\n justify-content: space-between;\n background-color: white; }\n\n.rst__rowContentsDragDisabled {\n border-left: solid #bbb 1px; }\n\n.rst__rowLabel {\n -webkit-box-flex: 0;\n -ms-flex: 0 1 auto;\n flex: 0 1 auto;\n padding-right: 20px; }\n\n.rst__rowToolbar {\n -webkit-box-flex: 0;\n -ms-flex: 0 1 auto;\n flex: 0 1 auto;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex; }\n\n.rst__moveHandle, .rst__loadingHandle {\n height: 100%;\n width: 44px;\n background: #d9d9d9 url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI0MiIgaGVpZ2h0PSI0MiI+PGcgc3Ryb2tlPSIjRkZGIiBzdHJva2Utd2lkdGg9IjIuOSIgPjxwYXRoIGQ9Ik0xNCAxNS43aDE0LjQiLz48cGF0aCBkPSJNMTQgMjEuNGgxNC40Ii8+PHBhdGggZD0iTTE0IDI3LjFoMTQuNCIvPjwvZz4KPC9zdmc+\") no-repeat center;\n border: solid #aaa 1px;\n -webkit-box-shadow: 0 2px 2px -2px;\n box-shadow: 0 2px 2px -2px;\n cursor: move;\n border-radius: 1px;\n z-index: 1; }\n\n.rst__loadingHandle {\n cursor: default;\n background: #d9d9d9; }\n\n@-webkit-keyframes rst__pointFade {\n 0%,\n 19.999%,\n 100% {\n opacity: 0; }\n 20% {\n opacity: 1; } }\n\n@keyframes rst__pointFade {\n 0%,\n 19.999%,\n 100% {\n opacity: 0; }\n 20% {\n opacity: 1; } }\n\n.rst__loadingCircle {\n width: 80%;\n height: 80%;\n margin: 10%;\n position: relative; }\n\n.rst__loadingCirclePoint {\n width: 100%;\n height: 100%;\n position: absolute;\n left: 0;\n top: 0; }\n .rst__loadingCirclePoint:before {\n content: '';\n display: block;\n margin: 0 auto;\n width: 11%;\n height: 30%;\n background-color: #fff;\n border-radius: 30%;\n -webkit-animation: rst__pointFade 800ms infinite ease-in-out both;\n animation: rst__pointFade 800ms infinite ease-in-out both; }\n .rst__loadingCirclePoint:nth-of-type(1) {\n -webkit-transform: rotate(0deg);\n -ms-transform: rotate(0deg);\n transform: rotate(0deg); }\n .rst__loadingCirclePoint:nth-of-type(7) {\n -webkit-transform: rotate(180deg);\n -ms-transform: rotate(180deg);\n transform: rotate(180deg); }\n .rst__loadingCirclePoint:nth-of-type(1):before, .rst__loadingCirclePoint:nth-of-type(7):before {\n -webkit-animation-delay: -800ms;\n animation-delay: -800ms; }\n .rst__loadingCirclePoint:nth-of-type(2) {\n -webkit-transform: rotate(30deg);\n -ms-transform: rotate(30deg);\n transform: rotate(30deg); }\n .rst__loadingCirclePoint:nth-of-type(8) {\n -webkit-transform: rotate(210deg);\n -ms-transform: rotate(210deg);\n transform: rotate(210deg); }\n .rst__loadingCirclePoint:nth-of-type(2):before, .rst__loadingCirclePoint:nth-of-type(8):before {\n -webkit-animation-delay: -666.66667ms;\n animation-delay: -666.66667ms; }\n .rst__loadingCirclePoint:nth-of-type(3) {\n -webkit-transform: rotate(60deg);\n -ms-transform: rotate(60deg);\n transform: rotate(60deg); }\n .rst__loadingCirclePoint:nth-of-type(9) {\n -webkit-transform: rotate(240deg);\n -ms-transform: rotate(240deg);\n transform: rotate(240deg); }\n .rst__loadingCirclePoint:nth-of-type(3):before, .rst__loadingCirclePoint:nth-of-type(9):before {\n -webkit-animation-delay: -533.33333ms;\n animation-delay: -533.33333ms; }\n .rst__loadingCirclePoint:nth-of-type(4) {\n -webkit-transform: rotate(90deg);\n -ms-transform: rotate(90deg);\n transform: rotate(90deg); }\n .rst__loadingCirclePoint:nth-of-type(10) {\n -webkit-transform: rotate(270deg);\n -ms-transform: rotate(270deg);\n transform: rotate(270deg); }\n .rst__loadingCirclePoint:nth-of-type(4):before, .rst__loadingCirclePoint:nth-of-type(10):before {\n -webkit-animation-delay: -400ms;\n animation-delay: -400ms; }\n .rst__loadingCirclePoint:nth-of-type(5) {\n -webkit-transform: rotate(120deg);\n -ms-transform: rotate(120deg);\n transform: rotate(120deg); }\n .rst__loadingCirclePoint:nth-of-type(11) {\n -webkit-transform: rotate(300deg);\n -ms-transform: rotate(300deg);\n transform: rotate(300deg); }\n .rst__loadingCirclePoint:nth-of-type(5):before, .rst__loadingCirclePoint:nth-of-type(11):before {\n -webkit-animation-delay: -266.66667ms;\n animation-delay: -266.66667ms; }\n .rst__loadingCirclePoint:nth-of-type(6) {\n -webkit-transform: rotate(150deg);\n -ms-transform: rotate(150deg);\n transform: rotate(150deg); }\n .rst__loadingCirclePoint:nth-of-type(12) {\n -webkit-transform: rotate(330deg);\n -ms-transform: rotate(330deg);\n transform: rotate(330deg); }\n .rst__loadingCirclePoint:nth-of-type(6):before, .rst__loadingCirclePoint:nth-of-type(12):before {\n -webkit-animation-delay: -133.33333ms;\n animation-delay: -133.33333ms; }\n .rst__loadingCirclePoint:nth-of-type(7) {\n -webkit-transform: rotate(180deg);\n -ms-transform: rotate(180deg);\n transform: rotate(180deg); }\n .rst__loadingCirclePoint:nth-of-type(13) {\n -webkit-transform: rotate(360deg);\n -ms-transform: rotate(360deg);\n transform: rotate(360deg); }\n .rst__loadingCirclePoint:nth-of-type(7):before, .rst__loadingCirclePoint:nth-of-type(13):before {\n -webkit-animation-delay: 0ms;\n animation-delay: 0ms; }\n\n.rst__rowTitle {\n font-weight: bold; }\n\n.rst__rowTitleWithSubtitle {\n font-size: 85%;\n display: block;\n height: 0.8rem; }\n\n.rst__rowSubtitle {\n font-size: 70%;\n line-height: 1; }\n\n.rst__collapseButton,\n.rst__expandButton {\n -webkit-appearance: none;\n -moz-appearance: none;\n appearance: none;\n border: none;\n position: absolute;\n border-radius: 100%;\n -webkit-box-shadow: 0 0 0 1px #000;\n box-shadow: 0 0 0 1px #000;\n width: 16px;\n height: 16px;\n padding: 0;\n top: 50%;\n -webkit-transform: translate(-50%, -50%);\n -ms-transform: translate(-50%, -50%);\n transform: translate(-50%, -50%);\n cursor: pointer; }\n .rst__collapseButton:focus,\n .rst__expandButton:focus {\n outline: none;\n -webkit-box-shadow: 0 0 0 1px #000, 0 0 1px 3px #83bef9;\n box-shadow: 0 0 0 1px #000, 0 0 1px 3px #83bef9; }\n .rst__collapseButton:hover:not(:active),\n .rst__expandButton:hover:not(:active) {\n background-size: 24px;\n height: 20px;\n width: 20px; }\n\n.rst__collapseButton {\n background: #fff url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxOCIgaGVpZ2h0PSIxOCI+PGNpcmNsZSBjeD0iOSIgY3k9IjkiIHI9IjgiIGZpbGw9IiNGRkYiLz48ZyBzdHJva2U9IiM5ODk4OTgiIHN0cm9rZS13aWR0aD0iMS45IiA+PHBhdGggZD0iTTQuNSA5aDkiLz48L2c+Cjwvc3ZnPg==\") no-repeat center; }\n\n.rst__expandButton {\n background: #fff url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxOCIgaGVpZ2h0PSIxOCI+PGNpcmNsZSBjeD0iOSIgY3k9IjkiIHI9IjgiIGZpbGw9IiNGRkYiLz48ZyBzdHJva2U9IiM5ODk4OTgiIHN0cm9rZS13aWR0aD0iMS45IiA+PHBhdGggZD0iTTQuNSA5aDkiLz48cGF0aCBkPSJNOSA0LjV2OSIvPjwvZz4KPC9zdmc+\") no-repeat center; }\n\n/**\n * Classes for IE9 and below\n */\n.rst__row_NoFlex::before, .rst__rowContents_NoFlex::before {\n content: '';\n display: inline-block;\n vertical-align: middle;\n height: 100%; }\n\n.rst__rowContents_NoFlex {\n display: inline-block; }\n .rst__rowContents_NoFlex::after {\n content: '';\n display: inline-block;\n width: 100%; }\n\n.rst__rowLabel_NoFlex {\n width: 50%; }\n\n.rst__rowToolbar_NoFlex {\n text-align: right;\n width: 50%; }\n\n/**\n * Line for under a node with children\n */\n.rst__lineChildren {\n height: 100%;\n display: inline-block;\n position: absolute; }\n .rst__lineChildren::after {\n content: '';\n position: absolute;\n background-color: black;\n width: 1px;\n left: 50%;\n bottom: 0;\n height: 10px; }\n", "" ]),
|
8760 |
-
// exports
|
8761 |
-
exports.locals = {
|
8762 |
-
rowWrapper: "rst__rowWrapper",
|
8763 |
-
row: "rst__row",
|
8764 |
-
rowLandingPad: "rst__rowLandingPad",
|
8765 |
-
rowCancelPad: "rst__rowCancelPad",
|
8766 |
-
rowSearchMatch: "rst__rowSearchMatch",
|
8767 |
-
rowSearchFocus: "rst__rowSearchFocus",
|
8768 |
-
rowContents: "rst__rowContents",
|
8769 |
-
rowLabel: "rst__rowLabel",
|
8770 |
-
rowToolbar: "rst__rowToolbar",
|
8771 |
-
moveHandle: "rst__moveHandle",
|
8772 |
-
loadingHandle: "rst__loadingHandle",
|
8773 |
-
toolbarButton: "rst__toolbarButton",
|
8774 |
-
rowLabel_NoFlex: "rst__rowLabel_NoFlex",
|
8775 |
-
rowToolbar_NoFlex: "rst__rowToolbar_NoFlex",
|
8776 |
-
rowContentsDragDisabled: "rst__rowContentsDragDisabled",
|
8777 |
-
loadingCircle: "rst__loadingCircle",
|
8778 |
-
loadingCirclePoint: "rst__loadingCirclePoint",
|
8779 |
-
pointFade: "rst__pointFade",
|
8780 |
-
rowTitle: "rst__rowTitle",
|
8781 |
-
rowTitleWithSubtitle: "rst__rowTitleWithSubtitle",
|
8782 |
-
rowSubtitle: "rst__rowSubtitle",
|
8783 |
-
collapseButton: "rst__collapseButton",
|
8784 |
-
expandButton: "rst__expandButton",
|
8785 |
-
row_NoFlex: "rst__row_NoFlex",
|
8786 |
-
rowContents_NoFlex: "rst__rowContents_NoFlex",
|
8787 |
-
lineChildren: "rst__lineChildren"
|
8788 |
-
};
|
8789 |
-
}, /* 22 */
|
8790 |
-
/***/
|
8791 |
-
function(module, exports, __webpack_require__) {
|
8792 |
-
"use strict";
|
8793 |
-
function _interopRequireDefault(obj) {
|
8794 |
-
return obj && obj.__esModule ? obj : {
|
8795 |
-
default: obj
|
8796 |
-
};
|
8797 |
-
}
|
8798 |
-
function _objectWithoutProperties(obj, keys) {
|
8799 |
-
var target = {};
|
8800 |
-
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
8801 |
-
return target;
|
8802 |
-
}
|
8803 |
-
function _classCallCheck(instance, Constructor) {
|
8804 |
-
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
8805 |
-
}
|
8806 |
-
function _possibleConstructorReturn(self, call) {
|
8807 |
-
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
8808 |
-
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
8809 |
-
}
|
8810 |
-
function _inherits(subClass, superClass) {
|
8811 |
-
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
8812 |
-
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
8813 |
-
constructor: {
|
8814 |
-
value: subClass,
|
8815 |
-
enumerable: !1,
|
8816 |
-
writable: !0,
|
8817 |
-
configurable: !0
|
8818 |
-
}
|
8819 |
-
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
8820 |
-
}
|
8821 |
-
Object.defineProperty(exports, "__esModule", {
|
8822 |
-
value: !0
|
8823 |
-
});
|
8824 |
-
var _extends = Object.assign || function(target) {
|
8825 |
-
for (var i = 1; i < arguments.length; i++) {
|
8826 |
-
var source = arguments[i];
|
8827 |
-
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
8828 |
-
}
|
8829 |
-
return target;
|
8830 |
-
}, _createClass = function() {
|
8831 |
-
function defineProperties(target, props) {
|
8832 |
-
for (var i = 0; i < props.length; i++) {
|
8833 |
-
var descriptor = props[i];
|
8834 |
-
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
8835 |
-
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
8836 |
-
}
|
8837 |
-
}
|
8838 |
-
return function(Constructor, protoProps, staticProps) {
|
8839 |
-
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
8840 |
-
Constructor;
|
8841 |
-
};
|
8842 |
-
}(), _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), TreePlaceholder = function(_Component) {
|
8843 |
-
function TreePlaceholder() {
|
8844 |
-
return _classCallCheck(this, TreePlaceholder), _possibleConstructorReturn(this, (TreePlaceholder.__proto__ || Object.getPrototypeOf(TreePlaceholder)).apply(this, arguments));
|
8845 |
-
}
|
8846 |
-
return _inherits(TreePlaceholder, _Component), _createClass(TreePlaceholder, [ {
|
8847 |
-
key: "render",
|
8848 |
-
value: function() {
|
8849 |
-
var _props = this.props, children = _props.children, connectDropTarget = _props.connectDropTarget, otherProps = (_props.treeId,
|
8850 |
-
_props.drop, _objectWithoutProperties(_props, [ "children", "connectDropTarget", "treeId", "drop" ]));
|
8851 |
-
return connectDropTarget(_react2.default.createElement("div", null, _react.Children.map(children, function(child) {
|
8852 |
-
return (0, _react.cloneElement)(child, _extends({}, otherProps));
|
8853 |
-
})));
|
8854 |
-
}
|
8855 |
-
} ]), TreePlaceholder;
|
8856 |
-
}(_react.Component);
|
8857 |
-
TreePlaceholder.defaultProps = {
|
8858 |
-
canDrop: !1,
|
8859 |
-
draggedNode: null
|
8860 |
-
}, TreePlaceholder.propTypes = {
|
8861 |
-
children: _propTypes2.default.node.isRequired,
|
8862 |
-
// Drop target
|
8863 |
-
connectDropTarget: _propTypes2.default.func.isRequired,
|
8864 |
-
isOver: _propTypes2.default.bool.isRequired,
|
8865 |
-
canDrop: _propTypes2.default.bool,
|
8866 |
-
draggedNode: _propTypes2.default.shape({}),
|
8867 |
-
treeId: _propTypes2.default.string.isRequired,
|
8868 |
-
drop: _propTypes2.default.func.isRequired
|
8869 |
-
}, exports.default = TreePlaceholder;
|
8870 |
-
}, /* 23 */
|
8871 |
-
/***/
|
8872 |
-
function(module, exports, __webpack_require__) {
|
8873 |
-
"use strict";
|
8874 |
-
function _interopRequireDefault(obj) {
|
8875 |
-
return obj && obj.__esModule ? obj : {
|
8876 |
-
default: obj
|
8877 |
-
};
|
8878 |
-
}
|
8879 |
-
Object.defineProperty(exports, "__esModule", {
|
8880 |
-
value: !0
|
8881 |
-
});
|
8882 |
-
var _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _placeholderRendererDefault = __webpack_require__(24), _placeholderRendererDefault2 = _interopRequireDefault(_placeholderRendererDefault), PlaceholderRendererDefault = function(_ref) {
|
8883 |
-
var isOver = _ref.isOver, canDrop = _ref.canDrop;
|
8884 |
-
return _react2.default.createElement("div", {
|
8885 |
-
className: _placeholderRendererDefault2.default.placeholder + (canDrop ? " " + _placeholderRendererDefault2.default.placeholderLandingPad : "") + (canDrop && !isOver ? " " + _placeholderRendererDefault2.default.placeholderCancelPad : "")
|
8886 |
-
});
|
8887 |
-
};
|
8888 |
-
PlaceholderRendererDefault.defaultProps = {
|
8889 |
-
isOver: !1,
|
8890 |
-
canDrop: !1
|
8891 |
-
}, PlaceholderRendererDefault.propTypes = {
|
8892 |
-
isOver: _propTypes2.default.bool,
|
8893 |
-
canDrop: _propTypes2.default.bool
|
8894 |
-
}, exports.default = PlaceholderRendererDefault;
|
8895 |
-
}, /* 24 */
|
8896 |
-
/***/
|
8897 |
-
function(module, exports, __webpack_require__) {
|
8898 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
8899 |
-
// load the styles
|
8900 |
-
var content = __webpack_require__(25);
|
8901 |
-
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
8902 |
-
// Prepare cssTransformation
|
8903 |
-
var options = {
|
8904 |
-
insertAt: "top",
|
8905 |
-
hmr: !0
|
8906 |
-
};
|
8907 |
-
options.transform = void 0;
|
8908 |
-
// add the styles to the DOM
|
8909 |
-
__webpack_require__(4)(content, options);
|
8910 |
-
content.locals && (module.exports = content.locals);
|
8911 |
-
}, /* 25 */
|
8912 |
-
/***/
|
8913 |
-
function(module, exports, __webpack_require__) {
|
8914 |
-
exports = module.exports = __webpack_require__(3)(!1), // imports
|
8915 |
-
// module
|
8916 |
-
exports.push([ module.i, ".rst__placeholder {\n position: relative;\n height: 68px;\n max-width: 300px;\n padding: 10px; }\n .rst__placeholder,\n .rst__placeholder > * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n .rst__placeholder::before {\n border: 3px dashed #d9d9d9;\n content: '';\n position: absolute;\n top: 5px;\n right: 5px;\n bottom: 5px;\n left: 5px;\n z-index: -1; }\n\n/**\n * The outline of where the element will go if dropped, displayed while dragging\n */\n.rst__placeholderLandingPad, .rst__placeholderCancelPad {\n border: none !important;\n -webkit-box-shadow: none !important;\n box-shadow: none !important;\n outline: none !important; }\n .rst__placeholderLandingPad *, .rst__placeholderCancelPad * {\n opacity: 0 !important; }\n .rst__placeholderLandingPad::before, .rst__placeholderCancelPad::before {\n background-color: lightblue;\n border-color: white; }\n\n/**\n * Alternate appearance of the landing pad when the dragged location is invalid\n */\n.rst__placeholderCancelPad::before {\n background-color: #e6a8ad; }\n", "" ]),
|
8917 |
-
// exports
|
8918 |
-
exports.locals = {
|
8919 |
-
placeholder: "rst__placeholder",
|
8920 |
-
placeholderLandingPad: "rst__placeholderLandingPad",
|
8921 |
-
placeholderCancelPad: "rst__placeholderCancelPad"
|
8922 |
-
};
|
8923 |
-
}, /* 26 */
|
8924 |
-
/***/
|
8925 |
-
function(module, exports, __webpack_require__) {
|
8926 |
-
"use strict";
|
8927 |
-
function _toConsumableArray(arr) {
|
8928 |
-
if (Array.isArray(arr)) {
|
8929 |
-
for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i];
|
8930 |
-
return arr2;
|
8931 |
-
}
|
8932 |
-
return Array.from(arr);
|
8933 |
-
}
|
8934 |
-
/* eslint-disable import/prefer-default-export */
|
8935 |
-
function slideRows(rows, fromIndex, toIndex) {
|
8936 |
-
var count = arguments.length > 3 && void 0 !== arguments[3] ? arguments[3] : 1, rowsWithoutMoved = [].concat(_toConsumableArray(rows.slice(0, fromIndex)), _toConsumableArray(rows.slice(fromIndex + count)));
|
8937 |
-
return [].concat(_toConsumableArray(rowsWithoutMoved.slice(0, toIndex)), _toConsumableArray(rows.slice(fromIndex, fromIndex + count)), _toConsumableArray(rowsWithoutMoved.slice(toIndex)));
|
8938 |
-
}
|
8939 |
-
Object.defineProperty(exports, "__esModule", {
|
8940 |
-
value: !0
|
8941 |
-
}), exports.slideRows = slideRows;
|
8942 |
-
}, /* 27 */
|
8943 |
-
/***/
|
8944 |
-
function(module, exports, __webpack_require__) {
|
8945 |
-
"use strict";
|
8946 |
-
function _classCallCheck(instance, Constructor) {
|
8947 |
-
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
8948 |
-
}
|
8949 |
-
Object.defineProperty(exports, "__esModule", {
|
8950 |
-
value: !0
|
8951 |
-
});
|
8952 |
-
var _createClass = function() {
|
8953 |
-
function defineProperties(target, props) {
|
8954 |
-
for (var i = 0; i < props.length; i++) {
|
8955 |
-
var descriptor = props[i];
|
8956 |
-
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
8957 |
-
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
8958 |
-
}
|
8959 |
-
}
|
8960 |
-
return function(Constructor, protoProps, staticProps) {
|
8961 |
-
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
8962 |
-
Constructor;
|
8963 |
-
};
|
8964 |
-
}(), _reactDnd = __webpack_require__(28), _reactDndHtml5Backend = __webpack_require__(29), _reactDndHtml5Backend2 = function(obj) {
|
8965 |
-
return obj && obj.__esModule ? obj : {
|
8966 |
-
default: obj
|
8967 |
-
};
|
8968 |
-
}(_reactDndHtml5Backend), _reactDom = __webpack_require__(30), _treeDataUtils = __webpack_require__(0), _memoizedTreeDataUtils = __webpack_require__(6), DndManager = function() {
|
8969 |
-
function DndManager(treeRef) {
|
8970 |
-
_classCallCheck(this, DndManager), this.treeRef = treeRef;
|
8971 |
-
}
|
8972 |
-
return _createClass(DndManager, [ {
|
8973 |
-
key: "getTargetDepth",
|
8974 |
-
value: function(dropTargetProps, monitor, component) {
|
8975 |
-
var dropTargetDepth = 0, rowAbove = dropTargetProps.getPrevRow();
|
8976 |
-
rowAbove && (// Limit the length of the path to the deepest possible
|
8977 |
-
dropTargetDepth = Math.min(rowAbove.path.length, dropTargetProps.path.length));
|
8978 |
-
var blocksOffset = void 0, dragSourceInitialDepth = (monitor.getItem().path || []).length;
|
8979 |
-
// When adding node from external source
|
8980 |
-
if (monitor.getItem().treeId !== this.treeId) if (// Ignore the tree depth of the source, if it had any to begin with
|
8981 |
-
dragSourceInitialDepth = 0, component) {
|
8982 |
-
var relativePosition = (0, _reactDom.findDOMNode)(component).getBoundingClientRect(), leftShift = monitor.getSourceClientOffset().x - relativePosition.left;
|
8983 |
-
blocksOffset = Math.round(leftShift / dropTargetProps.scaffoldBlockPxWidth);
|
8984 |
-
} else blocksOffset = dropTargetProps.path.length; else blocksOffset = Math.round(monitor.getDifferenceFromInitialOffset().x / dropTargetProps.scaffoldBlockPxWidth);
|
8985 |
-
var targetDepth = Math.min(dropTargetDepth, Math.max(0, dragSourceInitialDepth + blocksOffset - 1));
|
8986 |
-
// If a maxDepth is defined, constrain the target depth
|
8987 |
-
if (void 0 !== this.maxDepth && null !== this.maxDepth) {
|
8988 |
-
var draggedNode = monitor.getItem().node, draggedChildDepth = (0, _treeDataUtils.getDepth)(draggedNode);
|
8989 |
-
targetDepth = Math.max(0, Math.min(targetDepth, this.maxDepth - draggedChildDepth - 1));
|
8990 |
-
}
|
8991 |
-
return targetDepth;
|
8992 |
-
}
|
8993 |
-
}, {
|
8994 |
-
key: "canDrop",
|
8995 |
-
value: function(dropTargetProps, monitor) {
|
8996 |
-
if (!monitor.isOver()) return !1;
|
8997 |
-
var rowAbove = dropTargetProps.getPrevRow(), abovePath = rowAbove ? rowAbove.path : [], aboveNode = rowAbove ? rowAbove.node : {}, targetDepth = this.getTargetDepth(dropTargetProps, monitor, null);
|
8998 |
-
// Cannot drop if we're adding to the children of the row above and
|
8999 |
-
// the row above is a function
|
9000 |
-
if (targetDepth >= abovePath.length && "function" == typeof aboveNode.children) return !1;
|
9001 |
-
if ("function" == typeof this.customCanDrop) {
|
9002 |
-
var _monitor$getItem = monitor.getItem(), node = _monitor$getItem.node, addedResult = (0,
|
9003 |
-
_memoizedTreeDataUtils.memoizedInsertNode)({
|
9004 |
-
treeData: this.treeData,
|
9005 |
-
newNode: node,
|
9006 |
-
depth: targetDepth,
|
9007 |
-
getNodeKey: this.getNodeKey,
|
9008 |
-
minimumTreeIndex: dropTargetProps.listIndex,
|
9009 |
-
expandParent: !0
|
9010 |
-
});
|
9011 |
-
return this.customCanDrop({
|
9012 |
-
node: node,
|
9013 |
-
prevPath: monitor.getItem().path,
|
9014 |
-
prevParent: monitor.getItem().parentNode,
|
9015 |
-
prevTreeIndex: monitor.getItem().treeIndex,
|
9016 |
-
// Equals -1 when dragged from external tree
|
9017 |
-
nextPath: addedResult.path,
|
9018 |
-
nextParent: addedResult.parentNode,
|
9019 |
-
nextTreeIndex: addedResult.treeIndex
|
9020 |
-
});
|
9021 |
-
}
|
9022 |
-
return !0;
|
9023 |
-
}
|
9024 |
-
}, {
|
9025 |
-
key: "wrapSource",
|
9026 |
-
value: function(el) {
|
9027 |
-
function nodeDragSourcePropInjection(connect, monitor) {
|
9028 |
-
return {
|
9029 |
-
connectDragSource: connect.dragSource(),
|
9030 |
-
connectDragPreview: connect.dragPreview(),
|
9031 |
-
isDragging: monitor.isDragging(),
|
9032 |
-
didDrop: monitor.didDrop()
|
9033 |
-
};
|
9034 |
-
}
|
9035 |
-
var _this = this, nodeDragSource = {
|
9036 |
-
beginDrag: function(props) {
|
9037 |
-
return _this.startDrag(props), {
|
9038 |
-
node: props.node,
|
9039 |
-
parentNode: props.parentNode,
|
9040 |
-
path: props.path,
|
9041 |
-
treeIndex: props.treeIndex,
|
9042 |
-
treeId: props.treeId
|
9043 |
-
};
|
9044 |
-
},
|
9045 |
-
endDrag: function(props, monitor) {
|
9046 |
-
_this.endDrag(monitor.getDropResult());
|
9047 |
-
},
|
9048 |
-
isDragging: function(props, monitor) {
|
9049 |
-
var dropTargetNode = monitor.getItem().node;
|
9050 |
-
return props.node === dropTargetNode;
|
9051 |
-
}
|
9052 |
-
};
|
9053 |
-
return (0, _reactDnd.DragSource)(this.dndType, nodeDragSource, nodeDragSourcePropInjection)(el);
|
9054 |
-
}
|
9055 |
-
}, {
|
9056 |
-
key: "wrapTarget",
|
9057 |
-
value: function(el) {
|
9058 |
-
function nodeDropTargetPropInjection(connect, monitor) {
|
9059 |
-
var dragged = monitor.getItem();
|
9060 |
-
return {
|
9061 |
-
connectDropTarget: connect.dropTarget(),
|
9062 |
-
isOver: monitor.isOver(),
|
9063 |
-
canDrop: monitor.canDrop(),
|
9064 |
-
draggedNode: dragged ? dragged.node : null
|
9065 |
-
};
|
9066 |
-
}
|
9067 |
-
var _this2 = this, nodeDropTarget = {
|
9068 |
-
drop: function(dropTargetProps, monitor, component) {
|
9069 |
-
var result = {
|
9070 |
-
node: monitor.getItem().node,
|
9071 |
-
path: monitor.getItem().path,
|
9072 |
-
treeIndex: monitor.getItem().treeIndex,
|
9073 |
-
treeId: _this2.treeId,
|
9074 |
-
minimumTreeIndex: dropTargetProps.treeIndex,
|
9075 |
-
depth: _this2.getTargetDepth(dropTargetProps, monitor, component)
|
9076 |
-
};
|
9077 |
-
return _this2.drop(result), result;
|
9078 |
-
},
|
9079 |
-
hover: function(dropTargetProps, monitor, component) {
|
9080 |
-
var targetDepth = _this2.getTargetDepth(dropTargetProps, monitor, component), draggedNode = monitor.getItem().node;
|
9081 |
-
(// Redraw if hovered above different nodes
|
9082 |
-
dropTargetProps.node !== draggedNode || // Or hovered above the same node but at a different depth
|
9083 |
-
targetDepth !== dropTargetProps.path.length - 1) && _this2.dragHover({
|
9084 |
-
node: draggedNode,
|
9085 |
-
path: monitor.getItem().path,
|
9086 |
-
minimumTreeIndex: dropTargetProps.listIndex,
|
9087 |
-
depth: targetDepth
|
9088 |
-
});
|
9089 |
-
},
|
9090 |
-
canDrop: this.canDrop.bind(this)
|
9091 |
-
};
|
9092 |
-
return (0, _reactDnd.DropTarget)(this.dndType, nodeDropTarget, nodeDropTargetPropInjection)(el);
|
9093 |
-
}
|
9094 |
-
}, {
|
9095 |
-
key: "wrapPlaceholder",
|
9096 |
-
value: function(el) {
|
9097 |
-
function placeholderPropInjection(connect, monitor) {
|
9098 |
-
var dragged = monitor.getItem();
|
9099 |
-
return {
|
9100 |
-
connectDropTarget: connect.dropTarget(),
|
9101 |
-
isOver: monitor.isOver(),
|
9102 |
-
canDrop: monitor.canDrop(),
|
9103 |
-
draggedNode: dragged ? dragged.node : null
|
9104 |
-
};
|
9105 |
-
}
|
9106 |
-
var _this3 = this, placeholderDropTarget = {
|
9107 |
-
drop: function(dropTargetProps, monitor) {
|
9108 |
-
var _monitor$getItem2 = monitor.getItem(), node = _monitor$getItem2.node, path = _monitor$getItem2.path, treeIndex = _monitor$getItem2.treeIndex, result = {
|
9109 |
-
node: node,
|
9110 |
-
path: path,
|
9111 |
-
treeIndex: treeIndex,
|
9112 |
-
treeId: _this3.treeId,
|
9113 |
-
minimumTreeIndex: 0,
|
9114 |
-
depth: 0
|
9115 |
-
};
|
9116 |
-
return _this3.drop(result), result;
|
9117 |
-
}
|
9118 |
-
};
|
9119 |
-
return (0, _reactDnd.DropTarget)(this.dndType, placeholderDropTarget, placeholderPropInjection)(el);
|
9120 |
-
}
|
9121 |
-
}, {
|
9122 |
-
key: "startDrag",
|
9123 |
-
get: function() {
|
9124 |
-
return this.treeRef.startDrag;
|
9125 |
-
}
|
9126 |
-
}, {
|
9127 |
-
key: "dragHover",
|
9128 |
-
get: function() {
|
9129 |
-
return this.treeRef.dragHover;
|
9130 |
-
}
|
9131 |
-
}, {
|
9132 |
-
key: "endDrag",
|
9133 |
-
get: function() {
|
9134 |
-
return this.treeRef.endDrag;
|
9135 |
-
}
|
9136 |
-
}, {
|
9137 |
-
key: "drop",
|
9138 |
-
get: function() {
|
9139 |
-
return this.treeRef.drop;
|
9140 |
-
}
|
9141 |
-
}, {
|
9142 |
-
key: "treeId",
|
9143 |
-
get: function() {
|
9144 |
-
return this.treeRef.treeId;
|
9145 |
-
}
|
9146 |
-
}, {
|
9147 |
-
key: "dndType",
|
9148 |
-
get: function() {
|
9149 |
-
return this.treeRef.dndType;
|
9150 |
-
}
|
9151 |
-
}, {
|
9152 |
-
key: "treeData",
|
9153 |
-
get: function() {
|
9154 |
-
return this.treeRef.state.draggingTreeData || this.treeRef.props.treeData;
|
9155 |
-
}
|
9156 |
-
}, {
|
9157 |
-
key: "getNodeKey",
|
9158 |
-
get: function() {
|
9159 |
-
return this.treeRef.props.getNodeKey;
|
9160 |
-
}
|
9161 |
-
}, {
|
9162 |
-
key: "customCanDrop",
|
9163 |
-
get: function() {
|
9164 |
-
return this.treeRef.props.canDrop;
|
9165 |
-
}
|
9166 |
-
}, {
|
9167 |
-
key: "maxDepth",
|
9168 |
-
get: function() {
|
9169 |
-
return this.treeRef.props.maxDepth;
|
9170 |
-
}
|
9171 |
-
} ], [ {
|
9172 |
-
key: "wrapRoot",
|
9173 |
-
value: function(el) {
|
9174 |
-
return (0, _reactDnd.DragDropContext)(_reactDndHtml5Backend2.default)(el);
|
9175 |
-
}
|
9176 |
-
} ]), DndManager;
|
9177 |
-
}();
|
9178 |
-
exports.default = DndManager;
|
9179 |
-
}, /* 28 */
|
9180 |
-
/***/
|
9181 |
-
function(module, exports) {
|
9182 |
-
module.exports = __webpack_require__(180);
|
9183 |
-
}, /* 29 */
|
9184 |
-
/***/
|
9185 |
-
function(module, exports) {
|
9186 |
-
module.exports = __webpack_require__(288);
|
9187 |
-
}, /* 30 */
|
9188 |
-
/***/
|
9189 |
-
function(module, exports) {
|
9190 |
-
module.exports = __webpack_require__(19);
|
9191 |
-
}, /* 31 */
|
9192 |
-
/***/
|
9193 |
-
function(module, exports, __webpack_require__) {
|
9194 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
9195 |
-
// load the styles
|
9196 |
-
var content = __webpack_require__(32);
|
9197 |
-
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
9198 |
-
// Prepare cssTransformation
|
9199 |
-
var options = {
|
9200 |
-
insertAt: "top",
|
9201 |
-
hmr: !0
|
9202 |
-
};
|
9203 |
-
options.transform = void 0;
|
9204 |
-
// add the styles to the DOM
|
9205 |
-
__webpack_require__(4)(content, options);
|
9206 |
-
content.locals && (module.exports = content.locals);
|
9207 |
-
}, /* 32 */
|
9208 |
-
/***/
|
9209 |
-
function(module, exports, __webpack_require__) {
|
9210 |
-
exports = module.exports = __webpack_require__(3)(!1), // imports
|
9211 |
-
// module
|
9212 |
-
exports.push([ module.i, "/**\n * The container holding the VirtualScroll\n */\n.rst__tree {\n /*! This comment keeps Sass from deleting the empty rule */ }\n\n/**\n * Extra class applied to VirtualScroll through className prop\n */\n.rst__virtualScrollOverride {\n overflow: auto !important; }\n .rst__virtualScrollOverride * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n.ReactVirtualized__Grid__innerScrollContainer {\n overflow: visible !important; }\n\n.ReactVirtualized__Grid {\n outline: none; }\n", "" ]),
|
9213 |
-
// exports
|
9214 |
-
exports.locals = {
|
9215 |
-
tree: "rst__tree",
|
9216 |
-
virtualScrollOverride: "rst__virtualScrollOverride"
|
9217 |
-
};
|
9218 |
-
} ]);
|
9219 |
-
});
|
9220 |
-
|
9221 |
-
/***/ }),
|
9222 |
-
/* 159 */
|
9223 |
-
/***/ (function(module, exports) {
|
9224 |
-
|
9225 |
-
// 7.2.1 RequireObjectCoercible(argument)
|
9226 |
-
module.exports = function (it) {
|
9227 |
-
if (it == undefined) throw TypeError("Can't call method on " + it);
|
9228 |
-
return it;
|
9229 |
-
};
|
9230 |
-
|
9231 |
-
|
9232 |
-
/***/ }),
|
9233 |
-
/* 160 */
|
9234 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9235 |
-
|
9236 |
-
var shared = __webpack_require__(161)('keys');
|
9237 |
-
var uid = __webpack_require__(112);
|
9238 |
-
module.exports = function (key) {
|
9239 |
-
return shared[key] || (shared[key] = uid(key));
|
9240 |
-
};
|
9241 |
-
|
9242 |
-
|
9243 |
-
/***/ }),
|
9244 |
-
/* 161 */
|
9245 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9246 |
-
|
9247 |
-
var global = __webpack_require__(51);
|
9248 |
-
var SHARED = '__core-js_shared__';
|
9249 |
-
var store = global[SHARED] || (global[SHARED] = {});
|
9250 |
-
module.exports = function (key) {
|
9251 |
-
return store[key] || (store[key] = {});
|
9252 |
-
};
|
9253 |
-
|
9254 |
-
|
9255 |
-
/***/ }),
|
9256 |
-
/* 162 */
|
9257 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9258 |
-
|
9259 |
-
// most Object methods by ES6 should accept primitives
|
9260 |
-
var $export = __webpack_require__(66);
|
9261 |
-
var core = __webpack_require__(22);
|
9262 |
-
var fails = __webpack_require__(80);
|
9263 |
-
module.exports = function (KEY, exec) {
|
9264 |
-
var fn = (core.Object || {})[KEY] || Object[KEY];
|
9265 |
-
var exp = {};
|
9266 |
-
exp[KEY] = exec(fn);
|
9267 |
-
$export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp);
|
9268 |
-
};
|
9269 |
-
|
9270 |
-
|
9271 |
-
/***/ }),
|
9272 |
-
/* 163 */
|
9273 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9274 |
-
|
9275 |
-
// 7.1.1 ToPrimitive(input [, PreferredType])
|
9276 |
-
var isObject = __webpack_require__(79);
|
9277 |
-
// instead of the ES6 spec version, we didn't implement @@toPrimitive case
|
9278 |
-
// and the second argument - flag - preferred type is a string
|
9279 |
-
module.exports = function (it, S) {
|
9280 |
-
if (!isObject(it)) return it;
|
9281 |
-
var fn, val;
|
9282 |
-
if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
|
9283 |
-
if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val;
|
9284 |
-
if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
|
9285 |
-
throw TypeError("Can't convert object to primitive value");
|
9286 |
-
};
|
9287 |
-
|
9288 |
-
|
9289 |
-
/***/ }),
|
9290 |
-
/* 164 */
|
9291 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9292 |
-
|
9293 |
-
"use strict";
|
9294 |
-
|
9295 |
-
var $at = __webpack_require__(529)(true);
|
9296 |
-
|
9297 |
-
// 21.1.3.27 String.prototype[@@iterator]()
|
9298 |
-
__webpack_require__(241)(String, 'String', function (iterated) {
|
9299 |
-
this._t = String(iterated); // target
|
9300 |
-
this._i = 0; // next index
|
9301 |
-
// 21.1.5.2.1 %StringIteratorPrototype%.next()
|
9302 |
-
}, function () {
|
9303 |
-
var O = this._t;
|
9304 |
-
var index = this._i;
|
9305 |
-
var point;
|
9306 |
-
if (index >= O.length) return { value: undefined, done: true };
|
9307 |
-
point = $at(O, index);
|
9308 |
-
this._i += point.length;
|
9309 |
-
return { value: point, done: false };
|
9310 |
-
});
|
9311 |
-
|
9312 |
-
|
9313 |
-
/***/ }),
|
9314 |
-
/* 165 */
|
9315 |
-
/***/ (function(module, exports) {
|
9316 |
-
|
9317 |
-
// 7.1.4 ToInteger
|
9318 |
-
var ceil = Math.ceil;
|
9319 |
-
var floor = Math.floor;
|
9320 |
-
module.exports = function (it) {
|
9321 |
-
return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it);
|
9322 |
-
};
|
9323 |
-
|
9324 |
-
|
9325 |
-
/***/ }),
|
9326 |
-
/* 166 */
|
9327 |
-
/***/ (function(module, exports) {
|
9328 |
-
|
9329 |
-
module.exports = true;
|
9330 |
-
|
9331 |
-
|
9332 |
-
/***/ }),
|
9333 |
-
/* 167 */
|
9334 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9335 |
-
|
9336 |
-
// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
|
9337 |
-
var anObject = __webpack_require__(78);
|
9338 |
-
var dPs = __webpack_require__(531);
|
9339 |
-
var enumBugKeys = __webpack_require__(169);
|
9340 |
-
var IE_PROTO = __webpack_require__(160)('IE_PROTO');
|
9341 |
-
var Empty = function () { /* empty */ };
|
9342 |
-
var PROTOTYPE = 'prototype';
|
9343 |
-
|
9344 |
-
// Create object with fake `null` prototype: use iframe Object with cleared prototype
|
9345 |
-
var createDict = function () {
|
9346 |
-
// Thrash, waste and sodomy: IE GC bug
|
9347 |
-
var iframe = __webpack_require__(239)('iframe');
|
9348 |
-
var i = enumBugKeys.length;
|
9349 |
-
var lt = '<';
|
9350 |
-
var gt = '>';
|
9351 |
-
var iframeDocument;
|
9352 |
-
iframe.style.display = 'none';
|
9353 |
-
__webpack_require__(535).appendChild(iframe);
|
9354 |
-
iframe.src = 'javascript:'; // eslint-disable-line no-script-url
|
9355 |
-
// createDict = iframe.contentWindow.Object;
|
9356 |
-
// html.removeChild(iframe);
|
9357 |
-
iframeDocument = iframe.contentWindow.document;
|
9358 |
-
iframeDocument.open();
|
9359 |
-
iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt);
|
9360 |
-
iframeDocument.close();
|
9361 |
-
createDict = iframeDocument.F;
|
9362 |
-
while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]];
|
9363 |
-
return createDict();
|
9364 |
-
};
|
9365 |
-
|
9366 |
-
module.exports = Object.create || function create(O, Properties) {
|
9367 |
-
var result;
|
9368 |
-
if (O !== null) {
|
9369 |
-
Empty[PROTOTYPE] = anObject(O);
|
9370 |
-
result = new Empty();
|
9371 |
-
Empty[PROTOTYPE] = null;
|
9372 |
-
// add "__proto__" for Object.getPrototypeOf polyfill
|
9373 |
-
result[IE_PROTO] = O;
|
9374 |
-
} else result = createDict();
|
9375 |
-
return Properties === undefined ? result : dPs(result, Properties);
|
9376 |
-
};
|
9377 |
-
|
9378 |
-
|
9379 |
-
/***/ }),
|
9380 |
-
/* 168 */
|
9381 |
-
/***/ (function(module, exports) {
|
9382 |
-
|
9383 |
-
var toString = {}.toString;
|
9384 |
-
|
9385 |
-
module.exports = function (it) {
|
9386 |
-
return toString.call(it).slice(8, -1);
|
9387 |
-
};
|
9388 |
-
|
9389 |
-
|
9390 |
-
/***/ }),
|
9391 |
-
/* 169 */
|
9392 |
-
/***/ (function(module, exports) {
|
9393 |
-
|
9394 |
-
// IE 8- don't enum bug keys
|
9395 |
-
module.exports = (
|
9396 |
-
'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf'
|
9397 |
-
).split(',');
|
9398 |
-
|
9399 |
-
|
9400 |
-
/***/ }),
|
9401 |
-
/* 170 */
|
9402 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9403 |
-
|
9404 |
-
var def = __webpack_require__(67).f;
|
9405 |
-
var has = __webpack_require__(65);
|
9406 |
-
var TAG = __webpack_require__(46)('toStringTag');
|
9407 |
-
|
9408 |
-
module.exports = function (it, tag, stat) {
|
9409 |
-
if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag });
|
9410 |
-
};
|
9411 |
-
|
9412 |
-
|
9413 |
-
/***/ }),
|
9414 |
-
/* 171 */
|
9415 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9416 |
-
|
9417 |
-
__webpack_require__(536);
|
9418 |
-
var global = __webpack_require__(51);
|
9419 |
-
var hide = __webpack_require__(77);
|
9420 |
-
var Iterators = __webpack_require__(89);
|
9421 |
-
var TO_STRING_TAG = __webpack_require__(46)('toStringTag');
|
9422 |
-
|
9423 |
-
var DOMIterables = ('CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,' +
|
9424 |
-
'DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,' +
|
9425 |
-
'MediaList,MimeTypeArray,NamedNodeMap,NodeList,PaintRequestList,Plugin,PluginArray,SVGLengthList,SVGNumberList,' +
|
9426 |
-
'SVGPathSegList,SVGPointList,SVGStringList,SVGTransformList,SourceBufferList,StyleSheetList,TextTrackCueList,' +
|
9427 |
-
'TextTrackList,TouchList').split(',');
|
9428 |
-
|
9429 |
-
for (var i = 0; i < DOMIterables.length; i++) {
|
9430 |
-
var NAME = DOMIterables[i];
|
9431 |
-
var Collection = global[NAME];
|
9432 |
-
var proto = Collection && Collection.prototype;
|
9433 |
-
if (proto && !proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME);
|
9434 |
-
Iterators[NAME] = Iterators.Array;
|
9435 |
-
}
|
9436 |
-
|
9437 |
-
|
9438 |
-
/***/ }),
|
9439 |
-
/* 172 */
|
9440 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9441 |
-
|
9442 |
-
exports.f = __webpack_require__(46);
|
9443 |
-
|
9444 |
-
|
9445 |
-
/***/ }),
|
9446 |
-
/* 173 */
|
9447 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9448 |
-
|
9449 |
-
var global = __webpack_require__(51);
|
9450 |
-
var core = __webpack_require__(22);
|
9451 |
-
var LIBRARY = __webpack_require__(166);
|
9452 |
-
var wksExt = __webpack_require__(172);
|
9453 |
-
var defineProperty = __webpack_require__(67).f;
|
9454 |
-
module.exports = function (name) {
|
9455 |
-
var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {});
|
9456 |
-
if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) });
|
9457 |
-
};
|
9458 |
-
|
9459 |
-
|
9460 |
-
/***/ }),
|
9461 |
-
/* 174 */
|
9462 |
-
/***/ (function(module, exports) {
|
9463 |
-
|
9464 |
-
exports.f = Object.getOwnPropertySymbols;
|
9465 |
-
|
9466 |
-
|
9467 |
-
/***/ }),
|
9468 |
-
/* 175 */
|
9469 |
-
/***/ (function(module, exports, __webpack_require__) {
|
9470 |
-
|
9471 |
-
var pIE = __webpack_require__(115);
|
9472 |
-
var createDesc = __webpack_require__(113);
|
9473 |
-
var toIObject = __webpack_require__(69);
|
9474 |
-
var toPrimitive = __webpack_require__(163);
|
9475 |
-
var has = __webpack_require__(65);
|
9476 |
-
var IE8_DOM_DEFINE = __webpack_require__(238);
|
9477 |
-
var gOPD = Object.getOwnPropertyDescriptor;
|
9478 |
-
|
9479 |
-
exports.f = __webpack_require__(68) ? gOPD : function getOwnPropertyDescriptor(O, P) {
|
9480 |
-
O = toIObject(O);
|
9481 |
-
P = toPrimitive(P, true);
|
9482 |
-
if (IE8_DOM_DEFINE) try {
|
9483 |
-
return gOPD(O, P);
|
9484 |
-
} catch (e) { /* empty */ }
|
9485 |
-
if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]);
|
9486 |
-
};
|
9487 |
-
|
9488 |
-
|
9489 |
-
/***/ }),
|
9490 |
-
/* 176 */
|
9491 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9492 |
-
|
9493 |
-
"use strict";
|
9494 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__ = __webpack_require__(116);
|
9495 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__);
|
9496 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
9497 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__);
|
9498 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
9499 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__);
|
9500 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__CellSizeAndPositionManager__ = __webpack_require__(560);
|
9501 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__maxElementSize_js__ = __webpack_require__(561);
|
9502 |
-
|
9503 |
-
|
9504 |
-
|
9505 |
-
|
9506 |
-
var babelPluginFlowReactPropTypes_proptype_VisibleCellRange = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_VisibleCellRange || __webpack_require__(0).any;
|
9507 |
-
|
9508 |
-
var babelPluginFlowReactPropTypes_proptype_CellSizeGetter = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellSizeGetter || __webpack_require__(0).any;
|
9509 |
-
|
9510 |
-
var babelPluginFlowReactPropTypes_proptype_Alignment = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_Alignment || __webpack_require__(0).any;
|
9511 |
-
|
9512 |
-
|
9513 |
-
|
9514 |
-
|
9515 |
-
/**
|
9516 |
-
* Browsers have scroll offset limitations (eg Chrome stops scrolling at ~33.5M pixels where as Edge tops out at ~1.5M pixels).
|
9517 |
-
* After a certain position, the browser won't allow the user to scroll further (even via JavaScript scroll offset adjustments).
|
9518 |
-
* This util picks a lower ceiling for max size and artificially adjusts positions within to make it transparent for users.
|
9519 |
-
*/
|
9520 |
-
|
9521 |
-
/**
|
9522 |
-
* Extends CellSizeAndPositionManager and adds scaling behavior for lists that are too large to fit within a browser's native limits.
|
9523 |
-
*/
|
9524 |
-
var ScalingCellSizeAndPositionManager = function () {
|
9525 |
-
function ScalingCellSizeAndPositionManager(_ref) {
|
9526 |
-
var _ref$maxScrollSize = _ref.maxScrollSize,
|
9527 |
-
maxScrollSize = _ref$maxScrollSize === undefined ? Object(__WEBPACK_IMPORTED_MODULE_4__maxElementSize_js__["a" /* getMaxElementSize */])() : _ref$maxScrollSize,
|
9528 |
-
params = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default()(_ref, ['maxScrollSize']);
|
9529 |
-
|
9530 |
-
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default()(this, ScalingCellSizeAndPositionManager);
|
9531 |
-
|
9532 |
-
// Favor composition over inheritance to simplify IE10 support
|
9533 |
-
this._cellSizeAndPositionManager = new __WEBPACK_IMPORTED_MODULE_3__CellSizeAndPositionManager__["a" /* default */](params);
|
9534 |
-
this._maxScrollSize = maxScrollSize;
|
9535 |
-
}
|
9536 |
-
|
9537 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default()(ScalingCellSizeAndPositionManager, [{
|
9538 |
-
key: 'areOffsetsAdjusted',
|
9539 |
-
value: function areOffsetsAdjusted() {
|
9540 |
-
return this._cellSizeAndPositionManager.getTotalSize() > this._maxScrollSize;
|
9541 |
-
}
|
9542 |
-
}, {
|
9543 |
-
key: 'configure',
|
9544 |
-
value: function configure(params) {
|
9545 |
-
this._cellSizeAndPositionManager.configure(params);
|
9546 |
-
}
|
9547 |
-
}, {
|
9548 |
-
key: 'getCellCount',
|
9549 |
-
value: function getCellCount() {
|
9550 |
-
return this._cellSizeAndPositionManager.getCellCount();
|
9551 |
-
}
|
9552 |
-
}, {
|
9553 |
-
key: 'getEstimatedCellSize',
|
9554 |
-
value: function getEstimatedCellSize() {
|
9555 |
-
return this._cellSizeAndPositionManager.getEstimatedCellSize();
|
9556 |
-
}
|
9557 |
-
}, {
|
9558 |
-
key: 'getLastMeasuredIndex',
|
9559 |
-
value: function getLastMeasuredIndex() {
|
9560 |
-
return this._cellSizeAndPositionManager.getLastMeasuredIndex();
|
9561 |
-
}
|
9562 |
-
|
9563 |
-
/**
|
9564 |
-
* Number of pixels a cell at the given position (offset) should be shifted in order to fit within the scaled container.
|
9565 |
-
* The offset passed to this function is scaled (safe) as well.
|
9566 |
-
*/
|
9567 |
-
|
9568 |
-
}, {
|
9569 |
-
key: 'getOffsetAdjustment',
|
9570 |
-
value: function getOffsetAdjustment(_ref2) {
|
9571 |
-
var containerSize = _ref2.containerSize,
|
9572 |
-
offset = _ref2.offset;
|
9573 |
-
|
9574 |
-
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
9575 |
-
var safeTotalSize = this.getTotalSize();
|
9576 |
-
var offsetPercentage = this._getOffsetPercentage({
|
9577 |
-
containerSize: containerSize,
|
9578 |
-
offset: offset,
|
9579 |
-
totalSize: safeTotalSize
|
9580 |
-
});
|
9581 |
-
|
9582 |
-
return Math.round(offsetPercentage * (safeTotalSize - totalSize));
|
9583 |
-
}
|
9584 |
-
}, {
|
9585 |
-
key: 'getSizeAndPositionOfCell',
|
9586 |
-
value: function getSizeAndPositionOfCell(index) {
|
9587 |
-
return this._cellSizeAndPositionManager.getSizeAndPositionOfCell(index);
|
9588 |
-
}
|
9589 |
-
}, {
|
9590 |
-
key: 'getSizeAndPositionOfLastMeasuredCell',
|
9591 |
-
value: function getSizeAndPositionOfLastMeasuredCell() {
|
9592 |
-
return this._cellSizeAndPositionManager.getSizeAndPositionOfLastMeasuredCell();
|
9593 |
-
}
|
9594 |
-
|
9595 |
-
/** See CellSizeAndPositionManager#getTotalSize */
|
9596 |
-
|
9597 |
-
}, {
|
9598 |
-
key: 'getTotalSize',
|
9599 |
-
value: function getTotalSize() {
|
9600 |
-
return Math.min(this._maxScrollSize, this._cellSizeAndPositionManager.getTotalSize());
|
9601 |
-
}
|
9602 |
-
|
9603 |
-
/** See CellSizeAndPositionManager#getUpdatedOffsetForIndex */
|
9604 |
-
|
9605 |
-
}, {
|
9606 |
-
key: 'getUpdatedOffsetForIndex',
|
9607 |
-
value: function getUpdatedOffsetForIndex(_ref3) {
|
9608 |
-
var _ref3$align = _ref3.align,
|
9609 |
-
align = _ref3$align === undefined ? 'auto' : _ref3$align,
|
9610 |
-
containerSize = _ref3.containerSize,
|
9611 |
-
currentOffset = _ref3.currentOffset,
|
9612 |
-
targetIndex = _ref3.targetIndex;
|
9613 |
-
|
9614 |
-
currentOffset = this._safeOffsetToOffset({
|
9615 |
-
containerSize: containerSize,
|
9616 |
-
offset: currentOffset
|
9617 |
-
});
|
9618 |
-
|
9619 |
-
var offset = this._cellSizeAndPositionManager.getUpdatedOffsetForIndex({
|
9620 |
-
align: align,
|
9621 |
-
containerSize: containerSize,
|
9622 |
-
currentOffset: currentOffset,
|
9623 |
-
targetIndex: targetIndex
|
9624 |
-
});
|
9625 |
-
|
9626 |
-
return this._offsetToSafeOffset({
|
9627 |
-
containerSize: containerSize,
|
9628 |
-
offset: offset
|
9629 |
-
});
|
9630 |
-
}
|
9631 |
-
|
9632 |
-
/** See CellSizeAndPositionManager#getVisibleCellRange */
|
9633 |
-
|
9634 |
-
}, {
|
9635 |
-
key: 'getVisibleCellRange',
|
9636 |
-
value: function getVisibleCellRange(_ref4) {
|
9637 |
-
var containerSize = _ref4.containerSize,
|
9638 |
-
offset = _ref4.offset;
|
9639 |
-
|
9640 |
-
offset = this._safeOffsetToOffset({
|
9641 |
-
containerSize: containerSize,
|
9642 |
-
offset: offset
|
9643 |
-
});
|
9644 |
-
|
9645 |
-
return this._cellSizeAndPositionManager.getVisibleCellRange({
|
9646 |
-
containerSize: containerSize,
|
9647 |
-
offset: offset
|
9648 |
-
});
|
9649 |
-
}
|
9650 |
-
}, {
|
9651 |
-
key: 'resetCell',
|
9652 |
-
value: function resetCell(index) {
|
9653 |
-
this._cellSizeAndPositionManager.resetCell(index);
|
9654 |
-
}
|
9655 |
-
}, {
|
9656 |
-
key: '_getOffsetPercentage',
|
9657 |
-
value: function _getOffsetPercentage(_ref5) {
|
9658 |
-
var containerSize = _ref5.containerSize,
|
9659 |
-
offset = _ref5.offset,
|
9660 |
-
totalSize = _ref5.totalSize;
|
9661 |
-
|
9662 |
-
return totalSize <= containerSize ? 0 : offset / (totalSize - containerSize);
|
9663 |
-
}
|
9664 |
-
}, {
|
9665 |
-
key: '_offsetToSafeOffset',
|
9666 |
-
value: function _offsetToSafeOffset(_ref6) {
|
9667 |
-
var containerSize = _ref6.containerSize,
|
9668 |
-
offset = _ref6.offset;
|
9669 |
-
|
9670 |
-
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
9671 |
-
var safeTotalSize = this.getTotalSize();
|
9672 |
-
|
9673 |
-
if (totalSize === safeTotalSize) {
|
9674 |
-
return offset;
|
9675 |
-
} else {
|
9676 |
-
var offsetPercentage = this._getOffsetPercentage({
|
9677 |
-
containerSize: containerSize,
|
9678 |
-
offset: offset,
|
9679 |
-
totalSize: totalSize
|
9680 |
-
});
|
9681 |
-
|
9682 |
-
return Math.round(offsetPercentage * (safeTotalSize - containerSize));
|
9683 |
-
}
|
9684 |
-
}
|
9685 |
-
}, {
|
9686 |
-
key: '_safeOffsetToOffset',
|
9687 |
-
value: function _safeOffsetToOffset(_ref7) {
|
9688 |
-
var containerSize = _ref7.containerSize,
|
9689 |
-
offset = _ref7.offset;
|
9690 |
-
|
9691 |
-
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
9692 |
-
var safeTotalSize = this.getTotalSize();
|
9693 |
-
|
9694 |
-
if (totalSize === safeTotalSize) {
|
9695 |
-
return offset;
|
9696 |
-
} else {
|
9697 |
-
var offsetPercentage = this._getOffsetPercentage({
|
9698 |
-
containerSize: containerSize,
|
9699 |
-
offset: offset,
|
9700 |
-
totalSize: safeTotalSize
|
9701 |
-
});
|
9702 |
-
|
9703 |
-
return Math.round(offsetPercentage * (totalSize - containerSize));
|
9704 |
-
}
|
9705 |
-
}
|
9706 |
-
}]);
|
9707 |
-
|
9708 |
-
return ScalingCellSizeAndPositionManager;
|
9709 |
-
}();
|
9710 |
-
|
9711 |
-
/* harmony default export */ __webpack_exports__["a"] = (ScalingCellSizeAndPositionManager);
|
9712 |
-
|
9713 |
-
/***/ }),
|
9714 |
-
/* 177 */
|
9715 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9716 |
-
|
9717 |
-
"use strict";
|
9718 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = createCallbackMemoizer;
|
9719 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys__ = __webpack_require__(247);
|
9720 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys__);
|
9721 |
-
|
9722 |
-
/**
|
9723 |
-
* Helper utility that updates the specified callback whenever any of the specified indices have changed.
|
9724 |
-
*/
|
9725 |
-
function createCallbackMemoizer() {
|
9726 |
-
var requireAllKeys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
|
9727 |
-
|
9728 |
-
var cachedIndices = {};
|
9729 |
-
|
9730 |
-
return function (_ref) {
|
9731 |
-
var callback = _ref.callback,
|
9732 |
-
indices = _ref.indices;
|
9733 |
-
|
9734 |
-
var keys = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default()(indices);
|
9735 |
-
var allInitialized = !requireAllKeys || keys.every(function (key) {
|
9736 |
-
var value = indices[key];
|
9737 |
-
return Array.isArray(value) ? value.length > 0 : value >= 0;
|
9738 |
-
});
|
9739 |
-
var indexChanged = keys.length !== __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default()(cachedIndices).length || keys.some(function (key) {
|
9740 |
-
var cachedValue = cachedIndices[key];
|
9741 |
-
var value = indices[key];
|
9742 |
-
|
9743 |
-
return Array.isArray(value) ? cachedValue.join(',') !== value.join(',') : cachedValue !== value;
|
9744 |
-
});
|
9745 |
-
|
9746 |
-
cachedIndices = indices;
|
9747 |
-
|
9748 |
-
if (allInitialized && indexChanged) {
|
9749 |
-
callback(indices);
|
9750 |
-
}
|
9751 |
-
};
|
9752 |
-
}
|
9753 |
-
|
9754 |
-
/***/ }),
|
9755 |
-
/* 178 */
|
9756 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9757 |
-
|
9758 |
-
"use strict";
|
9759 |
-
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
9760 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(2);
|
9761 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
9762 |
-
|
9763 |
-
|
9764 |
-
var babelPluginFlowReactPropTypes_proptype_RowRendererParams = {
|
9765 |
-
index: __webpack_require__(0).number.isRequired,
|
9766 |
-
isScrolling: __webpack_require__(0).bool.isRequired,
|
9767 |
-
isVisible: __webpack_require__(0).bool.isRequired,
|
9768 |
-
key: __webpack_require__(0).string.isRequired,
|
9769 |
-
parent: __webpack_require__(0).object.isRequired,
|
9770 |
-
style: __webpack_require__(0).object.isRequired
|
9771 |
-
};
|
9772 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RowRendererParams', {
|
9773 |
-
value: babelPluginFlowReactPropTypes_proptype_RowRendererParams,
|
9774 |
-
configurable: true
|
9775 |
-
});
|
9776 |
-
|
9777 |
-
var babelPluginFlowReactPropTypes_proptype_RowRenderer = __webpack_require__(0).func;
|
9778 |
-
|
9779 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RowRenderer', {
|
9780 |
-
value: babelPluginFlowReactPropTypes_proptype_RowRenderer,
|
9781 |
-
configurable: true
|
9782 |
-
});
|
9783 |
-
var babelPluginFlowReactPropTypes_proptype_RenderedRows = {
|
9784 |
-
overscanStartIndex: __webpack_require__(0).number.isRequired,
|
9785 |
-
overscanStopIndex: __webpack_require__(0).number.isRequired,
|
9786 |
-
startIndex: __webpack_require__(0).number.isRequired,
|
9787 |
-
stopIndex: __webpack_require__(0).number.isRequired
|
9788 |
-
};
|
9789 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RenderedRows', {
|
9790 |
-
value: babelPluginFlowReactPropTypes_proptype_RenderedRows,
|
9791 |
-
configurable: true
|
9792 |
-
});
|
9793 |
-
var babelPluginFlowReactPropTypes_proptype_Scroll = {
|
9794 |
-
clientHeight: __webpack_require__(0).number.isRequired,
|
9795 |
-
scrollHeight: __webpack_require__(0).number.isRequired,
|
9796 |
-
scrollTop: __webpack_require__(0).number.isRequired
|
9797 |
-
};
|
9798 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_Scroll', {
|
9799 |
-
value: babelPluginFlowReactPropTypes_proptype_Scroll,
|
9800 |
-
configurable: true
|
9801 |
-
});
|
9802 |
-
|
9803 |
-
/***/ }),
|
9804 |
-
/* 179 */
|
9805 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9806 |
-
|
9807 |
-
"use strict";
|
9808 |
-
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
9809 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_SCROLLING_RESET_TIME_INTERVAL", function() { return DEFAULT_SCROLLING_RESET_TIME_INTERVAL; });
|
9810 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
9811 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
9812 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
9813 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__);
|
9814 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
9815 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
9816 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
9817 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
9818 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
9819 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
9820 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
9821 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
9822 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(2);
|
9823 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
9824 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames__ = __webpack_require__(47);
|
9825 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_classnames__);
|
9826 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__PositionCache__ = __webpack_require__(589);
|
9827 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_requestAnimationTimeout__ = __webpack_require__(91);
|
9828 |
-
|
9829 |
-
|
9830 |
-
|
9831 |
-
|
9832 |
-
|
9833 |
-
|
9834 |
-
|
9835 |
-
|
9836 |
-
|
9837 |
-
|
9838 |
-
|
9839 |
-
var babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId = __webpack_require__(91).babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId || __webpack_require__(0).any;
|
9840 |
-
|
9841 |
-
var emptyObject = {};
|
9842 |
-
|
9843 |
-
/**
|
9844 |
-
* Specifies the number of miliseconds during which to disable pointer events while a scroll is in progress.
|
9845 |
-
* This improves performance and makes scrolling smoother.
|
9846 |
-
*/
|
9847 |
-
var DEFAULT_SCROLLING_RESET_TIME_INTERVAL = 150;
|
9848 |
-
|
9849 |
-
/**
|
9850 |
-
* This component efficiently displays arbitrarily positioned cells using windowing techniques.
|
9851 |
-
* Cell position is determined by an injected `cellPositioner` property.
|
9852 |
-
* Windowing is vertical; this component does not support horizontal scrolling.
|
9853 |
-
*
|
9854 |
-
* Rendering occurs in two phases:
|
9855 |
-
* 1) First pass uses estimated cell sizes (provided by the cache) to determine how many cells to measure in a batch.
|
9856 |
-
* Batch size is chosen using a fast, naive layout algorithm that stacks images in order until the viewport has been filled.
|
9857 |
-
* After measurement is complete (componentDidMount or componentDidUpdate) this component evaluates positioned cells
|
9858 |
-
* in order to determine if another measurement pass is required (eg if actual cell sizes were less than estimated sizes).
|
9859 |
-
* All measurements are permanently cached (keyed by `keyMapper`) for performance purposes.
|
9860 |
-
* 2) Second pass uses the external `cellPositioner` to layout cells.
|
9861 |
-
* At this time the positioner has access to cached size measurements for all cells.
|
9862 |
-
* The positions it returns are cached by Masonry for fast access later.
|
9863 |
-
* Phase one is repeated if the user scrolls beyond the current layout's bounds.
|
9864 |
-
* If the layout is invalidated due to eg a resize, cached positions can be cleared using `recomputeCellPositions()`.
|
9865 |
-
*
|
9866 |
-
* Animation constraints:
|
9867 |
-
* Simple animations are supported (eg translate/slide into place on initial reveal).
|
9868 |
-
* More complex animations are not (eg flying from one position to another on resize).
|
9869 |
-
*
|
9870 |
-
* Layout constraints:
|
9871 |
-
* This component supports multi-column layout.
|
9872 |
-
* The height of each item may vary.
|
9873 |
-
* The width of each item must not exceed the width of the column it is "in".
|
9874 |
-
* The left position of all items within a column must align.
|
9875 |
-
* (Items may not span multiple columns.)
|
9876 |
-
*/
|
9877 |
-
|
9878 |
-
var Masonry = function (_PureComponent) {
|
9879 |
-
__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default()(Masonry, _PureComponent);
|
9880 |
-
|
9881 |
-
function Masonry(props, context) {
|
9882 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default()(this, Masonry);
|
9883 |
-
|
9884 |
-
var _this = __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(this, (Masonry.__proto__ || __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default()(Masonry)).call(this, props, context));
|
9885 |
-
|
9886 |
-
_this._invalidateOnUpdateStartIndex = null;
|
9887 |
-
_this._invalidateOnUpdateStopIndex = null;
|
9888 |
-
_this._positionCache = new __WEBPACK_IMPORTED_MODULE_8__PositionCache__["a" /* default */]();
|
9889 |
-
_this._startIndex = null;
|
9890 |
-
_this._startIndexMemoized = null;
|
9891 |
-
_this._stopIndex = null;
|
9892 |
-
_this._stopIndexMemoized = null;
|
9893 |
-
|
9894 |
-
|
9895 |
-
_this.state = {
|
9896 |
-
isScrolling: false,
|
9897 |
-
scrollTop: 0
|
9898 |
-
};
|
9899 |
-
|
9900 |
-
_this._debounceResetIsScrollingCallback = _this._debounceResetIsScrollingCallback.bind(_this);
|
9901 |
-
_this._setScrollingContainerRef = _this._setScrollingContainerRef.bind(_this);
|
9902 |
-
_this._onScroll = _this._onScroll.bind(_this);
|
9903 |
-
return _this;
|
9904 |
-
}
|
9905 |
-
|
9906 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default()(Masonry, [{
|
9907 |
-
key: 'clearCellPositions',
|
9908 |
-
value: function clearCellPositions() {
|
9909 |
-
this._positionCache = new __WEBPACK_IMPORTED_MODULE_8__PositionCache__["a" /* default */]();
|
9910 |
-
this.forceUpdate();
|
9911 |
-
}
|
9912 |
-
|
9913 |
-
// HACK This method signature was intended for Grid
|
9914 |
-
|
9915 |
-
}, {
|
9916 |
-
key: 'invalidateCellSizeAfterRender',
|
9917 |
-
value: function invalidateCellSizeAfterRender(_ref) {
|
9918 |
-
var index = _ref.rowIndex;
|
9919 |
-
|
9920 |
-
if (this._invalidateOnUpdateStartIndex === null) {
|
9921 |
-
this._invalidateOnUpdateStartIndex = index;
|
9922 |
-
this._invalidateOnUpdateStopIndex = index;
|
9923 |
-
} else {
|
9924 |
-
this._invalidateOnUpdateStartIndex = Math.min(this._invalidateOnUpdateStartIndex, index);
|
9925 |
-
this._invalidateOnUpdateStopIndex = Math.max(this._invalidateOnUpdateStopIndex, index);
|
9926 |
-
}
|
9927 |
-
}
|
9928 |
-
}, {
|
9929 |
-
key: 'recomputeCellPositions',
|
9930 |
-
value: function recomputeCellPositions() {
|
9931 |
-
var stopIndex = this._positionCache.count - 1;
|
9932 |
-
|
9933 |
-
this._positionCache = new __WEBPACK_IMPORTED_MODULE_8__PositionCache__["a" /* default */]();
|
9934 |
-
this._populatePositionCache(0, stopIndex);
|
9935 |
-
|
9936 |
-
this.forceUpdate();
|
9937 |
-
}
|
9938 |
-
}, {
|
9939 |
-
key: 'componentDidMount',
|
9940 |
-
value: function componentDidMount() {
|
9941 |
-
this._checkInvalidateOnUpdate();
|
9942 |
-
this._invokeOnScrollCallback();
|
9943 |
-
this._invokeOnCellsRenderedCallback();
|
9944 |
-
}
|
9945 |
-
}, {
|
9946 |
-
key: 'componentDidUpdate',
|
9947 |
-
value: function componentDidUpdate() {
|
9948 |
-
this._checkInvalidateOnUpdate();
|
9949 |
-
this._invokeOnScrollCallback();
|
9950 |
-
this._invokeOnCellsRenderedCallback();
|
9951 |
-
}
|
9952 |
-
}, {
|
9953 |
-
key: 'componentWillUnmount',
|
9954 |
-
value: function componentWillUnmount() {
|
9955 |
-
if (this._debounceResetIsScrollingId) {
|
9956 |
-
Object(__WEBPACK_IMPORTED_MODULE_9__utils_requestAnimationTimeout__["cancelAnimationTimeout"])(this._debounceResetIsScrollingId);
|
9957 |
-
}
|
9958 |
-
}
|
9959 |
-
}, {
|
9960 |
-
key: 'componentWillReceiveProps',
|
9961 |
-
value: function componentWillReceiveProps(nextProps) {
|
9962 |
-
var scrollTop = this.props.scrollTop;
|
9963 |
-
|
9964 |
-
|
9965 |
-
if (scrollTop !== nextProps.scrollTop) {
|
9966 |
-
this._debounceResetIsScrolling();
|
9967 |
-
|
9968 |
-
this.setState({
|
9969 |
-
isScrolling: true,
|
9970 |
-
scrollTop: nextProps.scrollTop
|
9971 |
-
});
|
9972 |
-
}
|
9973 |
-
}
|
9974 |
-
}, {
|
9975 |
-
key: 'render',
|
9976 |
-
value: function render() {
|
9977 |
-
var _this2 = this;
|
9978 |
-
|
9979 |
-
var _props = this.props,
|
9980 |
-
autoHeight = _props.autoHeight,
|
9981 |
-
cellCount = _props.cellCount,
|
9982 |
-
cellMeasurerCache = _props.cellMeasurerCache,
|
9983 |
-
cellRenderer = _props.cellRenderer,
|
9984 |
-
className = _props.className,
|
9985 |
-
height = _props.height,
|
9986 |
-
id = _props.id,
|
9987 |
-
keyMapper = _props.keyMapper,
|
9988 |
-
overscanByPixels = _props.overscanByPixels,
|
9989 |
-
role = _props.role,
|
9990 |
-
style = _props.style,
|
9991 |
-
tabIndex = _props.tabIndex,
|
9992 |
-
width = _props.width;
|
9993 |
-
var _state = this.state,
|
9994 |
-
isScrolling = _state.isScrolling,
|
9995 |
-
scrollTop = _state.scrollTop;
|
9996 |
-
|
9997 |
-
|
9998 |
-
var children = [];
|
9999 |
-
|
10000 |
-
var estimateTotalHeight = this._getEstimatedTotalHeight();
|
10001 |
-
|
10002 |
-
var shortestColumnSize = this._positionCache.shortestColumnSize;
|
10003 |
-
var measuredCellCount = this._positionCache.count;
|
10004 |
-
|
10005 |
-
var startIndex = 0;
|
10006 |
-
var stopIndex = void 0;
|
10007 |
-
|
10008 |
-
this._positionCache.range(Math.max(0, scrollTop - overscanByPixels), height + overscanByPixels * 2, function (index, left, top) {
|
10009 |
-
if (typeof stopIndex === 'undefined') {
|
10010 |
-
startIndex = index;
|
10011 |
-
stopIndex = index;
|
10012 |
-
} else {
|
10013 |
-
startIndex = Math.min(startIndex, index);
|
10014 |
-
stopIndex = Math.max(stopIndex, index);
|
10015 |
-
}
|
10016 |
-
|
10017 |
-
children.push(cellRenderer({
|
10018 |
-
index: index,
|
10019 |
-
isScrolling: isScrolling,
|
10020 |
-
key: keyMapper(index),
|
10021 |
-
parent: _this2,
|
10022 |
-
style: {
|
10023 |
-
height: cellMeasurerCache.getHeight(index),
|
10024 |
-
left: left,
|
10025 |
-
position: 'absolute',
|
10026 |
-
top: top,
|
10027 |
-
width: cellMeasurerCache.getWidth(index)
|
10028 |
-
}
|
10029 |
-
}));
|
10030 |
-
});
|
10031 |
-
|
10032 |
-
// We need to measure additional cells for this layout
|
10033 |
-
if (shortestColumnSize < scrollTop + height + overscanByPixels && measuredCellCount < cellCount) {
|
10034 |
-
var batchSize = Math.min(cellCount - measuredCellCount, Math.ceil((scrollTop + height + overscanByPixels - shortestColumnSize) / cellMeasurerCache.defaultHeight * width / cellMeasurerCache.defaultWidth));
|
10035 |
-
|
10036 |
-
for (var _index = measuredCellCount; _index < measuredCellCount + batchSize; _index++) {
|
10037 |
-
stopIndex = _index;
|
10038 |
-
|
10039 |
-
children.push(cellRenderer({
|
10040 |
-
index: _index,
|
10041 |
-
isScrolling: isScrolling,
|
10042 |
-
key: keyMapper(_index),
|
10043 |
-
parent: this,
|
10044 |
-
style: {
|
10045 |
-
width: cellMeasurerCache.getWidth(_index)
|
10046 |
-
}
|
10047 |
-
}));
|
10048 |
-
}
|
10049 |
-
}
|
10050 |
-
|
10051 |
-
this._startIndex = startIndex;
|
10052 |
-
this._stopIndex = stopIndex;
|
10053 |
-
|
10054 |
-
return __WEBPACK_IMPORTED_MODULE_6_react___default.a.createElement(
|
10055 |
-
'div',
|
10056 |
-
{
|
10057 |
-
ref: this._setScrollingContainerRef,
|
10058 |
-
'aria-label': this.props['aria-label'],
|
10059 |
-
className: __WEBPACK_IMPORTED_MODULE_7_classnames___default()('ReactVirtualized__Masonry', className),
|
10060 |
-
id: id,
|
10061 |
-
onScroll: this._onScroll,
|
10062 |
-
role: role,
|
10063 |
-
style: __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
10064 |
-
boxSizing: 'border-box',
|
10065 |
-
direction: 'ltr',
|
10066 |
-
height: autoHeight ? 'auto' : height,
|
10067 |
-
overflowX: 'hidden',
|
10068 |
-
overflowY: estimateTotalHeight < height ? 'hidden' : 'auto',
|
10069 |
-
position: 'relative',
|
10070 |
-
width: width,
|
10071 |
-
WebkitOverflowScrolling: 'touch',
|
10072 |
-
willChange: 'transform'
|
10073 |
-
}, style),
|
10074 |
-
tabIndex: tabIndex },
|
10075 |
-
__WEBPACK_IMPORTED_MODULE_6_react___default.a.createElement(
|
10076 |
-
'div',
|
10077 |
-
{
|
10078 |
-
className: 'ReactVirtualized__Masonry__innerScrollContainer',
|
10079 |
-
style: {
|
10080 |
-
width: '100%',
|
10081 |
-
height: estimateTotalHeight,
|
10082 |
-
maxWidth: '100%',
|
10083 |
-
maxHeight: estimateTotalHeight,
|
10084 |
-
overflow: 'hidden',
|
10085 |
-
pointerEvents: isScrolling ? 'none' : '',
|
10086 |
-
position: 'relative'
|
10087 |
-
} },
|
10088 |
-
children
|
10089 |
-
)
|
10090 |
-
);
|
10091 |
-
}
|
10092 |
-
}, {
|
10093 |
-
key: '_checkInvalidateOnUpdate',
|
10094 |
-
value: function _checkInvalidateOnUpdate() {
|
10095 |
-
if (typeof this._invalidateOnUpdateStartIndex === 'number') {
|
10096 |
-
var _startIndex = this._invalidateOnUpdateStartIndex;
|
10097 |
-
var _stopIndex = this._invalidateOnUpdateStopIndex;
|
10098 |
-
|
10099 |
-
this._invalidateOnUpdateStartIndex = null;
|
10100 |
-
this._invalidateOnUpdateStopIndex = null;
|
10101 |
-
|
10102 |
-
// Query external layout logic for position of newly-measured cells
|
10103 |
-
this._populatePositionCache(_startIndex, _stopIndex);
|
10104 |
-
|
10105 |
-
this.forceUpdate();
|
10106 |
-
}
|
10107 |
-
}
|
10108 |
-
}, {
|
10109 |
-
key: '_debounceResetIsScrolling',
|
10110 |
-
value: function _debounceResetIsScrolling() {
|
10111 |
-
var scrollingResetTimeInterval = this.props.scrollingResetTimeInterval;
|
10112 |
-
|
10113 |
-
|
10114 |
-
if (this._debounceResetIsScrollingId) {
|
10115 |
-
Object(__WEBPACK_IMPORTED_MODULE_9__utils_requestAnimationTimeout__["cancelAnimationTimeout"])(this._debounceResetIsScrollingId);
|
10116 |
-
}
|
10117 |
-
|
10118 |
-
this._debounceResetIsScrollingId = Object(__WEBPACK_IMPORTED_MODULE_9__utils_requestAnimationTimeout__["requestAnimationTimeout"])(this._debounceResetIsScrollingCallback, scrollingResetTimeInterval);
|
10119 |
-
}
|
10120 |
-
}, {
|
10121 |
-
key: '_debounceResetIsScrollingCallback',
|
10122 |
-
value: function _debounceResetIsScrollingCallback() {
|
10123 |
-
this.setState({
|
10124 |
-
isScrolling: false
|
10125 |
-
});
|
10126 |
-
}
|
10127 |
-
}, {
|
10128 |
-
key: '_getEstimatedTotalHeight',
|
10129 |
-
value: function _getEstimatedTotalHeight() {
|
10130 |
-
var _props2 = this.props,
|
10131 |
-
cellCount = _props2.cellCount,
|
10132 |
-
cellMeasurerCache = _props2.cellMeasurerCache,
|
10133 |
-
width = _props2.width;
|
10134 |
-
|
10135 |
-
|
10136 |
-
var estimatedColumnCount = Math.max(1, Math.floor(width / cellMeasurerCache.defaultWidth));
|
10137 |
-
|
10138 |
-
return this._positionCache.estimateTotalHeight(cellCount, estimatedColumnCount, cellMeasurerCache.defaultHeight);
|
10139 |
-
}
|
10140 |
-
}, {
|
10141 |
-
key: '_invokeOnScrollCallback',
|
10142 |
-
value: function _invokeOnScrollCallback() {
|
10143 |
-
var _props3 = this.props,
|
10144 |
-
height = _props3.height,
|
10145 |
-
onScroll = _props3.onScroll;
|
10146 |
-
var scrollTop = this.state.scrollTop;
|
10147 |
-
|
10148 |
-
|
10149 |
-
if (this._onScrollMemoized !== scrollTop) {
|
10150 |
-
onScroll({
|
10151 |
-
clientHeight: height,
|
10152 |
-
scrollHeight: this._getEstimatedTotalHeight(),
|
10153 |
-
scrollTop: scrollTop
|
10154 |
-
});
|
10155 |
-
|
10156 |
-
this._onScrollMemoized = scrollTop;
|
10157 |
-
}
|
10158 |
-
}
|
10159 |
-
}, {
|
10160 |
-
key: '_invokeOnCellsRenderedCallback',
|
10161 |
-
value: function _invokeOnCellsRenderedCallback() {
|
10162 |
-
if (this._startIndexMemoized !== this._startIndex || this._stopIndexMemoized !== this._stopIndex) {
|
10163 |
-
var _onCellsRendered = this.props.onCellsRendered;
|
10164 |
-
|
10165 |
-
|
10166 |
-
_onCellsRendered({
|
10167 |
-
startIndex: this._startIndex,
|
10168 |
-
stopIndex: this._stopIndex
|
10169 |
-
});
|
10170 |
-
|
10171 |
-
this._startIndexMemoized = this._startIndex;
|
10172 |
-
this._stopIndexMemoized = this._stopIndex;
|
10173 |
-
}
|
10174 |
-
}
|
10175 |
-
}, {
|
10176 |
-
key: '_populatePositionCache',
|
10177 |
-
value: function _populatePositionCache(startIndex, stopIndex) {
|
10178 |
-
var _props4 = this.props,
|
10179 |
-
cellMeasurerCache = _props4.cellMeasurerCache,
|
10180 |
-
cellPositioner = _props4.cellPositioner;
|
10181 |
-
|
10182 |
-
|
10183 |
-
for (var _index2 = startIndex; _index2 <= stopIndex; _index2++) {
|
10184 |
-
var _cellPositioner = cellPositioner(_index2),
|
10185 |
-
_left = _cellPositioner.left,
|
10186 |
-
_top = _cellPositioner.top;
|
10187 |
-
|
10188 |
-
this._positionCache.setPosition(_index2, _left, _top, cellMeasurerCache.getHeight(_index2));
|
10189 |
-
}
|
10190 |
-
}
|
10191 |
-
}, {
|
10192 |
-
key: '_setScrollingContainerRef',
|
10193 |
-
value: function _setScrollingContainerRef(ref) {
|
10194 |
-
this._scrollingContainer = ref;
|
10195 |
-
}
|
10196 |
-
}, {
|
10197 |
-
key: '_onScroll',
|
10198 |
-
value: function _onScroll(event) {
|
10199 |
-
var height = this.props.height;
|
10200 |
-
|
10201 |
-
|
10202 |
-
var eventScrollTop = event.target.scrollTop;
|
10203 |
-
|
10204 |
-
// When this component is shrunk drastically, React dispatches a series of back-to-back scroll events,
|
10205 |
-
// Gradually converging on a scrollTop that is within the bounds of the new, smaller height.
|
10206 |
-
// This causes a series of rapid renders that is slow for long lists.
|
10207 |
-
// We can avoid that by doing some simple bounds checking to ensure that scroll offsets never exceed their bounds.
|
10208 |
-
var scrollTop = Math.min(Math.max(0, this._getEstimatedTotalHeight() - height), eventScrollTop);
|
10209 |
-
|
10210 |
-
// On iOS, we can arrive at negative offsets by swiping past the start or end.
|
10211 |
-
// Avoid re-rendering in this case as it can cause problems; see #532 for more.
|
10212 |
-
if (eventScrollTop !== scrollTop) {
|
10213 |
-
return;
|
10214 |
-
}
|
10215 |
-
|
10216 |
-
// Prevent pointer events from interrupting a smooth scroll
|
10217 |
-
this._debounceResetIsScrolling();
|
10218 |
-
|
10219 |
-
// Certain devices (like Apple touchpad) rapid-fire duplicate events.
|
10220 |
-
// Don't force a re-render if this is the case.
|
10221 |
-
// The mouse may move faster then the animation frame does.
|
10222 |
-
// Use requestAnimationFrame to avoid over-updating.
|
10223 |
-
if (this.state.scrollTop !== scrollTop) {
|
10224 |
-
this.setState({
|
10225 |
-
isScrolling: true,
|
10226 |
-
scrollTop: scrollTop
|
10227 |
-
});
|
10228 |
-
}
|
10229 |
-
}
|
10230 |
-
}]);
|
10231 |
-
|
10232 |
-
return Masonry;
|
10233 |
-
}(__WEBPACK_IMPORTED_MODULE_6_react__["PureComponent"]);
|
10234 |
-
|
10235 |
-
Masonry.defaultProps = {
|
10236 |
-
autoHeight: false,
|
10237 |
-
keyMapper: identity,
|
10238 |
-
onCellsRendered: noop,
|
10239 |
-
onScroll: noop,
|
10240 |
-
overscanByPixels: 20,
|
10241 |
-
role: 'grid',
|
10242 |
-
scrollingResetTimeInterval: DEFAULT_SCROLLING_RESET_TIME_INTERVAL,
|
10243 |
-
style: emptyObject,
|
10244 |
-
tabIndex: 0
|
10245 |
-
};
|
10246 |
-
/* harmony default export */ __webpack_exports__["default"] = (Masonry);
|
10247 |
-
|
10248 |
-
|
10249 |
-
function identity(value) {
|
10250 |
-
return value;
|
10251 |
-
}
|
10252 |
-
|
10253 |
-
function noop() {}
|
10254 |
-
|
10255 |
-
var babelPluginFlowReactPropTypes_proptype_CellMeasurerCache = {
|
10256 |
-
defaultHeight: __webpack_require__(0).number.isRequired,
|
10257 |
-
defaultWidth: __webpack_require__(0).number.isRequired,
|
10258 |
-
getHeight: __webpack_require__(0).func.isRequired,
|
10259 |
-
getWidth: __webpack_require__(0).func.isRequired
|
10260 |
-
};
|
10261 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellMeasurerCache', {
|
10262 |
-
value: babelPluginFlowReactPropTypes_proptype_CellMeasurerCache,
|
10263 |
-
configurable: true
|
10264 |
-
});
|
10265 |
-
|
10266 |
-
var babelPluginFlowReactPropTypes_proptype_Positioner = __webpack_require__(0).func;
|
10267 |
-
|
10268 |
-
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_Positioner', {
|
10269 |
-
value: babelPluginFlowReactPropTypes_proptype_Positioner,
|
10270 |
-
configurable: true
|
10271 |
-
});
|
10272 |
-
|
10273 |
-
/***/ }),
|
10274 |
-
/* 180 */
|
10275 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10276 |
-
|
10277 |
-
"use strict";
|
10278 |
-
|
10279 |
-
|
10280 |
-
Object.defineProperty(exports, "__esModule", {
|
10281 |
-
value: true
|
10282 |
-
});
|
10283 |
-
|
10284 |
-
var _DragDropContext = __webpack_require__(265);
|
10285 |
-
|
10286 |
-
Object.defineProperty(exports, 'DragDropContext', {
|
10287 |
-
enumerable: true,
|
10288 |
-
get: function get() {
|
10289 |
-
return _interopRequireDefault(_DragDropContext).default;
|
10290 |
-
}
|
10291 |
-
});
|
10292 |
-
|
10293 |
-
var _DragDropContextProvider = __webpack_require__(687);
|
10294 |
-
|
10295 |
-
Object.defineProperty(exports, 'DragDropContextProvider', {
|
10296 |
-
enumerable: true,
|
10297 |
-
get: function get() {
|
10298 |
-
return _interopRequireDefault(_DragDropContextProvider).default;
|
10299 |
-
}
|
10300 |
-
});
|
10301 |
-
|
10302 |
-
var _DragLayer = __webpack_require__(688);
|
10303 |
-
|
10304 |
-
Object.defineProperty(exports, 'DragLayer', {
|
10305 |
-
enumerable: true,
|
10306 |
-
get: function get() {
|
10307 |
-
return _interopRequireDefault(_DragLayer).default;
|
10308 |
-
}
|
10309 |
-
});
|
10310 |
-
|
10311 |
-
var _DragSource = __webpack_require__(689);
|
10312 |
-
|
10313 |
-
Object.defineProperty(exports, 'DragSource', {
|
10314 |
-
enumerable: true,
|
10315 |
-
get: function get() {
|
10316 |
-
return _interopRequireDefault(_DragSource).default;
|
10317 |
-
}
|
10318 |
-
});
|
10319 |
-
|
10320 |
-
var _DropTarget = __webpack_require__(699);
|
10321 |
-
|
10322 |
-
Object.defineProperty(exports, 'DropTarget', {
|
10323 |
-
enumerable: true,
|
10324 |
-
get: function get() {
|
10325 |
-
return _interopRequireDefault(_DropTarget).default;
|
10326 |
-
}
|
10327 |
-
});
|
10328 |
-
|
10329 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
10330 |
-
|
10331 |
-
/***/ }),
|
10332 |
-
/* 181 */
|
10333 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10334 |
-
|
10335 |
-
var root = __webpack_require__(94);
|
10336 |
-
|
10337 |
-
/** Built-in value references. */
|
10338 |
-
var Symbol = root.Symbol;
|
10339 |
-
|
10340 |
-
module.exports = Symbol;
|
10341 |
-
|
10342 |
-
|
10343 |
-
/***/ }),
|
10344 |
-
/* 182 */
|
10345 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10346 |
-
|
10347 |
-
var MapCache = __webpack_require__(271),
|
10348 |
-
setCacheAdd = __webpack_require__(655),
|
10349 |
-
setCacheHas = __webpack_require__(656);
|
10350 |
-
|
10351 |
-
/**
|
10352 |
-
*
|
10353 |
-
* Creates an array cache object to store unique values.
|
10354 |
-
*
|
10355 |
-
* @private
|
10356 |
-
* @constructor
|
10357 |
-
* @param {Array} [values] The values to cache.
|
10358 |
-
*/
|
10359 |
-
function SetCache(values) {
|
10360 |
-
var index = -1,
|
10361 |
-
length = values == null ? 0 : values.length;
|
10362 |
-
|
10363 |
-
this.__data__ = new MapCache;
|
10364 |
-
while (++index < length) {
|
10365 |
-
this.add(values[index]);
|
10366 |
-
}
|
10367 |
-
}
|
10368 |
-
|
10369 |
-
// Add methods to `SetCache`.
|
10370 |
-
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
|
10371 |
-
SetCache.prototype.has = setCacheHas;
|
10372 |
-
|
10373 |
-
module.exports = SetCache;
|
10374 |
-
|
10375 |
-
|
10376 |
-
/***/ }),
|
10377 |
-
/* 183 */
|
10378 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10379 |
-
|
10380 |
-
var baseIndexOf = __webpack_require__(657);
|
10381 |
-
|
10382 |
-
/**
|
10383 |
-
* A specialized version of `_.includes` for arrays without support for
|
10384 |
-
* specifying an index to search from.
|
10385 |
-
*
|
10386 |
-
* @private
|
10387 |
-
* @param {Array} [array] The array to inspect.
|
10388 |
-
* @param {*} target The value to search for.
|
10389 |
-
* @returns {boolean} Returns `true` if `target` is found, else `false`.
|
10390 |
-
*/
|
10391 |
-
function arrayIncludes(array, value) {
|
10392 |
-
var length = array == null ? 0 : array.length;
|
10393 |
-
return !!length && baseIndexOf(array, value, 0) > -1;
|
10394 |
-
}
|
10395 |
-
|
10396 |
-
module.exports = arrayIncludes;
|
10397 |
-
|
10398 |
-
|
10399 |
-
/***/ }),
|
10400 |
-
/* 184 */
|
10401 |
-
/***/ (function(module, exports) {
|
10402 |
-
|
10403 |
-
/**
|
10404 |
-
* This function is like `arrayIncludes` except that it accepts a comparator.
|
10405 |
-
*
|
10406 |
-
* @private
|
10407 |
-
* @param {Array} [array] The array to inspect.
|
10408 |
-
* @param {*} target The value to search for.
|
10409 |
-
* @param {Function} comparator The comparator invoked per element.
|
10410 |
-
* @returns {boolean} Returns `true` if `target` is found, else `false`.
|
10411 |
-
*/
|
10412 |
-
function arrayIncludesWith(array, value, comparator) {
|
10413 |
-
var index = -1,
|
10414 |
-
length = array == null ? 0 : array.length;
|
10415 |
-
|
10416 |
-
while (++index < length) {
|
10417 |
-
if (comparator(value, array[index])) {
|
10418 |
-
return true;
|
10419 |
-
}
|
10420 |
-
}
|
10421 |
-
return false;
|
10422 |
-
}
|
10423 |
-
|
10424 |
-
module.exports = arrayIncludesWith;
|
10425 |
-
|
10426 |
-
|
10427 |
-
/***/ }),
|
10428 |
-
/* 185 */
|
10429 |
-
/***/ (function(module, exports) {
|
10430 |
-
|
10431 |
-
/**
|
10432 |
-
* A specialized version of `_.map` for arrays without support for iteratee
|
10433 |
-
* shorthands.
|
10434 |
-
*
|
10435 |
-
* @private
|
10436 |
-
* @param {Array} [array] The array to iterate over.
|
10437 |
-
* @param {Function} iteratee The function invoked per iteration.
|
10438 |
-
* @returns {Array} Returns the new mapped array.
|
10439 |
-
*/
|
10440 |
-
function arrayMap(array, iteratee) {
|
10441 |
-
var index = -1,
|
10442 |
-
length = array == null ? 0 : array.length,
|
10443 |
-
result = Array(length);
|
10444 |
-
|
10445 |
-
while (++index < length) {
|
10446 |
-
result[index] = iteratee(array[index], index, array);
|
10447 |
-
}
|
10448 |
-
return result;
|
10449 |
-
}
|
10450 |
-
|
10451 |
-
module.exports = arrayMap;
|
10452 |
-
|
10453 |
-
|
10454 |
-
/***/ }),
|
10455 |
-
/* 186 */
|
10456 |
-
/***/ (function(module, exports) {
|
10457 |
-
|
10458 |
-
/**
|
10459 |
-
* The base implementation of `_.unary` without support for storing metadata.
|
10460 |
-
*
|
10461 |
-
* @private
|
10462 |
-
* @param {Function} func The function to cap arguments for.
|
10463 |
-
* @returns {Function} Returns the new capped function.
|
10464 |
-
*/
|
10465 |
-
function baseUnary(func) {
|
10466 |
-
return function(value) {
|
10467 |
-
return func(value);
|
10468 |
-
};
|
10469 |
-
}
|
10470 |
-
|
10471 |
-
module.exports = baseUnary;
|
10472 |
-
|
10473 |
-
|
10474 |
-
/***/ }),
|
10475 |
-
/* 187 */
|
10476 |
-
/***/ (function(module, exports) {
|
10477 |
-
|
10478 |
-
/**
|
10479 |
-
* Checks if a `cache` value for `key` exists.
|
10480 |
-
*
|
10481 |
-
* @private
|
10482 |
-
* @param {Object} cache The cache to query.
|
10483 |
-
* @param {string} key The key of the entry to check.
|
10484 |
-
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
|
10485 |
-
*/
|
10486 |
-
function cacheHas(cache, key) {
|
10487 |
-
return cache.has(key);
|
10488 |
-
}
|
10489 |
-
|
10490 |
-
module.exports = cacheHas;
|
10491 |
-
|
10492 |
-
|
10493 |
-
/***/ }),
|
10494 |
-
/* 188 */
|
10495 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10496 |
-
|
10497 |
-
var isFunction = __webpack_require__(272),
|
10498 |
-
isLength = __webpack_require__(276);
|
10499 |
-
|
10500 |
-
/**
|
10501 |
-
* Checks if `value` is array-like. A value is considered array-like if it's
|
10502 |
-
* not a function and has a `value.length` that's an integer greater than or
|
10503 |
-
* equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
|
10504 |
-
*
|
10505 |
-
* @static
|
10506 |
-
* @memberOf _
|
10507 |
-
* @since 4.0.0
|
10508 |
-
* @category Lang
|
10509 |
-
* @param {*} value The value to check.
|
10510 |
-
* @returns {boolean} Returns `true` if `value` is array-like, else `false`.
|
10511 |
-
* @example
|
10512 |
-
*
|
10513 |
-
* _.isArrayLike([1, 2, 3]);
|
10514 |
-
* // => true
|
10515 |
-
*
|
10516 |
-
* _.isArrayLike(document.body.children);
|
10517 |
-
* // => true
|
10518 |
-
*
|
10519 |
-
* _.isArrayLike('abc');
|
10520 |
-
* // => true
|
10521 |
-
*
|
10522 |
-
* _.isArrayLike(_.noop);
|
10523 |
-
* // => false
|
10524 |
-
*/
|
10525 |
-
function isArrayLike(value) {
|
10526 |
-
return value != null && isLength(value.length) && !isFunction(value);
|
10527 |
-
}
|
10528 |
-
|
10529 |
-
module.exports = isArrayLike;
|
10530 |
-
|
10531 |
-
|
10532 |
-
/***/ }),
|
10533 |
-
/* 189 */
|
10534 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10535 |
-
|
10536 |
-
"use strict";
|
10537 |
-
/**
|
10538 |
-
* Copyright 2015, Yahoo! Inc.
|
10539 |
-
* Copyrights licensed under the New BSD License. See the accompanying LICENSE file for terms.
|
10540 |
-
*/
|
10541 |
-
|
10542 |
-
|
10543 |
-
var REACT_STATICS = {
|
10544 |
-
childContextTypes: true,
|
10545 |
-
contextTypes: true,
|
10546 |
-
defaultProps: true,
|
10547 |
-
displayName: true,
|
10548 |
-
getDefaultProps: true,
|
10549 |
-
mixins: true,
|
10550 |
-
propTypes: true,
|
10551 |
-
type: true
|
10552 |
-
};
|
10553 |
-
|
10554 |
-
var KNOWN_STATICS = {
|
10555 |
-
name: true,
|
10556 |
-
length: true,
|
10557 |
-
prototype: true,
|
10558 |
-
caller: true,
|
10559 |
-
callee: true,
|
10560 |
-
arguments: true,
|
10561 |
-
arity: true
|
10562 |
-
};
|
10563 |
-
|
10564 |
-
var defineProperty = Object.defineProperty;
|
10565 |
-
var getOwnPropertyNames = Object.getOwnPropertyNames;
|
10566 |
-
var getOwnPropertySymbols = Object.getOwnPropertySymbols;
|
10567 |
-
var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
10568 |
-
var getPrototypeOf = Object.getPrototypeOf;
|
10569 |
-
var objectPrototype = getPrototypeOf && getPrototypeOf(Object);
|
10570 |
-
|
10571 |
-
module.exports = function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) {
|
10572 |
-
if (typeof sourceComponent !== 'string') { // don't hoist over string (html) components
|
10573 |
-
|
10574 |
-
if (objectPrototype) {
|
10575 |
-
var inheritedComponent = getPrototypeOf(sourceComponent);
|
10576 |
-
if (inheritedComponent && inheritedComponent !== objectPrototype) {
|
10577 |
-
hoistNonReactStatics(targetComponent, inheritedComponent, blacklist);
|
10578 |
-
}
|
10579 |
-
}
|
10580 |
-
|
10581 |
-
var keys = getOwnPropertyNames(sourceComponent);
|
10582 |
-
|
10583 |
-
if (getOwnPropertySymbols) {
|
10584 |
-
keys = keys.concat(getOwnPropertySymbols(sourceComponent));
|
10585 |
-
}
|
10586 |
-
|
10587 |
-
for (var i = 0; i < keys.length; ++i) {
|
10588 |
-
var key = keys[i];
|
10589 |
-
if (!REACT_STATICS[key] && !KNOWN_STATICS[key] && (!blacklist || !blacklist[key])) {
|
10590 |
-
var descriptor = getOwnPropertyDescriptor(sourceComponent, key);
|
10591 |
-
try { // Avoid failures from read-only properties
|
10592 |
-
defineProperty(targetComponent, key, descriptor);
|
10593 |
-
} catch (e) {}
|
10594 |
-
}
|
10595 |
-
}
|
10596 |
-
|
10597 |
-
return targetComponent;
|
10598 |
-
}
|
10599 |
-
|
10600 |
-
return targetComponent;
|
10601 |
-
};
|
10602 |
-
|
10603 |
-
|
10604 |
-
/***/ }),
|
10605 |
-
/* 190 */
|
10606 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10607 |
-
|
10608 |
-
"use strict";
|
10609 |
-
|
10610 |
-
|
10611 |
-
Object.defineProperty(exports, "__esModule", {
|
10612 |
-
value: true
|
10613 |
-
});
|
10614 |
-
exports.default = shallowEqual;
|
10615 |
-
function shallowEqual(objA, objB) {
|
10616 |
-
if (objA === objB) {
|
10617 |
-
return true;
|
10618 |
-
}
|
10619 |
-
|
10620 |
-
var keysA = Object.keys(objA);
|
10621 |
-
var keysB = Object.keys(objB);
|
10622 |
-
|
10623 |
-
if (keysA.length !== keysB.length) {
|
10624 |
-
return false;
|
10625 |
-
}
|
10626 |
-
|
10627 |
-
// Test for A's keys different from B.
|
10628 |
-
var hasOwn = Object.prototype.hasOwnProperty;
|
10629 |
-
for (var i = 0; i < keysA.length; i += 1) {
|
10630 |
-
if (!hasOwn.call(objB, keysA[i]) || objA[keysA[i]] !== objB[keysA[i]]) {
|
10631 |
-
return false;
|
10632 |
-
}
|
10633 |
-
|
10634 |
-
var valA = objA[keysA[i]];
|
10635 |
-
var valB = objB[keysA[i]];
|
10636 |
-
|
10637 |
-
if (valA !== valB) {
|
10638 |
-
return false;
|
10639 |
-
}
|
10640 |
-
}
|
10641 |
-
|
10642 |
-
return true;
|
10643 |
-
}
|
10644 |
-
|
10645 |
-
/***/ }),
|
10646 |
-
/* 191 */
|
10647 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10648 |
-
|
10649 |
-
"use strict";
|
10650 |
-
|
10651 |
-
|
10652 |
-
exports.__esModule = true;
|
10653 |
-
exports['default'] = isDisposable;
|
10654 |
-
|
10655 |
-
function isDisposable(obj) {
|
10656 |
-
return Boolean(obj && typeof obj.dispose === 'function');
|
10657 |
-
}
|
10658 |
-
|
10659 |
-
module.exports = exports['default'];
|
10660 |
-
|
10661 |
-
/***/ }),
|
10662 |
-
/* 192 */
|
10663 |
-
/***/ (function(module, exports, __webpack_require__) {
|
10664 |
-
|
10665 |
-
"use strict";
|
10666 |
-
|
10667 |
-
|
10668 |
-
Object.defineProperty(exports, "__esModule", {
|
10669 |
-
value: true
|
10670 |
-
});
|
10671 |
-
var FILE = exports.FILE = '__NATIVE_FILE__';
|
10672 |
-
var URL = exports.URL = '__NATIVE_URL__';
|
10673 |
-
var TEXT = exports.TEXT = '__NATIVE_TEXT__';
|
10674 |
-
|
10675 |
-
/***/ }),
|
10676 |
-
/* 193 */
|
10677 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
10678 |
-
|
10679 |
-
"use strict";
|
10680 |
-
/**
|
10681 |
-
* @ignore
|
10682 |
-
* some key-codes definition and utils from closure-library
|
10683 |
-
* @author yiminghe@gmail.com
|
10684 |
-
*/
|
10685 |
-
|
10686 |
-
var KeyCode = {
|
10687 |
-
/**
|
10688 |
-
* MAC_ENTER
|
10689 |
-
*/
|
10690 |
-
MAC_ENTER: 3,
|
10691 |
-
/**
|
10692 |
-
* BACKSPACE
|
10693 |
-
*/
|
10694 |
-
BACKSPACE: 8,
|
10695 |
-
/**
|
10696 |
-
* TAB
|
10697 |
-
*/
|
10698 |
-
TAB: 9,
|
10699 |
-
/**
|
10700 |
-
* NUMLOCK on FF/Safari Mac
|
10701 |
-
*/
|
10702 |
-
NUM_CENTER: 12, // NUMLOCK on FF/Safari Mac
|
10703 |
-
/**
|
10704 |
-
* ENTER
|
10705 |
-
*/
|
10706 |
-
ENTER: 13,
|
10707 |
-
/**
|
10708 |
-
* SHIFT
|
10709 |
-
*/
|
10710 |
-
SHIFT: 16,
|
10711 |
-
/**
|
10712 |
-
* CTRL
|
10713 |
-
*/
|
10714 |
-
CTRL: 17,
|
10715 |
-
/**
|
10716 |
-
* ALT
|
10717 |
-
*/
|
10718 |
-
ALT: 18,
|
10719 |
-
/**
|
10720 |
-
* PAUSE
|
10721 |
-
*/
|
10722 |
-
PAUSE: 19,
|
10723 |
-
/**
|
10724 |
-
* CAPS_LOCK
|
10725 |
-
*/
|
10726 |
-
CAPS_LOCK: 20,
|
10727 |
-
/**
|
10728 |
-
* ESC
|
10729 |
-
*/
|
10730 |
-
ESC: 27,
|
10731 |
-
/**
|
10732 |
-
* SPACE
|
10733 |
-
*/
|
10734 |
-
SPACE: 32,
|
10735 |
-
/**
|
10736 |
-
* PAGE_UP
|
10737 |
-
*/
|
10738 |
-
PAGE_UP: 33, // also NUM_NORTH_EAST
|
10739 |
-
/**
|
10740 |
-
* PAGE_DOWN
|
10741 |
-
*/
|
10742 |
-
PAGE_DOWN: 34, // also NUM_SOUTH_EAST
|
10743 |
-
/**
|
10744 |
-
* END
|
10745 |
-
*/
|
10746 |
-
END: 35, // also NUM_SOUTH_WEST
|
10747 |
-
/**
|
10748 |
-
* HOME
|
10749 |
-
*/
|
10750 |
-
HOME: 36, // also NUM_NORTH_WEST
|
10751 |
-
/**
|
10752 |
-
* LEFT
|
10753 |
-
*/
|
10754 |
-
LEFT: 37, // also NUM_WEST
|
10755 |
-
/**
|
10756 |
-
* UP
|
10757 |
-
*/
|
10758 |
-
UP: 38, // also NUM_NORTH
|
10759 |
-
/**
|
10760 |
-
* RIGHT
|
10761 |
-
*/
|
10762 |
-
RIGHT: 39, // also NUM_EAST
|
10763 |
-
/**
|
10764 |
-
* DOWN
|
10765 |
-
*/
|
10766 |
-
DOWN: 40, // also NUM_SOUTH
|
10767 |
-
/**
|
10768 |
-
* PRINT_SCREEN
|
10769 |
-
*/
|
10770 |
-
PRINT_SCREEN: 44,
|
10771 |
-
/**
|
10772 |
-
* INSERT
|
10773 |
-
*/
|
10774 |
-
INSERT: 45, // also NUM_INSERT
|
10775 |
-
/**
|
10776 |
-
* DELETE
|
10777 |
-
*/
|
10778 |
-
DELETE: 46, // also NUM_DELETE
|
10779 |
-
/**
|
10780 |
-
* ZERO
|
10781 |
-
*/
|
10782 |
-
ZERO: 48,
|
10783 |
-
/**
|
10784 |
-
* ONE
|
10785 |
-
*/
|
10786 |
-
ONE: 49,
|
10787 |
-
/**
|
10788 |
-
* TWO
|
10789 |
-
*/
|
10790 |
-
TWO: 50,
|
10791 |
-
/**
|
10792 |
-
* THREE
|
10793 |
-
*/
|
10794 |
-
THREE: 51,
|
10795 |
-
/**
|
10796 |
-
* FOUR
|
10797 |
-
*/
|
10798 |
-
FOUR: 52,
|
10799 |
-
/**
|
10800 |
-
* FIVE
|
10801 |
-
*/
|
10802 |
-
FIVE: 53,
|
10803 |
-
/**
|
10804 |
-
* SIX
|
10805 |
-
*/
|
10806 |
-
SIX: 54,
|
10807 |
-
/**
|
10808 |
-
* SEVEN
|
10809 |
-
*/
|
10810 |
-
SEVEN: 55,
|
10811 |
-
/**
|
10812 |
-
* EIGHT
|
10813 |
-
*/
|
10814 |
-
EIGHT: 56,
|
10815 |
-
/**
|
10816 |
-
* NINE
|
10817 |
-
*/
|
10818 |
-
NINE: 57,
|
10819 |
-
/**
|
10820 |
-
* QUESTION_MARK
|
10821 |
-
*/
|
10822 |
-
QUESTION_MARK: 63, // needs localization
|
10823 |
-
/**
|
10824 |
-
* A
|
10825 |
-
*/
|
10826 |
-
A: 65,
|
10827 |
-
/**
|
10828 |
-
* B
|
10829 |
-
*/
|
10830 |
-
B: 66,
|
10831 |
-
/**
|
10832 |
-
* C
|
10833 |
-
*/
|
10834 |
-
C: 67,
|
10835 |
-
/**
|
10836 |
-
* D
|
10837 |
-
*/
|
10838 |
-
D: 68,
|
10839 |
-
/**
|
10840 |
-
* E
|
10841 |
-
*/
|
10842 |
-
E: 69,
|
10843 |
-
/**
|
10844 |
-
* F
|
10845 |
-
*/
|
10846 |
-
F: 70,
|
10847 |
-
/**
|
10848 |
-
* G
|
10849 |
-
*/
|
10850 |
-
G: 71,
|
10851 |
-
/**
|
10852 |
-
* H
|
10853 |
-
*/
|
10854 |
-
H: 72,
|
10855 |
-
/**
|
10856 |
-
* I
|
10857 |
-
*/
|
10858 |
-
I: 73,
|
10859 |
-
/**
|
10860 |
-
* J
|
10861 |
-
*/
|
10862 |
-
J: 74,
|
10863 |
-
/**
|
10864 |
-
* K
|
10865 |
-
*/
|
10866 |
-
K: 75,
|
10867 |
-
/**
|
10868 |
-
* L
|
10869 |
-
*/
|
10870 |
-
L: 76,
|
10871 |
-
/**
|
10872 |
-
* M
|
10873 |
-
*/
|
10874 |
-
M: 77,
|
10875 |
-
/**
|
10876 |
-
* N
|
10877 |
-
*/
|
10878 |
-
N: 78,
|
10879 |
-
/**
|
10880 |
-
* O
|
10881 |
-
*/
|
10882 |
-
O: 79,
|
10883 |
-
/**
|
10884 |
-
* P
|
10885 |
-
*/
|
10886 |
-
P: 80,
|
10887 |
-
/**
|
10888 |
-
* Q
|
10889 |
-
*/
|
10890 |
-
Q: 81,
|
10891 |
-
/**
|
10892 |
-
* R
|
10893 |
-
*/
|
10894 |
-
R: 82,
|
10895 |
-
/**
|
10896 |
-
* S
|
10897 |
-
*/
|
10898 |
-
S: 83,
|
10899 |
-
/**
|
10900 |
-
* T
|
10901 |
-
*/
|
10902 |
-
T: 84,
|
10903 |
-
/**
|
10904 |
-
* U
|
10905 |
-
*/
|
10906 |
-
U: 85,
|
10907 |
-
/**
|
10908 |
-
* V
|
10909 |
-
*/
|
10910 |
-
V: 86,
|
10911 |
-
/**
|
10912 |
-
* W
|
10913 |
-
*/
|
10914 |
-
W: 87,
|
10915 |
-
/**
|
10916 |
-
* X
|
10917 |
-
*/
|
10918 |
-
X: 88,
|
10919 |
-
/**
|
10920 |
-
* Y
|
10921 |
-
*/
|
10922 |
-
Y: 89,
|
10923 |
-
/**
|
10924 |
-
* Z
|
10925 |
-
*/
|
10926 |
-
Z: 90,
|
10927 |
-
/**
|
10928 |
-
* META
|
10929 |
-
*/
|
10930 |
-
META: 91, // WIN_KEY_LEFT
|
10931 |
-
/**
|
10932 |
-
* WIN_KEY_RIGHT
|
10933 |
-
*/
|
10934 |
-
WIN_KEY_RIGHT: 92,
|
10935 |
-
/**
|
10936 |
-
* CONTEXT_MENU
|
10937 |
-
*/
|
10938 |
-
CONTEXT_MENU: 93,
|
10939 |
-
/**
|
10940 |
-
* NUM_ZERO
|
10941 |
-
*/
|
10942 |
-
NUM_ZERO: 96,
|
10943 |
-
/**
|
10944 |
-
* NUM_ONE
|
10945 |
-
*/
|
10946 |
-
NUM_ONE: 97,
|
10947 |
-
/**
|
10948 |
-
* NUM_TWO
|
10949 |
-
*/
|
10950 |
-
NUM_TWO: 98,
|
10951 |
-
/**
|
10952 |
-
* NUM_THREE
|
10953 |
-
*/
|
10954 |
-
NUM_THREE: 99,
|
10955 |
-
/**
|
10956 |
-
* NUM_FOUR
|
10957 |
-
*/
|
10958 |
-
NUM_FOUR: 100,
|
10959 |
-
/**
|
10960 |
-
* NUM_FIVE
|
10961 |
-
*/
|
10962 |
-
NUM_FIVE: 101,
|
10963 |
-
/**
|
10964 |
-
* NUM_SIX
|
10965 |
-
*/
|
10966 |
-
NUM_SIX: 102,
|
10967 |
-
/**
|
10968 |
-
* NUM_SEVEN
|
10969 |
-
*/
|
10970 |
-
NUM_SEVEN: 103,
|
10971 |
-
/**
|
10972 |
-
* NUM_EIGHT
|
10973 |
-
*/
|
10974 |
-
NUM_EIGHT: 104,
|
10975 |
-
/**
|
10976 |
-
* NUM_NINE
|
10977 |
-
*/
|
10978 |
-
NUM_NINE: 105,
|
10979 |
-
/**
|
10980 |
-
* NUM_MULTIPLY
|
10981 |
-
*/
|
10982 |
-
NUM_MULTIPLY: 106,
|
10983 |
-
/**
|
10984 |
-
* NUM_PLUS
|
10985 |
-
*/
|
10986 |
-
NUM_PLUS: 107,
|
10987 |
-
/**
|
10988 |
-
* NUM_MINUS
|
10989 |
-
*/
|
10990 |
-
NUM_MINUS: 109,
|
10991 |
-
/**
|
10992 |
-
* NUM_PERIOD
|
10993 |
-
*/
|
10994 |
-
NUM_PERIOD: 110,
|
10995 |
-
/**
|
10996 |
-
* NUM_DIVISION
|
10997 |
-
*/
|
10998 |
-
NUM_DIVISION: 111,
|
10999 |
-
/**
|
11000 |
-
* F1
|
11001 |
-
*/
|
11002 |
-
F1: 112,
|
11003 |
-
/**
|
11004 |
-
* F2
|
11005 |
-
*/
|
11006 |
-
F2: 113,
|
11007 |
-
/**
|
11008 |
-
* F3
|
11009 |
-
*/
|
11010 |
-
F3: 114,
|
11011 |
-
/**
|
11012 |
-
* F4
|
11013 |
-
*/
|
11014 |
-
F4: 115,
|
11015 |
-
/**
|
11016 |
-
* F5
|
11017 |
-
*/
|
11018 |
-
F5: 116,
|
11019 |
-
/**
|
11020 |
-
* F6
|
11021 |
-
*/
|
11022 |
-
F6: 117,
|
11023 |
-
/**
|
11024 |
-
* F7
|
11025 |
-
*/
|
11026 |
-
F7: 118,
|
11027 |
-
/**
|
11028 |
-
* F8
|
11029 |
-
*/
|
11030 |
-
F8: 119,
|
11031 |
-
/**
|
11032 |
-
* F9
|
11033 |
-
*/
|
11034 |
-
F9: 120,
|
11035 |
-
/**
|
11036 |
-
* F10
|
11037 |
-
*/
|
11038 |
-
F10: 121,
|
11039 |
-
/**
|
11040 |
-
* F11
|
11041 |
-
*/
|
11042 |
-
F11: 122,
|
11043 |
-
/**
|
11044 |
-
* F12
|
11045 |
-
*/
|
11046 |
-
F12: 123,
|
11047 |
-
/**
|
11048 |
-
* NUMLOCK
|
11049 |
-
*/
|
11050 |
-
NUMLOCK: 144,
|
11051 |
-
/**
|
11052 |
-
* SEMICOLON
|
11053 |
-
*/
|
11054 |
-
SEMICOLON: 186, // needs localization
|
11055 |
-
/**
|
11056 |
-
* DASH
|
11057 |
-
*/
|
11058 |
-
DASH: 189, // needs localization
|
11059 |
-
/**
|
11060 |
-
* EQUALS
|
11061 |
-
*/
|
11062 |
-
EQUALS: 187, // needs localization
|
11063 |
-
/**
|
11064 |
-
* COMMA
|
11065 |
-
*/
|
11066 |
-
COMMA: 188, // needs localization
|
11067 |
-
/**
|
11068 |
-
* PERIOD
|
11069 |
-
*/
|
11070 |
-
PERIOD: 190, // needs localization
|
11071 |
-
/**
|
11072 |
-
* SLASH
|
11073 |
-
*/
|
11074 |
-
SLASH: 191, // needs localization
|
11075 |
-
/**
|
11076 |
-
* APOSTROPHE
|
11077 |
-
*/
|
11078 |
-
APOSTROPHE: 192, // needs localization
|
11079 |
-
/**
|
11080 |
-
* SINGLE_QUOTE
|
11081 |
-
*/
|
11082 |
-
SINGLE_QUOTE: 222, // needs localization
|
11083 |
-
/**
|
11084 |
-
* OPEN_SQUARE_BRACKET
|
11085 |
-
*/
|
11086 |
-
OPEN_SQUARE_BRACKET: 219, // needs localization
|
11087 |
-
/**
|
11088 |
-
* BACKSLASH
|
11089 |
-
*/
|
11090 |
-
BACKSLASH: 220, // needs localization
|
11091 |
-
/**
|
11092 |
-
* CLOSE_SQUARE_BRACKET
|
11093 |
-
*/
|
11094 |
-
CLOSE_SQUARE_BRACKET: 221, // needs localization
|
11095 |
-
/**
|
11096 |
-
* WIN_KEY
|
11097 |
-
*/
|
11098 |
-
WIN_KEY: 224,
|
11099 |
-
/**
|
11100 |
-
* MAC_FF_META
|
11101 |
-
*/
|
11102 |
-
MAC_FF_META: 224, // Firefox (Gecko) fires this for the meta key instead of 91
|
11103 |
-
/**
|
11104 |
-
* WIN_IME
|
11105 |
-
*/
|
11106 |
-
WIN_IME: 229
|
11107 |
-
};
|
11108 |
-
|
11109 |
-
/*
|
11110 |
-
whether text and modified key is entered at the same time.
|
11111 |
-
*/
|
11112 |
-
KeyCode.isTextModifyingKeyEvent = function isTextModifyingKeyEvent(e) {
|
11113 |
-
var keyCode = e.keyCode;
|
11114 |
-
if (e.altKey && !e.ctrlKey || e.metaKey ||
|
11115 |
-
// Function keys don't generate text
|
11116 |
-
keyCode >= KeyCode.F1 && keyCode <= KeyCode.F12) {
|
11117 |
-
return false;
|
11118 |
-
}
|
11119 |
-
|
11120 |
-
// The following keys are quite harmless, even in combination with
|
11121 |
-
// CTRL, ALT or SHIFT.
|
11122 |
-
switch (keyCode) {
|
11123 |
-
case KeyCode.ALT:
|
11124 |
-
case KeyCode.CAPS_LOCK:
|
11125 |
-
case KeyCode.CONTEXT_MENU:
|
11126 |
-
case KeyCode.CTRL:
|
11127 |
-
case KeyCode.DOWN:
|
11128 |
-
case KeyCode.END:
|
11129 |
-
case KeyCode.ESC:
|
11130 |
-
case KeyCode.HOME:
|
11131 |
-
case KeyCode.INSERT:
|
11132 |
-
case KeyCode.LEFT:
|
11133 |
-
case KeyCode.MAC_FF_META:
|
11134 |
-
case KeyCode.META:
|
11135 |
-
case KeyCode.NUMLOCK:
|
11136 |
-
case KeyCode.NUM_CENTER:
|
11137 |
-
case KeyCode.PAGE_DOWN:
|
11138 |
-
case KeyCode.PAGE_UP:
|
11139 |
-
case KeyCode.PAUSE:
|
11140 |
-
case KeyCode.PRINT_SCREEN:
|
11141 |
-
case KeyCode.RIGHT:
|
11142 |
-
case KeyCode.SHIFT:
|
11143 |
-
case KeyCode.UP:
|
11144 |
-
case KeyCode.WIN_KEY:
|
11145 |
-
case KeyCode.WIN_KEY_RIGHT:
|
11146 |
-
return false;
|
11147 |
-
default:
|
11148 |
-
return true;
|
11149 |
-
}
|
11150 |
-
};
|
11151 |
-
|
11152 |
-
/*
|
11153 |
-
whether character is entered.
|
11154 |
-
*/
|
11155 |
-
KeyCode.isCharacterKey = function isCharacterKey(keyCode) {
|
11156 |
-
if (keyCode >= KeyCode.ZERO && keyCode <= KeyCode.NINE) {
|
11157 |
-
return true;
|
11158 |
-
}
|
11159 |
-
|
11160 |
-
if (keyCode >= KeyCode.NUM_ZERO && keyCode <= KeyCode.NUM_MULTIPLY) {
|
11161 |
-
return true;
|
11162 |
-
}
|
11163 |
-
|
11164 |
-
if (keyCode >= KeyCode.A && keyCode <= KeyCode.Z) {
|
11165 |
-
return true;
|
11166 |
-
}
|
11167 |
-
|
11168 |
-
// Safari sends zero key code for non-latin characters.
|
11169 |
-
if (window.navigation.userAgent.indexOf('WebKit') !== -1 && keyCode === 0) {
|
11170 |
-
return true;
|
11171 |
-
}
|
11172 |
-
|
11173 |
-
switch (keyCode) {
|
11174 |
-
case KeyCode.SPACE:
|
11175 |
-
case KeyCode.QUESTION_MARK:
|
11176 |
-
case KeyCode.NUM_PLUS:
|
11177 |
-
case KeyCode.NUM_MINUS:
|
11178 |
-
case KeyCode.NUM_PERIOD:
|
11179 |
-
case KeyCode.NUM_DIVISION:
|
11180 |
-
case KeyCode.SEMICOLON:
|
11181 |
-
case KeyCode.DASH:
|
11182 |
-
case KeyCode.EQUALS:
|
11183 |
-
case KeyCode.COMMA:
|
11184 |
-
case KeyCode.PERIOD:
|
11185 |
-
case KeyCode.SLASH:
|
11186 |
-
case KeyCode.APOSTROPHE:
|
11187 |
-
case KeyCode.SINGLE_QUOTE:
|
11188 |
-
case KeyCode.OPEN_SQUARE_BRACKET:
|
11189 |
-
case KeyCode.BACKSLASH:
|
11190 |
-
case KeyCode.CLOSE_SQUARE_BRACKET:
|
11191 |
-
return true;
|
11192 |
-
default:
|
11193 |
-
return false;
|
11194 |
-
}
|
11195 |
-
};
|
11196 |
-
|
11197 |
-
/* harmony default export */ __webpack_exports__["a"] = (KeyCode);
|
11198 |
-
|
11199 |
-
/***/ }),
|
11200 |
-
/* 194 */
|
11201 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11202 |
-
|
11203 |
-
"use strict";
|
11204 |
-
|
11205 |
-
|
11206 |
-
Object.defineProperty(exports, "__esModule", {
|
11207 |
-
value: true
|
11208 |
-
});
|
11209 |
-
exports.cf7sDuplicateRules = exports.cf7sSurroundingRules = exports.cf7sDropRules = exports.cf7sRequest = exports.mergeDefault = exports.randomizeName = exports.cf7sItems = undefined;
|
11210 |
-
|
11211 |
-
var _cf7sItems = __webpack_require__(301);
|
11212 |
-
|
11213 |
-
var _api = __webpack_require__(800);
|
11214 |
-
|
11215 |
-
var _functions = __webpack_require__(302);
|
11216 |
-
|
11217 |
-
var _cf7sRules = __webpack_require__(802);
|
11218 |
-
|
11219 |
-
// Simplify import of utils
|
11220 |
-
exports.cf7sItems = _cf7sItems.cf7sItems;
|
11221 |
-
exports.randomizeName = _functions.randomizeName;
|
11222 |
-
exports.mergeDefault = _functions.mergeDefault;
|
11223 |
-
exports.cf7sRequest = _api.cf7sRequest;
|
11224 |
-
exports.cf7sDropRules = _cf7sRules.cf7sDropRules;
|
11225 |
-
exports.cf7sSurroundingRules = _cf7sRules.cf7sSurroundingRules;
|
11226 |
-
exports.cf7sDuplicateRules = _cf7sRules.cf7sDuplicateRules;
|
11227 |
-
|
11228 |
-
/***/ }),
|
11229 |
-
/* 195 */
|
11230 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11231 |
-
|
11232 |
-
module.exports = !__webpack_require__(14) && !__webpack_require__(5)(function () {
|
11233 |
-
return Object.defineProperty(__webpack_require__(129)('div'), 'a', { get: function () { return 7; } }).a != 7;
|
11234 |
-
});
|
11235 |
-
|
11236 |
-
|
11237 |
-
/***/ }),
|
11238 |
-
/* 196 */
|
11239 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11240 |
-
|
11241 |
-
exports.f = __webpack_require__(9);
|
11242 |
-
|
11243 |
-
|
11244 |
-
/***/ }),
|
11245 |
-
/* 197 */
|
11246 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11247 |
-
|
11248 |
-
var has = __webpack_require__(24);
|
11249 |
-
var toIObject = __webpack_require__(29);
|
11250 |
-
var arrayIndexOf = __webpack_require__(98)(false);
|
11251 |
-
var IE_PROTO = __webpack_require__(131)('IE_PROTO');
|
11252 |
-
|
11253 |
-
module.exports = function (object, names) {
|
11254 |
-
var O = toIObject(object);
|
11255 |
-
var i = 0;
|
11256 |
-
var result = [];
|
11257 |
-
var key;
|
11258 |
-
for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key);
|
11259 |
-
// Don't enum bug & hidden keys
|
11260 |
-
while (names.length > i) if (has(O, key = names[i++])) {
|
11261 |
-
~arrayIndexOf(result, key) || result.push(key);
|
11262 |
-
}
|
11263 |
-
return result;
|
11264 |
-
};
|
11265 |
-
|
11266 |
-
|
11267 |
-
/***/ }),
|
11268 |
-
/* 198 */
|
11269 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11270 |
-
|
11271 |
-
var dP = __webpack_require__(15);
|
11272 |
-
var anObject = __webpack_require__(3);
|
11273 |
-
var getKeys = __webpack_require__(56);
|
11274 |
-
|
11275 |
-
module.exports = __webpack_require__(14) ? Object.defineProperties : function defineProperties(O, Properties) {
|
11276 |
-
anObject(O);
|
11277 |
-
var keys = getKeys(Properties);
|
11278 |
-
var length = keys.length;
|
11279 |
-
var i = 0;
|
11280 |
-
var P;
|
11281 |
-
while (length > i) dP.f(O, P = keys[i++], Properties[P]);
|
11282 |
-
return O;
|
11283 |
-
};
|
11284 |
-
|
11285 |
-
|
11286 |
-
/***/ }),
|
11287 |
-
/* 199 */
|
11288 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11289 |
-
|
11290 |
-
// fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window
|
11291 |
-
var toIObject = __webpack_require__(29);
|
11292 |
-
var gOPN = __webpack_require__(59).f;
|
11293 |
-
var toString = {}.toString;
|
11294 |
-
|
11295 |
-
var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames
|
11296 |
-
? Object.getOwnPropertyNames(window) : [];
|
11297 |
-
|
11298 |
-
var getWindowNames = function (it) {
|
11299 |
-
try {
|
11300 |
-
return gOPN(it);
|
11301 |
-
} catch (e) {
|
11302 |
-
return windowNames.slice();
|
11303 |
-
}
|
11304 |
-
};
|
11305 |
-
|
11306 |
-
module.exports.f = function getOwnPropertyNames(it) {
|
11307 |
-
return windowNames && toString.call(it) == '[object Window]' ? getWindowNames(it) : gOPN(toIObject(it));
|
11308 |
-
};
|
11309 |
-
|
11310 |
-
|
11311 |
-
/***/ }),
|
11312 |
-
/* 200 */
|
11313 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11314 |
-
|
11315 |
-
"use strict";
|
11316 |
-
|
11317 |
-
// 19.1.2.1 Object.assign(target, source, ...)
|
11318 |
-
var getKeys = __webpack_require__(56);
|
11319 |
-
var gOPS = __webpack_require__(99);
|
11320 |
-
var pIE = __webpack_require__(85);
|
11321 |
-
var toObject = __webpack_require__(18);
|
11322 |
-
var IObject = __webpack_require__(84);
|
11323 |
-
var $assign = Object.assign;
|
11324 |
-
|
11325 |
-
// should work with symbols and should have deterministic property order (V8 bug)
|
11326 |
-
module.exports = !$assign || __webpack_require__(5)(function () {
|
11327 |
-
var A = {};
|
11328 |
-
var B = {};
|
11329 |
-
// eslint-disable-next-line no-undef
|
11330 |
-
var S = Symbol();
|
11331 |
-
var K = 'abcdefghijklmnopqrst';
|
11332 |
-
A[S] = 7;
|
11333 |
-
K.split('').forEach(function (k) { B[k] = k; });
|
11334 |
-
return $assign({}, A)[S] != 7 || Object.keys($assign({}, B)).join('') != K;
|
11335 |
-
}) ? function assign(target, source) { // eslint-disable-line no-unused-vars
|
11336 |
-
var T = toObject(target);
|
11337 |
-
var aLen = arguments.length;
|
11338 |
-
var index = 1;
|
11339 |
-
var getSymbols = gOPS.f;
|
11340 |
-
var isEnum = pIE.f;
|
11341 |
-
while (aLen > index) {
|
11342 |
-
var S = IObject(arguments[index++]);
|
11343 |
-
var keys = getSymbols ? getKeys(S).concat(getSymbols(S)) : getKeys(S);
|
11344 |
-
var length = keys.length;
|
11345 |
-
var j = 0;
|
11346 |
-
var key;
|
11347 |
-
while (length > j) if (isEnum.call(S, key = keys[j++])) T[key] = S[key];
|
11348 |
-
} return T;
|
11349 |
-
} : $assign;
|
11350 |
-
|
11351 |
-
|
11352 |
-
/***/ }),
|
11353 |
-
/* 201 */
|
11354 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11355 |
-
|
11356 |
-
"use strict";
|
11357 |
-
|
11358 |
-
var aFunction = __webpack_require__(20);
|
11359 |
-
var isObject = __webpack_require__(6);
|
11360 |
-
var invoke = __webpack_require__(202);
|
11361 |
-
var arraySlice = [].slice;
|
11362 |
-
var factories = {};
|
11363 |
-
|
11364 |
-
var construct = function (F, len, args) {
|
11365 |
-
if (!(len in factories)) {
|
11366 |
-
for (var n = [], i = 0; i < len; i++) n[i] = 'a[' + i + ']';
|
11367 |
-
// eslint-disable-next-line no-new-func
|
11368 |
-
factories[len] = Function('F,a', 'return new F(' + n.join(',') + ')');
|
11369 |
-
} return factories[len](F, args);
|
11370 |
-
};
|
11371 |
-
|
11372 |
-
module.exports = Function.bind || function bind(that /* , ...args */) {
|
11373 |
-
var fn = aFunction(this);
|
11374 |
-
var partArgs = arraySlice.call(arguments, 1);
|
11375 |
-
var bound = function (/* args... */) {
|
11376 |
-
var args = partArgs.concat(arraySlice.call(arguments));
|
11377 |
-
return this instanceof bound ? construct(fn, args.length, args) : invoke(fn, args, that);
|
11378 |
-
};
|
11379 |
-
if (isObject(fn.prototype)) bound.prototype = fn.prototype;
|
11380 |
-
return bound;
|
11381 |
-
};
|
11382 |
-
|
11383 |
-
|
11384 |
-
/***/ }),
|
11385 |
-
/* 202 */
|
11386 |
-
/***/ (function(module, exports) {
|
11387 |
-
|
11388 |
-
// fast apply, http://jsperf.lnkit.com/fast-apply/5
|
11389 |
-
module.exports = function (fn, args, that) {
|
11390 |
-
var un = that === undefined;
|
11391 |
-
switch (args.length) {
|
11392 |
-
case 0: return un ? fn()
|
11393 |
-
: fn.call(that);
|
11394 |
-
case 1: return un ? fn(args[0])
|
11395 |
-
: fn.call(that, args[0]);
|
11396 |
-
case 2: return un ? fn(args[0], args[1])
|
11397 |
-
: fn.call(that, args[0], args[1]);
|
11398 |
-
case 3: return un ? fn(args[0], args[1], args[2])
|
11399 |
-
: fn.call(that, args[0], args[1], args[2]);
|
11400 |
-
case 4: return un ? fn(args[0], args[1], args[2], args[3])
|
11401 |
-
: fn.call(that, args[0], args[1], args[2], args[3]);
|
11402 |
-
} return fn.apply(that, args);
|
11403 |
-
};
|
11404 |
-
|
11405 |
-
|
11406 |
-
/***/ }),
|
11407 |
-
/* 203 */
|
11408 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11409 |
-
|
11410 |
-
var $parseInt = __webpack_require__(4).parseInt;
|
11411 |
-
var $trim = __webpack_require__(73).trim;
|
11412 |
-
var ws = __webpack_require__(135);
|
11413 |
-
var hex = /^[-+]?0[xX]/;
|
11414 |
-
|
11415 |
-
module.exports = $parseInt(ws + '08') !== 8 || $parseInt(ws + '0x16') !== 22 ? function parseInt(str, radix) {
|
11416 |
-
var string = $trim(String(str), 3);
|
11417 |
-
return $parseInt(string, (radix >>> 0) || (hex.test(string) ? 16 : 10));
|
11418 |
-
} : $parseInt;
|
11419 |
-
|
11420 |
-
|
11421 |
-
/***/ }),
|
11422 |
-
/* 204 */
|
11423 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11424 |
-
|
11425 |
-
var $parseFloat = __webpack_require__(4).parseFloat;
|
11426 |
-
var $trim = __webpack_require__(73).trim;
|
11427 |
-
|
11428 |
-
module.exports = 1 / $parseFloat(__webpack_require__(135) + '-0') !== -Infinity ? function parseFloat(str) {
|
11429 |
-
var string = $trim(String(str), 3);
|
11430 |
-
var result = $parseFloat(string);
|
11431 |
-
return result === 0 && string.charAt(0) == '-' ? -0 : result;
|
11432 |
-
} : $parseFloat;
|
11433 |
-
|
11434 |
-
|
11435 |
-
/***/ }),
|
11436 |
-
/* 205 */
|
11437 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11438 |
-
|
11439 |
-
var cof = __webpack_require__(36);
|
11440 |
-
module.exports = function (it, msg) {
|
11441 |
-
if (typeof it != 'number' && cof(it) != 'Number') throw TypeError(msg);
|
11442 |
-
return +it;
|
11443 |
-
};
|
11444 |
-
|
11445 |
-
|
11446 |
-
/***/ }),
|
11447 |
-
/* 206 */
|
11448 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11449 |
-
|
11450 |
-
// 20.1.2.3 Number.isInteger(number)
|
11451 |
-
var isObject = __webpack_require__(6);
|
11452 |
-
var floor = Math.floor;
|
11453 |
-
module.exports = function isInteger(it) {
|
11454 |
-
return !isObject(it) && isFinite(it) && floor(it) === it;
|
11455 |
-
};
|
11456 |
-
|
11457 |
-
|
11458 |
-
/***/ }),
|
11459 |
-
/* 207 */
|
11460 |
-
/***/ (function(module, exports) {
|
11461 |
-
|
11462 |
-
// 20.2.2.20 Math.log1p(x)
|
11463 |
-
module.exports = Math.log1p || function log1p(x) {
|
11464 |
-
return (x = +x) > -1e-8 && x < 1e-8 ? x - x * x / 2 : Math.log(1 + x);
|
11465 |
-
};
|
11466 |
-
|
11467 |
-
|
11468 |
-
/***/ }),
|
11469 |
-
/* 208 */
|
11470 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11471 |
-
|
11472 |
-
// 20.2.2.16 Math.fround(x)
|
11473 |
-
var sign = __webpack_require__(138);
|
11474 |
-
var pow = Math.pow;
|
11475 |
-
var EPSILON = pow(2, -52);
|
11476 |
-
var EPSILON32 = pow(2, -23);
|
11477 |
-
var MAX32 = pow(2, 127) * (2 - EPSILON32);
|
11478 |
-
var MIN32 = pow(2, -126);
|
11479 |
-
|
11480 |
-
var roundTiesToEven = function (n) {
|
11481 |
-
return n + 1 / EPSILON - 1 / EPSILON;
|
11482 |
-
};
|
11483 |
-
|
11484 |
-
module.exports = Math.fround || function fround(x) {
|
11485 |
-
var $abs = Math.abs(x);
|
11486 |
-
var $sign = sign(x);
|
11487 |
-
var a, result;
|
11488 |
-
if ($abs < MIN32) return $sign * roundTiesToEven($abs / MIN32 / EPSILON32) * MIN32 * EPSILON32;
|
11489 |
-
a = (1 + EPSILON32 / EPSILON) * $abs;
|
11490 |
-
result = a - (a - $abs);
|
11491 |
-
// eslint-disable-next-line no-self-compare
|
11492 |
-
if (result > MAX32 || result != result) return $sign * Infinity;
|
11493 |
-
return $sign * result;
|
11494 |
-
};
|
11495 |
-
|
11496 |
-
|
11497 |
-
/***/ }),
|
11498 |
-
/* 209 */
|
11499 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11500 |
-
|
11501 |
-
// call something on iterator step with safe closing on error
|
11502 |
-
var anObject = __webpack_require__(3);
|
11503 |
-
module.exports = function (iterator, fn, value, entries) {
|
11504 |
-
try {
|
11505 |
-
return entries ? fn(anObject(value)[0], value[1]) : fn(value);
|
11506 |
-
// 7.4.6 IteratorClose(iterator, completion)
|
11507 |
-
} catch (e) {
|
11508 |
-
var ret = iterator['return'];
|
11509 |
-
if (ret !== undefined) anObject(ret.call(iterator));
|
11510 |
-
throw e;
|
11511 |
-
}
|
11512 |
-
};
|
11513 |
-
|
11514 |
-
|
11515 |
-
/***/ }),
|
11516 |
-
/* 210 */
|
11517 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11518 |
-
|
11519 |
-
var aFunction = __webpack_require__(20);
|
11520 |
-
var toObject = __webpack_require__(18);
|
11521 |
-
var IObject = __webpack_require__(84);
|
11522 |
-
var toLength = __webpack_require__(16);
|
11523 |
-
|
11524 |
-
module.exports = function (that, callbackfn, aLen, memo, isRight) {
|
11525 |
-
aFunction(callbackfn);
|
11526 |
-
var O = toObject(that);
|
11527 |
-
var self = IObject(O);
|
11528 |
-
var length = toLength(O.length);
|
11529 |
-
var index = isRight ? length - 1 : 0;
|
11530 |
-
var i = isRight ? -1 : 1;
|
11531 |
-
if (aLen < 2) for (;;) {
|
11532 |
-
if (index in self) {
|
11533 |
-
memo = self[index];
|
11534 |
-
index += i;
|
11535 |
-
break;
|
11536 |
-
}
|
11537 |
-
index += i;
|
11538 |
-
if (isRight ? index < 0 : length <= index) {
|
11539 |
-
throw TypeError('Reduce of empty array with no initial value');
|
11540 |
-
}
|
11541 |
-
}
|
11542 |
-
for (;isRight ? index >= 0 : length > index; index += i) if (index in self) {
|
11543 |
-
memo = callbackfn(memo, self[index], index, O);
|
11544 |
-
}
|
11545 |
-
return memo;
|
11546 |
-
};
|
11547 |
-
|
11548 |
-
|
11549 |
-
/***/ }),
|
11550 |
-
/* 211 */
|
11551 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11552 |
-
|
11553 |
-
"use strict";
|
11554 |
-
// 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length)
|
11555 |
-
|
11556 |
-
var toObject = __webpack_require__(18);
|
11557 |
-
var toAbsoluteIndex = __webpack_require__(57);
|
11558 |
-
var toLength = __webpack_require__(16);
|
11559 |
-
|
11560 |
-
module.exports = [].copyWithin || function copyWithin(target /* = 0 */, start /* = 0, end = @length */) {
|
11561 |
-
var O = toObject(this);
|
11562 |
-
var len = toLength(O.length);
|
11563 |
-
var to = toAbsoluteIndex(target, len);
|
11564 |
-
var from = toAbsoluteIndex(start, len);
|
11565 |
-
var end = arguments.length > 2 ? arguments[2] : undefined;
|
11566 |
-
var count = Math.min((end === undefined ? len : toAbsoluteIndex(end, len)) - from, len - to);
|
11567 |
-
var inc = 1;
|
11568 |
-
if (from < to && to < from + count) {
|
11569 |
-
inc = -1;
|
11570 |
-
from += count - 1;
|
11571 |
-
to += count - 1;
|
11572 |
-
}
|
11573 |
-
while (count-- > 0) {
|
11574 |
-
if (from in O) O[to] = O[from];
|
11575 |
-
else delete O[to];
|
11576 |
-
to += inc;
|
11577 |
-
from += inc;
|
11578 |
-
} return O;
|
11579 |
-
};
|
11580 |
-
|
11581 |
-
|
11582 |
-
/***/ }),
|
11583 |
-
/* 212 */
|
11584 |
-
/***/ (function(module, exports) {
|
11585 |
-
|
11586 |
-
module.exports = function (done, value) {
|
11587 |
-
return { value: value, done: !!done };
|
11588 |
-
};
|
11589 |
-
|
11590 |
-
|
11591 |
-
/***/ }),
|
11592 |
-
/* 213 */
|
11593 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11594 |
-
|
11595 |
-
// 21.2.5.3 get RegExp.prototype.flags()
|
11596 |
-
if (__webpack_require__(14) && /./g.flags != 'g') __webpack_require__(15).f(RegExp.prototype, 'flags', {
|
11597 |
-
configurable: true,
|
11598 |
-
get: __webpack_require__(103)
|
11599 |
-
});
|
11600 |
-
|
11601 |
-
|
11602 |
-
/***/ }),
|
11603 |
-
/* 214 */
|
11604 |
-
/***/ (function(module, exports) {
|
11605 |
-
|
11606 |
-
module.exports = function (exec) {
|
11607 |
-
try {
|
11608 |
-
return { e: false, v: exec() };
|
11609 |
-
} catch (e) {
|
11610 |
-
return { e: true, v: e };
|
11611 |
-
}
|
11612 |
-
};
|
11613 |
-
|
11614 |
-
|
11615 |
-
/***/ }),
|
11616 |
-
/* 215 */
|
11617 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11618 |
-
|
11619 |
-
var anObject = __webpack_require__(3);
|
11620 |
-
var isObject = __webpack_require__(6);
|
11621 |
-
var newPromiseCapability = __webpack_require__(153);
|
11622 |
-
|
11623 |
-
module.exports = function (C, x) {
|
11624 |
-
anObject(C);
|
11625 |
-
if (isObject(x) && x.constructor === C) return x;
|
11626 |
-
var promiseCapability = newPromiseCapability.f(C);
|
11627 |
-
var resolve = promiseCapability.resolve;
|
11628 |
-
resolve(x);
|
11629 |
-
return promiseCapability.promise;
|
11630 |
-
};
|
11631 |
-
|
11632 |
-
|
11633 |
-
/***/ }),
|
11634 |
-
/* 216 */
|
11635 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11636 |
-
|
11637 |
-
"use strict";
|
11638 |
-
|
11639 |
-
var strong = __webpack_require__(217);
|
11640 |
-
var validate = __webpack_require__(75);
|
11641 |
-
var MAP = 'Map';
|
11642 |
-
|
11643 |
-
// 23.1 Map Objects
|
11644 |
-
module.exports = __webpack_require__(106)(MAP, function (get) {
|
11645 |
-
return function Map() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
|
11646 |
-
}, {
|
11647 |
-
// 23.1.3.6 Map.prototype.get(key)
|
11648 |
-
get: function get(key) {
|
11649 |
-
var entry = strong.getEntry(validate(this, MAP), key);
|
11650 |
-
return entry && entry.v;
|
11651 |
-
},
|
11652 |
-
// 23.1.3.9 Map.prototype.set(key, value)
|
11653 |
-
set: function set(key, value) {
|
11654 |
-
return strong.def(validate(this, MAP), key === 0 ? 0 : key, value);
|
11655 |
-
}
|
11656 |
-
}, strong, true);
|
11657 |
-
|
11658 |
-
|
11659 |
-
/***/ }),
|
11660 |
-
/* 217 */
|
11661 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11662 |
-
|
11663 |
-
"use strict";
|
11664 |
-
|
11665 |
-
var dP = __webpack_require__(15).f;
|
11666 |
-
var create = __webpack_require__(58);
|
11667 |
-
var redefineAll = __webpack_require__(63);
|
11668 |
-
var ctx = __webpack_require__(35);
|
11669 |
-
var anInstance = __webpack_require__(61);
|
11670 |
-
var forOf = __webpack_require__(62);
|
11671 |
-
var $iterDefine = __webpack_require__(141);
|
11672 |
-
var step = __webpack_require__(212);
|
11673 |
-
var setSpecies = __webpack_require__(60);
|
11674 |
-
var DESCRIPTORS = __webpack_require__(14);
|
11675 |
-
var fastKey = __webpack_require__(48).fastKey;
|
11676 |
-
var validate = __webpack_require__(75);
|
11677 |
-
var SIZE = DESCRIPTORS ? '_s' : 'size';
|
11678 |
-
|
11679 |
-
var getEntry = function (that, key) {
|
11680 |
-
// fast case
|
11681 |
-
var index = fastKey(key);
|
11682 |
-
var entry;
|
11683 |
-
if (index !== 'F') return that._i[index];
|
11684 |
-
// frozen object case
|
11685 |
-
for (entry = that._f; entry; entry = entry.n) {
|
11686 |
-
if (entry.k == key) return entry;
|
11687 |
-
}
|
11688 |
-
};
|
11689 |
-
|
11690 |
-
module.exports = {
|
11691 |
-
getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
|
11692 |
-
var C = wrapper(function (that, iterable) {
|
11693 |
-
anInstance(that, C, NAME, '_i');
|
11694 |
-
that._t = NAME; // collection type
|
11695 |
-
that._i = create(null); // index
|
11696 |
-
that._f = undefined; // first entry
|
11697 |
-
that._l = undefined; // last entry
|
11698 |
-
that[SIZE] = 0; // size
|
11699 |
-
if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
|
11700 |
-
});
|
11701 |
-
redefineAll(C.prototype, {
|
11702 |
-
// 23.1.3.1 Map.prototype.clear()
|
11703 |
-
// 23.2.3.2 Set.prototype.clear()
|
11704 |
-
clear: function clear() {
|
11705 |
-
for (var that = validate(this, NAME), data = that._i, entry = that._f; entry; entry = entry.n) {
|
11706 |
-
entry.r = true;
|
11707 |
-
if (entry.p) entry.p = entry.p.n = undefined;
|
11708 |
-
delete data[entry.i];
|
11709 |
-
}
|
11710 |
-
that._f = that._l = undefined;
|
11711 |
-
that[SIZE] = 0;
|
11712 |
-
},
|
11713 |
-
// 23.1.3.3 Map.prototype.delete(key)
|
11714 |
-
// 23.2.3.4 Set.prototype.delete(value)
|
11715 |
-
'delete': function (key) {
|
11716 |
-
var that = validate(this, NAME);
|
11717 |
-
var entry = getEntry(that, key);
|
11718 |
-
if (entry) {
|
11719 |
-
var next = entry.n;
|
11720 |
-
var prev = entry.p;
|
11721 |
-
delete that._i[entry.i];
|
11722 |
-
entry.r = true;
|
11723 |
-
if (prev) prev.n = next;
|
11724 |
-
if (next) next.p = prev;
|
11725 |
-
if (that._f == entry) that._f = next;
|
11726 |
-
if (that._l == entry) that._l = prev;
|
11727 |
-
that[SIZE]--;
|
11728 |
-
} return !!entry;
|
11729 |
-
},
|
11730 |
-
// 23.2.3.6 Set.prototype.forEach(callbackfn, thisArg = undefined)
|
11731 |
-
// 23.1.3.5 Map.prototype.forEach(callbackfn, thisArg = undefined)
|
11732 |
-
forEach: function forEach(callbackfn /* , that = undefined */) {
|
11733 |
-
validate(this, NAME);
|
11734 |
-
var f = ctx(callbackfn, arguments.length > 1 ? arguments[1] : undefined, 3);
|
11735 |
-
var entry;
|
11736 |
-
while (entry = entry ? entry.n : this._f) {
|
11737 |
-
f(entry.v, entry.k, this);
|
11738 |
-
// revert to the last existing entry
|
11739 |
-
while (entry && entry.r) entry = entry.p;
|
11740 |
-
}
|
11741 |
-
},
|
11742 |
-
// 23.1.3.7 Map.prototype.has(key)
|
11743 |
-
// 23.2.3.7 Set.prototype.has(value)
|
11744 |
-
has: function has(key) {
|
11745 |
-
return !!getEntry(validate(this, NAME), key);
|
11746 |
-
}
|
11747 |
-
});
|
11748 |
-
if (DESCRIPTORS) dP(C.prototype, 'size', {
|
11749 |
-
get: function () {
|
11750 |
-
return validate(this, NAME)[SIZE];
|
11751 |
-
}
|
11752 |
-
});
|
11753 |
-
return C;
|
11754 |
-
},
|
11755 |
-
def: function (that, key, value) {
|
11756 |
-
var entry = getEntry(that, key);
|
11757 |
-
var prev, index;
|
11758 |
-
// change existing entry
|
11759 |
-
if (entry) {
|
11760 |
-
entry.v = value;
|
11761 |
-
// create new entry
|
11762 |
-
} else {
|
11763 |
-
that._l = entry = {
|
11764 |
-
i: index = fastKey(key, true), // <- index
|
11765 |
-
k: key, // <- key
|
11766 |
-
v: value, // <- value
|
11767 |
-
p: prev = that._l, // <- previous entry
|
11768 |
-
n: undefined, // <- next entry
|
11769 |
-
r: false // <- removed
|
11770 |
-
};
|
11771 |
-
if (!that._f) that._f = entry;
|
11772 |
-
if (prev) prev.n = entry;
|
11773 |
-
that[SIZE]++;
|
11774 |
-
// add to index
|
11775 |
-
if (index !== 'F') that._i[index] = entry;
|
11776 |
-
} return that;
|
11777 |
-
},
|
11778 |
-
getEntry: getEntry,
|
11779 |
-
setStrong: function (C, NAME, IS_MAP) {
|
11780 |
-
// add .keys, .values, .entries, [@@iterator]
|
11781 |
-
// 23.1.3.4, 23.1.3.8, 23.1.3.11, 23.1.3.12, 23.2.3.5, 23.2.3.8, 23.2.3.10, 23.2.3.11
|
11782 |
-
$iterDefine(C, NAME, function (iterated, kind) {
|
11783 |
-
this._t = validate(iterated, NAME); // target
|
11784 |
-
this._k = kind; // kind
|
11785 |
-
this._l = undefined; // previous
|
11786 |
-
}, function () {
|
11787 |
-
var that = this;
|
11788 |
-
var kind = that._k;
|
11789 |
-
var entry = that._l;
|
11790 |
-
// revert to the last existing entry
|
11791 |
-
while (entry && entry.r) entry = entry.p;
|
11792 |
-
// get next entry
|
11793 |
-
if (!that._t || !(that._l = entry = entry ? entry.n : that._t._f)) {
|
11794 |
-
// or finish the iteration
|
11795 |
-
that._t = undefined;
|
11796 |
-
return step(1);
|
11797 |
-
}
|
11798 |
-
// return step by kind
|
11799 |
-
if (kind == 'keys') return step(0, entry.k);
|
11800 |
-
if (kind == 'values') return step(0, entry.v);
|
11801 |
-
return step(0, [entry.k, entry.v]);
|
11802 |
-
}, IS_MAP ? 'entries' : 'values', !IS_MAP, true);
|
11803 |
-
|
11804 |
-
// add [@@species], 23.1.2.2, 23.2.2.2
|
11805 |
-
setSpecies(NAME);
|
11806 |
-
}
|
11807 |
-
};
|
11808 |
-
|
11809 |
-
|
11810 |
-
/***/ }),
|
11811 |
-
/* 218 */
|
11812 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11813 |
-
|
11814 |
-
"use strict";
|
11815 |
-
|
11816 |
-
var strong = __webpack_require__(217);
|
11817 |
-
var validate = __webpack_require__(75);
|
11818 |
-
var SET = 'Set';
|
11819 |
-
|
11820 |
-
// 23.2 Set Objects
|
11821 |
-
module.exports = __webpack_require__(106)(SET, function (get) {
|
11822 |
-
return function Set() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
|
11823 |
-
}, {
|
11824 |
-
// 23.2.3.1 Set.prototype.add(value)
|
11825 |
-
add: function add(value) {
|
11826 |
-
return strong.def(validate(this, SET), value = value === 0 ? 0 : value, value);
|
11827 |
-
}
|
11828 |
-
}, strong);
|
11829 |
-
|
11830 |
-
|
11831 |
-
/***/ }),
|
11832 |
-
/* 219 */
|
11833 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11834 |
-
|
11835 |
-
"use strict";
|
11836 |
-
|
11837 |
-
var each = __webpack_require__(43)(0);
|
11838 |
-
var redefine = __webpack_require__(26);
|
11839 |
-
var meta = __webpack_require__(48);
|
11840 |
-
var assign = __webpack_require__(200);
|
11841 |
-
var weak = __webpack_require__(220);
|
11842 |
-
var isObject = __webpack_require__(6);
|
11843 |
-
var fails = __webpack_require__(5);
|
11844 |
-
var validate = __webpack_require__(75);
|
11845 |
-
var WEAK_MAP = 'WeakMap';
|
11846 |
-
var getWeak = meta.getWeak;
|
11847 |
-
var isExtensible = Object.isExtensible;
|
11848 |
-
var uncaughtFrozenStore = weak.ufstore;
|
11849 |
-
var tmp = {};
|
11850 |
-
var InternalMap;
|
11851 |
-
|
11852 |
-
var wrapper = function (get) {
|
11853 |
-
return function WeakMap() {
|
11854 |
-
return get(this, arguments.length > 0 ? arguments[0] : undefined);
|
11855 |
-
};
|
11856 |
-
};
|
11857 |
-
|
11858 |
-
var methods = {
|
11859 |
-
// 23.3.3.3 WeakMap.prototype.get(key)
|
11860 |
-
get: function get(key) {
|
11861 |
-
if (isObject(key)) {
|
11862 |
-
var data = getWeak(key);
|
11863 |
-
if (data === true) return uncaughtFrozenStore(validate(this, WEAK_MAP)).get(key);
|
11864 |
-
return data ? data[this._i] : undefined;
|
11865 |
-
}
|
11866 |
-
},
|
11867 |
-
// 23.3.3.5 WeakMap.prototype.set(key, value)
|
11868 |
-
set: function set(key, value) {
|
11869 |
-
return weak.def(validate(this, WEAK_MAP), key, value);
|
11870 |
-
}
|
11871 |
-
};
|
11872 |
-
|
11873 |
-
// 23.3 WeakMap Objects
|
11874 |
-
var $WeakMap = module.exports = __webpack_require__(106)(WEAK_MAP, wrapper, methods, weak, true, true);
|
11875 |
-
|
11876 |
-
// IE11 WeakMap frozen keys fix
|
11877 |
-
if (fails(function () { return new $WeakMap().set((Object.freeze || Object)(tmp), 7).get(tmp) != 7; })) {
|
11878 |
-
InternalMap = weak.getConstructor(wrapper, WEAK_MAP);
|
11879 |
-
assign(InternalMap.prototype, methods);
|
11880 |
-
meta.NEED = true;
|
11881 |
-
each(['delete', 'has', 'get', 'set'], function (key) {
|
11882 |
-
var proto = $WeakMap.prototype;
|
11883 |
-
var method = proto[key];
|
11884 |
-
redefine(proto, key, function (a, b) {
|
11885 |
-
// store frozen objects on internal weakmap shim
|
11886 |
-
if (isObject(a) && !isExtensible(a)) {
|
11887 |
-
if (!this._f) this._f = new InternalMap();
|
11888 |
-
var result = this._f[key](a, b);
|
11889 |
-
return key == 'set' ? this : result;
|
11890 |
-
// store all the rest on native weakmap
|
11891 |
-
} return method.call(this, a, b);
|
11892 |
-
});
|
11893 |
-
});
|
11894 |
-
}
|
11895 |
-
|
11896 |
-
|
11897 |
-
/***/ }),
|
11898 |
-
/* 220 */
|
11899 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11900 |
-
|
11901 |
-
"use strict";
|
11902 |
-
|
11903 |
-
var redefineAll = __webpack_require__(63);
|
11904 |
-
var getWeak = __webpack_require__(48).getWeak;
|
11905 |
-
var anObject = __webpack_require__(3);
|
11906 |
-
var isObject = __webpack_require__(6);
|
11907 |
-
var anInstance = __webpack_require__(61);
|
11908 |
-
var forOf = __webpack_require__(62);
|
11909 |
-
var createArrayMethod = __webpack_require__(43);
|
11910 |
-
var $has = __webpack_require__(24);
|
11911 |
-
var validate = __webpack_require__(75);
|
11912 |
-
var arrayFind = createArrayMethod(5);
|
11913 |
-
var arrayFindIndex = createArrayMethod(6);
|
11914 |
-
var id = 0;
|
11915 |
-
|
11916 |
-
// fallback for uncaught frozen keys
|
11917 |
-
var uncaughtFrozenStore = function (that) {
|
11918 |
-
return that._l || (that._l = new UncaughtFrozenStore());
|
11919 |
-
};
|
11920 |
-
var UncaughtFrozenStore = function () {
|
11921 |
-
this.a = [];
|
11922 |
-
};
|
11923 |
-
var findUncaughtFrozen = function (store, key) {
|
11924 |
-
return arrayFind(store.a, function (it) {
|
11925 |
-
return it[0] === key;
|
11926 |
-
});
|
11927 |
-
};
|
11928 |
-
UncaughtFrozenStore.prototype = {
|
11929 |
-
get: function (key) {
|
11930 |
-
var entry = findUncaughtFrozen(this, key);
|
11931 |
-
if (entry) return entry[1];
|
11932 |
-
},
|
11933 |
-
has: function (key) {
|
11934 |
-
return !!findUncaughtFrozen(this, key);
|
11935 |
-
},
|
11936 |
-
set: function (key, value) {
|
11937 |
-
var entry = findUncaughtFrozen(this, key);
|
11938 |
-
if (entry) entry[1] = value;
|
11939 |
-
else this.a.push([key, value]);
|
11940 |
-
},
|
11941 |
-
'delete': function (key) {
|
11942 |
-
var index = arrayFindIndex(this.a, function (it) {
|
11943 |
-
return it[0] === key;
|
11944 |
-
});
|
11945 |
-
if (~index) this.a.splice(index, 1);
|
11946 |
-
return !!~index;
|
11947 |
-
}
|
11948 |
-
};
|
11949 |
-
|
11950 |
-
module.exports = {
|
11951 |
-
getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
|
11952 |
-
var C = wrapper(function (that, iterable) {
|
11953 |
-
anInstance(that, C, NAME, '_i');
|
11954 |
-
that._t = NAME; // collection type
|
11955 |
-
that._i = id++; // collection id
|
11956 |
-
that._l = undefined; // leak store for uncaught frozen objects
|
11957 |
-
if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
|
11958 |
-
});
|
11959 |
-
redefineAll(C.prototype, {
|
11960 |
-
// 23.3.3.2 WeakMap.prototype.delete(key)
|
11961 |
-
// 23.4.3.3 WeakSet.prototype.delete(value)
|
11962 |
-
'delete': function (key) {
|
11963 |
-
if (!isObject(key)) return false;
|
11964 |
-
var data = getWeak(key);
|
11965 |
-
if (data === true) return uncaughtFrozenStore(validate(this, NAME))['delete'](key);
|
11966 |
-
return data && $has(data, this._i) && delete data[this._i];
|
11967 |
-
},
|
11968 |
-
// 23.3.3.4 WeakMap.prototype.has(key)
|
11969 |
-
// 23.4.3.4 WeakSet.prototype.has(value)
|
11970 |
-
has: function has(key) {
|
11971 |
-
if (!isObject(key)) return false;
|
11972 |
-
var data = getWeak(key);
|
11973 |
-
if (data === true) return uncaughtFrozenStore(validate(this, NAME)).has(key);
|
11974 |
-
return data && $has(data, this._i);
|
11975 |
-
}
|
11976 |
-
});
|
11977 |
-
return C;
|
11978 |
-
},
|
11979 |
-
def: function (that, key, value) {
|
11980 |
-
var data = getWeak(anObject(key), true);
|
11981 |
-
if (data === true) uncaughtFrozenStore(that).set(key, value);
|
11982 |
-
else data[that._i] = value;
|
11983 |
-
return that;
|
11984 |
-
},
|
11985 |
-
ufstore: uncaughtFrozenStore
|
11986 |
-
};
|
11987 |
-
|
11988 |
-
|
11989 |
-
/***/ }),
|
11990 |
-
/* 221 */
|
11991 |
-
/***/ (function(module, exports, __webpack_require__) {
|
11992 |
-
|
11993 |
-
// https://tc39.github.io/ecma262/#sec-toindex
|
11994 |
-
var toInteger = __webpack_require__(41);
|
11995 |
-
var toLength = __webpack_require__(16);
|
11996 |
-
module.exports = function (it) {
|
11997 |
-
if (it === undefined) return 0;
|
11998 |
-
var number = toInteger(it);
|
11999 |
-
var length = toLength(number);
|
12000 |
-
if (number !== length) throw RangeError('Wrong length!');
|
12001 |
-
return length;
|
12002 |
-
};
|
12003 |
-
|
12004 |
-
|
12005 |
-
/***/ }),
|
12006 |
-
/* 222 */
|
12007 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12008 |
-
|
12009 |
-
// all object keys, includes non-enumerable and symbols
|
12010 |
-
var gOPN = __webpack_require__(59);
|
12011 |
-
var gOPS = __webpack_require__(99);
|
12012 |
-
var anObject = __webpack_require__(3);
|
12013 |
-
var Reflect = __webpack_require__(4).Reflect;
|
12014 |
-
module.exports = Reflect && Reflect.ownKeys || function ownKeys(it) {
|
12015 |
-
var keys = gOPN.f(anObject(it));
|
12016 |
-
var getSymbols = gOPS.f;
|
12017 |
-
return getSymbols ? keys.concat(getSymbols(it)) : keys;
|
12018 |
-
};
|
12019 |
-
|
12020 |
-
|
12021 |
-
/***/ }),
|
12022 |
-
/* 223 */
|
12023 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12024 |
-
|
12025 |
-
"use strict";
|
12026 |
-
|
12027 |
-
// https://tc39.github.io/proposal-flatMap/#sec-FlattenIntoArray
|
12028 |
-
var isArray = __webpack_require__(100);
|
12029 |
-
var isObject = __webpack_require__(6);
|
12030 |
-
var toLength = __webpack_require__(16);
|
12031 |
-
var ctx = __webpack_require__(35);
|
12032 |
-
var IS_CONCAT_SPREADABLE = __webpack_require__(9)('isConcatSpreadable');
|
12033 |
-
|
12034 |
-
function flattenIntoArray(target, original, source, sourceLen, start, depth, mapper, thisArg) {
|
12035 |
-
var targetIndex = start;
|
12036 |
-
var sourceIndex = 0;
|
12037 |
-
var mapFn = mapper ? ctx(mapper, thisArg, 3) : false;
|
12038 |
-
var element, spreadable;
|
12039 |
-
|
12040 |
-
while (sourceIndex < sourceLen) {
|
12041 |
-
if (sourceIndex in source) {
|
12042 |
-
element = mapFn ? mapFn(source[sourceIndex], sourceIndex, original) : source[sourceIndex];
|
12043 |
-
|
12044 |
-
spreadable = false;
|
12045 |
-
if (isObject(element)) {
|
12046 |
-
spreadable = element[IS_CONCAT_SPREADABLE];
|
12047 |
-
spreadable = spreadable !== undefined ? !!spreadable : isArray(element);
|
12048 |
-
}
|
12049 |
-
|
12050 |
-
if (spreadable && depth > 0) {
|
12051 |
-
targetIndex = flattenIntoArray(target, original, element, toLength(element.length), targetIndex, depth - 1) - 1;
|
12052 |
-
} else {
|
12053 |
-
if (targetIndex >= 0x1fffffffffffff) throw TypeError();
|
12054 |
-
target[targetIndex] = element;
|
12055 |
-
}
|
12056 |
-
|
12057 |
-
targetIndex++;
|
12058 |
-
}
|
12059 |
-
sourceIndex++;
|
12060 |
-
}
|
12061 |
-
return targetIndex;
|
12062 |
-
}
|
12063 |
-
|
12064 |
-
module.exports = flattenIntoArray;
|
12065 |
-
|
12066 |
-
|
12067 |
-
/***/ }),
|
12068 |
-
/* 224 */
|
12069 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12070 |
-
|
12071 |
-
// https://github.com/tc39/proposal-string-pad-start-end
|
12072 |
-
var toLength = __webpack_require__(16);
|
12073 |
-
var repeat = __webpack_require__(137);
|
12074 |
-
var defined = __webpack_require__(40);
|
12075 |
-
|
12076 |
-
module.exports = function (that, maxLength, fillString, left) {
|
12077 |
-
var S = String(defined(that));
|
12078 |
-
var stringLength = S.length;
|
12079 |
-
var fillStr = fillString === undefined ? ' ' : String(fillString);
|
12080 |
-
var intMaxLength = toLength(maxLength);
|
12081 |
-
if (intMaxLength <= stringLength || fillStr == '') return S;
|
12082 |
-
var fillLen = intMaxLength - stringLength;
|
12083 |
-
var stringFiller = repeat.call(fillStr, Math.ceil(fillLen / fillStr.length));
|
12084 |
-
if (stringFiller.length > fillLen) stringFiller = stringFiller.slice(0, fillLen);
|
12085 |
-
return left ? stringFiller + S : S + stringFiller;
|
12086 |
-
};
|
12087 |
-
|
12088 |
-
|
12089 |
-
/***/ }),
|
12090 |
-
/* 225 */
|
12091 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12092 |
-
|
12093 |
-
var getKeys = __webpack_require__(56);
|
12094 |
-
var toIObject = __webpack_require__(29);
|
12095 |
-
var isEnum = __webpack_require__(85).f;
|
12096 |
-
module.exports = function (isEntries) {
|
12097 |
-
return function (it) {
|
12098 |
-
var O = toIObject(it);
|
12099 |
-
var keys = getKeys(O);
|
12100 |
-
var length = keys.length;
|
12101 |
-
var i = 0;
|
12102 |
-
var result = [];
|
12103 |
-
var key;
|
12104 |
-
while (length > i) if (isEnum.call(O, key = keys[i++])) {
|
12105 |
-
result.push(isEntries ? [key, O[key]] : O[key]);
|
12106 |
-
} return result;
|
12107 |
-
};
|
12108 |
-
};
|
12109 |
-
|
12110 |
-
|
12111 |
-
/***/ }),
|
12112 |
-
/* 226 */
|
12113 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12114 |
-
|
12115 |
-
// https://github.com/DavidBruant/Map-Set.prototype.toJSON
|
12116 |
-
var classof = __webpack_require__(86);
|
12117 |
-
var from = __webpack_require__(227);
|
12118 |
-
module.exports = function (NAME) {
|
12119 |
-
return function toJSON() {
|
12120 |
-
if (classof(this) != NAME) throw TypeError(NAME + "#toJSON isn't generic");
|
12121 |
-
return from(this);
|
12122 |
-
};
|
12123 |
-
};
|
12124 |
-
|
12125 |
-
|
12126 |
-
/***/ }),
|
12127 |
-
/* 227 */
|
12128 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12129 |
-
|
12130 |
-
var forOf = __webpack_require__(62);
|
12131 |
-
|
12132 |
-
module.exports = function (iter, ITERATOR) {
|
12133 |
-
var result = [];
|
12134 |
-
forOf(iter, false, result.push, result, ITERATOR);
|
12135 |
-
return result;
|
12136 |
-
};
|
12137 |
-
|
12138 |
-
|
12139 |
-
/***/ }),
|
12140 |
-
/* 228 */
|
12141 |
-
/***/ (function(module, exports) {
|
12142 |
-
|
12143 |
-
// https://rwaldron.github.io/proposal-math-extensions/
|
12144 |
-
module.exports = Math.scale || function scale(x, inLow, inHigh, outLow, outHigh) {
|
12145 |
-
if (
|
12146 |
-
arguments.length === 0
|
12147 |
-
// eslint-disable-next-line no-self-compare
|
12148 |
-
|| x != x
|
12149 |
-
// eslint-disable-next-line no-self-compare
|
12150 |
-
|| inLow != inLow
|
12151 |
-
// eslint-disable-next-line no-self-compare
|
12152 |
-
|| inHigh != inHigh
|
12153 |
-
// eslint-disable-next-line no-self-compare
|
12154 |
-
|| outLow != outLow
|
12155 |
-
// eslint-disable-next-line no-self-compare
|
12156 |
-
|| outHigh != outHigh
|
12157 |
-
) return NaN;
|
12158 |
-
if (x === Infinity || x === -Infinity) return x;
|
12159 |
-
return (x - inLow) * (outHigh - outLow) / (inHigh - inLow) + outLow;
|
12160 |
-
};
|
12161 |
-
|
12162 |
-
|
12163 |
-
/***/ }),
|
12164 |
-
/* 229 */
|
12165 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12166 |
-
|
12167 |
-
"use strict";
|
12168 |
-
/**
|
12169 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12170 |
-
*
|
12171 |
-
* This source code is licensed under the MIT license found in the
|
12172 |
-
* LICENSE file in the root directory of this source tree.
|
12173 |
-
*
|
12174 |
-
*/
|
12175 |
-
|
12176 |
-
|
12177 |
-
|
12178 |
-
var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement);
|
12179 |
-
|
12180 |
-
/**
|
12181 |
-
* Simple, lightweight module assisting with the detection and context of
|
12182 |
-
* Worker. Helps avoid circular dependencies and allows code to reason about
|
12183 |
-
* whether or not they are in a Worker, even if they never include the main
|
12184 |
-
* `ReactWorker` dependency.
|
12185 |
-
*/
|
12186 |
-
var ExecutionEnvironment = {
|
12187 |
-
|
12188 |
-
canUseDOM: canUseDOM,
|
12189 |
-
|
12190 |
-
canUseWorkers: typeof Worker !== 'undefined',
|
12191 |
-
|
12192 |
-
canUseEventListeners: canUseDOM && !!(window.addEventListener || window.attachEvent),
|
12193 |
-
|
12194 |
-
canUseViewport: canUseDOM && !!window.screen,
|
12195 |
-
|
12196 |
-
isInWorker: !canUseDOM // For now, this is true - might change in the future.
|
12197 |
-
|
12198 |
-
};
|
12199 |
-
|
12200 |
-
module.exports = ExecutionEnvironment;
|
12201 |
-
|
12202 |
-
/***/ }),
|
12203 |
-
/* 230 */
|
12204 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12205 |
-
|
12206 |
-
"use strict";
|
12207 |
-
/* WEBPACK VAR INJECTION */(function(process) {
|
12208 |
-
|
12209 |
-
/**
|
12210 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12211 |
-
*
|
12212 |
-
* This source code is licensed under the MIT license found in the
|
12213 |
-
* LICENSE file in the root directory of this source tree.
|
12214 |
-
*
|
12215 |
-
* @typechecks
|
12216 |
-
*/
|
12217 |
-
|
12218 |
-
var emptyFunction = __webpack_require__(50);
|
12219 |
-
|
12220 |
-
/**
|
12221 |
-
* Upstream version of event listener. Does not take into account specific
|
12222 |
-
* nature of platform.
|
12223 |
-
*/
|
12224 |
-
var EventListener = {
|
12225 |
-
/**
|
12226 |
-
* Listen to DOM events during the bubble phase.
|
12227 |
-
*
|
12228 |
-
* @param {DOMEventTarget} target DOM element to register listener on.
|
12229 |
-
* @param {string} eventType Event type, e.g. 'click' or 'mouseover'.
|
12230 |
-
* @param {function} callback Callback function.
|
12231 |
-
* @return {object} Object with a `remove` method.
|
12232 |
-
*/
|
12233 |
-
listen: function listen(target, eventType, callback) {
|
12234 |
-
if (target.addEventListener) {
|
12235 |
-
target.addEventListener(eventType, callback, false);
|
12236 |
-
return {
|
12237 |
-
remove: function remove() {
|
12238 |
-
target.removeEventListener(eventType, callback, false);
|
12239 |
-
}
|
12240 |
-
};
|
12241 |
-
} else if (target.attachEvent) {
|
12242 |
-
target.attachEvent('on' + eventType, callback);
|
12243 |
-
return {
|
12244 |
-
remove: function remove() {
|
12245 |
-
target.detachEvent('on' + eventType, callback);
|
12246 |
-
}
|
12247 |
-
};
|
12248 |
-
}
|
12249 |
-
},
|
12250 |
-
|
12251 |
-
/**
|
12252 |
-
* Listen to DOM events during the capture phase.
|
12253 |
-
*
|
12254 |
-
* @param {DOMEventTarget} target DOM element to register listener on.
|
12255 |
-
* @param {string} eventType Event type, e.g. 'click' or 'mouseover'.
|
12256 |
-
* @param {function} callback Callback function.
|
12257 |
-
* @return {object} Object with a `remove` method.
|
12258 |
-
*/
|
12259 |
-
capture: function capture(target, eventType, callback) {
|
12260 |
-
if (target.addEventListener) {
|
12261 |
-
target.addEventListener(eventType, callback, true);
|
12262 |
-
return {
|
12263 |
-
remove: function remove() {
|
12264 |
-
target.removeEventListener(eventType, callback, true);
|
12265 |
-
}
|
12266 |
-
};
|
12267 |
-
} else {
|
12268 |
-
if (process.env.NODE_ENV !== 'production') {
|
12269 |
-
console.error('Attempted to listen to events during the capture phase on a ' + 'browser that does not support the capture phase. Your application ' + 'will not receive some events.');
|
12270 |
-
}
|
12271 |
-
return {
|
12272 |
-
remove: emptyFunction
|
12273 |
-
};
|
12274 |
-
}
|
12275 |
-
},
|
12276 |
-
|
12277 |
-
registerDefault: function registerDefault() {}
|
12278 |
-
};
|
12279 |
-
|
12280 |
-
module.exports = EventListener;
|
12281 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
12282 |
-
|
12283 |
-
/***/ }),
|
12284 |
-
/* 231 */
|
12285 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12286 |
-
|
12287 |
-
"use strict";
|
12288 |
-
|
12289 |
-
|
12290 |
-
/**
|
12291 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12292 |
-
*
|
12293 |
-
* This source code is licensed under the MIT license found in the
|
12294 |
-
* LICENSE file in the root directory of this source tree.
|
12295 |
-
*
|
12296 |
-
* @typechecks
|
12297 |
-
*/
|
12298 |
-
|
12299 |
-
/* eslint-disable fb-www/typeof-undefined */
|
12300 |
-
|
12301 |
-
/**
|
12302 |
-
* Same as document.activeElement but wraps in a try-catch block. In IE it is
|
12303 |
-
* not safe to call document.activeElement if there is nothing focused.
|
12304 |
-
*
|
12305 |
-
* The activeElement will be null only if the document or document body is not
|
12306 |
-
* yet defined.
|
12307 |
-
*
|
12308 |
-
* @param {?DOMDocument} doc Defaults to current document.
|
12309 |
-
* @return {?DOMElement}
|
12310 |
-
*/
|
12311 |
-
function getActiveElement(doc) /*?DOMElement*/{
|
12312 |
-
doc = doc || (typeof document !== 'undefined' ? document : undefined);
|
12313 |
-
if (typeof doc === 'undefined') {
|
12314 |
-
return null;
|
12315 |
-
}
|
12316 |
-
try {
|
12317 |
-
return doc.activeElement || doc.body;
|
12318 |
-
} catch (e) {
|
12319 |
-
return doc.body;
|
12320 |
-
}
|
12321 |
-
}
|
12322 |
-
|
12323 |
-
module.exports = getActiveElement;
|
12324 |
-
|
12325 |
-
/***/ }),
|
12326 |
-
/* 232 */
|
12327 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12328 |
-
|
12329 |
-
"use strict";
|
12330 |
-
/**
|
12331 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12332 |
-
*
|
12333 |
-
* This source code is licensed under the MIT license found in the
|
12334 |
-
* LICENSE file in the root directory of this source tree.
|
12335 |
-
*
|
12336 |
-
* @typechecks
|
12337 |
-
*
|
12338 |
-
*/
|
12339 |
-
|
12340 |
-
/*eslint-disable no-self-compare */
|
12341 |
-
|
12342 |
-
|
12343 |
-
|
12344 |
-
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
12345 |
-
|
12346 |
-
/**
|
12347 |
-
* inlined Object.is polyfill to avoid requiring consumers ship their own
|
12348 |
-
* https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is
|
12349 |
-
*/
|
12350 |
-
function is(x, y) {
|
12351 |
-
// SameValue algorithm
|
12352 |
-
if (x === y) {
|
12353 |
-
// Steps 1-5, 7-10
|
12354 |
-
// Steps 6.b-6.e: +0 != -0
|
12355 |
-
// Added the nonzero y check to make Flow happy, but it is redundant
|
12356 |
-
return x !== 0 || y !== 0 || 1 / x === 1 / y;
|
12357 |
-
} else {
|
12358 |
-
// Step 6.a: NaN == NaN
|
12359 |
-
return x !== x && y !== y;
|
12360 |
-
}
|
12361 |
-
}
|
12362 |
-
|
12363 |
-
/**
|
12364 |
-
* Performs equality by iterating through keys on an object and returning false
|
12365 |
-
* when any key has values which are not strictly equal between the arguments.
|
12366 |
-
* Returns true when the values of all keys are strictly equal.
|
12367 |
-
*/
|
12368 |
-
function shallowEqual(objA, objB) {
|
12369 |
-
if (is(objA, objB)) {
|
12370 |
-
return true;
|
12371 |
-
}
|
12372 |
-
|
12373 |
-
if (typeof objA !== 'object' || objA === null || typeof objB !== 'object' || objB === null) {
|
12374 |
-
return false;
|
12375 |
-
}
|
12376 |
-
|
12377 |
-
var keysA = Object.keys(objA);
|
12378 |
-
var keysB = Object.keys(objB);
|
12379 |
-
|
12380 |
-
if (keysA.length !== keysB.length) {
|
12381 |
-
return false;
|
12382 |
-
}
|
12383 |
-
|
12384 |
-
// Test for A's keys different from B.
|
12385 |
-
for (var i = 0; i < keysA.length; i++) {
|
12386 |
-
if (!hasOwnProperty.call(objB, keysA[i]) || !is(objA[keysA[i]], objB[keysA[i]])) {
|
12387 |
-
return false;
|
12388 |
-
}
|
12389 |
-
}
|
12390 |
-
|
12391 |
-
return true;
|
12392 |
-
}
|
12393 |
-
|
12394 |
-
module.exports = shallowEqual;
|
12395 |
-
|
12396 |
-
/***/ }),
|
12397 |
-
/* 233 */
|
12398 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12399 |
-
|
12400 |
-
"use strict";
|
12401 |
-
|
12402 |
-
|
12403 |
-
/**
|
12404 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12405 |
-
*
|
12406 |
-
* This source code is licensed under the MIT license found in the
|
12407 |
-
* LICENSE file in the root directory of this source tree.
|
12408 |
-
*
|
12409 |
-
*
|
12410 |
-
*/
|
12411 |
-
|
12412 |
-
var isTextNode = __webpack_require__(510);
|
12413 |
-
|
12414 |
-
/*eslint-disable no-bitwise */
|
12415 |
-
|
12416 |
-
/**
|
12417 |
-
* Checks if a given DOM node contains or is another DOM node.
|
12418 |
-
*/
|
12419 |
-
function containsNode(outerNode, innerNode) {
|
12420 |
-
if (!outerNode || !innerNode) {
|
12421 |
-
return false;
|
12422 |
-
} else if (outerNode === innerNode) {
|
12423 |
-
return true;
|
12424 |
-
} else if (isTextNode(outerNode)) {
|
12425 |
-
return false;
|
12426 |
-
} else if (isTextNode(innerNode)) {
|
12427 |
-
return containsNode(outerNode, innerNode.parentNode);
|
12428 |
-
} else if ('contains' in outerNode) {
|
12429 |
-
return outerNode.contains(innerNode);
|
12430 |
-
} else if (outerNode.compareDocumentPosition) {
|
12431 |
-
return !!(outerNode.compareDocumentPosition(innerNode) & 16);
|
12432 |
-
} else {
|
12433 |
-
return false;
|
12434 |
-
}
|
12435 |
-
}
|
12436 |
-
|
12437 |
-
module.exports = containsNode;
|
12438 |
-
|
12439 |
-
/***/ }),
|
12440 |
-
/* 234 */
|
12441 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12442 |
-
|
12443 |
-
"use strict";
|
12444 |
-
/**
|
12445 |
-
* Copyright (c) 2013-present, Facebook, Inc.
|
12446 |
-
*
|
12447 |
-
* This source code is licensed under the MIT license found in the
|
12448 |
-
* LICENSE file in the root directory of this source tree.
|
12449 |
-
*
|
12450 |
-
*/
|
12451 |
-
|
12452 |
-
|
12453 |
-
|
12454 |
-
/**
|
12455 |
-
* @param {DOMElement} node input/textarea to focus
|
12456 |
-
*/
|
12457 |
-
|
12458 |
-
function focusNode(node) {
|
12459 |
-
// IE8 can throw "Can't move focus to the control because it is invisible,
|
12460 |
-
// not enabled, or of a type that does not accept the focus." for all kinds of
|
12461 |
-
// reasons that are too expensive and fragile to test.
|
12462 |
-
try {
|
12463 |
-
node.focus();
|
12464 |
-
} catch (e) {}
|
12465 |
-
}
|
12466 |
-
|
12467 |
-
module.exports = focusNode;
|
12468 |
-
|
12469 |
-
/***/ }),
|
12470 |
-
/* 235 */
|
12471 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12472 |
-
|
12473 |
-
"use strict";
|
12474 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
12475 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of__);
|
12476 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
12477 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__);
|
12478 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
12479 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__);
|
12480 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
12481 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_possibleConstructorReturn__);
|
12482 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
12483 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_inherits__);
|
12484 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react__ = __webpack_require__(2);
|
12485 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_react__);
|
12486 |
-
|
12487 |
-
|
12488 |
-
|
12489 |
-
|
12490 |
-
|
12491 |
-
|
12492 |
-
var babelPluginFlowReactPropTypes_proptype_RenderedSection = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_RenderedSection || __webpack_require__(0).any;
|
12493 |
-
|
12494 |
-
var babelPluginFlowReactPropTypes_proptype_ScrollIndices = __webpack_require__(569).babelPluginFlowReactPropTypes_proptype_ScrollIndices || __webpack_require__(0).any;
|
12495 |
-
|
12496 |
-
|
12497 |
-
|
12498 |
-
/**
|
12499 |
-
* This HOC decorates a virtualized component and responds to arrow-key events by scrolling one row or column at a time.
|
12500 |
-
*/
|
12501 |
-
|
12502 |
-
var ArrowKeyStepper = function (_React$PureComponent) {
|
12503 |
-
__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_inherits___default()(ArrowKeyStepper, _React$PureComponent);
|
12504 |
-
|
12505 |
-
function ArrowKeyStepper(props) {
|
12506 |
-
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default()(this, ArrowKeyStepper);
|
12507 |
-
|
12508 |
-
var _this = __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_possibleConstructorReturn___default()(this, (ArrowKeyStepper.__proto__ || __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of___default()(ArrowKeyStepper)).call(this, props));
|
12509 |
-
|
12510 |
-
_this._columnStartIndex = 0;
|
12511 |
-
_this._columnStopIndex = 0;
|
12512 |
-
_this._rowStartIndex = 0;
|
12513 |
-
_this._rowStopIndex = 0;
|
12514 |
-
|
12515 |
-
_this._onKeyDown = function (event) {
|
12516 |
-
var _this$props = _this.props,
|
12517 |
-
columnCount = _this$props.columnCount,
|
12518 |
-
disabled = _this$props.disabled,
|
12519 |
-
mode = _this$props.mode,
|
12520 |
-
rowCount = _this$props.rowCount;
|
12521 |
-
|
12522 |
-
|
12523 |
-
if (disabled) {
|
12524 |
-
return;
|
12525 |
-
}
|
12526 |
-
|
12527 |
-
var _this$_getScrollState = _this._getScrollState(),
|
12528 |
-
scrollToColumnPrevious = _this$_getScrollState.scrollToColumn,
|
12529 |
-
scrollToRowPrevious = _this$_getScrollState.scrollToRow;
|
12530 |
-
|
12531 |
-
var _this$_getScrollState2 = _this._getScrollState(),
|
12532 |
-
scrollToColumn = _this$_getScrollState2.scrollToColumn,
|
12533 |
-
scrollToRow = _this$_getScrollState2.scrollToRow;
|
12534 |
-
|
12535 |
-
// The above cases all prevent default event event behavior.
|
12536 |
-
// This is to keep the grid from scrolling after the snap-to update.
|
12537 |
-
|
12538 |
-
|
12539 |
-
switch (event.key) {
|
12540 |
-
case 'ArrowDown':
|
12541 |
-
scrollToRow = mode === 'cells' ? Math.min(scrollToRow + 1, rowCount - 1) : Math.min(_this._rowStopIndex + 1, rowCount - 1);
|
12542 |
-
break;
|
12543 |
-
case 'ArrowLeft':
|
12544 |
-
scrollToColumn = mode === 'cells' ? Math.max(scrollToColumn - 1, 0) : Math.max(_this._columnStartIndex - 1, 0);
|
12545 |
-
break;
|
12546 |
-
case 'ArrowRight':
|
12547 |
-
scrollToColumn = mode === 'cells' ? Math.min(scrollToColumn + 1, columnCount - 1) : Math.min(_this._columnStopIndex + 1, columnCount - 1);
|
12548 |
-
break;
|
12549 |
-
case 'ArrowUp':
|
12550 |
-
scrollToRow = mode === 'cells' ? Math.max(scrollToRow - 1, 0) : Math.max(_this._rowStartIndex - 1, 0);
|
12551 |
-
break;
|
12552 |
-
}
|
12553 |
-
|
12554 |
-
if (scrollToColumn !== scrollToColumnPrevious || scrollToRow !== scrollToRowPrevious) {
|
12555 |
-
event.preventDefault();
|
12556 |
-
|
12557 |
-
_this._updateScrollState({ scrollToColumn: scrollToColumn, scrollToRow: scrollToRow });
|
12558 |
-
}
|
12559 |
-
};
|
12560 |
-
|
12561 |
-
_this._onSectionRendered = function (_ref) {
|
12562 |
-
var columnStartIndex = _ref.columnStartIndex,
|
12563 |
-
columnStopIndex = _ref.columnStopIndex,
|
12564 |
-
rowStartIndex = _ref.rowStartIndex,
|
12565 |
-
rowStopIndex = _ref.rowStopIndex;
|
12566 |
-
|
12567 |
-
_this._columnStartIndex = columnStartIndex;
|
12568 |
-
_this._columnStopIndex = columnStopIndex;
|
12569 |
-
_this._rowStartIndex = rowStartIndex;
|
12570 |
-
_this._rowStopIndex = rowStopIndex;
|
12571 |
-
};
|
12572 |
-
|
12573 |
-
_this.state = {
|
12574 |
-
scrollToColumn: props.scrollToColumn,
|
12575 |
-
scrollToRow: props.scrollToRow
|
12576 |
-
};
|
12577 |
-
return _this;
|
12578 |
-
}
|
12579 |
-
|
12580 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default()(ArrowKeyStepper, [{
|
12581 |
-
key: 'componentWillReceiveProps',
|
12582 |
-
value: function componentWillReceiveProps(nextProps) {
|
12583 |
-
if (this.props.isControlled) {
|
12584 |
-
return;
|
12585 |
-
}
|
12586 |
-
|
12587 |
-
var scrollToColumn = nextProps.scrollToColumn,
|
12588 |
-
scrollToRow = nextProps.scrollToRow;
|
12589 |
-
var _props = this.props,
|
12590 |
-
prevScrollToColumn = _props.scrollToColumn,
|
12591 |
-
prevScrollToRow = _props.scrollToRow;
|
12592 |
-
|
12593 |
-
|
12594 |
-
if (prevScrollToColumn !== scrollToColumn && prevScrollToRow !== scrollToRow) {
|
12595 |
-
this.setState({
|
12596 |
-
scrollToColumn: scrollToColumn,
|
12597 |
-
scrollToRow: scrollToRow
|
12598 |
-
});
|
12599 |
-
} else if (prevScrollToColumn !== scrollToColumn) {
|
12600 |
-
this.setState({ scrollToColumn: scrollToColumn });
|
12601 |
-
} else if (prevScrollToRow !== scrollToRow) {
|
12602 |
-
this.setState({ scrollToRow: scrollToRow });
|
12603 |
-
}
|
12604 |
-
}
|
12605 |
-
}, {
|
12606 |
-
key: 'setScrollIndexes',
|
12607 |
-
value: function setScrollIndexes(_ref2) {
|
12608 |
-
var scrollToColumn = _ref2.scrollToColumn,
|
12609 |
-
scrollToRow = _ref2.scrollToRow;
|
12610 |
-
|
12611 |
-
this.setState({
|
12612 |
-
scrollToRow: scrollToRow,
|
12613 |
-
scrollToColumn: scrollToColumn
|
12614 |
-
});
|
12615 |
-
}
|
12616 |
-
}, {
|
12617 |
-
key: 'render',
|
12618 |
-
value: function render() {
|
12619 |
-
var _props2 = this.props,
|
12620 |
-
className = _props2.className,
|
12621 |
-
children = _props2.children;
|
12622 |
-
|
12623 |
-
var _getScrollState2 = this._getScrollState(),
|
12624 |
-
scrollToColumn = _getScrollState2.scrollToColumn,
|
12625 |
-
scrollToRow = _getScrollState2.scrollToRow;
|
12626 |
-
|
12627 |
-
return __WEBPACK_IMPORTED_MODULE_5_react__["createElement"](
|
12628 |
-
'div',
|
12629 |
-
{ className: className, onKeyDown: this._onKeyDown },
|
12630 |
-
children({
|
12631 |
-
onSectionRendered: this._onSectionRendered,
|
12632 |
-
scrollToColumn: scrollToColumn,
|
12633 |
-
scrollToRow: scrollToRow
|
12634 |
-
})
|
12635 |
-
);
|
12636 |
-
}
|
12637 |
-
}, {
|
12638 |
-
key: '_getScrollState',
|
12639 |
-
value: function _getScrollState() {
|
12640 |
-
return this.props.isControlled ? this.props : this.state;
|
12641 |
-
}
|
12642 |
-
}, {
|
12643 |
-
key: '_updateScrollState',
|
12644 |
-
value: function _updateScrollState(_ref3) {
|
12645 |
-
var scrollToColumn = _ref3.scrollToColumn,
|
12646 |
-
scrollToRow = _ref3.scrollToRow;
|
12647 |
-
var _props3 = this.props,
|
12648 |
-
isControlled = _props3.isControlled,
|
12649 |
-
onScrollToChange = _props3.onScrollToChange;
|
12650 |
-
|
12651 |
-
|
12652 |
-
if (typeof onScrollToChange === 'function') {
|
12653 |
-
onScrollToChange({ scrollToColumn: scrollToColumn, scrollToRow: scrollToRow });
|
12654 |
-
}
|
12655 |
-
|
12656 |
-
if (!isControlled) {
|
12657 |
-
this.setState({ scrollToColumn: scrollToColumn, scrollToRow: scrollToRow });
|
12658 |
-
}
|
12659 |
-
}
|
12660 |
-
}]);
|
12661 |
-
|
12662 |
-
return ArrowKeyStepper;
|
12663 |
-
}(__WEBPACK_IMPORTED_MODULE_5_react__["PureComponent"]);
|
12664 |
-
|
12665 |
-
ArrowKeyStepper.defaultProps = {
|
12666 |
-
disabled: false,
|
12667 |
-
isControlled: false,
|
12668 |
-
mode: 'edges',
|
12669 |
-
scrollToColumn: 0,
|
12670 |
-
scrollToRow: 0
|
12671 |
-
};
|
12672 |
-
ArrowKeyStepper.propTypes = {
|
12673 |
-
children: __webpack_require__(0).func.isRequired,
|
12674 |
-
className: __webpack_require__(0).string,
|
12675 |
-
columnCount: __webpack_require__(0).number.isRequired,
|
12676 |
-
disabled: __webpack_require__(0).bool.isRequired,
|
12677 |
-
isControlled: __webpack_require__(0).bool.isRequired,
|
12678 |
-
mode: __webpack_require__(0).oneOf(['cells', 'edges']).isRequired,
|
12679 |
-
onScrollToChange: __webpack_require__(0).func,
|
12680 |
-
rowCount: __webpack_require__(0).number.isRequired,
|
12681 |
-
scrollToColumn: __webpack_require__(0).number.isRequired,
|
12682 |
-
scrollToRow: __webpack_require__(0).number.isRequired
|
12683 |
-
};
|
12684 |
-
/* harmony default export */ __webpack_exports__["a"] = (ArrowKeyStepper);
|
12685 |
-
|
12686 |
-
/***/ }),
|
12687 |
-
/* 236 */
|
12688 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12689 |
-
|
12690 |
-
// 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O)
|
12691 |
-
var has = __webpack_require__(65);
|
12692 |
-
var toObject = __webpack_require__(111);
|
12693 |
-
var IE_PROTO = __webpack_require__(160)('IE_PROTO');
|
12694 |
-
var ObjectProto = Object.prototype;
|
12695 |
-
|
12696 |
-
module.exports = Object.getPrototypeOf || function (O) {
|
12697 |
-
O = toObject(O);
|
12698 |
-
if (has(O, IE_PROTO)) return O[IE_PROTO];
|
12699 |
-
if (typeof O.constructor == 'function' && O instanceof O.constructor) {
|
12700 |
-
return O.constructor.prototype;
|
12701 |
-
} return O instanceof Object ? ObjectProto : null;
|
12702 |
-
};
|
12703 |
-
|
12704 |
-
|
12705 |
-
/***/ }),
|
12706 |
-
/* 237 */
|
12707 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12708 |
-
|
12709 |
-
// optional / simple context binding
|
12710 |
-
var aFunction = __webpack_require__(524);
|
12711 |
-
module.exports = function (fn, that, length) {
|
12712 |
-
aFunction(fn);
|
12713 |
-
if (that === undefined) return fn;
|
12714 |
-
switch (length) {
|
12715 |
-
case 1: return function (a) {
|
12716 |
-
return fn.call(that, a);
|
12717 |
-
};
|
12718 |
-
case 2: return function (a, b) {
|
12719 |
-
return fn.call(that, a, b);
|
12720 |
-
};
|
12721 |
-
case 3: return function (a, b, c) {
|
12722 |
-
return fn.call(that, a, b, c);
|
12723 |
-
};
|
12724 |
-
}
|
12725 |
-
return function (/* ...args */) {
|
12726 |
-
return fn.apply(that, arguments);
|
12727 |
-
};
|
12728 |
-
};
|
12729 |
-
|
12730 |
-
|
12731 |
-
/***/ }),
|
12732 |
-
/* 238 */
|
12733 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12734 |
-
|
12735 |
-
module.exports = !__webpack_require__(68) && !__webpack_require__(80)(function () {
|
12736 |
-
return Object.defineProperty(__webpack_require__(239)('div'), 'a', { get: function () { return 7; } }).a != 7;
|
12737 |
-
});
|
12738 |
-
|
12739 |
-
|
12740 |
-
/***/ }),
|
12741 |
-
/* 239 */
|
12742 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12743 |
-
|
12744 |
-
var isObject = __webpack_require__(79);
|
12745 |
-
var document = __webpack_require__(51).document;
|
12746 |
-
// typeof document.createElement is 'object' in old IE
|
12747 |
-
var is = isObject(document) && isObject(document.createElement);
|
12748 |
-
module.exports = function (it) {
|
12749 |
-
return is ? document.createElement(it) : {};
|
12750 |
-
};
|
12751 |
-
|
12752 |
-
|
12753 |
-
/***/ }),
|
12754 |
-
/* 240 */
|
12755 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12756 |
-
|
12757 |
-
module.exports = { "default": __webpack_require__(525), __esModule: true };
|
12758 |
-
|
12759 |
-
/***/ }),
|
12760 |
-
/* 241 */
|
12761 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12762 |
-
|
12763 |
-
"use strict";
|
12764 |
-
|
12765 |
-
var LIBRARY = __webpack_require__(166);
|
12766 |
-
var $export = __webpack_require__(66);
|
12767 |
-
var redefine = __webpack_require__(242);
|
12768 |
-
var hide = __webpack_require__(77);
|
12769 |
-
var has = __webpack_require__(65);
|
12770 |
-
var Iterators = __webpack_require__(89);
|
12771 |
-
var $iterCreate = __webpack_require__(530);
|
12772 |
-
var setToStringTag = __webpack_require__(170);
|
12773 |
-
var getPrototypeOf = __webpack_require__(236);
|
12774 |
-
var ITERATOR = __webpack_require__(46)('iterator');
|
12775 |
-
var BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next`
|
12776 |
-
var FF_ITERATOR = '@@iterator';
|
12777 |
-
var KEYS = 'keys';
|
12778 |
-
var VALUES = 'values';
|
12779 |
-
|
12780 |
-
var returnThis = function () { return this; };
|
12781 |
-
|
12782 |
-
module.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCED) {
|
12783 |
-
$iterCreate(Constructor, NAME, next);
|
12784 |
-
var getMethod = function (kind) {
|
12785 |
-
if (!BUGGY && kind in proto) return proto[kind];
|
12786 |
-
switch (kind) {
|
12787 |
-
case KEYS: return function keys() { return new Constructor(this, kind); };
|
12788 |
-
case VALUES: return function values() { return new Constructor(this, kind); };
|
12789 |
-
} return function entries() { return new Constructor(this, kind); };
|
12790 |
-
};
|
12791 |
-
var TAG = NAME + ' Iterator';
|
12792 |
-
var DEF_VALUES = DEFAULT == VALUES;
|
12793 |
-
var VALUES_BUG = false;
|
12794 |
-
var proto = Base.prototype;
|
12795 |
-
var $native = proto[ITERATOR] || proto[FF_ITERATOR] || DEFAULT && proto[DEFAULT];
|
12796 |
-
var $default = (!BUGGY && $native) || getMethod(DEFAULT);
|
12797 |
-
var $entries = DEFAULT ? !DEF_VALUES ? $default : getMethod('entries') : undefined;
|
12798 |
-
var $anyNative = NAME == 'Array' ? proto.entries || $native : $native;
|
12799 |
-
var methods, key, IteratorPrototype;
|
12800 |
-
// Fix native
|
12801 |
-
if ($anyNative) {
|
12802 |
-
IteratorPrototype = getPrototypeOf($anyNative.call(new Base()));
|
12803 |
-
if (IteratorPrototype !== Object.prototype && IteratorPrototype.next) {
|
12804 |
-
// Set @@toStringTag to native iterators
|
12805 |
-
setToStringTag(IteratorPrototype, TAG, true);
|
12806 |
-
// fix for some old engines
|
12807 |
-
if (!LIBRARY && !has(IteratorPrototype, ITERATOR)) hide(IteratorPrototype, ITERATOR, returnThis);
|
12808 |
-
}
|
12809 |
-
}
|
12810 |
-
// fix Array#{values, @@iterator}.name in V8 / FF
|
12811 |
-
if (DEF_VALUES && $native && $native.name !== VALUES) {
|
12812 |
-
VALUES_BUG = true;
|
12813 |
-
$default = function values() { return $native.call(this); };
|
12814 |
-
}
|
12815 |
-
// Define iterator
|
12816 |
-
if ((!LIBRARY || FORCED) && (BUGGY || VALUES_BUG || !proto[ITERATOR])) {
|
12817 |
-
hide(proto, ITERATOR, $default);
|
12818 |
-
}
|
12819 |
-
// Plug for library
|
12820 |
-
Iterators[NAME] = $default;
|
12821 |
-
Iterators[TAG] = returnThis;
|
12822 |
-
if (DEFAULT) {
|
12823 |
-
methods = {
|
12824 |
-
values: DEF_VALUES ? $default : getMethod(VALUES),
|
12825 |
-
keys: IS_SET ? $default : getMethod(KEYS),
|
12826 |
-
entries: $entries
|
12827 |
-
};
|
12828 |
-
if (FORCED) for (key in methods) {
|
12829 |
-
if (!(key in proto)) redefine(proto, key, methods[key]);
|
12830 |
-
} else $export($export.P + $export.F * (BUGGY || VALUES_BUG), NAME, methods);
|
12831 |
-
}
|
12832 |
-
return methods;
|
12833 |
-
};
|
12834 |
-
|
12835 |
-
|
12836 |
-
/***/ }),
|
12837 |
-
/* 242 */
|
12838 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12839 |
-
|
12840 |
-
module.exports = __webpack_require__(77);
|
12841 |
-
|
12842 |
-
|
12843 |
-
/***/ }),
|
12844 |
-
/* 243 */
|
12845 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12846 |
-
|
12847 |
-
var has = __webpack_require__(65);
|
12848 |
-
var toIObject = __webpack_require__(69);
|
12849 |
-
var arrayIndexOf = __webpack_require__(532)(false);
|
12850 |
-
var IE_PROTO = __webpack_require__(160)('IE_PROTO');
|
12851 |
-
|
12852 |
-
module.exports = function (object, names) {
|
12853 |
-
var O = toIObject(object);
|
12854 |
-
var i = 0;
|
12855 |
-
var result = [];
|
12856 |
-
var key;
|
12857 |
-
for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key);
|
12858 |
-
// Don't enum bug & hidden keys
|
12859 |
-
while (names.length > i) if (has(O, key = names[i++])) {
|
12860 |
-
~arrayIndexOf(result, key) || result.push(key);
|
12861 |
-
}
|
12862 |
-
return result;
|
12863 |
-
};
|
12864 |
-
|
12865 |
-
|
12866 |
-
/***/ }),
|
12867 |
-
/* 244 */
|
12868 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12869 |
-
|
12870 |
-
// fallback for non-array-like ES3 and non-enumerable old V8 strings
|
12871 |
-
var cof = __webpack_require__(168);
|
12872 |
-
// eslint-disable-next-line no-prototype-builtins
|
12873 |
-
module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) {
|
12874 |
-
return cof(it) == 'String' ? it.split('') : Object(it);
|
12875 |
-
};
|
12876 |
-
|
12877 |
-
|
12878 |
-
/***/ }),
|
12879 |
-
/* 245 */
|
12880 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12881 |
-
|
12882 |
-
// 19.1.2.7 / 15.2.3.4 Object.getOwnPropertyNames(O)
|
12883 |
-
var $keys = __webpack_require__(243);
|
12884 |
-
var hiddenKeys = __webpack_require__(169).concat('length', 'prototype');
|
12885 |
-
|
12886 |
-
exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {
|
12887 |
-
return $keys(O, hiddenKeys);
|
12888 |
-
};
|
12889 |
-
|
12890 |
-
|
12891 |
-
/***/ }),
|
12892 |
-
/* 246 */
|
12893 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12894 |
-
|
12895 |
-
"use strict";
|
12896 |
-
/* unused harmony export DEFAULT_SCROLLING_RESET_TIME_INTERVAL */
|
12897 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
12898 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
12899 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
12900 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__);
|
12901 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
12902 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
12903 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
12904 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
12905 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
12906 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
12907 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
12908 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
12909 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(2);
|
12910 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
12911 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames__ = __webpack_require__(47);
|
12912 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_classnames__);
|
12913 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_calculateSizeAndPositionDataAndUpdateScrollOffset__ = __webpack_require__(563);
|
12914 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_ScalingCellSizeAndPositionManager__ = __webpack_require__(176);
|
12915 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__utils_createCallbackMemoizer__ = __webpack_require__(177);
|
12916 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__ = __webpack_require__(248);
|
12917 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__utils_updateScrollIndexHelper__ = __webpack_require__(566);
|
12918 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__defaultCellRangeRenderer__ = __webpack_require__(249);
|
12919 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14_dom_helpers_util_scrollbarSize__ = __webpack_require__(250);
|
12920 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14_dom_helpers_util_scrollbarSize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_14_dom_helpers_util_scrollbarSize__);
|
12921 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__utils_requestAnimationTimeout__ = __webpack_require__(91);
|
12922 |
-
|
12923 |
-
|
12924 |
-
|
12925 |
-
|
12926 |
-
|
12927 |
-
|
12928 |
-
|
12929 |
-
var babelPluginFlowReactPropTypes_proptype_Alignment = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_Alignment || __webpack_require__(0).any;
|
12930 |
-
|
12931 |
-
var babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter || __webpack_require__(0).any;
|
12932 |
-
|
12933 |
-
var babelPluginFlowReactPropTypes_proptype_RenderedSection = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_RenderedSection || __webpack_require__(0).any;
|
12934 |
-
|
12935 |
-
var babelPluginFlowReactPropTypes_proptype_ScrollbarPresenceChange = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_ScrollbarPresenceChange || __webpack_require__(0).any;
|
12936 |
-
|
12937 |
-
var babelPluginFlowReactPropTypes_proptype_Scroll = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_Scroll || __webpack_require__(0).any;
|
12938 |
-
|
12939 |
-
var babelPluginFlowReactPropTypes_proptype_NoContentRenderer = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_NoContentRenderer || __webpack_require__(0).any;
|
12940 |
-
|
12941 |
-
var babelPluginFlowReactPropTypes_proptype_CellSizeGetter = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellSizeGetter || __webpack_require__(0).any;
|
12942 |
-
|
12943 |
-
var babelPluginFlowReactPropTypes_proptype_CellSize = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellSize || __webpack_require__(0).any;
|
12944 |
-
|
12945 |
-
var babelPluginFlowReactPropTypes_proptype_CellPosition = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellPosition || __webpack_require__(0).any;
|
12946 |
-
|
12947 |
-
var babelPluginFlowReactPropTypes_proptype_CellRangeRenderer = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellRangeRenderer || __webpack_require__(0).any;
|
12948 |
-
|
12949 |
-
var babelPluginFlowReactPropTypes_proptype_CellRenderer = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellRenderer || __webpack_require__(0).any;
|
12950 |
-
|
12951 |
-
var babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId = __webpack_require__(91).babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId || __webpack_require__(0).any;
|
12952 |
-
|
12953 |
-
|
12954 |
-
|
12955 |
-
|
12956 |
-
|
12957 |
-
|
12958 |
-
|
12959 |
-
|
12960 |
-
|
12961 |
-
|
12962 |
-
|
12963 |
-
|
12964 |
-
/**
|
12965 |
-
* Specifies the number of milliseconds during which to disable pointer events while a scroll is in progress.
|
12966 |
-
* This improves performance and makes scrolling smoother.
|
12967 |
-
*/
|
12968 |
-
var DEFAULT_SCROLLING_RESET_TIME_INTERVAL = 150;
|
12969 |
-
|
12970 |
-
/**
|
12971 |
-
* Controls whether the Grid updates the DOM element's scrollLeft/scrollTop based on the current state or just observes it.
|
12972 |
-
* This prevents Grid from interrupting mouse-wheel animations (see issue #2).
|
12973 |
-
*/
|
12974 |
-
var SCROLL_POSITION_CHANGE_REASONS = {
|
12975 |
-
OBSERVED: 'observed',
|
12976 |
-
REQUESTED: 'requested'
|
12977 |
-
};
|
12978 |
-
|
12979 |
-
var renderNull = function renderNull() {
|
12980 |
-
return null;
|
12981 |
-
};
|
12982 |
-
|
12983 |
-
/**
|
12984 |
-
* Renders tabular data with virtualization along the vertical and horizontal axes.
|
12985 |
-
* Row heights and column widths must be known ahead of time and specified as properties.
|
12986 |
-
*/
|
12987 |
-
var Grid = function (_React$PureComponent) {
|
12988 |
-
__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default()(Grid, _React$PureComponent);
|
12989 |
-
|
12990 |
-
// Invokes onSectionRendered callback only when start/stop row or column indices change
|
12991 |
-
function Grid(props) {
|
12992 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default()(this, Grid);
|
12993 |
-
|
12994 |
-
var _this = __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(this, (Grid.__proto__ || __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default()(Grid)).call(this, props));
|
12995 |
-
|
12996 |
-
_this.state = {
|
12997 |
-
isScrolling: false,
|
12998 |
-
scrollDirectionHorizontal: __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */],
|
12999 |
-
scrollDirectionVertical: __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */],
|
13000 |
-
scrollLeft: 0,
|
13001 |
-
scrollTop: 0,
|
13002 |
-
scrollPositionChangeReason: null
|
13003 |
-
};
|
13004 |
-
_this._onGridRenderedMemoizer = Object(__WEBPACK_IMPORTED_MODULE_10__utils_createCallbackMemoizer__["a" /* default */])();
|
13005 |
-
_this._onScrollMemoizer = Object(__WEBPACK_IMPORTED_MODULE_10__utils_createCallbackMemoizer__["a" /* default */])(false);
|
13006 |
-
_this._deferredInvalidateColumnIndex = null;
|
13007 |
-
_this._deferredInvalidateRowIndex = null;
|
13008 |
-
_this._recomputeScrollLeftFlag = false;
|
13009 |
-
_this._recomputeScrollTopFlag = false;
|
13010 |
-
_this._horizontalScrollBarSize = 0;
|
13011 |
-
_this._verticalScrollBarSize = 0;
|
13012 |
-
_this._scrollbarPresenceChanged = false;
|
13013 |
-
_this._cellCache = {};
|
13014 |
-
_this._styleCache = {};
|
13015 |
-
_this._scrollbarSizeMeasured = false;
|
13016 |
-
_this._renderedColumnStartIndex = 0;
|
13017 |
-
_this._renderedColumnStopIndex = 0;
|
13018 |
-
_this._renderedRowStartIndex = 0;
|
13019 |
-
_this._renderedRowStopIndex = 0;
|
13020 |
-
|
13021 |
-
_this._debounceScrollEndedCallback = function () {
|
13022 |
-
_this._disablePointerEventsTimeoutId = null;
|
13023 |
-
_this._resetStyleCache();
|
13024 |
-
};
|
13025 |
-
|
13026 |
-
_this._invokeOnGridRenderedHelper = function () {
|
13027 |
-
var onSectionRendered = _this.props.onSectionRendered;
|
13028 |
-
|
13029 |
-
|
13030 |
-
_this._onGridRenderedMemoizer({
|
13031 |
-
callback: onSectionRendered,
|
13032 |
-
indices: {
|
13033 |
-
columnOverscanStartIndex: _this._columnStartIndex,
|
13034 |
-
columnOverscanStopIndex: _this._columnStopIndex,
|
13035 |
-
columnStartIndex: _this._renderedColumnStartIndex,
|
13036 |
-
columnStopIndex: _this._renderedColumnStopIndex,
|
13037 |
-
rowOverscanStartIndex: _this._rowStartIndex,
|
13038 |
-
rowOverscanStopIndex: _this._rowStopIndex,
|
13039 |
-
rowStartIndex: _this._renderedRowStartIndex,
|
13040 |
-
rowStopIndex: _this._renderedRowStopIndex
|
13041 |
-
}
|
13042 |
-
});
|
13043 |
-
};
|
13044 |
-
|
13045 |
-
_this._setScrollingContainerRef = function (ref) {
|
13046 |
-
_this._scrollingContainer = ref;
|
13047 |
-
};
|
13048 |
-
|
13049 |
-
_this._onScroll = function (event) {
|
13050 |
-
// In certain edge-cases React dispatches an onScroll event with an invalid target.scrollLeft / target.scrollTop.
|
13051 |
-
// This invalid event can be detected by comparing event.target to this component's scrollable DOM element.
|
13052 |
-
// See issue #404 for more information.
|
13053 |
-
if (event.target === _this._scrollingContainer) {
|
13054 |
-
_this.handleScrollEvent(event.target);
|
13055 |
-
}
|
13056 |
-
};
|
13057 |
-
|
13058 |
-
_this._columnWidthGetter = _this._wrapSizeGetter(props.columnWidth);
|
13059 |
-
_this._rowHeightGetter = _this._wrapSizeGetter(props.rowHeight);
|
13060 |
-
|
13061 |
-
_this._columnSizeAndPositionManager = new __WEBPACK_IMPORTED_MODULE_9__utils_ScalingCellSizeAndPositionManager__["a" /* default */]({
|
13062 |
-
cellCount: props.columnCount,
|
13063 |
-
cellSizeGetter: function cellSizeGetter(params) {
|
13064 |
-
return _this._columnWidthGetter(params);
|
13065 |
-
},
|
13066 |
-
estimatedCellSize: _this._getEstimatedColumnSize(props)
|
13067 |
-
});
|
13068 |
-
_this._rowSizeAndPositionManager = new __WEBPACK_IMPORTED_MODULE_9__utils_ScalingCellSizeAndPositionManager__["a" /* default */]({
|
13069 |
-
cellCount: props.rowCount,
|
13070 |
-
cellSizeGetter: function cellSizeGetter(params) {
|
13071 |
-
return _this._rowHeightGetter(params);
|
13072 |
-
},
|
13073 |
-
estimatedCellSize: _this._getEstimatedRowSize(props)
|
13074 |
-
});
|
13075 |
-
return _this;
|
13076 |
-
}
|
13077 |
-
|
13078 |
-
/**
|
13079 |
-
* Gets offsets for a given cell and alignment.
|
13080 |
-
*/
|
13081 |
-
|
13082 |
-
|
13083 |
-
// See defaultCellRangeRenderer() for more information on the usage of these caches
|
13084 |
-
|
13085 |
-
|
13086 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default()(Grid, [{
|
13087 |
-
key: 'getOffsetForCell',
|
13088 |
-
value: function getOffsetForCell() {
|
13089 |
-
var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},
|
13090 |
-
_ref$alignment = _ref.alignment,
|
13091 |
-
alignment = _ref$alignment === undefined ? this.props.scrollToAlignment : _ref$alignment,
|
13092 |
-
_ref$columnIndex = _ref.columnIndex,
|
13093 |
-
columnIndex = _ref$columnIndex === undefined ? this.props.scrollToColumn : _ref$columnIndex,
|
13094 |
-
_ref$rowIndex = _ref.rowIndex,
|
13095 |
-
rowIndex = _ref$rowIndex === undefined ? this.props.scrollToRow : _ref$rowIndex;
|
13096 |
-
|
13097 |
-
var offsetProps = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, this.props, {
|
13098 |
-
scrollToAlignment: alignment,
|
13099 |
-
scrollToColumn: columnIndex,
|
13100 |
-
scrollToRow: rowIndex
|
13101 |
-
});
|
13102 |
-
|
13103 |
-
return {
|
13104 |
-
scrollLeft: this._getCalculatedScrollLeft(offsetProps),
|
13105 |
-
scrollTop: this._getCalculatedScrollTop(offsetProps)
|
13106 |
-
};
|
13107 |
-
}
|
13108 |
-
|
13109 |
-
/**
|
13110 |
-
* This method handles a scroll event originating from an external scroll control.
|
13111 |
-
* It's an advanced method and should probably not be used unless you're implementing a custom scroll-bar solution.
|
13112 |
-
*/
|
13113 |
-
|
13114 |
-
}, {
|
13115 |
-
key: 'handleScrollEvent',
|
13116 |
-
value: function handleScrollEvent(_ref2) {
|
13117 |
-
var _ref2$scrollLeft = _ref2.scrollLeft,
|
13118 |
-
scrollLeftParam = _ref2$scrollLeft === undefined ? 0 : _ref2$scrollLeft,
|
13119 |
-
_ref2$scrollTop = _ref2.scrollTop,
|
13120 |
-
scrollTopParam = _ref2$scrollTop === undefined ? 0 : _ref2$scrollTop;
|
13121 |
-
|
13122 |
-
// On iOS, we can arrive at negative offsets by swiping past the start.
|
13123 |
-
// To prevent flicker here, we make playing in the negative offset zone cause nothing to happen.
|
13124 |
-
if (scrollTopParam < 0) {
|
13125 |
-
return;
|
13126 |
-
}
|
13127 |
-
|
13128 |
-
// Prevent pointer events from interrupting a smooth scroll
|
13129 |
-
this._debounceScrollEnded();
|
13130 |
-
|
13131 |
-
var _props = this.props,
|
13132 |
-
autoHeight = _props.autoHeight,
|
13133 |
-
autoWidth = _props.autoWidth,
|
13134 |
-
height = _props.height,
|
13135 |
-
width = _props.width;
|
13136 |
-
|
13137 |
-
// When this component is shrunk drastically, React dispatches a series of back-to-back scroll events,
|
13138 |
-
// Gradually converging on a scrollTop that is within the bounds of the new, smaller height.
|
13139 |
-
// This causes a series of rapid renders that is slow for long lists.
|
13140 |
-
// We can avoid that by doing some simple bounds checking to ensure that scroll offsets never exceed their bounds.
|
13141 |
-
|
13142 |
-
var scrollbarSize = this._scrollbarSize;
|
13143 |
-
var totalRowsHeight = this._rowSizeAndPositionManager.getTotalSize();
|
13144 |
-
var totalColumnsWidth = this._columnSizeAndPositionManager.getTotalSize();
|
13145 |
-
var scrollLeft = Math.min(Math.max(0, totalColumnsWidth - width + scrollbarSize), scrollLeftParam);
|
13146 |
-
var scrollTop = Math.min(Math.max(0, totalRowsHeight - height + scrollbarSize), scrollTopParam);
|
13147 |
-
|
13148 |
-
// Certain devices (like Apple touchpad) rapid-fire duplicate events.
|
13149 |
-
// Don't force a re-render if this is the case.
|
13150 |
-
// The mouse may move faster then the animation frame does.
|
13151 |
-
// Use requestAnimationFrame to avoid over-updating.
|
13152 |
-
if (this.state.scrollLeft !== scrollLeft || this.state.scrollTop !== scrollTop) {
|
13153 |
-
// Track scrolling direction so we can more efficiently overscan rows to reduce empty space around the edges while scrolling.
|
13154 |
-
// Don't change direction for an axis unless scroll offset has changed.
|
13155 |
-
var _scrollDirectionHorizontal = scrollLeft !== this.state.scrollLeft ? scrollLeft > this.state.scrollLeft ? __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */] : __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["a" /* SCROLL_DIRECTION_BACKWARD */] : this.state.scrollDirectionHorizontal;
|
13156 |
-
var _scrollDirectionVertical = scrollTop !== this.state.scrollTop ? scrollTop > this.state.scrollTop ? __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */] : __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["a" /* SCROLL_DIRECTION_BACKWARD */] : this.state.scrollDirectionVertical;
|
13157 |
-
|
13158 |
-
var newState = {
|
13159 |
-
isScrolling: true,
|
13160 |
-
scrollDirectionHorizontal: _scrollDirectionHorizontal,
|
13161 |
-
scrollDirectionVertical: _scrollDirectionVertical,
|
13162 |
-
scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.OBSERVED
|
13163 |
-
};
|
13164 |
-
|
13165 |
-
if (!autoHeight) {
|
13166 |
-
newState.scrollTop = scrollTop;
|
13167 |
-
}
|
13168 |
-
|
13169 |
-
if (!autoWidth) {
|
13170 |
-
newState.scrollLeft = scrollLeft;
|
13171 |
-
}
|
13172 |
-
|
13173 |
-
this.setState(newState);
|
13174 |
-
}
|
13175 |
-
|
13176 |
-
this._invokeOnScrollMemoizer({
|
13177 |
-
scrollLeft: scrollLeft,
|
13178 |
-
scrollTop: scrollTop,
|
13179 |
-
totalColumnsWidth: totalColumnsWidth,
|
13180 |
-
totalRowsHeight: totalRowsHeight
|
13181 |
-
});
|
13182 |
-
}
|
13183 |
-
|
13184 |
-
/**
|
13185 |
-
* Invalidate Grid size and recompute visible cells.
|
13186 |
-
* This is a deferred wrapper for recomputeGridSize().
|
13187 |
-
* It sets a flag to be evaluated on cDM/cDU to avoid unnecessary renders.
|
13188 |
-
* This method is intended for advanced use-cases like CellMeasurer.
|
13189 |
-
*/
|
13190 |
-
// @TODO (bvaughn) Add automated test coverage for this.
|
13191 |
-
|
13192 |
-
}, {
|
13193 |
-
key: 'invalidateCellSizeAfterRender',
|
13194 |
-
value: function invalidateCellSizeAfterRender(_ref3) {
|
13195 |
-
var columnIndex = _ref3.columnIndex,
|
13196 |
-
rowIndex = _ref3.rowIndex;
|
13197 |
-
|
13198 |
-
this._deferredInvalidateColumnIndex = typeof this._deferredInvalidateColumnIndex === 'number' ? Math.min(this._deferredInvalidateColumnIndex, columnIndex) : columnIndex;
|
13199 |
-
this._deferredInvalidateRowIndex = typeof this._deferredInvalidateRowIndex === 'number' ? Math.min(this._deferredInvalidateRowIndex, rowIndex) : rowIndex;
|
13200 |
-
}
|
13201 |
-
|
13202 |
-
/**
|
13203 |
-
* Pre-measure all columns and rows in a Grid.
|
13204 |
-
* Typically cells are only measured as needed and estimated sizes are used for cells that have not yet been measured.
|
13205 |
-
* This method ensures that the next call to getTotalSize() returns an exact size (as opposed to just an estimated one).
|
13206 |
-
*/
|
13207 |
-
|
13208 |
-
}, {
|
13209 |
-
key: 'measureAllCells',
|
13210 |
-
value: function measureAllCells() {
|
13211 |
-
var _props2 = this.props,
|
13212 |
-
columnCount = _props2.columnCount,
|
13213 |
-
rowCount = _props2.rowCount;
|
13214 |
-
|
13215 |
-
|
13216 |
-
this._columnSizeAndPositionManager.getSizeAndPositionOfCell(columnCount - 1);
|
13217 |
-
this._rowSizeAndPositionManager.getSizeAndPositionOfCell(rowCount - 1);
|
13218 |
-
}
|
13219 |
-
|
13220 |
-
/**
|
13221 |
-
* Forced recompute of row heights and column widths.
|
13222 |
-
* This function should be called if dynamic column or row sizes have changed but nothing else has.
|
13223 |
-
* Since Grid only receives :columnCount and :rowCount it has no way of detecting when the underlying data changes.
|
13224 |
-
*/
|
13225 |
-
|
13226 |
-
}, {
|
13227 |
-
key: 'recomputeGridSize',
|
13228 |
-
value: function recomputeGridSize() {
|
13229 |
-
var _ref4 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},
|
13230 |
-
_ref4$columnIndex = _ref4.columnIndex,
|
13231 |
-
columnIndex = _ref4$columnIndex === undefined ? 0 : _ref4$columnIndex,
|
13232 |
-
_ref4$rowIndex = _ref4.rowIndex,
|
13233 |
-
rowIndex = _ref4$rowIndex === undefined ? 0 : _ref4$rowIndex;
|
13234 |
-
|
13235 |
-
var _props3 = this.props,
|
13236 |
-
scrollToColumn = _props3.scrollToColumn,
|
13237 |
-
scrollToRow = _props3.scrollToRow;
|
13238 |
-
|
13239 |
-
|
13240 |
-
this._columnSizeAndPositionManager.resetCell(columnIndex);
|
13241 |
-
this._rowSizeAndPositionManager.resetCell(rowIndex);
|
13242 |
-
|
13243 |
-
// Cell sizes may be determined by a function property.
|
13244 |
-
// In this case the cDU handler can't know if they changed.
|
13245 |
-
// Store this flag to let the next cDU pass know it needs to recompute the scroll offset.
|
13246 |
-
this._recomputeScrollLeftFlag = scrollToColumn >= 0 && columnIndex <= scrollToColumn;
|
13247 |
-
this._recomputeScrollTopFlag = scrollToRow >= 0 && rowIndex <= scrollToRow;
|
13248 |
-
|
13249 |
-
// Clear cell cache in case we are scrolling;
|
13250 |
-
// Invalid row heights likely mean invalid cached content as well.
|
13251 |
-
this._cellCache = {};
|
13252 |
-
this._styleCache = {};
|
13253 |
-
|
13254 |
-
this.forceUpdate();
|
13255 |
-
}
|
13256 |
-
|
13257 |
-
/**
|
13258 |
-
* Ensure column and row are visible.
|
13259 |
-
*/
|
13260 |
-
|
13261 |
-
}, {
|
13262 |
-
key: 'scrollToCell',
|
13263 |
-
value: function scrollToCell(_ref5) {
|
13264 |
-
var columnIndex = _ref5.columnIndex,
|
13265 |
-
rowIndex = _ref5.rowIndex;
|
13266 |
-
var columnCount = this.props.columnCount;
|
13267 |
-
|
13268 |
-
|
13269 |
-
var props = this.props;
|
13270 |
-
|
13271 |
-
// Don't adjust scroll offset for single-column grids (eg List, Table).
|
13272 |
-
// This can cause a funky scroll offset because of the vertical scrollbar width.
|
13273 |
-
if (columnCount > 1 && columnIndex !== undefined) {
|
13274 |
-
this._updateScrollLeftForScrollToColumn(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, props, {
|
13275 |
-
scrollToColumn: columnIndex
|
13276 |
-
}));
|
13277 |
-
}
|
13278 |
-
|
13279 |
-
if (rowIndex !== undefined) {
|
13280 |
-
this._updateScrollTopForScrollToRow(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, props, {
|
13281 |
-
scrollToRow: rowIndex
|
13282 |
-
}));
|
13283 |
-
}
|
13284 |
-
}
|
13285 |
-
}, {
|
13286 |
-
key: 'componentDidMount',
|
13287 |
-
value: function componentDidMount() {
|
13288 |
-
var _props4 = this.props,
|
13289 |
-
getScrollbarSize = _props4.getScrollbarSize,
|
13290 |
-
height = _props4.height,
|
13291 |
-
scrollLeft = _props4.scrollLeft,
|
13292 |
-
scrollToColumn = _props4.scrollToColumn,
|
13293 |
-
scrollTop = _props4.scrollTop,
|
13294 |
-
scrollToRow = _props4.scrollToRow,
|
13295 |
-
width = _props4.width;
|
13296 |
-
|
13297 |
-
// If cell sizes have been invalidated (eg we are using CellMeasurer) then reset cached positions.
|
13298 |
-
// We must do this at the start of the method as we may calculate and update scroll position below.
|
13299 |
-
|
13300 |
-
this._handleInvalidatedGridSize();
|
13301 |
-
|
13302 |
-
// If this component was first rendered server-side, scrollbar size will be undefined.
|
13303 |
-
// In that event we need to remeasure.
|
13304 |
-
if (!this._scrollbarSizeMeasured) {
|
13305 |
-
this._scrollbarSize = getScrollbarSize();
|
13306 |
-
this._scrollbarSizeMeasured = true;
|
13307 |
-
this.setState({});
|
13308 |
-
}
|
13309 |
-
|
13310 |
-
if (typeof scrollLeft === 'number' && scrollLeft >= 0 || typeof scrollTop === 'number' && scrollTop >= 0) {
|
13311 |
-
this.scrollToPosition({ scrollLeft: scrollLeft, scrollTop: scrollTop });
|
13312 |
-
}
|
13313 |
-
|
13314 |
-
// Don't update scroll offset if the size is 0; we don't render any cells in this case.
|
13315 |
-
// Setting a state may cause us to later thing we've updated the offce when we haven't.
|
13316 |
-
var sizeIsBiggerThanZero = height > 0 && width > 0;
|
13317 |
-
if (scrollToColumn >= 0 && sizeIsBiggerThanZero) {
|
13318 |
-
this._updateScrollLeftForScrollToColumn();
|
13319 |
-
}
|
13320 |
-
if (scrollToRow >= 0 && sizeIsBiggerThanZero) {
|
13321 |
-
this._updateScrollTopForScrollToRow();
|
13322 |
-
}
|
13323 |
-
|
13324 |
-
// Update onRowsRendered callback
|
13325 |
-
this._invokeOnGridRenderedHelper();
|
13326 |
-
|
13327 |
-
// Initialize onScroll callback
|
13328 |
-
this._invokeOnScrollMemoizer({
|
13329 |
-
scrollLeft: scrollLeft || 0,
|
13330 |
-
scrollTop: scrollTop || 0,
|
13331 |
-
totalColumnsWidth: this._columnSizeAndPositionManager.getTotalSize(),
|
13332 |
-
totalRowsHeight: this._rowSizeAndPositionManager.getTotalSize()
|
13333 |
-
});
|
13334 |
-
|
13335 |
-
this._maybeCallOnScrollbarPresenceChange();
|
13336 |
-
}
|
13337 |
-
|
13338 |
-
/**
|
13339 |
-
* @private
|
13340 |
-
* This method updates scrollLeft/scrollTop in state for the following conditions:
|
13341 |
-
* 1) New scroll-to-cell props have been set
|
13342 |
-
*/
|
13343 |
-
|
13344 |
-
}, {
|
13345 |
-
key: 'componentDidUpdate',
|
13346 |
-
value: function componentDidUpdate(prevProps, prevState) {
|
13347 |
-
var _this2 = this;
|
13348 |
-
|
13349 |
-
var _props5 = this.props,
|
13350 |
-
autoHeight = _props5.autoHeight,
|
13351 |
-
autoWidth = _props5.autoWidth,
|
13352 |
-
columnCount = _props5.columnCount,
|
13353 |
-
height = _props5.height,
|
13354 |
-
rowCount = _props5.rowCount,
|
13355 |
-
scrollToAlignment = _props5.scrollToAlignment,
|
13356 |
-
scrollToColumn = _props5.scrollToColumn,
|
13357 |
-
scrollToRow = _props5.scrollToRow,
|
13358 |
-
width = _props5.width;
|
13359 |
-
var _state = this.state,
|
13360 |
-
scrollLeft = _state.scrollLeft,
|
13361 |
-
scrollPositionChangeReason = _state.scrollPositionChangeReason,
|
13362 |
-
scrollTop = _state.scrollTop;
|
13363 |
-
|
13364 |
-
// If cell sizes have been invalidated (eg we are using CellMeasurer) then reset cached positions.
|
13365 |
-
// We must do this at the start of the method as we may calculate and update scroll position below.
|
13366 |
-
|
13367 |
-
this._handleInvalidatedGridSize();
|
13368 |
-
|
13369 |
-
// Handle edge case where column or row count has only just increased over 0.
|
13370 |
-
// In this case we may have to restore a previously-specified scroll offset.
|
13371 |
-
// For more info see bvaughn/react-virtualized/issues/218
|
13372 |
-
var columnOrRowCountJustIncreasedFromZero = columnCount > 0 && prevProps.columnCount === 0 || rowCount > 0 && prevProps.rowCount === 0;
|
13373 |
-
|
13374 |
-
// Make sure requested changes to :scrollLeft or :scrollTop get applied.
|
13375 |
-
// Assigning to scrollLeft/scrollTop tells the browser to interrupt any running scroll animations,
|
13376 |
-
// And to discard any pending async changes to the scroll position that may have happened in the meantime (e.g. on a separate scrolling thread).
|
13377 |
-
// So we only set these when we require an adjustment of the scroll position.
|
13378 |
-
// See issue #2 for more information.
|
13379 |
-
if (scrollPositionChangeReason === SCROLL_POSITION_CHANGE_REASONS.REQUESTED) {
|
13380 |
-
// @TRICKY :autoHeight and :autoWidth properties instructs Grid to leave :scrollTop and :scrollLeft management to an external HOC (eg WindowScroller).
|
13381 |
-
// In this case we should avoid checking scrollingContainer.scrollTop and scrollingContainer.scrollLeft since it forces layout/flow.
|
13382 |
-
if (!autoWidth && scrollLeft >= 0 && (scrollLeft !== prevState.scrollLeft && scrollLeft !== this._scrollingContainer.scrollLeft || columnOrRowCountJustIncreasedFromZero)) {
|
13383 |
-
this._scrollingContainer.scrollLeft = scrollLeft;
|
13384 |
-
}
|
13385 |
-
if (!autoHeight && scrollTop >= 0 && (scrollTop !== prevState.scrollTop && scrollTop !== this._scrollingContainer.scrollTop || columnOrRowCountJustIncreasedFromZero)) {
|
13386 |
-
this._scrollingContainer.scrollTop = scrollTop;
|
13387 |
-
}
|
13388 |
-
}
|
13389 |
-
|
13390 |
-
// Special case where the previous size was 0:
|
13391 |
-
// In this case we don't show any windowed cells at all.
|
13392 |
-
// So we should always recalculate offset afterwards.
|
13393 |
-
var sizeJustIncreasedFromZero = (prevProps.width === 0 || prevProps.height === 0) && height > 0 && width > 0;
|
13394 |
-
|
13395 |
-
// Update scroll offsets if the current :scrollToColumn or :scrollToRow values requires it
|
13396 |
-
// @TODO Do we also need this check or can the one in componentWillUpdate() suffice?
|
13397 |
-
if (this._recomputeScrollLeftFlag) {
|
13398 |
-
this._recomputeScrollLeftFlag = false;
|
13399 |
-
this._updateScrollLeftForScrollToColumn(this.props);
|
13400 |
-
} else {
|
13401 |
-
Object(__WEBPACK_IMPORTED_MODULE_12__utils_updateScrollIndexHelper__["a" /* default */])({
|
13402 |
-
cellSizeAndPositionManager: this._columnSizeAndPositionManager,
|
13403 |
-
previousCellsCount: prevProps.columnCount,
|
13404 |
-
previousCellSize: prevProps.columnWidth,
|
13405 |
-
previousScrollToAlignment: prevProps.scrollToAlignment,
|
13406 |
-
previousScrollToIndex: prevProps.scrollToColumn,
|
13407 |
-
previousSize: prevProps.width,
|
13408 |
-
scrollOffset: scrollLeft,
|
13409 |
-
scrollToAlignment: scrollToAlignment,
|
13410 |
-
scrollToIndex: scrollToColumn,
|
13411 |
-
size: width,
|
13412 |
-
sizeJustIncreasedFromZero: sizeJustIncreasedFromZero,
|
13413 |
-
updateScrollIndexCallback: function updateScrollIndexCallback() {
|
13414 |
-
return _this2._updateScrollLeftForScrollToColumn(_this2.props);
|
13415 |
-
}
|
13416 |
-
});
|
13417 |
-
}
|
13418 |
-
|
13419 |
-
if (this._recomputeScrollTopFlag) {
|
13420 |
-
this._recomputeScrollTopFlag = false;
|
13421 |
-
this._updateScrollTopForScrollToRow(this.props);
|
13422 |
-
} else {
|
13423 |
-
Object(__WEBPACK_IMPORTED_MODULE_12__utils_updateScrollIndexHelper__["a" /* default */])({
|
13424 |
-
cellSizeAndPositionManager: this._rowSizeAndPositionManager,
|
13425 |
-
previousCellsCount: prevProps.rowCount,
|
13426 |
-
previousCellSize: prevProps.rowHeight,
|
13427 |
-
previousScrollToAlignment: prevProps.scrollToAlignment,
|
13428 |
-
previousScrollToIndex: prevProps.scrollToRow,
|
13429 |
-
previousSize: prevProps.height,
|
13430 |
-
scrollOffset: scrollTop,
|
13431 |
-
scrollToAlignment: scrollToAlignment,
|
13432 |
-
scrollToIndex: scrollToRow,
|
13433 |
-
size: height,
|
13434 |
-
sizeJustIncreasedFromZero: sizeJustIncreasedFromZero,
|
13435 |
-
updateScrollIndexCallback: function updateScrollIndexCallback() {
|
13436 |
-
return _this2._updateScrollTopForScrollToRow(_this2.props);
|
13437 |
-
}
|
13438 |
-
});
|
13439 |
-
}
|
13440 |
-
|
13441 |
-
// Update onRowsRendered callback if start/stop indices have changed
|
13442 |
-
this._invokeOnGridRenderedHelper();
|
13443 |
-
|
13444 |
-
// Changes to :scrollLeft or :scrollTop should also notify :onScroll listeners
|
13445 |
-
if (scrollLeft !== prevState.scrollLeft || scrollTop !== prevState.scrollTop) {
|
13446 |
-
var totalRowsHeight = this._rowSizeAndPositionManager.getTotalSize();
|
13447 |
-
var totalColumnsWidth = this._columnSizeAndPositionManager.getTotalSize();
|
13448 |
-
|
13449 |
-
this._invokeOnScrollMemoizer({
|
13450 |
-
scrollLeft: scrollLeft,
|
13451 |
-
scrollTop: scrollTop,
|
13452 |
-
totalColumnsWidth: totalColumnsWidth,
|
13453 |
-
totalRowsHeight: totalRowsHeight
|
13454 |
-
});
|
13455 |
-
}
|
13456 |
-
|
13457 |
-
this._maybeCallOnScrollbarPresenceChange();
|
13458 |
-
}
|
13459 |
-
}, {
|
13460 |
-
key: 'componentWillMount',
|
13461 |
-
value: function componentWillMount() {
|
13462 |
-
var getScrollbarSize = this.props.getScrollbarSize;
|
13463 |
-
|
13464 |
-
// If this component is being rendered server-side, getScrollbarSize() will return undefined.
|
13465 |
-
// We handle this case in componentDidMount()
|
13466 |
-
|
13467 |
-
this._scrollbarSize = getScrollbarSize();
|
13468 |
-
if (this._scrollbarSize === undefined) {
|
13469 |
-
this._scrollbarSizeMeasured = false;
|
13470 |
-
this._scrollbarSize = 0;
|
13471 |
-
} else {
|
13472 |
-
this._scrollbarSizeMeasured = true;
|
13473 |
-
}
|
13474 |
-
|
13475 |
-
this._calculateChildrenToRender();
|
13476 |
-
}
|
13477 |
-
}, {
|
13478 |
-
key: 'componentWillUnmount',
|
13479 |
-
value: function componentWillUnmount() {
|
13480 |
-
if (this._disablePointerEventsTimeoutId) {
|
13481 |
-
Object(__WEBPACK_IMPORTED_MODULE_15__utils_requestAnimationTimeout__["cancelAnimationTimeout"])(this._disablePointerEventsTimeoutId);
|
13482 |
-
}
|
13483 |
-
}
|
13484 |
-
|
13485 |
-
/**
|
13486 |
-
* @private
|
13487 |
-
* This method updates scrollLeft/scrollTop in state for the following conditions:
|
13488 |
-
* 1) Empty content (0 rows or columns)
|
13489 |
-
* 2) New scroll props overriding the current state
|
13490 |
-
* 3) Cells-count or cells-size has changed, making previous scroll offsets invalid
|
13491 |
-
*/
|
13492 |
-
|
13493 |
-
}, {
|
13494 |
-
key: 'componentWillReceiveProps',
|
13495 |
-
value: function componentWillReceiveProps(nextProps) {
|
13496 |
-
var _this3 = this;
|
13497 |
-
|
13498 |
-
var _state2 = this.state,
|
13499 |
-
scrollLeft = _state2.scrollLeft,
|
13500 |
-
scrollTop = _state2.scrollTop;
|
13501 |
-
|
13502 |
-
|
13503 |
-
if (nextProps.columnCount === 0 && scrollLeft !== 0 || nextProps.rowCount === 0 && scrollTop !== 0) {
|
13504 |
-
this.scrollToPosition({
|
13505 |
-
scrollLeft: 0,
|
13506 |
-
scrollTop: 0
|
13507 |
-
});
|
13508 |
-
} else if (nextProps.scrollLeft !== this.props.scrollLeft || nextProps.scrollTop !== this.props.scrollTop) {
|
13509 |
-
var newState = {};
|
13510 |
-
|
13511 |
-
if (nextProps.scrollLeft != null) {
|
13512 |
-
newState.scrollLeft = nextProps.scrollLeft;
|
13513 |
-
}
|
13514 |
-
if (nextProps.scrollTop != null) {
|
13515 |
-
newState.scrollTop = nextProps.scrollTop;
|
13516 |
-
}
|
13517 |
-
|
13518 |
-
this.scrollToPosition(newState);
|
13519 |
-
}
|
13520 |
-
|
13521 |
-
if (nextProps.columnWidth !== this.props.columnWidth || nextProps.rowHeight !== this.props.rowHeight) {
|
13522 |
-
this._styleCache = {};
|
13523 |
-
}
|
13524 |
-
|
13525 |
-
this._columnWidthGetter = this._wrapSizeGetter(nextProps.columnWidth);
|
13526 |
-
this._rowHeightGetter = this._wrapSizeGetter(nextProps.rowHeight);
|
13527 |
-
|
13528 |
-
this._columnSizeAndPositionManager.configure({
|
13529 |
-
cellCount: nextProps.columnCount,
|
13530 |
-
estimatedCellSize: this._getEstimatedColumnSize(nextProps)
|
13531 |
-
});
|
13532 |
-
this._rowSizeAndPositionManager.configure({
|
13533 |
-
cellCount: nextProps.rowCount,
|
13534 |
-
estimatedCellSize: this._getEstimatedRowSize(nextProps)
|
13535 |
-
});
|
13536 |
-
|
13537 |
-
var _props6 = this.props,
|
13538 |
-
columnCount = _props6.columnCount,
|
13539 |
-
rowCount = _props6.rowCount;
|
13540 |
-
|
13541 |
-
// Special case when either cols or rows were 0
|
13542 |
-
// This would prevent any cells from rendering
|
13543 |
-
// So we need to reset row scroll if cols changed from 0 (and vice versa)
|
13544 |
-
|
13545 |
-
if (columnCount === 0 || rowCount === 0) {
|
13546 |
-
columnCount = 0;
|
13547 |
-
rowCount = 0;
|
13548 |
-
}
|
13549 |
-
|
13550 |
-
// If scrolling is controlled outside this component, clear cache when scrolling stops
|
13551 |
-
if (nextProps.autoHeight && nextProps.isScrolling === false && this.props.isScrolling === true) {
|
13552 |
-
this._resetStyleCache();
|
13553 |
-
}
|
13554 |
-
|
13555 |
-
// Update scroll offsets if the size or number of cells have changed, invalidating the previous value
|
13556 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_calculateSizeAndPositionDataAndUpdateScrollOffset__["a" /* default */])({
|
13557 |
-
cellCount: columnCount,
|
13558 |
-
cellSize: typeof this.props.columnWidth === 'number' ? this.props.columnWidth : null,
|
13559 |
-
computeMetadataCallback: function computeMetadataCallback() {
|
13560 |
-
return _this3._columnSizeAndPositionManager.resetCell(0);
|
13561 |
-
},
|
13562 |
-
computeMetadataCallbackProps: nextProps,
|
13563 |
-
nextCellsCount: nextProps.columnCount,
|
13564 |
-
nextCellSize: typeof nextProps.columnWidth === 'number' ? nextProps.columnWidth : null,
|
13565 |
-
nextScrollToIndex: nextProps.scrollToColumn,
|
13566 |
-
scrollToIndex: this.props.scrollToColumn,
|
13567 |
-
updateScrollOffsetForScrollToIndex: function updateScrollOffsetForScrollToIndex() {
|
13568 |
-
return _this3._updateScrollLeftForScrollToColumn(nextProps, _this3.state);
|
13569 |
-
}
|
13570 |
-
});
|
13571 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_calculateSizeAndPositionDataAndUpdateScrollOffset__["a" /* default */])({
|
13572 |
-
cellCount: rowCount,
|
13573 |
-
cellSize: typeof this.props.rowHeight === 'number' ? this.props.rowHeight : null,
|
13574 |
-
computeMetadataCallback: function computeMetadataCallback() {
|
13575 |
-
return _this3._rowSizeAndPositionManager.resetCell(0);
|
13576 |
-
},
|
13577 |
-
computeMetadataCallbackProps: nextProps,
|
13578 |
-
nextCellsCount: nextProps.rowCount,
|
13579 |
-
nextCellSize: typeof nextProps.rowHeight === 'number' ? nextProps.rowHeight : null,
|
13580 |
-
nextScrollToIndex: nextProps.scrollToRow,
|
13581 |
-
scrollToIndex: this.props.scrollToRow,
|
13582 |
-
updateScrollOffsetForScrollToIndex: function updateScrollOffsetForScrollToIndex() {
|
13583 |
-
return _this3._updateScrollTopForScrollToRow(nextProps, _this3.state);
|
13584 |
-
}
|
13585 |
-
});
|
13586 |
-
}
|
13587 |
-
}, {
|
13588 |
-
key: 'componentWillUpdate',
|
13589 |
-
value: function componentWillUpdate(nextProps, nextState) {
|
13590 |
-
this._calculateChildrenToRender(nextProps, nextState);
|
13591 |
-
}
|
13592 |
-
}, {
|
13593 |
-
key: 'render',
|
13594 |
-
value: function render() {
|
13595 |
-
var _props7 = this.props,
|
13596 |
-
autoContainerWidth = _props7.autoContainerWidth,
|
13597 |
-
autoHeight = _props7.autoHeight,
|
13598 |
-
autoWidth = _props7.autoWidth,
|
13599 |
-
className = _props7.className,
|
13600 |
-
containerProps = _props7.containerProps,
|
13601 |
-
containerRole = _props7.containerRole,
|
13602 |
-
containerStyle = _props7.containerStyle,
|
13603 |
-
height = _props7.height,
|
13604 |
-
id = _props7.id,
|
13605 |
-
noContentRenderer = _props7.noContentRenderer,
|
13606 |
-
role = _props7.role,
|
13607 |
-
style = _props7.style,
|
13608 |
-
tabIndex = _props7.tabIndex,
|
13609 |
-
width = _props7.width;
|
13610 |
-
|
13611 |
-
|
13612 |
-
var isScrolling = this._isScrolling();
|
13613 |
-
|
13614 |
-
var gridStyle = {
|
13615 |
-
boxSizing: 'border-box',
|
13616 |
-
direction: 'ltr',
|
13617 |
-
height: autoHeight ? 'auto' : height,
|
13618 |
-
position: 'relative',
|
13619 |
-
width: autoWidth ? 'auto' : width,
|
13620 |
-
WebkitOverflowScrolling: 'touch',
|
13621 |
-
willChange: 'transform'
|
13622 |
-
};
|
13623 |
-
|
13624 |
-
var totalColumnsWidth = this._columnSizeAndPositionManager.getTotalSize();
|
13625 |
-
var totalRowsHeight = this._rowSizeAndPositionManager.getTotalSize();
|
13626 |
-
|
13627 |
-
// Force browser to hide scrollbars when we know they aren't necessary.
|
13628 |
-
// Otherwise once scrollbars appear they may not disappear again.
|
13629 |
-
// For more info see issue #116
|
13630 |
-
var verticalScrollBarSize = totalRowsHeight > height ? this._scrollbarSize : 0;
|
13631 |
-
var horizontalScrollBarSize = totalColumnsWidth > width ? this._scrollbarSize : 0;
|
13632 |
-
|
13633 |
-
if (horizontalScrollBarSize !== this._horizontalScrollBarSize || verticalScrollBarSize !== this._verticalScrollBarSize) {
|
13634 |
-
this._horizontalScrollBarSize = horizontalScrollBarSize;
|
13635 |
-
this._verticalScrollBarSize = verticalScrollBarSize;
|
13636 |
-
this._scrollbarPresenceChanged = true;
|
13637 |
-
}
|
13638 |
-
|
13639 |
-
// Also explicitly init styles to 'auto' if scrollbars are required.
|
13640 |
-
// This works around an obscure edge case where external CSS styles have not yet been loaded,
|
13641 |
-
// But an initial scroll index of offset is set as an external prop.
|
13642 |
-
// Without this style, Grid would render the correct range of cells but would NOT update its internal offset.
|
13643 |
-
// This was originally reported via clauderic/react-infinite-calendar/issues/23
|
13644 |
-
gridStyle.overflowX = totalColumnsWidth + verticalScrollBarSize <= width ? 'hidden' : 'auto';
|
13645 |
-
gridStyle.overflowY = totalRowsHeight + horizontalScrollBarSize <= height ? 'hidden' : 'auto';
|
13646 |
-
|
13647 |
-
var childrenToDisplay = this._childrenToDisplay;
|
13648 |
-
|
13649 |
-
var showNoContentRenderer = childrenToDisplay.length === 0 && height > 0 && width > 0;
|
13650 |
-
|
13651 |
-
return __WEBPACK_IMPORTED_MODULE_6_react__["createElement"](
|
13652 |
-
'div',
|
13653 |
-
__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
13654 |
-
ref: this._setScrollingContainerRef
|
13655 |
-
}, containerProps, {
|
13656 |
-
'aria-label': this.props['aria-label'],
|
13657 |
-
'aria-readonly': this.props['aria-readonly'],
|
13658 |
-
className: __WEBPACK_IMPORTED_MODULE_7_classnames___default()('ReactVirtualized__Grid', className),
|
13659 |
-
id: id,
|
13660 |
-
onScroll: this._onScroll,
|
13661 |
-
role: role,
|
13662 |
-
style: __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, gridStyle, style),
|
13663 |
-
tabIndex: tabIndex }),
|
13664 |
-
childrenToDisplay.length > 0 && __WEBPACK_IMPORTED_MODULE_6_react__["createElement"](
|
13665 |
-
'div',
|
13666 |
-
{
|
13667 |
-
className: 'ReactVirtualized__Grid__innerScrollContainer',
|
13668 |
-
role: containerRole,
|
13669 |
-
style: __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
13670 |
-
width: autoContainerWidth ? 'auto' : totalColumnsWidth,
|
13671 |
-
height: totalRowsHeight,
|
13672 |
-
maxWidth: totalColumnsWidth,
|
13673 |
-
maxHeight: totalRowsHeight,
|
13674 |
-
overflow: 'hidden',
|
13675 |
-
pointerEvents: isScrolling ? 'none' : '',
|
13676 |
-
position: 'relative'
|
13677 |
-
}, containerStyle) },
|
13678 |
-
childrenToDisplay
|
13679 |
-
),
|
13680 |
-
showNoContentRenderer && noContentRenderer()
|
13681 |
-
);
|
13682 |
-
}
|
13683 |
-
|
13684 |
-
/* ---------------------------- Helper methods ---------------------------- */
|
13685 |
-
|
13686 |
-
}, {
|
13687 |
-
key: '_calculateChildrenToRender',
|
13688 |
-
value: function _calculateChildrenToRender() {
|
13689 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
13690 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
13691 |
-
var cellRenderer = props.cellRenderer,
|
13692 |
-
cellRangeRenderer = props.cellRangeRenderer,
|
13693 |
-
columnCount = props.columnCount,
|
13694 |
-
deferredMeasurementCache = props.deferredMeasurementCache,
|
13695 |
-
height = props.height,
|
13696 |
-
overscanColumnCount = props.overscanColumnCount,
|
13697 |
-
overscanIndicesGetter = props.overscanIndicesGetter,
|
13698 |
-
overscanRowCount = props.overscanRowCount,
|
13699 |
-
rowCount = props.rowCount,
|
13700 |
-
width = props.width;
|
13701 |
-
var scrollDirectionHorizontal = state.scrollDirectionHorizontal,
|
13702 |
-
scrollDirectionVertical = state.scrollDirectionVertical,
|
13703 |
-
scrollLeft = state.scrollLeft,
|
13704 |
-
scrollTop = state.scrollTop;
|
13705 |
-
|
13706 |
-
|
13707 |
-
var isScrolling = this._isScrolling(props, state);
|
13708 |
-
|
13709 |
-
this._childrenToDisplay = [];
|
13710 |
-
|
13711 |
-
// Render only enough columns and rows to cover the visible area of the grid.
|
13712 |
-
if (height > 0 && width > 0) {
|
13713 |
-
var visibleColumnIndices = this._columnSizeAndPositionManager.getVisibleCellRange({
|
13714 |
-
containerSize: width,
|
13715 |
-
offset: scrollLeft
|
13716 |
-
});
|
13717 |
-
var visibleRowIndices = this._rowSizeAndPositionManager.getVisibleCellRange({
|
13718 |
-
containerSize: height,
|
13719 |
-
offset: scrollTop
|
13720 |
-
});
|
13721 |
-
|
13722 |
-
var horizontalOffsetAdjustment = this._columnSizeAndPositionManager.getOffsetAdjustment({
|
13723 |
-
containerSize: width,
|
13724 |
-
offset: scrollLeft
|
13725 |
-
});
|
13726 |
-
var verticalOffsetAdjustment = this._rowSizeAndPositionManager.getOffsetAdjustment({
|
13727 |
-
containerSize: height,
|
13728 |
-
offset: scrollTop
|
13729 |
-
});
|
13730 |
-
|
13731 |
-
// Store for _invokeOnGridRenderedHelper()
|
13732 |
-
this._renderedColumnStartIndex = visibleColumnIndices.start;
|
13733 |
-
this._renderedColumnStopIndex = visibleColumnIndices.stop;
|
13734 |
-
this._renderedRowStartIndex = visibleRowIndices.start;
|
13735 |
-
this._renderedRowStopIndex = visibleRowIndices.stop;
|
13736 |
-
|
13737 |
-
var overscanColumnIndices = overscanIndicesGetter({
|
13738 |
-
direction: 'horizontal',
|
13739 |
-
cellCount: columnCount,
|
13740 |
-
overscanCellsCount: overscanColumnCount,
|
13741 |
-
scrollDirection: scrollDirectionHorizontal,
|
13742 |
-
startIndex: typeof visibleColumnIndices.start === 'number' ? visibleColumnIndices.start : 0,
|
13743 |
-
stopIndex: typeof visibleColumnIndices.stop === 'number' ? visibleColumnIndices.stop : -1
|
13744 |
-
});
|
13745 |
-
|
13746 |
-
var overscanRowIndices = overscanIndicesGetter({
|
13747 |
-
direction: 'vertical',
|
13748 |
-
cellCount: rowCount,
|
13749 |
-
overscanCellsCount: overscanRowCount,
|
13750 |
-
scrollDirection: scrollDirectionVertical,
|
13751 |
-
startIndex: typeof visibleRowIndices.start === 'number' ? visibleRowIndices.start : 0,
|
13752 |
-
stopIndex: typeof visibleRowIndices.stop === 'number' ? visibleRowIndices.stop : -1
|
13753 |
-
});
|
13754 |
-
|
13755 |
-
// Store for _invokeOnGridRenderedHelper()
|
13756 |
-
this._columnStartIndex = overscanColumnIndices.overscanStartIndex;
|
13757 |
-
this._columnStopIndex = overscanColumnIndices.overscanStopIndex;
|
13758 |
-
this._rowStartIndex = overscanRowIndices.overscanStartIndex;
|
13759 |
-
this._rowStopIndex = overscanRowIndices.overscanStopIndex;
|
13760 |
-
|
13761 |
-
// Advanced use-cases (eg CellMeasurer) require batched measurements to determine accurate sizes.
|
13762 |
-
if (deferredMeasurementCache) {
|
13763 |
-
// If rows have a dynamic height, scan the rows we are about to render.
|
13764 |
-
// If any have not yet been measured, then we need to render all columns initially,
|
13765 |
-
// Because the height of the row is equal to the tallest cell within that row,
|
13766 |
-
// (And so we can't know the height without measuring all column-cells first).
|
13767 |
-
if (!deferredMeasurementCache.hasFixedHeight()) {
|
13768 |
-
for (var rowIndex = this._rowStartIndex; rowIndex <= this._rowStopIndex; rowIndex++) {
|
13769 |
-
if (!deferredMeasurementCache.has(rowIndex, 0)) {
|
13770 |
-
this._columnStartIndex = 0;
|
13771 |
-
this._columnStopIndex = columnCount - 1;
|
13772 |
-
break;
|
13773 |
-
}
|
13774 |
-
}
|
13775 |
-
}
|
13776 |
-
|
13777 |
-
// If columns have a dynamic width, scan the columns we are about to render.
|
13778 |
-
// If any have not yet been measured, then we need to render all rows initially,
|
13779 |
-
// Because the width of the column is equal to the widest cell within that column,
|
13780 |
-
// (And so we can't know the width without measuring all row-cells first).
|
13781 |
-
if (!deferredMeasurementCache.hasFixedWidth()) {
|
13782 |
-
for (var columnIndex = this._columnStartIndex; columnIndex <= this._columnStopIndex; columnIndex++) {
|
13783 |
-
if (!deferredMeasurementCache.has(0, columnIndex)) {
|
13784 |
-
this._rowStartIndex = 0;
|
13785 |
-
this._rowStopIndex = rowCount - 1;
|
13786 |
-
break;
|
13787 |
-
}
|
13788 |
-
}
|
13789 |
-
}
|
13790 |
-
}
|
13791 |
-
|
13792 |
-
this._childrenToDisplay = cellRangeRenderer({
|
13793 |
-
cellCache: this._cellCache,
|
13794 |
-
cellRenderer: cellRenderer,
|
13795 |
-
columnSizeAndPositionManager: this._columnSizeAndPositionManager,
|
13796 |
-
columnStartIndex: this._columnStartIndex,
|
13797 |
-
columnStopIndex: this._columnStopIndex,
|
13798 |
-
deferredMeasurementCache: deferredMeasurementCache,
|
13799 |
-
horizontalOffsetAdjustment: horizontalOffsetAdjustment,
|
13800 |
-
isScrolling: isScrolling,
|
13801 |
-
parent: this,
|
13802 |
-
rowSizeAndPositionManager: this._rowSizeAndPositionManager,
|
13803 |
-
rowStartIndex: this._rowStartIndex,
|
13804 |
-
rowStopIndex: this._rowStopIndex,
|
13805 |
-
scrollLeft: scrollLeft,
|
13806 |
-
scrollTop: scrollTop,
|
13807 |
-
styleCache: this._styleCache,
|
13808 |
-
verticalOffsetAdjustment: verticalOffsetAdjustment,
|
13809 |
-
visibleColumnIndices: visibleColumnIndices,
|
13810 |
-
visibleRowIndices: visibleRowIndices
|
13811 |
-
});
|
13812 |
-
}
|
13813 |
-
}
|
13814 |
-
|
13815 |
-
/**
|
13816 |
-
* Sets an :isScrolling flag for a small window of time.
|
13817 |
-
* This flag is used to disable pointer events on the scrollable portion of the Grid.
|
13818 |
-
* This prevents jerky/stuttery mouse-wheel scrolling.
|
13819 |
-
*/
|
13820 |
-
|
13821 |
-
}, {
|
13822 |
-
key: '_debounceScrollEnded',
|
13823 |
-
value: function _debounceScrollEnded() {
|
13824 |
-
var scrollingResetTimeInterval = this.props.scrollingResetTimeInterval;
|
13825 |
-
|
13826 |
-
|
13827 |
-
if (this._disablePointerEventsTimeoutId) {
|
13828 |
-
Object(__WEBPACK_IMPORTED_MODULE_15__utils_requestAnimationTimeout__["cancelAnimationTimeout"])(this._disablePointerEventsTimeoutId);
|
13829 |
-
}
|
13830 |
-
|
13831 |
-
this._disablePointerEventsTimeoutId = Object(__WEBPACK_IMPORTED_MODULE_15__utils_requestAnimationTimeout__["requestAnimationTimeout"])(this._debounceScrollEndedCallback, scrollingResetTimeInterval);
|
13832 |
-
}
|
13833 |
-
}, {
|
13834 |
-
key: '_getEstimatedColumnSize',
|
13835 |
-
value: function _getEstimatedColumnSize(props) {
|
13836 |
-
return typeof props.columnWidth === 'number' ? props.columnWidth : props.estimatedColumnSize;
|
13837 |
-
}
|
13838 |
-
}, {
|
13839 |
-
key: '_getEstimatedRowSize',
|
13840 |
-
value: function _getEstimatedRowSize(props) {
|
13841 |
-
return typeof props.rowHeight === 'number' ? props.rowHeight : props.estimatedRowSize;
|
13842 |
-
}
|
13843 |
-
|
13844 |
-
/**
|
13845 |
-
* Check for batched CellMeasurer size invalidations.
|
13846 |
-
* This will occur the first time one or more previously unmeasured cells are rendered.
|
13847 |
-
*/
|
13848 |
-
|
13849 |
-
}, {
|
13850 |
-
key: '_handleInvalidatedGridSize',
|
13851 |
-
value: function _handleInvalidatedGridSize() {
|
13852 |
-
if (typeof this._deferredInvalidateColumnIndex === 'number' && typeof this._deferredInvalidateRowIndex === 'number') {
|
13853 |
-
var columnIndex = this._deferredInvalidateColumnIndex;
|
13854 |
-
var rowIndex = this._deferredInvalidateRowIndex;
|
13855 |
-
|
13856 |
-
this._deferredInvalidateColumnIndex = null;
|
13857 |
-
this._deferredInvalidateRowIndex = null;
|
13858 |
-
|
13859 |
-
this.recomputeGridSize({ columnIndex: columnIndex, rowIndex: rowIndex });
|
13860 |
-
}
|
13861 |
-
}
|
13862 |
-
}, {
|
13863 |
-
key: '_invokeOnScrollMemoizer',
|
13864 |
-
value: function _invokeOnScrollMemoizer(_ref6) {
|
13865 |
-
var _this4 = this;
|
13866 |
-
|
13867 |
-
var scrollLeft = _ref6.scrollLeft,
|
13868 |
-
scrollTop = _ref6.scrollTop,
|
13869 |
-
totalColumnsWidth = _ref6.totalColumnsWidth,
|
13870 |
-
totalRowsHeight = _ref6.totalRowsHeight;
|
13871 |
-
|
13872 |
-
this._onScrollMemoizer({
|
13873 |
-
callback: function callback(_ref7) {
|
13874 |
-
var scrollLeft = _ref7.scrollLeft,
|
13875 |
-
scrollTop = _ref7.scrollTop;
|
13876 |
-
var _props8 = _this4.props,
|
13877 |
-
height = _props8.height,
|
13878 |
-
onScroll = _props8.onScroll,
|
13879 |
-
width = _props8.width;
|
13880 |
-
|
13881 |
-
|
13882 |
-
onScroll({
|
13883 |
-
clientHeight: height,
|
13884 |
-
clientWidth: width,
|
13885 |
-
scrollHeight: totalRowsHeight,
|
13886 |
-
scrollLeft: scrollLeft,
|
13887 |
-
scrollTop: scrollTop,
|
13888 |
-
scrollWidth: totalColumnsWidth
|
13889 |
-
});
|
13890 |
-
},
|
13891 |
-
indices: {
|
13892 |
-
scrollLeft: scrollLeft,
|
13893 |
-
scrollTop: scrollTop
|
13894 |
-
}
|
13895 |
-
});
|
13896 |
-
}
|
13897 |
-
}, {
|
13898 |
-
key: '_isScrolling',
|
13899 |
-
value: function _isScrolling() {
|
13900 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
13901 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
13902 |
-
|
13903 |
-
// If isScrolling is defined in props, use it to override the value in state
|
13904 |
-
// This is a performance optimization for WindowScroller + Grid
|
13905 |
-
return Object.hasOwnProperty.call(props, 'isScrolling') ? Boolean(props.isScrolling) : Boolean(state.isScrolling);
|
13906 |
-
}
|
13907 |
-
}, {
|
13908 |
-
key: '_maybeCallOnScrollbarPresenceChange',
|
13909 |
-
value: function _maybeCallOnScrollbarPresenceChange() {
|
13910 |
-
if (this._scrollbarPresenceChanged) {
|
13911 |
-
var _onScrollbarPresenceChange = this.props.onScrollbarPresenceChange;
|
13912 |
-
|
13913 |
-
|
13914 |
-
this._scrollbarPresenceChanged = false;
|
13915 |
-
|
13916 |
-
_onScrollbarPresenceChange({
|
13917 |
-
horizontal: this._horizontalScrollBarSize > 0,
|
13918 |
-
size: this._scrollbarSize,
|
13919 |
-
vertical: this._verticalScrollBarSize > 0
|
13920 |
-
});
|
13921 |
-
}
|
13922 |
-
}
|
13923 |
-
}, {
|
13924 |
-
key: 'scrollToPosition',
|
13925 |
-
|
13926 |
-
|
13927 |
-
/**
|
13928 |
-
* Scroll to the specified offset(s).
|
13929 |
-
* Useful for animating position changes.
|
13930 |
-
*/
|
13931 |
-
value: function scrollToPosition(_ref8) {
|
13932 |
-
var scrollLeft = _ref8.scrollLeft,
|
13933 |
-
scrollTop = _ref8.scrollTop;
|
13934 |
-
|
13935 |
-
var newState = {
|
13936 |
-
scrollPositionChangeReason: SCROLL_POSITION_CHANGE_REASONS.REQUESTED
|
13937 |
-
};
|
13938 |
-
|
13939 |
-
if (typeof scrollLeft === 'number' && scrollLeft >= 0) {
|
13940 |
-
newState.scrollDirectionHorizontal = scrollLeft > this.state.scrollLeft ? __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */] : __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["a" /* SCROLL_DIRECTION_BACKWARD */];
|
13941 |
-
newState.scrollLeft = scrollLeft;
|
13942 |
-
}
|
13943 |
-
|
13944 |
-
if (typeof scrollTop === 'number' && scrollTop >= 0) {
|
13945 |
-
newState.scrollDirectionVertical = scrollTop > this.state.scrollTop ? __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["b" /* SCROLL_DIRECTION_FORWARD */] : __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["a" /* SCROLL_DIRECTION_BACKWARD */];
|
13946 |
-
newState.scrollTop = scrollTop;
|
13947 |
-
}
|
13948 |
-
|
13949 |
-
if (typeof scrollLeft === 'number' && scrollLeft >= 0 && scrollLeft !== this.state.scrollLeft || typeof scrollTop === 'number' && scrollTop >= 0 && scrollTop !== this.state.scrollTop) {
|
13950 |
-
this.setState(newState);
|
13951 |
-
}
|
13952 |
-
}
|
13953 |
-
}, {
|
13954 |
-
key: '_wrapSizeGetter',
|
13955 |
-
value: function _wrapSizeGetter(value) {
|
13956 |
-
return typeof value === 'function' ? value : function () {
|
13957 |
-
return value;
|
13958 |
-
};
|
13959 |
-
}
|
13960 |
-
}, {
|
13961 |
-
key: '_getCalculatedScrollLeft',
|
13962 |
-
value: function _getCalculatedScrollLeft() {
|
13963 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
13964 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
13965 |
-
var columnCount = props.columnCount,
|
13966 |
-
height = props.height,
|
13967 |
-
scrollToAlignment = props.scrollToAlignment,
|
13968 |
-
scrollToColumn = props.scrollToColumn,
|
13969 |
-
width = props.width;
|
13970 |
-
var scrollLeft = state.scrollLeft;
|
13971 |
-
|
13972 |
-
|
13973 |
-
if (columnCount > 0) {
|
13974 |
-
var finalColumn = columnCount - 1;
|
13975 |
-
var targetIndex = scrollToColumn < 0 ? finalColumn : Math.min(finalColumn, scrollToColumn);
|
13976 |
-
var totalRowsHeight = this._rowSizeAndPositionManager.getTotalSize();
|
13977 |
-
var scrollBarSize = totalRowsHeight > height ? this._scrollbarSize : 0;
|
13978 |
-
|
13979 |
-
return this._columnSizeAndPositionManager.getUpdatedOffsetForIndex({
|
13980 |
-
align: scrollToAlignment,
|
13981 |
-
containerSize: width - scrollBarSize,
|
13982 |
-
currentOffset: scrollLeft,
|
13983 |
-
targetIndex: targetIndex
|
13984 |
-
});
|
13985 |
-
}
|
13986 |
-
}
|
13987 |
-
}, {
|
13988 |
-
key: '_updateScrollLeftForScrollToColumn',
|
13989 |
-
value: function _updateScrollLeftForScrollToColumn() {
|
13990 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
13991 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
13992 |
-
var scrollLeft = state.scrollLeft;
|
13993 |
-
|
13994 |
-
var calculatedScrollLeft = this._getCalculatedScrollLeft(props, state);
|
13995 |
-
|
13996 |
-
if (typeof calculatedScrollLeft === 'number' && calculatedScrollLeft >= 0 && scrollLeft !== calculatedScrollLeft) {
|
13997 |
-
this.scrollToPosition({
|
13998 |
-
scrollLeft: calculatedScrollLeft,
|
13999 |
-
scrollTop: -1
|
14000 |
-
});
|
14001 |
-
}
|
14002 |
-
}
|
14003 |
-
}, {
|
14004 |
-
key: '_getCalculatedScrollTop',
|
14005 |
-
value: function _getCalculatedScrollTop() {
|
14006 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
14007 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
14008 |
-
var height = props.height,
|
14009 |
-
rowCount = props.rowCount,
|
14010 |
-
scrollToAlignment = props.scrollToAlignment,
|
14011 |
-
scrollToRow = props.scrollToRow,
|
14012 |
-
width = props.width;
|
14013 |
-
var scrollTop = state.scrollTop;
|
14014 |
-
|
14015 |
-
|
14016 |
-
if (rowCount > 0) {
|
14017 |
-
var finalRow = rowCount - 1;
|
14018 |
-
var targetIndex = scrollToRow < 0 ? finalRow : Math.min(finalRow, scrollToRow);
|
14019 |
-
var totalColumnsWidth = this._columnSizeAndPositionManager.getTotalSize();
|
14020 |
-
var scrollBarSize = totalColumnsWidth > width ? this._scrollbarSize : 0;
|
14021 |
-
|
14022 |
-
return this._rowSizeAndPositionManager.getUpdatedOffsetForIndex({
|
14023 |
-
align: scrollToAlignment,
|
14024 |
-
containerSize: height - scrollBarSize,
|
14025 |
-
currentOffset: scrollTop,
|
14026 |
-
targetIndex: targetIndex
|
14027 |
-
});
|
14028 |
-
}
|
14029 |
-
}
|
14030 |
-
}, {
|
14031 |
-
key: '_resetStyleCache',
|
14032 |
-
value: function _resetStyleCache() {
|
14033 |
-
var styleCache = this._styleCache;
|
14034 |
-
|
14035 |
-
// Reset cell and style caches once scrolling stops.
|
14036 |
-
// This makes Grid simpler to use (since cells commonly change).
|
14037 |
-
// And it keeps the caches from growing too large.
|
14038 |
-
// Performance is most sensitive when a user is scrolling.
|
14039 |
-
this._cellCache = {};
|
14040 |
-
this._styleCache = {};
|
14041 |
-
|
14042 |
-
// Copy over the visible cell styles so avoid unnecessary re-render.
|
14043 |
-
for (var rowIndex = this._rowStartIndex; rowIndex <= this._rowStopIndex; rowIndex++) {
|
14044 |
-
for (var columnIndex = this._columnStartIndex; columnIndex <= this._columnStopIndex; columnIndex++) {
|
14045 |
-
var key = rowIndex + '-' + columnIndex;
|
14046 |
-
this._styleCache[key] = styleCache[key];
|
14047 |
-
}
|
14048 |
-
}
|
14049 |
-
|
14050 |
-
this.setState({
|
14051 |
-
isScrolling: false
|
14052 |
-
});
|
14053 |
-
}
|
14054 |
-
}, {
|
14055 |
-
key: '_updateScrollTopForScrollToRow',
|
14056 |
-
value: function _updateScrollTopForScrollToRow() {
|
14057 |
-
var props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props;
|
14058 |
-
var state = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.state;
|
14059 |
-
var scrollTop = state.scrollTop;
|
14060 |
-
|
14061 |
-
var calculatedScrollTop = this._getCalculatedScrollTop(props, state);
|
14062 |
-
|
14063 |
-
if (typeof calculatedScrollTop === 'number' && calculatedScrollTop >= 0 && scrollTop !== calculatedScrollTop) {
|
14064 |
-
this.scrollToPosition({
|
14065 |
-
scrollLeft: -1,
|
14066 |
-
scrollTop: calculatedScrollTop
|
14067 |
-
});
|
14068 |
-
}
|
14069 |
-
}
|
14070 |
-
}]);
|
14071 |
-
|
14072 |
-
return Grid;
|
14073 |
-
}(__WEBPACK_IMPORTED_MODULE_6_react__["PureComponent"]);
|
14074 |
-
|
14075 |
-
Grid.defaultProps = {
|
14076 |
-
'aria-label': 'grid',
|
14077 |
-
'aria-readonly': true,
|
14078 |
-
autoContainerWidth: false,
|
14079 |
-
autoHeight: false,
|
14080 |
-
autoWidth: false,
|
14081 |
-
cellRangeRenderer: __WEBPACK_IMPORTED_MODULE_13__defaultCellRangeRenderer__["a" /* default */],
|
14082 |
-
containerRole: 'rowgroup',
|
14083 |
-
containerStyle: {},
|
14084 |
-
estimatedColumnSize: 100,
|
14085 |
-
estimatedRowSize: 30,
|
14086 |
-
getScrollbarSize: __WEBPACK_IMPORTED_MODULE_14_dom_helpers_util_scrollbarSize___default.a,
|
14087 |
-
noContentRenderer: renderNull,
|
14088 |
-
onScroll: function onScroll() {},
|
14089 |
-
onScrollbarPresenceChange: function onScrollbarPresenceChange() {},
|
14090 |
-
onSectionRendered: function onSectionRendered() {},
|
14091 |
-
overscanColumnCount: 0,
|
14092 |
-
overscanIndicesGetter: __WEBPACK_IMPORTED_MODULE_11__defaultOverscanIndicesGetter__["c" /* default */],
|
14093 |
-
overscanRowCount: 10,
|
14094 |
-
role: 'grid',
|
14095 |
-
scrollingResetTimeInterval: DEFAULT_SCROLLING_RESET_TIME_INTERVAL,
|
14096 |
-
scrollToAlignment: 'auto',
|
14097 |
-
scrollToColumn: -1,
|
14098 |
-
scrollToRow: -1,
|
14099 |
-
style: {},
|
14100 |
-
tabIndex: 0
|
14101 |
-
};
|
14102 |
-
Grid.propTypes = {
|
14103 |
-
"aria-label": __webpack_require__(0).string.isRequired,
|
14104 |
-
"aria-readonly": __webpack_require__(0).bool,
|
14105 |
-
|
14106 |
-
|
14107 |
-
/**
|
14108 |
-
* Set the width of the inner scrollable container to 'auto'.
|
14109 |
-
* This is useful for single-column Grids to ensure that the column doesn't extend below a vertical scrollbar.
|
14110 |
-
*/
|
14111 |
-
autoContainerWidth: __webpack_require__(0).bool.isRequired,
|
14112 |
-
|
14113 |
-
|
14114 |
-
/**
|
14115 |
-
* Removes fixed height from the scrollingContainer so that the total height of rows can stretch the window.
|
14116 |
-
* Intended for use with WindowScroller
|
14117 |
-
*/
|
14118 |
-
autoHeight: __webpack_require__(0).bool.isRequired,
|
14119 |
-
|
14120 |
-
|
14121 |
-
/**
|
14122 |
-
* Removes fixed width from the scrollingContainer so that the total width of rows can stretch the window.
|
14123 |
-
* Intended for use with WindowScroller
|
14124 |
-
*/
|
14125 |
-
autoWidth: __webpack_require__(0).bool.isRequired,
|
14126 |
-
|
14127 |
-
|
14128 |
-
/** Responsible for rendering a cell given an row and column index. */
|
14129 |
-
cellRenderer: typeof babelPluginFlowReactPropTypes_proptype_CellRenderer === 'function' ? babelPluginFlowReactPropTypes_proptype_CellRenderer.isRequired ? babelPluginFlowReactPropTypes_proptype_CellRenderer.isRequired : babelPluginFlowReactPropTypes_proptype_CellRenderer : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_CellRenderer).isRequired,
|
14130 |
-
|
14131 |
-
|
14132 |
-
/** Responsible for rendering a group of cells given their index ranges. */
|
14133 |
-
cellRangeRenderer: typeof babelPluginFlowReactPropTypes_proptype_CellRangeRenderer === 'function' ? babelPluginFlowReactPropTypes_proptype_CellRangeRenderer.isRequired ? babelPluginFlowReactPropTypes_proptype_CellRangeRenderer.isRequired : babelPluginFlowReactPropTypes_proptype_CellRangeRenderer : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_CellRangeRenderer).isRequired,
|
14134 |
-
|
14135 |
-
|
14136 |
-
/** Optional custom CSS class name to attach to root Grid element. */
|
14137 |
-
className: __webpack_require__(0).string,
|
14138 |
-
|
14139 |
-
|
14140 |
-
/** Number of columns in grid. */
|
14141 |
-
columnCount: __webpack_require__(0).number.isRequired,
|
14142 |
-
|
14143 |
-
|
14144 |
-
/** Either a fixed column width (number) or a function that returns the width of a column given its index. */
|
14145 |
-
columnWidth: typeof babelPluginFlowReactPropTypes_proptype_CellSize === 'function' ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired : babelPluginFlowReactPropTypes_proptype_CellSize : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_CellSize).isRequired,
|
14146 |
-
|
14147 |
-
|
14148 |
-
/** Unfiltered props for the Grid container. */
|
14149 |
-
containerProps: __webpack_require__(0).object,
|
14150 |
-
|
14151 |
-
|
14152 |
-
/** ARIA role for the cell-container. */
|
14153 |
-
containerRole: __webpack_require__(0).string.isRequired,
|
14154 |
-
|
14155 |
-
|
14156 |
-
/** Optional inline style applied to inner cell-container */
|
14157 |
-
containerStyle: __webpack_require__(0).object.isRequired,
|
14158 |
-
|
14159 |
-
|
14160 |
-
/**
|
14161 |
-
* If CellMeasurer is used to measure this Grid's children, this should be a pointer to its CellMeasurerCache.
|
14162 |
-
* A shared CellMeasurerCache reference enables Grid and CellMeasurer to share measurement data.
|
14163 |
-
*/
|
14164 |
-
deferredMeasurementCache: __webpack_require__(0).object,
|
14165 |
-
|
14166 |
-
|
14167 |
-
/**
|
14168 |
-
* Used to estimate the total width of a Grid before all of its columns have actually been measured.
|
14169 |
-
* The estimated total width is adjusted as columns are rendered.
|
14170 |
-
*/
|
14171 |
-
estimatedColumnSize: __webpack_require__(0).number.isRequired,
|
14172 |
-
|
14173 |
-
|
14174 |
-
/**
|
14175 |
-
* Used to estimate the total height of a Grid before all of its rows have actually been measured.
|
14176 |
-
* The estimated total height is adjusted as rows are rendered.
|
14177 |
-
*/
|
14178 |
-
estimatedRowSize: __webpack_require__(0).number.isRequired,
|
14179 |
-
|
14180 |
-
|
14181 |
-
/** Exposed for testing purposes only. */
|
14182 |
-
getScrollbarSize: __webpack_require__(0).func.isRequired,
|
14183 |
-
|
14184 |
-
|
14185 |
-
/** Height of Grid; this property determines the number of visible (vs virtualized) rows. */
|
14186 |
-
height: __webpack_require__(0).number.isRequired,
|
14187 |
-
|
14188 |
-
|
14189 |
-
/** Optional custom id to attach to root Grid element. */
|
14190 |
-
id: __webpack_require__(0).string,
|
14191 |
-
|
14192 |
-
|
14193 |
-
/**
|
14194 |
-
* Override internal is-scrolling state tracking.
|
14195 |
-
* This property is primarily intended for use with the WindowScroller component.
|
14196 |
-
*/
|
14197 |
-
isScrolling: __webpack_require__(0).bool,
|
14198 |
-
|
14199 |
-
|
14200 |
-
/** Optional renderer to be used in place of rows when either :rowCount or :columnCount is 0. */
|
14201 |
-
noContentRenderer: typeof babelPluginFlowReactPropTypes_proptype_NoContentRenderer === 'function' ? babelPluginFlowReactPropTypes_proptype_NoContentRenderer.isRequired ? babelPluginFlowReactPropTypes_proptype_NoContentRenderer.isRequired : babelPluginFlowReactPropTypes_proptype_NoContentRenderer : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_NoContentRenderer).isRequired,
|
14202 |
-
|
14203 |
-
|
14204 |
-
/**
|
14205 |
-
* Callback invoked whenever the scroll offset changes within the inner scrollable region.
|
14206 |
-
* This callback can be used to sync scrolling between lists, tables, or grids.
|
14207 |
-
*/
|
14208 |
-
onScroll: __webpack_require__(0).func.isRequired,
|
14209 |
-
|
14210 |
-
|
14211 |
-
/**
|
14212 |
-
* Called whenever a horizontal or vertical scrollbar is added or removed.
|
14213 |
-
* This prop is not intended for end-user use;
|
14214 |
-
* It is used by MultiGrid to support fixed-row/fixed-column scroll syncing.
|
14215 |
-
*/
|
14216 |
-
onScrollbarPresenceChange: __webpack_require__(0).func.isRequired,
|
14217 |
-
|
14218 |
-
|
14219 |
-
/** Callback invoked with information about the section of the Grid that was just rendered. */
|
14220 |
-
onSectionRendered: __webpack_require__(0).func.isRequired,
|
14221 |
-
|
14222 |
-
|
14223 |
-
/**
|
14224 |
-
* Number of columns to render before/after the visible section of the grid.
|
14225 |
-
* These columns can help for smoother scrolling on touch devices or browsers that send scroll events infrequently.
|
14226 |
-
*/
|
14227 |
-
overscanColumnCount: __webpack_require__(0).number.isRequired,
|
14228 |
-
|
14229 |
-
|
14230 |
-
/**
|
14231 |
-
* Calculates the number of cells to overscan before and after a specified range.
|
14232 |
-
* This function ensures that overscanning doesn't exceed the available cells.
|
14233 |
-
*/
|
14234 |
-
overscanIndicesGetter: typeof babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter === 'function' ? babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter.isRequired ? babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter.isRequired : babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter).isRequired,
|
14235 |
-
|
14236 |
-
|
14237 |
-
/**
|
14238 |
-
* Number of rows to render above/below the visible section of the grid.
|
14239 |
-
* These rows can help for smoother scrolling on touch devices or browsers that send scroll events infrequently.
|
14240 |
-
*/
|
14241 |
-
overscanRowCount: __webpack_require__(0).number.isRequired,
|
14242 |
-
|
14243 |
-
|
14244 |
-
/** ARIA role for the grid element. */
|
14245 |
-
role: __webpack_require__(0).string.isRequired,
|
14246 |
-
|
14247 |
-
|
14248 |
-
/**
|
14249 |
-
* Either a fixed row height (number) or a function that returns the height of a row given its index.
|
14250 |
-
* Should implement the following interface: ({ index: number }): number
|
14251 |
-
*/
|
14252 |
-
rowHeight: typeof babelPluginFlowReactPropTypes_proptype_CellSize === 'function' ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired : babelPluginFlowReactPropTypes_proptype_CellSize : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_CellSize).isRequired,
|
14253 |
-
|
14254 |
-
|
14255 |
-
/** Number of rows in grid. */
|
14256 |
-
rowCount: __webpack_require__(0).number.isRequired,
|
14257 |
-
|
14258 |
-
|
14259 |
-
/** Wait this amount of time after the last scroll event before resetting Grid `pointer-events`. */
|
14260 |
-
scrollingResetTimeInterval: __webpack_require__(0).number.isRequired,
|
14261 |
-
|
14262 |
-
|
14263 |
-
/** Horizontal offset. */
|
14264 |
-
scrollLeft: __webpack_require__(0).number,
|
14265 |
-
|
14266 |
-
|
14267 |
-
/**
|
14268 |
-
* Controls scroll-to-cell behavior of the Grid.
|
14269 |
-
* The default ("auto") scrolls the least amount possible to ensure that the specified cell is fully visible.
|
14270 |
-
* Use "start" to align cells to the top/left of the Grid and "end" to align bottom/right.
|
14271 |
-
*/
|
14272 |
-
scrollToAlignment: typeof babelPluginFlowReactPropTypes_proptype_Alignment === 'function' ? babelPluginFlowReactPropTypes_proptype_Alignment.isRequired ? babelPluginFlowReactPropTypes_proptype_Alignment.isRequired : babelPluginFlowReactPropTypes_proptype_Alignment : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_Alignment).isRequired,
|
14273 |
-
|
14274 |
-
|
14275 |
-
/** Column index to ensure visible (by forcefully scrolling if necessary) */
|
14276 |
-
scrollToColumn: __webpack_require__(0).number.isRequired,
|
14277 |
-
|
14278 |
-
|
14279 |
-
/** Vertical offset. */
|
14280 |
-
scrollTop: __webpack_require__(0).number,
|
14281 |
-
|
14282 |
-
|
14283 |
-
/** Row index to ensure visible (by forcefully scrolling if necessary) */
|
14284 |
-
scrollToRow: __webpack_require__(0).number.isRequired,
|
14285 |
-
|
14286 |
-
|
14287 |
-
/** Optional inline style */
|
14288 |
-
style: __webpack_require__(0).object.isRequired,
|
14289 |
-
|
14290 |
-
|
14291 |
-
/** Tab index for focus */
|
14292 |
-
tabIndex: __webpack_require__(0).number,
|
14293 |
-
|
14294 |
-
|
14295 |
-
/** Width of Grid; this property determines the number of visible (vs virtualized) columns. */
|
14296 |
-
width: __webpack_require__(0).number.isRequired
|
14297 |
-
};
|
14298 |
-
/* harmony default export */ __webpack_exports__["a"] = (Grid);
|
14299 |
-
|
14300 |
-
/***/ }),
|
14301 |
-
/* 247 */
|
14302 |
-
/***/ (function(module, exports, __webpack_require__) {
|
14303 |
-
|
14304 |
-
module.exports = { "default": __webpack_require__(564), __esModule: true };
|
14305 |
-
|
14306 |
-
/***/ }),
|
14307 |
-
/* 248 */
|
14308 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14309 |
-
|
14310 |
-
"use strict";
|
14311 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return SCROLL_DIRECTION_BACKWARD; });
|
14312 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SCROLL_DIRECTION_FORWARD; });
|
14313 |
-
/* unused harmony export SCROLL_DIRECTION_HORIZONTAL */
|
14314 |
-
/* unused harmony export SCROLL_DIRECTION_VERTICAL */
|
14315 |
-
/* harmony export (immutable) */ __webpack_exports__["c"] = defaultOverscanIndicesGetter;
|
14316 |
-
var babelPluginFlowReactPropTypes_proptype_OverscanIndices = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_OverscanIndices || __webpack_require__(0).any;
|
14317 |
-
|
14318 |
-
var babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetterParams = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetterParams || __webpack_require__(0).any;
|
14319 |
-
|
14320 |
-
var SCROLL_DIRECTION_BACKWARD = -1;
|
14321 |
-
var SCROLL_DIRECTION_FORWARD = 1;
|
14322 |
-
|
14323 |
-
var SCROLL_DIRECTION_HORIZONTAL = 'horizontal';
|
14324 |
-
var SCROLL_DIRECTION_VERTICAL = 'vertical';
|
14325 |
-
|
14326 |
-
/**
|
14327 |
-
* Calculates the number of cells to overscan before and after a specified range.
|
14328 |
-
* This function ensures that overscanning doesn't exceed the available cells.
|
14329 |
-
*/
|
14330 |
-
|
14331 |
-
function defaultOverscanIndicesGetter(_ref) {
|
14332 |
-
var cellCount = _ref.cellCount,
|
14333 |
-
overscanCellsCount = _ref.overscanCellsCount,
|
14334 |
-
scrollDirection = _ref.scrollDirection,
|
14335 |
-
startIndex = _ref.startIndex,
|
14336 |
-
stopIndex = _ref.stopIndex;
|
14337 |
-
|
14338 |
-
if (scrollDirection === SCROLL_DIRECTION_FORWARD) {
|
14339 |
-
return {
|
14340 |
-
overscanStartIndex: Math.max(0, startIndex),
|
14341 |
-
overscanStopIndex: Math.min(cellCount - 1, stopIndex + overscanCellsCount)
|
14342 |
-
};
|
14343 |
-
} else {
|
14344 |
-
return {
|
14345 |
-
overscanStartIndex: Math.max(0, startIndex - overscanCellsCount),
|
14346 |
-
overscanStopIndex: Math.min(cellCount - 1, stopIndex)
|
14347 |
-
};
|
14348 |
-
}
|
14349 |
-
}
|
14350 |
-
|
14351 |
-
/***/ }),
|
14352 |
-
/* 249 */
|
14353 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14354 |
-
|
14355 |
-
"use strict";
|
14356 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony export (immutable) */ __webpack_exports__["a"] = defaultCellRangeRenderer;
|
14357 |
-
|
14358 |
-
|
14359 |
-
/**
|
14360 |
-
* Default implementation of cellRangeRenderer used by Grid.
|
14361 |
-
* This renderer supports cell-caching while the user is scrolling.
|
14362 |
-
*/
|
14363 |
-
|
14364 |
-
var babelPluginFlowReactPropTypes_proptype_CellRangeRendererParams = __webpack_require__(11).babelPluginFlowReactPropTypes_proptype_CellRangeRendererParams || __webpack_require__(0).any;
|
14365 |
-
|
14366 |
-
function defaultCellRangeRenderer(_ref) {
|
14367 |
-
var cellCache = _ref.cellCache,
|
14368 |
-
cellRenderer = _ref.cellRenderer,
|
14369 |
-
columnSizeAndPositionManager = _ref.columnSizeAndPositionManager,
|
14370 |
-
columnStartIndex = _ref.columnStartIndex,
|
14371 |
-
columnStopIndex = _ref.columnStopIndex,
|
14372 |
-
deferredMeasurementCache = _ref.deferredMeasurementCache,
|
14373 |
-
horizontalOffsetAdjustment = _ref.horizontalOffsetAdjustment,
|
14374 |
-
isScrolling = _ref.isScrolling,
|
14375 |
-
parent = _ref.parent,
|
14376 |
-
rowSizeAndPositionManager = _ref.rowSizeAndPositionManager,
|
14377 |
-
rowStartIndex = _ref.rowStartIndex,
|
14378 |
-
rowStopIndex = _ref.rowStopIndex,
|
14379 |
-
styleCache = _ref.styleCache,
|
14380 |
-
verticalOffsetAdjustment = _ref.verticalOffsetAdjustment,
|
14381 |
-
visibleColumnIndices = _ref.visibleColumnIndices,
|
14382 |
-
visibleRowIndices = _ref.visibleRowIndices;
|
14383 |
-
|
14384 |
-
var renderedCells = [];
|
14385 |
-
|
14386 |
-
// Browsers have native size limits for elements (eg Chrome 33M pixels, IE 1.5M pixes).
|
14387 |
-
// User cannot scroll beyond these size limitations.
|
14388 |
-
// In order to work around this, ScalingCellSizeAndPositionManager compresses offsets.
|
14389 |
-
// We should never cache styles for compressed offsets though as this can lead to bugs.
|
14390 |
-
// See issue #576 for more.
|
14391 |
-
var areOffsetsAdjusted = columnSizeAndPositionManager.areOffsetsAdjusted() || rowSizeAndPositionManager.areOffsetsAdjusted();
|
14392 |
-
|
14393 |
-
var canCacheStyle = !isScrolling && !areOffsetsAdjusted;
|
14394 |
-
|
14395 |
-
for (var rowIndex = rowStartIndex; rowIndex <= rowStopIndex; rowIndex++) {
|
14396 |
-
var rowDatum = rowSizeAndPositionManager.getSizeAndPositionOfCell(rowIndex);
|
14397 |
-
|
14398 |
-
for (var columnIndex = columnStartIndex; columnIndex <= columnStopIndex; columnIndex++) {
|
14399 |
-
var columnDatum = columnSizeAndPositionManager.getSizeAndPositionOfCell(columnIndex);
|
14400 |
-
var isVisible = columnIndex >= visibleColumnIndices.start && columnIndex <= visibleColumnIndices.stop && rowIndex >= visibleRowIndices.start && rowIndex <= visibleRowIndices.stop;
|
14401 |
-
var key = rowIndex + '-' + columnIndex;
|
14402 |
-
var style = void 0;
|
14403 |
-
|
14404 |
-
// Cache style objects so shallow-compare doesn't re-render unnecessarily.
|
14405 |
-
if (canCacheStyle && styleCache[key]) {
|
14406 |
-
style = styleCache[key];
|
14407 |
-
} else {
|
14408 |
-
// In deferred mode, cells will be initially rendered before we know their size.
|
14409 |
-
// Don't interfere with CellMeasurer's measurements by setting an invalid size.
|
14410 |
-
if (deferredMeasurementCache && !deferredMeasurementCache.has(rowIndex, columnIndex)) {
|
14411 |
-
// Position not-yet-measured cells at top/left 0,0,
|
14412 |
-
// And give them width/height of 'auto' so they can grow larger than the parent Grid if necessary.
|
14413 |
-
// Positioning them further to the right/bottom influences their measured size.
|
14414 |
-
style = {
|
14415 |
-
height: 'auto',
|
14416 |
-
left: 0,
|
14417 |
-
position: 'absolute',
|
14418 |
-
top: 0,
|
14419 |
-
width: 'auto'
|
14420 |
-
};
|
14421 |
-
} else {
|
14422 |
-
style = {
|
14423 |
-
height: rowDatum.size,
|
14424 |
-
left: columnDatum.offset + horizontalOffsetAdjustment,
|
14425 |
-
position: 'absolute',
|
14426 |
-
top: rowDatum.offset + verticalOffsetAdjustment,
|
14427 |
-
width: columnDatum.size
|
14428 |
-
};
|
14429 |
-
|
14430 |
-
styleCache[key] = style;
|
14431 |
-
}
|
14432 |
-
}
|
14433 |
-
|
14434 |
-
var cellRendererParams = {
|
14435 |
-
columnIndex: columnIndex,
|
14436 |
-
isScrolling: isScrolling,
|
14437 |
-
isVisible: isVisible,
|
14438 |
-
key: key,
|
14439 |
-
parent: parent,
|
14440 |
-
rowIndex: rowIndex,
|
14441 |
-
style: style
|
14442 |
-
};
|
14443 |
-
|
14444 |
-
var renderedCell = void 0;
|
14445 |
-
|
14446 |
-
// Avoid re-creating cells while scrolling.
|
14447 |
-
// This can lead to the same cell being created many times and can cause performance issues for "heavy" cells.
|
14448 |
-
// If a scroll is in progress- cache and reuse cells.
|
14449 |
-
// This cache will be thrown away once scrolling completes.
|
14450 |
-
// However if we are scaling scroll positions and sizes, we should also avoid caching.
|
14451 |
-
// This is because the offset changes slightly as scroll position changes and caching leads to stale values.
|
14452 |
-
// For more info refer to issue #395
|
14453 |
-
if (isScrolling && !horizontalOffsetAdjustment && !verticalOffsetAdjustment) {
|
14454 |
-
if (!cellCache[key]) {
|
14455 |
-
cellCache[key] = cellRenderer(cellRendererParams);
|
14456 |
-
}
|
14457 |
-
|
14458 |
-
renderedCell = cellCache[key];
|
14459 |
-
|
14460 |
-
// If the user is no longer scrolling, don't cache cells.
|
14461 |
-
// This makes dynamic cell content difficult for users and would also lead to a heavier memory footprint.
|
14462 |
-
} else {
|
14463 |
-
renderedCell = cellRenderer(cellRendererParams);
|
14464 |
-
}
|
14465 |
-
|
14466 |
-
if (renderedCell == null || renderedCell === false) {
|
14467 |
-
continue;
|
14468 |
-
}
|
14469 |
-
|
14470 |
-
if (process.env.NODE_ENV !== 'production') {
|
14471 |
-
warnAboutMissingStyle(parent, renderedCell);
|
14472 |
-
}
|
14473 |
-
|
14474 |
-
renderedCells.push(renderedCell);
|
14475 |
-
}
|
14476 |
-
}
|
14477 |
-
|
14478 |
-
return renderedCells;
|
14479 |
-
}
|
14480 |
-
|
14481 |
-
function warnAboutMissingStyle(parent, renderedCell) {
|
14482 |
-
if (process.env.NODE_ENV !== 'production') {
|
14483 |
-
if (renderedCell) {
|
14484 |
-
// If the direct child is a CellMeasurer, then we should check its child
|
14485 |
-
// See issue #611
|
14486 |
-
if (renderedCell.type && renderedCell.type.__internalCellMeasurerFlag) {
|
14487 |
-
renderedCell = renderedCell.props.children;
|
14488 |
-
}
|
14489 |
-
|
14490 |
-
if (renderedCell && renderedCell.props && renderedCell.props.style === undefined && parent.__warnedAboutMissingStyle !== true) {
|
14491 |
-
parent.__warnedAboutMissingStyle = true;
|
14492 |
-
|
14493 |
-
console.warn('Rendered cell should include style property for positioning.');
|
14494 |
-
}
|
14495 |
-
}
|
14496 |
-
}
|
14497 |
-
}
|
14498 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(7)))
|
14499 |
-
|
14500 |
-
/***/ }),
|
14501 |
-
/* 250 */
|
14502 |
-
/***/ (function(module, exports, __webpack_require__) {
|
14503 |
-
|
14504 |
-
"use strict";
|
14505 |
-
|
14506 |
-
|
14507 |
-
Object.defineProperty(exports, "__esModule", {
|
14508 |
-
value: true
|
14509 |
-
});
|
14510 |
-
|
14511 |
-
exports.default = function (recalc) {
|
14512 |
-
if (!size && size !== 0 || recalc) {
|
14513 |
-
if (_inDOM2.default) {
|
14514 |
-
var scrollDiv = document.createElement('div');
|
14515 |
-
|
14516 |
-
scrollDiv.style.position = 'absolute';
|
14517 |
-
scrollDiv.style.top = '-9999px';
|
14518 |
-
scrollDiv.style.width = '50px';
|
14519 |
-
scrollDiv.style.height = '50px';
|
14520 |
-
scrollDiv.style.overflow = 'scroll';
|
14521 |
-
|
14522 |
-
document.body.appendChild(scrollDiv);
|
14523 |
-
size = scrollDiv.offsetWidth - scrollDiv.clientWidth;
|
14524 |
-
document.body.removeChild(scrollDiv);
|
14525 |
-
}
|
14526 |
-
}
|
14527 |
-
|
14528 |
-
return size;
|
14529 |
-
};
|
14530 |
-
|
14531 |
-
var _inDOM = __webpack_require__(567);
|
14532 |
-
|
14533 |
-
var _inDOM2 = _interopRequireDefault(_inDOM);
|
14534 |
-
|
14535 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
14536 |
-
|
14537 |
-
var size = void 0;
|
14538 |
-
|
14539 |
-
module.exports = exports['default'];
|
14540 |
-
|
14541 |
-
/***/ }),
|
14542 |
-
/* 251 */
|
14543 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14544 |
-
|
14545 |
-
"use strict";
|
14546 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
14547 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
14548 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
14549 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__);
|
14550 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
14551 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
14552 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
14553 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
14554 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
14555 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
14556 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
14557 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
14558 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(2);
|
14559 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
14560 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__vendor_detectElementResize__ = __webpack_require__(252);
|
14561 |
-
|
14562 |
-
|
14563 |
-
|
14564 |
-
|
14565 |
-
|
14566 |
-
|
14567 |
-
|
14568 |
-
|
14569 |
-
|
14570 |
-
var AutoSizer = function (_React$PureComponent) {
|
14571 |
-
__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default()(AutoSizer, _React$PureComponent);
|
14572 |
-
|
14573 |
-
function AutoSizer() {
|
14574 |
-
var _ref;
|
14575 |
-
|
14576 |
-
var _temp, _this, _ret;
|
14577 |
-
|
14578 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default()(this, AutoSizer);
|
14579 |
-
|
14580 |
-
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
14581 |
-
args[_key] = arguments[_key];
|
14582 |
-
}
|
14583 |
-
|
14584 |
-
return _ret = (_temp = (_this = __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(this, (_ref = AutoSizer.__proto__ || __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default()(AutoSizer)).call.apply(_ref, [this].concat(args))), _this), _this.state = {
|
14585 |
-
height: _this.props.defaultHeight || 0,
|
14586 |
-
width: _this.props.defaultWidth || 0
|
14587 |
-
}, _this._onResize = function () {
|
14588 |
-
var _this$props = _this.props,
|
14589 |
-
disableHeight = _this$props.disableHeight,
|
14590 |
-
disableWidth = _this$props.disableWidth,
|
14591 |
-
onResize = _this$props.onResize;
|
14592 |
-
|
14593 |
-
|
14594 |
-
if (_this._parentNode) {
|
14595 |
-
// Guard against AutoSizer component being removed from the DOM immediately after being added.
|
14596 |
-
// This can result in invalid style values which can result in NaN values if we don't handle them.
|
14597 |
-
// See issue #150 for more context.
|
14598 |
-
|
14599 |
-
var _height = _this._parentNode.offsetHeight || 0;
|
14600 |
-
var _width = _this._parentNode.offsetWidth || 0;
|
14601 |
-
|
14602 |
-
var _style = window.getComputedStyle(_this._parentNode) || {};
|
14603 |
-
var paddingLeft = parseInt(_style.paddingLeft, 10) || 0;
|
14604 |
-
var paddingRight = parseInt(_style.paddingRight, 10) || 0;
|
14605 |
-
var paddingTop = parseInt(_style.paddingTop, 10) || 0;
|
14606 |
-
var paddingBottom = parseInt(_style.paddingBottom, 10) || 0;
|
14607 |
-
|
14608 |
-
var newHeight = _height - paddingTop - paddingBottom;
|
14609 |
-
var newWidth = _width - paddingLeft - paddingRight;
|
14610 |
-
|
14611 |
-
if (!disableHeight && _this.state.height !== newHeight || !disableWidth && _this.state.width !== newWidth) {
|
14612 |
-
_this.setState({
|
14613 |
-
height: _height - paddingTop - paddingBottom,
|
14614 |
-
width: _width - paddingLeft - paddingRight
|
14615 |
-
});
|
14616 |
-
|
14617 |
-
onResize({ height: _height, width: _width });
|
14618 |
-
}
|
14619 |
-
}
|
14620 |
-
}, _this._setRef = function (autoSizer) {
|
14621 |
-
_this._autoSizer = autoSizer;
|
14622 |
-
}, _temp), __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(_this, _ret);
|
14623 |
-
}
|
14624 |
-
|
14625 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default()(AutoSizer, [{
|
14626 |
-
key: 'componentDidMount',
|
14627 |
-
value: function componentDidMount() {
|
14628 |
-
var nonce = this.props.nonce;
|
14629 |
-
|
14630 |
-
if (this._autoSizer && this._autoSizer.parentNode && this._autoSizer.parentNode.ownerDocument && this._autoSizer.parentNode.ownerDocument.defaultView && this._autoSizer.parentNode instanceof this._autoSizer.parentNode.ownerDocument.defaultView.HTMLElement) {
|
14631 |
-
// Delay access of parentNode until mount.
|
14632 |
-
// This handles edge-cases where the component has already been unmounted before its ref has been set,
|
14633 |
-
// As well as libraries like react-lite which have a slightly different lifecycle.
|
14634 |
-
this._parentNode = this._autoSizer.parentNode;
|
14635 |
-
|
14636 |
-
// Defer requiring resize handler in order to support server-side rendering.
|
14637 |
-
// See issue #41
|
14638 |
-
this._detectElementResize = Object(__WEBPACK_IMPORTED_MODULE_7__vendor_detectElementResize__["a" /* default */])(nonce);
|
14639 |
-
this._detectElementResize.addResizeListener(this._parentNode, this._onResize);
|
14640 |
-
|
14641 |
-
this._onResize();
|
14642 |
-
}
|
14643 |
-
}
|
14644 |
-
}, {
|
14645 |
-
key: 'componentWillUnmount',
|
14646 |
-
value: function componentWillUnmount() {
|
14647 |
-
if (this._detectElementResize && this._parentNode) {
|
14648 |
-
this._detectElementResize.removeResizeListener(this._parentNode, this._onResize);
|
14649 |
-
}
|
14650 |
-
}
|
14651 |
-
}, {
|
14652 |
-
key: 'render',
|
14653 |
-
value: function render() {
|
14654 |
-
var _props = this.props,
|
14655 |
-
children = _props.children,
|
14656 |
-
className = _props.className,
|
14657 |
-
disableHeight = _props.disableHeight,
|
14658 |
-
disableWidth = _props.disableWidth,
|
14659 |
-
style = _props.style;
|
14660 |
-
var _state = this.state,
|
14661 |
-
height = _state.height,
|
14662 |
-
width = _state.width;
|
14663 |
-
|
14664 |
-
// Outer div should not force width/height since that may prevent containers from shrinking.
|
14665 |
-
// Inner component should overflow and use calculated width/height.
|
14666 |
-
// See issue #68 for more information.
|
14667 |
-
|
14668 |
-
var outerStyle = { overflow: 'visible' };
|
14669 |
-
var childParams = {};
|
14670 |
-
|
14671 |
-
if (!disableHeight) {
|
14672 |
-
outerStyle.height = 0;
|
14673 |
-
childParams.height = height;
|
14674 |
-
}
|
14675 |
-
|
14676 |
-
if (!disableWidth) {
|
14677 |
-
outerStyle.width = 0;
|
14678 |
-
childParams.width = width;
|
14679 |
-
}
|
14680 |
-
|
14681 |
-
/**
|
14682 |
-
* TODO: Avoid rendering children before the initial measurements have been collected.
|
14683 |
-
* At best this would just be wasting cycles.
|
14684 |
-
* Add this check into version 10 though as it could break too many ref callbacks in version 9.
|
14685 |
-
* Note that if default width/height props were provided this would still work with SSR.
|
14686 |
-
if (
|
14687 |
-
height !== 0 &&
|
14688 |
-
width !== 0
|
14689 |
-
) {
|
14690 |
-
child = children({ height, width })
|
14691 |
-
}
|
14692 |
-
*/
|
14693 |
-
|
14694 |
-
return __WEBPACK_IMPORTED_MODULE_6_react__["createElement"](
|
14695 |
-
'div',
|
14696 |
-
{
|
14697 |
-
className: className,
|
14698 |
-
ref: this._setRef,
|
14699 |
-
style: __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, outerStyle, style) },
|
14700 |
-
children(childParams)
|
14701 |
-
);
|
14702 |
-
}
|
14703 |
-
}]);
|
14704 |
-
|
14705 |
-
return AutoSizer;
|
14706 |
-
}(__WEBPACK_IMPORTED_MODULE_6_react__["PureComponent"]);
|
14707 |
-
|
14708 |
-
AutoSizer.defaultProps = {
|
14709 |
-
onResize: function onResize() {},
|
14710 |
-
disableHeight: false,
|
14711 |
-
disableWidth: false,
|
14712 |
-
style: {}
|
14713 |
-
};
|
14714 |
-
AutoSizer.propTypes = {
|
14715 |
-
/** Function responsible for rendering children.*/
|
14716 |
-
children: __webpack_require__(0).func.isRequired,
|
14717 |
-
|
14718 |
-
|
14719 |
-
/** Optional custom CSS class name to attach to root AutoSizer element. */
|
14720 |
-
className: __webpack_require__(0).string,
|
14721 |
-
|
14722 |
-
|
14723 |
-
/** Default height to use for initial render; useful for SSR */
|
14724 |
-
defaultHeight: __webpack_require__(0).number,
|
14725 |
-
|
14726 |
-
|
14727 |
-
/** Default width to use for initial render; useful for SSR */
|
14728 |
-
defaultWidth: __webpack_require__(0).number,
|
14729 |
-
|
14730 |
-
|
14731 |
-
/** Disable dynamic :height property */
|
14732 |
-
disableHeight: __webpack_require__(0).bool.isRequired,
|
14733 |
-
|
14734 |
-
|
14735 |
-
/** Disable dynamic :width property */
|
14736 |
-
disableWidth: __webpack_require__(0).bool.isRequired,
|
14737 |
-
|
14738 |
-
|
14739 |
-
/** Nonce of the inlined stylesheet for Content Security Policy */
|
14740 |
-
nonce: __webpack_require__(0).string,
|
14741 |
-
|
14742 |
-
|
14743 |
-
/** Callback to be invoked on-resize */
|
14744 |
-
onResize: __webpack_require__(0).func.isRequired,
|
14745 |
-
|
14746 |
-
|
14747 |
-
/** Optional inline style */
|
14748 |
-
style: __webpack_require__(0).object
|
14749 |
-
};
|
14750 |
-
/* harmony default export */ __webpack_exports__["a"] = (AutoSizer);
|
14751 |
-
|
14752 |
-
/***/ }),
|
14753 |
-
/* 252 */
|
14754 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14755 |
-
|
14756 |
-
"use strict";
|
14757 |
-
/* WEBPACK VAR INJECTION */(function(global) {/* harmony export (immutable) */ __webpack_exports__["a"] = createDetectElementResize;
|
14758 |
-
/**
|
14759 |
-
* Detect Element Resize.
|
14760 |
-
* https://github.com/sdecima/javascript-detect-element-resize
|
14761 |
-
* Sebastian Decima
|
14762 |
-
*
|
14763 |
-
* Forked from version 0.5.3; includes the following modifications:
|
14764 |
-
* 1) Guard against unsafe 'window' and 'document' references (to support SSR).
|
14765 |
-
* 2) Defer initialization code via a top-level function wrapper (to support SSR).
|
14766 |
-
* 3) Avoid unnecessary reflows by not measuring size for scroll events bubbling from children.
|
14767 |
-
* 4) Add nonce for style element.
|
14768 |
-
**/
|
14769 |
-
|
14770 |
-
function createDetectElementResize(nonce) {
|
14771 |
-
// Check `document` and `window` in case of server-side rendering
|
14772 |
-
var _window;
|
14773 |
-
if (typeof window !== 'undefined') {
|
14774 |
-
_window = window;
|
14775 |
-
} else if (typeof self !== 'undefined') {
|
14776 |
-
_window = self;
|
14777 |
-
} else {
|
14778 |
-
_window = global;
|
14779 |
-
}
|
14780 |
-
|
14781 |
-
var attachEvent = typeof document !== 'undefined' && document.attachEvent;
|
14782 |
-
|
14783 |
-
if (!attachEvent) {
|
14784 |
-
var requestFrame = function () {
|
14785 |
-
var raf = _window.requestAnimationFrame || _window.mozRequestAnimationFrame || _window.webkitRequestAnimationFrame || function (fn) {
|
14786 |
-
return _window.setTimeout(fn, 20);
|
14787 |
-
};
|
14788 |
-
return function (fn) {
|
14789 |
-
return raf(fn);
|
14790 |
-
};
|
14791 |
-
}();
|
14792 |
-
|
14793 |
-
var cancelFrame = function () {
|
14794 |
-
var cancel = _window.cancelAnimationFrame || _window.mozCancelAnimationFrame || _window.webkitCancelAnimationFrame || _window.clearTimeout;
|
14795 |
-
return function (id) {
|
14796 |
-
return cancel(id);
|
14797 |
-
};
|
14798 |
-
}();
|
14799 |
-
|
14800 |
-
var resetTriggers = function resetTriggers(element) {
|
14801 |
-
var triggers = element.__resizeTriggers__,
|
14802 |
-
expand = triggers.firstElementChild,
|
14803 |
-
contract = triggers.lastElementChild,
|
14804 |
-
expandChild = expand.firstElementChild;
|
14805 |
-
contract.scrollLeft = contract.scrollWidth;
|
14806 |
-
contract.scrollTop = contract.scrollHeight;
|
14807 |
-
expandChild.style.width = expand.offsetWidth + 1 + 'px';
|
14808 |
-
expandChild.style.height = expand.offsetHeight + 1 + 'px';
|
14809 |
-
expand.scrollLeft = expand.scrollWidth;
|
14810 |
-
expand.scrollTop = expand.scrollHeight;
|
14811 |
-
};
|
14812 |
-
|
14813 |
-
var checkTriggers = function checkTriggers(element) {
|
14814 |
-
return element.offsetWidth != element.__resizeLast__.width || element.offsetHeight != element.__resizeLast__.height;
|
14815 |
-
};
|
14816 |
-
|
14817 |
-
var scrollListener = function scrollListener(e) {
|
14818 |
-
// Don't measure (which forces) reflow for scrolls that happen inside of children!
|
14819 |
-
if (e.target.className.indexOf('contract-trigger') < 0 && e.target.className.indexOf('expand-trigger') < 0) {
|
14820 |
-
return;
|
14821 |
-
}
|
14822 |
-
|
14823 |
-
var element = this;
|
14824 |
-
resetTriggers(this);
|
14825 |
-
if (this.__resizeRAF__) {
|
14826 |
-
cancelFrame(this.__resizeRAF__);
|
14827 |
-
}
|
14828 |
-
this.__resizeRAF__ = requestFrame(function () {
|
14829 |
-
if (checkTriggers(element)) {
|
14830 |
-
element.__resizeLast__.width = element.offsetWidth;
|
14831 |
-
element.__resizeLast__.height = element.offsetHeight;
|
14832 |
-
element.__resizeListeners__.forEach(function (fn) {
|
14833 |
-
fn.call(element, e);
|
14834 |
-
});
|
14835 |
-
}
|
14836 |
-
});
|
14837 |
-
};
|
14838 |
-
|
14839 |
-
/* Detect CSS Animations support to detect element display/re-attach */
|
14840 |
-
var animation = false,
|
14841 |
-
keyframeprefix = '',
|
14842 |
-
animationstartevent = 'animationstart',
|
14843 |
-
domPrefixes = 'Webkit Moz O ms'.split(' '),
|
14844 |
-
startEvents = 'webkitAnimationStart animationstart oAnimationStart MSAnimationStart'.split(' '),
|
14845 |
-
pfx = '';
|
14846 |
-
{
|
14847 |
-
var elm = document.createElement('fakeelement');
|
14848 |
-
if (elm.style.animationName !== undefined) {
|
14849 |
-
animation = true;
|
14850 |
-
}
|
14851 |
-
|
14852 |
-
if (animation === false) {
|
14853 |
-
for (var i = 0; i < domPrefixes.length; i++) {
|
14854 |
-
if (elm.style[domPrefixes[i] + 'AnimationName'] !== undefined) {
|
14855 |
-
pfx = domPrefixes[i];
|
14856 |
-
keyframeprefix = '-' + pfx.toLowerCase() + '-';
|
14857 |
-
animationstartevent = startEvents[i];
|
14858 |
-
animation = true;
|
14859 |
-
break;
|
14860 |
-
}
|
14861 |
-
}
|
14862 |
-
}
|
14863 |
-
}
|
14864 |
-
|
14865 |
-
var animationName = 'resizeanim';
|
14866 |
-
var animationKeyframes = '@' + keyframeprefix + 'keyframes ' + animationName + ' { from { opacity: 0; } to { opacity: 0; } } ';
|
14867 |
-
var animationStyle = keyframeprefix + 'animation: 1ms ' + animationName + '; ';
|
14868 |
-
}
|
14869 |
-
|
14870 |
-
var createStyles = function createStyles(doc) {
|
14871 |
-
if (!doc.getElementById('detectElementResize')) {
|
14872 |
-
//opacity:0 works around a chrome bug https://code.google.com/p/chromium/issues/detail?id=286360
|
14873 |
-
var css = (animationKeyframes ? animationKeyframes : '') + '.resize-triggers { ' + (animationStyle ? animationStyle : '') + 'visibility: hidden; opacity: 0; } ' + '.resize-triggers, .resize-triggers > div, .contract-trigger:before { content: " "; display: block; position: absolute; top: 0; left: 0; height: 100%; width: 100%; overflow: hidden; z-index: -1; } .resize-triggers > div { background: #eee; overflow: auto; } .contract-trigger:before { width: 200%; height: 200%; }',
|
14874 |
-
head = doc.head || doc.getElementsByTagName('head')[0],
|
14875 |
-
style = doc.createElement('style');
|
14876 |
-
|
14877 |
-
style.id = 'detectElementResize';
|
14878 |
-
style.type = 'text/css';
|
14879 |
-
|
14880 |
-
if (nonce != null) {
|
14881 |
-
style.setAttribute('nonce', nonce);
|
14882 |
-
}
|
14883 |
-
|
14884 |
-
if (style.styleSheet) {
|
14885 |
-
style.styleSheet.cssText = css;
|
14886 |
-
} else {
|
14887 |
-
style.appendChild(doc.createTextNode(css));
|
14888 |
-
}
|
14889 |
-
|
14890 |
-
head.appendChild(style);
|
14891 |
-
}
|
14892 |
-
};
|
14893 |
-
|
14894 |
-
var addResizeListener = function addResizeListener(element, fn) {
|
14895 |
-
if (attachEvent) {
|
14896 |
-
element.attachEvent('onresize', fn);
|
14897 |
-
} else {
|
14898 |
-
if (!element.__resizeTriggers__) {
|
14899 |
-
var doc = element.ownerDocument;
|
14900 |
-
var elementStyle = _window.getComputedStyle(element);
|
14901 |
-
if (elementStyle && elementStyle.position == 'static') {
|
14902 |
-
element.style.position = 'relative';
|
14903 |
-
}
|
14904 |
-
createStyles(doc);
|
14905 |
-
element.__resizeLast__ = {};
|
14906 |
-
element.__resizeListeners__ = [];
|
14907 |
-
(element.__resizeTriggers__ = doc.createElement('div')).className = 'resize-triggers';
|
14908 |
-
element.__resizeTriggers__.innerHTML = '<div class="expand-trigger"><div></div></div>' + '<div class="contract-trigger"></div>';
|
14909 |
-
element.appendChild(element.__resizeTriggers__);
|
14910 |
-
resetTriggers(element);
|
14911 |
-
element.addEventListener('scroll', scrollListener, true);
|
14912 |
-
|
14913 |
-
/* Listen for a css animation to detect element display/re-attach */
|
14914 |
-
if (animationstartevent) {
|
14915 |
-
element.__resizeTriggers__.__animationListener__ = function animationListener(e) {
|
14916 |
-
if (e.animationName == animationName) {
|
14917 |
-
resetTriggers(element);
|
14918 |
-
}
|
14919 |
-
};
|
14920 |
-
element.__resizeTriggers__.addEventListener(animationstartevent, element.__resizeTriggers__.__animationListener__);
|
14921 |
-
}
|
14922 |
-
}
|
14923 |
-
element.__resizeListeners__.push(fn);
|
14924 |
-
}
|
14925 |
-
};
|
14926 |
-
|
14927 |
-
var removeResizeListener = function removeResizeListener(element, fn) {
|
14928 |
-
if (attachEvent) {
|
14929 |
-
element.detachEvent('onresize', fn);
|
14930 |
-
} else {
|
14931 |
-
element.__resizeListeners__.splice(element.__resizeListeners__.indexOf(fn), 1);
|
14932 |
-
if (!element.__resizeListeners__.length) {
|
14933 |
-
element.removeEventListener('scroll', scrollListener, true);
|
14934 |
-
if (element.__resizeTriggers__.__animationListener__) {
|
14935 |
-
element.__resizeTriggers__.removeEventListener(animationstartevent, element.__resizeTriggers__.__animationListener__);
|
14936 |
-
element.__resizeTriggers__.__animationListener__ = null;
|
14937 |
-
}
|
14938 |
-
try {
|
14939 |
-
element.__resizeTriggers__ = !element.removeChild(element.__resizeTriggers__);
|
14940 |
-
} catch (e) {
|
14941 |
-
// Preact compat; see developit/preact-compat/issues/228
|
14942 |
-
}
|
14943 |
-
}
|
14944 |
-
}
|
14945 |
-
};
|
14946 |
-
|
14947 |
-
return {
|
14948 |
-
addResizeListener: addResizeListener,
|
14949 |
-
removeResizeListener: removeResizeListener
|
14950 |
-
};
|
14951 |
-
}
|
14952 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(34)))
|
14953 |
-
|
14954 |
-
/***/ }),
|
14955 |
-
/* 253 */
|
14956 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14957 |
-
|
14958 |
-
"use strict";
|
14959 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__CellMeasurer__ = __webpack_require__(571);
|
14960 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__CellMeasurerCache__ = __webpack_require__(254);
|
14961 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__CellMeasurer__["a"]; });
|
14962 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__CellMeasurerCache__["a"]; });
|
14963 |
-
|
14964 |
-
|
14965 |
-
|
14966 |
-
/* unused harmony default export */ var _unused_webpack_default_export = (__WEBPACK_IMPORTED_MODULE_0__CellMeasurer__["a" /* default */]);
|
14967 |
-
|
14968 |
-
|
14969 |
-
/***/ }),
|
14970 |
-
/* 254 */
|
14971 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14972 |
-
|
14973 |
-
"use strict";
|
14974 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* unused harmony export DEFAULT_HEIGHT */
|
14975 |
-
/* unused harmony export DEFAULT_WIDTH */
|
14976 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
14977 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_classCallCheck__);
|
14978 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
14979 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_createClass__);
|
14980 |
-
|
14981 |
-
|
14982 |
-
var DEFAULT_HEIGHT = 30;
|
14983 |
-
var DEFAULT_WIDTH = 100;
|
14984 |
-
|
14985 |
-
// Enables more intelligent mapping of a given column and row index to an item ID.
|
14986 |
-
// This prevents a cell cache from being invalidated when its parent collection is modified.
|
14987 |
-
|
14988 |
-
/**
|
14989 |
-
* Caches measurements for a given cell.
|
14990 |
-
*/
|
14991 |
-
var CellMeasurerCache = function () {
|
14992 |
-
function CellMeasurerCache() {
|
14993 |
-
var _this = this;
|
14994 |
-
|
14995 |
-
var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
14996 |
-
|
14997 |
-
__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_classCallCheck___default()(this, CellMeasurerCache);
|
14998 |
-
|
14999 |
-
this._cellHeightCache = {};
|
15000 |
-
this._cellWidthCache = {};
|
15001 |
-
this._columnWidthCache = {};
|
15002 |
-
this._rowHeightCache = {};
|
15003 |
-
this._columnCount = 0;
|
15004 |
-
this._rowCount = 0;
|
15005 |
-
|
15006 |
-
this.columnWidth = function (_ref) {
|
15007 |
-
var index = _ref.index;
|
15008 |
-
|
15009 |
-
var key = _this._keyMapper(0, index);
|
15010 |
-
|
15011 |
-
return _this._columnWidthCache.hasOwnProperty(key) ? _this._columnWidthCache[key] : _this._defaultWidth;
|
15012 |
-
};
|
15013 |
-
|
15014 |
-
this.rowHeight = function (_ref2) {
|
15015 |
-
var index = _ref2.index;
|
15016 |
-
|
15017 |
-
var key = _this._keyMapper(index, 0);
|
15018 |
-
|
15019 |
-
return _this._rowHeightCache.hasOwnProperty(key) ? _this._rowHeightCache[key] : _this._defaultHeight;
|
15020 |
-
};
|
15021 |
-
|
15022 |
-
var defaultHeight = params.defaultHeight,
|
15023 |
-
defaultWidth = params.defaultWidth,
|
15024 |
-
fixedHeight = params.fixedHeight,
|
15025 |
-
fixedWidth = params.fixedWidth,
|
15026 |
-
keyMapper = params.keyMapper,
|
15027 |
-
minHeight = params.minHeight,
|
15028 |
-
minWidth = params.minWidth;
|
15029 |
-
|
15030 |
-
|
15031 |
-
this._hasFixedHeight = fixedHeight === true;
|
15032 |
-
this._hasFixedWidth = fixedWidth === true;
|
15033 |
-
this._minHeight = minHeight || 0;
|
15034 |
-
this._minWidth = minWidth || 0;
|
15035 |
-
this._keyMapper = keyMapper || defaultKeyMapper;
|
15036 |
-
|
15037 |
-
this._defaultHeight = Math.max(this._minHeight, typeof defaultHeight === 'number' ? defaultHeight : DEFAULT_HEIGHT);
|
15038 |
-
this._defaultWidth = Math.max(this._minWidth, typeof defaultWidth === 'number' ? defaultWidth : DEFAULT_WIDTH);
|
15039 |
-
|
15040 |
-
if (process.env.NODE_ENV !== 'production') {
|
15041 |
-
if (this._hasFixedHeight === false && this._hasFixedWidth === false) {
|
15042 |
-
console.warn("CellMeasurerCache should only measure a cell's width or height. " + 'You have configured CellMeasurerCache to measure both. ' + 'This will result in poor performance.');
|
15043 |
-
}
|
15044 |
-
|
15045 |
-
if (this._hasFixedHeight === false && this._defaultHeight === 0) {
|
15046 |
-
console.warn('Fixed height CellMeasurerCache should specify a :defaultHeight greater than 0. ' + 'Failing to do so will lead to unnecessary layout and poor performance.');
|
15047 |
-
}
|
15048 |
-
|
15049 |
-
if (this._hasFixedWidth === false && this._defaultWidth === 0) {
|
15050 |
-
console.warn('Fixed width CellMeasurerCache should specify a :defaultWidth greater than 0. ' + 'Failing to do so will lead to unnecessary layout and poor performance.');
|
15051 |
-
}
|
15052 |
-
}
|
15053 |
-
}
|
15054 |
-
|
15055 |
-
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_createClass___default()(CellMeasurerCache, [{
|
15056 |
-
key: 'clear',
|
15057 |
-
value: function clear(rowIndex) {
|
15058 |
-
var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;
|
15059 |
-
|
15060 |
-
var key = this._keyMapper(rowIndex, columnIndex);
|
15061 |
-
|
15062 |
-
delete this._cellHeightCache[key];
|
15063 |
-
delete this._cellWidthCache[key];
|
15064 |
-
|
15065 |
-
this._updateCachedColumnAndRowSizes(rowIndex, columnIndex);
|
15066 |
-
}
|
15067 |
-
}, {
|
15068 |
-
key: 'clearAll',
|
15069 |
-
value: function clearAll() {
|
15070 |
-
this._cellHeightCache = {};
|
15071 |
-
this._cellWidthCache = {};
|
15072 |
-
this._columnWidthCache = {};
|
15073 |
-
this._rowHeightCache = {};
|
15074 |
-
this._rowCount = 0;
|
15075 |
-
this._columnCount = 0;
|
15076 |
-
}
|
15077 |
-
}, {
|
15078 |
-
key: 'hasFixedHeight',
|
15079 |
-
value: function hasFixedHeight() {
|
15080 |
-
return this._hasFixedHeight;
|
15081 |
-
}
|
15082 |
-
}, {
|
15083 |
-
key: 'hasFixedWidth',
|
15084 |
-
value: function hasFixedWidth() {
|
15085 |
-
return this._hasFixedWidth;
|
15086 |
-
}
|
15087 |
-
}, {
|
15088 |
-
key: 'getHeight',
|
15089 |
-
value: function getHeight(rowIndex) {
|
15090 |
-
var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;
|
15091 |
-
|
15092 |
-
if (this._hasFixedHeight) {
|
15093 |
-
return this._defaultHeight;
|
15094 |
-
} else {
|
15095 |
-
var _key = this._keyMapper(rowIndex, columnIndex);
|
15096 |
-
|
15097 |
-
return this._cellHeightCache.hasOwnProperty(_key) ? Math.max(this._minHeight, this._cellHeightCache[_key]) : this._defaultHeight;
|
15098 |
-
}
|
15099 |
-
}
|
15100 |
-
}, {
|
15101 |
-
key: 'getWidth',
|
15102 |
-
value: function getWidth(rowIndex) {
|
15103 |
-
var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;
|
15104 |
-
|
15105 |
-
if (this._hasFixedWidth) {
|
15106 |
-
return this._defaultWidth;
|
15107 |
-
} else {
|
15108 |
-
var _key2 = this._keyMapper(rowIndex, columnIndex);
|
15109 |
-
|
15110 |
-
return this._cellWidthCache.hasOwnProperty(_key2) ? Math.max(this._minWidth, this._cellWidthCache[_key2]) : this._defaultWidth;
|
15111 |
-
}
|
15112 |
-
}
|
15113 |
-
}, {
|
15114 |
-
key: 'has',
|
15115 |
-
value: function has(rowIndex) {
|
15116 |
-
var columnIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;
|
15117 |
-
|
15118 |
-
var key = this._keyMapper(rowIndex, columnIndex);
|
15119 |
-
|
15120 |
-
return this._cellHeightCache.hasOwnProperty(key);
|
15121 |
-
}
|
15122 |
-
}, {
|
15123 |
-
key: 'set',
|
15124 |
-
value: function set(rowIndex, columnIndex, width, height) {
|
15125 |
-
var key = this._keyMapper(rowIndex, columnIndex);
|
15126 |
-
|
15127 |
-
if (columnIndex >= this._columnCount) {
|
15128 |
-
this._columnCount = columnIndex + 1;
|
15129 |
-
}
|
15130 |
-
if (rowIndex >= this._rowCount) {
|
15131 |
-
this._rowCount = rowIndex + 1;
|
15132 |
-
}
|
15133 |
-
|
15134 |
-
// Size is cached per cell so we don't have to re-measure if cells are re-ordered.
|
15135 |
-
this._cellHeightCache[key] = height;
|
15136 |
-
this._cellWidthCache[key] = width;
|
15137 |
-
|
15138 |
-
this._updateCachedColumnAndRowSizes(rowIndex, columnIndex);
|
15139 |
-
}
|
15140 |
-
}, {
|
15141 |
-
key: '_updateCachedColumnAndRowSizes',
|
15142 |
-
value: function _updateCachedColumnAndRowSizes(rowIndex, columnIndex) {
|
15143 |
-
// :columnWidth and :rowHeight are derived based on all cells in a column/row.
|
15144 |
-
// Pre-cache these derived values for faster lookup later.
|
15145 |
-
// Reads are expected to occur more frequently than writes in this case.
|
15146 |
-
// Only update non-fixed dimensions though to avoid doing unnecessary work.
|
15147 |
-
if (!this._hasFixedWidth) {
|
15148 |
-
var columnWidth = 0;
|
15149 |
-
for (var i = 0; i < this._rowCount; i++) {
|
15150 |
-
columnWidth = Math.max(columnWidth, this.getWidth(i, columnIndex));
|
15151 |
-
}
|
15152 |
-
var columnKey = this._keyMapper(0, columnIndex);
|
15153 |
-
this._columnWidthCache[columnKey] = columnWidth;
|
15154 |
-
}
|
15155 |
-
if (!this._hasFixedHeight) {
|
15156 |
-
var rowHeight = 0;
|
15157 |
-
for (var _i = 0; _i < this._columnCount; _i++) {
|
15158 |
-
rowHeight = Math.max(rowHeight, this.getHeight(rowIndex, _i));
|
15159 |
-
}
|
15160 |
-
var rowKey = this._keyMapper(rowIndex, 0);
|
15161 |
-
this._rowHeightCache[rowKey] = rowHeight;
|
15162 |
-
}
|
15163 |
-
}
|
15164 |
-
}, {
|
15165 |
-
key: 'defaultHeight',
|
15166 |
-
get: function get() {
|
15167 |
-
return this._defaultHeight;
|
15168 |
-
}
|
15169 |
-
}, {
|
15170 |
-
key: 'defaultWidth',
|
15171 |
-
get: function get() {
|
15172 |
-
return this._defaultWidth;
|
15173 |
-
}
|
15174 |
-
}]);
|
15175 |
-
|
15176 |
-
return CellMeasurerCache;
|
15177 |
-
}();
|
15178 |
-
|
15179 |
-
/* harmony default export */ __webpack_exports__["a"] = (CellMeasurerCache);
|
15180 |
-
|
15181 |
-
|
15182 |
-
function defaultKeyMapper(rowIndex, columnIndex) {
|
15183 |
-
return rowIndex + '-' + columnIndex;
|
15184 |
-
}
|
15185 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(7)))
|
15186 |
-
|
15187 |
-
/***/ }),
|
15188 |
-
/* 255 */
|
15189 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15190 |
-
|
15191 |
-
"use strict";
|
15192 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
15193 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
15194 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_own_property_descriptor__ = __webpack_require__(584);
|
15195 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_own_property_descriptor___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_own_property_descriptor__);
|
15196 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
15197 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_core_js_object_get_prototype_of__);
|
15198 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
15199 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_classCallCheck__);
|
15200 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
15201 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_createClass__);
|
15202 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
15203 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_possibleConstructorReturn__);
|
15204 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
15205 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_babel_runtime_helpers_inherits__);
|
15206 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__Grid__ = __webpack_require__(23);
|
15207 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_react__ = __webpack_require__(2);
|
15208 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_react__);
|
15209 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames__ = __webpack_require__(47);
|
15210 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_classnames__);
|
15211 |
-
|
15212 |
-
|
15213 |
-
|
15214 |
-
|
15215 |
-
|
15216 |
-
|
15217 |
-
|
15218 |
-
|
15219 |
-
var babelPluginFlowReactPropTypes_proptype_Scroll = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_Scroll || __webpack_require__(0).any;
|
15220 |
-
|
15221 |
-
var babelPluginFlowReactPropTypes_proptype_CellRendererParams = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_CellRendererParams || __webpack_require__(0).any;
|
15222 |
-
|
15223 |
-
var babelPluginFlowReactPropTypes_proptype_RenderedSection = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_RenderedSection || __webpack_require__(0).any;
|
15224 |
-
|
15225 |
-
var babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter || __webpack_require__(0).any;
|
15226 |
-
|
15227 |
-
var babelPluginFlowReactPropTypes_proptype_CellPosition = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_CellPosition || __webpack_require__(0).any;
|
15228 |
-
|
15229 |
-
var babelPluginFlowReactPropTypes_proptype_CellSize = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_CellSize || __webpack_require__(0).any;
|
15230 |
-
|
15231 |
-
var babelPluginFlowReactPropTypes_proptype_Alignment = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_Alignment || __webpack_require__(0).any;
|
15232 |
-
|
15233 |
-
var babelPluginFlowReactPropTypes_proptype_NoContentRenderer = __webpack_require__(23).babelPluginFlowReactPropTypes_proptype_NoContentRenderer || __webpack_require__(0).any;
|
15234 |
-
|
15235 |
-
var babelPluginFlowReactPropTypes_proptype_Scroll = __webpack_require__(178).babelPluginFlowReactPropTypes_proptype_Scroll || __webpack_require__(0).any;
|
15236 |
-
|
15237 |
-
var babelPluginFlowReactPropTypes_proptype_RenderedRows = __webpack_require__(178).babelPluginFlowReactPropTypes_proptype_RenderedRows || __webpack_require__(0).any;
|
15238 |
-
|
15239 |
-
var babelPluginFlowReactPropTypes_proptype_RowRenderer = __webpack_require__(178).babelPluginFlowReactPropTypes_proptype_RowRenderer || __webpack_require__(0).any;
|
15240 |
-
|
15241 |
-
|
15242 |
-
|
15243 |
-
|
15244 |
-
|
15245 |
-
/**
|
15246 |
-
* It is inefficient to create and manage a large list of DOM elements within a scrolling container
|
15247 |
-
* if only a few of those elements are visible. The primary purpose of this component is to improve
|
15248 |
-
* performance by only rendering the DOM nodes that a user is able to see based on their current
|
15249 |
-
* scroll position.
|
15250 |
-
*
|
15251 |
-
* This component renders a virtualized list of elements with either fixed or dynamic heights.
|
15252 |
-
*/
|
15253 |
-
|
15254 |
-
var List = function (_React$PureComponent) {
|
15255 |
-
__WEBPACK_IMPORTED_MODULE_6_babel_runtime_helpers_inherits___default()(List, _React$PureComponent);
|
15256 |
-
|
15257 |
-
function List() {
|
15258 |
-
var _ref;
|
15259 |
-
|
15260 |
-
var _temp, _this, _ret;
|
15261 |
-
|
15262 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_classCallCheck___default()(this, List);
|
15263 |
-
|
15264 |
-
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
15265 |
-
args[_key] = arguments[_key];
|
15266 |
-
}
|
15267 |
-
|
15268 |
-
return _ret = (_temp = (_this = __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_possibleConstructorReturn___default()(this, (_ref = List.__proto__ || __WEBPACK_IMPORTED_MODULE_2_babel_runtime_core_js_object_get_prototype_of___default()(List)).call.apply(_ref, [this].concat(args))), _this), _this._cellRenderer = function (_ref2) {
|
15269 |
-
var parent = _ref2.parent,
|
15270 |
-
rowIndex = _ref2.rowIndex,
|
15271 |
-
style = _ref2.style,
|
15272 |
-
isScrolling = _ref2.isScrolling,
|
15273 |
-
isVisible = _ref2.isVisible,
|
15274 |
-
key = _ref2.key;
|
15275 |
-
var rowRenderer = _this.props.rowRenderer;
|
15276 |
-
|
15277 |
-
// TRICKY The style object is sometimes cached by Grid.
|
15278 |
-
// This prevents new style objects from bypassing shallowCompare().
|
15279 |
-
// However as of React 16, style props are auto-frozen (at least in dev mode)
|
15280 |
-
// Check to make sure we can still modify the style before proceeding.
|
15281 |
-
// https://github.com/facebook/react/commit/977357765b44af8ff0cfea327866861073095c12#commitcomment-20648713
|
15282 |
-
|
15283 |
-
var _Object$getOwnPropert = __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_own_property_descriptor___default()(style, 'width'),
|
15284 |
-
writable = _Object$getOwnPropert.writable;
|
15285 |
-
|
15286 |
-
if (writable) {
|
15287 |
-
// By default, List cells should be 100% width.
|
15288 |
-
// This prevents them from flowing under a scrollbar (if present).
|
15289 |
-
style.width = '100%';
|
15290 |
-
}
|
15291 |
-
|
15292 |
-
return rowRenderer({
|
15293 |
-
index: rowIndex,
|
15294 |
-
style: style,
|
15295 |
-
isScrolling: isScrolling,
|
15296 |
-
isVisible: isVisible,
|
15297 |
-
key: key,
|
15298 |
-
parent: parent
|
15299 |
-
});
|
15300 |
-
}, _this._setRef = function (ref) {
|
15301 |
-
_this.Grid = ref;
|
15302 |
-
}, _this._onScroll = function (_ref3) {
|
15303 |
-
var clientHeight = _ref3.clientHeight,
|
15304 |
-
scrollHeight = _ref3.scrollHeight,
|
15305 |
-
scrollTop = _ref3.scrollTop;
|
15306 |
-
var onScroll = _this.props.onScroll;
|
15307 |
-
|
15308 |
-
|
15309 |
-
onScroll({ clientHeight: clientHeight, scrollHeight: scrollHeight, scrollTop: scrollTop });
|
15310 |
-
}, _this._onSectionRendered = function (_ref4) {
|
15311 |
-
var rowOverscanStartIndex = _ref4.rowOverscanStartIndex,
|
15312 |
-
rowOverscanStopIndex = _ref4.rowOverscanStopIndex,
|
15313 |
-
rowStartIndex = _ref4.rowStartIndex,
|
15314 |
-
rowStopIndex = _ref4.rowStopIndex;
|
15315 |
-
var onRowsRendered = _this.props.onRowsRendered;
|
15316 |
-
|
15317 |
-
|
15318 |
-
onRowsRendered({
|
15319 |
-
overscanStartIndex: rowOverscanStartIndex,
|
15320 |
-
overscanStopIndex: rowOverscanStopIndex,
|
15321 |
-
startIndex: rowStartIndex,
|
15322 |
-
stopIndex: rowStopIndex
|
15323 |
-
});
|
15324 |
-
}, _temp), __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_possibleConstructorReturn___default()(_this, _ret);
|
15325 |
-
}
|
15326 |
-
|
15327 |
-
__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_createClass___default()(List, [{
|
15328 |
-
key: 'forceUpdateGrid',
|
15329 |
-
value: function forceUpdateGrid() {
|
15330 |
-
if (this.Grid) {
|
15331 |
-
this.Grid.forceUpdate();
|
15332 |
-
}
|
15333 |
-
}
|
15334 |
-
|
15335 |
-
/** See Grid#getOffsetForCell */
|
15336 |
-
|
15337 |
-
}, {
|
15338 |
-
key: 'getOffsetForRow',
|
15339 |
-
value: function getOffsetForRow(_ref5) {
|
15340 |
-
var alignment = _ref5.alignment,
|
15341 |
-
index = _ref5.index;
|
15342 |
-
|
15343 |
-
if (this.Grid) {
|
15344 |
-
var _Grid$getOffsetForCel = this.Grid.getOffsetForCell({
|
15345 |
-
alignment: alignment,
|
15346 |
-
rowIndex: index,
|
15347 |
-
columnIndex: 0
|
15348 |
-
}),
|
15349 |
-
_scrollTop = _Grid$getOffsetForCel.scrollTop;
|
15350 |
-
|
15351 |
-
return _scrollTop;
|
15352 |
-
}
|
15353 |
-
return 0;
|
15354 |
-
}
|
15355 |
-
|
15356 |
-
/** CellMeasurer compatibility */
|
15357 |
-
|
15358 |
-
}, {
|
15359 |
-
key: 'invalidateCellSizeAfterRender',
|
15360 |
-
value: function invalidateCellSizeAfterRender(_ref6) {
|
15361 |
-
var columnIndex = _ref6.columnIndex,
|
15362 |
-
rowIndex = _ref6.rowIndex;
|
15363 |
-
|
15364 |
-
if (this.Grid) {
|
15365 |
-
this.Grid.invalidateCellSizeAfterRender({
|
15366 |
-
rowIndex: rowIndex,
|
15367 |
-
columnIndex: columnIndex
|
15368 |
-
});
|
15369 |
-
}
|
15370 |
-
}
|
15371 |
-
|
15372 |
-
/** See Grid#measureAllCells */
|
15373 |
-
|
15374 |
-
}, {
|
15375 |
-
key: 'measureAllRows',
|
15376 |
-
value: function measureAllRows() {
|
15377 |
-
if (this.Grid) {
|
15378 |
-
this.Grid.measureAllCells();
|
15379 |
-
}
|
15380 |
-
}
|
15381 |
-
|
15382 |
-
/** CellMeasurer compatibility */
|
15383 |
-
|
15384 |
-
}, {
|
15385 |
-
key: 'recomputeGridSize',
|
15386 |
-
value: function recomputeGridSize() {
|
15387 |
-
var _ref7 = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},
|
15388 |
-
_ref7$columnIndex = _ref7.columnIndex,
|
15389 |
-
columnIndex = _ref7$columnIndex === undefined ? 0 : _ref7$columnIndex,
|
15390 |
-
_ref7$rowIndex = _ref7.rowIndex,
|
15391 |
-
rowIndex = _ref7$rowIndex === undefined ? 0 : _ref7$rowIndex;
|
15392 |
-
|
15393 |
-
if (this.Grid) {
|
15394 |
-
this.Grid.recomputeGridSize({
|
15395 |
-
rowIndex: rowIndex,
|
15396 |
-
columnIndex: columnIndex
|
15397 |
-
});
|
15398 |
-
}
|
15399 |
-
}
|
15400 |
-
|
15401 |
-
/** See Grid#recomputeGridSize */
|
15402 |
-
|
15403 |
-
}, {
|
15404 |
-
key: 'recomputeRowHeights',
|
15405 |
-
value: function recomputeRowHeights() {
|
15406 |
-
var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;
|
15407 |
-
|
15408 |
-
if (this.Grid) {
|
15409 |
-
this.Grid.recomputeGridSize({
|
15410 |
-
rowIndex: index,
|
15411 |
-
columnIndex: 0
|
15412 |
-
});
|
15413 |
-
}
|
15414 |
-
}
|
15415 |
-
|
15416 |
-
/** See Grid#scrollToPosition */
|
15417 |
-
|
15418 |
-
}, {
|
15419 |
-
key: 'scrollToPosition',
|
15420 |
-
value: function scrollToPosition() {
|
15421 |
-
var scrollTop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;
|
15422 |
-
|
15423 |
-
if (this.Grid) {
|
15424 |
-
this.Grid.scrollToPosition({ scrollTop: scrollTop });
|
15425 |
-
}
|
15426 |
-
}
|
15427 |
-
|
15428 |
-
/** See Grid#scrollToCell */
|
15429 |
-
|
15430 |
-
}, {
|
15431 |
-
key: 'scrollToRow',
|
15432 |
-
value: function scrollToRow() {
|
15433 |
-
var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0;
|
15434 |
-
|
15435 |
-
if (this.Grid) {
|
15436 |
-
this.Grid.scrollToCell({
|
15437 |
-
columnIndex: 0,
|
15438 |
-
rowIndex: index
|
15439 |
-
});
|
15440 |
-
}
|
15441 |
-
}
|
15442 |
-
}, {
|
15443 |
-
key: 'render',
|
15444 |
-
value: function render() {
|
15445 |
-
var _props = this.props,
|
15446 |
-
className = _props.className,
|
15447 |
-
noRowsRenderer = _props.noRowsRenderer,
|
15448 |
-
scrollToIndex = _props.scrollToIndex,
|
15449 |
-
width = _props.width;
|
15450 |
-
|
15451 |
-
|
15452 |
-
var classNames = __WEBPACK_IMPORTED_MODULE_9_classnames___default()('ReactVirtualized__List', className);
|
15453 |
-
|
15454 |
-
return __WEBPACK_IMPORTED_MODULE_8_react__["createElement"](__WEBPACK_IMPORTED_MODULE_7__Grid__["default"], __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, this.props, {
|
15455 |
-
autoContainerWidth: true,
|
15456 |
-
cellRenderer: this._cellRenderer,
|
15457 |
-
className: classNames,
|
15458 |
-
columnWidth: width,
|
15459 |
-
columnCount: 1,
|
15460 |
-
noContentRenderer: noRowsRenderer,
|
15461 |
-
onScroll: this._onScroll,
|
15462 |
-
onSectionRendered: this._onSectionRendered,
|
15463 |
-
ref: this._setRef,
|
15464 |
-
scrollToRow: scrollToIndex
|
15465 |
-
}));
|
15466 |
-
}
|
15467 |
-
}]);
|
15468 |
-
|
15469 |
-
return List;
|
15470 |
-
}(__WEBPACK_IMPORTED_MODULE_8_react__["PureComponent"]);
|
15471 |
-
|
15472 |
-
List.defaultProps = {
|
15473 |
-
autoHeight: false,
|
15474 |
-
estimatedRowSize: 30,
|
15475 |
-
onScroll: function onScroll() {},
|
15476 |
-
noRowsRenderer: function noRowsRenderer() {
|
15477 |
-
return null;
|
15478 |
-
},
|
15479 |
-
onRowsRendered: function onRowsRendered() {},
|
15480 |
-
overscanIndicesGetter: __WEBPACK_IMPORTED_MODULE_7__Grid__["accessibilityOverscanIndicesGetter"],
|
15481 |
-
overscanRowCount: 10,
|
15482 |
-
scrollToAlignment: 'auto',
|
15483 |
-
scrollToIndex: -1,
|
15484 |
-
style: {}
|
15485 |
-
};
|
15486 |
-
List.propTypes = {
|
15487 |
-
"aria-label": __webpack_require__(0).string,
|
15488 |
-
|
15489 |
-
|
15490 |
-
/**
|
15491 |
-
* Removes fixed height from the scrollingContainer so that the total height
|
15492 |
-
* of rows can stretch the window. Intended for use with WindowScroller
|
15493 |
-
*/
|
15494 |
-
autoHeight: __webpack_require__(0).bool.isRequired,
|
15495 |
-
|
15496 |
-
|
15497 |
-
/** Optional CSS class name */
|
15498 |
-
className: __webpack_require__(0).string,
|
15499 |
-
|
15500 |
-
|
15501 |
-
/**
|
15502 |
-
* Used to estimate the total height of a List before all of its rows have actually been measured.
|
15503 |
-
* The estimated total height is adjusted as rows are rendered.
|
15504 |
-
*/
|
15505 |
-
estimatedRowSize: __webpack_require__(0).number.isRequired,
|
15506 |
-
|
15507 |
-
|
15508 |
-
/** Height constraint for list (determines how many actual rows are rendered) */
|
15509 |
-
height: __webpack_require__(0).number.isRequired,
|
15510 |
-
|
15511 |
-
|
15512 |
-
/** Optional renderer to be used in place of rows when rowCount is 0 */
|
15513 |
-
noRowsRenderer: typeof babelPluginFlowReactPropTypes_proptype_NoContentRenderer === 'function' ? babelPluginFlowReactPropTypes_proptype_NoContentRenderer.isRequired ? babelPluginFlowReactPropTypes_proptype_NoContentRenderer.isRequired : babelPluginFlowReactPropTypes_proptype_NoContentRenderer : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_NoContentRenderer).isRequired,
|
15514 |
-
|
15515 |
-
|
15516 |
-
/** Callback invoked with information about the slice of rows that were just rendered. */
|
15517 |
-
|
15518 |
-
onRowsRendered: __webpack_require__(0).func.isRequired,
|
15519 |
-
|
15520 |
-
|
15521 |
-
/**
|
15522 |
-
* Callback invoked whenever the scroll offset changes within the inner scrollable region.
|
15523 |
-
* This callback can be used to sync scrolling between lists, tables, or grids.
|
15524 |
-
*/
|
15525 |
-
onScroll: __webpack_require__(0).func.isRequired,
|
15526 |
-
|
15527 |
-
|
15528 |
-
/** See Grid#overscanIndicesGetter */
|
15529 |
-
overscanIndicesGetter: typeof babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter === 'function' ? babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter.isRequired ? babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter.isRequired : babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter).isRequired,
|
15530 |
-
|
15531 |
-
|
15532 |
-
/**
|
15533 |
-
* Number of rows to render above/below the visible bounds of the list.
|
15534 |
-
* These rows can help for smoother scrolling on touch devices.
|
15535 |
-
*/
|
15536 |
-
overscanRowCount: __webpack_require__(0).number.isRequired,
|
15537 |
-
|
15538 |
-
|
15539 |
-
/** Either a fixed row height (number) or a function that returns the height of a row given its index. */
|
15540 |
-
rowHeight: typeof babelPluginFlowReactPropTypes_proptype_CellSize === 'function' ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired ? babelPluginFlowReactPropTypes_proptype_CellSize.isRequired : babelPluginFlowReactPropTypes_proptype_CellSize : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_CellSize).isRequired,
|
15541 |
-
|
15542 |
-
|
15543 |
-
/** Responsible for rendering a row given an index; ({ index: number }): node */
|
15544 |
-
rowRenderer: typeof babelPluginFlowReactPropTypes_proptype_RowRenderer === 'function' ? babelPluginFlowReactPropTypes_proptype_RowRenderer.isRequired ? babelPluginFlowReactPropTypes_proptype_RowRenderer.isRequired : babelPluginFlowReactPropTypes_proptype_RowRenderer : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_RowRenderer).isRequired,
|
15545 |
-
|
15546 |
-
|
15547 |
-
/** Number of rows in list. */
|
15548 |
-
rowCount: __webpack_require__(0).number.isRequired,
|
15549 |
-
|
15550 |
-
|
15551 |
-
/** See Grid#scrollToAlignment */
|
15552 |
-
scrollToAlignment: typeof babelPluginFlowReactPropTypes_proptype_Alignment === 'function' ? babelPluginFlowReactPropTypes_proptype_Alignment.isRequired ? babelPluginFlowReactPropTypes_proptype_Alignment.isRequired : babelPluginFlowReactPropTypes_proptype_Alignment : __webpack_require__(0).shape(babelPluginFlowReactPropTypes_proptype_Alignment).isRequired,
|
15553 |
-
|
15554 |
-
|
15555 |
-
/** Row index to ensure visible (by forcefully scrolling if necessary) */
|
15556 |
-
scrollToIndex: __webpack_require__(0).number.isRequired,
|
15557 |
-
|
15558 |
-
|
15559 |
-
/** Vertical offset. */
|
15560 |
-
scrollTop: __webpack_require__(0).number,
|
15561 |
-
|
15562 |
-
|
15563 |
-
/** Optional inline style */
|
15564 |
-
style: __webpack_require__(0).object.isRequired,
|
15565 |
-
|
15566 |
-
|
15567 |
-
/** Tab index for focus */
|
15568 |
-
tabIndex: __webpack_require__(0).number,
|
15569 |
-
|
15570 |
-
|
15571 |
-
/** Width of list */
|
15572 |
-
width: __webpack_require__(0).number.isRequired
|
15573 |
-
};
|
15574 |
-
/* harmony default export */ __webpack_exports__["a"] = (List);
|
15575 |
-
|
15576 |
-
/***/ }),
|
15577 |
-
/* 256 */
|
15578 |
-
/***/ (function(module, exports, __webpack_require__) {
|
15579 |
-
|
15580 |
-
// getting tag from 19.1.3.6 Object.prototype.toString()
|
15581 |
-
var cof = __webpack_require__(168);
|
15582 |
-
var TAG = __webpack_require__(46)('toStringTag');
|
15583 |
-
// ES3 wrong here
|
15584 |
-
var ARG = cof(function () { return arguments; }()) == 'Arguments';
|
15585 |
-
|
15586 |
-
// fallback for IE11 Script Access Denied error
|
15587 |
-
var tryGet = function (it, key) {
|
15588 |
-
try {
|
15589 |
-
return it[key];
|
15590 |
-
} catch (e) { /* empty */ }
|
15591 |
-
};
|
15592 |
-
|
15593 |
-
module.exports = function (it) {
|
15594 |
-
var O, T, B;
|
15595 |
-
return it === undefined ? 'Undefined' : it === null ? 'Null'
|
15596 |
-
// @@toStringTag case
|
15597 |
-
: typeof (T = tryGet(O = Object(it), TAG)) == 'string' ? T
|
15598 |
-
// builtinTag case
|
15599 |
-
: ARG ? cof(O)
|
15600 |
-
// ES3 arguments fallback
|
15601 |
-
: (B = cof(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : B;
|
15602 |
-
};
|
15603 |
-
|
15604 |
-
|
15605 |
-
/***/ }),
|
15606 |
-
/* 257 */
|
15607 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15608 |
-
|
15609 |
-
"use strict";
|
15610 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = defaultCellDataGetter;
|
15611 |
-
|
15612 |
-
|
15613 |
-
/**
|
15614 |
-
* Default accessor for returning a cell value for a given attribute.
|
15615 |
-
* This function expects to operate on either a vanilla Object or an Immutable Map.
|
15616 |
-
* You should override the column's cellDataGetter if your data is some other type of object.
|
15617 |
-
*/
|
15618 |
-
var babelPluginFlowReactPropTypes_proptype_CellDataGetterParams = __webpack_require__(92).babelPluginFlowReactPropTypes_proptype_CellDataGetterParams || __webpack_require__(0).any;
|
15619 |
-
|
15620 |
-
function defaultCellDataGetter(_ref) {
|
15621 |
-
var dataKey = _ref.dataKey,
|
15622 |
-
rowData = _ref.rowData;
|
15623 |
-
|
15624 |
-
if (typeof rowData.get === 'function') {
|
15625 |
-
return rowData.get(dataKey);
|
15626 |
-
} else {
|
15627 |
-
return rowData[dataKey];
|
15628 |
-
}
|
15629 |
-
}
|
15630 |
-
|
15631 |
-
/***/ }),
|
15632 |
-
/* 258 */
|
15633 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15634 |
-
|
15635 |
-
"use strict";
|
15636 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = defaultCellRenderer;
|
15637 |
-
|
15638 |
-
|
15639 |
-
/**
|
15640 |
-
* Default cell renderer that displays an attribute as a simple string
|
15641 |
-
* You should override the column's cellRenderer if your data is some other type of object.
|
15642 |
-
*/
|
15643 |
-
var babelPluginFlowReactPropTypes_proptype_CellRendererParams = __webpack_require__(92).babelPluginFlowReactPropTypes_proptype_CellRendererParams || __webpack_require__(0).any;
|
15644 |
-
|
15645 |
-
function defaultCellRenderer(_ref) {
|
15646 |
-
var cellData = _ref.cellData;
|
15647 |
-
|
15648 |
-
if (cellData == null) {
|
15649 |
-
return '';
|
15650 |
-
} else {
|
15651 |
-
return String(cellData);
|
15652 |
-
}
|
15653 |
-
}
|
15654 |
-
|
15655 |
-
/***/ }),
|
15656 |
-
/* 259 */
|
15657 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15658 |
-
|
15659 |
-
"use strict";
|
15660 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = defaultHeaderRowRenderer;
|
15661 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(2);
|
15662 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
15663 |
-
|
15664 |
-
|
15665 |
-
var babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams = __webpack_require__(92).babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams || __webpack_require__(0).any;
|
15666 |
-
|
15667 |
-
function defaultHeaderRowRenderer(_ref) {
|
15668 |
-
var className = _ref.className,
|
15669 |
-
columns = _ref.columns,
|
15670 |
-
style = _ref.style;
|
15671 |
-
|
15672 |
-
return __WEBPACK_IMPORTED_MODULE_0_react___default.a.createElement(
|
15673 |
-
'div',
|
15674 |
-
{ className: className, role: 'row', style: style },
|
15675 |
-
columns
|
15676 |
-
);
|
15677 |
-
}
|
15678 |
-
defaultHeaderRowRenderer.propTypes = babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams === __webpack_require__(0).any ? {} : babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams;
|
15679 |
-
|
15680 |
-
/***/ }),
|
15681 |
-
/* 260 */
|
15682 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15683 |
-
|
15684 |
-
"use strict";
|
15685 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = defaultHeaderRenderer;
|
15686 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(2);
|
15687 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
15688 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__SortIndicator__ = __webpack_require__(261);
|
15689 |
-
|
15690 |
-
|
15691 |
-
|
15692 |
-
/**
|
15693 |
-
* Default table header renderer.
|
15694 |
-
*/
|
15695 |
-
var babelPluginFlowReactPropTypes_proptype_HeaderRendererParams = __webpack_require__(92).babelPluginFlowReactPropTypes_proptype_HeaderRendererParams || __webpack_require__(0).any;
|
15696 |
-
|
15697 |
-
function defaultHeaderRenderer(_ref) {
|
15698 |
-
var dataKey = _ref.dataKey,
|
15699 |
-
label = _ref.label,
|
15700 |
-
sortBy = _ref.sortBy,
|
15701 |
-
sortDirection = _ref.sortDirection;
|
15702 |
-
|
15703 |
-
var showSortIndicator = sortBy === dataKey;
|
15704 |
-
var children = [__WEBPACK_IMPORTED_MODULE_0_react___default.a.createElement(
|
15705 |
-
'span',
|
15706 |
-
{
|
15707 |
-
className: 'ReactVirtualized__Table__headerTruncatedText',
|
15708 |
-
key: 'label',
|
15709 |
-
title: label },
|
15710 |
-
label
|
15711 |
-
)];
|
15712 |
-
|
15713 |
-
if (showSortIndicator) {
|
15714 |
-
children.push(__WEBPACK_IMPORTED_MODULE_0_react___default.a.createElement(__WEBPACK_IMPORTED_MODULE_1__SortIndicator__["a" /* default */], { key: 'SortIndicator', sortDirection: sortDirection }));
|
15715 |
-
}
|
15716 |
-
|
15717 |
-
return children;
|
15718 |
-
}
|
15719 |
-
defaultHeaderRenderer.propTypes = babelPluginFlowReactPropTypes_proptype_HeaderRendererParams === __webpack_require__(0).any ? {} : babelPluginFlowReactPropTypes_proptype_HeaderRendererParams;
|
15720 |
-
|
15721 |
-
/***/ }),
|
15722 |
-
/* 261 */
|
15723 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15724 |
-
|
15725 |
-
"use strict";
|
15726 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony export (immutable) */ __webpack_exports__["a"] = SortIndicator;
|
15727 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_classnames__ = __webpack_require__(47);
|
15728 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_classnames__);
|
15729 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_prop_types__ = __webpack_require__(0);
|
15730 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_prop_types__);
|
15731 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(2);
|
15732 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
15733 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__SortDirection__ = __webpack_require__(117);
|
15734 |
-
|
15735 |
-
|
15736 |
-
|
15737 |
-
|
15738 |
-
|
15739 |
-
/**
|
15740 |
-
* Displayed beside a header to indicate that a Table is currently sorted by this column.
|
15741 |
-
*/
|
15742 |
-
function SortIndicator(_ref) {
|
15743 |
-
var sortDirection = _ref.sortDirection;
|
15744 |
-
|
15745 |
-
var classNames = __WEBPACK_IMPORTED_MODULE_0_classnames___default()('ReactVirtualized__Table__sortableHeaderIcon', {
|
15746 |
-
'ReactVirtualized__Table__sortableHeaderIcon--ASC': sortDirection === __WEBPACK_IMPORTED_MODULE_3__SortDirection__["a" /* default */].ASC,
|
15747 |
-
'ReactVirtualized__Table__sortableHeaderIcon--DESC': sortDirection === __WEBPACK_IMPORTED_MODULE_3__SortDirection__["a" /* default */].DESC
|
15748 |
-
});
|
15749 |
-
|
15750 |
-
return __WEBPACK_IMPORTED_MODULE_2_react___default.a.createElement(
|
15751 |
-
'svg',
|
15752 |
-
{ className: classNames, width: 18, height: 18, viewBox: '0 0 24 24' },
|
15753 |
-
sortDirection === __WEBPACK_IMPORTED_MODULE_3__SortDirection__["a" /* default */].ASC ? __WEBPACK_IMPORTED_MODULE_2_react___default.a.createElement('path', { d: 'M7 14l5-5 5 5z' }) : __WEBPACK_IMPORTED_MODULE_2_react___default.a.createElement('path', { d: 'M7 10l5 5 5-5z' }),
|
15754 |
-
__WEBPACK_IMPORTED_MODULE_2_react___default.a.createElement('path', { d: 'M0 0h24v24H0z', fill: 'none' })
|
15755 |
-
);
|
15756 |
-
}
|
15757 |
-
|
15758 |
-
SortIndicator.propTypes = process.env.NODE_ENV !== "production" ? {
|
15759 |
-
sortDirection: __WEBPACK_IMPORTED_MODULE_1_prop_types___default.a.oneOf([__WEBPACK_IMPORTED_MODULE_3__SortDirection__["a" /* default */].ASC, __WEBPACK_IMPORTED_MODULE_3__SortDirection__["a" /* default */].DESC])
|
15760 |
-
} : {};
|
15761 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(7)))
|
15762 |
-
|
15763 |
-
/***/ }),
|
15764 |
-
/* 262 */
|
15765 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15766 |
-
|
15767 |
-
"use strict";
|
15768 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = defaultRowRenderer;
|
15769 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
15770 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
15771 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react__ = __webpack_require__(2);
|
15772 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_react__);
|
15773 |
-
|
15774 |
-
|
15775 |
-
|
15776 |
-
/**
|
15777 |
-
* Default row renderer for Table.
|
15778 |
-
*/
|
15779 |
-
var babelPluginFlowReactPropTypes_proptype_RowRendererParams = __webpack_require__(92).babelPluginFlowReactPropTypes_proptype_RowRendererParams || __webpack_require__(0).any;
|
15780 |
-
|
15781 |
-
function defaultRowRenderer(_ref) {
|
15782 |
-
var className = _ref.className,
|
15783 |
-
columns = _ref.columns,
|
15784 |
-
index = _ref.index,
|
15785 |
-
key = _ref.key,
|
15786 |
-
onRowClick = _ref.onRowClick,
|
15787 |
-
onRowDoubleClick = _ref.onRowDoubleClick,
|
15788 |
-
onRowMouseOut = _ref.onRowMouseOut,
|
15789 |
-
onRowMouseOver = _ref.onRowMouseOver,
|
15790 |
-
onRowRightClick = _ref.onRowRightClick,
|
15791 |
-
rowData = _ref.rowData,
|
15792 |
-
style = _ref.style;
|
15793 |
-
|
15794 |
-
var a11yProps = {};
|
15795 |
-
|
15796 |
-
if (onRowClick || onRowDoubleClick || onRowMouseOut || onRowMouseOver || onRowRightClick) {
|
15797 |
-
a11yProps['aria-label'] = 'row';
|
15798 |
-
a11yProps.tabIndex = 0;
|
15799 |
-
|
15800 |
-
if (onRowClick) {
|
15801 |
-
a11yProps.onClick = function (event) {
|
15802 |
-
return onRowClick({ event: event, index: index, rowData: rowData });
|
15803 |
-
};
|
15804 |
-
}
|
15805 |
-
if (onRowDoubleClick) {
|
15806 |
-
a11yProps.onDoubleClick = function (event) {
|
15807 |
-
return onRowDoubleClick({ event: event, index: index, rowData: rowData });
|
15808 |
-
};
|
15809 |
-
}
|
15810 |
-
if (onRowMouseOut) {
|
15811 |
-
a11yProps.onMouseOut = function (event) {
|
15812 |
-
return onRowMouseOut({ event: event, index: index, rowData: rowData });
|
15813 |
-
};
|
15814 |
-
}
|
15815 |
-
if (onRowMouseOver) {
|
15816 |
-
a11yProps.onMouseOver = function (event) {
|
15817 |
-
return onRowMouseOver({ event: event, index: index, rowData: rowData });
|
15818 |
-
};
|
15819 |
-
}
|
15820 |
-
if (onRowRightClick) {
|
15821 |
-
a11yProps.onContextMenu = function (event) {
|
15822 |
-
return onRowRightClick({ event: event, index: index, rowData: rowData });
|
15823 |
-
};
|
15824 |
-
}
|
15825 |
-
}
|
15826 |
-
|
15827 |
-
return __WEBPACK_IMPORTED_MODULE_1_react___default.a.createElement(
|
15828 |
-
'div',
|
15829 |
-
__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, a11yProps, {
|
15830 |
-
className: className,
|
15831 |
-
key: key,
|
15832 |
-
role: 'row',
|
15833 |
-
style: style }),
|
15834 |
-
columns
|
15835 |
-
);
|
15836 |
-
}
|
15837 |
-
defaultRowRenderer.propTypes = babelPluginFlowReactPropTypes_proptype_RowRendererParams === __webpack_require__(0).any ? {} : babelPluginFlowReactPropTypes_proptype_RowRendererParams;
|
15838 |
-
|
15839 |
-
/***/ }),
|
15840 |
-
/* 263 */
|
15841 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15842 |
-
|
15843 |
-
"use strict";
|
15844 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
15845 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of__);
|
15846 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
15847 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__);
|
15848 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
15849 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn__);
|
15850 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
15851 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits__);
|
15852 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_prop_types__ = __webpack_require__(0);
|
15853 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_prop_types__);
|
15854 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react__ = __webpack_require__(2);
|
15855 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_react__);
|
15856 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__defaultHeaderRenderer__ = __webpack_require__(260);
|
15857 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__defaultCellRenderer__ = __webpack_require__(258);
|
15858 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__defaultCellDataGetter__ = __webpack_require__(257);
|
15859 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__SortDirection__ = __webpack_require__(117);
|
15860 |
-
|
15861 |
-
|
15862 |
-
|
15863 |
-
|
15864 |
-
|
15865 |
-
|
15866 |
-
|
15867 |
-
|
15868 |
-
|
15869 |
-
|
15870 |
-
|
15871 |
-
/**
|
15872 |
-
* Describes the header and cell contents of a table column.
|
15873 |
-
*/
|
15874 |
-
|
15875 |
-
var Column = function (_Component) {
|
15876 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits___default()(Column, _Component);
|
15877 |
-
|
15878 |
-
function Column() {
|
15879 |
-
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default()(this, Column);
|
15880 |
-
|
15881 |
-
return __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn___default()(this, (Column.__proto__ || __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_get_prototype_of___default()(Column)).apply(this, arguments));
|
15882 |
-
}
|
15883 |
-
|
15884 |
-
return Column;
|
15885 |
-
}(__WEBPACK_IMPORTED_MODULE_5_react__["Component"]);
|
15886 |
-
|
15887 |
-
Column.defaultProps = {
|
15888 |
-
cellDataGetter: __WEBPACK_IMPORTED_MODULE_8__defaultCellDataGetter__["a" /* default */],
|
15889 |
-
cellRenderer: __WEBPACK_IMPORTED_MODULE_7__defaultCellRenderer__["a" /* default */],
|
15890 |
-
defaultSortDirection: __WEBPACK_IMPORTED_MODULE_9__SortDirection__["a" /* default */].ASC,
|
15891 |
-
flexGrow: 0,
|
15892 |
-
flexShrink: 1,
|
15893 |
-
headerRenderer: __WEBPACK_IMPORTED_MODULE_6__defaultHeaderRenderer__["a" /* default */],
|
15894 |
-
style: {}
|
15895 |
-
};
|
15896 |
-
/* harmony default export */ __webpack_exports__["a"] = (Column);
|
15897 |
-
Column.propTypes = process.env.NODE_ENV !== "production" ? {
|
15898 |
-
/** Optional aria-label value to set on the column header */
|
15899 |
-
'aria-label': __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.string,
|
15900 |
-
|
15901 |
-
/**
|
15902 |
-
* Callback responsible for returning a cell's data, given its :dataKey
|
15903 |
-
* ({ columnData: any, dataKey: string, rowData: any }): any
|
15904 |
-
*/
|
15905 |
-
cellDataGetter: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.func,
|
15906 |
-
|
15907 |
-
/**
|
15908 |
-
* Callback responsible for rendering a cell's contents.
|
15909 |
-
* ({ cellData: any, columnData: any, dataKey: string, rowData: any, rowIndex: number }): node
|
15910 |
-
*/
|
15911 |
-
cellRenderer: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.func,
|
15912 |
-
|
15913 |
-
/** Optional CSS class to apply to cell */
|
15914 |
-
className: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.string,
|
15915 |
-
|
15916 |
-
/** Optional additional data passed to this column's :cellDataGetter */
|
15917 |
-
columnData: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.object,
|
15918 |
-
|
15919 |
-
/** Uniquely identifies the row-data attribute corresponding to this cell */
|
15920 |
-
dataKey: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.any.isRequired,
|
15921 |
-
|
15922 |
-
/** Optional direction to be used when clicked the first time */
|
15923 |
-
defaultSortDirection: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.oneOf([__WEBPACK_IMPORTED_MODULE_9__SortDirection__["a" /* default */].ASC, __WEBPACK_IMPORTED_MODULE_9__SortDirection__["a" /* default */].DESC]),
|
15924 |
-
|
15925 |
-
/** If sort is enabled for the table at large, disable it for this column */
|
15926 |
-
disableSort: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.bool,
|
15927 |
-
|
15928 |
-
/** Flex grow style; defaults to 0 */
|
15929 |
-
flexGrow: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.number,
|
15930 |
-
|
15931 |
-
/** Flex shrink style; defaults to 1 */
|
15932 |
-
flexShrink: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.number,
|
15933 |
-
|
15934 |
-
/** Optional CSS class to apply to this column's header */
|
15935 |
-
headerClassName: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.string,
|
15936 |
-
|
15937 |
-
/**
|
15938 |
-
* Optional callback responsible for rendering a column header contents.
|
15939 |
-
* ({ columnData: object, dataKey: string, disableSort: boolean, label: node, sortBy: string, sortDirection: string }): PropTypes.node
|
15940 |
-
*/
|
15941 |
-
headerRenderer: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.func.isRequired,
|
15942 |
-
|
15943 |
-
/** Optional inline style to apply to this column's header */
|
15944 |
-
headerStyle: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.object,
|
15945 |
-
|
15946 |
-
/** Optional id to set on the column header */
|
15947 |
-
id: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.string,
|
15948 |
-
|
15949 |
-
/** Header label for this column */
|
15950 |
-
label: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.node,
|
15951 |
-
|
15952 |
-
/** Maximum width of column; this property will only be used if :flexGrow is > 0. */
|
15953 |
-
maxWidth: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.number,
|
15954 |
-
|
15955 |
-
/** Minimum width of column. */
|
15956 |
-
minWidth: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.number,
|
15957 |
-
|
15958 |
-
/** Optional inline style to apply to cell */
|
15959 |
-
style: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.object,
|
15960 |
-
|
15961 |
-
/** Flex basis (width) for this column; This value can grow or shrink based on :flexGrow and :flexShrink properties. */
|
15962 |
-
width: __WEBPACK_IMPORTED_MODULE_4_prop_types___default.a.number.isRequired
|
15963 |
-
} : {};
|
15964 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(7)))
|
15965 |
-
|
15966 |
-
/***/ }),
|
15967 |
-
/* 264 */
|
15968 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15969 |
-
|
15970 |
-
"use strict";
|
15971 |
-
/* unused harmony export IS_SCROLLING_TIMEOUT */
|
15972 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
15973 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
15974 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(21);
|
15975 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__);
|
15976 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
15977 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
15978 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
15979 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
15980 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
15981 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
15982 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
15983 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
15984 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(2);
|
15985 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
15986 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_react_dom__ = __webpack_require__(19);
|
15987 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_react_dom__);
|
15988 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_onScroll__ = __webpack_require__(609);
|
15989 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_dimensions__ = __webpack_require__(610);
|
15990 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__vendor_detectElementResize__ = __webpack_require__(252);
|
15991 |
-
|
15992 |
-
|
15993 |
-
|
15994 |
-
|
15995 |
-
|
15996 |
-
|
15997 |
-
|
15998 |
-
|
15999 |
-
|
16000 |
-
|
16001 |
-
|
16002 |
-
|
16003 |
-
/**
|
16004 |
-
* Specifies the number of miliseconds during which to disable pointer events while a scroll is in progress.
|
16005 |
-
* This improves performance and makes scrolling smoother.
|
16006 |
-
*/
|
16007 |
-
var IS_SCROLLING_TIMEOUT = 150;
|
16008 |
-
|
16009 |
-
var getWindow = function getWindow() {
|
16010 |
-
return typeof window !== 'undefined' ? window : undefined;
|
16011 |
-
};
|
16012 |
-
|
16013 |
-
var WindowScroller = function (_React$PureComponent) {
|
16014 |
-
__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default()(WindowScroller, _React$PureComponent);
|
16015 |
-
|
16016 |
-
function WindowScroller() {
|
16017 |
-
var _ref;
|
16018 |
-
|
16019 |
-
var _temp, _this, _ret;
|
16020 |
-
|
16021 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default()(this, WindowScroller);
|
16022 |
-
|
16023 |
-
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
16024 |
-
args[_key] = arguments[_key];
|
16025 |
-
}
|
16026 |
-
|
16027 |
-
return _ret = (_temp = (_this = __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(this, (_ref = WindowScroller.__proto__ || __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default()(WindowScroller)).call.apply(_ref, [this].concat(args))), _this), _this._window = getWindow(), _this._isMounted = false, _this._positionFromTop = 0, _this._positionFromLeft = 0, _this.state = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, Object(__WEBPACK_IMPORTED_MODULE_9__utils_dimensions__["a" /* getDimensions */])(_this.props.scrollElement, _this.props), {
|
16028 |
-
isScrolling: false,
|
16029 |
-
scrollLeft: 0,
|
16030 |
-
scrollTop: 0
|
16031 |
-
}), _this._registerChild = function (element) {
|
16032 |
-
if (element && !(element instanceof Element)) {
|
16033 |
-
console.warn('WindowScroller registerChild expects to be passed Element or null');
|
16034 |
-
}
|
16035 |
-
_this._child = element;
|
16036 |
-
_this.updatePosition();
|
16037 |
-
}, _this._onChildScroll = function (_ref2) {
|
16038 |
-
var scrollTop = _ref2.scrollTop;
|
16039 |
-
|
16040 |
-
if (_this.state.scrollTop === scrollTop) {
|
16041 |
-
return;
|
16042 |
-
}
|
16043 |
-
|
16044 |
-
var scrollElement = _this.props.scrollElement;
|
16045 |
-
if (scrollElement) {
|
16046 |
-
if (typeof scrollElement.scrollTo === 'function') {
|
16047 |
-
scrollElement.scrollTo(0, scrollTop + _this._positionFromTop);
|
16048 |
-
} else {
|
16049 |
-
scrollElement.scrollTop = scrollTop + _this._positionFromTop;
|
16050 |
-
}
|
16051 |
-
}
|
16052 |
-
}, _this._registerResizeListener = function (element) {
|
16053 |
-
if (element === window) {
|
16054 |
-
window.addEventListener('resize', _this._onResize, false);
|
16055 |
-
} else {
|
16056 |
-
_this._detectElementResize.addResizeListener(element, _this._onResize);
|
16057 |
-
}
|
16058 |
-
}, _this._unregisterResizeListener = function (element) {
|
16059 |
-
if (element === window) {
|
16060 |
-
window.removeEventListener('resize', _this._onResize, false);
|
16061 |
-
} else if (element) {
|
16062 |
-
_this._detectElementResize.removeResizeListener(element, _this._onResize);
|
16063 |
-
}
|
16064 |
-
}, _this._onResize = function () {
|
16065 |
-
_this.updatePosition();
|
16066 |
-
}, _this.__handleWindowScrollEvent = function () {
|
16067 |
-
if (!_this._isMounted) {
|
16068 |
-
return;
|
16069 |
-
}
|
16070 |
-
|
16071 |
-
var onScroll = _this.props.onScroll;
|
16072 |
-
|
16073 |
-
|
16074 |
-
var scrollElement = _this.props.scrollElement;
|
16075 |
-
if (scrollElement) {
|
16076 |
-
var scrollOffset = Object(__WEBPACK_IMPORTED_MODULE_9__utils_dimensions__["c" /* getScrollOffset */])(scrollElement);
|
16077 |
-
var _scrollLeft = Math.max(0, scrollOffset.left - _this._positionFromLeft);
|
16078 |
-
var _scrollTop = Math.max(0, scrollOffset.top - _this._positionFromTop);
|
16079 |
-
|
16080 |
-
_this.setState({
|
16081 |
-
isScrolling: true,
|
16082 |
-
scrollLeft: _scrollLeft,
|
16083 |
-
scrollTop: _scrollTop
|
16084 |
-
});
|
16085 |
-
|
16086 |
-
onScroll({
|
16087 |
-
scrollLeft: _scrollLeft,
|
16088 |
-
scrollTop: _scrollTop
|
16089 |
-
});
|
16090 |
-
}
|
16091 |
-
}, _this.__resetIsScrolling = function () {
|
16092 |
-
_this.setState({
|
16093 |
-
isScrolling: false
|
16094 |
-
});
|
16095 |
-
}, _temp), __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(_this, _ret);
|
16096 |
-
}
|
16097 |
-
|
16098 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default()(WindowScroller, [{
|
16099 |
-
key: 'updatePosition',
|
16100 |
-
value: function updatePosition() {
|
16101 |
-
var scrollElement = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.props.scrollElement;
|
16102 |
-
var props = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.props;
|
16103 |
-
var onResize = this.props.onResize;
|
16104 |
-
var _state = this.state,
|
16105 |
-
height = _state.height,
|
16106 |
-
width = _state.width;
|
16107 |
-
|
16108 |
-
|
16109 |
-
var thisNode = this._child || __WEBPACK_IMPORTED_MODULE_7_react_dom___default.a.findDOMNode(this);
|
16110 |
-
if (thisNode instanceof Element && scrollElement) {
|
16111 |
-
var offset = Object(__WEBPACK_IMPORTED_MODULE_9__utils_dimensions__["b" /* getPositionOffset */])(thisNode, scrollElement);
|
16112 |
-
this._positionFromTop = offset.top;
|
16113 |
-
this._positionFromLeft = offset.left;
|
16114 |
-
}
|
16115 |
-
|
16116 |
-
var dimensions = Object(__WEBPACK_IMPORTED_MODULE_9__utils_dimensions__["a" /* getDimensions */])(scrollElement, props);
|
16117 |
-
if (height !== dimensions.height || width !== dimensions.width) {
|
16118 |
-
this.setState({
|
16119 |
-
height: dimensions.height,
|
16120 |
-
width: dimensions.width
|
16121 |
-
});
|
16122 |
-
onResize({
|
16123 |
-
height: dimensions.height,
|
16124 |
-
width: dimensions.width
|
16125 |
-
});
|
16126 |
-
}
|
16127 |
-
}
|
16128 |
-
}, {
|
16129 |
-
key: 'componentDidMount',
|
16130 |
-
value: function componentDidMount() {
|
16131 |
-
var scrollElement = this.props.scrollElement;
|
16132 |
-
|
16133 |
-
this._detectElementResize = Object(__WEBPACK_IMPORTED_MODULE_10__vendor_detectElementResize__["a" /* default */])();
|
16134 |
-
|
16135 |
-
this.updatePosition(scrollElement);
|
16136 |
-
|
16137 |
-
if (scrollElement) {
|
16138 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_onScroll__["a" /* registerScrollListener */])(this, scrollElement);
|
16139 |
-
this._registerResizeListener(scrollElement);
|
16140 |
-
}
|
16141 |
-
|
16142 |
-
this._isMounted = true;
|
16143 |
-
}
|
16144 |
-
}, {
|
16145 |
-
key: 'componentWillReceiveProps',
|
16146 |
-
value: function componentWillReceiveProps(nextProps) {
|
16147 |
-
var scrollElement = this.props.scrollElement;
|
16148 |
-
var nextScrollElement = nextProps.scrollElement;
|
16149 |
-
|
16150 |
-
if (scrollElement !== nextScrollElement && scrollElement && nextScrollElement) {
|
16151 |
-
this.updatePosition(nextScrollElement, nextProps);
|
16152 |
-
|
16153 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_onScroll__["b" /* unregisterScrollListener */])(this, scrollElement);
|
16154 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_onScroll__["a" /* registerScrollListener */])(this, nextScrollElement);
|
16155 |
-
|
16156 |
-
this._unregisterResizeListener(scrollElement);
|
16157 |
-
this._registerResizeListener(nextScrollElement);
|
16158 |
-
}
|
16159 |
-
}
|
16160 |
-
}, {
|
16161 |
-
key: 'componentWillUnmount',
|
16162 |
-
value: function componentWillUnmount() {
|
16163 |
-
var scrollElement = this.props.scrollElement;
|
16164 |
-
if (scrollElement) {
|
16165 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__utils_onScroll__["b" /* unregisterScrollListener */])(this, scrollElement);
|
16166 |
-
this._unregisterResizeListener(scrollElement);
|
16167 |
-
}
|
16168 |
-
|
16169 |
-
this._isMounted = false;
|
16170 |
-
}
|
16171 |
-
}, {
|
16172 |
-
key: 'render',
|
16173 |
-
value: function render() {
|
16174 |
-
var children = this.props.children;
|
16175 |
-
var _state2 = this.state,
|
16176 |
-
isScrolling = _state2.isScrolling,
|
16177 |
-
scrollTop = _state2.scrollTop,
|
16178 |
-
scrollLeft = _state2.scrollLeft,
|
16179 |
-
height = _state2.height,
|
16180 |
-
width = _state2.width;
|
16181 |
-
|
16182 |
-
|
16183 |
-
return children({
|
16184 |
-
onChildScroll: this._onChildScroll,
|
16185 |
-
registerChild: this._registerChild,
|
16186 |
-
height: height,
|
16187 |
-
isScrolling: isScrolling,
|
16188 |
-
scrollLeft: scrollLeft,
|
16189 |
-
scrollTop: scrollTop,
|
16190 |
-
width: width
|
16191 |
-
});
|
16192 |
-
}
|
16193 |
-
|
16194 |
-
// Referenced by utils/onScroll
|
16195 |
-
|
16196 |
-
|
16197 |
-
// Referenced by utils/onScroll
|
16198 |
-
|
16199 |
-
}]);
|
16200 |
-
|
16201 |
-
return WindowScroller;
|
16202 |
-
}(__WEBPACK_IMPORTED_MODULE_6_react__["PureComponent"]);
|
16203 |
-
|
16204 |
-
WindowScroller.defaultProps = {
|
16205 |
-
onResize: function onResize() {},
|
16206 |
-
onScroll: function onScroll() {},
|
16207 |
-
scrollingResetTimeInterval: IS_SCROLLING_TIMEOUT,
|
16208 |
-
scrollElement: getWindow(),
|
16209 |
-
serverHeight: 0,
|
16210 |
-
serverWidth: 0
|
16211 |
-
};
|
16212 |
-
WindowScroller.propTypes = {
|
16213 |
-
/**
|
16214 |
-
* Function responsible for rendering children.
|
16215 |
-
* This function should implement the following signature:
|
16216 |
-
* ({ height, isScrolling, scrollLeft, scrollTop, width }) => PropTypes.element
|
16217 |
-
*/
|
16218 |
-
children: __webpack_require__(0).func.isRequired,
|
16219 |
-
|
16220 |
-
|
16221 |
-
/** Callback to be invoked on-resize: ({ height, width }) */
|
16222 |
-
onResize: __webpack_require__(0).func.isRequired,
|
16223 |
-
|
16224 |
-
|
16225 |
-
/** Callback to be invoked on-scroll: ({ scrollLeft, scrollTop }) */
|
16226 |
-
onScroll: __webpack_require__(0).func.isRequired,
|
16227 |
-
|
16228 |
-
|
16229 |
-
/** Element to attach scroll event listeners. Defaults to window. */
|
16230 |
-
scrollElement: __webpack_require__(0).oneOfType([__webpack_require__(0).any, typeof Element === 'function' ? __webpack_require__(0).instanceOf(Element) : __webpack_require__(0).any]),
|
16231 |
-
|
16232 |
-
/**
|
16233 |
-
* Wait this amount of time after the last scroll event before resetting child `pointer-events`.
|
16234 |
-
*/
|
16235 |
-
scrollingResetTimeInterval: __webpack_require__(0).number.isRequired,
|
16236 |
-
|
16237 |
-
|
16238 |
-
/** Height used for server-side rendering */
|
16239 |
-
serverHeight: __webpack_require__(0).number.isRequired,
|
16240 |
-
|
16241 |
-
|
16242 |
-
/** Width used for server-side rendering */
|
16243 |
-
serverWidth: __webpack_require__(0).number.isRequired
|
16244 |
-
};
|
16245 |
-
/* harmony default export */ __webpack_exports__["a"] = (WindowScroller);
|
16246 |
-
|
16247 |
-
/***/ }),
|
16248 |
-
/* 265 */
|
16249 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16250 |
-
|
16251 |
-
"use strict";
|
16252 |
-
|
16253 |
-
|
16254 |
-
Object.defineProperty(exports, "__esModule", {
|
16255 |
-
value: true
|
16256 |
-
});
|
16257 |
-
exports.unpackBackendForEs5Users = exports.createChildContext = exports.CHILD_CONTEXT_TYPES = undefined;
|
16258 |
-
|
16259 |
-
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
16260 |
-
|
16261 |
-
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
16262 |
-
|
16263 |
-
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
16264 |
-
|
16265 |
-
exports.default = DragDropContext;
|
16266 |
-
|
16267 |
-
var _react = __webpack_require__(2);
|
16268 |
-
|
16269 |
-
var _react2 = _interopRequireDefault(_react);
|
16270 |
-
|
16271 |
-
var _propTypes = __webpack_require__(0);
|
16272 |
-
|
16273 |
-
var _propTypes2 = _interopRequireDefault(_propTypes);
|
16274 |
-
|
16275 |
-
var _dndCore = __webpack_require__(619);
|
16276 |
-
|
16277 |
-
var _invariant = __webpack_require__(28);
|
16278 |
-
|
16279 |
-
var _invariant2 = _interopRequireDefault(_invariant);
|
16280 |
-
|
16281 |
-
var _hoistNonReactStatics = __webpack_require__(189);
|
16282 |
-
|
16283 |
-
var _hoistNonReactStatics2 = _interopRequireDefault(_hoistNonReactStatics);
|
16284 |
-
|
16285 |
-
var _checkDecoratorArguments = __webpack_require__(127);
|
16286 |
-
|
16287 |
-
var _checkDecoratorArguments2 = _interopRequireDefault(_checkDecoratorArguments);
|
16288 |
-
|
16289 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
16290 |
-
|
16291 |
-
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
16292 |
-
|
16293 |
-
function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; }
|
16294 |
-
|
16295 |
-
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
16296 |
-
|
16297 |
-
var CHILD_CONTEXT_TYPES = exports.CHILD_CONTEXT_TYPES = {
|
16298 |
-
dragDropManager: _propTypes2.default.object.isRequired
|
16299 |
-
};
|
16300 |
-
|
16301 |
-
var createChildContext = exports.createChildContext = function createChildContext(backend, context) {
|
16302 |
-
return {
|
16303 |
-
dragDropManager: new _dndCore.DragDropManager(backend, context)
|
16304 |
-
};
|
16305 |
-
};
|
16306 |
-
|
16307 |
-
var unpackBackendForEs5Users = exports.unpackBackendForEs5Users = function unpackBackendForEs5Users(backendOrModule) {
|
16308 |
-
// Auto-detect ES6 default export for people still using ES5
|
16309 |
-
var backend = backendOrModule;
|
16310 |
-
if ((typeof backend === 'undefined' ? 'undefined' : _typeof(backend)) === 'object' && typeof backend.default === 'function') {
|
16311 |
-
backend = backend.default;
|
16312 |
-
}
|
16313 |
-
(0, _invariant2.default)(typeof backend === 'function', 'Expected the backend to be a function or an ES6 module exporting a default function. ' + 'Read more: http://react-dnd.github.io/react-dnd/docs-drag-drop-context.html');
|
16314 |
-
return backend;
|
16315 |
-
};
|
16316 |
-
|
16317 |
-
function DragDropContext(backendOrModule) {
|
16318 |
-
_checkDecoratorArguments2.default.apply(undefined, ['DragDropContext', 'backend'].concat(Array.prototype.slice.call(arguments))); // eslint-disable-line prefer-rest-params
|
16319 |
-
|
16320 |
-
var backend = unpackBackendForEs5Users(backendOrModule);
|
16321 |
-
var childContext = createChildContext(backend);
|
16322 |
-
|
16323 |
-
return function decorateContext(DecoratedComponent) {
|
16324 |
-
var _class, _temp;
|
16325 |
-
|
16326 |
-
var displayName = DecoratedComponent.displayName || DecoratedComponent.name || 'Component';
|
16327 |
-
|
16328 |
-
var DragDropContextContainer = (_temp = _class = function (_Component) {
|
16329 |
-
_inherits(DragDropContextContainer, _Component);
|
16330 |
-
|
16331 |
-
function DragDropContextContainer() {
|
16332 |
-
_classCallCheck(this, DragDropContextContainer);
|
16333 |
-
|
16334 |
-
return _possibleConstructorReturn(this, (DragDropContextContainer.__proto__ || Object.getPrototypeOf(DragDropContextContainer)).apply(this, arguments));
|
16335 |
-
}
|
16336 |
-
|
16337 |
-
_createClass(DragDropContextContainer, [{
|
16338 |
-
key: 'getDecoratedComponentInstance',
|
16339 |
-
value: function getDecoratedComponentInstance() {
|
16340 |
-
(0, _invariant2.default)(this.child, 'In order to access an instance of the decorated component it can not be a stateless component.');
|
16341 |
-
return this.child;
|
16342 |
-
}
|
16343 |
-
}, {
|
16344 |
-
key: 'getManager',
|
16345 |
-
value: function getManager() {
|
16346 |
-
return childContext.dragDropManager;
|
16347 |
-
}
|
16348 |
-
}, {
|
16349 |
-
key: 'getChildContext',
|
16350 |
-
value: function getChildContext() {
|
16351 |
-
return childContext;
|
16352 |
-
}
|
16353 |
-
}, {
|
16354 |
-
key: 'render',
|
16355 |
-
value: function render() {
|
16356 |
-
var _this2 = this;
|
16357 |
-
|
16358 |
-
return _react2.default.createElement(DecoratedComponent, _extends({}, this.props, {
|
16359 |
-
ref: function ref(child) {
|
16360 |
-
_this2.child = child;
|
16361 |
-
}
|
16362 |
-
}));
|
16363 |
-
}
|
16364 |
-
}]);
|
16365 |
-
|
16366 |
-
return DragDropContextContainer;
|
16367 |
-
}(_react.Component), _class.DecoratedComponent = DecoratedComponent, _class.displayName = 'DragDropContext(' + displayName + ')', _class.childContextTypes = CHILD_CONTEXT_TYPES, _temp);
|
16368 |
-
|
16369 |
-
|
16370 |
-
return (0, _hoistNonReactStatics2.default)(DragDropContextContainer, DecoratedComponent);
|
16371 |
-
};
|
16372 |
-
}
|
16373 |
-
|
16374 |
-
/***/ }),
|
16375 |
-
/* 266 */
|
16376 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16377 |
-
|
16378 |
-
/* WEBPACK VAR INJECTION */(function(global) {/** Detect free variable `global` from Node.js. */
|
16379 |
-
var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
|
16380 |
-
|
16381 |
-
module.exports = freeGlobal;
|
16382 |
-
|
16383 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(34)))
|
16384 |
-
|
16385 |
-
/***/ }),
|
16386 |
-
/* 267 */
|
16387 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16388 |
-
|
16389 |
-
"use strict";
|
16390 |
-
|
16391 |
-
|
16392 |
-
Object.defineProperty(exports, "__esModule", {
|
16393 |
-
value: true
|
16394 |
-
});
|
16395 |
-
|
16396 |
-
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
16397 |
-
|
16398 |
-
exports.default = dragOffset;
|
16399 |
-
exports.getSourceClientOffset = getSourceClientOffset;
|
16400 |
-
exports.getDifferenceFromInitialOffset = getDifferenceFromInitialOffset;
|
16401 |
-
|
16402 |
-
var _dragDrop = __webpack_require__(119);
|
16403 |
-
|
16404 |
-
var initialState = {
|
16405 |
-
initialSourceClientOffset: null,
|
16406 |
-
initialClientOffset: null,
|
16407 |
-
clientOffset: null
|
16408 |
-
};
|
16409 |
-
|
16410 |
-
function areOffsetsEqual(offsetA, offsetB) {
|
16411 |
-
if (offsetA === offsetB) {
|
16412 |
-
return true;
|
16413 |
-
}
|
16414 |
-
return offsetA && offsetB && offsetA.x === offsetB.x && offsetA.y === offsetB.y;
|
16415 |
-
}
|
16416 |
-
|
16417 |
-
function dragOffset() {
|
16418 |
-
var state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : initialState;
|
16419 |
-
var action = arguments[1];
|
16420 |
-
|
16421 |
-
switch (action.type) {
|
16422 |
-
case _dragDrop.BEGIN_DRAG:
|
16423 |
-
return {
|
16424 |
-
initialSourceClientOffset: action.sourceClientOffset,
|
16425 |
-
initialClientOffset: action.clientOffset,
|
16426 |
-
clientOffset: action.clientOffset
|
16427 |
-
};
|
16428 |
-
case _dragDrop.HOVER:
|
16429 |
-
if (areOffsetsEqual(state.clientOffset, action.clientOffset)) {
|
16430 |
-
return state;
|
16431 |
-
}
|
16432 |
-
return _extends({}, state, {
|
16433 |
-
clientOffset: action.clientOffset
|
16434 |
-
});
|
16435 |
-
case _dragDrop.END_DRAG:
|
16436 |
-
case _dragDrop.DROP:
|
16437 |
-
return initialState;
|
16438 |
-
default:
|
16439 |
-
return state;
|
16440 |
-
}
|
16441 |
-
}
|
16442 |
-
|
16443 |
-
function getSourceClientOffset(state) {
|
16444 |
-
var clientOffset = state.clientOffset,
|
16445 |
-
initialClientOffset = state.initialClientOffset,
|
16446 |
-
initialSourceClientOffset = state.initialSourceClientOffset;
|
16447 |
-
|
16448 |
-
if (!clientOffset || !initialClientOffset || !initialSourceClientOffset) {
|
16449 |
-
return null;
|
16450 |
-
}
|
16451 |
-
return {
|
16452 |
-
x: clientOffset.x + initialSourceClientOffset.x - initialClientOffset.x,
|
16453 |
-
y: clientOffset.y + initialSourceClientOffset.y - initialClientOffset.y
|
16454 |
-
};
|
16455 |
-
}
|
16456 |
-
|
16457 |
-
function getDifferenceFromInitialOffset(state) {
|
16458 |
-
var clientOffset = state.clientOffset,
|
16459 |
-
initialClientOffset = state.initialClientOffset;
|
16460 |
-
|
16461 |
-
if (!clientOffset || !initialClientOffset) {
|
16462 |
-
return null;
|
16463 |
-
}
|
16464 |
-
return {
|
16465 |
-
x: clientOffset.x - initialClientOffset.x,
|
16466 |
-
y: clientOffset.y - initialClientOffset.y
|
16467 |
-
};
|
16468 |
-
}
|
16469 |
-
|
16470 |
-
/***/ }),
|
16471 |
-
/* 268 */
|
16472 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16473 |
-
|
16474 |
-
"use strict";
|
16475 |
-
|
16476 |
-
|
16477 |
-
Object.defineProperty(exports, "__esModule", {
|
16478 |
-
value: true
|
16479 |
-
});
|
16480 |
-
exports.default = matchesType;
|
16481 |
-
|
16482 |
-
var _isArray = __webpack_require__(71);
|
16483 |
-
|
16484 |
-
var _isArray2 = _interopRequireDefault(_isArray);
|
16485 |
-
|
16486 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
16487 |
-
|
16488 |
-
function matchesType(targetType, draggedItemType) {
|
16489 |
-
if ((0, _isArray2.default)(targetType)) {
|
16490 |
-
return targetType.some(function (t) {
|
16491 |
-
return t === draggedItemType;
|
16492 |
-
});
|
16493 |
-
} else {
|
16494 |
-
return targetType === draggedItemType;
|
16495 |
-
}
|
16496 |
-
}
|
16497 |
-
|
16498 |
-
/***/ }),
|
16499 |
-
/* 269 */
|
16500 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16501 |
-
|
16502 |
-
var baseDifference = __webpack_require__(270),
|
16503 |
-
baseRest = __webpack_require__(82),
|
16504 |
-
isArrayLikeObject = __webpack_require__(125);
|
16505 |
-
|
16506 |
-
/**
|
16507 |
-
* Creates an array excluding all given values using
|
16508 |
-
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
16509 |
-
* for equality comparisons.
|
16510 |
-
*
|
16511 |
-
* **Note:** Unlike `_.pull`, this method returns a new array.
|
16512 |
-
*
|
16513 |
-
* @static
|
16514 |
-
* @memberOf _
|
16515 |
-
* @since 0.1.0
|
16516 |
-
* @category Array
|
16517 |
-
* @param {Array} array The array to inspect.
|
16518 |
-
* @param {...*} [values] The values to exclude.
|
16519 |
-
* @returns {Array} Returns the new array of filtered values.
|
16520 |
-
* @see _.difference, _.xor
|
16521 |
-
* @example
|
16522 |
-
*
|
16523 |
-
* _.without([2, 1, 2, 3], 1, 2);
|
16524 |
-
* // => [3]
|
16525 |
-
*/
|
16526 |
-
var without = baseRest(function(array, values) {
|
16527 |
-
return isArrayLikeObject(array)
|
16528 |
-
? baseDifference(array, values)
|
16529 |
-
: [];
|
16530 |
-
});
|
16531 |
-
|
16532 |
-
module.exports = without;
|
16533 |
-
|
16534 |
-
|
16535 |
-
/***/ }),
|
16536 |
-
/* 270 */
|
16537 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16538 |
-
|
16539 |
-
var SetCache = __webpack_require__(182),
|
16540 |
-
arrayIncludes = __webpack_require__(183),
|
16541 |
-
arrayIncludesWith = __webpack_require__(184),
|
16542 |
-
arrayMap = __webpack_require__(185),
|
16543 |
-
baseUnary = __webpack_require__(186),
|
16544 |
-
cacheHas = __webpack_require__(187);
|
16545 |
-
|
16546 |
-
/** Used as the size to enable large array optimizations. */
|
16547 |
-
var LARGE_ARRAY_SIZE = 200;
|
16548 |
-
|
16549 |
-
/**
|
16550 |
-
* The base implementation of methods like `_.difference` without support
|
16551 |
-
* for excluding multiple arrays or iteratee shorthands.
|
16552 |
-
*
|
16553 |
-
* @private
|
16554 |
-
* @param {Array} array The array to inspect.
|
16555 |
-
* @param {Array} values The values to exclude.
|
16556 |
-
* @param {Function} [iteratee] The iteratee invoked per element.
|
16557 |
-
* @param {Function} [comparator] The comparator invoked per element.
|
16558 |
-
* @returns {Array} Returns the new array of filtered values.
|
16559 |
-
*/
|
16560 |
-
function baseDifference(array, values, iteratee, comparator) {
|
16561 |
-
var index = -1,
|
16562 |
-
includes = arrayIncludes,
|
16563 |
-
isCommon = true,
|
16564 |
-
length = array.length,
|
16565 |
-
result = [],
|
16566 |
-
valuesLength = values.length;
|
16567 |
-
|
16568 |
-
if (!length) {
|
16569 |
-
return result;
|
16570 |
-
}
|
16571 |
-
if (iteratee) {
|
16572 |
-
values = arrayMap(values, baseUnary(iteratee));
|
16573 |
-
}
|
16574 |
-
if (comparator) {
|
16575 |
-
includes = arrayIncludesWith;
|
16576 |
-
isCommon = false;
|
16577 |
-
}
|
16578 |
-
else if (values.length >= LARGE_ARRAY_SIZE) {
|
16579 |
-
includes = cacheHas;
|
16580 |
-
isCommon = false;
|
16581 |
-
values = new SetCache(values);
|
16582 |
-
}
|
16583 |
-
outer:
|
16584 |
-
while (++index < length) {
|
16585 |
-
var value = array[index],
|
16586 |
-
computed = iteratee == null ? value : iteratee(value);
|
16587 |
-
|
16588 |
-
value = (comparator || value !== 0) ? value : 0;
|
16589 |
-
if (isCommon && computed === computed) {
|
16590 |
-
var valuesIndex = valuesLength;
|
16591 |
-
while (valuesIndex--) {
|
16592 |
-
if (values[valuesIndex] === computed) {
|
16593 |
-
continue outer;
|
16594 |
-
}
|
16595 |
-
}
|
16596 |
-
result.push(value);
|
16597 |
-
}
|
16598 |
-
else if (!includes(values, computed, comparator)) {
|
16599 |
-
result.push(value);
|
16600 |
-
}
|
16601 |
-
}
|
16602 |
-
return result;
|
16603 |
-
}
|
16604 |
-
|
16605 |
-
module.exports = baseDifference;
|
16606 |
-
|
16607 |
-
|
16608 |
-
/***/ }),
|
16609 |
-
/* 271 */
|
16610 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16611 |
-
|
16612 |
-
var mapCacheClear = __webpack_require__(631),
|
16613 |
-
mapCacheDelete = __webpack_require__(650),
|
16614 |
-
mapCacheGet = __webpack_require__(652),
|
16615 |
-
mapCacheHas = __webpack_require__(653),
|
16616 |
-
mapCacheSet = __webpack_require__(654);
|
16617 |
-
|
16618 |
-
/**
|
16619 |
-
* Creates a map cache object to store key-value pairs.
|
16620 |
-
*
|
16621 |
-
* @private
|
16622 |
-
* @constructor
|
16623 |
-
* @param {Array} [entries] The key-value pairs to cache.
|
16624 |
-
*/
|
16625 |
-
function MapCache(entries) {
|
16626 |
-
var index = -1,
|
16627 |
-
length = entries == null ? 0 : entries.length;
|
16628 |
-
|
16629 |
-
this.clear();
|
16630 |
-
while (++index < length) {
|
16631 |
-
var entry = entries[index];
|
16632 |
-
this.set(entry[0], entry[1]);
|
16633 |
-
}
|
16634 |
-
}
|
16635 |
-
|
16636 |
-
// Add methods to `MapCache`.
|
16637 |
-
MapCache.prototype.clear = mapCacheClear;
|
16638 |
-
MapCache.prototype['delete'] = mapCacheDelete;
|
16639 |
-
MapCache.prototype.get = mapCacheGet;
|
16640 |
-
MapCache.prototype.has = mapCacheHas;
|
16641 |
-
MapCache.prototype.set = mapCacheSet;
|
16642 |
-
|
16643 |
-
module.exports = MapCache;
|
16644 |
-
|
16645 |
-
|
16646 |
-
/***/ }),
|
16647 |
-
/* 272 */
|
16648 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16649 |
-
|
16650 |
-
var baseGetTag = __webpack_require__(118),
|
16651 |
-
isObject = __webpack_require__(96);
|
16652 |
-
|
16653 |
-
/** `Object#toString` result references. */
|
16654 |
-
var asyncTag = '[object AsyncFunction]',
|
16655 |
-
funcTag = '[object Function]',
|
16656 |
-
genTag = '[object GeneratorFunction]',
|
16657 |
-
proxyTag = '[object Proxy]';
|
16658 |
-
|
16659 |
-
/**
|
16660 |
-
* Checks if `value` is classified as a `Function` object.
|
16661 |
-
*
|
16662 |
-
* @static
|
16663 |
-
* @memberOf _
|
16664 |
-
* @since 0.1.0
|
16665 |
-
* @category Lang
|
16666 |
-
* @param {*} value The value to check.
|
16667 |
-
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
|
16668 |
-
* @example
|
16669 |
-
*
|
16670 |
-
* _.isFunction(_);
|
16671 |
-
* // => true
|
16672 |
-
*
|
16673 |
-
* _.isFunction(/abc/);
|
16674 |
-
* // => false
|
16675 |
-
*/
|
16676 |
-
function isFunction(value) {
|
16677 |
-
if (!isObject(value)) {
|
16678 |
-
return false;
|
16679 |
-
}
|
16680 |
-
// The use of `Object#toString` avoids issues with the `typeof` operator
|
16681 |
-
// in Safari 9 which returns 'object' for typed arrays and other constructors.
|
16682 |
-
var tag = baseGetTag(value);
|
16683 |
-
return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
|
16684 |
-
}
|
16685 |
-
|
16686 |
-
module.exports = isFunction;
|
16687 |
-
|
16688 |
-
|
16689 |
-
/***/ }),
|
16690 |
-
/* 273 */
|
16691 |
-
/***/ (function(module, exports) {
|
16692 |
-
|
16693 |
-
/**
|
16694 |
-
* This method returns the first argument it receives.
|
16695 |
-
*
|
16696 |
-
* @static
|
16697 |
-
* @since 0.1.0
|
16698 |
-
* @memberOf _
|
16699 |
-
* @category Util
|
16700 |
-
* @param {*} value Any value.
|
16701 |
-
* @returns {*} Returns `value`.
|
16702 |
-
* @example
|
16703 |
-
*
|
16704 |
-
* var object = { 'a': 1 };
|
16705 |
-
*
|
16706 |
-
* console.log(_.identity(object) === object);
|
16707 |
-
* // => true
|
16708 |
-
*/
|
16709 |
-
function identity(value) {
|
16710 |
-
return value;
|
16711 |
-
}
|
16712 |
-
|
16713 |
-
module.exports = identity;
|
16714 |
-
|
16715 |
-
|
16716 |
-
/***/ }),
|
16717 |
-
/* 274 */
|
16718 |
-
/***/ (function(module, exports) {
|
16719 |
-
|
16720 |
-
/**
|
16721 |
-
* A faster alternative to `Function#apply`, this function invokes `func`
|
16722 |
-
* with the `this` binding of `thisArg` and the arguments of `args`.
|
16723 |
-
*
|
16724 |
-
* @private
|
16725 |
-
* @param {Function} func The function to invoke.
|
16726 |
-
* @param {*} thisArg The `this` binding of `func`.
|
16727 |
-
* @param {Array} args The arguments to invoke `func` with.
|
16728 |
-
* @returns {*} Returns the result of `func`.
|
16729 |
-
*/
|
16730 |
-
function apply(func, thisArg, args) {
|
16731 |
-
switch (args.length) {
|
16732 |
-
case 0: return func.call(thisArg);
|
16733 |
-
case 1: return func.call(thisArg, args[0]);
|
16734 |
-
case 2: return func.call(thisArg, args[0], args[1]);
|
16735 |
-
case 3: return func.call(thisArg, args[0], args[1], args[2]);
|
16736 |
-
}
|
16737 |
-
return func.apply(thisArg, args);
|
16738 |
-
}
|
16739 |
-
|
16740 |
-
module.exports = apply;
|
16741 |
-
|
16742 |
-
|
16743 |
-
/***/ }),
|
16744 |
-
/* 275 */
|
16745 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16746 |
-
|
16747 |
-
var getNative = __webpack_require__(121);
|
16748 |
-
|
16749 |
-
var defineProperty = (function() {
|
16750 |
-
try {
|
16751 |
-
var func = getNative(Object, 'defineProperty');
|
16752 |
-
func({}, '', {});
|
16753 |
-
return func;
|
16754 |
-
} catch (e) {}
|
16755 |
-
}());
|
16756 |
-
|
16757 |
-
module.exports = defineProperty;
|
16758 |
-
|
16759 |
-
|
16760 |
-
/***/ }),
|
16761 |
-
/* 276 */
|
16762 |
-
/***/ (function(module, exports) {
|
16763 |
-
|
16764 |
-
/** Used as references for various `Number` constants. */
|
16765 |
-
var MAX_SAFE_INTEGER = 9007199254740991;
|
16766 |
-
|
16767 |
-
/**
|
16768 |
-
* Checks if `value` is a valid array-like length.
|
16769 |
-
*
|
16770 |
-
* **Note:** This method is loosely based on
|
16771 |
-
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
|
16772 |
-
*
|
16773 |
-
* @static
|
16774 |
-
* @memberOf _
|
16775 |
-
* @since 4.0.0
|
16776 |
-
* @category Lang
|
16777 |
-
* @param {*} value The value to check.
|
16778 |
-
* @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
|
16779 |
-
* @example
|
16780 |
-
*
|
16781 |
-
* _.isLength(3);
|
16782 |
-
* // => true
|
16783 |
-
*
|
16784 |
-
* _.isLength(Number.MIN_VALUE);
|
16785 |
-
* // => false
|
16786 |
-
*
|
16787 |
-
* _.isLength(Infinity);
|
16788 |
-
* // => false
|
16789 |
-
*
|
16790 |
-
* _.isLength('3');
|
16791 |
-
* // => false
|
16792 |
-
*/
|
16793 |
-
function isLength(value) {
|
16794 |
-
return typeof value == 'number' &&
|
16795 |
-
value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
|
16796 |
-
}
|
16797 |
-
|
16798 |
-
module.exports = isLength;
|
16799 |
-
|
16800 |
-
|
16801 |
-
/***/ }),
|
16802 |
-
/* 277 */
|
16803 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16804 |
-
|
16805 |
-
"use strict";
|
16806 |
-
|
16807 |
-
|
16808 |
-
Object.defineProperty(exports, "__esModule", {
|
16809 |
-
value: true
|
16810 |
-
});
|
16811 |
-
exports.default = dirtyHandlerIds;
|
16812 |
-
exports.areDirty = areDirty;
|
16813 |
-
|
16814 |
-
var _xor = __webpack_require__(667);
|
16815 |
-
|
16816 |
-
var _xor2 = _interopRequireDefault(_xor);
|
16817 |
-
|
16818 |
-
var _intersection = __webpack_require__(675);
|
16819 |
-
|
16820 |
-
var _intersection2 = _interopRequireDefault(_intersection);
|
16821 |
-
|
16822 |
-
var _dragDrop = __webpack_require__(119);
|
16823 |
-
|
16824 |
-
var _registry = __webpack_require__(126);
|
16825 |
-
|
16826 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
16827 |
-
|
16828 |
-
var NONE = [];
|
16829 |
-
var ALL = [];
|
16830 |
-
|
16831 |
-
function dirtyHandlerIds() {
|
16832 |
-
var state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : NONE;
|
16833 |
-
var action = arguments[1];
|
16834 |
-
var dragOperation = arguments[2];
|
16835 |
-
|
16836 |
-
switch (action.type) {
|
16837 |
-
case _dragDrop.HOVER:
|
16838 |
-
break;
|
16839 |
-
case _registry.ADD_SOURCE:
|
16840 |
-
case _registry.ADD_TARGET:
|
16841 |
-
case _registry.REMOVE_TARGET:
|
16842 |
-
case _registry.REMOVE_SOURCE:
|
16843 |
-
return NONE;
|
16844 |
-
case _dragDrop.BEGIN_DRAG:
|
16845 |
-
case _dragDrop.PUBLISH_DRAG_SOURCE:
|
16846 |
-
case _dragDrop.END_DRAG:
|
16847 |
-
case _dragDrop.DROP:
|
16848 |
-
default:
|
16849 |
-
return ALL;
|
16850 |
-
}
|
16851 |
-
|
16852 |
-
var targetIds = action.targetIds;
|
16853 |
-
var prevTargetIds = dragOperation.targetIds;
|
16854 |
-
|
16855 |
-
var result = (0, _xor2.default)(targetIds, prevTargetIds);
|
16856 |
-
|
16857 |
-
var didChange = false;
|
16858 |
-
if (result.length === 0) {
|
16859 |
-
for (var i = 0; i < targetIds.length; i++) {
|
16860 |
-
if (targetIds[i] !== prevTargetIds[i]) {
|
16861 |
-
didChange = true;
|
16862 |
-
break;
|
16863 |
-
}
|
16864 |
-
}
|
16865 |
-
} else {
|
16866 |
-
didChange = true;
|
16867 |
-
}
|
16868 |
-
|
16869 |
-
if (!didChange) {
|
16870 |
-
return NONE;
|
16871 |
-
}
|
16872 |
-
|
16873 |
-
var prevInnermostTargetId = prevTargetIds[prevTargetIds.length - 1];
|
16874 |
-
var innermostTargetId = targetIds[targetIds.length - 1];
|
16875 |
-
|
16876 |
-
if (prevInnermostTargetId !== innermostTargetId) {
|
16877 |
-
if (prevInnermostTargetId) {
|
16878 |
-
result.push(prevInnermostTargetId);
|
16879 |
-
}
|
16880 |
-
if (innermostTargetId) {
|
16881 |
-
result.push(innermostTargetId);
|
16882 |
-
}
|
16883 |
-
}
|
16884 |
-
|
16885 |
-
return result;
|
16886 |
-
}
|
16887 |
-
|
16888 |
-
function areDirty(state, handlerIds) {
|
16889 |
-
if (state === NONE) {
|
16890 |
-
return false;
|
16891 |
-
}
|
16892 |
-
|
16893 |
-
if (state === ALL || typeof handlerIds === 'undefined') {
|
16894 |
-
return true;
|
16895 |
-
}
|
16896 |
-
|
16897 |
-
return (0, _intersection2.default)(handlerIds, state).length > 0;
|
16898 |
-
}
|
16899 |
-
|
16900 |
-
/***/ }),
|
16901 |
-
/* 278 */
|
16902 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16903 |
-
|
16904 |
-
var arrayPush = __webpack_require__(670),
|
16905 |
-
isFlattenable = __webpack_require__(671);
|
16906 |
-
|
16907 |
-
/**
|
16908 |
-
* The base implementation of `_.flatten` with support for restricting flattening.
|
16909 |
-
*
|
16910 |
-
* @private
|
16911 |
-
* @param {Array} array The array to flatten.
|
16912 |
-
* @param {number} depth The maximum recursion depth.
|
16913 |
-
* @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
|
16914 |
-
* @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
|
16915 |
-
* @param {Array} [result=[]] The initial result value.
|
16916 |
-
* @returns {Array} Returns the new flattened array.
|
16917 |
-
*/
|
16918 |
-
function baseFlatten(array, depth, predicate, isStrict, result) {
|
16919 |
-
var index = -1,
|
16920 |
-
length = array.length;
|
16921 |
-
|
16922 |
-
predicate || (predicate = isFlattenable);
|
16923 |
-
result || (result = []);
|
16924 |
-
|
16925 |
-
while (++index < length) {
|
16926 |
-
var value = array[index];
|
16927 |
-
if (depth > 0 && predicate(value)) {
|
16928 |
-
if (depth > 1) {
|
16929 |
-
// Recursively flatten arrays (susceptible to call stack limits).
|
16930 |
-
baseFlatten(value, depth - 1, predicate, isStrict, result);
|
16931 |
-
} else {
|
16932 |
-
arrayPush(result, value);
|
16933 |
-
}
|
16934 |
-
} else if (!isStrict) {
|
16935 |
-
result[result.length] = value;
|
16936 |
-
}
|
16937 |
-
}
|
16938 |
-
return result;
|
16939 |
-
}
|
16940 |
-
|
16941 |
-
module.exports = baseFlatten;
|
16942 |
-
|
16943 |
-
|
16944 |
-
/***/ }),
|
16945 |
-
/* 279 */
|
16946 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16947 |
-
|
16948 |
-
var baseIsArguments = __webpack_require__(672),
|
16949 |
-
isObjectLike = __webpack_require__(95);
|
16950 |
-
|
16951 |
-
/** Used for built-in method references. */
|
16952 |
-
var objectProto = Object.prototype;
|
16953 |
-
|
16954 |
-
/** Used to check objects for own properties. */
|
16955 |
-
var hasOwnProperty = objectProto.hasOwnProperty;
|
16956 |
-
|
16957 |
-
/** Built-in value references. */
|
16958 |
-
var propertyIsEnumerable = objectProto.propertyIsEnumerable;
|
16959 |
-
|
16960 |
-
/**
|
16961 |
-
* Checks if `value` is likely an `arguments` object.
|
16962 |
-
*
|
16963 |
-
* @static
|
16964 |
-
* @memberOf _
|
16965 |
-
* @since 0.1.0
|
16966 |
-
* @category Lang
|
16967 |
-
* @param {*} value The value to check.
|
16968 |
-
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
|
16969 |
-
* else `false`.
|
16970 |
-
* @example
|
16971 |
-
*
|
16972 |
-
* _.isArguments(function() { return arguments; }());
|
16973 |
-
* // => true
|
16974 |
-
*
|
16975 |
-
* _.isArguments([1, 2, 3]);
|
16976 |
-
* // => false
|
16977 |
-
*/
|
16978 |
-
var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
|
16979 |
-
return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
|
16980 |
-
!propertyIsEnumerable.call(value, 'callee');
|
16981 |
-
};
|
16982 |
-
|
16983 |
-
module.exports = isArguments;
|
16984 |
-
|
16985 |
-
|
16986 |
-
/***/ }),
|
16987 |
-
/* 280 */
|
16988 |
-
/***/ (function(module, exports, __webpack_require__) {
|
16989 |
-
|
16990 |
-
var SetCache = __webpack_require__(182),
|
16991 |
-
arrayIncludes = __webpack_require__(183),
|
16992 |
-
arrayIncludesWith = __webpack_require__(184),
|
16993 |
-
cacheHas = __webpack_require__(187),
|
16994 |
-
createSet = __webpack_require__(673),
|
16995 |
-
setToArray = __webpack_require__(282);
|
16996 |
-
|
16997 |
-
/** Used as the size to enable large array optimizations. */
|
16998 |
-
var LARGE_ARRAY_SIZE = 200;
|
16999 |
-
|
17000 |
-
/**
|
17001 |
-
* The base implementation of `_.uniqBy` without support for iteratee shorthands.
|
17002 |
-
*
|
17003 |
-
* @private
|
17004 |
-
* @param {Array} array The array to inspect.
|
17005 |
-
* @param {Function} [iteratee] The iteratee invoked per element.
|
17006 |
-
* @param {Function} [comparator] The comparator invoked per element.
|
17007 |
-
* @returns {Array} Returns the new duplicate free array.
|
17008 |
-
*/
|
17009 |
-
function baseUniq(array, iteratee, comparator) {
|
17010 |
-
var index = -1,
|
17011 |
-
includes = arrayIncludes,
|
17012 |
-
length = array.length,
|
17013 |
-
isCommon = true,
|
17014 |
-
result = [],
|
17015 |
-
seen = result;
|
17016 |
-
|
17017 |
-
if (comparator) {
|
17018 |
-
isCommon = false;
|
17019 |
-
includes = arrayIncludesWith;
|
17020 |
-
}
|
17021 |
-
else if (length >= LARGE_ARRAY_SIZE) {
|
17022 |
-
var set = iteratee ? null : createSet(array);
|
17023 |
-
if (set) {
|
17024 |
-
return setToArray(set);
|
17025 |
-
}
|
17026 |
-
isCommon = false;
|
17027 |
-
includes = cacheHas;
|
17028 |
-
seen = new SetCache;
|
17029 |
-
}
|
17030 |
-
else {
|
17031 |
-
seen = iteratee ? [] : result;
|
17032 |
-
}
|
17033 |
-
outer:
|
17034 |
-
while (++index < length) {
|
17035 |
-
var value = array[index],
|
17036 |
-
computed = iteratee ? iteratee(value) : value;
|
17037 |
-
|
17038 |
-
value = (comparator || value !== 0) ? value : 0;
|
17039 |
-
if (isCommon && computed === computed) {
|
17040 |
-
var seenIndex = seen.length;
|
17041 |
-
while (seenIndex--) {
|
17042 |
-
if (seen[seenIndex] === computed) {
|
17043 |
-
continue outer;
|
17044 |
-
}
|
17045 |
-
}
|
17046 |
-
if (iteratee) {
|
17047 |
-
seen.push(computed);
|
17048 |
-
}
|
17049 |
-
result.push(value);
|
17050 |
-
}
|
17051 |
-
else if (!includes(seen, computed, comparator)) {
|
17052 |
-
if (seen !== result) {
|
17053 |
-
seen.push(computed);
|
17054 |
-
}
|
17055 |
-
result.push(value);
|
17056 |
-
}
|
17057 |
-
}
|
17058 |
-
return result;
|
17059 |
-
}
|
17060 |
-
|
17061 |
-
module.exports = baseUniq;
|
17062 |
-
|
17063 |
-
|
17064 |
-
/***/ }),
|
17065 |
-
/* 281 */
|
17066 |
-
/***/ (function(module, exports) {
|
17067 |
-
|
17068 |
-
/**
|
17069 |
-
* This method returns `undefined`.
|
17070 |
-
*
|
17071 |
-
* @static
|
17072 |
-
* @memberOf _
|
17073 |
-
* @since 2.3.0
|
17074 |
-
* @category Util
|
17075 |
-
* @example
|
17076 |
-
*
|
17077 |
-
* _.times(2, _.noop);
|
17078 |
-
* // => [undefined, undefined]
|
17079 |
-
*/
|
17080 |
-
function noop() {
|
17081 |
-
// No operation performed.
|
17082 |
-
}
|
17083 |
-
|
17084 |
-
module.exports = noop;
|
17085 |
-
|
17086 |
-
|
17087 |
-
/***/ }),
|
17088 |
-
/* 282 */
|
17089 |
-
/***/ (function(module, exports) {
|
17090 |
-
|
17091 |
-
/**
|
17092 |
-
* Converts `set` to an array of its values.
|
17093 |
-
*
|
17094 |
-
* @private
|
17095 |
-
* @param {Object} set The set to convert.
|
17096 |
-
* @returns {Array} Returns the values.
|
17097 |
-
*/
|
17098 |
-
function setToArray(set) {
|
17099 |
-
var index = -1,
|
17100 |
-
result = Array(set.size);
|
17101 |
-
|
17102 |
-
set.forEach(function(value) {
|
17103 |
-
result[++index] = value;
|
17104 |
-
});
|
17105 |
-
return result;
|
17106 |
-
}
|
17107 |
-
|
17108 |
-
module.exports = setToArray;
|
17109 |
-
|
17110 |
-
|
17111 |
-
/***/ }),
|
17112 |
-
/* 283 */
|
17113 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17114 |
-
|
17115 |
-
"use strict";
|
17116 |
-
|
17117 |
-
|
17118 |
-
Object.defineProperty(exports, "__esModule", {
|
17119 |
-
value: true
|
17120 |
-
});
|
17121 |
-
|
17122 |
-
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
17123 |
-
|
17124 |
-
exports.default = shallowEqualScalar;
|
17125 |
-
function shallowEqualScalar(objA, objB) {
|
17126 |
-
if (objA === objB) {
|
17127 |
-
return true;
|
17128 |
-
}
|
17129 |
-
|
17130 |
-
if ((typeof objA === 'undefined' ? 'undefined' : _typeof(objA)) !== 'object' || objA === null || (typeof objB === 'undefined' ? 'undefined' : _typeof(objB)) !== 'object' || objB === null) {
|
17131 |
-
return false;
|
17132 |
-
}
|
17133 |
-
|
17134 |
-
var keysA = Object.keys(objA);
|
17135 |
-
var keysB = Object.keys(objB);
|
17136 |
-
|
17137 |
-
if (keysA.length !== keysB.length) {
|
17138 |
-
return false;
|
17139 |
-
}
|
17140 |
-
|
17141 |
-
// Test for A's keys different from B.
|
17142 |
-
var hasOwn = Object.prototype.hasOwnProperty;
|
17143 |
-
for (var i = 0; i < keysA.length; i += 1) {
|
17144 |
-
if (!hasOwn.call(objB, keysA[i])) {
|
17145 |
-
return false;
|
17146 |
-
}
|
17147 |
-
|
17148 |
-
var valA = objA[keysA[i]];
|
17149 |
-
var valB = objB[keysA[i]];
|
17150 |
-
|
17151 |
-
if (valA !== valB || (typeof valA === 'undefined' ? 'undefined' : _typeof(valA)) === 'object' || (typeof valB === 'undefined' ? 'undefined' : _typeof(valB)) === 'object') {
|
17152 |
-
return false;
|
17153 |
-
}
|
17154 |
-
}
|
17155 |
-
|
17156 |
-
return true;
|
17157 |
-
}
|
17158 |
-
|
17159 |
-
/***/ }),
|
17160 |
-
/* 284 */
|
17161 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17162 |
-
|
17163 |
-
"use strict";
|
17164 |
-
/* WEBPACK VAR INJECTION */(function(process) {
|
17165 |
-
|
17166 |
-
Object.defineProperty(exports, "__esModule", {
|
17167 |
-
value: true
|
17168 |
-
});
|
17169 |
-
|
17170 |
-
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
17171 |
-
|
17172 |
-
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
17173 |
-
|
17174 |
-
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
17175 |
-
|
17176 |
-
exports.default = decorateHandler;
|
17177 |
-
|
17178 |
-
var _react = __webpack_require__(2);
|
17179 |
-
|
17180 |
-
var _react2 = _interopRequireDefault(_react);
|
17181 |
-
|
17182 |
-
var _propTypes = __webpack_require__(0);
|
17183 |
-
|
17184 |
-
var _propTypes2 = _interopRequireDefault(_propTypes);
|
17185 |
-
|
17186 |
-
var _disposables = __webpack_require__(690);
|
17187 |
-
|
17188 |
-
var _isPlainObject = __webpack_require__(70);
|
17189 |
-
|
17190 |
-
var _isPlainObject2 = _interopRequireDefault(_isPlainObject);
|
17191 |
-
|
17192 |
-
var _invariant = __webpack_require__(28);
|
17193 |
-
|
17194 |
-
var _invariant2 = _interopRequireDefault(_invariant);
|
17195 |
-
|
17196 |
-
var _hoistNonReactStatics = __webpack_require__(189);
|
17197 |
-
|
17198 |
-
var _hoistNonReactStatics2 = _interopRequireDefault(_hoistNonReactStatics);
|
17199 |
-
|
17200 |
-
var _shallowEqual = __webpack_require__(190);
|
17201 |
-
|
17202 |
-
var _shallowEqual2 = _interopRequireDefault(_shallowEqual);
|
17203 |
-
|
17204 |
-
var _shallowEqualScalar = __webpack_require__(283);
|
17205 |
-
|
17206 |
-
var _shallowEqualScalar2 = _interopRequireDefault(_shallowEqualScalar);
|
17207 |
-
|
17208 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17209 |
-
|
17210 |
-
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
17211 |
-
|
17212 |
-
function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; }
|
17213 |
-
|
17214 |
-
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
17215 |
-
|
17216 |
-
var isClassComponent = function isClassComponent(Comp) {
|
17217 |
-
return Boolean(Comp && Comp.prototype && typeof Comp.prototype.render === 'function');
|
17218 |
-
};
|
17219 |
-
|
17220 |
-
function decorateHandler(_ref) {
|
17221 |
-
var _class, _temp;
|
17222 |
-
|
17223 |
-
var DecoratedComponent = _ref.DecoratedComponent,
|
17224 |
-
createHandler = _ref.createHandler,
|
17225 |
-
createMonitor = _ref.createMonitor,
|
17226 |
-
createConnector = _ref.createConnector,
|
17227 |
-
registerHandler = _ref.registerHandler,
|
17228 |
-
containerDisplayName = _ref.containerDisplayName,
|
17229 |
-
getType = _ref.getType,
|
17230 |
-
collect = _ref.collect,
|
17231 |
-
options = _ref.options;
|
17232 |
-
var _options$arePropsEqua = options.arePropsEqual,
|
17233 |
-
arePropsEqual = _options$arePropsEqua === undefined ? _shallowEqualScalar2.default : _options$arePropsEqua;
|
17234 |
-
|
17235 |
-
var displayName = DecoratedComponent.displayName || DecoratedComponent.name || 'Component';
|
17236 |
-
|
17237 |
-
var DragDropContainer = (_temp = _class = function (_Component) {
|
17238 |
-
_inherits(DragDropContainer, _Component);
|
17239 |
-
|
17240 |
-
_createClass(DragDropContainer, [{
|
17241 |
-
key: 'getHandlerId',
|
17242 |
-
value: function getHandlerId() {
|
17243 |
-
return this.handlerId;
|
17244 |
-
}
|
17245 |
-
}, {
|
17246 |
-
key: 'getDecoratedComponentInstance',
|
17247 |
-
value: function getDecoratedComponentInstance() {
|
17248 |
-
return this.decoratedComponentInstance;
|
17249 |
-
}
|
17250 |
-
}, {
|
17251 |
-
key: 'shouldComponentUpdate',
|
17252 |
-
value: function shouldComponentUpdate(nextProps, nextState) {
|
17253 |
-
return !arePropsEqual(nextProps, this.props) || !(0, _shallowEqual2.default)(nextState, this.state);
|
17254 |
-
}
|
17255 |
-
}]);
|
17256 |
-
|
17257 |
-
function DragDropContainer(props, context) {
|
17258 |
-
_classCallCheck(this, DragDropContainer);
|
17259 |
-
|
17260 |
-
var _this = _possibleConstructorReturn(this, (DragDropContainer.__proto__ || Object.getPrototypeOf(DragDropContainer)).call(this, props, context));
|
17261 |
-
|
17262 |
-
_this.handleChange = _this.handleChange.bind(_this);
|
17263 |
-
_this.handleChildRef = _this.handleChildRef.bind(_this);
|
17264 |
-
|
17265 |
-
(0, _invariant2.default)(_typeof(_this.context.dragDropManager) === 'object', 'Could not find the drag and drop manager in the context of %s. ' + 'Make sure to wrap the top-level component of your app with DragDropContext. ' + 'Read more: http://react-dnd.github.io/react-dnd/docs-troubleshooting.html#could-not-find-the-drag-and-drop-manager-in-the-context', displayName, displayName);
|
17266 |
-
|
17267 |
-
_this.manager = _this.context.dragDropManager;
|
17268 |
-
_this.handlerMonitor = createMonitor(_this.manager);
|
17269 |
-
_this.handlerConnector = createConnector(_this.manager.getBackend());
|
17270 |
-
_this.handler = createHandler(_this.handlerMonitor);
|
17271 |
-
|
17272 |
-
_this.disposable = new _disposables.SerialDisposable();
|
17273 |
-
_this.receiveProps(props);
|
17274 |
-
_this.state = _this.getCurrentState();
|
17275 |
-
_this.dispose();
|
17276 |
-
return _this;
|
17277 |
-
}
|
17278 |
-
|
17279 |
-
_createClass(DragDropContainer, [{
|
17280 |
-
key: 'componentDidMount',
|
17281 |
-
value: function componentDidMount() {
|
17282 |
-
this.isCurrentlyMounted = true;
|
17283 |
-
this.disposable = new _disposables.SerialDisposable();
|
17284 |
-
this.currentType = null;
|
17285 |
-
this.receiveProps(this.props);
|
17286 |
-
this.handleChange();
|
17287 |
-
}
|
17288 |
-
}, {
|
17289 |
-
key: 'componentWillReceiveProps',
|
17290 |
-
value: function componentWillReceiveProps(nextProps) {
|
17291 |
-
if (!arePropsEqual(nextProps, this.props)) {
|
17292 |
-
this.receiveProps(nextProps);
|
17293 |
-
this.handleChange();
|
17294 |
-
}
|
17295 |
-
}
|
17296 |
-
}, {
|
17297 |
-
key: 'componentWillUnmount',
|
17298 |
-
value: function componentWillUnmount() {
|
17299 |
-
this.dispose();
|
17300 |
-
this.isCurrentlyMounted = false;
|
17301 |
-
}
|
17302 |
-
}, {
|
17303 |
-
key: 'receiveProps',
|
17304 |
-
value: function receiveProps(props) {
|
17305 |
-
this.handler.receiveProps(props);
|
17306 |
-
this.receiveType(getType(props));
|
17307 |
-
}
|
17308 |
-
}, {
|
17309 |
-
key: 'receiveType',
|
17310 |
-
value: function receiveType(type) {
|
17311 |
-
if (type === this.currentType) {
|
17312 |
-
return;
|
17313 |
-
}
|
17314 |
-
|
17315 |
-
this.currentType = type;
|
17316 |
-
|
17317 |
-
var _registerHandler = registerHandler(type, this.handler, this.manager),
|
17318 |
-
handlerId = _registerHandler.handlerId,
|
17319 |
-
unregister = _registerHandler.unregister;
|
17320 |
-
|
17321 |
-
this.handlerId = handlerId;
|
17322 |
-
this.handlerMonitor.receiveHandlerId(handlerId);
|
17323 |
-
this.handlerConnector.receiveHandlerId(handlerId);
|
17324 |
-
|
17325 |
-
var globalMonitor = this.manager.getMonitor();
|
17326 |
-
var unsubscribe = globalMonitor.subscribeToStateChange(this.handleChange, { handlerIds: [handlerId] });
|
17327 |
-
|
17328 |
-
this.disposable.setDisposable(new _disposables.CompositeDisposable(new _disposables.Disposable(unsubscribe), new _disposables.Disposable(unregister)));
|
17329 |
-
}
|
17330 |
-
}, {
|
17331 |
-
key: 'handleChange',
|
17332 |
-
value: function handleChange() {
|
17333 |
-
if (!this.isCurrentlyMounted) {
|
17334 |
-
return;
|
17335 |
-
}
|
17336 |
-
|
17337 |
-
var nextState = this.getCurrentState();
|
17338 |
-
if (!(0, _shallowEqual2.default)(nextState, this.state)) {
|
17339 |
-
this.setState(nextState);
|
17340 |
-
}
|
17341 |
-
}
|
17342 |
-
}, {
|
17343 |
-
key: 'dispose',
|
17344 |
-
value: function dispose() {
|
17345 |
-
this.disposable.dispose();
|
17346 |
-
this.handlerConnector.receiveHandlerId(null);
|
17347 |
-
}
|
17348 |
-
}, {
|
17349 |
-
key: 'handleChildRef',
|
17350 |
-
value: function handleChildRef(component) {
|
17351 |
-
this.decoratedComponentInstance = component;
|
17352 |
-
this.handler.receiveComponent(component);
|
17353 |
-
}
|
17354 |
-
}, {
|
17355 |
-
key: 'getCurrentState',
|
17356 |
-
value: function getCurrentState() {
|
17357 |
-
var nextState = collect(this.handlerConnector.hooks, this.handlerMonitor);
|
17358 |
-
|
17359 |
-
if (process.env.NODE_ENV !== 'production') {
|
17360 |
-
(0, _invariant2.default)((0, _isPlainObject2.default)(nextState), 'Expected `collect` specified as the second argument to ' + '%s for %s to return a plain object of props to inject. ' + 'Instead, received %s.', containerDisplayName, displayName, nextState);
|
17361 |
-
}
|
17362 |
-
|
17363 |
-
return nextState;
|
17364 |
-
}
|
17365 |
-
}, {
|
17366 |
-
key: 'render',
|
17367 |
-
value: function render() {
|
17368 |
-
return _react2.default.createElement(DecoratedComponent, _extends({}, this.props, this.state, {
|
17369 |
-
ref: isClassComponent(DecoratedComponent) ? this.handleChildRef : null
|
17370 |
-
}));
|
17371 |
-
}
|
17372 |
-
}]);
|
17373 |
-
|
17374 |
-
return DragDropContainer;
|
17375 |
-
}(_react.Component), _class.DecoratedComponent = DecoratedComponent, _class.displayName = containerDisplayName + '(' + displayName + ')', _class.contextTypes = {
|
17376 |
-
dragDropManager: _propTypes2.default.object.isRequired
|
17377 |
-
}, _temp);
|
17378 |
-
|
17379 |
-
|
17380 |
-
return (0, _hoistNonReactStatics2.default)(DragDropContainer, DecoratedComponent);
|
17381 |
-
}
|
17382 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
17383 |
-
|
17384 |
-
/***/ }),
|
17385 |
-
/* 285 */
|
17386 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17387 |
-
|
17388 |
-
"use strict";
|
17389 |
-
|
17390 |
-
|
17391 |
-
Object.defineProperty(exports, "__esModule", {
|
17392 |
-
value: true
|
17393 |
-
});
|
17394 |
-
exports.default = wrapConnectorHooks;
|
17395 |
-
|
17396 |
-
var _react = __webpack_require__(2);
|
17397 |
-
|
17398 |
-
var _cloneWithRef = __webpack_require__(698);
|
17399 |
-
|
17400 |
-
var _cloneWithRef2 = _interopRequireDefault(_cloneWithRef);
|
17401 |
-
|
17402 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17403 |
-
|
17404 |
-
function throwIfCompositeComponentElement(element) {
|
17405 |
-
// Custom components can no longer be wrapped directly in React DnD 2.0
|
17406 |
-
// so that we don't need to depend on findDOMNode() from react-dom.
|
17407 |
-
if (typeof element.type === 'string') {
|
17408 |
-
return;
|
17409 |
-
}
|
17410 |
-
|
17411 |
-
var displayName = element.type.displayName || element.type.name || 'the component';
|
17412 |
-
|
17413 |
-
throw new Error('Only native element nodes can now be passed to React DnD connectors.' + ('You can either wrap ' + displayName + ' into a <div>, or turn it into a ') + 'drag source or a drop target itself.');
|
17414 |
-
}
|
17415 |
-
|
17416 |
-
function wrapHookToRecognizeElement(hook) {
|
17417 |
-
return function () {
|
17418 |
-
var elementOrNode = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
|
17419 |
-
var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
|
17420 |
-
|
17421 |
-
// When passed a node, call the hook straight away.
|
17422 |
-
if (!(0, _react.isValidElement)(elementOrNode)) {
|
17423 |
-
var node = elementOrNode;
|
17424 |
-
hook(node, options);
|
17425 |
-
return undefined;
|
17426 |
-
}
|
17427 |
-
|
17428 |
-
// If passed a ReactElement, clone it and attach this function as a ref.
|
17429 |
-
// This helps us achieve a neat API where user doesn't even know that refs
|
17430 |
-
// are being used under the hood.
|
17431 |
-
var element = elementOrNode;
|
17432 |
-
throwIfCompositeComponentElement(element);
|
17433 |
-
|
17434 |
-
// When no options are passed, use the hook directly
|
17435 |
-
var ref = options ? function (node) {
|
17436 |
-
return hook(node, options);
|
17437 |
-
} : hook;
|
17438 |
-
|
17439 |
-
return (0, _cloneWithRef2.default)(element, ref);
|
17440 |
-
};
|
17441 |
-
}
|
17442 |
-
|
17443 |
-
function wrapConnectorHooks(hooks) {
|
17444 |
-
var wrappedHooks = {};
|
17445 |
-
|
17446 |
-
Object.keys(hooks).forEach(function (key) {
|
17447 |
-
var hook = hooks[key];
|
17448 |
-
var wrappedHook = wrapHookToRecognizeElement(hook);
|
17449 |
-
wrappedHooks[key] = function () {
|
17450 |
-
return wrappedHook;
|
17451 |
-
};
|
17452 |
-
});
|
17453 |
-
|
17454 |
-
return wrappedHooks;
|
17455 |
-
}
|
17456 |
-
|
17457 |
-
/***/ }),
|
17458 |
-
/* 286 */
|
17459 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17460 |
-
|
17461 |
-
"use strict";
|
17462 |
-
|
17463 |
-
|
17464 |
-
Object.defineProperty(exports, "__esModule", {
|
17465 |
-
value: true
|
17466 |
-
});
|
17467 |
-
exports.default = areOptionsEqual;
|
17468 |
-
|
17469 |
-
var _shallowEqual = __webpack_require__(190);
|
17470 |
-
|
17471 |
-
var _shallowEqual2 = _interopRequireDefault(_shallowEqual);
|
17472 |
-
|
17473 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17474 |
-
|
17475 |
-
function areOptionsEqual(nextOptions, currentOptions) {
|
17476 |
-
if (currentOptions === nextOptions) {
|
17477 |
-
return true;
|
17478 |
-
}
|
17479 |
-
|
17480 |
-
return currentOptions !== null && nextOptions !== null && (0, _shallowEqual2.default)(currentOptions, nextOptions);
|
17481 |
-
}
|
17482 |
-
|
17483 |
-
/***/ }),
|
17484 |
-
/* 287 */
|
17485 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17486 |
-
|
17487 |
-
"use strict";
|
17488 |
-
|
17489 |
-
|
17490 |
-
Object.defineProperty(exports, "__esModule", {
|
17491 |
-
value: true
|
17492 |
-
});
|
17493 |
-
|
17494 |
-
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
17495 |
-
|
17496 |
-
exports.default = isValidType;
|
17497 |
-
|
17498 |
-
var _isArray = __webpack_require__(71);
|
17499 |
-
|
17500 |
-
var _isArray2 = _interopRequireDefault(_isArray);
|
17501 |
-
|
17502 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17503 |
-
|
17504 |
-
function isValidType(type, allowArray) {
|
17505 |
-
return typeof type === 'string' || (typeof type === 'undefined' ? 'undefined' : _typeof(type)) === 'symbol' || allowArray && (0, _isArray2.default)(type) && type.every(function (t) {
|
17506 |
-
return isValidType(t, false);
|
17507 |
-
});
|
17508 |
-
}
|
17509 |
-
|
17510 |
-
/***/ }),
|
17511 |
-
/* 288 */
|
17512 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17513 |
-
|
17514 |
-
"use strict";
|
17515 |
-
|
17516 |
-
|
17517 |
-
Object.defineProperty(exports, "__esModule", {
|
17518 |
-
value: true
|
17519 |
-
});
|
17520 |
-
exports.getEmptyImage = exports.NativeTypes = undefined;
|
17521 |
-
exports.default = createHTML5Backend;
|
17522 |
-
|
17523 |
-
var _HTML5Backend = __webpack_require__(704);
|
17524 |
-
|
17525 |
-
var _HTML5Backend2 = _interopRequireDefault(_HTML5Backend);
|
17526 |
-
|
17527 |
-
var _getEmptyImage = __webpack_require__(730);
|
17528 |
-
|
17529 |
-
var _getEmptyImage2 = _interopRequireDefault(_getEmptyImage);
|
17530 |
-
|
17531 |
-
var _NativeTypes = __webpack_require__(192);
|
17532 |
-
|
17533 |
-
var NativeTypes = _interopRequireWildcard(_NativeTypes);
|
17534 |
-
|
17535 |
-
function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
|
17536 |
-
|
17537 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17538 |
-
|
17539 |
-
exports.NativeTypes = NativeTypes;
|
17540 |
-
exports.getEmptyImage = _getEmptyImage2.default;
|
17541 |
-
function createHTML5Backend(manager) {
|
17542 |
-
return new _HTML5Backend2.default(manager);
|
17543 |
-
}
|
17544 |
-
|
17545 |
-
/***/ }),
|
17546 |
-
/* 289 */
|
17547 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17548 |
-
|
17549 |
-
var defineProperty = __webpack_require__(275);
|
17550 |
-
|
17551 |
-
/**
|
17552 |
-
* The base implementation of `assignValue` and `assignMergeValue` without
|
17553 |
-
* value checks.
|
17554 |
-
*
|
17555 |
-
* @private
|
17556 |
-
* @param {Object} object The object to modify.
|
17557 |
-
* @param {string} key The key of the property to assign.
|
17558 |
-
* @param {*} value The value to assign.
|
17559 |
-
*/
|
17560 |
-
function baseAssignValue(object, key, value) {
|
17561 |
-
if (key == '__proto__' && defineProperty) {
|
17562 |
-
defineProperty(object, key, {
|
17563 |
-
'configurable': true,
|
17564 |
-
'enumerable': true,
|
17565 |
-
'value': value,
|
17566 |
-
'writable': true
|
17567 |
-
});
|
17568 |
-
} else {
|
17569 |
-
object[key] = value;
|
17570 |
-
}
|
17571 |
-
}
|
17572 |
-
|
17573 |
-
module.exports = baseAssignValue;
|
17574 |
-
|
17575 |
-
|
17576 |
-
/***/ }),
|
17577 |
-
/* 290 */
|
17578 |
-
/***/ (function(module, exports) {
|
17579 |
-
|
17580 |
-
/** Used as references for various `Number` constants. */
|
17581 |
-
var MAX_SAFE_INTEGER = 9007199254740991;
|
17582 |
-
|
17583 |
-
/** Used to detect unsigned integer values. */
|
17584 |
-
var reIsUint = /^(?:0|[1-9]\d*)$/;
|
17585 |
-
|
17586 |
-
/**
|
17587 |
-
* Checks if `value` is a valid array-like index.
|
17588 |
-
*
|
17589 |
-
* @private
|
17590 |
-
* @param {*} value The value to check.
|
17591 |
-
* @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
|
17592 |
-
* @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
|
17593 |
-
*/
|
17594 |
-
function isIndex(value, length) {
|
17595 |
-
length = length == null ? MAX_SAFE_INTEGER : length;
|
17596 |
-
return !!length &&
|
17597 |
-
(typeof value == 'number' || reIsUint.test(value)) &&
|
17598 |
-
(value > -1 && value % 1 == 0 && value < length);
|
17599 |
-
}
|
17600 |
-
|
17601 |
-
module.exports = isIndex;
|
17602 |
-
|
17603 |
-
|
17604 |
-
/***/ }),
|
17605 |
-
/* 291 */
|
17606 |
-
/***/ (function(module, exports, __webpack_require__) {
|
17607 |
-
|
17608 |
-
"use strict";
|
17609 |
-
|
17610 |
-
|
17611 |
-
Object.defineProperty(exports, "__esModule", {
|
17612 |
-
value: true
|
17613 |
-
});
|
17614 |
-
exports.isSafari = exports.isFirefox = undefined;
|
17615 |
-
|
17616 |
-
var _memoize = __webpack_require__(726);
|
17617 |
-
|
17618 |
-
var _memoize2 = _interopRequireDefault(_memoize);
|
17619 |
-
|
17620 |
-
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
17621 |
-
|
17622 |
-
var isFirefox = exports.isFirefox = (0, _memoize2.default)(function () {
|
17623 |
-
return (/firefox/i.test(navigator.userAgent)
|
17624 |
-
);
|
17625 |
-
});
|
17626 |
-
var isSafari = exports.isSafari = (0, _memoize2.default)(function () {
|
17627 |
-
return Boolean(window.safari);
|
17628 |
-
});
|
17629 |
-
|
17630 |
-
/***/ }),
|
17631 |
-
/* 292 */
|
17632 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17633 |
-
|
17634 |
-
"use strict";
|
17635 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
17636 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
17637 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react__ = __webpack_require__(2);
|
17638 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_react__);
|
17639 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_prop_types__ = __webpack_require__(0);
|
17640 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_prop_types__);
|
17641 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react_dom__ = __webpack_require__(19);
|
17642 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_react_dom__);
|
17643 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_rc_util_es_KeyCode__ = __webpack_require__(193);
|
17644 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_rc_util_es_createChainedFunction__ = __webpack_require__(749);
|
17645 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_classnames__ = __webpack_require__(47);
|
17646 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_classnames__);
|
17647 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_dom_scroll_into_view__ = __webpack_require__(750);
|
17648 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_dom_scroll_into_view___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_dom_scroll_into_view__);
|
17649 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__util__ = __webpack_require__(128);
|
17650 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__DOMWrap__ = __webpack_require__(753);
|
17651 |
-
|
17652 |
-
|
17653 |
-
|
17654 |
-
|
17655 |
-
|
17656 |
-
|
17657 |
-
|
17658 |
-
|
17659 |
-
|
17660 |
-
|
17661 |
-
|
17662 |
-
function allDisabled(arr) {
|
17663 |
-
if (!arr.length) {
|
17664 |
-
return true;
|
17665 |
-
}
|
17666 |
-
return arr.every(function (c) {
|
17667 |
-
return !!c.props.disabled;
|
17668 |
-
});
|
17669 |
-
}
|
17670 |
-
|
17671 |
-
function getActiveKey(props, originalActiveKey) {
|
17672 |
-
var activeKey = originalActiveKey;
|
17673 |
-
var children = props.children,
|
17674 |
-
eventKey = props.eventKey;
|
17675 |
-
|
17676 |
-
if (activeKey) {
|
17677 |
-
var found = void 0;
|
17678 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__util__["b" /* loopMenuItem */])(children, function (c, i) {
|
17679 |
-
if (c && !c.props.disabled && activeKey === Object(__WEBPACK_IMPORTED_MODULE_8__util__["a" /* getKeyFromChildrenIndex */])(c, eventKey, i)) {
|
17680 |
-
found = true;
|
17681 |
-
}
|
17682 |
-
});
|
17683 |
-
if (found) {
|
17684 |
-
return activeKey;
|
17685 |
-
}
|
17686 |
-
}
|
17687 |
-
activeKey = null;
|
17688 |
-
if (props.defaultActiveFirst) {
|
17689 |
-
Object(__WEBPACK_IMPORTED_MODULE_8__util__["b" /* loopMenuItem */])(children, function (c, i) {
|
17690 |
-
if (!activeKey && c && !c.props.disabled) {
|
17691 |
-
activeKey = Object(__WEBPACK_IMPORTED_MODULE_8__util__["a" /* getKeyFromChildrenIndex */])(c, eventKey, i);
|
17692 |
-
}
|
17693 |
-
});
|
17694 |
-
return activeKey;
|
17695 |
-
}
|
17696 |
-
return activeKey;
|
17697 |
-
}
|
17698 |
-
|
17699 |
-
function saveRef(index, subIndex, c) {
|
17700 |
-
if (c) {
|
17701 |
-
if (subIndex !== undefined) {
|
17702 |
-
this.instanceArray[index] = this.instanceArray[index] || [];
|
17703 |
-
this.instanceArray[index][subIndex] = c;
|
17704 |
-
} else {
|
17705 |
-
this.instanceArray[index] = c;
|
17706 |
-
}
|
17707 |
-
}
|
17708 |
-
}
|
17709 |
-
|
17710 |
-
var MenuMixin = {
|
17711 |
-
propTypes: {
|
17712 |
-
focusable: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.bool,
|
17713 |
-
multiple: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.bool,
|
17714 |
-
style: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.object,
|
17715 |
-
defaultActiveFirst: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.bool,
|
17716 |
-
visible: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.bool,
|
17717 |
-
activeKey: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.string,
|
17718 |
-
selectedKeys: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.arrayOf(__WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.string),
|
17719 |
-
defaultSelectedKeys: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.arrayOf(__WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.string),
|
17720 |
-
defaultOpenKeys: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.arrayOf(__WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.string),
|
17721 |
-
openKeys: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.arrayOf(__WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.string),
|
17722 |
-
children: __WEBPACK_IMPORTED_MODULE_2_prop_types___default.a.any
|
17723 |
-
},
|
17724 |
-
|
17725 |
-
getDefaultProps: function getDefaultProps() {
|
17726 |
-
return {
|
17727 |
-
prefixCls: 'rc-menu',
|
17728 |
-
className: '',
|
17729 |
-
mode: 'vertical',
|
17730 |
-
level: 1,
|
17731 |
-
inlineIndent: 24,
|
17732 |
-
visible: true,
|
17733 |
-
focusable: true,
|
17734 |
-
style: {}
|
17735 |
-
};
|
17736 |
-
},
|
17737 |
-
getInitialState: function getInitialState() {
|
17738 |
-
var props = this.props;
|
17739 |
-
return {
|
17740 |
-
activeKey: getActiveKey(props, props.activeKey)
|
17741 |
-
};
|
17742 |
-
},
|
17743 |
-
componentWillReceiveProps: function componentWillReceiveProps(nextProps) {
|
17744 |
-
var props = void 0;
|
17745 |
-
if ('activeKey' in nextProps) {
|
17746 |
-
props = {
|
17747 |
-
activeKey: getActiveKey(nextProps, nextProps.activeKey)
|
17748 |
-
};
|
17749 |
-
} else {
|
17750 |
-
var originalActiveKey = this.state.activeKey;
|
17751 |
-
var activeKey = getActiveKey(nextProps, originalActiveKey);
|
17752 |
-
// fix: this.setState(), parent.render(),
|
17753 |
-
if (activeKey !== originalActiveKey) {
|
17754 |
-
props = {
|
17755 |
-
activeKey: activeKey
|
17756 |
-
};
|
17757 |
-
}
|
17758 |
-
}
|
17759 |
-
if (props) {
|
17760 |
-
this.setState(props);
|
17761 |
-
}
|
17762 |
-
},
|
17763 |
-
shouldComponentUpdate: function shouldComponentUpdate(nextProps) {
|
17764 |
-
return this.props.visible || nextProps.visible;
|
17765 |
-
},
|
17766 |
-
componentWillMount: function componentWillMount() {
|
17767 |
-
this.instanceArray = [];
|
17768 |
-
},
|
17769 |
-
|
17770 |
-
|
17771 |
-
// all keyboard events callbacks run from here at first
|
17772 |
-
onKeyDown: function onKeyDown(e, callback) {
|
17773 |
-
var _this = this;
|
17774 |
-
|
17775 |
-
var keyCode = e.keyCode;
|
17776 |
-
var handled = void 0;
|
17777 |
-
this.getFlatInstanceArray().forEach(function (obj) {
|
17778 |
-
if (obj && obj.props.active && obj.onKeyDown) {
|
17779 |
-
handled = obj.onKeyDown(e);
|
17780 |
-
}
|
17781 |
-
});
|
17782 |
-
if (handled) {
|
17783 |
-
return 1;
|
17784 |
-
}
|
17785 |
-
var activeItem = null;
|
17786 |
-
if (keyCode === __WEBPACK_IMPORTED_MODULE_4_rc_util_es_KeyCode__["a" /* default */].UP || keyCode === __WEBPACK_IMPORTED_MODULE_4_rc_util_es_KeyCode__["a" /* default */].DOWN) {
|
17787 |
-
activeItem = this.step(keyCode === __WEBPACK_IMPORTED_MODULE_4_rc_util_es_KeyCode__["a" /* default */].UP ? -1 : 1);
|
17788 |
-
}
|
17789 |
-
if (activeItem) {
|
17790 |
-
e.preventDefault();
|
17791 |
-
this.setState({
|
17792 |
-
activeKey: activeItem.props.eventKey
|
17793 |
-
}, function () {
|
17794 |
-
__WEBPACK_IMPORTED_MODULE_7_dom_scroll_into_view___default()(__WEBPACK_IMPORTED_MODULE_3_react_dom___default.a.findDOMNode(activeItem), __WEBPACK_IMPORTED_MODULE_3_react_dom___default.a.findDOMNode(_this), {
|
17795 |
-
onlyScrollIfNeeded: true
|
17796 |
-
});
|
17797 |
-
// https://github.com/react-component/menu/commit/9899a9672f6f028ec3cdf773f1ecea5badd2d33e
|
17798 |
-
if (typeof callback === 'function') {
|
17799 |
-
callback(activeItem);
|
17800 |
-
}
|
17801 |
-
});
|
17802 |
-
return 1;
|
17803 |
-
} else if (activeItem === undefined) {
|
17804 |
-
e.preventDefault();
|
17805 |
-
this.setState({
|
17806 |
-
activeKey: null
|
17807 |
-
});
|
17808 |
-
return 1;
|
17809 |
-
}
|
17810 |
-
},
|
17811 |
-
onItemHover: function onItemHover(e) {
|
17812 |
-
var key = e.key,
|
17813 |
-
hover = e.hover;
|
17814 |
-
|
17815 |
-
this.setState({
|
17816 |
-
activeKey: hover ? key : null
|
17817 |
-
});
|
17818 |
-
},
|
17819 |
-
getFlatInstanceArray: function getFlatInstanceArray() {
|
17820 |
-
var instanceArray = this.instanceArray;
|
17821 |
-
var hasInnerArray = instanceArray.some(function (a) {
|
17822 |
-
return Array.isArray(a);
|
17823 |
-
});
|
17824 |
-
if (hasInnerArray) {
|
17825 |
-
instanceArray = [];
|
17826 |
-
this.instanceArray.forEach(function (a) {
|
17827 |
-
if (Array.isArray(a)) {
|
17828 |
-
instanceArray.push.apply(instanceArray, a);
|
17829 |
-
} else {
|
17830 |
-
instanceArray.push(a);
|
17831 |
-
}
|
17832 |
-
});
|
17833 |
-
this.instanceArray = instanceArray;
|
17834 |
-
}
|
17835 |
-
return instanceArray;
|
17836 |
-
},
|
17837 |
-
renderCommonMenuItem: function renderCommonMenuItem(child, i, subIndex, extraProps) {
|
17838 |
-
var state = this.state;
|
17839 |
-
var props = this.props;
|
17840 |
-
var key = Object(__WEBPACK_IMPORTED_MODULE_8__util__["a" /* getKeyFromChildrenIndex */])(child, props.eventKey, i);
|
17841 |
-
var childProps = child.props;
|
17842 |
-
var isActive = key === state.activeKey;
|
17843 |
-
var newChildProps = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
17844 |
-
mode: props.mode,
|
17845 |
-
level: props.level,
|
17846 |
-
inlineIndent: props.inlineIndent,
|
17847 |
-
renderMenuItem: this.renderMenuItem,
|
17848 |
-
rootPrefixCls: props.prefixCls,
|
17849 |
-
index: i,
|
17850 |
-
parentMenu: this,
|
17851 |
-
ref: childProps.disabled ? undefined : Object(__WEBPACK_IMPORTED_MODULE_5_rc_util_es_createChainedFunction__["a" /* default */])(child.ref, saveRef.bind(this, i, subIndex)),
|
17852 |
-
eventKey: key,
|
17853 |
-
active: !childProps.disabled && isActive,
|
17854 |
-
multiple: props.multiple,
|
17855 |
-
onClick: this.onClick,
|
17856 |
-
onItemHover: this.onItemHover,
|
17857 |
-
openTransitionName: this.getOpenTransitionName(),
|
17858 |
-
openAnimation: props.openAnimation,
|
17859 |
-
subMenuOpenDelay: props.subMenuOpenDelay,
|
17860 |
-
subMenuCloseDelay: props.subMenuCloseDelay,
|
17861 |
-
forceSubMenuRender: props.forceSubMenuRender,
|
17862 |
-
onOpenChange: this.onOpenChange,
|
17863 |
-
onDeselect: this.onDeselect,
|
17864 |
-
onSelect: this.onSelect
|
17865 |
-
}, extraProps);
|
17866 |
-
if (props.mode === 'inline') {
|
17867 |
-
newChildProps.triggerSubMenuAction = 'click';
|
17868 |
-
}
|
17869 |
-
return __WEBPACK_IMPORTED_MODULE_1_react___default.a.cloneElement(child, newChildProps);
|
17870 |
-
},
|
17871 |
-
renderRoot: function renderRoot(props) {
|
17872 |
-
this.instanceArray = [];
|
17873 |
-
var className = __WEBPACK_IMPORTED_MODULE_6_classnames___default()(props.prefixCls, props.className, props.prefixCls + '-' + props.mode);
|
17874 |
-
var domProps = {
|
17875 |
-
className: className,
|
17876 |
-
role: 'menu',
|
17877 |
-
'aria-activedescendant': ''
|
17878 |
-
};
|
17879 |
-
if (props.id) {
|
17880 |
-
domProps.id = props.id;
|
17881 |
-
}
|
17882 |
-
if (props.focusable) {
|
17883 |
-
domProps.tabIndex = '0';
|
17884 |
-
domProps.onKeyDown = this.onKeyDown;
|
17885 |
-
}
|
17886 |
-
return (
|
17887 |
-
// ESLint is not smart enough to know that the type of `children` was checked.
|
17888 |
-
/* eslint-disable */
|
17889 |
-
__WEBPACK_IMPORTED_MODULE_1_react___default.a.createElement(
|
17890 |
-
__WEBPACK_IMPORTED_MODULE_9__DOMWrap__["a" /* default */],
|
17891 |
-
__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
17892 |
-
style: props.style,
|
17893 |
-
tag: 'ul',
|
17894 |
-
hiddenClassName: props.prefixCls + '-hidden',
|
17895 |
-
visible: props.visible
|
17896 |
-
}, domProps),
|
17897 |
-
__WEBPACK_IMPORTED_MODULE_1_react___default.a.Children.map(props.children, this.renderMenuItem)
|
17898 |
-
)
|
17899 |
-
/*eslint-enable */
|
17900 |
-
|
17901 |
-
);
|
17902 |
-
},
|
17903 |
-
step: function step(direction) {
|
17904 |
-
var children = this.getFlatInstanceArray();
|
17905 |
-
var activeKey = this.state.activeKey;
|
17906 |
-
var len = children.length;
|
17907 |
-
if (!len) {
|
17908 |
-
return null;
|
17909 |
-
}
|
17910 |
-
if (direction < 0) {
|
17911 |
-
children = children.concat().reverse();
|
17912 |
-
}
|
17913 |
-
// find current activeIndex
|
17914 |
-
var activeIndex = -1;
|
17915 |
-
children.every(function (c, ci) {
|
17916 |
-
if (c && c.props.eventKey === activeKey) {
|
17917 |
-
activeIndex = ci;
|
17918 |
-
return false;
|
17919 |
-
}
|
17920 |
-
return true;
|
17921 |
-
});
|
17922 |
-
if (!this.props.defaultActiveFirst && activeIndex !== -1) {
|
17923 |
-
if (allDisabled(children.slice(activeIndex, len - 1))) {
|
17924 |
-
return undefined;
|
17925 |
-
}
|
17926 |
-
}
|
17927 |
-
var start = (activeIndex + 1) % len;
|
17928 |
-
var i = start;
|
17929 |
-
for (;;) {
|
17930 |
-
var child = children[i];
|
17931 |
-
if (!child || child.props.disabled) {
|
17932 |
-
i = (i + 1 + len) % len;
|
17933 |
-
// complete a loop
|
17934 |
-
if (i === start) {
|
17935 |
-
return null;
|
17936 |
-
}
|
17937 |
-
} else {
|
17938 |
-
return child;
|
17939 |
-
}
|
17940 |
-
}
|
17941 |
-
}
|
17942 |
-
};
|
17943 |
-
|
17944 |
-
/* harmony default export */ __webpack_exports__["a"] = (MenuMixin);
|
17945 |
-
|
17946 |
-
/***/ }),
|
17947 |
-
/* 293 */
|
17948 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17949 |
-
|
17950 |
-
"use strict";
|
17951 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = addEventListenerWrap;
|
17952 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_add_dom_event_listener__ = __webpack_require__(757);
|
17953 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_add_dom_event_listener___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_add_dom_event_listener__);
|
17954 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react_dom__ = __webpack_require__(19);
|
17955 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_react_dom__);
|
17956 |
-
|
17957 |
-
|
17958 |
-
|
17959 |
-
function addEventListenerWrap(target, eventType, cb) {
|
17960 |
-
/* eslint camelcase: 2 */
|
17961 |
-
var callback = __WEBPACK_IMPORTED_MODULE_1_react_dom___default.a.unstable_batchedUpdates ? function run(e) {
|
17962 |
-
__WEBPACK_IMPORTED_MODULE_1_react_dom___default.a.unstable_batchedUpdates(cb, e);
|
17963 |
-
} : cb;
|
17964 |
-
return __WEBPACK_IMPORTED_MODULE_0_add_dom_event_listener___default()(target, eventType, callback);
|
17965 |
-
}
|
17966 |
-
|
17967 |
-
/***/ }),
|
17968 |
-
/* 294 */
|
17969 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17970 |
-
|
17971 |
-
"use strict";
|
17972 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils__ = __webpack_require__(83);
|
17973 |
-
|
17974 |
-
|
17975 |
-
/**
|
17976 |
-
* 得到会导致元素显示不全的祖先元素
|
17977 |
-
*/
|
17978 |
-
|
17979 |
-
function getOffsetParent(element) {
|
17980 |
-
if (__WEBPACK_IMPORTED_MODULE_0__utils__["a" /* default */].isWindow(element) || element.nodeType === 9) {
|
17981 |
-
return null;
|
17982 |
-
}
|
17983 |
-
// ie 这个也不是完全可行
|
17984 |
-
/*
|
17985 |
-
<div style="width: 50px;height: 100px;overflow: hidden">
|
17986 |
-
<div style="width: 50px;height: 100px;position: relative;" id="d6">
|
17987 |
-
元素 6 高 100px 宽 50px<br/>
|
17988 |
-
</div>
|
17989 |
-
</div>
|
17990 |
-
*/
|
17991 |
-
// element.offsetParent does the right thing in ie7 and below. Return parent with layout!
|
17992 |
-
// In other browsers it only includes elements with position absolute, relative or
|
17993 |
-
// fixed, not elements with overflow set to auto or scroll.
|
17994 |
-
// if (UA.ie && ieMode < 8) {
|
17995 |
-
// return element.offsetParent;
|
17996 |
-
// }
|
17997 |
-
// 统一的 offsetParent 方法
|
17998 |
-
var doc = __WEBPACK_IMPORTED_MODULE_0__utils__["a" /* default */].getDocument(element);
|
17999 |
-
var body = doc.body;
|
18000 |
-
var parent = void 0;
|
18001 |
-
var positionStyle = __WEBPACK_IMPORTED_MODULE_0__utils__["a" /* default */].css(element, 'position');
|
18002 |
-
var skipStatic = positionStyle === 'fixed' || positionStyle === 'absolute';
|
18003 |
-
|
18004 |
-
if (!skipStatic) {
|
18005 |
-
return element.nodeName.toLowerCase() === 'html' ? null : element.parentNode;
|
18006 |
-
}
|
18007 |
-
|
18008 |
-
for (parent = element.parentNode; parent && parent !== body; parent = parent.parentNode) {
|
18009 |
-
positionStyle = __WEBPACK_IMPORTED_MODULE_0__utils__["a" /* default */].css(parent, 'position');
|
18010 |
-
if (positionStyle !== 'static') {
|
18011 |
-
return parent;
|
18012 |
-
}
|
18013 |
-
}
|
18014 |
-
return null;
|
18015 |
-
}
|
18016 |
-
|
18017 |
-
/* harmony default export */ __webpack_exports__["a"] = (getOffsetParent);
|
18018 |
-
|
18019 |
-
/***/ }),
|
18020 |
-
/* 295 */
|
18021 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18022 |
-
|
18023 |
-
"use strict";
|
18024 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
18025 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
18026 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_defineProperty__ = __webpack_require__(772);
|
18027 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_defineProperty___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_defineProperty__);
|
18028 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
18029 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
18030 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(10);
|
18031 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
18032 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
18033 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
18034 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
18035 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
18036 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(2);
|
18037 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
18038 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_prop_types__ = __webpack_require__(0);
|
18039 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_prop_types__);
|
18040 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__ = __webpack_require__(773);
|
18041 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__AnimateChild__ = __webpack_require__(774);
|
18042 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__util__ = __webpack_require__(297);
|
18043 |
-
|
18044 |
-
|
18045 |
-
|
18046 |
-
|
18047 |
-
|
18048 |
-
|
18049 |
-
|
18050 |
-
|
18051 |
-
|
18052 |
-
|
18053 |
-
var defaultKey = 'rc_animate_' + Date.now();
|
18054 |
-
|
18055 |
-
|
18056 |
-
function getChildrenFromProps(props) {
|
18057 |
-
var children = props.children;
|
18058 |
-
if (__WEBPACK_IMPORTED_MODULE_6_react___default.a.isValidElement(children)) {
|
18059 |
-
if (!children.key) {
|
18060 |
-
return __WEBPACK_IMPORTED_MODULE_6_react___default.a.cloneElement(children, {
|
18061 |
-
key: defaultKey
|
18062 |
-
});
|
18063 |
-
}
|
18064 |
-
}
|
18065 |
-
return children;
|
18066 |
-
}
|
18067 |
-
|
18068 |
-
function noop() {}
|
18069 |
-
|
18070 |
-
var Animate = function (_React$Component) {
|
18071 |
-
__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default()(Animate, _React$Component);
|
18072 |
-
|
18073 |
-
// eslint-disable-line
|
18074 |
-
|
18075 |
-
function Animate(props) {
|
18076 |
-
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default()(this, Animate);
|
18077 |
-
|
18078 |
-
var _this = __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default()(this, (Animate.__proto__ || Object.getPrototypeOf(Animate)).call(this, props));
|
18079 |
-
|
18080 |
-
_initialiseProps.call(_this);
|
18081 |
-
|
18082 |
-
_this.currentlyAnimatingKeys = {};
|
18083 |
-
_this.keysToEnter = [];
|
18084 |
-
_this.keysToLeave = [];
|
18085 |
-
|
18086 |
-
_this.state = {
|
18087 |
-
children: Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["e" /* toArrayChildren */])(getChildrenFromProps(props))
|
18088 |
-
};
|
18089 |
-
|
18090 |
-
_this.childrenRefs = {};
|
18091 |
-
return _this;
|
18092 |
-
}
|
18093 |
-
|
18094 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default()(Animate, [{
|
18095 |
-
key: 'componentDidMount',
|
18096 |
-
value: function componentDidMount() {
|
18097 |
-
var _this2 = this;
|
18098 |
-
|
18099 |
-
var showProp = this.props.showProp;
|
18100 |
-
var children = this.state.children;
|
18101 |
-
if (showProp) {
|
18102 |
-
children = children.filter(function (child) {
|
18103 |
-
return !!child.props[showProp];
|
18104 |
-
});
|
18105 |
-
}
|
18106 |
-
children.forEach(function (child) {
|
18107 |
-
if (child) {
|
18108 |
-
_this2.performAppear(child.key);
|
18109 |
-
}
|
18110 |
-
});
|
18111 |
-
}
|
18112 |
-
}, {
|
18113 |
-
key: 'componentWillReceiveProps',
|
18114 |
-
value: function componentWillReceiveProps(nextProps) {
|
18115 |
-
var _this3 = this;
|
18116 |
-
|
18117 |
-
this.nextProps = nextProps;
|
18118 |
-
var nextChildren = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["e" /* toArrayChildren */])(getChildrenFromProps(nextProps));
|
18119 |
-
var props = this.props;
|
18120 |
-
// exclusive needs immediate response
|
18121 |
-
if (props.exclusive) {
|
18122 |
-
Object.keys(this.currentlyAnimatingKeys).forEach(function (key) {
|
18123 |
-
_this3.stop(key);
|
18124 |
-
});
|
18125 |
-
}
|
18126 |
-
var showProp = props.showProp;
|
18127 |
-
var currentlyAnimatingKeys = this.currentlyAnimatingKeys;
|
18128 |
-
// last props children if exclusive
|
18129 |
-
var currentChildren = props.exclusive ? Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["e" /* toArrayChildren */])(getChildrenFromProps(props)) : this.state.children;
|
18130 |
-
// in case destroy in showProp mode
|
18131 |
-
var newChildren = [];
|
18132 |
-
if (showProp) {
|
18133 |
-
currentChildren.forEach(function (currentChild) {
|
18134 |
-
var nextChild = currentChild && Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["a" /* findChildInChildrenByKey */])(nextChildren, currentChild.key);
|
18135 |
-
var newChild = void 0;
|
18136 |
-
if ((!nextChild || !nextChild.props[showProp]) && currentChild.props[showProp]) {
|
18137 |
-
newChild = __WEBPACK_IMPORTED_MODULE_6_react___default.a.cloneElement(nextChild || currentChild, __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_defineProperty___default()({}, showProp, true));
|
18138 |
-
} else {
|
18139 |
-
newChild = nextChild;
|
18140 |
-
}
|
18141 |
-
if (newChild) {
|
18142 |
-
newChildren.push(newChild);
|
18143 |
-
}
|
18144 |
-
});
|
18145 |
-
nextChildren.forEach(function (nextChild) {
|
18146 |
-
if (!nextChild || !Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["a" /* findChildInChildrenByKey */])(currentChildren, nextChild.key)) {
|
18147 |
-
newChildren.push(nextChild);
|
18148 |
-
}
|
18149 |
-
});
|
18150 |
-
} else {
|
18151 |
-
newChildren = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["d" /* mergeChildren */])(currentChildren, nextChildren);
|
18152 |
-
}
|
18153 |
-
|
18154 |
-
// need render to avoid update
|
18155 |
-
this.setState({
|
18156 |
-
children: newChildren
|
18157 |
-
});
|
18158 |
-
|
18159 |
-
nextChildren.forEach(function (child) {
|
18160 |
-
var key = child && child.key;
|
18161 |
-
if (child && currentlyAnimatingKeys[key]) {
|
18162 |
-
return;
|
18163 |
-
}
|
18164 |
-
var hasPrev = child && Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["a" /* findChildInChildrenByKey */])(currentChildren, key);
|
18165 |
-
if (showProp) {
|
18166 |
-
var showInNext = child.props[showProp];
|
18167 |
-
if (hasPrev) {
|
18168 |
-
var showInNow = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["b" /* findShownChildInChildrenByKey */])(currentChildren, key, showProp);
|
18169 |
-
if (!showInNow && showInNext) {
|
18170 |
-
_this3.keysToEnter.push(key);
|
18171 |
-
}
|
18172 |
-
} else if (showInNext) {
|
18173 |
-
_this3.keysToEnter.push(key);
|
18174 |
-
}
|
18175 |
-
} else if (!hasPrev) {
|
18176 |
-
_this3.keysToEnter.push(key);
|
18177 |
-
}
|
18178 |
-
});
|
18179 |
-
|
18180 |
-
currentChildren.forEach(function (child) {
|
18181 |
-
var key = child && child.key;
|
18182 |
-
if (child && currentlyAnimatingKeys[key]) {
|
18183 |
-
return;
|
18184 |
-
}
|
18185 |
-
var hasNext = child && Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["a" /* findChildInChildrenByKey */])(nextChildren, key);
|
18186 |
-
if (showProp) {
|
18187 |
-
var showInNow = child.props[showProp];
|
18188 |
-
if (hasNext) {
|
18189 |
-
var showInNext = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["b" /* findShownChildInChildrenByKey */])(nextChildren, key, showProp);
|
18190 |
-
if (!showInNext && showInNow) {
|
18191 |
-
_this3.keysToLeave.push(key);
|
18192 |
-
}
|
18193 |
-
} else if (showInNow) {
|
18194 |
-
_this3.keysToLeave.push(key);
|
18195 |
-
}
|
18196 |
-
} else if (!hasNext) {
|
18197 |
-
_this3.keysToLeave.push(key);
|
18198 |
-
}
|
18199 |
-
});
|
18200 |
-
}
|
18201 |
-
}, {
|
18202 |
-
key: 'componentDidUpdate',
|
18203 |
-
value: function componentDidUpdate() {
|
18204 |
-
var keysToEnter = this.keysToEnter;
|
18205 |
-
this.keysToEnter = [];
|
18206 |
-
keysToEnter.forEach(this.performEnter);
|
18207 |
-
var keysToLeave = this.keysToLeave;
|
18208 |
-
this.keysToLeave = [];
|
18209 |
-
keysToLeave.forEach(this.performLeave);
|
18210 |
-
}
|
18211 |
-
}, {
|
18212 |
-
key: 'isValidChildByKey',
|
18213 |
-
value: function isValidChildByKey(currentChildren, key) {
|
18214 |
-
var showProp = this.props.showProp;
|
18215 |
-
if (showProp) {
|
18216 |
-
return Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["b" /* findShownChildInChildrenByKey */])(currentChildren, key, showProp);
|
18217 |
-
}
|
18218 |
-
return Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["a" /* findChildInChildrenByKey */])(currentChildren, key);
|
18219 |
-
}
|
18220 |
-
}, {
|
18221 |
-
key: 'stop',
|
18222 |
-
value: function stop(key) {
|
18223 |
-
delete this.currentlyAnimatingKeys[key];
|
18224 |
-
var component = this.childrenRefs[key];
|
18225 |
-
if (component) {
|
18226 |
-
component.stop();
|
18227 |
-
}
|
18228 |
-
}
|
18229 |
-
}, {
|
18230 |
-
key: 'render',
|
18231 |
-
value: function render() {
|
18232 |
-
var _this4 = this;
|
18233 |
-
|
18234 |
-
var props = this.props;
|
18235 |
-
this.nextProps = props;
|
18236 |
-
var stateChildren = this.state.children;
|
18237 |
-
var children = null;
|
18238 |
-
if (stateChildren) {
|
18239 |
-
children = stateChildren.map(function (child) {
|
18240 |
-
if (child === null || child === undefined) {
|
18241 |
-
return child;
|
18242 |
-
}
|
18243 |
-
if (!child.key) {
|
18244 |
-
throw new Error('must set key for <rc-animate> children');
|
18245 |
-
}
|
18246 |
-
return __WEBPACK_IMPORTED_MODULE_6_react___default.a.createElement(
|
18247 |
-
__WEBPACK_IMPORTED_MODULE_9__AnimateChild__["a" /* default */],
|
18248 |
-
{
|
18249 |
-
key: child.key,
|
18250 |
-
ref: function ref(node) {
|
18251 |
-
return _this4.childrenRefs[child.key] = node;
|
18252 |
-
},
|
18253 |
-
animation: props.animation,
|
18254 |
-
transitionName: props.transitionName,
|
18255 |
-
transitionEnter: props.transitionEnter,
|
18256 |
-
transitionAppear: props.transitionAppear,
|
18257 |
-
transitionLeave: props.transitionLeave
|
18258 |
-
},
|
18259 |
-
child
|
18260 |
-
);
|
18261 |
-
});
|
18262 |
-
}
|
18263 |
-
var Component = props.component;
|
18264 |
-
if (Component) {
|
18265 |
-
var passedProps = props;
|
18266 |
-
if (typeof Component === 'string') {
|
18267 |
-
passedProps = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({
|
18268 |
-
className: props.className,
|
18269 |
-
style: props.style
|
18270 |
-
}, props.componentProps);
|
18271 |
-
}
|
18272 |
-
return __WEBPACK_IMPORTED_MODULE_6_react___default.a.createElement(
|
18273 |
-
Component,
|
18274 |
-
passedProps,
|
18275 |
-
children
|
18276 |
-
);
|
18277 |
-
}
|
18278 |
-
return children[0] || null;
|
18279 |
-
}
|
18280 |
-
}]);
|
18281 |
-
|
18282 |
-
return Animate;
|
18283 |
-
}(__WEBPACK_IMPORTED_MODULE_6_react___default.a.Component);
|
18284 |
-
|
18285 |
-
Animate.isAnimate = true;
|
18286 |
-
Animate.propTypes = {
|
18287 |
-
component: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.any,
|
18288 |
-
componentProps: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.object,
|
18289 |
-
animation: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.object,
|
18290 |
-
transitionName: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.oneOfType([__WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.string, __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.object]),
|
18291 |
-
transitionEnter: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.bool,
|
18292 |
-
transitionAppear: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.bool,
|
18293 |
-
exclusive: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.bool,
|
18294 |
-
transitionLeave: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.bool,
|
18295 |
-
onEnd: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.func,
|
18296 |
-
onEnter: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.func,
|
18297 |
-
onLeave: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.func,
|
18298 |
-
onAppear: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.func,
|
18299 |
-
showProp: __WEBPACK_IMPORTED_MODULE_7_prop_types___default.a.string
|
18300 |
-
};
|
18301 |
-
Animate.defaultProps = {
|
18302 |
-
animation: {},
|
18303 |
-
component: 'span',
|
18304 |
-
componentProps: {},
|
18305 |
-
transitionEnter: true,
|
18306 |
-
transitionLeave: true,
|
18307 |
-
transitionAppear: false,
|
18308 |
-
onEnd: noop,
|
18309 |
-
onEnter: noop,
|
18310 |
-
onLeave: noop,
|
18311 |
-
onAppear: noop
|
18312 |
-
};
|
18313 |
-
|
18314 |
-
var _initialiseProps = function _initialiseProps() {
|
18315 |
-
var _this5 = this;
|
18316 |
-
|
18317 |
-
this.performEnter = function (key) {
|
18318 |
-
// may already remove by exclusive
|
18319 |
-
if (_this5.childrenRefs[key]) {
|
18320 |
-
_this5.currentlyAnimatingKeys[key] = true;
|
18321 |
-
_this5.childrenRefs[key].componentWillEnter(_this5.handleDoneAdding.bind(_this5, key, 'enter'));
|
18322 |
-
}
|
18323 |
-
};
|
18324 |
-
|
18325 |
-
this.performAppear = function (key) {
|
18326 |
-
if (_this5.childrenRefs[key]) {
|
18327 |
-
_this5.currentlyAnimatingKeys[key] = true;
|
18328 |
-
_this5.childrenRefs[key].componentWillAppear(_this5.handleDoneAdding.bind(_this5, key, 'appear'));
|
18329 |
-
}
|
18330 |
-
};
|
18331 |
-
|
18332 |
-
this.handleDoneAdding = function (key, type) {
|
18333 |
-
var props = _this5.props;
|
18334 |
-
delete _this5.currentlyAnimatingKeys[key];
|
18335 |
-
// if update on exclusive mode, skip check
|
18336 |
-
if (props.exclusive && props !== _this5.nextProps) {
|
18337 |
-
return;
|
18338 |
-
}
|
18339 |
-
var currentChildren = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["e" /* toArrayChildren */])(getChildrenFromProps(props));
|
18340 |
-
if (!_this5.isValidChildByKey(currentChildren, key)) {
|
18341 |
-
// exclusive will not need this
|
18342 |
-
_this5.performLeave(key);
|
18343 |
-
} else {
|
18344 |
-
if (type === 'appear') {
|
18345 |
-
if (__WEBPACK_IMPORTED_MODULE_10__util__["a" /* default */].allowAppearCallback(props)) {
|
18346 |
-
props.onAppear(key);
|
18347 |
-
props.onEnd(key, true);
|
18348 |
-
}
|
18349 |
-
} else {
|
18350 |
-
if (__WEBPACK_IMPORTED_MODULE_10__util__["a" /* default */].allowEnterCallback(props)) {
|
18351 |
-
props.onEnter(key);
|
18352 |
-
props.onEnd(key, true);
|
18353 |
-
}
|
18354 |
-
}
|
18355 |
-
}
|
18356 |
-
};
|
18357 |
-
|
18358 |
-
this.performLeave = function (key) {
|
18359 |
-
// may already remove by exclusive
|
18360 |
-
if (_this5.childrenRefs[key]) {
|
18361 |
-
_this5.currentlyAnimatingKeys[key] = true;
|
18362 |
-
_this5.childrenRefs[key].componentWillLeave(_this5.handleDoneLeaving.bind(_this5, key));
|
18363 |
-
}
|
18364 |
-
};
|
18365 |
-
|
18366 |
-
this.handleDoneLeaving = function (key) {
|
18367 |
-
var props = _this5.props;
|
18368 |
-
delete _this5.currentlyAnimatingKeys[key];
|
18369 |
-
// if update on exclusive mode, skip check
|
18370 |
-
if (props.exclusive && props !== _this5.nextProps) {
|
18371 |
-
return;
|
18372 |
-
}
|
18373 |
-
var currentChildren = Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["e" /* toArrayChildren */])(getChildrenFromProps(props));
|
18374 |
-
// in case state change is too fast
|
18375 |
-
if (_this5.isValidChildByKey(currentChildren, key)) {
|
18376 |
-
_this5.performEnter(key);
|
18377 |
-
} else {
|
18378 |
-
var end = function end() {
|
18379 |
-
if (__WEBPACK_IMPORTED_MODULE_10__util__["a" /* default */].allowLeaveCallback(props)) {
|
18380 |
-
props.onLeave(key);
|
18381 |
-
props.onEnd(key, false);
|
18382 |
-
}
|
18383 |
-
};
|
18384 |
-
if (!Object(__WEBPACK_IMPORTED_MODULE_8__ChildrenUtils__["c" /* isSameChildren */])(_this5.state.children, currentChildren, props.showProp)) {
|
18385 |
-
_this5.setState({
|
18386 |
-
children: currentChildren
|
18387 |
-
}, end);
|
18388 |
-
} else {
|
18389 |
-
end();
|
18390 |
-
}
|
18391 |
-
}
|
18392 |
-
};
|
18393 |
-
};
|
18394 |
-
|
18395 |
-
/* harmony default export */ __webpack_exports__["a"] = (Animate);
|
18396 |
-
|
18397 |
-
/***/ }),
|
18398 |
-
/* 296 */
|
18399 |
-
/***/ (function(module, exports) {
|
18400 |
-
|
18401 |
-
module.exports = function(arr, obj){
|
18402 |
-
if (arr.indexOf) return arr.indexOf(obj);
|
18403 |
-
for (var i = 0; i < arr.length; ++i) {
|
18404 |
-
if (arr[i] === obj) return i;
|
18405 |
-
}
|
18406 |
-
return -1;
|
18407 |
-
};
|
18408 |
-
|
18409 |
-
/***/ }),
|
18410 |
-
/* 297 */
|
18411 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18412 |
-
|
18413 |
-
"use strict";
|
18414 |
-
var util = {
|
18415 |
-
isAppearSupported: function isAppearSupported(props) {
|
18416 |
-
return props.transitionName && props.transitionAppear || props.animation.appear;
|
18417 |
-
},
|
18418 |
-
isEnterSupported: function isEnterSupported(props) {
|
18419 |
-
return props.transitionName && props.transitionEnter || props.animation.enter;
|
18420 |
-
},
|
18421 |
-
isLeaveSupported: function isLeaveSupported(props) {
|
18422 |
-
return props.transitionName && props.transitionLeave || props.animation.leave;
|
18423 |
-
},
|
18424 |
-
allowAppearCallback: function allowAppearCallback(props) {
|
18425 |
-
return props.transitionAppear || props.animation.appear;
|
18426 |
-
},
|
18427 |
-
allowEnterCallback: function allowEnterCallback(props) {
|
18428 |
-
return props.transitionEnter || props.animation.enter;
|
18429 |
-
},
|
18430 |
-
allowLeaveCallback: function allowLeaveCallback(props) {
|
18431 |
-
return props.transitionLeave || props.animation.leave;
|
18432 |
-
}
|
18433 |
-
};
|
18434 |
-
/* harmony default export */ __webpack_exports__["a"] = (util);
|
18435 |
-
|
18436 |
-
/***/ }),
|
18437 |
-
/* 298 */
|
18438 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18439 |
-
|
18440 |
-
"use strict";
|
18441 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__ = __webpack_require__(116);
|
18442 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__);
|
18443 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__ = __webpack_require__(8);
|
18444 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__);
|
18445 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(12);
|
18446 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn__);
|
18447 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits__ = __webpack_require__(13);
|
18448 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits__);
|
18449 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_react__ = __webpack_require__(2);
|
18450 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_react__);
|
18451 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_prop_types__ = __webpack_require__(0);
|
18452 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_prop_types__);
|
18453 |
-
|
18454 |
-
|
18455 |
-
|
18456 |
-
|
18457 |
-
|
18458 |
-
|
18459 |
-
|
18460 |
-
var LazyRenderBox = function (_Component) {
|
18461 |
-
__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_inherits___default()(LazyRenderBox, _Component);
|
18462 |
-
|
18463 |
-
function LazyRenderBox() {
|
18464 |
-
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default()(this, LazyRenderBox);
|
18465 |
-
|
18466 |
-
return __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_possibleConstructorReturn___default()(this, _Component.apply(this, arguments));
|
18467 |
-
}
|
18468 |
-
|
18469 |
-
LazyRenderBox.prototype.shouldComponentUpdate = function shouldComponentUpdate(nextProps) {
|
18470 |
-
return nextProps.hiddenClassName || nextProps.visible;
|
18471 |
-
};
|
18472 |
-
|
18473 |
-
LazyRenderBox.prototype.render = function render() {
|
18474 |
-
var _props = this.props,
|
18475 |
-
hiddenClassName = _props.hiddenClassName,
|
18476 |
-
visible = _props.visible,
|
18477 |
-
props = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default()(_props, ['hiddenClassName', 'visible']);
|
18478 |
-
|
18479 |
-
if (hiddenClassName || __WEBPACK_IMPORTED_MODULE_4_react___default.a.Children.count(props.children) > 1) {
|
18480 |
-
if (!visible && hiddenClassName) {
|
18481 |
-
props.className += ' ' + hiddenClassName;
|
18482 |
-
}
|
18483 |
-
return __WEBPACK_IMPORTED_MODULE_4_react___default.a.createElement('div', props);
|
18484 |
-
}
|
18485 |
-
|
18486 |
-
return __WEBPACK_IMPORTED_MODULE_4_react___default.a.Children.only(props.children);
|
18487 |
-
};
|
18488 |
-
|
18489 |
-
return LazyRenderBox;
|
18490 |
-
}(__WEBPACK_IMPORTED_MODULE_4_react__["Component"]);
|
18491 |
-
|
18492 |
-
LazyRenderBox.propTypes = {
|
18493 |
-
children: __WEBPACK_IMPORTED_MODULE_5_prop_types___default.a.any,
|
18494 |
-
className: __WEBPACK_IMPORTED_MODULE_5_prop_types___default.a.string,
|
18495 |
-
visible: __WEBPACK_IMPORTED_MODULE_5_prop_types___default.a.bool,
|
18496 |
-
hiddenClassName: __WEBPACK_IMPORTED_MODULE_5_prop_types___default.a.string
|
18497 |
-
};
|
18498 |
-
|
18499 |
-
|
18500 |
-
/* harmony default export */ __webpack_exports__["a"] = (LazyRenderBox);
|
18501 |
-
|
18502 |
-
/***/ }),
|
18503 |
-
/* 299 */
|
18504 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18505 |
-
|
18506 |
-
"use strict";
|
18507 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = getAlignFromPlacement;
|
18508 |
-
/* harmony export (immutable) */ __webpack_exports__["b"] = getPopupClassNameFromAlign;
|
18509 |
-
/* harmony export (immutable) */ __webpack_exports__["c"] = saveRef;
|
18510 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(17);
|
18511 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
18512 |
-
|
18513 |
-
function isPointsEq(a1, a2) {
|
18514 |
-
return a1[0] === a2[0] && a1[1] === a2[1];
|
18515 |
-
}
|
18516 |
-
|
18517 |
-
function getAlignFromPlacement(builtinPlacements, placementStr, align) {
|
18518 |
-
var baseAlign = builtinPlacements[placementStr] || {};
|
18519 |
-
return __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default()({}, baseAlign, align);
|
18520 |
-
}
|
18521 |
-
|
18522 |
-
function getPopupClassNameFromAlign(builtinPlacements, prefixCls, align) {
|
18523 |
-
var points = align.points;
|
18524 |
-
for (var placement in builtinPlacements) {
|
18525 |
-
if (builtinPlacements.hasOwnProperty(placement)) {
|
18526 |
-
if (isPointsEq(builtinPlacements[placement].points, points)) {
|
18527 |
-
return prefixCls + '-placement-' + placement;
|
18528 |
-
}
|
18529 |
-
}
|
18530 |
-
}
|
18531 |
-
return '';
|
18532 |
-
}
|
18533 |
-
|
18534 |
-
function saveRef(name, component) {
|
18535 |
-
this[name] = component;
|
18536 |
-
}
|
18537 |
-
|
18538 |
-
/***/ }),
|
18539 |
-
/* 300 */
|
18540 |
-
/***/ (function(module, exports, __webpack_require__) {
|
18541 |
-
|
18542 |
-
// style-loader: Adds some css to the DOM by adding a <style> tag
|
18543 |
-
|
18544 |
-
// load the styles
|
18545 |
-
var content = __webpack_require__(788);
|
18546 |
-
if(typeof content === 'string') content = [[module.i, content, '']];
|
18547 |
-
// Prepare cssTransformation
|
18548 |
-
var transform;
|
18549 |
-
|
18550 |
-
var options = {"hmr":true}
|
18551 |
-
options.transform = transform
|
18552 |
-
// add the styles to the DOM
|
18553 |
-
var update = __webpack_require__(33)(content, options);
|
18554 |
-
if(content.locals) module.exports = content.locals;
|
18555 |
-
// Hot Module Replacement
|
18556 |
-
if(false) {
|
18557 |
-
// When the styles change, update the <style> tags
|
18558 |
-
if(!content.locals) {
|
18559 |
-
module.hot.accept("!!../../css-loader/index.js?modules&-autoprefixer&importLoaders=1&localIdentName=[local]!../../sass-loader/lib/loader.js!./balloon.scss", function() {
|
18560 |
-
var newContent = require("!!../../css-loader/index.js?modules&-autoprefixer&importLoaders=1&localIdentName=[local]!../../sass-loader/lib/loader.js!./balloon.scss");
|
18561 |
-
if(typeof newContent === 'string') newContent = [[module.id, newContent, '']];
|
18562 |
-
update(newContent);
|
18563 |
-
});
|
18564 |
-
}
|
18565 |
-
// When the module is disposed, remove the <style> tags
|
18566 |
-
module.hot.dispose(function() { update(); });
|
18567 |
-
}
|
18568 |
-
|
18569 |
-
/***/ }),
|
18570 |
-
/* 301 */
|
18571 |
-
/***/ (function(module, exports, __webpack_require__) {
|
18572 |
-
|
18573 |
-
"use strict";
|
18574 |
-
|
18575 |
-
|
18576 |
-
Object.defineProperty(exports, "__esModule", {
|
18577 |
-
value: true
|
18578 |
-
});
|
1 |
+
/******/ (function(modules) { // webpackBootstrap
|
2 |
+
/******/ // install a JSONP callback for chunk loading
|
3 |
+
/******/ var parentJsonpFunction = window["webpackJsonp"];
|
4 |
+
/******/ window["webpackJsonp"] = function webpackJsonpCallback(chunkIds, moreModules, executeModules) {
|
5 |
+
/******/ // add "moreModules" to the modules object,
|
6 |
+
/******/ // then flag all "chunkIds" as loaded and fire callback
|
7 |
+
/******/ var moduleId, chunkId, i = 0, resolves = [], result;
|
8 |
+
/******/ for(;i < chunkIds.length; i++) {
|
9 |
+
/******/ chunkId = chunkIds[i];
|
10 |
+
/******/ if(installedChunks[chunkId]) {
|
11 |
+
/******/ resolves.push(installedChunks[chunkId][0]);
|
12 |
+
/******/ }
|
13 |
+
/******/ installedChunks[chunkId] = 0;
|
14 |
+
/******/ }
|
15 |
+
/******/ for(moduleId in moreModules) {
|
16 |
+
/******/ if(Object.prototype.hasOwnProperty.call(moreModules, moduleId)) {
|
17 |
+
/******/ modules[moduleId] = moreModules[moduleId];
|
18 |
+
/******/ }
|
19 |
+
/******/ }
|
20 |
+
/******/ if(parentJsonpFunction) parentJsonpFunction(chunkIds, moreModules, executeModules);
|
21 |
+
/******/ while(resolves.length) {
|
22 |
+
/******/ resolves.shift()();
|
23 |
+
/******/ }
|
24 |
+
/******/ if(executeModules) {
|
25 |
+
/******/ for(i=0; i < executeModules.length; i++) {
|
26 |
+
/******/ result = __webpack_require__(__webpack_require__.s = executeModules[i]);
|
27 |
+
/******/ }
|
28 |
+
/******/ }
|
29 |
+
/******/ return result;
|
30 |
+
/******/ };
|
31 |
+
/******/
|
32 |
+
/******/ // The module cache
|
33 |
+
/******/ var installedModules = {};
|
34 |
+
/******/
|
35 |
+
/******/ // objects to store loaded and loading chunks
|
36 |
+
/******/ var installedChunks = {
|
37 |
+
/******/ 1: 0
|
38 |
+
/******/ };
|
39 |
+
/******/
|
40 |
+
/******/ // The require function
|
41 |
+
/******/ function __webpack_require__(moduleId) {
|
42 |
+
/******/
|
43 |
+
/******/ // Check if module is in cache
|
44 |
+
/******/ if(installedModules[moduleId]) {
|
45 |
+
/******/ return installedModules[moduleId].exports;
|
46 |
+
/******/ }
|
47 |
+
/******/ // Create a new module (and put it into the cache)
|
48 |
+
/******/ var module = installedModules[moduleId] = {
|
49 |
+
/******/ i: moduleId,
|
50 |
+
/******/ l: false,
|
51 |
+
/******/ exports: {}
|
52 |
+
/******/ };
|
53 |
+
/******/
|
54 |
+
/******/ // Execute the module function
|
55 |
+
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
56 |
+
/******/
|
57 |
+
/******/ // Flag the module as loaded
|
58 |
+
/******/ module.l = true;
|
59 |
+
/******/
|
60 |
+
/******/ // Return the exports of the module
|
61 |
+
/******/ return module.exports;
|
62 |
+
/******/ }
|
63 |
+
/******/
|
64 |
+
/******/ // This file contains only the entry chunk.
|
65 |
+
/******/ // The chunk loading function for additional chunks
|
66 |
+
/******/ __webpack_require__.e = function requireEnsure(chunkId) {
|
67 |
+
/******/ var installedChunkData = installedChunks[chunkId];
|
68 |
+
/******/ if(installedChunkData === 0) {
|
69 |
+
/******/ return new Promise(function(resolve) { resolve(); });
|
70 |
+
/******/ }
|
71 |
+
/******/
|
72 |
+
/******/ // a Promise means "currently loading".
|
73 |
+
/******/ if(installedChunkData) {
|
74 |
+
/******/ return installedChunkData[2];
|
75 |
+
/******/ }
|
76 |
+
/******/
|
77 |
+
/******/ // setup Promise in chunk cache
|
78 |
+
/******/ var promise = new Promise(function(resolve, reject) {
|
79 |
+
/******/ installedChunkData = installedChunks[chunkId] = [resolve, reject];
|
80 |
+
/******/ });
|
81 |
+
/******/ installedChunkData[2] = promise;
|
82 |
+
/******/
|
83 |
+
/******/ // start chunk loading
|
84 |
+
/******/ var head = document.getElementsByTagName('head')[0];
|
85 |
+
/******/ var script = document.createElement('script');
|
86 |
+
/******/ script.type = 'text/javascript';
|
87 |
+
/******/ script.charset = 'utf-8';
|
88 |
+
/******/ script.async = true;
|
89 |
+
/******/ script.timeout = 120000;
|
90 |
+
/******/
|
91 |
+
/******/ if (__webpack_require__.nc) {
|
92 |
+
/******/ script.setAttribute("nonce", __webpack_require__.nc);
|
93 |
+
/******/ }
|
94 |
+
/******/ script.src = __webpack_require__.p + "dist/" + chunkId + ".js";
|
95 |
+
/******/ var timeout = setTimeout(onScriptComplete, 120000);
|
96 |
+
/******/ script.onerror = script.onload = onScriptComplete;
|
97 |
+
/******/ function onScriptComplete() {
|
98 |
+
/******/ // avoid mem leaks in IE.
|
99 |
+
/******/ script.onerror = script.onload = null;
|
100 |
+
/******/ clearTimeout(timeout);
|
101 |
+
/******/ var chunk = installedChunks[chunkId];
|
102 |
+
/******/ if(chunk !== 0) {
|
103 |
+
/******/ if(chunk) {
|
104 |
+
/******/ chunk[1](new Error('Loading chunk ' + chunkId + ' failed.'));
|
105 |
+
/******/ }
|
106 |
+
/******/ installedChunks[chunkId] = undefined;
|
107 |
+
/******/ }
|
108 |
+
/******/ };
|
109 |
+
/******/ head.appendChild(script);
|
110 |
+
/******/
|
111 |
+
/******/ return promise;
|
112 |
+
/******/ };
|
113 |
+
/******/
|
114 |
+
/******/ // expose the modules object (__webpack_modules__)
|
115 |
+
/******/ __webpack_require__.m = modules;
|
116 |
+
/******/
|
117 |
+
/******/ // expose the module cache
|
118 |
+
/******/ __webpack_require__.c = installedModules;
|
119 |
+
/******/
|
120 |
+
/******/ // define getter function for harmony exports
|
121 |
+
/******/ __webpack_require__.d = function(exports, name, getter) {
|
122 |
+
/******/ if(!__webpack_require__.o(exports, name)) {
|
123 |
+
/******/ Object.defineProperty(exports, name, {
|
124 |
+
/******/ configurable: false,
|
125 |
+
/******/ enumerable: true,
|
126 |
+
/******/ get: getter
|
127 |
+
/******/ });
|
128 |
+
/******/ }
|
129 |
+
/******/ };
|
130 |
+
/******/
|
131 |
+
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
132 |
+
/******/ __webpack_require__.n = function(module) {
|
133 |
+
/******/ var getter = module && module.__esModule ?
|
134 |
+
/******/ function getDefault() { return module['default']; } :
|
135 |
+
/******/ function getModuleExports() { return module; };
|
136 |
+
/******/ __webpack_require__.d(getter, 'a', getter);
|
137 |
+
/******/ return getter;
|
138 |
+
/******/ };
|
139 |
+
/******/
|
140 |
+
/******/ // Object.prototype.hasOwnProperty.call
|
141 |
+
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
|
142 |
+
/******/
|
143 |
+
/******/ // __webpack_public_path__
|
144 |
+
/******/ __webpack_require__.p = "";
|
145 |
+
/******/
|
146 |
+
/******/ // on error function for async loading
|
147 |
+
/******/ __webpack_require__.oe = function(err) { console.error(err); throw err; };
|
148 |
+
/******/
|
149 |
+
/******/ // Load entry module and return exports
|
150 |
+
/******/ return __webpack_require__(__webpack_require__.s = 193);
|
151 |
+
/******/ })
|
152 |
+
/************************************************************************/
|
153 |
+
/******/ ([
|
154 |
+
/* 0 */
|
155 |
+
/***/ (function(module, exports, __webpack_require__) {
|
156 |
+
|
157 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
158 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
159 |
+
*
|
160 |
+
* This source code is licensed under the MIT license found in the
|
161 |
+
* LICENSE file in the root directory of this source tree.
|
162 |
+
*/
|
163 |
+
|
164 |
+
if (process.env.NODE_ENV !== 'production') {
|
165 |
+
var REACT_ELEMENT_TYPE = (typeof Symbol === 'function' &&
|
166 |
+
Symbol.for &&
|
167 |
+
Symbol.for('react.element')) ||
|
168 |
+
0xeac7;
|
169 |
+
|
170 |
+
var isValidElement = function(object) {
|
171 |
+
return typeof object === 'object' &&
|
172 |
+
object !== null &&
|
173 |
+
object.$$typeof === REACT_ELEMENT_TYPE;
|
174 |
+
};
|
175 |
+
|
176 |
+
// By explicitly using `prop-types` you are opting into new development behavior.
|
177 |
+
// http://fb.me/prop-types-in-prod
|
178 |
+
var throwOnDirectAccess = true;
|
179 |
+
module.exports = __webpack_require__(249)(isValidElement, throwOnDirectAccess);
|
180 |
+
} else {
|
181 |
+
// By explicitly using `prop-types` you are opting into new production behavior.
|
182 |
+
// http://fb.me/prop-types-in-prod
|
183 |
+
module.exports = __webpack_require__(250)();
|
184 |
+
}
|
185 |
+
|
186 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
187 |
+
|
188 |
+
/***/ }),
|
189 |
+
/* 1 */
|
190 |
+
/***/ (function(module, exports, __webpack_require__) {
|
191 |
+
|
192 |
+
"use strict";
|
193 |
+
/* WEBPACK VAR INJECTION */(function(process) {
|
194 |
+
|
195 |
+
if (process.env.NODE_ENV === 'production') {
|
196 |
+
module.exports = __webpack_require__(198);
|
197 |
+
} else {
|
198 |
+
module.exports = __webpack_require__(199);
|
199 |
+
}
|
200 |
+
|
201 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
202 |
+
|
203 |
+
/***/ }),
|
204 |
+
/* 2 */
|
205 |
+
/***/ (function(module, exports, __webpack_require__) {
|
206 |
+
|
207 |
+
"use strict";
|
208 |
+
|
209 |
+
|
210 |
+
exports.__esModule = true;
|
211 |
+
|
212 |
+
exports.default = function (instance, Constructor) {
|
213 |
+
if (!(instance instanceof Constructor)) {
|
214 |
+
throw new TypeError("Cannot call a class as a function");
|
215 |
+
}
|
216 |
+
};
|
217 |
+
|
218 |
+
/***/ }),
|
219 |
+
/* 3 */
|
220 |
+
/***/ (function(module, exports, __webpack_require__) {
|
221 |
+
|
222 |
+
"use strict";
|
223 |
+
|
224 |
+
|
225 |
+
exports.__esModule = true;
|
226 |
+
|
227 |
+
var _defineProperty = __webpack_require__(132);
|
228 |
+
|
229 |
+
var _defineProperty2 = _interopRequireDefault(_defineProperty);
|
230 |
+
|
231 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
232 |
+
|
233 |
+
exports.default = function () {
|
234 |
+
function defineProperties(target, props) {
|
235 |
+
for (var i = 0; i < props.length; i++) {
|
236 |
+
var descriptor = props[i];
|
237 |
+
descriptor.enumerable = descriptor.enumerable || false;
|
238 |
+
descriptor.configurable = true;
|
239 |
+
if ("value" in descriptor) descriptor.writable = true;
|
240 |
+
(0, _defineProperty2.default)(target, descriptor.key, descriptor);
|
241 |
+
}
|
242 |
+
}
|
243 |
+
|
244 |
+
return function (Constructor, protoProps, staticProps) {
|
245 |
+
if (protoProps) defineProperties(Constructor.prototype, protoProps);
|
246 |
+
if (staticProps) defineProperties(Constructor, staticProps);
|
247 |
+
return Constructor;
|
248 |
+
};
|
249 |
+
}();
|
250 |
+
|
251 |
+
/***/ }),
|
252 |
+
/* 4 */
|
253 |
+
/***/ (function(module, exports, __webpack_require__) {
|
254 |
+
|
255 |
+
"use strict";
|
256 |
+
|
257 |
+
|
258 |
+
exports.__esModule = true;
|
259 |
+
|
260 |
+
var _assign = __webpack_require__(230);
|
261 |
+
|
262 |
+
var _assign2 = _interopRequireDefault(_assign);
|
263 |
+
|
264 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
265 |
+
|
266 |
+
exports.default = _assign2.default || function (target) {
|
267 |
+
for (var i = 1; i < arguments.length; i++) {
|
268 |
+
var source = arguments[i];
|
269 |
+
|
270 |
+
for (var key in source) {
|
271 |
+
if (Object.prototype.hasOwnProperty.call(source, key)) {
|
272 |
+
target[key] = source[key];
|
273 |
+
}
|
274 |
+
}
|
275 |
+
}
|
276 |
+
|
277 |
+
return target;
|
278 |
+
};
|
279 |
+
|
280 |
+
/***/ }),
|
281 |
+
/* 5 */
|
282 |
+
/***/ (function(module, exports, __webpack_require__) {
|
283 |
+
|
284 |
+
"use strict";
|
285 |
+
|
286 |
+
|
287 |
+
exports.__esModule = true;
|
288 |
+
|
289 |
+
var _typeof2 = __webpack_require__(42);
|
290 |
+
|
291 |
+
var _typeof3 = _interopRequireDefault(_typeof2);
|
292 |
+
|
293 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
294 |
+
|
295 |
+
exports.default = function (self, call) {
|
296 |
+
if (!self) {
|
297 |
+
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
298 |
+
}
|
299 |
+
|
300 |
+
return call && ((typeof call === "undefined" ? "undefined" : (0, _typeof3.default)(call)) === "object" || typeof call === "function") ? call : self;
|
301 |
+
};
|
302 |
+
|
303 |
+
/***/ }),
|
304 |
+
/* 6 */
|
305 |
+
/***/ (function(module, exports, __webpack_require__) {
|
306 |
+
|
307 |
+
"use strict";
|
308 |
+
|
309 |
+
|
310 |
+
exports.__esModule = true;
|
311 |
+
|
312 |
+
var _setPrototypeOf = __webpack_require__(242);
|
313 |
+
|
314 |
+
var _setPrototypeOf2 = _interopRequireDefault(_setPrototypeOf);
|
315 |
+
|
316 |
+
var _create = __webpack_require__(246);
|
317 |
+
|
318 |
+
var _create2 = _interopRequireDefault(_create);
|
319 |
+
|
320 |
+
var _typeof2 = __webpack_require__(42);
|
321 |
+
|
322 |
+
var _typeof3 = _interopRequireDefault(_typeof2);
|
323 |
+
|
324 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
325 |
+
|
326 |
+
exports.default = function (subClass, superClass) {
|
327 |
+
if (typeof superClass !== "function" && superClass !== null) {
|
328 |
+
throw new TypeError("Super expression must either be null or a function, not " + (typeof superClass === "undefined" ? "undefined" : (0, _typeof3.default)(superClass)));
|
329 |
+
}
|
330 |
+
|
331 |
+
subClass.prototype = (0, _create2.default)(superClass && superClass.prototype, {
|
332 |
+
constructor: {
|
333 |
+
value: subClass,
|
334 |
+
enumerable: false,
|
335 |
+
writable: true,
|
336 |
+
configurable: true
|
337 |
+
}
|
338 |
+
});
|
339 |
+
if (superClass) _setPrototypeOf2.default ? (0, _setPrototypeOf2.default)(subClass, superClass) : subClass.__proto__ = superClass;
|
340 |
+
};
|
341 |
+
|
342 |
+
/***/ }),
|
343 |
+
/* 7 */
|
344 |
+
/***/ (function(module, exports) {
|
345 |
+
|
346 |
+
// shim for using process in browser
|
347 |
+
var process = module.exports = {};
|
348 |
+
|
349 |
+
// cached from whatever global is present so that test runners that stub it
|
350 |
+
// don't break things. But we need to wrap it in a try catch in case it is
|
351 |
+
// wrapped in strict mode code which doesn't define any globals. It's inside a
|
352 |
+
// function because try/catches deoptimize in certain engines.
|
353 |
+
|
354 |
+
var cachedSetTimeout;
|
355 |
+
var cachedClearTimeout;
|
356 |
+
|
357 |
+
function defaultSetTimout() {
|
358 |
+
throw new Error('setTimeout has not been defined');
|
359 |
+
}
|
360 |
+
function defaultClearTimeout () {
|
361 |
+
throw new Error('clearTimeout has not been defined');
|
362 |
+
}
|
363 |
+
(function () {
|
364 |
+
try {
|
365 |
+
if (typeof setTimeout === 'function') {
|
366 |
+
cachedSetTimeout = setTimeout;
|
367 |
+
} else {
|
368 |
+
cachedSetTimeout = defaultSetTimout;
|
369 |
+
}
|
370 |
+
} catch (e) {
|
371 |
+
cachedSetTimeout = defaultSetTimout;
|
372 |
+
}
|
373 |
+
try {
|
374 |
+
if (typeof clearTimeout === 'function') {
|
375 |
+
cachedClearTimeout = clearTimeout;
|
376 |
+
} else {
|
377 |
+
cachedClearTimeout = defaultClearTimeout;
|
378 |
+
}
|
379 |
+
} catch (e) {
|
380 |
+
cachedClearTimeout = defaultClearTimeout;
|
381 |
+
}
|
382 |
+
} ())
|
383 |
+
function runTimeout(fun) {
|
384 |
+
if (cachedSetTimeout === setTimeout) {
|
385 |
+
//normal enviroments in sane situations
|
386 |
+
return setTimeout(fun, 0);
|
387 |
+
}
|
388 |
+
// if setTimeout wasn't available but was latter defined
|
389 |
+
if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
|
390 |
+
cachedSetTimeout = setTimeout;
|
391 |
+
return setTimeout(fun, 0);
|
392 |
+
}
|
393 |
+
try {
|
394 |
+
// when when somebody has screwed with setTimeout but no I.E. maddness
|
395 |
+
return cachedSetTimeout(fun, 0);
|
396 |
+
} catch(e){
|
397 |
+
try {
|
398 |
+
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
|
399 |
+
return cachedSetTimeout.call(null, fun, 0);
|
400 |
+
} catch(e){
|
401 |
+
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
|
402 |
+
return cachedSetTimeout.call(this, fun, 0);
|
403 |
+
}
|
404 |
+
}
|
405 |
+
|
406 |
+
|
407 |
+
}
|
408 |
+
function runClearTimeout(marker) {
|
409 |
+
if (cachedClearTimeout === clearTimeout) {
|
410 |
+
//normal enviroments in sane situations
|
411 |
+
return clearTimeout(marker);
|
412 |
+
}
|
413 |
+
// if clearTimeout wasn't available but was latter defined
|
414 |
+
if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
|
415 |
+
cachedClearTimeout = clearTimeout;
|
416 |
+
return clearTimeout(marker);
|
417 |
+
}
|
418 |
+
try {
|
419 |
+
// when when somebody has screwed with setTimeout but no I.E. maddness
|
420 |
+
return cachedClearTimeout(marker);
|
421 |
+
} catch (e){
|
422 |
+
try {
|
423 |
+
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
|
424 |
+
return cachedClearTimeout.call(null, marker);
|
425 |
+
} catch (e){
|
426 |
+
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
|
427 |
+
// Some versions of I.E. have different rules for clearTimeout vs setTimeout
|
428 |
+
return cachedClearTimeout.call(this, marker);
|
429 |
+
}
|
430 |
+
}
|
431 |
+
|
432 |
+
|
433 |
+
|
434 |
+
}
|
435 |
+
var queue = [];
|
436 |
+
var draining = false;
|
437 |
+
var currentQueue;
|
438 |
+
var queueIndex = -1;
|
439 |
+
|
440 |
+
function cleanUpNextTick() {
|
441 |
+
if (!draining || !currentQueue) {
|
442 |
+
return;
|
443 |
+
}
|
444 |
+
draining = false;
|
445 |
+
if (currentQueue.length) {
|
446 |
+
queue = currentQueue.concat(queue);
|
447 |
+
} else {
|
448 |
+
queueIndex = -1;
|
449 |
+
}
|
450 |
+
if (queue.length) {
|
451 |
+
drainQueue();
|
452 |
+
}
|
453 |
+
}
|
454 |
+
|
455 |
+
function drainQueue() {
|
456 |
+
if (draining) {
|
457 |
+
return;
|
458 |
+
}
|
459 |
+
var timeout = runTimeout(cleanUpNextTick);
|
460 |
+
draining = true;
|
461 |
+
|
462 |
+
var len = queue.length;
|
463 |
+
while(len) {
|
464 |
+
currentQueue = queue;
|
465 |
+
queue = [];
|
466 |
+
while (++queueIndex < len) {
|
467 |
+
if (currentQueue) {
|
468 |
+
currentQueue[queueIndex].run();
|
469 |
+
}
|
470 |
+
}
|
471 |
+
queueIndex = -1;
|
472 |
+
len = queue.length;
|
473 |
+
}
|
474 |
+
currentQueue = null;
|
475 |
+
draining = false;
|
476 |
+
runClearTimeout(timeout);
|
477 |
+
}
|
478 |
+
|
479 |
+
process.nextTick = function (fun) {
|
480 |
+
var args = new Array(arguments.length - 1);
|
481 |
+
if (arguments.length > 1) {
|
482 |
+
for (var i = 1; i < arguments.length; i++) {
|
483 |
+
args[i - 1] = arguments[i];
|
484 |
+
}
|
485 |
+
}
|
486 |
+
queue.push(new Item(fun, args));
|
487 |
+
if (queue.length === 1 && !draining) {
|
488 |
+
runTimeout(drainQueue);
|
489 |
+
}
|
490 |
+
};
|
491 |
+
|
492 |
+
// v8 likes predictible objects
|
493 |
+
function Item(fun, array) {
|
494 |
+
this.fun = fun;
|
495 |
+
this.array = array;
|
496 |
+
}
|
497 |
+
Item.prototype.run = function () {
|
498 |
+
this.fun.apply(null, this.array);
|
499 |
+
};
|
500 |
+
process.title = 'browser';
|
501 |
+
process.browser = true;
|
502 |
+
process.env = {};
|
503 |
+
process.argv = [];
|
504 |
+
process.version = ''; // empty string to avoid regexp issues
|
505 |
+
process.versions = {};
|
506 |
+
|
507 |
+
function noop() {}
|
508 |
+
|
509 |
+
process.on = noop;
|
510 |
+
process.addListener = noop;
|
511 |
+
process.once = noop;
|
512 |
+
process.off = noop;
|
513 |
+
process.removeListener = noop;
|
514 |
+
process.removeAllListeners = noop;
|
515 |
+
process.emit = noop;
|
516 |
+
process.prependListener = noop;
|
517 |
+
process.prependOnceListener = noop;
|
518 |
+
|
519 |
+
process.listeners = function (name) { return [] }
|
520 |
+
|
521 |
+
process.binding = function (name) {
|
522 |
+
throw new Error('process.binding is not supported');
|
523 |
+
};
|
524 |
+
|
525 |
+
process.cwd = function () { return '/' };
|
526 |
+
process.chdir = function (dir) {
|
527 |
+
throw new Error('process.chdir is not supported');
|
528 |
+
};
|
529 |
+
process.umask = function() { return 0; };
|
530 |
+
|
531 |
+
|
532 |
+
/***/ }),
|
533 |
+
/* 8 */
|
534 |
+
/***/ (function(module, exports, __webpack_require__) {
|
535 |
+
|
536 |
+
module.exports = { "default": __webpack_require__(238), __esModule: true };
|
537 |
+
|
538 |
+
/***/ }),
|
539 |
+
/* 9 */
|
540 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
541 |
+
|
542 |
+
"use strict";
|
543 |
+
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
544 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(1);
|
545 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
546 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_ScalingCellSizeAndPositionManager__ = __webpack_require__(92);
|
547 |
+
|
548 |
+
|
549 |
+
|
550 |
+
var babelPluginFlowReactPropTypes_proptype_CellPosition = {
|
551 |
+
columnIndex: __webpack_require__(0).number.isRequired,
|
552 |
+
rowIndex: __webpack_require__(0).number.isRequired
|
553 |
+
};
|
554 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellPosition', {
|
555 |
+
value: babelPluginFlowReactPropTypes_proptype_CellPosition,
|
556 |
+
configurable: true
|
557 |
+
});
|
558 |
+
var babelPluginFlowReactPropTypes_proptype_CellRendererParams = {
|
559 |
+
columnIndex: __webpack_require__(0).number.isRequired,
|
560 |
+
isScrolling: __webpack_require__(0).bool.isRequired,
|
561 |
+
isVisible: __webpack_require__(0).bool.isRequired,
|
562 |
+
key: __webpack_require__(0).string.isRequired,
|
563 |
+
parent: __webpack_require__(0).object.isRequired,
|
564 |
+
rowIndex: __webpack_require__(0).number.isRequired,
|
565 |
+
style: __webpack_require__(0).object.isRequired
|
566 |
+
};
|
567 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellRendererParams', {
|
568 |
+
value: babelPluginFlowReactPropTypes_proptype_CellRendererParams,
|
569 |
+
configurable: true
|
570 |
+
});
|
571 |
+
|
572 |
+
var babelPluginFlowReactPropTypes_proptype_CellRenderer = __webpack_require__(0).func;
|
573 |
+
|
574 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellRenderer', {
|
575 |
+
value: babelPluginFlowReactPropTypes_proptype_CellRenderer,
|
576 |
+
configurable: true
|
577 |
+
});
|
578 |
+
var babelPluginFlowReactPropTypes_proptype_CellRangeRendererParams = {
|
579 |
+
cellCache: __webpack_require__(0).object.isRequired,
|
580 |
+
cellRenderer: __webpack_require__(0).func.isRequired,
|
581 |
+
columnSizeAndPositionManager: typeof __WEBPACK_IMPORTED_MODULE_1__utils_ScalingCellSizeAndPositionManager__["a" /* default */] === 'function' ? __webpack_require__(0).instanceOf(__WEBPACK_IMPORTED_MODULE_1__utils_ScalingCellSizeAndPositionManager__["a" /* default */]).isRequired : __webpack_require__(0).any.isRequired,
|
582 |
+
columnStartIndex: __webpack_require__(0).number.isRequired,
|
583 |
+
columnStopIndex: __webpack_require__(0).number.isRequired,
|
584 |
+
deferredMeasurementCache: __webpack_require__(0).object,
|
585 |
+
horizontalOffsetAdjustment: __webpack_require__(0).number.isRequired,
|
586 |
+
isScrolling: __webpack_require__(0).bool.isRequired,
|
587 |
+
parent: __webpack_require__(0).object.isRequired,
|
588 |
+
rowSizeAndPositionManager: typeof __WEBPACK_IMPORTED_MODULE_1__utils_ScalingCellSizeAndPositionManager__["a" /* default */] === 'function' ? __webpack_require__(0).instanceOf(__WEBPACK_IMPORTED_MODULE_1__utils_ScalingCellSizeAndPositionManager__["a" /* default */]).isRequired : __webpack_require__(0).any.isRequired,
|
589 |
+
rowStartIndex: __webpack_require__(0).number.isRequired,
|
590 |
+
rowStopIndex: __webpack_require__(0).number.isRequired,
|
591 |
+
scrollLeft: __webpack_require__(0).number.isRequired,
|
592 |
+
scrollTop: __webpack_require__(0).number.isRequired,
|
593 |
+
styleCache: __webpack_require__(0).object.isRequired,
|
594 |
+
verticalOffsetAdjustment: __webpack_require__(0).number.isRequired,
|
595 |
+
visibleColumnIndices: __webpack_require__(0).object.isRequired,
|
596 |
+
visibleRowIndices: __webpack_require__(0).object.isRequired
|
597 |
+
};
|
598 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellRangeRendererParams', {
|
599 |
+
value: babelPluginFlowReactPropTypes_proptype_CellRangeRendererParams,
|
600 |
+
configurable: true
|
601 |
+
});
|
602 |
+
|
603 |
+
var babelPluginFlowReactPropTypes_proptype_CellRangeRenderer = __webpack_require__(0).func;
|
604 |
+
|
605 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellRangeRenderer', {
|
606 |
+
value: babelPluginFlowReactPropTypes_proptype_CellRangeRenderer,
|
607 |
+
configurable: true
|
608 |
+
});
|
609 |
+
|
610 |
+
var babelPluginFlowReactPropTypes_proptype_CellSizeGetter = __webpack_require__(0).func;
|
611 |
+
|
612 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellSizeGetter', {
|
613 |
+
value: babelPluginFlowReactPropTypes_proptype_CellSizeGetter,
|
614 |
+
configurable: true
|
615 |
+
});
|
616 |
+
|
617 |
+
var babelPluginFlowReactPropTypes_proptype_CellSize = __webpack_require__(0).oneOfType([__webpack_require__(0).func, __webpack_require__(0).number]);
|
618 |
+
|
619 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_CellSize', {
|
620 |
+
value: babelPluginFlowReactPropTypes_proptype_CellSize,
|
621 |
+
configurable: true
|
622 |
+
});
|
623 |
+
|
624 |
+
var babelPluginFlowReactPropTypes_proptype_NoContentRenderer = __webpack_require__(0).func;
|
625 |
+
|
626 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_NoContentRenderer', {
|
627 |
+
value: babelPluginFlowReactPropTypes_proptype_NoContentRenderer,
|
628 |
+
configurable: true
|
629 |
+
});
|
630 |
+
var babelPluginFlowReactPropTypes_proptype_Scroll = {
|
631 |
+
clientHeight: __webpack_require__(0).number.isRequired,
|
632 |
+
clientWidth: __webpack_require__(0).number.isRequired,
|
633 |
+
scrollHeight: __webpack_require__(0).number.isRequired,
|
634 |
+
scrollLeft: __webpack_require__(0).number.isRequired,
|
635 |
+
scrollTop: __webpack_require__(0).number.isRequired,
|
636 |
+
scrollWidth: __webpack_require__(0).number.isRequired
|
637 |
+
};
|
638 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_Scroll', {
|
639 |
+
value: babelPluginFlowReactPropTypes_proptype_Scroll,
|
640 |
+
configurable: true
|
641 |
+
});
|
642 |
+
var babelPluginFlowReactPropTypes_proptype_ScrollbarPresenceChange = {
|
643 |
+
horizontal: __webpack_require__(0).bool.isRequired,
|
644 |
+
vertical: __webpack_require__(0).bool.isRequired,
|
645 |
+
size: __webpack_require__(0).number.isRequired
|
646 |
+
};
|
647 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_ScrollbarPresenceChange', {
|
648 |
+
value: babelPluginFlowReactPropTypes_proptype_ScrollbarPresenceChange,
|
649 |
+
configurable: true
|
650 |
+
});
|
651 |
+
var babelPluginFlowReactPropTypes_proptype_RenderedSection = {
|
652 |
+
columnOverscanStartIndex: __webpack_require__(0).number.isRequired,
|
653 |
+
columnOverscanStopIndex: __webpack_require__(0).number.isRequired,
|
654 |
+
columnStartIndex: __webpack_require__(0).number.isRequired,
|
655 |
+
columnStopIndex: __webpack_require__(0).number.isRequired,
|
656 |
+
rowOverscanStartIndex: __webpack_require__(0).number.isRequired,
|
657 |
+
rowOverscanStopIndex: __webpack_require__(0).number.isRequired,
|
658 |
+
rowStartIndex: __webpack_require__(0).number.isRequired,
|
659 |
+
rowStopIndex: __webpack_require__(0).number.isRequired
|
660 |
+
};
|
661 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RenderedSection', {
|
662 |
+
value: babelPluginFlowReactPropTypes_proptype_RenderedSection,
|
663 |
+
configurable: true
|
664 |
+
});
|
665 |
+
var babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetterParams = {
|
666 |
+
// One of SCROLL_DIRECTION_HORIZONTAL or SCROLL_DIRECTION_VERTICAL
|
667 |
+
direction: __webpack_require__(0).oneOf(['horizontal', 'vertical']).isRequired,
|
668 |
+
|
669 |
+
|
670 |
+
// One of SCROLL_DIRECTION_BACKWARD or SCROLL_DIRECTION_FORWARD
|
671 |
+
scrollDirection: __webpack_require__(0).oneOf([-1, 1]).isRequired,
|
672 |
+
|
673 |
+
|
674 |
+
// Number of rows or columns in the current axis
|
675 |
+
cellCount: __webpack_require__(0).number.isRequired,
|
676 |
+
|
677 |
+
|
678 |
+
// Maximum number of cells to over-render in either direction
|
679 |
+
overscanCellsCount: __webpack_require__(0).number.isRequired,
|
680 |
+
|
681 |
+
|
682 |
+
// Begin of range of visible cells
|
683 |
+
startIndex: __webpack_require__(0).number.isRequired,
|
684 |
+
|
685 |
+
|
686 |
+
// End of range of visible cells
|
687 |
+
stopIndex: __webpack_require__(0).number.isRequired
|
688 |
+
};
|
689 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetterParams', {
|
690 |
+
value: babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetterParams,
|
691 |
+
configurable: true
|
692 |
+
});
|
693 |
+
var babelPluginFlowReactPropTypes_proptype_OverscanIndices = {
|
694 |
+
overscanStartIndex: __webpack_require__(0).number.isRequired,
|
695 |
+
overscanStopIndex: __webpack_require__(0).number.isRequired
|
696 |
+
};
|
697 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_OverscanIndices', {
|
698 |
+
value: babelPluginFlowReactPropTypes_proptype_OverscanIndices,
|
699 |
+
configurable: true
|
700 |
+
});
|
701 |
+
|
702 |
+
var babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter = __webpack_require__(0).func;
|
703 |
+
|
704 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter', {
|
705 |
+
value: babelPluginFlowReactPropTypes_proptype_OverscanIndicesGetter,
|
706 |
+
configurable: true
|
707 |
+
});
|
708 |
+
|
709 |
+
var babelPluginFlowReactPropTypes_proptype_Alignment = __webpack_require__(0).oneOf(['auto', 'end', 'start', 'center']);
|
710 |
+
|
711 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_Alignment', {
|
712 |
+
value: babelPluginFlowReactPropTypes_proptype_Alignment,
|
713 |
+
configurable: true
|
714 |
+
});
|
715 |
+
var babelPluginFlowReactPropTypes_proptype_VisibleCellRange = {
|
716 |
+
start: __webpack_require__(0).number,
|
717 |
+
stop: __webpack_require__(0).number
|
718 |
+
};
|
719 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_VisibleCellRange', {
|
720 |
+
value: babelPluginFlowReactPropTypes_proptype_VisibleCellRange,
|
721 |
+
configurable: true
|
722 |
+
});
|
723 |
+
|
724 |
+
/***/ }),
|
725 |
+
/* 10 */
|
726 |
+
/***/ (function(module, exports) {
|
727 |
+
|
728 |
+
var core = module.exports = { version: '2.5.3' };
|
729 |
+
if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef
|
730 |
+
|
731 |
+
|
732 |
+
/***/ }),
|
733 |
+
/* 11 */
|
734 |
+
/***/ (function(module, exports, __webpack_require__) {
|
735 |
+
|
736 |
+
"use strict";
|
737 |
+
/* WEBPACK VAR INJECTION */(function(process) {
|
738 |
+
|
739 |
+
function checkDCE() {
|
740 |
+
/* global __REACT_DEVTOOLS_GLOBAL_HOOK__ */
|
741 |
+
if (
|
742 |
+
typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ === 'undefined' ||
|
743 |
+
typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE !== 'function'
|
744 |
+
) {
|
745 |
+
return;
|
746 |
+
}
|
747 |
+
if (process.env.NODE_ENV !== 'production') {
|
748 |
+
// This branch is unreachable because this function is only called
|
749 |
+
// in production, but the condition is true only in development.
|
750 |
+
// Therefore if the branch is still here, dead code elimination wasn't
|
751 |
+
// properly applied.
|
752 |
+
// Don't change the message. React DevTools relies on it. Also make sure
|
753 |
+
// this message doesn't occur elsewhere in this function, or it will cause
|
754 |
+
// a false positive.
|
755 |
+
throw new Error('^_^');
|
756 |
+
}
|
757 |
+
try {
|
758 |
+
// Verify that the code above has been dead code eliminated (DCE'd).
|
759 |
+
__REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE(checkDCE);
|
760 |
+
} catch (err) {
|
761 |
+
// DevTools shouldn't crash React, no matter what.
|
762 |
+
// We should still report in case we break this code.
|
763 |
+
console.error(err);
|
764 |
+
}
|
765 |
+
}
|
766 |
+
|
767 |
+
if (process.env.NODE_ENV === 'production') {
|
768 |
+
// DCE check should happen before ReactDOM bundle executes so that
|
769 |
+
// DevTools can report bad minification during injection.
|
770 |
+
checkDCE();
|
771 |
+
module.exports = __webpack_require__(200);
|
772 |
+
} else {
|
773 |
+
module.exports = __webpack_require__(203);
|
774 |
+
}
|
775 |
+
|
776 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
777 |
+
|
778 |
+
/***/ }),
|
779 |
+
/* 12 */
|
780 |
+
/***/ (function(module, exports, __webpack_require__) {
|
781 |
+
|
782 |
+
var store = __webpack_require__(83)('wks');
|
783 |
+
var uid = __webpack_require__(58);
|
784 |
+
var Symbol = __webpack_require__(14).Symbol;
|
785 |
+
var USE_SYMBOL = typeof Symbol == 'function';
|
786 |
+
|
787 |
+
var $exports = module.exports = function (name) {
|
788 |
+
return store[name] || (store[name] =
|
789 |
+
USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));
|
790 |
+
};
|
791 |
+
|
792 |
+
$exports.store = store;
|
793 |
+
|
794 |
+
|
795 |
+
/***/ }),
|
796 |
+
/* 13 */
|
797 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
798 |
+
|
799 |
+
"use strict";
|
800 |
+
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
801 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__Grid__ = __webpack_require__(134);
|
802 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "default", function() { return __WEBPACK_IMPORTED_MODULE_0__Grid__["a"]; });
|
803 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Grid", function() { return __WEBPACK_IMPORTED_MODULE_0__Grid__["a"]; });
|
804 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__accessibilityOverscanIndicesGetter__ = __webpack_require__(259);
|
805 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "accessibilityOverscanIndicesGetter", function() { return __WEBPACK_IMPORTED_MODULE_1__accessibilityOverscanIndicesGetter__["a"]; });
|
806 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__defaultCellRangeRenderer__ = __webpack_require__(136);
|
807 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "defaultCellRangeRenderer", function() { return __WEBPACK_IMPORTED_MODULE_2__defaultCellRangeRenderer__["a"]; });
|
808 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__defaultOverscanIndicesGetter__ = __webpack_require__(135);
|
809 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "defaultOverscanIndicesGetter", function() { return __WEBPACK_IMPORTED_MODULE_3__defaultOverscanIndicesGetter__["c"]; });
|
810 |
+
|
811 |
+
|
812 |
+
|
813 |
+
|
814 |
+
|
815 |
+
|
816 |
+
|
817 |
+
|
818 |
+
|
819 |
+
/***/ }),
|
820 |
+
/* 14 */
|
821 |
+
/***/ (function(module, exports) {
|
822 |
+
|
823 |
+
// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
|
824 |
+
var global = module.exports = typeof window != 'undefined' && window.Math == Math
|
825 |
+
? window : typeof self != 'undefined' && self.Math == Math ? self
|
826 |
+
// eslint-disable-next-line no-new-func
|
827 |
+
: Function('return this')();
|
828 |
+
if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef
|
829 |
+
|
830 |
+
|
831 |
+
/***/ }),
|
832 |
+
/* 15 */
|
833 |
+
/***/ (function(module, exports, __webpack_require__) {
|
834 |
+
|
835 |
+
"use strict";
|
836 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
837 |
+
* Copyright 2013-2015, Facebook, Inc.
|
838 |
+
* All rights reserved.
|
839 |
+
*
|
840 |
+
* This source code is licensed under the BSD-style license found in the
|
841 |
+
* LICENSE file in the root directory of this source tree. An additional grant
|
842 |
+
* of patent rights can be found in the PATENTS file in the same directory.
|
843 |
+
*/
|
844 |
+
|
845 |
+
|
846 |
+
|
847 |
+
/**
|
848 |
+
* Use invariant() to assert state which your program assumes to be true.
|
849 |
+
*
|
850 |
+
* Provide sprintf-style format (only %s is supported) and arguments
|
851 |
+
* to provide information about what broke and what you were
|
852 |
+
* expecting.
|
853 |
+
*
|
854 |
+
* The invariant message will be stripped in production, but the invariant
|
855 |
+
* will remain to ensure logic does not differ in production.
|
856 |
+
*/
|
857 |
+
|
858 |
+
var invariant = function(condition, format, a, b, c, d, e, f) {
|
859 |
+
if (process.env.NODE_ENV !== 'production') {
|
860 |
+
if (format === undefined) {
|
861 |
+
throw new Error('invariant requires an error message argument');
|
862 |
+
}
|
863 |
+
}
|
864 |
+
|
865 |
+
if (!condition) {
|
866 |
+
var error;
|
867 |
+
if (format === undefined) {
|
868 |
+
error = new Error(
|
869 |
+
'Minified exception occurred; use the non-minified dev environment ' +
|
870 |
+
'for the full error message and additional helpful warnings.'
|
871 |
+
);
|
872 |
+
} else {
|
873 |
+
var args = [a, b, c, d, e, f];
|
874 |
+
var argIndex = 0;
|
875 |
+
error = new Error(
|
876 |
+
format.replace(/%s/g, function() { return args[argIndex++]; })
|
877 |
+
);
|
878 |
+
error.name = 'Invariant Violation';
|
879 |
+
}
|
880 |
+
|
881 |
+
error.framesToPop = 1; // we don't care about invariant's own frame
|
882 |
+
throw error;
|
883 |
+
}
|
884 |
+
};
|
885 |
+
|
886 |
+
module.exports = invariant;
|
887 |
+
|
888 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
889 |
+
|
890 |
+
/***/ }),
|
891 |
+
/* 16 */
|
892 |
+
/***/ (function(module, exports) {
|
893 |
+
|
894 |
+
/*
|
895 |
+
MIT License http://www.opensource.org/licenses/mit-license.php
|
896 |
+
Author Tobias Koppers @sokra
|
897 |
+
*/
|
898 |
+
// css base code, injected by the css-loader
|
899 |
+
module.exports = function(useSourceMap) {
|
900 |
+
var list = [];
|
901 |
+
|
902 |
+
// return the list of modules as css string
|
903 |
+
list.toString = function toString() {
|
904 |
+
return this.map(function (item) {
|
905 |
+
var content = cssWithMappingToString(item, useSourceMap);
|
906 |
+
if(item[2]) {
|
907 |
+
return "@media " + item[2] + "{" + content + "}";
|
908 |
+
} else {
|
909 |
+
return content;
|
910 |
+
}
|
911 |
+
}).join("");
|
912 |
+
};
|
913 |
+
|
914 |
+
// import a list of modules into the list
|
915 |
+
list.i = function(modules, mediaQuery) {
|
916 |
+
if(typeof modules === "string")
|
917 |
+
modules = [[null, modules, ""]];
|
918 |
+
var alreadyImportedModules = {};
|
919 |
+
for(var i = 0; i < this.length; i++) {
|
920 |
+
var id = this[i][0];
|
921 |
+
if(typeof id === "number")
|
922 |
+
alreadyImportedModules[id] = true;
|
923 |
+
}
|
924 |
+
for(i = 0; i < modules.length; i++) {
|
925 |
+
var item = modules[i];
|
926 |
+
// skip already imported module
|
927 |
+
// this implementation is not 100% perfect for weird media query combinations
|
928 |
+
// when a module is imported multiple times with different media queries.
|
929 |
+
// I hope this will never occur (Hey this way we have smaller bundles)
|
930 |
+
if(typeof item[0] !== "number" || !alreadyImportedModules[item[0]]) {
|
931 |
+
if(mediaQuery && !item[2]) {
|
932 |
+
item[2] = mediaQuery;
|
933 |
+
} else if(mediaQuery) {
|
934 |
+
item[2] = "(" + item[2] + ") and (" + mediaQuery + ")";
|
935 |
+
}
|
936 |
+
list.push(item);
|
937 |
+
}
|
938 |
+
}
|
939 |
+
};
|
940 |
+
return list;
|
941 |
+
};
|
942 |
+
|
943 |
+
function cssWithMappingToString(item, useSourceMap) {
|
944 |
+
var content = item[1] || '';
|
945 |
+
var cssMapping = item[3];
|
946 |
+
if (!cssMapping) {
|
947 |
+
return content;
|
948 |
+
}
|
949 |
+
|
950 |
+
if (useSourceMap && typeof btoa === 'function') {
|
951 |
+
var sourceMapping = toComment(cssMapping);
|
952 |
+
var sourceURLs = cssMapping.sources.map(function (source) {
|
953 |
+
return '/*# sourceURL=' + cssMapping.sourceRoot + source + ' */'
|
954 |
+
});
|
955 |
+
|
956 |
+
return [content].concat(sourceURLs).concat([sourceMapping]).join('\n');
|
957 |
+
}
|
958 |
+
|
959 |
+
return [content].join('\n');
|
960 |
+
}
|
961 |
+
|
962 |
+
// Adapted from convert-source-map (MIT)
|
963 |
+
function toComment(sourceMap) {
|
964 |
+
// eslint-disable-next-line no-undef
|
965 |
+
var base64 = btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap))));
|
966 |
+
var data = 'sourceMappingURL=data:application/json;charset=utf-8;base64,' + base64;
|
967 |
+
|
968 |
+
return '/*# ' + data + ' */';
|
969 |
+
}
|
970 |
+
|
971 |
+
|
972 |
+
/***/ }),
|
973 |
+
/* 17 */
|
974 |
+
/***/ (function(module, exports, __webpack_require__) {
|
975 |
+
|
976 |
+
/*
|
977 |
+
MIT License http://www.opensource.org/licenses/mit-license.php
|
978 |
+
Author Tobias Koppers @sokra
|
979 |
+
*/
|
980 |
+
|
981 |
+
var stylesInDom = {};
|
982 |
+
|
983 |
+
var memoize = function (fn) {
|
984 |
+
var memo;
|
985 |
+
|
986 |
+
return function () {
|
987 |
+
if (typeof memo === "undefined") memo = fn.apply(this, arguments);
|
988 |
+
return memo;
|
989 |
+
};
|
990 |
+
};
|
991 |
+
|
992 |
+
var isOldIE = memoize(function () {
|
993 |
+
// Test for IE <= 9 as proposed by Browserhacks
|
994 |
+
// @see http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805
|
995 |
+
// Tests for existence of standard globals is to allow style-loader
|
996 |
+
// to operate correctly into non-standard environments
|
997 |
+
// @see https://github.com/webpack-contrib/style-loader/issues/177
|
998 |
+
return window && document && document.all && !window.atob;
|
999 |
+
});
|
1000 |
+
|
1001 |
+
var getElement = (function (fn) {
|
1002 |
+
var memo = {};
|
1003 |
+
|
1004 |
+
return function(selector) {
|
1005 |
+
if (typeof memo[selector] === "undefined") {
|
1006 |
+
var styleTarget = fn.call(this, selector);
|
1007 |
+
// Special case to return head of iframe instead of iframe itself
|
1008 |
+
if (styleTarget instanceof window.HTMLIFrameElement) {
|
1009 |
+
try {
|
1010 |
+
// This will throw an exception if access to iframe is blocked
|
1011 |
+
// due to cross-origin restrictions
|
1012 |
+
styleTarget = styleTarget.contentDocument.head;
|
1013 |
+
} catch(e) {
|
1014 |
+
styleTarget = null;
|
1015 |
+
}
|
1016 |
+
}
|
1017 |
+
memo[selector] = styleTarget;
|
1018 |
+
}
|
1019 |
+
return memo[selector]
|
1020 |
+
};
|
1021 |
+
})(function (target) {
|
1022 |
+
return document.querySelector(target)
|
1023 |
+
});
|
1024 |
+
|
1025 |
+
var singleton = null;
|
1026 |
+
var singletonCounter = 0;
|
1027 |
+
var stylesInsertedAtTop = [];
|
1028 |
+
|
1029 |
+
var fixUrls = __webpack_require__(426);
|
1030 |
+
|
1031 |
+
module.exports = function(list, options) {
|
1032 |
+
if (typeof DEBUG !== "undefined" && DEBUG) {
|
1033 |
+
if (typeof document !== "object") throw new Error("The style-loader cannot be used in a non-browser environment");
|
1034 |
+
}
|
1035 |
+
|
1036 |
+
options = options || {};
|
1037 |
+
|
1038 |
+
options.attrs = typeof options.attrs === "object" ? options.attrs : {};
|
1039 |
+
|
1040 |
+
// Force single-tag solution on IE6-9, which has a hard limit on the # of <style>
|
1041 |
+
// tags it will allow on a page
|
1042 |
+
if (!options.singleton) options.singleton = isOldIE();
|
1043 |
+
|
1044 |
+
// By default, add <style> tags to the <head> element
|
1045 |
+
if (!options.insertInto) options.insertInto = "head";
|
1046 |
+
|
1047 |
+
// By default, add <style> tags to the bottom of the target
|
1048 |
+
if (!options.insertAt) options.insertAt = "bottom";
|
1049 |
+
|
1050 |
+
var styles = listToStyles(list, options);
|
1051 |
+
|
1052 |
+
addStylesToDom(styles, options);
|
1053 |
+
|
1054 |
+
return function update (newList) {
|
1055 |
+
var mayRemove = [];
|
1056 |
+
|
1057 |
+
for (var i = 0; i < styles.length; i++) {
|
1058 |
+
var item = styles[i];
|
1059 |
+
var domStyle = stylesInDom[item.id];
|
1060 |
+
|
1061 |
+
domStyle.refs--;
|
1062 |
+
mayRemove.push(domStyle);
|
1063 |
+
}
|
1064 |
+
|
1065 |
+
if(newList) {
|
1066 |
+
var newStyles = listToStyles(newList, options);
|
1067 |
+
addStylesToDom(newStyles, options);
|
1068 |
+
}
|
1069 |
+
|
1070 |
+
for (var i = 0; i < mayRemove.length; i++) {
|
1071 |
+
var domStyle = mayRemove[i];
|
1072 |
+
|
1073 |
+
if(domStyle.refs === 0) {
|
1074 |
+
for (var j = 0; j < domStyle.parts.length; j++) domStyle.parts[j]();
|
1075 |
+
|
1076 |
+
delete stylesInDom[domStyle.id];
|
1077 |
+
}
|
1078 |
+
}
|
1079 |
+
};
|
1080 |
+
};
|
1081 |
+
|
1082 |
+
function addStylesToDom (styles, options) {
|
1083 |
+
for (var i = 0; i < styles.length; i++) {
|
1084 |
+
var item = styles[i];
|
1085 |
+
var domStyle = stylesInDom[item.id];
|
1086 |
+
|
1087 |
+
if(domStyle) {
|
1088 |
+
domStyle.refs++;
|
1089 |
+
|
1090 |
+
for(var j = 0; j < domStyle.parts.length; j++) {
|
1091 |
+
domStyle.parts[j](item.parts[j]);
|
1092 |
+
}
|
1093 |
+
|
1094 |
+
for(; j < item.parts.length; j++) {
|
1095 |
+
domStyle.parts.push(addStyle(item.parts[j], options));
|
1096 |
+
}
|
1097 |
+
} else {
|
1098 |
+
var parts = [];
|
1099 |
+
|
1100 |
+
for(var j = 0; j < item.parts.length; j++) {
|
1101 |
+
parts.push(addStyle(item.parts[j], options));
|
1102 |
+
}
|
1103 |
+
|
1104 |
+
stylesInDom[item.id] = {id: item.id, refs: 1, parts: parts};
|
1105 |
+
}
|
1106 |
+
}
|
1107 |
+
}
|
1108 |
+
|
1109 |
+
function listToStyles (list, options) {
|
1110 |
+
var styles = [];
|
1111 |
+
var newStyles = {};
|
1112 |
+
|
1113 |
+
for (var i = 0; i < list.length; i++) {
|
1114 |
+
var item = list[i];
|
1115 |
+
var id = options.base ? item[0] + options.base : item[0];
|
1116 |
+
var css = item[1];
|
1117 |
+
var media = item[2];
|
1118 |
+
var sourceMap = item[3];
|
1119 |
+
var part = {css: css, media: media, sourceMap: sourceMap};
|
1120 |
+
|
1121 |
+
if(!newStyles[id]) styles.push(newStyles[id] = {id: id, parts: [part]});
|
1122 |
+
else newStyles[id].parts.push(part);
|
1123 |
+
}
|
1124 |
+
|
1125 |
+
return styles;
|
1126 |
+
}
|
1127 |
+
|
1128 |
+
function insertStyleElement (options, style) {
|
1129 |
+
var target = getElement(options.insertInto)
|
1130 |
+
|
1131 |
+
if (!target) {
|
1132 |
+
throw new Error("Couldn't find a style target. This probably means that the value for the 'insertInto' parameter is invalid.");
|
1133 |
+
}
|
1134 |
+
|
1135 |
+
var lastStyleElementInsertedAtTop = stylesInsertedAtTop[stylesInsertedAtTop.length - 1];
|
1136 |
+
|
1137 |
+
if (options.insertAt === "top") {
|
1138 |
+
if (!lastStyleElementInsertedAtTop) {
|
1139 |
+
target.insertBefore(style, target.firstChild);
|
1140 |
+
} else if (lastStyleElementInsertedAtTop.nextSibling) {
|
1141 |
+
target.insertBefore(style, lastStyleElementInsertedAtTop.nextSibling);
|
1142 |
+
} else {
|
1143 |
+
target.appendChild(style);
|
1144 |
+
}
|
1145 |
+
stylesInsertedAtTop.push(style);
|
1146 |
+
} else if (options.insertAt === "bottom") {
|
1147 |
+
target.appendChild(style);
|
1148 |
+
} else if (typeof options.insertAt === "object" && options.insertAt.before) {
|
1149 |
+
var nextSibling = getElement(options.insertInto + " " + options.insertAt.before);
|
1150 |
+
target.insertBefore(style, nextSibling);
|
1151 |
+
} else {
|
1152 |
+
throw new Error("[Style Loader]\n\n Invalid value for parameter 'insertAt' ('options.insertAt') found.\n Must be 'top', 'bottom', or Object.\n (https://github.com/webpack-contrib/style-loader#insertat)\n");
|
1153 |
+
}
|
1154 |
+
}
|
1155 |
+
|
1156 |
+
function removeStyleElement (style) {
|
1157 |
+
if (style.parentNode === null) return false;
|
1158 |
+
style.parentNode.removeChild(style);
|
1159 |
+
|
1160 |
+
var idx = stylesInsertedAtTop.indexOf(style);
|
1161 |
+
if(idx >= 0) {
|
1162 |
+
stylesInsertedAtTop.splice(idx, 1);
|
1163 |
+
}
|
1164 |
+
}
|
1165 |
+
|
1166 |
+
function createStyleElement (options) {
|
1167 |
+
var style = document.createElement("style");
|
1168 |
+
|
1169 |
+
options.attrs.type = "text/css";
|
1170 |
+
|
1171 |
+
addAttrs(style, options.attrs);
|
1172 |
+
insertStyleElement(options, style);
|
1173 |
+
|
1174 |
+
return style;
|
1175 |
+
}
|
1176 |
+
|
1177 |
+
function createLinkElement (options) {
|
1178 |
+
var link = document.createElement("link");
|
1179 |
+
|
1180 |
+
options.attrs.type = "text/css";
|
1181 |
+
options.attrs.rel = "stylesheet";
|
1182 |
+
|
1183 |
+
addAttrs(link, options.attrs);
|
1184 |
+
insertStyleElement(options, link);
|
1185 |
+
|
1186 |
+
return link;
|
1187 |
+
}
|
1188 |
+
|
1189 |
+
function addAttrs (el, attrs) {
|
1190 |
+
Object.keys(attrs).forEach(function (key) {
|
1191 |
+
el.setAttribute(key, attrs[key]);
|
1192 |
+
});
|
1193 |
+
}
|
1194 |
+
|
1195 |
+
function addStyle (obj, options) {
|
1196 |
+
var style, update, remove, result;
|
1197 |
+
|
1198 |
+
// If a transform function was defined, run it on the css
|
1199 |
+
if (options.transform && obj.css) {
|
1200 |
+
result = options.transform(obj.css);
|
1201 |
+
|
1202 |
+
if (result) {
|
1203 |
+
// If transform returns a value, use that instead of the original css.
|
1204 |
+
// This allows running runtime transformations on the css.
|
1205 |
+
obj.css = result;
|
1206 |
+
} else {
|
1207 |
+
// If the transform function returns a falsy value, don't add this css.
|
1208 |
+
// This allows conditional loading of css
|
1209 |
+
return function() {
|
1210 |
+
// noop
|
1211 |
+
};
|
1212 |
+
}
|
1213 |
+
}
|
1214 |
+
|
1215 |
+
if (options.singleton) {
|
1216 |
+
var styleIndex = singletonCounter++;
|
1217 |
+
|
1218 |
+
style = singleton || (singleton = createStyleElement(options));
|
1219 |
+
|
1220 |
+
update = applyToSingletonTag.bind(null, style, styleIndex, false);
|
1221 |
+
remove = applyToSingletonTag.bind(null, style, styleIndex, true);
|
1222 |
+
|
1223 |
+
} else if (
|
1224 |
+
obj.sourceMap &&
|
1225 |
+
typeof URL === "function" &&
|
1226 |
+
typeof URL.createObjectURL === "function" &&
|
1227 |
+
typeof URL.revokeObjectURL === "function" &&
|
1228 |
+
typeof Blob === "function" &&
|
1229 |
+
typeof btoa === "function"
|
1230 |
+
) {
|
1231 |
+
style = createLinkElement(options);
|
1232 |
+
update = updateLink.bind(null, style, options);
|
1233 |
+
remove = function () {
|
1234 |
+
removeStyleElement(style);
|
1235 |
+
|
1236 |
+
if(style.href) URL.revokeObjectURL(style.href);
|
1237 |
+
};
|
1238 |
+
} else {
|
1239 |
+
style = createStyleElement(options);
|
1240 |
+
update = applyToTag.bind(null, style);
|
1241 |
+
remove = function () {
|
1242 |
+
removeStyleElement(style);
|
1243 |
+
};
|
1244 |
+
}
|
1245 |
+
|
1246 |
+
update(obj);
|
1247 |
+
|
1248 |
+
return function updateStyle (newObj) {
|
1249 |
+
if (newObj) {
|
1250 |
+
if (
|
1251 |
+
newObj.css === obj.css &&
|
1252 |
+
newObj.media === obj.media &&
|
1253 |
+
newObj.sourceMap === obj.sourceMap
|
1254 |
+
) {
|
1255 |
+
return;
|
1256 |
+
}
|
1257 |
+
|
1258 |
+
update(obj = newObj);
|
1259 |
+
} else {
|
1260 |
+
remove();
|
1261 |
+
}
|
1262 |
+
};
|
1263 |
+
}
|
1264 |
+
|
1265 |
+
var replaceText = (function () {
|
1266 |
+
var textStore = [];
|
1267 |
+
|
1268 |
+
return function (index, replacement) {
|
1269 |
+
textStore[index] = replacement;
|
1270 |
+
|
1271 |
+
return textStore.filter(Boolean).join('\n');
|
1272 |
+
};
|
1273 |
+
})();
|
1274 |
+
|
1275 |
+
function applyToSingletonTag (style, index, remove, obj) {
|
1276 |
+
var css = remove ? "" : obj.css;
|
1277 |
+
|
1278 |
+
if (style.styleSheet) {
|
1279 |
+
style.styleSheet.cssText = replaceText(index, css);
|
1280 |
+
} else {
|
1281 |
+
var cssNode = document.createTextNode(css);
|
1282 |
+
var childNodes = style.childNodes;
|
1283 |
+
|
1284 |
+
if (childNodes[index]) style.removeChild(childNodes[index]);
|
1285 |
+
|
1286 |
+
if (childNodes.length) {
|
1287 |
+
style.insertBefore(cssNode, childNodes[index]);
|
1288 |
+
} else {
|
1289 |
+
style.appendChild(cssNode);
|
1290 |
+
}
|
1291 |
+
}
|
1292 |
+
}
|
1293 |
+
|
1294 |
+
function applyToTag (style, obj) {
|
1295 |
+
var css = obj.css;
|
1296 |
+
var media = obj.media;
|
1297 |
+
|
1298 |
+
if(media) {
|
1299 |
+
style.setAttribute("media", media)
|
1300 |
+
}
|
1301 |
+
|
1302 |
+
if(style.styleSheet) {
|
1303 |
+
style.styleSheet.cssText = css;
|
1304 |
+
} else {
|
1305 |
+
while(style.firstChild) {
|
1306 |
+
style.removeChild(style.firstChild);
|
1307 |
+
}
|
1308 |
+
|
1309 |
+
style.appendChild(document.createTextNode(css));
|
1310 |
+
}
|
1311 |
+
}
|
1312 |
+
|
1313 |
+
function updateLink (link, options, obj) {
|
1314 |
+
var css = obj.css;
|
1315 |
+
var sourceMap = obj.sourceMap;
|
1316 |
+
|
1317 |
+
/*
|
1318 |
+
If convertToAbsoluteUrls isn't defined, but sourcemaps are enabled
|
1319 |
+
and there is no publicPath defined then lets turn convertToAbsoluteUrls
|
1320 |
+
on by default. Otherwise default to the convertToAbsoluteUrls option
|
1321 |
+
directly
|
1322 |
+
*/
|
1323 |
+
var autoFixUrls = options.convertToAbsoluteUrls === undefined && sourceMap;
|
1324 |
+
|
1325 |
+
if (options.convertToAbsoluteUrls || autoFixUrls) {
|
1326 |
+
css = fixUrls(css);
|
1327 |
+
}
|
1328 |
+
|
1329 |
+
if (sourceMap) {
|
1330 |
+
// http://stackoverflow.com/a/26603875
|
1331 |
+
css += "\n/*# sourceMappingURL=data:application/json;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))) + " */";
|
1332 |
+
}
|
1333 |
+
|
1334 |
+
var blob = new Blob([css], { type: "text/css" });
|
1335 |
+
|
1336 |
+
var oldSrc = link.href;
|
1337 |
+
|
1338 |
+
link.href = URL.createObjectURL(blob);
|
1339 |
+
|
1340 |
+
if(oldSrc) URL.revokeObjectURL(oldSrc);
|
1341 |
+
}
|
1342 |
+
|
1343 |
+
|
1344 |
+
/***/ }),
|
1345 |
+
/* 18 */
|
1346 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1347 |
+
|
1348 |
+
var global = __webpack_require__(14);
|
1349 |
+
var core = __webpack_require__(10);
|
1350 |
+
var ctx = __webpack_require__(43);
|
1351 |
+
var hide = __webpack_require__(28);
|
1352 |
+
var PROTOTYPE = 'prototype';
|
1353 |
+
|
1354 |
+
var $export = function (type, name, source) {
|
1355 |
+
var IS_FORCED = type & $export.F;
|
1356 |
+
var IS_GLOBAL = type & $export.G;
|
1357 |
+
var IS_STATIC = type & $export.S;
|
1358 |
+
var IS_PROTO = type & $export.P;
|
1359 |
+
var IS_BIND = type & $export.B;
|
1360 |
+
var IS_WRAP = type & $export.W;
|
1361 |
+
var exports = IS_GLOBAL ? core : core[name] || (core[name] = {});
|
1362 |
+
var expProto = exports[PROTOTYPE];
|
1363 |
+
var target = IS_GLOBAL ? global : IS_STATIC ? global[name] : (global[name] || {})[PROTOTYPE];
|
1364 |
+
var key, own, out;
|
1365 |
+
if (IS_GLOBAL) source = name;
|
1366 |
+
for (key in source) {
|
1367 |
+
// contains in native
|
1368 |
+
own = !IS_FORCED && target && target[key] !== undefined;
|
1369 |
+
if (own && key in exports) continue;
|
1370 |
+
// export native or passed
|
1371 |
+
out = own ? target[key] : source[key];
|
1372 |
+
// prevent global pollution for namespaces
|
1373 |
+
exports[key] = IS_GLOBAL && typeof target[key] != 'function' ? source[key]
|
1374 |
+
// bind timers to global for call from export context
|
1375 |
+
: IS_BIND && own ? ctx(out, global)
|
1376 |
+
// wrap global constructors for prevent change them in library
|
1377 |
+
: IS_WRAP && target[key] == out ? (function (C) {
|
1378 |
+
var F = function (a, b, c) {
|
1379 |
+
if (this instanceof C) {
|
1380 |
+
switch (arguments.length) {
|
1381 |
+
case 0: return new C();
|
1382 |
+
case 1: return new C(a);
|
1383 |
+
case 2: return new C(a, b);
|
1384 |
+
} return new C(a, b, c);
|
1385 |
+
} return C.apply(this, arguments);
|
1386 |
+
};
|
1387 |
+
F[PROTOTYPE] = C[PROTOTYPE];
|
1388 |
+
return F;
|
1389 |
+
// make static versions for prototype methods
|
1390 |
+
})(out) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out;
|
1391 |
+
// export proto methods to core.%CONSTRUCTOR%.methods.%NAME%
|
1392 |
+
if (IS_PROTO) {
|
1393 |
+
(exports.virtual || (exports.virtual = {}))[key] = out;
|
1394 |
+
// export proto methods to core.%CONSTRUCTOR%.prototype.%NAME%
|
1395 |
+
if (type & $export.R && expProto && !expProto[key]) hide(expProto, key, out);
|
1396 |
+
}
|
1397 |
+
}
|
1398 |
+
};
|
1399 |
+
// type bitmap
|
1400 |
+
$export.F = 1; // forced
|
1401 |
+
$export.G = 2; // global
|
1402 |
+
$export.S = 4; // static
|
1403 |
+
$export.P = 8; // proto
|
1404 |
+
$export.B = 16; // bind
|
1405 |
+
$export.W = 32; // wrap
|
1406 |
+
$export.U = 64; // safe
|
1407 |
+
$export.R = 128; // real proto method for `library`
|
1408 |
+
module.exports = $export;
|
1409 |
+
|
1410 |
+
|
1411 |
+
/***/ }),
|
1412 |
+
/* 19 */
|
1413 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1414 |
+
|
1415 |
+
var isObject = __webpack_require__(25);
|
1416 |
+
module.exports = function (it) {
|
1417 |
+
if (!isObject(it)) throw TypeError(it + ' is not an object!');
|
1418 |
+
return it;
|
1419 |
+
};
|
1420 |
+
|
1421 |
+
|
1422 |
+
/***/ }),
|
1423 |
+
/* 20 */
|
1424 |
+
/***/ (function(module, exports) {
|
1425 |
+
|
1426 |
+
var g;
|
1427 |
+
|
1428 |
+
// This works in non-strict mode
|
1429 |
+
g = (function() {
|
1430 |
+
return this;
|
1431 |
+
})();
|
1432 |
+
|
1433 |
+
try {
|
1434 |
+
// This works if eval is allowed (see CSP)
|
1435 |
+
g = g || Function("return this")() || (1,eval)("this");
|
1436 |
+
} catch(e) {
|
1437 |
+
// This works if the window reference is available
|
1438 |
+
if(typeof window === "object")
|
1439 |
+
g = window;
|
1440 |
+
}
|
1441 |
+
|
1442 |
+
// g can still be undefined, but nothing to do about it...
|
1443 |
+
// We return undefined, instead of nothing here, so it's
|
1444 |
+
// easier to handle this case. if(!global) { ...}
|
1445 |
+
|
1446 |
+
module.exports = g;
|
1447 |
+
|
1448 |
+
|
1449 |
+
/***/ }),
|
1450 |
+
/* 21 */
|
1451 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1452 |
+
|
1453 |
+
var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
|
1454 |
+
Copyright (c) 2016 Jed Watson.
|
1455 |
+
Licensed under the MIT License (MIT), see
|
1456 |
+
http://jedwatson.github.io/classnames
|
1457 |
+
*/
|
1458 |
+
/* global define */
|
1459 |
+
|
1460 |
+
(function () {
|
1461 |
+
'use strict';
|
1462 |
+
|
1463 |
+
var hasOwn = {}.hasOwnProperty;
|
1464 |
+
|
1465 |
+
function classNames () {
|
1466 |
+
var classes = [];
|
1467 |
+
|
1468 |
+
for (var i = 0; i < arguments.length; i++) {
|
1469 |
+
var arg = arguments[i];
|
1470 |
+
if (!arg) continue;
|
1471 |
+
|
1472 |
+
var argType = typeof arg;
|
1473 |
+
|
1474 |
+
if (argType === 'string' || argType === 'number') {
|
1475 |
+
classes.push(arg);
|
1476 |
+
} else if (Array.isArray(arg)) {
|
1477 |
+
classes.push(classNames.apply(null, arg));
|
1478 |
+
} else if (argType === 'object') {
|
1479 |
+
for (var key in arg) {
|
1480 |
+
if (hasOwn.call(arg, key) && arg[key]) {
|
1481 |
+
classes.push(key);
|
1482 |
+
}
|
1483 |
+
}
|
1484 |
+
}
|
1485 |
+
}
|
1486 |
+
|
1487 |
+
return classes.join(' ');
|
1488 |
+
}
|
1489 |
+
|
1490 |
+
if (typeof module !== 'undefined' && module.exports) {
|
1491 |
+
module.exports = classNames;
|
1492 |
+
} else if (true) {
|
1493 |
+
// register as 'classnames', consistent with npm package name
|
1494 |
+
!(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = function () {
|
1495 |
+
return classNames;
|
1496 |
+
}.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
|
1497 |
+
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
|
1498 |
+
} else {
|
1499 |
+
window.classNames = classNames;
|
1500 |
+
}
|
1501 |
+
}());
|
1502 |
+
|
1503 |
+
|
1504 |
+
/***/ }),
|
1505 |
+
/* 22 */
|
1506 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1507 |
+
|
1508 |
+
"use strict";
|
1509 |
+
/*
|
1510 |
+
object-assign
|
1511 |
+
(c) Sindre Sorhus
|
1512 |
+
@license MIT
|
1513 |
+
*/
|
1514 |
+
|
1515 |
+
|
1516 |
+
/* eslint-disable no-unused-vars */
|
1517 |
+
var getOwnPropertySymbols = Object.getOwnPropertySymbols;
|
1518 |
+
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
1519 |
+
var propIsEnumerable = Object.prototype.propertyIsEnumerable;
|
1520 |
+
|
1521 |
+
function toObject(val) {
|
1522 |
+
if (val === null || val === undefined) {
|
1523 |
+
throw new TypeError('Object.assign cannot be called with null or undefined');
|
1524 |
+
}
|
1525 |
+
|
1526 |
+
return Object(val);
|
1527 |
+
}
|
1528 |
+
|
1529 |
+
function shouldUseNative() {
|
1530 |
+
try {
|
1531 |
+
if (!Object.assign) {
|
1532 |
+
return false;
|
1533 |
+
}
|
1534 |
+
|
1535 |
+
// Detect buggy property enumeration order in older V8 versions.
|
1536 |
+
|
1537 |
+
// https://bugs.chromium.org/p/v8/issues/detail?id=4118
|
1538 |
+
var test1 = new String('abc'); // eslint-disable-line no-new-wrappers
|
1539 |
+
test1[5] = 'de';
|
1540 |
+
if (Object.getOwnPropertyNames(test1)[0] === '5') {
|
1541 |
+
return false;
|
1542 |
+
}
|
1543 |
+
|
1544 |
+
// https://bugs.chromium.org/p/v8/issues/detail?id=3056
|
1545 |
+
var test2 = {};
|
1546 |
+
for (var i = 0; i < 10; i++) {
|
1547 |
+
test2['_' + String.fromCharCode(i)] = i;
|
1548 |
+
}
|
1549 |
+
var order2 = Object.getOwnPropertyNames(test2).map(function (n) {
|
1550 |
+
return test2[n];
|
1551 |
+
});
|
1552 |
+
if (order2.join('') !== '0123456789') {
|
1553 |
+
return false;
|
1554 |
+
}
|
1555 |
+
|
1556 |
+
// https://bugs.chromium.org/p/v8/issues/detail?id=3056
|
1557 |
+
var test3 = {};
|
1558 |
+
'abcdefghijklmnopqrst'.split('').forEach(function (letter) {
|
1559 |
+
test3[letter] = letter;
|
1560 |
+
});
|
1561 |
+
if (Object.keys(Object.assign({}, test3)).join('') !==
|
1562 |
+
'abcdefghijklmnopqrst') {
|
1563 |
+
return false;
|
1564 |
+
}
|
1565 |
+
|
1566 |
+
return true;
|
1567 |
+
} catch (err) {
|
1568 |
+
// We don't expect any of the above to throw, but better to be safe.
|
1569 |
+
return false;
|
1570 |
+
}
|
1571 |
+
}
|
1572 |
+
|
1573 |
+
module.exports = shouldUseNative() ? Object.assign : function (target, source) {
|
1574 |
+
var from;
|
1575 |
+
var to = toObject(target);
|
1576 |
+
var symbols;
|
1577 |
+
|
1578 |
+
for (var s = 1; s < arguments.length; s++) {
|
1579 |
+
from = Object(arguments[s]);
|
1580 |
+
|
1581 |
+
for (var key in from) {
|
1582 |
+
if (hasOwnProperty.call(from, key)) {
|
1583 |
+
to[key] = from[key];
|
1584 |
+
}
|
1585 |
+
}
|
1586 |
+
|
1587 |
+
if (getOwnPropertySymbols) {
|
1588 |
+
symbols = getOwnPropertySymbols(from);
|
1589 |
+
for (var i = 0; i < symbols.length; i++) {
|
1590 |
+
if (propIsEnumerable.call(from, symbols[i])) {
|
1591 |
+
to[symbols[i]] = from[symbols[i]];
|
1592 |
+
}
|
1593 |
+
}
|
1594 |
+
}
|
1595 |
+
}
|
1596 |
+
|
1597 |
+
return to;
|
1598 |
+
};
|
1599 |
+
|
1600 |
+
|
1601 |
+
/***/ }),
|
1602 |
+
/* 23 */
|
1603 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1604 |
+
|
1605 |
+
"use strict";
|
1606 |
+
|
1607 |
+
|
1608 |
+
/**
|
1609 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
1610 |
+
*
|
1611 |
+
* This source code is licensed under the MIT license found in the
|
1612 |
+
* LICENSE file in the root directory of this source tree.
|
1613 |
+
*
|
1614 |
+
*
|
1615 |
+
*/
|
1616 |
+
|
1617 |
+
function makeEmptyFunction(arg) {
|
1618 |
+
return function () {
|
1619 |
+
return arg;
|
1620 |
+
};
|
1621 |
+
}
|
1622 |
+
|
1623 |
+
/**
|
1624 |
+
* This function accepts and discards inputs; it has no side effects. This is
|
1625 |
+
* primarily useful idiomatically for overridable function endpoints which
|
1626 |
+
* always need to be callable, since JS lacks a null-call idiom ala Cocoa.
|
1627 |
+
*/
|
1628 |
+
var emptyFunction = function emptyFunction() {};
|
1629 |
+
|
1630 |
+
emptyFunction.thatReturns = makeEmptyFunction;
|
1631 |
+
emptyFunction.thatReturnsFalse = makeEmptyFunction(false);
|
1632 |
+
emptyFunction.thatReturnsTrue = makeEmptyFunction(true);
|
1633 |
+
emptyFunction.thatReturnsNull = makeEmptyFunction(null);
|
1634 |
+
emptyFunction.thatReturnsThis = function () {
|
1635 |
+
return this;
|
1636 |
+
};
|
1637 |
+
emptyFunction.thatReturnsArgument = function (arg) {
|
1638 |
+
return arg;
|
1639 |
+
};
|
1640 |
+
|
1641 |
+
module.exports = emptyFunction;
|
1642 |
+
|
1643 |
+
/***/ }),
|
1644 |
+
/* 24 */
|
1645 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1646 |
+
|
1647 |
+
var anObject = __webpack_require__(19);
|
1648 |
+
var IE8_DOM_DEFINE = __webpack_require__(122);
|
1649 |
+
var toPrimitive = __webpack_require__(80);
|
1650 |
+
var dP = Object.defineProperty;
|
1651 |
+
|
1652 |
+
exports.f = __webpack_require__(26) ? Object.defineProperty : function defineProperty(O, P, Attributes) {
|
1653 |
+
anObject(O);
|
1654 |
+
P = toPrimitive(P, true);
|
1655 |
+
anObject(Attributes);
|
1656 |
+
if (IE8_DOM_DEFINE) try {
|
1657 |
+
return dP(O, P, Attributes);
|
1658 |
+
} catch (e) { /* empty */ }
|
1659 |
+
if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported!');
|
1660 |
+
if ('value' in Attributes) O[P] = Attributes.value;
|
1661 |
+
return O;
|
1662 |
+
};
|
1663 |
+
|
1664 |
+
|
1665 |
+
/***/ }),
|
1666 |
+
/* 25 */
|
1667 |
+
/***/ (function(module, exports) {
|
1668 |
+
|
1669 |
+
module.exports = function (it) {
|
1670 |
+
return typeof it === 'object' ? it !== null : typeof it === 'function';
|
1671 |
+
};
|
1672 |
+
|
1673 |
+
|
1674 |
+
/***/ }),
|
1675 |
+
/* 26 */
|
1676 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1677 |
+
|
1678 |
+
// Thank's IE8 for his funny defineProperty
|
1679 |
+
module.exports = !__webpack_require__(35)(function () {
|
1680 |
+
return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7;
|
1681 |
+
});
|
1682 |
+
|
1683 |
+
|
1684 |
+
/***/ }),
|
1685 |
+
/* 27 */
|
1686 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1687 |
+
|
1688 |
+
"use strict";
|
1689 |
+
/**
|
1690 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
1691 |
+
*
|
1692 |
+
* This source code is licensed under the MIT license found in the
|
1693 |
+
* LICENSE file in the root directory of this source tree.
|
1694 |
+
*
|
1695 |
+
*/
|
1696 |
+
|
1697 |
+
|
1698 |
+
|
1699 |
+
var React = __webpack_require__(1);
|
1700 |
+
var factory = __webpack_require__(434);
|
1701 |
+
|
1702 |
+
if (typeof React === 'undefined') {
|
1703 |
+
throw Error(
|
1704 |
+
'create-react-class could not find the React object. If you are using script tags, ' +
|
1705 |
+
'make sure that React is being loaded before create-react-class.'
|
1706 |
+
);
|
1707 |
+
}
|
1708 |
+
|
1709 |
+
// Hack to grab NoopUpdateQueue from isomorphic React
|
1710 |
+
var ReactNoopUpdateQueue = new React.Component().updater;
|
1711 |
+
|
1712 |
+
module.exports = factory(
|
1713 |
+
React.Component,
|
1714 |
+
React.isValidElement,
|
1715 |
+
ReactNoopUpdateQueue
|
1716 |
+
);
|
1717 |
+
|
1718 |
+
|
1719 |
+
/***/ }),
|
1720 |
+
/* 28 */
|
1721 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1722 |
+
|
1723 |
+
var dP = __webpack_require__(24);
|
1724 |
+
var createDesc = __webpack_require__(57);
|
1725 |
+
module.exports = __webpack_require__(26) ? function (object, key, value) {
|
1726 |
+
return dP.f(object, key, createDesc(1, value));
|
1727 |
+
} : function (object, key, value) {
|
1728 |
+
object[key] = value;
|
1729 |
+
return object;
|
1730 |
+
};
|
1731 |
+
|
1732 |
+
|
1733 |
+
/***/ }),
|
1734 |
+
/* 29 */
|
1735 |
+
/***/ (function(module, exports) {
|
1736 |
+
|
1737 |
+
var hasOwnProperty = {}.hasOwnProperty;
|
1738 |
+
module.exports = function (it, key) {
|
1739 |
+
return hasOwnProperty.call(it, key);
|
1740 |
+
};
|
1741 |
+
|
1742 |
+
|
1743 |
+
/***/ }),
|
1744 |
+
/* 30 */
|
1745 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1746 |
+
|
1747 |
+
// to indexed object, toObject with fallback for non-array-like ES3 strings
|
1748 |
+
var IObject = __webpack_require__(125);
|
1749 |
+
var defined = __webpack_require__(78);
|
1750 |
+
module.exports = function (it) {
|
1751 |
+
return IObject(defined(it));
|
1752 |
+
};
|
1753 |
+
|
1754 |
+
|
1755 |
+
/***/ }),
|
1756 |
+
/* 31 */
|
1757 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1758 |
+
|
1759 |
+
module.exports = { "default": __webpack_require__(234), __esModule: true };
|
1760 |
+
|
1761 |
+
/***/ }),
|
1762 |
+
/* 32 */
|
1763 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1764 |
+
|
1765 |
+
var baseGetTag = __webpack_require__(64),
|
1766 |
+
getPrototype = __webpack_require__(311),
|
1767 |
+
isObjectLike = __webpack_require__(52);
|
1768 |
+
|
1769 |
+
/** `Object#toString` result references. */
|
1770 |
+
var objectTag = '[object Object]';
|
1771 |
+
|
1772 |
+
/** Used for built-in method references. */
|
1773 |
+
var funcProto = Function.prototype,
|
1774 |
+
objectProto = Object.prototype;
|
1775 |
+
|
1776 |
+
/** Used to resolve the decompiled source of functions. */
|
1777 |
+
var funcToString = funcProto.toString;
|
1778 |
+
|
1779 |
+
/** Used to check objects for own properties. */
|
1780 |
+
var hasOwnProperty = objectProto.hasOwnProperty;
|
1781 |
+
|
1782 |
+
/** Used to infer the `Object` constructor. */
|
1783 |
+
var objectCtorString = funcToString.call(Object);
|
1784 |
+
|
1785 |
+
/**
|
1786 |
+
* Checks if `value` is a plain object, that is, an object created by the
|
1787 |
+
* `Object` constructor or one with a `[[Prototype]]` of `null`.
|
1788 |
+
*
|
1789 |
+
* @static
|
1790 |
+
* @memberOf _
|
1791 |
+
* @since 0.8.0
|
1792 |
+
* @category Lang
|
1793 |
+
* @param {*} value The value to check.
|
1794 |
+
* @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
|
1795 |
+
* @example
|
1796 |
+
*
|
1797 |
+
* function Foo() {
|
1798 |
+
* this.a = 1;
|
1799 |
+
* }
|
1800 |
+
*
|
1801 |
+
* _.isPlainObject(new Foo);
|
1802 |
+
* // => false
|
1803 |
+
*
|
1804 |
+
* _.isPlainObject([1, 2, 3]);
|
1805 |
+
* // => false
|
1806 |
+
*
|
1807 |
+
* _.isPlainObject({ 'x': 0, 'y': 0 });
|
1808 |
+
* // => true
|
1809 |
+
*
|
1810 |
+
* _.isPlainObject(Object.create(null));
|
1811 |
+
* // => true
|
1812 |
+
*/
|
1813 |
+
function isPlainObject(value) {
|
1814 |
+
if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
|
1815 |
+
return false;
|
1816 |
+
}
|
1817 |
+
var proto = getPrototype(value);
|
1818 |
+
if (proto === null) {
|
1819 |
+
return true;
|
1820 |
+
}
|
1821 |
+
var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
|
1822 |
+
return typeof Ctor == 'function' && Ctor instanceof Ctor &&
|
1823 |
+
funcToString.call(Ctor) == objectCtorString;
|
1824 |
+
}
|
1825 |
+
|
1826 |
+
module.exports = isPlainObject;
|
1827 |
+
|
1828 |
+
|
1829 |
+
/***/ }),
|
1830 |
+
/* 33 */
|
1831 |
+
/***/ (function(module, exports) {
|
1832 |
+
|
1833 |
+
/**
|
1834 |
+
* Checks if `value` is classified as an `Array` object.
|
1835 |
+
*
|
1836 |
+
* @static
|
1837 |
+
* @memberOf _
|
1838 |
+
* @since 0.1.0
|
1839 |
+
* @category Lang
|
1840 |
+
* @param {*} value The value to check.
|
1841 |
+
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
|
1842 |
+
* @example
|
1843 |
+
*
|
1844 |
+
* _.isArray([1, 2, 3]);
|
1845 |
+
* // => true
|
1846 |
+
*
|
1847 |
+
* _.isArray(document.body.children);
|
1848 |
+
* // => false
|
1849 |
+
*
|
1850 |
+
* _.isArray('abc');
|
1851 |
+
* // => false
|
1852 |
+
*
|
1853 |
+
* _.isArray(_.noop);
|
1854 |
+
* // => false
|
1855 |
+
*/
|
1856 |
+
var isArray = Array.isArray;
|
1857 |
+
|
1858 |
+
module.exports = isArray;
|
1859 |
+
|
1860 |
+
|
1861 |
+
/***/ }),
|
1862 |
+
/* 34 */
|
1863 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1864 |
+
|
1865 |
+
"use strict";
|
1866 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
1867 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
1868 |
+
*
|
1869 |
+
* This source code is licensed under the MIT license found in the
|
1870 |
+
* LICENSE file in the root directory of this source tree.
|
1871 |
+
*
|
1872 |
+
*/
|
1873 |
+
|
1874 |
+
|
1875 |
+
|
1876 |
+
/**
|
1877 |
+
* Use invariant() to assert state which your program assumes to be true.
|
1878 |
+
*
|
1879 |
+
* Provide sprintf-style format (only %s is supported) and arguments
|
1880 |
+
* to provide information about what broke and what you were
|
1881 |
+
* expecting.
|
1882 |
+
*
|
1883 |
+
* The invariant message will be stripped in production, but the invariant
|
1884 |
+
* will remain to ensure logic does not differ in production.
|
1885 |
+
*/
|
1886 |
+
|
1887 |
+
var validateFormat = function validateFormat(format) {};
|
1888 |
+
|
1889 |
+
if (process.env.NODE_ENV !== 'production') {
|
1890 |
+
validateFormat = function validateFormat(format) {
|
1891 |
+
if (format === undefined) {
|
1892 |
+
throw new Error('invariant requires an error message argument');
|
1893 |
+
}
|
1894 |
+
};
|
1895 |
+
}
|
1896 |
+
|
1897 |
+
function invariant(condition, format, a, b, c, d, e, f) {
|
1898 |
+
validateFormat(format);
|
1899 |
+
|
1900 |
+
if (!condition) {
|
1901 |
+
var error;
|
1902 |
+
if (format === undefined) {
|
1903 |
+
error = new Error('Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.');
|
1904 |
+
} else {
|
1905 |
+
var args = [a, b, c, d, e, f];
|
1906 |
+
var argIndex = 0;
|
1907 |
+
error = new Error(format.replace(/%s/g, function () {
|
1908 |
+
return args[argIndex++];
|
1909 |
+
}));
|
1910 |
+
error.name = 'Invariant Violation';
|
1911 |
+
}
|
1912 |
+
|
1913 |
+
error.framesToPop = 1; // we don't care about invariant's own frame
|
1914 |
+
throw error;
|
1915 |
+
}
|
1916 |
+
}
|
1917 |
+
|
1918 |
+
module.exports = invariant;
|
1919 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
1920 |
+
|
1921 |
+
/***/ }),
|
1922 |
+
/* 35 */
|
1923 |
+
/***/ (function(module, exports) {
|
1924 |
+
|
1925 |
+
module.exports = function (exec) {
|
1926 |
+
try {
|
1927 |
+
return !!exec();
|
1928 |
+
} catch (e) {
|
1929 |
+
return true;
|
1930 |
+
}
|
1931 |
+
};
|
1932 |
+
|
1933 |
+
|
1934 |
+
/***/ }),
|
1935 |
+
/* 36 */
|
1936 |
+
/***/ (function(module, exports) {
|
1937 |
+
|
1938 |
+
module.exports = {};
|
1939 |
+
|
1940 |
+
|
1941 |
+
/***/ }),
|
1942 |
+
/* 37 */
|
1943 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1944 |
+
|
1945 |
+
var babelPluginFlowReactPropTypes_proptype_Index = {
|
1946 |
+
index: __webpack_require__(0).number.isRequired
|
1947 |
+
};
|
1948 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_Index", {
|
1949 |
+
value: babelPluginFlowReactPropTypes_proptype_Index,
|
1950 |
+
configurable: true
|
1951 |
+
});
|
1952 |
+
var babelPluginFlowReactPropTypes_proptype_PositionInfo = {
|
1953 |
+
x: __webpack_require__(0).number.isRequired,
|
1954 |
+
y: __webpack_require__(0).number.isRequired
|
1955 |
+
};
|
1956 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_PositionInfo", {
|
1957 |
+
value: babelPluginFlowReactPropTypes_proptype_PositionInfo,
|
1958 |
+
configurable: true
|
1959 |
+
});
|
1960 |
+
var babelPluginFlowReactPropTypes_proptype_ScrollPosition = {
|
1961 |
+
scrollLeft: __webpack_require__(0).number.isRequired,
|
1962 |
+
scrollTop: __webpack_require__(0).number.isRequired
|
1963 |
+
};
|
1964 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_ScrollPosition", {
|
1965 |
+
value: babelPluginFlowReactPropTypes_proptype_ScrollPosition,
|
1966 |
+
configurable: true
|
1967 |
+
});
|
1968 |
+
var babelPluginFlowReactPropTypes_proptype_SizeAndPositionInfo = {
|
1969 |
+
height: __webpack_require__(0).number.isRequired,
|
1970 |
+
width: __webpack_require__(0).number.isRequired,
|
1971 |
+
x: __webpack_require__(0).number.isRequired,
|
1972 |
+
y: __webpack_require__(0).number.isRequired
|
1973 |
+
};
|
1974 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_SizeAndPositionInfo", {
|
1975 |
+
value: babelPluginFlowReactPropTypes_proptype_SizeAndPositionInfo,
|
1976 |
+
configurable: true
|
1977 |
+
});
|
1978 |
+
var babelPluginFlowReactPropTypes_proptype_SizeInfo = {
|
1979 |
+
height: __webpack_require__(0).number.isRequired,
|
1980 |
+
width: __webpack_require__(0).number.isRequired
|
1981 |
+
};
|
1982 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_SizeInfo", {
|
1983 |
+
value: babelPluginFlowReactPropTypes_proptype_SizeInfo,
|
1984 |
+
configurable: true
|
1985 |
+
});
|
1986 |
+
|
1987 |
+
/***/ }),
|
1988 |
+
/* 38 */
|
1989 |
+
/***/ (function(module, exports, __webpack_require__) {
|
1990 |
+
|
1991 |
+
var identity = __webpack_require__(159),
|
1992 |
+
overRest = __webpack_require__(348),
|
1993 |
+
setToString = __webpack_require__(349);
|
1994 |
+
|
1995 |
+
/**
|
1996 |
+
* The base implementation of `_.rest` which doesn't validate or coerce arguments.
|
1997 |
+
*
|
1998 |
+
* @private
|
1999 |
+
* @param {Function} func The function to apply a rest parameter to.
|
2000 |
+
* @param {number} [start=func.length-1] The start position of the rest parameter.
|
2001 |
+
* @returns {Function} Returns the new function.
|
2002 |
+
*/
|
2003 |
+
function baseRest(func, start) {
|
2004 |
+
return setToString(overRest(func, start, identity), func + '');
|
2005 |
+
}
|
2006 |
+
|
2007 |
+
module.exports = baseRest;
|
2008 |
+
|
2009 |
+
|
2010 |
+
/***/ }),
|
2011 |
+
/* 39 */
|
2012 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
2013 |
+
|
2014 |
+
"use strict";
|
2015 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__propertyUtils__ = __webpack_require__(450);
|
2016 |
+
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
2017 |
+
|
2018 |
+
|
2019 |
+
|
2020 |
+
var RE_NUM = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source;
|
2021 |
+
|
2022 |
+
var getComputedStyleX = void 0;
|
2023 |
+
|
2024 |
+
// https://stackoverflow.com/a/3485654/3040605
|
2025 |
+
function forceRelayout(elem) {
|
2026 |
+
var originalStyle = elem.style.display;
|
2027 |
+
elem.style.display = 'none';
|
2028 |
+
elem.offsetHeight; // eslint-disable-line
|
2029 |
+
elem.style.display = originalStyle;
|
2030 |
+
}
|
2031 |
+
|
2032 |
+
function css(el, name, v) {
|
2033 |
+
var value = v;
|
2034 |
+
if ((typeof name === 'undefined' ? 'undefined' : _typeof(name)) === 'object') {
|
2035 |
+
for (var i in name) {
|
2036 |
+
if (name.hasOwnProperty(i)) {
|
2037 |
+
css(el, i, name[i]);
|
2038 |
+
}
|
2039 |
+
}
|
2040 |
+
return undefined;
|
2041 |
+
}
|
2042 |
+
if (typeof value !== 'undefined') {
|
2043 |
+
if (typeof value === 'number') {
|
2044 |
+
value = value + 'px';
|
2045 |
+
}
|
2046 |
+
el.style[name] = value;
|
2047 |
+
return undefined;
|
2048 |
+
}
|
2049 |
+
return getComputedStyleX(el, name);
|
2050 |
+
}
|
2051 |
+
|
2052 |
+
function getClientPosition(elem) {
|
2053 |
+
var box = void 0;
|
2054 |
+
var x = void 0;
|
2055 |
+
var y = void 0;
|
2056 |
+
var doc = elem.ownerDocument;
|
2057 |
+
var body = doc.body;
|
2058 |
+
var docElem = doc && doc.documentElement;
|
2059 |
+
// 根据 GBS 最新数据,A-Grade Browsers 都已支持 getBoundingClientRect 方法,不用再考虑传统的实现方式
|
2060 |
+
box = elem.getBoundingClientRect();
|
2061 |
+
|
2062 |
+
// 注:jQuery 还考虑减去 docElem.clientLeft/clientTop
|
2063 |
+
// 但测试发现,这样反而会导致当 html 和 body 有边距/边框样式时,获取的值不正确
|
2064 |
+
// 此外,ie6 会忽略 html 的 margin 值,幸运地是没有谁会去设置 html 的 margin
|
2065 |
+
|
2066 |
+
x = box.left;
|
2067 |
+
y = box.top;
|
2068 |
+
|
2069 |
+
// In IE, most of the time, 2 extra pixels are added to the top and left
|
2070 |
+
// due to the implicit 2-pixel inset border. In IE6/7 quirks mode and
|
2071 |
+
// IE6 standards mode, this border can be overridden by setting the
|
2072 |
+
// document element's border to zero -- thus, we cannot rely on the
|
2073 |
+
// offset always being 2 pixels.
|
2074 |
+
|
2075 |
+
// In quirks mode, the offset can be determined by querying the body's
|
2076 |
+
// clientLeft/clientTop, but in standards mode, it is found by querying
|
2077 |
+
// the document element's clientLeft/clientTop. Since we already called
|
2078 |
+
// getClientBoundingRect we have already forced a reflow, so it is not
|
2079 |
+
// too expensive just to query them all.
|
2080 |
+
|
2081 |
+
// ie 下应该减去窗口的边框吧,毕竟默认 absolute 都是相对窗口定位的
|
2082 |
+
// 窗口边框标准是设 documentElement ,quirks 时设置 body
|
2083 |
+
// 最好禁止在 body 和 html 上边框 ,但 ie < 9 html 默认有 2px ,减去
|
2084 |
+
// 但是非 ie 不可能设置窗口边框,body html 也不是窗口 ,ie 可以通过 html,body 设置
|
2085 |
+
// 标准 ie 下 docElem.clientTop 就是 border-top
|
2086 |
+
// ie7 html 即窗口边框改变不了。永远为 2
|
2087 |
+
// 但标准 firefox/chrome/ie9 下 docElem.clientTop 是窗口边框,即使设了 border-top 也为 0
|
2088 |
+
|
2089 |
+
x -= docElem.clientLeft || body.clientLeft || 0;
|
2090 |
+
y -= docElem.clientTop || body.clientTop || 0;
|
2091 |
+
|
2092 |
+
return {
|
2093 |
+
left: x,
|
2094 |
+
top: y
|
2095 |
+
};
|
2096 |
+
}
|
2097 |
+
|
2098 |
+
function getScroll(w, top) {
|
2099 |
+
var ret = w['page' + (top ? 'Y' : 'X') + 'Offset'];
|
2100 |
+
var method = 'scroll' + (top ? 'Top' : 'Left');
|
2101 |
+
if (typeof ret !== 'number') {
|
2102 |
+
var d = w.document;
|
2103 |
+
// ie6,7,8 standard mode
|
2104 |
+
ret = d.documentElement[method];
|
2105 |
+
if (typeof ret !== 'number') {
|
2106 |
+
// quirks mode
|
2107 |
+
ret = d.body[method];
|
2108 |
+
}
|
2109 |
+
}
|
2110 |
+
return ret;
|
2111 |
+
}
|
2112 |
+
|
2113 |
+
function getScrollLeft(w) {
|
2114 |
+
return getScroll(w);
|
2115 |
+
}
|
2116 |
+
|
2117 |
+
function getScrollTop(w) {
|
2118 |
+
return getScroll(w, true);
|
2119 |
+
}
|
2120 |
+
|
2121 |
+
function getOffset(el) {
|
2122 |
+
var pos = getClientPosition(el);
|
2123 |
+
var doc = el.ownerDocument;
|
2124 |
+
var w = doc.defaultView || doc.parentWindow;
|
2125 |
+
pos.left += getScrollLeft(w);
|
2126 |
+
pos.top += getScrollTop(w);
|
2127 |
+
return pos;
|
2128 |
+
}
|
2129 |
+
|
2130 |
+
/**
|
2131 |
+
* A crude way of determining if an object is a window
|
2132 |
+
* @member util
|
2133 |
+
*/
|
2134 |
+
function isWindow(obj) {
|
2135 |
+
// must use == for ie8
|
2136 |
+
/* eslint eqeqeq:0 */
|
2137 |
+
return obj !== null && obj !== undefined && obj == obj.window;
|
2138 |
+
}
|
2139 |
+
|
2140 |
+
function getDocument(node) {
|
2141 |
+
if (isWindow(node)) {
|
2142 |
+
return node.document;
|
2143 |
+
}
|
2144 |
+
if (node.nodeType === 9) {
|
2145 |
+
return node;
|
2146 |
+
}
|
2147 |
+
return node.ownerDocument;
|
2148 |
+
}
|
2149 |
+
|
2150 |
+
function _getComputedStyle(elem, name, cs) {
|
2151 |
+
var computedStyle = cs;
|
2152 |
+
var val = '';
|
2153 |
+
var d = getDocument(elem);
|
2154 |
+
computedStyle = computedStyle || d.defaultView.getComputedStyle(elem, null);
|
2155 |
+
|
2156 |
+
// https://github.com/kissyteam/kissy/issues/61
|
2157 |
+
if (computedStyle) {
|
2158 |
+
val = computedStyle.getPropertyValue(name) || computedStyle[name];
|
2159 |
+
}
|
2160 |
+
|
2161 |
+
return val;
|
2162 |
+
}
|
2163 |
+
|
2164 |
+
var _RE_NUM_NO_PX = new RegExp('^(' + RE_NUM + ')(?!px)[a-z%]+$', 'i');
|
2165 |
+
var RE_POS = /^(top|right|bottom|left)$/;
|
2166 |
+
var CURRENT_STYLE = 'currentStyle';
|
2167 |
+
var RUNTIME_STYLE = 'runtimeStyle';
|
2168 |
+
var LEFT = 'left';
|
2169 |
+
var PX = 'px';
|
2170 |
+
|
2171 |
+
function _getComputedStyleIE(elem, name) {
|
2172 |
+
// currentStyle maybe null
|
2173 |
+
// http://msdn.microsoft.com/en-us/library/ms535231.aspx
|
2174 |
+
var ret = elem[CURRENT_STYLE] && elem[CURRENT_STYLE][name];
|
2175 |
+
|
2176 |
+
// 当 width/height 设置为百分比时,通过 pixelLeft 方式转换的 width/height 值
|
2177 |
+
// 一开始就处理了! CUSTOM_STYLE.height,CUSTOM_STYLE.width ,cssHook 解决@2011-08-19
|
2178 |
+
// 在 ie 下不对,需要直接用 offset 方式
|
2179 |
+
// borderWidth 等值也有问题,但考虑到 borderWidth 设为百分比的概率很小,这里就不考虑了
|
2180 |
+
|
2181 |
+
// From the awesome hack by Dean Edwards
|
2182 |
+
// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
|
2183 |
+
// If we're not dealing with a regular pixel number
|
2184 |
+
// but a number that has a weird ending, we need to convert it to pixels
|
2185 |
+
// exclude left right for relativity
|
2186 |
+
if (_RE_NUM_NO_PX.test(ret) && !RE_POS.test(name)) {
|
2187 |
+
// Remember the original values
|
2188 |
+
var style = elem.style;
|
2189 |
+
var left = style[LEFT];
|
2190 |
+
var rsLeft = elem[RUNTIME_STYLE][LEFT];
|
2191 |
+
|
2192 |
+
// prevent flashing of content
|
2193 |
+
elem[RUNTIME_STYLE][LEFT] = elem[CURRENT_STYLE][LEFT];
|
2194 |
+
|
2195 |
+
// Put in the new values to get a computed value out
|
2196 |
+
style[LEFT] = name === 'fontSize' ? '1em' : ret || 0;
|
2197 |
+
ret = style.pixelLeft + PX;
|
2198 |
+
|
2199 |
+
// Revert the changed values
|
2200 |
+
style[LEFT] = left;
|
2201 |
+
|
2202 |
+
elem[RUNTIME_STYLE][LEFT] = rsLeft;
|
2203 |
+
}
|
2204 |
+
return ret === '' ? 'auto' : ret;
|
2205 |
+
}
|
2206 |
+
|
2207 |
+
if (typeof window !== 'undefined') {
|
2208 |
+
getComputedStyleX = window.getComputedStyle ? _getComputedStyle : _getComputedStyleIE;
|
2209 |
+
}
|
2210 |
+
|
2211 |
+
function getOffsetDirection(dir, option) {
|
2212 |
+
if (dir === 'left') {
|
2213 |
+
return option.useCssRight ? 'right' : dir;
|
2214 |
+
}
|
2215 |
+
return option.useCssBottom ? 'bottom' : dir;
|
2216 |
+
}
|
2217 |
+
|
2218 |
+
function oppositeOffsetDirection(dir) {
|
2219 |
+
if (dir === 'left') {
|
2220 |
+
return 'right';
|
2221 |
+
} else if (dir === 'right') {
|
2222 |
+
return 'left';
|
2223 |
+
} else if (dir === 'top') {
|
2224 |
+
return 'bottom';
|
2225 |
+
} else if (dir === 'bottom') {
|
2226 |
+
return 'top';
|
2227 |
+
}
|
2228 |
+
}
|
2229 |
+
|
2230 |
+
// 设置 elem 相对 elem.ownerDocument 的坐标
|
2231 |
+
function setLeftTop(elem, offset, option) {
|
2232 |
+
// set position first, in-case top/left are set even on static elem
|
2233 |
+
if (css(elem, 'position') === 'static') {
|
2234 |
+
elem.style.position = 'relative';
|
2235 |
+
}
|
2236 |
+
var presetH = -999;
|
2237 |
+
var presetV = -999;
|
2238 |
+
var horizontalProperty = getOffsetDirection('left', option);
|
2239 |
+
var verticalProperty = getOffsetDirection('top', option);
|
2240 |
+
var oppositeHorizontalProperty = oppositeOffsetDirection(horizontalProperty);
|
2241 |
+
var oppositeVerticalProperty = oppositeOffsetDirection(verticalProperty);
|
2242 |
+
|
2243 |
+
if (horizontalProperty !== 'left') {
|
2244 |
+
presetH = 999;
|
2245 |
+
}
|
2246 |
+
|
2247 |
+
if (verticalProperty !== 'top') {
|
2248 |
+
presetV = 999;
|
2249 |
+
}
|
2250 |
+
var originalTransition = '';
|
2251 |
+
var originalOffset = getOffset(elem);
|
2252 |
+
if ('left' in offset || 'top' in offset) {
|
2253 |
+
originalTransition = Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["c" /* getTransitionProperty */])(elem) || '';
|
2254 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["e" /* setTransitionProperty */])(elem, 'none');
|
2255 |
+
}
|
2256 |
+
if ('left' in offset) {
|
2257 |
+
elem.style[oppositeHorizontalProperty] = '';
|
2258 |
+
elem.style[horizontalProperty] = presetH + 'px';
|
2259 |
+
}
|
2260 |
+
if ('top' in offset) {
|
2261 |
+
elem.style[oppositeVerticalProperty] = '';
|
2262 |
+
elem.style[verticalProperty] = presetV + 'px';
|
2263 |
+
}
|
2264 |
+
// force relayout
|
2265 |
+
forceRelayout(elem);
|
2266 |
+
var old = getOffset(elem);
|
2267 |
+
var originalStyle = {};
|
2268 |
+
for (var key in offset) {
|
2269 |
+
if (offset.hasOwnProperty(key)) {
|
2270 |
+
var dir = getOffsetDirection(key, option);
|
2271 |
+
var preset = key === 'left' ? presetH : presetV;
|
2272 |
+
var off = originalOffset[key] - old[key];
|
2273 |
+
if (dir === key) {
|
2274 |
+
originalStyle[dir] = preset + off;
|
2275 |
+
} else {
|
2276 |
+
originalStyle[dir] = preset - off;
|
2277 |
+
}
|
2278 |
+
}
|
2279 |
+
}
|
2280 |
+
css(elem, originalStyle);
|
2281 |
+
// force relayout
|
2282 |
+
forceRelayout(elem);
|
2283 |
+
if ('left' in offset || 'top' in offset) {
|
2284 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["e" /* setTransitionProperty */])(elem, originalTransition);
|
2285 |
+
}
|
2286 |
+
var ret = {};
|
2287 |
+
for (var _key in offset) {
|
2288 |
+
if (offset.hasOwnProperty(_key)) {
|
2289 |
+
var _dir = getOffsetDirection(_key, option);
|
2290 |
+
var _off = offset[_key] - originalOffset[_key];
|
2291 |
+
if (_key === _dir) {
|
2292 |
+
ret[_dir] = originalStyle[_dir] + _off;
|
2293 |
+
} else {
|
2294 |
+
ret[_dir] = originalStyle[_dir] - _off;
|
2295 |
+
}
|
2296 |
+
}
|
2297 |
+
}
|
2298 |
+
css(elem, ret);
|
2299 |
+
}
|
2300 |
+
|
2301 |
+
function setTransform(elem, offset) {
|
2302 |
+
var originalOffset = getOffset(elem);
|
2303 |
+
var originalXY = Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["b" /* getTransformXY */])(elem);
|
2304 |
+
var resultXY = { x: originalXY.x, y: originalXY.y };
|
2305 |
+
if ('left' in offset) {
|
2306 |
+
resultXY.x = originalXY.x + offset.left - originalOffset.left;
|
2307 |
+
}
|
2308 |
+
if ('top' in offset) {
|
2309 |
+
resultXY.y = originalXY.y + offset.top - originalOffset.top;
|
2310 |
+
}
|
2311 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["d" /* setTransformXY */])(elem, resultXY);
|
2312 |
+
}
|
2313 |
+
|
2314 |
+
function setOffset(elem, offset, option) {
|
2315 |
+
if (option.useCssRight || option.useCssBottom) {
|
2316 |
+
setLeftTop(elem, offset, option);
|
2317 |
+
} else if (option.useCssTransform && Object(__WEBPACK_IMPORTED_MODULE_0__propertyUtils__["a" /* getTransformName */])() in document.body.style) {
|
2318 |
+
setTransform(elem, offset, option);
|
2319 |
+
} else {
|
2320 |
+
setLeftTop(elem, offset, option);
|
2321 |
+
}
|
2322 |
+
}
|
2323 |
+
|
2324 |
+
function each(arr, fn) {
|
2325 |
+
for (var i = 0; i < arr.length; i++) {
|
2326 |
+
fn(arr[i]);
|
2327 |
+
}
|
2328 |
+
}
|
2329 |
+
|
2330 |
+
function isBorderBoxFn(elem) {
|
2331 |
+
return getComputedStyleX(elem, 'boxSizing') === 'border-box';
|
2332 |
+
}
|
2333 |
+
|
2334 |
+
var BOX_MODELS = ['margin', 'border', 'padding'];
|
2335 |
+
var CONTENT_INDEX = -1;
|
2336 |
+
var PADDING_INDEX = 2;
|
2337 |
+
var BORDER_INDEX = 1;
|
2338 |
+
var MARGIN_INDEX = 0;
|
2339 |
+
|
2340 |
+
function swap(elem, options, callback) {
|
2341 |
+
var old = {};
|
2342 |
+
var style = elem.style;
|
2343 |
+
var name = void 0;
|
2344 |
+
|
2345 |
+
// Remember the old values, and insert the new ones
|
2346 |
+
for (name in options) {
|
2347 |
+
if (options.hasOwnProperty(name)) {
|
2348 |
+
old[name] = style[name];
|
2349 |
+
style[name] = options[name];
|
2350 |
+
}
|
2351 |
+
}
|
2352 |
+
|
2353 |
+
callback.call(elem);
|
2354 |
+
|
2355 |
+
// Revert the old values
|
2356 |
+
for (name in options) {
|
2357 |
+
if (options.hasOwnProperty(name)) {
|
2358 |
+
style[name] = old[name];
|
2359 |
+
}
|
2360 |
+
}
|
2361 |
+
}
|
2362 |
+
|
2363 |
+
function getPBMWidth(elem, props, which) {
|
2364 |
+
var value = 0;
|
2365 |
+
var prop = void 0;
|
2366 |
+
var j = void 0;
|
2367 |
+
var i = void 0;
|
2368 |
+
for (j = 0; j < props.length; j++) {
|
2369 |
+
prop = props[j];
|
2370 |
+
if (prop) {
|
2371 |
+
for (i = 0; i < which.length; i++) {
|
2372 |
+
var cssProp = void 0;
|
2373 |
+
if (prop === 'border') {
|
2374 |
+
cssProp = '' + prop + which[i] + 'Width';
|
2375 |
+
} else {
|
2376 |
+
cssProp = prop + which[i];
|
2377 |
+
}
|
2378 |
+
value += parseFloat(getComputedStyleX(elem, cssProp)) || 0;
|
2379 |
+
}
|
2380 |
+
}
|
2381 |
+
}
|
2382 |
+
return value;
|
2383 |
+
}
|
2384 |
+
|
2385 |
+
var domUtils = {};
|
2386 |
+
|
2387 |
+
each(['Width', 'Height'], function (name) {
|
2388 |
+
domUtils['doc' + name] = function (refWin) {
|
2389 |
+
var d = refWin.document;
|
2390 |
+
return Math.max(
|
2391 |
+
// firefox chrome documentElement.scrollHeight< body.scrollHeight
|
2392 |
+
// ie standard mode : documentElement.scrollHeight> body.scrollHeight
|
2393 |
+
d.documentElement['scroll' + name],
|
2394 |
+
// quirks : documentElement.scrollHeight 最大等于可视窗口多一点?
|
2395 |
+
d.body['scroll' + name], domUtils['viewport' + name](d));
|
2396 |
+
};
|
2397 |
+
|
2398 |
+
domUtils['viewport' + name] = function (win) {
|
2399 |
+
// pc browser includes scrollbar in window.innerWidth
|
2400 |
+
var prop = 'client' + name;
|
2401 |
+
var doc = win.document;
|
2402 |
+
var body = doc.body;
|
2403 |
+
var documentElement = doc.documentElement;
|
2404 |
+
var documentElementProp = documentElement[prop];
|
2405 |
+
// 标准模式取 documentElement
|
2406 |
+
// backcompat 取 body
|
2407 |
+
return doc.compatMode === 'CSS1Compat' && documentElementProp || body && body[prop] || documentElementProp;
|
2408 |
+
};
|
2409 |
+
});
|
2410 |
+
|
2411 |
+
/*
|
2412 |
+
得到元素的大小信息
|
2413 |
+
@param elem
|
2414 |
+
@param name
|
2415 |
+
@param {String} [extra] 'padding' : (css width) + padding
|
2416 |
+
'border' : (css width) + padding + border
|
2417 |
+
'margin' : (css width) + padding + border + margin
|
2418 |
+
*/
|
2419 |
+
function getWH(elem, name, ex) {
|
2420 |
+
var extra = ex;
|
2421 |
+
if (isWindow(elem)) {
|
2422 |
+
return name === 'width' ? domUtils.viewportWidth(elem) : domUtils.viewportHeight(elem);
|
2423 |
+
} else if (elem.nodeType === 9) {
|
2424 |
+
return name === 'width' ? domUtils.docWidth(elem) : domUtils.docHeight(elem);
|
2425 |
+
}
|
2426 |
+
var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];
|
2427 |
+
var borderBoxValue = name === 'width' ? elem.getBoundingClientRect().width : elem.getBoundingClientRect().height;
|
2428 |
+
var computedStyle = getComputedStyleX(elem);
|
2429 |
+
var isBorderBox = isBorderBoxFn(elem, computedStyle);
|
2430 |
+
var cssBoxValue = 0;
|
2431 |
+
if (borderBoxValue === null || borderBoxValue === undefined || borderBoxValue <= 0) {
|
2432 |
+
borderBoxValue = undefined;
|
2433 |
+
// Fall back to computed then un computed css if necessary
|
2434 |
+
cssBoxValue = getComputedStyleX(elem, name);
|
2435 |
+
if (cssBoxValue === null || cssBoxValue === undefined || Number(cssBoxValue) < 0) {
|
2436 |
+
cssBoxValue = elem.style[name] || 0;
|
2437 |
+
}
|
2438 |
+
// Normalize '', auto, and prepare for extra
|
2439 |
+
cssBoxValue = parseFloat(cssBoxValue) || 0;
|
2440 |
+
}
|
2441 |
+
if (extra === undefined) {
|
2442 |
+
extra = isBorderBox ? BORDER_INDEX : CONTENT_INDEX;
|
2443 |
+
}
|
2444 |
+
var borderBoxValueOrIsBorderBox = borderBoxValue !== undefined || isBorderBox;
|
2445 |
+
var val = borderBoxValue || cssBoxValue;
|
2446 |
+
if (extra === CONTENT_INDEX) {
|
2447 |
+
if (borderBoxValueOrIsBorderBox) {
|
2448 |
+
return val - getPBMWidth(elem, ['border', 'padding'], which, computedStyle);
|
2449 |
+
}
|
2450 |
+
return cssBoxValue;
|
2451 |
+
} else if (borderBoxValueOrIsBorderBox) {
|
2452 |
+
if (extra === BORDER_INDEX) {
|
2453 |
+
return val;
|
2454 |
+
}
|
2455 |
+
return val + (extra === PADDING_INDEX ? -getPBMWidth(elem, ['border'], which, computedStyle) : getPBMWidth(elem, ['margin'], which, computedStyle));
|
2456 |
+
}
|
2457 |
+
return cssBoxValue + getPBMWidth(elem, BOX_MODELS.slice(extra), which, computedStyle);
|
2458 |
+
}
|
2459 |
+
|
2460 |
+
var cssShow = {
|
2461 |
+
position: 'absolute',
|
2462 |
+
visibility: 'hidden',
|
2463 |
+
display: 'block'
|
2464 |
+
};
|
2465 |
+
|
2466 |
+
// fix #119 : https://github.com/kissyteam/kissy/issues/119
|
2467 |
+
function getWHIgnoreDisplay() {
|
2468 |
+
for (var _len = arguments.length, args = Array(_len), _key2 = 0; _key2 < _len; _key2++) {
|
2469 |
+
args[_key2] = arguments[_key2];
|
2470 |
+
}
|
2471 |
+
|
2472 |
+
var val = void 0;
|
2473 |
+
var elem = args[0];
|
2474 |
+
// in case elem is window
|
2475 |
+
// elem.offsetWidth === undefined
|
2476 |
+
if (elem.offsetWidth !== 0) {
|
2477 |
+
val = getWH.apply(undefined, args);
|
2478 |
+
} else {
|
2479 |
+
swap(elem, cssShow, function () {
|
2480 |
+
val = getWH.apply(undefined, args);
|
2481 |
+
});
|
2482 |
+
}
|
2483 |
+
return val;
|
2484 |
+
}
|
2485 |
+
|
2486 |
+
each(['width', 'height'], function (name) {
|
2487 |
+
var first = name.charAt(0).toUpperCase() + name.slice(1);
|
2488 |
+
domUtils['outer' + first] = function (el, includeMargin) {
|
2489 |
+
return el && getWHIgnoreDisplay(el, name, includeMargin ? MARGIN_INDEX : BORDER_INDEX);
|
2490 |
+
};
|
2491 |
+
var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];
|
2492 |
+
|
2493 |
+
domUtils[name] = function (elem, v) {
|
2494 |
+
var val = v;
|
2495 |
+
if (val !== undefined) {
|
2496 |
+
if (elem) {
|
2497 |
+
var computedStyle = getComputedStyleX(elem);
|
2498 |
+
var isBorderBox = isBorderBoxFn(elem);
|
2499 |
+
if (isBorderBox) {
|
2500 |
+
val += getPBMWidth(elem, ['padding', 'border'], which, computedStyle);
|
2501 |
+
}
|
2502 |
+
return css(elem, name, val);
|
2503 |
+
}
|
2504 |
+
return undefined;
|
2505 |
+
}
|
2506 |
+
return elem && getWHIgnoreDisplay(elem, name, CONTENT_INDEX);
|
2507 |
+
};
|
2508 |
+
});
|
2509 |
+
|
2510 |
+
function mix(to, from) {
|
2511 |
+
for (var i in from) {
|
2512 |
+
if (from.hasOwnProperty(i)) {
|
2513 |
+
to[i] = from[i];
|
2514 |
+
}
|
2515 |
+
}
|
2516 |
+
return to;
|
2517 |
+
}
|
2518 |
+
|
2519 |
+
var utils = {
|
2520 |
+
getWindow: function getWindow(node) {
|
2521 |
+
if (node && node.document && node.setTimeout) {
|
2522 |
+
return node;
|
2523 |
+
}
|
2524 |
+
var doc = node.ownerDocument || node;
|
2525 |
+
return doc.defaultView || doc.parentWindow;
|
2526 |
+
},
|
2527 |
+
|
2528 |
+
getDocument: getDocument,
|
2529 |
+
offset: function offset(el, value, option) {
|
2530 |
+
if (typeof value !== 'undefined') {
|
2531 |
+
setOffset(el, value, option || {});
|
2532 |
+
} else {
|
2533 |
+
return getOffset(el);
|
2534 |
+
}
|
2535 |
+
},
|
2536 |
+
|
2537 |
+
isWindow: isWindow,
|
2538 |
+
each: each,
|
2539 |
+
css: css,
|
2540 |
+
clone: function clone(obj) {
|
2541 |
+
var i = void 0;
|
2542 |
+
var ret = {};
|
2543 |
+
for (i in obj) {
|
2544 |
+
if (obj.hasOwnProperty(i)) {
|
2545 |
+
ret[i] = obj[i];
|
2546 |
+
}
|
2547 |
+
}
|
2548 |
+
var overflow = obj.overflow;
|
2549 |
+
if (overflow) {
|
2550 |
+
for (i in obj) {
|
2551 |
+
if (obj.hasOwnProperty(i)) {
|
2552 |
+
ret.overflow[i] = obj.overflow[i];
|
2553 |
+
}
|
2554 |
+
}
|
2555 |
+
}
|
2556 |
+
return ret;
|
2557 |
+
},
|
2558 |
+
|
2559 |
+
mix: mix,
|
2560 |
+
getWindowScrollLeft: function getWindowScrollLeft(w) {
|
2561 |
+
return getScrollLeft(w);
|
2562 |
+
},
|
2563 |
+
getWindowScrollTop: function getWindowScrollTop(w) {
|
2564 |
+
return getScrollTop(w);
|
2565 |
+
},
|
2566 |
+
merge: function merge() {
|
2567 |
+
var ret = {};
|
2568 |
+
|
2569 |
+
for (var _len2 = arguments.length, args = Array(_len2), _key3 = 0; _key3 < _len2; _key3++) {
|
2570 |
+
args[_key3] = arguments[_key3];
|
2571 |
+
}
|
2572 |
+
|
2573 |
+
for (var i = 0; i < args.length; i++) {
|
2574 |
+
utils.mix(ret, args[i]);
|
2575 |
+
}
|
2576 |
+
return ret;
|
2577 |
+
},
|
2578 |
+
|
2579 |
+
viewportWidth: 0,
|
2580 |
+
viewportHeight: 0
|
2581 |
+
};
|
2582 |
+
|
2583 |
+
mix(utils, domUtils);
|
2584 |
+
|
2585 |
+
/* harmony default export */ __webpack_exports__["a"] = (utils);
|
2586 |
+
|
2587 |
+
/***/ }),
|
2588 |
+
/* 40 */
|
2589 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2590 |
+
|
2591 |
+
"use strict";
|
2592 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
2593 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
2594 |
+
*
|
2595 |
+
* This source code is licensed under the MIT license found in the
|
2596 |
+
* LICENSE file in the root directory of this source tree.
|
2597 |
+
*
|
2598 |
+
*/
|
2599 |
+
|
2600 |
+
|
2601 |
+
|
2602 |
+
var emptyObject = {};
|
2603 |
+
|
2604 |
+
if (process.env.NODE_ENV !== 'production') {
|
2605 |
+
Object.freeze(emptyObject);
|
2606 |
+
}
|
2607 |
+
|
2608 |
+
module.exports = emptyObject;
|
2609 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
2610 |
+
|
2611 |
+
/***/ }),
|
2612 |
+
/* 41 */
|
2613 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2614 |
+
|
2615 |
+
"use strict";
|
2616 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
2617 |
+
* Copyright (c) 2014-present, Facebook, Inc.
|
2618 |
+
*
|
2619 |
+
* This source code is licensed under the MIT license found in the
|
2620 |
+
* LICENSE file in the root directory of this source tree.
|
2621 |
+
*
|
2622 |
+
*/
|
2623 |
+
|
2624 |
+
|
2625 |
+
|
2626 |
+
var emptyFunction = __webpack_require__(23);
|
2627 |
+
|
2628 |
+
/**
|
2629 |
+
* Similar to invariant but only logs a warning if the condition is not met.
|
2630 |
+
* This can be used to log issues in development environments in critical
|
2631 |
+
* paths. Removing the logging code for production environments will keep the
|
2632 |
+
* same logic and follow the same code paths.
|
2633 |
+
*/
|
2634 |
+
|
2635 |
+
var warning = emptyFunction;
|
2636 |
+
|
2637 |
+
if (process.env.NODE_ENV !== 'production') {
|
2638 |
+
var printWarning = function printWarning(format) {
|
2639 |
+
for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
2640 |
+
args[_key - 1] = arguments[_key];
|
2641 |
+
}
|
2642 |
+
|
2643 |
+
var argIndex = 0;
|
2644 |
+
var message = 'Warning: ' + format.replace(/%s/g, function () {
|
2645 |
+
return args[argIndex++];
|
2646 |
+
});
|
2647 |
+
if (typeof console !== 'undefined') {
|
2648 |
+
console.error(message);
|
2649 |
+
}
|
2650 |
+
try {
|
2651 |
+
// --- Welcome to debugging React ---
|
2652 |
+
// This error was thrown as a convenience so that you can use this stack
|
2653 |
+
// to find the callsite that caused this warning to fire.
|
2654 |
+
throw new Error(message);
|
2655 |
+
} catch (x) {}
|
2656 |
+
};
|
2657 |
+
|
2658 |
+
warning = function warning(condition, format) {
|
2659 |
+
if (format === undefined) {
|
2660 |
+
throw new Error('`warning(condition, format, ...args)` requires a warning ' + 'message argument');
|
2661 |
+
}
|
2662 |
+
|
2663 |
+
if (format.indexOf('Failed Composite propType: ') === 0) {
|
2664 |
+
return; // Ignore CompositeComponent proptype check.
|
2665 |
+
}
|
2666 |
+
|
2667 |
+
if (!condition) {
|
2668 |
+
for (var _len2 = arguments.length, args = Array(_len2 > 2 ? _len2 - 2 : 0), _key2 = 2; _key2 < _len2; _key2++) {
|
2669 |
+
args[_key2 - 2] = arguments[_key2];
|
2670 |
+
}
|
2671 |
+
|
2672 |
+
printWarning.apply(undefined, [format].concat(args));
|
2673 |
+
}
|
2674 |
+
};
|
2675 |
+
}
|
2676 |
+
|
2677 |
+
module.exports = warning;
|
2678 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
2679 |
+
|
2680 |
+
/***/ }),
|
2681 |
+
/* 42 */
|
2682 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2683 |
+
|
2684 |
+
"use strict";
|
2685 |
+
|
2686 |
+
|
2687 |
+
exports.__esModule = true;
|
2688 |
+
|
2689 |
+
var _iterator = __webpack_require__(209);
|
2690 |
+
|
2691 |
+
var _iterator2 = _interopRequireDefault(_iterator);
|
2692 |
+
|
2693 |
+
var _symbol = __webpack_require__(219);
|
2694 |
+
|
2695 |
+
var _symbol2 = _interopRequireDefault(_symbol);
|
2696 |
+
|
2697 |
+
var _typeof = typeof _symbol2.default === "function" && typeof _iterator2.default === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof _symbol2.default === "function" && obj.constructor === _symbol2.default && obj !== _symbol2.default.prototype ? "symbol" : typeof obj; };
|
2698 |
+
|
2699 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
2700 |
+
|
2701 |
+
exports.default = typeof _symbol2.default === "function" && _typeof(_iterator2.default) === "symbol" ? function (obj) {
|
2702 |
+
return typeof obj === "undefined" ? "undefined" : _typeof(obj);
|
2703 |
+
} : function (obj) {
|
2704 |
+
return obj && typeof _symbol2.default === "function" && obj.constructor === _symbol2.default && obj !== _symbol2.default.prototype ? "symbol" : typeof obj === "undefined" ? "undefined" : _typeof(obj);
|
2705 |
+
};
|
2706 |
+
|
2707 |
+
/***/ }),
|
2708 |
+
/* 43 */
|
2709 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2710 |
+
|
2711 |
+
// optional / simple context binding
|
2712 |
+
var aFunction = __webpack_require__(56);
|
2713 |
+
module.exports = function (fn, that, length) {
|
2714 |
+
aFunction(fn);
|
2715 |
+
if (that === undefined) return fn;
|
2716 |
+
switch (length) {
|
2717 |
+
case 1: return function (a) {
|
2718 |
+
return fn.call(that, a);
|
2719 |
+
};
|
2720 |
+
case 2: return function (a, b) {
|
2721 |
+
return fn.call(that, a, b);
|
2722 |
+
};
|
2723 |
+
case 3: return function (a, b, c) {
|
2724 |
+
return fn.call(that, a, b, c);
|
2725 |
+
};
|
2726 |
+
}
|
2727 |
+
return function (/* ...args */) {
|
2728 |
+
return fn.apply(that, arguments);
|
2729 |
+
};
|
2730 |
+
};
|
2731 |
+
|
2732 |
+
|
2733 |
+
/***/ }),
|
2734 |
+
/* 44 */
|
2735 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2736 |
+
|
2737 |
+
// 19.1.2.14 / 15.2.3.14 Object.keys(O)
|
2738 |
+
var $keys = __webpack_require__(124);
|
2739 |
+
var enumBugKeys = __webpack_require__(84);
|
2740 |
+
|
2741 |
+
module.exports = Object.keys || function keys(O) {
|
2742 |
+
return $keys(O, enumBugKeys);
|
2743 |
+
};
|
2744 |
+
|
2745 |
+
|
2746 |
+
/***/ }),
|
2747 |
+
/* 45 */
|
2748 |
+
/***/ (function(module, exports) {
|
2749 |
+
|
2750 |
+
var toString = {}.toString;
|
2751 |
+
|
2752 |
+
module.exports = function (it) {
|
2753 |
+
return toString.call(it).slice(8, -1);
|
2754 |
+
};
|
2755 |
+
|
2756 |
+
|
2757 |
+
/***/ }),
|
2758 |
+
/* 46 */
|
2759 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2760 |
+
|
2761 |
+
module.exports = { "default": __webpack_require__(236), __esModule: true };
|
2762 |
+
|
2763 |
+
/***/ }),
|
2764 |
+
/* 47 */
|
2765 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2766 |
+
|
2767 |
+
"use strict";
|
2768 |
+
|
2769 |
+
|
2770 |
+
exports.__esModule = true;
|
2771 |
+
|
2772 |
+
exports.default = function (obj, keys) {
|
2773 |
+
var target = {};
|
2774 |
+
|
2775 |
+
for (var i in obj) {
|
2776 |
+
if (keys.indexOf(i) >= 0) continue;
|
2777 |
+
if (!Object.prototype.hasOwnProperty.call(obj, i)) continue;
|
2778 |
+
target[i] = obj[i];
|
2779 |
+
}
|
2780 |
+
|
2781 |
+
return target;
|
2782 |
+
};
|
2783 |
+
|
2784 |
+
/***/ }),
|
2785 |
+
/* 48 */
|
2786 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
2787 |
+
|
2788 |
+
"use strict";
|
2789 |
+
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
2790 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "cancelAnimationTimeout", function() { return cancelAnimationTimeout; });
|
2791 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "requestAnimationTimeout", function() { return requestAnimationTimeout; });
|
2792 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__animationFrame__ = __webpack_require__(255);
|
2793 |
+
|
2794 |
+
|
2795 |
+
var babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId = {
|
2796 |
+
id: __webpack_require__(0).number.isRequired
|
2797 |
+
};
|
2798 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId', {
|
2799 |
+
value: babelPluginFlowReactPropTypes_proptype_AnimationTimeoutId,
|
2800 |
+
configurable: true
|
2801 |
+
});
|
2802 |
+
|
2803 |
+
|
2804 |
+
var cancelAnimationTimeout = function cancelAnimationTimeout(frame) {
|
2805 |
+
return Object(__WEBPACK_IMPORTED_MODULE_0__animationFrame__["a" /* caf */])(frame.id);
|
2806 |
+
};
|
2807 |
+
|
2808 |
+
/**
|
2809 |
+
* Recursively calls requestAnimationFrame until a specified delay has been met or exceeded.
|
2810 |
+
* When the delay time has been reached the function you're timing out will be called.
|
2811 |
+
*
|
2812 |
+
* Credit: Joe Lambert (https://gist.github.com/joelambert/1002116#file-requesttimeout-js)
|
2813 |
+
*/
|
2814 |
+
var requestAnimationTimeout = function requestAnimationTimeout(callback, delay) {
|
2815 |
+
var start = Date.now();
|
2816 |
+
|
2817 |
+
var timeout = function timeout() {
|
2818 |
+
if (Date.now() - start >= delay) {
|
2819 |
+
callback.call();
|
2820 |
+
} else {
|
2821 |
+
frame.id = Object(__WEBPACK_IMPORTED_MODULE_0__animationFrame__["b" /* raf */])(timeout);
|
2822 |
+
}
|
2823 |
+
};
|
2824 |
+
|
2825 |
+
var frame = {
|
2826 |
+
id: Object(__WEBPACK_IMPORTED_MODULE_0__animationFrame__["b" /* raf */])(timeout)
|
2827 |
+
};
|
2828 |
+
|
2829 |
+
return frame;
|
2830 |
+
};
|
2831 |
+
|
2832 |
+
/***/ }),
|
2833 |
+
/* 49 */
|
2834 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2835 |
+
|
2836 |
+
var babelPluginFlowReactPropTypes_proptype_CellDataGetterParams = {
|
2837 |
+
columnData: __webpack_require__(0).any,
|
2838 |
+
dataKey: __webpack_require__(0).string.isRequired,
|
2839 |
+
rowData: function rowData(props, propName, componentName) {
|
2840 |
+
if (!Object.prototype.hasOwnProperty.call(props, propName)) {
|
2841 |
+
throw new Error("Prop `" + propName + "` has type 'any' or 'mixed', but was not provided to `" + componentName + "`. Pass undefined or any other value.");
|
2842 |
+
}
|
2843 |
+
}
|
2844 |
+
};
|
2845 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_CellDataGetterParams", {
|
2846 |
+
value: babelPluginFlowReactPropTypes_proptype_CellDataGetterParams,
|
2847 |
+
configurable: true
|
2848 |
+
});
|
2849 |
+
var babelPluginFlowReactPropTypes_proptype_CellRendererParams = {
|
2850 |
+
cellData: __webpack_require__(0).any,
|
2851 |
+
columnData: __webpack_require__(0).any,
|
2852 |
+
dataKey: __webpack_require__(0).string.isRequired,
|
2853 |
+
rowData: function rowData(props, propName, componentName) {
|
2854 |
+
if (!Object.prototype.hasOwnProperty.call(props, propName)) {
|
2855 |
+
throw new Error("Prop `" + propName + "` has type 'any' or 'mixed', but was not provided to `" + componentName + "`. Pass undefined or any other value.");
|
2856 |
+
}
|
2857 |
+
},
|
2858 |
+
rowIndex: __webpack_require__(0).number.isRequired
|
2859 |
+
};
|
2860 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_CellRendererParams", {
|
2861 |
+
value: babelPluginFlowReactPropTypes_proptype_CellRendererParams,
|
2862 |
+
configurable: true
|
2863 |
+
});
|
2864 |
+
var babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams = {
|
2865 |
+
className: __webpack_require__(0).string.isRequired,
|
2866 |
+
columns: __webpack_require__(0).arrayOf(__webpack_require__(0).any).isRequired,
|
2867 |
+
style: function style(props, propName, componentName) {
|
2868 |
+
if (!Object.prototype.hasOwnProperty.call(props, propName)) {
|
2869 |
+
throw new Error("Prop `" + propName + "` has type 'any' or 'mixed', but was not provided to `" + componentName + "`. Pass undefined or any other value.");
|
2870 |
+
}
|
2871 |
+
}
|
2872 |
+
};
|
2873 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams", {
|
2874 |
+
value: babelPluginFlowReactPropTypes_proptype_HeaderRowRendererParams,
|
2875 |
+
configurable: true
|
2876 |
+
});
|
2877 |
+
var babelPluginFlowReactPropTypes_proptype_HeaderRendererParams = {
|
2878 |
+
columnData: __webpack_require__(0).any,
|
2879 |
+
dataKey: __webpack_require__(0).string.isRequired,
|
2880 |
+
disableSort: __webpack_require__(0).bool,
|
2881 |
+
label: __webpack_require__(0).any,
|
2882 |
+
sortBy: __webpack_require__(0).string,
|
2883 |
+
sortDirection: __webpack_require__(0).string
|
2884 |
+
};
|
2885 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_HeaderRendererParams", {
|
2886 |
+
value: babelPluginFlowReactPropTypes_proptype_HeaderRendererParams,
|
2887 |
+
configurable: true
|
2888 |
+
});
|
2889 |
+
var babelPluginFlowReactPropTypes_proptype_RowRendererParams = {
|
2890 |
+
className: __webpack_require__(0).string.isRequired,
|
2891 |
+
columns: __webpack_require__(0).arrayOf(__webpack_require__(0).any).isRequired,
|
2892 |
+
index: __webpack_require__(0).number.isRequired,
|
2893 |
+
isScrolling: __webpack_require__(0).bool.isRequired,
|
2894 |
+
onRowClick: __webpack_require__(0).func,
|
2895 |
+
onRowDoubleClick: __webpack_require__(0).func,
|
2896 |
+
onRowMouseOver: __webpack_require__(0).func,
|
2897 |
+
onRowMouseOut: __webpack_require__(0).func,
|
2898 |
+
rowData: function rowData(props, propName, componentName) {
|
2899 |
+
if (!Object.prototype.hasOwnProperty.call(props, propName)) {
|
2900 |
+
throw new Error("Prop `" + propName + "` has type 'any' or 'mixed', but was not provided to `" + componentName + "`. Pass undefined or any other value.");
|
2901 |
+
}
|
2902 |
+
},
|
2903 |
+
style: function style(props, propName, componentName) {
|
2904 |
+
if (!Object.prototype.hasOwnProperty.call(props, propName)) {
|
2905 |
+
throw new Error("Prop `" + propName + "` has type 'any' or 'mixed', but was not provided to `" + componentName + "`. Pass undefined or any other value.");
|
2906 |
+
}
|
2907 |
+
}
|
2908 |
+
};
|
2909 |
+
if (true) Object.defineProperty(exports, "babelPluginFlowReactPropTypes_proptype_RowRendererParams", {
|
2910 |
+
value: babelPluginFlowReactPropTypes_proptype_RowRendererParams,
|
2911 |
+
configurable: true
|
2912 |
+
});
|
2913 |
+
|
2914 |
+
/***/ }),
|
2915 |
+
/* 50 */
|
2916 |
+
/***/ (function(module, exports) {
|
2917 |
+
|
2918 |
+
module.exports = function(module) {
|
2919 |
+
if(!module.webpackPolyfill) {
|
2920 |
+
module.deprecate = function() {};
|
2921 |
+
module.paths = [];
|
2922 |
+
// module.parent = undefined by default
|
2923 |
+
if(!module.children) module.children = [];
|
2924 |
+
Object.defineProperty(module, "loaded", {
|
2925 |
+
enumerable: true,
|
2926 |
+
get: function() {
|
2927 |
+
return module.l;
|
2928 |
+
}
|
2929 |
+
});
|
2930 |
+
Object.defineProperty(module, "id", {
|
2931 |
+
enumerable: true,
|
2932 |
+
get: function() {
|
2933 |
+
return module.i;
|
2934 |
+
}
|
2935 |
+
});
|
2936 |
+
module.webpackPolyfill = 1;
|
2937 |
+
}
|
2938 |
+
return module;
|
2939 |
+
};
|
2940 |
+
|
2941 |
+
|
2942 |
+
/***/ }),
|
2943 |
+
/* 51 */
|
2944 |
+
/***/ (function(module, exports, __webpack_require__) {
|
2945 |
+
|
2946 |
+
var freeGlobal = __webpack_require__(152);
|
2947 |
+
|
2948 |
+
/** Detect free variable `self`. */
|
2949 |
+
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
|
2950 |
+
|
2951 |
+
/** Used as a reference to the global object. */
|
2952 |
+
var root = freeGlobal || freeSelf || Function('return this')();
|
2953 |
+
|
2954 |
+
module.exports = root;
|
2955 |
+
|
2956 |
+
|
2957 |
+
/***/ }),
|
2958 |
+
/* 52 */
|
2959 |
+
/***/ (function(module, exports) {
|
2960 |
+
|
2961 |
+
/**
|
2962 |
+
* Checks if `value` is object-like. A value is object-like if it's not `null`
|
2963 |
+
* and has a `typeof` result of "object".
|
2964 |
+
*
|
2965 |
+
* @static
|
2966 |
+
* @memberOf _
|
2967 |
+
* @since 4.0.0
|
2968 |
+
* @category Lang
|
2969 |
+
* @param {*} value The value to check.
|
2970 |
+
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
|
2971 |
+
* @example
|
2972 |
+
*
|
2973 |
+
* _.isObjectLike({});
|
2974 |
+
* // => true
|
2975 |
+
*
|
2976 |
+
* _.isObjectLike([1, 2, 3]);
|
2977 |
+
* // => true
|
2978 |
+
*
|
2979 |
+
* _.isObjectLike(_.noop);
|
2980 |
+
* // => false
|
2981 |
+
*
|
2982 |
+
* _.isObjectLike(null);
|
2983 |
+
* // => false
|
2984 |
+
*/
|
2985 |
+
function isObjectLike(value) {
|
2986 |
+
return value != null && typeof value == 'object';
|
2987 |
+
}
|
2988 |
+
|
2989 |
+
module.exports = isObjectLike;
|
2990 |
+
|
2991 |
+
|
2992 |
+
/***/ }),
|
2993 |
+
/* 53 */
|
2994 |
+
/***/ (function(module, exports) {
|
2995 |
+
|
2996 |
+
/**
|
2997 |
+
* Checks if `value` is the
|
2998 |
+
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
|
2999 |
+
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
|
3000 |
+
*
|
3001 |
+
* @static
|
3002 |
+
* @memberOf _
|
3003 |
+
* @since 0.1.0
|
3004 |
+
* @category Lang
|
3005 |
+
* @param {*} value The value to check.
|
3006 |
+
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
|
3007 |
+
* @example
|
3008 |
+
*
|
3009 |
+
* _.isObject({});
|
3010 |
+
* // => true
|
3011 |
+
*
|
3012 |
+
* _.isObject([1, 2, 3]);
|
3013 |
+
* // => true
|
3014 |
+
*
|
3015 |
+
* _.isObject(_.noop);
|
3016 |
+
* // => true
|
3017 |
+
*
|
3018 |
+
* _.isObject(null);
|
3019 |
+
* // => false
|
3020 |
+
*/
|
3021 |
+
function isObject(value) {
|
3022 |
+
var type = typeof value;
|
3023 |
+
return value != null && (type == 'object' || type == 'function');
|
3024 |
+
}
|
3025 |
+
|
3026 |
+
module.exports = isObject;
|
3027 |
+
|
3028 |
+
|
3029 |
+
/***/ }),
|
3030 |
+
/* 54 */
|
3031 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3032 |
+
|
3033 |
+
"use strict";
|
3034 |
+
|
3035 |
+
var $at = __webpack_require__(211)(true);
|
3036 |
+
|
3037 |
+
// 21.1.3.27 String.prototype[@@iterator]()
|
3038 |
+
__webpack_require__(121)(String, 'String', function (iterated) {
|
3039 |
+
this._t = String(iterated); // target
|
3040 |
+
this._i = 0; // next index
|
3041 |
+
// 21.1.5.2.1 %StringIteratorPrototype%.next()
|
3042 |
+
}, function () {
|
3043 |
+
var O = this._t;
|
3044 |
+
var index = this._i;
|
3045 |
+
var point;
|
3046 |
+
if (index >= O.length) return { value: undefined, done: true };
|
3047 |
+
point = $at(O, index);
|
3048 |
+
this._i += point.length;
|
3049 |
+
return { value: point, done: false };
|
3050 |
+
});
|
3051 |
+
|
3052 |
+
|
3053 |
+
/***/ }),
|
3054 |
+
/* 55 */
|
3055 |
+
/***/ (function(module, exports) {
|
3056 |
+
|
3057 |
+
module.exports = true;
|
3058 |
+
|
3059 |
+
|
3060 |
+
/***/ }),
|
3061 |
+
/* 56 */
|
3062 |
+
/***/ (function(module, exports) {
|
3063 |
+
|
3064 |
+
module.exports = function (it) {
|
3065 |
+
if (typeof it != 'function') throw TypeError(it + ' is not a function!');
|
3066 |
+
return it;
|
3067 |
+
};
|
3068 |
+
|
3069 |
+
|
3070 |
+
/***/ }),
|
3071 |
+
/* 57 */
|
3072 |
+
/***/ (function(module, exports) {
|
3073 |
+
|
3074 |
+
module.exports = function (bitmap, value) {
|
3075 |
+
return {
|
3076 |
+
enumerable: !(bitmap & 1),
|
3077 |
+
configurable: !(bitmap & 2),
|
3078 |
+
writable: !(bitmap & 4),
|
3079 |
+
value: value
|
3080 |
+
};
|
3081 |
+
};
|
3082 |
+
|
3083 |
+
|
3084 |
+
/***/ }),
|
3085 |
+
/* 58 */
|
3086 |
+
/***/ (function(module, exports) {
|
3087 |
+
|
3088 |
+
var id = 0;
|
3089 |
+
var px = Math.random();
|
3090 |
+
module.exports = function (key) {
|
3091 |
+
return 'Symbol('.concat(key === undefined ? '' : key, ')_', (++id + px).toString(36));
|
3092 |
+
};
|
3093 |
+
|
3094 |
+
|
3095 |
+
/***/ }),
|
3096 |
+
/* 59 */
|
3097 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3098 |
+
|
3099 |
+
var def = __webpack_require__(24).f;
|
3100 |
+
var has = __webpack_require__(29);
|
3101 |
+
var TAG = __webpack_require__(12)('toStringTag');
|
3102 |
+
|
3103 |
+
module.exports = function (it, tag, stat) {
|
3104 |
+
if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag });
|
3105 |
+
};
|
3106 |
+
|
3107 |
+
|
3108 |
+
/***/ }),
|
3109 |
+
/* 60 */
|
3110 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3111 |
+
|
3112 |
+
// 7.1.13 ToObject(argument)
|
3113 |
+
var defined = __webpack_require__(78);
|
3114 |
+
module.exports = function (it) {
|
3115 |
+
return Object(defined(it));
|
3116 |
+
};
|
3117 |
+
|
3118 |
+
|
3119 |
+
/***/ }),
|
3120 |
+
/* 61 */
|
3121 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3122 |
+
|
3123 |
+
__webpack_require__(216);
|
3124 |
+
var global = __webpack_require__(14);
|
3125 |
+
var hide = __webpack_require__(28);
|
3126 |
+
var Iterators = __webpack_require__(36);
|
3127 |
+
var TO_STRING_TAG = __webpack_require__(12)('toStringTag');
|
3128 |
+
|
3129 |
+
var DOMIterables = ('CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,' +
|
3130 |
+
'DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,' +
|
3131 |
+
'MediaList,MimeTypeArray,NamedNodeMap,NodeList,PaintRequestList,Plugin,PluginArray,SVGLengthList,SVGNumberList,' +
|
3132 |
+
'SVGPathSegList,SVGPointList,SVGStringList,SVGTransformList,SourceBufferList,StyleSheetList,TextTrackCueList,' +
|
3133 |
+
'TextTrackList,TouchList').split(',');
|
3134 |
+
|
3135 |
+
for (var i = 0; i < DOMIterables.length; i++) {
|
3136 |
+
var NAME = DOMIterables[i];
|
3137 |
+
var Collection = global[NAME];
|
3138 |
+
var proto = Collection && Collection.prototype;
|
3139 |
+
if (proto && !proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME);
|
3140 |
+
Iterators[NAME] = Iterators.Array;
|
3141 |
+
}
|
3142 |
+
|
3143 |
+
|
3144 |
+
/***/ }),
|
3145 |
+
/* 62 */
|
3146 |
+
/***/ (function(module, exports) {
|
3147 |
+
|
3148 |
+
exports.f = {}.propertyIsEnumerable;
|
3149 |
+
|
3150 |
+
|
3151 |
+
/***/ }),
|
3152 |
+
/* 63 */
|
3153 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
3154 |
+
|
3155 |
+
"use strict";
|
3156 |
+
var SortDirection = {
|
3157 |
+
/**
|
3158 |
+
* Sort items in ascending order.
|
3159 |
+
* This means arranging from the lowest value to the highest (e.g. a-z, 0-9).
|
3160 |
+
*/
|
3161 |
+
ASC: 'ASC',
|
3162 |
+
|
3163 |
+
/**
|
3164 |
+
* Sort items in descending order.
|
3165 |
+
* This means arranging from the highest value to the lowest (e.g. z-a, 9-0).
|
3166 |
+
*/
|
3167 |
+
DESC: 'DESC'
|
3168 |
+
};
|
3169 |
+
|
3170 |
+
/* harmony default export */ __webpack_exports__["a"] = (SortDirection);
|
3171 |
+
|
3172 |
+
/***/ }),
|
3173 |
+
/* 64 */
|
3174 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3175 |
+
|
3176 |
+
var Symbol = __webpack_require__(97),
|
3177 |
+
getRawTag = __webpack_require__(309),
|
3178 |
+
objectToString = __webpack_require__(310);
|
3179 |
+
|
3180 |
+
/** `Object#toString` result references. */
|
3181 |
+
var nullTag = '[object Null]',
|
3182 |
+
undefinedTag = '[object Undefined]';
|
3183 |
+
|
3184 |
+
/** Built-in value references. */
|
3185 |
+
var symToStringTag = Symbol ? Symbol.toStringTag : undefined;
|
3186 |
+
|
3187 |
+
/**
|
3188 |
+
* The base implementation of `getTag` without fallbacks for buggy environments.
|
3189 |
+
*
|
3190 |
+
* @private
|
3191 |
+
* @param {*} value The value to query.
|
3192 |
+
* @returns {string} Returns the `toStringTag`.
|
3193 |
+
*/
|
3194 |
+
function baseGetTag(value) {
|
3195 |
+
if (value == null) {
|
3196 |
+
return value === undefined ? undefinedTag : nullTag;
|
3197 |
+
}
|
3198 |
+
return (symToStringTag && symToStringTag in Object(value))
|
3199 |
+
? getRawTag(value)
|
3200 |
+
: objectToString(value);
|
3201 |
+
}
|
3202 |
+
|
3203 |
+
module.exports = baseGetTag;
|
3204 |
+
|
3205 |
+
|
3206 |
+
/***/ }),
|
3207 |
+
/* 65 */
|
3208 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3209 |
+
|
3210 |
+
"use strict";
|
3211 |
+
|
3212 |
+
|
3213 |
+
Object.defineProperty(exports, "__esModule", {
|
3214 |
+
value: true
|
3215 |
+
});
|
3216 |
+
exports.END_DRAG = exports.DROP = exports.HOVER = exports.PUBLISH_DRAG_SOURCE = exports.BEGIN_DRAG = undefined;
|
3217 |
+
|
3218 |
+
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
3219 |
+
|
3220 |
+
exports.beginDrag = beginDrag;
|
3221 |
+
exports.publishDragSource = publishDragSource;
|
3222 |
+
exports.hover = hover;
|
3223 |
+
exports.drop = drop;
|
3224 |
+
exports.endDrag = endDrag;
|
3225 |
+
|
3226 |
+
var _invariant = __webpack_require__(15);
|
3227 |
+
|
3228 |
+
var _invariant2 = _interopRequireDefault(_invariant);
|
3229 |
+
|
3230 |
+
var _isArray = __webpack_require__(33);
|
3231 |
+
|
3232 |
+
var _isArray2 = _interopRequireDefault(_isArray);
|
3233 |
+
|
3234 |
+
var _isObject = __webpack_require__(53);
|
3235 |
+
|
3236 |
+
var _isObject2 = _interopRequireDefault(_isObject);
|
3237 |
+
|
3238 |
+
var _matchesType = __webpack_require__(154);
|
3239 |
+
|
3240 |
+
var _matchesType2 = _interopRequireDefault(_matchesType);
|
3241 |
+
|
3242 |
+
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
3243 |
+
|
3244 |
+
var BEGIN_DRAG = exports.BEGIN_DRAG = 'dnd-core/BEGIN_DRAG';
|
3245 |
+
var PUBLISH_DRAG_SOURCE = exports.PUBLISH_DRAG_SOURCE = 'dnd-core/PUBLISH_DRAG_SOURCE';
|
3246 |
+
var HOVER = exports.HOVER = 'dnd-core/HOVER';
|
3247 |
+
var DROP = exports.DROP = 'dnd-core/DROP';
|
3248 |
+
var END_DRAG = exports.END_DRAG = 'dnd-core/END_DRAG';
|
3249 |
+
|
3250 |
+
function beginDrag(sourceIds) {
|
3251 |
+
var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : { publishSource: true, clientOffset: null };
|
3252 |
+
var publishSource = options.publishSource,
|
3253 |
+
clientOffset = options.clientOffset,
|
3254 |
+
getSourceClientOffset = options.getSourceClientOffset;
|
3255 |
+
|
3256 |
+
(0, _invariant2.default)((0, _isArray2.default)(sourceIds), 'Expected sourceIds to be an array.');
|
3257 |
+
|
3258 |
+
var monitor = this.getMonitor();
|
3259 |
+
var registry = this.getRegistry();
|
3260 |
+
(0, _invariant2.default)(!monitor.isDragging(), 'Cannot call beginDrag while dragging.');
|
3261 |
+
|
3262 |
+
for (var i = 0; i < sourceIds.length; i++) {
|
3263 |
+
(0, _invariant2.default)(registry.getSource(sourceIds[i]), 'Expected sourceIds to be registered.');
|
3264 |
+
}
|
3265 |
+
|
3266 |
+
var sourceId = null;
|
3267 |
+
for (var _i = sourceIds.length - 1; _i >= 0; _i--) {
|
3268 |
+
if (monitor.canDragSource(sourceIds[_i])) {
|
3269 |
+
sourceId = sourceIds[_i];
|
3270 |
+
break;
|
3271 |
+
}
|
3272 |
+
}
|
3273 |
+
if (sourceId === null) {
|
3274 |
+
return;
|
3275 |
+
}
|
3276 |
+
|
3277 |
+
var sourceClientOffset = null;
|
3278 |
+
if (clientOffset) {
|
3279 |
+
(0, _invariant2.default)(typeof getSourceClientOffset === 'function', 'When clientOffset is provided, getSourceClientOffset must be a function.');
|
3280 |
+
sourceClientOffset = getSourceClientOffset(sourceId);
|
3281 |
+
}
|
3282 |
+
|
3283 |
+
var source = registry.getSource(sourceId);
|
3284 |
+
var item = source.beginDrag(monitor, sourceId);
|
3285 |
+
(0, _invariant2.default)((0, _isObject2.default)(item), 'Item must be an object.');
|
3286 |
+
|
3287 |
+
registry.pinSource(sourceId);
|
3288 |
+
|
3289 |
+
var itemType = registry.getSourceType(sourceId);
|
3290 |
+
return {
|
3291 |
+
type: BEGIN_DRAG,
|
3292 |
+
itemType: itemType,
|
3293 |
+
item: item,
|
3294 |
+
sourceId: sourceId,
|
3295 |
+
clientOffset: clientOffset,
|
3296 |
+
sourceClientOffset: sourceClientOffset,
|
3297 |
+
isSourcePublic: publishSource
|
3298 |
+
};
|
3299 |
+
}
|
3300 |
+
|
3301 |
+
function publishDragSource() {
|
3302 |
+
var monitor = this.getMonitor();
|
3303 |
+
if (!monitor.isDragging()) {
|
3304 |
+
return;
|
3305 |
+
}
|
3306 |
+
|
3307 |
+
return { type: PUBLISH_DRAG_SOURCE };
|
3308 |
+
}
|
3309 |
+
|
3310 |
+
function hover(targetIdsArg) {
|
3311 |
+
var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
3312 |
+
_ref$clientOffset = _ref.clientOffset,
|
3313 |
+
clientOffset = _ref$clientOffset === undefined ? null : _ref$clientOffset;
|
3314 |
+
|
3315 |
+
(0, _invariant2.default)((0, _isArray2.default)(targetIdsArg), 'Expected targetIds to be an array.');
|
3316 |
+
var targetIds = targetIdsArg.slice(0);
|
3317 |
+
|
3318 |
+
var monitor = this.getMonitor();
|
3319 |
+
var registry = this.getRegistry();
|
3320 |
+
(0, _invariant2.default)(monitor.isDragging(), 'Cannot call hover while not dragging.');
|
3321 |
+
(0, _invariant2.default)(!monitor.didDrop(), 'Cannot call hover after drop.');
|
3322 |
+
|
3323 |
+
// First check invariants.
|
3324 |
+
for (var i = 0; i < targetIds.length; i++) {
|
3325 |
+
var targetId = targetIds[i];
|
3326 |
+
(0, _invariant2.default)(targetIds.lastIndexOf(targetId) === i, 'Expected targetIds to be unique in the passed array.');
|
3327 |
+
|
3328 |
+
var target = registry.getTarget(targetId);
|
3329 |
+
(0, _invariant2.default)(target, 'Expected targetIds to be registered.');
|
3330 |
+
}
|
3331 |
+
|
3332 |
+
var draggedItemType = monitor.getItemType();
|
3333 |
+
|
3334 |
+
// Remove those targetIds that don't match the targetType. This
|
3335 |
+
// fixes shallow isOver which would only be non-shallow because of
|
3336 |
+
// non-matching targets.
|
3337 |
+
for (var _i2 = targetIds.length - 1; _i2 >= 0; _i2--) {
|
3338 |
+
var _targetId = targetIds[_i2];
|
3339 |
+
var targetType = registry.getTargetType(_targetId);
|
3340 |
+
if (!(0, _matchesType2.default)(targetType, draggedItemType)) {
|
3341 |
+
targetIds.splice(_i2, 1);
|
3342 |
+
}
|
3343 |
+
}
|
3344 |
+
|
3345 |
+
// Finally call hover on all matching targets.
|
3346 |
+
for (var _i3 = 0; _i3 < targetIds.length; _i3++) {
|
3347 |
+
var _targetId2 = targetIds[_i3];
|
3348 |
+
var _target = registry.getTarget(_targetId2);
|
3349 |
+
_target.hover(monitor, _targetId2);
|
3350 |
+
}
|
3351 |
+
|
3352 |
+
return {
|
3353 |
+
type: HOVER,
|
3354 |
+
targetIds: targetIds,
|
3355 |
+
clientOffset: clientOffset
|
3356 |
+
};
|
3357 |
+
}
|
3358 |
+
|
3359 |
+
function drop() {
|
3360 |
+
var _this = this;
|
3361 |
+
|
3362 |
+
var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
3363 |
+
|
3364 |
+
var monitor = this.getMonitor();
|
3365 |
+
var registry = this.getRegistry();
|
3366 |
+
(0, _invariant2.default)(monitor.isDragging(), 'Cannot call drop while not dragging.');
|
3367 |
+
(0, _invariant2.default)(!monitor.didDrop(), 'Cannot call drop twice during one drag operation.');
|
3368 |
+
|
3369 |
+
var targetIds = monitor.getTargetIds().filter(monitor.canDropOnTarget, monitor);
|
3370 |
+
|
3371 |
+
targetIds.reverse();
|
3372 |
+
targetIds.forEach(function (targetId, index) {
|
3373 |
+
var target = registry.getTarget(targetId);
|
3374 |
+
|
3375 |
+
var dropResult = target.drop(monitor, targetId);
|
3376 |
+
(0, _invariant2.default)(typeof dropResult === 'undefined' || (0, _isObject2.default)(dropResult), 'Drop result must either be an object or undefined.');
|
3377 |
+
if (typeof dropResult === 'undefined') {
|
3378 |
+
dropResult = index === 0 ? {} : monitor.getDropResult();
|
3379 |
+
}
|
3380 |
+
|
3381 |
+
_this.store.dispatch({
|
3382 |
+
type: DROP,
|
3383 |
+
dropResult: _extends({}, options, dropResult)
|
3384 |
+
});
|
3385 |
+
});
|
3386 |
+
}
|
3387 |
+
|
3388 |
+
function endDrag() {
|
3389 |
+
var monitor = this.getMonitor();
|
3390 |
+
var registry = this.getRegistry();
|
3391 |
+
(0, _invariant2.default)(monitor.isDragging(), 'Cannot call endDrag while not dragging.');
|
3392 |
+
|
3393 |
+
var sourceId = monitor.getSourceId();
|
3394 |
+
var source = registry.getSource(sourceId, true);
|
3395 |
+
source.endDrag(monitor, sourceId);
|
3396 |
+
|
3397 |
+
registry.unpinSource();
|
3398 |
+
|
3399 |
+
return { type: END_DRAG };
|
3400 |
+
}
|
3401 |
+
|
3402 |
+
/***/ }),
|
3403 |
+
/* 66 */
|
3404 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3405 |
+
|
3406 |
+
var getNative = __webpack_require__(67);
|
3407 |
+
|
3408 |
+
/* Built-in method references that are verified to be native. */
|
3409 |
+
var nativeCreate = getNative(Object, 'create');
|
3410 |
+
|
3411 |
+
module.exports = nativeCreate;
|
3412 |
+
|
3413 |
+
|
3414 |
+
/***/ }),
|
3415 |
+
/* 67 */
|
3416 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3417 |
+
|
3418 |
+
var baseIsNative = __webpack_require__(321),
|
3419 |
+
getValue = __webpack_require__(325);
|
3420 |
+
|
3421 |
+
/**
|
3422 |
+
* Gets the native function at `key` of `object`.
|
3423 |
+
*
|
3424 |
+
* @private
|
3425 |
+
* @param {Object} object The object to query.
|
3426 |
+
* @param {string} key The key of the method to get.
|
3427 |
+
* @returns {*} Returns the function if it's native, else `undefined`.
|
3428 |
+
*/
|
3429 |
+
function getNative(object, key) {
|
3430 |
+
var value = getValue(object, key);
|
3431 |
+
return baseIsNative(value) ? value : undefined;
|
3432 |
+
}
|
3433 |
+
|
3434 |
+
module.exports = getNative;
|
3435 |
+
|
3436 |
+
|
3437 |
+
/***/ }),
|
3438 |
+
/* 68 */
|
3439 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3440 |
+
|
3441 |
+
var eq = __webpack_require__(69);
|
3442 |
+
|
3443 |
+
/**
|
3444 |
+
* Gets the index at which the `key` is found in `array` of key-value pairs.
|
3445 |
+
*
|
3446 |
+
* @private
|
3447 |
+
* @param {Array} array The array to inspect.
|
3448 |
+
* @param {*} key The key to search for.
|
3449 |
+
* @returns {number} Returns the index of the matched value, else `-1`.
|
3450 |
+
*/
|
3451 |
+
function assocIndexOf(array, key) {
|
3452 |
+
var length = array.length;
|
3453 |
+
while (length--) {
|
3454 |
+
if (eq(array[length][0], key)) {
|
3455 |
+
return length;
|
3456 |
+
}
|
3457 |
+
}
|
3458 |
+
return -1;
|
3459 |
+
}
|
3460 |
+
|
3461 |
+
module.exports = assocIndexOf;
|
3462 |
+
|
3463 |
+
|
3464 |
+
/***/ }),
|
3465 |
+
/* 69 */
|
3466 |
+
/***/ (function(module, exports) {
|
3467 |
+
|
3468 |
+
/**
|
3469 |
+
* Performs a
|
3470 |
+
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
|
3471 |
+
* comparison between two values to determine if they are equivalent.
|
3472 |
+
*
|
3473 |
+
* @static
|
3474 |
+
* @memberOf _
|
3475 |
+
* @since 4.0.0
|
3476 |
+
* @category Lang
|
3477 |
+
* @param {*} value The value to compare.
|
3478 |
+
* @param {*} other The other value to compare.
|
3479 |
+
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
|
3480 |
+
* @example
|
3481 |
+
*
|
3482 |
+
* var object = { 'a': 1 };
|
3483 |
+
* var other = { 'a': 1 };
|
3484 |
+
*
|
3485 |
+
* _.eq(object, object);
|
3486 |
+
* // => true
|
3487 |
+
*
|
3488 |
+
* _.eq(object, other);
|
3489 |
+
* // => false
|
3490 |
+
*
|
3491 |
+
* _.eq('a', 'a');
|
3492 |
+
* // => true
|
3493 |
+
*
|
3494 |
+
* _.eq('a', Object('a'));
|
3495 |
+
* // => false
|
3496 |
+
*
|
3497 |
+
* _.eq(NaN, NaN);
|
3498 |
+
* // => true
|
3499 |
+
*/
|
3500 |
+
function eq(value, other) {
|
3501 |
+
return value === other || (value !== value && other !== other);
|
3502 |
+
}
|
3503 |
+
|
3504 |
+
module.exports = eq;
|
3505 |
+
|
3506 |
+
|
3507 |
+
/***/ }),
|
3508 |
+
/* 70 */
|
3509 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3510 |
+
|
3511 |
+
var isKeyable = __webpack_require__(338);
|
3512 |
+
|
3513 |
+
/**
|
3514 |
+
* Gets the data for `map`.
|
3515 |
+
*
|
3516 |
+
* @private
|
3517 |
+
* @param {Object} map The map to query.
|
3518 |
+
* @param {string} key The reference key.
|
3519 |
+
* @returns {*} Returns the map data.
|
3520 |
+
*/
|
3521 |
+
function getMapData(map, key) {
|
3522 |
+
var data = map.__data__;
|
3523 |
+
return isKeyable(key)
|
3524 |
+
? data[typeof key == 'string' ? 'string' : 'hash']
|
3525 |
+
: data.map;
|
3526 |
+
}
|
3527 |
+
|
3528 |
+
module.exports = getMapData;
|
3529 |
+
|
3530 |
+
|
3531 |
+
/***/ }),
|
3532 |
+
/* 71 */
|
3533 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3534 |
+
|
3535 |
+
var isArrayLike = __webpack_require__(104),
|
3536 |
+
isObjectLike = __webpack_require__(52);
|
3537 |
+
|
3538 |
+
/**
|
3539 |
+
* This method is like `_.isArrayLike` except that it also checks if `value`
|
3540 |
+
* is an object.
|
3541 |
+
*
|
3542 |
+
* @static
|
3543 |
+
* @memberOf _
|
3544 |
+
* @since 4.0.0
|
3545 |
+
* @category Lang
|
3546 |
+
* @param {*} value The value to check.
|
3547 |
+
* @returns {boolean} Returns `true` if `value` is an array-like object,
|
3548 |
+
* else `false`.
|
3549 |
+
* @example
|
3550 |
+
*
|
3551 |
+
* _.isArrayLikeObject([1, 2, 3]);
|
3552 |
+
* // => true
|
3553 |
+
*
|
3554 |
+
* _.isArrayLikeObject(document.body.children);
|
3555 |
+
* // => true
|
3556 |
+
*
|
3557 |
+
* _.isArrayLikeObject('abc');
|
3558 |
+
* // => false
|
3559 |
+
*
|
3560 |
+
* _.isArrayLikeObject(_.noop);
|
3561 |
+
* // => false
|
3562 |
+
*/
|
3563 |
+
function isArrayLikeObject(value) {
|
3564 |
+
return isObjectLike(value) && isArrayLike(value);
|
3565 |
+
}
|
3566 |
+
|
3567 |
+
module.exports = isArrayLikeObject;
|
3568 |
+
|
3569 |
+
|
3570 |
+
/***/ }),
|
3571 |
+
/* 72 */
|
3572 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3573 |
+
|
3574 |
+
"use strict";
|
3575 |
+
|
3576 |
+
|
3577 |
+
Object.defineProperty(exports, "__esModule", {
|
3578 |
+
value: true
|
3579 |
+
});
|
3580 |
+
exports.addSource = addSource;
|
3581 |
+
exports.addTarget = addTarget;
|
3582 |
+
exports.removeSource = removeSource;
|
3583 |
+
exports.removeTarget = removeTarget;
|
3584 |
+
var ADD_SOURCE = exports.ADD_SOURCE = 'dnd-core/ADD_SOURCE';
|
3585 |
+
var ADD_TARGET = exports.ADD_TARGET = 'dnd-core/ADD_TARGET';
|
3586 |
+
var REMOVE_SOURCE = exports.REMOVE_SOURCE = 'dnd-core/REMOVE_SOURCE';
|
3587 |
+
var REMOVE_TARGET = exports.REMOVE_TARGET = 'dnd-core/REMOVE_TARGET';
|
3588 |
+
|
3589 |
+
function addSource(sourceId) {
|
3590 |
+
return {
|
3591 |
+
type: ADD_SOURCE,
|
3592 |
+
sourceId: sourceId
|
3593 |
+
};
|
3594 |
+
}
|
3595 |
+
|
3596 |
+
function addTarget(targetId) {
|
3597 |
+
return {
|
3598 |
+
type: ADD_TARGET,
|
3599 |
+
targetId: targetId
|
3600 |
+
};
|
3601 |
+
}
|
3602 |
+
|
3603 |
+
function removeSource(sourceId) {
|
3604 |
+
return {
|
3605 |
+
type: REMOVE_SOURCE,
|
3606 |
+
sourceId: sourceId
|
3607 |
+
};
|
3608 |
+
}
|
3609 |
+
|
3610 |
+
function removeTarget(targetId) {
|
3611 |
+
return {
|
3612 |
+
type: REMOVE_TARGET,
|
3613 |
+
targetId: targetId
|
3614 |
+
};
|
3615 |
+
}
|
3616 |
+
|
3617 |
+
/***/ }),
|
3618 |
+
/* 73 */
|
3619 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3620 |
+
|
3621 |
+
"use strict";
|
3622 |
+
/* WEBPACK VAR INJECTION */(function(process) {
|
3623 |
+
|
3624 |
+
Object.defineProperty(exports, "__esModule", {
|
3625 |
+
value: true
|
3626 |
+
});
|
3627 |
+
exports.default = checkDecoratorArguments;
|
3628 |
+
function checkDecoratorArguments(functionName, signature) {
|
3629 |
+
if (process.env.NODE_ENV !== 'production') {
|
3630 |
+
for (var i = 0; i < (arguments.length <= 2 ? 0 : arguments.length - 2); i += 1) {
|
3631 |
+
var arg = arguments.length <= i + 2 ? undefined : arguments[i + 2];
|
3632 |
+
if (arg && arg.prototype && arg.prototype.render) {
|
3633 |
+
// eslint-disable-next-line no-console
|
3634 |
+
console.error('You seem to be applying the arguments in the wrong order. ' + ('It should be ' + functionName + '(' + signature + ')(Component), not the other way around. ') + 'Read more: http://react-dnd.github.io/react-dnd/docs-troubleshooting.html#you-seem-to-be-applying-the-arguments-in-the-wrong-order');
|
3635 |
+
return;
|
3636 |
+
}
|
3637 |
+
}
|
3638 |
+
}
|
3639 |
+
}
|
3640 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
3641 |
+
|
3642 |
+
/***/ }),
|
3643 |
+
/* 74 */
|
3644 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
3645 |
+
|
3646 |
+
"use strict";
|
3647 |
+
/* harmony export (immutable) */ __webpack_exports__["d"] = noop;
|
3648 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = getKeyFromChildrenIndex;
|
3649 |
+
/* harmony export (immutable) */ __webpack_exports__["b"] = loopMenuItem;
|
3650 |
+
/* harmony export (immutable) */ __webpack_exports__["c"] = loopMenuItemRecusively;
|
3651 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(1);
|
3652 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
3653 |
+
|
3654 |
+
|
3655 |
+
function noop() {}
|
3656 |
+
|
3657 |
+
function getKeyFromChildrenIndex(child, menuEventKey, index) {
|
3658 |
+
var prefix = menuEventKey || '';
|
3659 |
+
return child.key || prefix + 'item_' + index;
|
3660 |
+
}
|
3661 |
+
|
3662 |
+
function loopMenuItem(children, cb) {
|
3663 |
+
var index = -1;
|
3664 |
+
__WEBPACK_IMPORTED_MODULE_0_react___default.a.Children.forEach(children, function (c) {
|
3665 |
+
index++;
|
3666 |
+
if (c && c.type && c.type.isMenuItemGroup) {
|
3667 |
+
__WEBPACK_IMPORTED_MODULE_0_react___default.a.Children.forEach(c.props.children, function (c2) {
|
3668 |
+
index++;
|
3669 |
+
cb(c2, index);
|
3670 |
+
});
|
3671 |
+
} else {
|
3672 |
+
cb(c, index);
|
3673 |
+
}
|
3674 |
+
});
|
3675 |
+
}
|
3676 |
+
|
3677 |
+
function loopMenuItemRecusively(children, keys, ret) {
|
3678 |
+
if (!children || ret.find) {
|
3679 |
+
return;
|
3680 |
+
}
|
3681 |
+
__WEBPACK_IMPORTED_MODULE_0_react___default.a.Children.forEach(children, function (c) {
|
3682 |
+
if (ret.find) {
|
3683 |
+
return;
|
3684 |
+
}
|
3685 |
+
if (c) {
|
3686 |
+
var construt = c.type;
|
3687 |
+
if (!construt || !(construt.isSubMenu || construt.isMenuItem || construt.isMenuItemGroup)) {
|
3688 |
+
return;
|
3689 |
+
}
|
3690 |
+
if (keys.indexOf(c.key) !== -1) {
|
3691 |
+
ret.find = true;
|
3692 |
+
} else if (c.props.children) {
|
3693 |
+
loopMenuItemRecusively(c.props.children, keys, ret);
|
3694 |
+
}
|
3695 |
+
}
|
3696 |
+
});
|
3697 |
+
}
|
3698 |
+
|
3699 |
+
/***/ }),
|
3700 |
+
/* 75 */
|
3701 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3702 |
+
|
3703 |
+
"use strict";
|
3704 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
3705 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
3706 |
+
*
|
3707 |
+
* This source code is licensed under the MIT license found in the
|
3708 |
+
* LICENSE file in the root directory of this source tree.
|
3709 |
+
*/
|
3710 |
+
|
3711 |
+
|
3712 |
+
|
3713 |
+
if (process.env.NODE_ENV !== 'production') {
|
3714 |
+
var invariant = __webpack_require__(34);
|
3715 |
+
var warning = __webpack_require__(41);
|
3716 |
+
var ReactPropTypesSecret = __webpack_require__(76);
|
3717 |
+
var loggedTypeFailures = {};
|
3718 |
+
}
|
3719 |
+
|
3720 |
+
/**
|
3721 |
+
* Assert that the values match with the type specs.
|
3722 |
+
* Error messages are memorized and will only be shown once.
|
3723 |
+
*
|
3724 |
+
* @param {object} typeSpecs Map of name to a ReactPropType
|
3725 |
+
* @param {object} values Runtime values that need to be type-checked
|
3726 |
+
* @param {string} location e.g. "prop", "context", "child context"
|
3727 |
+
* @param {string} componentName Name of the component for error messages.
|
3728 |
+
* @param {?Function} getStack Returns the component stack.
|
3729 |
+
* @private
|
3730 |
+
*/
|
3731 |
+
function checkPropTypes(typeSpecs, values, location, componentName, getStack) {
|
3732 |
+
if (process.env.NODE_ENV !== 'production') {
|
3733 |
+
for (var typeSpecName in typeSpecs) {
|
3734 |
+
if (typeSpecs.hasOwnProperty(typeSpecName)) {
|
3735 |
+
var error;
|
3736 |
+
// Prop type validation may throw. In case they do, we don't want to
|
3737 |
+
// fail the render phase where it didn't fail before. So we log it.
|
3738 |
+
// After these have been cleaned up, we'll let them throw.
|
3739 |
+
try {
|
3740 |
+
// This is intentionally an invariant that gets caught. It's the same
|
3741 |
+
// behavior as without this statement except with a better message.
|
3742 |
+
invariant(typeof typeSpecs[typeSpecName] === 'function', '%s: %s type `%s` is invalid; it must be a function, usually from ' + 'the `prop-types` package, but received `%s`.', componentName || 'React class', location, typeSpecName, typeof typeSpecs[typeSpecName]);
|
3743 |
+
error = typeSpecs[typeSpecName](values, typeSpecName, componentName, location, null, ReactPropTypesSecret);
|
3744 |
+
} catch (ex) {
|
3745 |
+
error = ex;
|
3746 |
+
}
|
3747 |
+
warning(!error || error instanceof Error, '%s: type specification of %s `%s` is invalid; the type checker ' + 'function must return `null` or an `Error` but returned a %s. ' + 'You may have forgotten to pass an argument to the type checker ' + 'creator (arrayOf, instanceOf, objectOf, oneOf, oneOfType, and ' + 'shape all require an argument).', componentName || 'React class', location, typeSpecName, typeof error);
|
3748 |
+
if (error instanceof Error && !(error.message in loggedTypeFailures)) {
|
3749 |
+
// Only monitor this failure once because there tends to be a lot of the
|
3750 |
+
// same error.
|
3751 |
+
loggedTypeFailures[error.message] = true;
|
3752 |
+
|
3753 |
+
var stack = getStack ? getStack() : '';
|
3754 |
+
|
3755 |
+
warning(false, 'Failed %s type: %s%s', location, error.message, stack != null ? stack : '');
|
3756 |
+
}
|
3757 |
+
}
|
3758 |
+
}
|
3759 |
+
}
|
3760 |
+
}
|
3761 |
+
|
3762 |
+
module.exports = checkPropTypes;
|
3763 |
+
|
3764 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(7)))
|
3765 |
+
|
3766 |
+
/***/ }),
|
3767 |
+
/* 76 */
|
3768 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3769 |
+
|
3770 |
+
"use strict";
|
3771 |
+
/**
|
3772 |
+
* Copyright (c) 2013-present, Facebook, Inc.
|
3773 |
+
*
|
3774 |
+
* This source code is licensed under the MIT license found in the
|
3775 |
+
* LICENSE file in the root directory of this source tree.
|
3776 |
+
*/
|
3777 |
+
|
3778 |
+
|
3779 |
+
|
3780 |
+
var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED';
|
3781 |
+
|
3782 |
+
module.exports = ReactPropTypesSecret;
|
3783 |
+
|
3784 |
+
|
3785 |
+
/***/ }),
|
3786 |
+
/* 77 */
|
3787 |
+
/***/ (function(module, exports) {
|
3788 |
+
|
3789 |
+
// 7.1.4 ToInteger
|
3790 |
+
var ceil = Math.ceil;
|
3791 |
+
var floor = Math.floor;
|
3792 |
+
module.exports = function (it) {
|
3793 |
+
return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it);
|
3794 |
+
};
|
3795 |
+
|
3796 |
+
|
3797 |
+
/***/ }),
|
3798 |
+
/* 78 */
|
3799 |
+
/***/ (function(module, exports) {
|
3800 |
+
|
3801 |
+
// 7.2.1 RequireObjectCoercible(argument)
|
3802 |
+
module.exports = function (it) {
|
3803 |
+
if (it == undefined) throw TypeError("Can't call method on " + it);
|
3804 |
+
return it;
|
3805 |
+
};
|
3806 |
+
|
3807 |
+
|
3808 |
+
/***/ }),
|
3809 |
+
/* 79 */
|
3810 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3811 |
+
|
3812 |
+
var isObject = __webpack_require__(25);
|
3813 |
+
var document = __webpack_require__(14).document;
|
3814 |
+
// typeof document.createElement is 'object' in old IE
|
3815 |
+
var is = isObject(document) && isObject(document.createElement);
|
3816 |
+
module.exports = function (it) {
|
3817 |
+
return is ? document.createElement(it) : {};
|
3818 |
+
};
|
3819 |
+
|
3820 |
+
|
3821 |
+
/***/ }),
|
3822 |
+
/* 80 */
|
3823 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3824 |
+
|
3825 |
+
// 7.1.1 ToPrimitive(input [, PreferredType])
|
3826 |
+
var isObject = __webpack_require__(25);
|
3827 |
+
// instead of the ES6 spec version, we didn't implement @@toPrimitive case
|
3828 |
+
// and the second argument - flag - preferred type is a string
|
3829 |
+
module.exports = function (it, S) {
|
3830 |
+
if (!isObject(it)) return it;
|
3831 |
+
var fn, val;
|
3832 |
+
if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
|
3833 |
+
if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val;
|
3834 |
+
if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
|
3835 |
+
throw TypeError("Can't convert object to primitive value");
|
3836 |
+
};
|
3837 |
+
|
3838 |
+
|
3839 |
+
/***/ }),
|
3840 |
+
/* 81 */
|
3841 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3842 |
+
|
3843 |
+
// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
|
3844 |
+
var anObject = __webpack_require__(19);
|
3845 |
+
var dPs = __webpack_require__(213);
|
3846 |
+
var enumBugKeys = __webpack_require__(84);
|
3847 |
+
var IE_PROTO = __webpack_require__(82)('IE_PROTO');
|
3848 |
+
var Empty = function () { /* empty */ };
|
3849 |
+
var PROTOTYPE = 'prototype';
|
3850 |
+
|
3851 |
+
// Create object with fake `null` prototype: use iframe Object with cleared prototype
|
3852 |
+
var createDict = function () {
|
3853 |
+
// Thrash, waste and sodomy: IE GC bug
|
3854 |
+
var iframe = __webpack_require__(79)('iframe');
|
3855 |
+
var i = enumBugKeys.length;
|
3856 |
+
var lt = '<';
|
3857 |
+
var gt = '>';
|
3858 |
+
var iframeDocument;
|
3859 |
+
iframe.style.display = 'none';
|
3860 |
+
__webpack_require__(127).appendChild(iframe);
|
3861 |
+
iframe.src = 'javascript:'; // eslint-disable-line no-script-url
|
3862 |
+
// createDict = iframe.contentWindow.Object;
|
3863 |
+
// html.removeChild(iframe);
|
3864 |
+
iframeDocument = iframe.contentWindow.document;
|
3865 |
+
iframeDocument.open();
|
3866 |
+
iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt);
|
3867 |
+
iframeDocument.close();
|
3868 |
+
createDict = iframeDocument.F;
|
3869 |
+
while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]];
|
3870 |
+
return createDict();
|
3871 |
+
};
|
3872 |
+
|
3873 |
+
module.exports = Object.create || function create(O, Properties) {
|
3874 |
+
var result;
|
3875 |
+
if (O !== null) {
|
3876 |
+
Empty[PROTOTYPE] = anObject(O);
|
3877 |
+
result = new Empty();
|
3878 |
+
Empty[PROTOTYPE] = null;
|
3879 |
+
// add "__proto__" for Object.getPrototypeOf polyfill
|
3880 |
+
result[IE_PROTO] = O;
|
3881 |
+
} else result = createDict();
|
3882 |
+
return Properties === undefined ? result : dPs(result, Properties);
|
3883 |
+
};
|
3884 |
+
|
3885 |
+
|
3886 |
+
/***/ }),
|
3887 |
+
/* 82 */
|
3888 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3889 |
+
|
3890 |
+
var shared = __webpack_require__(83)('keys');
|
3891 |
+
var uid = __webpack_require__(58);
|
3892 |
+
module.exports = function (key) {
|
3893 |
+
return shared[key] || (shared[key] = uid(key));
|
3894 |
+
};
|
3895 |
+
|
3896 |
+
|
3897 |
+
/***/ }),
|
3898 |
+
/* 83 */
|
3899 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3900 |
+
|
3901 |
+
var global = __webpack_require__(14);
|
3902 |
+
var SHARED = '__core-js_shared__';
|
3903 |
+
var store = global[SHARED] || (global[SHARED] = {});
|
3904 |
+
module.exports = function (key) {
|
3905 |
+
return store[key] || (store[key] = {});
|
3906 |
+
};
|
3907 |
+
|
3908 |
+
|
3909 |
+
/***/ }),
|
3910 |
+
/* 84 */
|
3911 |
+
/***/ (function(module, exports) {
|
3912 |
+
|
3913 |
+
// IE 8- don't enum bug keys
|
3914 |
+
module.exports = (
|
3915 |
+
'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf'
|
3916 |
+
).split(',');
|
3917 |
+
|
3918 |
+
|
3919 |
+
/***/ }),
|
3920 |
+
/* 85 */
|
3921 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3922 |
+
|
3923 |
+
exports.f = __webpack_require__(12);
|
3924 |
+
|
3925 |
+
|
3926 |
+
/***/ }),
|
3927 |
+
/* 86 */
|
3928 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3929 |
+
|
3930 |
+
var global = __webpack_require__(14);
|
3931 |
+
var core = __webpack_require__(10);
|
3932 |
+
var LIBRARY = __webpack_require__(55);
|
3933 |
+
var wksExt = __webpack_require__(85);
|
3934 |
+
var defineProperty = __webpack_require__(24).f;
|
3935 |
+
module.exports = function (name) {
|
3936 |
+
var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {});
|
3937 |
+
if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) });
|
3938 |
+
};
|
3939 |
+
|
3940 |
+
|
3941 |
+
/***/ }),
|
3942 |
+
/* 87 */
|
3943 |
+
/***/ (function(module, exports) {
|
3944 |
+
|
3945 |
+
exports.f = Object.getOwnPropertySymbols;
|
3946 |
+
|
3947 |
+
|
3948 |
+
/***/ }),
|
3949 |
+
/* 88 */
|
3950 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3951 |
+
|
3952 |
+
var pIE = __webpack_require__(62);
|
3953 |
+
var createDesc = __webpack_require__(57);
|
3954 |
+
var toIObject = __webpack_require__(30);
|
3955 |
+
var toPrimitive = __webpack_require__(80);
|
3956 |
+
var has = __webpack_require__(29);
|
3957 |
+
var IE8_DOM_DEFINE = __webpack_require__(122);
|
3958 |
+
var gOPD = Object.getOwnPropertyDescriptor;
|
3959 |
+
|
3960 |
+
exports.f = __webpack_require__(26) ? gOPD : function getOwnPropertyDescriptor(O, P) {
|
3961 |
+
O = toIObject(O);
|
3962 |
+
P = toPrimitive(P, true);
|
3963 |
+
if (IE8_DOM_DEFINE) try {
|
3964 |
+
return gOPD(O, P);
|
3965 |
+
} catch (e) { /* empty */ }
|
3966 |
+
if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]);
|
3967 |
+
};
|
3968 |
+
|
3969 |
+
|
3970 |
+
/***/ }),
|
3971 |
+
/* 89 */
|
3972 |
+
/***/ (function(module, exports, __webpack_require__) {
|
3973 |
+
|
3974 |
+
// getting tag from 19.1.3.6 Object.prototype.toString()
|
3975 |
+
var cof = __webpack_require__(45);
|
3976 |
+
var TAG = __webpack_require__(12)('toStringTag');
|
3977 |
+
// ES3 wrong here
|
3978 |
+
var ARG = cof(function () { return arguments; }()) == 'Arguments';
|
3979 |
+
|
3980 |
+
// fallback for IE11 Script Access Denied error
|
3981 |
+
var tryGet = function (it, key) {
|
3982 |
+
try {
|
3983 |
+
return it[key];
|
3984 |
+
} catch (e) { /* empty */ }
|
3985 |
+
};
|
3986 |
+
|
3987 |
+
module.exports = function (it) {
|
3988 |
+
var O, T, B;
|
3989 |
+
return it === undefined ? 'Undefined' : it === null ? 'Null'
|
3990 |
+
// @@toStringTag case
|
3991 |
+
: typeof (T = tryGet(O = Object(it), TAG)) == 'string' ? T
|
3992 |
+
// builtinTag case
|
3993 |
+
: ARG ? cof(O)
|
3994 |
+
// ES3 arguments fallback
|
3995 |
+
: (B = cof(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : B;
|
3996 |
+
};
|
3997 |
+
|
3998 |
+
|
3999 |
+
/***/ }),
|
4000 |
+
/* 90 */
|
4001 |
+
/***/ (function(module, exports, __webpack_require__) {
|
4002 |
+
|
4003 |
+
// most Object methods by ES6 should accept primitives
|
4004 |
+
var $export = __webpack_require__(18);
|
4005 |
+
var core = __webpack_require__(10);
|
4006 |
+
var fails = __webpack_require__(35);
|
4007 |
+
module.exports = function (KEY, exec) {
|
4008 |
+
var fn = (core.Object || {})[KEY] || Object[KEY];
|
4009 |
+
var exp = {};
|
4010 |
+
exp[KEY] = exec(fn);
|
4011 |
+
$export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp);
|
4012 |
+
};
|
4013 |
+
|
4014 |
+
|
4015 |
+
/***/ }),
|
4016 |
+
/* 91 */
|
4017 |
+
/***/ (function(module, exports, __webpack_require__) {
|
4018 |
+
|
4019 |
+
!function(root, factory) {
|
4020 |
+
true ? module.exports = factory() : "function" == typeof define && define.amd ? define([], factory) : "object" == typeof exports ? exports.ReactSortableTree = factory() : root.ReactSortableTree = factory();
|
4021 |
+
}("undefined" != typeof self ? self : this, function() {
|
4022 |
+
/******/
|
4023 |
+
return function(modules) {
|
4024 |
+
/******/
|
4025 |
+
/******/
|
4026 |
+
// The require function
|
4027 |
+
/******/
|
4028 |
+
function __webpack_require__(moduleId) {
|
4029 |
+
/******/
|
4030 |
+
/******/
|
4031 |
+
// Check if module is in cache
|
4032 |
+
/******/
|
4033 |
+
if (installedModules[moduleId]) /******/
|
4034 |
+
return installedModules[moduleId].exports;
|
4035 |
+
/******/
|
4036 |
+
// Create a new module (and put it into the cache)
|
4037 |
+
/******/
|
4038 |
+
var module = installedModules[moduleId] = {
|
4039 |
+
/******/
|
4040 |
+
i: moduleId,
|
4041 |
+
/******/
|
4042 |
+
l: !1,
|
4043 |
+
/******/
|
4044 |
+
exports: {}
|
4045 |
+
};
|
4046 |
+
/******/
|
4047 |
+
/******/
|
4048 |
+
// Return the exports of the module
|
4049 |
+
/******/
|
4050 |
+
/******/
|
4051 |
+
/******/
|
4052 |
+
// Execute the module function
|
4053 |
+
/******/
|
4054 |
+
/******/
|
4055 |
+
/******/
|
4056 |
+
// Flag the module as loaded
|
4057 |
+
/******/
|
4058 |
+
return modules[moduleId].call(module.exports, module, module.exports, __webpack_require__),
|
4059 |
+
module.l = !0, module.exports;
|
4060 |
+
}
|
4061 |
+
// webpackBootstrap
|
4062 |
+
/******/
|
4063 |
+
// The module cache
|
4064 |
+
/******/
|
4065 |
+
var installedModules = {};
|
4066 |
+
/******/
|
4067 |
+
/******/
|
4068 |
+
// Load entry module and return exports
|
4069 |
+
/******/
|
4070 |
+
/******/
|
4071 |
+
/******/
|
4072 |
+
/******/
|
4073 |
+
// expose the modules object (__webpack_modules__)
|
4074 |
+
/******/
|
4075 |
+
/******/
|
4076 |
+
/******/
|
4077 |
+
// expose the module cache
|
4078 |
+
/******/
|
4079 |
+
/******/
|
4080 |
+
/******/
|
4081 |
+
// define getter function for harmony exports
|
4082 |
+
/******/
|
4083 |
+
/******/
|
4084 |
+
/******/
|
4085 |
+
// getDefaultExport function for compatibility with non-harmony modules
|
4086 |
+
/******/
|
4087 |
+
/******/
|
4088 |
+
/******/
|
4089 |
+
// Object.prototype.hasOwnProperty.call
|
4090 |
+
/******/
|
4091 |
+
/******/
|
4092 |
+
/******/
|
4093 |
+
// __webpack_public_path__
|
4094 |
+
/******/
|
4095 |
+
return __webpack_require__.m = modules, __webpack_require__.c = installedModules,
|
4096 |
+
__webpack_require__.d = function(exports, name, getter) {
|
4097 |
+
/******/
|
4098 |
+
__webpack_require__.o(exports, name) || /******/
|
4099 |
+
Object.defineProperty(exports, name, {
|
4100 |
+
/******/
|
4101 |
+
configurable: !1,
|
4102 |
+
/******/
|
4103 |
+
enumerable: !0,
|
4104 |
+
/******/
|
4105 |
+
get: getter
|
4106 |
+
});
|
4107 |
+
}, __webpack_require__.n = function(module) {
|
4108 |
+
/******/
|
4109 |
+
var getter = module && module.__esModule ? /******/
|
4110 |
+
function() {
|
4111 |
+
return module.default;
|
4112 |
+
} : /******/
|
4113 |
+
function() {
|
4114 |
+
return module;
|
4115 |
+
};
|
4116 |
+
/******/
|
4117 |
+
/******/
|
4118 |
+
return __webpack_require__.d(getter, "a", getter), getter;
|
4119 |
+
}, __webpack_require__.o = function(object, property) {
|
4120 |
+
return Object.prototype.hasOwnProperty.call(object, property);
|
4121 |
+
}, __webpack_require__.p = "", __webpack_require__(__webpack_require__.s = 7);
|
4122 |
+
}([ /* 0 */
|
4123 |
+
/***/
|
4124 |
+
function(module, exports, __webpack_require__) {
|
4125 |
+
"use strict";
|
4126 |
+
function _toConsumableArray(arr) {
|
4127 |
+
if (Array.isArray(arr)) {
|
4128 |
+
for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i];
|
4129 |
+
return arr2;
|
4130 |
+
}
|
4131 |
+
return Array.from(arr);
|
4132 |
+
}
|
4133 |
+
/**
|
4134 |
+
* Performs a depth-first traversal over all of the node descendants,
|
4135 |
+
* incrementing currentIndex by 1 for each
|
4136 |
+
*/
|
4137 |
+
function getNodeDataAtTreeIndexOrNextIndex(_ref) {
|
4138 |
+
var targetIndex = _ref.targetIndex, node = _ref.node, currentIndex = _ref.currentIndex, getNodeKey = _ref.getNodeKey, _ref$path = _ref.path, path = void 0 === _ref$path ? [] : _ref$path, _ref$lowerSiblingCoun = _ref.lowerSiblingCounts, lowerSiblingCounts = void 0 === _ref$lowerSiblingCoun ? [] : _ref$lowerSiblingCoun, _ref$ignoreCollapsed = _ref.ignoreCollapsed, ignoreCollapsed = void 0 === _ref$ignoreCollapsed || _ref$ignoreCollapsed, _ref$isPseudoRoot = _ref.isPseudoRoot, isPseudoRoot = void 0 !== _ref$isPseudoRoot && _ref$isPseudoRoot, selfPath = isPseudoRoot ? [] : [].concat(_toConsumableArray(path), [ getNodeKey({
|
4139 |
+
node: node,
|
4140 |
+
treeIndex: currentIndex
|
4141 |
+
}) ]);
|
4142 |
+
// Return target node when found
|
4143 |
+
if (currentIndex === targetIndex) return {
|
4144 |
+
node: node,
|
4145 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
4146 |
+
path: selfPath
|
4147 |
+
};
|
4148 |
+
// Add one and continue for nodes with no children or hidden children
|
4149 |
+
if (!node.children || ignoreCollapsed && !0 !== node.expanded) return {
|
4150 |
+
nextIndex: currentIndex + 1
|
4151 |
+
};
|
4152 |
+
for (var childIndex = currentIndex + 1, childCount = node.children.length, i = 0; i < childCount; i += 1) {
|
4153 |
+
var result = getNodeDataAtTreeIndexOrNextIndex({
|
4154 |
+
ignoreCollapsed: ignoreCollapsed,
|
4155 |
+
getNodeKey: getNodeKey,
|
4156 |
+
targetIndex: targetIndex,
|
4157 |
+
node: node.children[i],
|
4158 |
+
currentIndex: childIndex,
|
4159 |
+
lowerSiblingCounts: [].concat(_toConsumableArray(lowerSiblingCounts), [ childCount - i - 1 ]),
|
4160 |
+
path: selfPath
|
4161 |
+
});
|
4162 |
+
if (result.node) return result;
|
4163 |
+
childIndex = result.nextIndex;
|
4164 |
+
}
|
4165 |
+
// If the target node is not found, return the farthest traversed index
|
4166 |
+
return {
|
4167 |
+
nextIndex: childIndex
|
4168 |
+
};
|
4169 |
+
}
|
4170 |
+
function getDescendantCount(_ref2) {
|
4171 |
+
var node = _ref2.node, _ref2$ignoreCollapsed = _ref2.ignoreCollapsed, ignoreCollapsed = void 0 === _ref2$ignoreCollapsed || _ref2$ignoreCollapsed;
|
4172 |
+
return getNodeDataAtTreeIndexOrNextIndex({
|
4173 |
+
getNodeKey: function() {},
|
4174 |
+
ignoreCollapsed: ignoreCollapsed,
|
4175 |
+
node: node,
|
4176 |
+
currentIndex: 0,
|
4177 |
+
targetIndex: -1
|
4178 |
+
}).nextIndex - 1;
|
4179 |
+
}
|
4180 |
+
/**
|
4181 |
+
* Walk all descendants of the given node, depth-first
|
4182 |
+
*
|
4183 |
+
* @param {Object} args - Function parameters
|
4184 |
+
* @param {function} args.callback - Function to call on each node
|
4185 |
+
* @param {function} args.getNodeKey - Function to get the key from the nodeData and tree index
|
4186 |
+
* @param {boolean} args.ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4187 |
+
* @param {boolean=} args.isPseudoRoot - If true, this node has no real data, and only serves
|
4188 |
+
* as the parent of all the nodes in the tree
|
4189 |
+
* @param {Object} args.node - A tree node
|
4190 |
+
* @param {Object=} args.parentNode - The parent node of `node`
|
4191 |
+
* @param {number} args.currentIndex - The treeIndex of `node`
|
4192 |
+
* @param {number[]|string[]} args.path - Array of keys leading up to node to be changed
|
4193 |
+
* @param {number[]} args.lowerSiblingCounts - An array containing the count of siblings beneath the
|
4194 |
+
* previous nodes in this path
|
4195 |
+
*
|
4196 |
+
* @return {number|false} nextIndex - Index of the next sibling of `node`,
|
4197 |
+
* or false if the walk should be terminated
|
4198 |
+
*/
|
4199 |
+
function walkDescendants(_ref3) {
|
4200 |
+
var callback = _ref3.callback, getNodeKey = _ref3.getNodeKey, ignoreCollapsed = _ref3.ignoreCollapsed, _ref3$isPseudoRoot = _ref3.isPseudoRoot, isPseudoRoot = void 0 !== _ref3$isPseudoRoot && _ref3$isPseudoRoot, node = _ref3.node, _ref3$parentNode = _ref3.parentNode, parentNode = void 0 === _ref3$parentNode ? null : _ref3$parentNode, currentIndex = _ref3.currentIndex, _ref3$path = _ref3.path, path = void 0 === _ref3$path ? [] : _ref3$path, _ref3$lowerSiblingCou = _ref3.lowerSiblingCounts, lowerSiblingCounts = void 0 === _ref3$lowerSiblingCou ? [] : _ref3$lowerSiblingCou, selfPath = isPseudoRoot ? [] : [].concat(_toConsumableArray(path), [ getNodeKey({
|
4201 |
+
node: node,
|
4202 |
+
treeIndex: currentIndex
|
4203 |
+
}) ]), selfInfo = isPseudoRoot ? null : {
|
4204 |
+
node: node,
|
4205 |
+
parentNode: parentNode,
|
4206 |
+
path: selfPath,
|
4207 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
4208 |
+
treeIndex: currentIndex
|
4209 |
+
};
|
4210 |
+
if (!isPseudoRoot) {
|
4211 |
+
// Cut walk short if the callback returned false
|
4212 |
+
if (!1 === callback(selfInfo)) return !1;
|
4213 |
+
}
|
4214 |
+
// Return self on nodes with no children or hidden children
|
4215 |
+
if (!node.children || !0 !== node.expanded && ignoreCollapsed && !isPseudoRoot) return currentIndex;
|
4216 |
+
// Get all descendants
|
4217 |
+
var childIndex = currentIndex, childCount = node.children.length;
|
4218 |
+
if ("function" != typeof node.children) for (var i = 0; i < childCount; i += 1) // Cut walk short if the callback returned false
|
4219 |
+
if (!1 === (childIndex = walkDescendants({
|
4220 |
+
callback: callback,
|
4221 |
+
getNodeKey: getNodeKey,
|
4222 |
+
ignoreCollapsed: ignoreCollapsed,
|
4223 |
+
node: node.children[i],
|
4224 |
+
parentNode: isPseudoRoot ? null : node,
|
4225 |
+
currentIndex: childIndex + 1,
|
4226 |
+
lowerSiblingCounts: [].concat(_toConsumableArray(lowerSiblingCounts), [ childCount - i - 1 ]),
|
4227 |
+
path: selfPath
|
4228 |
+
}))) return !1;
|
4229 |
+
return childIndex;
|
4230 |
+
}
|
4231 |
+
/**
|
4232 |
+
* Perform a change on the given node and all its descendants, traversing the tree depth-first
|
4233 |
+
*
|
4234 |
+
* @param {Object} args - Function parameters
|
4235 |
+
* @param {function} args.callback - Function to call on each node
|
4236 |
+
* @param {function} args.getNodeKey - Function to get the key from the nodeData and tree index
|
4237 |
+
* @param {boolean} args.ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4238 |
+
* @param {boolean=} args.isPseudoRoot - If true, this node has no real data, and only serves
|
4239 |
+
* as the parent of all the nodes in the tree
|
4240 |
+
* @param {Object} args.node - A tree node
|
4241 |
+
* @param {Object=} args.parentNode - The parent node of `node`
|
4242 |
+
* @param {number} args.currentIndex - The treeIndex of `node`
|
4243 |
+
* @param {number[]|string[]} args.path - Array of keys leading up to node to be changed
|
4244 |
+
* @param {number[]} args.lowerSiblingCounts - An array containing the count of siblings beneath the
|
4245 |
+
* previous nodes in this path
|
4246 |
+
*
|
4247 |
+
* @return {number|false} nextIndex - Index of the next sibling of `node`,
|
4248 |
+
* or false if the walk should be terminated
|
4249 |
+
*/
|
4250 |
+
function mapDescendants(_ref4) {
|
4251 |
+
var callback = _ref4.callback, getNodeKey = _ref4.getNodeKey, ignoreCollapsed = _ref4.ignoreCollapsed, _ref4$isPseudoRoot = _ref4.isPseudoRoot, isPseudoRoot = void 0 !== _ref4$isPseudoRoot && _ref4$isPseudoRoot, node = _ref4.node, _ref4$parentNode = _ref4.parentNode, parentNode = void 0 === _ref4$parentNode ? null : _ref4$parentNode, currentIndex = _ref4.currentIndex, _ref4$path = _ref4.path, path = void 0 === _ref4$path ? [] : _ref4$path, _ref4$lowerSiblingCou = _ref4.lowerSiblingCounts, lowerSiblingCounts = void 0 === _ref4$lowerSiblingCou ? [] : _ref4$lowerSiblingCou, nextNode = _extends({}, node), selfPath = isPseudoRoot ? [] : [].concat(_toConsumableArray(path), [ getNodeKey({
|
4252 |
+
node: nextNode,
|
4253 |
+
treeIndex: currentIndex
|
4254 |
+
}) ]), selfInfo = {
|
4255 |
+
node: nextNode,
|
4256 |
+
parentNode: parentNode,
|
4257 |
+
path: selfPath,
|
4258 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
4259 |
+
treeIndex: currentIndex
|
4260 |
+
};
|
4261 |
+
// Return self on nodes with no children or hidden children
|
4262 |
+
if (!nextNode.children || !0 !== nextNode.expanded && ignoreCollapsed && !isPseudoRoot) return {
|
4263 |
+
treeIndex: currentIndex,
|
4264 |
+
node: callback(selfInfo)
|
4265 |
+
};
|
4266 |
+
// Get all descendants
|
4267 |
+
var childIndex = currentIndex, childCount = nextNode.children.length;
|
4268 |
+
return "function" != typeof nextNode.children && (nextNode.children = nextNode.children.map(function(child, i) {
|
4269 |
+
var mapResult = mapDescendants({
|
4270 |
+
callback: callback,
|
4271 |
+
getNodeKey: getNodeKey,
|
4272 |
+
ignoreCollapsed: ignoreCollapsed,
|
4273 |
+
node: child,
|
4274 |
+
parentNode: isPseudoRoot ? null : nextNode,
|
4275 |
+
currentIndex: childIndex + 1,
|
4276 |
+
lowerSiblingCounts: [].concat(_toConsumableArray(lowerSiblingCounts), [ childCount - i - 1 ]),
|
4277 |
+
path: selfPath
|
4278 |
+
});
|
4279 |
+
return childIndex = mapResult.treeIndex, mapResult.node;
|
4280 |
+
})), {
|
4281 |
+
node: callback(selfInfo),
|
4282 |
+
treeIndex: childIndex
|
4283 |
+
};
|
4284 |
+
}
|
4285 |
+
/**
|
4286 |
+
* Count all the visible (expanded) descendants in the tree data.
|
4287 |
+
*
|
4288 |
+
* @param {!Object[]} treeData - Tree data
|
4289 |
+
*
|
4290 |
+
* @return {number} count
|
4291 |
+
*/
|
4292 |
+
function getVisibleNodeCount(_ref5) {
|
4293 |
+
var traverse = function traverse(node) {
|
4294 |
+
return node.children && !0 === node.expanded && "function" != typeof node.children ? 1 + node.children.reduce(function(total, currentNode) {
|
4295 |
+
return total + traverse(currentNode);
|
4296 |
+
}, 0) : 1;
|
4297 |
+
};
|
4298 |
+
return _ref5.treeData.reduce(function(total, currentNode) {
|
4299 |
+
return total + traverse(currentNode);
|
4300 |
+
}, 0);
|
4301 |
+
}
|
4302 |
+
/**
|
4303 |
+
* Get the <targetIndex>th visible node in the tree data.
|
4304 |
+
*
|
4305 |
+
* @param {!Object[]} treeData - Tree data
|
4306 |
+
* @param {!number} targetIndex - The index of the node to search for
|
4307 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4308 |
+
*
|
4309 |
+
* @return {{
|
4310 |
+
* node: Object,
|
4311 |
+
* path: []string|[]number,
|
4312 |
+
* lowerSiblingCounts: []number
|
4313 |
+
* }|null} node - The node at targetIndex, or null if not found
|
4314 |
+
*/
|
4315 |
+
function getVisibleNodeInfoAtIndex(_ref6) {
|
4316 |
+
var treeData = _ref6.treeData, targetIndex = _ref6.index, getNodeKey = _ref6.getNodeKey;
|
4317 |
+
if (!treeData || treeData.length < 1) return null;
|
4318 |
+
// Call the tree traversal with a pseudo-root node
|
4319 |
+
var result = getNodeDataAtTreeIndexOrNextIndex({
|
4320 |
+
targetIndex: targetIndex,
|
4321 |
+
getNodeKey: getNodeKey,
|
4322 |
+
node: {
|
4323 |
+
children: treeData,
|
4324 |
+
expanded: !0
|
4325 |
+
},
|
4326 |
+
currentIndex: -1,
|
4327 |
+
path: [],
|
4328 |
+
lowerSiblingCounts: [],
|
4329 |
+
isPseudoRoot: !0
|
4330 |
+
});
|
4331 |
+
return result.node ? result : null;
|
4332 |
+
}
|
4333 |
+
/**
|
4334 |
+
* Walk descendants depth-first and call a callback on each
|
4335 |
+
*
|
4336 |
+
* @param {!Object[]} treeData - Tree data
|
4337 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4338 |
+
* @param {function} callback - Function to call on each node
|
4339 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4340 |
+
*
|
4341 |
+
* @return void
|
4342 |
+
*/
|
4343 |
+
function walk(_ref7) {
|
4344 |
+
var treeData = _ref7.treeData, getNodeKey = _ref7.getNodeKey, callback = _ref7.callback, _ref7$ignoreCollapsed = _ref7.ignoreCollapsed, ignoreCollapsed = void 0 === _ref7$ignoreCollapsed || _ref7$ignoreCollapsed;
|
4345 |
+
!treeData || treeData.length < 1 || walkDescendants({
|
4346 |
+
callback: callback,
|
4347 |
+
getNodeKey: getNodeKey,
|
4348 |
+
ignoreCollapsed: ignoreCollapsed,
|
4349 |
+
isPseudoRoot: !0,
|
4350 |
+
node: {
|
4351 |
+
children: treeData
|
4352 |
+
},
|
4353 |
+
currentIndex: -1,
|
4354 |
+
path: [],
|
4355 |
+
lowerSiblingCounts: []
|
4356 |
+
});
|
4357 |
+
}
|
4358 |
+
/**
|
4359 |
+
* Perform a depth-first transversal of the descendants and
|
4360 |
+
* make a change to every node in the tree
|
4361 |
+
*
|
4362 |
+
* @param {!Object[]} treeData - Tree data
|
4363 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4364 |
+
* @param {function} callback - Function to call on each node
|
4365 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4366 |
+
*
|
4367 |
+
* @return {Object[]} changedTreeData - The changed tree data
|
4368 |
+
*/
|
4369 |
+
function map(_ref8) {
|
4370 |
+
var treeData = _ref8.treeData, getNodeKey = _ref8.getNodeKey, callback = _ref8.callback, _ref8$ignoreCollapsed = _ref8.ignoreCollapsed, ignoreCollapsed = void 0 === _ref8$ignoreCollapsed || _ref8$ignoreCollapsed;
|
4371 |
+
return !treeData || treeData.length < 1 ? [] : mapDescendants({
|
4372 |
+
callback: callback,
|
4373 |
+
getNodeKey: getNodeKey,
|
4374 |
+
ignoreCollapsed: ignoreCollapsed,
|
4375 |
+
isPseudoRoot: !0,
|
4376 |
+
node: {
|
4377 |
+
children: treeData
|
4378 |
+
},
|
4379 |
+
currentIndex: -1,
|
4380 |
+
path: [],
|
4381 |
+
lowerSiblingCounts: []
|
4382 |
+
}).node.children;
|
4383 |
+
}
|
4384 |
+
/**
|
4385 |
+
* Expand or close every node in the tree
|
4386 |
+
*
|
4387 |
+
* @param {!Object[]} treeData - Tree data
|
4388 |
+
* @param {?boolean} expanded - Whether the node is expanded or not
|
4389 |
+
*
|
4390 |
+
* @return {Object[]} changedTreeData - The changed tree data
|
4391 |
+
*/
|
4392 |
+
function toggleExpandedForAll(_ref9) {
|
4393 |
+
var treeData = _ref9.treeData, _ref9$expanded = _ref9.expanded, expanded = void 0 === _ref9$expanded || _ref9$expanded;
|
4394 |
+
return map({
|
4395 |
+
treeData: treeData,
|
4396 |
+
callback: function(_ref10) {
|
4397 |
+
var node = _ref10.node;
|
4398 |
+
return _extends({}, node, {
|
4399 |
+
expanded: expanded
|
4400 |
+
});
|
4401 |
+
},
|
4402 |
+
getNodeKey: function(_ref11) {
|
4403 |
+
return _ref11.treeIndex;
|
4404 |
+
},
|
4405 |
+
ignoreCollapsed: !1
|
4406 |
+
});
|
4407 |
+
}
|
4408 |
+
/**
|
4409 |
+
* Replaces node at path with object, or callback-defined object
|
4410 |
+
*
|
4411 |
+
* @param {!Object[]} treeData
|
4412 |
+
* @param {number[]|string[]} path - Array of keys leading up to node to be changed
|
4413 |
+
* @param {function|any} newNode - Node to replace the node at the path with, or a function producing the new node
|
4414 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4415 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4416 |
+
*
|
4417 |
+
* @return {Object[]} changedTreeData - The changed tree data
|
4418 |
+
*/
|
4419 |
+
function changeNodeAtPath(_ref12) {
|
4420 |
+
var treeData = _ref12.treeData, path = _ref12.path, newNode = _ref12.newNode, getNodeKey = _ref12.getNodeKey, _ref12$ignoreCollapse = _ref12.ignoreCollapsed, ignoreCollapsed = void 0 === _ref12$ignoreCollapse || _ref12$ignoreCollapse, result = function traverse(_ref13) {
|
4421 |
+
var _ref13$isPseudoRoot = _ref13.isPseudoRoot, isPseudoRoot = void 0 !== _ref13$isPseudoRoot && _ref13$isPseudoRoot, node = _ref13.node, currentTreeIndex = _ref13.currentTreeIndex, pathIndex = _ref13.pathIndex;
|
4422 |
+
if (!isPseudoRoot && getNodeKey({
|
4423 |
+
node: node,
|
4424 |
+
treeIndex: currentTreeIndex
|
4425 |
+
}) !== path[pathIndex]) return "RESULT_MISS";
|
4426 |
+
if (pathIndex >= path.length - 1) // If this is the final location in the path, return its changed form
|
4427 |
+
return "function" == typeof newNode ? newNode({
|
4428 |
+
node: node,
|
4429 |
+
treeIndex: currentTreeIndex
|
4430 |
+
}) : newNode;
|
4431 |
+
if (!node.children) // If this node is part of the path, but has no children, return the unchanged node
|
4432 |
+
throw new Error("Path referenced children of node with no children.");
|
4433 |
+
for (var nextTreeIndex = currentTreeIndex + 1, i = 0; i < node.children.length; i += 1) {
|
4434 |
+
var _result = traverse({
|
4435 |
+
node: node.children[i],
|
4436 |
+
currentTreeIndex: nextTreeIndex,
|
4437 |
+
pathIndex: pathIndex + 1
|
4438 |
+
});
|
4439 |
+
// If the result went down the correct path
|
4440 |
+
if ("RESULT_MISS" !== _result) return _result ? _extends({}, node, {
|
4441 |
+
children: [].concat(_toConsumableArray(node.children.slice(0, i)), [ _result ], _toConsumableArray(node.children.slice(i + 1)))
|
4442 |
+
}) : _extends({}, node, {
|
4443 |
+
children: [].concat(_toConsumableArray(node.children.slice(0, i)), _toConsumableArray(node.children.slice(i + 1)))
|
4444 |
+
});
|
4445 |
+
nextTreeIndex += 1 + getDescendantCount({
|
4446 |
+
node: node.children[i],
|
4447 |
+
ignoreCollapsed: ignoreCollapsed
|
4448 |
+
});
|
4449 |
+
}
|
4450 |
+
return "RESULT_MISS";
|
4451 |
+
}({
|
4452 |
+
node: {
|
4453 |
+
children: treeData
|
4454 |
+
},
|
4455 |
+
currentTreeIndex: -1,
|
4456 |
+
pathIndex: -1,
|
4457 |
+
isPseudoRoot: !0
|
4458 |
+
});
|
4459 |
+
if ("RESULT_MISS" === result) throw new Error("No node found at the given path.");
|
4460 |
+
return result.children;
|
4461 |
+
}
|
4462 |
+
/**
|
4463 |
+
* Removes the node at the specified path and returns the resulting treeData.
|
4464 |
+
*
|
4465 |
+
* @param {!Object[]} treeData
|
4466 |
+
* @param {number[]|string[]} path - Array of keys leading up to node to be deleted
|
4467 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4468 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4469 |
+
*
|
4470 |
+
* @return {Object[]} changedTreeData - The tree data with the node removed
|
4471 |
+
*/
|
4472 |
+
function removeNodeAtPath(_ref14) {
|
4473 |
+
var treeData = _ref14.treeData, path = _ref14.path, getNodeKey = _ref14.getNodeKey, _ref14$ignoreCollapse = _ref14.ignoreCollapsed;
|
4474 |
+
return changeNodeAtPath({
|
4475 |
+
treeData: treeData,
|
4476 |
+
path: path,
|
4477 |
+
getNodeKey: getNodeKey,
|
4478 |
+
ignoreCollapsed: void 0 === _ref14$ignoreCollapse || _ref14$ignoreCollapse,
|
4479 |
+
newNode: null
|
4480 |
+
});
|
4481 |
+
}
|
4482 |
+
/**
|
4483 |
+
* Removes the node at the specified path and returns the resulting treeData.
|
4484 |
+
*
|
4485 |
+
* @param {!Object[]} treeData
|
4486 |
+
* @param {number[]|string[]} path - Array of keys leading up to node to be deleted
|
4487 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4488 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4489 |
+
*
|
4490 |
+
* @return {Object} result
|
4491 |
+
* @return {Object[]} result.treeData - The tree data with the node removed
|
4492 |
+
* @return {Object} result.node - The node that was removed
|
4493 |
+
* @return {number} result.treeIndex - The previous treeIndex of the removed node
|
4494 |
+
*/
|
4495 |
+
function removeNode(_ref15) {
|
4496 |
+
var treeData = _ref15.treeData, path = _ref15.path, getNodeKey = _ref15.getNodeKey, _ref15$ignoreCollapse = _ref15.ignoreCollapsed, ignoreCollapsed = void 0 === _ref15$ignoreCollapse || _ref15$ignoreCollapse, removedNode = null, removedTreeIndex = null;
|
4497 |
+
return {
|
4498 |
+
treeData: changeNodeAtPath({
|
4499 |
+
treeData: treeData,
|
4500 |
+
path: path,
|
4501 |
+
getNodeKey: getNodeKey,
|
4502 |
+
ignoreCollapsed: ignoreCollapsed,
|
4503 |
+
newNode: function(_ref16) {
|
4504 |
+
var node = _ref16.node, treeIndex = _ref16.treeIndex;
|
4505 |
+
// Store the target node and delete it from the tree
|
4506 |
+
return removedNode = node, removedTreeIndex = treeIndex, null;
|
4507 |
+
}
|
4508 |
+
}),
|
4509 |
+
node: removedNode,
|
4510 |
+
treeIndex: removedTreeIndex
|
4511 |
+
};
|
4512 |
+
}
|
4513 |
+
/**
|
4514 |
+
* Gets the node at the specified path
|
4515 |
+
*
|
4516 |
+
* @param {!Object[]} treeData
|
4517 |
+
* @param {number[]|string[]} path - Array of keys leading up to node to be deleted
|
4518 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4519 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4520 |
+
*
|
4521 |
+
* @return {Object|null} nodeInfo - The node info at the given path, or null if not found
|
4522 |
+
*/
|
4523 |
+
function getNodeAtPath(_ref17) {
|
4524 |
+
var treeData = _ref17.treeData, path = _ref17.path, getNodeKey = _ref17.getNodeKey, _ref17$ignoreCollapse = _ref17.ignoreCollapsed, ignoreCollapsed = void 0 === _ref17$ignoreCollapse || _ref17$ignoreCollapse, foundNodeInfo = null;
|
4525 |
+
try {
|
4526 |
+
changeNodeAtPath({
|
4527 |
+
treeData: treeData,
|
4528 |
+
path: path,
|
4529 |
+
getNodeKey: getNodeKey,
|
4530 |
+
ignoreCollapsed: ignoreCollapsed,
|
4531 |
+
newNode: function(_ref18) {
|
4532 |
+
var node = _ref18.node, treeIndex = _ref18.treeIndex;
|
4533 |
+
return foundNodeInfo = {
|
4534 |
+
node: node,
|
4535 |
+
treeIndex: treeIndex
|
4536 |
+
}, node;
|
4537 |
+
}
|
4538 |
+
});
|
4539 |
+
} catch (err) {}
|
4540 |
+
return foundNodeInfo;
|
4541 |
+
}
|
4542 |
+
/**
|
4543 |
+
* Adds the node to the specified parent and returns the resulting treeData.
|
4544 |
+
*
|
4545 |
+
* @param {!Object[]} treeData
|
4546 |
+
* @param {!Object} newNode - The node to insert
|
4547 |
+
* @param {number|string} parentKey - The key of the to-be parentNode of the node
|
4548 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4549 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4550 |
+
* @param {boolean=} expandParent - If true, expands the parentNode specified by parentPath
|
4551 |
+
*
|
4552 |
+
* @return {Object} result
|
4553 |
+
* @return {Object[]} result.treeData - The updated tree data
|
4554 |
+
* @return {number} result.treeIndex - The tree index at which the node was inserted
|
4555 |
+
*/
|
4556 |
+
function addNodeUnderParent(_ref19) {
|
4557 |
+
var treeData = _ref19.treeData, newNode = _ref19.newNode, _ref19$parentKey = _ref19.parentKey, parentKey = void 0 === _ref19$parentKey ? null : _ref19$parentKey, getNodeKey = _ref19.getNodeKey, _ref19$ignoreCollapse = _ref19.ignoreCollapsed, ignoreCollapsed = void 0 === _ref19$ignoreCollapse || _ref19$ignoreCollapse, _ref19$expandParent = _ref19.expandParent, expandParent = void 0 !== _ref19$expandParent && _ref19$expandParent;
|
4558 |
+
if (null === parentKey) return {
|
4559 |
+
treeData: [].concat(_toConsumableArray(treeData || []), [ newNode ]),
|
4560 |
+
treeIndex: (treeData || []).length
|
4561 |
+
};
|
4562 |
+
var insertedTreeIndex = null, hasBeenAdded = !1, changedTreeData = map({
|
4563 |
+
treeData: treeData,
|
4564 |
+
getNodeKey: getNodeKey,
|
4565 |
+
ignoreCollapsed: ignoreCollapsed,
|
4566 |
+
callback: function(_ref20) {
|
4567 |
+
var node = _ref20.node, treeIndex = _ref20.treeIndex, path = _ref20.path, key = path ? path[path.length - 1] : null;
|
4568 |
+
// Return nodes that are not the parent as-is
|
4569 |
+
if (hasBeenAdded || key !== parentKey) return node;
|
4570 |
+
hasBeenAdded = !0;
|
4571 |
+
var parentNode = _extends({}, node);
|
4572 |
+
// If no children exist yet, just add the single newNode
|
4573 |
+
if (expandParent && (parentNode.expanded = !0), !parentNode.children) return insertedTreeIndex = treeIndex + 1,
|
4574 |
+
_extends({}, parentNode, {
|
4575 |
+
children: [ newNode ]
|
4576 |
+
});
|
4577 |
+
if ("function" == typeof parentNode.children) throw new Error("Cannot add to children defined by a function");
|
4578 |
+
for (var nextTreeIndex = treeIndex + 1, i = 0; i < parentNode.children.length; i += 1) nextTreeIndex += 1 + getDescendantCount({
|
4579 |
+
node: parentNode.children[i],
|
4580 |
+
ignoreCollapsed: ignoreCollapsed
|
4581 |
+
});
|
4582 |
+
return insertedTreeIndex = nextTreeIndex, _extends({}, parentNode, {
|
4583 |
+
children: [].concat(_toConsumableArray(parentNode.children), [ newNode ])
|
4584 |
+
});
|
4585 |
+
}
|
4586 |
+
});
|
4587 |
+
if (!hasBeenAdded) throw new Error("No node found with the given key.");
|
4588 |
+
return {
|
4589 |
+
treeData: changedTreeData,
|
4590 |
+
treeIndex: insertedTreeIndex
|
4591 |
+
};
|
4592 |
+
}
|
4593 |
+
function addNodeAtDepthAndIndex(_ref21) {
|
4594 |
+
var targetDepth = _ref21.targetDepth, minimumTreeIndex = _ref21.minimumTreeIndex, newNode = _ref21.newNode, ignoreCollapsed = _ref21.ignoreCollapsed, expandParent = _ref21.expandParent, _ref21$isPseudoRoot = _ref21.isPseudoRoot, isPseudoRoot = void 0 !== _ref21$isPseudoRoot && _ref21$isPseudoRoot, isLastChild = _ref21.isLastChild, node = _ref21.node, currentIndex = _ref21.currentIndex, currentDepth = _ref21.currentDepth, getNodeKey = _ref21.getNodeKey, _ref21$path = _ref21.path, path = void 0 === _ref21$path ? [] : _ref21$path, selfPath = function(n) {
|
4595 |
+
return isPseudoRoot ? [] : [].concat(_toConsumableArray(path), [ getNodeKey({
|
4596 |
+
node: n,
|
4597 |
+
treeIndex: currentIndex
|
4598 |
+
}) ]);
|
4599 |
+
};
|
4600 |
+
// If the current position is the only possible place to add, add it
|
4601 |
+
if (currentIndex >= minimumTreeIndex - 1 || isLastChild && (!node.children || !node.children.length)) {
|
4602 |
+
if ("function" == typeof node.children) throw new Error("Cannot add to children defined by a function");
|
4603 |
+
var extraNodeProps = expandParent ? {
|
4604 |
+
expanded: !0
|
4605 |
+
} : {}, _nextNode = _extends({}, node, extraNodeProps, {
|
4606 |
+
children: node.children ? [ newNode ].concat(_toConsumableArray(node.children)) : [ newNode ]
|
4607 |
+
});
|
4608 |
+
return {
|
4609 |
+
node: _nextNode,
|
4610 |
+
nextIndex: currentIndex + 2,
|
4611 |
+
insertedTreeIndex: currentIndex + 1,
|
4612 |
+
parentPath: selfPath(_nextNode),
|
4613 |
+
parentNode: isPseudoRoot ? null : _nextNode
|
4614 |
+
};
|
4615 |
+
}
|
4616 |
+
// If this is the target depth for the insertion,
|
4617 |
+
// i.e., where the newNode can be added to the current node's children
|
4618 |
+
if (currentDepth >= targetDepth - 1) {
|
4619 |
+
// Skip over nodes with no children or hidden children
|
4620 |
+
if (!node.children || "function" == typeof node.children || !0 !== node.expanded && ignoreCollapsed && !isPseudoRoot) return {
|
4621 |
+
node: node,
|
4622 |
+
nextIndex: currentIndex + 1
|
4623 |
+
};
|
4624 |
+
for (var _childIndex = currentIndex + 1, _insertedTreeIndex = null, insertIndex = null, i = 0; i < node.children.length; i += 1) {
|
4625 |
+
// If a valid location is found, mark it as the insertion location and
|
4626 |
+
// break out of the loop
|
4627 |
+
if (_childIndex >= minimumTreeIndex) {
|
4628 |
+
_insertedTreeIndex = _childIndex, insertIndex = i;
|
4629 |
+
break;
|
4630 |
+
}
|
4631 |
+
// Increment the index by the child itself plus the number of descendants it has
|
4632 |
+
_childIndex += 1 + getDescendantCount({
|
4633 |
+
node: node.children[i],
|
4634 |
+
ignoreCollapsed: ignoreCollapsed
|
4635 |
+
});
|
4636 |
+
}
|
4637 |
+
// If no valid indices to add the node were found
|
4638 |
+
if (null === insertIndex) {
|
4639 |
+
// If the last position in this node's children is less than the minimum index
|
4640 |
+
// and there are more children on the level of this node, return without insertion
|
4641 |
+
if (_childIndex < minimumTreeIndex && !isLastChild) return {
|
4642 |
+
node: node,
|
4643 |
+
nextIndex: _childIndex
|
4644 |
+
};
|
4645 |
+
// Use the last position in the children array to insert the newNode
|
4646 |
+
_insertedTreeIndex = _childIndex, insertIndex = node.children.length;
|
4647 |
+
}
|
4648 |
+
// Insert the newNode at the insertIndex
|
4649 |
+
var _nextNode2 = _extends({}, node, {
|
4650 |
+
children: [].concat(_toConsumableArray(node.children.slice(0, insertIndex)), [ newNode ], _toConsumableArray(node.children.slice(insertIndex)))
|
4651 |
+
});
|
4652 |
+
// Return node with successful insert result
|
4653 |
+
return {
|
4654 |
+
node: _nextNode2,
|
4655 |
+
nextIndex: _childIndex,
|
4656 |
+
insertedTreeIndex: _insertedTreeIndex,
|
4657 |
+
parentPath: selfPath(_nextNode2),
|
4658 |
+
parentNode: isPseudoRoot ? null : _nextNode2
|
4659 |
+
};
|
4660 |
+
}
|
4661 |
+
// Skip over nodes with no children or hidden children
|
4662 |
+
if (!node.children || "function" == typeof node.children || !0 !== node.expanded && ignoreCollapsed && !isPseudoRoot) return {
|
4663 |
+
node: node,
|
4664 |
+
nextIndex: currentIndex + 1
|
4665 |
+
};
|
4666 |
+
// Get all descendants
|
4667 |
+
var insertedTreeIndex = null, pathFragment = null, parentNode = null, childIndex = currentIndex + 1, newChildren = node.children;
|
4668 |
+
"function" != typeof newChildren && (newChildren = newChildren.map(function(child, i) {
|
4669 |
+
if (null !== insertedTreeIndex) return child;
|
4670 |
+
var mapResult = addNodeAtDepthAndIndex({
|
4671 |
+
targetDepth: targetDepth,
|
4672 |
+
minimumTreeIndex: minimumTreeIndex,
|
4673 |
+
newNode: newNode,
|
4674 |
+
ignoreCollapsed: ignoreCollapsed,
|
4675 |
+
expandParent: expandParent,
|
4676 |
+
isLastChild: isLastChild && i === newChildren.length - 1,
|
4677 |
+
node: child,
|
4678 |
+
currentIndex: childIndex,
|
4679 |
+
currentDepth: currentDepth + 1,
|
4680 |
+
getNodeKey: getNodeKey,
|
4681 |
+
path: []
|
4682 |
+
});
|
4683 |
+
return "insertedTreeIndex" in mapResult && (insertedTreeIndex = mapResult.insertedTreeIndex,
|
4684 |
+
parentNode = mapResult.parentNode, pathFragment = mapResult.parentPath), childIndex = mapResult.nextIndex,
|
4685 |
+
mapResult.node;
|
4686 |
+
}));
|
4687 |
+
var nextNode = _extends({}, node, {
|
4688 |
+
children: newChildren
|
4689 |
+
}), result = {
|
4690 |
+
node: nextNode,
|
4691 |
+
nextIndex: childIndex
|
4692 |
+
};
|
4693 |
+
return null !== insertedTreeIndex && (result.insertedTreeIndex = insertedTreeIndex,
|
4694 |
+
result.parentPath = [].concat(_toConsumableArray(selfPath(nextNode)), _toConsumableArray(pathFragment)),
|
4695 |
+
result.parentNode = parentNode), result;
|
4696 |
+
}
|
4697 |
+
/**
|
4698 |
+
* Insert a node into the tree at the given depth, after the minimum index
|
4699 |
+
*
|
4700 |
+
* @param {!Object[]} treeData - Tree data
|
4701 |
+
* @param {!number} depth - The depth to insert the node at (the first level of the array being depth 0)
|
4702 |
+
* @param {!number} minimumTreeIndex - The lowest possible treeIndex to insert the node at
|
4703 |
+
* @param {!Object} newNode - The node to insert into the tree
|
4704 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4705 |
+
* @param {boolean=} expandParent - If true, expands the parent of the inserted node
|
4706 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4707 |
+
*
|
4708 |
+
* @return {Object} result
|
4709 |
+
* @return {Object[]} result.treeData - The tree data with the node added
|
4710 |
+
* @return {number} result.treeIndex - The tree index at which the node was inserted
|
4711 |
+
* @return {number[]|string[]} result.path - Array of keys leading to the node location after insertion
|
4712 |
+
* @return {Object} result.parentNode - The parent node of the inserted node
|
4713 |
+
*/
|
4714 |
+
function insertNode(_ref22) {
|
4715 |
+
var treeData = _ref22.treeData, targetDepth = _ref22.depth, minimumTreeIndex = _ref22.minimumTreeIndex, newNode = _ref22.newNode, _ref22$getNodeKey = _ref22.getNodeKey, getNodeKey = void 0 === _ref22$getNodeKey ? function() {} : _ref22$getNodeKey, _ref22$ignoreCollapse = _ref22.ignoreCollapsed, ignoreCollapsed = void 0 === _ref22$ignoreCollapse || _ref22$ignoreCollapse, _ref22$expandParent = _ref22.expandParent, expandParent = void 0 !== _ref22$expandParent && _ref22$expandParent;
|
4716 |
+
if (!treeData && 0 === targetDepth) return {
|
4717 |
+
treeData: [ newNode ],
|
4718 |
+
treeIndex: 0,
|
4719 |
+
path: [ getNodeKey({
|
4720 |
+
node: newNode,
|
4721 |
+
treeIndex: 0
|
4722 |
+
}) ],
|
4723 |
+
parentNode: null
|
4724 |
+
};
|
4725 |
+
var insertResult = addNodeAtDepthAndIndex({
|
4726 |
+
targetDepth: targetDepth,
|
4727 |
+
minimumTreeIndex: minimumTreeIndex,
|
4728 |
+
newNode: newNode,
|
4729 |
+
ignoreCollapsed: ignoreCollapsed,
|
4730 |
+
expandParent: expandParent,
|
4731 |
+
getNodeKey: getNodeKey,
|
4732 |
+
isPseudoRoot: !0,
|
4733 |
+
isLastChild: !0,
|
4734 |
+
node: {
|
4735 |
+
children: treeData
|
4736 |
+
},
|
4737 |
+
currentIndex: -1,
|
4738 |
+
currentDepth: -1
|
4739 |
+
});
|
4740 |
+
if (!("insertedTreeIndex" in insertResult)) throw new Error("No suitable position found to insert.");
|
4741 |
+
var treeIndex = insertResult.insertedTreeIndex;
|
4742 |
+
return {
|
4743 |
+
treeData: insertResult.node.children,
|
4744 |
+
treeIndex: treeIndex,
|
4745 |
+
path: [].concat(_toConsumableArray(insertResult.parentPath), [ getNodeKey({
|
4746 |
+
node: newNode,
|
4747 |
+
treeIndex: treeIndex
|
4748 |
+
}) ]),
|
4749 |
+
parentNode: insertResult.parentNode
|
4750 |
+
};
|
4751 |
+
}
|
4752 |
+
/**
|
4753 |
+
* Get tree data flattened.
|
4754 |
+
*
|
4755 |
+
* @param {!Object[]} treeData - Tree data
|
4756 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4757 |
+
* @param {boolean=} ignoreCollapsed - Ignore children of nodes without `expanded` set to `true`
|
4758 |
+
*
|
4759 |
+
* @return {{
|
4760 |
+
* node: Object,
|
4761 |
+
* path: []string|[]number,
|
4762 |
+
* lowerSiblingCounts: []number
|
4763 |
+
* }}[] nodes - The node array
|
4764 |
+
*/
|
4765 |
+
function getFlatDataFromTree(_ref23) {
|
4766 |
+
var treeData = _ref23.treeData, getNodeKey = _ref23.getNodeKey, _ref23$ignoreCollapse = _ref23.ignoreCollapsed, ignoreCollapsed = void 0 === _ref23$ignoreCollapse || _ref23$ignoreCollapse;
|
4767 |
+
if (!treeData || treeData.length < 1) return [];
|
4768 |
+
var flattened = [];
|
4769 |
+
return walk({
|
4770 |
+
treeData: treeData,
|
4771 |
+
getNodeKey: getNodeKey,
|
4772 |
+
ignoreCollapsed: ignoreCollapsed,
|
4773 |
+
callback: function(nodeInfo) {
|
4774 |
+
flattened.push(nodeInfo);
|
4775 |
+
}
|
4776 |
+
}), flattened;
|
4777 |
+
}
|
4778 |
+
/**
|
4779 |
+
* Generate a tree structure from flat data.
|
4780 |
+
*
|
4781 |
+
* @param {!Object[]} flatData
|
4782 |
+
* @param {!function=} getKey - Function to get the key from the nodeData
|
4783 |
+
* @param {!function=} getParentKey - Function to get the parent key from the nodeData
|
4784 |
+
* @param {string|number=} rootKey - The value returned by `getParentKey` that corresponds to the root node.
|
4785 |
+
* For example, if your nodes have id 1-99, you might use rootKey = 0
|
4786 |
+
*
|
4787 |
+
* @return {Object[]} treeData - The flat data represented as a tree
|
4788 |
+
*/
|
4789 |
+
function getTreeFromFlatData(_ref24) {
|
4790 |
+
var flatData = _ref24.flatData, _ref24$getKey = _ref24.getKey, getKey = void 0 === _ref24$getKey ? function(node) {
|
4791 |
+
return node.id;
|
4792 |
+
} : _ref24$getKey, _ref24$getParentKey = _ref24.getParentKey, getParentKey = void 0 === _ref24$getParentKey ? function(node) {
|
4793 |
+
return node.parentId;
|
4794 |
+
} : _ref24$getParentKey, _ref24$rootKey = _ref24.rootKey, rootKey = void 0 === _ref24$rootKey ? "0" : _ref24$rootKey;
|
4795 |
+
if (!flatData) return [];
|
4796 |
+
var childrenToParents = {};
|
4797 |
+
if (flatData.forEach(function(child) {
|
4798 |
+
var parentKey = getParentKey(child);
|
4799 |
+
parentKey in childrenToParents ? childrenToParents[parentKey].push(child) : childrenToParents[parentKey] = [ child ];
|
4800 |
+
}), !(rootKey in childrenToParents)) return [];
|
4801 |
+
var trav = function trav(parent) {
|
4802 |
+
var parentKey = getKey(parent);
|
4803 |
+
return parentKey in childrenToParents ? _extends({}, parent, {
|
4804 |
+
children: childrenToParents[parentKey].map(function(child) {
|
4805 |
+
return trav(child);
|
4806 |
+
})
|
4807 |
+
}) : _extends({}, parent);
|
4808 |
+
};
|
4809 |
+
return childrenToParents[rootKey].map(function(child) {
|
4810 |
+
return trav(child);
|
4811 |
+
});
|
4812 |
+
}
|
4813 |
+
/**
|
4814 |
+
* Check if a node is a descendant of another node.
|
4815 |
+
*
|
4816 |
+
* @param {!Object} older - Potential ancestor of younger node
|
4817 |
+
* @param {!Object} younger - Potential descendant of older node
|
4818 |
+
*
|
4819 |
+
* @return {boolean}
|
4820 |
+
*/
|
4821 |
+
function isDescendant(older, younger) {
|
4822 |
+
return !!older.children && "function" != typeof older.children && older.children.some(function(child) {
|
4823 |
+
return child === younger || isDescendant(child, younger);
|
4824 |
+
});
|
4825 |
+
}
|
4826 |
+
/**
|
4827 |
+
* Get the maximum depth of the children (the depth of the root node is 0).
|
4828 |
+
*
|
4829 |
+
* @param {!Object} node - Node in the tree
|
4830 |
+
* @param {?number} depth - The current depth
|
4831 |
+
*
|
4832 |
+
* @return {number} maxDepth - The deepest depth in the tree
|
4833 |
+
*/
|
4834 |
+
function getDepth(node) {
|
4835 |
+
var depth = arguments.length > 1 && void 0 !== arguments[1] ? arguments[1] : 0;
|
4836 |
+
return node.children ? "function" == typeof node.children ? depth + 1 : node.children.reduce(function(deepest, child) {
|
4837 |
+
return Math.max(deepest, getDepth(child, depth + 1));
|
4838 |
+
}, depth) : depth;
|
4839 |
+
}
|
4840 |
+
/**
|
4841 |
+
* Find nodes matching a search query in the tree,
|
4842 |
+
*
|
4843 |
+
* @param {!function} getNodeKey - Function to get the key from the nodeData and tree index
|
4844 |
+
* @param {!Object[]} treeData - Tree data
|
4845 |
+
* @param {?string|number} searchQuery - Function returning a boolean to indicate whether the node is a match or not
|
4846 |
+
* @param {!function} searchMethod - Function returning a boolean to indicate whether the node is a match or not
|
4847 |
+
* @param {?number} searchFocusOffset - The offset of the match to focus on
|
4848 |
+
* (e.g., 0 focuses on the first match, 1 on the second)
|
4849 |
+
* @param {boolean=} expandAllMatchPaths - If true, expands the paths to any matched node
|
4850 |
+
* @param {boolean=} expandFocusMatchPaths - If true, expands the path to the focused node
|
4851 |
+
*
|
4852 |
+
* @return {Object[]} matches - An array of objects containing the matching `node`s, their `path`s and `treeIndex`s
|
4853 |
+
* @return {Object[]} treeData - The original tree data with all relevant nodes expanded.
|
4854 |
+
* If expandAllMatchPaths and expandFocusMatchPaths are both false,
|
4855 |
+
* it will be the same as the original tree data.
|
4856 |
+
*/
|
4857 |
+
function find(_ref25) {
|
4858 |
+
var getNodeKey = _ref25.getNodeKey, treeData = _ref25.treeData, searchQuery = _ref25.searchQuery, searchMethod = _ref25.searchMethod, searchFocusOffset = _ref25.searchFocusOffset, _ref25$expandAllMatch = _ref25.expandAllMatchPaths, expandAllMatchPaths = void 0 !== _ref25$expandAllMatch && _ref25$expandAllMatch, _ref25$expandFocusMat = _ref25.expandFocusMatchPaths, expandFocusMatchPaths = void 0 === _ref25$expandFocusMat || _ref25$expandFocusMat, matchCount = 0, result = function trav(_ref26) {
|
4859 |
+
var _ref26$isPseudoRoot = _ref26.isPseudoRoot, isPseudoRoot = void 0 !== _ref26$isPseudoRoot && _ref26$isPseudoRoot, node = _ref26.node, currentIndex = _ref26.currentIndex, _ref26$path = _ref26.path, path = void 0 === _ref26$path ? [] : _ref26$path, matches = [], isSelfMatch = !1, hasFocusMatch = !1, selfPath = isPseudoRoot ? [] : [].concat(_toConsumableArray(path), [ getNodeKey({
|
4860 |
+
node: node,
|
4861 |
+
treeIndex: currentIndex
|
4862 |
+
}) ]), extraInfo = isPseudoRoot ? null : {
|
4863 |
+
path: selfPath,
|
4864 |
+
treeIndex: currentIndex
|
4865 |
+
}, hasChildren = node.children && "function" != typeof node.children && node.children.length > 0;
|
4866 |
+
// Examine the current node to see if it is a match
|
4867 |
+
!isPseudoRoot && searchMethod(_extends({}, extraInfo, {
|
4868 |
+
node: node,
|
4869 |
+
searchQuery: searchQuery
|
4870 |
+
})) && (matchCount === searchFocusOffset && (hasFocusMatch = !0), // Keep track of the number of matching nodes, so we know when the searchFocusOffset
|
4871 |
+
// is reached
|
4872 |
+
matchCount += 1, // We cannot add this node to the matches right away, as it may be changed
|
4873 |
+
// during the search of the descendants. The entire node is used in
|
4874 |
+
// comparisons between nodes inside the `matches` and `treeData` results
|
4875 |
+
// of this method (`find`)
|
4876 |
+
isSelfMatch = !0);
|
4877 |
+
var childIndex = currentIndex, newNode = _extends({}, node);
|
4878 |
+
// Get all descendants
|
4879 |
+
// Cannot assign a treeIndex to hidden nodes
|
4880 |
+
// Add this node to the matches if it fits the search criteria.
|
4881 |
+
// This is performed at the last minute so newNode can be sent in its final form.
|
4882 |
+
return hasChildren && (newNode.children = newNode.children.map(function(child) {
|
4883 |
+
var mapResult = trav({
|
4884 |
+
node: child,
|
4885 |
+
currentIndex: childIndex + 1,
|
4886 |
+
path: selfPath
|
4887 |
+
});
|
4888 |
+
// Ignore hidden nodes by only advancing the index counter to the returned treeIndex
|
4889 |
+
// if the child is expanded.
|
4890 |
+
//
|
4891 |
+
// The child could have been expanded from the start,
|
4892 |
+
// or expanded due to a matching node being found in its descendants
|
4893 |
+
// Expand the current node if it has descendants matching the search
|
4894 |
+
// and the settings are set to do so.
|
4895 |
+
return mapResult.node.expanded ? childIndex = mapResult.treeIndex : childIndex += 1,
|
4896 |
+
(mapResult.matches.length > 0 || mapResult.hasFocusMatch) && (matches = [].concat(_toConsumableArray(matches), _toConsumableArray(mapResult.matches)),
|
4897 |
+
mapResult.hasFocusMatch && (hasFocusMatch = !0), (expandAllMatchPaths && mapResult.matches.length > 0 || (expandAllMatchPaths || expandFocusMatchPaths) && mapResult.hasFocusMatch) && (newNode.expanded = !0)),
|
4898 |
+
mapResult.node;
|
4899 |
+
})), isPseudoRoot || newNode.expanded || (matches = matches.map(function(match) {
|
4900 |
+
return _extends({}, match, {
|
4901 |
+
treeIndex: null
|
4902 |
+
});
|
4903 |
+
})), isSelfMatch && (matches = [ _extends({}, extraInfo, {
|
4904 |
+
node: newNode
|
4905 |
+
}) ].concat(_toConsumableArray(matches))), {
|
4906 |
+
node: matches.length > 0 ? newNode : node,
|
4907 |
+
matches: matches,
|
4908 |
+
hasFocusMatch: hasFocusMatch,
|
4909 |
+
treeIndex: childIndex
|
4910 |
+
};
|
4911 |
+
}({
|
4912 |
+
node: {
|
4913 |
+
children: treeData
|
4914 |
+
},
|
4915 |
+
isPseudoRoot: !0,
|
4916 |
+
currentIndex: -1
|
4917 |
+
});
|
4918 |
+
return {
|
4919 |
+
matches: result.matches,
|
4920 |
+
treeData: result.node.children
|
4921 |
+
};
|
4922 |
+
}
|
4923 |
+
Object.defineProperty(exports, "__esModule", {
|
4924 |
+
value: !0
|
4925 |
+
});
|
4926 |
+
var _extends = Object.assign || function(target) {
|
4927 |
+
for (var i = 1; i < arguments.length; i++) {
|
4928 |
+
var source = arguments[i];
|
4929 |
+
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
4930 |
+
}
|
4931 |
+
return target;
|
4932 |
+
};
|
4933 |
+
exports.getDescendantCount = getDescendantCount, exports.getVisibleNodeCount = getVisibleNodeCount,
|
4934 |
+
exports.getVisibleNodeInfoAtIndex = getVisibleNodeInfoAtIndex, exports.walk = walk,
|
4935 |
+
exports.map = map, exports.toggleExpandedForAll = toggleExpandedForAll, exports.changeNodeAtPath = changeNodeAtPath,
|
4936 |
+
exports.removeNodeAtPath = removeNodeAtPath, exports.removeNode = removeNode, exports.getNodeAtPath = getNodeAtPath,
|
4937 |
+
exports.addNodeUnderParent = addNodeUnderParent, exports.insertNode = insertNode,
|
4938 |
+
exports.getFlatDataFromTree = getFlatDataFromTree, exports.getTreeFromFlatData = getTreeFromFlatData,
|
4939 |
+
exports.isDescendant = isDescendant, exports.getDepth = getDepth, exports.find = find;
|
4940 |
+
}, /* 1 */
|
4941 |
+
/***/
|
4942 |
+
function(module, exports) {
|
4943 |
+
module.exports = __webpack_require__(1);
|
4944 |
+
}, /* 2 */
|
4945 |
+
/***/
|
4946 |
+
function(module, exports) {
|
4947 |
+
module.exports = __webpack_require__(0);
|
4948 |
+
}, /* 3 */
|
4949 |
+
/***/
|
4950 |
+
function(module, exports) {
|
4951 |
+
function cssWithMappingToString(item, useSourceMap) {
|
4952 |
+
var content = item[1] || "", cssMapping = item[3];
|
4953 |
+
if (!cssMapping) return content;
|
4954 |
+
if (useSourceMap && "function" == typeof btoa) {
|
4955 |
+
var sourceMapping = toComment(cssMapping);
|
4956 |
+
return [ content ].concat(cssMapping.sources.map(function(source) {
|
4957 |
+
return "/*# sourceURL=" + cssMapping.sourceRoot + source + " */";
|
4958 |
+
})).concat([ sourceMapping ]).join("\n");
|
4959 |
+
}
|
4960 |
+
return [ content ].join("\n");
|
4961 |
+
}
|
4962 |
+
// Adapted from convert-source-map (MIT)
|
4963 |
+
function toComment(sourceMap) {
|
4964 |
+
return "/*# sourceMappingURL=data:application/json;charset=utf-8;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))) + " */";
|
4965 |
+
}
|
4966 |
+
/*
|
4967 |
+
MIT License http://www.opensource.org/licenses/mit-license.php
|
4968 |
+
Author Tobias Koppers @sokra
|
4969 |
+
*/
|
4970 |
+
// css base code, injected by the css-loader
|
4971 |
+
module.exports = function(useSourceMap) {
|
4972 |
+
var list = [];
|
4973 |
+
// return the list of modules as css string
|
4974 |
+
// import a list of modules into the list
|
4975 |
+
return list.toString = function() {
|
4976 |
+
return this.map(function(item) {
|
4977 |
+
var content = cssWithMappingToString(item, useSourceMap);
|
4978 |
+
return item[2] ? "@media " + item[2] + "{" + content + "}" : content;
|
4979 |
+
}).join("");
|
4980 |
+
}, list.i = function(modules, mediaQuery) {
|
4981 |
+
"string" == typeof modules && (modules = [ [ null, modules, "" ] ]);
|
4982 |
+
for (var alreadyImportedModules = {}, i = 0; i < this.length; i++) {
|
4983 |
+
var id = this[i][0];
|
4984 |
+
"number" == typeof id && (alreadyImportedModules[id] = !0);
|
4985 |
+
}
|
4986 |
+
for (i = 0; i < modules.length; i++) {
|
4987 |
+
var item = modules[i];
|
4988 |
+
// skip already imported module
|
4989 |
+
// this implementation is not 100% perfect for weird media query combinations
|
4990 |
+
// when a module is imported multiple times with different media queries.
|
4991 |
+
// I hope this will never occur (Hey this way we have smaller bundles)
|
4992 |
+
"number" == typeof item[0] && alreadyImportedModules[item[0]] || (mediaQuery && !item[2] ? item[2] = mediaQuery : mediaQuery && (item[2] = "(" + item[2] + ") and (" + mediaQuery + ")"),
|
4993 |
+
list.push(item));
|
4994 |
+
}
|
4995 |
+
}, list;
|
4996 |
+
};
|
4997 |
+
}, /* 4 */
|
4998 |
+
/***/
|
4999 |
+
function(module, exports, __webpack_require__) {
|
5000 |
+
function addStylesToDom(styles, options) {
|
5001 |
+
for (var i = 0; i < styles.length; i++) {
|
5002 |
+
var item = styles[i], domStyle = stylesInDom[item.id];
|
5003 |
+
if (domStyle) {
|
5004 |
+
domStyle.refs++;
|
5005 |
+
for (var j = 0; j < domStyle.parts.length; j++) domStyle.parts[j](item.parts[j]);
|
5006 |
+
for (;j < item.parts.length; j++) domStyle.parts.push(addStyle(item.parts[j], options));
|
5007 |
+
} else {
|
5008 |
+
for (var parts = [], j = 0; j < item.parts.length; j++) parts.push(addStyle(item.parts[j], options));
|
5009 |
+
stylesInDom[item.id] = {
|
5010 |
+
id: item.id,
|
5011 |
+
refs: 1,
|
5012 |
+
parts: parts
|
5013 |
+
};
|
5014 |
+
}
|
5015 |
+
}
|
5016 |
+
}
|
5017 |
+
function listToStyles(list, options) {
|
5018 |
+
for (var styles = [], newStyles = {}, i = 0; i < list.length; i++) {
|
5019 |
+
var item = list[i], id = options.base ? item[0] + options.base : item[0], css = item[1], media = item[2], sourceMap = item[3], part = {
|
5020 |
+
css: css,
|
5021 |
+
media: media,
|
5022 |
+
sourceMap: sourceMap
|
5023 |
+
};
|
5024 |
+
newStyles[id] ? newStyles[id].parts.push(part) : styles.push(newStyles[id] = {
|
5025 |
+
id: id,
|
5026 |
+
parts: [ part ]
|
5027 |
+
});
|
5028 |
+
}
|
5029 |
+
return styles;
|
5030 |
+
}
|
5031 |
+
function insertStyleElement(options, style) {
|
5032 |
+
var target = getElement(options.insertInto);
|
5033 |
+
if (!target) throw new Error("Couldn't find a style target. This probably means that the value for the 'insertInto' parameter is invalid.");
|
5034 |
+
var lastStyleElementInsertedAtTop = stylesInsertedAtTop[stylesInsertedAtTop.length - 1];
|
5035 |
+
if ("top" === options.insertAt) lastStyleElementInsertedAtTop ? lastStyleElementInsertedAtTop.nextSibling ? target.insertBefore(style, lastStyleElementInsertedAtTop.nextSibling) : target.appendChild(style) : target.insertBefore(style, target.firstChild),
|
5036 |
+
stylesInsertedAtTop.push(style); else if ("bottom" === options.insertAt) target.appendChild(style); else {
|
5037 |
+
if ("object" != typeof options.insertAt || !options.insertAt.before) throw new Error("[Style Loader]\n\n Invalid value for parameter 'insertAt' ('options.insertAt') found.\n Must be 'top', 'bottom', or Object.\n (https://github.com/webpack-contrib/style-loader#insertat)\n");
|
5038 |
+
var nextSibling = getElement(options.insertInto + " " + options.insertAt.before);
|
5039 |
+
target.insertBefore(style, nextSibling);
|
5040 |
+
}
|
5041 |
+
}
|
5042 |
+
function removeStyleElement(style) {
|
5043 |
+
if (null === style.parentNode) return !1;
|
5044 |
+
style.parentNode.removeChild(style);
|
5045 |
+
var idx = stylesInsertedAtTop.indexOf(style);
|
5046 |
+
idx >= 0 && stylesInsertedAtTop.splice(idx, 1);
|
5047 |
+
}
|
5048 |
+
function createStyleElement(options) {
|
5049 |
+
var style = document.createElement("style");
|
5050 |
+
return options.attrs.type = "text/css", addAttrs(style, options.attrs), insertStyleElement(options, style),
|
5051 |
+
style;
|
5052 |
+
}
|
5053 |
+
function createLinkElement(options) {
|
5054 |
+
var link = document.createElement("link");
|
5055 |
+
return options.attrs.type = "text/css", options.attrs.rel = "stylesheet", addAttrs(link, options.attrs),
|
5056 |
+
insertStyleElement(options, link), link;
|
5057 |
+
}
|
5058 |
+
function addAttrs(el, attrs) {
|
5059 |
+
Object.keys(attrs).forEach(function(key) {
|
5060 |
+
el.setAttribute(key, attrs[key]);
|
5061 |
+
});
|
5062 |
+
}
|
5063 |
+
function addStyle(obj, options) {
|
5064 |
+
var style, update, remove, result;
|
5065 |
+
// If a transform function was defined, run it on the css
|
5066 |
+
if (options.transform && obj.css) {
|
5067 |
+
if (!(result = options.transform(obj.css))) // If the transform function returns a falsy value, don't add this css.
|
5068 |
+
// This allows conditional loading of css
|
5069 |
+
return function() {};
|
5070 |
+
// If transform returns a value, use that instead of the original css.
|
5071 |
+
// This allows running runtime transformations on the css.
|
5072 |
+
obj.css = result;
|
5073 |
+
}
|
5074 |
+
if (options.singleton) {
|
5075 |
+
var styleIndex = singletonCounter++;
|
5076 |
+
style = singleton || (singleton = createStyleElement(options)), update = applyToSingletonTag.bind(null, style, styleIndex, !1),
|
5077 |
+
remove = applyToSingletonTag.bind(null, style, styleIndex, !0);
|
5078 |
+
} else obj.sourceMap && "function" == typeof URL && "function" == typeof URL.createObjectURL && "function" == typeof URL.revokeObjectURL && "function" == typeof Blob && "function" == typeof btoa ? (style = createLinkElement(options),
|
5079 |
+
update = updateLink.bind(null, style, options), remove = function() {
|
5080 |
+
removeStyleElement(style), style.href && URL.revokeObjectURL(style.href);
|
5081 |
+
}) : (style = createStyleElement(options), update = applyToTag.bind(null, style),
|
5082 |
+
remove = function() {
|
5083 |
+
removeStyleElement(style);
|
5084 |
+
});
|
5085 |
+
return update(obj), function(newObj) {
|
5086 |
+
if (newObj) {
|
5087 |
+
if (newObj.css === obj.css && newObj.media === obj.media && newObj.sourceMap === obj.sourceMap) return;
|
5088 |
+
update(obj = newObj);
|
5089 |
+
} else remove();
|
5090 |
+
};
|
5091 |
+
}
|
5092 |
+
function applyToSingletonTag(style, index, remove, obj) {
|
5093 |
+
var css = remove ? "" : obj.css;
|
5094 |
+
if (style.styleSheet) style.styleSheet.cssText = replaceText(index, css); else {
|
5095 |
+
var cssNode = document.createTextNode(css), childNodes = style.childNodes;
|
5096 |
+
childNodes[index] && style.removeChild(childNodes[index]), childNodes.length ? style.insertBefore(cssNode, childNodes[index]) : style.appendChild(cssNode);
|
5097 |
+
}
|
5098 |
+
}
|
5099 |
+
function applyToTag(style, obj) {
|
5100 |
+
var css = obj.css, media = obj.media;
|
5101 |
+
if (media && style.setAttribute("media", media), style.styleSheet) style.styleSheet.cssText = css; else {
|
5102 |
+
for (;style.firstChild; ) style.removeChild(style.firstChild);
|
5103 |
+
style.appendChild(document.createTextNode(css));
|
5104 |
+
}
|
5105 |
+
}
|
5106 |
+
function updateLink(link, options, obj) {
|
5107 |
+
var css = obj.css, sourceMap = obj.sourceMap, autoFixUrls = void 0 === options.convertToAbsoluteUrls && sourceMap;
|
5108 |
+
(options.convertToAbsoluteUrls || autoFixUrls) && (css = fixUrls(css)), sourceMap && (// http://stackoverflow.com/a/26603875
|
5109 |
+
css += "\n/*# sourceMappingURL=data:application/json;base64," + btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))) + " */");
|
5110 |
+
var blob = new Blob([ css ], {
|
5111 |
+
type: "text/css"
|
5112 |
+
}), oldSrc = link.href;
|
5113 |
+
link.href = URL.createObjectURL(blob), oldSrc && URL.revokeObjectURL(oldSrc);
|
5114 |
+
}
|
5115 |
+
/*
|
5116 |
+
MIT License http://www.opensource.org/licenses/mit-license.php
|
5117 |
+
Author Tobias Koppers @sokra
|
5118 |
+
*/
|
5119 |
+
var stylesInDom = {}, isOldIE = function(fn) {
|
5120 |
+
var memo;
|
5121 |
+
return function() {
|
5122 |
+
return void 0 === memo && (memo = fn.apply(this, arguments)), memo;
|
5123 |
+
};
|
5124 |
+
}(function() {
|
5125 |
+
// Test for IE <= 9 as proposed by Browserhacks
|
5126 |
+
// @see http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805
|
5127 |
+
// Tests for existence of standard globals is to allow style-loader
|
5128 |
+
// to operate correctly into non-standard environments
|
5129 |
+
// @see https://github.com/webpack-contrib/style-loader/issues/177
|
5130 |
+
return window && document && document.all && !window.atob;
|
5131 |
+
}), getElement = function(fn) {
|
5132 |
+
var memo = {};
|
5133 |
+
return function(selector) {
|
5134 |
+
if (void 0 === memo[selector]) {
|
5135 |
+
var styleTarget = fn.call(this, selector);
|
5136 |
+
// Special case to return head of iframe instead of iframe itself
|
5137 |
+
if (styleTarget instanceof window.HTMLIFrameElement) try {
|
5138 |
+
// This will throw an exception if access to iframe is blocked
|
5139 |
+
// due to cross-origin restrictions
|
5140 |
+
styleTarget = styleTarget.contentDocument.head;
|
5141 |
+
} catch (e) {
|
5142 |
+
styleTarget = null;
|
5143 |
+
}
|
5144 |
+
memo[selector] = styleTarget;
|
5145 |
+
}
|
5146 |
+
return memo[selector];
|
5147 |
+
};
|
5148 |
+
}(function(target) {
|
5149 |
+
return document.querySelector(target);
|
5150 |
+
}), singleton = null, singletonCounter = 0, stylesInsertedAtTop = [], fixUrls = __webpack_require__(14);
|
5151 |
+
module.exports = function(list, options) {
|
5152 |
+
if ("undefined" != typeof DEBUG && DEBUG && "object" != typeof document) throw new Error("The style-loader cannot be used in a non-browser environment");
|
5153 |
+
options = options || {}, options.attrs = "object" == typeof options.attrs ? options.attrs : {},
|
5154 |
+
// Force single-tag solution on IE6-9, which has a hard limit on the # of <style>
|
5155 |
+
// tags it will allow on a page
|
5156 |
+
options.singleton || "boolean" == typeof options.singleton || (options.singleton = isOldIE()),
|
5157 |
+
// By default, add <style> tags to the <head> element
|
5158 |
+
options.insertInto || (options.insertInto = "head"), // By default, add <style> tags to the bottom of the target
|
5159 |
+
options.insertAt || (options.insertAt = "bottom");
|
5160 |
+
var styles = listToStyles(list, options);
|
5161 |
+
return addStylesToDom(styles, options), function(newList) {
|
5162 |
+
for (var mayRemove = [], i = 0; i < styles.length; i++) {
|
5163 |
+
var item = styles[i], domStyle = stylesInDom[item.id];
|
5164 |
+
domStyle.refs--, mayRemove.push(domStyle);
|
5165 |
+
}
|
5166 |
+
if (newList) {
|
5167 |
+
addStylesToDom(listToStyles(newList, options), options);
|
5168 |
+
}
|
5169 |
+
for (var i = 0; i < mayRemove.length; i++) {
|
5170 |
+
var domStyle = mayRemove[i];
|
5171 |
+
if (0 === domStyle.refs) {
|
5172 |
+
for (var j = 0; j < domStyle.parts.length; j++) domStyle.parts[j]();
|
5173 |
+
delete stylesInDom[domStyle.id];
|
5174 |
+
}
|
5175 |
+
}
|
5176 |
+
};
|
5177 |
+
};
|
5178 |
+
var replaceText = function() {
|
5179 |
+
var textStore = [];
|
5180 |
+
return function(index, replacement) {
|
5181 |
+
return textStore[index] = replacement, textStore.filter(Boolean).join("\n");
|
5182 |
+
};
|
5183 |
+
}();
|
5184 |
+
}, /* 5 */
|
5185 |
+
/***/
|
5186 |
+
function(module, exports, __webpack_require__) {
|
5187 |
+
"use strict";
|
5188 |
+
function defaultGetNodeKey(_ref) {
|
5189 |
+
return _ref.treeIndex;
|
5190 |
+
}
|
5191 |
+
// Cheap hack to get the text of a react object
|
5192 |
+
function getReactElementText(parent) {
|
5193 |
+
return "string" == typeof parent ? parent : "object" !== (void 0 === parent ? "undefined" : _typeof(parent)) || !parent.props || !parent.props.children || "string" != typeof parent.props.children && "object" !== _typeof(parent.props.children) ? "" : "string" == typeof parent.props.children ? parent.props.children : parent.props.children.map(function(child) {
|
5194 |
+
return getReactElementText(child);
|
5195 |
+
}).join("");
|
5196 |
+
}
|
5197 |
+
// Search for a query string inside a node property
|
5198 |
+
function stringSearch(key, searchQuery, node, path, treeIndex) {
|
5199 |
+
return "function" == typeof node[key] ? String(node[key]({
|
5200 |
+
node: node,
|
5201 |
+
path: path,
|
5202 |
+
treeIndex: treeIndex
|
5203 |
+
})).indexOf(searchQuery) > -1 : "object" === _typeof(node[key]) ? getReactElementText(node[key]).indexOf(searchQuery) > -1 : node[key] && String(node[key]).indexOf(searchQuery) > -1;
|
5204 |
+
}
|
5205 |
+
function defaultSearchMethod(_ref2) {
|
5206 |
+
var node = _ref2.node, path = _ref2.path, treeIndex = _ref2.treeIndex, searchQuery = _ref2.searchQuery;
|
5207 |
+
return stringSearch("title", searchQuery, node, path, treeIndex) || stringSearch("subtitle", searchQuery, node, path, treeIndex);
|
5208 |
+
}
|
5209 |
+
Object.defineProperty(exports, "__esModule", {
|
5210 |
+
value: !0
|
5211 |
+
});
|
5212 |
+
var _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function(obj) {
|
5213 |
+
return typeof obj;
|
5214 |
+
} : function(obj) {
|
5215 |
+
return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
|
5216 |
+
};
|
5217 |
+
exports.defaultGetNodeKey = defaultGetNodeKey, exports.defaultSearchMethod = defaultSearchMethod;
|
5218 |
+
}, /* 6 */
|
5219 |
+
/***/
|
5220 |
+
function(module, exports, __webpack_require__) {
|
5221 |
+
"use strict";
|
5222 |
+
Object.defineProperty(exports, "__esModule", {
|
5223 |
+
value: !0
|
5224 |
+
}), exports.memoizedGetDescendantCount = exports.memoizedGetFlatDataFromTree = exports.memoizedInsertNode = void 0;
|
5225 |
+
var _treeDataUtils = __webpack_require__(0), memoize = function(f) {
|
5226 |
+
var savedArgsArray = [], savedKeysArray = [], savedResult = null;
|
5227 |
+
return function(args) {
|
5228 |
+
var keysArray = Object.keys(args).sort(), argsArray = keysArray.map(function(key) {
|
5229 |
+
return args[key];
|
5230 |
+
});
|
5231 |
+
// If the arguments for the last insert operation are different than this time,
|
5232 |
+
// recalculate the result
|
5233 |
+
return (argsArray.length !== savedArgsArray.length || argsArray.some(function(arg, index) {
|
5234 |
+
return arg !== savedArgsArray[index];
|
5235 |
+
}) || keysArray.some(function(key, index) {
|
5236 |
+
return key !== savedKeysArray[index];
|
5237 |
+
})) && (savedArgsArray = argsArray, savedKeysArray = keysArray, savedResult = f(args)),
|
5238 |
+
savedResult;
|
5239 |
+
};
|
5240 |
+
};
|
5241 |
+
exports.memoizedInsertNode = memoize(_treeDataUtils.insertNode), exports.memoizedGetFlatDataFromTree = memoize(_treeDataUtils.getFlatDataFromTree),
|
5242 |
+
exports.memoizedGetDescendantCount = memoize(_treeDataUtils.getDescendantCount);
|
5243 |
+
}, /* 7 */
|
5244 |
+
/***/
|
5245 |
+
function(module, exports, __webpack_require__) {
|
5246 |
+
"use strict";
|
5247 |
+
Object.defineProperty(exports, "__esModule", {
|
5248 |
+
value: !0
|
5249 |
+
}), exports.SortableTreeWithoutDndContext = void 0;
|
5250 |
+
var _defaultHandlers = __webpack_require__(5);
|
5251 |
+
Object.keys(_defaultHandlers).forEach(function(key) {
|
5252 |
+
"default" !== key && "__esModule" !== key && Object.defineProperty(exports, key, {
|
5253 |
+
enumerable: !0,
|
5254 |
+
get: function() {
|
5255 |
+
return _defaultHandlers[key];
|
5256 |
+
}
|
5257 |
+
});
|
5258 |
+
});
|
5259 |
+
var _treeDataUtils = __webpack_require__(0);
|
5260 |
+
Object.keys(_treeDataUtils).forEach(function(key) {
|
5261 |
+
"default" !== key && "__esModule" !== key && Object.defineProperty(exports, key, {
|
5262 |
+
enumerable: !0,
|
5263 |
+
get: function() {
|
5264 |
+
return _treeDataUtils[key];
|
5265 |
+
}
|
5266 |
+
});
|
5267 |
+
});
|
5268 |
+
var _reactSortableTree = __webpack_require__(8), _reactSortableTree2 = function(obj) {
|
5269 |
+
return obj && obj.__esModule ? obj : {
|
5270 |
+
default: obj
|
5271 |
+
};
|
5272 |
+
}(_reactSortableTree);
|
5273 |
+
exports.default = _reactSortableTree2.default, // Export the tree component without the react-dnd DragDropContext,
|
5274 |
+
// for when component is used with other components using react-dnd.
|
5275 |
+
// see: https://github.com/gaearon/react-dnd/issues/186
|
5276 |
+
exports.SortableTreeWithoutDndContext = _reactSortableTree.SortableTreeWithoutDndContext;
|
5277 |
+
}, /* 8 */
|
5278 |
+
/***/
|
5279 |
+
function(module, exports, __webpack_require__) {
|
5280 |
+
"use strict";
|
5281 |
+
function _interopRequireDefault(obj) {
|
5282 |
+
return obj && obj.__esModule ? obj : {
|
5283 |
+
default: obj
|
5284 |
+
};
|
5285 |
+
}
|
5286 |
+
function _classCallCheck(instance, Constructor) {
|
5287 |
+
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
5288 |
+
}
|
5289 |
+
function _possibleConstructorReturn(self, call) {
|
5290 |
+
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
5291 |
+
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
5292 |
+
}
|
5293 |
+
function _inherits(subClass, superClass) {
|
5294 |
+
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
5295 |
+
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
5296 |
+
constructor: {
|
5297 |
+
value: subClass,
|
5298 |
+
enumerable: !1,
|
5299 |
+
writable: !0,
|
5300 |
+
configurable: !0
|
5301 |
+
}
|
5302 |
+
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
5303 |
+
}
|
5304 |
+
Object.defineProperty(exports, "__esModule", {
|
5305 |
+
value: !0
|
5306 |
+
}), exports.SortableTreeWithoutDndContext = void 0;
|
5307 |
+
var _createClass = function() {
|
5308 |
+
function defineProperties(target, props) {
|
5309 |
+
for (var i = 0; i < props.length; i++) {
|
5310 |
+
var descriptor = props[i];
|
5311 |
+
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
5312 |
+
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
5313 |
+
}
|
5314 |
+
}
|
5315 |
+
return function(Constructor, protoProps, staticProps) {
|
5316 |
+
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
5317 |
+
Constructor;
|
5318 |
+
};
|
5319 |
+
}(), _extends = Object.assign || function(target) {
|
5320 |
+
for (var i = 1; i < arguments.length; i++) {
|
5321 |
+
var source = arguments[i];
|
5322 |
+
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
5323 |
+
}
|
5324 |
+
return target;
|
5325 |
+
}, _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _reactVirtualized = __webpack_require__(9), _lodash = __webpack_require__(10), _lodash2 = _interopRequireDefault(_lodash), _reactDndScrollzone = __webpack_require__(11), _reactDndScrollzone2 = _interopRequireDefault(_reactDndScrollzone);
|
5326 |
+
__webpack_require__(12);
|
5327 |
+
var _treeNode = __webpack_require__(15), _treeNode2 = _interopRequireDefault(_treeNode), _nodeRendererDefault = __webpack_require__(18), _nodeRendererDefault2 = _interopRequireDefault(_nodeRendererDefault), _treePlaceholder = __webpack_require__(22), _treePlaceholder2 = _interopRequireDefault(_treePlaceholder), _placeholderRendererDefault = __webpack_require__(23), _placeholderRendererDefault2 = _interopRequireDefault(_placeholderRendererDefault), _treeDataUtils = __webpack_require__(0), _memoizedTreeDataUtils = __webpack_require__(6), _genericUtils = __webpack_require__(26), _defaultHandlers = __webpack_require__(5), _dndManager = __webpack_require__(27), _dndManager2 = _interopRequireDefault(_dndManager), _reactSortableTree = __webpack_require__(31), _reactSortableTree2 = _interopRequireDefault(_reactSortableTree), treeIdCounter = 1, mergeTheme = function(props) {
|
5328 |
+
var merged = _extends({}, props, {
|
5329 |
+
style: _extends({}, props.theme.style, props.style),
|
5330 |
+
innerStyle: _extends({}, props.theme.innerStyle, props.innerStyle),
|
5331 |
+
reactVirtualizedListProps: _extends({}, props.theme.reactVirtualizedListProps, props.reactVirtualizedListProps)
|
5332 |
+
}), overridableDefaults = {
|
5333 |
+
nodeContentRenderer: _nodeRendererDefault2.default,
|
5334 |
+
placeholderRenderer: _placeholderRendererDefault2.default,
|
5335 |
+
rowHeight: 62,
|
5336 |
+
scaffoldBlockPxWidth: 44,
|
5337 |
+
slideRegionSize: 100,
|
5338 |
+
treeNodeRenderer: _treeNode2.default
|
5339 |
+
};
|
5340 |
+
return Object.keys(overridableDefaults).forEach(function(propKey) {
|
5341 |
+
// If prop has been specified, do not change it
|
5342 |
+
// If prop is specified in theme, use the theme setting
|
5343 |
+
// If all else fails, fall back to the default
|
5344 |
+
null === props[propKey] && (merged[propKey] = void 0 !== props.theme[propKey] ? props.theme[propKey] : overridableDefaults[propKey]);
|
5345 |
+
}), merged;
|
5346 |
+
}, ReactSortableTree = function(_Component) {
|
5347 |
+
function ReactSortableTree(props) {
|
5348 |
+
_classCallCheck(this, ReactSortableTree);
|
5349 |
+
var _this = _possibleConstructorReturn(this, (ReactSortableTree.__proto__ || Object.getPrototypeOf(ReactSortableTree)).call(this, props)), _mergeTheme = mergeTheme(props), dndType = _mergeTheme.dndType, nodeContentRenderer = _mergeTheme.nodeContentRenderer, treeNodeRenderer = _mergeTheme.treeNodeRenderer, isVirtualized = _mergeTheme.isVirtualized, slideRegionSize = _mergeTheme.slideRegionSize;
|
5350 |
+
// Wrapping classes for use with react-dnd
|
5351 |
+
// Prepare scroll-on-drag options for this list
|
5352 |
+
return _this.dndManager = new _dndManager2.default(_this), _this.treeId = "rst__" + treeIdCounter,
|
5353 |
+
treeIdCounter += 1, _this.dndType = dndType || _this.treeId, _this.nodeContentRenderer = _this.dndManager.wrapSource(nodeContentRenderer),
|
5354 |
+
_this.treePlaceholderRenderer = _this.dndManager.wrapPlaceholder(_treePlaceholder2.default),
|
5355 |
+
_this.treeNodeRenderer = _this.dndManager.wrapTarget(treeNodeRenderer), isVirtualized && (_this.scrollZoneVirtualList = (0,
|
5356 |
+
_reactDndScrollzone2.default)(_reactVirtualized.List), _this.vStrength = (0, _reactDndScrollzone.createVerticalStrength)(slideRegionSize),
|
5357 |
+
_this.hStrength = (0, _reactDndScrollzone.createHorizontalStrength)(slideRegionSize)),
|
5358 |
+
_this.state = {
|
5359 |
+
draggingTreeData: null,
|
5360 |
+
draggedNode: null,
|
5361 |
+
draggedMinimumTreeIndex: null,
|
5362 |
+
draggedDepth: null,
|
5363 |
+
searchMatches: [],
|
5364 |
+
searchFocusTreeIndex: null,
|
5365 |
+
dragging: !1
|
5366 |
+
}, _this.toggleChildrenVisibility = _this.toggleChildrenVisibility.bind(_this),
|
5367 |
+
_this.moveNode = _this.moveNode.bind(_this), _this.startDrag = _this.startDrag.bind(_this),
|
5368 |
+
_this.dragHover = _this.dragHover.bind(_this), _this.endDrag = _this.endDrag.bind(_this),
|
5369 |
+
_this.drop = _this.drop.bind(_this), _this.handleDndMonitorChange = _this.handleDndMonitorChange.bind(_this),
|
5370 |
+
_this;
|
5371 |
+
}
|
5372 |
+
return _inherits(ReactSortableTree, _Component), _createClass(ReactSortableTree, [ {
|
5373 |
+
key: "componentDidMount",
|
5374 |
+
value: function() {
|
5375 |
+
this.loadLazyChildren(), this.search(this.props), // Hook into react-dnd state changes to detect when the drag ends
|
5376 |
+
// TODO: This is very brittle, so it needs to be replaced if react-dnd
|
5377 |
+
// offers a more official way to detect when a drag ends
|
5378 |
+
this.clearMonitorSubscription = this.context.dragDropManager.getMonitor().subscribeToStateChange(this.handleDndMonitorChange);
|
5379 |
+
}
|
5380 |
+
}, {
|
5381 |
+
key: "componentWillReceiveProps",
|
5382 |
+
value: function(nextProps) {
|
5383 |
+
this.props.treeData !== nextProps.treeData ? (// Ignore updates caused by search, in order to avoid infinite looping
|
5384 |
+
this.ignoreOneTreeUpdate ? this.ignoreOneTreeUpdate = !1 : (// Reset the focused index if the tree has changed
|
5385 |
+
this.setState({
|
5386 |
+
searchFocusTreeIndex: null
|
5387 |
+
}), // Load any children defined by a function
|
5388 |
+
this.loadLazyChildren(nextProps), this.search(nextProps, !1, !1)), // Reset the drag state
|
5389 |
+
this.setState({
|
5390 |
+
draggingTreeData: null,
|
5391 |
+
draggedNode: null,
|
5392 |
+
draggedMinimumTreeIndex: null,
|
5393 |
+
draggedDepth: null,
|
5394 |
+
dragging: !1
|
5395 |
+
})) : (0, _lodash2.default)(this.props.searchQuery, nextProps.searchQuery) ? this.props.searchFocusOffset !== nextProps.searchFocusOffset && this.search(nextProps, !0, !0, !0) : this.search(nextProps);
|
5396 |
+
}
|
5397 |
+
}, {
|
5398 |
+
key: "componentDidUpdate",
|
5399 |
+
value: function(prevProps, prevState) {
|
5400 |
+
// if it is not the same then call the onDragStateChanged
|
5401 |
+
this.state.dragging !== prevState.dragging && this.props.onDragStateChanged && this.props.onDragStateChanged({
|
5402 |
+
isDragging: this.state.dragging,
|
5403 |
+
draggedNode: this.state.draggedNode
|
5404 |
+
});
|
5405 |
+
}
|
5406 |
+
}, {
|
5407 |
+
key: "componentWillUnmount",
|
5408 |
+
value: function() {
|
5409 |
+
this.clearMonitorSubscription();
|
5410 |
+
}
|
5411 |
+
}, {
|
5412 |
+
key: "getRows",
|
5413 |
+
value: function(treeData) {
|
5414 |
+
return (0, _memoizedTreeDataUtils.memoizedGetFlatDataFromTree)({
|
5415 |
+
ignoreCollapsed: !0,
|
5416 |
+
getNodeKey: this.props.getNodeKey,
|
5417 |
+
treeData: treeData
|
5418 |
+
});
|
5419 |
+
}
|
5420 |
+
}, {
|
5421 |
+
key: "handleDndMonitorChange",
|
5422 |
+
value: function() {
|
5423 |
+
// If the drag ends and the tree is still in a mid-drag state,
|
5424 |
+
// it means that the drag was canceled or the dragSource dropped
|
5425 |
+
// elsewhere, and we should reset the state of this tree
|
5426 |
+
!this.context.dragDropManager.getMonitor().isDragging() && this.state.draggingTreeData && this.endDrag();
|
5427 |
+
}
|
5428 |
+
}, {
|
5429 |
+
key: "toggleChildrenVisibility",
|
5430 |
+
value: function(_ref) {
|
5431 |
+
var targetNode = _ref.node, path = _ref.path, treeData = (0, _treeDataUtils.changeNodeAtPath)({
|
5432 |
+
treeData: this.props.treeData,
|
5433 |
+
path: path,
|
5434 |
+
newNode: function(_ref2) {
|
5435 |
+
var node = _ref2.node;
|
5436 |
+
return _extends({}, node, {
|
5437 |
+
expanded: !node.expanded
|
5438 |
+
});
|
5439 |
+
},
|
5440 |
+
getNodeKey: this.props.getNodeKey
|
5441 |
+
});
|
5442 |
+
this.props.onChange(treeData), this.props.onVisibilityToggle({
|
5443 |
+
treeData: treeData,
|
5444 |
+
node: targetNode,
|
5445 |
+
expanded: !targetNode.expanded,
|
5446 |
+
path: path
|
5447 |
+
});
|
5448 |
+
}
|
5449 |
+
}, {
|
5450 |
+
key: "moveNode",
|
5451 |
+
value: function(_ref3) {
|
5452 |
+
var node = _ref3.node, prevPath = _ref3.path, prevTreeIndex = _ref3.treeIndex, depth = _ref3.depth, minimumTreeIndex = _ref3.minimumTreeIndex, _insertNode = (0,
|
5453 |
+
_treeDataUtils.insertNode)({
|
5454 |
+
treeData: this.state.draggingTreeData,
|
5455 |
+
newNode: node,
|
5456 |
+
depth: depth,
|
5457 |
+
minimumTreeIndex: minimumTreeIndex,
|
5458 |
+
expandParent: !0,
|
5459 |
+
getNodeKey: this.props.getNodeKey
|
5460 |
+
}), treeData = _insertNode.treeData, treeIndex = _insertNode.treeIndex, path = _insertNode.path, nextParentNode = _insertNode.parentNode;
|
5461 |
+
this.props.onChange(treeData), this.props.onMoveNode({
|
5462 |
+
treeData: treeData,
|
5463 |
+
node: node,
|
5464 |
+
treeIndex: treeIndex,
|
5465 |
+
path: path,
|
5466 |
+
nextPath: path,
|
5467 |
+
nextTreeIndex: treeIndex,
|
5468 |
+
prevPath: prevPath,
|
5469 |
+
prevTreeIndex: prevTreeIndex,
|
5470 |
+
nextParentNode: nextParentNode
|
5471 |
+
});
|
5472 |
+
}
|
5473 |
+
}, {
|
5474 |
+
key: "search",
|
5475 |
+
value: function() {
|
5476 |
+
var props = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : this.props, seekIndex = !(arguments.length > 1 && void 0 !== arguments[1]) || arguments[1], expand = !(arguments.length > 2 && void 0 !== arguments[2]) || arguments[2], singleSearch = arguments.length > 3 && void 0 !== arguments[3] && arguments[3], treeData = props.treeData, onChange = props.onChange, searchFinishCallback = props.searchFinishCallback, searchQuery = props.searchQuery, searchMethod = props.searchMethod, searchFocusOffset = props.searchFocusOffset;
|
5477 |
+
// Skip search if no conditions are specified
|
5478 |
+
if ((null === searchQuery || void 0 === searchQuery || "" === String(searchQuery)) && !searchMethod) return this.setState({
|
5479 |
+
searchMatches: []
|
5480 |
+
}), void (searchFinishCallback && searchFinishCallback([]));
|
5481 |
+
var _find = (0, _treeDataUtils.find)({
|
5482 |
+
getNodeKey: this.props.getNodeKey,
|
5483 |
+
treeData: treeData,
|
5484 |
+
searchQuery: searchQuery,
|
5485 |
+
searchMethod: searchMethod || _defaultHandlers.defaultSearchMethod,
|
5486 |
+
searchFocusOffset: searchFocusOffset,
|
5487 |
+
expandAllMatchPaths: expand && !singleSearch,
|
5488 |
+
expandFocusMatchPaths: !!expand
|
5489 |
+
}), expandedTreeData = _find.treeData, searchMatches = _find.matches;
|
5490 |
+
// Update the tree with data leaving all paths leading to matching nodes open
|
5491 |
+
expand && (this.ignoreOneTreeUpdate = !0, // Prevents infinite loop
|
5492 |
+
onChange(expandedTreeData)), searchFinishCallback && searchFinishCallback(searchMatches);
|
5493 |
+
var searchFocusTreeIndex = null;
|
5494 |
+
seekIndex && null !== searchFocusOffset && searchFocusOffset < searchMatches.length && (searchFocusTreeIndex = searchMatches[searchFocusOffset].treeIndex),
|
5495 |
+
this.setState({
|
5496 |
+
searchMatches: searchMatches,
|
5497 |
+
searchFocusTreeIndex: searchFocusTreeIndex
|
5498 |
+
});
|
5499 |
+
}
|
5500 |
+
}, {
|
5501 |
+
key: "startDrag",
|
5502 |
+
value: function(_ref4) {
|
5503 |
+
var _this2 = this, path = _ref4.path;
|
5504 |
+
this.setState(function() {
|
5505 |
+
var _removeNode = (0, _treeDataUtils.removeNode)({
|
5506 |
+
treeData: _this2.props.treeData,
|
5507 |
+
path: path,
|
5508 |
+
getNodeKey: _this2.props.getNodeKey
|
5509 |
+
}), draggingTreeData = _removeNode.treeData, draggedNode = _removeNode.node, draggedMinimumTreeIndex = _removeNode.treeIndex;
|
5510 |
+
return {
|
5511 |
+
draggingTreeData: draggingTreeData,
|
5512 |
+
draggedNode: draggedNode,
|
5513 |
+
draggedDepth: path.length - 1,
|
5514 |
+
draggedMinimumTreeIndex: draggedMinimumTreeIndex,
|
5515 |
+
dragging: !0
|
5516 |
+
};
|
5517 |
+
});
|
5518 |
+
}
|
5519 |
+
}, {
|
5520 |
+
key: "dragHover",
|
5521 |
+
value: function(_ref5) {
|
5522 |
+
var draggedNode = _ref5.node, draggedDepth = _ref5.depth, draggedMinimumTreeIndex = _ref5.minimumTreeIndex;
|
5523 |
+
// Ignore this hover if it is at the same position as the last hover
|
5524 |
+
if (this.state.draggedDepth !== draggedDepth || this.state.draggedMinimumTreeIndex !== draggedMinimumTreeIndex) {
|
5525 |
+
// Fall back to the tree data if something is being dragged in from
|
5526 |
+
// an external element
|
5527 |
+
var draggingTreeData = this.state.draggingTreeData || this.props.treeData, addedResult = (0,
|
5528 |
+
_memoizedTreeDataUtils.memoizedInsertNode)({
|
5529 |
+
treeData: draggingTreeData,
|
5530 |
+
newNode: draggedNode,
|
5531 |
+
depth: draggedDepth,
|
5532 |
+
minimumTreeIndex: draggedMinimumTreeIndex,
|
5533 |
+
expandParent: !0,
|
5534 |
+
getNodeKey: this.props.getNodeKey
|
5535 |
+
}), rows = this.getRows(addedResult.treeData), expandedParentPath = rows[addedResult.treeIndex].path;
|
5536 |
+
this.setState({
|
5537 |
+
draggedNode: draggedNode,
|
5538 |
+
draggedDepth: draggedDepth,
|
5539 |
+
draggedMinimumTreeIndex: draggedMinimumTreeIndex,
|
5540 |
+
draggingTreeData: (0, _treeDataUtils.changeNodeAtPath)({
|
5541 |
+
treeData: draggingTreeData,
|
5542 |
+
path: expandedParentPath.slice(0, -1),
|
5543 |
+
newNode: function(_ref6) {
|
5544 |
+
var node = _ref6.node;
|
5545 |
+
return _extends({}, node, {
|
5546 |
+
expanded: !0
|
5547 |
+
});
|
5548 |
+
},
|
5549 |
+
getNodeKey: this.props.getNodeKey
|
5550 |
+
}),
|
5551 |
+
// reset the scroll focus so it doesn't jump back
|
5552 |
+
// to a search result while dragging
|
5553 |
+
searchFocusTreeIndex: null,
|
5554 |
+
dragging: !0
|
5555 |
+
});
|
5556 |
+
}
|
5557 |
+
}
|
5558 |
+
}, {
|
5559 |
+
key: "endDrag",
|
5560 |
+
value: function(dropResult) {
|
5561 |
+
var _this3 = this;
|
5562 |
+
// Drop was cancelled
|
5563 |
+
if (dropResult) {
|
5564 |
+
if (dropResult.treeId !== this.treeId) {
|
5565 |
+
// The node was dropped in an external drop target or tree
|
5566 |
+
var node = dropResult.node, path = dropResult.path, treeIndex = dropResult.treeIndex, shouldCopy = this.props.shouldCopyOnOutsideDrop;
|
5567 |
+
"function" == typeof shouldCopy && (shouldCopy = shouldCopy({
|
5568 |
+
node: node,
|
5569 |
+
prevTreeIndex: treeIndex,
|
5570 |
+
prevPath: path
|
5571 |
+
}));
|
5572 |
+
var treeData = this.state.draggingTreeData || this.props.treeData;
|
5573 |
+
// If copying is enabled, a drop outside leaves behind a copy in the
|
5574 |
+
// source tree
|
5575 |
+
shouldCopy && (treeData = (0, _treeDataUtils.changeNodeAtPath)({
|
5576 |
+
treeData: this.props.treeData,
|
5577 |
+
// use treeData unaltered by the drag operation
|
5578 |
+
path: path,
|
5579 |
+
newNode: function(_ref7) {
|
5580 |
+
var copyNode = _ref7.node;
|
5581 |
+
return _extends({}, copyNode);
|
5582 |
+
},
|
5583 |
+
// create a shallow copy of the node
|
5584 |
+
getNodeKey: this.props.getNodeKey
|
5585 |
+
})), this.props.onChange(treeData), this.props.onMoveNode({
|
5586 |
+
treeData: treeData,
|
5587 |
+
node: node,
|
5588 |
+
treeIndex: null,
|
5589 |
+
path: null,
|
5590 |
+
nextPath: null,
|
5591 |
+
nextTreeIndex: null,
|
5592 |
+
prevPath: path,
|
5593 |
+
prevTreeIndex: treeIndex
|
5594 |
+
});
|
5595 |
+
}
|
5596 |
+
} else !function() {
|
5597 |
+
_this3.setState({
|
5598 |
+
draggingTreeData: null,
|
5599 |
+
draggedNode: null,
|
5600 |
+
draggedMinimumTreeIndex: null,
|
5601 |
+
draggedDepth: null,
|
5602 |
+
dragging: !1
|
5603 |
+
});
|
5604 |
+
}();
|
5605 |
+
}
|
5606 |
+
}, {
|
5607 |
+
key: "drop",
|
5608 |
+
value: function(dropResult) {
|
5609 |
+
this.moveNode(dropResult);
|
5610 |
+
}
|
5611 |
+
}, {
|
5612 |
+
key: "loadLazyChildren",
|
5613 |
+
value: function() {
|
5614 |
+
var _this4 = this, props = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : this.props;
|
5615 |
+
(0, _treeDataUtils.walk)({
|
5616 |
+
treeData: props.treeData,
|
5617 |
+
getNodeKey: this.props.getNodeKey,
|
5618 |
+
callback: function(_ref8) {
|
5619 |
+
var node = _ref8.node, path = _ref8.path, lowerSiblingCounts = _ref8.lowerSiblingCounts, treeIndex = _ref8.treeIndex;
|
5620 |
+
// If the node has children defined by a function, and is either expanded
|
5621 |
+
// or set to load even before expansion, run the function.
|
5622 |
+
node.children && "function" == typeof node.children && (node.expanded || props.loadCollapsedLazyChildren) && // Call the children fetching function
|
5623 |
+
node.children({
|
5624 |
+
node: node,
|
5625 |
+
path: path,
|
5626 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
5627 |
+
treeIndex: treeIndex,
|
5628 |
+
// Provide a helper to append the new data when it is received
|
5629 |
+
done: function(childrenArray) {
|
5630 |
+
return _this4.props.onChange((0, _treeDataUtils.changeNodeAtPath)({
|
5631 |
+
treeData: _this4.props.treeData,
|
5632 |
+
path: path,
|
5633 |
+
newNode: function(_ref9) {
|
5634 |
+
var oldNode = _ref9.node;
|
5635 |
+
// Only replace the old node if it's the one we set off to find children
|
5636 |
+
// for in the first place
|
5637 |
+
return oldNode === node ? _extends({}, oldNode, {
|
5638 |
+
children: childrenArray
|
5639 |
+
}) : oldNode;
|
5640 |
+
},
|
5641 |
+
getNodeKey: _this4.props.getNodeKey
|
5642 |
+
}));
|
5643 |
+
}
|
5644 |
+
});
|
5645 |
+
}
|
5646 |
+
});
|
5647 |
+
}
|
5648 |
+
}, {
|
5649 |
+
key: "renderRow",
|
5650 |
+
value: function(_ref10, _ref11) {
|
5651 |
+
var node = _ref10.node, parentNode = _ref10.parentNode, path = _ref10.path, lowerSiblingCounts = _ref10.lowerSiblingCounts, treeIndex = _ref10.treeIndex, listIndex = _ref11.listIndex, style = _ref11.style, getPrevRow = _ref11.getPrevRow, matchKeys = _ref11.matchKeys, swapFrom = _ref11.swapFrom, swapDepth = _ref11.swapDepth, swapLength = _ref11.swapLength, _mergeTheme2 = mergeTheme(this.props), canDrag = _mergeTheme2.canDrag, generateNodeProps = _mergeTheme2.generateNodeProps, scaffoldBlockPxWidth = _mergeTheme2.scaffoldBlockPxWidth, searchFocusOffset = _mergeTheme2.searchFocusOffset, TreeNodeRenderer = this.treeNodeRenderer, NodeContentRenderer = this.nodeContentRenderer, nodeKey = path[path.length - 1], isSearchMatch = nodeKey in matchKeys, isSearchFocus = isSearchMatch && matchKeys[nodeKey] === searchFocusOffset, callbackParams = {
|
5652 |
+
node: node,
|
5653 |
+
parentNode: parentNode,
|
5654 |
+
path: path,
|
5655 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
5656 |
+
treeIndex: treeIndex,
|
5657 |
+
isSearchMatch: isSearchMatch,
|
5658 |
+
isSearchFocus: isSearchFocus
|
5659 |
+
}, nodeProps = generateNodeProps ? generateNodeProps(callbackParams) : {}, rowCanDrag = "function" != typeof canDrag ? canDrag : canDrag(callbackParams), sharedProps = {
|
5660 |
+
treeIndex: treeIndex,
|
5661 |
+
scaffoldBlockPxWidth: scaffoldBlockPxWidth,
|
5662 |
+
node: node,
|
5663 |
+
path: path,
|
5664 |
+
treeId: this.treeId
|
5665 |
+
};
|
5666 |
+
return _react2.default.createElement(TreeNodeRenderer, _extends({
|
5667 |
+
style: style,
|
5668 |
+
key: nodeKey,
|
5669 |
+
listIndex: listIndex,
|
5670 |
+
getPrevRow: getPrevRow,
|
5671 |
+
lowerSiblingCounts: lowerSiblingCounts,
|
5672 |
+
swapFrom: swapFrom,
|
5673 |
+
swapLength: swapLength,
|
5674 |
+
swapDepth: swapDepth
|
5675 |
+
}, sharedProps), _react2.default.createElement(NodeContentRenderer, _extends({
|
5676 |
+
parentNode: parentNode,
|
5677 |
+
isSearchMatch: isSearchMatch,
|
5678 |
+
isSearchFocus: isSearchFocus,
|
5679 |
+
canDrag: rowCanDrag,
|
5680 |
+
toggleChildrenVisibility: this.toggleChildrenVisibility
|
5681 |
+
}, sharedProps, nodeProps)));
|
5682 |
+
}
|
5683 |
+
}, {
|
5684 |
+
key: "render",
|
5685 |
+
value: function() {
|
5686 |
+
var _this5 = this, _mergeTheme3 = mergeTheme(this.props), style = _mergeTheme3.style, className = _mergeTheme3.className, innerStyle = _mergeTheme3.innerStyle, rowHeight = _mergeTheme3.rowHeight, isVirtualized = _mergeTheme3.isVirtualized, placeholderRenderer = _mergeTheme3.placeholderRenderer, reactVirtualizedListProps = _mergeTheme3.reactVirtualizedListProps, getNodeKey = _mergeTheme3.getNodeKey, _state = this.state, searchMatches = _state.searchMatches, searchFocusTreeIndex = _state.searchFocusTreeIndex, draggedNode = _state.draggedNode, draggedDepth = _state.draggedDepth, draggedMinimumTreeIndex = _state.draggedMinimumTreeIndex, treeData = this.state.draggingTreeData || this.props.treeData, rows = void 0, swapFrom = null, swapLength = null;
|
5687 |
+
if (draggedNode && null !== draggedMinimumTreeIndex) {
|
5688 |
+
var addedResult = (0, _memoizedTreeDataUtils.memoizedInsertNode)({
|
5689 |
+
treeData: treeData,
|
5690 |
+
newNode: draggedNode,
|
5691 |
+
depth: draggedDepth,
|
5692 |
+
minimumTreeIndex: draggedMinimumTreeIndex,
|
5693 |
+
expandParent: !0,
|
5694 |
+
getNodeKey: getNodeKey
|
5695 |
+
}), swapTo = draggedMinimumTreeIndex;
|
5696 |
+
swapFrom = addedResult.treeIndex, swapLength = 1 + (0, _memoizedTreeDataUtils.memoizedGetDescendantCount)({
|
5697 |
+
node: draggedNode
|
5698 |
+
}), rows = (0, _genericUtils.slideRows)(this.getRows(addedResult.treeData), swapFrom, swapTo, swapLength);
|
5699 |
+
} else rows = this.getRows(treeData);
|
5700 |
+
// Get indices for rows that match the search conditions
|
5701 |
+
var matchKeys = {};
|
5702 |
+
searchMatches.forEach(function(_ref12, i) {
|
5703 |
+
var path = _ref12.path;
|
5704 |
+
matchKeys[path[path.length - 1]] = i;
|
5705 |
+
});
|
5706 |
+
// Seek to the focused search result if there is one specified
|
5707 |
+
var scrollToInfo = null !== searchFocusTreeIndex ? {
|
5708 |
+
scrollToIndex: searchFocusTreeIndex
|
5709 |
+
} : {}, containerStyle = style, list = void 0;
|
5710 |
+
if (rows.length < 1) {
|
5711 |
+
var Placeholder = this.treePlaceholderRenderer, PlaceholderContent = placeholderRenderer;
|
5712 |
+
list = _react2.default.createElement(Placeholder, {
|
5713 |
+
treeId: this.treeId,
|
5714 |
+
drop: this.drop
|
5715 |
+
}, _react2.default.createElement(PlaceholderContent, null));
|
5716 |
+
} else if (isVirtualized) {
|
5717 |
+
containerStyle = _extends({
|
5718 |
+
height: "100%"
|
5719 |
+
}, containerStyle);
|
5720 |
+
var ScrollZoneVirtualList = this.scrollZoneVirtualList;
|
5721 |
+
// Render list with react-virtualized
|
5722 |
+
list = _react2.default.createElement(_reactVirtualized.AutoSizer, null, function(_ref13) {
|
5723 |
+
var height = _ref13.height, width = _ref13.width;
|
5724 |
+
return _react2.default.createElement(ScrollZoneVirtualList, _extends({}, scrollToInfo, {
|
5725 |
+
verticalStrength: _this5.vStrength,
|
5726 |
+
horizontalStrength: _this5.hStrength,
|
5727 |
+
speed: 30,
|
5728 |
+
scrollToAlignment: "start",
|
5729 |
+
className: _reactSortableTree2.default.virtualScrollOverride,
|
5730 |
+
width: width,
|
5731 |
+
onScroll: function(_ref14) {
|
5732 |
+
var scrollTop = _ref14.scrollTop;
|
5733 |
+
_this5.scrollTop = scrollTop;
|
5734 |
+
},
|
5735 |
+
height: height,
|
5736 |
+
style: innerStyle,
|
5737 |
+
rowCount: rows.length,
|
5738 |
+
estimatedRowSize: "function" != typeof rowHeight ? rowHeight : void 0,
|
5739 |
+
rowHeight: "function" != typeof rowHeight ? rowHeight : function(_ref15) {
|
5740 |
+
var index = _ref15.index;
|
5741 |
+
return rowHeight({
|
5742 |
+
index: index,
|
5743 |
+
treeIndex: index,
|
5744 |
+
node: rows[index].node,
|
5745 |
+
path: rows[index].path
|
5746 |
+
});
|
5747 |
+
},
|
5748 |
+
rowRenderer: function(_ref16) {
|
5749 |
+
var index = _ref16.index, rowStyle = _ref16.style;
|
5750 |
+
return _this5.renderRow(rows[index], {
|
5751 |
+
listIndex: index,
|
5752 |
+
style: rowStyle,
|
5753 |
+
getPrevRow: function() {
|
5754 |
+
return rows[index - 1] || null;
|
5755 |
+
},
|
5756 |
+
matchKeys: matchKeys,
|
5757 |
+
swapFrom: swapFrom,
|
5758 |
+
swapDepth: draggedDepth,
|
5759 |
+
swapLength: swapLength
|
5760 |
+
});
|
5761 |
+
}
|
5762 |
+
}, reactVirtualizedListProps));
|
5763 |
+
});
|
5764 |
+
} else // Render list without react-virtualized
|
5765 |
+
list = rows.map(function(row, index) {
|
5766 |
+
return _this5.renderRow(row, {
|
5767 |
+
listIndex: index,
|
5768 |
+
style: {
|
5769 |
+
height: "function" != typeof rowHeight ? rowHeight : rowHeight({
|
5770 |
+
index: index,
|
5771 |
+
treeIndex: index,
|
5772 |
+
node: row.node,
|
5773 |
+
path: row.path
|
5774 |
+
})
|
5775 |
+
},
|
5776 |
+
getPrevRow: function() {
|
5777 |
+
return rows[index - 1] || null;
|
5778 |
+
},
|
5779 |
+
matchKeys: matchKeys,
|
5780 |
+
swapFrom: swapFrom,
|
5781 |
+
swapDepth: draggedDepth,
|
5782 |
+
swapLength: swapLength
|
5783 |
+
});
|
5784 |
+
});
|
5785 |
+
return _react2.default.createElement("div", {
|
5786 |
+
className: _reactSortableTree2.default.tree + (className ? " " + className : ""),
|
5787 |
+
style: containerStyle
|
5788 |
+
}, list);
|
5789 |
+
}
|
5790 |
+
} ]), ReactSortableTree;
|
5791 |
+
}(_react.Component);
|
5792 |
+
ReactSortableTree.propTypes = {
|
5793 |
+
// Tree data in the following format:
|
5794 |
+
// [{title: 'main', subtitle: 'sub'}, { title: 'value2', expanded: true, children: [{ title: 'value3') }] }]
|
5795 |
+
// `title` is the primary label for the node
|
5796 |
+
// `subtitle` is a secondary label for the node
|
5797 |
+
// `expanded` shows children of the node if true, or hides them if false. Defaults to false.
|
5798 |
+
// `children` is an array of child nodes belonging to the node.
|
5799 |
+
treeData: _propTypes2.default.arrayOf(_propTypes2.default.object).isRequired,
|
5800 |
+
// Style applied to the container wrapping the tree (style defaults to {height: '100%'})
|
5801 |
+
style: _propTypes2.default.shape({}),
|
5802 |
+
// Class name for the container wrapping the tree
|
5803 |
+
className: _propTypes2.default.string,
|
5804 |
+
// Style applied to the inner, scrollable container (for padding, etc.)
|
5805 |
+
innerStyle: _propTypes2.default.shape({}),
|
5806 |
+
// Used by react-virtualized
|
5807 |
+
// Either a fixed row height (number) or a function that returns the
|
5808 |
+
// height of a row given its index: `({ index: number }): number`
|
5809 |
+
rowHeight: _propTypes2.default.oneOfType([ _propTypes2.default.number, _propTypes2.default.func ]),
|
5810 |
+
// Size in px of the region near the edges that initiates scrolling on dragover
|
5811 |
+
slideRegionSize: _propTypes2.default.number,
|
5812 |
+
// Custom properties to hand to the react-virtualized list
|
5813 |
+
// https://github.com/bvaughn/react-virtualized/blob/master/docs/List.md#prop-types
|
5814 |
+
reactVirtualizedListProps: _propTypes2.default.shape({}),
|
5815 |
+
// The width of the blocks containing the lines representing the structure of the tree.
|
5816 |
+
scaffoldBlockPxWidth: _propTypes2.default.number,
|
5817 |
+
// Maximum depth nodes can be inserted at. Defaults to infinite.
|
5818 |
+
maxDepth: _propTypes2.default.number,
|
5819 |
+
// The method used to search nodes.
|
5820 |
+
// Defaults to a function that uses the `searchQuery` string to search for nodes with
|
5821 |
+
// matching `title` or `subtitle` values.
|
5822 |
+
// NOTE: Changing `searchMethod` will not update the search, but changing the `searchQuery` will.
|
5823 |
+
searchMethod: _propTypes2.default.func,
|
5824 |
+
// Used by the `searchMethod` to highlight and scroll to matched nodes.
|
5825 |
+
// Should be a string for the default `searchMethod`, but can be anything when using a custom search.
|
5826 |
+
searchQuery: _propTypes2.default.any,
|
5827 |
+
// eslint-disable-line react/forbid-prop-types
|
5828 |
+
// Outline the <`searchFocusOffset`>th node and scroll to it.
|
5829 |
+
searchFocusOffset: _propTypes2.default.number,
|
5830 |
+
// Get the nodes that match the search criteria. Used for counting total matches, etc.
|
5831 |
+
searchFinishCallback: _propTypes2.default.func,
|
5832 |
+
// Generate an object with additional props to be passed to the node renderer.
|
5833 |
+
// Use this for adding buttons via the `buttons` key,
|
5834 |
+
// or additional `style` / `className` settings.
|
5835 |
+
generateNodeProps: _propTypes2.default.func,
|
5836 |
+
// Set to false to disable virtualization.
|
5837 |
+
// NOTE: Auto-scrolling while dragging, and scrolling to the `searchFocusOffset` will be disabled.
|
5838 |
+
isVirtualized: _propTypes2.default.bool,
|
5839 |
+
treeNodeRenderer: _propTypes2.default.func,
|
5840 |
+
// Override the default component for rendering nodes (but keep the scaffolding generator)
|
5841 |
+
// This is an advanced option for complete customization of the appearance.
|
5842 |
+
// It is best to copy the component in `node-renderer-default.js` to use as a base, and customize as needed.
|
5843 |
+
nodeContentRenderer: _propTypes2.default.func,
|
5844 |
+
// Override the default component for rendering an empty tree
|
5845 |
+
// This is an advanced option for complete customization of the appearance.
|
5846 |
+
// It is best to copy the component in `placeholder-renderer-default.js` to use as a base,
|
5847 |
+
// and customize as needed.
|
5848 |
+
placeholderRenderer: _propTypes2.default.func,
|
5849 |
+
theme: _propTypes2.default.shape({
|
5850 |
+
style: _propTypes2.default.shape({}),
|
5851 |
+
innerStyle: _propTypes2.default.shape({}),
|
5852 |
+
reactVirtualizedListProps: _propTypes2.default.shape({}),
|
5853 |
+
scaffoldBlockPxWidth: _propTypes2.default.number,
|
5854 |
+
slideRegionSize: _propTypes2.default.number,
|
5855 |
+
rowHeight: _propTypes2.default.oneOfType([ _propTypes2.default.number, _propTypes2.default.func ]),
|
5856 |
+
treeNodeRenderer: _propTypes2.default.func,
|
5857 |
+
nodeContentRenderer: _propTypes2.default.func,
|
5858 |
+
placeholderRenderer: _propTypes2.default.func
|
5859 |
+
}),
|
5860 |
+
// Determine the unique key used to identify each node and
|
5861 |
+
// generate the `path` array passed in callbacks.
|
5862 |
+
// By default, returns the index in the tree (omitting hidden nodes).
|
5863 |
+
getNodeKey: _propTypes2.default.func,
|
5864 |
+
// Called whenever tree data changed.
|
5865 |
+
// Just like with React input elements, you have to update your
|
5866 |
+
// own component's data to see the changes reflected.
|
5867 |
+
onChange: _propTypes2.default.func.isRequired,
|
5868 |
+
// Called after node move operation.
|
5869 |
+
onMoveNode: _propTypes2.default.func,
|
5870 |
+
// Determine whether a node can be dragged. Set to false to disable dragging on all nodes.
|
5871 |
+
canDrag: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.bool ]),
|
5872 |
+
// Determine whether a node can be dropped based on its path and parents'.
|
5873 |
+
canDrop: _propTypes2.default.func,
|
5874 |
+
// When true, or a callback returning true, dropping nodes to react-dnd
|
5875 |
+
// drop targets outside of this tree will not remove them from this tree
|
5876 |
+
shouldCopyOnOutsideDrop: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.bool ]),
|
5877 |
+
// Called after children nodes collapsed or expanded.
|
5878 |
+
onVisibilityToggle: _propTypes2.default.func,
|
5879 |
+
dndType: _propTypes2.default.string,
|
5880 |
+
// Called to track between dropped and dragging
|
5881 |
+
onDragStateChanged: _propTypes2.default.func
|
5882 |
+
}, ReactSortableTree.defaultProps = {
|
5883 |
+
canDrag: !0,
|
5884 |
+
canDrop: null,
|
5885 |
+
className: "",
|
5886 |
+
dndType: null,
|
5887 |
+
generateNodeProps: null,
|
5888 |
+
getNodeKey: _defaultHandlers.defaultGetNodeKey,
|
5889 |
+
innerStyle: {},
|
5890 |
+
isVirtualized: !0,
|
5891 |
+
maxDepth: null,
|
5892 |
+
treeNodeRenderer: null,
|
5893 |
+
nodeContentRenderer: null,
|
5894 |
+
onMoveNode: function() {},
|
5895 |
+
onVisibilityToggle: function() {},
|
5896 |
+
placeholderRenderer: null,
|
5897 |
+
reactVirtualizedListProps: {},
|
5898 |
+
rowHeight: null,
|
5899 |
+
scaffoldBlockPxWidth: null,
|
5900 |
+
searchFinishCallback: null,
|
5901 |
+
searchFocusOffset: null,
|
5902 |
+
searchMethod: null,
|
5903 |
+
searchQuery: null,
|
5904 |
+
shouldCopyOnOutsideDrop: !1,
|
5905 |
+
slideRegionSize: null,
|
5906 |
+
style: {},
|
5907 |
+
theme: {},
|
5908 |
+
onDragStateChanged: function() {}
|
5909 |
+
}, ReactSortableTree.contextTypes = {
|
5910 |
+
dragDropManager: _propTypes2.default.shape({})
|
5911 |
+
}, // Export the tree component without the react-dnd DragDropContext,
|
5912 |
+
// for when component is used with other components using react-dnd.
|
5913 |
+
// see: https://github.com/gaearon/react-dnd/issues/186
|
5914 |
+
exports.SortableTreeWithoutDndContext = ReactSortableTree, exports.default = _dndManager2.default.wrapRoot(ReactSortableTree);
|
5915 |
+
}, /* 9 */
|
5916 |
+
/***/
|
5917 |
+
function(module, exports) {
|
5918 |
+
module.exports = __webpack_require__(251);
|
5919 |
+
}, /* 10 */
|
5920 |
+
/***/
|
5921 |
+
function(module, exports) {
|
5922 |
+
module.exports = __webpack_require__(298);
|
5923 |
+
}, /* 11 */
|
5924 |
+
/***/
|
5925 |
+
function(module, exports) {
|
5926 |
+
module.exports = __webpack_require__(299);
|
5927 |
+
}, /* 12 */
|
5928 |
+
/***/
|
5929 |
+
function(module, exports, __webpack_require__) {
|
5930 |
+
// style-loader: Adds some css to the DOM by adding a <style> tag
|
5931 |
+
// load the styles
|
5932 |
+
var content = __webpack_require__(13);
|
5933 |
+
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
5934 |
+
// Prepare cssTransformation
|
5935 |
+
var options = {
|
5936 |
+
insertAt: "top",
|
5937 |
+
hmr: !0
|
5938 |
+
};
|
5939 |
+
options.transform = void 0;
|
5940 |
+
// add the styles to the DOM
|
5941 |
+
__webpack_require__(4)(content, options);
|
5942 |
+
content.locals && (module.exports = content.locals);
|
5943 |
+
}, /* 13 */
|
5944 |
+
/***/
|
5945 |
+
function(module, exports, __webpack_require__) {
|
5946 |
+
exports = module.exports = __webpack_require__(3)(!1), // imports
|
5947 |
+
// module
|
5948 |
+
exports.push([ module.i, "/* Collection default theme */\n\n._2Ys25aFCIH7ZWp76lcHbjs {\n}\n\n._1wpSOFYFr7x9PMM0KcYTxm {\n}\n\n/* Grid default theme */\n\n._2SUC15-WVgF4XhvHuU81GS {\n}\n\n._3q1PBGJ8fGciELoHlm7I3C {\n}\n\n/* Table default theme */\n\n._1yPBpbwEbdtD7UxLvhZhM {\n}\n\n._1itUjAnMCYR-25x1rmTdtF {\n}\n\n._33g8s-zht4xwLlXSWWWwa3 {\n font-weight: 700;\n text-transform: uppercase;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-orient: horizontal;\n -webkit-box-direction: normal;\n -ms-flex-direction: row;\n flex-direction: row;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n._3ZiV_g6aRjm62hwIWbJU38 {\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-orient: horizontal;\n -webkit-box-direction: normal;\n -ms-flex-direction: row;\n flex-direction: row;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n\n._3eKreK7WxwxtZyKjYLiygd {\n display: inline-block;\n max-width: 100%;\n white-space: nowrap;\n text-overflow: ellipsis;\n overflow: hidden;\n}\n\n._19Z4wAfIa_DTwtOUYjz8t,\n._2TseG-JCD0K5o_VT5VIN_w {\n margin-right: 10px;\n min-width: 0px;\n}\n._2TseG-JCD0K5o_VT5VIN_w {\n text-overflow: ellipsis;\n white-space: nowrap;\n}\n\n._19Z4wAfIa_DTwtOUYjz8t:first-of-type,\n._2TseG-JCD0K5o_VT5VIN_w:first-of-type {\n margin-left: 10px;\n}\n._1RR8EsDxozD7xvl8boaBiB {\n cursor: pointer;\n}\n\n._1u1DZQe3YaUugu3cLrtqng {\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n}\n._15mdGqvC02VcdkTaoIuS06 {\n -webkit-box-flex: 0;\n -ms-flex: 0 0 24px;\n flex: 0 0 24px;\n height: 1em;\n width: 1em;\n fill: currentColor;\n}\n\n/* List default theme */\n\n._3HeSXQaspPzpYJlLHQlyit {\n}", "" ]),
|
5949 |
+
// exports
|
5950 |
+
exports.locals = {
|
5951 |
+
ReactVirtualized__Collection: "_2Ys25aFCIH7ZWp76lcHbjs",
|
5952 |
+
ReactVirtualized__Collection__innerScrollContainer: "_1wpSOFYFr7x9PMM0KcYTxm",
|
5953 |
+
ReactVirtualized__Grid: "_2SUC15-WVgF4XhvHuU81GS",
|
5954 |
+
ReactVirtualized__Grid__innerScrollContainer: "_3q1PBGJ8fGciELoHlm7I3C",
|
5955 |
+
ReactVirtualized__Table: "_1yPBpbwEbdtD7UxLvhZhM",
|
5956 |
+
ReactVirtualized__Table__Grid: "_1itUjAnMCYR-25x1rmTdtF",
|
5957 |
+
ReactVirtualized__Table__headerRow: "_33g8s-zht4xwLlXSWWWwa3",
|
5958 |
+
ReactVirtualized__Table__row: "_3ZiV_g6aRjm62hwIWbJU38",
|
5959 |
+
ReactVirtualized__Table__headerTruncatedText: "_3eKreK7WxwxtZyKjYLiygd",
|
5960 |
+
ReactVirtualized__Table__headerColumn: "_19Z4wAfIa_DTwtOUYjz8t",
|
5961 |
+
ReactVirtualized__Table__rowColumn: "_2TseG-JCD0K5o_VT5VIN_w",
|
5962 |
+
ReactVirtualized__Table__sortableHeaderColumn: "_1RR8EsDxozD7xvl8boaBiB",
|
5963 |
+
ReactVirtualized__Table__sortableHeaderIconContainer: "_1u1DZQe3YaUugu3cLrtqng",
|
5964 |
+
ReactVirtualized__Table__sortableHeaderIcon: "_15mdGqvC02VcdkTaoIuS06",
|
5965 |
+
ReactVirtualized__List: "_3HeSXQaspPzpYJlLHQlyit"
|
5966 |
+
};
|
5967 |
+
}, /* 14 */
|
5968 |
+
/***/
|
5969 |
+
function(module, exports) {
|
5970 |
+
/**
|
5971 |
+
* When source maps are enabled, `style-loader` uses a link element with a data-uri to
|
5972 |
+
* embed the css on the page. This breaks all relative urls because now they are relative to a
|
5973 |
+
* bundle instead of the current page.
|
5974 |
+
*
|
5975 |
+
* One solution is to only use full urls, but that may be impossible.
|
5976 |
+
*
|
5977 |
+
* Instead, this function "fixes" the relative urls to be absolute according to the current page location.
|
5978 |
+
*
|
5979 |
+
* A rudimentary test suite is located at `test/fixUrls.js` and can be run via the `npm test` command.
|
5980 |
+
*
|
5981 |
+
*/
|
5982 |
+
module.exports = function(css) {
|
5983 |
+
// get current location
|
5984 |
+
var location = "undefined" != typeof window && window.location;
|
5985 |
+
if (!location) throw new Error("fixUrls requires window.location");
|
5986 |
+
// blank or null?
|
5987 |
+
if (!css || "string" != typeof css) return css;
|
5988 |
+
var baseUrl = location.protocol + "//" + location.host, currentDir = baseUrl + location.pathname.replace(/\/[^\/]*$/, "/");
|
5989 |
+
// send back the fixed css
|
5990 |
+
return css.replace(/url\s*\(((?:[^)(]|\((?:[^)(]+|\([^)(]*\))*\))*)\)/gi, function(fullMatch, origUrl) {
|
5991 |
+
// strip quotes (if they exist)
|
5992 |
+
var unquotedOrigUrl = origUrl.trim().replace(/^"(.*)"$/, function(o, $1) {
|
5993 |
+
return $1;
|
5994 |
+
}).replace(/^'(.*)'$/, function(o, $1) {
|
5995 |
+
return $1;
|
5996 |
+
});
|
5997 |
+
// already a full url? no change
|
5998 |
+
if (/^(#|data:|http:\/\/|https:\/\/|file:\/\/\/)/i.test(unquotedOrigUrl)) return fullMatch;
|
5999 |
+
// convert the url to a full url
|
6000 |
+
var newUrl;
|
6001 |
+
// send back the fixed url(...)
|
6002 |
+
//TODO: should we add protocol?
|
6003 |
+
return newUrl = 0 === unquotedOrigUrl.indexOf("//") ? unquotedOrigUrl : 0 === unquotedOrigUrl.indexOf("/") ? baseUrl + unquotedOrigUrl : currentDir + unquotedOrigUrl.replace(/^\.\//, ""),
|
6004 |
+
"url(" + JSON.stringify(newUrl) + ")";
|
6005 |
+
});
|
6006 |
+
};
|
6007 |
+
}, /* 15 */
|
6008 |
+
/***/
|
6009 |
+
function(module, exports, __webpack_require__) {
|
6010 |
+
"use strict";
|
6011 |
+
function _interopRequireDefault(obj) {
|
6012 |
+
return obj && obj.__esModule ? obj : {
|
6013 |
+
default: obj
|
6014 |
+
};
|
6015 |
+
}
|
6016 |
+
function _objectWithoutProperties(obj, keys) {
|
6017 |
+
var target = {};
|
6018 |
+
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
6019 |
+
return target;
|
6020 |
+
}
|
6021 |
+
function _classCallCheck(instance, Constructor) {
|
6022 |
+
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
6023 |
+
}
|
6024 |
+
function _possibleConstructorReturn(self, call) {
|
6025 |
+
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
6026 |
+
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
6027 |
+
}
|
6028 |
+
function _inherits(subClass, superClass) {
|
6029 |
+
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
6030 |
+
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
6031 |
+
constructor: {
|
6032 |
+
value: subClass,
|
6033 |
+
enumerable: !1,
|
6034 |
+
writable: !0,
|
6035 |
+
configurable: !0
|
6036 |
+
}
|
6037 |
+
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
6038 |
+
}
|
6039 |
+
Object.defineProperty(exports, "__esModule", {
|
6040 |
+
value: !0
|
6041 |
+
});
|
6042 |
+
var _extends = Object.assign || function(target) {
|
6043 |
+
for (var i = 1; i < arguments.length; i++) {
|
6044 |
+
var source = arguments[i];
|
6045 |
+
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
6046 |
+
}
|
6047 |
+
return target;
|
6048 |
+
}, _createClass = function() {
|
6049 |
+
function defineProperties(target, props) {
|
6050 |
+
for (var i = 0; i < props.length; i++) {
|
6051 |
+
var descriptor = props[i];
|
6052 |
+
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
6053 |
+
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
6054 |
+
}
|
6055 |
+
}
|
6056 |
+
return function(Constructor, protoProps, staticProps) {
|
6057 |
+
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
6058 |
+
Constructor;
|
6059 |
+
};
|
6060 |
+
}(), _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _treeNode = __webpack_require__(16), _treeNode2 = _interopRequireDefault(_treeNode), TreeNode = function(_Component) {
|
6061 |
+
function TreeNode() {
|
6062 |
+
return _classCallCheck(this, TreeNode), _possibleConstructorReturn(this, (TreeNode.__proto__ || Object.getPrototypeOf(TreeNode)).apply(this, arguments));
|
6063 |
+
}
|
6064 |
+
return _inherits(TreeNode, _Component), _createClass(TreeNode, [ {
|
6065 |
+
key: "render",
|
6066 |
+
value: function() {
|
6067 |
+
var _props = this.props, children = _props.children, listIndex = _props.listIndex, swapFrom = _props.swapFrom, swapLength = _props.swapLength, swapDepth = _props.swapDepth, scaffoldBlockPxWidth = _props.scaffoldBlockPxWidth, lowerSiblingCounts = _props.lowerSiblingCounts, connectDropTarget = _props.connectDropTarget, isOver = _props.isOver, draggedNode = _props.draggedNode, canDrop = _props.canDrop, treeIndex = _props.treeIndex, otherProps = (_props.treeId,
|
6068 |
+
_props.getPrevRow, _props.node, _props.path, _objectWithoutProperties(_props, [ "children", "listIndex", "swapFrom", "swapLength", "swapDepth", "scaffoldBlockPxWidth", "lowerSiblingCounts", "connectDropTarget", "isOver", "draggedNode", "canDrop", "treeIndex", "treeId", "getPrevRow", "node", "path" ])), scaffoldBlockCount = lowerSiblingCounts.length, scaffold = [];
|
6069 |
+
return lowerSiblingCounts.forEach(function(lowerSiblingCount, i) {
|
6070 |
+
var lineClass = "";
|
6071 |
+
if (lowerSiblingCount > 0 ? // At this level in the tree, the nodes had sibling nodes further down
|
6072 |
+
// Top-left corner of the tree
|
6073 |
+
// +-----+
|
6074 |
+
// | |
|
6075 |
+
// | +--+
|
6076 |
+
// | | |
|
6077 |
+
// +--+--+
|
6078 |
+
lineClass = 0 === listIndex ? _treeNode2.default.lineHalfHorizontalRight + " " + _treeNode2.default.lineHalfVerticalBottom : i === scaffoldBlockCount - 1 ? _treeNode2.default.lineHalfHorizontalRight + " " + _treeNode2.default.lineFullVertical : _treeNode2.default.lineFullVertical : 0 === listIndex ? // Top-left corner of the tree, but has no siblings
|
6079 |
+
// +-----+
|
6080 |
+
// | |
|
6081 |
+
// | +--+
|
6082 |
+
// | |
|
6083 |
+
// +-----+
|
6084 |
+
lineClass = _treeNode2.default.lineHalfHorizontalRight : i === scaffoldBlockCount - 1 && (// The last or only node in this level of the tree
|
6085 |
+
// +--+--+
|
6086 |
+
// | | |
|
6087 |
+
// | +--+
|
6088 |
+
// | |
|
6089 |
+
// +-----+
|
6090 |
+
lineClass = _treeNode2.default.lineHalfVerticalTop + " " + _treeNode2.default.lineHalfHorizontalRight),
|
6091 |
+
scaffold.push(_react2.default.createElement("div", {
|
6092 |
+
key: "pre_" + (1 + i),
|
6093 |
+
style: {
|
6094 |
+
width: scaffoldBlockPxWidth
|
6095 |
+
},
|
6096 |
+
className: _treeNode2.default.lineBlock + " " + lineClass
|
6097 |
+
})), treeIndex !== listIndex && i === swapDepth) {
|
6098 |
+
// This row has been shifted, and is at the depth of
|
6099 |
+
// the line pointing to the new destination
|
6100 |
+
var highlightLineClass = "";
|
6101 |
+
// This block is on the bottom (target) line
|
6102 |
+
// This block points at the target block (where the row will go when released)
|
6103 |
+
highlightLineClass = listIndex === swapFrom + swapLength - 1 ? _treeNode2.default.highlightBottomLeftCorner : treeIndex === swapFrom ? _treeNode2.default.highlightTopLeftCorner : _treeNode2.default.highlightLineVertical,
|
6104 |
+
scaffold.push(_react2.default.createElement("div", {
|
6105 |
+
// eslint-disable-next-line react/no-array-index-key
|
6106 |
+
key: i,
|
6107 |
+
style: {
|
6108 |
+
width: scaffoldBlockPxWidth,
|
6109 |
+
left: scaffoldBlockPxWidth * i
|
6110 |
+
},
|
6111 |
+
className: _treeNode2.default.absoluteLineBlock + " " + highlightLineClass
|
6112 |
+
}));
|
6113 |
+
}
|
6114 |
+
}), connectDropTarget(_react2.default.createElement("div", _extends({}, otherProps, {
|
6115 |
+
className: _treeNode2.default.node
|
6116 |
+
}), scaffold, _react2.default.createElement("div", {
|
6117 |
+
className: _treeNode2.default.nodeContent,
|
6118 |
+
style: {
|
6119 |
+
left: scaffoldBlockPxWidth * scaffoldBlockCount
|
6120 |
+
}
|
6121 |
+
}, _react.Children.map(children, function(child) {
|
6122 |
+
return (0, _react.cloneElement)(child, {
|
6123 |
+
isOver: isOver,
|
6124 |
+
canDrop: canDrop,
|
6125 |
+
draggedNode: draggedNode
|
6126 |
+
});
|
6127 |
+
}))));
|
6128 |
+
}
|
6129 |
+
} ]), TreeNode;
|
6130 |
+
}(_react.Component);
|
6131 |
+
TreeNode.defaultProps = {
|
6132 |
+
swapFrom: null,
|
6133 |
+
swapDepth: null,
|
6134 |
+
swapLength: null,
|
6135 |
+
canDrop: !1,
|
6136 |
+
draggedNode: null
|
6137 |
+
}, TreeNode.propTypes = {
|
6138 |
+
treeIndex: _propTypes2.default.number.isRequired,
|
6139 |
+
treeId: _propTypes2.default.string.isRequired,
|
6140 |
+
swapFrom: _propTypes2.default.number,
|
6141 |
+
swapDepth: _propTypes2.default.number,
|
6142 |
+
swapLength: _propTypes2.default.number,
|
6143 |
+
scaffoldBlockPxWidth: _propTypes2.default.number.isRequired,
|
6144 |
+
lowerSiblingCounts: _propTypes2.default.arrayOf(_propTypes2.default.number).isRequired,
|
6145 |
+
listIndex: _propTypes2.default.number.isRequired,
|
6146 |
+
children: _propTypes2.default.node.isRequired,
|
6147 |
+
// Drop target
|
6148 |
+
connectDropTarget: _propTypes2.default.func.isRequired,
|
6149 |
+
isOver: _propTypes2.default.bool.isRequired,
|
6150 |
+
canDrop: _propTypes2.default.bool,
|
6151 |
+
draggedNode: _propTypes2.default.shape({}),
|
6152 |
+
// used in dndManager
|
6153 |
+
getPrevRow: _propTypes2.default.func.isRequired,
|
6154 |
+
node: _propTypes2.default.shape({}).isRequired,
|
6155 |
+
path: _propTypes2.default.arrayOf(_propTypes2.default.oneOfType([ _propTypes2.default.string, _propTypes2.default.number ])).isRequired
|
6156 |
+
}, exports.default = TreeNode;
|
6157 |
+
}, /* 16 */
|
6158 |
+
/***/
|
6159 |
+
function(module, exports, __webpack_require__) {
|
6160 |
+
// style-loader: Adds some css to the DOM by adding a <style> tag
|
6161 |
+
// load the styles
|
6162 |
+
var content = __webpack_require__(17);
|
6163 |
+
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
6164 |
+
// Prepare cssTransformation
|
6165 |
+
var options = {
|
6166 |
+
insertAt: "top",
|
6167 |
+
hmr: !0
|
6168 |
+
};
|
6169 |
+
options.transform = void 0;
|
6170 |
+
// add the styles to the DOM
|
6171 |
+
__webpack_require__(4)(content, options);
|
6172 |
+
content.locals && (module.exports = content.locals);
|
6173 |
+
}, /* 17 */
|
6174 |
+
/***/
|
6175 |
+
function(module, exports, __webpack_require__) {
|
6176 |
+
exports = module.exports = __webpack_require__(3)(!1), // imports
|
6177 |
+
// module
|
6178 |
+
exports.push([ module.i, ".rst__node {\n min-width: 100%;\n white-space: nowrap;\n position: relative;\n text-align: left; }\n\n.rst__nodeContent {\n position: absolute;\n top: 0;\n bottom: 0; }\n\n/* ==========================================================================\n Scaffold\n\n Line-overlaid blocks used for showing the tree structure\n ========================================================================== */\n.rst__lineBlock, .rst__absoluteLineBlock {\n height: 100%;\n position: relative;\n display: inline-block; }\n\n.rst__absoluteLineBlock {\n position: absolute;\n top: 0; }\n\n.rst__lineHalfHorizontalRight::before, .rst__lineFullVertical::after, .rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n position: absolute;\n content: '';\n background-color: black; }\n\n/**\n * +-----+\n * | |\n * | +--+\n * | |\n * +-----+\n */\n.rst__lineHalfHorizontalRight::before {\n height: 1px;\n top: 50%;\n right: 0;\n width: 50%; }\n\n/**\n * +--+--+\n * | | |\n * | | |\n * | | |\n * +--+--+\n */\n.rst__lineFullVertical::after, .rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n width: 1px;\n left: 50%;\n top: 0;\n height: 100%; }\n\n/**\n * +-----+\n * | | |\n * | + |\n * | |\n * +-----+\n */\n.rst__lineHalfVerticalTop::after, .rst__lineHalfVerticalBottom::after {\n top: 0;\n height: 50%; }\n\n/**\n * +-----+\n * | |\n * | + |\n * | | |\n * +-----+\n */\n.rst__lineHalfVerticalBottom::after {\n top: auto;\n bottom: 0; }\n\n/* Highlight line for pointing to dragged row destination\n ========================================================================== */\n/**\n * +--+--+\n * | | |\n * | | |\n * | | |\n * +--+--+\n */\n.rst__highlightLineVertical {\n z-index: 3; }\n .rst__highlightLineVertical::before {\n position: absolute;\n content: '';\n background-color: #36c2f6;\n width: 8px;\n margin-left: -4px;\n left: 50%;\n top: 0;\n height: 100%; }\n\n@-webkit-keyframes rst__arrow-pulse {\n 0% {\n -webkit-transform: translate(0, 0);\n transform: translate(0, 0);\n opacity: 0; }\n 30% {\n -webkit-transform: translate(0, 300%);\n transform: translate(0, 300%);\n opacity: 1; }\n 70% {\n -webkit-transform: translate(0, 700%);\n transform: translate(0, 700%);\n opacity: 1; }\n 100% {\n -webkit-transform: translate(0, 1000%);\n transform: translate(0, 1000%);\n opacity: 0; } }\n\n@keyframes rst__arrow-pulse {\n 0% {\n -webkit-transform: translate(0, 0);\n transform: translate(0, 0);\n opacity: 0; }\n 30% {\n -webkit-transform: translate(0, 300%);\n transform: translate(0, 300%);\n opacity: 1; }\n 70% {\n -webkit-transform: translate(0, 700%);\n transform: translate(0, 700%);\n opacity: 1; }\n 100% {\n -webkit-transform: translate(0, 1000%);\n transform: translate(0, 1000%);\n opacity: 0; } }\n .rst__highlightLineVertical::after {\n content: '';\n position: absolute;\n height: 0;\n margin-left: -4px;\n left: 50%;\n top: 0;\n border-left: 4px solid transparent;\n border-right: 4px solid transparent;\n border-top: 4px solid white;\n -webkit-animation: rst__arrow-pulse 1s infinite linear both;\n animation: rst__arrow-pulse 1s infinite linear both; }\n\n/**\n * +-----+\n * | |\n * | +--+\n * | | |\n * +--+--+\n */\n.rst__highlightTopLeftCorner::before {\n z-index: 3;\n content: '';\n position: absolute;\n border-top: solid 8px #36c2f6;\n border-left: solid 8px #36c2f6;\n -webkit-box-sizing: border-box;\n box-sizing: border-box;\n height: calc(50% + 4px);\n top: 50%;\n margin-top: -4px;\n right: 0;\n width: calc(50% + 4px); }\n\n/**\n * +--+--+\n * | | |\n * | | |\n * | +->|\n * +-----+\n */\n.rst__highlightBottomLeftCorner {\n z-index: 3; }\n .rst__highlightBottomLeftCorner::before {\n content: '';\n position: absolute;\n border-bottom: solid 8px #36c2f6;\n border-left: solid 8px #36c2f6;\n -webkit-box-sizing: border-box;\n box-sizing: border-box;\n height: calc(100% + 4px);\n top: 0;\n right: 12px;\n width: calc(50% - 8px); }\n .rst__highlightBottomLeftCorner::after {\n content: '';\n position: absolute;\n height: 0;\n right: 0;\n top: 100%;\n margin-top: -12px;\n border-top: 12px solid transparent;\n border-bottom: 12px solid transparent;\n border-left: 12px solid #36c2f6; }\n", "" ]),
|
6179 |
+
// exports
|
6180 |
+
exports.locals = {
|
6181 |
+
node: "rst__node",
|
6182 |
+
nodeContent: "rst__nodeContent",
|
6183 |
+
lineBlock: "rst__lineBlock",
|
6184 |
+
absoluteLineBlock: "rst__absoluteLineBlock",
|
6185 |
+
lineHalfHorizontalRight: "rst__lineHalfHorizontalRight",
|
6186 |
+
lineFullVertical: "rst__lineFullVertical",
|
6187 |
+
lineHalfVerticalTop: "rst__lineHalfVerticalTop",
|
6188 |
+
lineHalfVerticalBottom: "rst__lineHalfVerticalBottom",
|
6189 |
+
highlightLineVertical: "rst__highlightLineVertical",
|
6190 |
+
"arrow-pulse": "rst__arrow-pulse",
|
6191 |
+
highlightTopLeftCorner: "rst__highlightTopLeftCorner",
|
6192 |
+
highlightBottomLeftCorner: "rst__highlightBottomLeftCorner"
|
6193 |
+
};
|
6194 |
+
}, /* 18 */
|
6195 |
+
/***/
|
6196 |
+
function(module, exports, __webpack_require__) {
|
6197 |
+
"use strict";
|
6198 |
+
function _interopRequireDefault(obj) {
|
6199 |
+
return obj && obj.__esModule ? obj : {
|
6200 |
+
default: obj
|
6201 |
+
};
|
6202 |
+
}
|
6203 |
+
function _objectWithoutProperties(obj, keys) {
|
6204 |
+
var target = {};
|
6205 |
+
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
6206 |
+
return target;
|
6207 |
+
}
|
6208 |
+
function _classCallCheck(instance, Constructor) {
|
6209 |
+
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
6210 |
+
}
|
6211 |
+
function _possibleConstructorReturn(self, call) {
|
6212 |
+
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
6213 |
+
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
6214 |
+
}
|
6215 |
+
function _inherits(subClass, superClass) {
|
6216 |
+
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
6217 |
+
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
6218 |
+
constructor: {
|
6219 |
+
value: subClass,
|
6220 |
+
enumerable: !1,
|
6221 |
+
writable: !0,
|
6222 |
+
configurable: !0
|
6223 |
+
}
|
6224 |
+
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
6225 |
+
}
|
6226 |
+
Object.defineProperty(exports, "__esModule", {
|
6227 |
+
value: !0
|
6228 |
+
});
|
6229 |
+
var _createClass = function() {
|
6230 |
+
function defineProperties(target, props) {
|
6231 |
+
for (var i = 0; i < props.length; i++) {
|
6232 |
+
var descriptor = props[i];
|
6233 |
+
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
6234 |
+
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
6235 |
+
}
|
6236 |
+
}
|
6237 |
+
return function(Constructor, protoProps, staticProps) {
|
6238 |
+
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
6239 |
+
Constructor;
|
6240 |
+
};
|
6241 |
+
}(), _extends = Object.assign || function(target) {
|
6242 |
+
for (var i = 1; i < arguments.length; i++) {
|
6243 |
+
var source = arguments[i];
|
6244 |
+
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
6245 |
+
}
|
6246 |
+
return target;
|
6247 |
+
}, _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _browserUtils = __webpack_require__(19), _nodeRendererDefault = __webpack_require__(20), _nodeRendererDefault2 = _interopRequireDefault(_nodeRendererDefault), _treeDataUtils = __webpack_require__(0), styles = _nodeRendererDefault2.default;
|
6248 |
+
// Add extra classes in browsers that don't support flex
|
6249 |
+
_browserUtils.getIEVersion < 10 && (styles = _extends({}, _nodeRendererDefault2.default, {
|
6250 |
+
row: styles.row + " " + styles.row_NoFlex,
|
6251 |
+
rowContents: styles.rowContents + " " + styles.rowContents_NoFlex,
|
6252 |
+
rowLabel: styles.rowLabel + " " + styles.rowLabel_NoFlex,
|
6253 |
+
rowToolbar: styles.rowToolbar + " " + styles.rowToolbar_NoFlex
|
6254 |
+
}));
|
6255 |
+
var NodeRendererDefault = function(_Component) {
|
6256 |
+
function NodeRendererDefault() {
|
6257 |
+
return _classCallCheck(this, NodeRendererDefault), _possibleConstructorReturn(this, (NodeRendererDefault.__proto__ || Object.getPrototypeOf(NodeRendererDefault)).apply(this, arguments));
|
6258 |
+
}
|
6259 |
+
return _inherits(NodeRendererDefault, _Component), _createClass(NodeRendererDefault, [ {
|
6260 |
+
key: "render",
|
6261 |
+
value: function() {
|
6262 |
+
var _props = this.props, scaffoldBlockPxWidth = _props.scaffoldBlockPxWidth, toggleChildrenVisibility = _props.toggleChildrenVisibility, connectDragPreview = _props.connectDragPreview, connectDragSource = _props.connectDragSource, isDragging = _props.isDragging, canDrop = _props.canDrop, canDrag = _props.canDrag, node = _props.node, title = _props.title, subtitle = _props.subtitle, draggedNode = _props.draggedNode, path = _props.path, treeIndex = _props.treeIndex, isSearchMatch = _props.isSearchMatch, isSearchFocus = _props.isSearchFocus, buttons = _props.buttons, className = _props.className, style = _props.style, didDrop = _props.didDrop, otherProps = (_props.treeId,
|
6263 |
+
_props.isOver, _props.parentNode, _objectWithoutProperties(_props, [ "scaffoldBlockPxWidth", "toggleChildrenVisibility", "connectDragPreview", "connectDragSource", "isDragging", "canDrop", "canDrag", "node", "title", "subtitle", "draggedNode", "path", "treeIndex", "isSearchMatch", "isSearchFocus", "buttons", "className", "style", "didDrop", "treeId", "isOver", "parentNode" ])), nodeTitle = title || node.title, nodeSubtitle = subtitle || node.subtitle, handle = void 0;
|
6264 |
+
canDrag && (// Show a loading symbol on the handle when the children are expanded
|
6265 |
+
// and yet still defined by a function (a callback to fetch the children)
|
6266 |
+
handle = "function" == typeof node.children && node.expanded ? _react2.default.createElement("div", {
|
6267 |
+
className: styles.loadingHandle
|
6268 |
+
}, _react2.default.createElement("div", {
|
6269 |
+
className: styles.loadingCircle
|
6270 |
+
}, _react2.default.createElement("div", {
|
6271 |
+
className: styles.loadingCirclePoint
|
6272 |
+
}), _react2.default.createElement("div", {
|
6273 |
+
className: styles.loadingCirclePoint
|
6274 |
+
}), _react2.default.createElement("div", {
|
6275 |
+
className: styles.loadingCirclePoint
|
6276 |
+
}), _react2.default.createElement("div", {
|
6277 |
+
className: styles.loadingCirclePoint
|
6278 |
+
}), _react2.default.createElement("div", {
|
6279 |
+
className: styles.loadingCirclePoint
|
6280 |
+
}), _react2.default.createElement("div", {
|
6281 |
+
className: styles.loadingCirclePoint
|
6282 |
+
}), _react2.default.createElement("div", {
|
6283 |
+
className: styles.loadingCirclePoint
|
6284 |
+
}), _react2.default.createElement("div", {
|
6285 |
+
className: styles.loadingCirclePoint
|
6286 |
+
}), _react2.default.createElement("div", {
|
6287 |
+
className: styles.loadingCirclePoint
|
6288 |
+
}), _react2.default.createElement("div", {
|
6289 |
+
className: styles.loadingCirclePoint
|
6290 |
+
}), _react2.default.createElement("div", {
|
6291 |
+
className: styles.loadingCirclePoint
|
6292 |
+
}), _react2.default.createElement("div", {
|
6293 |
+
className: styles.loadingCirclePoint
|
6294 |
+
}))) : connectDragSource(_react2.default.createElement("div", {
|
6295 |
+
className: styles.moveHandle
|
6296 |
+
}), {
|
6297 |
+
dropEffect: "copy"
|
6298 |
+
}));
|
6299 |
+
var isDraggedDescendant = draggedNode && (0, _treeDataUtils.isDescendant)(draggedNode, node), isLandingPadActive = !didDrop && isDragging;
|
6300 |
+
return _react2.default.createElement("div", _extends({
|
6301 |
+
style: {
|
6302 |
+
height: "100%"
|
6303 |
+
}
|
6304 |
+
}, otherProps), toggleChildrenVisibility && node.children && (node.children.length > 0 || "function" == typeof node.children) && _react2.default.createElement("div", null, _react2.default.createElement("button", {
|
6305 |
+
type: "button",
|
6306 |
+
"aria-label": node.expanded ? "Collapse" : "Expand",
|
6307 |
+
className: node.expanded ? styles.collapseButton : styles.expandButton,
|
6308 |
+
style: {
|
6309 |
+
left: -.5 * scaffoldBlockPxWidth
|
6310 |
+
},
|
6311 |
+
onClick: function() {
|
6312 |
+
return toggleChildrenVisibility({
|
6313 |
+
node: node,
|
6314 |
+
path: path,
|
6315 |
+
treeIndex: treeIndex
|
6316 |
+
});
|
6317 |
+
}
|
6318 |
+
}), node.expanded && !isDragging && _react2.default.createElement("div", {
|
6319 |
+
style: {
|
6320 |
+
width: scaffoldBlockPxWidth
|
6321 |
+
},
|
6322 |
+
className: styles.lineChildren
|
6323 |
+
})), _react2.default.createElement("div", {
|
6324 |
+
className: styles.rowWrapper
|
6325 |
+
}, connectDragPreview(_react2.default.createElement("div", {
|
6326 |
+
className: styles.row + (isLandingPadActive ? " " + styles.rowLandingPad : "") + (isLandingPadActive && !canDrop ? " " + styles.rowCancelPad : "") + (isSearchMatch ? " " + styles.rowSearchMatch : "") + (isSearchFocus ? " " + styles.rowSearchFocus : "") + (className ? " " + className : ""),
|
6327 |
+
style: _extends({
|
6328 |
+
opacity: isDraggedDescendant ? .5 : 1
|
6329 |
+
}, style)
|
6330 |
+
}, handle, _react2.default.createElement("div", {
|
6331 |
+
className: styles.rowContents + (canDrag ? "" : " " + styles.rowContentsDragDisabled)
|
6332 |
+
}, _react2.default.createElement("div", {
|
6333 |
+
className: styles.rowLabel
|
6334 |
+
}, _react2.default.createElement("span", {
|
6335 |
+
className: styles.rowTitle + (node.subtitle ? " " + styles.rowTitleWithSubtitle : "")
|
6336 |
+
}, "function" == typeof nodeTitle ? nodeTitle({
|
6337 |
+
node: node,
|
6338 |
+
path: path,
|
6339 |
+
treeIndex: treeIndex
|
6340 |
+
}) : nodeTitle), nodeSubtitle && _react2.default.createElement("span", {
|
6341 |
+
className: styles.rowSubtitle
|
6342 |
+
}, "function" == typeof nodeSubtitle ? nodeSubtitle({
|
6343 |
+
node: node,
|
6344 |
+
path: path,
|
6345 |
+
treeIndex: treeIndex
|
6346 |
+
}) : nodeSubtitle)), _react2.default.createElement("div", {
|
6347 |
+
className: styles.rowToolbar
|
6348 |
+
}, buttons.map(function(btn, index) {
|
6349 |
+
return _react2.default.createElement("div", {
|
6350 |
+
key: index,
|
6351 |
+
className: styles.toolbarButton
|
6352 |
+
}, btn);
|
6353 |
+
})))))));
|
6354 |
+
}
|
6355 |
+
} ]), NodeRendererDefault;
|
6356 |
+
}(_react.Component);
|
6357 |
+
NodeRendererDefault.defaultProps = {
|
6358 |
+
isSearchMatch: !1,
|
6359 |
+
isSearchFocus: !1,
|
6360 |
+
canDrag: !1,
|
6361 |
+
toggleChildrenVisibility: null,
|
6362 |
+
buttons: [],
|
6363 |
+
className: "",
|
6364 |
+
style: {},
|
6365 |
+
parentNode: null,
|
6366 |
+
draggedNode: null,
|
6367 |
+
canDrop: !1,
|
6368 |
+
title: null,
|
6369 |
+
subtitle: null
|
6370 |
+
}, NodeRendererDefault.propTypes = {
|
6371 |
+
node: _propTypes2.default.shape({}).isRequired,
|
6372 |
+
title: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.node ]),
|
6373 |
+
subtitle: _propTypes2.default.oneOfType([ _propTypes2.default.func, _propTypes2.default.node ]),
|
6374 |
+
path: _propTypes2.default.arrayOf(_propTypes2.default.oneOfType([ _propTypes2.default.string, _propTypes2.default.number ])).isRequired,
|
6375 |
+
treeIndex: _propTypes2.default.number.isRequired,
|
6376 |
+
treeId: _propTypes2.default.string.isRequired,
|
6377 |
+
isSearchMatch: _propTypes2.default.bool,
|
6378 |
+
isSearchFocus: _propTypes2.default.bool,
|
6379 |
+
canDrag: _propTypes2.default.bool,
|
6380 |
+
scaffoldBlockPxWidth: _propTypes2.default.number.isRequired,
|
6381 |
+
toggleChildrenVisibility: _propTypes2.default.func,
|
6382 |
+
buttons: _propTypes2.default.arrayOf(_propTypes2.default.node),
|
6383 |
+
className: _propTypes2.default.string,
|
6384 |
+
style: _propTypes2.default.shape({}),
|
6385 |
+
// Drag and drop API functions
|
6386 |
+
// Drag source
|
6387 |
+
connectDragPreview: _propTypes2.default.func.isRequired,
|
6388 |
+
connectDragSource: _propTypes2.default.func.isRequired,
|
6389 |
+
parentNode: _propTypes2.default.shape({}),
|
6390 |
+
// Needed for dndManager
|
6391 |
+
isDragging: _propTypes2.default.bool.isRequired,
|
6392 |
+
didDrop: _propTypes2.default.bool.isRequired,
|
6393 |
+
draggedNode: _propTypes2.default.shape({}),
|
6394 |
+
// Drop target
|
6395 |
+
isOver: _propTypes2.default.bool.isRequired,
|
6396 |
+
canDrop: _propTypes2.default.bool
|
6397 |
+
}, exports.default = NodeRendererDefault;
|
6398 |
+
}, /* 19 */
|
6399 |
+
/***/
|
6400 |
+
function(module, exports, __webpack_require__) {
|
6401 |
+
"use strict";
|
6402 |
+
/* eslint-disable import/prefer-default-export */
|
6403 |
+
/**
|
6404 |
+
* Get the version of Internet Explorer in use, or undefined
|
6405 |
+
*
|
6406 |
+
* @return {?number} ieVersion - IE version as an integer, or undefined if not IE
|
6407 |
+
*/
|
6408 |
+
function getIEVersion() {
|
6409 |
+
var match = navigator.userAgent.match(/(?:MSIE |Trident\/.*; rv:)(\d+)/);
|
6410 |
+
return match ? parseInt(match[1], 10) : void 0;
|
6411 |
+
}
|
6412 |
+
Object.defineProperty(exports, "__esModule", {
|
6413 |
+
value: !0
|
6414 |
+
}), exports.getIEVersion = getIEVersion;
|
6415 |
+
}, /* 20 */
|
6416 |
+
/***/
|
6417 |
+
function(module, exports, __webpack_require__) {
|
6418 |
+
// style-loader: Adds some css to the DOM by adding a <style> tag
|
6419 |
+
// load the styles
|
6420 |
+
var content = __webpack_require__(21);
|
6421 |
+
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
6422 |
+
// Prepare cssTransformation
|
6423 |
+
var options = {
|
6424 |
+
insertAt: "top",
|
6425 |
+
hmr: !0
|
6426 |
+
};
|
6427 |
+
options.transform = void 0;
|
6428 |
+
// add the styles to the DOM
|
6429 |
+
__webpack_require__(4)(content, options);
|
6430 |
+
content.locals && (module.exports = content.locals);
|
6431 |
+
}, /* 21 */
|
6432 |
+
/***/
|
6433 |
+
function(module, exports, __webpack_require__) {
|
6434 |
+
exports = module.exports = __webpack_require__(3)(!1), // imports
|
6435 |
+
// module
|
6436 |
+
exports.push([ module.i, ".rst__rowWrapper {\n padding: 10px 10px 10px 0;\n height: 100%;\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n.rst__row {\n height: 100%;\n white-space: nowrap;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex; }\n .rst__row > * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n/**\n * The outline of where the element will go if dropped, displayed while dragging\n */\n.rst__rowLandingPad, .rst__rowCancelPad {\n border: none !important;\n -webkit-box-shadow: none !important;\n box-shadow: none !important;\n outline: none !important; }\n .rst__rowLandingPad > *, .rst__rowCancelPad > * {\n opacity: 0 !important; }\n .rst__rowLandingPad::before, .rst__rowCancelPad::before {\n background-color: lightblue;\n border: 3px dashed white;\n content: '';\n position: absolute;\n top: 0;\n right: 0;\n bottom: 0;\n left: 0;\n z-index: -1; }\n\n/**\n * Alternate appearance of the landing pad when the dragged location is invalid\n */\n.rst__rowCancelPad::before {\n background-color: #e6a8ad; }\n\n/**\n * Nodes matching the search conditions are highlighted\n */\n.rst__rowSearchMatch {\n outline: solid 3px #0080ff; }\n\n/**\n * The node that matches the search conditions and is currently focused\n */\n.rst__rowSearchFocus {\n outline: solid 3px #fc6421; }\n\n.rst__rowContents, .rst__rowLabel, .rst__rowToolbar, .rst__moveHandle, .rst__loadingHandle, .rst__toolbarButton, .rst__rowLabel_NoFlex, .rst__rowToolbar_NoFlex {\n display: inline-block;\n vertical-align: middle; }\n\n.rst__rowContents {\n position: relative;\n height: 100%;\n border: solid #bbb 1px;\n border-left: none;\n -webkit-box-shadow: 0 2px 2px -2px;\n box-shadow: 0 2px 2px -2px;\n padding: 0 5px 0 10px;\n border-radius: 2px;\n min-width: 230px;\n -webkit-box-flex: 1;\n -ms-flex: 1 0 auto;\n flex: 1 0 auto;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex;\n -webkit-box-align: center;\n -ms-flex-align: center;\n align-items: center;\n -webkit-box-pack: justify;\n -ms-flex-pack: justify;\n justify-content: space-between;\n background-color: white; }\n\n.rst__rowContentsDragDisabled {\n border-left: solid #bbb 1px; }\n\n.rst__rowLabel {\n -webkit-box-flex: 0;\n -ms-flex: 0 1 auto;\n flex: 0 1 auto;\n padding-right: 20px; }\n\n.rst__rowToolbar {\n -webkit-box-flex: 0;\n -ms-flex: 0 1 auto;\n flex: 0 1 auto;\n display: -webkit-box;\n display: -ms-flexbox;\n display: flex; }\n\n.rst__moveHandle, .rst__loadingHandle {\n height: 100%;\n width: 44px;\n background: #d9d9d9 url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI0MiIgaGVpZ2h0PSI0MiI+PGcgc3Ryb2tlPSIjRkZGIiBzdHJva2Utd2lkdGg9IjIuOSIgPjxwYXRoIGQ9Ik0xNCAxNS43aDE0LjQiLz48cGF0aCBkPSJNMTQgMjEuNGgxNC40Ii8+PHBhdGggZD0iTTE0IDI3LjFoMTQuNCIvPjwvZz4KPC9zdmc+\") no-repeat center;\n border: solid #aaa 1px;\n -webkit-box-shadow: 0 2px 2px -2px;\n box-shadow: 0 2px 2px -2px;\n cursor: move;\n border-radius: 1px;\n z-index: 1; }\n\n.rst__loadingHandle {\n cursor: default;\n background: #d9d9d9; }\n\n@-webkit-keyframes rst__pointFade {\n 0%,\n 19.999%,\n 100% {\n opacity: 0; }\n 20% {\n opacity: 1; } }\n\n@keyframes rst__pointFade {\n 0%,\n 19.999%,\n 100% {\n opacity: 0; }\n 20% {\n opacity: 1; } }\n\n.rst__loadingCircle {\n width: 80%;\n height: 80%;\n margin: 10%;\n position: relative; }\n\n.rst__loadingCirclePoint {\n width: 100%;\n height: 100%;\n position: absolute;\n left: 0;\n top: 0; }\n .rst__loadingCirclePoint:before {\n content: '';\n display: block;\n margin: 0 auto;\n width: 11%;\n height: 30%;\n background-color: #fff;\n border-radius: 30%;\n -webkit-animation: rst__pointFade 800ms infinite ease-in-out both;\n animation: rst__pointFade 800ms infinite ease-in-out both; }\n .rst__loadingCirclePoint:nth-of-type(1) {\n -webkit-transform: rotate(0deg);\n -ms-transform: rotate(0deg);\n transform: rotate(0deg); }\n .rst__loadingCirclePoint:nth-of-type(7) {\n -webkit-transform: rotate(180deg);\n -ms-transform: rotate(180deg);\n transform: rotate(180deg); }\n .rst__loadingCirclePoint:nth-of-type(1):before, .rst__loadingCirclePoint:nth-of-type(7):before {\n -webkit-animation-delay: -800ms;\n animation-delay: -800ms; }\n .rst__loadingCirclePoint:nth-of-type(2) {\n -webkit-transform: rotate(30deg);\n -ms-transform: rotate(30deg);\n transform: rotate(30deg); }\n .rst__loadingCirclePoint:nth-of-type(8) {\n -webkit-transform: rotate(210deg);\n -ms-transform: rotate(210deg);\n transform: rotate(210deg); }\n .rst__loadingCirclePoint:nth-of-type(2):before, .rst__loadingCirclePoint:nth-of-type(8):before {\n -webkit-animation-delay: -666.66667ms;\n animation-delay: -666.66667ms; }\n .rst__loadingCirclePoint:nth-of-type(3) {\n -webkit-transform: rotate(60deg);\n -ms-transform: rotate(60deg);\n transform: rotate(60deg); }\n .rst__loadingCirclePoint:nth-of-type(9) {\n -webkit-transform: rotate(240deg);\n -ms-transform: rotate(240deg);\n transform: rotate(240deg); }\n .rst__loadingCirclePoint:nth-of-type(3):before, .rst__loadingCirclePoint:nth-of-type(9):before {\n -webkit-animation-delay: -533.33333ms;\n animation-delay: -533.33333ms; }\n .rst__loadingCirclePoint:nth-of-type(4) {\n -webkit-transform: rotate(90deg);\n -ms-transform: rotate(90deg);\n transform: rotate(90deg); }\n .rst__loadingCirclePoint:nth-of-type(10) {\n -webkit-transform: rotate(270deg);\n -ms-transform: rotate(270deg);\n transform: rotate(270deg); }\n .rst__loadingCirclePoint:nth-of-type(4):before, .rst__loadingCirclePoint:nth-of-type(10):before {\n -webkit-animation-delay: -400ms;\n animation-delay: -400ms; }\n .rst__loadingCirclePoint:nth-of-type(5) {\n -webkit-transform: rotate(120deg);\n -ms-transform: rotate(120deg);\n transform: rotate(120deg); }\n .rst__loadingCirclePoint:nth-of-type(11) {\n -webkit-transform: rotate(300deg);\n -ms-transform: rotate(300deg);\n transform: rotate(300deg); }\n .rst__loadingCirclePoint:nth-of-type(5):before, .rst__loadingCirclePoint:nth-of-type(11):before {\n -webkit-animation-delay: -266.66667ms;\n animation-delay: -266.66667ms; }\n .rst__loadingCirclePoint:nth-of-type(6) {\n -webkit-transform: rotate(150deg);\n -ms-transform: rotate(150deg);\n transform: rotate(150deg); }\n .rst__loadingCirclePoint:nth-of-type(12) {\n -webkit-transform: rotate(330deg);\n -ms-transform: rotate(330deg);\n transform: rotate(330deg); }\n .rst__loadingCirclePoint:nth-of-type(6):before, .rst__loadingCirclePoint:nth-of-type(12):before {\n -webkit-animation-delay: -133.33333ms;\n animation-delay: -133.33333ms; }\n .rst__loadingCirclePoint:nth-of-type(7) {\n -webkit-transform: rotate(180deg);\n -ms-transform: rotate(180deg);\n transform: rotate(180deg); }\n .rst__loadingCirclePoint:nth-of-type(13) {\n -webkit-transform: rotate(360deg);\n -ms-transform: rotate(360deg);\n transform: rotate(360deg); }\n .rst__loadingCirclePoint:nth-of-type(7):before, .rst__loadingCirclePoint:nth-of-type(13):before {\n -webkit-animation-delay: 0ms;\n animation-delay: 0ms; }\n\n.rst__rowTitle {\n font-weight: bold; }\n\n.rst__rowTitleWithSubtitle {\n font-size: 85%;\n display: block;\n height: 0.8rem; }\n\n.rst__rowSubtitle {\n font-size: 70%;\n line-height: 1; }\n\n.rst__collapseButton,\n.rst__expandButton {\n -webkit-appearance: none;\n -moz-appearance: none;\n appearance: none;\n border: none;\n position: absolute;\n border-radius: 100%;\n -webkit-box-shadow: 0 0 0 1px #000;\n box-shadow: 0 0 0 1px #000;\n width: 16px;\n height: 16px;\n padding: 0;\n top: 50%;\n -webkit-transform: translate(-50%, -50%);\n -ms-transform: translate(-50%, -50%);\n transform: translate(-50%, -50%);\n cursor: pointer; }\n .rst__collapseButton:focus,\n .rst__expandButton:focus {\n outline: none;\n -webkit-box-shadow: 0 0 0 1px #000, 0 0 1px 3px #83bef9;\n box-shadow: 0 0 0 1px #000, 0 0 1px 3px #83bef9; }\n .rst__collapseButton:hover:not(:active),\n .rst__expandButton:hover:not(:active) {\n background-size: 24px;\n height: 20px;\n width: 20px; }\n\n.rst__collapseButton {\n background: #fff url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxOCIgaGVpZ2h0PSIxOCI+PGNpcmNsZSBjeD0iOSIgY3k9IjkiIHI9IjgiIGZpbGw9IiNGRkYiLz48ZyBzdHJva2U9IiM5ODk4OTgiIHN0cm9rZS13aWR0aD0iMS45IiA+PHBhdGggZD0iTTQuNSA5aDkiLz48L2c+Cjwvc3ZnPg==\") no-repeat center; }\n\n.rst__expandButton {\n background: #fff url(\"data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxOCIgaGVpZ2h0PSIxOCI+PGNpcmNsZSBjeD0iOSIgY3k9IjkiIHI9IjgiIGZpbGw9IiNGRkYiLz48ZyBzdHJva2U9IiM5ODk4OTgiIHN0cm9rZS13aWR0aD0iMS45IiA+PHBhdGggZD0iTTQuNSA5aDkiLz48cGF0aCBkPSJNOSA0LjV2OSIvPjwvZz4KPC9zdmc+\") no-repeat center; }\n\n/**\n * Classes for IE9 and below\n */\n.rst__row_NoFlex::before, .rst__rowContents_NoFlex::before {\n content: '';\n display: inline-block;\n vertical-align: middle;\n height: 100%; }\n\n.rst__rowContents_NoFlex {\n display: inline-block; }\n .rst__rowContents_NoFlex::after {\n content: '';\n display: inline-block;\n width: 100%; }\n\n.rst__rowLabel_NoFlex {\n width: 50%; }\n\n.rst__rowToolbar_NoFlex {\n text-align: right;\n width: 50%; }\n\n/**\n * Line for under a node with children\n */\n.rst__lineChildren {\n height: 100%;\n display: inline-block;\n position: absolute; }\n .rst__lineChildren::after {\n content: '';\n position: absolute;\n background-color: black;\n width: 1px;\n left: 50%;\n bottom: 0;\n height: 10px; }\n", "" ]),
|
6437 |
+
// exports
|
6438 |
+
exports.locals = {
|
6439 |
+
rowWrapper: "rst__rowWrapper",
|
6440 |
+
row: "rst__row",
|
6441 |
+
rowLandingPad: "rst__rowLandingPad",
|
6442 |
+
rowCancelPad: "rst__rowCancelPad",
|
6443 |
+
rowSearchMatch: "rst__rowSearchMatch",
|
6444 |
+
rowSearchFocus: "rst__rowSearchFocus",
|
6445 |
+
rowContents: "rst__rowContents",
|
6446 |
+
rowLabel: "rst__rowLabel",
|
6447 |
+
rowToolbar: "rst__rowToolbar",
|
6448 |
+
moveHandle: "rst__moveHandle",
|
6449 |
+
loadingHandle: "rst__loadingHandle",
|
6450 |
+
toolbarButton: "rst__toolbarButton",
|
6451 |
+
rowLabel_NoFlex: "rst__rowLabel_NoFlex",
|
6452 |
+
rowToolbar_NoFlex: "rst__rowToolbar_NoFlex",
|
6453 |
+
rowContentsDragDisabled: "rst__rowContentsDragDisabled",
|
6454 |
+
loadingCircle: "rst__loadingCircle",
|
6455 |
+
loadingCirclePoint: "rst__loadingCirclePoint",
|
6456 |
+
pointFade: "rst__pointFade",
|
6457 |
+
rowTitle: "rst__rowTitle",
|
6458 |
+
rowTitleWithSubtitle: "rst__rowTitleWithSubtitle",
|
6459 |
+
rowSubtitle: "rst__rowSubtitle",
|
6460 |
+
collapseButton: "rst__collapseButton",
|
6461 |
+
expandButton: "rst__expandButton",
|
6462 |
+
row_NoFlex: "rst__row_NoFlex",
|
6463 |
+
rowContents_NoFlex: "rst__rowContents_NoFlex",
|
6464 |
+
lineChildren: "rst__lineChildren"
|
6465 |
+
};
|
6466 |
+
}, /* 22 */
|
6467 |
+
/***/
|
6468 |
+
function(module, exports, __webpack_require__) {
|
6469 |
+
"use strict";
|
6470 |
+
function _interopRequireDefault(obj) {
|
6471 |
+
return obj && obj.__esModule ? obj : {
|
6472 |
+
default: obj
|
6473 |
+
};
|
6474 |
+
}
|
6475 |
+
function _objectWithoutProperties(obj, keys) {
|
6476 |
+
var target = {};
|
6477 |
+
for (var i in obj) keys.indexOf(i) >= 0 || Object.prototype.hasOwnProperty.call(obj, i) && (target[i] = obj[i]);
|
6478 |
+
return target;
|
6479 |
+
}
|
6480 |
+
function _classCallCheck(instance, Constructor) {
|
6481 |
+
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
6482 |
+
}
|
6483 |
+
function _possibleConstructorReturn(self, call) {
|
6484 |
+
if (!self) throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
6485 |
+
return !call || "object" != typeof call && "function" != typeof call ? self : call;
|
6486 |
+
}
|
6487 |
+
function _inherits(subClass, superClass) {
|
6488 |
+
if ("function" != typeof superClass && null !== superClass) throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
6489 |
+
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
6490 |
+
constructor: {
|
6491 |
+
value: subClass,
|
6492 |
+
enumerable: !1,
|
6493 |
+
writable: !0,
|
6494 |
+
configurable: !0
|
6495 |
+
}
|
6496 |
+
}), superClass && (Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass);
|
6497 |
+
}
|
6498 |
+
Object.defineProperty(exports, "__esModule", {
|
6499 |
+
value: !0
|
6500 |
+
});
|
6501 |
+
var _extends = Object.assign || function(target) {
|
6502 |
+
for (var i = 1; i < arguments.length; i++) {
|
6503 |
+
var source = arguments[i];
|
6504 |
+
for (var key in source) Object.prototype.hasOwnProperty.call(source, key) && (target[key] = source[key]);
|
6505 |
+
}
|
6506 |
+
return target;
|
6507 |
+
}, _createClass = function() {
|
6508 |
+
function defineProperties(target, props) {
|
6509 |
+
for (var i = 0; i < props.length; i++) {
|
6510 |
+
var descriptor = props[i];
|
6511 |
+
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
6512 |
+
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
6513 |
+
}
|
6514 |
+
}
|
6515 |
+
return function(Constructor, protoProps, staticProps) {
|
6516 |
+
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
6517 |
+
Constructor;
|
6518 |
+
};
|
6519 |
+
}(), _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), TreePlaceholder = function(_Component) {
|
6520 |
+
function TreePlaceholder() {
|
6521 |
+
return _classCallCheck(this, TreePlaceholder), _possibleConstructorReturn(this, (TreePlaceholder.__proto__ || Object.getPrototypeOf(TreePlaceholder)).apply(this, arguments));
|
6522 |
+
}
|
6523 |
+
return _inherits(TreePlaceholder, _Component), _createClass(TreePlaceholder, [ {
|
6524 |
+
key: "render",
|
6525 |
+
value: function() {
|
6526 |
+
var _props = this.props, children = _props.children, connectDropTarget = _props.connectDropTarget, otherProps = (_props.treeId,
|
6527 |
+
_props.drop, _objectWithoutProperties(_props, [ "children", "connectDropTarget", "treeId", "drop" ]));
|
6528 |
+
return connectDropTarget(_react2.default.createElement("div", null, _react.Children.map(children, function(child) {
|
6529 |
+
return (0, _react.cloneElement)(child, _extends({}, otherProps));
|
6530 |
+
})));
|
6531 |
+
}
|
6532 |
+
} ]), TreePlaceholder;
|
6533 |
+
}(_react.Component);
|
6534 |
+
TreePlaceholder.defaultProps = {
|
6535 |
+
canDrop: !1,
|
6536 |
+
draggedNode: null
|
6537 |
+
}, TreePlaceholder.propTypes = {
|
6538 |
+
children: _propTypes2.default.node.isRequired,
|
6539 |
+
// Drop target
|
6540 |
+
connectDropTarget: _propTypes2.default.func.isRequired,
|
6541 |
+
isOver: _propTypes2.default.bool.isRequired,
|
6542 |
+
canDrop: _propTypes2.default.bool,
|
6543 |
+
draggedNode: _propTypes2.default.shape({}),
|
6544 |
+
treeId: _propTypes2.default.string.isRequired,
|
6545 |
+
drop: _propTypes2.default.func.isRequired
|
6546 |
+
}, exports.default = TreePlaceholder;
|
6547 |
+
}, /* 23 */
|
6548 |
+
/***/
|
6549 |
+
function(module, exports, __webpack_require__) {
|
6550 |
+
"use strict";
|
6551 |
+
function _interopRequireDefault(obj) {
|
6552 |
+
return obj && obj.__esModule ? obj : {
|
6553 |
+
default: obj
|
6554 |
+
};
|
6555 |
+
}
|
6556 |
+
Object.defineProperty(exports, "__esModule", {
|
6557 |
+
value: !0
|
6558 |
+
});
|
6559 |
+
var _react = __webpack_require__(1), _react2 = _interopRequireDefault(_react), _propTypes = __webpack_require__(2), _propTypes2 = _interopRequireDefault(_propTypes), _placeholderRendererDefault = __webpack_require__(24), _placeholderRendererDefault2 = _interopRequireDefault(_placeholderRendererDefault), PlaceholderRendererDefault = function(_ref) {
|
6560 |
+
var isOver = _ref.isOver, canDrop = _ref.canDrop;
|
6561 |
+
return _react2.default.createElement("div", {
|
6562 |
+
className: _placeholderRendererDefault2.default.placeholder + (canDrop ? " " + _placeholderRendererDefault2.default.placeholderLandingPad : "") + (canDrop && !isOver ? " " + _placeholderRendererDefault2.default.placeholderCancelPad : "")
|
6563 |
+
});
|
6564 |
+
};
|
6565 |
+
PlaceholderRendererDefault.defaultProps = {
|
6566 |
+
isOver: !1,
|
6567 |
+
canDrop: !1
|
6568 |
+
}, PlaceholderRendererDefault.propTypes = {
|
6569 |
+
isOver: _propTypes2.default.bool,
|
6570 |
+
canDrop: _propTypes2.default.bool
|
6571 |
+
}, exports.default = PlaceholderRendererDefault;
|
6572 |
+
}, /* 24 */
|
6573 |
+
/***/
|
6574 |
+
function(module, exports, __webpack_require__) {
|
6575 |
+
// style-loader: Adds some css to the DOM by adding a <style> tag
|
6576 |
+
// load the styles
|
6577 |
+
var content = __webpack_require__(25);
|
6578 |
+
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
6579 |
+
// Prepare cssTransformation
|
6580 |
+
var options = {
|
6581 |
+
insertAt: "top",
|
6582 |
+
hmr: !0
|
6583 |
+
};
|
6584 |
+
options.transform = void 0;
|
6585 |
+
// add the styles to the DOM
|
6586 |
+
__webpack_require__(4)(content, options);
|
6587 |
+
content.locals && (module.exports = content.locals);
|
6588 |
+
}, /* 25 */
|
6589 |
+
/***/
|
6590 |
+
function(module, exports, __webpack_require__) {
|
6591 |
+
exports = module.exports = __webpack_require__(3)(!1), // imports
|
6592 |
+
// module
|
6593 |
+
exports.push([ module.i, ".rst__placeholder {\n position: relative;\n height: 68px;\n max-width: 300px;\n padding: 10px; }\n .rst__placeholder,\n .rst__placeholder > * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n .rst__placeholder::before {\n border: 3px dashed #d9d9d9;\n content: '';\n position: absolute;\n top: 5px;\n right: 5px;\n bottom: 5px;\n left: 5px;\n z-index: -1; }\n\n/**\n * The outline of where the element will go if dropped, displayed while dragging\n */\n.rst__placeholderLandingPad, .rst__placeholderCancelPad {\n border: none !important;\n -webkit-box-shadow: none !important;\n box-shadow: none !important;\n outline: none !important; }\n .rst__placeholderLandingPad *, .rst__placeholderCancelPad * {\n opacity: 0 !important; }\n .rst__placeholderLandingPad::before, .rst__placeholderCancelPad::before {\n background-color: lightblue;\n border-color: white; }\n\n/**\n * Alternate appearance of the landing pad when the dragged location is invalid\n */\n.rst__placeholderCancelPad::before {\n background-color: #e6a8ad; }\n", "" ]),
|
6594 |
+
// exports
|
6595 |
+
exports.locals = {
|
6596 |
+
placeholder: "rst__placeholder",
|
6597 |
+
placeholderLandingPad: "rst__placeholderLandingPad",
|
6598 |
+
placeholderCancelPad: "rst__placeholderCancelPad"
|
6599 |
+
};
|
6600 |
+
}, /* 26 */
|
6601 |
+
/***/
|
6602 |
+
function(module, exports, __webpack_require__) {
|
6603 |
+
"use strict";
|
6604 |
+
function _toConsumableArray(arr) {
|
6605 |
+
if (Array.isArray(arr)) {
|
6606 |
+
for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i];
|
6607 |
+
return arr2;
|
6608 |
+
}
|
6609 |
+
return Array.from(arr);
|
6610 |
+
}
|
6611 |
+
/* eslint-disable import/prefer-default-export */
|
6612 |
+
function slideRows(rows, fromIndex, toIndex) {
|
6613 |
+
var count = arguments.length > 3 && void 0 !== arguments[3] ? arguments[3] : 1, rowsWithoutMoved = [].concat(_toConsumableArray(rows.slice(0, fromIndex)), _toConsumableArray(rows.slice(fromIndex + count)));
|
6614 |
+
return [].concat(_toConsumableArray(rowsWithoutMoved.slice(0, toIndex)), _toConsumableArray(rows.slice(fromIndex, fromIndex + count)), _toConsumableArray(rowsWithoutMoved.slice(toIndex)));
|
6615 |
+
}
|
6616 |
+
Object.defineProperty(exports, "__esModule", {
|
6617 |
+
value: !0
|
6618 |
+
}), exports.slideRows = slideRows;
|
6619 |
+
}, /* 27 */
|
6620 |
+
/***/
|
6621 |
+
function(module, exports, __webpack_require__) {
|
6622 |
+
"use strict";
|
6623 |
+
function _classCallCheck(instance, Constructor) {
|
6624 |
+
if (!(instance instanceof Constructor)) throw new TypeError("Cannot call a class as a function");
|
6625 |
+
}
|
6626 |
+
Object.defineProperty(exports, "__esModule", {
|
6627 |
+
value: !0
|
6628 |
+
});
|
6629 |
+
var _createClass = function() {
|
6630 |
+
function defineProperties(target, props) {
|
6631 |
+
for (var i = 0; i < props.length; i++) {
|
6632 |
+
var descriptor = props[i];
|
6633 |
+
descriptor.enumerable = descriptor.enumerable || !1, descriptor.configurable = !0,
|
6634 |
+
"value" in descriptor && (descriptor.writable = !0), Object.defineProperty(target, descriptor.key, descriptor);
|
6635 |
+
}
|
6636 |
+
}
|
6637 |
+
return function(Constructor, protoProps, staticProps) {
|
6638 |
+
return protoProps && defineProperties(Constructor.prototype, protoProps), staticProps && defineProperties(Constructor, staticProps),
|
6639 |
+
Constructor;
|
6640 |
+
};
|
6641 |
+
}(), _reactDnd = __webpack_require__(28), _reactDndHtml5Backend = __webpack_require__(29), _reactDndHtml5Backend2 = function(obj) {
|
6642 |
+
return obj && obj.__esModule ? obj : {
|
6643 |
+
default: obj
|
6644 |
+
};
|
6645 |
+
}(_reactDndHtml5Backend), _reactDom = __webpack_require__(30), _treeDataUtils = __webpack_require__(0), _memoizedTreeDataUtils = __webpack_require__(6), DndManager = function() {
|
6646 |
+
function DndManager(treeRef) {
|
6647 |
+
_classCallCheck(this, DndManager), this.treeRef = treeRef;
|
6648 |
+
}
|
6649 |
+
return _createClass(DndManager, [ {
|
6650 |
+
key: "getTargetDepth",
|
6651 |
+
value: function(dropTargetProps, monitor, component) {
|
6652 |
+
var dropTargetDepth = 0, rowAbove = dropTargetProps.getPrevRow();
|
6653 |
+
rowAbove && (// Limit the length of the path to the deepest possible
|
6654 |
+
dropTargetDepth = Math.min(rowAbove.path.length, dropTargetProps.path.length));
|
6655 |
+
var blocksOffset = void 0, dragSourceInitialDepth = (monitor.getItem().path || []).length;
|
6656 |
+
// When adding node from external source
|
6657 |
+
if (monitor.getItem().treeId !== this.treeId) if (// Ignore the tree depth of the source, if it had any to begin with
|
6658 |
+
dragSourceInitialDepth = 0, component) {
|
6659 |
+
var relativePosition = (0, _reactDom.findDOMNode)(component).getBoundingClientRect(), leftShift = monitor.getSourceClientOffset().x - relativePosition.left;
|
6660 |
+
blocksOffset = Math.round(leftShift / dropTargetProps.scaffoldBlockPxWidth);
|
6661 |
+
} else blocksOffset = dropTargetProps.path.length; else blocksOffset = Math.round(monitor.getDifferenceFromInitialOffset().x / dropTargetProps.scaffoldBlockPxWidth);
|
6662 |
+
var targetDepth = Math.min(dropTargetDepth, Math.max(0, dragSourceInitialDepth + blocksOffset - 1));
|
6663 |
+
// If a maxDepth is defined, constrain the target depth
|
6664 |
+
if (void 0 !== this.maxDepth && null !== this.maxDepth) {
|
6665 |
+
var draggedNode = monitor.getItem().node, draggedChildDepth = (0, _treeDataUtils.getDepth)(draggedNode);
|
6666 |
+
targetDepth = Math.max(0, Math.min(targetDepth, this.maxDepth - draggedChildDepth - 1));
|
6667 |
+
}
|
6668 |
+
return targetDepth;
|
6669 |
+
}
|
6670 |
+
}, {
|
6671 |
+
key: "canDrop",
|
6672 |
+
value: function(dropTargetProps, monitor) {
|
6673 |
+
if (!monitor.isOver()) return !1;
|
6674 |
+
var rowAbove = dropTargetProps.getPrevRow(), abovePath = rowAbove ? rowAbove.path : [], aboveNode = rowAbove ? rowAbove.node : {}, targetDepth = this.getTargetDepth(dropTargetProps, monitor, null);
|
6675 |
+
// Cannot drop if we're adding to the children of the row above and
|
6676 |
+
// the row above is a function
|
6677 |
+
if (targetDepth >= abovePath.length && "function" == typeof aboveNode.children) return !1;
|
6678 |
+
if ("function" == typeof this.customCanDrop) {
|
6679 |
+
var _monitor$getItem = monitor.getItem(), node = _monitor$getItem.node, addedResult = (0,
|
6680 |
+
_memoizedTreeDataUtils.memoizedInsertNode)({
|
6681 |
+
treeData: this.treeData,
|
6682 |
+
newNode: node,
|
6683 |
+
depth: targetDepth,
|
6684 |
+
getNodeKey: this.getNodeKey,
|
6685 |
+
minimumTreeIndex: dropTargetProps.listIndex,
|
6686 |
+
expandParent: !0
|
6687 |
+
});
|
6688 |
+
return this.customCanDrop({
|
6689 |
+
node: node,
|
6690 |
+
prevPath: monitor.getItem().path,
|
6691 |
+
prevParent: monitor.getItem().parentNode,
|
6692 |
+
prevTreeIndex: monitor.getItem().treeIndex,
|
6693 |
+
// Equals -1 when dragged from external tree
|
6694 |
+
nextPath: addedResult.path,
|
6695 |
+
nextParent: addedResult.parentNode,
|
6696 |
+
nextTreeIndex: addedResult.treeIndex
|
6697 |
+
});
|
6698 |
+
}
|
6699 |
+
return !0;
|
6700 |
+
}
|
6701 |
+
}, {
|
6702 |
+
key: "wrapSource",
|
6703 |
+
value: function(el) {
|
6704 |
+
function nodeDragSourcePropInjection(connect, monitor) {
|
6705 |
+
return {
|
6706 |
+
connectDragSource: connect.dragSource(),
|
6707 |
+
connectDragPreview: connect.dragPreview(),
|
6708 |
+
isDragging: monitor.isDragging(),
|
6709 |
+
didDrop: monitor.didDrop()
|
6710 |
+
};
|
6711 |
+
}
|
6712 |
+
var _this = this, nodeDragSource = {
|
6713 |
+
beginDrag: function(props) {
|
6714 |
+
return _this.startDrag(props), {
|
6715 |
+
node: props.node,
|
6716 |
+
parentNode: props.parentNode,
|
6717 |
+
path: props.path,
|
6718 |
+
treeIndex: props.treeIndex,
|
6719 |
+
treeId: props.treeId
|
6720 |
+
};
|
6721 |
+
},
|
6722 |
+
endDrag: function(props, monitor) {
|
6723 |
+
_this.endDrag(monitor.getDropResult());
|
6724 |
+
},
|
6725 |
+
isDragging: function(props, monitor) {
|
6726 |
+
var dropTargetNode = monitor.getItem().node;
|
6727 |
+
return props.node === dropTargetNode;
|
6728 |
+
}
|
6729 |
+
};
|
6730 |
+
return (0, _reactDnd.DragSource)(this.dndType, nodeDragSource, nodeDragSourcePropInjection)(el);
|
6731 |
+
}
|
6732 |
+
}, {
|
6733 |
+
key: "wrapTarget",
|
6734 |
+
value: function(el) {
|
6735 |
+
function nodeDropTargetPropInjection(connect, monitor) {
|
6736 |
+
var dragged = monitor.getItem();
|
6737 |
+
return {
|
6738 |
+
connectDropTarget: connect.dropTarget(),
|
6739 |
+
isOver: monitor.isOver(),
|
6740 |
+
canDrop: monitor.canDrop(),
|
6741 |
+
draggedNode: dragged ? dragged.node : null
|
6742 |
+
};
|
6743 |
+
}
|
6744 |
+
var _this2 = this, nodeDropTarget = {
|
6745 |
+
drop: function(dropTargetProps, monitor, component) {
|
6746 |
+
var result = {
|
6747 |
+
node: monitor.getItem().node,
|
6748 |
+
path: monitor.getItem().path,
|
6749 |
+
treeIndex: monitor.getItem().treeIndex,
|
6750 |
+
treeId: _this2.treeId,
|
6751 |
+
minimumTreeIndex: dropTargetProps.treeIndex,
|
6752 |
+
depth: _this2.getTargetDepth(dropTargetProps, monitor, component)
|
6753 |
+
};
|
6754 |
+
return _this2.drop(result), result;
|
6755 |
+
},
|
6756 |
+
hover: function(dropTargetProps, monitor, component) {
|
6757 |
+
var targetDepth = _this2.getTargetDepth(dropTargetProps, monitor, component), draggedNode = monitor.getItem().node;
|
6758 |
+
(// Redraw if hovered above different nodes
|
6759 |
+
dropTargetProps.node !== draggedNode || // Or hovered above the same node but at a different depth
|
6760 |
+
targetDepth !== dropTargetProps.path.length - 1) && _this2.dragHover({
|
6761 |
+
node: draggedNode,
|
6762 |
+
path: monitor.getItem().path,
|
6763 |
+
minimumTreeIndex: dropTargetProps.listIndex,
|
6764 |
+
depth: targetDepth
|
6765 |
+
});
|
6766 |
+
},
|
6767 |
+
canDrop: this.canDrop.bind(this)
|
6768 |
+
};
|
6769 |
+
return (0, _reactDnd.DropTarget)(this.dndType, nodeDropTarget, nodeDropTargetPropInjection)(el);
|
6770 |
+
}
|
6771 |
+
}, {
|
6772 |
+
key: "wrapPlaceholder",
|
6773 |
+
value: function(el) {
|
6774 |
+
function placeholderPropInjection(connect, monitor) {
|
6775 |
+
var dragged = monitor.getItem();
|
6776 |
+
return {
|
6777 |
+
connectDropTarget: connect.dropTarget(),
|
6778 |
+
isOver: monitor.isOver(),
|
6779 |
+
canDrop: monitor.canDrop(),
|
6780 |
+
draggedNode: dragged ? dragged.node : null
|
6781 |
+
};
|
6782 |
+
}
|
6783 |
+
var _this3 = this, placeholderDropTarget = {
|
6784 |
+
drop: function(dropTargetProps, monitor) {
|
6785 |
+
var _monitor$getItem2 = monitor.getItem(), node = _monitor$getItem2.node, path = _monitor$getItem2.path, treeIndex = _monitor$getItem2.treeIndex, result = {
|
6786 |
+
node: node,
|
6787 |
+
path: path,
|
6788 |
+
treeIndex: treeIndex,
|
6789 |
+
treeId: _this3.treeId,
|
6790 |
+
minimumTreeIndex: 0,
|
6791 |
+
depth: 0
|
6792 |
+
};
|
6793 |
+
return _this3.drop(result), result;
|
6794 |
+
}
|
6795 |
+
};
|
6796 |
+
return (0, _reactDnd.DropTarget)(this.dndType, placeholderDropTarget, placeholderPropInjection)(el);
|
6797 |
+
}
|
6798 |
+
}, {
|
6799 |
+
key: "startDrag",
|
6800 |
+
get: function() {
|
6801 |
+
return this.treeRef.startDrag;
|
6802 |
+
}
|
6803 |
+
}, {
|
6804 |
+
key: "dragHover",
|
6805 |
+
get: function() {
|
6806 |
+
return this.treeRef.dragHover;
|
6807 |
+
}
|
6808 |
+
}, {
|
6809 |
+
key: "endDrag",
|
6810 |
+
get: function() {
|
6811 |
+
return this.treeRef.endDrag;
|
6812 |
+
}
|
6813 |
+
}, {
|
6814 |
+
key: "drop",
|
6815 |
+
get: function() {
|
6816 |
+
return this.treeRef.drop;
|
6817 |
+
}
|
6818 |
+
}, {
|
6819 |
+
key: "treeId",
|
6820 |
+
get: function() {
|
6821 |
+
return this.treeRef.treeId;
|
6822 |
+
}
|
6823 |
+
}, {
|
6824 |
+
key: "dndType",
|
6825 |
+
get: function() {
|
6826 |
+
return this.treeRef.dndType;
|
6827 |
+
}
|
6828 |
+
}, {
|
6829 |
+
key: "treeData",
|
6830 |
+
get: function() {
|
6831 |
+
return this.treeRef.state.draggingTreeData || this.treeRef.props.treeData;
|
6832 |
+
}
|
6833 |
+
}, {
|
6834 |
+
key: "getNodeKey",
|
6835 |
+
get: function() {
|
6836 |
+
return this.treeRef.props.getNodeKey;
|
6837 |
+
}
|
6838 |
+
}, {
|
6839 |
+
key: "customCanDrop",
|
6840 |
+
get: function() {
|
6841 |
+
return this.treeRef.props.canDrop;
|
6842 |
+
}
|
6843 |
+
}, {
|
6844 |
+
key: "maxDepth",
|
6845 |
+
get: function() {
|
6846 |
+
return this.treeRef.props.maxDepth;
|
6847 |
+
}
|
6848 |
+
} ], [ {
|
6849 |
+
key: "wrapRoot",
|
6850 |
+
value: function(el) {
|
6851 |
+
return (0, _reactDnd.DragDropContext)(_reactDndHtml5Backend2.default)(el);
|
6852 |
+
}
|
6853 |
+
} ]), DndManager;
|
6854 |
+
}();
|
6855 |
+
exports.default = DndManager;
|
6856 |
+
}, /* 28 */
|
6857 |
+
/***/
|
6858 |
+
function(module, exports) {
|
6859 |
+
module.exports = __webpack_require__(96);
|
6860 |
+
}, /* 29 */
|
6861 |
+
/***/
|
6862 |
+
function(module, exports) {
|
6863 |
+
module.exports = __webpack_require__(174);
|
6864 |
+
}, /* 30 */
|
6865 |
+
/***/
|
6866 |
+
function(module, exports) {
|
6867 |
+
module.exports = __webpack_require__(11);
|
6868 |
+
}, /* 31 */
|
6869 |
+
/***/
|
6870 |
+
function(module, exports, __webpack_require__) {
|
6871 |
+
// style-loader: Adds some css to the DOM by adding a <style> tag
|
6872 |
+
// load the styles
|
6873 |
+
var content = __webpack_require__(32);
|
6874 |
+
"string" == typeof content && (content = [ [ module.i, content, "" ] ]);
|
6875 |
+
// Prepare cssTransformation
|
6876 |
+
var options = {
|
6877 |
+
insertAt: "top",
|
6878 |
+
hmr: !0
|
6879 |
+
};
|
6880 |
+
options.transform = void 0;
|
6881 |
+
// add the styles to the DOM
|
6882 |
+
__webpack_require__(4)(content, options);
|
6883 |
+
content.locals && (module.exports = content.locals);
|
6884 |
+
}, /* 32 */
|
6885 |
+
/***/
|
6886 |
+
function(module, exports, __webpack_require__) {
|
6887 |
+
exports = module.exports = __webpack_require__(3)(!1), // imports
|
6888 |
+
// module
|
6889 |
+
exports.push([ module.i, "/**\n * The container holding the VirtualScroll\n */\n.rst__tree {\n /*! This comment keeps Sass from deleting the empty rule */ }\n\n/**\n * Extra class applied to VirtualScroll through className prop\n */\n.rst__virtualScrollOverride {\n overflow: auto !important; }\n .rst__virtualScrollOverride * {\n -webkit-box-sizing: border-box;\n box-sizing: border-box; }\n\n.ReactVirtualized__Grid__innerScrollContainer {\n overflow: visible !important; }\n\n.ReactVirtualized__Grid {\n outline: none; }\n", "" ]),
|
6890 |
+
// exports
|
6891 |
+
exports.locals = {
|
6892 |
+
tree: "rst__tree",
|
6893 |
+
virtualScrollOverride: "rst__virtualScrollOverride"
|
6894 |
+
};
|
6895 |
+
} ]);
|
6896 |
+
});
|
6897 |
+
|
6898 |
+
/***/ }),
|
6899 |
+
/* 92 */
|
6900 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6901 |
+
|
6902 |
+
"use strict";
|
6903 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__ = __webpack_require__(47);
|
6904 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties__);
|
6905 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__ = __webpack_require__(2);
|
6906 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck__);
|
6907 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__ = __webpack_require__(3);
|
6908 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass__);
|
6909 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__CellSizeAndPositionManager__ = __webpack_require__(253);
|
6910 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__maxElementSize_js__ = __webpack_require__(254);
|
6911 |
+
|
6912 |
+
|
6913 |
+
|
6914 |
+
|
6915 |
+
var babelPluginFlowReactPropTypes_proptype_VisibleCellRange = __webpack_require__(9).babelPluginFlowReactPropTypes_proptype_VisibleCellRange || __webpack_require__(0).any;
|
6916 |
+
|
6917 |
+
var babelPluginFlowReactPropTypes_proptype_CellSizeGetter = __webpack_require__(9).babelPluginFlowReactPropTypes_proptype_CellSizeGetter || __webpack_require__(0).any;
|
6918 |
+
|
6919 |
+
var babelPluginFlowReactPropTypes_proptype_Alignment = __webpack_require__(9).babelPluginFlowReactPropTypes_proptype_Alignment || __webpack_require__(0).any;
|
6920 |
+
|
6921 |
+
|
6922 |
+
|
6923 |
+
|
6924 |
+
/**
|
6925 |
+
* Browsers have scroll offset limitations (eg Chrome stops scrolling at ~33.5M pixels where as Edge tops out at ~1.5M pixels).
|
6926 |
+
* After a certain position, the browser won't allow the user to scroll further (even via JavaScript scroll offset adjustments).
|
6927 |
+
* This util picks a lower ceiling for max size and artificially adjusts positions within to make it transparent for users.
|
6928 |
+
*/
|
6929 |
+
|
6930 |
+
/**
|
6931 |
+
* Extends CellSizeAndPositionManager and adds scaling behavior for lists that are too large to fit within a browser's native limits.
|
6932 |
+
*/
|
6933 |
+
var ScalingCellSizeAndPositionManager = function () {
|
6934 |
+
function ScalingCellSizeAndPositionManager(_ref) {
|
6935 |
+
var _ref$maxScrollSize = _ref.maxScrollSize,
|
6936 |
+
maxScrollSize = _ref$maxScrollSize === undefined ? Object(__WEBPACK_IMPORTED_MODULE_4__maxElementSize_js__["a" /* getMaxElementSize */])() : _ref$maxScrollSize,
|
6937 |
+
params = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_objectWithoutProperties___default()(_ref, ['maxScrollSize']);
|
6938 |
+
|
6939 |
+
__WEBPACK_IMPORTED_MODULE_1_babel_runtime_helpers_classCallCheck___default()(this, ScalingCellSizeAndPositionManager);
|
6940 |
+
|
6941 |
+
// Favor composition over inheritance to simplify IE10 support
|
6942 |
+
this._cellSizeAndPositionManager = new __WEBPACK_IMPORTED_MODULE_3__CellSizeAndPositionManager__["a" /* default */](params);
|
6943 |
+
this._maxScrollSize = maxScrollSize;
|
6944 |
+
}
|
6945 |
+
|
6946 |
+
__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_createClass___default()(ScalingCellSizeAndPositionManager, [{
|
6947 |
+
key: 'areOffsetsAdjusted',
|
6948 |
+
value: function areOffsetsAdjusted() {
|
6949 |
+
return this._cellSizeAndPositionManager.getTotalSize() > this._maxScrollSize;
|
6950 |
+
}
|
6951 |
+
}, {
|
6952 |
+
key: 'configure',
|
6953 |
+
value: function configure(params) {
|
6954 |
+
this._cellSizeAndPositionManager.configure(params);
|
6955 |
+
}
|
6956 |
+
}, {
|
6957 |
+
key: 'getCellCount',
|
6958 |
+
value: function getCellCount() {
|
6959 |
+
return this._cellSizeAndPositionManager.getCellCount();
|
6960 |
+
}
|
6961 |
+
}, {
|
6962 |
+
key: 'getEstimatedCellSize',
|
6963 |
+
value: function getEstimatedCellSize() {
|
6964 |
+
return this._cellSizeAndPositionManager.getEstimatedCellSize();
|
6965 |
+
}
|
6966 |
+
}, {
|
6967 |
+
key: 'getLastMeasuredIndex',
|
6968 |
+
value: function getLastMeasuredIndex() {
|
6969 |
+
return this._cellSizeAndPositionManager.getLastMeasuredIndex();
|
6970 |
+
}
|
6971 |
+
|
6972 |
+
/**
|
6973 |
+
* Number of pixels a cell at the given position (offset) should be shifted in order to fit within the scaled container.
|
6974 |
+
* The offset passed to this function is scaled (safe) as well.
|
6975 |
+
*/
|
6976 |
+
|
6977 |
+
}, {
|
6978 |
+
key: 'getOffsetAdjustment',
|
6979 |
+
value: function getOffsetAdjustment(_ref2) {
|
6980 |
+
var containerSize = _ref2.containerSize,
|
6981 |
+
offset = _ref2.offset;
|
6982 |
+
|
6983 |
+
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
6984 |
+
var safeTotalSize = this.getTotalSize();
|
6985 |
+
var offsetPercentage = this._getOffsetPercentage({
|
6986 |
+
containerSize: containerSize,
|
6987 |
+
offset: offset,
|
6988 |
+
totalSize: safeTotalSize
|
6989 |
+
});
|
6990 |
+
|
6991 |
+
return Math.round(offsetPercentage * (safeTotalSize - totalSize));
|
6992 |
+
}
|
6993 |
+
}, {
|
6994 |
+
key: 'getSizeAndPositionOfCell',
|
6995 |
+
value: function getSizeAndPositionOfCell(index) {
|
6996 |
+
return this._cellSizeAndPositionManager.getSizeAndPositionOfCell(index);
|
6997 |
+
}
|
6998 |
+
}, {
|
6999 |
+
key: 'getSizeAndPositionOfLastMeasuredCell',
|
7000 |
+
value: function getSizeAndPositionOfLastMeasuredCell() {
|
7001 |
+
return this._cellSizeAndPositionManager.getSizeAndPositionOfLastMeasuredCell();
|
7002 |
+
}
|
7003 |
+
|
7004 |
+
/** See CellSizeAndPositionManager#getTotalSize */
|
7005 |
+
|
7006 |
+
}, {
|
7007 |
+
key: 'getTotalSize',
|
7008 |
+
value: function getTotalSize() {
|
7009 |
+
return Math.min(this._maxScrollSize, this._cellSizeAndPositionManager.getTotalSize());
|
7010 |
+
}
|
7011 |
+
|
7012 |
+
/** See CellSizeAndPositionManager#getUpdatedOffsetForIndex */
|
7013 |
+
|
7014 |
+
}, {
|
7015 |
+
key: 'getUpdatedOffsetForIndex',
|
7016 |
+
value: function getUpdatedOffsetForIndex(_ref3) {
|
7017 |
+
var _ref3$align = _ref3.align,
|
7018 |
+
align = _ref3$align === undefined ? 'auto' : _ref3$align,
|
7019 |
+
containerSize = _ref3.containerSize,
|
7020 |
+
currentOffset = _ref3.currentOffset,
|
7021 |
+
targetIndex = _ref3.targetIndex;
|
7022 |
+
|
7023 |
+
currentOffset = this._safeOffsetToOffset({
|
7024 |
+
containerSize: containerSize,
|
7025 |
+
offset: currentOffset
|
7026 |
+
});
|
7027 |
+
|
7028 |
+
var offset = this._cellSizeAndPositionManager.getUpdatedOffsetForIndex({
|
7029 |
+
align: align,
|
7030 |
+
containerSize: containerSize,
|
7031 |
+
currentOffset: currentOffset,
|
7032 |
+
targetIndex: targetIndex
|
7033 |
+
});
|
7034 |
+
|
7035 |
+
return this._offsetToSafeOffset({
|
7036 |
+
containerSize: containerSize,
|
7037 |
+
offset: offset
|
7038 |
+
});
|
7039 |
+
}
|
7040 |
+
|
7041 |
+
/** See CellSizeAndPositionManager#getVisibleCellRange */
|
7042 |
+
|
7043 |
+
}, {
|
7044 |
+
key: 'getVisibleCellRange',
|
7045 |
+
value: function getVisibleCellRange(_ref4) {
|
7046 |
+
var containerSize = _ref4.containerSize,
|
7047 |
+
offset = _ref4.offset;
|
7048 |
+
|
7049 |
+
offset = this._safeOffsetToOffset({
|
7050 |
+
containerSize: containerSize,
|
7051 |
+
offset: offset
|
7052 |
+
});
|
7053 |
+
|
7054 |
+
return this._cellSizeAndPositionManager.getVisibleCellRange({
|
7055 |
+
containerSize: containerSize,
|
7056 |
+
offset: offset
|
7057 |
+
});
|
7058 |
+
}
|
7059 |
+
}, {
|
7060 |
+
key: 'resetCell',
|
7061 |
+
value: function resetCell(index) {
|
7062 |
+
this._cellSizeAndPositionManager.resetCell(index);
|
7063 |
+
}
|
7064 |
+
}, {
|
7065 |
+
key: '_getOffsetPercentage',
|
7066 |
+
value: function _getOffsetPercentage(_ref5) {
|
7067 |
+
var containerSize = _ref5.containerSize,
|
7068 |
+
offset = _ref5.offset,
|
7069 |
+
totalSize = _ref5.totalSize;
|
7070 |
+
|
7071 |
+
return totalSize <= containerSize ? 0 : offset / (totalSize - containerSize);
|
7072 |
+
}
|
7073 |
+
}, {
|
7074 |
+
key: '_offsetToSafeOffset',
|
7075 |
+
value: function _offsetToSafeOffset(_ref6) {
|
7076 |
+
var containerSize = _ref6.containerSize,
|
7077 |
+
offset = _ref6.offset;
|
7078 |
+
|
7079 |
+
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
7080 |
+
var safeTotalSize = this.getTotalSize();
|
7081 |
+
|
7082 |
+
if (totalSize === safeTotalSize) {
|
7083 |
+
return offset;
|
7084 |
+
} else {
|
7085 |
+
var offsetPercentage = this._getOffsetPercentage({
|
7086 |
+
containerSize: containerSize,
|
7087 |
+
offset: offset,
|
7088 |
+
totalSize: totalSize
|
7089 |
+
});
|
7090 |
+
|
7091 |
+
return Math.round(offsetPercentage * (safeTotalSize - containerSize));
|
7092 |
+
}
|
7093 |
+
}
|
7094 |
+
}, {
|
7095 |
+
key: '_safeOffsetToOffset',
|
7096 |
+
value: function _safeOffsetToOffset(_ref7) {
|
7097 |
+
var containerSize = _ref7.containerSize,
|
7098 |
+
offset = _ref7.offset;
|
7099 |
+
|
7100 |
+
var totalSize = this._cellSizeAndPositionManager.getTotalSize();
|
7101 |
+
var safeTotalSize = this.getTotalSize();
|
7102 |
+
|
7103 |
+
if (totalSize === safeTotalSize) {
|
7104 |
+
return offset;
|
7105 |
+
} else {
|
7106 |
+
var offsetPercentage = this._getOffsetPercentage({
|
7107 |
+
containerSize: containerSize,
|
7108 |
+
offset: offset,
|
7109 |
+
totalSize: safeTotalSize
|
7110 |
+
});
|
7111 |
+
|
7112 |
+
return Math.round(offsetPercentage * (totalSize - containerSize));
|
7113 |
+
}
|
7114 |
+
}
|
7115 |
+
}]);
|
7116 |
+
|
7117 |
+
return ScalingCellSizeAndPositionManager;
|
7118 |
+
}();
|
7119 |
+
|
7120 |
+
/* harmony default export */ __webpack_exports__["a"] = (ScalingCellSizeAndPositionManager);
|
7121 |
+
|
7122 |
+
/***/ }),
|
7123 |
+
/* 93 */
|
7124 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7125 |
+
|
7126 |
+
"use strict";
|
7127 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = createCallbackMemoizer;
|
7128 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys__ = __webpack_require__(46);
|
7129 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys__);
|
7130 |
+
|
7131 |
+
/**
|
7132 |
+
* Helper utility that updates the specified callback whenever any of the specified indices have changed.
|
7133 |
+
*/
|
7134 |
+
function createCallbackMemoizer() {
|
7135 |
+
var requireAllKeys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
|
7136 |
+
|
7137 |
+
var cachedIndices = {};
|
7138 |
+
|
7139 |
+
return function (_ref) {
|
7140 |
+
var callback = _ref.callback,
|
7141 |
+
indices = _ref.indices;
|
7142 |
+
|
7143 |
+
var keys = __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default()(indices);
|
7144 |
+
var allInitialized = !requireAllKeys || keys.every(function (key) {
|
7145 |
+
var value = indices[key];
|
7146 |
+
return Array.isArray(value) ? value.length > 0 : value >= 0;
|
7147 |
+
});
|
7148 |
+
var indexChanged = keys.length !== __WEBPACK_IMPORTED_MODULE_0_babel_runtime_core_js_object_keys___default()(cachedIndices).length || keys.some(function (key) {
|
7149 |
+
var cachedValue = cachedIndices[key];
|
7150 |
+
var value = indices[key];
|
7151 |
+
|
7152 |
+
return Array.isArray(value) ? cachedValue.join(',') !== value.join(',') : cachedValue !== value;
|
7153 |
+
});
|
7154 |
+
|
7155 |
+
cachedIndices = indices;
|
7156 |
+
|
7157 |
+
if (allInitialized && indexChanged) {
|
7158 |
+
callback(indices);
|
7159 |
+
}
|
7160 |
+
};
|
7161 |
+
}
|
7162 |
+
|
7163 |
+
/***/ }),
|
7164 |
+
/* 94 */
|
7165 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7166 |
+
|
7167 |
+
"use strict";
|
7168 |
+
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
7169 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(1);
|
7170 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
7171 |
+
|
7172 |
+
|
7173 |
+
var babelPluginFlowReactPropTypes_proptype_RowRendererParams = {
|
7174 |
+
index: __webpack_require__(0).number.isRequired,
|
7175 |
+
isScrolling: __webpack_require__(0).bool.isRequired,
|
7176 |
+
isVisible: __webpack_require__(0).bool.isRequired,
|
7177 |
+
key: __webpack_require__(0).string.isRequired,
|
7178 |
+
parent: __webpack_require__(0).object.isRequired,
|
7179 |
+
style: __webpack_require__(0).object.isRequired
|
7180 |
+
};
|
7181 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RowRendererParams', {
|
7182 |
+
value: babelPluginFlowReactPropTypes_proptype_RowRendererParams,
|
7183 |
+
configurable: true
|
7184 |
+
});
|
7185 |
+
|
7186 |
+
var babelPluginFlowReactPropTypes_proptype_RowRenderer = __webpack_require__(0).func;
|
7187 |
+
|
7188 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RowRenderer', {
|
7189 |
+
value: babelPluginFlowReactPropTypes_proptype_RowRenderer,
|
7190 |
+
configurable: true
|
7191 |
+
});
|
7192 |
+
var babelPluginFlowReactPropTypes_proptype_RenderedRows = {
|
7193 |
+
overscanStartIndex: __webpack_require__(0).number.isRequired,
|
7194 |
+
overscanStopIndex: __webpack_require__(0).number.isRequired,
|
7195 |
+
startIndex: __webpack_require__(0).number.isRequired,
|
7196 |
+
stopIndex: __webpack_require__(0).number.isRequired
|
7197 |
+
};
|
7198 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_RenderedRows', {
|
7199 |
+
value: babelPluginFlowReactPropTypes_proptype_RenderedRows,
|
7200 |
+
configurable: true
|
7201 |
+
});
|
7202 |
+
var babelPluginFlowReactPropTypes_proptype_Scroll = {
|
7203 |
+
clientHeight: __webpack_require__(0).number.isRequired,
|
7204 |
+
scrollHeight: __webpack_require__(0).number.isRequired,
|
7205 |
+
scrollTop: __webpack_require__(0).number.isRequired
|
7206 |
+
};
|
7207 |
+
if (typeof exports !== 'undefined') Object.defineProperty(exports, 'babelPluginFlowReactPropTypes_proptype_Scroll', {
|
7208 |
+
value: babelPluginFlowReactPropTypes_proptype_Scroll,
|
7209 |
+
configurable: true
|
7210 |
+
});
|
7211 |
+
|
7212 |
+
/***/ }),
|
7213 |
+
/* 95 */
|
7214 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7215 |
+
|
7216 |
+
"use strict";
|
7217 |
+
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
7218 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_SCROLLING_RESET_TIME_INTERVAL", function() { return DEFAULT_SCROLLING_RESET_TIME_INTERVAL; });
|
7219 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__ = __webpack_require__(4);
|
7220 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_babel_runtime_helpers_extends__);
|
7221 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__ = __webpack_require__(8);
|
7222 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_babel_runtime_core_js_object_get_prototype_of__);
|
7223 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__ = __webpack_require__(2);
|
7224 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_babel_runtime_helpers_classCallCheck__);
|
7225 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__ = __webpack_require__(3);
|
7226 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_babel_runtime_helpers_createClass__);
|
7227 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(5);
|
7228 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_babel_runtime_helpers_possibleConstructorReturn__);
|
7229 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__ = __webpack_require__(6);
|
7230 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_babel_runtime_helpers_inherits__);
|
7231 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react__ = __webpack_require__(1);
|
7232 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_react__);
|
7233 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames__ = __webpack_require__(21);
|
7234 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames___default = __webpack_req
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|