Version Description
View Release Notes
- Added: woocommerce 3.0 compat
- Added: badgeos compat
- Added: UI improvements in widget manager
Download this release
Release Info
Developer | intoxstudio |
Plugin | Content Aware Sidebars – Unlimited Widget Areas |
Version | 3.5.2 |
Comparing to | |
See all releases |
Code changes from version 3.4.3 to 3.5.2
- admin/admin.php +46 -11
- admin/db-updates.php +33 -0
- admin/post_type_sidebar.php +50 -25
- admin/screen_widgets.php +81 -6
- admin/sidebar-edit.php +63 -29
- admin/sidebar-list-table.php +14 -2
- admin/sidebar-overview.php +49 -37
- app.php +1 -4
- changelog.txt +27 -0
- content-aware-sidebars.php +2 -2
- css/select2/index.php +0 -2
- css/select2/select2-spinner.gif +0 -0
- css/select2/select2.css +0 -774
- css/select2/select2.png +0 -0
- css/style.css +1 -1
- freemius.php +5 -2
- js/select2.min.js +0 -23
- js/suggest-sidebars.js +22 -29
- js/suggest-sidebars.min.js +1 -1
- js/widgets.js +40 -4
- js/widgets.min.js +1 -1
- lang/content-aware-sidebars-ar.po +734 -734
- lang/content-aware-sidebars-bg_BG.po +712 -712
- lang/content-aware-sidebars-ca.po +712 -712
- lang/content-aware-sidebars-cs_CZ.po +716 -716
- lang/content-aware-sidebars-da_DK.po +712 -712
- lang/content-aware-sidebars-de_DE.po +716 -716
- lang/content-aware-sidebars-el.po +712 -712
- lang/content-aware-sidebars-es_ES.po +713 -713
- lang/content-aware-sidebars-et.po +711 -711
- lang/content-aware-sidebars-eu.po +711 -711
- lang/content-aware-sidebars-fa_IR.po +707 -707
- lang/content-aware-sidebars-fi.po +711 -711
- lang/content-aware-sidebars-fr_CA.po +711 -711
- lang/content-aware-sidebars-fr_FR.po +713 -713
- lang/content-aware-sidebars-he_IL.po +711 -711
- lang/content-aware-sidebars-hr.po +717 -717
- lang/content-aware-sidebars-hu_HU.po +711 -711
- lang/content-aware-sidebars-id_ID.po +706 -706
- lang/content-aware-sidebars-it_IT.po +712 -712
- lang/content-aware-sidebars-ja.po +298 -707
admin/admin.php
CHANGED
@@ -21,8 +21,13 @@ abstract class CAS_Admin {
|
|
21 |
protected $_screen;
|
22 |
|
23 |
public function __construct() {
|
24 |
-
|
25 |
-
|
|
|
|
|
|
|
|
|
|
|
26 |
}
|
27 |
|
28 |
/**
|
@@ -33,13 +38,26 @@ abstract class CAS_Admin {
|
|
33 |
public function add_menu() {
|
34 |
$this->_screen = $this->get_screen();
|
35 |
add_action('load-'.$this->_screen,
|
36 |
-
array($this,'
|
37 |
-
add_action('load-'.$this->_screen,
|
38 |
-
array($this,'add_scripts_styles'));
|
39 |
-
add_action('load-'.$this->_screen,
|
40 |
-
array($this,'prepare_upgrade_modal'));
|
41 |
}
|
42 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
43 |
/**
|
44 |
* Get current screen
|
45 |
*
|
@@ -56,6 +74,14 @@ abstract class CAS_Admin {
|
|
56 |
*/
|
57 |
abstract public function prepare_screen();
|
58 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
59 |
/**
|
60 |
* Register and enqueue scripts styles
|
61 |
* for screen
|
@@ -70,7 +96,16 @@ abstract class CAS_Admin {
|
|
70 |
* @since 3.4.1
|
71 |
* @return void
|
72 |
*/
|
73 |
-
public function
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
74 |
if ( cas_fs()->is_not_paying() ) {
|
75 |
add_thickbox();
|
76 |
//enqueue scripts here
|
@@ -93,15 +128,15 @@ abstract class CAS_Admin {
|
|
93 |
__('Time Schedule','content-aware-sidebars'),
|
94 |
__('Sync widgets across themes','content-aware-sidebars')
|
95 |
);
|
96 |
-
echo '<a style="display:none;" class="thickbox js-cas-pro-popup" href="#TB_inline?width=
|
97 |
echo '<div id="pro-popup-notice" style="display:none;">';
|
98 |
echo '<img style="margin-top:15px;" class="alignright" src="'.plugins_url('../css/icon.png', __FILE__).'" width="128" height="128" />';
|
99 |
echo '
|
100 |
<h2>'.__('Get All Features With Content Aware Sidebars Pro','content-aware-sidebars').'</h2>';
|
101 |
-
echo '<p>'.sprintf(__('
|
102 |
echo '<p>'.__('You can upgrade without leaving the admin panel by clicking below.','content-aware-sidebars');
|
103 |
echo '<br />'.__('Free updates and email support included.','content-aware-sidebars').'</p>';
|
104 |
-
echo '<p><a class="button-primary" target="_blank" href="'.esc_url(cas_fs()->get_upgrade_url()).'">'.__('
|
105 |
echo '</div>';
|
106 |
}
|
107 |
|
21 |
protected $_screen;
|
22 |
|
23 |
public function __construct() {
|
24 |
+
if(is_admin()) {
|
25 |
+
add_action('admin_menu',
|
26 |
+
array($this,'add_menu'),99);
|
27 |
+
$this->admin_hooks();
|
28 |
+
} else {
|
29 |
+
$this->frontend_hooks();
|
30 |
+
}
|
31 |
}
|
32 |
|
33 |
/**
|
38 |
public function add_menu() {
|
39 |
$this->_screen = $this->get_screen();
|
40 |
add_action('load-'.$this->_screen,
|
41 |
+
array($this,'load_screen'));
|
|
|
|
|
|
|
|
|
42 |
}
|
43 |
|
44 |
+
/**
|
45 |
+
* Add filters and actions for admin dashboard
|
46 |
+
* e.g. AJAX calls
|
47 |
+
*
|
48 |
+
* @since 3.5
|
49 |
+
* @return void
|
50 |
+
*/
|
51 |
+
abstract public function admin_hooks();
|
52 |
+
|
53 |
+
/**
|
54 |
+
* Add filters and actions for frontend
|
55 |
+
*
|
56 |
+
* @since 3.5
|
57 |
+
* @return void
|
58 |
+
*/
|
59 |
+
abstract public function frontend_hooks();
|
60 |
+
|
61 |
/**
|
62 |
* Get current screen
|
63 |
*
|
74 |
*/
|
75 |
abstract public function prepare_screen();
|
76 |
|
77 |
+
/**
|
78 |
+
* Authorize user for screen
|
79 |
+
*
|
80 |
+
* @since 3.5
|
81 |
+
* @return boolean
|
82 |
+
*/
|
83 |
+
abstract public function authorize_user();
|
84 |
+
|
85 |
/**
|
86 |
* Register and enqueue scripts styles
|
87 |
* for screen
|
96 |
* @since 3.4.1
|
97 |
* @return void
|
98 |
*/
|
99 |
+
public function load_screen() {
|
100 |
+
if(!$this->authorize_user()) {
|
101 |
+
wp_die(
|
102 |
+
'<p>' . __( 'You do not have access to this screen.', 'content-aware-sidebars' ) . '</p>',
|
103 |
+
403
|
104 |
+
);
|
105 |
+
}
|
106 |
+
$this->prepare_screen();
|
107 |
+
add_action('admin_enqueue_scripts',
|
108 |
+
array($this,'add_scripts_styles'),11);
|
109 |
if ( cas_fs()->is_not_paying() ) {
|
110 |
add_thickbox();
|
111 |
//enqueue scripts here
|
128 |
__('Time Schedule','content-aware-sidebars'),
|
129 |
__('Sync widgets across themes','content-aware-sidebars')
|
130 |
);
|
131 |
+
echo '<a style="display:none;" class="thickbox js-cas-pro-popup" href="#TB_inline?width=600&height=235&inlineId=pro-popup-notice" title="'.__('Content Aware Sidebars Pro','content-aware-sidebars').'"></a>';
|
132 |
echo '<div id="pro-popup-notice" style="display:none;">';
|
133 |
echo '<img style="margin-top:15px;" class="alignright" src="'.plugins_url('../css/icon.png', __FILE__).'" width="128" height="128" />';
|
134 |
echo '
|
135 |
<h2>'.__('Get All Features With Content Aware Sidebars Pro','content-aware-sidebars').'</h2>';
|
136 |
+
echo '<p>'.sprintf(__('Enhance your sidebars and widget areas with: %s and more.','content-aware-sidebars'),strtolower(implode(', ', $features))).'</p>';
|
137 |
echo '<p>'.__('You can upgrade without leaving the admin panel by clicking below.','content-aware-sidebars');
|
138 |
echo '<br />'.__('Free updates and email support included.','content-aware-sidebars').'</p>';
|
139 |
+
echo '<p><a class="button-primary" target="_blank" href="'.esc_url(cas_fs()->get_upgrade_url()).'">'.__('Upgrade Now','content-aware-sidebars').'</a> <a href="" class="button-secondary js-cas-pro-read-more" target="_blank" href="">'.__('Read More','content-aware-sidebars').'</a></p>';
|
140 |
echo '</div>';
|
141 |
}
|
142 |
|
admin/db-updates.php
CHANGED
@@ -18,6 +18,39 @@ $cas_db_updater->register_version_update('2.0','cas_update_to_20');
|
|
18 |
$cas_db_updater->register_version_update('3.0','cas_update_to_30');
|
19 |
$cas_db_updater->register_version_update('3.1','cas_update_to_31');
|
20 |
$cas_db_updater->register_version_update('3.4','cas_update_to_34');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21 |
|
22 |
/**
|
23 |
* Version 3.3.3 -> 3.4
|
18 |
$cas_db_updater->register_version_update('3.0','cas_update_to_30');
|
19 |
$cas_db_updater->register_version_update('3.1','cas_update_to_31');
|
20 |
$cas_db_updater->register_version_update('3.4','cas_update_to_34');
|
21 |
+
$cas_db_updater->register_version_update('3.5.1','cas_update_to_351');
|
22 |
+
|
23 |
+
/**
|
24 |
+
* Update to version 3.5.1
|
25 |
+
* Simplify auto select option
|
26 |
+
* Remove old review data
|
27 |
+
*
|
28 |
+
* @since 3.5.1
|
29 |
+
* @return boolean
|
30 |
+
*/
|
31 |
+
function cas_update_to_351() {
|
32 |
+
global $wpdb;
|
33 |
+
|
34 |
+
$group_ids = $wpdb->get_col("SELECT post_id FROM $wpdb->postmeta WHERE meta_value LIKE '_ca_sub_%'");
|
35 |
+
foreach ($group_ids as $group_id) {
|
36 |
+
add_post_meta($group_id,'_ca_autoselect',1,true);
|
37 |
+
}
|
38 |
+
|
39 |
+
$wpdb->query("
|
40 |
+
DELETE FROM $wpdb->postmeta
|
41 |
+
WHERE meta_value LIKE '_ca_sub_%'
|
42 |
+
");
|
43 |
+
|
44 |
+
$wpdb->query("
|
45 |
+
DELETE FROM $wpdb->usermeta
|
46 |
+
WHERE meta_key = 'wp__ca_cas_review'
|
47 |
+
AND meta_value != '1'
|
48 |
+
AND CAST(meta_value AS DECIMAL) <= 1459468800
|
49 |
+
");
|
50 |
+
|
51 |
+
return true;
|
52 |
+
}
|
53 |
+
|
54 |
|
55 |
/**
|
56 |
* Version 3.3.3 -> 3.4
|
admin/post_type_sidebar.php
CHANGED
@@ -33,9 +33,11 @@ class CAS_Post_Type_Sidebar {
|
|
33 |
array(__CLASS__,'create_meta_boxes'));
|
34 |
add_action('save_post_'.$post_type->name,
|
35 |
array(__CLASS__,'save_post_sidebars'),10,2);
|
36 |
-
add_action('admin_enqueue_scripts',
|
37 |
-
array(__CLASS__,'enqueue_scripts'),8);
|
38 |
}
|
|
|
|
|
|
|
|
|
39 |
}
|
40 |
}
|
41 |
|
@@ -52,8 +54,7 @@ class CAS_Post_Type_Sidebar {
|
|
52 |
//todo: check for cas id, issue after switching themes
|
53 |
self::$_theme_sidebars[$sidebar['id']] = array(
|
54 |
'label' => $sidebar['name'],
|
55 |
-
'options' => array()
|
56 |
-
'select' => array()
|
57 |
);
|
58 |
}
|
59 |
}
|
@@ -96,7 +97,8 @@ class CAS_Post_Type_Sidebar {
|
|
96 |
$user_can_create_sidebar = current_user_can(CAS_App::CAPABILITY);
|
97 |
|
98 |
foreach ($new as $host => $sidebar_id_string) {
|
99 |
-
|
|
|
100 |
foreach ($sidebar_ids as $sidebar_id) {
|
101 |
//Post has sidebar already
|
102 |
if(isset($relations[$sidebar_id])) {
|
@@ -202,13 +204,13 @@ class CAS_Post_Type_Sidebar {
|
|
202 |
foreach ($sidebars as $sidebar) {
|
203 |
$host_id = $host_meta->get_data($sidebar->ID);
|
204 |
if(isset(self::$_theme_sidebars[$host_id])) {
|
205 |
-
self::$_theme_sidebars[$host_id]['options'][] = array(
|
206 |
'id' => $sidebar->ID,
|
207 |
'text' => $sidebar->post_title.self::sidebar_states($sidebar)
|
208 |
);
|
209 |
}
|
210 |
if(isset($post_sidebars[$sidebar->ID])) {
|
211 |
-
self::$_theme_sidebars[$host_id]['
|
212 |
}
|
213 |
}
|
214 |
|
@@ -218,11 +220,10 @@ class CAS_Post_Type_Sidebar {
|
|
218 |
'labelNew' => __('New','content-aware-sidebars')
|
219 |
);
|
220 |
if($labels['canCreate']) {
|
221 |
-
$labels['notFound'] = __('Type to Add New Sidebar');
|
222 |
} else {
|
223 |
-
$labels['notFound'] = __('No sidebars found');
|
224 |
}
|
225 |
-
$labels['sidebars'] = self::$_theme_sidebars;
|
226 |
wp_localize_script('cas/sidebars/suggest', 'CAS', $labels);
|
227 |
|
228 |
$post_type = get_post_type_object($post->post_type);
|
@@ -253,7 +254,14 @@ class CAS_Post_Type_Sidebar {
|
|
253 |
|
254 |
echo '<div><label style="display:block;padding:8px 0 4px;font-weight:bold;" for="ca_sidebars_'.$id.'">'.$sidebar['label'].'</label>';
|
255 |
|
256 |
-
echo '<
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
257 |
$i++;
|
258 |
}
|
259 |
if($i > $limit) {
|
@@ -290,28 +298,45 @@ class CAS_Post_Type_Sidebar {
|
|
290 |
return $status;
|
291 |
}
|
292 |
|
293 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
294 |
$screen = get_current_screen();
|
295 |
$module = WPCACore::modules()->get(self::MODULE_NAME);
|
296 |
|
297 |
if($screen->base == 'post' && $module->_post_types()->has($screen->post_type)) {
|
298 |
-
//we keep a select2 3.5 version because
|
299 |
-
//some plugins (woocommerce) depend on it
|
300 |
-
$select2 = 'select2';
|
301 |
wp_register_script(
|
302 |
-
|
303 |
-
plugins_url('/js/select2.min.js',
|
304 |
array('jquery'),
|
305 |
-
'
|
306 |
false
|
307 |
);
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
315 |
}
|
316 |
}
|
317 |
|
33 |
array(__CLASS__,'create_meta_boxes'));
|
34 |
add_action('save_post_'.$post_type->name,
|
35 |
array(__CLASS__,'save_post_sidebars'),10,2);
|
|
|
|
|
36 |
}
|
37 |
+
add_action('admin_enqueue_scripts',
|
38 |
+
array(__CLASS__,'register_scripts'),8);
|
39 |
+
add_action('admin_enqueue_scripts',
|
40 |
+
array(__CLASS__,'enqueue_scripts'),11);
|
41 |
}
|
42 |
}
|
43 |
|
54 |
//todo: check for cas id, issue after switching themes
|
55 |
self::$_theme_sidebars[$sidebar['id']] = array(
|
56 |
'label' => $sidebar['name'],
|
57 |
+
'options' => array()
|
|
|
58 |
);
|
59 |
}
|
60 |
}
|
97 |
$user_can_create_sidebar = current_user_can(CAS_App::CAPABILITY);
|
98 |
|
99 |
foreach ($new as $host => $sidebar_id_string) {
|
100 |
+
//$sidebar_ids = explode(',', $sidebar_id_string);
|
101 |
+
$sidebar_ids = $sidebar_id_string;
|
102 |
foreach ($sidebar_ids as $sidebar_id) {
|
103 |
//Post has sidebar already
|
104 |
if(isset($relations[$sidebar_id])) {
|
204 |
foreach ($sidebars as $sidebar) {
|
205 |
$host_id = $host_meta->get_data($sidebar->ID);
|
206 |
if(isset(self::$_theme_sidebars[$host_id])) {
|
207 |
+
self::$_theme_sidebars[$host_id]['options'][$sidebar->ID] = array(
|
208 |
'id' => $sidebar->ID,
|
209 |
'text' => $sidebar->post_title.self::sidebar_states($sidebar)
|
210 |
);
|
211 |
}
|
212 |
if(isset($post_sidebars[$sidebar->ID])) {
|
213 |
+
self::$_theme_sidebars[$host_id]['options'][$sidebar->ID]['select'] = 1;
|
214 |
}
|
215 |
}
|
216 |
|
220 |
'labelNew' => __('New','content-aware-sidebars')
|
221 |
);
|
222 |
if($labels['canCreate']) {
|
223 |
+
$labels['notFound'] = __('Type to Add New Sidebar','content-aware-sidebars');
|
224 |
} else {
|
225 |
+
$labels['notFound'] = __('No sidebars found','content-aware-sidebars');
|
226 |
}
|
|
|
227 |
wp_localize_script('cas/sidebars/suggest', 'CAS', $labels);
|
228 |
|
229 |
$post_type = get_post_type_object($post->post_type);
|
254 |
|
255 |
echo '<div><label style="display:block;padding:8px 0 4px;font-weight:bold;" for="ca_sidebars_'.$id.'">'.$sidebar['label'].'</label>';
|
256 |
|
257 |
+
echo '<select style="width:100%;" id="ca_sidebars_'.$id.'" class="js-cas-sidebars" name="cas_sidebars['.$id.'][]" multiple data-tags="'.$labels['canCreate'].'" data-placeholder="'.__('Default').'">';
|
258 |
+
foreach ($sidebar['options'] as $sidebar) {
|
259 |
+
echo '<option value="'.$sidebar['id'].'" '.selected(isset($sidebar['select']),true,false).'>'.$sidebar['text'].'</option>';
|
260 |
+
}
|
261 |
+
if($labels['canCreate']) {
|
262 |
+
echo '<option value="0" disabled="disabled">'.__('Type to Add New Sidebar','content-aware-sidebars').'</option>';
|
263 |
+
}
|
264 |
+
echo '</select></div>';
|
265 |
$i++;
|
266 |
}
|
267 |
if($i > $limit) {
|
298 |
return $status;
|
299 |
}
|
300 |
|
301 |
+
/**
|
302 |
+
* Register scripts and styles
|
303 |
+
* We register early to make sure our select2 comes first
|
304 |
+
*
|
305 |
+
* @since 3.5.2
|
306 |
+
* @param string $hook
|
307 |
+
* @return void
|
308 |
+
*/
|
309 |
+
public static function register_scripts($hook) {
|
310 |
$screen = get_current_screen();
|
311 |
$module = WPCACore::modules()->get(self::MODULE_NAME);
|
312 |
|
313 |
if($screen->base == 'post' && $module->_post_types()->has($screen->post_type)) {
|
|
|
|
|
|
|
314 |
wp_register_script(
|
315 |
+
'select2',
|
316 |
+
plugins_url('../lib/wp-content-aware-engine/assets/js/select2.min.js', __FILE__),
|
317 |
array('jquery'),
|
318 |
+
'4.0.3',
|
319 |
false
|
320 |
);
|
321 |
+
wp_register_script('cas/sidebars/suggest', plugins_url('/js/suggest-sidebars.min.js', dirname(__FILE__)), array('select2'), CAS_App::PLUGIN_VERSION, true);
|
322 |
+
}
|
323 |
+
}
|
324 |
+
|
325 |
+
/**
|
326 |
+
* Enqueue scripts and styles
|
327 |
+
* We enqueue later to make sure our CSS takes precedence
|
328 |
+
*
|
329 |
+
* @since 3.5.2
|
330 |
+
* @param string $hook
|
331 |
+
* @return void
|
332 |
+
*/
|
333 |
+
public static function enqueue_scripts($hook) {
|
334 |
+
$screen = get_current_screen();
|
335 |
+
$module = WPCACore::modules()->get(self::MODULE_NAME);
|
336 |
+
|
337 |
+
if($screen->base == 'post' && $module->_post_types()->has($screen->post_type)) {
|
338 |
+
wp_enqueue_style(CAS_App::META_PREFIX.'condition-groups');
|
339 |
+
wp_enqueue_script('cas/sidebars/suggest');
|
340 |
}
|
341 |
}
|
342 |
|
admin/screen_widgets.php
CHANGED
@@ -24,6 +24,16 @@ class CAS_Admin_Screen_Widgets extends CAS_Admin {
|
|
24 |
return 'widgets.php';
|
25 |
}
|
26 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27 |
/**
|
28 |
* Prepare screen load
|
29 |
*
|
@@ -35,6 +45,72 @@ class CAS_Admin_Screen_Widgets extends CAS_Admin {
|
|
35 |
array($this,'render_sidebar_controls'));
|
36 |
}
|
37 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
38 |
/**
|
39 |
* Render controls for custom sidebars
|
40 |
*
|
@@ -63,7 +139,7 @@ class CAS_Admin_Screen_Widgets extends CAS_Admin {
|
|
63 |
?>
|
64 |
<div class="cas-settings">
|
65 |
<div class="sidebar-status">
|
66 |
-
<input type="checkbox" class="
|
67 |
<label title="<?php echo $status; ?>" class="sidebar-status-label" for="cas-status-<?php echo $sidebar->ID; ?>">
|
68 |
</label>
|
69 |
</div>
|
@@ -81,19 +157,18 @@ class CAS_Admin_Screen_Widgets extends CAS_Admin {
|
|
81 |
* @since 3.4
|
82 |
*/
|
83 |
public function add_scripts_styles() {
|
84 |
-
|
85 |
-
wp_enqueue_style('cas/admin/style');
|
86 |
|
87 |
$sidebar = get_post_type_object(CAS_App::TYPE_SIDEBAR);
|
88 |
|
89 |
-
|
90 |
-
wp_enqueue_script('cas/admin/widgets');
|
91 |
wp_localize_script( 'cas/admin/widgets', 'CASAdmin', array(
|
92 |
'addNew' => $sidebar->labels->add_new_item,
|
93 |
'collapse' => __('Collapse','content-aware-sidebars'),
|
94 |
'expand' => __('Expand','content-aware-sidebars'),
|
95 |
'filterSidebars' => __('Filter Sidebars','content-aware-sidebars'),
|
96 |
-
'filterWidgets' => __('Filter Widgets', 'content-aware-sidebars')
|
|
|
97 |
));
|
98 |
}
|
99 |
|
24 |
return 'widgets.php';
|
25 |
}
|
26 |
|
27 |
+
/**
|
28 |
+
* Authorize user for screen
|
29 |
+
*
|
30 |
+
* @since 3.5
|
31 |
+
* @return boolean
|
32 |
+
*/
|
33 |
+
public function authorize_user() {
|
34 |
+
return true;
|
35 |
+
}
|
36 |
+
|
37 |
/**
|
38 |
* Prepare screen load
|
39 |
*
|
45 |
array($this,'render_sidebar_controls'));
|
46 |
}
|
47 |
|
48 |
+
/**
|
49 |
+
* Add filters and actions for admin dashboard
|
50 |
+
* e.g. AJAX calls
|
51 |
+
*
|
52 |
+
* @since 3.5
|
53 |
+
* @return void
|
54 |
+
*/
|
55 |
+
public function admin_hooks() {
|
56 |
+
add_action( 'wp_ajax_cas_sidebar_status',
|
57 |
+
array($this,'ajax_set_sidebar_status'));
|
58 |
+
}
|
59 |
+
|
60 |
+
/**
|
61 |
+
* Add filters and actions for frontend
|
62 |
+
*
|
63 |
+
* @since 3.5
|
64 |
+
* @return void
|
65 |
+
*/
|
66 |
+
public function frontend_hooks() {
|
67 |
+
|
68 |
+
}
|
69 |
+
|
70 |
+
/**
|
71 |
+
* Set post type status on AJAX
|
72 |
+
*
|
73 |
+
* @since 3.5
|
74 |
+
* @return void
|
75 |
+
*/
|
76 |
+
public function ajax_set_sidebar_status() {
|
77 |
+
|
78 |
+
//todo:validate nonce?
|
79 |
+
|
80 |
+
if(!isset($_POST['sidebar_id'],$_POST['status'])) {
|
81 |
+
wp_send_json_error('msg');
|
82 |
+
}
|
83 |
+
|
84 |
+
if(!current_user_can(CAS_App::CAPABILITY,$_POST['sidebar_id'])) {
|
85 |
+
wp_send_json_error('msg');
|
86 |
+
}
|
87 |
+
|
88 |
+
$data = array();
|
89 |
+
$status = filter_var($_POST['status'], FILTER_VALIDATE_BOOLEAN);
|
90 |
+
if($status) {
|
91 |
+
$data = array(
|
92 |
+
'ID' => $_POST['sidebar_id'],
|
93 |
+
'post_status' => CAS_App::STATUS_ACTIVE,
|
94 |
+
'post_date' => current_time( 'mysql' ),
|
95 |
+
'post_date_gmt' => current_time( 'mysql', true )
|
96 |
+
);
|
97 |
+
} else {
|
98 |
+
$data = array(
|
99 |
+
'ID' => $_POST['sidebar_id'],
|
100 |
+
'post_status' => CAS_App::STATUS_INACTIVE
|
101 |
+
);
|
102 |
+
}
|
103 |
+
|
104 |
+
if(!wp_update_post($data)) {
|
105 |
+
wp_send_json_error('msg');
|
106 |
+
}
|
107 |
+
|
108 |
+
$data['title'] = $status ? __('Active','content-aware-sidebars') : __('Inactive','content-aware-sidebars');
|
109 |
+
//$data['message'] = sprintf(__('Status set to %s'),$data['title']);
|
110 |
+
|
111 |
+
wp_send_json_success($data);
|
112 |
+
}
|
113 |
+
|
114 |
/**
|
115 |
* Render controls for custom sidebars
|
116 |
*
|
139 |
?>
|
140 |
<div class="cas-settings">
|
141 |
<div class="sidebar-status">
|
142 |
+
<input type="checkbox" class="sidebar-status-input sidebar-status-<?php echo $sidebar->post_status; ?>" id="cas-status-<?php echo $sidebar->ID; ?>" value="<?php echo $sidebar->ID; ?>" <?php checked($sidebar->post_status, CAS_App::STATUS_ACTIVE) ?>>
|
143 |
<label title="<?php echo $status; ?>" class="sidebar-status-label" for="cas-status-<?php echo $sidebar->ID; ?>">
|
144 |
</label>
|
145 |
</div>
|
157 |
* @since 3.4
|
158 |
*/
|
159 |
public function add_scripts_styles() {
|
160 |
+
wp_enqueue_style('cas/admin/style', plugins_url('../css/style.css', __FILE__), array(), CAS_App::PLUGIN_VERSION);
|
|
|
161 |
|
162 |
$sidebar = get_post_type_object(CAS_App::TYPE_SIDEBAR);
|
163 |
|
164 |
+
wp_enqueue_script('cas/admin/widgets', plugins_url('../js/widgets.min.js', __FILE__), array('jquery'), CAS_App::PLUGIN_VERSION, true);
|
|
|
165 |
wp_localize_script( 'cas/admin/widgets', 'CASAdmin', array(
|
166 |
'addNew' => $sidebar->labels->add_new_item,
|
167 |
'collapse' => __('Collapse','content-aware-sidebars'),
|
168 |
'expand' => __('Expand','content-aware-sidebars'),
|
169 |
'filterSidebars' => __('Filter Sidebars','content-aware-sidebars'),
|
170 |
+
'filterWidgets' => __('Filter Widgets', 'content-aware-sidebars'),
|
171 |
+
'enableConfirm' => __('This sidebar is already scheduled to be activated. Do you want to activate it now?', 'content-aware-sidebars')
|
172 |
));
|
173 |
}
|
174 |
|
admin/sidebar-edit.php
CHANGED
@@ -20,9 +20,14 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
20 |
*/
|
21 |
private $_tour_manager;
|
22 |
|
23 |
-
|
24 |
-
|
25 |
-
|
|
|
|
|
|
|
|
|
|
|
26 |
$this->_tour_manager = new WP_Pointer_Tour(CAS_App::META_PREFIX.'cas_tour');
|
27 |
|
28 |
add_action('delete_post',
|
@@ -56,6 +61,16 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
56 |
}
|
57 |
}
|
58 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
59 |
/**
|
60 |
* Show extra elements in content type list
|
61 |
*
|
@@ -64,7 +79,10 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
64 |
*/
|
65 |
public function add_to_module_list($list) {
|
66 |
if(get_post_type() == CAS_App::TYPE_SIDEBAR) {
|
67 |
-
$list[''] =
|
|
|
|
|
|
|
68 |
}
|
69 |
return $list;
|
70 |
}
|
@@ -98,7 +116,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
98 |
echo '<div style="float:right;"><a href="'.esc_url($url).'" class="button button-cas-upgrade button-small" target="_blank">'.__('Upgrade to Pro','content-aware-sidebars').'</a></div>';
|
99 |
echo '<div style="line-height:24px;">';
|
100 |
echo '<span class="cas-heart">❤</span> ';
|
101 |
-
printf(__('Like it? %1$sSupport the plugin with a %2$s Review%3$s','content-aware-sidebars'),'<b><a target="_blank" href="https://wordpress.org/support/
|
102 |
echo '</div>';
|
103 |
echo '</div>';
|
104 |
}
|
@@ -122,6 +140,16 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
122 |
);
|
123 |
}
|
124 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
125 |
/**
|
126 |
* Prepare screen load
|
127 |
*
|
@@ -164,11 +192,11 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
164 |
$post = get_post($post_id, OBJECT, 'edit');
|
165 |
|
166 |
if ( ! $post )
|
167 |
-
wp_die( __( '
|
168 |
if ( ! current_user_can( 'edit_post', $post_id ) )
|
169 |
-
wp_die( __( '
|
170 |
if ( 'trash' == $post->post_status )
|
171 |
-
wp_die( __( 'You
|
172 |
|
173 |
if ( ! empty( $_GET['get-post-lock'] ) ) {
|
174 |
check_admin_referer( 'lock-post_' . $post_id );
|
@@ -191,8 +219,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
191 |
|
192 |
if ( ! current_user_can( $post_type_object->cap->edit_posts ) || ! current_user_can( $post_type_object->cap->create_posts ) ) {
|
193 |
wp_die(
|
194 |
-
'<
|
195 |
-
'<p>' . __( 'Sorry, you are not allowed to create posts as this user.' ) . '</p>',
|
196 |
403
|
197 |
);
|
198 |
}
|
@@ -258,7 +285,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
258 |
|
259 |
$post = get_post( $post_id );
|
260 |
if ( ! $post ) {
|
261 |
-
wp_die( __( 'The
|
262 |
}
|
263 |
|
264 |
switch($action) {
|
@@ -305,11 +332,11 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
305 |
check_admin_referer('trash-post_' . $post_id);
|
306 |
|
307 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
308 |
-
wp_die( __( '
|
309 |
|
310 |
if ( $user_id = wp_check_post_lock( $post_id ) ) {
|
311 |
$user = get_userdata( $user_id );
|
312 |
-
wp_die( sprintf( __( 'You cannot move this
|
313 |
}
|
314 |
|
315 |
if ( ! wp_trash_post( $post_id ) )
|
@@ -328,7 +355,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
328 |
check_admin_referer('untrash-post_' . $post_id);
|
329 |
|
330 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
331 |
-
wp_die( __( '
|
332 |
|
333 |
if ( ! wp_untrash_post( $post_id ) )
|
334 |
wp_die( __( 'Error in restoring from Trash.' ) );
|
@@ -339,7 +366,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
339 |
check_admin_referer('delete-post_' . $post_id);
|
340 |
|
341 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
342 |
-
wp_die( __( '
|
343 |
|
344 |
if ( ! wp_delete_post( $post_id, true ) )
|
345 |
wp_die( __( 'Error in deleting.' ) );
|
@@ -351,7 +378,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
351 |
), $sendback ));
|
352 |
exit();
|
353 |
default:
|
354 |
-
do_action('cas/admin/action', $action, $
|
355 |
break;
|
356 |
}
|
357 |
}
|
@@ -370,9 +397,9 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
370 |
$post_ID = $post->ID;
|
371 |
$post_type_object = get_post_type_object( $post->post_type );
|
372 |
|
373 |
-
$messages = $this->sidebar_updated_messages($post);
|
374 |
$message = false;
|
375 |
if ( isset($_GET['message']) ) {
|
|
|
376 |
$_GET['message'] = absint( $_GET['message'] );
|
377 |
if ( isset($messages[$_GET['message']]) )
|
378 |
$message = $messages[$_GET['message']];
|
@@ -521,12 +548,12 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
521 |
$ptype = get_post_type_object($post_data['post_type']);
|
522 |
|
523 |
if ( !current_user_can( 'edit_post', $post_ID ) ) {
|
524 |
-
wp_die( __('
|
525 |
} elseif (! current_user_can( $ptype->cap->create_posts ) ) {
|
526 |
-
return new WP_Error( 'edit_others_posts', __( '
|
527 |
} elseif ( $post_data['post_author'] != $_POST['post_author']
|
528 |
&& ! current_user_can( $ptype->cap->edit_others_posts ) ) {
|
529 |
-
return new WP_Error( 'edit_others_posts', __( '
|
530 |
}
|
531 |
|
532 |
if ( isset($_POST['post_status']) ) {
|
@@ -536,9 +563,11 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
536 |
$post_data['post_date'] = current_time( 'mysql' );
|
537 |
}
|
538 |
} elseif($_POST['sidebar_activate']) {
|
|
|
539 |
$post_data['post_status'] = CAS_App::STATUS_SCHEDULED;
|
540 |
$post_data['post_date'] = $_POST['sidebar_activate'];
|
541 |
} else {
|
|
|
542 |
$post_data['post_status'] = CAS_App::STATUS_INACTIVE;
|
543 |
}
|
544 |
|
@@ -757,8 +786,6 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
757 |
);
|
758 |
}
|
759 |
|
760 |
-
add_action('admin_enqueue_scripts',
|
761 |
-
array('WPCACore','enqueue_scripts_styles'),9);
|
762 |
//todo: refactor add of meta box
|
763 |
//with new bootstrapper, legacy core might be loaded
|
764 |
if(method_exists('WPCACore', 'render_group_meta_box')) {
|
@@ -774,12 +801,12 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
774 |
* @return void
|
775 |
*/
|
776 |
public function admin_notice_review() {
|
|
|
777 |
$has_reviewed = get_user_option(CAS_App::META_PREFIX.'cas_review');
|
778 |
if($has_reviewed === false) {
|
779 |
-
$tour_taken = $this->_tour_manager->get_user_option();
|
780 |
if($tour_taken && (time() - $tour_taken) >= WEEK_IN_SECONDS) {
|
781 |
$current_user = wp_get_current_user();
|
782 |
-
|
783 |
//updated class for wp4.0 and below
|
784 |
echo '<div class="notice notice-success updated js-cas-notice-review">';
|
785 |
echo '<p>';
|
@@ -789,11 +816,11 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
789 |
);
|
790 |
echo '<br>';
|
791 |
printf(__("I have spent countless hours developing it, and it would mean a lot to me if you %ssupport it with a quick review on WordPress.org.%s",'content-aware-sidebars'),
|
792 |
-
'<strong><a target="_blank" href="https://wordpress.org/support/
|
793 |
'</a></strong>'
|
794 |
);
|
795 |
echo '</p>';
|
796 |
-
echo '<p><a target="_blank" class="button-primary" href="https://wordpress.org/support/
|
797 |
echo '</div>';
|
798 |
}
|
799 |
}
|
@@ -925,7 +952,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
925 |
<div style="overflow:hidden;">
|
926 |
<ul>
|
927 |
<?php if($locale != "en_US") : ?>
|
928 |
-
<li><a href="https://
|
929 |
<?php endif; ?>
|
930 |
<li><a href="https://dev.institute/docs/content-aware-sidebars/?utm_source=plugin&utm_medium=referral&utm_content=info-box&utm_campaign=cas" target="_blank"><?php _e('Documentation','content-aware-sidebars'); ?></a></li>
|
931 |
<li><a href="https://dev.institute/docs/content-aware-sidebars/getting-started/?utm_source=plugin&utm_medium=referral&utm_content=info-box&utm_campaign=cas" target="_blank"><?php _e('Get Started','content-aware-sidebars'); ?></a></li>
|
@@ -998,7 +1025,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
998 |
$revision_id = key( $revisions );
|
999 |
?>
|
1000 |
<li><span class="dashicons dashicons-backup"></span>
|
1001 |
-
<?php printf( __( 'Widget Revisions: %s' ), '<b>' . number_format_i18n( $revision_count ) . '</b>' ); ?>
|
1002 |
<a class="hide-if-no-js" href="<?php echo esc_url( get_edit_post_link( $revision_id ) ); ?>" title="<?php esc_attr_e( 'Browse revisions' ); ?>"><?php _ex( 'Browse', 'revisions' ); ?></a>
|
1003 |
</li>
|
1004 |
<?php
|
@@ -1006,7 +1033,7 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
1006 |
} elseif (cas_fs()->is_not_paying() ) {
|
1007 |
?>
|
1008 |
<li><span class="dashicons dashicons-backup"></span>
|
1009 |
-
<?php printf( __( 'Widget Revisions: %s' ), '<b>0</b>' );
|
1010 |
echo ' <b><a href="'.esc_url(cas_fs()->get_upgrade_url()).'">'.__( 'Enable').'</a></b>'; ?>
|
1011 |
</li>
|
1012 |
<?php
|
@@ -1252,6 +1279,8 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
1252 |
*/
|
1253 |
public function add_scripts_styles() {
|
1254 |
|
|
|
|
|
1255 |
wp_register_script('flatpickr', plugins_url('../js/flatpickr.min.js', __FILE__), array(), '2.3.4', false);
|
1256 |
|
1257 |
wp_register_script('cas/admin/edit', plugins_url('../js/cas_admin.min.js', __FILE__), array('jquery','flatpickr'), CAS_App::PLUGIN_VERSION, false);
|
@@ -1295,6 +1324,11 @@ final class CAS_Sidebar_Edit extends CAS_Admin {
|
|
1295 |
|
1296 |
wp_enqueue_style('cas/admin/style');
|
1297 |
|
|
|
|
|
|
|
|
|
|
|
1298 |
}
|
1299 |
|
1300 |
}
|
20 |
*/
|
21 |
private $_tour_manager;
|
22 |
|
23 |
+
/**
|
24 |
+
* Add filters and actions for admin dashboard
|
25 |
+
* e.g. AJAX calls
|
26 |
+
*
|
27 |
+
* @since 3.5
|
28 |
+
* @return void
|
29 |
+
*/
|
30 |
+
public function admin_hooks() {
|
31 |
$this->_tour_manager = new WP_Pointer_Tour(CAS_App::META_PREFIX.'cas_tour');
|
32 |
|
33 |
add_action('delete_post',
|
61 |
}
|
62 |
}
|
63 |
|
64 |
+
/**
|
65 |
+
* Add filters and actions for frontend
|
66 |
+
*
|
67 |
+
* @since 3.5
|
68 |
+
* @return void
|
69 |
+
*/
|
70 |
+
public function frontend_hooks() {
|
71 |
+
|
72 |
+
}
|
73 |
+
|
74 |
/**
|
75 |
* Show extra elements in content type list
|
76 |
*
|
79 |
*/
|
80 |
public function add_to_module_list($list) {
|
81 |
if(get_post_type() == CAS_App::TYPE_SIDEBAR) {
|
82 |
+
$list[''] = array(
|
83 |
+
'name' =>__('URLs (Pro Feature)','content-aware-sidebars'),
|
84 |
+
'default_value' => ''
|
85 |
+
);
|
86 |
}
|
87 |
return $list;
|
88 |
}
|
116 |
echo '<div style="float:right;"><a href="'.esc_url($url).'" class="button button-cas-upgrade button-small" target="_blank">'.__('Upgrade to Pro','content-aware-sidebars').'</a></div>';
|
117 |
echo '<div style="line-height:24px;">';
|
118 |
echo '<span class="cas-heart">❤</span> ';
|
119 |
+
printf(__('Like it? %1$sSupport the plugin with a %2$s Review%3$s','content-aware-sidebars'),'<b><a target="_blank" href="https://wordpress.org/support/plugin/content-aware-sidebars/reviews/?rate=5#new-post">','5★','</a></b>');
|
120 |
echo '</div>';
|
121 |
echo '</div>';
|
122 |
}
|
140 |
);
|
141 |
}
|
142 |
|
143 |
+
/**
|
144 |
+
* Authorize user for screen
|
145 |
+
*
|
146 |
+
* @since 3.5
|
147 |
+
* @return boolean
|
148 |
+
*/
|
149 |
+
public function authorize_user() {
|
150 |
+
return true;
|
151 |
+
}
|
152 |
+
|
153 |
/**
|
154 |
* Prepare screen load
|
155 |
*
|
192 |
$post = get_post($post_id, OBJECT, 'edit');
|
193 |
|
194 |
if ( ! $post )
|
195 |
+
wp_die( __( 'The sidebar no longer exists.' ) );
|
196 |
if ( ! current_user_can( 'edit_post', $post_id ) )
|
197 |
+
wp_die( __( 'You are not allowed to edit this sidebar.' ) );
|
198 |
if ( 'trash' == $post->post_status )
|
199 |
+
wp_die( __( 'You cannot edit this sidebar because it is in the Trash. Please restore it and try again.' ) );
|
200 |
|
201 |
if ( ! empty( $_GET['get-post-lock'] ) ) {
|
202 |
check_admin_referer( 'lock-post_' . $post_id );
|
219 |
|
220 |
if ( ! current_user_can( $post_type_object->cap->edit_posts ) || ! current_user_can( $post_type_object->cap->create_posts ) ) {
|
221 |
wp_die(
|
222 |
+
'<p>' . __( 'You are not allowed to create sidebars.', 'content-aware-sidebars' ) . '</p>',
|
|
|
223 |
403
|
224 |
);
|
225 |
}
|
285 |
|
286 |
$post = get_post( $post_id );
|
287 |
if ( ! $post ) {
|
288 |
+
wp_die( __( 'The sidebar no longer exists.', 'content-aware-sidebars' ) );
|
289 |
}
|
290 |
|
291 |
switch($action) {
|
332 |
check_admin_referer('trash-post_' . $post_id);
|
333 |
|
334 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
335 |
+
wp_die( __( 'You are not allowed to move this sidebar to the Trash.', 'content-aware-sidebars' ) );
|
336 |
|
337 |
if ( $user_id = wp_check_post_lock( $post_id ) ) {
|
338 |
$user = get_userdata( $user_id );
|
339 |
+
wp_die( sprintf( __( 'You cannot move this sidebar to the Trash. %s is currently editing.', 'content-aware-sidebars' ), $user->display_name ) );
|
340 |
}
|
341 |
|
342 |
if ( ! wp_trash_post( $post_id ) )
|
355 |
check_admin_referer('untrash-post_' . $post_id);
|
356 |
|
357 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
358 |
+
wp_die( __( 'You are not allowed to restore this sidebar from the Trash.', 'content-aware-sidebars' ) );
|
359 |
|
360 |
if ( ! wp_untrash_post( $post_id ) )
|
361 |
wp_die( __( 'Error in restoring from Trash.' ) );
|
366 |
check_admin_referer('delete-post_' . $post_id);
|
367 |
|
368 |
if ( ! current_user_can( 'delete_post', $post_id ) )
|
369 |
+
wp_die( __( 'You are not allowed to delete this sidebar.', 'content-aware-sidebars' ) );
|
370 |
|
371 |
if ( ! wp_delete_post( $post_id, true ) )
|
372 |
wp_die( __( 'Error in deleting.' ) );
|
378 |
), $sendback ));
|
379 |
exit();
|
380 |
default:
|
381 |
+
do_action('cas/admin/action', $action, $post);
|
382 |
break;
|
383 |
}
|
384 |
}
|
397 |
$post_ID = $post->ID;
|
398 |
$post_type_object = get_post_type_object( $post->post_type );
|
399 |
|
|
|
400 |
$message = false;
|
401 |
if ( isset($_GET['message']) ) {
|
402 |
+
$messages = $this->sidebar_updated_messages($post);
|
403 |
$_GET['message'] = absint( $_GET['message'] );
|
404 |
if ( isset($messages[$_GET['message']]) )
|
405 |
$message = $messages[$_GET['message']];
|
548 |
$ptype = get_post_type_object($post_data['post_type']);
|
549 |
|
550 |
if ( !current_user_can( 'edit_post', $post_ID ) ) {
|
551 |
+
wp_die( __('You are not allowed to edit this sidebar.', 'content-aware-sidebars' ));
|
552 |
} elseif (! current_user_can( $ptype->cap->create_posts ) ) {
|
553 |
+
return new WP_Error( 'edit_others_posts', __( 'You are not allowed to create sidebars.', 'content-aware-sidebars' ) );
|
554 |
} elseif ( $post_data['post_author'] != $_POST['post_author']
|
555 |
&& ! current_user_can( $ptype->cap->edit_others_posts ) ) {
|
556 |
+
return new WP_Error( 'edit_others_posts', __( 'You are not allowed to edit this sidebar.', 'content-aware-sidebars' ) );
|
557 |
}
|
558 |
|
559 |
if ( isset($_POST['post_status']) ) {
|
563 |
$post_data['post_date'] = current_time( 'mysql' );
|
564 |
}
|
565 |
} elseif($_POST['sidebar_activate']) {
|
566 |
+
$_POST['post_status'] = CAS_App::STATUS_SCHEDULED; //yoast seo expects this
|
567 |
$post_data['post_status'] = CAS_App::STATUS_SCHEDULED;
|
568 |
$post_data['post_date'] = $_POST['sidebar_activate'];
|
569 |
} else {
|
570 |
+
$_POST['post_status'] = CAS_App::STATUS_INACTIVE;
|
571 |
$post_data['post_status'] = CAS_App::STATUS_INACTIVE;
|
572 |
}
|
573 |
|
786 |
);
|
787 |
}
|
788 |
|
|
|
|
|
789 |
//todo: refactor add of meta box
|
790 |
//with new bootstrapper, legacy core might be loaded
|
791 |
if(method_exists('WPCACore', 'render_group_meta_box')) {
|
801 |
* @return void
|
802 |
*/
|
803 |
public function admin_notice_review() {
|
804 |
+
|
805 |
$has_reviewed = get_user_option(CAS_App::META_PREFIX.'cas_review');
|
806 |
if($has_reviewed === false) {
|
807 |
+
$tour_taken = (int) $this->_tour_manager->get_user_option();
|
808 |
if($tour_taken && (time() - $tour_taken) >= WEEK_IN_SECONDS) {
|
809 |
$current_user = wp_get_current_user();
|
|
|
810 |
//updated class for wp4.0 and below
|
811 |
echo '<div class="notice notice-success updated js-cas-notice-review">';
|
812 |
echo '<p>';
|
816 |
);
|
817 |
echo '<br>';
|
818 |
printf(__("I have spent countless hours developing it, and it would mean a lot to me if you %ssupport it with a quick review on WordPress.org.%s",'content-aware-sidebars'),
|
819 |
+
'<strong><a target="_blank" href="https://wordpress.org/support/plugin/content-aware-sidebars/reviews/?rate=5#new-post">',
|
820 |
'</a></strong>'
|
821 |
);
|
822 |
echo '</p>';
|
823 |
+
echo '<p><a target="_blank" class="button-primary" href="https://wordpress.org/support/plugin/content-aware-sidebars/reviews/?rate=5#new-post">'.__('Review Content Aware Sidebars','content-aware-sidebars').'</a> <button class="button-secondary">'.__("No thanks",'content-aware-sidebars').'</button></p>';
|
824 |
echo '</div>';
|
825 |
}
|
826 |
}
|
952 |
<div style="overflow:hidden;">
|
953 |
<ul>
|
954 |
<?php if($locale != "en_US") : ?>
|
955 |
+
<li><a href="https://translate.wordpress.org/projects/wp-plugins/content-aware-sidebars" target="_blank"><?php _e('Translate the plugin into your language','content-aware-sidebars'); ?></a></li>
|
956 |
<?php endif; ?>
|
957 |
<li><a href="https://dev.institute/docs/content-aware-sidebars/?utm_source=plugin&utm_medium=referral&utm_content=info-box&utm_campaign=cas" target="_blank"><?php _e('Documentation','content-aware-sidebars'); ?></a></li>
|
958 |
<li><a href="https://dev.institute/docs/content-aware-sidebars/getting-started/?utm_source=plugin&utm_medium=referral&utm_content=info-box&utm_campaign=cas" target="_blank"><?php _e('Get Started','content-aware-sidebars'); ?></a></li>
|
1025 |
$revision_id = key( $revisions );
|
1026 |
?>
|
1027 |
<li><span class="dashicons dashicons-backup"></span>
|
1028 |
+
<?php printf( __( 'Widget Revisions: %s', 'content-aware-sidebars' ), '<b>' . number_format_i18n( $revision_count ) . '</b>' ); ?>
|
1029 |
<a class="hide-if-no-js" href="<?php echo esc_url( get_edit_post_link( $revision_id ) ); ?>" title="<?php esc_attr_e( 'Browse revisions' ); ?>"><?php _ex( 'Browse', 'revisions' ); ?></a>
|
1030 |
</li>
|
1031 |
<?php
|
1033 |
} elseif (cas_fs()->is_not_paying() ) {
|
1034 |
?>
|
1035 |
<li><span class="dashicons dashicons-backup"></span>
|
1036 |
+
<?php printf( __( 'Widget Revisions: %s', 'content-aware-sidebars' ), '<b>0</b>' );
|
1037 |
echo ' <b><a href="'.esc_url(cas_fs()->get_upgrade_url()).'">'.__( 'Enable').'</a></b>'; ?>
|
1038 |
</li>
|
1039 |
<?php
|
1279 |
*/
|
1280 |
public function add_scripts_styles() {
|
1281 |
|
1282 |
+
WPCACore::enqueue_scripts_styles('');
|
1283 |
+
|
1284 |
wp_register_script('flatpickr', plugins_url('../js/flatpickr.min.js', __FILE__), array(), '2.3.4', false);
|
1285 |
|
1286 |
wp_register_script('cas/admin/edit', plugins_url('../js/cas_admin.min.js', __FILE__), array('jquery','flatpickr'), CAS_App::PLUGIN_VERSION, false);
|
1324 |
|
1325 |
wp_enqueue_style('cas/admin/style');
|
1326 |
|
1327 |
+
//badgeos compat
|
1328 |
+
//todo: check that developers respond with a fix soon
|
1329 |
+
wp_register_script('badgeos-select2', '');
|
1330 |
+
wp_register_style( 'badgeos-select2-css', '');
|
1331 |
+
|
1332 |
}
|
1333 |
|
1334 |
}
|
admin/sidebar-list-table.php
CHANGED
@@ -513,7 +513,9 @@ class CAS_Sidebar_List_Table extends WP_List_Table {
|
|
513 |
echo '<strong>'.__( 'Active' ).'</strong>';
|
514 |
$deactivate_date = get_post_meta($post->ID, CAS_App::META_PREFIX.'deactivate_time',true);
|
515 |
if($deactivate_date) {
|
|
|
516 |
$h_time = mysql2date( __( 'Y/m/d' ), $deactivate_date );
|
|
|
517 |
$t_time = mysql2date( __( 'Y/m/d g:i:s a' ), $deactivate_date );
|
518 |
echo '<br />'.sprintf(__('Until %s','content-aware-sidebars'),'<abbr title="' . $t_time . '">' . $h_time . '</abbr>');
|
519 |
}
|
@@ -585,15 +587,23 @@ class CAS_Sidebar_List_Table extends WP_List_Table {
|
|
585 |
$post_type_object = get_post_type_object( $post->post_type );
|
586 |
$actions = array();
|
587 |
$title = _draft_or_post_title();
|
|
|
588 |
|
589 |
if (current_user_can( 'edit_post', $post->ID ) && $post->post_status != 'trash') {
|
590 |
$actions['edit'] = sprintf(
|
591 |
'<a href="%s" aria-label="%s">%s</a>',
|
592 |
get_edit_post_link( $post->ID ),
|
593 |
-
/* translators: %s:
|
594 |
esc_attr( sprintf( __( 'Edit “%s”' ), $title ) ),
|
595 |
__( 'Edit' )
|
596 |
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
597 |
|
598 |
$link = admin_url('post.php?post='.$post->ID);
|
599 |
$actions['widget_revisions'] = '<a href="'.add_query_arg('action','cas-revisions',$link).'" title="' . esc_attr__('Widget Revisions', 'content-aware-sidebars') . '">' . __('Widget Revisions', 'content-aware-sidebars') . '</a>';
|
@@ -628,7 +638,9 @@ class CAS_Sidebar_List_Table extends WP_List_Table {
|
|
628 |
}
|
629 |
}
|
630 |
|
631 |
-
return $this->row_actions(
|
|
|
|
|
632 |
}
|
633 |
|
634 |
}
|
513 |
echo '<strong>'.__( 'Active' ).'</strong>';
|
514 |
$deactivate_date = get_post_meta($post->ID, CAS_App::META_PREFIX.'deactivate_time',true);
|
515 |
if($deactivate_date) {
|
516 |
+
// translators: Sidebar status date format, see http://php.net/date
|
517 |
$h_time = mysql2date( __( 'Y/m/d' ), $deactivate_date );
|
518 |
+
// translators: Sidebar status date and time format, see http://php.net/date
|
519 |
$t_time = mysql2date( __( 'Y/m/d g:i:s a' ), $deactivate_date );
|
520 |
echo '<br />'.sprintf(__('Until %s','content-aware-sidebars'),'<abbr title="' . $t_time . '">' . $h_time . '</abbr>');
|
521 |
}
|
587 |
$post_type_object = get_post_type_object( $post->post_type );
|
588 |
$actions = array();
|
589 |
$title = _draft_or_post_title();
|
590 |
+
$cas_fs = cas_fs();
|
591 |
|
592 |
if (current_user_can( 'edit_post', $post->ID ) && $post->post_status != 'trash') {
|
593 |
$actions['edit'] = sprintf(
|
594 |
'<a href="%s" aria-label="%s">%s</a>',
|
595 |
get_edit_post_link( $post->ID ),
|
596 |
+
/* translators: %s: sidebar title */
|
597 |
esc_attr( sprintf( __( 'Edit “%s”' ), $title ) ),
|
598 |
__( 'Edit' )
|
599 |
);
|
600 |
+
$actions['duplicate'] = sprintf(
|
601 |
+
'<a href="%s" aria-label="%s">%s</a>',
|
602 |
+
esc_url($cas_fs->get_upgrade_url()),
|
603 |
+
/* translators: %s: sidebar title */
|
604 |
+
esc_attr( sprintf( __( 'Duplicate %s', 'content-aware-sidebars' ), $title ) ),
|
605 |
+
__( 'Duplicate', 'content-aware-sidebars' )
|
606 |
+
);
|
607 |
|
608 |
$link = admin_url('post.php?post='.$post->ID);
|
609 |
$actions['widget_revisions'] = '<a href="'.add_query_arg('action','cas-revisions',$link).'" title="' . esc_attr__('Widget Revisions', 'content-aware-sidebars') . '">' . __('Widget Revisions', 'content-aware-sidebars') . '</a>';
|
638 |
}
|
639 |
}
|
640 |
|
641 |
+
return $this->row_actions(
|
642 |
+
apply_filters( 'cas/admin/row_actions', $actions, $post )
|
643 |
+
);
|
644 |
}
|
645 |
|
646 |
}
|
admin/sidebar-overview.php
CHANGED
@@ -20,13 +20,26 @@ final class CAS_Sidebar_Overview extends CAS_Admin {
|
|
20 |
*/
|
21 |
public $table;
|
22 |
|
23 |
-
|
24 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
25 |
|
26 |
-
if(is_admin()) {
|
27 |
-
add_filter('set-screen-option',
|
28 |
-
array($this,'set_screen_option'), 10, 3);
|
29 |
-
}
|
30 |
}
|
31 |
|
32 |
/**
|
@@ -60,6 +73,18 @@ final class CAS_Sidebar_Overview extends CAS_Admin {
|
|
60 |
);
|
61 |
}
|
62 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
63 |
/**
|
64 |
* Prepare screen load
|
65 |
*
|
@@ -67,15 +92,6 @@ final class CAS_Sidebar_Overview extends CAS_Admin {
|
|
67 |
* @return void
|
68 |
*/
|
69 |
public function prepare_screen() {
|
70 |
-
|
71 |
-
$post_type_object = get_post_type_object(CAS_App::TYPE_SIDEBAR);
|
72 |
-
if ( ! current_user_can( $post_type_object->cap->edit_posts ) ) {
|
73 |
-
wp_die(
|
74 |
-
'<h1>' . __( 'Cheatin’ uh?' ) . '</h1>' .
|
75 |
-
'<p>' . __( 'You are not allowed to edit posts in this post type.' ) . '</p>',
|
76 |
-
403
|
77 |
-
);
|
78 |
-
}
|
79 |
|
80 |
add_screen_option( 'per_page', array(
|
81 |
'default' => 20,
|
@@ -251,34 +267,30 @@ final class CAS_Sidebar_Overview extends CAS_Admin {
|
|
251 |
|
252 |
public function bulk_messages() {
|
253 |
|
254 |
-
$bulk_counts = array(
|
255 |
-
'updated' => isset($_REQUEST['updated'] )? absint( $_REQUEST['updated'] ) : 0,
|
256 |
-
'locked' => isset($_REQUEST['locked'] ) ? absint( $_REQUEST['locked'] ) : 0,
|
257 |
-
'deleted' => isset($_REQUEST['deleted'] ) ? absint( $_REQUEST['deleted'] ) : 0,
|
258 |
-
'trashed' => isset($_REQUEST['trashed'] ) ? absint( $_REQUEST['trashed'] ) : 0,
|
259 |
-
'untrashed' => isset($_REQUEST['untrashed'] ) ? absint( $_REQUEST['untrashed'] ) : 0
|
260 |
-
);
|
261 |
-
|
262 |
$manage_widgets = sprintf(' <a href="%1$s">%2$s</a>','widgets.php',__('Manage widgets','content-aware-sidebars'));
|
263 |
|
264 |
$bulk_messages = array(
|
265 |
-
'updated' =>
|
266 |
-
'locked' =>
|
267 |
-
'deleted' =>
|
268 |
-
'trashed' =>
|
269 |
-
'untrashed' =>
|
270 |
);
|
271 |
-
|
272 |
-
$bulk_counts = array_filter( $bulk_counts );
|
273 |
|
274 |
$messages = array();
|
275 |
-
foreach ( $
|
276 |
-
if
|
277 |
-
$
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
|
|
|
|
|
|
|
|
|
|
282 |
}
|
283 |
}
|
284 |
|
20 |
*/
|
21 |
public $table;
|
22 |
|
23 |
+
/**
|
24 |
+
* Add filters and actions for admin dashboard
|
25 |
+
* e.g. AJAX calls
|
26 |
+
*
|
27 |
+
* @since 3.5
|
28 |
+
* @return void
|
29 |
+
*/
|
30 |
+
public function admin_hooks() {
|
31 |
+
add_filter('set-screen-option',
|
32 |
+
array($this,'set_screen_option'), 10, 3);
|
33 |
+
}
|
34 |
+
|
35 |
+
/**
|
36 |
+
* Add filters and actions for frontend
|
37 |
+
*
|
38 |
+
* @since 3.5
|
39 |
+
* @return void
|
40 |
+
*/
|
41 |
+
public function frontend_hooks() {
|
42 |
|
|
|
|
|
|
|
|
|
43 |
}
|
44 |
|
45 |
/**
|
73 |
);
|
74 |
}
|
75 |
|
76 |
+
|
77 |
+
/**
|
78 |
+
* Authorize user for screen
|
79 |
+
*
|
80 |
+
* @since 3.5
|
81 |
+
* @return boolean
|
82 |
+
*/
|
83 |
+
public function authorize_user() {
|
84 |
+
$post_type_object = get_post_type_object(CAS_App::TYPE_SIDEBAR);
|
85 |
+
return current_user_can( $post_type_object->cap->edit_posts );
|
86 |
+
}
|
87 |
+
|
88 |
/**
|
89 |
* Prepare screen load
|
90 |
*
|
92 |
* @return void
|
93 |
*/
|
94 |
public function prepare_screen() {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95 |
|
96 |
add_screen_option( 'per_page', array(
|
97 |
'default' => 20,
|
267 |
|
268 |
public function bulk_messages() {
|
269 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
270 |
$manage_widgets = sprintf(' <a href="%1$s">%2$s</a>','widgets.php',__('Manage widgets','content-aware-sidebars'));
|
271 |
|
272 |
$bulk_messages = array(
|
273 |
+
'updated' => _n_noop( '%s sidebar updated.', '%s sidebars updated.', 'content-aware-sidebars'),
|
274 |
+
'locked' => _n_noop( '%s sidebar not updated, somebody is editing it.', '%s sidebars not updated, somebody is editing them.', 'content-aware-sidebars'),
|
275 |
+
'deleted' => _n_noop( '%s sidebar permanently deleted.', '%s sidebars permanently deleted.', 'content-aware-sidebars'),
|
276 |
+
'trashed' => _n_noop( '%s sidebar moved to the Trash.', '%s sidebars moved to the Trash.', 'content-aware-sidebars'),
|
277 |
+
'untrashed' => _n_noop( '%s sidebar restored from the Trash.', '%s sidebars restored from the Trash.', 'content-aware-sidebars'),
|
278 |
);
|
279 |
+
$bulk_messages = apply_filters('cas/admin/bulk_messages',$bulk_messages);
|
|
|
280 |
|
281 |
$messages = array();
|
282 |
+
foreach ( $bulk_messages as $key => $message ) {
|
283 |
+
if(isset($_REQUEST[$key] )) {
|
284 |
+
$count = absint( $_REQUEST[$key] );
|
285 |
+
$messages[] = sprintf(
|
286 |
+
translate_nooped_plural($message, $count ),
|
287 |
+
number_format_i18n( $count )
|
288 |
+
);
|
289 |
+
|
290 |
+
if ( $key == 'trashed' && isset( $_REQUEST['ids'] ) ) {
|
291 |
+
$ids = preg_replace( '/[^0-9,]/', '', $_REQUEST['ids'] );
|
292 |
+
$messages[] = '<a href="' . esc_url( wp_nonce_url( "admin.php?page=wpcas&doaction=undo&action=untrash&ids=$ids", "bulk-sidebars" ) ) . '">' . __('Undo') . '</a>';
|
293 |
+
}
|
294 |
}
|
295 |
}
|
296 |
|
app.php
CHANGED
@@ -17,7 +17,7 @@ final class CAS_App {
|
|
17 |
/**
|
18 |
* Plugin version
|
19 |
*/
|
20 |
-
const PLUGIN_VERSION = '3.
|
21 |
|
22 |
/**
|
23 |
* Prefix for sidebar id
|
@@ -73,9 +73,6 @@ final class CAS_App {
|
|
73 |
|
74 |
public function __construct() {
|
75 |
|
76 |
-
//__('Manage and show sidebars according to the content being viewed.','content-aware-sidebars');
|
77 |
-
//__('Content Aware Sidebars','content-aware-sidebars');
|
78 |
-
|
79 |
$this->_manager = new CAS_Sidebar_Manager();
|
80 |
|
81 |
if(is_admin()) {
|
17 |
/**
|
18 |
* Plugin version
|
19 |
*/
|
20 |
+
const PLUGIN_VERSION = '3.5.2';
|
21 |
|
22 |
/**
|
23 |
* Prefix for sidebar id
|
73 |
|
74 |
public function __construct() {
|
75 |
|
|
|
|
|
|
|
76 |
$this->_manager = new CAS_Sidebar_Manager();
|
77 |
|
78 |
if(is_admin()) {
|
changelog.txt
CHANGED
@@ -1,3 +1,30 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
= 3.0.1 =
|
2 |
|
3 |
* Added: wp4.4 compatibility
|
1 |
+
= 3.1.2 =
|
2 |
+
|
3 |
+
* Added: wordpress 4.5 support
|
4 |
+
* Added: module javascript more extensible
|
5 |
+
* Fixed: styling for autocomplete input fields
|
6 |
+
* Fixed: updated translations
|
7 |
+
|
8 |
+
= 3.1.1 =
|
9 |
+
|
10 |
+
* Added: pods pages module, props @sc0ttkclark @herold
|
11 |
+
* Fixed: better compat when other themes or plugins load breaking scripts
|
12 |
+
|
13 |
+
= 3.1 =
|
14 |
+
|
15 |
+
* Added: completely rewritten sidebar editor ui
|
16 |
+
* Added: refactored plugin into more logical abstractions
|
17 |
+
* Added: wp-db-updater now handles database updates
|
18 |
+
* Added: tour reflects new sidebar editor ui
|
19 |
+
* Added: review notice after 2 weeks use
|
20 |
+
* Added: admin footer text on relevant pages
|
21 |
+
* Added: minified some scripts
|
22 |
+
* Added: qtranslate x module
|
23 |
+
* Fixed: sidebar and widget filtering for wp4.4+
|
24 |
+
* Fixed: bug making attachments not selectable
|
25 |
+
* Fixed: bumped versions for integrated plugins
|
26 |
+
* Removed: qtranslate module
|
27 |
+
|
28 |
= 3.0.1 =
|
29 |
|
30 |
* Added: wp4.4 compatibility
|
content-aware-sidebars.php
CHANGED
@@ -8,8 +8,8 @@
|
|
8 |
/*
|
9 |
Plugin Name: Content Aware Sidebars
|
10 |
Plugin URI: https://dev.institute/wordpress/sidebars-pro/
|
11 |
-
Description: Unlimited custom sidebars for any post, page, category etc.
|
12 |
-
Version: 3.
|
13 |
Author: Joachim Jensen
|
14 |
Author URI: https://dev.institute
|
15 |
Text Domain: content-aware-sidebars
|
8 |
/*
|
9 |
Plugin Name: Content Aware Sidebars
|
10 |
Plugin URI: https://dev.institute/wordpress/sidebars-pro/
|
11 |
+
Description: Unlimited custom sidebars and widget areas for any post, page, category etc.
|
12 |
+
Version: 3.5.2
|
13 |
Author: Joachim Jensen
|
14 |
Author URI: https://dev.institute
|
15 |
Text Domain: content-aware-sidebars
|
css/select2/index.php
DELETED
@@ -1,2 +0,0 @@
|
|
1 |
-
<?php
|
2 |
-
/**/
|
|
|
|
css/select2/select2-spinner.gif
DELETED
Binary file
|
css/select2/select2.css
DELETED
@@ -1,774 +0,0 @@
|
|
1 |
-
.select2-container {
|
2 |
-
margin: 0;
|
3 |
-
position: relative;
|
4 |
-
display: block !important;
|
5 |
-
zoom: 1;
|
6 |
-
*display: inline;
|
7 |
-
vertical-align: middle;
|
8 |
-
}
|
9 |
-
|
10 |
-
.select2-container,
|
11 |
-
.select2-drop,
|
12 |
-
.select2-search,
|
13 |
-
.select2-search input {
|
14 |
-
-webkit-box-sizing: border-box;
|
15 |
-
-moz-box-sizing: border-box;
|
16 |
-
box-sizing: border-box;
|
17 |
-
}
|
18 |
-
|
19 |
-
.select2-container .select2-choice {
|
20 |
-
display: block;
|
21 |
-
padding: 0 0 0 8px;
|
22 |
-
overflow: hidden;
|
23 |
-
position: relative;
|
24 |
-
|
25 |
-
border: 1px solid #ccc;
|
26 |
-
white-space: nowrap;
|
27 |
-
color: #444;
|
28 |
-
text-decoration: none;
|
29 |
-
|
30 |
-
border-radius: 3px;
|
31 |
-
|
32 |
-
background-clip: padding-box;
|
33 |
-
|
34 |
-
-webkit-touch-callout: none;
|
35 |
-
-webkit-user-select: none;
|
36 |
-
-moz-user-select: none;
|
37 |
-
-ms-user-select: none;
|
38 |
-
user-select: none;
|
39 |
-
|
40 |
-
background-color: #fff;
|
41 |
-
font-weight: 400;
|
42 |
-
}
|
43 |
-
|
44 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
45 |
-
padding: 0 8px 0 0;
|
46 |
-
}
|
47 |
-
|
48 |
-
.select2-container.select2-drop-above .select2-choice {
|
49 |
-
border-bottom-color: #ccc;
|
50 |
-
|
51 |
-
border-radius: 0 0 4px 4px;
|
52 |
-
}
|
53 |
-
|
54 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
55 |
-
margin-right: 42px;
|
56 |
-
}
|
57 |
-
|
58 |
-
.select2-container .select2-choice > .select2-chosen {
|
59 |
-
margin-right: 26px;
|
60 |
-
display: block;
|
61 |
-
overflow: hidden;
|
62 |
-
|
63 |
-
white-space: nowrap;
|
64 |
-
|
65 |
-
text-overflow: ellipsis;
|
66 |
-
float: none;
|
67 |
-
width: auto;
|
68 |
-
}
|
69 |
-
|
70 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
71 |
-
margin-left: 26px;
|
72 |
-
margin-right: 0;
|
73 |
-
}
|
74 |
-
|
75 |
-
.select2-container .select2-choice abbr {
|
76 |
-
display: none;
|
77 |
-
width: 12px;
|
78 |
-
height: 12px;
|
79 |
-
position: absolute;
|
80 |
-
right: 24px;
|
81 |
-
top: 5px;
|
82 |
-
|
83 |
-
font-size: 1px;
|
84 |
-
text-decoration: none;
|
85 |
-
|
86 |
-
border: 0;
|
87 |
-
background: url('select2.png') right top no-repeat;
|
88 |
-
cursor: pointer;
|
89 |
-
outline: 0;
|
90 |
-
}
|
91 |
-
|
92 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
93 |
-
display: inline-block;
|
94 |
-
}
|
95 |
-
|
96 |
-
.select2-container .select2-choice abbr:hover {
|
97 |
-
background-position: right -11px;
|
98 |
-
cursor: pointer;
|
99 |
-
}
|
100 |
-
|
101 |
-
.select2-drop-mask {
|
102 |
-
border: 0;
|
103 |
-
margin: 0;
|
104 |
-
padding: 0;
|
105 |
-
position: fixed;
|
106 |
-
left: 0;
|
107 |
-
top: 0;
|
108 |
-
min-height: 100%;
|
109 |
-
min-width: 100%;
|
110 |
-
height: auto;
|
111 |
-
width: auto;
|
112 |
-
opacity: 0;
|
113 |
-
z-index: 9998;
|
114 |
-
background-color: #fff;
|
115 |
-
filter: alpha(opacity=0);
|
116 |
-
}
|
117 |
-
|
118 |
-
.select2-drop {
|
119 |
-
width: 100%;
|
120 |
-
margin-top: -1px;
|
121 |
-
position: absolute;
|
122 |
-
z-index: 9999;
|
123 |
-
top: 100%;
|
124 |
-
|
125 |
-
background: #fff;
|
126 |
-
color: #000;
|
127 |
-
border: 1px solid #ccc;
|
128 |
-
border-top: 0;
|
129 |
-
|
130 |
-
border-radius: 0 0 3px 3px;
|
131 |
-
}
|
132 |
-
|
133 |
-
.select2-drop.select2-drop-above {
|
134 |
-
margin-top: 1px;
|
135 |
-
border-top: 1px solid #ccc;
|
136 |
-
border-bottom: 0;
|
137 |
-
|
138 |
-
border-radius: 3px 3px 0 0;
|
139 |
-
}
|
140 |
-
|
141 |
-
.select2-drop-active {
|
142 |
-
border: 1px solid #666;
|
143 |
-
border-top: none;
|
144 |
-
}
|
145 |
-
|
146 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
147 |
-
border-top: 1px solid #666;
|
148 |
-
}
|
149 |
-
|
150 |
-
.select2-drop-auto-width {
|
151 |
-
border-top: 1px solid #ccc;
|
152 |
-
width: auto;
|
153 |
-
}
|
154 |
-
|
155 |
-
.select2-drop-auto-width .select2-search {
|
156 |
-
padding-top: 4px;
|
157 |
-
}
|
158 |
-
|
159 |
-
.select2-container .select2-choice .select2-arrow {
|
160 |
-
display: inline-block;
|
161 |
-
width: 18px;
|
162 |
-
height: 100%;
|
163 |
-
position: absolute;
|
164 |
-
right: 0;
|
165 |
-
top: 0;
|
166 |
-
|
167 |
-
border-radius: 0 3px 3px 0;
|
168 |
-
|
169 |
-
background-clip: padding-box;
|
170 |
-
}
|
171 |
-
|
172 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
173 |
-
left: 0;
|
174 |
-
right: auto;
|
175 |
-
|
176 |
-
border-radius: 3px 0 0 3px;
|
177 |
-
}
|
178 |
-
|
179 |
-
.select2-container .select2-choice .select2-arrow b {
|
180 |
-
display: block;
|
181 |
-
width: 100%;
|
182 |
-
height: 100%;
|
183 |
-
position: relative;
|
184 |
-
|
185 |
-
&:after {
|
186 |
-
position: absolute;
|
187 |
-
display: block;
|
188 |
-
content: "";
|
189 |
-
top: 50%;
|
190 |
-
left: 50%;
|
191 |
-
border: 4px solid transparent;
|
192 |
-
border-top-color: #666;
|
193 |
-
margin-left: -7px;
|
194 |
-
margin-top: -2px;
|
195 |
-
}
|
196 |
-
}
|
197 |
-
|
198 |
-
.select2-search {
|
199 |
-
display: inline-block;
|
200 |
-
width: 100%;
|
201 |
-
margin: 0;
|
202 |
-
padding-left: 4px;
|
203 |
-
padding-right: 4px;
|
204 |
-
position: relative;
|
205 |
-
z-index: 10000;
|
206 |
-
white-space: nowrap;
|
207 |
-
padding-bottom: 4px;
|
208 |
-
}
|
209 |
-
|
210 |
-
.select2-search input {
|
211 |
-
width: 100%;
|
212 |
-
height: auto !important;
|
213 |
-
padding: 4px 20px 4px 5px !important;
|
214 |
-
margin: 0;
|
215 |
-
|
216 |
-
outline: 0;
|
217 |
-
font-family: sans-serif;
|
218 |
-
font-size: 1em;
|
219 |
-
|
220 |
-
border: 1px solid #ccc;
|
221 |
-
|
222 |
-
-webkit-box-shadow: none;
|
223 |
-
box-shadow: none;
|
224 |
-
|
225 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
226 |
-
}
|
227 |
-
|
228 |
-
html[dir="rtl"] .select2-search input {
|
229 |
-
padding: 4px 5px 4px 20px;
|
230 |
-
|
231 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
232 |
-
}
|
233 |
-
|
234 |
-
.select2-drop.select2-drop-above .select2-search input {
|
235 |
-
margin-top: 4px;
|
236 |
-
}
|
237 |
-
|
238 |
-
.select2-search input.select2-active {
|
239 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
240 |
-
}
|
241 |
-
|
242 |
-
.select2-container-active .select2-choice,
|
243 |
-
.select2-container-active .select2-choices {
|
244 |
-
border: 1px solid #666;
|
245 |
-
outline: none;
|
246 |
-
}
|
247 |
-
|
248 |
-
.select2-dropdown-open .select2-choice {
|
249 |
-
border-bottom-color: transparent;
|
250 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
251 |
-
box-shadow: 0 1px 0 #fff inset;
|
252 |
-
|
253 |
-
border-bottom-left-radius: 0;
|
254 |
-
border-bottom-right-radius: 0;
|
255 |
-
|
256 |
-
.select2-arrow {
|
257 |
-
b {
|
258 |
-
&:after {
|
259 |
-
border-top-color: transparent;
|
260 |
-
border-bottom-color: #666;
|
261 |
-
margin-top: -6px;
|
262 |
-
}
|
263 |
-
}
|
264 |
-
}
|
265 |
-
}
|
266 |
-
|
267 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
268 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
269 |
-
border: 1px solid #666;
|
270 |
-
border-top-color: transparent;
|
271 |
-
}
|
272 |
-
|
273 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
274 |
-
background: transparent;
|
275 |
-
border-left: none;
|
276 |
-
filter: none;
|
277 |
-
}
|
278 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
279 |
-
border-right: none;
|
280 |
-
}
|
281 |
-
|
282 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
283 |
-
background-position: -18px 1px;
|
284 |
-
}
|
285 |
-
|
286 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
287 |
-
background-position: -16px 1px;
|
288 |
-
}
|
289 |
-
|
290 |
-
.select2-hidden-accessible {
|
291 |
-
border: 0;
|
292 |
-
clip: rect(0 0 0 0);
|
293 |
-
height: 1px;
|
294 |
-
margin: -1px;
|
295 |
-
overflow: hidden;
|
296 |
-
padding: 0;
|
297 |
-
position: absolute;
|
298 |
-
width: 1px;
|
299 |
-
}
|
300 |
-
|
301 |
-
/* results */
|
302 |
-
.select2-results {
|
303 |
-
max-height: 200px;
|
304 |
-
padding: 4px;
|
305 |
-
margin: 0;
|
306 |
-
position: relative;
|
307 |
-
overflow-x: hidden;
|
308 |
-
overflow-y: auto;
|
309 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
310 |
-
background: #fafafa;
|
311 |
-
}
|
312 |
-
|
313 |
-
html[dir="rtl"] .select2-results {
|
314 |
-
padding: 0 4px 0 0;
|
315 |
-
margin: 4px 0 4px 4px;
|
316 |
-
}
|
317 |
-
|
318 |
-
.select2-results ul.select2-result-sub {
|
319 |
-
margin: 0;
|
320 |
-
padding-left: 0;
|
321 |
-
}
|
322 |
-
|
323 |
-
.select2-results li {
|
324 |
-
list-style: none;
|
325 |
-
display: list-item;
|
326 |
-
background-image: none;
|
327 |
-
margin: 3px 0;
|
328 |
-
}
|
329 |
-
|
330 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
331 |
-
font-weight: bold;
|
332 |
-
}
|
333 |
-
|
334 |
-
.select2-results .select2-result-label {
|
335 |
-
padding: 5px 7px;
|
336 |
-
margin: 0;
|
337 |
-
cursor: pointer;
|
338 |
-
|
339 |
-
min-height: 1em;
|
340 |
-
|
341 |
-
-webkit-touch-callout: none;
|
342 |
-
-webkit-user-select: none;
|
343 |
-
-moz-user-select: none;
|
344 |
-
-ms-user-select: none;
|
345 |
-
user-select: none;
|
346 |
-
}
|
347 |
-
|
348 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
349 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
350 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
351 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
352 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
353 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
354 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
355 |
-
|
356 |
-
.select2-results .select2-highlighted {
|
357 |
-
background: #f1f1f1;
|
358 |
-
color: #000;
|
359 |
-
border-radius: 3px;
|
360 |
-
}
|
361 |
-
|
362 |
-
.select2-results li em {
|
363 |
-
background: #feffde;
|
364 |
-
font-style: normal;
|
365 |
-
}
|
366 |
-
|
367 |
-
.select2-results .select2-highlighted em {
|
368 |
-
background: transparent;
|
369 |
-
}
|
370 |
-
|
371 |
-
.select2-results .select2-highlighted ul {
|
372 |
-
background: #fff;
|
373 |
-
color: #000;
|
374 |
-
}
|
375 |
-
|
376 |
-
.select2-results .select2-no-results,
|
377 |
-
.select2-results .select2-searching,
|
378 |
-
.select2-results .select2-ajax-error,
|
379 |
-
.select2-results .select2-selection-limit {
|
380 |
-
background: #f4f4f4;
|
381 |
-
display: list-item;
|
382 |
-
padding-left: 5px;
|
383 |
-
}
|
384 |
-
|
385 |
-
/*
|
386 |
-
disabled look for disabled choices in the results dropdown
|
387 |
-
*/
|
388 |
-
.select2-results .select2-disabled.select2-highlighted {
|
389 |
-
color: #666;
|
390 |
-
background: #f4f4f4;
|
391 |
-
display: list-item;
|
392 |
-
cursor: default;
|
393 |
-
}
|
394 |
-
.select2-results .select2-disabled {
|
395 |
-
background: #f4f4f4;
|
396 |
-
display: list-item;
|
397 |
-
cursor: default;
|
398 |
-
}
|
399 |
-
|
400 |
-
.select2-results .select2-selected {
|
401 |
-
display: none;
|
402 |
-
}
|
403 |
-
|
404 |
-
.select2-more-results.select2-active {
|
405 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
406 |
-
}
|
407 |
-
|
408 |
-
.select2-results .select2-ajax-error {
|
409 |
-
background: rgba(255, 50, 50, .2);
|
410 |
-
}
|
411 |
-
|
412 |
-
.select2-more-results {
|
413 |
-
background: #f4f4f4;
|
414 |
-
display: list-item;
|
415 |
-
}
|
416 |
-
|
417 |
-
/* disabled styles */
|
418 |
-
|
419 |
-
.select2-container.select2-container-disabled .select2-choice {
|
420 |
-
background-color: #f4f4f4;
|
421 |
-
background-image: none;
|
422 |
-
border: 1px solid #ddd;
|
423 |
-
cursor: default;
|
424 |
-
}
|
425 |
-
|
426 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
427 |
-
background-color: #f4f4f4;
|
428 |
-
background-image: none;
|
429 |
-
border-left: 0;
|
430 |
-
}
|
431 |
-
|
432 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
433 |
-
display: none;
|
434 |
-
}
|
435 |
-
|
436 |
-
|
437 |
-
/* multiselect */
|
438 |
-
|
439 |
-
.select2-container-multi .select2-choices {
|
440 |
-
height: auto !important;
|
441 |
-
height: 1%;
|
442 |
-
margin: 0;
|
443 |
-
padding: 0 5px 0 0;
|
444 |
-
position: relative;
|
445 |
-
|
446 |
-
border: 1px solid #ccc;
|
447 |
-
cursor: text;
|
448 |
-
overflow: hidden;
|
449 |
-
|
450 |
-
background-color: #fff;
|
451 |
-
}
|
452 |
-
|
453 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
454 |
-
padding: 0 0 0 5px;
|
455 |
-
}
|
456 |
-
|
457 |
-
.select2-locked {
|
458 |
-
padding: 3px 5px 3px 5px !important;
|
459 |
-
}
|
460 |
-
|
461 |
-
.select2-container-multi .select2-choices {
|
462 |
-
min-height: 26px;
|
463 |
-
}
|
464 |
-
|
465 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
466 |
-
border: 1px solid #666;
|
467 |
-
outline: none;
|
468 |
-
}
|
469 |
-
.select2-container-multi .select2-choices li {
|
470 |
-
float: left;
|
471 |
-
list-style: none;
|
472 |
-
}
|
473 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
474 |
-
{
|
475 |
-
float: right;
|
476 |
-
}
|
477 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
478 |
-
margin: 0;
|
479 |
-
padding: 0;
|
480 |
-
white-space: nowrap;
|
481 |
-
}
|
482 |
-
|
483 |
-
.select2-container-multi .select2-choices .select2-search-field:first-child {
|
484 |
-
width: 100%;
|
485 |
-
}
|
486 |
-
|
487 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
488 |
-
padding: 5px;
|
489 |
-
margin: 1px 0;
|
490 |
-
font-family: sans-serif;
|
491 |
-
outline: 0;
|
492 |
-
border: 0;
|
493 |
-
-webkit-box-shadow: none;
|
494 |
-
box-shadow: none;
|
495 |
-
background: transparent !important;
|
496 |
-
}
|
497 |
-
|
498 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
499 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
500 |
-
}
|
501 |
-
|
502 |
-
.select2-default {
|
503 |
-
color: #999 !important;
|
504 |
-
}
|
505 |
-
|
506 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
507 |
-
padding: 5px 8px 5px 24px;
|
508 |
-
margin: 3px 0 3px 5px;
|
509 |
-
position: relative;
|
510 |
-
|
511 |
-
line-height: 15px;
|
512 |
-
color: #333;
|
513 |
-
cursor: default;
|
514 |
-
border-radius: 2px;
|
515 |
-
|
516 |
-
background-clip: padding-box;
|
517 |
-
|
518 |
-
-webkit-touch-callout: none;
|
519 |
-
-webkit-user-select: none;
|
520 |
-
-moz-user-select: none;
|
521 |
-
-ms-user-select: none;
|
522 |
-
user-select: none;
|
523 |
-
|
524 |
-
background-color: #e4e4e4;
|
525 |
-
}
|
526 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
527 |
-
{
|
528 |
-
margin: 3px 5px 3px 0;
|
529 |
-
padding: 5px 24px 5px 8px;
|
530 |
-
}
|
531 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
532 |
-
cursor: default;
|
533 |
-
}
|
534 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
535 |
-
background: #d4d4d4;
|
536 |
-
}
|
537 |
-
|
538 |
-
.select2-search-choice-close {
|
539 |
-
display: block;
|
540 |
-
width: 12px;
|
541 |
-
height: 13px;
|
542 |
-
position: absolute;
|
543 |
-
right: 7px;
|
544 |
-
top: 6px;
|
545 |
-
|
546 |
-
font-size: 1px;
|
547 |
-
outline: none;
|
548 |
-
background: url('select2.png') right top no-repeat;
|
549 |
-
}
|
550 |
-
html[dir="rtl"] .select2-search-choice-close {
|
551 |
-
right: auto;
|
552 |
-
left: 7px;
|
553 |
-
}
|
554 |
-
|
555 |
-
.select2-container-multi .select2-search-choice-close {
|
556 |
-
left: 7px;
|
557 |
-
}
|
558 |
-
|
559 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
560 |
-
left: auto;
|
561 |
-
right: 7px;
|
562 |
-
}
|
563 |
-
|
564 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
565 |
-
background-position: right -11px;
|
566 |
-
}
|
567 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
568 |
-
background-position: right -11px;
|
569 |
-
}
|
570 |
-
|
571 |
-
/* disabled styles */
|
572 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
573 |
-
background-color: #f4f4f4;
|
574 |
-
background-image: none;
|
575 |
-
border: 1px solid #ddd;
|
576 |
-
cursor: default;
|
577 |
-
}
|
578 |
-
|
579 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
580 |
-
padding: 3px 5px 3px 5px;
|
581 |
-
border: 1px solid #ddd;
|
582 |
-
background-image: none;
|
583 |
-
background-color: #f4f4f4;
|
584 |
-
}
|
585 |
-
|
586 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
587 |
-
background: none;
|
588 |
-
}
|
589 |
-
/* end multiselect */
|
590 |
-
|
591 |
-
|
592 |
-
.select2-result-selectable .select2-match,
|
593 |
-
.select2-result-unselectable .select2-match {
|
594 |
-
text-decoration: underline;
|
595 |
-
}
|
596 |
-
|
597 |
-
.select2-offscreen, .select2-offscreen:focus {
|
598 |
-
clip: rect(0 0 0 0) !important;
|
599 |
-
width: 1px !important;
|
600 |
-
height: 1px !important;
|
601 |
-
border: 0 !important;
|
602 |
-
margin: 0 !important;
|
603 |
-
padding: 0 !important;
|
604 |
-
overflow: hidden !important;
|
605 |
-
position: absolute !important;
|
606 |
-
outline: 0 !important;
|
607 |
-
left: 0px !important;
|
608 |
-
top: 0px !important;
|
609 |
-
}
|
610 |
-
|
611 |
-
.select2-display-none {
|
612 |
-
display: none;
|
613 |
-
}
|
614 |
-
|
615 |
-
.select2-measure-scrollbar {
|
616 |
-
position: absolute;
|
617 |
-
top: -10000px;
|
618 |
-
left: -10000px;
|
619 |
-
width: 100px;
|
620 |
-
height: 100px;
|
621 |
-
overflow: scroll;
|
622 |
-
}
|
623 |
-
|
624 |
-
/* Sidebars related */
|
625 |
-
|
626 |
-
.cas-select2.select2-drop {
|
627 |
-
box-sizing: border-box;
|
628 |
-
width: 100%;
|
629 |
-
margin-top: -1px;
|
630 |
-
position: absolute;
|
631 |
-
z-index: 9999;
|
632 |
-
top: 100%;
|
633 |
-
background: #fff;
|
634 |
-
color: #444;
|
635 |
-
border: 1px solid #ddd;
|
636 |
-
border-top: 0;
|
637 |
-
border-radius: 0 0 3px 3px;
|
638 |
-
box-shadow: 0 2px 3px rgba(0, 0, 0, .15)
|
639 |
-
}
|
640 |
-
.cas-select2.select2-drop.select2-drop-active {
|
641 |
-
border: 1px solid #5b9dd9;
|
642 |
-
border-top: none
|
643 |
-
}
|
644 |
-
.cas-select2.select2-drop.select2-drop-above {
|
645 |
-
margin-top: 1px;
|
646 |
-
border-top: 1px solid #ddd;
|
647 |
-
border-bottom: 0;
|
648 |
-
border-radius: 3px 3px 0 0;
|
649 |
-
box-shadow: 0 -2px 3px rgba(0, 0, 0, .15)
|
650 |
-
}
|
651 |
-
.cas-select2.select2-drop.select2-drop-above.select2-drop-active {
|
652 |
-
border-top: 1px solid #5b9dd9;
|
653 |
-
}
|
654 |
-
.cas-select2.select2-drop-auto-width {
|
655 |
-
border-top: 1px solid #ddd;
|
656 |
-
}
|
657 |
-
.cas-select2 .select2-results {
|
658 |
-
padding: 0 0 0 4px;
|
659 |
-
margin: 4px 4px 4px 0;
|
660 |
-
}
|
661 |
-
.cas-select2 .select2-results li {
|
662 |
-
margin-bottom: 0
|
663 |
-
}
|
664 |
-
|
665 |
-
.cas-select2 .select2-results .select2-result-label {
|
666 |
-
padding: 3px 7px 4px;
|
667 |
-
margin: 0;
|
668 |
-
}
|
669 |
-
.cas-select2 .select2-results .select2-highlighted {
|
670 |
-
background: #3875d7;
|
671 |
-
color: #fff
|
672 |
-
}
|
673 |
-
.cas-select2 .select2-results .select2-highlighted em {
|
674 |
-
background: none;
|
675 |
-
}
|
676 |
-
.cas-select2 .select2-results .select2-highlighted ul {
|
677 |
-
color: #444;
|
678 |
-
}
|
679 |
-
.cas-select2 .select2-results .select2-ajax-error,
|
680 |
-
.cas-select2 .select2-results .select2-more-results,
|
681 |
-
.cas-select2 .select2-results .select2-no-results,
|
682 |
-
.cas-select2 .select2-results .select2-searching,
|
683 |
-
.cas-select2 .select2-results .select2-selection-limit {
|
684 |
-
padding: 3px 7px 4px;
|
685 |
-
font-weight: 700
|
686 |
-
}
|
687 |
-
|
688 |
-
.cas-select2.select2-container-multi.select2-container-active .select2-choices {
|
689 |
-
border: 1px solid #5b9dd9;
|
690 |
-
outline: 0;
|
691 |
-
box-shadow: 0 2px 3px rgba(0, 0, 0, .15)
|
692 |
-
}
|
693 |
-
.cas-select2.select2-container-multi .select2-choices {
|
694 |
-
height: auto!important;
|
695 |
-
height: 1%;
|
696 |
-
margin: 0;
|
697 |
-
padding: 0 5px 0 0;
|
698 |
-
position: relative;
|
699 |
-
border: 1px solid #ddd;
|
700 |
-
cursor: text;
|
701 |
-
overflow: hidden;
|
702 |
-
background-color: #fff;
|
703 |
-
box-shadow: 0 1px 2px rgba(0, 0, 0, .07) inset;
|
704 |
-
min-height: 26px
|
705 |
-
}
|
706 |
-
|
707 |
-
.cas-select2.select2-container-multi .select2-choices .select2-search-choice {
|
708 |
-
padding: 3px 5px 3px 18px;
|
709 |
-
margin: 3px 0 3px 4px;
|
710 |
-
line-height: 1;
|
711 |
-
color: #23282d;
|
712 |
-
border: 1px solid #439eb4;
|
713 |
-
border-radius: 2px;
|
714 |
-
box-shadow: 0 1px 0 0 rgba(255, 255, 255, .9) inset, 0 1px 1px rgba(0, 0, 0, .1);
|
715 |
-
background-color: #bfe7f1
|
716 |
-
}
|
717 |
-
.cas-select2 .select2-search-choice-close {
|
718 |
-
font-size: inherit;
|
719 |
-
background: 0 0;
|
720 |
-
display: block;
|
721 |
-
width: 13px;
|
722 |
-
height: 13px;
|
723 |
-
position: absolute;
|
724 |
-
right: auto;
|
725 |
-
top: 4px!important;
|
726 |
-
left: 3px!important;
|
727 |
-
outline: 0;
|
728 |
-
color: #439eb4;
|
729 |
-
transition: color .3s ease
|
730 |
-
}
|
731 |
-
.cas-select2 .select2-search-choice-close:after {
|
732 |
-
|
733 |
-
position: absolute;
|
734 |
-
top: 0;
|
735 |
-
left: 0;
|
736 |
-
width: 100%;
|
737 |
-
height: 100%;
|
738 |
-
content: "\f158";
|
739 |
-
font-family: dashicons
|
740 |
-
}
|
741 |
-
.cas-select2 .select2-search-choice-close:hover {
|
742 |
-
color:#444;
|
743 |
-
}
|
744 |
-
|
745 |
-
.cas-select2.select2-container-multi .select2-choices .select2-search-choice-focus {
|
746 |
-
background: #81d0e3
|
747 |
-
}
|
748 |
-
|
749 |
-
.cas-select2 .select2-search {
|
750 |
-
min-height: 26px;
|
751 |
-
margin: 0;
|
752 |
-
padding: 4px 4px 0;
|
753 |
-
}
|
754 |
-
.cas-select2.select2-container-active .select2-choices {
|
755 |
-
border: 1px solid #5897fb;
|
756 |
-
outline: 0;
|
757 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3)
|
758 |
-
}
|
759 |
-
html[dir=rtl] .cas-select2 .select2-results {
|
760 |
-
padding: 0 4px 0 0;
|
761 |
-
margin: 4px 0 4px 4px
|
762 |
-
}
|
763 |
-
html[dir=rtl] .cas-select2.select2-container-multi .select2-search-choice-close {
|
764 |
-
left: auto!important;
|
765 |
-
right: 3px!important;
|
766 |
-
}
|
767 |
-
html[dir=rtl] .cas-select2.select2-container-multi .select2-choices {
|
768 |
-
padding: 0 0 0 5px
|
769 |
-
}
|
770 |
-
|
771 |
-
html[dir=rtl] .cas-select2.select2-container-multi .select2-choices .select2-search-choice {
|
772 |
-
margin: 3px 5px 3px 0;
|
773 |
-
padding: 3px 18px 3px 5px
|
774 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
css/select2/select2.png
DELETED
Binary file
|
css/style.css
CHANGED
@@ -3,4 +3,4 @@
|
|
3 |
* @author Joachim Jensen <jv@intox.dk>
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
-
*/#cas-rules .cas-heart{color:#ac170a}.cas-section{display:none}.nav-tab-active:focus{box-shadow:none}#submitdiv .hndle,#submitdiv .handlediv{display:none}#submitdiv .cas-save{background:#f5f5f5;border-bottom:1px solid #ddd;overflow:hidden;padding:7px 10px}#submitdiv .cas-overview-actions{padding:0 10px}#submitdiv .cas-overview-actions .dashicons{color:#82878c}#submitdiv .cas-overview-actions li{margin-bottom:14px}.cas-pro-label{background-color:#31c455;border-radius:5px;color:#fff;padding:3px 8px 3px;text-transform:uppercase;vertical-align:baseline;white-space:nowrap;font-weight:700}a.cas-delete{color:#a00;text-decoration:none}a.cas-delete:hover{color:red}.cas-schedule-slide.ui-slider{position:relative;margin:12px;border-radius:4px;background:#c5c5c5;color:#333}.cas-schedule-slide.ui-slider .ui-slider-handle{position:absolute;z-index:2;height:24px;width:24px;-ms-touch-action:none;touch-action:none;text-align:center;border-radius:12px;transition:background 200ms ease}.cas-schedule-slide.ui-slider .ui-slider-handle.ui-state-default{border:1px solid #c5c5c5;background:#fff;box-shadow:0 0 0 9px #fff inset,0 1px 2px rgba(0,0,0,.15)}.cas-schedule-slide.ui-slider .ui-slider-handle.ui-state-active{background:#7ad03a}.cas-schedule-slide.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background:#7ad03a}.cas-schedule-slide.ui-slider.ui-state-disabled{opacity:.35;cursor:default!important;pointer-events:none}.cas-schedule-slide.ui-slider.ui-slider-horizontal{height:4px}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-handle{margin-left:-12px;top:-12px}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range-min{left:0}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range-max{right:0}.button.button-cas-upgrade{background:#dd1d0c;color:#fff;border-color:#ac170a;font-weight:700;box-shadow:0 0 0 1px rgba(255,255,255,.3) inset,0 1px 0 #ac170a}.button.button-cas-upgrade:hover{color:#fff;border-color:#ac170a;background:#eb5c50}.button.button-cas-upgrade:active,.button.button-cas-upgrade:focus{color:#fff;background:#dd1d0c;border-color:#ac170a;box-shadow:inset 0 2px 0 #ac170a;vertical-align:top}#cas-plugin-links.postbox{background-color:#ddecf4;border-color:#9fcadf;box-shadow:0 0 0 1px #fff inset,0 1px 1px rgba(0,0,0,.04)}#cas-plugin-links .hndle{border-bottom-color:#9fcadf;box-shadow:0 -1px #fff inset}.wp-list-table.fixed.striped>tbody>:nth-child(2n+1){background-color:#f9f9f9}.wp-list-table.fixed .column-widgets{width:8%}.wp-list-table.fixed .column-visibility{width:20%}.wp-list-table.fixed .column-handle{width:25%}.wp-list-table.fixed .column-status{width:12%}.widget-liquid-right .widgets-holder-wrap .cas-settings{border-top:1px solid #dfdfdf;border-bottom:1px solid #dfdfdf;background-color:#f7f7f7;margin-left:-8px;margin-right:-8px;margin-bottom:10px;overflow:hidden}.widget-liquid-right .widgets-holder-wrap .sidebar-status{margin:10px 10px 0;float:right;position:relative;width:28px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;box-sizing:border-box}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input{display:none}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-label{display:block;overflow:hidden;cursor:pointer;height:16px;padding:0;line-height:16px;border-radius:16px;background-color:#dc3232;box-shadow:0 0 2px rgba(0,0,0,.2) inset;transition:background-color .2s ease-in}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-label:before{content:"";display:block;width:12px;height:12px;margin:0;background:#FFF;position:absolute;top:2px;bottom:0;right:14px;border-radius:16px;transition:right .2s ease-in 0s;box-shadow:0 1px 2px rgba(0,0,0,.2)}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:checked+.sidebar-status-label{background-color:#7ad03a}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:checked+.sidebar-status-label:before{right:2px}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input.sidebar-status-future:not(:checked)+.sidebar-status-label{background-color:#ffb900}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:disabled+.sidebar-status-label{cursor:auto}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link{display:inline-block;border-left:1px solid #dfdfdf;border-right:1px solid #dfdfdf;padding:8px 10px;color:#444;text-decoration:none}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link:hover{color:#2ea2cc}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link:first-of-type{border:0}.widget-liquid-right .widgets-holder-wrap.closed .cas-settings{display:none}.widget-liquid-right .widgets-holder-wrap div[id^=ca-sidebar]{box-shadow:inset 0 4px 0 #75d7ef}.cas-form-table tr td:first-child{min-width:30%}.cas-schedule-days{text-transform:uppercase;overflow:hidden;display:inline-block;border:1px solid #dfdfdf;margin:0;border-radius:3px}.cas-schedule-days li{float:left;margin:0}.cas-schedule-days input{display:none}.cas-schedule-days label{transition:background 200ms;background:#0085BA;display:block;padding:8px 12px;color:#fff}.cas-schedule-days label:hover{background:#007aab}.cas-schedule-days input:checked+label{color:inherit;background:#f1f1f1}.cas-schedule-days input:checked+label:hover{background:#e9e9e9}.cas-filter-sidebar{margin:10px 0;vertical-align:middle}.cas-filter-sidebar .sidebars-toggle{margin:16px 16px 0 0;float:right;display:inline-block}.cas-filter-sidebar .button,.cas-filter-sidebar input{margin:12px 0 11px}.cas-filter-sidebar input{float:right}.cas-filter-widget{margin:10px 0}body.branch-3-9 .cas-filter-sidebar.wp-filter{background:#fff none repeat scroll 0 0;border:1px solid #e5e5e5;box-shadow:0 1px 1px rgba(0,0,0,.04);box-sizing:border-box;color:#555;display:inline-block;font-size:13px;margin:9pt 0 25px;padding:0 10px;position:relative;width:100%}body.branch-3-9 .cas-filter-sidebar.wp-filter input{padding:3px 5px;line-height:initial}body.branch-3-9 .cas-filter-widget{padding:3px 5px;line-height:initial}
|
3 |
* @author Joachim Jensen <jv@intox.dk>
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
+
*/#cas-rules .cas-heart{color:#ac170a}.cas-section{display:none}.nav-tab-active:focus{box-shadow:none}#submitdiv .hndle,#submitdiv .handlediv{display:none}#submitdiv .cas-save{background:#f5f5f5;border-bottom:1px solid #ddd;overflow:hidden;padding:7px 10px}#submitdiv .cas-overview-actions{padding:0 10px}#submitdiv .cas-overview-actions .dashicons{color:#82878c}#submitdiv .cas-overview-actions li{margin-bottom:14px}.cas-pro-label{background-color:#31c455;border-radius:5px;color:#fff;padding:3px 8px 3px;text-transform:uppercase;vertical-align:baseline;white-space:nowrap;font-weight:700}a.cas-delete{color:#a00;text-decoration:none}a.cas-delete:hover{color:red}.cas-schedule-slide.ui-slider{position:relative;margin:12px;border-radius:4px;background:#c5c5c5;color:#333}.cas-schedule-slide.ui-slider .ui-slider-handle{position:absolute;z-index:2;height:24px;width:24px;-ms-touch-action:none;touch-action:none;text-align:center;border-radius:12px;transition:background 200ms ease}.cas-schedule-slide.ui-slider .ui-slider-handle.ui-state-default{border:1px solid #c5c5c5;background:#fff;box-shadow:0 0 0 9px #fff inset,0 1px 2px rgba(0,0,0,.15)}.cas-schedule-slide.ui-slider .ui-slider-handle.ui-state-active{background:#7ad03a}.cas-schedule-slide.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background:#7ad03a}.cas-schedule-slide.ui-slider.ui-state-disabled{opacity:.35;cursor:default!important;pointer-events:none}.cas-schedule-slide.ui-slider.ui-slider-horizontal{height:4px}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-handle{margin-left:-12px;top:-12px}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range-min{left:0}.cas-schedule-slide.ui-slider.ui-slider-horizontal .ui-slider-range-max{right:0}.button.button-cas-upgrade{background:#dd1d0c;color:#fff;border-color:#ac170a;font-weight:700;box-shadow:0 0 0 1px rgba(255,255,255,.3) inset,0 1px 0 #ac170a}.button.button-cas-upgrade:hover{color:#fff;border-color:#ac170a;background:#eb5c50}.button.button-cas-upgrade:active,.button.button-cas-upgrade:focus{color:#fff;background:#dd1d0c;border-color:#ac170a;box-shadow:inset 0 2px 0 #ac170a;vertical-align:top}#cas-plugin-links.postbox{background-color:#ddecf4;border-color:#9fcadf;box-shadow:0 0 0 1px #fff inset,0 1px 1px rgba(0,0,0,.04)}#cas-plugin-links .hndle{border-bottom-color:#9fcadf;box-shadow:0 -1px #fff inset}.wp-list-table.fixed.striped>tbody>:nth-child(2n+1){background-color:#f9f9f9}.wp-list-table.fixed .column-widgets{width:8%}.wp-list-table.fixed .column-visibility{width:20%}.wp-list-table.fixed .column-handle{width:25%}.wp-list-table.fixed .column-status{width:12%}.widget-liquid-right .widgets-holder-wrap .cas-settings{border-top:1px solid #dfdfdf;border-bottom:1px solid #dfdfdf;background-color:#f7f7f7;margin-left:-8px;margin-right:-8px;margin-bottom:10px;overflow:hidden}.widget-liquid-right .widgets-holder-wrap .sidebar-status{margin:10px 10px 0;float:right;position:relative;width:28px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;box-sizing:border-box}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input{display:none}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-label{display:block;overflow:hidden;cursor:pointer;height:16px;padding:0;line-height:16px;border-radius:16px;background-color:#dc3232;box-shadow:0 0 2px rgba(0,0,0,.2) inset;transition:background-color .2s ease-in}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-label:before{content:"";display:block;width:12px;height:12px;margin:0;background:#FFF;position:absolute;top:2px;bottom:0;right:14px;border-radius:16px;transition:right .2s ease-in 0s;box-shadow:0 1px 2px rgba(0,0,0,.2)}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:checked+.sidebar-status-label{background-color:#7ad03a}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:checked+.sidebar-status-label:before{right:2px}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input.sidebar-status-future:not(:checked)+.sidebar-status-label{background-color:#ffb900}.widget-liquid-right .widgets-holder-wrap .sidebar-status .sidebar-status-input:disabled+.sidebar-status-label{cursor:auto}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link{display:inline-block;border-left:1px solid #dfdfdf;border-right:1px solid #dfdfdf;padding:8px 10px;color:#444;text-decoration:none}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link:hover{color:#2ea2cc}.widget-liquid-right .widgets-holder-wrap .cas-sidebar-link:first-of-type{border:0}.widget-liquid-right .widgets-holder-wrap.closed .cas-settings{display:none}.widget-liquid-right .widgets-holder-wrap div[id^=ca-sidebar]{box-shadow:inset 0 4px 0 #75d7ef}.cas-form-table tr td:first-child{min-width:30%}.cas-schedule-days{text-transform:uppercase;overflow:hidden;display:inline-block;border:1px solid #dfdfdf;margin:0;border-radius:3px}.cas-schedule-days li{float:left;margin:0}.cas-schedule-days input{display:none}.cas-schedule-days label{transition:background 200ms;background:#0085BA;display:block;padding:8px 12px;color:#fff}.cas-schedule-days label:hover{background:#007aab}.cas-schedule-days input:checked+label{color:inherit;background:#f1f1f1}.cas-schedule-days input:checked+label:hover{background:#e9e9e9}.cas-filter-sidebar{max-width:calc(900px + 2%);margin:10px 0;vertical-align:middle}.cas-filter-sidebar .sidebars-toggle{margin:16px 16px 0 0;float:right;display:inline-block}.cas-filter-sidebar .button,.cas-filter-sidebar input{margin:12px 0 11px}.cas-filter-sidebar input{float:right}.cas-filter-widget{margin:10px 0}body.branch-3-9 .cas-filter-sidebar.wp-filter{background:#fff none repeat scroll 0 0;border:1px solid #e5e5e5;box-shadow:0 1px 1px rgba(0,0,0,.04);box-sizing:border-box;color:#555;display:inline-block;font-size:13px;margin:9pt 0 25px;padding:0 10px;position:relative;width:100%}body.branch-3-9 .cas-filter-sidebar.wp-filter input{padding:3px 5px;line-height:initial}body.branch-3-9 .cas-filter-widget{padding:3px 5px;line-height:initial}@media (min-width:785px){.js.branch-4-7.widgets-php:not(.widgets_access) #screen-meta{z-index:20}.js.branch-4-7.widgets-php:not(.widgets_access) .wrap h1{margin:0 0 0 calc(38% + 56px)}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets{z-index:1;position:fixed;top:32px;padding:0 10px;background:#fafafa;box-shadow:0 0 5px 0 rgba(0,0,0,.1);width:32%;border-color:#dfdfdf;border-style:solid;border-width:1px;left:160px}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets .cas-filter-widget{width:100%}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets .sidebar-name .sidebar-name-arrow{display:block}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets .widget{padding-bottom:10px}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets #widget-list{border-top:1px solid #dfdfdf;padding:3px;margin:0 -10px;background:#fff}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets:not(.closed){min-height:600px;bottom:0}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets:not(.closed) .sidebar-name{position:static}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets:not(.closed) #removing-widget{box-sizing:border-box;padding:10px 0 0;color:#c00;z-index:2;text-align:center;position:absolute;background-color:rgba(255,255,255,.6);border:4px dashed #c00;top:0;left:0;right:0;height:100%}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets:not(.closed) .description{display:none}.js.branch-4-7.widgets-php:not(.widgets_access) #available-widgets:not(.closed) #widget-list{position:fixed;top:120px;padding:12px 10px;overflow-y:auto;width:calc(32% - 1px);bottom:0}.js.branch-4-7.widgets-php:not(.widgets_access).folded #available-widgets{left:36px;width:38%}.js.branch-4-7.widgets-php:not(.widgets_access).folded #available-widgets:not(.closed) #widget-list{width:calc(38% - 1px)}.js.branch-4-7.widgets-php:not(.widgets_access).rtl .wrap h1{margin:0 calc(38% + 56px) 0 0}.js.branch-4-7.widgets-php:not(.widgets_access).rtl #available-widgets{box-shadow:0 0 5px 0 rgba(0,0,0,.1);border-width:0 0 0 1px;right:160px;left:auto}.js.branch-4-7.widgets-php:not(.widgets_access).rtl.folded #available-widgets{left:auto;right:36px}}@media (min-width:785px) and (max-width:960px){.js.branch-4-7.widgets-php.auto-fold:not(.widgets_access) #available-widgets{left:36px;width:38%}.js.branch-4-7.widgets-php.auto-fold:not(.widgets_access) #available-widgets:not(.closed) #widget-list{width:calc(38% - 1px)}.js.branch-4-7.widgets-php.auto-fold:not(.widgets_access).rtl #available-widgets{left:auto;right:36px}}@media (min-width:1250px){.js.branch-4-7.widgets-php:not(.widgets_access) #widgets-left #available-widgets .widget:nth-child(even){float:left;margin:0 0 0 2%}.js.branch-4-7.widgets-php:not(.widgets_access).rtl #widgets-left #available-widgets .widget{float:right;padding-left:2%}.js.branch-4-7.widgets-php:not(.widgets_access).rtl #widgets-left #available-widgets .widget:nth-child(odd){margin-right:-2%}}
|
freemius.php
CHANGED
@@ -24,6 +24,7 @@ function cas_fs()
|
|
24 |
$cas_fs = fs_dynamic_init( array(
|
25 |
'id' => '259',
|
26 |
'slug' => 'content-aware-sidebars',
|
|
|
27 |
'public_key' => 'pk_75513325effa77f024565ef74c9d6',
|
28 |
'is_premium' => false,
|
29 |
'has_addons' => false,
|
@@ -41,6 +42,8 @@ function cas_fs()
|
|
41 |
|
42 |
// Init Freemius.
|
43 |
cas_fs();
|
|
|
|
|
44 |
global $cas_fs ;
|
45 |
function cas_fs_connect_message_update(
|
46 |
$message,
|
@@ -78,7 +81,7 @@ function cas_fs_upgrade()
|
|
78 |
global $cas_fs ;
|
79 |
$flag = 'cas_pro';
|
80 |
$upgrade_flag = (int) $cas_fs->can_use_premium_code();
|
81 |
-
if ( $upgrade_flag != get_option( $flag, 0 ) ) {
|
82 |
if ( !$upgrade_flag ) {
|
83 |
//downgrade
|
84 |
update_option( $flag, $upgrade_flag );
|
@@ -86,7 +89,7 @@ function cas_fs_upgrade()
|
|
86 |
}
|
87 |
}
|
88 |
|
89 |
-
add_action( '
|
90 |
function cas_fs_uninstall()
|
91 |
{
|
92 |
require plugin_dir_path( __FILE__ ) . '/cas_uninstall.php';
|
24 |
$cas_fs = fs_dynamic_init( array(
|
25 |
'id' => '259',
|
26 |
'slug' => 'content-aware-sidebars',
|
27 |
+
'type' => 'plugin',
|
28 |
'public_key' => 'pk_75513325effa77f024565ef74c9d6',
|
29 |
'is_premium' => false,
|
30 |
'has_addons' => false,
|
42 |
|
43 |
// Init Freemius.
|
44 |
cas_fs();
|
45 |
+
// Signal that SDK was initiated.
|
46 |
+
do_action( 'cas_fs_loaded' );
|
47 |
global $cas_fs ;
|
48 |
function cas_fs_connect_message_update(
|
49 |
$message,
|
81 |
global $cas_fs ;
|
82 |
$flag = 'cas_pro';
|
83 |
$upgrade_flag = (int) $cas_fs->can_use_premium_code();
|
84 |
+
if ( $upgrade_flag != (int) get_option( $flag, 0 ) ) {
|
85 |
if ( !$upgrade_flag ) {
|
86 |
//downgrade
|
87 |
update_option( $flag, $upgrade_flag );
|
89 |
}
|
90 |
}
|
91 |
|
92 |
+
add_action( 'admin_init', 'cas_fs_upgrade', 999 );
|
93 |
function cas_fs_uninstall()
|
94 |
{
|
95 |
require plugin_dir_path( __FILE__ ) . '/cas_uninstall.php';
|
js/select2.min.js
DELETED
@@ -1,23 +0,0 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2014 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
-
permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?void c.push(d(a)):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),void c.push(d(a.substring(e+f,a.length))))}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?void b.callback(c()):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),void b.callback(e))}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(a){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.lastSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeData("select2").off(".select2"),a.is("input[type='hidden']")?a.css("display",""):(a.show().prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c.debug=c.debug||a.fn.select2.defaults.debug,c.debug&&console&&console.warn&&(null!=c.id&&console.warn("Select2: The `id` option has been removed in Select2 4.0.0, consider renaming your `id` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.text&&console.warn("Select2: The `text` option has been removed in Select2 4.0.0, consider renaming your `text` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.sortResults&&console.warn("Select2: the `sortResults` option has been renamed to `sorter` in Select2 4.0.0. "),null!=c.selectOnBlur&&console.warn("Select2: The `selectOnBlur` option has been renamed to `selectOnClose` in Select2 4.0.0."),null!=c.ajax&&null!=c.ajax.results&&console.warn("Select2: The `ajax.results` option has been renamed to `ajax.processResults` in Select2 4.0.0."),null!=c.formatNoResults&&console.warn("Select2: The `formatNoResults` option has been renamed to `language.noResults` in Select2 4.0.0."),null!=c.formatSearching&&console.warn("Select2: The `formatSearching` option has been renamed to `language.searching` in Select2 4.0.0."),null!=c.formatInputTooShort&&console.warn("Select2: The `formatInputTooShort` option has been renamed to `language.inputTooShort` in Select2 4.0.0."),null!=c.formatInputTooLong&&console.warn("Select2: The `formatInputTooLong` option has been renamed to `language.inputTooLong` in Select2 4.0.0."),null!=c.formatLoading&&console.warn("Select2: The `formatLoading` option has been renamed to `language.loadingMore` in Select2 4.0.0."),null!=c.formatSelectionTooBig&&console.warn("Select2: The `formatSelectionTooBig` option has been renamed to `language.maximumSelected` in Select2 4.0.0."),c.element.data("select2Tags")&&console.warn("Select2: The `data-select2-tags` attribute has been renamed to `data-tags` in Select2 4.0.0.")),null!=c.element.data("tags")){var j=c.element.data("tags");a.isArray(j)||(j=[]),c.element.data("select2Tags",j)}if(null!=c.sorter&&(c.sortResults=c.sorter),null!=c.selectOnClose&&(c.selectOnBlur=c.selectOnClose),null!=c.ajax&&a.isFunction(c.ajax.processResults)&&(c.ajax.results=c.ajax.processResults),null!=c.language){var k=c.language;a.isFunction(k.noMatches)&&(c.formatNoMatches=k.noMatches),a.isFunction(k.searching)&&(c.formatSearching=k.searching),a.isFunction(k.inputTooShort)&&(c.formatInputTooShort=k.inputTooShort),a.isFunction(k.inputTooLong)&&(c.formatInputTooLong=k.inputTooLong),a.isFunction(k.loadingMore)&&(c.formatLoading=k.loadingMore),a.isFunction(k.maximumSelected)&&(c.formatSelectionTooBig=k.maximumSelected)}if(c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;(h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))})(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(a){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above"),g=b.outerHeight(!1),y.top=d.top-g,y.bottom="auto"):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),
|
22 |
-
this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(a){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.search.removeAttr("aria-activedescendant"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},prefillNextSearchTerm:function(){if(""!==this.search.val())return!1;var a=this.opts.nextSearchTerm(this.data(),this.lastSearchTerm);return a!==b?(this.search.val(a),this.search.select(),!0):!1},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return void b.scrollTop(0);c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),void(e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e})))},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return void n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>");if(d.val().length<f.minimumInputLength)return n(J(f.formatInputTooShort,"formatInputTooShort")?"<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>":""),void(c&&this.showSearch&&this.showSearch(!0));if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return void n(J(f.formatInputTooLong,"formatInputTooLong")?"<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>":"");f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return void this.search.removeClass("select2-active");if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return void n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>");if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void(this.showSearch&&this.showSearch(d.val()));e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return void this.clearTouchMoved();var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function b(){var b,c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(b=this.opts.element.attr("style"),"string"==typeof b)for(c=b.split(";"),e=0,f=c.length;f>e;e+=1)if(g=c[e].replace(/\s/g,""),d=g.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==d&&d.length>=1)return d[1];return"resolve"===this.opts.width?(b=this.opts.element.css("width"),b.indexOf("%")>0?b:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var c=b.call(this);null!==c&&this.container.css("width",c)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var b,c,d;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),b=this.search.get(0),b.createTextRange?(c=b.createTextRange(),c.collapse(!1),c.select()):b.setSelectionRange&&(d=this.search.val().length,b.setSelectionRange(d,d))),this.prefillNextSearchTerm(),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return void A(a);switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return void this.selectHighlighted({noFocus:!0});case k.ESC:return this.cancel(a),void A(a)}}})),this.search.on("blur",this.bind(function(a){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.results&&this.results.length>1&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return void A(a);if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),void A(a)}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),void A(a)):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.lastSearchTerm=c.search.val())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1],this.opts.debug&&console&&console.warn&&console.warn('Select2: The second option to `select2("val")` is not supported in Select2 4.0.0. The `change` event will always be triggered in 4.0.0.')),this.select)this.opts.debug&&console&&console.warn&&console.warn('Select2: Setting the value on a <select> using `select2("val")` is no longer supported in 4.0.0. You can use the `.val(newValue).trigger("change")` method provided by jQuery instead.'),this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return void this.clear(c);if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(this.opts.debug&&console&&console.warn&&console.warn('Select2: The `select2("data")` method can no longer set selected values in 4.0.0, consider using the `.val()` method instead.'),arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(b){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),void(g&&g.length||this.open())}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),void A(a);if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return this.selectHighlighted({noFocus:!0}),void this.close();case k.ESC:return this.cancel(a),void A(a)}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(a){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.prefillNextSearchTerm(),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c={},d=[],e=this;a(b).each(function(){e.id(this)in c||(c[e.id(this)]=0,d.push(this))}),this.selection.find(".select2-search-choice").remove(),this.addSelectedChoice(d),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.prefillNextSearchTerm()&&this.updateResults(),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(b){var c=this.getVal(),d=this;a(b).each(function(){c.push(d.createChoice(this))}),this.setVal(c)},createChoice:function(c){var i,j,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c);return i=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),i!=b&&g.find("div").replaceWith(a("<div></div>").html(i)),j=this.opts.formatSelectionCssClass(c,g.find("div")),j!=b&&g.addClass(j),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),h},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){if(this.select)this.select.val(b);else{var c=[],d={};a(b).each(function(){this in d||(c.push(this),d[this]=0)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator))}},buildChangeDetails:function(a,b){
|
23 |
-
for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)if(r(this.opts.id(b[c]),this.opts.id(a[d]))){b.splice(c,1),c--,a.splice(d,1);break}return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),void(d&&this.triggerChange({added:this.data(),removed:e}));if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={debug:!1,width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a,b,c){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(a,c){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(a){return null},nextSearchTerm:function(a,c){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b&&a.opts.minimumResultsForSearch<0?!1:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(a,b,c){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(a){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/suggest-sidebars.js
CHANGED
@@ -46,47 +46,40 @@
|
|
46 |
* @since 3.3
|
47 |
*/
|
48 |
suggestSidebars: function() {
|
49 |
-
var
|
50 |
-
|
51 |
-
$
|
52 |
-
|
53 |
-
$elem.select2({
|
54 |
-
containerCssClass:'cas-select2',
|
55 |
-
dropdownCssClass: 'cas-select2',
|
56 |
minimumInputLength: 0,
|
57 |
closeOnSelect: true,//does not work properly on false
|
58 |
allowClear:false,
|
59 |
-
|
60 |
-
//maximumSelectionSize: 1,
|
61 |
-
data:CAS.sidebars[hostSidebar]['options'],
|
62 |
width:"100%",
|
63 |
-
|
64 |
-
//
|
65 |
-
|
66 |
-
|
67 |
-
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
return {
|
73 |
id: '_'+term.replace(",","__"),
|
74 |
-
text: term
|
75 |
-
|
76 |
}
|
77 |
-
return null;
|
78 |
},
|
79 |
-
|
80 |
-
return (term.
|
81 |
},
|
82 |
-
|
83 |
-
return (term.
|
84 |
},
|
85 |
-
|
86 |
return CAS.notFound;
|
87 |
}
|
88 |
});
|
89 |
-
}
|
90 |
}
|
91 |
};
|
92 |
|
46 |
* @since 3.3
|
47 |
*/
|
48 |
suggestSidebars: function() {
|
49 |
+
var $elem = $('.js-cas-sidebars');
|
50 |
+
$elem.each(function() {
|
51 |
+
$(this).select2({
|
52 |
+
theme:'wpca',
|
|
|
|
|
|
|
53 |
minimumInputLength: 0,
|
54 |
closeOnSelect: true,//does not work properly on false
|
55 |
allowClear:false,
|
56 |
+
//maximumSelectionLength: 0,
|
|
|
|
|
57 |
width:"100%",
|
58 |
+
//multiple:true,//defined in html for 3.5 compat
|
59 |
+
//tags: CAS.canCreate, defined in html for 3.5 compat
|
60 |
+
escapeMarkup:function (m) {return m;},
|
61 |
+
createTag: function (params) {
|
62 |
+
var term = $.trim(params.term);
|
63 |
+
if (term === '') {
|
64 |
+
return null;
|
65 |
+
}
|
66 |
+
return {
|
|
|
67 |
id: '_'+term.replace(",","__"),
|
68 |
+
text: term,
|
69 |
+
new:true
|
70 |
}
|
|
|
71 |
},
|
72 |
+
templateSelection: function(term) {
|
73 |
+
return (term.new ? "<b>("+CAS.labelNew+")</b> " : "") + term.text;
|
74 |
},
|
75 |
+
templateResult: function(term) {
|
76 |
+
return (term.new ? "<b>"+CAS.createNew+":</b> " : "") + term.text;
|
77 |
},
|
78 |
+
templateNoMatches: function(term) {
|
79 |
return CAS.notFound;
|
80 |
}
|
81 |
});
|
82 |
+
});
|
83 |
}
|
84 |
};
|
85 |
|
js/suggest-sidebars.min.js
CHANGED
@@ -4,4 +4,4 @@
|
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
*/
|
7 |
-
!function(a){var b={init:function(){this.suggestSidebars(),this.toggleSidebarInputs()},toggleSidebarInputs:function(){a(".js-cas-more").click(function(b){b.preventDefault();var c=a(this),d=a(c.data("toggle")),e=c.children(":first");e.hasClass("dashicons-arrow-down-alt2")?(e.addClass("dashicons-arrow-up-alt2").removeClass("dashicons-arrow-down-alt2"),d.slideDown()):(e.addClass("dashicons-arrow-down-alt2").removeClass("dashicons-arrow-up-alt2"),d.slideUp())})},suggestSidebars:function(){var b
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
*/
|
7 |
+
!function(a){var b={init:function(){this.suggestSidebars(),this.toggleSidebarInputs()},toggleSidebarInputs:function(){a(".js-cas-more").click(function(b){b.preventDefault();var c=a(this),d=a(c.data("toggle")),e=c.children(":first");e.hasClass("dashicons-arrow-down-alt2")?(e.addClass("dashicons-arrow-up-alt2").removeClass("dashicons-arrow-down-alt2"),d.slideDown()):(e.addClass("dashicons-arrow-down-alt2").removeClass("dashicons-arrow-up-alt2"),d.slideUp())})},suggestSidebars:function(){var b=a(".js-cas-sidebars");b.each(function(){a(this).select2({theme:"wpca",minimumInputLength:0,closeOnSelect:!0,allowClear:!1,width:"100%",escapeMarkup:function(a){return a},createTag:function(b){var c=a.trim(b.term);return""===c?null:{id:"_"+c.replace(",","__"),text:c,"new":!0}},templateSelection:function(a){return(a["new"]?"<b>("+CAS.labelNew+")</b> ":"")+a.text},templateResult:function(a){return(a["new"]?"<b>"+CAS.createNew+":</b> ":"")+a.text},templateNoMatches:function(){return CAS.notFound}})})}};a(document).ready(function(){b.init()})}(jQuery);
|
js/widgets.js
CHANGED
@@ -23,8 +23,44 @@
|
|
23 |
|
24 |
this.addSidebarToolbar();
|
25 |
this.addWidgetSearch();
|
|
|
26 |
|
27 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
28 |
/**
|
29 |
* Add search input for widgets
|
30 |
*
|
@@ -45,7 +81,7 @@
|
|
45 |
var that = this,
|
46 |
filterTimer,
|
47 |
cachedFilter = "";
|
48 |
-
this.$widgetContainer.on('
|
49 |
var filter = $(this).val();
|
50 |
if(filter != cachedFilter) {
|
51 |
cachedFilter = filter;
|
@@ -77,8 +113,8 @@
|
|
77 |
var box = '<div class="wp-filter cas-filter-sidebar">'+
|
78 |
'<a href="admin.php?page=wpcas-edit" class="button button-primary">'+CASAdmin.addNew+'</a>'+
|
79 |
'<input type="search" class="js-cas-filter" placeholder="'+CASAdmin.filterSidebars+'...">'+
|
80 |
-
'<a href="#" class="js-sidebars-toggle sidebars-toggle" data-toggle="0"
|
81 |
-
'<a href="#" class="js-sidebars-toggle sidebars-toggle" data-toggle="1"
|
82 |
'</div>';
|
83 |
|
84 |
this.$sidebarContainer.prepend(box);
|
@@ -121,7 +157,7 @@
|
|
121 |
var that = this,
|
122 |
filterTimer,
|
123 |
cachedFilter = "";
|
124 |
-
this.$sidebarContainer.on('
|
125 |
var filter = $(this).val();
|
126 |
if(filter != cachedFilter) {
|
127 |
cachedFilter = filter;
|
23 |
|
24 |
this.addSidebarToolbar();
|
25 |
this.addWidgetSearch();
|
26 |
+
this.toggleSidebarStatus();
|
27 |
|
28 |
},
|
29 |
+
|
30 |
+
/**
|
31 |
+
* Initiate
|
32 |
+
*
|
33 |
+
* @since 3.3
|
34 |
+
* @return {void}
|
35 |
+
*/
|
36 |
+
toggleSidebarStatus: function() {
|
37 |
+
$(".widget-liquid-right").on('change','.sidebar-status-input',function(e) {
|
38 |
+
var $this = $(this),
|
39 |
+
status = $this.is(':checked');
|
40 |
+
|
41 |
+
if(!($this.hasClass('sidebar-status-future') && !confirm(CASAdmin.enableConfirm))) {
|
42 |
+
$.post(
|
43 |
+
ajaxurl,
|
44 |
+
{
|
45 |
+
'action' : 'cas_sidebar_status',
|
46 |
+
'sidebar_id': $this.val(),
|
47 |
+
'status' : status
|
48 |
+
},
|
49 |
+
function(response){
|
50 |
+
if(response.success) {
|
51 |
+
//change title attr
|
52 |
+
$this.next().attr('title',response.data.title);
|
53 |
+
$this.removeClass('sidebar-status-future');
|
54 |
+
} else {
|
55 |
+
$this.attr('checked',!status);
|
56 |
+
}
|
57 |
+
}
|
58 |
+
);
|
59 |
+
} else {
|
60 |
+
$this.attr('checked',!status);
|
61 |
+
}
|
62 |
+
});
|
63 |
+
},
|
64 |
/**
|
65 |
* Add search input for widgets
|
66 |
*
|
81 |
var that = this,
|
82 |
filterTimer,
|
83 |
cachedFilter = "";
|
84 |
+
this.$widgetContainer.on('input', '.js-cas-widget-filter',function(e) {
|
85 |
var filter = $(this).val();
|
86 |
if(filter != cachedFilter) {
|
87 |
cachedFilter = filter;
|
113 |
var box = '<div class="wp-filter cas-filter-sidebar">'+
|
114 |
'<a href="admin.php?page=wpcas-edit" class="button button-primary">'+CASAdmin.addNew+'</a>'+
|
115 |
'<input type="search" class="js-cas-filter" placeholder="'+CASAdmin.filterSidebars+'...">'+
|
116 |
+
'<a href="#" title="'+CASAdmin.collapse+'" class="js-sidebars-toggle sidebars-toggle" data-toggle="0"><span class="dashicons dashicons-arrow-up-alt2"></span></a>'+
|
117 |
+
'<a href="#" title="'+CASAdmin.expand+'" class="js-sidebars-toggle sidebars-toggle" data-toggle="1"><span class="dashicons dashicons-arrow-down-alt2"></span></a>'+
|
118 |
'</div>';
|
119 |
|
120 |
this.$sidebarContainer.prepend(box);
|
157 |
var that = this,
|
158 |
filterTimer,
|
159 |
cachedFilter = "";
|
160 |
+
this.$sidebarContainer.on('input', '.js-cas-filter',function(e) {
|
161 |
var filter = $(this).val();
|
162 |
if(filter != cachedFilter) {
|
163 |
cachedFilter = filter;
|
js/widgets.min.js
CHANGED
@@ -4,4 +4,4 @@
|
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
*/
|
7 |
-
!function(a){var b={$sidebarContainer:a(".widget-liquid-right"),$widgetContainer:a("#available-widgets"),$widgets:null,init:function(){this.addSidebarToolbar(),this.addWidgetSearch()},addWidgetSearch:function(){this.$widgets=a(".widget",this.$widgetContainer).get().reverse(),a(".sidebar-description",this.$widgetContainer).prepend('<input type="search" class="js-cas-widget-filter cas-filter-widget" placeholder="'+CASAdmin.filterWidgets+'...">'),this.searchWidgetListener()},searchWidgetListener:function(){var b,c=this,d="";this.$widgetContainer.on("
|
4 |
* @license GPLv3
|
5 |
* @copyright 2017 by Joachim Jensen
|
6 |
*/
|
7 |
+
!function(a){var b={$sidebarContainer:a(".widget-liquid-right"),$widgetContainer:a("#available-widgets"),$widgets:null,init:function(){this.addSidebarToolbar(),this.addWidgetSearch(),this.toggleSidebarStatus()},toggleSidebarStatus:function(){a(".widget-liquid-right").on("change",".sidebar-status-input",function(){var b=a(this),c=b.is(":checked");!b.hasClass("sidebar-status-future")||confirm(CASAdmin.enableConfirm)?a.post(ajaxurl,{action:"cas_sidebar_status",sidebar_id:b.val(),status:c},function(a){a.success?(b.next().attr("title",a.data.title),b.removeClass("sidebar-status-future")):b.attr("checked",!c)}):b.attr("checked",!c)})},addWidgetSearch:function(){this.$widgets=a(".widget",this.$widgetContainer).get().reverse(),a(".sidebar-description",this.$widgetContainer).prepend('<input type="search" class="js-cas-widget-filter cas-filter-widget" placeholder="'+CASAdmin.filterWidgets+'...">'),this.searchWidgetListener()},searchWidgetListener:function(){var b,c=this,d="";this.$widgetContainer.on("input",".js-cas-widget-filter",function(){var e=a(this).val();e!=d&&(d=e,b&&clearTimeout(b),b=setTimeout(function(){a(c.$widgets).each(function(b,c){var d=a(c);d.find(".widget-title :nth-child(1)").text().search(new RegExp(e,"i"))<0?d.fadeOut():(d.prependTo(d.parent()),d.fadeIn().css("display",""))})},250))})},addSidebarToolbar:function(){var a='<div class="wp-filter cas-filter-sidebar"><a href="admin.php?page=wpcas-edit" class="button button-primary">'+CASAdmin.addNew+'</a><input type="search" class="js-cas-filter" placeholder="'+CASAdmin.filterSidebars+'..."><a href="#" title="'+CASAdmin.collapse+'" class="js-sidebars-toggle sidebars-toggle" data-toggle="0"><span class="dashicons dashicons-arrow-up-alt2"></span></a><a href="#" title="'+CASAdmin.expand+'" class="js-sidebars-toggle sidebars-toggle" data-toggle="1"><span class="dashicons dashicons-arrow-down-alt2"></span></a></div>';this.$sidebarContainer.prepend(a),this.searchSidebarListener(),this.addSidebarToggle()},addSidebarToggle:function(){var b=a(document),c=this.$sidebarContainer.find(".widgets-holder-wrap");a("body").on("click",".js-sidebars-toggle",function(d){d.preventDefault();var e=!!a(this).data("toggle");c.toggleClass("closed",!e),e&&c.children(".widgets-sortables").sortable("refresh"),b.triggerHandler("wp-pin-menu")})},searchSidebarListener:function(){var b,c=this,d="";this.$sidebarContainer.on("input",".js-cas-filter",function(){var e=a(this).val();e!=d&&(d=e,b&&clearTimeout(b),b=setTimeout(function(){a(".widgets-holder-wrap",c.$sidebarContainer).each(function(b,c){var d=a(c);d.find(".sidebar-name :nth-child(2)").text().search(new RegExp(e,"i"))<0?d.fadeOut():d.fadeIn()})},250))})}};a(document).ready(function(){b.init()})}(jQuery);
|
lang/content-aware-sidebars-ar.po
CHANGED
@@ -1,734 +1,734 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Ahmed Abdelaziz <dr.outlander@gmail.com>, 2015
|
5 |
-
# Ahmed Galal <ag184@icloud.com>, 2015
|
6 |
-
# Allo Babi <allo.babi@yahoo.fr>, 2015
|
7 |
-
# Seghir Oussama <raziol03@gmail.com>, 2015
|
8 |
-
msgid ""
|
9 |
-
msgstr ""
|
10 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
11 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
12 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
13 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
14 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
15 |
-
"Language-Team: Arabic (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ar/)\n"
|
16 |
-
"MIME-Version: 1.0\n"
|
17 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
18 |
-
"Content-Transfer-Encoding: 8bit\n"
|
19 |
-
"Language: ar\n"
|
20 |
-
"Plural-Forms: nplurals=6; plural=n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n%100>=3 && n%100<=10 ? 3 : n%100>=11 && n%100<=99 ? 4 : 5;\n"
|
21 |
-
"X-Generator: Poedit 1.7.6\n"
|
22 |
-
"X-Poedit-Basepath: .\n"
|
23 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
24 |
-
"X-Poedit-SearchPath-0: .\n"
|
25 |
-
"X-Poedit-SearchPath-1: ..\n"
|
26 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
27 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
28 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
29 |
-
"X-Textdomain-Support: yes\n"
|
30 |
-
|
31 |
-
#: ../content-aware-sidebars.php:95
|
32 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
33 |
-
msgstr "عرض وادارة الجوانب بالنسبة للمحتوي الذي يتم تصفحه."
|
34 |
-
|
35 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
36 |
-
msgid "Content Aware Sidebars"
|
37 |
-
msgstr "جوانب مدركة للمحتوي"
|
38 |
-
|
39 |
-
#: ../content-aware-sidebars.php:97
|
40 |
-
msgid "Import"
|
41 |
-
msgstr "استورد"
|
42 |
-
|
43 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
44 |
-
msgid "FAQ"
|
45 |
-
msgstr "الأسئلة الاكثر شيوعا"
|
46 |
-
|
47 |
-
#: ../content-aware-sidebars.php:256
|
48 |
-
msgid "Exposure"
|
49 |
-
msgstr "الاظهار"
|
50 |
-
|
51 |
-
#: ../content-aware-sidebars.php:260
|
52 |
-
msgid "Singular"
|
53 |
-
msgstr "فردي"
|
54 |
-
|
55 |
-
#: ../content-aware-sidebars.php:261
|
56 |
-
msgid "Singular & Archive"
|
57 |
-
msgstr "الأرشيف والفردي"
|
58 |
-
|
59 |
-
#: ../content-aware-sidebars.php:262
|
60 |
-
msgid "Archive"
|
61 |
-
msgstr "الأرشيف"
|
62 |
-
|
63 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
64 |
-
msgctxt "option"
|
65 |
-
msgid "Handle"
|
66 |
-
msgstr "معاملة"
|
67 |
-
|
68 |
-
#: ../content-aware-sidebars.php:271
|
69 |
-
msgid "Replace"
|
70 |
-
msgstr "تبديل"
|
71 |
-
|
72 |
-
#: ../content-aware-sidebars.php:272
|
73 |
-
msgid "Merge"
|
74 |
-
msgstr "دمج"
|
75 |
-
|
76 |
-
#: ../content-aware-sidebars.php:273
|
77 |
-
msgid "Manual"
|
78 |
-
msgstr "يدوي"
|
79 |
-
|
80 |
-
#: ../content-aware-sidebars.php:274
|
81 |
-
msgid "Forced replace"
|
82 |
-
msgstr "التبديل بالإجبار"
|
83 |
-
|
84 |
-
#: ../content-aware-sidebars.php:276
|
85 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
86 |
-
msgstr "قم بتبديل الجانب المستضاف ،أو ادمجه، أو اضف جانب يدويا."
|
87 |
-
|
88 |
-
#: ../content-aware-sidebars.php:280
|
89 |
-
msgid "Host Sidebar"
|
90 |
-
msgstr "الجانب المستضاف"
|
91 |
-
|
92 |
-
#: ../content-aware-sidebars.php:287
|
93 |
-
msgid "Merge Position"
|
94 |
-
msgstr "أدمج المواقع"
|
95 |
-
|
96 |
-
#: ../content-aware-sidebars.php:291
|
97 |
-
msgid "Top"
|
98 |
-
msgstr "اعلى"
|
99 |
-
|
100 |
-
#: ../content-aware-sidebars.php:292
|
101 |
-
msgid "Bottom"
|
102 |
-
msgstr "اسفل"
|
103 |
-
|
104 |
-
#: ../content-aware-sidebars.php:294
|
105 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
106 |
-
msgstr "ضع الشريط الجانبي فوق أو تحت المضيف عند الدمج."
|
107 |
-
|
108 |
-
#: ../content-aware-sidebars.php:309
|
109 |
-
msgid "Sidebars"
|
110 |
-
msgstr "جوانب"
|
111 |
-
|
112 |
-
#: ../content-aware-sidebars.php:310
|
113 |
-
msgid "Sidebar"
|
114 |
-
msgstr "جانب"
|
115 |
-
|
116 |
-
#: ../content-aware-sidebars.php:311
|
117 |
-
msgctxt "sidebar"
|
118 |
-
msgid "Add New"
|
119 |
-
msgstr "اضف جديد"
|
120 |
-
|
121 |
-
#: ../content-aware-sidebars.php:312
|
122 |
-
msgid "Add New Sidebar"
|
123 |
-
msgstr "أضف جانب جديد"
|
124 |
-
|
125 |
-
#: ../content-aware-sidebars.php:313
|
126 |
-
msgid "Edit Sidebar"
|
127 |
-
msgstr "تعديل جانب"
|
128 |
-
|
129 |
-
#: ../content-aware-sidebars.php:314
|
130 |
-
msgid "New Sidebar"
|
131 |
-
msgstr "جانب جديد"
|
132 |
-
|
133 |
-
#: ../content-aware-sidebars.php:315
|
134 |
-
msgid "All Sidebars"
|
135 |
-
msgstr "كل الجوانب"
|
136 |
-
|
137 |
-
#: ../content-aware-sidebars.php:316
|
138 |
-
msgid "View Sidebar"
|
139 |
-
msgstr "اعرض الجانب"
|
140 |
-
|
141 |
-
#: ../content-aware-sidebars.php:317
|
142 |
-
msgid "Search Sidebars"
|
143 |
-
msgstr "ابحث في الجوانب"
|
144 |
-
|
145 |
-
#: ../content-aware-sidebars.php:318
|
146 |
-
msgid "No sidebars found"
|
147 |
-
msgstr "لا يوجد جوانب"
|
148 |
-
|
149 |
-
#: ../content-aware-sidebars.php:319
|
150 |
-
msgid "No sidebars found in Trash"
|
151 |
-
msgstr "لا يوجد جوانب في المهملات"
|
152 |
-
|
153 |
-
#: ../content-aware-sidebars.php:321
|
154 |
-
msgid "Display sidebar with"
|
155 |
-
msgstr "اعرض الجوانب التي بها"
|
156 |
-
|
157 |
-
#: ../content-aware-sidebars.php:322
|
158 |
-
msgid ""
|
159 |
-
"No content. Please add at least one condition group to make the sidebar "
|
160 |
-
"content aware."
|
161 |
-
msgstr "لا يوجد محتوى. يرجى إضافة الشرط الأدنى للمجموعة لجعل الشريط الجانبي يتعرف عليه."
|
162 |
-
|
163 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
164 |
-
msgid "Manage widgets"
|
165 |
-
msgstr "ضبط الويدجات"
|
166 |
-
|
167 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
168 |
-
msgid "Sidebar updated."
|
169 |
-
msgstr "تم تحديث الشريط الجانبي"
|
170 |
-
|
171 |
-
#: ../content-aware-sidebars.php:361
|
172 |
-
msgid "Sidebar published."
|
173 |
-
msgstr "تم نشر الشريط الجانبي"
|
174 |
-
|
175 |
-
#: ../content-aware-sidebars.php:362
|
176 |
-
msgid "Sidebar saved."
|
177 |
-
msgstr "تم حفظ الشريط الجانبي"
|
178 |
-
|
179 |
-
#: ../content-aware-sidebars.php:363
|
180 |
-
msgid "Sidebar submitted."
|
181 |
-
msgstr "تم إرسال الشريط الجانبي"
|
182 |
-
|
183 |
-
#: ../content-aware-sidebars.php:364
|
184 |
-
#, php-format
|
185 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
186 |
-
msgstr "تم تأكيد الشريط الجانبي لـ <strong>%1$s</strong>."
|
187 |
-
|
188 |
-
#. translators: Publish box date format, see http://php.net/date
|
189 |
-
#: ../content-aware-sidebars.php:366
|
190 |
-
msgid "M j, Y @ G:i"
|
191 |
-
msgstr ""
|
192 |
-
|
193 |
-
#: ../content-aware-sidebars.php:367
|
194 |
-
msgid "Sidebar draft updated."
|
195 |
-
msgstr "تم تحديث مسودة الشريط الجانبي."
|
196 |
-
|
197 |
-
#: ../content-aware-sidebars.php:383
|
198 |
-
#, php-format
|
199 |
-
msgid "%s sidebar updated."
|
200 |
-
msgid_plural "%s sidebars updated."
|
201 |
-
msgstr[0] ""
|
202 |
-
msgstr[1] ""
|
203 |
-
msgstr[2] ""
|
204 |
-
msgstr[3] ""
|
205 |
-
msgstr[4] ""
|
206 |
-
msgstr[5] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:384
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
211 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
msgstr[2] ""
|
215 |
-
msgstr[3] ""
|
216 |
-
msgstr[4] ""
|
217 |
-
msgstr[5] ""
|
218 |
-
|
219 |
-
#: ../content-aware-sidebars.php:385
|
220 |
-
#, php-format
|
221 |
-
msgid "%s sidebar permanently deleted."
|
222 |
-
msgid_plural "%s sidebars permanently deleted."
|
223 |
-
msgstr[0] ""
|
224 |
-
msgstr[1] ""
|
225 |
-
msgstr[2] ""
|
226 |
-
msgstr[3] ""
|
227 |
-
msgstr[4] ""
|
228 |
-
msgstr[5] ""
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:386
|
231 |
-
#, php-format
|
232 |
-
msgid "%s sidebar moved to the Trash."
|
233 |
-
msgid_plural "%s sidebars moved to the Trash."
|
234 |
-
msgstr[0] ""
|
235 |
-
msgstr[1] ""
|
236 |
-
msgstr[2] ""
|
237 |
-
msgstr[3] ""
|
238 |
-
msgstr[4] ""
|
239 |
-
msgstr[5] ""
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:387
|
242 |
-
#, php-format
|
243 |
-
msgid "%s sidebar restored from the Trash."
|
244 |
-
msgid_plural "%s sidebars restored from the Trash."
|
245 |
-
msgstr[0] ""
|
246 |
-
msgstr[1] ""
|
247 |
-
msgstr[2] ""
|
248 |
-
msgstr[3] ""
|
249 |
-
msgstr[4] ""
|
250 |
-
msgstr[5] ""
|
251 |
-
|
252 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
253 |
-
msgid "Please update Host Sidebar"
|
254 |
-
msgstr "الرجاء تحديث الشريط الجانبي للمضيف."
|
255 |
-
|
256 |
-
#: ../content-aware-sidebars.php:472
|
257 |
-
msgid "Merge position"
|
258 |
-
msgstr "دمج الوضعية."
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:473
|
261 |
-
msgid "Widgets"
|
262 |
-
msgstr "ويدجات."
|
263 |
-
|
264 |
-
#: ../content-aware-sidebars.php:586
|
265 |
-
msgid "Manage Widgets"
|
266 |
-
msgstr "إدارة الويدجات."
|
267 |
-
|
268 |
-
#: ../content-aware-sidebars.php:756
|
269 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
270 |
-
msgstr "أحصل على حزمة قيمة ( Premium ) مجانية من Content Aware Sidebars."
|
271 |
-
|
272 |
-
#: ../content-aware-sidebars.php:772
|
273 |
-
msgid "Options"
|
274 |
-
msgstr "الإعدادات."
|
275 |
-
|
276 |
-
#: ../content-aware-sidebars.php:795
|
277 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
278 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
279 |
-
msgid "Condition Groups"
|
280 |
-
msgstr "مجموعات الشروط."
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:796
|
283 |
-
msgid ""
|
284 |
-
"Each created condition group describe some specific content (conditions) "
|
285 |
-
"that the current sidebar should be displayed with."
|
286 |
-
msgstr "كل مجموعة شروط مولدة تصف محتويات معينة ( شروط ), هذه المحتويات يجب أن يظهر بها الشريط الجانبي الحالي."
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:797
|
289 |
-
msgid ""
|
290 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
291 |
-
" groups themselves use logical disjunction. This means that content added to"
|
292 |
-
" a group should be associated, as they are treated as such, and that the "
|
293 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
294 |
-
"extremely focused and at the same time distinct conditions."
|
295 |
-
msgstr ""
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:800
|
298 |
-
msgid "More Information"
|
299 |
-
msgstr "المزيد من المعلومات"
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
302 |
-
msgid "Get Support"
|
303 |
-
msgstr "الحصول على الدعم."
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:816
|
306 |
-
msgid ""
|
307 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
308 |
-
" of the upcoming Premium Bundle*!"
|
309 |
-
msgstr ""
|
310 |
-
|
311 |
-
#: ../content-aware-sidebars.php:817
|
312 |
-
msgid "Translate Now"
|
313 |
-
msgstr "ترجم الآن"
|
314 |
-
|
315 |
-
#: ../content-aware-sidebars.php:818
|
316 |
-
msgid "Get Premium Bundle"
|
317 |
-
msgstr "أحصل على الحزمة القيمة ( Premium )"
|
318 |
-
|
319 |
-
#: ../content-aware-sidebars.php:819
|
320 |
-
msgid ""
|
321 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
322 |
-
msgstr ""
|
323 |
-
|
324 |
-
#: ../content-aware-sidebars.php:822
|
325 |
-
msgid "Partial Feature List"
|
326 |
-
msgstr "قائمة الميزات الجزئية"
|
327 |
-
|
328 |
-
#: ../content-aware-sidebars.php:824
|
329 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
330 |
-
msgstr ""
|
331 |
-
|
332 |
-
#: ../content-aware-sidebars.php:825
|
333 |
-
msgid "Display sidebars with URLs using wildcards"
|
334 |
-
msgstr ""
|
335 |
-
|
336 |
-
#: ../content-aware-sidebars.php:826
|
337 |
-
msgid "Display sidebars with User Roles"
|
338 |
-
msgstr ""
|
339 |
-
|
340 |
-
#: ../content-aware-sidebars.php:827
|
341 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
342 |
-
msgstr ""
|
343 |
-
|
344 |
-
#: ../content-aware-sidebars.php:828
|
345 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
346 |
-
msgstr ""
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
349 |
-
msgid "Order"
|
350 |
-
msgstr ""
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:880
|
353 |
-
msgid "Give a review on WordPress.org"
|
354 |
-
msgstr ""
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
357 |
-
msgid "Translate the plugin into your language"
|
358 |
-
msgstr ""
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:884
|
361 |
-
msgid "Read the FAQ"
|
362 |
-
msgstr ""
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:899
|
365 |
-
msgid ""
|
366 |
-
"If you love this plugin, please consider donating to support future "
|
367 |
-
"development."
|
368 |
-
msgstr ""
|
369 |
-
|
370 |
-
#: ../content-aware-sidebars.php:908
|
371 |
-
msgid "Or you could:"
|
372 |
-
msgstr ""
|
373 |
-
|
374 |
-
#: ../content-aware-sidebars.php:910
|
375 |
-
msgid "Rate the plugin on WordPress.org"
|
376 |
-
msgstr ""
|
377 |
-
|
378 |
-
#: ../content-aware-sidebars.php:911
|
379 |
-
msgid "Link to the plugin page"
|
380 |
-
msgstr ""
|
381 |
-
|
382 |
-
#: ../content-aware-sidebars.php:1045
|
383 |
-
msgid "Filter Sidebars"
|
384 |
-
msgstr ""
|
385 |
-
|
386 |
-
#: ../content-aware-sidebars.php:1046
|
387 |
-
msgid "Filter Widgets"
|
388 |
-
msgstr ""
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
391 |
-
msgid "Condition Group"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
395 |
-
msgctxt "group"
|
396 |
-
msgid "Add New"
|
397 |
-
msgstr "اضف جديد"
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
400 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
401 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
402 |
-
msgid "Add New Group"
|
403 |
-
msgstr ""
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
407 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
408 |
-
msgctxt "group"
|
409 |
-
msgid "Edit"
|
410 |
-
msgstr "تحرير"
|
411 |
-
|
412 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
414 |
-
msgid "No Groups found"
|
415 |
-
msgstr ""
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
418 |
-
msgctxt "condition group"
|
419 |
-
msgid "Negated"
|
420 |
-
msgstr ""
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
423 |
-
msgid "Content"
|
424 |
-
msgstr ""
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
427 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
428 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
429 |
-
msgid "Unauthorized request"
|
430 |
-
msgstr ""
|
431 |
-
|
432 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
433 |
-
msgid "Condition group cannot be empty"
|
434 |
-
msgstr ""
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
437 |
-
msgid "Condition group saved"
|
438 |
-
msgstr ""
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
441 |
-
msgid "Condition group could not be removed"
|
442 |
-
msgstr ""
|
443 |
-
|
444 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
445 |
-
msgid "Condition group removed"
|
446 |
-
msgstr ""
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
450 |
-
msgid "Save"
|
451 |
-
msgstr ""
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
454 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
455 |
-
msgid "Cancel"
|
456 |
-
msgstr ""
|
457 |
-
|
458 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
459 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
460 |
-
msgid "Or"
|
461 |
-
msgstr ""
|
462 |
-
|
463 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
464 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
465 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
466 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
467 |
-
msgid "And"
|
468 |
-
msgstr ""
|
469 |
-
|
470 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
471 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
472 |
-
msgid "Remove"
|
473 |
-
msgstr ""
|
474 |
-
|
475 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
476 |
-
msgid "Remove this group and its contents permanently?"
|
477 |
-
msgstr ""
|
478 |
-
|
479 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
480 |
-
msgid "No results found."
|
481 |
-
msgstr ""
|
482 |
-
|
483 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
484 |
-
msgid ""
|
485 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
486 |
-
"these changes?"
|
487 |
-
msgstr ""
|
488 |
-
|
489 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
490 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
491 |
-
msgid "Negate group"
|
492 |
-
msgstr ""
|
493 |
-
|
494 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
495 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
496 |
-
msgid "Target all but this context"
|
497 |
-
msgstr ""
|
498 |
-
|
499 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
500 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
501 |
-
msgid "Target this context"
|
502 |
-
msgstr ""
|
503 |
-
|
504 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
505 |
-
msgid "Authors"
|
506 |
-
msgstr ""
|
507 |
-
|
508 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
509 |
-
#, php-format
|
510 |
-
msgid "Display with All %s"
|
511 |
-
msgstr ""
|
512 |
-
|
513 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
515 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
517 |
-
msgid "View All"
|
518 |
-
msgstr ""
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
521 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
522 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
523 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
524 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
525 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
526 |
-
msgid "Search"
|
527 |
-
msgstr ""
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
530 |
-
msgid "bbPress User Profiles"
|
531 |
-
msgstr ""
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
534 |
-
msgid "BuddyPress Members"
|
535 |
-
msgstr ""
|
536 |
-
|
537 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
538 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
539 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
540 |
-
msgid "Add to Group"
|
541 |
-
msgstr ""
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
544 |
-
msgid "Dates"
|
545 |
-
msgstr ""
|
546 |
-
|
547 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
548 |
-
msgid "Date Archives"
|
549 |
-
msgstr ""
|
550 |
-
|
551 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
552 |
-
msgid "Page Templates"
|
553 |
-
msgstr ""
|
554 |
-
|
555 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
556 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
557 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
558 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
559 |
-
msgid "Languages"
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
563 |
-
msgid "Post Types"
|
564 |
-
msgstr ""
|
565 |
-
|
566 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
567 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
568 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
569 |
-
msgid "Automatically select new children of a selected ancestor"
|
570 |
-
msgstr ""
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
573 |
-
msgid "Automatically add new children of a selected ancestor"
|
574 |
-
msgstr ""
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
577 |
-
#, php-format
|
578 |
-
msgid "%s Archives"
|
579 |
-
msgstr ""
|
580 |
-
|
581 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
582 |
-
msgid "Blog Page"
|
583 |
-
msgstr ""
|
584 |
-
|
585 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
586 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
587 |
-
msgid "No items."
|
588 |
-
msgstr ""
|
589 |
-
|
590 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
591 |
-
msgid "Most Recent"
|
592 |
-
msgstr ""
|
593 |
-
|
594 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
595 |
-
msgid "Static Pages"
|
596 |
-
msgstr ""
|
597 |
-
|
598 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
599 |
-
msgid "Front Page"
|
600 |
-
msgstr ""
|
601 |
-
|
602 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
603 |
-
msgid "Search Results"
|
604 |
-
msgstr ""
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
607 |
-
msgid "404 Page"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
611 |
-
msgid "Taxonomies"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
615 |
-
msgid "Most Used"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
619 |
-
msgid "Conditional Content"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
623 |
-
msgid ""
|
624 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
625 |
-
" it. In each group, you can combine different types of associated content."
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
629 |
-
#, php-format
|
630 |
-
msgid "All %s"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
634 |
-
msgid "Password protected"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
638 |
-
msgid "Private"
|
639 |
-
msgstr ""
|
640 |
-
|
641 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
642 |
-
msgid "Draft"
|
643 |
-
msgstr ""
|
644 |
-
|
645 |
-
#. translators: post state
|
646 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
647 |
-
msgctxt "post state"
|
648 |
-
msgid "Pending"
|
649 |
-
msgstr ""
|
650 |
-
|
651 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
652 |
-
msgid "Sticky"
|
653 |
-
msgstr ""
|
654 |
-
|
655 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
656 |
-
msgid "Scheduled"
|
657 |
-
msgstr ""
|
658 |
-
|
659 |
-
#: ../pointers.php:68
|
660 |
-
msgid "Get started"
|
661 |
-
msgstr ""
|
662 |
-
|
663 |
-
#: ../pointers.php:69
|
664 |
-
msgid ""
|
665 |
-
"You've just installed Content Aware Sidebars!\n"
|
666 |
-
"\n"
|
667 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
668 |
-
"\n"
|
669 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
670 |
-
msgstr ""
|
671 |
-
|
672 |
-
#: ../pointers.php:76
|
673 |
-
msgid "Start Tour"
|
674 |
-
msgstr ""
|
675 |
-
|
676 |
-
#: ../pointers.php:78
|
677 |
-
msgid "Not now"
|
678 |
-
msgstr ""
|
679 |
-
|
680 |
-
#: ../pointers.php:83
|
681 |
-
msgid ""
|
682 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
683 |
-
"\n"
|
684 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
685 |
-
"\n"
|
686 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
687 |
-
msgstr ""
|
688 |
-
|
689 |
-
#: ../pointers.php:92
|
690 |
-
msgid "Content and contexts"
|
691 |
-
msgstr ""
|
692 |
-
|
693 |
-
#: ../pointers.php:93
|
694 |
-
msgid ""
|
695 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
696 |
-
"\n"
|
697 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
698 |
-
"\n"
|
699 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
700 |
-
msgstr ""
|
701 |
-
|
702 |
-
#: ../pointers.php:102
|
703 |
-
msgid "Options, options"
|
704 |
-
msgstr ""
|
705 |
-
|
706 |
-
#: ../pointers.php:103
|
707 |
-
msgid ""
|
708 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
709 |
-
"\n"
|
710 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
711 |
-
"\n"
|
712 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
713 |
-
"\n"
|
714 |
-
" You are in control."
|
715 |
-
msgstr ""
|
716 |
-
|
717 |
-
#: ../pointers.php:112
|
718 |
-
msgid "Help and Support"
|
719 |
-
msgstr ""
|
720 |
-
|
721 |
-
#: ../pointers.php:113
|
722 |
-
msgid ""
|
723 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
724 |
-
"\n"
|
725 |
-
"If you need more help, click on the \"Help\" tab here."
|
726 |
-
msgstr ""
|
727 |
-
|
728 |
-
#: ../pointers.php:142
|
729 |
-
msgid "Close"
|
730 |
-
msgstr ""
|
731 |
-
|
732 |
-
#: ../pointers.php:143
|
733 |
-
msgid "Next"
|
734 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Ahmed Abdelaziz <dr.outlander@gmail.com>, 2015
|
5 |
+
# Ahmed Galal <ag184@icloud.com>, 2015
|
6 |
+
# Allo Babi <allo.babi@yahoo.fr>, 2015
|
7 |
+
# Seghir Oussama <raziol03@gmail.com>, 2015
|
8 |
+
msgid ""
|
9 |
+
msgstr ""
|
10 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
11 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
12 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
13 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
14 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
15 |
+
"Language-Team: Arabic (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ar/)\n"
|
16 |
+
"MIME-Version: 1.0\n"
|
17 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
18 |
+
"Content-Transfer-Encoding: 8bit\n"
|
19 |
+
"Language: ar\n"
|
20 |
+
"Plural-Forms: nplurals=6; plural=n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n%100>=3 && n%100<=10 ? 3 : n%100>=11 && n%100<=99 ? 4 : 5;\n"
|
21 |
+
"X-Generator: Poedit 1.7.6\n"
|
22 |
+
"X-Poedit-Basepath: .\n"
|
23 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
24 |
+
"X-Poedit-SearchPath-0: .\n"
|
25 |
+
"X-Poedit-SearchPath-1: ..\n"
|
26 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
27 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
28 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
29 |
+
"X-Textdomain-Support: yes\n"
|
30 |
+
|
31 |
+
#: ../content-aware-sidebars.php:95
|
32 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
33 |
+
msgstr "عرض وادارة الجوانب بالنسبة للمحتوي الذي يتم تصفحه."
|
34 |
+
|
35 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
36 |
+
msgid "Content Aware Sidebars"
|
37 |
+
msgstr "جوانب مدركة للمحتوي"
|
38 |
+
|
39 |
+
#: ../content-aware-sidebars.php:97
|
40 |
+
msgid "Import"
|
41 |
+
msgstr "استورد"
|
42 |
+
|
43 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
44 |
+
msgid "FAQ"
|
45 |
+
msgstr "الأسئلة الاكثر شيوعا"
|
46 |
+
|
47 |
+
#: ../content-aware-sidebars.php:256
|
48 |
+
msgid "Exposure"
|
49 |
+
msgstr "الاظهار"
|
50 |
+
|
51 |
+
#: ../content-aware-sidebars.php:260
|
52 |
+
msgid "Singular"
|
53 |
+
msgstr "فردي"
|
54 |
+
|
55 |
+
#: ../content-aware-sidebars.php:261
|
56 |
+
msgid "Singular & Archive"
|
57 |
+
msgstr "الأرشيف والفردي"
|
58 |
+
|
59 |
+
#: ../content-aware-sidebars.php:262
|
60 |
+
msgid "Archive"
|
61 |
+
msgstr "الأرشيف"
|
62 |
+
|
63 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
64 |
+
msgctxt "option"
|
65 |
+
msgid "Handle"
|
66 |
+
msgstr "معاملة"
|
67 |
+
|
68 |
+
#: ../content-aware-sidebars.php:271
|
69 |
+
msgid "Replace"
|
70 |
+
msgstr "تبديل"
|
71 |
+
|
72 |
+
#: ../content-aware-sidebars.php:272
|
73 |
+
msgid "Merge"
|
74 |
+
msgstr "دمج"
|
75 |
+
|
76 |
+
#: ../content-aware-sidebars.php:273
|
77 |
+
msgid "Manual"
|
78 |
+
msgstr "يدوي"
|
79 |
+
|
80 |
+
#: ../content-aware-sidebars.php:274
|
81 |
+
msgid "Forced replace"
|
82 |
+
msgstr "التبديل بالإجبار"
|
83 |
+
|
84 |
+
#: ../content-aware-sidebars.php:276
|
85 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
86 |
+
msgstr "قم بتبديل الجانب المستضاف ،أو ادمجه، أو اضف جانب يدويا."
|
87 |
+
|
88 |
+
#: ../content-aware-sidebars.php:280
|
89 |
+
msgid "Host Sidebar"
|
90 |
+
msgstr "الجانب المستضاف"
|
91 |
+
|
92 |
+
#: ../content-aware-sidebars.php:287
|
93 |
+
msgid "Merge Position"
|
94 |
+
msgstr "أدمج المواقع"
|
95 |
+
|
96 |
+
#: ../content-aware-sidebars.php:291
|
97 |
+
msgid "Top"
|
98 |
+
msgstr "اعلى"
|
99 |
+
|
100 |
+
#: ../content-aware-sidebars.php:292
|
101 |
+
msgid "Bottom"
|
102 |
+
msgstr "اسفل"
|
103 |
+
|
104 |
+
#: ../content-aware-sidebars.php:294
|
105 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
106 |
+
msgstr "ضع الشريط الجانبي فوق أو تحت المضيف عند الدمج."
|
107 |
+
|
108 |
+
#: ../content-aware-sidebars.php:309
|
109 |
+
msgid "Sidebars"
|
110 |
+
msgstr "جوانب"
|
111 |
+
|
112 |
+
#: ../content-aware-sidebars.php:310
|
113 |
+
msgid "Sidebar"
|
114 |
+
msgstr "جانب"
|
115 |
+
|
116 |
+
#: ../content-aware-sidebars.php:311
|
117 |
+
msgctxt "sidebar"
|
118 |
+
msgid "Add New"
|
119 |
+
msgstr "اضف جديد"
|
120 |
+
|
121 |
+
#: ../content-aware-sidebars.php:312
|
122 |
+
msgid "Add New Sidebar"
|
123 |
+
msgstr "أضف جانب جديد"
|
124 |
+
|
125 |
+
#: ../content-aware-sidebars.php:313
|
126 |
+
msgid "Edit Sidebar"
|
127 |
+
msgstr "تعديل جانب"
|
128 |
+
|
129 |
+
#: ../content-aware-sidebars.php:314
|
130 |
+
msgid "New Sidebar"
|
131 |
+
msgstr "جانب جديد"
|
132 |
+
|
133 |
+
#: ../content-aware-sidebars.php:315
|
134 |
+
msgid "All Sidebars"
|
135 |
+
msgstr "كل الجوانب"
|
136 |
+
|
137 |
+
#: ../content-aware-sidebars.php:316
|
138 |
+
msgid "View Sidebar"
|
139 |
+
msgstr "اعرض الجانب"
|
140 |
+
|
141 |
+
#: ../content-aware-sidebars.php:317
|
142 |
+
msgid "Search Sidebars"
|
143 |
+
msgstr "ابحث في الجوانب"
|
144 |
+
|
145 |
+
#: ../content-aware-sidebars.php:318
|
146 |
+
msgid "No sidebars found"
|
147 |
+
msgstr "لا يوجد جوانب"
|
148 |
+
|
149 |
+
#: ../content-aware-sidebars.php:319
|
150 |
+
msgid "No sidebars found in Trash"
|
151 |
+
msgstr "لا يوجد جوانب في المهملات"
|
152 |
+
|
153 |
+
#: ../content-aware-sidebars.php:321
|
154 |
+
msgid "Display sidebar with"
|
155 |
+
msgstr "اعرض الجوانب التي بها"
|
156 |
+
|
157 |
+
#: ../content-aware-sidebars.php:322
|
158 |
+
msgid ""
|
159 |
+
"No content. Please add at least one condition group to make the sidebar "
|
160 |
+
"content aware."
|
161 |
+
msgstr "لا يوجد محتوى. يرجى إضافة الشرط الأدنى للمجموعة لجعل الشريط الجانبي يتعرف عليه."
|
162 |
+
|
163 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
164 |
+
msgid "Manage widgets"
|
165 |
+
msgstr "ضبط الويدجات"
|
166 |
+
|
167 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
168 |
+
msgid "Sidebar updated."
|
169 |
+
msgstr "تم تحديث الشريط الجانبي"
|
170 |
+
|
171 |
+
#: ../content-aware-sidebars.php:361
|
172 |
+
msgid "Sidebar published."
|
173 |
+
msgstr "تم نشر الشريط الجانبي"
|
174 |
+
|
175 |
+
#: ../content-aware-sidebars.php:362
|
176 |
+
msgid "Sidebar saved."
|
177 |
+
msgstr "تم حفظ الشريط الجانبي"
|
178 |
+
|
179 |
+
#: ../content-aware-sidebars.php:363
|
180 |
+
msgid "Sidebar submitted."
|
181 |
+
msgstr "تم إرسال الشريط الجانبي"
|
182 |
+
|
183 |
+
#: ../content-aware-sidebars.php:364
|
184 |
+
#, php-format
|
185 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
186 |
+
msgstr "تم تأكيد الشريط الجانبي لـ <strong>%1$s</strong>."
|
187 |
+
|
188 |
+
#. translators: Publish box date format, see http://php.net/date
|
189 |
+
#: ../content-aware-sidebars.php:366
|
190 |
+
msgid "M j, Y @ G:i"
|
191 |
+
msgstr ""
|
192 |
+
|
193 |
+
#: ../content-aware-sidebars.php:367
|
194 |
+
msgid "Sidebar draft updated."
|
195 |
+
msgstr "تم تحديث مسودة الشريط الجانبي."
|
196 |
+
|
197 |
+
#: ../content-aware-sidebars.php:383
|
198 |
+
#, php-format
|
199 |
+
msgid "%s sidebar updated."
|
200 |
+
msgid_plural "%s sidebars updated."
|
201 |
+
msgstr[0] ""
|
202 |
+
msgstr[1] ""
|
203 |
+
msgstr[2] ""
|
204 |
+
msgstr[3] ""
|
205 |
+
msgstr[4] ""
|
206 |
+
msgstr[5] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:384
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
211 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
msgstr[2] ""
|
215 |
+
msgstr[3] ""
|
216 |
+
msgstr[4] ""
|
217 |
+
msgstr[5] ""
|
218 |
+
|
219 |
+
#: ../content-aware-sidebars.php:385
|
220 |
+
#, php-format
|
221 |
+
msgid "%s sidebar permanently deleted."
|
222 |
+
msgid_plural "%s sidebars permanently deleted."
|
223 |
+
msgstr[0] ""
|
224 |
+
msgstr[1] ""
|
225 |
+
msgstr[2] ""
|
226 |
+
msgstr[3] ""
|
227 |
+
msgstr[4] ""
|
228 |
+
msgstr[5] ""
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:386
|
231 |
+
#, php-format
|
232 |
+
msgid "%s sidebar moved to the Trash."
|
233 |
+
msgid_plural "%s sidebars moved to the Trash."
|
234 |
+
msgstr[0] ""
|
235 |
+
msgstr[1] ""
|
236 |
+
msgstr[2] ""
|
237 |
+
msgstr[3] ""
|
238 |
+
msgstr[4] ""
|
239 |
+
msgstr[5] ""
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:387
|
242 |
+
#, php-format
|
243 |
+
msgid "%s sidebar restored from the Trash."
|
244 |
+
msgid_plural "%s sidebars restored from the Trash."
|
245 |
+
msgstr[0] ""
|
246 |
+
msgstr[1] ""
|
247 |
+
msgstr[2] ""
|
248 |
+
msgstr[3] ""
|
249 |
+
msgstr[4] ""
|
250 |
+
msgstr[5] ""
|
251 |
+
|
252 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
253 |
+
msgid "Please update Host Sidebar"
|
254 |
+
msgstr "الرجاء تحديث الشريط الجانبي للمضيف."
|
255 |
+
|
256 |
+
#: ../content-aware-sidebars.php:472
|
257 |
+
msgid "Merge position"
|
258 |
+
msgstr "دمج الوضعية."
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:473
|
261 |
+
msgid "Widgets"
|
262 |
+
msgstr "ويدجات."
|
263 |
+
|
264 |
+
#: ../content-aware-sidebars.php:586
|
265 |
+
msgid "Manage Widgets"
|
266 |
+
msgstr "إدارة الويدجات."
|
267 |
+
|
268 |
+
#: ../content-aware-sidebars.php:756
|
269 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
270 |
+
msgstr "أحصل على حزمة قيمة ( Premium ) مجانية من Content Aware Sidebars."
|
271 |
+
|
272 |
+
#: ../content-aware-sidebars.php:772
|
273 |
+
msgid "Options"
|
274 |
+
msgstr "الإعدادات."
|
275 |
+
|
276 |
+
#: ../content-aware-sidebars.php:795
|
277 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
278 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
279 |
+
msgid "Condition Groups"
|
280 |
+
msgstr "مجموعات الشروط."
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:796
|
283 |
+
msgid ""
|
284 |
+
"Each created condition group describe some specific content (conditions) "
|
285 |
+
"that the current sidebar should be displayed with."
|
286 |
+
msgstr "كل مجموعة شروط مولدة تصف محتويات معينة ( شروط ), هذه المحتويات يجب أن يظهر بها الشريط الجانبي الحالي."
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:797
|
289 |
+
msgid ""
|
290 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
291 |
+
" groups themselves use logical disjunction. This means that content added to"
|
292 |
+
" a group should be associated, as they are treated as such, and that the "
|
293 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
294 |
+
"extremely focused and at the same time distinct conditions."
|
295 |
+
msgstr ""
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:800
|
298 |
+
msgid "More Information"
|
299 |
+
msgstr "المزيد من المعلومات"
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
302 |
+
msgid "Get Support"
|
303 |
+
msgstr "الحصول على الدعم."
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:816
|
306 |
+
msgid ""
|
307 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
308 |
+
" of the upcoming Premium Bundle*!"
|
309 |
+
msgstr ""
|
310 |
+
|
311 |
+
#: ../content-aware-sidebars.php:817
|
312 |
+
msgid "Translate Now"
|
313 |
+
msgstr "ترجم الآن"
|
314 |
+
|
315 |
+
#: ../content-aware-sidebars.php:818
|
316 |
+
msgid "Get Premium Bundle"
|
317 |
+
msgstr "أحصل على الحزمة القيمة ( Premium )"
|
318 |
+
|
319 |
+
#: ../content-aware-sidebars.php:819
|
320 |
+
msgid ""
|
321 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
322 |
+
msgstr ""
|
323 |
+
|
324 |
+
#: ../content-aware-sidebars.php:822
|
325 |
+
msgid "Partial Feature List"
|
326 |
+
msgstr "قائمة الميزات الجزئية"
|
327 |
+
|
328 |
+
#: ../content-aware-sidebars.php:824
|
329 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
330 |
+
msgstr ""
|
331 |
+
|
332 |
+
#: ../content-aware-sidebars.php:825
|
333 |
+
msgid "Display sidebars with URLs using wildcards"
|
334 |
+
msgstr ""
|
335 |
+
|
336 |
+
#: ../content-aware-sidebars.php:826
|
337 |
+
msgid "Display sidebars with User Roles"
|
338 |
+
msgstr ""
|
339 |
+
|
340 |
+
#: ../content-aware-sidebars.php:827
|
341 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
342 |
+
msgstr ""
|
343 |
+
|
344 |
+
#: ../content-aware-sidebars.php:828
|
345 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
346 |
+
msgstr ""
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
349 |
+
msgid "Order"
|
350 |
+
msgstr ""
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:880
|
353 |
+
msgid "Give a review on WordPress.org"
|
354 |
+
msgstr ""
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
357 |
+
msgid "Translate the plugin into your language"
|
358 |
+
msgstr ""
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:884
|
361 |
+
msgid "Read the FAQ"
|
362 |
+
msgstr ""
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:899
|
365 |
+
msgid ""
|
366 |
+
"If you love this plugin, please consider donating to support future "
|
367 |
+
"development."
|
368 |
+
msgstr ""
|
369 |
+
|
370 |
+
#: ../content-aware-sidebars.php:908
|
371 |
+
msgid "Or you could:"
|
372 |
+
msgstr ""
|
373 |
+
|
374 |
+
#: ../content-aware-sidebars.php:910
|
375 |
+
msgid "Rate the plugin on WordPress.org"
|
376 |
+
msgstr ""
|
377 |
+
|
378 |
+
#: ../content-aware-sidebars.php:911
|
379 |
+
msgid "Link to the plugin page"
|
380 |
+
msgstr ""
|
381 |
+
|
382 |
+
#: ../content-aware-sidebars.php:1045
|
383 |
+
msgid "Filter Sidebars"
|
384 |
+
msgstr ""
|
385 |
+
|
386 |
+
#: ../content-aware-sidebars.php:1046
|
387 |
+
msgid "Filter Widgets"
|
388 |
+
msgstr ""
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
391 |
+
msgid "Condition Group"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
395 |
+
msgctxt "group"
|
396 |
+
msgid "Add New"
|
397 |
+
msgstr "اضف جديد"
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
400 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
401 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
402 |
+
msgid "Add New Group"
|
403 |
+
msgstr ""
|
404 |
+
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
407 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
408 |
+
msgctxt "group"
|
409 |
+
msgid "Edit"
|
410 |
+
msgstr "تحرير"
|
411 |
+
|
412 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
414 |
+
msgid "No Groups found"
|
415 |
+
msgstr ""
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
418 |
+
msgctxt "condition group"
|
419 |
+
msgid "Negated"
|
420 |
+
msgstr ""
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
423 |
+
msgid "Content"
|
424 |
+
msgstr ""
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
427 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
428 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
429 |
+
msgid "Unauthorized request"
|
430 |
+
msgstr ""
|
431 |
+
|
432 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
433 |
+
msgid "Condition group cannot be empty"
|
434 |
+
msgstr ""
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
437 |
+
msgid "Condition group saved"
|
438 |
+
msgstr ""
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
441 |
+
msgid "Condition group could not be removed"
|
442 |
+
msgstr ""
|
443 |
+
|
444 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
445 |
+
msgid "Condition group removed"
|
446 |
+
msgstr ""
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
450 |
+
msgid "Save"
|
451 |
+
msgstr ""
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
454 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
455 |
+
msgid "Cancel"
|
456 |
+
msgstr ""
|
457 |
+
|
458 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
459 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
460 |
+
msgid "Or"
|
461 |
+
msgstr ""
|
462 |
+
|
463 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
464 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
465 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
466 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
467 |
+
msgid "And"
|
468 |
+
msgstr ""
|
469 |
+
|
470 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
471 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
472 |
+
msgid "Remove"
|
473 |
+
msgstr ""
|
474 |
+
|
475 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
476 |
+
msgid "Remove this group and its contents permanently?"
|
477 |
+
msgstr ""
|
478 |
+
|
479 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
480 |
+
msgid "No results found."
|
481 |
+
msgstr ""
|
482 |
+
|
483 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
484 |
+
msgid ""
|
485 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
486 |
+
"these changes?"
|
487 |
+
msgstr ""
|
488 |
+
|
489 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
490 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
491 |
+
msgid "Negate group"
|
492 |
+
msgstr ""
|
493 |
+
|
494 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
495 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
496 |
+
msgid "Target all but this context"
|
497 |
+
msgstr ""
|
498 |
+
|
499 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
500 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
501 |
+
msgid "Target this context"
|
502 |
+
msgstr ""
|
503 |
+
|
504 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
505 |
+
msgid "Authors"
|
506 |
+
msgstr ""
|
507 |
+
|
508 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
509 |
+
#, php-format
|
510 |
+
msgid "Display with All %s"
|
511 |
+
msgstr ""
|
512 |
+
|
513 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
515 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
517 |
+
msgid "View All"
|
518 |
+
msgstr ""
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
521 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
522 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
523 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
524 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
525 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
526 |
+
msgid "Search"
|
527 |
+
msgstr ""
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
530 |
+
msgid "bbPress User Profiles"
|
531 |
+
msgstr ""
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
534 |
+
msgid "BuddyPress Members"
|
535 |
+
msgstr ""
|
536 |
+
|
537 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
538 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
539 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
540 |
+
msgid "Add to Group"
|
541 |
+
msgstr ""
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
544 |
+
msgid "Dates"
|
545 |
+
msgstr ""
|
546 |
+
|
547 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
548 |
+
msgid "Date Archives"
|
549 |
+
msgstr ""
|
550 |
+
|
551 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
552 |
+
msgid "Page Templates"
|
553 |
+
msgstr ""
|
554 |
+
|
555 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
556 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
557 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
558 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
559 |
+
msgid "Languages"
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
563 |
+
msgid "Post Types"
|
564 |
+
msgstr ""
|
565 |
+
|
566 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
567 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
568 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
569 |
+
msgid "Automatically select new children of a selected ancestor"
|
570 |
+
msgstr ""
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
573 |
+
msgid "Automatically add new children of a selected ancestor"
|
574 |
+
msgstr ""
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
577 |
+
#, php-format
|
578 |
+
msgid "%s Archives"
|
579 |
+
msgstr ""
|
580 |
+
|
581 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
582 |
+
msgid "Blog Page"
|
583 |
+
msgstr ""
|
584 |
+
|
585 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
586 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
587 |
+
msgid "No items."
|
588 |
+
msgstr ""
|
589 |
+
|
590 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
591 |
+
msgid "Most Recent"
|
592 |
+
msgstr ""
|
593 |
+
|
594 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
595 |
+
msgid "Static Pages"
|
596 |
+
msgstr ""
|
597 |
+
|
598 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
599 |
+
msgid "Front Page"
|
600 |
+
msgstr ""
|
601 |
+
|
602 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
603 |
+
msgid "Search Results"
|
604 |
+
msgstr ""
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
607 |
+
msgid "404 Page"
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
611 |
+
msgid "Taxonomies"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
615 |
+
msgid "Most Used"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
619 |
+
msgid "Conditional Content"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
623 |
+
msgid ""
|
624 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
625 |
+
" it. In each group, you can combine different types of associated content."
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
629 |
+
#, php-format
|
630 |
+
msgid "All %s"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
634 |
+
msgid "Password protected"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
638 |
+
msgid "Private"
|
639 |
+
msgstr ""
|
640 |
+
|
641 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
642 |
+
msgid "Draft"
|
643 |
+
msgstr ""
|
644 |
+
|
645 |
+
#. translators: post state
|
646 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
647 |
+
msgctxt "post state"
|
648 |
+
msgid "Pending"
|
649 |
+
msgstr ""
|
650 |
+
|
651 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
652 |
+
msgid "Sticky"
|
653 |
+
msgstr ""
|
654 |
+
|
655 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
656 |
+
msgid "Scheduled"
|
657 |
+
msgstr ""
|
658 |
+
|
659 |
+
#: ../pointers.php:68
|
660 |
+
msgid "Get started"
|
661 |
+
msgstr ""
|
662 |
+
|
663 |
+
#: ../pointers.php:69
|
664 |
+
msgid ""
|
665 |
+
"You've just installed Content Aware Sidebars!\n"
|
666 |
+
"\n"
|
667 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
668 |
+
"\n"
|
669 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
670 |
+
msgstr ""
|
671 |
+
|
672 |
+
#: ../pointers.php:76
|
673 |
+
msgid "Start Tour"
|
674 |
+
msgstr ""
|
675 |
+
|
676 |
+
#: ../pointers.php:78
|
677 |
+
msgid "Not now"
|
678 |
+
msgstr ""
|
679 |
+
|
680 |
+
#: ../pointers.php:83
|
681 |
+
msgid ""
|
682 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
683 |
+
"\n"
|
684 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
685 |
+
"\n"
|
686 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
687 |
+
msgstr ""
|
688 |
+
|
689 |
+
#: ../pointers.php:92
|
690 |
+
msgid "Content and contexts"
|
691 |
+
msgstr ""
|
692 |
+
|
693 |
+
#: ../pointers.php:93
|
694 |
+
msgid ""
|
695 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
696 |
+
"\n"
|
697 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
698 |
+
"\n"
|
699 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
700 |
+
msgstr ""
|
701 |
+
|
702 |
+
#: ../pointers.php:102
|
703 |
+
msgid "Options, options"
|
704 |
+
msgstr ""
|
705 |
+
|
706 |
+
#: ../pointers.php:103
|
707 |
+
msgid ""
|
708 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
709 |
+
"\n"
|
710 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
711 |
+
"\n"
|
712 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
713 |
+
"\n"
|
714 |
+
" You are in control."
|
715 |
+
msgstr ""
|
716 |
+
|
717 |
+
#: ../pointers.php:112
|
718 |
+
msgid "Help and Support"
|
719 |
+
msgstr ""
|
720 |
+
|
721 |
+
#: ../pointers.php:113
|
722 |
+
msgid ""
|
723 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
724 |
+
"\n"
|
725 |
+
"If you need more help, click on the \"Help\" tab here."
|
726 |
+
msgstr ""
|
727 |
+
|
728 |
+
#: ../pointers.php:142
|
729 |
+
msgid "Close"
|
730 |
+
msgstr ""
|
731 |
+
|
732 |
+
#: ../pointers.php:143
|
733 |
+
msgid "Next"
|
734 |
+
msgstr ""
|
lang/content-aware-sidebars-bg_BG.po
CHANGED
@@ -1,712 +1,712 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Dimitar Tsonev <dimitar.tsonev@gmail.com>, 2015
|
5 |
-
# Elena Uzunova <eliuzunova@gmail.com>, 2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Bulgarian (Bulgaria) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/bg_BG/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: bg_BG\n"
|
18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Управление и показване на сайдбарс спрямо разглежданото съдържание"
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Сайдбарс спрямо съдържанието"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "Внасяне"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "ЧЗВ"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Излагане"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Единичен"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Единичен и архив"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Архив"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Управление"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Замяна"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Сливане"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Ръчно"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Замяна насила"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "Замяна на хост сайдбар, сливане с него или ръчно добавяне на сайдбар"
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "Хост Сайдбар"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "Сливане на позиция"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Горе"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Долу"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Слагане на сайдбар горе или долу на хоста при сливане"
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "Сайдбарс"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "Сайдбар"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Добавяне на нов"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Добавяне на нов сайдбар"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Промяна на сайдбар"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Нов сайдбар"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Всички сайдбарс"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Преглед на сайдбар"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Търсене в сайдбарс"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "Няма намерени сайдбарс"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "Няма намерени сайдбарс в Кошчето"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Показване на сайдбар с"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Няма съдържание. Моля, добавете поне една условна група, за да направите сайдбара зависим от съдържанието."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Управление на джаджи"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "Сайдбар обновен."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Сайдбар публикуван."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Сайдбар запазен."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Сайдбар зададен."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Сайдбар планиран за: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "M j, Y @ G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Чернова на сайдбар обновена."
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
msgstr[1] ""
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] ""
|
207 |
-
msgstr[1] ""
|
208 |
-
|
209 |
-
#: ../content-aware-sidebars.php:385
|
210 |
-
#, php-format
|
211 |
-
msgid "%s sidebar permanently deleted."
|
212 |
-
msgid_plural "%s sidebars permanently deleted."
|
213 |
-
msgstr[0] ""
|
214 |
-
msgstr[1] ""
|
215 |
-
|
216 |
-
#: ../content-aware-sidebars.php:386
|
217 |
-
#, php-format
|
218 |
-
msgid "%s sidebar moved to the Trash."
|
219 |
-
msgid_plural "%s sidebars moved to the Trash."
|
220 |
-
msgstr[0] ""
|
221 |
-
msgstr[1] ""
|
222 |
-
|
223 |
-
#: ../content-aware-sidebars.php:387
|
224 |
-
#, php-format
|
225 |
-
msgid "%s sidebar restored from the Trash."
|
226 |
-
msgid_plural "%s sidebars restored from the Trash."
|
227 |
-
msgstr[0] ""
|
228 |
-
msgstr[1] ""
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
-
msgid "Please update Host Sidebar"
|
232 |
-
msgstr "Моля, обновете хост сайдбар."
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:472
|
235 |
-
msgid "Merge position"
|
236 |
-
msgstr "Сливане на позиция"
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:473
|
239 |
-
msgid "Widgets"
|
240 |
-
msgstr "Джаджи"
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:586
|
243 |
-
msgid "Manage Widgets"
|
244 |
-
msgstr "Управление на джаджи"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:756
|
247 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
-
msgstr "Вземете безплатен бъндъл за сайдбарс, зависими от съдържанието"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:772
|
251 |
-
msgid "Options"
|
252 |
-
msgstr "Настройки"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:795
|
255 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
-
msgid "Condition Groups"
|
258 |
-
msgstr "Условни групи"
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:796
|
261 |
-
msgid ""
|
262 |
-
"Each created condition group describe some specific content (conditions) "
|
263 |
-
"that the current sidebar should be displayed with."
|
264 |
-
msgstr "Всяка създадена условна група описва дадено определено съдържание (условия), което би трябвало да се съдържа в настоящия сайдбар."
|
265 |
-
|
266 |
-
#: ../content-aware-sidebars.php:797
|
267 |
-
msgid ""
|
268 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
-
" groups themselves use logical disjunction. This means that content added to"
|
270 |
-
" a group should be associated, as they are treated as such, and that the "
|
271 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
-
"extremely focused and at the same time distinct conditions."
|
273 |
-
msgstr "Съдържание, добавено към условна група, използва логично съединение, докато условните групи използват логично разединение. Това означава, че съдържанието, добавено към групата, трябва да бъде свързано, защото се третират като такива, както и че групите не се месят една с друга. Така, възможно е да имаме изключително насочени и същевременно отделни условия."
|
274 |
-
|
275 |
-
#: ../content-aware-sidebars.php:800
|
276 |
-
msgid "More Information"
|
277 |
-
msgstr "Повече информация"
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
-
msgid "Get Support"
|
281 |
-
msgstr "Обърнете се към Поддръжка"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:816
|
284 |
-
msgid ""
|
285 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
-
" of the upcoming Premium Bundle*!"
|
287 |
-
msgstr "Преведете Content Aware Sidebars на Вашия език и станете BETA тестер на предстоящия платен пакет*!"
|
288 |
-
|
289 |
-
#: ../content-aware-sidebars.php:817
|
290 |
-
msgid "Translate Now"
|
291 |
-
msgstr "Преведете сега"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:818
|
294 |
-
msgid "Get Premium Bundle"
|
295 |
-
msgstr "Вземете платен пакет"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:819
|
298 |
-
msgid ""
|
299 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
-
msgstr "Ползва се само за един сайт. БЕТА предполага, че не се препоръчва за масови сайтове."
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:822
|
303 |
-
msgid "Partial Feature List"
|
304 |
-
msgstr "Частичен списък със свойства"
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:824
|
307 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
-
msgstr "Изберете и създайте сайдбарс в екраните за редакция на публикации"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:825
|
311 |
-
msgid "Display sidebars with URLs using wildcards"
|
312 |
-
msgstr "Показване на сайдбарс с URL, използвайки wildcards"
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:826
|
315 |
-
msgid "Display sidebars with User Roles"
|
316 |
-
msgstr "Показване на сайдбарс с потребителски роли"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:827
|
319 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
-
msgstr "Показване на сайдбарс с потребителски групи от BuddyPress"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:828
|
323 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
-
msgstr "Сайдбар колони в екраните с вид публикация и преглед на таксономия"
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
-
msgid "Order"
|
328 |
-
msgstr "Поръчка"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:880
|
331 |
-
msgid "Give a review on WordPress.org"
|
332 |
-
msgstr ""
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
-
msgid "Translate the plugin into your language"
|
336 |
-
msgstr "Преведете разширението на своя език"
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:884
|
339 |
-
msgid "Read the FAQ"
|
340 |
-
msgstr ""
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:899
|
343 |
-
msgid ""
|
344 |
-
"If you love this plugin, please consider donating to support future "
|
345 |
-
"development."
|
346 |
-
msgstr "Ако обичате това разширение, моля, обмислете дарение, за да подкрепите бъдещото му развитие."
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:908
|
349 |
-
msgid "Or you could:"
|
350 |
-
msgstr "Или бихте могли:"
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:910
|
353 |
-
msgid "Rate the plugin on WordPress.org"
|
354 |
-
msgstr "Оценете това разширение на WordPress.org"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:911
|
357 |
-
msgid "Link to the plugin page"
|
358 |
-
msgstr "Линк към страницата на разширението"
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:1045
|
361 |
-
msgid "Filter Sidebars"
|
362 |
-
msgstr "Филтър на сайдбарс"
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1046
|
365 |
-
msgid "Filter Widgets"
|
366 |
-
msgstr ""
|
367 |
-
|
368 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
-
msgid "Condition Group"
|
370 |
-
msgstr "Условна група"
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
-
msgctxt "group"
|
374 |
-
msgid "Add New"
|
375 |
-
msgstr "Добавяне на ново"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
-
msgid "Add New Group"
|
381 |
-
msgstr "Добавяне на нова група"
|
382 |
-
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
-
msgctxt "group"
|
387 |
-
msgid "Edit"
|
388 |
-
msgstr "Промяна"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
-
msgid "No Groups found"
|
393 |
-
msgstr "Няма намерени групи"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
-
msgctxt "condition group"
|
397 |
-
msgid "Negated"
|
398 |
-
msgstr "Отхвърлено"
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
-
msgid "Content"
|
402 |
-
msgstr "Съдържание"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
-
msgid "Unauthorized request"
|
408 |
-
msgstr "Неоторизирана молба"
|
409 |
-
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
-
msgid "Condition group cannot be empty"
|
412 |
-
msgstr "Условната група не може да бъде празна"
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
-
msgid "Condition group saved"
|
416 |
-
msgstr "Условна група запазена"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
-
msgid "Condition group could not be removed"
|
420 |
-
msgstr "Условната група не може да бъде премахната"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
-
msgid "Condition group removed"
|
424 |
-
msgstr "Условна група премахната"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Save"
|
429 |
-
msgstr "Запазване"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Cancel"
|
434 |
-
msgstr "Отказ"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
-
msgid "Or"
|
439 |
-
msgstr "Или"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
-
msgid "And"
|
446 |
-
msgstr ""
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
-
msgid "Remove"
|
451 |
-
msgstr "Премахване"
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
-
msgid "Remove this group and its contents permanently?"
|
455 |
-
msgstr "Премахване на тази група и нейното съдържание перманентно?"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
-
msgid "No results found."
|
459 |
-
msgstr "Няма намерени резултати"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
-
msgid ""
|
463 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
-
"these changes?"
|
465 |
-
msgstr "Настоящата група има незапазени промени. Искате ли да продължите и да откажете тези промени?"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
-
msgid "Negate group"
|
470 |
-
msgstr "Отхвърляне на група"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target all but this context"
|
475 |
-
msgstr "Насочване към всичко, освен този контекст"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target this context"
|
480 |
-
msgstr "Насочване към този контекст"
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
-
msgid "Authors"
|
484 |
-
msgstr "Автори"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
-
#, php-format
|
488 |
-
msgid "Display with All %s"
|
489 |
-
msgstr "Показване с всички %s"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
-
msgid "View All"
|
496 |
-
msgstr "Преглед на всичко"
|
497 |
-
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
-
msgid "Search"
|
505 |
-
msgstr "Търсене"
|
506 |
-
|
507 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
-
msgid "bbPress User Profiles"
|
509 |
-
msgstr "Потребителски профили в bbPress"
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
-
msgid "BuddyPress Members"
|
513 |
-
msgstr "Членове на BuddyPress"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
-
msgid "Add to Group"
|
519 |
-
msgstr "Добавяне към група"
|
520 |
-
|
521 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
-
msgid "Dates"
|
523 |
-
msgstr "Дати"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
-
msgid "Date Archives"
|
527 |
-
msgstr "Архив на дати"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
-
msgid "Page Templates"
|
531 |
-
msgstr "Темплейти за страници"
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
-
msgid "Languages"
|
538 |
-
msgstr "Езици"
|
539 |
-
|
540 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
-
msgid "Post Types"
|
542 |
-
msgstr "Видове публикации"
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
-
msgid "Automatically select new children of a selected ancestor"
|
548 |
-
msgstr "Автоматично избиране на нови деца на избран предшественик"
|
549 |
-
|
550 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
-
msgid "Automatically add new children of a selected ancestor"
|
552 |
-
msgstr "Автоматично добавяне на деца на избран предшественик"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
-
#, php-format
|
556 |
-
msgid "%s Archives"
|
557 |
-
msgstr "%s Архиви"
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
-
msgid "Blog Page"
|
561 |
-
msgstr "Блог страница"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
-
msgid "No items."
|
566 |
-
msgstr "Няма обекти."
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
-
msgid "Most Recent"
|
570 |
-
msgstr "Най-скорошни"
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
-
msgid "Static Pages"
|
574 |
-
msgstr "Статични страници"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
-
msgid "Front Page"
|
578 |
-
msgstr "Начална страница"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
-
msgid "Search Results"
|
582 |
-
msgstr "Резултати от търсенето"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
-
msgid "404 Page"
|
586 |
-
msgstr "404 Страница"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
-
msgid "Taxonomies"
|
590 |
-
msgstr "Таксономии"
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
-
msgid "Most Used"
|
594 |
-
msgstr "Най-използвани"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
-
msgid "Conditional Content"
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
-
msgid ""
|
602 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
-
" it. In each group, you can combine different types of associated content."
|
604 |
-
msgstr "Кликнете, за да промените група или да създадете нова. Изберете съдържание от ляво, за да го добавите. Във всяка група, можете да комбинирате различните видове свързано съдържание."
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
-
#, php-format
|
608 |
-
msgid "All %s"
|
609 |
-
msgstr "Всички %s"
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
-
msgid "Password protected"
|
613 |
-
msgstr ""
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
-
msgid "Private"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
-
msgid "Draft"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#. translators: post state
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
-
msgctxt "post state"
|
626 |
-
msgid "Pending"
|
627 |
-
msgstr ""
|
628 |
-
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
-
msgid "Sticky"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
-
msgid "Scheduled"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../pointers.php:68
|
638 |
-
msgid "Get started"
|
639 |
-
msgstr "Започнете"
|
640 |
-
|
641 |
-
#: ../pointers.php:69
|
642 |
-
msgid ""
|
643 |
-
"You've just installed Content Aware Sidebars!\n"
|
644 |
-
"\n"
|
645 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
-
"\n"
|
647 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
-
msgstr "Току-що инсталирахте Сайдбарс, свързани със съдържанието!\n\nТова Ви дава много опции, така че този екран би могъл да изглежда натоварващ в началото. Не се притеснявайте.\n\nКликнете \"Започване на обиколка\", за да разгледате бързо въведение и да научите как да показвате сайдбар точно и когато искате."
|
649 |
-
|
650 |
-
#: ../pointers.php:76
|
651 |
-
msgid "Start Tour"
|
652 |
-
msgstr "Започване на обиколка"
|
653 |
-
|
654 |
-
#: ../pointers.php:78
|
655 |
-
msgid "Not now"
|
656 |
-
msgstr "Не сега"
|
657 |
-
|
658 |
-
#: ../pointers.php:83
|
659 |
-
msgid ""
|
660 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
-
"\n"
|
662 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
-
"\n"
|
664 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
-
msgstr "За да направите сайдбар в контекст, започнете като създадете условна група.\n\nУсловните групи са изолирани от другите, това означава, че даден сайдбар може да има много различни условия.\n\nОтхвърляне на група означава, че сайдбарът ще се показва при всички, освен тези условия."
|
666 |
-
|
667 |
-
#: ../pointers.php:92
|
668 |
-
msgid "Content and contexts"
|
669 |
-
msgstr "Съдържание и контекст"
|
670 |
-
|
671 |
-
#: ../pointers.php:93
|
672 |
-
msgid ""
|
673 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
-
"\n"
|
675 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
-
"\n"
|
677 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
-
msgstr "Тук ще намерите цялото съдържание от сайта Ви, поддържано от кутията от Сайдбарс, зависещи от съдържанието.\n\nПросто изберете съдържанието, което искате да бъде показвано в сайдбара и го добавете към група.\n\nДори можете да комбинирате свързано съдържание в една група; пробвайте да изберете \"Всички публикации\", една Категория и даден Автор. Страхотно!"
|
679 |
-
|
680 |
-
#: ../pointers.php:102
|
681 |
-
msgid "Options, options"
|
682 |
-
msgstr "Опции, опции"
|
683 |
-
|
684 |
-
#: ../pointers.php:103
|
685 |
-
msgid ""
|
686 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
-
"\n"
|
688 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
-
"\n"
|
690 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
-
"\n"
|
692 |
-
" You are in control."
|
693 |
-
msgstr "Трябва ли сайдбарът да се показва на единични страници и/ли архиви?\n\nТрябва ли да се слива с друг сайдбар или да го заменя? Може би искате ръчно да го вкарате във Вашето съдържание чрез шорткод.\n\nПланирайте сайдбара, както го правите с публикациите и страниците, или го направете частен, така че да се вижда само от влезнали потребители.\n\nВие контролирате."
|
694 |
-
|
695 |
-
#: ../pointers.php:112
|
696 |
-
msgid "Help and Support"
|
697 |
-
msgstr "Помощ и поддръжка"
|
698 |
-
|
699 |
-
#: ../pointers.php:113
|
700 |
-
msgid ""
|
701 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
-
"\n"
|
703 |
-
"If you need more help, click on the \"Help\" tab here."
|
704 |
-
msgstr "Това е! Сега можете да започнете да създавате сайдбарс и да ги показвате при Вашите условия.\n\nАко имате нужда от повече помощ, кликнете върху таба \"Помощ\" тук."
|
705 |
-
|
706 |
-
#: ../pointers.php:142
|
707 |
-
msgid "Close"
|
708 |
-
msgstr "Затваряне"
|
709 |
-
|
710 |
-
#: ../pointers.php:143
|
711 |
-
msgid "Next"
|
712 |
-
msgstr "Следващ"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Dimitar Tsonev <dimitar.tsonev@gmail.com>, 2015
|
5 |
+
# Elena Uzunova <eliuzunova@gmail.com>, 2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Bulgarian (Bulgaria) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/bg_BG/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: bg_BG\n"
|
18 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Управление и показване на сайдбарс спрямо разглежданото съдържание"
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Сайдбарс спрямо съдържанието"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "Внасяне"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "ЧЗВ"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Излагане"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Единичен"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Единичен и архив"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Архив"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Управление"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Замяна"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Сливане"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Ръчно"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Замяна насила"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "Замяна на хост сайдбар, сливане с него или ръчно добавяне на сайдбар"
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "Хост Сайдбар"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "Сливане на позиция"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Горе"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Долу"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Слагане на сайдбар горе или долу на хоста при сливане"
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "Сайдбарс"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "Сайдбар"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Добавяне на нов"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Добавяне на нов сайдбар"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Промяна на сайдбар"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Нов сайдбар"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Всички сайдбарс"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Преглед на сайдбар"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Търсене в сайдбарс"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "Няма намерени сайдбарс"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "Няма намерени сайдбарс в Кошчето"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Показване на сайдбар с"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Няма съдържание. Моля, добавете поне една условна група, за да направите сайдбара зависим от съдържанието."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Управление на джаджи"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "Сайдбар обновен."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Сайдбар публикуван."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Сайдбар запазен."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Сайдбар зададен."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Сайдбар планиран за: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "M j, Y @ G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Чернова на сайдбар обновена."
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
msgstr[1] ""
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] ""
|
207 |
+
msgstr[1] ""
|
208 |
+
|
209 |
+
#: ../content-aware-sidebars.php:385
|
210 |
+
#, php-format
|
211 |
+
msgid "%s sidebar permanently deleted."
|
212 |
+
msgid_plural "%s sidebars permanently deleted."
|
213 |
+
msgstr[0] ""
|
214 |
+
msgstr[1] ""
|
215 |
+
|
216 |
+
#: ../content-aware-sidebars.php:386
|
217 |
+
#, php-format
|
218 |
+
msgid "%s sidebar moved to the Trash."
|
219 |
+
msgid_plural "%s sidebars moved to the Trash."
|
220 |
+
msgstr[0] ""
|
221 |
+
msgstr[1] ""
|
222 |
+
|
223 |
+
#: ../content-aware-sidebars.php:387
|
224 |
+
#, php-format
|
225 |
+
msgid "%s sidebar restored from the Trash."
|
226 |
+
msgid_plural "%s sidebars restored from the Trash."
|
227 |
+
msgstr[0] ""
|
228 |
+
msgstr[1] ""
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
+
msgid "Please update Host Sidebar"
|
232 |
+
msgstr "Моля, обновете хост сайдбар."
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:472
|
235 |
+
msgid "Merge position"
|
236 |
+
msgstr "Сливане на позиция"
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:473
|
239 |
+
msgid "Widgets"
|
240 |
+
msgstr "Джаджи"
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:586
|
243 |
+
msgid "Manage Widgets"
|
244 |
+
msgstr "Управление на джаджи"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:756
|
247 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
+
msgstr "Вземете безплатен бъндъл за сайдбарс, зависими от съдържанието"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:772
|
251 |
+
msgid "Options"
|
252 |
+
msgstr "Настройки"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:795
|
255 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
+
msgid "Condition Groups"
|
258 |
+
msgstr "Условни групи"
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:796
|
261 |
+
msgid ""
|
262 |
+
"Each created condition group describe some specific content (conditions) "
|
263 |
+
"that the current sidebar should be displayed with."
|
264 |
+
msgstr "Всяка създадена условна група описва дадено определено съдържание (условия), което би трябвало да се съдържа в настоящия сайдбар."
|
265 |
+
|
266 |
+
#: ../content-aware-sidebars.php:797
|
267 |
+
msgid ""
|
268 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
+
" groups themselves use logical disjunction. This means that content added to"
|
270 |
+
" a group should be associated, as they are treated as such, and that the "
|
271 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
+
"extremely focused and at the same time distinct conditions."
|
273 |
+
msgstr "Съдържание, добавено към условна група, използва логично съединение, докато условните групи използват логично разединение. Това означава, че съдържанието, добавено към групата, трябва да бъде свързано, защото се третират като такива, както и че групите не се месят една с друга. Така, възможно е да имаме изключително насочени и същевременно отделни условия."
|
274 |
+
|
275 |
+
#: ../content-aware-sidebars.php:800
|
276 |
+
msgid "More Information"
|
277 |
+
msgstr "Повече информация"
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
+
msgid "Get Support"
|
281 |
+
msgstr "Обърнете се към Поддръжка"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:816
|
284 |
+
msgid ""
|
285 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
+
" of the upcoming Premium Bundle*!"
|
287 |
+
msgstr "Преведете Content Aware Sidebars на Вашия език и станете BETA тестер на предстоящия платен пакет*!"
|
288 |
+
|
289 |
+
#: ../content-aware-sidebars.php:817
|
290 |
+
msgid "Translate Now"
|
291 |
+
msgstr "Преведете сега"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:818
|
294 |
+
msgid "Get Premium Bundle"
|
295 |
+
msgstr "Вземете платен пакет"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:819
|
298 |
+
msgid ""
|
299 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
+
msgstr "Ползва се само за един сайт. БЕТА предполага, че не се препоръчва за масови сайтове."
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:822
|
303 |
+
msgid "Partial Feature List"
|
304 |
+
msgstr "Частичен списък със свойства"
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:824
|
307 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
+
msgstr "Изберете и създайте сайдбарс в екраните за редакция на публикации"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:825
|
311 |
+
msgid "Display sidebars with URLs using wildcards"
|
312 |
+
msgstr "Показване на сайдбарс с URL, използвайки wildcards"
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:826
|
315 |
+
msgid "Display sidebars with User Roles"
|
316 |
+
msgstr "Показване на сайдбарс с потребителски роли"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:827
|
319 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
+
msgstr "Показване на сайдбарс с потребителски групи от BuddyPress"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:828
|
323 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
+
msgstr "Сайдбар колони в екраните с вид публикация и преглед на таксономия"
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
+
msgid "Order"
|
328 |
+
msgstr "Поръчка"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:880
|
331 |
+
msgid "Give a review on WordPress.org"
|
332 |
+
msgstr ""
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
+
msgid "Translate the plugin into your language"
|
336 |
+
msgstr "Преведете разширението на своя език"
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:884
|
339 |
+
msgid "Read the FAQ"
|
340 |
+
msgstr ""
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:899
|
343 |
+
msgid ""
|
344 |
+
"If you love this plugin, please consider donating to support future "
|
345 |
+
"development."
|
346 |
+
msgstr "Ако обичате това разширение, моля, обмислете дарение, за да подкрепите бъдещото му развитие."
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:908
|
349 |
+
msgid "Or you could:"
|
350 |
+
msgstr "Или бихте могли:"
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:910
|
353 |
+
msgid "Rate the plugin on WordPress.org"
|
354 |
+
msgstr "Оценете това разширение на WordPress.org"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:911
|
357 |
+
msgid "Link to the plugin page"
|
358 |
+
msgstr "Линк към страницата на разширението"
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:1045
|
361 |
+
msgid "Filter Sidebars"
|
362 |
+
msgstr "Филтър на сайдбарс"
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1046
|
365 |
+
msgid "Filter Widgets"
|
366 |
+
msgstr ""
|
367 |
+
|
368 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
+
msgid "Condition Group"
|
370 |
+
msgstr "Условна група"
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
+
msgctxt "group"
|
374 |
+
msgid "Add New"
|
375 |
+
msgstr "Добавяне на ново"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
+
msgid "Add New Group"
|
381 |
+
msgstr "Добавяне на нова група"
|
382 |
+
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
+
msgctxt "group"
|
387 |
+
msgid "Edit"
|
388 |
+
msgstr "Промяна"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
+
msgid "No Groups found"
|
393 |
+
msgstr "Няма намерени групи"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
+
msgctxt "condition group"
|
397 |
+
msgid "Negated"
|
398 |
+
msgstr "Отхвърлено"
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
+
msgid "Content"
|
402 |
+
msgstr "Съдържание"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
+
msgid "Unauthorized request"
|
408 |
+
msgstr "Неоторизирана молба"
|
409 |
+
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
+
msgid "Condition group cannot be empty"
|
412 |
+
msgstr "Условната група не може да бъде празна"
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
+
msgid "Condition group saved"
|
416 |
+
msgstr "Условна група запазена"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
+
msgid "Condition group could not be removed"
|
420 |
+
msgstr "Условната група не може да бъде премахната"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
+
msgid "Condition group removed"
|
424 |
+
msgstr "Условна група премахната"
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Save"
|
429 |
+
msgstr "Запазване"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Cancel"
|
434 |
+
msgstr "Отказ"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
+
msgid "Or"
|
439 |
+
msgstr "Или"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
+
msgid "And"
|
446 |
+
msgstr ""
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
+
msgid "Remove"
|
451 |
+
msgstr "Премахване"
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
+
msgid "Remove this group and its contents permanently?"
|
455 |
+
msgstr "Премахване на тази група и нейното съдържание перманентно?"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
+
msgid "No results found."
|
459 |
+
msgstr "Няма намерени резултати"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
+
msgid ""
|
463 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
+
"these changes?"
|
465 |
+
msgstr "Настоящата група има незапазени промени. Искате ли да продължите и да откажете тези промени?"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
+
msgid "Negate group"
|
470 |
+
msgstr "Отхвърляне на група"
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target all but this context"
|
475 |
+
msgstr "Насочване към всичко, освен този контекст"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target this context"
|
480 |
+
msgstr "Насочване към този контекст"
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
+
msgid "Authors"
|
484 |
+
msgstr "Автори"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
+
#, php-format
|
488 |
+
msgid "Display with All %s"
|
489 |
+
msgstr "Показване с всички %s"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
+
msgid "View All"
|
496 |
+
msgstr "Преглед на всичко"
|
497 |
+
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
+
msgid "Search"
|
505 |
+
msgstr "Търсене"
|
506 |
+
|
507 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
+
msgid "bbPress User Profiles"
|
509 |
+
msgstr "Потребителски профили в bbPress"
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
+
msgid "BuddyPress Members"
|
513 |
+
msgstr "Членове на BuddyPress"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
+
msgid "Add to Group"
|
519 |
+
msgstr "Добавяне към група"
|
520 |
+
|
521 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
+
msgid "Dates"
|
523 |
+
msgstr "Дати"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
+
msgid "Date Archives"
|
527 |
+
msgstr "Архив на дати"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
+
msgid "Page Templates"
|
531 |
+
msgstr "Темплейти за страници"
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
+
msgid "Languages"
|
538 |
+
msgstr "Езици"
|
539 |
+
|
540 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
+
msgid "Post Types"
|
542 |
+
msgstr "Видове публикации"
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
+
msgid "Automatically select new children of a selected ancestor"
|
548 |
+
msgstr "Автоматично избиране на нови деца на избран предшественик"
|
549 |
+
|
550 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
+
msgid "Automatically add new children of a selected ancestor"
|
552 |
+
msgstr "Автоматично добавяне на деца на избран предшественик"
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
+
#, php-format
|
556 |
+
msgid "%s Archives"
|
557 |
+
msgstr "%s Архиви"
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
+
msgid "Blog Page"
|
561 |
+
msgstr "Блог страница"
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
+
msgid "No items."
|
566 |
+
msgstr "Няма обекти."
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
+
msgid "Most Recent"
|
570 |
+
msgstr "Най-скорошни"
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
+
msgid "Static Pages"
|
574 |
+
msgstr "Статични страници"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
+
msgid "Front Page"
|
578 |
+
msgstr "Начална страница"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
+
msgid "Search Results"
|
582 |
+
msgstr "Резултати от търсенето"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
+
msgid "404 Page"
|
586 |
+
msgstr "404 Страница"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
+
msgid "Taxonomies"
|
590 |
+
msgstr "Таксономии"
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
+
msgid "Most Used"
|
594 |
+
msgstr "Най-използвани"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
+
msgid "Conditional Content"
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
+
msgid ""
|
602 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
+
" it. In each group, you can combine different types of associated content."
|
604 |
+
msgstr "Кликнете, за да промените група или да създадете нова. Изберете съдържание от ляво, за да го добавите. Във всяка група, можете да комбинирате различните видове свързано съдържание."
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
+
#, php-format
|
608 |
+
msgid "All %s"
|
609 |
+
msgstr "Всички %s"
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
+
msgid "Password protected"
|
613 |
+
msgstr ""
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
+
msgid "Private"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
+
msgid "Draft"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#. translators: post state
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
+
msgctxt "post state"
|
626 |
+
msgid "Pending"
|
627 |
+
msgstr ""
|
628 |
+
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
+
msgid "Sticky"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
+
msgid "Scheduled"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../pointers.php:68
|
638 |
+
msgid "Get started"
|
639 |
+
msgstr "Започнете"
|
640 |
+
|
641 |
+
#: ../pointers.php:69
|
642 |
+
msgid ""
|
643 |
+
"You've just installed Content Aware Sidebars!\n"
|
644 |
+
"\n"
|
645 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
+
"\n"
|
647 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
+
msgstr "Току-що инсталирахте Сайдбарс, свързани със съдържанието!\n\nТова Ви дава много опции, така че този екран би могъл да изглежда натоварващ в началото. Не се притеснявайте.\n\nКликнете \"Започване на обиколка\", за да разгледате бързо въведение и да научите как да показвате сайдбар точно и когато искате."
|
649 |
+
|
650 |
+
#: ../pointers.php:76
|
651 |
+
msgid "Start Tour"
|
652 |
+
msgstr "Започване на обиколка"
|
653 |
+
|
654 |
+
#: ../pointers.php:78
|
655 |
+
msgid "Not now"
|
656 |
+
msgstr "Не сега"
|
657 |
+
|
658 |
+
#: ../pointers.php:83
|
659 |
+
msgid ""
|
660 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
+
"\n"
|
662 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
+
"\n"
|
664 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
+
msgstr "За да направите сайдбар в контекст, започнете като създадете условна група.\n\nУсловните групи са изолирани от другите, това означава, че даден сайдбар може да има много различни условия.\n\nОтхвърляне на група означава, че сайдбарът ще се показва при всички, освен тези условия."
|
666 |
+
|
667 |
+
#: ../pointers.php:92
|
668 |
+
msgid "Content and contexts"
|
669 |
+
msgstr "Съдържание и контекст"
|
670 |
+
|
671 |
+
#: ../pointers.php:93
|
672 |
+
msgid ""
|
673 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
+
"\n"
|
675 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
+
"\n"
|
677 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
+
msgstr "Тук ще намерите цялото съдържание от сайта Ви, поддържано от кутията от Сайдбарс, зависещи от съдържанието.\n\nПросто изберете съдържанието, което искате да бъде показвано в сайдбара и го добавете към група.\n\nДори можете да комбинирате свързано съдържание в една група; пробвайте да изберете \"Всички публикации\", една Категория и даден Автор. Страхотно!"
|
679 |
+
|
680 |
+
#: ../pointers.php:102
|
681 |
+
msgid "Options, options"
|
682 |
+
msgstr "Опции, опции"
|
683 |
+
|
684 |
+
#: ../pointers.php:103
|
685 |
+
msgid ""
|
686 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
+
"\n"
|
688 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
+
"\n"
|
690 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
+
"\n"
|
692 |
+
" You are in control."
|
693 |
+
msgstr "Трябва ли сайдбарът да се показва на единични страници и/ли архиви?\n\nТрябва ли да се слива с друг сайдбар или да го заменя? Може би искате ръчно да го вкарате във Вашето съдържание чрез шорткод.\n\nПланирайте сайдбара, както го правите с публикациите и страниците, или го направете частен, така че да се вижда само от влезнали потребители.\n\nВие контролирате."
|
694 |
+
|
695 |
+
#: ../pointers.php:112
|
696 |
+
msgid "Help and Support"
|
697 |
+
msgstr "Помощ и поддръжка"
|
698 |
+
|
699 |
+
#: ../pointers.php:113
|
700 |
+
msgid ""
|
701 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
+
"\n"
|
703 |
+
"If you need more help, click on the \"Help\" tab here."
|
704 |
+
msgstr "Това е! Сега можете да започнете да създавате сайдбарс и да ги показвате при Вашите условия.\n\nАко имате нужда от повече помощ, кликнете върху таба \"Помощ\" тук."
|
705 |
+
|
706 |
+
#: ../pointers.php:142
|
707 |
+
msgid "Close"
|
708 |
+
msgstr "Затваряне"
|
709 |
+
|
710 |
+
#: ../pointers.php:143
|
711 |
+
msgid "Next"
|
712 |
+
msgstr "Следващ"
|
lang/content-aware-sidebars-ca.po
CHANGED
@@ -1,712 +1,712 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Jordi Encabo <info@abd-ong.org>, 2015
|
5 |
-
# keystorm <keystorm@gmail.com>, 2014
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Catalan (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ca/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: ca\n"
|
18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Administra i mostra les barres laterals en funció del contingut a mostrar."
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Barres Laterals Intel·ligents"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr ""
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "Preguntes freqüents"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Exposició"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Vista senzilla"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Vista senzilla i Arxius"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Arxius"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Operacions"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Substituir"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Adjuntar"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Manual"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Forçar-ne la substitució"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "Substitueix la barra lateral original, fusiona-les o afegeix-ne una de nova."
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "Barra lateral original"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr ""
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Dalt"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Baix"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Coloca la barra lateral damunt o dessota de la original"
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "Barres laterals"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "Barra lateral"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Nova Barra Lateral"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Afegeix una nova Barra Lateral"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Edita la Barra lateral"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Nova Barra lateral"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Totes les Barres laterals"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Visualitza la Barra lateral"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Cerca Barres laterals"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "No s'ha trobat cap barra lateral"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "No hi ha cap barra lateral a les escombraries"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Mostra la barra lateral a"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Sense contingut. Afegiu al menys un grup condicional per tal que aquesta barra sigui sensible al contingut."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Gestiona'n els ginys"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "Barra lateral actualitzada."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Barra lateral publicada."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Barra lateral desada."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Barra lateral enviada."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Barra lateral programada pel: <strong%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "j/m/Y, a les G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Esborrany de barra lateral desat"
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
msgstr[1] ""
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] ""
|
207 |
-
msgstr[1] ""
|
208 |
-
|
209 |
-
#: ../content-aware-sidebars.php:385
|
210 |
-
#, php-format
|
211 |
-
msgid "%s sidebar permanently deleted."
|
212 |
-
msgid_plural "%s sidebars permanently deleted."
|
213 |
-
msgstr[0] ""
|
214 |
-
msgstr[1] ""
|
215 |
-
|
216 |
-
#: ../content-aware-sidebars.php:386
|
217 |
-
#, php-format
|
218 |
-
msgid "%s sidebar moved to the Trash."
|
219 |
-
msgid_plural "%s sidebars moved to the Trash."
|
220 |
-
msgstr[0] ""
|
221 |
-
msgstr[1] ""
|
222 |
-
|
223 |
-
#: ../content-aware-sidebars.php:387
|
224 |
-
#, php-format
|
225 |
-
msgid "%s sidebar restored from the Trash."
|
226 |
-
msgid_plural "%s sidebars restored from the Trash."
|
227 |
-
msgstr[0] ""
|
228 |
-
msgstr[1] ""
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
-
msgid "Please update Host Sidebar"
|
232 |
-
msgstr "Actualitzeu la barra lateral original"
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:472
|
235 |
-
msgid "Merge position"
|
236 |
-
msgstr "Posició de l'adjunció"
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:473
|
239 |
-
msgid "Widgets"
|
240 |
-
msgstr "Ginys"
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:586
|
243 |
-
msgid "Manage Widgets"
|
244 |
-
msgstr "Gestiona els ginys"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:756
|
247 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
-
msgstr "Aconseguiu la versió Premium de Barres Laterals Intel·ligents"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:772
|
251 |
-
msgid "Options"
|
252 |
-
msgstr "Opcions"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:795
|
255 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
-
msgid "Condition Groups"
|
258 |
-
msgstr "Grups condicionals"
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:796
|
261 |
-
msgid ""
|
262 |
-
"Each created condition group describe some specific content (conditions) "
|
263 |
-
"that the current sidebar should be displayed with."
|
264 |
-
msgstr "Cada grup condicional creat descriu un contingut específic amb el qual l'actual barra lateral s'hauria de mostrar."
|
265 |
-
|
266 |
-
#: ../content-aware-sidebars.php:797
|
267 |
-
msgid ""
|
268 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
-
" groups themselves use logical disjunction. This means that content added to"
|
270 |
-
" a group should be associated, as they are treated as such, and that the "
|
271 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
-
"extremely focused and at the same time distinct conditions."
|
273 |
-
msgstr "El continguts afegits a un grup condicional usen conjuncions lògiques, mentre els grups condicionals usen disjuncions lògiques. Això vol dir que un contingut introduït a un grup quedaran associats, i seran tractats com a tal, però els grups no interferiran entre ells. Per tant és possible tenir més d'una condició concreta per mostrar una barra lateral."
|
274 |
-
|
275 |
-
#: ../content-aware-sidebars.php:800
|
276 |
-
msgid "More Information"
|
277 |
-
msgstr "Més informació"
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
-
msgid "Get Support"
|
281 |
-
msgstr "Suport"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:816
|
284 |
-
msgid ""
|
285 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
-
" of the upcoming Premium Bundle*!"
|
287 |
-
msgstr "Traduïu Barres Laterals Intel·ligents al vostre idioma i convertiu-vos en verificador BETA del futur paquet Premium*."
|
288 |
-
|
289 |
-
#: ../content-aware-sidebars.php:817
|
290 |
-
msgid "Translate Now"
|
291 |
-
msgstr "Vull traduir!"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:818
|
294 |
-
msgid "Get Premium Bundle"
|
295 |
-
msgstr "Vull obtenir el paquet Premium"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:819
|
298 |
-
msgid ""
|
299 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
-
msgstr "Us en un sol web. BETA significa que no es recomana el seu ús en entorns de producció."
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:822
|
303 |
-
msgid "Partial Feature List"
|
304 |
-
msgstr "Llista parcial de característiques"
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:824
|
307 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
-
msgstr "Selecció i creació de barres laterals a l'editor d'Entrades i Pàgines"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:825
|
311 |
-
msgid "Display sidebars with URLs using wildcards"
|
312 |
-
msgstr "Mostra barres en funció de la URL."
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:826
|
315 |
-
msgid "Display sidebars with User Roles"
|
316 |
-
msgstr "Mostra barres en funció del nivell d'usuari"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:827
|
319 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
-
msgstr "Mostra barres laterals per a grups de BuddyPress"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:828
|
323 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
-
msgstr "Columna de barres laterals a les vistes de Post Types i Taxonomies de tercers."
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
-
msgid "Order"
|
328 |
-
msgstr "Ordre"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:880
|
331 |
-
msgid "Give a review on WordPress.org"
|
332 |
-
msgstr ""
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
-
msgid "Translate the plugin into your language"
|
336 |
-
msgstr "Trauir-la a la vostra llengua"
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:884
|
339 |
-
msgid "Read the FAQ"
|
340 |
-
msgstr ""
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:899
|
343 |
-
msgid ""
|
344 |
-
"If you love this plugin, please consider donating to support future "
|
345 |
-
"development."
|
346 |
-
msgstr "Si us agrada aquesta extensió, feu una donació per recolzar el seu desenvolupament. "
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:908
|
349 |
-
msgid "Or you could:"
|
350 |
-
msgstr "O bé podeu:"
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:910
|
353 |
-
msgid "Rate the plugin on WordPress.org"
|
354 |
-
msgstr "Valorar-la a Wordpress.org"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:911
|
357 |
-
msgid "Link to the plugin page"
|
358 |
-
msgstr "Enllaç a la pàgina de l'extensió"
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:1045
|
361 |
-
msgid "Filter Sidebars"
|
362 |
-
msgstr ""
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1046
|
365 |
-
msgid "Filter Widgets"
|
366 |
-
msgstr ""
|
367 |
-
|
368 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
-
msgid "Condition Group"
|
370 |
-
msgstr "Grup condicional"
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
-
msgctxt "group"
|
374 |
-
msgid "Add New"
|
375 |
-
msgstr "Nou grup"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
-
msgid "Add New Group"
|
381 |
-
msgstr "Afegeix un nou grup"
|
382 |
-
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
-
msgctxt "group"
|
387 |
-
msgid "Edit"
|
388 |
-
msgstr "Edita"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
-
msgid "No Groups found"
|
393 |
-
msgstr ""
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
-
msgctxt "condition group"
|
397 |
-
msgid "Negated"
|
398 |
-
msgstr ""
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
-
msgid "Content"
|
402 |
-
msgstr "Contingut"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
-
msgid "Unauthorized request"
|
408 |
-
msgstr "Sol·licitud no autoritzada"
|
409 |
-
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
-
msgid "Condition group cannot be empty"
|
412 |
-
msgstr "El grup condicional no pot estar buit."
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
-
msgid "Condition group saved"
|
416 |
-
msgstr "Grup condicional desat!"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
-
msgid "Condition group could not be removed"
|
420 |
-
msgstr "El grup condicional no s'ha pogut eliminar"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
-
msgid "Condition group removed"
|
424 |
-
msgstr "Grup condicional eliminat"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Save"
|
429 |
-
msgstr "Desa"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Cancel"
|
434 |
-
msgstr "Cancel·la"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
-
msgid "Or"
|
439 |
-
msgstr "O bé"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
-
msgid "And"
|
446 |
-
msgstr ""
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
-
msgid "Remove"
|
451 |
-
msgstr "Elimina"
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
-
msgid "Remove this group and its contents permanently?"
|
455 |
-
msgstr "Elimina aquest grup i els continguts associats permanentment?"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
-
msgid "No results found."
|
459 |
-
msgstr "No s'ha trobat cap resultat"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
-
msgid ""
|
463 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
-
"these changes?"
|
465 |
-
msgstr "El grup actual té canvis no desats. Voleu continuar descartant aquests canvis?"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
-
msgid "Negate group"
|
470 |
-
msgstr ""
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target all but this context"
|
475 |
-
msgstr ""
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target this context"
|
480 |
-
msgstr ""
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
-
msgid "Authors"
|
484 |
-
msgstr "Autors"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
-
#, php-format
|
488 |
-
msgid "Display with All %s"
|
489 |
-
msgstr "Mostra amb qualsevol %s"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
-
msgid "View All"
|
496 |
-
msgstr "Mostra tots"
|
497 |
-
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
-
msgid "Search"
|
505 |
-
msgstr "Cerca"
|
506 |
-
|
507 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
-
msgid "bbPress User Profiles"
|
509 |
-
msgstr "Perfils d'usuari bbPress"
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
-
msgid "BuddyPress Members"
|
513 |
-
msgstr "Membres de BuddyPress"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
-
msgid "Add to Group"
|
519 |
-
msgstr "Afegeix al grup"
|
520 |
-
|
521 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
-
msgid "Dates"
|
523 |
-
msgstr "Cronologia"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
-
msgid "Date Archives"
|
527 |
-
msgstr "Arxius cronològics"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
-
msgid "Page Templates"
|
531 |
-
msgstr "Plantilla de pàgina"
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
-
msgid "Languages"
|
538 |
-
msgstr "Idioma"
|
539 |
-
|
540 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
-
msgid "Post Types"
|
542 |
-
msgstr "Tipus d'entrada"
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
-
msgid "Automatically select new children of a selected ancestor"
|
548 |
-
msgstr "Selecciona automàticament els nous descendents dels pares seleccionats."
|
549 |
-
|
550 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
-
msgid "Automatically add new children of a selected ancestor"
|
552 |
-
msgstr ""
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
-
#, php-format
|
556 |
-
msgid "%s Archives"
|
557 |
-
msgstr ""
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
-
msgid "Blog Page"
|
561 |
-
msgstr ""
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
-
msgid "No items."
|
566 |
-
msgstr "Cap element."
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
-
msgid "Most Recent"
|
570 |
-
msgstr "Més recents"
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
-
msgid "Static Pages"
|
574 |
-
msgstr "Pàgina estàtica"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
-
msgid "Front Page"
|
578 |
-
msgstr "Pàgina inicial"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
-
msgid "Search Results"
|
582 |
-
msgstr "Resultats de cerca"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
-
msgid "404 Page"
|
586 |
-
msgstr "Pàgina 404"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
-
msgid "Taxonomies"
|
590 |
-
msgstr "Taxonomia"
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
-
msgid "Most Used"
|
594 |
-
msgstr "Més utilitzats"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
-
msgid "Conditional Content"
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
-
msgid ""
|
602 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
-
" it. In each group, you can combine different types of associated content."
|
604 |
-
msgstr "Editeu un grup o creeu-ne un de nou. Seleccioneu el contingut a l'esquerra per afegir-lo. En cada grup, podeu combinar diferents tipus de contingut associat."
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
-
#, php-format
|
608 |
-
msgid "All %s"
|
609 |
-
msgstr "Qualsevol %s"
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
-
msgid "Password protected"
|
613 |
-
msgstr ""
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
-
msgid "Private"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
-
msgid "Draft"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#. translators: post state
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
-
msgctxt "post state"
|
626 |
-
msgid "Pending"
|
627 |
-
msgstr ""
|
628 |
-
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
-
msgid "Sticky"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
-
msgid "Scheduled"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../pointers.php:68
|
638 |
-
msgid "Get started"
|
639 |
-
msgstr ""
|
640 |
-
|
641 |
-
#: ../pointers.php:69
|
642 |
-
msgid ""
|
643 |
-
"You've just installed Content Aware Sidebars!\n"
|
644 |
-
"\n"
|
645 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
-
"\n"
|
647 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
-
msgstr ""
|
649 |
-
|
650 |
-
#: ../pointers.php:76
|
651 |
-
msgid "Start Tour"
|
652 |
-
msgstr ""
|
653 |
-
|
654 |
-
#: ../pointers.php:78
|
655 |
-
msgid "Not now"
|
656 |
-
msgstr ""
|
657 |
-
|
658 |
-
#: ../pointers.php:83
|
659 |
-
msgid ""
|
660 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
-
"\n"
|
662 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
-
"\n"
|
664 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
-
msgstr ""
|
666 |
-
|
667 |
-
#: ../pointers.php:92
|
668 |
-
msgid "Content and contexts"
|
669 |
-
msgstr ""
|
670 |
-
|
671 |
-
#: ../pointers.php:93
|
672 |
-
msgid ""
|
673 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
-
"\n"
|
675 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
-
"\n"
|
677 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
-
msgstr ""
|
679 |
-
|
680 |
-
#: ../pointers.php:102
|
681 |
-
msgid "Options, options"
|
682 |
-
msgstr ""
|
683 |
-
|
684 |
-
#: ../pointers.php:103
|
685 |
-
msgid ""
|
686 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
-
"\n"
|
688 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
-
"\n"
|
690 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
-
"\n"
|
692 |
-
" You are in control."
|
693 |
-
msgstr ""
|
694 |
-
|
695 |
-
#: ../pointers.php:112
|
696 |
-
msgid "Help and Support"
|
697 |
-
msgstr ""
|
698 |
-
|
699 |
-
#: ../pointers.php:113
|
700 |
-
msgid ""
|
701 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
-
"\n"
|
703 |
-
"If you need more help, click on the \"Help\" tab here."
|
704 |
-
msgstr ""
|
705 |
-
|
706 |
-
#: ../pointers.php:142
|
707 |
-
msgid "Close"
|
708 |
-
msgstr ""
|
709 |
-
|
710 |
-
#: ../pointers.php:143
|
711 |
-
msgid "Next"
|
712 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Jordi Encabo <info@abd-ong.org>, 2015
|
5 |
+
# keystorm <keystorm@gmail.com>, 2014
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Catalan (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ca/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: ca\n"
|
18 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Administra i mostra les barres laterals en funció del contingut a mostrar."
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Barres Laterals Intel·ligents"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr ""
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "Preguntes freqüents"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Exposició"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Vista senzilla"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Vista senzilla i Arxius"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Arxius"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Operacions"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Substituir"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Adjuntar"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Manual"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Forçar-ne la substitució"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "Substitueix la barra lateral original, fusiona-les o afegeix-ne una de nova."
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "Barra lateral original"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr ""
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Dalt"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Baix"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Coloca la barra lateral damunt o dessota de la original"
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "Barres laterals"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "Barra lateral"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Nova Barra Lateral"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Afegeix una nova Barra Lateral"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Edita la Barra lateral"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Nova Barra lateral"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Totes les Barres laterals"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Visualitza la Barra lateral"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Cerca Barres laterals"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "No s'ha trobat cap barra lateral"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "No hi ha cap barra lateral a les escombraries"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Mostra la barra lateral a"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Sense contingut. Afegiu al menys un grup condicional per tal que aquesta barra sigui sensible al contingut."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Gestiona'n els ginys"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "Barra lateral actualitzada."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Barra lateral publicada."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Barra lateral desada."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Barra lateral enviada."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Barra lateral programada pel: <strong%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "j/m/Y, a les G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Esborrany de barra lateral desat"
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
msgstr[1] ""
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] ""
|
207 |
+
msgstr[1] ""
|
208 |
+
|
209 |
+
#: ../content-aware-sidebars.php:385
|
210 |
+
#, php-format
|
211 |
+
msgid "%s sidebar permanently deleted."
|
212 |
+
msgid_plural "%s sidebars permanently deleted."
|
213 |
+
msgstr[0] ""
|
214 |
+
msgstr[1] ""
|
215 |
+
|
216 |
+
#: ../content-aware-sidebars.php:386
|
217 |
+
#, php-format
|
218 |
+
msgid "%s sidebar moved to the Trash."
|
219 |
+
msgid_plural "%s sidebars moved to the Trash."
|
220 |
+
msgstr[0] ""
|
221 |
+
msgstr[1] ""
|
222 |
+
|
223 |
+
#: ../content-aware-sidebars.php:387
|
224 |
+
#, php-format
|
225 |
+
msgid "%s sidebar restored from the Trash."
|
226 |
+
msgid_plural "%s sidebars restored from the Trash."
|
227 |
+
msgstr[0] ""
|
228 |
+
msgstr[1] ""
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
+
msgid "Please update Host Sidebar"
|
232 |
+
msgstr "Actualitzeu la barra lateral original"
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:472
|
235 |
+
msgid "Merge position"
|
236 |
+
msgstr "Posició de l'adjunció"
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:473
|
239 |
+
msgid "Widgets"
|
240 |
+
msgstr "Ginys"
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:586
|
243 |
+
msgid "Manage Widgets"
|
244 |
+
msgstr "Gestiona els ginys"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:756
|
247 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
+
msgstr "Aconseguiu la versió Premium de Barres Laterals Intel·ligents"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:772
|
251 |
+
msgid "Options"
|
252 |
+
msgstr "Opcions"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:795
|
255 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
+
msgid "Condition Groups"
|
258 |
+
msgstr "Grups condicionals"
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:796
|
261 |
+
msgid ""
|
262 |
+
"Each created condition group describe some specific content (conditions) "
|
263 |
+
"that the current sidebar should be displayed with."
|
264 |
+
msgstr "Cada grup condicional creat descriu un contingut específic amb el qual l'actual barra lateral s'hauria de mostrar."
|
265 |
+
|
266 |
+
#: ../content-aware-sidebars.php:797
|
267 |
+
msgid ""
|
268 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
+
" groups themselves use logical disjunction. This means that content added to"
|
270 |
+
" a group should be associated, as they are treated as such, and that the "
|
271 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
+
"extremely focused and at the same time distinct conditions."
|
273 |
+
msgstr "El continguts afegits a un grup condicional usen conjuncions lògiques, mentre els grups condicionals usen disjuncions lògiques. Això vol dir que un contingut introduït a un grup quedaran associats, i seran tractats com a tal, però els grups no interferiran entre ells. Per tant és possible tenir més d'una condició concreta per mostrar una barra lateral."
|
274 |
+
|
275 |
+
#: ../content-aware-sidebars.php:800
|
276 |
+
msgid "More Information"
|
277 |
+
msgstr "Més informació"
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
+
msgid "Get Support"
|
281 |
+
msgstr "Suport"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:816
|
284 |
+
msgid ""
|
285 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
+
" of the upcoming Premium Bundle*!"
|
287 |
+
msgstr "Traduïu Barres Laterals Intel·ligents al vostre idioma i convertiu-vos en verificador BETA del futur paquet Premium*."
|
288 |
+
|
289 |
+
#: ../content-aware-sidebars.php:817
|
290 |
+
msgid "Translate Now"
|
291 |
+
msgstr "Vull traduir!"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:818
|
294 |
+
msgid "Get Premium Bundle"
|
295 |
+
msgstr "Vull obtenir el paquet Premium"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:819
|
298 |
+
msgid ""
|
299 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
+
msgstr "Us en un sol web. BETA significa que no es recomana el seu ús en entorns de producció."
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:822
|
303 |
+
msgid "Partial Feature List"
|
304 |
+
msgstr "Llista parcial de característiques"
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:824
|
307 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
+
msgstr "Selecció i creació de barres laterals a l'editor d'Entrades i Pàgines"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:825
|
311 |
+
msgid "Display sidebars with URLs using wildcards"
|
312 |
+
msgstr "Mostra barres en funció de la URL."
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:826
|
315 |
+
msgid "Display sidebars with User Roles"
|
316 |
+
msgstr "Mostra barres en funció del nivell d'usuari"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:827
|
319 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
+
msgstr "Mostra barres laterals per a grups de BuddyPress"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:828
|
323 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
+
msgstr "Columna de barres laterals a les vistes de Post Types i Taxonomies de tercers."
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
+
msgid "Order"
|
328 |
+
msgstr "Ordre"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:880
|
331 |
+
msgid "Give a review on WordPress.org"
|
332 |
+
msgstr ""
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
+
msgid "Translate the plugin into your language"
|
336 |
+
msgstr "Trauir-la a la vostra llengua"
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:884
|
339 |
+
msgid "Read the FAQ"
|
340 |
+
msgstr ""
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:899
|
343 |
+
msgid ""
|
344 |
+
"If you love this plugin, please consider donating to support future "
|
345 |
+
"development."
|
346 |
+
msgstr "Si us agrada aquesta extensió, feu una donació per recolzar el seu desenvolupament. "
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:908
|
349 |
+
msgid "Or you could:"
|
350 |
+
msgstr "O bé podeu:"
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:910
|
353 |
+
msgid "Rate the plugin on WordPress.org"
|
354 |
+
msgstr "Valorar-la a Wordpress.org"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:911
|
357 |
+
msgid "Link to the plugin page"
|
358 |
+
msgstr "Enllaç a la pàgina de l'extensió"
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:1045
|
361 |
+
msgid "Filter Sidebars"
|
362 |
+
msgstr ""
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1046
|
365 |
+
msgid "Filter Widgets"
|
366 |
+
msgstr ""
|
367 |
+
|
368 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
+
msgid "Condition Group"
|
370 |
+
msgstr "Grup condicional"
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
+
msgctxt "group"
|
374 |
+
msgid "Add New"
|
375 |
+
msgstr "Nou grup"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
+
msgid "Add New Group"
|
381 |
+
msgstr "Afegeix un nou grup"
|
382 |
+
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
+
msgctxt "group"
|
387 |
+
msgid "Edit"
|
388 |
+
msgstr "Edita"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
+
msgid "No Groups found"
|
393 |
+
msgstr ""
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
+
msgctxt "condition group"
|
397 |
+
msgid "Negated"
|
398 |
+
msgstr ""
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
+
msgid "Content"
|
402 |
+
msgstr "Contingut"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
+
msgid "Unauthorized request"
|
408 |
+
msgstr "Sol·licitud no autoritzada"
|
409 |
+
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
+
msgid "Condition group cannot be empty"
|
412 |
+
msgstr "El grup condicional no pot estar buit."
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
+
msgid "Condition group saved"
|
416 |
+
msgstr "Grup condicional desat!"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
+
msgid "Condition group could not be removed"
|
420 |
+
msgstr "El grup condicional no s'ha pogut eliminar"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
+
msgid "Condition group removed"
|
424 |
+
msgstr "Grup condicional eliminat"
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Save"
|
429 |
+
msgstr "Desa"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Cancel"
|
434 |
+
msgstr "Cancel·la"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
+
msgid "Or"
|
439 |
+
msgstr "O bé"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
+
msgid "And"
|
446 |
+
msgstr ""
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
+
msgid "Remove"
|
451 |
+
msgstr "Elimina"
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
+
msgid "Remove this group and its contents permanently?"
|
455 |
+
msgstr "Elimina aquest grup i els continguts associats permanentment?"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
+
msgid "No results found."
|
459 |
+
msgstr "No s'ha trobat cap resultat"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
+
msgid ""
|
463 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
+
"these changes?"
|
465 |
+
msgstr "El grup actual té canvis no desats. Voleu continuar descartant aquests canvis?"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
+
msgid "Negate group"
|
470 |
+
msgstr ""
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target all but this context"
|
475 |
+
msgstr ""
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target this context"
|
480 |
+
msgstr ""
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
+
msgid "Authors"
|
484 |
+
msgstr "Autors"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
+
#, php-format
|
488 |
+
msgid "Display with All %s"
|
489 |
+
msgstr "Mostra amb qualsevol %s"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
+
msgid "View All"
|
496 |
+
msgstr "Mostra tots"
|
497 |
+
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
+
msgid "Search"
|
505 |
+
msgstr "Cerca"
|
506 |
+
|
507 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
+
msgid "bbPress User Profiles"
|
509 |
+
msgstr "Perfils d'usuari bbPress"
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
+
msgid "BuddyPress Members"
|
513 |
+
msgstr "Membres de BuddyPress"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
+
msgid "Add to Group"
|
519 |
+
msgstr "Afegeix al grup"
|
520 |
+
|
521 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
+
msgid "Dates"
|
523 |
+
msgstr "Cronologia"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
+
msgid "Date Archives"
|
527 |
+
msgstr "Arxius cronològics"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
+
msgid "Page Templates"
|
531 |
+
msgstr "Plantilla de pàgina"
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
+
msgid "Languages"
|
538 |
+
msgstr "Idioma"
|
539 |
+
|
540 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
+
msgid "Post Types"
|
542 |
+
msgstr "Tipus d'entrada"
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
+
msgid "Automatically select new children of a selected ancestor"
|
548 |
+
msgstr "Selecciona automàticament els nous descendents dels pares seleccionats."
|
549 |
+
|
550 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
+
msgid "Automatically add new children of a selected ancestor"
|
552 |
+
msgstr ""
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
+
#, php-format
|
556 |
+
msgid "%s Archives"
|
557 |
+
msgstr ""
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
+
msgid "Blog Page"
|
561 |
+
msgstr ""
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
+
msgid "No items."
|
566 |
+
msgstr "Cap element."
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
+
msgid "Most Recent"
|
570 |
+
msgstr "Més recents"
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
+
msgid "Static Pages"
|
574 |
+
msgstr "Pàgina estàtica"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
+
msgid "Front Page"
|
578 |
+
msgstr "Pàgina inicial"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
+
msgid "Search Results"
|
582 |
+
msgstr "Resultats de cerca"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
+
msgid "404 Page"
|
586 |
+
msgstr "Pàgina 404"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
+
msgid "Taxonomies"
|
590 |
+
msgstr "Taxonomia"
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
+
msgid "Most Used"
|
594 |
+
msgstr "Més utilitzats"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
+
msgid "Conditional Content"
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
+
msgid ""
|
602 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
+
" it. In each group, you can combine different types of associated content."
|
604 |
+
msgstr "Editeu un grup o creeu-ne un de nou. Seleccioneu el contingut a l'esquerra per afegir-lo. En cada grup, podeu combinar diferents tipus de contingut associat."
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
+
#, php-format
|
608 |
+
msgid "All %s"
|
609 |
+
msgstr "Qualsevol %s"
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
+
msgid "Password protected"
|
613 |
+
msgstr ""
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
+
msgid "Private"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
+
msgid "Draft"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#. translators: post state
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
+
msgctxt "post state"
|
626 |
+
msgid "Pending"
|
627 |
+
msgstr ""
|
628 |
+
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
+
msgid "Sticky"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
+
msgid "Scheduled"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../pointers.php:68
|
638 |
+
msgid "Get started"
|
639 |
+
msgstr ""
|
640 |
+
|
641 |
+
#: ../pointers.php:69
|
642 |
+
msgid ""
|
643 |
+
"You've just installed Content Aware Sidebars!\n"
|
644 |
+
"\n"
|
645 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
+
"\n"
|
647 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
+
msgstr ""
|
649 |
+
|
650 |
+
#: ../pointers.php:76
|
651 |
+
msgid "Start Tour"
|
652 |
+
msgstr ""
|
653 |
+
|
654 |
+
#: ../pointers.php:78
|
655 |
+
msgid "Not now"
|
656 |
+
msgstr ""
|
657 |
+
|
658 |
+
#: ../pointers.php:83
|
659 |
+
msgid ""
|
660 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
+
"\n"
|
662 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
+
"\n"
|
664 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
+
msgstr ""
|
666 |
+
|
667 |
+
#: ../pointers.php:92
|
668 |
+
msgid "Content and contexts"
|
669 |
+
msgstr ""
|
670 |
+
|
671 |
+
#: ../pointers.php:93
|
672 |
+
msgid ""
|
673 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
+
"\n"
|
675 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
+
"\n"
|
677 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
+
msgstr ""
|
679 |
+
|
680 |
+
#: ../pointers.php:102
|
681 |
+
msgid "Options, options"
|
682 |
+
msgstr ""
|
683 |
+
|
684 |
+
#: ../pointers.php:103
|
685 |
+
msgid ""
|
686 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
+
"\n"
|
688 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
+
"\n"
|
690 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
+
"\n"
|
692 |
+
" You are in control."
|
693 |
+
msgstr ""
|
694 |
+
|
695 |
+
#: ../pointers.php:112
|
696 |
+
msgid "Help and Support"
|
697 |
+
msgstr ""
|
698 |
+
|
699 |
+
#: ../pointers.php:113
|
700 |
+
msgid ""
|
701 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
+
"\n"
|
703 |
+
"If you need more help, click on the \"Help\" tab here."
|
704 |
+
msgstr ""
|
705 |
+
|
706 |
+
#: ../pointers.php:142
|
707 |
+
msgid "Close"
|
708 |
+
msgstr ""
|
709 |
+
|
710 |
+
#: ../pointers.php:143
|
711 |
+
msgid "Next"
|
712 |
+
msgstr ""
|
lang/content-aware-sidebars-cs_CZ.po
CHANGED
@@ -1,716 +1,716 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Blanka Salkova <blanka@salkova.com>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Czech (Czech Republic) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/cs_CZ/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: cs_CZ\n"
|
17 |
-
"Plural-Forms: nplurals=3; plural=(n==1) ? 0 : (n>=2 && n<=4) ? 1 : 2;\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr "Spravujte a podle vlastních požadavků na základě prohlíženého obsahu zobrazujte nebo skrývejte postranní panely."
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr "Content Aware Sidebars"
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "Importovat"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "Nejčastější dotazy"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr ""
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr ""
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr ""
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Archiv"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr ""
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Nahradit"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Sloučit"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Ruční"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Vynucené nahrazení"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr ""
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr ""
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Nahoře"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Dole"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr ""
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Postranní panely"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Postranní panel"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Přidat nový"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Přidat nový postranní panel"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Upravit postranní panel"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Nový postranní panel"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Všechny postranní panely"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Zobrazit postranní panel"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr ""
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr ""
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr ""
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr ""
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr ""
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr ""
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr ""
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr ""
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr ""
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr ""
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr ""
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr ""
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
msgstr[2] ""
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] ""
|
207 |
-
msgstr[1] ""
|
208 |
-
msgstr[2] ""
|
209 |
-
|
210 |
-
#: ../content-aware-sidebars.php:385
|
211 |
-
#, php-format
|
212 |
-
msgid "%s sidebar permanently deleted."
|
213 |
-
msgid_plural "%s sidebars permanently deleted."
|
214 |
-
msgstr[0] ""
|
215 |
-
msgstr[1] ""
|
216 |
-
msgstr[2] ""
|
217 |
-
|
218 |
-
#: ../content-aware-sidebars.php:386
|
219 |
-
#, php-format
|
220 |
-
msgid "%s sidebar moved to the Trash."
|
221 |
-
msgid_plural "%s sidebars moved to the Trash."
|
222 |
-
msgstr[0] ""
|
223 |
-
msgstr[1] ""
|
224 |
-
msgstr[2] ""
|
225 |
-
|
226 |
-
#: ../content-aware-sidebars.php:387
|
227 |
-
#, php-format
|
228 |
-
msgid "%s sidebar restored from the Trash."
|
229 |
-
msgid_plural "%s sidebars restored from the Trash."
|
230 |
-
msgstr[0] ""
|
231 |
-
msgstr[1] ""
|
232 |
-
msgstr[2] ""
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
235 |
-
msgid "Please update Host Sidebar"
|
236 |
-
msgstr ""
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:472
|
239 |
-
msgid "Merge position"
|
240 |
-
msgstr ""
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:473
|
243 |
-
msgid "Widgets"
|
244 |
-
msgstr ""
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:586
|
247 |
-
msgid "Manage Widgets"
|
248 |
-
msgstr ""
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:756
|
251 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
252 |
-
msgstr ""
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:772
|
255 |
-
msgid "Options"
|
256 |
-
msgstr ""
|
257 |
-
|
258 |
-
#: ../content-aware-sidebars.php:795
|
259 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
260 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
261 |
-
msgid "Condition Groups"
|
262 |
-
msgstr ""
|
263 |
-
|
264 |
-
#: ../content-aware-sidebars.php:796
|
265 |
-
msgid ""
|
266 |
-
"Each created condition group describe some specific content (conditions) "
|
267 |
-
"that the current sidebar should be displayed with."
|
268 |
-
msgstr ""
|
269 |
-
|
270 |
-
#: ../content-aware-sidebars.php:797
|
271 |
-
msgid ""
|
272 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
273 |
-
" groups themselves use logical disjunction. This means that content added to"
|
274 |
-
" a group should be associated, as they are treated as such, and that the "
|
275 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
276 |
-
"extremely focused and at the same time distinct conditions."
|
277 |
-
msgstr ""
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:800
|
280 |
-
msgid "More Information"
|
281 |
-
msgstr ""
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
284 |
-
msgid "Get Support"
|
285 |
-
msgstr ""
|
286 |
-
|
287 |
-
#: ../content-aware-sidebars.php:816
|
288 |
-
msgid ""
|
289 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
290 |
-
" of the upcoming Premium Bundle*!"
|
291 |
-
msgstr ""
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:817
|
294 |
-
msgid "Translate Now"
|
295 |
-
msgstr ""
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:818
|
298 |
-
msgid "Get Premium Bundle"
|
299 |
-
msgstr ""
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:819
|
302 |
-
msgid ""
|
303 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
304 |
-
msgstr ""
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:822
|
307 |
-
msgid "Partial Feature List"
|
308 |
-
msgstr ""
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:824
|
311 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
312 |
-
msgstr ""
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:825
|
315 |
-
msgid "Display sidebars with URLs using wildcards"
|
316 |
-
msgstr ""
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:826
|
319 |
-
msgid "Display sidebars with User Roles"
|
320 |
-
msgstr ""
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:827
|
323 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
324 |
-
msgstr ""
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:828
|
327 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
328 |
-
msgstr ""
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
331 |
-
msgid "Order"
|
332 |
-
msgstr ""
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:880
|
335 |
-
msgid "Give a review on WordPress.org"
|
336 |
-
msgstr ""
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
339 |
-
msgid "Translate the plugin into your language"
|
340 |
-
msgstr ""
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:884
|
343 |
-
msgid "Read the FAQ"
|
344 |
-
msgstr ""
|
345 |
-
|
346 |
-
#: ../content-aware-sidebars.php:899
|
347 |
-
msgid ""
|
348 |
-
"If you love this plugin, please consider donating to support future "
|
349 |
-
"development."
|
350 |
-
msgstr ""
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:908
|
353 |
-
msgid "Or you could:"
|
354 |
-
msgstr ""
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:910
|
357 |
-
msgid "Rate the plugin on WordPress.org"
|
358 |
-
msgstr ""
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:911
|
361 |
-
msgid "Link to the plugin page"
|
362 |
-
msgstr ""
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1045
|
365 |
-
msgid "Filter Sidebars"
|
366 |
-
msgstr ""
|
367 |
-
|
368 |
-
#: ../content-aware-sidebars.php:1046
|
369 |
-
msgid "Filter Widgets"
|
370 |
-
msgstr ""
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
373 |
-
msgid "Condition Group"
|
374 |
-
msgstr ""
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
377 |
-
msgctxt "group"
|
378 |
-
msgid "Add New"
|
379 |
-
msgstr "Přidat nový"
|
380 |
-
|
381 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
382 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
383 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
384 |
-
msgid "Add New Group"
|
385 |
-
msgstr ""
|
386 |
-
|
387 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
388 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
389 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
390 |
-
msgctxt "group"
|
391 |
-
msgid "Edit"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
396 |
-
msgid "No Groups found"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
400 |
-
msgctxt "condition group"
|
401 |
-
msgid "Negated"
|
402 |
-
msgstr ""
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
405 |
-
msgid "Content"
|
406 |
-
msgstr ""
|
407 |
-
|
408 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
411 |
-
msgid "Unauthorized request"
|
412 |
-
msgstr ""
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
415 |
-
msgid "Condition group cannot be empty"
|
416 |
-
msgstr ""
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
419 |
-
msgid "Condition group saved"
|
420 |
-
msgstr ""
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
423 |
-
msgid "Condition group could not be removed"
|
424 |
-
msgstr ""
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
427 |
-
msgid "Condition group removed"
|
428 |
-
msgstr ""
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Save"
|
433 |
-
msgstr ""
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
437 |
-
msgid "Cancel"
|
438 |
-
msgstr ""
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
441 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
442 |
-
msgid "Or"
|
443 |
-
msgstr ""
|
444 |
-
|
445 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
446 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
447 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
448 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
449 |
-
msgid "And"
|
450 |
-
msgstr ""
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
453 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
454 |
-
msgid "Remove"
|
455 |
-
msgstr ""
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
458 |
-
msgid "Remove this group and its contents permanently?"
|
459 |
-
msgstr ""
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
462 |
-
msgid "No results found."
|
463 |
-
msgstr ""
|
464 |
-
|
465 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
466 |
-
msgid ""
|
467 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
468 |
-
"these changes?"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
473 |
-
msgid "Negate group"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target all but this context"
|
479 |
-
msgstr ""
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
482 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
483 |
-
msgid "Target this context"
|
484 |
-
msgstr ""
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
487 |
-
msgid "Authors"
|
488 |
-
msgstr ""
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
491 |
-
#, php-format
|
492 |
-
msgid "Display with All %s"
|
493 |
-
msgstr ""
|
494 |
-
|
495 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
496 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
497 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
498 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
499 |
-
msgid "View All"
|
500 |
-
msgstr ""
|
501 |
-
|
502 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
503 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
504 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
505 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
506 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
507 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
508 |
-
msgid "Search"
|
509 |
-
msgstr ""
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
512 |
-
msgid "bbPress User Profiles"
|
513 |
-
msgstr ""
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
516 |
-
msgid "BuddyPress Members"
|
517 |
-
msgstr ""
|
518 |
-
|
519 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
520 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
521 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
522 |
-
msgid "Add to Group"
|
523 |
-
msgstr ""
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
526 |
-
msgid "Dates"
|
527 |
-
msgstr ""
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
530 |
-
msgid "Date Archives"
|
531 |
-
msgstr ""
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
534 |
-
msgid "Page Templates"
|
535 |
-
msgstr ""
|
536 |
-
|
537 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
538 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
539 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
540 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
541 |
-
msgid "Languages"
|
542 |
-
msgstr ""
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
545 |
-
msgid "Post Types"
|
546 |
-
msgstr ""
|
547 |
-
|
548 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
549 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
550 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
551 |
-
msgid "Automatically select new children of a selected ancestor"
|
552 |
-
msgstr ""
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
555 |
-
msgid "Automatically add new children of a selected ancestor"
|
556 |
-
msgstr ""
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
559 |
-
#, php-format
|
560 |
-
msgid "%s Archives"
|
561 |
-
msgstr ""
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
564 |
-
msgid "Blog Page"
|
565 |
-
msgstr ""
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
568 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
569 |
-
msgid "No items."
|
570 |
-
msgstr ""
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
573 |
-
msgid "Most Recent"
|
574 |
-
msgstr ""
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
577 |
-
msgid "Static Pages"
|
578 |
-
msgstr ""
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
581 |
-
msgid "Front Page"
|
582 |
-
msgstr ""
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
585 |
-
msgid "Search Results"
|
586 |
-
msgstr ""
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
589 |
-
msgid "404 Page"
|
590 |
-
msgstr ""
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
593 |
-
msgid "Taxonomies"
|
594 |
-
msgstr ""
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
597 |
-
msgid "Most Used"
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
601 |
-
msgid "Conditional Content"
|
602 |
-
msgstr ""
|
603 |
-
|
604 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
605 |
-
msgid ""
|
606 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
607 |
-
" it. In each group, you can combine different types of associated content."
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
611 |
-
#, php-format
|
612 |
-
msgid "All %s"
|
613 |
-
msgstr ""
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
616 |
-
msgid "Password protected"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
620 |
-
msgid "Private"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
624 |
-
msgid "Draft"
|
625 |
-
msgstr ""
|
626 |
-
|
627 |
-
#. translators: post state
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
629 |
-
msgctxt "post state"
|
630 |
-
msgid "Pending"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
634 |
-
msgid "Sticky"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
638 |
-
msgid "Scheduled"
|
639 |
-
msgstr ""
|
640 |
-
|
641 |
-
#: ../pointers.php:68
|
642 |
-
msgid "Get started"
|
643 |
-
msgstr ""
|
644 |
-
|
645 |
-
#: ../pointers.php:69
|
646 |
-
msgid ""
|
647 |
-
"You've just installed Content Aware Sidebars!\n"
|
648 |
-
"\n"
|
649 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
650 |
-
"\n"
|
651 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
652 |
-
msgstr ""
|
653 |
-
|
654 |
-
#: ../pointers.php:76
|
655 |
-
msgid "Start Tour"
|
656 |
-
msgstr ""
|
657 |
-
|
658 |
-
#: ../pointers.php:78
|
659 |
-
msgid "Not now"
|
660 |
-
msgstr ""
|
661 |
-
|
662 |
-
#: ../pointers.php:83
|
663 |
-
msgid ""
|
664 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
665 |
-
"\n"
|
666 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
667 |
-
"\n"
|
668 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
669 |
-
msgstr ""
|
670 |
-
|
671 |
-
#: ../pointers.php:92
|
672 |
-
msgid "Content and contexts"
|
673 |
-
msgstr ""
|
674 |
-
|
675 |
-
#: ../pointers.php:93
|
676 |
-
msgid ""
|
677 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
678 |
-
"\n"
|
679 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
680 |
-
"\n"
|
681 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
682 |
-
msgstr ""
|
683 |
-
|
684 |
-
#: ../pointers.php:102
|
685 |
-
msgid "Options, options"
|
686 |
-
msgstr ""
|
687 |
-
|
688 |
-
#: ../pointers.php:103
|
689 |
-
msgid ""
|
690 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
691 |
-
"\n"
|
692 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
693 |
-
"\n"
|
694 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
695 |
-
"\n"
|
696 |
-
" You are in control."
|
697 |
-
msgstr ""
|
698 |
-
|
699 |
-
#: ../pointers.php:112
|
700 |
-
msgid "Help and Support"
|
701 |
-
msgstr ""
|
702 |
-
|
703 |
-
#: ../pointers.php:113
|
704 |
-
msgid ""
|
705 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
706 |
-
"\n"
|
707 |
-
"If you need more help, click on the \"Help\" tab here."
|
708 |
-
msgstr ""
|
709 |
-
|
710 |
-
#: ../pointers.php:142
|
711 |
-
msgid "Close"
|
712 |
-
msgstr ""
|
713 |
-
|
714 |
-
#: ../pointers.php:143
|
715 |
-
msgid "Next"
|
716 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Blanka Salkova <blanka@salkova.com>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Czech (Czech Republic) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/cs_CZ/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: cs_CZ\n"
|
17 |
+
"Plural-Forms: nplurals=3; plural=(n==1) ? 0 : (n>=2 && n<=4) ? 1 : 2;\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr "Spravujte a podle vlastních požadavků na základě prohlíženého obsahu zobrazujte nebo skrývejte postranní panely."
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr "Content Aware Sidebars"
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "Importovat"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "Nejčastější dotazy"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr ""
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr ""
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr ""
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Archiv"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr ""
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Nahradit"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Sloučit"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Ruční"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Vynucené nahrazení"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr ""
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr ""
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Nahoře"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Dole"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr ""
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Postranní panely"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Postranní panel"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Přidat nový"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Přidat nový postranní panel"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Upravit postranní panel"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Nový postranní panel"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Všechny postranní panely"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Zobrazit postranní panel"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr ""
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr ""
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr ""
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr ""
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr ""
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr ""
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr ""
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr ""
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr ""
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr ""
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr ""
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr ""
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
msgstr[2] ""
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] ""
|
207 |
+
msgstr[1] ""
|
208 |
+
msgstr[2] ""
|
209 |
+
|
210 |
+
#: ../content-aware-sidebars.php:385
|
211 |
+
#, php-format
|
212 |
+
msgid "%s sidebar permanently deleted."
|
213 |
+
msgid_plural "%s sidebars permanently deleted."
|
214 |
+
msgstr[0] ""
|
215 |
+
msgstr[1] ""
|
216 |
+
msgstr[2] ""
|
217 |
+
|
218 |
+
#: ../content-aware-sidebars.php:386
|
219 |
+
#, php-format
|
220 |
+
msgid "%s sidebar moved to the Trash."
|
221 |
+
msgid_plural "%s sidebars moved to the Trash."
|
222 |
+
msgstr[0] ""
|
223 |
+
msgstr[1] ""
|
224 |
+
msgstr[2] ""
|
225 |
+
|
226 |
+
#: ../content-aware-sidebars.php:387
|
227 |
+
#, php-format
|
228 |
+
msgid "%s sidebar restored from the Trash."
|
229 |
+
msgid_plural "%s sidebars restored from the Trash."
|
230 |
+
msgstr[0] ""
|
231 |
+
msgstr[1] ""
|
232 |
+
msgstr[2] ""
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
235 |
+
msgid "Please update Host Sidebar"
|
236 |
+
msgstr ""
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:472
|
239 |
+
msgid "Merge position"
|
240 |
+
msgstr ""
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:473
|
243 |
+
msgid "Widgets"
|
244 |
+
msgstr ""
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:586
|
247 |
+
msgid "Manage Widgets"
|
248 |
+
msgstr ""
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:756
|
251 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
252 |
+
msgstr ""
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:772
|
255 |
+
msgid "Options"
|
256 |
+
msgstr ""
|
257 |
+
|
258 |
+
#: ../content-aware-sidebars.php:795
|
259 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
260 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
261 |
+
msgid "Condition Groups"
|
262 |
+
msgstr ""
|
263 |
+
|
264 |
+
#: ../content-aware-sidebars.php:796
|
265 |
+
msgid ""
|
266 |
+
"Each created condition group describe some specific content (conditions) "
|
267 |
+
"that the current sidebar should be displayed with."
|
268 |
+
msgstr ""
|
269 |
+
|
270 |
+
#: ../content-aware-sidebars.php:797
|
271 |
+
msgid ""
|
272 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
273 |
+
" groups themselves use logical disjunction. This means that content added to"
|
274 |
+
" a group should be associated, as they are treated as such, and that the "
|
275 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
276 |
+
"extremely focused and at the same time distinct conditions."
|
277 |
+
msgstr ""
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:800
|
280 |
+
msgid "More Information"
|
281 |
+
msgstr ""
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
284 |
+
msgid "Get Support"
|
285 |
+
msgstr ""
|
286 |
+
|
287 |
+
#: ../content-aware-sidebars.php:816
|
288 |
+
msgid ""
|
289 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
290 |
+
" of the upcoming Premium Bundle*!"
|
291 |
+
msgstr ""
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:817
|
294 |
+
msgid "Translate Now"
|
295 |
+
msgstr ""
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:818
|
298 |
+
msgid "Get Premium Bundle"
|
299 |
+
msgstr ""
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:819
|
302 |
+
msgid ""
|
303 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
304 |
+
msgstr ""
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:822
|
307 |
+
msgid "Partial Feature List"
|
308 |
+
msgstr ""
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:824
|
311 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
312 |
+
msgstr ""
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:825
|
315 |
+
msgid "Display sidebars with URLs using wildcards"
|
316 |
+
msgstr ""
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:826
|
319 |
+
msgid "Display sidebars with User Roles"
|
320 |
+
msgstr ""
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:827
|
323 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
324 |
+
msgstr ""
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:828
|
327 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
328 |
+
msgstr ""
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
331 |
+
msgid "Order"
|
332 |
+
msgstr ""
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:880
|
335 |
+
msgid "Give a review on WordPress.org"
|
336 |
+
msgstr ""
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
339 |
+
msgid "Translate the plugin into your language"
|
340 |
+
msgstr ""
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:884
|
343 |
+
msgid "Read the FAQ"
|
344 |
+
msgstr ""
|
345 |
+
|
346 |
+
#: ../content-aware-sidebars.php:899
|
347 |
+
msgid ""
|
348 |
+
"If you love this plugin, please consider donating to support future "
|
349 |
+
"development."
|
350 |
+
msgstr ""
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:908
|
353 |
+
msgid "Or you could:"
|
354 |
+
msgstr ""
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:910
|
357 |
+
msgid "Rate the plugin on WordPress.org"
|
358 |
+
msgstr ""
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:911
|
361 |
+
msgid "Link to the plugin page"
|
362 |
+
msgstr ""
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1045
|
365 |
+
msgid "Filter Sidebars"
|
366 |
+
msgstr ""
|
367 |
+
|
368 |
+
#: ../content-aware-sidebars.php:1046
|
369 |
+
msgid "Filter Widgets"
|
370 |
+
msgstr ""
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
373 |
+
msgid "Condition Group"
|
374 |
+
msgstr ""
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
377 |
+
msgctxt "group"
|
378 |
+
msgid "Add New"
|
379 |
+
msgstr "Přidat nový"
|
380 |
+
|
381 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
382 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
383 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
384 |
+
msgid "Add New Group"
|
385 |
+
msgstr ""
|
386 |
+
|
387 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
388 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
389 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
390 |
+
msgctxt "group"
|
391 |
+
msgid "Edit"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
396 |
+
msgid "No Groups found"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
400 |
+
msgctxt "condition group"
|
401 |
+
msgid "Negated"
|
402 |
+
msgstr ""
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
405 |
+
msgid "Content"
|
406 |
+
msgstr ""
|
407 |
+
|
408 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
411 |
+
msgid "Unauthorized request"
|
412 |
+
msgstr ""
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
415 |
+
msgid "Condition group cannot be empty"
|
416 |
+
msgstr ""
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
419 |
+
msgid "Condition group saved"
|
420 |
+
msgstr ""
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
423 |
+
msgid "Condition group could not be removed"
|
424 |
+
msgstr ""
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
427 |
+
msgid "Condition group removed"
|
428 |
+
msgstr ""
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Save"
|
433 |
+
msgstr ""
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
437 |
+
msgid "Cancel"
|
438 |
+
msgstr ""
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
441 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
442 |
+
msgid "Or"
|
443 |
+
msgstr ""
|
444 |
+
|
445 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
446 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
447 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
448 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
449 |
+
msgid "And"
|
450 |
+
msgstr ""
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
453 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
454 |
+
msgid "Remove"
|
455 |
+
msgstr ""
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
458 |
+
msgid "Remove this group and its contents permanently?"
|
459 |
+
msgstr ""
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
462 |
+
msgid "No results found."
|
463 |
+
msgstr ""
|
464 |
+
|
465 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
466 |
+
msgid ""
|
467 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
468 |
+
"these changes?"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
473 |
+
msgid "Negate group"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target all but this context"
|
479 |
+
msgstr ""
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
482 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
483 |
+
msgid "Target this context"
|
484 |
+
msgstr ""
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
487 |
+
msgid "Authors"
|
488 |
+
msgstr ""
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
491 |
+
#, php-format
|
492 |
+
msgid "Display with All %s"
|
493 |
+
msgstr ""
|
494 |
+
|
495 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
496 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
497 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
498 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
499 |
+
msgid "View All"
|
500 |
+
msgstr ""
|
501 |
+
|
502 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
503 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
504 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
505 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
506 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
507 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
508 |
+
msgid "Search"
|
509 |
+
msgstr ""
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
512 |
+
msgid "bbPress User Profiles"
|
513 |
+
msgstr ""
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
516 |
+
msgid "BuddyPress Members"
|
517 |
+
msgstr ""
|
518 |
+
|
519 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
520 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
521 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
522 |
+
msgid "Add to Group"
|
523 |
+
msgstr ""
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
526 |
+
msgid "Dates"
|
527 |
+
msgstr ""
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
530 |
+
msgid "Date Archives"
|
531 |
+
msgstr ""
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
534 |
+
msgid "Page Templates"
|
535 |
+
msgstr ""
|
536 |
+
|
537 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
538 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
539 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
540 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
541 |
+
msgid "Languages"
|
542 |
+
msgstr ""
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
545 |
+
msgid "Post Types"
|
546 |
+
msgstr ""
|
547 |
+
|
548 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
549 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
550 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
551 |
+
msgid "Automatically select new children of a selected ancestor"
|
552 |
+
msgstr ""
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
555 |
+
msgid "Automatically add new children of a selected ancestor"
|
556 |
+
msgstr ""
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
559 |
+
#, php-format
|
560 |
+
msgid "%s Archives"
|
561 |
+
msgstr ""
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
564 |
+
msgid "Blog Page"
|
565 |
+
msgstr ""
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
568 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
569 |
+
msgid "No items."
|
570 |
+
msgstr ""
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
573 |
+
msgid "Most Recent"
|
574 |
+
msgstr ""
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
577 |
+
msgid "Static Pages"
|
578 |
+
msgstr ""
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
581 |
+
msgid "Front Page"
|
582 |
+
msgstr ""
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
585 |
+
msgid "Search Results"
|
586 |
+
msgstr ""
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
589 |
+
msgid "404 Page"
|
590 |
+
msgstr ""
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
593 |
+
msgid "Taxonomies"
|
594 |
+
msgstr ""
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
597 |
+
msgid "Most Used"
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
601 |
+
msgid "Conditional Content"
|
602 |
+
msgstr ""
|
603 |
+
|
604 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
605 |
+
msgid ""
|
606 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
607 |
+
" it. In each group, you can combine different types of associated content."
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
611 |
+
#, php-format
|
612 |
+
msgid "All %s"
|
613 |
+
msgstr ""
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
616 |
+
msgid "Password protected"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
620 |
+
msgid "Private"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
624 |
+
msgid "Draft"
|
625 |
+
msgstr ""
|
626 |
+
|
627 |
+
#. translators: post state
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
629 |
+
msgctxt "post state"
|
630 |
+
msgid "Pending"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
634 |
+
msgid "Sticky"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
638 |
+
msgid "Scheduled"
|
639 |
+
msgstr ""
|
640 |
+
|
641 |
+
#: ../pointers.php:68
|
642 |
+
msgid "Get started"
|
643 |
+
msgstr ""
|
644 |
+
|
645 |
+
#: ../pointers.php:69
|
646 |
+
msgid ""
|
647 |
+
"You've just installed Content Aware Sidebars!\n"
|
648 |
+
"\n"
|
649 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
650 |
+
"\n"
|
651 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
652 |
+
msgstr ""
|
653 |
+
|
654 |
+
#: ../pointers.php:76
|
655 |
+
msgid "Start Tour"
|
656 |
+
msgstr ""
|
657 |
+
|
658 |
+
#: ../pointers.php:78
|
659 |
+
msgid "Not now"
|
660 |
+
msgstr ""
|
661 |
+
|
662 |
+
#: ../pointers.php:83
|
663 |
+
msgid ""
|
664 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
665 |
+
"\n"
|
666 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
667 |
+
"\n"
|
668 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
669 |
+
msgstr ""
|
670 |
+
|
671 |
+
#: ../pointers.php:92
|
672 |
+
msgid "Content and contexts"
|
673 |
+
msgstr ""
|
674 |
+
|
675 |
+
#: ../pointers.php:93
|
676 |
+
msgid ""
|
677 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
678 |
+
"\n"
|
679 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
680 |
+
"\n"
|
681 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
682 |
+
msgstr ""
|
683 |
+
|
684 |
+
#: ../pointers.php:102
|
685 |
+
msgid "Options, options"
|
686 |
+
msgstr ""
|
687 |
+
|
688 |
+
#: ../pointers.php:103
|
689 |
+
msgid ""
|
690 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
691 |
+
"\n"
|
692 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
693 |
+
"\n"
|
694 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
695 |
+
"\n"
|
696 |
+
" You are in control."
|
697 |
+
msgstr ""
|
698 |
+
|
699 |
+
#: ../pointers.php:112
|
700 |
+
msgid "Help and Support"
|
701 |
+
msgstr ""
|
702 |
+
|
703 |
+
#: ../pointers.php:113
|
704 |
+
msgid ""
|
705 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
706 |
+
"\n"
|
707 |
+
"If you need more help, click on the \"Help\" tab here."
|
708 |
+
msgstr ""
|
709 |
+
|
710 |
+
#: ../pointers.php:142
|
711 |
+
msgid "Close"
|
712 |
+
msgstr ""
|
713 |
+
|
714 |
+
#: ../pointers.php:143
|
715 |
+
msgid "Next"
|
716 |
+
msgstr ""
|
lang/content-aware-sidebars-da_DK.po
CHANGED
@@ -1,712 +1,712 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Joachim Jensen <jv@intox.dk>, 2015
|
5 |
-
# Joachim Jensen <jv@intox.dk>, 2014-2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Danish (Denmark) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/da_DK/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: da_DK\n"
|
18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Administrer og vis sidebars i henhold til det indhold, der vises."
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Content Aware Sidebars"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "Importer"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "FAQ"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Eksponering"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Singulær"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Singulær og arkiv"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Arkiv"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Håndtering"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Erstat"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Flet"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Manuel"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Erstat tvungent"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "Erstat værts-sidebar, flet med den eller tilføj denne sidebar manuelt."
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "Værts-sidebar"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "Fletteposition"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Top"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Bund"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Flet ind fra oven eller bunden."
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "Sidebars"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "Sidebar"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Tilføj ny"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Tilføj ny sidebar"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Rediger sidebar"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Ny sidebar"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Alle sidebars"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Vis sidebar"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Søg sidebars"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "Ingen sidebars fundet"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "Ingen sidebars fundet i papirkurven"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Vis sidebar ved"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Intet indhold. Tilføj mindst en betingelsesgruppe for at gøre sidebaren indholdsbevidst."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Håndter widgets"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "Sidebar opdateret."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Sidebar udgivet."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Sidebar gemt."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Sidebar indsendt."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Sidebar planlagt til: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "j. M, Y @ G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Sidebar-kladde opdateret."
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
msgstr[1] ""
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] ""
|
207 |
-
msgstr[1] ""
|
208 |
-
|
209 |
-
#: ../content-aware-sidebars.php:385
|
210 |
-
#, php-format
|
211 |
-
msgid "%s sidebar permanently deleted."
|
212 |
-
msgid_plural "%s sidebars permanently deleted."
|
213 |
-
msgstr[0] ""
|
214 |
-
msgstr[1] ""
|
215 |
-
|
216 |
-
#: ../content-aware-sidebars.php:386
|
217 |
-
#, php-format
|
218 |
-
msgid "%s sidebar moved to the Trash."
|
219 |
-
msgid_plural "%s sidebars moved to the Trash."
|
220 |
-
msgstr[0] ""
|
221 |
-
msgstr[1] ""
|
222 |
-
|
223 |
-
#: ../content-aware-sidebars.php:387
|
224 |
-
#, php-format
|
225 |
-
msgid "%s sidebar restored from the Trash."
|
226 |
-
msgid_plural "%s sidebars restored from the Trash."
|
227 |
-
msgstr[0] ""
|
228 |
-
msgstr[1] ""
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
-
msgid "Please update Host Sidebar"
|
232 |
-
msgstr "Værts-sidebar skal opdateres"
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:472
|
235 |
-
msgid "Merge position"
|
236 |
-
msgstr "Fletteposition"
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:473
|
239 |
-
msgid "Widgets"
|
240 |
-
msgstr "Widgets"
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:586
|
243 |
-
msgid "Manage Widgets"
|
244 |
-
msgstr "Håndter widgets"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:756
|
247 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
-
msgstr "Få en gratis Content Aware Sidebars Premium Bundle"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:772
|
251 |
-
msgid "Options"
|
252 |
-
msgstr "Indstillinger"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:795
|
255 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
-
msgid "Condition Groups"
|
258 |
-
msgstr "Betingelsesgrupper"
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:796
|
261 |
-
msgid ""
|
262 |
-
"Each created condition group describe some specific content (conditions) "
|
263 |
-
"that the current sidebar should be displayed with."
|
264 |
-
msgstr "Hver oprettet betingelsesgruppe beskriver noget specifikt indhold (betingelser) som den nuværende sidebar skal vises ved."
|
265 |
-
|
266 |
-
#: ../content-aware-sidebars.php:797
|
267 |
-
msgid ""
|
268 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
-
" groups themselves use logical disjunction. This means that content added to"
|
270 |
-
" a group should be associated, as they are treated as such, and that the "
|
271 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
-
"extremely focused and at the same time distinct conditions."
|
273 |
-
msgstr "Indhold tilføjet til en betingelsesgruppe bruger logisk konjunktion, mens betingelsesgrupperne selv bruger logisk disjunktion. Dette betyder, at indhold tilføjet til en gruppe, skal være associeret, fordi det behandles som sådant, og at grupperne ikke forstyrrer hinanden. Det er således muligt at have både ekstremt fokuserede og samtidig forskellige betingelser."
|
274 |
-
|
275 |
-
#: ../content-aware-sidebars.php:800
|
276 |
-
msgid "More Information"
|
277 |
-
msgstr "Flere informationer"
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
-
msgid "Get Support"
|
281 |
-
msgstr "Få support"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:816
|
284 |
-
msgid ""
|
285 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
-
" of the upcoming Premium Bundle*!"
|
287 |
-
msgstr "Oversæt Content Aware Sidebars til dit sprog og bliv en BETA-tester af det kommende Premium Bundle*!"
|
288 |
-
|
289 |
-
#: ../content-aware-sidebars.php:817
|
290 |
-
msgid "Translate Now"
|
291 |
-
msgstr "Oversæt nu"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:818
|
294 |
-
msgid "Get Premium Bundle"
|
295 |
-
msgstr "Modtag Premium Bundle"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:819
|
298 |
-
msgid ""
|
299 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
-
msgstr "Til brug på ét websted. BETA betyder, det ikke er anbefalet til produktionswebsteder."
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:822
|
303 |
-
msgid "Partial Feature List"
|
304 |
-
msgstr "Delvis funktionsliste"
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:824
|
307 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
-
msgstr "Vælg og opret sidebars i vinduet for indlægsredigering"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:825
|
311 |
-
msgid "Display sidebars with URLs using wildcards"
|
312 |
-
msgstr "Vis sidebars med URLs ved brug af wildcards"
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:826
|
315 |
-
msgid "Display sidebars with User Roles"
|
316 |
-
msgstr "Vis sidebars med brugerroller"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:827
|
319 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
-
msgstr "Vis sidebars med BuddyPress brugergrupper"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:828
|
323 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
-
msgstr "Sidebars-kolonne i oversigtsvinduerne for indholdstyper og taksonomier"
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
-
msgid "Order"
|
328 |
-
msgstr "Rækkefølge"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:880
|
331 |
-
msgid "Give a review on WordPress.org"
|
332 |
-
msgstr ""
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
-
msgid "Translate the plugin into your language"
|
336 |
-
msgstr "Oversæt dette plugin til dit sprog"
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:884
|
339 |
-
msgid "Read the FAQ"
|
340 |
-
msgstr ""
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:899
|
343 |
-
msgid ""
|
344 |
-
"If you love this plugin, please consider donating to support future "
|
345 |
-
"development."
|
346 |
-
msgstr "Hvis du elsker dette plugin, kan du overveje at donere for at støtte den fremtidige udvikling."
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:908
|
349 |
-
msgid "Or you could:"
|
350 |
-
msgstr "Eller du kunne:"
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:910
|
353 |
-
msgid "Rate the plugin on WordPress.org"
|
354 |
-
msgstr "Bedømme pluginnet på WordPress.org"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:911
|
357 |
-
msgid "Link to the plugin page"
|
358 |
-
msgstr "Linke til plugin-siden"
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:1045
|
361 |
-
msgid "Filter Sidebars"
|
362 |
-
msgstr "Filtrer sidebars"
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1046
|
365 |
-
msgid "Filter Widgets"
|
366 |
-
msgstr ""
|
367 |
-
|
368 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
-
msgid "Condition Group"
|
370 |
-
msgstr "Betingelsesgruppe"
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
-
msgctxt "group"
|
374 |
-
msgid "Add New"
|
375 |
-
msgstr "Tilføj ny"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
-
msgid "Add New Group"
|
381 |
-
msgstr "Tilføj ny gruppe"
|
382 |
-
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
-
msgctxt "group"
|
387 |
-
msgid "Edit"
|
388 |
-
msgstr "Rediger"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
-
msgid "No Groups found"
|
393 |
-
msgstr "Ingen grupper fundet"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
-
msgctxt "condition group"
|
397 |
-
msgid "Negated"
|
398 |
-
msgstr "Negeret"
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
-
msgid "Content"
|
402 |
-
msgstr "Indhold"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
-
msgid "Unauthorized request"
|
408 |
-
msgstr "Uautoriseret forespørgsel"
|
409 |
-
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
-
msgid "Condition group cannot be empty"
|
412 |
-
msgstr "Betingelsesgruppe må ikke være tom"
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
-
msgid "Condition group saved"
|
416 |
-
msgstr "Betingelsesgruppe gemt"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
-
msgid "Condition group could not be removed"
|
420 |
-
msgstr "Betingelsesgruppe kunne ikke fjernes"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
-
msgid "Condition group removed"
|
424 |
-
msgstr "Betingelsesgruppe fjernet"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Save"
|
429 |
-
msgstr "Gem"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Cancel"
|
434 |
-
msgstr "Annuller"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
-
msgid "Or"
|
439 |
-
msgstr "Eller"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
-
msgid "And"
|
446 |
-
msgstr ""
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
-
msgid "Remove"
|
451 |
-
msgstr "Fjern"
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
-
msgid "Remove this group and its contents permanently?"
|
455 |
-
msgstr "Fjern denne gruppe og dens indhold permanent?"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
-
msgid "No results found."
|
459 |
-
msgstr "Ingen resultater fundet."
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
-
msgid ""
|
463 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
-
"these changes?"
|
465 |
-
msgstr "Den nuværende gruppe har ugemte ændringer. Ønsker du at fortsætte og kassere disse ændringer?"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
-
msgid "Negate group"
|
470 |
-
msgstr "Negér gruppe"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target all but this context"
|
475 |
-
msgstr "Vælg alle udover denne kontekst"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target this context"
|
480 |
-
msgstr "Vælg denne kontekst"
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
-
msgid "Authors"
|
484 |
-
msgstr "Forfattere"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
-
#, php-format
|
488 |
-
msgid "Display with All %s"
|
489 |
-
msgstr "Vis ved alle %s"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
-
msgid "View All"
|
496 |
-
msgstr "Vis alle"
|
497 |
-
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
-
msgid "Search"
|
505 |
-
msgstr "Søg"
|
506 |
-
|
507 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
-
msgid "bbPress User Profiles"
|
509 |
-
msgstr "bbPress brugerprofiler"
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
-
msgid "BuddyPress Members"
|
513 |
-
msgstr "BuddyPress medlemmer"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
-
msgid "Add to Group"
|
519 |
-
msgstr "Tilføj til gruppe"
|
520 |
-
|
521 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
-
msgid "Dates"
|
523 |
-
msgstr "Datoer"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
-
msgid "Date Archives"
|
527 |
-
msgstr "Dato-arkiver"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
-
msgid "Page Templates"
|
531 |
-
msgstr "Skabeloner"
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
-
msgid "Languages"
|
538 |
-
msgstr "Sprog"
|
539 |
-
|
540 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
-
msgid "Post Types"
|
542 |
-
msgstr "Indholdstyper"
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
-
msgid "Automatically select new children of a selected ancestor"
|
548 |
-
msgstr "Vælg automatisk nye børn af den valgte forælder"
|
549 |
-
|
550 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
-
msgid "Automatically add new children of a selected ancestor"
|
552 |
-
msgstr "Tilføj automatisk nye børn af den valgte forælder"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
-
#, php-format
|
556 |
-
msgid "%s Archives"
|
557 |
-
msgstr "Arkiver for %s"
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
-
msgid "Blog Page"
|
561 |
-
msgstr "Blog-side"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
-
msgid "No items."
|
566 |
-
msgstr "Ingen elementer."
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
-
msgid "Most Recent"
|
570 |
-
msgstr "Seneste"
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
-
msgid "Static Pages"
|
574 |
-
msgstr "Statiske sider"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
-
msgid "Front Page"
|
578 |
-
msgstr "Forside"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
-
msgid "Search Results"
|
582 |
-
msgstr "Søgeresultater"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
-
msgid "404 Page"
|
586 |
-
msgstr "404-side"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
-
msgid "Taxonomies"
|
590 |
-
msgstr "Taksonomier"
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
-
msgid "Most Used"
|
594 |
-
msgstr "Mest brugte"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
-
msgid "Conditional Content"
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
-
msgid ""
|
602 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
-
" it. In each group, you can combine different types of associated content."
|
604 |
-
msgstr "Klik for at redigere en gruppe eller opret en ny. Vælg indhold til venstre for at tilføje det. I hver gruppe kan du kombinere forskellige typer af forbundet indhold."
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
-
#, php-format
|
608 |
-
msgid "All %s"
|
609 |
-
msgstr "Alle %s"
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
-
msgid "Password protected"
|
613 |
-
msgstr ""
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
-
msgid "Private"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
-
msgid "Draft"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#. translators: post state
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
-
msgctxt "post state"
|
626 |
-
msgid "Pending"
|
627 |
-
msgstr ""
|
628 |
-
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
-
msgid "Sticky"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
-
msgid "Scheduled"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../pointers.php:68
|
638 |
-
msgid "Get started"
|
639 |
-
msgstr "Kom i gang"
|
640 |
-
|
641 |
-
#: ../pointers.php:69
|
642 |
-
msgid ""
|
643 |
-
"You've just installed Content Aware Sidebars!\n"
|
644 |
-
"\n"
|
645 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
-
"\n"
|
647 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
-
msgstr "Du har lige installeret Content Aware Sidebars!\n\nDet giver dig en masse valgmuligheder, så dette vindue kan være overvældende ved første blik. Bare rolig.\n\nKlik Start rundvisning for at se en hurtig introduktion og lær hvordan du kan vise en sidebar præcist der, hvor du ønsker den."
|
649 |
-
|
650 |
-
#: ../pointers.php:76
|
651 |
-
msgid "Start Tour"
|
652 |
-
msgstr "Start rundvisning"
|
653 |
-
|
654 |
-
#: ../pointers.php:78
|
655 |
-
msgid "Not now"
|
656 |
-
msgstr "Ikke nu"
|
657 |
-
|
658 |
-
#: ../pointers.php:83
|
659 |
-
msgid ""
|
660 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
-
"\n"
|
662 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
-
"\n"
|
664 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
-
msgstr "For at gøre en sidebar indholdsbestemt skal du starte med at oprette en betingelsesgruppe.\n\nBetingelsesgrupper er isoleret fra hinanden, hvilket betyder, at en sidebar kan have mange forskellige betingelser.\n\nAt negere en gruppe betyder, at sidebaren vil blive vist under alle andre betingelser end de valgte."
|
666 |
-
|
667 |
-
#: ../pointers.php:92
|
668 |
-
msgid "Content and contexts"
|
669 |
-
msgstr "Indhold og kontekster"
|
670 |
-
|
671 |
-
#: ../pointers.php:93
|
672 |
-
msgid ""
|
673 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
-
"\n"
|
675 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
-
"\n"
|
677 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
-
msgstr "Her finder du alt indholdet på dit websted, som Content Aware Sidebars understøtter ud af boksen.\n\nVælg blot det indhold du ønsker, at sidebaren skal vises ved og tilføj det til en gruppe.\n\nDu kan endda kombinere associeret indhold i en gruppe; prøv at vælge \"Alle indlæg\", en kategori og en forfatter. Genialt!"
|
679 |
-
|
680 |
-
#: ../pointers.php:102
|
681 |
-
msgid "Options, options"
|
682 |
-
msgstr "Mange valgmuligheder"
|
683 |
-
|
684 |
-
#: ../pointers.php:103
|
685 |
-
msgid ""
|
686 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
-
"\n"
|
688 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
-
"\n"
|
690 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
-
"\n"
|
692 |
-
" You are in control."
|
693 |
-
msgstr "Skal sidebaren vises på singulære sider og/eller arkiver?\n\nSkal den flette med en anden sidebar eller erstatte den? Måske vil du indsætte den manuelt i dit indhold med en shortcode.\n\nPlanlæg sidebaren ligesom du gør med indlæg og sider, eller gør den privat, så den kun er synlig for brugere, der er logget ind.\n\nDu har kontrollen."
|
694 |
-
|
695 |
-
#: ../pointers.php:112
|
696 |
-
msgid "Help and Support"
|
697 |
-
msgstr "Hjælp og support"
|
698 |
-
|
699 |
-
#: ../pointers.php:113
|
700 |
-
msgid ""
|
701 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
-
"\n"
|
703 |
-
"If you need more help, click on the \"Help\" tab here."
|
704 |
-
msgstr "Det var det! Nu kan du begynde at oprette sidebars og vise dem på dine egne betingelser.\n\nHvis du har brug for mere hjælp, så klik på fanen \"Hjælp\" her."
|
705 |
-
|
706 |
-
#: ../pointers.php:142
|
707 |
-
msgid "Close"
|
708 |
-
msgstr "Luk"
|
709 |
-
|
710 |
-
#: ../pointers.php:143
|
711 |
-
msgid "Next"
|
712 |
-
msgstr "Næste"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Joachim Jensen <jv@intox.dk>, 2015
|
5 |
+
# Joachim Jensen <jv@intox.dk>, 2014-2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Danish (Denmark) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/da_DK/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: da_DK\n"
|
18 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Administrer og vis sidebars i henhold til det indhold, der vises."
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Content Aware Sidebars"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "Importer"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "FAQ"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Eksponering"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Singulær"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Singulær og arkiv"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Arkiv"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Håndtering"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Erstat"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Flet"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Manuel"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Erstat tvungent"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "Erstat værts-sidebar, flet med den eller tilføj denne sidebar manuelt."
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "Værts-sidebar"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "Fletteposition"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Top"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Bund"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Flet ind fra oven eller bunden."
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "Sidebars"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "Sidebar"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Tilføj ny"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Tilføj ny sidebar"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Rediger sidebar"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Ny sidebar"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Alle sidebars"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Vis sidebar"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Søg sidebars"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "Ingen sidebars fundet"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "Ingen sidebars fundet i papirkurven"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Vis sidebar ved"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Intet indhold. Tilføj mindst en betingelsesgruppe for at gøre sidebaren indholdsbevidst."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Håndter widgets"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "Sidebar opdateret."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Sidebar udgivet."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Sidebar gemt."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Sidebar indsendt."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Sidebar planlagt til: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "j. M, Y @ G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Sidebar-kladde opdateret."
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
msgstr[1] ""
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] ""
|
207 |
+
msgstr[1] ""
|
208 |
+
|
209 |
+
#: ../content-aware-sidebars.php:385
|
210 |
+
#, php-format
|
211 |
+
msgid "%s sidebar permanently deleted."
|
212 |
+
msgid_plural "%s sidebars permanently deleted."
|
213 |
+
msgstr[0] ""
|
214 |
+
msgstr[1] ""
|
215 |
+
|
216 |
+
#: ../content-aware-sidebars.php:386
|
217 |
+
#, php-format
|
218 |
+
msgid "%s sidebar moved to the Trash."
|
219 |
+
msgid_plural "%s sidebars moved to the Trash."
|
220 |
+
msgstr[0] ""
|
221 |
+
msgstr[1] ""
|
222 |
+
|
223 |
+
#: ../content-aware-sidebars.php:387
|
224 |
+
#, php-format
|
225 |
+
msgid "%s sidebar restored from the Trash."
|
226 |
+
msgid_plural "%s sidebars restored from the Trash."
|
227 |
+
msgstr[0] ""
|
228 |
+
msgstr[1] ""
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
+
msgid "Please update Host Sidebar"
|
232 |
+
msgstr "Værts-sidebar skal opdateres"
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:472
|
235 |
+
msgid "Merge position"
|
236 |
+
msgstr "Fletteposition"
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:473
|
239 |
+
msgid "Widgets"
|
240 |
+
msgstr "Widgets"
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:586
|
243 |
+
msgid "Manage Widgets"
|
244 |
+
msgstr "Håndter widgets"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:756
|
247 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
+
msgstr "Få en gratis Content Aware Sidebars Premium Bundle"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:772
|
251 |
+
msgid "Options"
|
252 |
+
msgstr "Indstillinger"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:795
|
255 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
+
msgid "Condition Groups"
|
258 |
+
msgstr "Betingelsesgrupper"
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:796
|
261 |
+
msgid ""
|
262 |
+
"Each created condition group describe some specific content (conditions) "
|
263 |
+
"that the current sidebar should be displayed with."
|
264 |
+
msgstr "Hver oprettet betingelsesgruppe beskriver noget specifikt indhold (betingelser) som den nuværende sidebar skal vises ved."
|
265 |
+
|
266 |
+
#: ../content-aware-sidebars.php:797
|
267 |
+
msgid ""
|
268 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
+
" groups themselves use logical disjunction. This means that content added to"
|
270 |
+
" a group should be associated, as they are treated as such, and that the "
|
271 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
+
"extremely focused and at the same time distinct conditions."
|
273 |
+
msgstr "Indhold tilføjet til en betingelsesgruppe bruger logisk konjunktion, mens betingelsesgrupperne selv bruger logisk disjunktion. Dette betyder, at indhold tilføjet til en gruppe, skal være associeret, fordi det behandles som sådant, og at grupperne ikke forstyrrer hinanden. Det er således muligt at have både ekstremt fokuserede og samtidig forskellige betingelser."
|
274 |
+
|
275 |
+
#: ../content-aware-sidebars.php:800
|
276 |
+
msgid "More Information"
|
277 |
+
msgstr "Flere informationer"
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
+
msgid "Get Support"
|
281 |
+
msgstr "Få support"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:816
|
284 |
+
msgid ""
|
285 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
+
" of the upcoming Premium Bundle*!"
|
287 |
+
msgstr "Oversæt Content Aware Sidebars til dit sprog og bliv en BETA-tester af det kommende Premium Bundle*!"
|
288 |
+
|
289 |
+
#: ../content-aware-sidebars.php:817
|
290 |
+
msgid "Translate Now"
|
291 |
+
msgstr "Oversæt nu"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:818
|
294 |
+
msgid "Get Premium Bundle"
|
295 |
+
msgstr "Modtag Premium Bundle"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:819
|
298 |
+
msgid ""
|
299 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
+
msgstr "Til brug på ét websted. BETA betyder, det ikke er anbefalet til produktionswebsteder."
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:822
|
303 |
+
msgid "Partial Feature List"
|
304 |
+
msgstr "Delvis funktionsliste"
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:824
|
307 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
+
msgstr "Vælg og opret sidebars i vinduet for indlægsredigering"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:825
|
311 |
+
msgid "Display sidebars with URLs using wildcards"
|
312 |
+
msgstr "Vis sidebars med URLs ved brug af wildcards"
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:826
|
315 |
+
msgid "Display sidebars with User Roles"
|
316 |
+
msgstr "Vis sidebars med brugerroller"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:827
|
319 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
+
msgstr "Vis sidebars med BuddyPress brugergrupper"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:828
|
323 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
+
msgstr "Sidebars-kolonne i oversigtsvinduerne for indholdstyper og taksonomier"
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
+
msgid "Order"
|
328 |
+
msgstr "Rækkefølge"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:880
|
331 |
+
msgid "Give a review on WordPress.org"
|
332 |
+
msgstr ""
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
+
msgid "Translate the plugin into your language"
|
336 |
+
msgstr "Oversæt dette plugin til dit sprog"
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:884
|
339 |
+
msgid "Read the FAQ"
|
340 |
+
msgstr ""
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:899
|
343 |
+
msgid ""
|
344 |
+
"If you love this plugin, please consider donating to support future "
|
345 |
+
"development."
|
346 |
+
msgstr "Hvis du elsker dette plugin, kan du overveje at donere for at støtte den fremtidige udvikling."
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:908
|
349 |
+
msgid "Or you could:"
|
350 |
+
msgstr "Eller du kunne:"
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:910
|
353 |
+
msgid "Rate the plugin on WordPress.org"
|
354 |
+
msgstr "Bedømme pluginnet på WordPress.org"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:911
|
357 |
+
msgid "Link to the plugin page"
|
358 |
+
msgstr "Linke til plugin-siden"
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:1045
|
361 |
+
msgid "Filter Sidebars"
|
362 |
+
msgstr "Filtrer sidebars"
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1046
|
365 |
+
msgid "Filter Widgets"
|
366 |
+
msgstr ""
|
367 |
+
|
368 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
+
msgid "Condition Group"
|
370 |
+
msgstr "Betingelsesgruppe"
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
+
msgctxt "group"
|
374 |
+
msgid "Add New"
|
375 |
+
msgstr "Tilføj ny"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
+
msgid "Add New Group"
|
381 |
+
msgstr "Tilføj ny gruppe"
|
382 |
+
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
+
msgctxt "group"
|
387 |
+
msgid "Edit"
|
388 |
+
msgstr "Rediger"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
+
msgid "No Groups found"
|
393 |
+
msgstr "Ingen grupper fundet"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
+
msgctxt "condition group"
|
397 |
+
msgid "Negated"
|
398 |
+
msgstr "Negeret"
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
+
msgid "Content"
|
402 |
+
msgstr "Indhold"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
+
msgid "Unauthorized request"
|
408 |
+
msgstr "Uautoriseret forespørgsel"
|
409 |
+
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
+
msgid "Condition group cannot be empty"
|
412 |
+
msgstr "Betingelsesgruppe må ikke være tom"
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
+
msgid "Condition group saved"
|
416 |
+
msgstr "Betingelsesgruppe gemt"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
+
msgid "Condition group could not be removed"
|
420 |
+
msgstr "Betingelsesgruppe kunne ikke fjernes"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
+
msgid "Condition group removed"
|
424 |
+
msgstr "Betingelsesgruppe fjernet"
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Save"
|
429 |
+
msgstr "Gem"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Cancel"
|
434 |
+
msgstr "Annuller"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
+
msgid "Or"
|
439 |
+
msgstr "Eller"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
+
msgid "And"
|
446 |
+
msgstr ""
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
+
msgid "Remove"
|
451 |
+
msgstr "Fjern"
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
+
msgid "Remove this group and its contents permanently?"
|
455 |
+
msgstr "Fjern denne gruppe og dens indhold permanent?"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
+
msgid "No results found."
|
459 |
+
msgstr "Ingen resultater fundet."
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
+
msgid ""
|
463 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
+
"these changes?"
|
465 |
+
msgstr "Den nuværende gruppe har ugemte ændringer. Ønsker du at fortsætte og kassere disse ændringer?"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
+
msgid "Negate group"
|
470 |
+
msgstr "Negér gruppe"
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target all but this context"
|
475 |
+
msgstr "Vælg alle udover denne kontekst"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target this context"
|
480 |
+
msgstr "Vælg denne kontekst"
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
+
msgid "Authors"
|
484 |
+
msgstr "Forfattere"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
+
#, php-format
|
488 |
+
msgid "Display with All %s"
|
489 |
+
msgstr "Vis ved alle %s"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
+
msgid "View All"
|
496 |
+
msgstr "Vis alle"
|
497 |
+
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
+
msgid "Search"
|
505 |
+
msgstr "Søg"
|
506 |
+
|
507 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
+
msgid "bbPress User Profiles"
|
509 |
+
msgstr "bbPress brugerprofiler"
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
+
msgid "BuddyPress Members"
|
513 |
+
msgstr "BuddyPress medlemmer"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
+
msgid "Add to Group"
|
519 |
+
msgstr "Tilføj til gruppe"
|
520 |
+
|
521 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
+
msgid "Dates"
|
523 |
+
msgstr "Datoer"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
+
msgid "Date Archives"
|
527 |
+
msgstr "Dato-arkiver"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
+
msgid "Page Templates"
|
531 |
+
msgstr "Skabeloner"
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
+
msgid "Languages"
|
538 |
+
msgstr "Sprog"
|
539 |
+
|
540 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
+
msgid "Post Types"
|
542 |
+
msgstr "Indholdstyper"
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
+
msgid "Automatically select new children of a selected ancestor"
|
548 |
+
msgstr "Vælg automatisk nye børn af den valgte forælder"
|
549 |
+
|
550 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
+
msgid "Automatically add new children of a selected ancestor"
|
552 |
+
msgstr "Tilføj automatisk nye børn af den valgte forælder"
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
+
#, php-format
|
556 |
+
msgid "%s Archives"
|
557 |
+
msgstr "Arkiver for %s"
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
+
msgid "Blog Page"
|
561 |
+
msgstr "Blog-side"
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
+
msgid "No items."
|
566 |
+
msgstr "Ingen elementer."
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
+
msgid "Most Recent"
|
570 |
+
msgstr "Seneste"
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
+
msgid "Static Pages"
|
574 |
+
msgstr "Statiske sider"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
+
msgid "Front Page"
|
578 |
+
msgstr "Forside"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
+
msgid "Search Results"
|
582 |
+
msgstr "Søgeresultater"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
+
msgid "404 Page"
|
586 |
+
msgstr "404-side"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
+
msgid "Taxonomies"
|
590 |
+
msgstr "Taksonomier"
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
+
msgid "Most Used"
|
594 |
+
msgstr "Mest brugte"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
+
msgid "Conditional Content"
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
+
msgid ""
|
602 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
+
" it. In each group, you can combine different types of associated content."
|
604 |
+
msgstr "Klik for at redigere en gruppe eller opret en ny. Vælg indhold til venstre for at tilføje det. I hver gruppe kan du kombinere forskellige typer af forbundet indhold."
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
+
#, php-format
|
608 |
+
msgid "All %s"
|
609 |
+
msgstr "Alle %s"
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
+
msgid "Password protected"
|
613 |
+
msgstr ""
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
+
msgid "Private"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
+
msgid "Draft"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#. translators: post state
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
+
msgctxt "post state"
|
626 |
+
msgid "Pending"
|
627 |
+
msgstr ""
|
628 |
+
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
+
msgid "Sticky"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
+
msgid "Scheduled"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../pointers.php:68
|
638 |
+
msgid "Get started"
|
639 |
+
msgstr "Kom i gang"
|
640 |
+
|
641 |
+
#: ../pointers.php:69
|
642 |
+
msgid ""
|
643 |
+
"You've just installed Content Aware Sidebars!\n"
|
644 |
+
"\n"
|
645 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
+
"\n"
|
647 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
+
msgstr "Du har lige installeret Content Aware Sidebars!\n\nDet giver dig en masse valgmuligheder, så dette vindue kan være overvældende ved første blik. Bare rolig.\n\nKlik Start rundvisning for at se en hurtig introduktion og lær hvordan du kan vise en sidebar præcist der, hvor du ønsker den."
|
649 |
+
|
650 |
+
#: ../pointers.php:76
|
651 |
+
msgid "Start Tour"
|
652 |
+
msgstr "Start rundvisning"
|
653 |
+
|
654 |
+
#: ../pointers.php:78
|
655 |
+
msgid "Not now"
|
656 |
+
msgstr "Ikke nu"
|
657 |
+
|
658 |
+
#: ../pointers.php:83
|
659 |
+
msgid ""
|
660 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
+
"\n"
|
662 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
+
"\n"
|
664 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
+
msgstr "For at gøre en sidebar indholdsbestemt skal du starte med at oprette en betingelsesgruppe.\n\nBetingelsesgrupper er isoleret fra hinanden, hvilket betyder, at en sidebar kan have mange forskellige betingelser.\n\nAt negere en gruppe betyder, at sidebaren vil blive vist under alle andre betingelser end de valgte."
|
666 |
+
|
667 |
+
#: ../pointers.php:92
|
668 |
+
msgid "Content and contexts"
|
669 |
+
msgstr "Indhold og kontekster"
|
670 |
+
|
671 |
+
#: ../pointers.php:93
|
672 |
+
msgid ""
|
673 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
+
"\n"
|
675 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
+
"\n"
|
677 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
+
msgstr "Her finder du alt indholdet på dit websted, som Content Aware Sidebars understøtter ud af boksen.\n\nVælg blot det indhold du ønsker, at sidebaren skal vises ved og tilføj det til en gruppe.\n\nDu kan endda kombinere associeret indhold i en gruppe; prøv at vælge \"Alle indlæg\", en kategori og en forfatter. Genialt!"
|
679 |
+
|
680 |
+
#: ../pointers.php:102
|
681 |
+
msgid "Options, options"
|
682 |
+
msgstr "Mange valgmuligheder"
|
683 |
+
|
684 |
+
#: ../pointers.php:103
|
685 |
+
msgid ""
|
686 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
+
"\n"
|
688 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
+
"\n"
|
690 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
+
"\n"
|
692 |
+
" You are in control."
|
693 |
+
msgstr "Skal sidebaren vises på singulære sider og/eller arkiver?\n\nSkal den flette med en anden sidebar eller erstatte den? Måske vil du indsætte den manuelt i dit indhold med en shortcode.\n\nPlanlæg sidebaren ligesom du gør med indlæg og sider, eller gør den privat, så den kun er synlig for brugere, der er logget ind.\n\nDu har kontrollen."
|
694 |
+
|
695 |
+
#: ../pointers.php:112
|
696 |
+
msgid "Help and Support"
|
697 |
+
msgstr "Hjælp og support"
|
698 |
+
|
699 |
+
#: ../pointers.php:113
|
700 |
+
msgid ""
|
701 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
+
"\n"
|
703 |
+
"If you need more help, click on the \"Help\" tab here."
|
704 |
+
msgstr "Det var det! Nu kan du begynde at oprette sidebars og vise dem på dine egne betingelser.\n\nHvis du har brug for mere hjælp, så klik på fanen \"Hjælp\" her."
|
705 |
+
|
706 |
+
#: ../pointers.php:142
|
707 |
+
msgid "Close"
|
708 |
+
msgstr "Luk"
|
709 |
+
|
710 |
+
#: ../pointers.php:143
|
711 |
+
msgid "Next"
|
712 |
+
msgstr "Næste"
|
lang/content-aware-sidebars-de_DE.po
CHANGED
@@ -1,716 +1,716 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Andreas Kuhl <mail@andreas-kuhl.de>, 2014
|
5 |
-
# Christine Graber, 2015
|
6 |
-
# Henrik Heil <contact@henrikheil.net>, 2014
|
7 |
-
# mcpitten <mcpitten@web.de>, 2015
|
8 |
-
# Michael Stollmann <18micha48@gmail.com>, 2015
|
9 |
-
# TheFluffyDonkey, 2015
|
10 |
-
msgid ""
|
11 |
-
msgstr ""
|
12 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
13 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
14 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
15 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
16 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
17 |
-
"Language-Team: German (Germany) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/de_DE/)\n"
|
18 |
-
"MIME-Version: 1.0\n"
|
19 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
20 |
-
"Content-Transfer-Encoding: 8bit\n"
|
21 |
-
"Language: de_DE\n"
|
22 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
23 |
-
"X-Generator: Poedit 1.7.6\n"
|
24 |
-
"X-Poedit-Basepath: .\n"
|
25 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
26 |
-
"X-Poedit-SearchPath-0: .\n"
|
27 |
-
"X-Poedit-SearchPath-1: ..\n"
|
28 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
29 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
30 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
31 |
-
"X-Textdomain-Support: yes\n"
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:95
|
34 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
35 |
-
msgstr "Sidebars abhängig vom dargestellten Inhalt einblenden und verwalten."
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
38 |
-
msgid "Content Aware Sidebars"
|
39 |
-
msgstr "Content Aware Sidebars"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:97
|
42 |
-
msgid "Import"
|
43 |
-
msgstr "Importieren"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
46 |
-
msgid "FAQ"
|
47 |
-
msgstr "FAQ"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:256
|
50 |
-
msgid "Exposure"
|
51 |
-
msgstr "Darstellung"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:260
|
54 |
-
msgid "Singular"
|
55 |
-
msgstr "Beitragsseite"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:261
|
58 |
-
msgid "Singular & Archive"
|
59 |
-
msgstr "Beitrags- & Archivseite"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:262
|
62 |
-
msgid "Archive"
|
63 |
-
msgstr "Archivseite"
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
66 |
-
msgctxt "option"
|
67 |
-
msgid "Handle"
|
68 |
-
msgstr "Funktion"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:271
|
71 |
-
msgid "Replace"
|
72 |
-
msgstr "Ersetze"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:272
|
75 |
-
msgid "Merge"
|
76 |
-
msgstr "Verbinde"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:273
|
79 |
-
msgid "Manual"
|
80 |
-
msgstr "Handbuch"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:274
|
83 |
-
msgid "Forced replace"
|
84 |
-
msgstr "Erzwungene Ersetzung"
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:276
|
87 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
88 |
-
msgstr "Haupt-Sidebar ersetzen, mit Haupt-Sidebar verbinden oder manuell hinzufügen."
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:280
|
91 |
-
msgid "Host Sidebar"
|
92 |
-
msgstr "Haupt-Sidebar"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:287
|
95 |
-
msgid "Merge Position"
|
96 |
-
msgstr "Zusammenführen von Position"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:291
|
99 |
-
msgid "Top"
|
100 |
-
msgstr "Oberhalb"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:292
|
103 |
-
msgid "Bottom"
|
104 |
-
msgstr "Unterhalb"
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:294
|
107 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
108 |
-
msgstr "Sidebar bem Verbinden ober- oder unterhalb der Haupt-Sidebar platzieren."
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:309
|
111 |
-
msgid "Sidebars"
|
112 |
-
msgstr "Sidebars"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:310
|
115 |
-
msgid "Sidebar"
|
116 |
-
msgstr "Sidebar"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:311
|
119 |
-
msgctxt "sidebar"
|
120 |
-
msgid "Add New"
|
121 |
-
msgstr "Neu hinzufügen"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:312
|
124 |
-
msgid "Add New Sidebar"
|
125 |
-
msgstr "Neue Sidebar hinzufügen"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:313
|
128 |
-
msgid "Edit Sidebar"
|
129 |
-
msgstr "Sidebar bearbeiten"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:314
|
132 |
-
msgid "New Sidebar"
|
133 |
-
msgstr "Neue Sidebar"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:315
|
136 |
-
msgid "All Sidebars"
|
137 |
-
msgstr "Alle Sidebars"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:316
|
140 |
-
msgid "View Sidebar"
|
141 |
-
msgstr "Sidebar ansehen"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:317
|
144 |
-
msgid "Search Sidebars"
|
145 |
-
msgstr "Sidebars durchsuchen"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:318
|
148 |
-
msgid "No sidebars found"
|
149 |
-
msgstr "Keine Sidebars gefunden"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:319
|
152 |
-
msgid "No sidebars found in Trash"
|
153 |
-
msgstr "Keine Sidebars im Papierkorb gefunden"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:321
|
156 |
-
msgid "Display sidebar with"
|
157 |
-
msgstr "Sidebar anzeigen bei"
|
158 |
-
|
159 |
-
#: ../content-aware-sidebars.php:322
|
160 |
-
msgid ""
|
161 |
-
"No content. Please add at least one condition group to make the sidebar "
|
162 |
-
"content aware."
|
163 |
-
msgstr "Kein Inhalt vorhanden. Bitte erstelle mindestens eine Gruppe um die Sidebar inhaltsabhängig darstellen zu können."
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
166 |
-
msgid "Manage widgets"
|
167 |
-
msgstr "Widgets verwalten"
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
170 |
-
msgid "Sidebar updated."
|
171 |
-
msgstr "Sidebar wurde aktualisiert."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:361
|
174 |
-
msgid "Sidebar published."
|
175 |
-
msgstr "Sidebar wurde publiziert."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:362
|
178 |
-
msgid "Sidebar saved."
|
179 |
-
msgstr "Sidebar wurde gespeichert."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:363
|
182 |
-
msgid "Sidebar submitted."
|
183 |
-
msgstr "Sidebar wurde übertragen."
|
184 |
-
|
185 |
-
#: ../content-aware-sidebars.php:364
|
186 |
-
#, php-format
|
187 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
188 |
-
msgstr "Sidebar wurde eingeplant für: <strong>%1$s</strong>."
|
189 |
-
|
190 |
-
#. translators: Publish box date format, see http://php.net/date
|
191 |
-
#: ../content-aware-sidebars.php:366
|
192 |
-
msgid "M j, Y @ G:i"
|
193 |
-
msgstr "j. M Y @ G:i"
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:367
|
196 |
-
msgid "Sidebar draft updated."
|
197 |
-
msgstr "Sidebar-Entwurf aktualisiert."
|
198 |
-
|
199 |
-
#: ../content-aware-sidebars.php:383
|
200 |
-
#, php-format
|
201 |
-
msgid "%s sidebar updated."
|
202 |
-
msgid_plural "%s sidebars updated."
|
203 |
-
msgstr[0] ""
|
204 |
-
msgstr[1] ""
|
205 |
-
|
206 |
-
#: ../content-aware-sidebars.php:384
|
207 |
-
#, php-format
|
208 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
209 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
210 |
-
msgstr[0] ""
|
211 |
-
msgstr[1] ""
|
212 |
-
|
213 |
-
#: ../content-aware-sidebars.php:385
|
214 |
-
#, php-format
|
215 |
-
msgid "%s sidebar permanently deleted."
|
216 |
-
msgid_plural "%s sidebars permanently deleted."
|
217 |
-
msgstr[0] ""
|
218 |
-
msgstr[1] ""
|
219 |
-
|
220 |
-
#: ../content-aware-sidebars.php:386
|
221 |
-
#, php-format
|
222 |
-
msgid "%s sidebar moved to the Trash."
|
223 |
-
msgid_plural "%s sidebars moved to the Trash."
|
224 |
-
msgstr[0] ""
|
225 |
-
msgstr[1] ""
|
226 |
-
|
227 |
-
#: ../content-aware-sidebars.php:387
|
228 |
-
#, php-format
|
229 |
-
msgid "%s sidebar restored from the Trash."
|
230 |
-
msgid_plural "%s sidebars restored from the Trash."
|
231 |
-
msgstr[0] ""
|
232 |
-
msgstr[1] ""
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
235 |
-
msgid "Please update Host Sidebar"
|
236 |
-
msgstr "Bitte Haupt-Sidebar aktualisieren."
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:472
|
239 |
-
msgid "Merge position"
|
240 |
-
msgstr "Position bei verbinden"
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:473
|
243 |
-
msgid "Widgets"
|
244 |
-
msgstr "Widgets"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:586
|
247 |
-
msgid "Manage Widgets"
|
248 |
-
msgstr "Widgetverwaltung"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:756
|
251 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
252 |
-
msgstr "Erhalte ein kostenloses Content Aware Sidebars Premium Bundle"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:772
|
255 |
-
msgid "Options"
|
256 |
-
msgstr "Optionen"
|
257 |
-
|
258 |
-
#: ../content-aware-sidebars.php:795
|
259 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
260 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
261 |
-
msgid "Condition Groups"
|
262 |
-
msgstr "Gruppen"
|
263 |
-
|
264 |
-
#: ../content-aware-sidebars.php:796
|
265 |
-
msgid ""
|
266 |
-
"Each created condition group describe some specific content (conditions) "
|
267 |
-
"that the current sidebar should be displayed with."
|
268 |
-
msgstr "Jede erstellte Gruppe beschreibt einige spezifische Content-Bedingungen unter welchen die aktuelle Sidebar angzeigt werden soll."
|
269 |
-
|
270 |
-
#: ../content-aware-sidebars.php:797
|
271 |
-
msgid ""
|
272 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
273 |
-
" groups themselves use logical disjunction. This means that content added to"
|
274 |
-
" a group should be associated, as they are treated as such, and that the "
|
275 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
276 |
-
"extremely focused and at the same time distinct conditions."
|
277 |
-
msgstr "Content, der zu einer Gruppe hinzugefügt wird, benutzt logische UND Verknüpfungen, während die Gruppe selbst logische ODER Verknüpfungen verwendet. Das bedeutet, dass der einer Gruppe hinzugefügte Content thematisch zugehörig sein sollte und die Gruppen sich nicht gegenseitig beeinflussen sollten. Somit ist es möglich, gleichzeitig extrem spitze als auch eindeutige Bedingungen zu haben."
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:800
|
280 |
-
msgid "More Information"
|
281 |
-
msgstr "Weitere Informationen"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
284 |
-
msgid "Get Support"
|
285 |
-
msgstr "Erhalte Support"
|
286 |
-
|
287 |
-
#: ../content-aware-sidebars.php:816
|
288 |
-
msgid ""
|
289 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
290 |
-
" of the upcoming Premium Bundle*!"
|
291 |
-
msgstr "Übersetze Content Aware Sidebars in deine Sprache und werde ein BETA-Tester für das bald erscheinende Premium Bundle*!"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:817
|
294 |
-
msgid "Translate Now"
|
295 |
-
msgstr "Jetzt übersetzen"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:818
|
298 |
-
msgid "Get Premium Bundle"
|
299 |
-
msgstr "Premium Bundle holen"
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:819
|
302 |
-
msgid ""
|
303 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
304 |
-
msgstr "Verwendung für eine einzelne Site. BETA bedeutet, dass der Gebrauch für Produktivseiten nicht empfohlen wird."
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:822
|
307 |
-
msgid "Partial Feature List"
|
308 |
-
msgstr "Unvollständige Feature Liste"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:824
|
311 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
312 |
-
msgstr "Wähle und erstelle Sidebars in der Bearbeitungsansicht von Beiträgen."
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:825
|
315 |
-
msgid "Display sidebars with URLs using wildcards"
|
316 |
-
msgstr "Zeige Sidebars mit URLs, die Wildcards beinthalten"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:826
|
319 |
-
msgid "Display sidebars with User Roles"
|
320 |
-
msgstr "Zeige Sidebars mit Benutzerrollen"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:827
|
323 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
324 |
-
msgstr "Zeige Sidebars mit BuddyPress Benutzergruppen"
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:828
|
327 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
328 |
-
msgstr "Sidebars Spalte in Beiträgen und Taxonomieübersichten"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
331 |
-
msgid "Order"
|
332 |
-
msgstr "Bestellung"
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:880
|
335 |
-
msgid "Give a review on WordPress.org"
|
336 |
-
msgstr ""
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
339 |
-
msgid "Translate the plugin into your language"
|
340 |
-
msgstr "Übersetze das Plugin in deine Sprache"
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:884
|
343 |
-
msgid "Read the FAQ"
|
344 |
-
msgstr ""
|
345 |
-
|
346 |
-
#: ../content-aware-sidebars.php:899
|
347 |
-
msgid ""
|
348 |
-
"If you love this plugin, please consider donating to support future "
|
349 |
-
"development."
|
350 |
-
msgstr "Wenn du dieses Plugin magst, dann würde sich der Autor über eine Spende freuen."
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:908
|
353 |
-
msgid "Or you could:"
|
354 |
-
msgstr "Weitere Möglichkeiten:"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:910
|
357 |
-
msgid "Rate the plugin on WordPress.org"
|
358 |
-
msgstr "Dieses Plugin bei WordPress.org bewerten"
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:911
|
361 |
-
msgid "Link to the plugin page"
|
362 |
-
msgstr "Link zur Plugin-Seite"
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1045
|
365 |
-
msgid "Filter Sidebars"
|
366 |
-
msgstr "Sidebars filtern"
|
367 |
-
|
368 |
-
#: ../content-aware-sidebars.php:1046
|
369 |
-
msgid "Filter Widgets"
|
370 |
-
msgstr ""
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
373 |
-
msgid "Condition Group"
|
374 |
-
msgstr "Gruppe"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
377 |
-
msgctxt "group"
|
378 |
-
msgid "Add New"
|
379 |
-
msgstr "Neu erstellen"
|
380 |
-
|
381 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
382 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
383 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
384 |
-
msgid "Add New Group"
|
385 |
-
msgstr "Erstelle neue Gruppe"
|
386 |
-
|
387 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
388 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
389 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
390 |
-
msgctxt "group"
|
391 |
-
msgid "Edit"
|
392 |
-
msgstr "Bearbeiten"
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
396 |
-
msgid "No Groups found"
|
397 |
-
msgstr "keine Gruppen gefunden"
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
400 |
-
msgctxt "condition group"
|
401 |
-
msgid "Negated"
|
402 |
-
msgstr "verwerfe"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
405 |
-
msgid "Content"
|
406 |
-
msgstr "Inhalt"
|
407 |
-
|
408 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
411 |
-
msgid "Unauthorized request"
|
412 |
-
msgstr "Unerlaubter Zugriff"
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
415 |
-
msgid "Condition group cannot be empty"
|
416 |
-
msgstr "Die Gruppe darf nicht leer sein"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
419 |
-
msgid "Condition group saved"
|
420 |
-
msgstr "Gruppe wurde gesichert"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
423 |
-
msgid "Condition group could not be removed"
|
424 |
-
msgstr "Gruppe konnte nicht entfernt werden"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
427 |
-
msgid "Condition group removed"
|
428 |
-
msgstr "Gruppe wurde entfernt"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Save"
|
433 |
-
msgstr "Sichern"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
437 |
-
msgid "Cancel"
|
438 |
-
msgstr "Abbrechen"
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
441 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
442 |
-
msgid "Or"
|
443 |
-
msgstr "Oder"
|
444 |
-
|
445 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
446 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
447 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
448 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
449 |
-
msgid "And"
|
450 |
-
msgstr ""
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
453 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
454 |
-
msgid "Remove"
|
455 |
-
msgstr "Löschen"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
458 |
-
msgid "Remove this group and its contents permanently?"
|
459 |
-
msgstr "Diese Gruppe und seine Inhalte unwiderruflich löschen?"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
462 |
-
msgid "No results found."
|
463 |
-
msgstr "Keine Ergebnisse gefunden."
|
464 |
-
|
465 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
466 |
-
msgid ""
|
467 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
468 |
-
"these changes?"
|
469 |
-
msgstr "Die aktuelle Gruppe wurde geändert. Möchtest du die Änderungen speichern oder die Änderungen verwerfen?"
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
473 |
-
msgid "Negate group"
|
474 |
-
msgstr "verwerfe Gruppe"
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target all but this context"
|
479 |
-
msgstr "Auf alles ausser diesen Kontext anwenden"
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
482 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
483 |
-
msgid "Target this context"
|
484 |
-
msgstr "Auf diesen Kontext anwenden"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
487 |
-
msgid "Authors"
|
488 |
-
msgstr "Autoren"
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
491 |
-
#, php-format
|
492 |
-
msgid "Display with All %s"
|
493 |
-
msgstr "Anzeige aller %s"
|
494 |
-
|
495 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
496 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
497 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
498 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
499 |
-
msgid "View All"
|
500 |
-
msgstr "Alle anzeigen"
|
501 |
-
|
502 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
503 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
504 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
505 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
506 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
507 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
508 |
-
msgid "Search"
|
509 |
-
msgstr "Suche"
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
512 |
-
msgid "bbPress User Profiles"
|
513 |
-
msgstr "bbPress Benutzerprofile"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
516 |
-
msgid "BuddyPress Members"
|
517 |
-
msgstr "BuddyPress Mitglieder"
|
518 |
-
|
519 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
520 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
521 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
522 |
-
msgid "Add to Group"
|
523 |
-
msgstr "Zur Gruppe hinzufügen"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
526 |
-
msgid "Dates"
|
527 |
-
msgstr "Termine"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
530 |
-
msgid "Date Archives"
|
531 |
-
msgstr "Terminarchiv"
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
534 |
-
msgid "Page Templates"
|
535 |
-
msgstr "Seitenvorlage"
|
536 |
-
|
537 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
538 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
539 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
540 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
541 |
-
msgid "Languages"
|
542 |
-
msgstr "Sprachen"
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
545 |
-
msgid "Post Types"
|
546 |
-
msgstr "Post Types"
|
547 |
-
|
548 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
549 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
550 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
551 |
-
msgid "Automatically select new children of a selected ancestor"
|
552 |
-
msgstr "Neue untergeordnete Einträge automatisch markieren"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
555 |
-
msgid "Automatically add new children of a selected ancestor"
|
556 |
-
msgstr "Neue Unterelemente eines ausgewählten Elements automatisch hinzufügen"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
559 |
-
#, php-format
|
560 |
-
msgid "%s Archives"
|
561 |
-
msgstr "%s Archiv"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
564 |
-
msgid "Blog Page"
|
565 |
-
msgstr "Beitrags Seite"
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
568 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
569 |
-
msgid "No items."
|
570 |
-
msgstr "Keine Elemente."
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
573 |
-
msgid "Most Recent"
|
574 |
-
msgstr "Neueste"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
577 |
-
msgid "Static Pages"
|
578 |
-
msgstr "Statische Seiten"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
581 |
-
msgid "Front Page"
|
582 |
-
msgstr "Titelseite"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
585 |
-
msgid "Search Results"
|
586 |
-
msgstr "Suchergebnisse"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
589 |
-
msgid "404 Page"
|
590 |
-
msgstr "404 Seite"
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
593 |
-
msgid "Taxonomies"
|
594 |
-
msgstr "Taxonomien"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
597 |
-
msgid "Most Used"
|
598 |
-
msgstr "Am häufigsten benutzt"
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
601 |
-
msgid "Conditional Content"
|
602 |
-
msgstr ""
|
603 |
-
|
604 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
605 |
-
msgid ""
|
606 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
607 |
-
" it. In each group, you can combine different types of associated content."
|
608 |
-
msgstr "Klicke \"Bearbeiten\" um eine Gruppe auszuwählen oder lege eine neue Gruppe an. Wähle links den Inhalt aus und klicke auf \"Zur Gruppe hinzufügen\" um ihn der Gruppe zuzuordnen. In jeder Gruppe können verschiedene Inhaltstypen kombiniert werden."
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
611 |
-
#, php-format
|
612 |
-
msgid "All %s"
|
613 |
-
msgstr "Alle %s"
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
616 |
-
msgid "Password protected"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
620 |
-
msgid "Private"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
624 |
-
msgid "Draft"
|
625 |
-
msgstr ""
|
626 |
-
|
627 |
-
#. translators: post state
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
629 |
-
msgctxt "post state"
|
630 |
-
msgid "Pending"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
634 |
-
msgid "Sticky"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
638 |
-
msgid "Scheduled"
|
639 |
-
msgstr ""
|
640 |
-
|
641 |
-
#: ../pointers.php:68
|
642 |
-
msgid "Get started"
|
643 |
-
msgstr "Beginne"
|
644 |
-
|
645 |
-
#: ../pointers.php:69
|
646 |
-
msgid ""
|
647 |
-
"You've just installed Content Aware Sidebars!\n"
|
648 |
-
"\n"
|
649 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
650 |
-
"\n"
|
651 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
652 |
-
msgstr "Du hast soeben Content Aware Sidebars installiert! \n\nContent Aware Sidebars bietet eine Menge an Optionen, so dass es auf den ersten Blick überwältigend aussehen mag. Doch keine Sorge.\n\nKlicke auf Tour-Starten um eine kurze Einführung zu sehen und zu erfahren, wie Du eine Sidebar genau dann anzeigst, wie Du es willst."
|
653 |
-
|
654 |
-
#: ../pointers.php:76
|
655 |
-
msgid "Start Tour"
|
656 |
-
msgstr "Tour starten"
|
657 |
-
|
658 |
-
#: ../pointers.php:78
|
659 |
-
msgid "Not now"
|
660 |
-
msgstr "später"
|
661 |
-
|
662 |
-
#: ../pointers.php:83
|
663 |
-
msgid ""
|
664 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
665 |
-
"\n"
|
666 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
667 |
-
"\n"
|
668 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
669 |
-
msgstr "Erstelle eine Gruppe mit Bedingungen um eine Sidebar kontextuell einzubinden.\n\nBedingungsgruppen sind voneinander getrennt, so dass eine Sidebar sehr unterschiedlichen Bedingungen unterliegen kann.\n\nEine negierte Gruppe bedeutet, dass die Sidebar überall ausser bei jener negierten Bedingung angezeigt wird."
|
670 |
-
|
671 |
-
#: ../pointers.php:92
|
672 |
-
msgid "Content and contexts"
|
673 |
-
msgstr "Inhalt und Kontext"
|
674 |
-
|
675 |
-
#: ../pointers.php:93
|
676 |
-
msgid ""
|
677 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
678 |
-
"\n"
|
679 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
680 |
-
"\n"
|
681 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
682 |
-
msgstr "Hier findest Du alle Inhalte auf deiner Seite die Content Aware Sidebars standardmäßig unterstützt.\n\nWähle einfach die Inhalte bei welchen Du die Sidebar anzeigen möchtest und füge sie der Gruppe hinzu.\n\nDu kannst sogar verbundene Inhalte in einer Gruppe kombinieren; versuche einfach einmal \"Alle Beiträge\", eine Kategorie und ein Autor auszuwählen. Phantastisch!"
|
683 |
-
|
684 |
-
#: ../pointers.php:102
|
685 |
-
msgid "Options, options"
|
686 |
-
msgstr "Optionen"
|
687 |
-
|
688 |
-
#: ../pointers.php:103
|
689 |
-
msgid ""
|
690 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
691 |
-
"\n"
|
692 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
693 |
-
"\n"
|
694 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
695 |
-
"\n"
|
696 |
-
" You are in control."
|
697 |
-
msgstr "Soll die Sidebar auf Einzel-Seiten und/oder den Archiven-Seiten dargestellt werden?\n\nSoll sie sich mit einer anderen Sidebar verbinden oder jene ersetzten? Vielleicht willst Du sie auch manuell in deinen Inhalt einbinden mittels Shortcode.\n\nPlane die Veröffentlichung deiner Sidebar genau wie bei Beiträgen und Seiten, oder setze die Sichtbarkeit auf \"privat\" so dass sie nur für eingeloggte Benutzer sichtbar ist.\n\nDu hast die Kontrolle."
|
698 |
-
|
699 |
-
#: ../pointers.php:112
|
700 |
-
msgid "Help and Support"
|
701 |
-
msgstr "Hilfe und Support"
|
702 |
-
|
703 |
-
#: ../pointers.php:113
|
704 |
-
msgid ""
|
705 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
706 |
-
"\n"
|
707 |
-
"If you need more help, click on the \"Help\" tab here."
|
708 |
-
msgstr "Das war's! Jetzt kannst Du los legen, Sidebars erstellen und genau nach deinen Bedingungen anzeigen.\n\nWenn Du weitere Hilfe benötigst, klick auf den \"Hilfe\" Tab hier."
|
709 |
-
|
710 |
-
#: ../pointers.php:142
|
711 |
-
msgid "Close"
|
712 |
-
msgstr "schließen"
|
713 |
-
|
714 |
-
#: ../pointers.php:143
|
715 |
-
msgid "Next"
|
716 |
-
msgstr "weiter"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Andreas Kuhl <mail@andreas-kuhl.de>, 2014
|
5 |
+
# Christine Graber, 2015
|
6 |
+
# Henrik Heil <contact@henrikheil.net>, 2014
|
7 |
+
# mcpitten <mcpitten@web.de>, 2015
|
8 |
+
# Michael Stollmann <18micha48@gmail.com>, 2015
|
9 |
+
# TheFluffyDonkey, 2015
|
10 |
+
msgid ""
|
11 |
+
msgstr ""
|
12 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
13 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
14 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
15 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
16 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
17 |
+
"Language-Team: German (Germany) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/de_DE/)\n"
|
18 |
+
"MIME-Version: 1.0\n"
|
19 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
20 |
+
"Content-Transfer-Encoding: 8bit\n"
|
21 |
+
"Language: de_DE\n"
|
22 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
23 |
+
"X-Generator: Poedit 1.7.6\n"
|
24 |
+
"X-Poedit-Basepath: .\n"
|
25 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
26 |
+
"X-Poedit-SearchPath-0: .\n"
|
27 |
+
"X-Poedit-SearchPath-1: ..\n"
|
28 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
29 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
30 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
31 |
+
"X-Textdomain-Support: yes\n"
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:95
|
34 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
35 |
+
msgstr "Sidebars abhängig vom dargestellten Inhalt einblenden und verwalten."
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
38 |
+
msgid "Content Aware Sidebars"
|
39 |
+
msgstr "Content Aware Sidebars"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:97
|
42 |
+
msgid "Import"
|
43 |
+
msgstr "Importieren"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
46 |
+
msgid "FAQ"
|
47 |
+
msgstr "FAQ"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:256
|
50 |
+
msgid "Exposure"
|
51 |
+
msgstr "Darstellung"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:260
|
54 |
+
msgid "Singular"
|
55 |
+
msgstr "Beitragsseite"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:261
|
58 |
+
msgid "Singular & Archive"
|
59 |
+
msgstr "Beitrags- & Archivseite"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:262
|
62 |
+
msgid "Archive"
|
63 |
+
msgstr "Archivseite"
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
66 |
+
msgctxt "option"
|
67 |
+
msgid "Handle"
|
68 |
+
msgstr "Funktion"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:271
|
71 |
+
msgid "Replace"
|
72 |
+
msgstr "Ersetze"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:272
|
75 |
+
msgid "Merge"
|
76 |
+
msgstr "Verbinde"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:273
|
79 |
+
msgid "Manual"
|
80 |
+
msgstr "Handbuch"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:274
|
83 |
+
msgid "Forced replace"
|
84 |
+
msgstr "Erzwungene Ersetzung"
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:276
|
87 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
88 |
+
msgstr "Haupt-Sidebar ersetzen, mit Haupt-Sidebar verbinden oder manuell hinzufügen."
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:280
|
91 |
+
msgid "Host Sidebar"
|
92 |
+
msgstr "Haupt-Sidebar"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:287
|
95 |
+
msgid "Merge Position"
|
96 |
+
msgstr "Zusammenführen von Position"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:291
|
99 |
+
msgid "Top"
|
100 |
+
msgstr "Oberhalb"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:292
|
103 |
+
msgid "Bottom"
|
104 |
+
msgstr "Unterhalb"
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:294
|
107 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
108 |
+
msgstr "Sidebar bem Verbinden ober- oder unterhalb der Haupt-Sidebar platzieren."
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:309
|
111 |
+
msgid "Sidebars"
|
112 |
+
msgstr "Sidebars"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:310
|
115 |
+
msgid "Sidebar"
|
116 |
+
msgstr "Sidebar"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:311
|
119 |
+
msgctxt "sidebar"
|
120 |
+
msgid "Add New"
|
121 |
+
msgstr "Neu hinzufügen"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:312
|
124 |
+
msgid "Add New Sidebar"
|
125 |
+
msgstr "Neue Sidebar hinzufügen"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:313
|
128 |
+
msgid "Edit Sidebar"
|
129 |
+
msgstr "Sidebar bearbeiten"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:314
|
132 |
+
msgid "New Sidebar"
|
133 |
+
msgstr "Neue Sidebar"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:315
|
136 |
+
msgid "All Sidebars"
|
137 |
+
msgstr "Alle Sidebars"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:316
|
140 |
+
msgid "View Sidebar"
|
141 |
+
msgstr "Sidebar ansehen"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:317
|
144 |
+
msgid "Search Sidebars"
|
145 |
+
msgstr "Sidebars durchsuchen"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:318
|
148 |
+
msgid "No sidebars found"
|
149 |
+
msgstr "Keine Sidebars gefunden"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:319
|
152 |
+
msgid "No sidebars found in Trash"
|
153 |
+
msgstr "Keine Sidebars im Papierkorb gefunden"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:321
|
156 |
+
msgid "Display sidebar with"
|
157 |
+
msgstr "Sidebar anzeigen bei"
|
158 |
+
|
159 |
+
#: ../content-aware-sidebars.php:322
|
160 |
+
msgid ""
|
161 |
+
"No content. Please add at least one condition group to make the sidebar "
|
162 |
+
"content aware."
|
163 |
+
msgstr "Kein Inhalt vorhanden. Bitte erstelle mindestens eine Gruppe um die Sidebar inhaltsabhängig darstellen zu können."
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
166 |
+
msgid "Manage widgets"
|
167 |
+
msgstr "Widgets verwalten"
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
170 |
+
msgid "Sidebar updated."
|
171 |
+
msgstr "Sidebar wurde aktualisiert."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:361
|
174 |
+
msgid "Sidebar published."
|
175 |
+
msgstr "Sidebar wurde publiziert."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:362
|
178 |
+
msgid "Sidebar saved."
|
179 |
+
msgstr "Sidebar wurde gespeichert."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:363
|
182 |
+
msgid "Sidebar submitted."
|
183 |
+
msgstr "Sidebar wurde übertragen."
|
184 |
+
|
185 |
+
#: ../content-aware-sidebars.php:364
|
186 |
+
#, php-format
|
187 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
188 |
+
msgstr "Sidebar wurde eingeplant für: <strong>%1$s</strong>."
|
189 |
+
|
190 |
+
#. translators: Publish box date format, see http://php.net/date
|
191 |
+
#: ../content-aware-sidebars.php:366
|
192 |
+
msgid "M j, Y @ G:i"
|
193 |
+
msgstr "j. M Y @ G:i"
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:367
|
196 |
+
msgid "Sidebar draft updated."
|
197 |
+
msgstr "Sidebar-Entwurf aktualisiert."
|
198 |
+
|
199 |
+
#: ../content-aware-sidebars.php:383
|
200 |
+
#, php-format
|
201 |
+
msgid "%s sidebar updated."
|
202 |
+
msgid_plural "%s sidebars updated."
|
203 |
+
msgstr[0] ""
|
204 |
+
msgstr[1] ""
|
205 |
+
|
206 |
+
#: ../content-aware-sidebars.php:384
|
207 |
+
#, php-format
|
208 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
209 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
210 |
+
msgstr[0] ""
|
211 |
+
msgstr[1] ""
|
212 |
+
|
213 |
+
#: ../content-aware-sidebars.php:385
|
214 |
+
#, php-format
|
215 |
+
msgid "%s sidebar permanently deleted."
|
216 |
+
msgid_plural "%s sidebars permanently deleted."
|
217 |
+
msgstr[0] ""
|
218 |
+
msgstr[1] ""
|
219 |
+
|
220 |
+
#: ../content-aware-sidebars.php:386
|
221 |
+
#, php-format
|
222 |
+
msgid "%s sidebar moved to the Trash."
|
223 |
+
msgid_plural "%s sidebars moved to the Trash."
|
224 |
+
msgstr[0] ""
|
225 |
+
msgstr[1] ""
|
226 |
+
|
227 |
+
#: ../content-aware-sidebars.php:387
|
228 |
+
#, php-format
|
229 |
+
msgid "%s sidebar restored from the Trash."
|
230 |
+
msgid_plural "%s sidebars restored from the Trash."
|
231 |
+
msgstr[0] ""
|
232 |
+
msgstr[1] ""
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
235 |
+
msgid "Please update Host Sidebar"
|
236 |
+
msgstr "Bitte Haupt-Sidebar aktualisieren."
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:472
|
239 |
+
msgid "Merge position"
|
240 |
+
msgstr "Position bei verbinden"
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:473
|
243 |
+
msgid "Widgets"
|
244 |
+
msgstr "Widgets"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:586
|
247 |
+
msgid "Manage Widgets"
|
248 |
+
msgstr "Widgetverwaltung"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:756
|
251 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
252 |
+
msgstr "Erhalte ein kostenloses Content Aware Sidebars Premium Bundle"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:772
|
255 |
+
msgid "Options"
|
256 |
+
msgstr "Optionen"
|
257 |
+
|
258 |
+
#: ../content-aware-sidebars.php:795
|
259 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
260 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
261 |
+
msgid "Condition Groups"
|
262 |
+
msgstr "Gruppen"
|
263 |
+
|
264 |
+
#: ../content-aware-sidebars.php:796
|
265 |
+
msgid ""
|
266 |
+
"Each created condition group describe some specific content (conditions) "
|
267 |
+
"that the current sidebar should be displayed with."
|
268 |
+
msgstr "Jede erstellte Gruppe beschreibt einige spezifische Content-Bedingungen unter welchen die aktuelle Sidebar angzeigt werden soll."
|
269 |
+
|
270 |
+
#: ../content-aware-sidebars.php:797
|
271 |
+
msgid ""
|
272 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
273 |
+
" groups themselves use logical disjunction. This means that content added to"
|
274 |
+
" a group should be associated, as they are treated as such, and that the "
|
275 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
276 |
+
"extremely focused and at the same time distinct conditions."
|
277 |
+
msgstr "Content, der zu einer Gruppe hinzugefügt wird, benutzt logische UND Verknüpfungen, während die Gruppe selbst logische ODER Verknüpfungen verwendet. Das bedeutet, dass der einer Gruppe hinzugefügte Content thematisch zugehörig sein sollte und die Gruppen sich nicht gegenseitig beeinflussen sollten. Somit ist es möglich, gleichzeitig extrem spitze als auch eindeutige Bedingungen zu haben."
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:800
|
280 |
+
msgid "More Information"
|
281 |
+
msgstr "Weitere Informationen"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
284 |
+
msgid "Get Support"
|
285 |
+
msgstr "Erhalte Support"
|
286 |
+
|
287 |
+
#: ../content-aware-sidebars.php:816
|
288 |
+
msgid ""
|
289 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
290 |
+
" of the upcoming Premium Bundle*!"
|
291 |
+
msgstr "Übersetze Content Aware Sidebars in deine Sprache und werde ein BETA-Tester für das bald erscheinende Premium Bundle*!"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:817
|
294 |
+
msgid "Translate Now"
|
295 |
+
msgstr "Jetzt übersetzen"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:818
|
298 |
+
msgid "Get Premium Bundle"
|
299 |
+
msgstr "Premium Bundle holen"
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:819
|
302 |
+
msgid ""
|
303 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
304 |
+
msgstr "Verwendung für eine einzelne Site. BETA bedeutet, dass der Gebrauch für Produktivseiten nicht empfohlen wird."
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:822
|
307 |
+
msgid "Partial Feature List"
|
308 |
+
msgstr "Unvollständige Feature Liste"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:824
|
311 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
312 |
+
msgstr "Wähle und erstelle Sidebars in der Bearbeitungsansicht von Beiträgen."
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:825
|
315 |
+
msgid "Display sidebars with URLs using wildcards"
|
316 |
+
msgstr "Zeige Sidebars mit URLs, die Wildcards beinthalten"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:826
|
319 |
+
msgid "Display sidebars with User Roles"
|
320 |
+
msgstr "Zeige Sidebars mit Benutzerrollen"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:827
|
323 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
324 |
+
msgstr "Zeige Sidebars mit BuddyPress Benutzergruppen"
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:828
|
327 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
328 |
+
msgstr "Sidebars Spalte in Beiträgen und Taxonomieübersichten"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
331 |
+
msgid "Order"
|
332 |
+
msgstr "Bestellung"
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:880
|
335 |
+
msgid "Give a review on WordPress.org"
|
336 |
+
msgstr ""
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
339 |
+
msgid "Translate the plugin into your language"
|
340 |
+
msgstr "Übersetze das Plugin in deine Sprache"
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:884
|
343 |
+
msgid "Read the FAQ"
|
344 |
+
msgstr ""
|
345 |
+
|
346 |
+
#: ../content-aware-sidebars.php:899
|
347 |
+
msgid ""
|
348 |
+
"If you love this plugin, please consider donating to support future "
|
349 |
+
"development."
|
350 |
+
msgstr "Wenn du dieses Plugin magst, dann würde sich der Autor über eine Spende freuen."
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:908
|
353 |
+
msgid "Or you could:"
|
354 |
+
msgstr "Weitere Möglichkeiten:"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:910
|
357 |
+
msgid "Rate the plugin on WordPress.org"
|
358 |
+
msgstr "Dieses Plugin bei WordPress.org bewerten"
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:911
|
361 |
+
msgid "Link to the plugin page"
|
362 |
+
msgstr "Link zur Plugin-Seite"
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1045
|
365 |
+
msgid "Filter Sidebars"
|
366 |
+
msgstr "Sidebars filtern"
|
367 |
+
|
368 |
+
#: ../content-aware-sidebars.php:1046
|
369 |
+
msgid "Filter Widgets"
|
370 |
+
msgstr ""
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
373 |
+
msgid "Condition Group"
|
374 |
+
msgstr "Gruppe"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
377 |
+
msgctxt "group"
|
378 |
+
msgid "Add New"
|
379 |
+
msgstr "Neu erstellen"
|
380 |
+
|
381 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
382 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
383 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
384 |
+
msgid "Add New Group"
|
385 |
+
msgstr "Erstelle neue Gruppe"
|
386 |
+
|
387 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
388 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
389 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
390 |
+
msgctxt "group"
|
391 |
+
msgid "Edit"
|
392 |
+
msgstr "Bearbeiten"
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
396 |
+
msgid "No Groups found"
|
397 |
+
msgstr "keine Gruppen gefunden"
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
400 |
+
msgctxt "condition group"
|
401 |
+
msgid "Negated"
|
402 |
+
msgstr "verwerfe"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
405 |
+
msgid "Content"
|
406 |
+
msgstr "Inhalt"
|
407 |
+
|
408 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
411 |
+
msgid "Unauthorized request"
|
412 |
+
msgstr "Unerlaubter Zugriff"
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
415 |
+
msgid "Condition group cannot be empty"
|
416 |
+
msgstr "Die Gruppe darf nicht leer sein"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
419 |
+
msgid "Condition group saved"
|
420 |
+
msgstr "Gruppe wurde gesichert"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
423 |
+
msgid "Condition group could not be removed"
|
424 |
+
msgstr "Gruppe konnte nicht entfernt werden"
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
427 |
+
msgid "Condition group removed"
|
428 |
+
msgstr "Gruppe wurde entfernt"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Save"
|
433 |
+
msgstr "Sichern"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
437 |
+
msgid "Cancel"
|
438 |
+
msgstr "Abbrechen"
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
441 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
442 |
+
msgid "Or"
|
443 |
+
msgstr "Oder"
|
444 |
+
|
445 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
446 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
447 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
448 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
449 |
+
msgid "And"
|
450 |
+
msgstr ""
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
453 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
454 |
+
msgid "Remove"
|
455 |
+
msgstr "Löschen"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
458 |
+
msgid "Remove this group and its contents permanently?"
|
459 |
+
msgstr "Diese Gruppe und seine Inhalte unwiderruflich löschen?"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
462 |
+
msgid "No results found."
|
463 |
+
msgstr "Keine Ergebnisse gefunden."
|
464 |
+
|
465 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
466 |
+
msgid ""
|
467 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
468 |
+
"these changes?"
|
469 |
+
msgstr "Die aktuelle Gruppe wurde geändert. Möchtest du die Änderungen speichern oder die Änderungen verwerfen?"
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
473 |
+
msgid "Negate group"
|
474 |
+
msgstr "verwerfe Gruppe"
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target all but this context"
|
479 |
+
msgstr "Auf alles ausser diesen Kontext anwenden"
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
482 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
483 |
+
msgid "Target this context"
|
484 |
+
msgstr "Auf diesen Kontext anwenden"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
487 |
+
msgid "Authors"
|
488 |
+
msgstr "Autoren"
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
491 |
+
#, php-format
|
492 |
+
msgid "Display with All %s"
|
493 |
+
msgstr "Anzeige aller %s"
|
494 |
+
|
495 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
496 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
497 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
498 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
499 |
+
msgid "View All"
|
500 |
+
msgstr "Alle anzeigen"
|
501 |
+
|
502 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
503 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
504 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
505 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
506 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
507 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
508 |
+
msgid "Search"
|
509 |
+
msgstr "Suche"
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
512 |
+
msgid "bbPress User Profiles"
|
513 |
+
msgstr "bbPress Benutzerprofile"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
516 |
+
msgid "BuddyPress Members"
|
517 |
+
msgstr "BuddyPress Mitglieder"
|
518 |
+
|
519 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
520 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
521 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
522 |
+
msgid "Add to Group"
|
523 |
+
msgstr "Zur Gruppe hinzufügen"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
526 |
+
msgid "Dates"
|
527 |
+
msgstr "Termine"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
530 |
+
msgid "Date Archives"
|
531 |
+
msgstr "Terminarchiv"
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
534 |
+
msgid "Page Templates"
|
535 |
+
msgstr "Seitenvorlage"
|
536 |
+
|
537 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
538 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
539 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
540 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
541 |
+
msgid "Languages"
|
542 |
+
msgstr "Sprachen"
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
545 |
+
msgid "Post Types"
|
546 |
+
msgstr "Post Types"
|
547 |
+
|
548 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
549 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
550 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
551 |
+
msgid "Automatically select new children of a selected ancestor"
|
552 |
+
msgstr "Neue untergeordnete Einträge automatisch markieren"
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
555 |
+
msgid "Automatically add new children of a selected ancestor"
|
556 |
+
msgstr "Neue Unterelemente eines ausgewählten Elements automatisch hinzufügen"
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
559 |
+
#, php-format
|
560 |
+
msgid "%s Archives"
|
561 |
+
msgstr "%s Archiv"
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
564 |
+
msgid "Blog Page"
|
565 |
+
msgstr "Beitrags Seite"
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
568 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
569 |
+
msgid "No items."
|
570 |
+
msgstr "Keine Elemente."
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
573 |
+
msgid "Most Recent"
|
574 |
+
msgstr "Neueste"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
577 |
+
msgid "Static Pages"
|
578 |
+
msgstr "Statische Seiten"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
581 |
+
msgid "Front Page"
|
582 |
+
msgstr "Titelseite"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
585 |
+
msgid "Search Results"
|
586 |
+
msgstr "Suchergebnisse"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
589 |
+
msgid "404 Page"
|
590 |
+
msgstr "404 Seite"
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
593 |
+
msgid "Taxonomies"
|
594 |
+
msgstr "Taxonomien"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
597 |
+
msgid "Most Used"
|
598 |
+
msgstr "Am häufigsten benutzt"
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
601 |
+
msgid "Conditional Content"
|
602 |
+
msgstr ""
|
603 |
+
|
604 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
605 |
+
msgid ""
|
606 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
607 |
+
" it. In each group, you can combine different types of associated content."
|
608 |
+
msgstr "Klicke \"Bearbeiten\" um eine Gruppe auszuwählen oder lege eine neue Gruppe an. Wähle links den Inhalt aus und klicke auf \"Zur Gruppe hinzufügen\" um ihn der Gruppe zuzuordnen. In jeder Gruppe können verschiedene Inhaltstypen kombiniert werden."
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
611 |
+
#, php-format
|
612 |
+
msgid "All %s"
|
613 |
+
msgstr "Alle %s"
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
616 |
+
msgid "Password protected"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
620 |
+
msgid "Private"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
624 |
+
msgid "Draft"
|
625 |
+
msgstr ""
|
626 |
+
|
627 |
+
#. translators: post state
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
629 |
+
msgctxt "post state"
|
630 |
+
msgid "Pending"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
634 |
+
msgid "Sticky"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
638 |
+
msgid "Scheduled"
|
639 |
+
msgstr ""
|
640 |
+
|
641 |
+
#: ../pointers.php:68
|
642 |
+
msgid "Get started"
|
643 |
+
msgstr "Beginne"
|
644 |
+
|
645 |
+
#: ../pointers.php:69
|
646 |
+
msgid ""
|
647 |
+
"You've just installed Content Aware Sidebars!\n"
|
648 |
+
"\n"
|
649 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
650 |
+
"\n"
|
651 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
652 |
+
msgstr "Du hast soeben Content Aware Sidebars installiert! \n\nContent Aware Sidebars bietet eine Menge an Optionen, so dass es auf den ersten Blick überwältigend aussehen mag. Doch keine Sorge.\n\nKlicke auf Tour-Starten um eine kurze Einführung zu sehen und zu erfahren, wie Du eine Sidebar genau dann anzeigst, wie Du es willst."
|
653 |
+
|
654 |
+
#: ../pointers.php:76
|
655 |
+
msgid "Start Tour"
|
656 |
+
msgstr "Tour starten"
|
657 |
+
|
658 |
+
#: ../pointers.php:78
|
659 |
+
msgid "Not now"
|
660 |
+
msgstr "später"
|
661 |
+
|
662 |
+
#: ../pointers.php:83
|
663 |
+
msgid ""
|
664 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
665 |
+
"\n"
|
666 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
667 |
+
"\n"
|
668 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
669 |
+
msgstr "Erstelle eine Gruppe mit Bedingungen um eine Sidebar kontextuell einzubinden.\n\nBedingungsgruppen sind voneinander getrennt, so dass eine Sidebar sehr unterschiedlichen Bedingungen unterliegen kann.\n\nEine negierte Gruppe bedeutet, dass die Sidebar überall ausser bei jener negierten Bedingung angezeigt wird."
|
670 |
+
|
671 |
+
#: ../pointers.php:92
|
672 |
+
msgid "Content and contexts"
|
673 |
+
msgstr "Inhalt und Kontext"
|
674 |
+
|
675 |
+
#: ../pointers.php:93
|
676 |
+
msgid ""
|
677 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
678 |
+
"\n"
|
679 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
680 |
+
"\n"
|
681 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
682 |
+
msgstr "Hier findest Du alle Inhalte auf deiner Seite die Content Aware Sidebars standardmäßig unterstützt.\n\nWähle einfach die Inhalte bei welchen Du die Sidebar anzeigen möchtest und füge sie der Gruppe hinzu.\n\nDu kannst sogar verbundene Inhalte in einer Gruppe kombinieren; versuche einfach einmal \"Alle Beiträge\", eine Kategorie und ein Autor auszuwählen. Phantastisch!"
|
683 |
+
|
684 |
+
#: ../pointers.php:102
|
685 |
+
msgid "Options, options"
|
686 |
+
msgstr "Optionen"
|
687 |
+
|
688 |
+
#: ../pointers.php:103
|
689 |
+
msgid ""
|
690 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
691 |
+
"\n"
|
692 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
693 |
+
"\n"
|
694 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
695 |
+
"\n"
|
696 |
+
" You are in control."
|
697 |
+
msgstr "Soll die Sidebar auf Einzel-Seiten und/oder den Archiven-Seiten dargestellt werden?\n\nSoll sie sich mit einer anderen Sidebar verbinden oder jene ersetzten? Vielleicht willst Du sie auch manuell in deinen Inhalt einbinden mittels Shortcode.\n\nPlane die Veröffentlichung deiner Sidebar genau wie bei Beiträgen und Seiten, oder setze die Sichtbarkeit auf \"privat\" so dass sie nur für eingeloggte Benutzer sichtbar ist.\n\nDu hast die Kontrolle."
|
698 |
+
|
699 |
+
#: ../pointers.php:112
|
700 |
+
msgid "Help and Support"
|
701 |
+
msgstr "Hilfe und Support"
|
702 |
+
|
703 |
+
#: ../pointers.php:113
|
704 |
+
msgid ""
|
705 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
706 |
+
"\n"
|
707 |
+
"If you need more help, click on the \"Help\" tab here."
|
708 |
+
msgstr "Das war's! Jetzt kannst Du los legen, Sidebars erstellen und genau nach deinen Bedingungen anzeigen.\n\nWenn Du weitere Hilfe benötigst, klick auf den \"Hilfe\" Tab hier."
|
709 |
+
|
710 |
+
#: ../pointers.php:142
|
711 |
+
msgid "Close"
|
712 |
+
msgstr "schließen"
|
713 |
+
|
714 |
+
#: ../pointers.php:143
|
715 |
+
msgid "Next"
|
716 |
+
msgstr "weiter"
|
lang/content-aware-sidebars-el.po
CHANGED
@@ -1,712 +1,712 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Dimitris katsanis <dimikats1@gmail.com>, 2015
|
5 |
-
# Panagiotis Tabakis <tabakisp@gmail.com>, 2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Greek (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/el/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: el\n"
|
18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Διαχειριστείτε και εμφανίστε πλευρικές μπάρες, σύμφωνα με το περιεχόμενο που προβάλλεται."
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr ""
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "Εισαγωγή"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "Συχνές Ερωτήσεις"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Εμφάνιση"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Μονές Σελίδες"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Μονές Σελίδες και Σελίδες Αρχείων"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Αρχείο"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Τρόπος εμφάνισης"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Αντικατάσταση"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Συγχώνευση"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Χειροκίνητα"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Υποχρεωτική αντικατάσταση"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr ""
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr ""
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "Συγχώνευση θέσης"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Κορυφή (Top)"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Βάση (bottom)"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Τοποθετήστε το Sidebar στην Κορυφή ή στη Βάση όταν κάνετε συγχώνευση."
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr ""
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr ""
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Προσθήκη νέου "
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Προσθήκη νέου sidebar"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Επεξεργασία sidebar"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Νέο sidebar"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Όλα τα sidebar"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Προβολή sidebar"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Αναζήτηση sidebar"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "Δεν βρέθηκαν sidebar"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "Δεν βρέθηκαν sidebar στο Καλάθι Απορριμάτων"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Προβολή sidebar μαζί με"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Δεν υπάρχει περιεχόμενο. Παρακαλούμε, εισάγετε τουλάχιστον ένα γκρουπ, ώστε να κάνετε το sidebar content aware."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Διαχείριση widgets"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "To sidebar ενημερώθηκε"
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Το sidebar δημοσιεύθηκε"
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Το sidebar αποθηκεύθηκε"
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Το sidebar υποβλήθηκε."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Το Sidebar έχει προγραμματιστεί για: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr ""
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Το draft sidebar ενημερώθηκε."
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
msgstr[1] ""
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] ""
|
207 |
-
msgstr[1] ""
|
208 |
-
|
209 |
-
#: ../content-aware-sidebars.php:385
|
210 |
-
#, php-format
|
211 |
-
msgid "%s sidebar permanently deleted."
|
212 |
-
msgid_plural "%s sidebars permanently deleted."
|
213 |
-
msgstr[0] ""
|
214 |
-
msgstr[1] ""
|
215 |
-
|
216 |
-
#: ../content-aware-sidebars.php:386
|
217 |
-
#, php-format
|
218 |
-
msgid "%s sidebar moved to the Trash."
|
219 |
-
msgid_plural "%s sidebars moved to the Trash."
|
220 |
-
msgstr[0] ""
|
221 |
-
msgstr[1] ""
|
222 |
-
|
223 |
-
#: ../content-aware-sidebars.php:387
|
224 |
-
#, php-format
|
225 |
-
msgid "%s sidebar restored from the Trash."
|
226 |
-
msgid_plural "%s sidebars restored from the Trash."
|
227 |
-
msgstr[0] ""
|
228 |
-
msgstr[1] ""
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
-
msgid "Please update Host Sidebar"
|
232 |
-
msgstr "Παρακαλούμε, ενημερώστε το Host Sidebar"
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:472
|
235 |
-
msgid "Merge position"
|
236 |
-
msgstr "Συγχώνευση θέσης"
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:473
|
239 |
-
msgid "Widgets"
|
240 |
-
msgstr ""
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:586
|
243 |
-
msgid "Manage Widgets"
|
244 |
-
msgstr "Διαχείριση Widgets"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:756
|
247 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
-
msgstr "Λάβετε δωρεάν ένα Content Aware Sidebars Premium Bundle"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:772
|
251 |
-
msgid "Options"
|
252 |
-
msgstr "Επιλογές"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:795
|
255 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
-
msgid "Condition Groups"
|
258 |
-
msgstr ""
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:796
|
261 |
-
msgid ""
|
262 |
-
"Each created condition group describe some specific content (conditions) "
|
263 |
-
"that the current sidebar should be displayed with."
|
264 |
-
msgstr "Κάθε νέο Condition group που δημιουργείτε χρησιμεύει στο να ορίζετε τις τοποθεσίες (προΰποθέσεις) που θα εμφανίζεται το παρόν sidebar."
|
265 |
-
|
266 |
-
#: ../content-aware-sidebars.php:797
|
267 |
-
msgid ""
|
268 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
-
" groups themselves use logical disjunction. This means that content added to"
|
270 |
-
" a group should be associated, as they are treated as such, and that the "
|
271 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
-
"extremely focused and at the same time distinct conditions."
|
273 |
-
msgstr ""
|
274 |
-
|
275 |
-
#: ../content-aware-sidebars.php:800
|
276 |
-
msgid "More Information"
|
277 |
-
msgstr "Περισσότερες πληροφορίες"
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
-
msgid "Get Support"
|
281 |
-
msgstr "Ζητήστε βοήθεια"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:816
|
284 |
-
msgid ""
|
285 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
-
" of the upcoming Premium Bundle*!"
|
287 |
-
msgstr "Μεταφράστε το Content Aware Sidebars στη γλώσσα σας και γίνετε ένας BETA tester στο επερχόμενο Premium Bundle*!"
|
288 |
-
|
289 |
-
#: ../content-aware-sidebars.php:817
|
290 |
-
msgid "Translate Now"
|
291 |
-
msgstr "Μεταφράστε τώρα"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:818
|
294 |
-
msgid "Get Premium Bundle"
|
295 |
-
msgstr "Λήψη Premium Bundle"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:819
|
298 |
-
msgid ""
|
299 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
-
msgstr "Χρήση για μία ιστοσελίδα. Η έκδοση ΒΕΤΑ δεν προτείνεται για εν λειτουργία ιστοσελίδες."
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:822
|
303 |
-
msgid "Partial Feature List"
|
304 |
-
msgstr "Λίστα με μερικά από τα χαρακτηριστικά."
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:824
|
307 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
-
msgstr "Επιλέξτε και δημιουργήστε sidebars στην Οθόνη Επεξεργασίας Δημοσιεύσεων"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:825
|
311 |
-
msgid "Display sidebars with URLs using wildcards"
|
312 |
-
msgstr "Προβάλετε sidebars με URLs χρησιμοποιώντας wildcards"
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:826
|
315 |
-
msgid "Display sidebars with User Roles"
|
316 |
-
msgstr "Προβάλετε sidebars με User Roles"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:827
|
319 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
-
msgstr "Προβάλετε sidebars με BuddyPress User Groups"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:828
|
323 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
-
msgstr "Η στήλη προβολής των sidebar στις ενότητες που προβάλλονται οι Σελίδες, οι Δημοσιεύσεις, οι Κατηγορίες κ.λπ.."
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
-
msgid "Order"
|
328 |
-
msgstr "Υπόλοιπα"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:880
|
331 |
-
msgid "Give a review on WordPress.org"
|
332 |
-
msgstr ""
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
-
msgid "Translate the plugin into your language"
|
336 |
-
msgstr "Μεταφράστε το plugin στη γλώσσα σας"
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:884
|
339 |
-
msgid "Read the FAQ"
|
340 |
-
msgstr ""
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:899
|
343 |
-
msgid ""
|
344 |
-
"If you love this plugin, please consider donating to support future "
|
345 |
-
"development."
|
346 |
-
msgstr "Εάν σας αρέσει αυτό το plugin, μπορείτε να μας ενισχύσετε κάνοντας μία δωρεά ώστε να είναι δυνατή η συνέχιση της ανάπτυξής του."
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:908
|
349 |
-
msgid "Or you could:"
|
350 |
-
msgstr "Ή θα μπορούσατε:"
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:910
|
353 |
-
msgid "Rate the plugin on WordPress.org"
|
354 |
-
msgstr "Βαθμολογήστε το plugin στο WordPress.org"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:911
|
357 |
-
msgid "Link to the plugin page"
|
358 |
-
msgstr "Τοποθετήστε έναν σύνδεσμο προς τη σελίδα του plugin "
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:1045
|
361 |
-
msgid "Filter Sidebars"
|
362 |
-
msgstr "Φίλτρο Sidebars"
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1046
|
365 |
-
msgid "Filter Widgets"
|
366 |
-
msgstr ""
|
367 |
-
|
368 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
-
msgid "Condition Group"
|
370 |
-
msgstr ""
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
-
msgctxt "group"
|
374 |
-
msgid "Add New"
|
375 |
-
msgstr "Προσθήκη νέου"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
-
msgid "Add New Group"
|
381 |
-
msgstr "Προσθήκη νέου Group"
|
382 |
-
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
-
msgctxt "group"
|
387 |
-
msgid "Edit"
|
388 |
-
msgstr "Επεξεργασία"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
-
msgid "No Groups found"
|
393 |
-
msgstr "Δεν βρέθηκαν Groups"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
-
msgctxt "condition group"
|
397 |
-
msgid "Negated"
|
398 |
-
msgstr "Αναιρέθηκε"
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
-
msgid "Content"
|
402 |
-
msgstr "Περιεχόμενο"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
-
msgid "Unauthorized request"
|
408 |
-
msgstr "Μη εξουσιοδοτημένο αίτημα"
|
409 |
-
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
-
msgid "Condition group cannot be empty"
|
412 |
-
msgstr "Το Condition group δεν ήταν δυνατό να αφαιρεθεί"
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
-
msgid "Condition group saved"
|
416 |
-
msgstr "Το Condition group αποθηκεύθηκε"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
-
msgid "Condition group could not be removed"
|
420 |
-
msgstr "Το Condition group δεν ήταν δυνατό να αφαιρεθεί"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
-
msgid "Condition group removed"
|
424 |
-
msgstr "Το Condition group αφαιρέθηκε."
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Save"
|
429 |
-
msgstr "Αποθήκευση"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Cancel"
|
434 |
-
msgstr "Ακύρωση"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
-
msgid "Or"
|
439 |
-
msgstr "Ή"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
-
msgid "And"
|
446 |
-
msgstr ""
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
-
msgid "Remove"
|
451 |
-
msgstr "Αφαίρεση"
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
-
msgid "Remove this group and its contents permanently?"
|
455 |
-
msgstr "Να αφαιρεθεί οριστικά αυτό το group και τα περιεχόμενά του;"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
-
msgid "No results found."
|
459 |
-
msgstr "Δεν βρέθηκαν αποτελέσματα"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
-
msgid ""
|
463 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
-
"these changes?"
|
465 |
-
msgstr "Οι ρυθμίσεις του παρόντος group δεν έχουν αποθηκευθεί. Θέλετε να συνεχίσετε και να χάσετε αυτές τις ρυθμίσεις;"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
-
msgid "Negate group"
|
470 |
-
msgstr "Αναίρεση Group"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target all but this context"
|
475 |
-
msgstr "Στόχευση όλων εκτός από αυτό το περιεχόμενο"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target this context"
|
480 |
-
msgstr "Στόχευση αυτού του περιεχομένου"
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
-
msgid "Authors"
|
484 |
-
msgstr "Συντάκτες"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
-
#, php-format
|
488 |
-
msgid "Display with All %s"
|
489 |
-
msgstr "Προβολή με Όλα τα %s"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
-
msgid "View All"
|
496 |
-
msgstr "Προβολή Όλων"
|
497 |
-
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
-
msgid "Search"
|
505 |
-
msgstr "Αναζήτηση"
|
506 |
-
|
507 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
-
msgid "bbPress User Profiles"
|
509 |
-
msgstr ""
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
-
msgid "BuddyPress Members"
|
513 |
-
msgstr ""
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
-
msgid "Add to Group"
|
519 |
-
msgstr "Προσθήκη στο Group"
|
520 |
-
|
521 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
-
msgid "Dates"
|
523 |
-
msgstr "Ημερομηνίες"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
-
msgid "Date Archives"
|
527 |
-
msgstr "Αρχεία Ημέρας"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
-
msgid "Page Templates"
|
531 |
-
msgstr ""
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
-
msgid "Languages"
|
538 |
-
msgstr "Γλώσσες"
|
539 |
-
|
540 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
-
msgid "Post Types"
|
542 |
-
msgstr ""
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
-
msgid "Automatically select new children of a selected ancestor"
|
548 |
-
msgstr ""
|
549 |
-
|
550 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
-
msgid "Automatically add new children of a selected ancestor"
|
552 |
-
msgstr ""
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
-
#, php-format
|
556 |
-
msgid "%s Archives"
|
557 |
-
msgstr "%s Αρχεία"
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
-
msgid "Blog Page"
|
561 |
-
msgstr "Σελίδα Blog "
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
-
msgid "No items."
|
566 |
-
msgstr "Δεν υπάρχουν αντικείμενα."
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
-
msgid "Most Recent"
|
570 |
-
msgstr "Πιο Πρόσφατα"
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
-
msgid "Static Pages"
|
574 |
-
msgstr "Στατικές Σελίδες"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
-
msgid "Front Page"
|
578 |
-
msgstr "Αρχική Σελίδα"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
-
msgid "Search Results"
|
582 |
-
msgstr "Αποτελέσματα Αναζήτησης"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
-
msgid "404 Page"
|
586 |
-
msgstr "Σελίδα 404"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
-
msgid "Taxonomies"
|
590 |
-
msgstr ""
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
-
msgid "Most Used"
|
594 |
-
msgstr "Περισσότερο Χρησιμοποιημένα"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
-
msgid "Conditional Content"
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
-
msgid ""
|
602 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
-
" it. In each group, you can combine different types of associated content."
|
604 |
-
msgstr "Πατήστε εδώ για να διαχειριστείτε ένα group ή να δημιουργ΄ξησετε ένα νέο.Επιλέξτε περιεχόμενο από αριστερά για να το προσθέσετε στο group. Σε κάθε group, μπορείτε να συνδυάσετε διαφορετικούς τύπους περιεχομένου."
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
-
#, php-format
|
608 |
-
msgid "All %s"
|
609 |
-
msgstr "Όλα %s"
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
-
msgid "Password protected"
|
613 |
-
msgstr ""
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
-
msgid "Private"
|
617 |
-
msgstr ""
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
-
msgid "Draft"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#. translators: post state
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
-
msgctxt "post state"
|
626 |
-
msgid "Pending"
|
627 |
-
msgstr ""
|
628 |
-
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
-
msgid "Sticky"
|
631 |
-
msgstr ""
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
-
msgid "Scheduled"
|
635 |
-
msgstr ""
|
636 |
-
|
637 |
-
#: ../pointers.php:68
|
638 |
-
msgid "Get started"
|
639 |
-
msgstr "Ξεκινήστε"
|
640 |
-
|
641 |
-
#: ../pointers.php:69
|
642 |
-
msgid ""
|
643 |
-
"You've just installed Content Aware Sidebars!\n"
|
644 |
-
"\n"
|
645 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
-
"\n"
|
647 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
-
msgstr "Μόλις εγκαταστήσατε το Content Aware Sidebars!\n\nΣας παρέχει πολλές επιλογές, έτσι αυτή η οθόνη ίσως να σας φαίνεται κουραστική. Μην ανησυχείτ όμως!\n\nΠατήστε το κομβίο Εκκίνηση Παρουσίασης για να δείτε μία γρήγορη εισαγωγή και να μάθετε πως να εμφανίζετε ένα sidebar ακριβώς εκεί που θέλετε να εμφανιστεί."
|
649 |
-
|
650 |
-
#: ../pointers.php:76
|
651 |
-
msgid "Start Tour"
|
652 |
-
msgstr "Εκκίνηση Παρουσίασης"
|
653 |
-
|
654 |
-
#: ../pointers.php:78
|
655 |
-
msgid "Not now"
|
656 |
-
msgstr "Όχι τώρα"
|
657 |
-
|
658 |
-
#: ../pointers.php:83
|
659 |
-
msgid ""
|
660 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
-
"\n"
|
662 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
-
"\n"
|
664 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
-
msgstr "Για να γίνει ρυθμιστεί κάποιο sidebar σωστά και να γίνει λειτουργικό, πρέπει να ορίσετε το condition group στο οποίο αυτό θα εμφανίζεται.\n\nΤα Condition groups στα οποία θα εμφανίζεται το sidebar μπορούν να είναι πολλά και είναι ανεξάρτητα μεταξύ τους. \n\nΗ αναίρεση ενός group δεν θα έχει επίδραση στη συμπεριφορά του sidebar στα υπόλοιπα group."
|
666 |
-
|
667 |
-
#: ../pointers.php:92
|
668 |
-
msgid "Content and contexts"
|
669 |
-
msgstr "Περιεχόμενο και πλαίσια"
|
670 |
-
|
671 |
-
#: ../pointers.php:93
|
672 |
-
msgid ""
|
673 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
-
"\n"
|
675 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
-
"\n"
|
677 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
-
msgstr "Εδώ θα βρείτε όλο το περιεχόμενο της ιστοσελίδας σας το οποίο το Content Aware Sidebars υποστηρίζει και μπορεί να διαχειριστεί.\n\nΤο μόνο που πρέπει να κάνετε έιναι να επιλέξετε το περιεχόμενο το οποίο θέλετε να εμφανίζεται στο sidebar και να το προσθέσετε σε ένα Group.\n\nΜπορείτε επίσης να δημιουργήσετε συνδυαζόμενο περιεχόμενο για τα sidebars σας, όπως για παράδειγμα: επιλέξτε Όλες τις Δημοσιεύσεις, μίας Κατηγορίας και ενός Συντάκτη. Είναι πολύ εύκολο και εξαιρετικά χρήσιμο!"
|
679 |
-
|
680 |
-
#: ../pointers.php:102
|
681 |
-
msgid "Options, options"
|
682 |
-
msgstr "Επιλογές, επιλογές"
|
683 |
-
|
684 |
-
#: ../pointers.php:103
|
685 |
-
msgid ""
|
686 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
-
"\n"
|
688 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
-
"\n"
|
690 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
-
"\n"
|
692 |
-
" You are in control."
|
693 |
-
msgstr ""
|
694 |
-
|
695 |
-
#: ../pointers.php:112
|
696 |
-
msgid "Help and Support"
|
697 |
-
msgstr "Βοήθεια και Υποστήριξη"
|
698 |
-
|
699 |
-
#: ../pointers.php:113
|
700 |
-
msgid ""
|
701 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
-
"\n"
|
703 |
-
"If you need more help, click on the \"Help\" tab here."
|
704 |
-
msgstr ""
|
705 |
-
|
706 |
-
#: ../pointers.php:142
|
707 |
-
msgid "Close"
|
708 |
-
msgstr "Κλείσιμο"
|
709 |
-
|
710 |
-
#: ../pointers.php:143
|
711 |
-
msgid "Next"
|
712 |
-
msgstr "Επόμενο"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Dimitris katsanis <dimikats1@gmail.com>, 2015
|
5 |
+
# Panagiotis Tabakis <tabakisp@gmail.com>, 2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Greek (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/el/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: el\n"
|
18 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Διαχειριστείτε και εμφανίστε πλευρικές μπάρες, σύμφωνα με το περιεχόμενο που προβάλλεται."
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr ""
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "Εισαγωγή"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "Συχνές Ερωτήσεις"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Εμφάνιση"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Μονές Σελίδες"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Μονές Σελίδες και Σελίδες Αρχείων"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Αρχείο"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Τρόπος εμφάνισης"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Αντικατάσταση"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Συγχώνευση"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Χειροκίνητα"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Υποχρεωτική αντικατάσταση"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr ""
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr ""
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "Συγχώνευση θέσης"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Κορυφή (Top)"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Βάση (bottom)"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Τοποθετήστε το Sidebar στην Κορυφή ή στη Βάση όταν κάνετε συγχώνευση."
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr ""
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr ""
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Προσθήκη νέου "
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Προσθήκη νέου sidebar"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Επεξεργασία sidebar"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Νέο sidebar"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Όλα τα sidebar"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Προβολή sidebar"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Αναζήτηση sidebar"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "Δεν βρέθηκαν sidebar"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "Δεν βρέθηκαν sidebar στο Καλάθι Απορριμάτων"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Προβολή sidebar μαζί με"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Δεν υπάρχει περιεχόμενο. Παρακαλούμε, εισάγετε τουλάχιστον ένα γκρουπ, ώστε να κάνετε το sidebar content aware."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Διαχείριση widgets"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "To sidebar ενημερώθηκε"
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Το sidebar δημοσιεύθηκε"
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Το sidebar αποθηκεύθηκε"
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Το sidebar υποβλήθηκε."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Το Sidebar έχει προγραμματιστεί για: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr ""
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Το draft sidebar ενημερώθηκε."
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
msgstr[1] ""
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] ""
|
207 |
+
msgstr[1] ""
|
208 |
+
|
209 |
+
#: ../content-aware-sidebars.php:385
|
210 |
+
#, php-format
|
211 |
+
msgid "%s sidebar permanently deleted."
|
212 |
+
msgid_plural "%s sidebars permanently deleted."
|
213 |
+
msgstr[0] ""
|
214 |
+
msgstr[1] ""
|
215 |
+
|
216 |
+
#: ../content-aware-sidebars.php:386
|
217 |
+
#, php-format
|
218 |
+
msgid "%s sidebar moved to the Trash."
|
219 |
+
msgid_plural "%s sidebars moved to the Trash."
|
220 |
+
msgstr[0] ""
|
221 |
+
msgstr[1] ""
|
222 |
+
|
223 |
+
#: ../content-aware-sidebars.php:387
|
224 |
+
#, php-format
|
225 |
+
msgid "%s sidebar restored from the Trash."
|
226 |
+
msgid_plural "%s sidebars restored from the Trash."
|
227 |
+
msgstr[0] ""
|
228 |
+
msgstr[1] ""
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
+
msgid "Please update Host Sidebar"
|
232 |
+
msgstr "Παρακαλούμε, ενημερώστε το Host Sidebar"
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:472
|
235 |
+
msgid "Merge position"
|
236 |
+
msgstr "Συγχώνευση θέσης"
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:473
|
239 |
+
msgid "Widgets"
|
240 |
+
msgstr ""
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:586
|
243 |
+
msgid "Manage Widgets"
|
244 |
+
msgstr "Διαχείριση Widgets"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:756
|
247 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
+
msgstr "Λάβετε δωρεάν ένα Content Aware Sidebars Premium Bundle"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:772
|
251 |
+
msgid "Options"
|
252 |
+
msgstr "Επιλογές"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:795
|
255 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
+
msgid "Condition Groups"
|
258 |
+
msgstr ""
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:796
|
261 |
+
msgid ""
|
262 |
+
"Each created condition group describe some specific content (conditions) "
|
263 |
+
"that the current sidebar should be displayed with."
|
264 |
+
msgstr "Κάθε νέο Condition group που δημιουργείτε χρησιμεύει στο να ορίζετε τις τοποθεσίες (προΰποθέσεις) που θα εμφανίζεται το παρόν sidebar."
|
265 |
+
|
266 |
+
#: ../content-aware-sidebars.php:797
|
267 |
+
msgid ""
|
268 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
+
" groups themselves use logical disjunction. This means that content added to"
|
270 |
+
" a group should be associated, as they are treated as such, and that the "
|
271 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
+
"extremely focused and at the same time distinct conditions."
|
273 |
+
msgstr ""
|
274 |
+
|
275 |
+
#: ../content-aware-sidebars.php:800
|
276 |
+
msgid "More Information"
|
277 |
+
msgstr "Περισσότερες πληροφορίες"
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
+
msgid "Get Support"
|
281 |
+
msgstr "Ζητήστε βοήθεια"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:816
|
284 |
+
msgid ""
|
285 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
+
" of the upcoming Premium Bundle*!"
|
287 |
+
msgstr "Μεταφράστε το Content Aware Sidebars στη γλώσσα σας και γίνετε ένας BETA tester στο επερχόμενο Premium Bundle*!"
|
288 |
+
|
289 |
+
#: ../content-aware-sidebars.php:817
|
290 |
+
msgid "Translate Now"
|
291 |
+
msgstr "Μεταφράστε τώρα"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:818
|
294 |
+
msgid "Get Premium Bundle"
|
295 |
+
msgstr "Λήψη Premium Bundle"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:819
|
298 |
+
msgid ""
|
299 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
+
msgstr "Χρήση για μία ιστοσελίδα. Η έκδοση ΒΕΤΑ δεν προτείνεται για εν λειτουργία ιστοσελίδες."
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:822
|
303 |
+
msgid "Partial Feature List"
|
304 |
+
msgstr "Λίστα με μερικά από τα χαρακτηριστικά."
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:824
|
307 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
+
msgstr "Επιλέξτε και δημιουργήστε sidebars στην Οθόνη Επεξεργασίας Δημοσιεύσεων"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:825
|
311 |
+
msgid "Display sidebars with URLs using wildcards"
|
312 |
+
msgstr "Προβάλετε sidebars με URLs χρησιμοποιώντας wildcards"
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:826
|
315 |
+
msgid "Display sidebars with User Roles"
|
316 |
+
msgstr "Προβάλετε sidebars με User Roles"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:827
|
319 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
+
msgstr "Προβάλετε sidebars με BuddyPress User Groups"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:828
|
323 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
+
msgstr "Η στήλη προβολής των sidebar στις ενότητες που προβάλλονται οι Σελίδες, οι Δημοσιεύσεις, οι Κατηγορίες κ.λπ.."
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
+
msgid "Order"
|
328 |
+
msgstr "Υπόλοιπα"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:880
|
331 |
+
msgid "Give a review on WordPress.org"
|
332 |
+
msgstr ""
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
+
msgid "Translate the plugin into your language"
|
336 |
+
msgstr "Μεταφράστε το plugin στη γλώσσα σας"
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:884
|
339 |
+
msgid "Read the FAQ"
|
340 |
+
msgstr ""
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:899
|
343 |
+
msgid ""
|
344 |
+
"If you love this plugin, please consider donating to support future "
|
345 |
+
"development."
|
346 |
+
msgstr "Εάν σας αρέσει αυτό το plugin, μπορείτε να μας ενισχύσετε κάνοντας μία δωρεά ώστε να είναι δυνατή η συνέχιση της ανάπτυξής του."
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:908
|
349 |
+
msgid "Or you could:"
|
350 |
+
msgstr "Ή θα μπορούσατε:"
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:910
|
353 |
+
msgid "Rate the plugin on WordPress.org"
|
354 |
+
msgstr "Βαθμολογήστε το plugin στο WordPress.org"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:911
|
357 |
+
msgid "Link to the plugin page"
|
358 |
+
msgstr "Τοποθετήστε έναν σύνδεσμο προς τη σελίδα του plugin "
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:1045
|
361 |
+
msgid "Filter Sidebars"
|
362 |
+
msgstr "Φίλτρο Sidebars"
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1046
|
365 |
+
msgid "Filter Widgets"
|
366 |
+
msgstr ""
|
367 |
+
|
368 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
+
msgid "Condition Group"
|
370 |
+
msgstr ""
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
+
msgctxt "group"
|
374 |
+
msgid "Add New"
|
375 |
+
msgstr "Προσθήκη νέου"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
+
msgid "Add New Group"
|
381 |
+
msgstr "Προσθήκη νέου Group"
|
382 |
+
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
+
msgctxt "group"
|
387 |
+
msgid "Edit"
|
388 |
+
msgstr "Επεξεργασία"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
+
msgid "No Groups found"
|
393 |
+
msgstr "Δεν βρέθηκαν Groups"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
+
msgctxt "condition group"
|
397 |
+
msgid "Negated"
|
398 |
+
msgstr "Αναιρέθηκε"
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
+
msgid "Content"
|
402 |
+
msgstr "Περιεχόμενο"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
+
msgid "Unauthorized request"
|
408 |
+
msgstr "Μη εξουσιοδοτημένο αίτημα"
|
409 |
+
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
+
msgid "Condition group cannot be empty"
|
412 |
+
msgstr "Το Condition group δεν ήταν δυνατό να αφαιρεθεί"
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
+
msgid "Condition group saved"
|
416 |
+
msgstr "Το Condition group αποθηκεύθηκε"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
+
msgid "Condition group could not be removed"
|
420 |
+
msgstr "Το Condition group δεν ήταν δυνατό να αφαιρεθεί"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
+
msgid "Condition group removed"
|
424 |
+
msgstr "Το Condition group αφαιρέθηκε."
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Save"
|
429 |
+
msgstr "Αποθήκευση"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Cancel"
|
434 |
+
msgstr "Ακύρωση"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
+
msgid "Or"
|
439 |
+
msgstr "Ή"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
+
msgid "And"
|
446 |
+
msgstr ""
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
+
msgid "Remove"
|
451 |
+
msgstr "Αφαίρεση"
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
+
msgid "Remove this group and its contents permanently?"
|
455 |
+
msgstr "Να αφαιρεθεί οριστικά αυτό το group και τα περιεχόμενά του;"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
+
msgid "No results found."
|
459 |
+
msgstr "Δεν βρέθηκαν αποτελέσματα"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
+
msgid ""
|
463 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
+
"these changes?"
|
465 |
+
msgstr "Οι ρυθμίσεις του παρόντος group δεν έχουν αποθηκευθεί. Θέλετε να συνεχίσετε και να χάσετε αυτές τις ρυθμίσεις;"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
+
msgid "Negate group"
|
470 |
+
msgstr "Αναίρεση Group"
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target all but this context"
|
475 |
+
msgstr "Στόχευση όλων εκτός από αυτό το περιεχόμενο"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target this context"
|
480 |
+
msgstr "Στόχευση αυτού του περιεχομένου"
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
+
msgid "Authors"
|
484 |
+
msgstr "Συντάκτες"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
+
#, php-format
|
488 |
+
msgid "Display with All %s"
|
489 |
+
msgstr "Προβολή με Όλα τα %s"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
+
msgid "View All"
|
496 |
+
msgstr "Προβολή Όλων"
|
497 |
+
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
+
msgid "Search"
|
505 |
+
msgstr "Αναζήτηση"
|
506 |
+
|
507 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
+
msgid "bbPress User Profiles"
|
509 |
+
msgstr ""
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
+
msgid "BuddyPress Members"
|
513 |
+
msgstr ""
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
+
msgid "Add to Group"
|
519 |
+
msgstr "Προσθήκη στο Group"
|
520 |
+
|
521 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
+
msgid "Dates"
|
523 |
+
msgstr "Ημερομηνίες"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
+
msgid "Date Archives"
|
527 |
+
msgstr "Αρχεία Ημέρας"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
+
msgid "Page Templates"
|
531 |
+
msgstr ""
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
+
msgid "Languages"
|
538 |
+
msgstr "Γλώσσες"
|
539 |
+
|
540 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
+
msgid "Post Types"
|
542 |
+
msgstr ""
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
+
msgid "Automatically select new children of a selected ancestor"
|
548 |
+
msgstr ""
|
549 |
+
|
550 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
+
msgid "Automatically add new children of a selected ancestor"
|
552 |
+
msgstr ""
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
+
#, php-format
|
556 |
+
msgid "%s Archives"
|
557 |
+
msgstr "%s Αρχεία"
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
+
msgid "Blog Page"
|
561 |
+
msgstr "Σελίδα Blog "
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
+
msgid "No items."
|
566 |
+
msgstr "Δεν υπάρχουν αντικείμενα."
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
+
msgid "Most Recent"
|
570 |
+
msgstr "Πιο Πρόσφατα"
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
+
msgid "Static Pages"
|
574 |
+
msgstr "Στατικές Σελίδες"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
+
msgid "Front Page"
|
578 |
+
msgstr "Αρχική Σελίδα"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
+
msgid "Search Results"
|
582 |
+
msgstr "Αποτελέσματα Αναζήτησης"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
+
msgid "404 Page"
|
586 |
+
msgstr "Σελίδα 404"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
+
msgid "Taxonomies"
|
590 |
+
msgstr ""
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
+
msgid "Most Used"
|
594 |
+
msgstr "Περισσότερο Χρησιμοποιημένα"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
+
msgid "Conditional Content"
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
+
msgid ""
|
602 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
+
" it. In each group, you can combine different types of associated content."
|
604 |
+
msgstr "Πατήστε εδώ για να διαχειριστείτε ένα group ή να δημιουργ΄ξησετε ένα νέο.Επιλέξτε περιεχόμενο από αριστερά για να το προσθέσετε στο group. Σε κάθε group, μπορείτε να συνδυάσετε διαφορετικούς τύπους περιεχομένου."
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
+
#, php-format
|
608 |
+
msgid "All %s"
|
609 |
+
msgstr "Όλα %s"
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
+
msgid "Password protected"
|
613 |
+
msgstr ""
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
+
msgid "Private"
|
617 |
+
msgstr ""
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
+
msgid "Draft"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#. translators: post state
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
+
msgctxt "post state"
|
626 |
+
msgid "Pending"
|
627 |
+
msgstr ""
|
628 |
+
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
+
msgid "Sticky"
|
631 |
+
msgstr ""
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
+
msgid "Scheduled"
|
635 |
+
msgstr ""
|
636 |
+
|
637 |
+
#: ../pointers.php:68
|
638 |
+
msgid "Get started"
|
639 |
+
msgstr "Ξεκινήστε"
|
640 |
+
|
641 |
+
#: ../pointers.php:69
|
642 |
+
msgid ""
|
643 |
+
"You've just installed Content Aware Sidebars!\n"
|
644 |
+
"\n"
|
645 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
+
"\n"
|
647 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
+
msgstr "Μόλις εγκαταστήσατε το Content Aware Sidebars!\n\nΣας παρέχει πολλές επιλογές, έτσι αυτή η οθόνη ίσως να σας φαίνεται κουραστική. Μην ανησυχείτ όμως!\n\nΠατήστε το κομβίο Εκκίνηση Παρουσίασης για να δείτε μία γρήγορη εισαγωγή και να μάθετε πως να εμφανίζετε ένα sidebar ακριβώς εκεί που θέλετε να εμφανιστεί."
|
649 |
+
|
650 |
+
#: ../pointers.php:76
|
651 |
+
msgid "Start Tour"
|
652 |
+
msgstr "Εκκίνηση Παρουσίασης"
|
653 |
+
|
654 |
+
#: ../pointers.php:78
|
655 |
+
msgid "Not now"
|
656 |
+
msgstr "Όχι τώρα"
|
657 |
+
|
658 |
+
#: ../pointers.php:83
|
659 |
+
msgid ""
|
660 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
+
"\n"
|
662 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
+
"\n"
|
664 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
+
msgstr "Για να γίνει ρυθμιστεί κάποιο sidebar σωστά και να γίνει λειτουργικό, πρέπει να ορίσετε το condition group στο οποίο αυτό θα εμφανίζεται.\n\nΤα Condition groups στα οποία θα εμφανίζεται το sidebar μπορούν να είναι πολλά και είναι ανεξάρτητα μεταξύ τους. \n\nΗ αναίρεση ενός group δεν θα έχει επίδραση στη συμπεριφορά του sidebar στα υπόλοιπα group."
|
666 |
+
|
667 |
+
#: ../pointers.php:92
|
668 |
+
msgid "Content and contexts"
|
669 |
+
msgstr "Περιεχόμενο και πλαίσια"
|
670 |
+
|
671 |
+
#: ../pointers.php:93
|
672 |
+
msgid ""
|
673 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
+
"\n"
|
675 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
+
"\n"
|
677 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
+
msgstr "Εδώ θα βρείτε όλο το περιεχόμενο της ιστοσελίδας σας το οποίο το Content Aware Sidebars υποστηρίζει και μπορεί να διαχειριστεί.\n\nΤο μόνο που πρέπει να κάνετε έιναι να επιλέξετε το περιεχόμενο το οποίο θέλετε να εμφανίζεται στο sidebar και να το προσθέσετε σε ένα Group.\n\nΜπορείτε επίσης να δημιουργήσετε συνδυαζόμενο περιεχόμενο για τα sidebars σας, όπως για παράδειγμα: επιλέξτε Όλες τις Δημοσιεύσεις, μίας Κατηγορίας και ενός Συντάκτη. Είναι πολύ εύκολο και εξαιρετικά χρήσιμο!"
|
679 |
+
|
680 |
+
#: ../pointers.php:102
|
681 |
+
msgid "Options, options"
|
682 |
+
msgstr "Επιλογές, επιλογές"
|
683 |
+
|
684 |
+
#: ../pointers.php:103
|
685 |
+
msgid ""
|
686 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
+
"\n"
|
688 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
+
"\n"
|
690 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
+
"\n"
|
692 |
+
" You are in control."
|
693 |
+
msgstr ""
|
694 |
+
|
695 |
+
#: ../pointers.php:112
|
696 |
+
msgid "Help and Support"
|
697 |
+
msgstr "Βοήθεια και Υποστήριξη"
|
698 |
+
|
699 |
+
#: ../pointers.php:113
|
700 |
+
msgid ""
|
701 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
+
"\n"
|
703 |
+
"If you need more help, click on the \"Help\" tab here."
|
704 |
+
msgstr ""
|
705 |
+
|
706 |
+
#: ../pointers.php:142
|
707 |
+
msgid "Close"
|
708 |
+
msgstr "Κλείσιμο"
|
709 |
+
|
710 |
+
#: ../pointers.php:143
|
711 |
+
msgid "Next"
|
712 |
+
msgstr "Επόμενο"
|
lang/content-aware-sidebars-es_ES.po
CHANGED
@@ -1,713 +1,713 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Diego Canal <canaldiego@gmail.com>, 2015
|
5 |
-
# Horacio Salazar <horacio.salazar@gmail.com>, 2015
|
6 |
-
# Javier Awwad <jaawme@hotmail.com>, 2015
|
7 |
-
msgid ""
|
8 |
-
msgstr ""
|
9 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
10 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
11 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
12 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
13 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
14 |
-
"Language-Team: Spanish (Spain) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/es_ES/)\n"
|
15 |
-
"MIME-Version: 1.0\n"
|
16 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
17 |
-
"Content-Transfer-Encoding: 8bit\n"
|
18 |
-
"Language: es_ES\n"
|
19 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
20 |
-
"X-Generator: Poedit 1.7.6\n"
|
21 |
-
"X-Poedit-Basepath: .\n"
|
22 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
23 |
-
"X-Poedit-SearchPath-0: .\n"
|
24 |
-
"X-Poedit-SearchPath-1: ..\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
26 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
27 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
28 |
-
"X-Textdomain-Support: yes\n"
|
29 |
-
|
30 |
-
#: ../content-aware-sidebars.php:95
|
31 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
32 |
-
msgstr "Administrar y mostrar las barras laterales, en función del contenido que se está viendo."
|
33 |
-
|
34 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
35 |
-
msgid "Content Aware Sidebars"
|
36 |
-
msgstr "Content Aware Sidebars (Barras Laterales)"
|
37 |
-
|
38 |
-
#: ../content-aware-sidebars.php:97
|
39 |
-
msgid "Import"
|
40 |
-
msgstr "Importar"
|
41 |
-
|
42 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
43 |
-
msgid "FAQ"
|
44 |
-
msgstr "FAQ"
|
45 |
-
|
46 |
-
#: ../content-aware-sidebars.php:256
|
47 |
-
msgid "Exposure"
|
48 |
-
msgstr "Exposición"
|
49 |
-
|
50 |
-
#: ../content-aware-sidebars.php:260
|
51 |
-
msgid "Singular"
|
52 |
-
msgstr "Singular"
|
53 |
-
|
54 |
-
#: ../content-aware-sidebars.php:261
|
55 |
-
msgid "Singular & Archive"
|
56 |
-
msgstr "Singular y Archivo"
|
57 |
-
|
58 |
-
#: ../content-aware-sidebars.php:262
|
59 |
-
msgid "Archive"
|
60 |
-
msgstr "Archivo"
|
61 |
-
|
62 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
63 |
-
msgctxt "option"
|
64 |
-
msgid "Handle"
|
65 |
-
msgstr "Acciones"
|
66 |
-
|
67 |
-
#: ../content-aware-sidebars.php:271
|
68 |
-
msgid "Replace"
|
69 |
-
msgstr "Reemplazar"
|
70 |
-
|
71 |
-
#: ../content-aware-sidebars.php:272
|
72 |
-
msgid "Merge"
|
73 |
-
msgstr "Fusionar"
|
74 |
-
|
75 |
-
#: ../content-aware-sidebars.php:273
|
76 |
-
msgid "Manual"
|
77 |
-
msgstr "Manualmente"
|
78 |
-
|
79 |
-
#: ../content-aware-sidebars.php:274
|
80 |
-
msgid "Forced replace"
|
81 |
-
msgstr "Reemplazar forzadamente"
|
82 |
-
|
83 |
-
#: ../content-aware-sidebars.php:276
|
84 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
85 |
-
msgstr "Reemplazar la barra lateral huésped, fusionar con la misma, o añadir una barra lateral manualmente."
|
86 |
-
|
87 |
-
#: ../content-aware-sidebars.php:280
|
88 |
-
msgid "Host Sidebar"
|
89 |
-
msgstr "Barra lateral huésped"
|
90 |
-
|
91 |
-
#: ../content-aware-sidebars.php:287
|
92 |
-
msgid "Merge Position"
|
93 |
-
msgstr "Combinar posición"
|
94 |
-
|
95 |
-
#: ../content-aware-sidebars.php:291
|
96 |
-
msgid "Top"
|
97 |
-
msgstr "Arriba"
|
98 |
-
|
99 |
-
#: ../content-aware-sidebars.php:292
|
100 |
-
msgid "Bottom"
|
101 |
-
msgstr "Abajo"
|
102 |
-
|
103 |
-
#: ../content-aware-sidebars.php:294
|
104 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
105 |
-
msgstr "Coloque esta barra lateral en la parte de arriba o abajo del huésped, al fusionar."
|
106 |
-
|
107 |
-
#: ../content-aware-sidebars.php:309
|
108 |
-
msgid "Sidebars"
|
109 |
-
msgstr "Barras laterales"
|
110 |
-
|
111 |
-
#: ../content-aware-sidebars.php:310
|
112 |
-
msgid "Sidebar"
|
113 |
-
msgstr "Barra lateral"
|
114 |
-
|
115 |
-
#: ../content-aware-sidebars.php:311
|
116 |
-
msgctxt "sidebar"
|
117 |
-
msgid "Add New"
|
118 |
-
msgstr "Añadir nuevo"
|
119 |
-
|
120 |
-
#: ../content-aware-sidebars.php:312
|
121 |
-
msgid "Add New Sidebar"
|
122 |
-
msgstr "Añadir nueva barra lateral"
|
123 |
-
|
124 |
-
#: ../content-aware-sidebars.php:313
|
125 |
-
msgid "Edit Sidebar"
|
126 |
-
msgstr "Editar barra lateral"
|
127 |
-
|
128 |
-
#: ../content-aware-sidebars.php:314
|
129 |
-
msgid "New Sidebar"
|
130 |
-
msgstr "Nueva barra lateral"
|
131 |
-
|
132 |
-
#: ../content-aware-sidebars.php:315
|
133 |
-
msgid "All Sidebars"
|
134 |
-
msgstr "Todas las barras laterales"
|
135 |
-
|
136 |
-
#: ../content-aware-sidebars.php:316
|
137 |
-
msgid "View Sidebar"
|
138 |
-
msgstr "Ver barra lateral"
|
139 |
-
|
140 |
-
#: ../content-aware-sidebars.php:317
|
141 |
-
msgid "Search Sidebars"
|
142 |
-
msgstr "Buscar barras laterales"
|
143 |
-
|
144 |
-
#: ../content-aware-sidebars.php:318
|
145 |
-
msgid "No sidebars found"
|
146 |
-
msgstr "No se encontraron barras laterales"
|
147 |
-
|
148 |
-
#: ../content-aware-sidebars.php:319
|
149 |
-
msgid "No sidebars found in Trash"
|
150 |
-
msgstr "Ninguna barra lateral encontradada en la papelera"
|
151 |
-
|
152 |
-
#: ../content-aware-sidebars.php:321
|
153 |
-
msgid "Display sidebar with"
|
154 |
-
msgstr "Mostrar la barra lateral con"
|
155 |
-
|
156 |
-
#: ../content-aware-sidebars.php:322
|
157 |
-
msgid ""
|
158 |
-
"No content. Please add at least one condition group to make the sidebar "
|
159 |
-
"content aware."
|
160 |
-
msgstr "Sin contenido. Por favor añada al menos un grupo de condiciones para que la barra lateral pueda tener en cuenta el contenido."
|
161 |
-
|
162 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
163 |
-
msgid "Manage widgets"
|
164 |
-
msgstr "Administrar los widgets"
|
165 |
-
|
166 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
167 |
-
msgid "Sidebar updated."
|
168 |
-
msgstr "Barra lateral actualizada"
|
169 |
-
|
170 |
-
#: ../content-aware-sidebars.php:361
|
171 |
-
msgid "Sidebar published."
|
172 |
-
msgstr "Barra lateral publicada."
|
173 |
-
|
174 |
-
#: ../content-aware-sidebars.php:362
|
175 |
-
msgid "Sidebar saved."
|
176 |
-
msgstr "Barra lateral guardada."
|
177 |
-
|
178 |
-
#: ../content-aware-sidebars.php:363
|
179 |
-
msgid "Sidebar submitted."
|
180 |
-
msgstr "Barra lateral actualizada."
|
181 |
-
|
182 |
-
#: ../content-aware-sidebars.php:364
|
183 |
-
#, php-format
|
184 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
185 |
-
msgstr "Barra lateral programada el: <strong>%1$s</strong>."
|
186 |
-
|
187 |
-
#. translators: Publish box date format, see http://php.net/date
|
188 |
-
#: ../content-aware-sidebars.php:366
|
189 |
-
msgid "M j, Y @ G:i"
|
190 |
-
msgstr "j M, Y @ G:i"
|
191 |
-
|
192 |
-
#: ../content-aware-sidebars.php:367
|
193 |
-
msgid "Sidebar draft updated."
|
194 |
-
msgstr "Borrador de la barra lateral actualizado"
|
195 |
-
|
196 |
-
#: ../content-aware-sidebars.php:383
|
197 |
-
#, php-format
|
198 |
-
msgid "%s sidebar updated."
|
199 |
-
msgid_plural "%s sidebars updated."
|
200 |
-
msgstr[0] "%s barra lateral actualizada."
|
201 |
-
msgstr[1] "%s barras laterales actualizadas."
|
202 |
-
|
203 |
-
#: ../content-aware-sidebars.php:384
|
204 |
-
#, php-format
|
205 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
-
msgstr[0] "%s barra lateral no actualizada, alguien la está editando."
|
208 |
-
msgstr[1] "%s barras laterales no actualizadas, alguien las está editando."
|
209 |
-
|
210 |
-
#: ../content-aware-sidebars.php:385
|
211 |
-
#, php-format
|
212 |
-
msgid "%s sidebar permanently deleted."
|
213 |
-
msgid_plural "%s sidebars permanently deleted."
|
214 |
-
msgstr[0] "%s barra lateral eliminada permanentemente."
|
215 |
-
msgstr[1] "%s barras laterales eliminadas permanentemente."
|
216 |
-
|
217 |
-
#: ../content-aware-sidebars.php:386
|
218 |
-
#, php-format
|
219 |
-
msgid "%s sidebar moved to the Trash."
|
220 |
-
msgid_plural "%s sidebars moved to the Trash."
|
221 |
-
msgstr[0] "%s barra lateral movida a la papelera."
|
222 |
-
msgstr[1] "%s barras laterales movidas a la papelera."
|
223 |
-
|
224 |
-
#: ../content-aware-sidebars.php:387
|
225 |
-
#, php-format
|
226 |
-
msgid "%s sidebar restored from the Trash."
|
227 |
-
msgid_plural "%s sidebars restored from the Trash."
|
228 |
-
msgstr[0] "%s barra lateral restaurada desde la papelera."
|
229 |
-
msgstr[1] "%s barras laterales restauradas desde la papelera."
|
230 |
-
|
231 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
232 |
-
msgid "Please update Host Sidebar"
|
233 |
-
msgstr "Por favor, actualice la barra lateral huésped"
|
234 |
-
|
235 |
-
#: ../content-aware-sidebars.php:472
|
236 |
-
msgid "Merge position"
|
237 |
-
msgstr "Fusionar en posición"
|
238 |
-
|
239 |
-
#: ../content-aware-sidebars.php:473
|
240 |
-
msgid "Widgets"
|
241 |
-
msgstr "Widgets"
|
242 |
-
|
243 |
-
#: ../content-aware-sidebars.php:586
|
244 |
-
msgid "Manage Widgets"
|
245 |
-
msgstr "Administrar los widgets"
|
246 |
-
|
247 |
-
#: ../content-aware-sidebars.php:756
|
248 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
249 |
-
msgstr "Consigue gratis el plugin Premium Content Aware Sidebars"
|
250 |
-
|
251 |
-
#: ../content-aware-sidebars.php:772
|
252 |
-
msgid "Options"
|
253 |
-
msgstr "Opciónes"
|
254 |
-
|
255 |
-
#: ../content-aware-sidebars.php:795
|
256 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
257 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
258 |
-
msgid "Condition Groups"
|
259 |
-
msgstr "Grupos de condiciones"
|
260 |
-
|
261 |
-
#: ../content-aware-sidebars.php:796
|
262 |
-
msgid ""
|
263 |
-
"Each created condition group describe some specific content (conditions) "
|
264 |
-
"that the current sidebar should be displayed with."
|
265 |
-
msgstr "Cada grupo de condiciones creado, describe un contenido específico (de condiciones) con el que la barra lateral actual se debe mostrar."
|
266 |
-
|
267 |
-
#: ../content-aware-sidebars.php:797
|
268 |
-
msgid ""
|
269 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
270 |
-
" groups themselves use logical disjunction. This means that content added to"
|
271 |
-
" a group should be associated, as they are treated as such, and that the "
|
272 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
273 |
-
"extremely focused and at the same time distinct conditions."
|
274 |
-
msgstr "El contenido agregado a un grupo de condiciones utiliza la conjunción lógica, mientras que estos grupos de condiciones utilizan la disyunción lógica. Esto significa que el contenido que sea agregado a un grupo deberá estar relacionado, porque sera tratado de esta manera. Significa tambien que los grupos no pueden interferirse mutuamente. Por lo cual, es posible obtener condiciones extremadamente específicas y al mismo tiempo distintas."
|
275 |
-
|
276 |
-
#: ../content-aware-sidebars.php:800
|
277 |
-
msgid "More Information"
|
278 |
-
msgstr "Más información"
|
279 |
-
|
280 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
281 |
-
msgid "Get Support"
|
282 |
-
msgstr "Obtener apoyo"
|
283 |
-
|
284 |
-
#: ../content-aware-sidebars.php:816
|
285 |
-
msgid ""
|
286 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
287 |
-
" of the upcoming Premium Bundle*!"
|
288 |
-
msgstr "¡Traduzca Content Aware Sidebars en su idioma y conviertase en un probador beta de la próxima versión Premium*!"
|
289 |
-
|
290 |
-
#: ../content-aware-sidebars.php:817
|
291 |
-
msgid "Translate Now"
|
292 |
-
msgstr "Traducir ahora"
|
293 |
-
|
294 |
-
#: ../content-aware-sidebars.php:818
|
295 |
-
msgid "Get Premium Bundle"
|
296 |
-
msgstr "Obtener el paquete Premium"
|
297 |
-
|
298 |
-
#: ../content-aware-sidebars.php:819
|
299 |
-
msgid ""
|
300 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
301 |
-
msgstr "Uso en un solo sitio. BETA implica que no se recomienda para los sitios en producción."
|
302 |
-
|
303 |
-
#: ../content-aware-sidebars.php:822
|
304 |
-
msgid "Partial Feature List"
|
305 |
-
msgstr "Lista parcial de funciones"
|
306 |
-
|
307 |
-
#: ../content-aware-sidebars.php:824
|
308 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
309 |
-
msgstr "Seleccionar y crear barras laterales en las pantallas de edición de posts"
|
310 |
-
|
311 |
-
#: ../content-aware-sidebars.php:825
|
312 |
-
msgid "Display sidebars with URLs using wildcards"
|
313 |
-
msgstr "Mostrar barras laterales con URL usando caracteres comodín"
|
314 |
-
|
315 |
-
#: ../content-aware-sidebars.php:826
|
316 |
-
msgid "Display sidebars with User Roles"
|
317 |
-
msgstr "Mostrar barras laterales con funciones de usuario"
|
318 |
-
|
319 |
-
#: ../content-aware-sidebars.php:827
|
320 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
321 |
-
msgstr "Mostrar barras laterales con Grupos de usuarios BuddyPress"
|
322 |
-
|
323 |
-
#: ../content-aware-sidebars.php:828
|
324 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
325 |
-
msgstr "Columna Barras laterales en Post Tipo y Taxonomía en la vista general de pantallas"
|
326 |
-
|
327 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
328 |
-
msgid "Order"
|
329 |
-
msgstr "Solicitar"
|
330 |
-
|
331 |
-
#: ../content-aware-sidebars.php:880
|
332 |
-
msgid "Give a review on WordPress.org"
|
333 |
-
msgstr "Da tu opinión sobre el plugin en WordPress.org"
|
334 |
-
|
335 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
336 |
-
msgid "Translate the plugin into your language"
|
337 |
-
msgstr "Traducir el plugin a su idioma"
|
338 |
-
|
339 |
-
#: ../content-aware-sidebars.php:884
|
340 |
-
msgid "Read the FAQ"
|
341 |
-
msgstr "Lee las \"Preguntas Frecuentes\""
|
342 |
-
|
343 |
-
#: ../content-aware-sidebars.php:899
|
344 |
-
msgid ""
|
345 |
-
"If you love this plugin, please consider donating to support future "
|
346 |
-
"development."
|
347 |
-
msgstr "Si usted ama este plugin, por favor considere hacer una donación para apoyar el futuro desarrollo."
|
348 |
-
|
349 |
-
#: ../content-aware-sidebars.php:908
|
350 |
-
msgid "Or you could:"
|
351 |
-
msgstr "O usted podría:"
|
352 |
-
|
353 |
-
#: ../content-aware-sidebars.php:910
|
354 |
-
msgid "Rate the plugin on WordPress.org"
|
355 |
-
msgstr "Califica el plugin en WordPress.org"
|
356 |
-
|
357 |
-
#: ../content-aware-sidebars.php:911
|
358 |
-
msgid "Link to the plugin page"
|
359 |
-
msgstr "Crear un enlace web refiriendo al plugin"
|
360 |
-
|
361 |
-
#: ../content-aware-sidebars.php:1045
|
362 |
-
msgid "Filter Sidebars"
|
363 |
-
msgstr "Filtrar barras laterales"
|
364 |
-
|
365 |
-
#: ../content-aware-sidebars.php:1046
|
366 |
-
msgid "Filter Widgets"
|
367 |
-
msgstr "Filtrar Widgets"
|
368 |
-
|
369 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
370 |
-
msgid "Condition Group"
|
371 |
-
msgstr "Grupo de condiciones"
|
372 |
-
|
373 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
374 |
-
msgctxt "group"
|
375 |
-
msgid "Add New"
|
376 |
-
msgstr "Añadir nuevo"
|
377 |
-
|
378 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
380 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
381 |
-
msgid "Add New Group"
|
382 |
-
msgstr "Añadir nuevo"
|
383 |
-
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
385 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
386 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
387 |
-
msgctxt "group"
|
388 |
-
msgid "Edit"
|
389 |
-
msgstr "Editar"
|
390 |
-
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
392 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
393 |
-
msgid "No Groups found"
|
394 |
-
msgstr "No se hallaron grupos"
|
395 |
-
|
396 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
397 |
-
msgctxt "condition group"
|
398 |
-
msgid "Negated"
|
399 |
-
msgstr "Denegado"
|
400 |
-
|
401 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
402 |
-
msgid "Content"
|
403 |
-
msgstr "Contenido"
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
407 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
408 |
-
msgid "Unauthorized request"
|
409 |
-
msgstr "Solicitud no autorizada"
|
410 |
-
|
411 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
412 |
-
msgid "Condition group cannot be empty"
|
413 |
-
msgstr "Grupo de condiciones no puede estar vacío"
|
414 |
-
|
415 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
416 |
-
msgid "Condition group saved"
|
417 |
-
msgstr "Grupo de condiciones guardado"
|
418 |
-
|
419 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
420 |
-
msgid "Condition group could not be removed"
|
421 |
-
msgstr "Grupo de condiciones no pudo ser eliminado"
|
422 |
-
|
423 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
424 |
-
msgid "Condition group removed"
|
425 |
-
msgstr "Grupo de condiciones eliminado"
|
426 |
-
|
427 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
428 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
429 |
-
msgid "Save"
|
430 |
-
msgstr "Guardar"
|
431 |
-
|
432 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
433 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
434 |
-
msgid "Cancel"
|
435 |
-
msgstr "Cancelar"
|
436 |
-
|
437 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
438 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
439 |
-
msgid "Or"
|
440 |
-
msgstr "O"
|
441 |
-
|
442 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
443 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
444 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
445 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
446 |
-
msgid "And"
|
447 |
-
msgstr "Y"
|
448 |
-
|
449 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
450 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
451 |
-
msgid "Remove"
|
452 |
-
msgstr "Eliminar"
|
453 |
-
|
454 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
455 |
-
msgid "Remove this group and its contents permanently?"
|
456 |
-
msgstr "Eliminar este grupo y sus contenidos de forma permanente?"
|
457 |
-
|
458 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
459 |
-
msgid "No results found."
|
460 |
-
msgstr "No se han encontrado resultados."
|
461 |
-
|
462 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
463 |
-
msgid ""
|
464 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
465 |
-
"these changes?"
|
466 |
-
msgstr "El grupo actual tiene cambios no guardados. ¿Quieres continuar y descartar estos cambios?"
|
467 |
-
|
468 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
469 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
470 |
-
msgid "Negate group"
|
471 |
-
msgstr "Denegar grupo"
|
472 |
-
|
473 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
474 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
475 |
-
msgid "Target all but this context"
|
476 |
-
msgstr "Dirigido a todos los contextos excepto este"
|
477 |
-
|
478 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
479 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
480 |
-
msgid "Target this context"
|
481 |
-
msgstr "Dirigir a este contexto"
|
482 |
-
|
483 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
484 |
-
msgid "Authors"
|
485 |
-
msgstr "Autores"
|
486 |
-
|
487 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
488 |
-
#, php-format
|
489 |
-
msgid "Display with All %s"
|
490 |
-
msgstr "Mostrar con todo %s"
|
491 |
-
|
492 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
493 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
494 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
495 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
496 |
-
msgid "View All"
|
497 |
-
msgstr "Ver todo"
|
498 |
-
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
500 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
502 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
504 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
505 |
-
msgid "Search"
|
506 |
-
msgstr "Buscar"
|
507 |
-
|
508 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
509 |
-
msgid "bbPress User Profiles"
|
510 |
-
msgstr "Perfiles de usuario de bbPress"
|
511 |
-
|
512 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
513 |
-
msgid "BuddyPress Members"
|
514 |
-
msgstr "Miembros de BuddyPress"
|
515 |
-
|
516 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
517 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
518 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
519 |
-
msgid "Add to Group"
|
520 |
-
msgstr "Añadir al grupo"
|
521 |
-
|
522 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
523 |
-
msgid "Dates"
|
524 |
-
msgstr "Fechas"
|
525 |
-
|
526 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
527 |
-
msgid "Date Archives"
|
528 |
-
msgstr "Fecha de archivos"
|
529 |
-
|
530 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
531 |
-
msgid "Page Templates"
|
532 |
-
msgstr "Plantillas"
|
533 |
-
|
534 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
537 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
538 |
-
msgid "Languages"
|
539 |
-
msgstr "Idiomas"
|
540 |
-
|
541 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
542 |
-
msgid "Post Types"
|
543 |
-
msgstr "Tipos de contenido"
|
544 |
-
|
545 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
547 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
548 |
-
msgid "Automatically select new children of a selected ancestor"
|
549 |
-
msgstr "Seleccionar automáticamente nuevos inferiores de los superiores seleccionados"
|
550 |
-
|
551 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
552 |
-
msgid "Automatically add new children of a selected ancestor"
|
553 |
-
msgstr "Agregar automáticamente nuevos inferiores de un superior seleccionado"
|
554 |
-
|
555 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
556 |
-
#, php-format
|
557 |
-
msgid "%s Archives"
|
558 |
-
msgstr "Archivos de %s"
|
559 |
-
|
560 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
561 |
-
msgid "Blog Page"
|
562 |
-
msgstr "Página de blog"
|
563 |
-
|
564 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
565 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
566 |
-
msgid "No items."
|
567 |
-
msgstr "Ningun elemento."
|
568 |
-
|
569 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
570 |
-
msgid "Most Recent"
|
571 |
-
msgstr "Más reciente"
|
572 |
-
|
573 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
574 |
-
msgid "Static Pages"
|
575 |
-
msgstr "Páginas estáticas"
|
576 |
-
|
577 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
578 |
-
msgid "Front Page"
|
579 |
-
msgstr "Página delantera"
|
580 |
-
|
581 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
582 |
-
msgid "Search Results"
|
583 |
-
msgstr "Resultados de la búsqueda"
|
584 |
-
|
585 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
586 |
-
msgid "404 Page"
|
587 |
-
msgstr "Página 404"
|
588 |
-
|
589 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
590 |
-
msgid "Taxonomies"
|
591 |
-
msgstr "Taxonomias"
|
592 |
-
|
593 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
594 |
-
msgid "Most Used"
|
595 |
-
msgstr "Mest brugte"
|
596 |
-
|
597 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
598 |
-
msgid "Conditional Content"
|
599 |
-
msgstr "Contenido Condicional"
|
600 |
-
|
601 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
602 |
-
msgid ""
|
603 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
604 |
-
" it. In each group, you can combine different types of associated content."
|
605 |
-
msgstr "Haga clic para editar un grupo o crear uno nuevo. Seleccione el contenido de la izquierda para añadirlo. En cada grupo, se pueden combinar diferentes tipos de contenido asociado."
|
606 |
-
|
607 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
608 |
-
#, php-format
|
609 |
-
msgid "All %s"
|
610 |
-
msgstr "Todo %s"
|
611 |
-
|
612 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
613 |
-
msgid "Password protected"
|
614 |
-
msgstr "Protegido con contraseña"
|
615 |
-
|
616 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
617 |
-
msgid "Private"
|
618 |
-
msgstr "Privado"
|
619 |
-
|
620 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
621 |
-
msgid "Draft"
|
622 |
-
msgstr "Borrador"
|
623 |
-
|
624 |
-
#. translators: post state
|
625 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
626 |
-
msgctxt "post state"
|
627 |
-
msgid "Pending"
|
628 |
-
msgstr "Pendiente"
|
629 |
-
|
630 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
631 |
-
msgid "Sticky"
|
632 |
-
msgstr "Fija"
|
633 |
-
|
634 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
635 |
-
msgid "Scheduled"
|
636 |
-
msgstr "Programado"
|
637 |
-
|
638 |
-
#: ../pointers.php:68
|
639 |
-
msgid "Get started"
|
640 |
-
msgstr "Empezar"
|
641 |
-
|
642 |
-
#: ../pointers.php:69
|
643 |
-
msgid ""
|
644 |
-
"You've just installed Content Aware Sidebars!\n"
|
645 |
-
"\n"
|
646 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
647 |
-
"\n"
|
648 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
649 |
-
msgstr "Acaba de instalar el plugin Content Aware Sidebars!\n\nLe ofrece muchas opciones, de modo que esta pantalla puede verse abrumadora en principio. No se preocupe.\n\nPulse Iniciar tour para ver una rápida introducción y para aprender a desplegar una barra lateral exactamente en el sitio y el momento en que la quiere."
|
650 |
-
|
651 |
-
#: ../pointers.php:76
|
652 |
-
msgid "Start Tour"
|
653 |
-
msgstr "Iniciar el tour"
|
654 |
-
|
655 |
-
#: ../pointers.php:78
|
656 |
-
msgid "Not now"
|
657 |
-
msgstr "De momento no"
|
658 |
-
|
659 |
-
#: ../pointers.php:83
|
660 |
-
msgid ""
|
661 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
662 |
-
"\n"
|
663 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
664 |
-
"\n"
|
665 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
666 |
-
msgstr "Para hacer que una barra lateral sea contextual, se empieza creando un grupo de condiciones.\n\nLos grupos de condiciones están separados unos de otros, lo cual significa que una barra lateral puede tener condiciones muy diferentes.\n\nDenegar un grupo significa que la barra lateral se desplegará en todas las condiciones excepto esas."
|
667 |
-
|
668 |
-
#: ../pointers.php:92
|
669 |
-
msgid "Content and contexts"
|
670 |
-
msgstr "Contenido y contextos"
|
671 |
-
|
672 |
-
#: ../pointers.php:93
|
673 |
-
msgid ""
|
674 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
675 |
-
"\n"
|
676 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
677 |
-
"\n"
|
678 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
679 |
-
msgstr "Aquí encontrará todo el contenido de su sitio que Content Aware Sidebarse soporta desde la instalación.\n\nSimplemente elija el contenido con el que quiere que se muestre la barra lateral y agréguelo a un grupo.\n\nPuede incluso combinar contenido asociado en un grupo; pruébelo eligiendo \"Todas las entradas\", una Categoría y un Autor. ¡Fenomenal!"
|
680 |
-
|
681 |
-
#: ../pointers.php:102
|
682 |
-
msgid "Options, options"
|
683 |
-
msgstr "Opciones, opciones"
|
684 |
-
|
685 |
-
#: ../pointers.php:103
|
686 |
-
msgid ""
|
687 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
688 |
-
"\n"
|
689 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
690 |
-
"\n"
|
691 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
692 |
-
"\n"
|
693 |
-
" You are in control."
|
694 |
-
msgstr "¿Debe mostrarse la barra lateral en páginas individuales o de archivo?\n\n¿Debe combinarse con otra barra lateral o reemplazarla? Tal vez quiera insertarla manualmente en su contenido con un shortcode.\n\nPrograme la barra lateral tal y como lo hace con entradas y páginas, o conviértala en privada de modo que solo sea visible para los usuarios conectados.\n\nUsted tiene el control."
|
695 |
-
|
696 |
-
#: ../pointers.php:112
|
697 |
-
msgid "Help and Support"
|
698 |
-
msgstr "Ayuda y soporte"
|
699 |
-
|
700 |
-
#: ../pointers.php:113
|
701 |
-
msgid ""
|
702 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
703 |
-
"\n"
|
704 |
-
"If you need more help, click on the \"Help\" tab here."
|
705 |
-
msgstr "¡Es todo! Ahora puede empezar a crear barras laterales y a desplegarlas en las condiciones que usted mismo defina.\n\nSi necesita más ayuda, pulse aquí en la pestaña \"Ayuda\"."
|
706 |
-
|
707 |
-
#: ../pointers.php:142
|
708 |
-
msgid "Close"
|
709 |
-
msgstr "Cerrar"
|
710 |
-
|
711 |
-
#: ../pointers.php:143
|
712 |
-
msgid "Next"
|
713 |
-
msgstr "Siguiente"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Diego Canal <canaldiego@gmail.com>, 2015
|
5 |
+
# Horacio Salazar <horacio.salazar@gmail.com>, 2015
|
6 |
+
# Javier Awwad <jaawme@hotmail.com>, 2015
|
7 |
+
msgid ""
|
8 |
+
msgstr ""
|
9 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
10 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
11 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
12 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
13 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
14 |
+
"Language-Team: Spanish (Spain) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/es_ES/)\n"
|
15 |
+
"MIME-Version: 1.0\n"
|
16 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
17 |
+
"Content-Transfer-Encoding: 8bit\n"
|
18 |
+
"Language: es_ES\n"
|
19 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
20 |
+
"X-Generator: Poedit 1.7.6\n"
|
21 |
+
"X-Poedit-Basepath: .\n"
|
22 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
23 |
+
"X-Poedit-SearchPath-0: .\n"
|
24 |
+
"X-Poedit-SearchPath-1: ..\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
26 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
27 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
28 |
+
"X-Textdomain-Support: yes\n"
|
29 |
+
|
30 |
+
#: ../content-aware-sidebars.php:95
|
31 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
32 |
+
msgstr "Administrar y mostrar las barras laterales, en función del contenido que se está viendo."
|
33 |
+
|
34 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
35 |
+
msgid "Content Aware Sidebars"
|
36 |
+
msgstr "Content Aware Sidebars (Barras Laterales)"
|
37 |
+
|
38 |
+
#: ../content-aware-sidebars.php:97
|
39 |
+
msgid "Import"
|
40 |
+
msgstr "Importar"
|
41 |
+
|
42 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
43 |
+
msgid "FAQ"
|
44 |
+
msgstr "FAQ"
|
45 |
+
|
46 |
+
#: ../content-aware-sidebars.php:256
|
47 |
+
msgid "Exposure"
|
48 |
+
msgstr "Exposición"
|
49 |
+
|
50 |
+
#: ../content-aware-sidebars.php:260
|
51 |
+
msgid "Singular"
|
52 |
+
msgstr "Singular"
|
53 |
+
|
54 |
+
#: ../content-aware-sidebars.php:261
|
55 |
+
msgid "Singular & Archive"
|
56 |
+
msgstr "Singular y Archivo"
|
57 |
+
|
58 |
+
#: ../content-aware-sidebars.php:262
|
59 |
+
msgid "Archive"
|
60 |
+
msgstr "Archivo"
|
61 |
+
|
62 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
63 |
+
msgctxt "option"
|
64 |
+
msgid "Handle"
|
65 |
+
msgstr "Acciones"
|
66 |
+
|
67 |
+
#: ../content-aware-sidebars.php:271
|
68 |
+
msgid "Replace"
|
69 |
+
msgstr "Reemplazar"
|
70 |
+
|
71 |
+
#: ../content-aware-sidebars.php:272
|
72 |
+
msgid "Merge"
|
73 |
+
msgstr "Fusionar"
|
74 |
+
|
75 |
+
#: ../content-aware-sidebars.php:273
|
76 |
+
msgid "Manual"
|
77 |
+
msgstr "Manualmente"
|
78 |
+
|
79 |
+
#: ../content-aware-sidebars.php:274
|
80 |
+
msgid "Forced replace"
|
81 |
+
msgstr "Reemplazar forzadamente"
|
82 |
+
|
83 |
+
#: ../content-aware-sidebars.php:276
|
84 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
85 |
+
msgstr "Reemplazar la barra lateral huésped, fusionar con la misma, o añadir una barra lateral manualmente."
|
86 |
+
|
87 |
+
#: ../content-aware-sidebars.php:280
|
88 |
+
msgid "Host Sidebar"
|
89 |
+
msgstr "Barra lateral huésped"
|
90 |
+
|
91 |
+
#: ../content-aware-sidebars.php:287
|
92 |
+
msgid "Merge Position"
|
93 |
+
msgstr "Combinar posición"
|
94 |
+
|
95 |
+
#: ../content-aware-sidebars.php:291
|
96 |
+
msgid "Top"
|
97 |
+
msgstr "Arriba"
|
98 |
+
|
99 |
+
#: ../content-aware-sidebars.php:292
|
100 |
+
msgid "Bottom"
|
101 |
+
msgstr "Abajo"
|
102 |
+
|
103 |
+
#: ../content-aware-sidebars.php:294
|
104 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
105 |
+
msgstr "Coloque esta barra lateral en la parte de arriba o abajo del huésped, al fusionar."
|
106 |
+
|
107 |
+
#: ../content-aware-sidebars.php:309
|
108 |
+
msgid "Sidebars"
|
109 |
+
msgstr "Barras laterales"
|
110 |
+
|
111 |
+
#: ../content-aware-sidebars.php:310
|
112 |
+
msgid "Sidebar"
|
113 |
+
msgstr "Barra lateral"
|
114 |
+
|
115 |
+
#: ../content-aware-sidebars.php:311
|
116 |
+
msgctxt "sidebar"
|
117 |
+
msgid "Add New"
|
118 |
+
msgstr "Añadir nuevo"
|
119 |
+
|
120 |
+
#: ../content-aware-sidebars.php:312
|
121 |
+
msgid "Add New Sidebar"
|
122 |
+
msgstr "Añadir nueva barra lateral"
|
123 |
+
|
124 |
+
#: ../content-aware-sidebars.php:313
|
125 |
+
msgid "Edit Sidebar"
|
126 |
+
msgstr "Editar barra lateral"
|
127 |
+
|
128 |
+
#: ../content-aware-sidebars.php:314
|
129 |
+
msgid "New Sidebar"
|
130 |
+
msgstr "Nueva barra lateral"
|
131 |
+
|
132 |
+
#: ../content-aware-sidebars.php:315
|
133 |
+
msgid "All Sidebars"
|
134 |
+
msgstr "Todas las barras laterales"
|
135 |
+
|
136 |
+
#: ../content-aware-sidebars.php:316
|
137 |
+
msgid "View Sidebar"
|
138 |
+
msgstr "Ver barra lateral"
|
139 |
+
|
140 |
+
#: ../content-aware-sidebars.php:317
|
141 |
+
msgid "Search Sidebars"
|
142 |
+
msgstr "Buscar barras laterales"
|
143 |
+
|
144 |
+
#: ../content-aware-sidebars.php:318
|
145 |
+
msgid "No sidebars found"
|
146 |
+
msgstr "No se encontraron barras laterales"
|
147 |
+
|
148 |
+
#: ../content-aware-sidebars.php:319
|
149 |
+
msgid "No sidebars found in Trash"
|
150 |
+
msgstr "Ninguna barra lateral encontradada en la papelera"
|
151 |
+
|
152 |
+
#: ../content-aware-sidebars.php:321
|
153 |
+
msgid "Display sidebar with"
|
154 |
+
msgstr "Mostrar la barra lateral con"
|
155 |
+
|
156 |
+
#: ../content-aware-sidebars.php:322
|
157 |
+
msgid ""
|
158 |
+
"No content. Please add at least one condition group to make the sidebar "
|
159 |
+
"content aware."
|
160 |
+
msgstr "Sin contenido. Por favor añada al menos un grupo de condiciones para que la barra lateral pueda tener en cuenta el contenido."
|
161 |
+
|
162 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
163 |
+
msgid "Manage widgets"
|
164 |
+
msgstr "Administrar los widgets"
|
165 |
+
|
166 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
167 |
+
msgid "Sidebar updated."
|
168 |
+
msgstr "Barra lateral actualizada"
|
169 |
+
|
170 |
+
#: ../content-aware-sidebars.php:361
|
171 |
+
msgid "Sidebar published."
|
172 |
+
msgstr "Barra lateral publicada."
|
173 |
+
|
174 |
+
#: ../content-aware-sidebars.php:362
|
175 |
+
msgid "Sidebar saved."
|
176 |
+
msgstr "Barra lateral guardada."
|
177 |
+
|
178 |
+
#: ../content-aware-sidebars.php:363
|
179 |
+
msgid "Sidebar submitted."
|
180 |
+
msgstr "Barra lateral actualizada."
|
181 |
+
|
182 |
+
#: ../content-aware-sidebars.php:364
|
183 |
+
#, php-format
|
184 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
185 |
+
msgstr "Barra lateral programada el: <strong>%1$s</strong>."
|
186 |
+
|
187 |
+
#. translators: Publish box date format, see http://php.net/date
|
188 |
+
#: ../content-aware-sidebars.php:366
|
189 |
+
msgid "M j, Y @ G:i"
|
190 |
+
msgstr "j M, Y @ G:i"
|
191 |
+
|
192 |
+
#: ../content-aware-sidebars.php:367
|
193 |
+
msgid "Sidebar draft updated."
|
194 |
+
msgstr "Borrador de la barra lateral actualizado"
|
195 |
+
|
196 |
+
#: ../content-aware-sidebars.php:383
|
197 |
+
#, php-format
|
198 |
+
msgid "%s sidebar updated."
|
199 |
+
msgid_plural "%s sidebars updated."
|
200 |
+
msgstr[0] "%s barra lateral actualizada."
|
201 |
+
msgstr[1] "%s barras laterales actualizadas."
|
202 |
+
|
203 |
+
#: ../content-aware-sidebars.php:384
|
204 |
+
#, php-format
|
205 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
+
msgstr[0] "%s barra lateral no actualizada, alguien la está editando."
|
208 |
+
msgstr[1] "%s barras laterales no actualizadas, alguien las está editando."
|
209 |
+
|
210 |
+
#: ../content-aware-sidebars.php:385
|
211 |
+
#, php-format
|
212 |
+
msgid "%s sidebar permanently deleted."
|
213 |
+
msgid_plural "%s sidebars permanently deleted."
|
214 |
+
msgstr[0] "%s barra lateral eliminada permanentemente."
|
215 |
+
msgstr[1] "%s barras laterales eliminadas permanentemente."
|
216 |
+
|
217 |
+
#: ../content-aware-sidebars.php:386
|
218 |
+
#, php-format
|
219 |
+
msgid "%s sidebar moved to the Trash."
|
220 |
+
msgid_plural "%s sidebars moved to the Trash."
|
221 |
+
msgstr[0] "%s barra lateral movida a la papelera."
|
222 |
+
msgstr[1] "%s barras laterales movidas a la papelera."
|
223 |
+
|
224 |
+
#: ../content-aware-sidebars.php:387
|
225 |
+
#, php-format
|
226 |
+
msgid "%s sidebar restored from the Trash."
|
227 |
+
msgid_plural "%s sidebars restored from the Trash."
|
228 |
+
msgstr[0] "%s barra lateral restaurada desde la papelera."
|
229 |
+
msgstr[1] "%s barras laterales restauradas desde la papelera."
|
230 |
+
|
231 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
232 |
+
msgid "Please update Host Sidebar"
|
233 |
+
msgstr "Por favor, actualice la barra lateral huésped"
|
234 |
+
|
235 |
+
#: ../content-aware-sidebars.php:472
|
236 |
+
msgid "Merge position"
|
237 |
+
msgstr "Fusionar en posición"
|
238 |
+
|
239 |
+
#: ../content-aware-sidebars.php:473
|
240 |
+
msgid "Widgets"
|
241 |
+
msgstr "Widgets"
|
242 |
+
|
243 |
+
#: ../content-aware-sidebars.php:586
|
244 |
+
msgid "Manage Widgets"
|
245 |
+
msgstr "Administrar los widgets"
|
246 |
+
|
247 |
+
#: ../content-aware-sidebars.php:756
|
248 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
249 |
+
msgstr "Consigue gratis el plugin Premium Content Aware Sidebars"
|
250 |
+
|
251 |
+
#: ../content-aware-sidebars.php:772
|
252 |
+
msgid "Options"
|
253 |
+
msgstr "Opciónes"
|
254 |
+
|
255 |
+
#: ../content-aware-sidebars.php:795
|
256 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
257 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
258 |
+
msgid "Condition Groups"
|
259 |
+
msgstr "Grupos de condiciones"
|
260 |
+
|
261 |
+
#: ../content-aware-sidebars.php:796
|
262 |
+
msgid ""
|
263 |
+
"Each created condition group describe some specific content (conditions) "
|
264 |
+
"that the current sidebar should be displayed with."
|
265 |
+
msgstr "Cada grupo de condiciones creado, describe un contenido específico (de condiciones) con el que la barra lateral actual se debe mostrar."
|
266 |
+
|
267 |
+
#: ../content-aware-sidebars.php:797
|
268 |
+
msgid ""
|
269 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
270 |
+
" groups themselves use logical disjunction. This means that content added to"
|
271 |
+
" a group should be associated, as they are treated as such, and that the "
|
272 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
273 |
+
"extremely focused and at the same time distinct conditions."
|
274 |
+
msgstr "El contenido agregado a un grupo de condiciones utiliza la conjunción lógica, mientras que estos grupos de condiciones utilizan la disyunción lógica. Esto significa que el contenido que sea agregado a un grupo deberá estar relacionado, porque sera tratado de esta manera. Significa tambien que los grupos no pueden interferirse mutuamente. Por lo cual, es posible obtener condiciones extremadamente específicas y al mismo tiempo distintas."
|
275 |
+
|
276 |
+
#: ../content-aware-sidebars.php:800
|
277 |
+
msgid "More Information"
|
278 |
+
msgstr "Más información"
|
279 |
+
|
280 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
281 |
+
msgid "Get Support"
|
282 |
+
msgstr "Obtener apoyo"
|
283 |
+
|
284 |
+
#: ../content-aware-sidebars.php:816
|
285 |
+
msgid ""
|
286 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
287 |
+
" of the upcoming Premium Bundle*!"
|
288 |
+
msgstr "¡Traduzca Content Aware Sidebars en su idioma y conviertase en un probador beta de la próxima versión Premium*!"
|
289 |
+
|
290 |
+
#: ../content-aware-sidebars.php:817
|
291 |
+
msgid "Translate Now"
|
292 |
+
msgstr "Traducir ahora"
|
293 |
+
|
294 |
+
#: ../content-aware-sidebars.php:818
|
295 |
+
msgid "Get Premium Bundle"
|
296 |
+
msgstr "Obtener el paquete Premium"
|
297 |
+
|
298 |
+
#: ../content-aware-sidebars.php:819
|
299 |
+
msgid ""
|
300 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
301 |
+
msgstr "Uso en un solo sitio. BETA implica que no se recomienda para los sitios en producción."
|
302 |
+
|
303 |
+
#: ../content-aware-sidebars.php:822
|
304 |
+
msgid "Partial Feature List"
|
305 |
+
msgstr "Lista parcial de funciones"
|
306 |
+
|
307 |
+
#: ../content-aware-sidebars.php:824
|
308 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
309 |
+
msgstr "Seleccionar y crear barras laterales en las pantallas de edición de posts"
|
310 |
+
|
311 |
+
#: ../content-aware-sidebars.php:825
|
312 |
+
msgid "Display sidebars with URLs using wildcards"
|
313 |
+
msgstr "Mostrar barras laterales con URL usando caracteres comodín"
|
314 |
+
|
315 |
+
#: ../content-aware-sidebars.php:826
|
316 |
+
msgid "Display sidebars with User Roles"
|
317 |
+
msgstr "Mostrar barras laterales con funciones de usuario"
|
318 |
+
|
319 |
+
#: ../content-aware-sidebars.php:827
|
320 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
321 |
+
msgstr "Mostrar barras laterales con Grupos de usuarios BuddyPress"
|
322 |
+
|
323 |
+
#: ../content-aware-sidebars.php:828
|
324 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
325 |
+
msgstr "Columna Barras laterales en Post Tipo y Taxonomía en la vista general de pantallas"
|
326 |
+
|
327 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
328 |
+
msgid "Order"
|
329 |
+
msgstr "Solicitar"
|
330 |
+
|
331 |
+
#: ../content-aware-sidebars.php:880
|
332 |
+
msgid "Give a review on WordPress.org"
|
333 |
+
msgstr "Da tu opinión sobre el plugin en WordPress.org"
|
334 |
+
|
335 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
336 |
+
msgid "Translate the plugin into your language"
|
337 |
+
msgstr "Traducir el plugin a su idioma"
|
338 |
+
|
339 |
+
#: ../content-aware-sidebars.php:884
|
340 |
+
msgid "Read the FAQ"
|
341 |
+
msgstr "Lee las \"Preguntas Frecuentes\""
|
342 |
+
|
343 |
+
#: ../content-aware-sidebars.php:899
|
344 |
+
msgid ""
|
345 |
+
"If you love this plugin, please consider donating to support future "
|
346 |
+
"development."
|
347 |
+
msgstr "Si usted ama este plugin, por favor considere hacer una donación para apoyar el futuro desarrollo."
|
348 |
+
|
349 |
+
#: ../content-aware-sidebars.php:908
|
350 |
+
msgid "Or you could:"
|
351 |
+
msgstr "O usted podría:"
|
352 |
+
|
353 |
+
#: ../content-aware-sidebars.php:910
|
354 |
+
msgid "Rate the plugin on WordPress.org"
|
355 |
+
msgstr "Califica el plugin en WordPress.org"
|
356 |
+
|
357 |
+
#: ../content-aware-sidebars.php:911
|
358 |
+
msgid "Link to the plugin page"
|
359 |
+
msgstr "Crear un enlace web refiriendo al plugin"
|
360 |
+
|
361 |
+
#: ../content-aware-sidebars.php:1045
|
362 |
+
msgid "Filter Sidebars"
|
363 |
+
msgstr "Filtrar barras laterales"
|
364 |
+
|
365 |
+
#: ../content-aware-sidebars.php:1046
|
366 |
+
msgid "Filter Widgets"
|
367 |
+
msgstr "Filtrar Widgets"
|
368 |
+
|
369 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
370 |
+
msgid "Condition Group"
|
371 |
+
msgstr "Grupo de condiciones"
|
372 |
+
|
373 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
374 |
+
msgctxt "group"
|
375 |
+
msgid "Add New"
|
376 |
+
msgstr "Añadir nuevo"
|
377 |
+
|
378 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
380 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
381 |
+
msgid "Add New Group"
|
382 |
+
msgstr "Añadir nuevo"
|
383 |
+
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
385 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
386 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
387 |
+
msgctxt "group"
|
388 |
+
msgid "Edit"
|
389 |
+
msgstr "Editar"
|
390 |
+
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
392 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
393 |
+
msgid "No Groups found"
|
394 |
+
msgstr "No se hallaron grupos"
|
395 |
+
|
396 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
397 |
+
msgctxt "condition group"
|
398 |
+
msgid "Negated"
|
399 |
+
msgstr "Denegado"
|
400 |
+
|
401 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
402 |
+
msgid "Content"
|
403 |
+
msgstr "Contenido"
|
404 |
+
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
407 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
408 |
+
msgid "Unauthorized request"
|
409 |
+
msgstr "Solicitud no autorizada"
|
410 |
+
|
411 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
412 |
+
msgid "Condition group cannot be empty"
|
413 |
+
msgstr "Grupo de condiciones no puede estar vacío"
|
414 |
+
|
415 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
416 |
+
msgid "Condition group saved"
|
417 |
+
msgstr "Grupo de condiciones guardado"
|
418 |
+
|
419 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
420 |
+
msgid "Condition group could not be removed"
|
421 |
+
msgstr "Grupo de condiciones no pudo ser eliminado"
|
422 |
+
|
423 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
424 |
+
msgid "Condition group removed"
|
425 |
+
msgstr "Grupo de condiciones eliminado"
|
426 |
+
|
427 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
428 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
429 |
+
msgid "Save"
|
430 |
+
msgstr "Guardar"
|
431 |
+
|
432 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
433 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
434 |
+
msgid "Cancel"
|
435 |
+
msgstr "Cancelar"
|
436 |
+
|
437 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
438 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
439 |
+
msgid "Or"
|
440 |
+
msgstr "O"
|
441 |
+
|
442 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
443 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
444 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
445 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
446 |
+
msgid "And"
|
447 |
+
msgstr "Y"
|
448 |
+
|
449 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
450 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
451 |
+
msgid "Remove"
|
452 |
+
msgstr "Eliminar"
|
453 |
+
|
454 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
455 |
+
msgid "Remove this group and its contents permanently?"
|
456 |
+
msgstr "Eliminar este grupo y sus contenidos de forma permanente?"
|
457 |
+
|
458 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
459 |
+
msgid "No results found."
|
460 |
+
msgstr "No se han encontrado resultados."
|
461 |
+
|
462 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
463 |
+
msgid ""
|
464 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
465 |
+
"these changes?"
|
466 |
+
msgstr "El grupo actual tiene cambios no guardados. ¿Quieres continuar y descartar estos cambios?"
|
467 |
+
|
468 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
469 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
470 |
+
msgid "Negate group"
|
471 |
+
msgstr "Denegar grupo"
|
472 |
+
|
473 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
474 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
475 |
+
msgid "Target all but this context"
|
476 |
+
msgstr "Dirigido a todos los contextos excepto este"
|
477 |
+
|
478 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
479 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
480 |
+
msgid "Target this context"
|
481 |
+
msgstr "Dirigir a este contexto"
|
482 |
+
|
483 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
484 |
+
msgid "Authors"
|
485 |
+
msgstr "Autores"
|
486 |
+
|
487 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
488 |
+
#, php-format
|
489 |
+
msgid "Display with All %s"
|
490 |
+
msgstr "Mostrar con todo %s"
|
491 |
+
|
492 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
493 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
494 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
495 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
496 |
+
msgid "View All"
|
497 |
+
msgstr "Ver todo"
|
498 |
+
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
500 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
502 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
504 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
505 |
+
msgid "Search"
|
506 |
+
msgstr "Buscar"
|
507 |
+
|
508 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
509 |
+
msgid "bbPress User Profiles"
|
510 |
+
msgstr "Perfiles de usuario de bbPress"
|
511 |
+
|
512 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
513 |
+
msgid "BuddyPress Members"
|
514 |
+
msgstr "Miembros de BuddyPress"
|
515 |
+
|
516 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
517 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
518 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
519 |
+
msgid "Add to Group"
|
520 |
+
msgstr "Añadir al grupo"
|
521 |
+
|
522 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
523 |
+
msgid "Dates"
|
524 |
+
msgstr "Fechas"
|
525 |
+
|
526 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
527 |
+
msgid "Date Archives"
|
528 |
+
msgstr "Fecha de archivos"
|
529 |
+
|
530 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
531 |
+
msgid "Page Templates"
|
532 |
+
msgstr "Plantillas"
|
533 |
+
|
534 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
537 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
538 |
+
msgid "Languages"
|
539 |
+
msgstr "Idiomas"
|
540 |
+
|
541 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
542 |
+
msgid "Post Types"
|
543 |
+
msgstr "Tipos de contenido"
|
544 |
+
|
545 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
547 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
548 |
+
msgid "Automatically select new children of a selected ancestor"
|
549 |
+
msgstr "Seleccionar automáticamente nuevos inferiores de los superiores seleccionados"
|
550 |
+
|
551 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
552 |
+
msgid "Automatically add new children of a selected ancestor"
|
553 |
+
msgstr "Agregar automáticamente nuevos inferiores de un superior seleccionado"
|
554 |
+
|
555 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
556 |
+
#, php-format
|
557 |
+
msgid "%s Archives"
|
558 |
+
msgstr "Archivos de %s"
|
559 |
+
|
560 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
561 |
+
msgid "Blog Page"
|
562 |
+
msgstr "Página de blog"
|
563 |
+
|
564 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
565 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
566 |
+
msgid "No items."
|
567 |
+
msgstr "Ningun elemento."
|
568 |
+
|
569 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
570 |
+
msgid "Most Recent"
|
571 |
+
msgstr "Más reciente"
|
572 |
+
|
573 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
574 |
+
msgid "Static Pages"
|
575 |
+
msgstr "Páginas estáticas"
|
576 |
+
|
577 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
578 |
+
msgid "Front Page"
|
579 |
+
msgstr "Página delantera"
|
580 |
+
|
581 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
582 |
+
msgid "Search Results"
|
583 |
+
msgstr "Resultados de la búsqueda"
|
584 |
+
|
585 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
586 |
+
msgid "404 Page"
|
587 |
+
msgstr "Página 404"
|
588 |
+
|
589 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
590 |
+
msgid "Taxonomies"
|
591 |
+
msgstr "Taxonomias"
|
592 |
+
|
593 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
594 |
+
msgid "Most Used"
|
595 |
+
msgstr "Mest brugte"
|
596 |
+
|
597 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
598 |
+
msgid "Conditional Content"
|
599 |
+
msgstr "Contenido Condicional"
|
600 |
+
|
601 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
602 |
+
msgid ""
|
603 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
604 |
+
" it. In each group, you can combine different types of associated content."
|
605 |
+
msgstr "Haga clic para editar un grupo o crear uno nuevo. Seleccione el contenido de la izquierda para añadirlo. En cada grupo, se pueden combinar diferentes tipos de contenido asociado."
|
606 |
+
|
607 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
608 |
+
#, php-format
|
609 |
+
msgid "All %s"
|
610 |
+
msgstr "Todo %s"
|
611 |
+
|
612 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
613 |
+
msgid "Password protected"
|
614 |
+
msgstr "Protegido con contraseña"
|
615 |
+
|
616 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
617 |
+
msgid "Private"
|
618 |
+
msgstr "Privado"
|
619 |
+
|
620 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
621 |
+
msgid "Draft"
|
622 |
+
msgstr "Borrador"
|
623 |
+
|
624 |
+
#. translators: post state
|
625 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
626 |
+
msgctxt "post state"
|
627 |
+
msgid "Pending"
|
628 |
+
msgstr "Pendiente"
|
629 |
+
|
630 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
631 |
+
msgid "Sticky"
|
632 |
+
msgstr "Fija"
|
633 |
+
|
634 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
635 |
+
msgid "Scheduled"
|
636 |
+
msgstr "Programado"
|
637 |
+
|
638 |
+
#: ../pointers.php:68
|
639 |
+
msgid "Get started"
|
640 |
+
msgstr "Empezar"
|
641 |
+
|
642 |
+
#: ../pointers.php:69
|
643 |
+
msgid ""
|
644 |
+
"You've just installed Content Aware Sidebars!\n"
|
645 |
+
"\n"
|
646 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
647 |
+
"\n"
|
648 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
649 |
+
msgstr "Acaba de instalar el plugin Content Aware Sidebars!\n\nLe ofrece muchas opciones, de modo que esta pantalla puede verse abrumadora en principio. No se preocupe.\n\nPulse Iniciar tour para ver una rápida introducción y para aprender a desplegar una barra lateral exactamente en el sitio y el momento en que la quiere."
|
650 |
+
|
651 |
+
#: ../pointers.php:76
|
652 |
+
msgid "Start Tour"
|
653 |
+
msgstr "Iniciar el tour"
|
654 |
+
|
655 |
+
#: ../pointers.php:78
|
656 |
+
msgid "Not now"
|
657 |
+
msgstr "De momento no"
|
658 |
+
|
659 |
+
#: ../pointers.php:83
|
660 |
+
msgid ""
|
661 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
662 |
+
"\n"
|
663 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
664 |
+
"\n"
|
665 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
666 |
+
msgstr "Para hacer que una barra lateral sea contextual, se empieza creando un grupo de condiciones.\n\nLos grupos de condiciones están separados unos de otros, lo cual significa que una barra lateral puede tener condiciones muy diferentes.\n\nDenegar un grupo significa que la barra lateral se desplegará en todas las condiciones excepto esas."
|
667 |
+
|
668 |
+
#: ../pointers.php:92
|
669 |
+
msgid "Content and contexts"
|
670 |
+
msgstr "Contenido y contextos"
|
671 |
+
|
672 |
+
#: ../pointers.php:93
|
673 |
+
msgid ""
|
674 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
675 |
+
"\n"
|
676 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
677 |
+
"\n"
|
678 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
679 |
+
msgstr "Aquí encontrará todo el contenido de su sitio que Content Aware Sidebarse soporta desde la instalación.\n\nSimplemente elija el contenido con el que quiere que se muestre la barra lateral y agréguelo a un grupo.\n\nPuede incluso combinar contenido asociado en un grupo; pruébelo eligiendo \"Todas las entradas\", una Categoría y un Autor. ¡Fenomenal!"
|
680 |
+
|
681 |
+
#: ../pointers.php:102
|
682 |
+
msgid "Options, options"
|
683 |
+
msgstr "Opciones, opciones"
|
684 |
+
|
685 |
+
#: ../pointers.php:103
|
686 |
+
msgid ""
|
687 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
688 |
+
"\n"
|
689 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
690 |
+
"\n"
|
691 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
692 |
+
"\n"
|
693 |
+
" You are in control."
|
694 |
+
msgstr "¿Debe mostrarse la barra lateral en páginas individuales o de archivo?\n\n¿Debe combinarse con otra barra lateral o reemplazarla? Tal vez quiera insertarla manualmente en su contenido con un shortcode.\n\nPrograme la barra lateral tal y como lo hace con entradas y páginas, o conviértala en privada de modo que solo sea visible para los usuarios conectados.\n\nUsted tiene el control."
|
695 |
+
|
696 |
+
#: ../pointers.php:112
|
697 |
+
msgid "Help and Support"
|
698 |
+
msgstr "Ayuda y soporte"
|
699 |
+
|
700 |
+
#: ../pointers.php:113
|
701 |
+
msgid ""
|
702 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
703 |
+
"\n"
|
704 |
+
"If you need more help, click on the \"Help\" tab here."
|
705 |
+
msgstr "¡Es todo! Ahora puede empezar a crear barras laterales y a desplegarlas en las condiciones que usted mismo defina.\n\nSi necesita más ayuda, pulse aquí en la pestaña \"Ayuda\"."
|
706 |
+
|
707 |
+
#: ../pointers.php:142
|
708 |
+
msgid "Close"
|
709 |
+
msgstr "Cerrar"
|
710 |
+
|
711 |
+
#: ../pointers.php:143
|
712 |
+
msgid "Next"
|
713 |
+
msgstr "Siguiente"
|
lang/content-aware-sidebars-et.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Tanel Jüris <tannu@marketingsharks.ee>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Estonian (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/et/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: et\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr "Halda ja näita küljepaane sõltuvalt vaadatavast sisust."
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr "Content Aware Sidebars"
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "Impordi"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "KKK"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr ""
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr "Üksik"
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr "Üksik ja arhiiv"
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Arhiiv"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr ""
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Asenda"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Ühenda"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Käsitsi"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Vägisi asendamine"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr ""
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr "Ühenda asukohad"
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Üleval"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "All"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr ""
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Küljepaanid"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Küljepaan"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Lisa uus"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Lisa uus küljepaan"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Muuda küljepaani"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Uus küljepaan"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Kõik küljepaanid"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Vaata küljepaani"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Otsi küljepaanidest"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr "Küljepaane ei leitud"
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr "Prügi hulgast küljepaane ei leitud"
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr "Näita küljepaani koos"
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr "Halda mooduleid"
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr "Küljepaan uuendatud."
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr "Küljepaan avaldatud."
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr "Küljepaan salvestatud."
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr "Küljepaan sisestatud."
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr ""
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr "M j, Y @ G:i"
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr "Küljepaani mustand uuendatud."
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
msgstr[1] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] ""
|
220 |
-
msgstr[1] ""
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] ""
|
227 |
-
msgstr[1] ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr ""
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr ""
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr "Moodulid"
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr "Halda mooduleid"
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr ""
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr "Valikud"
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr "Tingimuste grupid"
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr ""
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr ""
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr "Rohkem infot"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr "Leia abi"
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr ""
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr "Tõlgi kohe"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr "Hangi Preemium komplekt"
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr "Ühel veebilehel kasutamiseks. BETA tähendab, et valmis lehtedel kasutamine ei ole soovitatav."
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr "Poolik omaduste nimekiri"
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr "Vali ja loo küljepaane postituste muutmise vaadetes"
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr ""
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr ""
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr ""
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr ""
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr "Järjekord"
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr ""
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr "Tõlgi see plugin enda keelde"
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr ""
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr "Või siis saad:"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr "Hinnata pluginat lehel WordPress.org"
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr "Link plugina lehele"
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr "Filtreeri küljepaane"
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr "Tingimuste grupp"
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr "Lisa uus"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr "Lisa uus grupp"
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "Muuda"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr "Gruppe ei leitud"
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr "Sisu"
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr "Autoriseerimata päring"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr "Tingimuste grupp ei saa olla tühi"
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr "Tingimuste grupp salvestatud"
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr "Tingimuste grupi eemaldamine ebaõnnestus"
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr "Tingimuste grupp eemaldatud"
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr "Salvesta"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr "Katkesta"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr "Või"
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr ""
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr "Eemalda"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr "Eemalda jäädavalt see grupp ja tema sisu?"
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr "Tulemusi ei leitud."
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr ""
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr "Kehtib kõigis kontekstides peale selle"
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr "Kehtib selles kontekstis"
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr "Autorid"
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr "Näita koos kõikide %s"
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr "Vaata kõiki"
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr "Otsi"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr "bbPress kasutajaprofiilid"
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr "BuddyPress liikmed"
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr "Lisa gruppi"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr "Kuupäevad"
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr "Kuupäevade arhiivid"
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr "Lehtede mallid"
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr "Keeled"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr "Postitüübid"
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr ""
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr ""
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr "%s arhiivid"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr "Blogi leht"
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr "Elemente pole."
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr "Kõige hilisemad"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr "Staatilised lehed"
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr "Esileht"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr "Otsingutulemused"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr "404 leht"
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr "Taksonoomiad"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr "Enim kasutatud"
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr ""
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr "Kõik %s"
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr ""
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr "Tee algust"
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr ""
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr "Alusta tuuri"
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr "Mitte praegu"
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr "Sisu ja kontekstid"
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr "Valikud, valikud"
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr "Abi ja tugi"
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr ""
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr "Sulge"
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr "Järgmine"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Tanel Jüris <tannu@marketingsharks.ee>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Estonian (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/et/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: et\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr "Halda ja näita küljepaane sõltuvalt vaadatavast sisust."
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr "Content Aware Sidebars"
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "Impordi"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "KKK"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr ""
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr "Üksik"
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr "Üksik ja arhiiv"
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Arhiiv"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr ""
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Asenda"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Ühenda"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Käsitsi"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Vägisi asendamine"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr ""
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr "Ühenda asukohad"
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Üleval"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "All"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr ""
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Küljepaanid"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Küljepaan"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Lisa uus"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Lisa uus küljepaan"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Muuda küljepaani"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Uus küljepaan"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Kõik küljepaanid"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Vaata küljepaani"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Otsi küljepaanidest"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr "Küljepaane ei leitud"
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr "Prügi hulgast küljepaane ei leitud"
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr "Näita küljepaani koos"
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr "Halda mooduleid"
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr "Küljepaan uuendatud."
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr "Küljepaan avaldatud."
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr "Küljepaan salvestatud."
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr "Küljepaan sisestatud."
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr ""
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr "M j, Y @ G:i"
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr "Küljepaani mustand uuendatud."
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
msgstr[1] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] ""
|
220 |
+
msgstr[1] ""
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] ""
|
227 |
+
msgstr[1] ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr ""
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr ""
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr "Moodulid"
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr "Halda mooduleid"
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr ""
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr "Valikud"
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr "Tingimuste grupid"
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr ""
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr ""
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr "Rohkem infot"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr "Leia abi"
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr ""
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr "Tõlgi kohe"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr "Hangi Preemium komplekt"
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr "Ühel veebilehel kasutamiseks. BETA tähendab, et valmis lehtedel kasutamine ei ole soovitatav."
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr "Poolik omaduste nimekiri"
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr "Vali ja loo küljepaane postituste muutmise vaadetes"
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr ""
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr ""
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr ""
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr ""
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr "Järjekord"
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr ""
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr "Tõlgi see plugin enda keelde"
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr ""
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr "Või siis saad:"
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr "Hinnata pluginat lehel WordPress.org"
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr "Link plugina lehele"
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr "Filtreeri küljepaane"
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr "Tingimuste grupp"
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr "Lisa uus"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr "Lisa uus grupp"
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "Muuda"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr "Gruppe ei leitud"
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr "Sisu"
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr "Autoriseerimata päring"
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr "Tingimuste grupp ei saa olla tühi"
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr "Tingimuste grupp salvestatud"
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr "Tingimuste grupi eemaldamine ebaõnnestus"
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr "Tingimuste grupp eemaldatud"
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr "Salvesta"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr "Katkesta"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr "Või"
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr ""
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr "Eemalda"
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr "Eemalda jäädavalt see grupp ja tema sisu?"
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr "Tulemusi ei leitud."
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr ""
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr "Kehtib kõigis kontekstides peale selle"
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr "Kehtib selles kontekstis"
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr "Autorid"
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr "Näita koos kõikide %s"
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr "Vaata kõiki"
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr "Otsi"
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr "bbPress kasutajaprofiilid"
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr "BuddyPress liikmed"
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr "Lisa gruppi"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr "Kuupäevad"
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr "Kuupäevade arhiivid"
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr "Lehtede mallid"
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr "Keeled"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr "Postitüübid"
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr ""
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr ""
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr "%s arhiivid"
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr "Blogi leht"
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr "Elemente pole."
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr "Kõige hilisemad"
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr "Staatilised lehed"
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr "Esileht"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr "Otsingutulemused"
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr "404 leht"
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr "Taksonoomiad"
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr "Enim kasutatud"
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr ""
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr ""
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr "Kõik %s"
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr ""
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr "Tee algust"
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr ""
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr "Alusta tuuri"
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr "Mitte praegu"
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr "Sisu ja kontekstid"
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr "Valikud, valikud"
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr "Abi ja tugi"
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr ""
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr "Sulge"
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr "Järgmine"
|
lang/content-aware-sidebars-eu.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Gattiken Produkzioak <gattiken@gattiken.com>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Basque (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/eu/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: eu\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr "Kudeatu eta erakutsi albo-barrak erakutsi nahi den edukiaren arabera."
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr "Content Aware Sidebars"
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr ""
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "Ohiko Galderak"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr "Esposaketa"
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr "Singularra"
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr "Singularra & Artxiboa"
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Artxiboa"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr "Maneiatu"
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Ordezkatu"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Batu"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Eskuz"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Behartu ordezkapena"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr "Ordezkatu berezko albo-barra, batu berarekin edo gehitu albo-barra bat eskuz."
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr "Berezko Albo-Barra"
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr ""
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Gainean"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Azpian"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr "Albo-Barra berezkoaren gainean edo azpian kokatu elkartzea gauzatzean."
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Albo-Barrak"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Albo-barra"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Gehitu berria"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Gehitu Albo-Barra Berria"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Editatu Albo-Barra"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Albo-Barra Berria"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Albo-Barra Guztiak"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Ikusi Albo-Barra"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Bilatu Albo-Barrak"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr "Ez da Albo-Barrarik topatu"
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr "Ez da Albo-Barrarik topatu zakarrontzian"
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr "Erakutsi Albo-Barra honekin:"
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr "Ez dago edukirik. Faborez, gehitu gutxienez baldintzazko talde bat albo-barra erabilgarri bihurtzeko."
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr "Kudeatu Widgetak"
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr "Albo-Barra eguneratu da."
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr "Albo-Barra argitaratu da."
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr "Albo-Barra gorde da."
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr "Albo-Barra aurkeztu da."
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr "<strong>%1$s</strong> erako programatutako Albo-Barra."
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr "M j, Y @ G:i"
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr "Zirriborroa eguneratu da."
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
msgstr[1] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] ""
|
220 |
-
msgstr[1] ""
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] ""
|
227 |
-
msgstr[1] ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr "Faborez, eguneratu Berezko Albo-Barra"
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr "Batu kokapena"
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr "Widgetak"
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr "Kudeatu Widgetak"
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr "Eskuratu doako Content Aware Sidebar Premium Bundle -a."
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr "Ezarpenak"
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr "Baldintzazko Taldeak"
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr "Sortzen den baldintzazko talde bakoitzak, hainbat eduki (baldintza) zehatz deskribatzen ditu, uneko albo-barrak erakutsiko dituenak."
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr "Baldintzazko talde batera gehitutako edukiak modu lojikoan elkartzen ditu, baina baldintzazko taldeek eurek ez-elkartze lojikoa dute. Honek esan nahi du, talde batera gehitutako edukiak asoziatu egin daitezkeela, modu horretan tratatzen diren bitartean, eta taldeek ez diotela elkarri interferitzen. honek baldintza desberdinek aldi berean funtzionatzeko aukera ematen du."
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr "Informazio Gehiago"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr "Eskuratu Laguntza"
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr "Itzuli Content Aware Sidebars zure hizkuntzara eta bihurtu zaitez BETA probalari bat, datorren Premiun Bundle-rako!"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr "Itzuli orain"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr "Eskuratu Premiun Bundle"
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr "Gune bakarreko erabilera. BETA izanik, ez da gomendatzen produkzio guneetarako."
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr "Ezaugarrien Zerrenda Partziala"
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr "Aukeratu eta sortu albo-barrak Bidalketak Editatzeko Pantailan"
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr "Erakutsi albo-barrak URL-ekin komodinak erabiliz"
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr "Erakutsi Albo-Barra Erabiltzaile Baimenekin"
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr "Erakutsi albo-barrakl BuddyPress Erabiltzaile Taldeekin"
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr "Albo-Barren zutabea Post Type and Taxonomy aukeren pantailan"
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr "Ordena"
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr ""
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr "Itzuli plugin hau zure hizkuntzara"
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr ""
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr "Plugin hau maite baduzu, mesedez aztertu etorkizunean berau garatzeko diru apur bat ematea."
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr "Edo bestela:"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr "Eman puntuak plugin honi WordPress.org-n"
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr "Egin lotura pluginaren orrialdearekin"
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr "Baldintzazko Taldea"
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr "Gehitu Berria"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr "Gehitu Talde Berria"
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "Editatu"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr "Edukia"
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr "Baimenik gabeko eskaera"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr "Baldintzazko Taldea ezin da hutsik egon"
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr "Baldintzazko taldea gorde da"
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr "Baldintzazko taldea ezin da ezabatu"
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr "Baldintzazko taldea ezabatu da"
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr "Gorde"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr "Ezeztatu"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr "Edo"
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr ""
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr "Ezabatu"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr "Ezabatu talde hau eta bere edukia betirako?"
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr "Ez da emaitzarik topatu."
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr "Talde honek gorde gabeko aldaketak ditu. Aurrera segi nahi duzu eta aldaketak baztertu?"
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr ""
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr "Egileak"
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr "Erakutsi %s guztiekin"
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr "Ikusi Guztiak"
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr "Bilatu"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr "bbPress Erabiltzaile Profilak"
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr "BuddyPress Kideak"
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr "Gehitu Taldera"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr ""
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr ""
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr "Orrialde Plantillak"
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr "Hizkuntzak"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr "Bidalketa Motak"
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr "Aukeratu automatikoki aukeratutako aurretiazko albo-barra baten kume berri bat "
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr ""
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr ""
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr "Ez dago elementurik."
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr "Berrienak"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr "Orrialde Estatikoak"
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr "Azala"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr "Bilaketaren Emaitzak"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr "404 orrialdea"
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr "Taxonomiak"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr "Erabilienak"
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr ""
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr "Egin klik talde bat editatzeko edo sortzeko. Aukeratu edukia ezkerretik. Talde bakoitzean, elkartutako eduki mota desberdinak uztartu ditzakezu."
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr "%s Guztiak"
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr ""
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr ""
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr ""
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr ""
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr ""
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr ""
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr ""
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr ""
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr ""
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr ""
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Gattiken Produkzioak <gattiken@gattiken.com>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Basque (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/eu/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: eu\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr "Kudeatu eta erakutsi albo-barrak erakutsi nahi den edukiaren arabera."
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr "Content Aware Sidebars"
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr ""
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "Ohiko Galderak"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr "Esposaketa"
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr "Singularra"
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr "Singularra & Artxiboa"
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Artxiboa"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr "Maneiatu"
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Ordezkatu"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Batu"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Eskuz"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Behartu ordezkapena"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr "Ordezkatu berezko albo-barra, batu berarekin edo gehitu albo-barra bat eskuz."
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr "Berezko Albo-Barra"
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr ""
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Gainean"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Azpian"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr "Albo-Barra berezkoaren gainean edo azpian kokatu elkartzea gauzatzean."
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Albo-Barrak"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Albo-barra"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Gehitu berria"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Gehitu Albo-Barra Berria"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Editatu Albo-Barra"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Albo-Barra Berria"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Albo-Barra Guztiak"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Ikusi Albo-Barra"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Bilatu Albo-Barrak"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr "Ez da Albo-Barrarik topatu"
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr "Ez da Albo-Barrarik topatu zakarrontzian"
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr "Erakutsi Albo-Barra honekin:"
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr "Ez dago edukirik. Faborez, gehitu gutxienez baldintzazko talde bat albo-barra erabilgarri bihurtzeko."
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr "Kudeatu Widgetak"
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr "Albo-Barra eguneratu da."
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr "Albo-Barra argitaratu da."
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr "Albo-Barra gorde da."
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr "Albo-Barra aurkeztu da."
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr "<strong>%1$s</strong> erako programatutako Albo-Barra."
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr "M j, Y @ G:i"
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr "Zirriborroa eguneratu da."
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
msgstr[1] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] ""
|
220 |
+
msgstr[1] ""
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] ""
|
227 |
+
msgstr[1] ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr "Faborez, eguneratu Berezko Albo-Barra"
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr "Batu kokapena"
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr "Widgetak"
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr "Kudeatu Widgetak"
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr "Eskuratu doako Content Aware Sidebar Premium Bundle -a."
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr "Ezarpenak"
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr "Baldintzazko Taldeak"
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr "Sortzen den baldintzazko talde bakoitzak, hainbat eduki (baldintza) zehatz deskribatzen ditu, uneko albo-barrak erakutsiko dituenak."
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr "Baldintzazko talde batera gehitutako edukiak modu lojikoan elkartzen ditu, baina baldintzazko taldeek eurek ez-elkartze lojikoa dute. Honek esan nahi du, talde batera gehitutako edukiak asoziatu egin daitezkeela, modu horretan tratatzen diren bitartean, eta taldeek ez diotela elkarri interferitzen. honek baldintza desberdinek aldi berean funtzionatzeko aukera ematen du."
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr "Informazio Gehiago"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr "Eskuratu Laguntza"
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr "Itzuli Content Aware Sidebars zure hizkuntzara eta bihurtu zaitez BETA probalari bat, datorren Premiun Bundle-rako!"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr "Itzuli orain"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr "Eskuratu Premiun Bundle"
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr "Gune bakarreko erabilera. BETA izanik, ez da gomendatzen produkzio guneetarako."
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr "Ezaugarrien Zerrenda Partziala"
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr "Aukeratu eta sortu albo-barrak Bidalketak Editatzeko Pantailan"
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr "Erakutsi albo-barrak URL-ekin komodinak erabiliz"
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr "Erakutsi Albo-Barra Erabiltzaile Baimenekin"
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr "Erakutsi albo-barrakl BuddyPress Erabiltzaile Taldeekin"
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr "Albo-Barren zutabea Post Type and Taxonomy aukeren pantailan"
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr "Ordena"
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr ""
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr "Itzuli plugin hau zure hizkuntzara"
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr ""
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr "Plugin hau maite baduzu, mesedez aztertu etorkizunean berau garatzeko diru apur bat ematea."
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr "Edo bestela:"
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr "Eman puntuak plugin honi WordPress.org-n"
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr "Egin lotura pluginaren orrialdearekin"
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr ""
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr "Baldintzazko Taldea"
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr "Gehitu Berria"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr "Gehitu Talde Berria"
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "Editatu"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr "Edukia"
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr "Baimenik gabeko eskaera"
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr "Baldintzazko Taldea ezin da hutsik egon"
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr "Baldintzazko taldea gorde da"
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr "Baldintzazko taldea ezin da ezabatu"
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr "Baldintzazko taldea ezabatu da"
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr "Gorde"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr "Ezeztatu"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr "Edo"
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr ""
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr "Ezabatu"
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr "Ezabatu talde hau eta bere edukia betirako?"
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr "Ez da emaitzarik topatu."
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr "Talde honek gorde gabeko aldaketak ditu. Aurrera segi nahi duzu eta aldaketak baztertu?"
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr ""
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr "Egileak"
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr "Erakutsi %s guztiekin"
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr "Ikusi Guztiak"
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr "Bilatu"
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr "bbPress Erabiltzaile Profilak"
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr "BuddyPress Kideak"
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr "Gehitu Taldera"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr ""
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr ""
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr "Orrialde Plantillak"
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr "Hizkuntzak"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr "Bidalketa Motak"
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr "Aukeratu automatikoki aukeratutako aurretiazko albo-barra baten kume berri bat "
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr ""
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr ""
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr "Ez dago elementurik."
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr "Berrienak"
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr "Orrialde Estatikoak"
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr "Azala"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr "Bilaketaren Emaitzak"
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr "404 orrialdea"
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr "Taxonomiak"
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr "Erabilienak"
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr ""
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr "Egin klik talde bat editatzeko edo sortzeko. Aukeratu edukia ezkerretik. Talde bakoitzean, elkartutako eduki mota desberdinak uztartu ditzakezu."
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr "%s Guztiak"
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr ""
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr ""
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr ""
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr ""
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr ""
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr ""
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr ""
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr ""
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr ""
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr ""
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr ""
|
lang/content-aware-sidebars-fa_IR.po
CHANGED
@@ -1,707 +1,707 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Khalil Delavaran <khalil.delavaran@gmail.com>, 2015
|
5 |
-
# mohsen salarifar <m@aleme.ir>, 2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Persian (Iran) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fa_IR/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: fa_IR\n"
|
18 |
-
"Plural-Forms: nplurals=1; plural=0;\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr ""
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr ""
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "درون ریزی"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "پرسش و پاسخ"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "قرار گرفتن در معرض"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr ""
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr ""
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "بایگانی"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "دسته"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "جایگزین"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "ترکیب"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "دستی"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr ""
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr ""
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr ""
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr ""
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "بالا"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "پایین"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr ""
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "سایدبارها"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "سایدبار"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "افزودن تازه"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "افزودن سایدبار تازه"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "ویرایش سایدبار"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "سایدبار تازه"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "همه سایدبارها"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "نمایش سایدبارها"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "جستجوی سایدبارها"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "هیچ سایدباری پیدا نشد"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "هیچ سایدباری درون سطل زباله پیدا نشد"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "نمایش سایدبار با"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr ""
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "مدیریت ابزارک ها"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "سایدبار بروزرسانی شد."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "سایدبار منتشر شد."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "سایدبار ذخیره شد."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "سایدبار ثبت شد."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr ""
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr ""
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr ""
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
|
207 |
-
#: ../content-aware-sidebars.php:385
|
208 |
-
#, php-format
|
209 |
-
msgid "%s sidebar permanently deleted."
|
210 |
-
msgid_plural "%s sidebars permanently deleted."
|
211 |
-
msgstr[0] ""
|
212 |
-
|
213 |
-
#: ../content-aware-sidebars.php:386
|
214 |
-
#, php-format
|
215 |
-
msgid "%s sidebar moved to the Trash."
|
216 |
-
msgid_plural "%s sidebars moved to the Trash."
|
217 |
-
msgstr[0] ""
|
218 |
-
|
219 |
-
#: ../content-aware-sidebars.php:387
|
220 |
-
#, php-format
|
221 |
-
msgid "%s sidebar restored from the Trash."
|
222 |
-
msgid_plural "%s sidebars restored from the Trash."
|
223 |
-
msgstr[0] ""
|
224 |
-
|
225 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
226 |
-
msgid "Please update Host Sidebar"
|
227 |
-
msgstr ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:472
|
230 |
-
msgid "Merge position"
|
231 |
-
msgstr ""
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:473
|
234 |
-
msgid "Widgets"
|
235 |
-
msgstr "ابزارکها"
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:586
|
238 |
-
msgid "Manage Widgets"
|
239 |
-
msgstr "مدیریت ابزارکها"
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:756
|
242 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
243 |
-
msgstr ""
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:772
|
246 |
-
msgid "Options"
|
247 |
-
msgstr "تنظیمات"
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:795
|
250 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
251 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
252 |
-
msgid "Condition Groups"
|
253 |
-
msgstr ""
|
254 |
-
|
255 |
-
#: ../content-aware-sidebars.php:796
|
256 |
-
msgid ""
|
257 |
-
"Each created condition group describe some specific content (conditions) "
|
258 |
-
"that the current sidebar should be displayed with."
|
259 |
-
msgstr ""
|
260 |
-
|
261 |
-
#: ../content-aware-sidebars.php:797
|
262 |
-
msgid ""
|
263 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
264 |
-
" groups themselves use logical disjunction. This means that content added to"
|
265 |
-
" a group should be associated, as they are treated as such, and that the "
|
266 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
267 |
-
"extremely focused and at the same time distinct conditions."
|
268 |
-
msgstr ""
|
269 |
-
|
270 |
-
#: ../content-aware-sidebars.php:800
|
271 |
-
msgid "More Information"
|
272 |
-
msgstr "اطلاعات بیشتر"
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
275 |
-
msgid "Get Support"
|
276 |
-
msgstr "تقاضای پشتیبانی"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:816
|
279 |
-
msgid ""
|
280 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
281 |
-
" of the upcoming Premium Bundle*!"
|
282 |
-
msgstr ""
|
283 |
-
|
284 |
-
#: ../content-aware-sidebars.php:817
|
285 |
-
msgid "Translate Now"
|
286 |
-
msgstr "ترجمه کنید"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:818
|
289 |
-
msgid "Get Premium Bundle"
|
290 |
-
msgstr "دریافت نسخه پریمیوم"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:819
|
293 |
-
msgid ""
|
294 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
295 |
-
msgstr ""
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:822
|
298 |
-
msgid "Partial Feature List"
|
299 |
-
msgstr ""
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:824
|
302 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
303 |
-
msgstr ""
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:825
|
306 |
-
msgid "Display sidebars with URLs using wildcards"
|
307 |
-
msgstr ""
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:826
|
310 |
-
msgid "Display sidebars with User Roles"
|
311 |
-
msgstr "نمایش ابزارک به همراه قوانین کاربری"
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:827
|
314 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
315 |
-
msgstr ""
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:828
|
318 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
319 |
-
msgstr ""
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
322 |
-
msgid "Order"
|
323 |
-
msgstr "سفارش"
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:880
|
326 |
-
msgid "Give a review on WordPress.org"
|
327 |
-
msgstr ""
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
330 |
-
msgid "Translate the plugin into your language"
|
331 |
-
msgstr "ترجمه این پلاگین به زبان شما"
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:884
|
334 |
-
msgid "Read the FAQ"
|
335 |
-
msgstr ""
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:899
|
338 |
-
msgid ""
|
339 |
-
"If you love this plugin, please consider donating to support future "
|
340 |
-
"development."
|
341 |
-
msgstr ""
|
342 |
-
|
343 |
-
#: ../content-aware-sidebars.php:908
|
344 |
-
msgid "Or you could:"
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:910
|
348 |
-
msgid "Rate the plugin on WordPress.org"
|
349 |
-
msgstr "رای دادن به این پلاگین در سایت وردپرس"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:911
|
352 |
-
msgid "Link to the plugin page"
|
353 |
-
msgstr "دسترسی به صفحه پلاگین"
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:1045
|
356 |
-
msgid "Filter Sidebars"
|
357 |
-
msgstr ""
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1046
|
360 |
-
msgid "Filter Widgets"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
364 |
-
msgid "Condition Group"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
368 |
-
msgctxt "group"
|
369 |
-
msgid "Add New"
|
370 |
-
msgstr "افزودن تازه"
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
373 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
374 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
375 |
-
msgid "Add New Group"
|
376 |
-
msgstr "افزودن گروه جدید"
|
377 |
-
|
378 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
379 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
380 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
381 |
-
msgctxt "group"
|
382 |
-
msgid "Edit"
|
383 |
-
msgstr "ویرایش"
|
384 |
-
|
385 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
386 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
387 |
-
msgid "No Groups found"
|
388 |
-
msgstr "فاقد گروه"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
391 |
-
msgctxt "condition group"
|
392 |
-
msgid "Negated"
|
393 |
-
msgstr "نفی"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
396 |
-
msgid "Content"
|
397 |
-
msgstr "محتوا"
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
401 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
402 |
-
msgid "Unauthorized request"
|
403 |
-
msgstr "درخواست غیر مجاز"
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
406 |
-
msgid "Condition group cannot be empty"
|
407 |
-
msgstr "شرایط گروه را مشخص کنید"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
410 |
-
msgid "Condition group saved"
|
411 |
-
msgstr "شرایط گروه ذخیره شد"
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
414 |
-
msgid "Condition group could not be removed"
|
415 |
-
msgstr "شرایط گروه حذف نشد"
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
418 |
-
msgid "Condition group removed"
|
419 |
-
msgstr "شرایط گروه حذف شد"
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
422 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
423 |
-
msgid "Save"
|
424 |
-
msgstr "ذخیره"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Cancel"
|
429 |
-
msgstr "لغو"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
433 |
-
msgid "Or"
|
434 |
-
msgstr "یا"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
437 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
438 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
439 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
440 |
-
msgid "And"
|
441 |
-
msgstr ""
|
442 |
-
|
443 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
444 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
445 |
-
msgid "Remove"
|
446 |
-
msgstr "حذف"
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
449 |
-
msgid "Remove this group and its contents permanently?"
|
450 |
-
msgstr ""
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
453 |
-
msgid "No results found."
|
454 |
-
msgstr "نتیجهای حاصل نشد."
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
457 |
-
msgid ""
|
458 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
459 |
-
"these changes?"
|
460 |
-
msgstr ""
|
461 |
-
|
462 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
463 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
464 |
-
msgid "Negate group"
|
465 |
-
msgstr "نادیده گرفتن گروه"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
469 |
-
msgid "Target all but this context"
|
470 |
-
msgstr ""
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target this context"
|
475 |
-
msgstr "هدف قرار دادن این زمینه"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
478 |
-
msgid "Authors"
|
479 |
-
msgstr "نویسندگان"
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
482 |
-
#, php-format
|
483 |
-
msgid "Display with All %s"
|
484 |
-
msgstr "نمایش همه %s"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
487 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
488 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
489 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
490 |
-
msgid "View All"
|
491 |
-
msgstr "نمایش همه"
|
492 |
-
|
493 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
494 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
495 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
496 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
497 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
498 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
499 |
-
msgid "Search"
|
500 |
-
msgstr "جستجو"
|
501 |
-
|
502 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
503 |
-
msgid "bbPress User Profiles"
|
504 |
-
msgstr "پروفایل کاربران bbPress"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
507 |
-
msgid "BuddyPress Members"
|
508 |
-
msgstr "اعضای BuddyPress"
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
511 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
512 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
513 |
-
msgid "Add to Group"
|
514 |
-
msgstr "افزودن به گروه"
|
515 |
-
|
516 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
517 |
-
msgid "Dates"
|
518 |
-
msgstr "تاریخ"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
521 |
-
msgid "Date Archives"
|
522 |
-
msgstr "تاریخ بایگانی"
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
525 |
-
msgid "Page Templates"
|
526 |
-
msgstr "قالببندی صفحه"
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
529 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
530 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
531 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
532 |
-
msgid "Languages"
|
533 |
-
msgstr "زبان"
|
534 |
-
|
535 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
536 |
-
msgid "Post Types"
|
537 |
-
msgstr "نوع ارسال"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
540 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
541 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
542 |
-
msgid "Automatically select new children of a selected ancestor"
|
543 |
-
msgstr ""
|
544 |
-
|
545 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
546 |
-
msgid "Automatically add new children of a selected ancestor"
|
547 |
-
msgstr ""
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
550 |
-
#, php-format
|
551 |
-
msgid "%s Archives"
|
552 |
-
msgstr "%s بایگانی"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
555 |
-
msgid "Blog Page"
|
556 |
-
msgstr "صفحه وبلاگ"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
559 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
560 |
-
msgid "No items."
|
561 |
-
msgstr "فاقد محتوا"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
564 |
-
msgid "Most Recent"
|
565 |
-
msgstr "آخرین ارسال"
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
568 |
-
msgid "Static Pages"
|
569 |
-
msgstr "صفحات ثابت"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
572 |
-
msgid "Front Page"
|
573 |
-
msgstr "صفحه اصلی"
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
576 |
-
msgid "Search Results"
|
577 |
-
msgstr "نتایج جستجو"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
580 |
-
msgid "404 Page"
|
581 |
-
msgstr "صفحه خطای 404"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
584 |
-
msgid "Taxonomies"
|
585 |
-
msgstr ""
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
588 |
-
msgid "Most Used"
|
589 |
-
msgstr "بیشتر استفاده شده"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
592 |
-
msgid "Conditional Content"
|
593 |
-
msgstr ""
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
596 |
-
msgid ""
|
597 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
598 |
-
" it. In each group, you can combine different types of associated content."
|
599 |
-
msgstr ""
|
600 |
-
|
601 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
602 |
-
#, php-format
|
603 |
-
msgid "All %s"
|
604 |
-
msgstr "همه %s"
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
607 |
-
msgid "Password protected"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
611 |
-
msgid "Private"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
615 |
-
msgid "Draft"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#. translators: post state
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
620 |
-
msgctxt "post state"
|
621 |
-
msgid "Pending"
|
622 |
-
msgstr ""
|
623 |
-
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
625 |
-
msgid "Sticky"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
629 |
-
msgid "Scheduled"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../pointers.php:68
|
633 |
-
msgid "Get started"
|
634 |
-
msgstr "شروع کنید"
|
635 |
-
|
636 |
-
#: ../pointers.php:69
|
637 |
-
msgid ""
|
638 |
-
"You've just installed Content Aware Sidebars!\n"
|
639 |
-
"\n"
|
640 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
641 |
-
"\n"
|
642 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
643 |
-
msgstr ""
|
644 |
-
|
645 |
-
#: ../pointers.php:76
|
646 |
-
msgid "Start Tour"
|
647 |
-
msgstr "نمایش تور معرفی"
|
648 |
-
|
649 |
-
#: ../pointers.php:78
|
650 |
-
msgid "Not now"
|
651 |
-
msgstr "فعلا نه"
|
652 |
-
|
653 |
-
#: ../pointers.php:83
|
654 |
-
msgid ""
|
655 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
656 |
-
"\n"
|
657 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
658 |
-
"\n"
|
659 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
660 |
-
msgstr ""
|
661 |
-
|
662 |
-
#: ../pointers.php:92
|
663 |
-
msgid "Content and contexts"
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:93
|
667 |
-
msgid ""
|
668 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
669 |
-
"\n"
|
670 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
671 |
-
"\n"
|
672 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
673 |
-
msgstr ""
|
674 |
-
|
675 |
-
#: ../pointers.php:102
|
676 |
-
msgid "Options, options"
|
677 |
-
msgstr "تنظیمات"
|
678 |
-
|
679 |
-
#: ../pointers.php:103
|
680 |
-
msgid ""
|
681 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
682 |
-
"\n"
|
683 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
684 |
-
"\n"
|
685 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
686 |
-
"\n"
|
687 |
-
" You are in control."
|
688 |
-
msgstr ""
|
689 |
-
|
690 |
-
#: ../pointers.php:112
|
691 |
-
msgid "Help and Support"
|
692 |
-
msgstr "کمک و شتیبانی"
|
693 |
-
|
694 |
-
#: ../pointers.php:113
|
695 |
-
msgid ""
|
696 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
697 |
-
"\n"
|
698 |
-
"If you need more help, click on the \"Help\" tab here."
|
699 |
-
msgstr ""
|
700 |
-
|
701 |
-
#: ../pointers.php:142
|
702 |
-
msgid "Close"
|
703 |
-
msgstr "بسته"
|
704 |
-
|
705 |
-
#: ../pointers.php:143
|
706 |
-
msgid "Next"
|
707 |
-
msgstr "بعدی"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Khalil Delavaran <khalil.delavaran@gmail.com>, 2015
|
5 |
+
# mohsen salarifar <m@aleme.ir>, 2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Persian (Iran) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fa_IR/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: fa_IR\n"
|
18 |
+
"Plural-Forms: nplurals=1; plural=0;\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr ""
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr ""
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "درون ریزی"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "پرسش و پاسخ"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "قرار گرفتن در معرض"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr ""
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr ""
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "بایگانی"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "دسته"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "جایگزین"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "ترکیب"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "دستی"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr ""
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr ""
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr ""
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr ""
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "بالا"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "پایین"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr ""
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "سایدبارها"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "سایدبار"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "افزودن تازه"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "افزودن سایدبار تازه"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "ویرایش سایدبار"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "سایدبار تازه"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "همه سایدبارها"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "نمایش سایدبارها"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "جستجوی سایدبارها"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "هیچ سایدباری پیدا نشد"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "هیچ سایدباری درون سطل زباله پیدا نشد"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "نمایش سایدبار با"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr ""
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "مدیریت ابزارک ها"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "سایدبار بروزرسانی شد."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "سایدبار منتشر شد."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "سایدبار ذخیره شد."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "سایدبار ثبت شد."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr ""
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr ""
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr ""
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
|
207 |
+
#: ../content-aware-sidebars.php:385
|
208 |
+
#, php-format
|
209 |
+
msgid "%s sidebar permanently deleted."
|
210 |
+
msgid_plural "%s sidebars permanently deleted."
|
211 |
+
msgstr[0] ""
|
212 |
+
|
213 |
+
#: ../content-aware-sidebars.php:386
|
214 |
+
#, php-format
|
215 |
+
msgid "%s sidebar moved to the Trash."
|
216 |
+
msgid_plural "%s sidebars moved to the Trash."
|
217 |
+
msgstr[0] ""
|
218 |
+
|
219 |
+
#: ../content-aware-sidebars.php:387
|
220 |
+
#, php-format
|
221 |
+
msgid "%s sidebar restored from the Trash."
|
222 |
+
msgid_plural "%s sidebars restored from the Trash."
|
223 |
+
msgstr[0] ""
|
224 |
+
|
225 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
226 |
+
msgid "Please update Host Sidebar"
|
227 |
+
msgstr ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:472
|
230 |
+
msgid "Merge position"
|
231 |
+
msgstr ""
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:473
|
234 |
+
msgid "Widgets"
|
235 |
+
msgstr "ابزارکها"
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:586
|
238 |
+
msgid "Manage Widgets"
|
239 |
+
msgstr "مدیریت ابزارکها"
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:756
|
242 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
243 |
+
msgstr ""
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:772
|
246 |
+
msgid "Options"
|
247 |
+
msgstr "تنظیمات"
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:795
|
250 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
251 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
252 |
+
msgid "Condition Groups"
|
253 |
+
msgstr ""
|
254 |
+
|
255 |
+
#: ../content-aware-sidebars.php:796
|
256 |
+
msgid ""
|
257 |
+
"Each created condition group describe some specific content (conditions) "
|
258 |
+
"that the current sidebar should be displayed with."
|
259 |
+
msgstr ""
|
260 |
+
|
261 |
+
#: ../content-aware-sidebars.php:797
|
262 |
+
msgid ""
|
263 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
264 |
+
" groups themselves use logical disjunction. This means that content added to"
|
265 |
+
" a group should be associated, as they are treated as such, and that the "
|
266 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
267 |
+
"extremely focused and at the same time distinct conditions."
|
268 |
+
msgstr ""
|
269 |
+
|
270 |
+
#: ../content-aware-sidebars.php:800
|
271 |
+
msgid "More Information"
|
272 |
+
msgstr "اطلاعات بیشتر"
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
275 |
+
msgid "Get Support"
|
276 |
+
msgstr "تقاضای پشتیبانی"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:816
|
279 |
+
msgid ""
|
280 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
281 |
+
" of the upcoming Premium Bundle*!"
|
282 |
+
msgstr ""
|
283 |
+
|
284 |
+
#: ../content-aware-sidebars.php:817
|
285 |
+
msgid "Translate Now"
|
286 |
+
msgstr "ترجمه کنید"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:818
|
289 |
+
msgid "Get Premium Bundle"
|
290 |
+
msgstr "دریافت نسخه پریمیوم"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:819
|
293 |
+
msgid ""
|
294 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
295 |
+
msgstr ""
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:822
|
298 |
+
msgid "Partial Feature List"
|
299 |
+
msgstr ""
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:824
|
302 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
303 |
+
msgstr ""
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:825
|
306 |
+
msgid "Display sidebars with URLs using wildcards"
|
307 |
+
msgstr ""
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:826
|
310 |
+
msgid "Display sidebars with User Roles"
|
311 |
+
msgstr "نمایش ابزارک به همراه قوانین کاربری"
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:827
|
314 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
315 |
+
msgstr ""
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:828
|
318 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
319 |
+
msgstr ""
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
322 |
+
msgid "Order"
|
323 |
+
msgstr "سفارش"
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:880
|
326 |
+
msgid "Give a review on WordPress.org"
|
327 |
+
msgstr ""
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
330 |
+
msgid "Translate the plugin into your language"
|
331 |
+
msgstr "ترجمه این پلاگین به زبان شما"
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:884
|
334 |
+
msgid "Read the FAQ"
|
335 |
+
msgstr ""
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:899
|
338 |
+
msgid ""
|
339 |
+
"If you love this plugin, please consider donating to support future "
|
340 |
+
"development."
|
341 |
+
msgstr ""
|
342 |
+
|
343 |
+
#: ../content-aware-sidebars.php:908
|
344 |
+
msgid "Or you could:"
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:910
|
348 |
+
msgid "Rate the plugin on WordPress.org"
|
349 |
+
msgstr "رای دادن به این پلاگین در سایت وردپرس"
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:911
|
352 |
+
msgid "Link to the plugin page"
|
353 |
+
msgstr "دسترسی به صفحه پلاگین"
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:1045
|
356 |
+
msgid "Filter Sidebars"
|
357 |
+
msgstr ""
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1046
|
360 |
+
msgid "Filter Widgets"
|
361 |
+
msgstr ""
|
362 |
+
|
363 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
364 |
+
msgid "Condition Group"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
368 |
+
msgctxt "group"
|
369 |
+
msgid "Add New"
|
370 |
+
msgstr "افزودن تازه"
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
373 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
374 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
375 |
+
msgid "Add New Group"
|
376 |
+
msgstr "افزودن گروه جدید"
|
377 |
+
|
378 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
379 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
380 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
381 |
+
msgctxt "group"
|
382 |
+
msgid "Edit"
|
383 |
+
msgstr "ویرایش"
|
384 |
+
|
385 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
386 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
387 |
+
msgid "No Groups found"
|
388 |
+
msgstr "فاقد گروه"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
391 |
+
msgctxt "condition group"
|
392 |
+
msgid "Negated"
|
393 |
+
msgstr "نفی"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
396 |
+
msgid "Content"
|
397 |
+
msgstr "محتوا"
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
401 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
402 |
+
msgid "Unauthorized request"
|
403 |
+
msgstr "درخواست غیر مجاز"
|
404 |
+
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
406 |
+
msgid "Condition group cannot be empty"
|
407 |
+
msgstr "شرایط گروه را مشخص کنید"
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
410 |
+
msgid "Condition group saved"
|
411 |
+
msgstr "شرایط گروه ذخیره شد"
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
414 |
+
msgid "Condition group could not be removed"
|
415 |
+
msgstr "شرایط گروه حذف نشد"
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
418 |
+
msgid "Condition group removed"
|
419 |
+
msgstr "شرایط گروه حذف شد"
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
422 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
423 |
+
msgid "Save"
|
424 |
+
msgstr "ذخیره"
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Cancel"
|
429 |
+
msgstr "لغو"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
433 |
+
msgid "Or"
|
434 |
+
msgstr "یا"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
437 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
438 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
439 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
440 |
+
msgid "And"
|
441 |
+
msgstr ""
|
442 |
+
|
443 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
444 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
445 |
+
msgid "Remove"
|
446 |
+
msgstr "حذف"
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
449 |
+
msgid "Remove this group and its contents permanently?"
|
450 |
+
msgstr ""
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
453 |
+
msgid "No results found."
|
454 |
+
msgstr "نتیجهای حاصل نشد."
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
457 |
+
msgid ""
|
458 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
459 |
+
"these changes?"
|
460 |
+
msgstr ""
|
461 |
+
|
462 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
463 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
464 |
+
msgid "Negate group"
|
465 |
+
msgstr "نادیده گرفتن گروه"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
469 |
+
msgid "Target all but this context"
|
470 |
+
msgstr ""
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target this context"
|
475 |
+
msgstr "هدف قرار دادن این زمینه"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
478 |
+
msgid "Authors"
|
479 |
+
msgstr "نویسندگان"
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
482 |
+
#, php-format
|
483 |
+
msgid "Display with All %s"
|
484 |
+
msgstr "نمایش همه %s"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
487 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
488 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
489 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
490 |
+
msgid "View All"
|
491 |
+
msgstr "نمایش همه"
|
492 |
+
|
493 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
494 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
495 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
496 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
497 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
498 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
499 |
+
msgid "Search"
|
500 |
+
msgstr "جستجو"
|
501 |
+
|
502 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
503 |
+
msgid "bbPress User Profiles"
|
504 |
+
msgstr "پروفایل کاربران bbPress"
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
507 |
+
msgid "BuddyPress Members"
|
508 |
+
msgstr "اعضای BuddyPress"
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
511 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
512 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
513 |
+
msgid "Add to Group"
|
514 |
+
msgstr "افزودن به گروه"
|
515 |
+
|
516 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
517 |
+
msgid "Dates"
|
518 |
+
msgstr "تاریخ"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
521 |
+
msgid "Date Archives"
|
522 |
+
msgstr "تاریخ بایگانی"
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
525 |
+
msgid "Page Templates"
|
526 |
+
msgstr "قالببندی صفحه"
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
529 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
530 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
531 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
532 |
+
msgid "Languages"
|
533 |
+
msgstr "زبان"
|
534 |
+
|
535 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
536 |
+
msgid "Post Types"
|
537 |
+
msgstr "نوع ارسال"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
540 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
541 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
542 |
+
msgid "Automatically select new children of a selected ancestor"
|
543 |
+
msgstr ""
|
544 |
+
|
545 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
546 |
+
msgid "Automatically add new children of a selected ancestor"
|
547 |
+
msgstr ""
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
550 |
+
#, php-format
|
551 |
+
msgid "%s Archives"
|
552 |
+
msgstr "%s بایگانی"
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
555 |
+
msgid "Blog Page"
|
556 |
+
msgstr "صفحه وبلاگ"
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
559 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
560 |
+
msgid "No items."
|
561 |
+
msgstr "فاقد محتوا"
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
564 |
+
msgid "Most Recent"
|
565 |
+
msgstr "آخرین ارسال"
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
568 |
+
msgid "Static Pages"
|
569 |
+
msgstr "صفحات ثابت"
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
572 |
+
msgid "Front Page"
|
573 |
+
msgstr "صفحه اصلی"
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
576 |
+
msgid "Search Results"
|
577 |
+
msgstr "نتایج جستجو"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
580 |
+
msgid "404 Page"
|
581 |
+
msgstr "صفحه خطای 404"
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
584 |
+
msgid "Taxonomies"
|
585 |
+
msgstr ""
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
588 |
+
msgid "Most Used"
|
589 |
+
msgstr "بیشتر استفاده شده"
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
592 |
+
msgid "Conditional Content"
|
593 |
+
msgstr ""
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
596 |
+
msgid ""
|
597 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
598 |
+
" it. In each group, you can combine different types of associated content."
|
599 |
+
msgstr ""
|
600 |
+
|
601 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
602 |
+
#, php-format
|
603 |
+
msgid "All %s"
|
604 |
+
msgstr "همه %s"
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
607 |
+
msgid "Password protected"
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
611 |
+
msgid "Private"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
615 |
+
msgid "Draft"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#. translators: post state
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
620 |
+
msgctxt "post state"
|
621 |
+
msgid "Pending"
|
622 |
+
msgstr ""
|
623 |
+
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
625 |
+
msgid "Sticky"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
629 |
+
msgid "Scheduled"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../pointers.php:68
|
633 |
+
msgid "Get started"
|
634 |
+
msgstr "شروع کنید"
|
635 |
+
|
636 |
+
#: ../pointers.php:69
|
637 |
+
msgid ""
|
638 |
+
"You've just installed Content Aware Sidebars!\n"
|
639 |
+
"\n"
|
640 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
641 |
+
"\n"
|
642 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
643 |
+
msgstr ""
|
644 |
+
|
645 |
+
#: ../pointers.php:76
|
646 |
+
msgid "Start Tour"
|
647 |
+
msgstr "نمایش تور معرفی"
|
648 |
+
|
649 |
+
#: ../pointers.php:78
|
650 |
+
msgid "Not now"
|
651 |
+
msgstr "فعلا نه"
|
652 |
+
|
653 |
+
#: ../pointers.php:83
|
654 |
+
msgid ""
|
655 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
656 |
+
"\n"
|
657 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
658 |
+
"\n"
|
659 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
660 |
+
msgstr ""
|
661 |
+
|
662 |
+
#: ../pointers.php:92
|
663 |
+
msgid "Content and contexts"
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:93
|
667 |
+
msgid ""
|
668 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
669 |
+
"\n"
|
670 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
671 |
+
"\n"
|
672 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
673 |
+
msgstr ""
|
674 |
+
|
675 |
+
#: ../pointers.php:102
|
676 |
+
msgid "Options, options"
|
677 |
+
msgstr "تنظیمات"
|
678 |
+
|
679 |
+
#: ../pointers.php:103
|
680 |
+
msgid ""
|
681 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
682 |
+
"\n"
|
683 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
684 |
+
"\n"
|
685 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
686 |
+
"\n"
|
687 |
+
" You are in control."
|
688 |
+
msgstr ""
|
689 |
+
|
690 |
+
#: ../pointers.php:112
|
691 |
+
msgid "Help and Support"
|
692 |
+
msgstr "کمک و شتیبانی"
|
693 |
+
|
694 |
+
#: ../pointers.php:113
|
695 |
+
msgid ""
|
696 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
697 |
+
"\n"
|
698 |
+
"If you need more help, click on the \"Help\" tab here."
|
699 |
+
msgstr ""
|
700 |
+
|
701 |
+
#: ../pointers.php:142
|
702 |
+
msgid "Close"
|
703 |
+
msgstr "بسته"
|
704 |
+
|
705 |
+
#: ../pointers.php:143
|
706 |
+
msgid "Next"
|
707 |
+
msgstr "بعدی"
|
lang/content-aware-sidebars-fi.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Anna Illikainen <anna.illikainenx@gmail.com>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Finnish (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fi/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: fi\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr ""
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr ""
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr ""
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "UKK"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr ""
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr ""
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr ""
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Arkisto"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr ""
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr ""
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Yhdistä"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr ""
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr ""
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr ""
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr ""
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Ylä"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Ala"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr ""
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Sivupalkit"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Sivupalkki"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Lisää uusi"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Lisää uusi sivupalkki"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Muokkaa sivupalkkia"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Uusi sivupalkki"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Kaikki sivupalkit"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Näytä sivupalkki"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Hae sivupalkeista"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr "Sivupalkkeja ei löytynyt"
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr "Ei sivupalkkeja roskakorissa"
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr ""
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr ""
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr "Sivupalkki päivitetty."
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr "Sivupalkki julkaistu."
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr "Sivupalkki tallennettu."
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr "Sivupalkki lähetetty."
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr ""
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr ""
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr "Sivupalkin luonnos päivitetty."
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
msgstr[1] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] ""
|
220 |
-
msgstr[1] ""
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] ""
|
227 |
-
msgstr[1] ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr ""
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr "Yhdistä paikka"
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr ""
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr ""
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr "Hanki ilmainen Content Aware Sidebars premium-paketti"
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr "Asetukset"
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr ""
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr ""
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr ""
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr "Lisätietoa"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr "Tuki"
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr ""
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr "Käännä nyt"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr "Hanki premium-pakkaus"
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr "Yhden sivun käyttöön. "
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr "Osittainen lista ominaisuuksista"
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr ""
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr ""
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr ""
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr ""
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr ""
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr "Järjestys"
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr ""
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr ""
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr ""
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr "Vaihtoehtoisesti:"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr ""
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr ""
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr ""
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr "Lisää uusi"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr "Lisää uusi ryhmä"
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "Muokkaa"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr "Sisältö"
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr ""
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr ""
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr ""
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr ""
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr ""
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr "Tallenna"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr "Peruuta"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr "Tai"
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr ""
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr "Poista"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr ""
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr "Ei hakutuloksia."
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr ""
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr ""
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr ""
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr ""
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr "Näytä kaikki"
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr "Haku"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr ""
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr ""
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr "Lisää ryhmään"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr ""
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr ""
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr ""
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr "Kielet"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr ""
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr ""
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr ""
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr ""
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr ""
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr "Uusin"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr ""
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr "Etusivu"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr "Hakutulokset"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr "404 Sivu"
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr "Luokittelut"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr "Eniten käytetty"
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr ""
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr ""
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr ""
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr ""
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr ""
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr ""
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr ""
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr ""
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr ""
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr ""
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr ""
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Anna Illikainen <anna.illikainenx@gmail.com>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Finnish (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fi/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: fi\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr ""
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr ""
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr ""
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "UKK"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr ""
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr ""
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr ""
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Arkisto"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr ""
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr ""
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Yhdistä"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr ""
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr ""
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr ""
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr ""
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Ylä"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Ala"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr ""
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Sivupalkit"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Sivupalkki"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Lisää uusi"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Lisää uusi sivupalkki"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Muokkaa sivupalkkia"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Uusi sivupalkki"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Kaikki sivupalkit"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Näytä sivupalkki"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Hae sivupalkeista"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr "Sivupalkkeja ei löytynyt"
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr "Ei sivupalkkeja roskakorissa"
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr ""
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr ""
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr "Sivupalkki päivitetty."
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr "Sivupalkki julkaistu."
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr "Sivupalkki tallennettu."
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr "Sivupalkki lähetetty."
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr ""
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr ""
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr "Sivupalkin luonnos päivitetty."
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
msgstr[1] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] ""
|
220 |
+
msgstr[1] ""
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] ""
|
227 |
+
msgstr[1] ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr ""
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr "Yhdistä paikka"
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr ""
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr ""
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr "Hanki ilmainen Content Aware Sidebars premium-paketti"
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr "Asetukset"
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr ""
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr ""
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr ""
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr "Lisätietoa"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr "Tuki"
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr ""
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr "Käännä nyt"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr "Hanki premium-pakkaus"
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr "Yhden sivun käyttöön. "
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr "Osittainen lista ominaisuuksista"
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr ""
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr ""
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr ""
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr ""
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr ""
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr "Järjestys"
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr ""
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr ""
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr ""
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr "Vaihtoehtoisesti:"
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr ""
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr ""
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr ""
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr ""
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr "Lisää uusi"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr "Lisää uusi ryhmä"
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "Muokkaa"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr "Sisältö"
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr ""
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr ""
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr ""
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr ""
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr ""
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr "Tallenna"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr "Peruuta"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr "Tai"
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr ""
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr "Poista"
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr ""
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr "Ei hakutuloksia."
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr ""
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr ""
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr ""
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr ""
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr "Näytä kaikki"
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr "Haku"
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr ""
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr ""
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr "Lisää ryhmään"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr ""
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr ""
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr ""
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr "Kielet"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr ""
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr ""
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr ""
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr ""
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr ""
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr "Uusin"
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr ""
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr "Etusivu"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr "Hakutulokset"
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr "404 Sivu"
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr "Luokittelut"
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr "Eniten käytetty"
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr ""
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr ""
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr ""
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr ""
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr ""
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr ""
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr ""
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr ""
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr ""
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr ""
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr ""
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr ""
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr ""
|
lang/content-aware-sidebars-fr_CA.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Francois Richard <frichard@videotron.ca>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: French (Canada) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fr_CA/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: fr_CA\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n > 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr ""
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr ""
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "Importer"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "FAQ"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr "Exposition"
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr "Du singulier"
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr ""
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Archive"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr "Poignée"
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Remplacer"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Fusionner"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Manuel"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Forcer le remplacement"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr "Hôte Sidebar"
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr "Fusionner la position"
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Haut"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Bas"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr "Placez le Sidebar en haut ou en bas de l'hôte lors de la fusion."
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Sidebars"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Sidebar"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Ajouter un nouveau"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Ajoutez un nouveau Sidebar"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Éditer le Sidebar"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Nouveau Sidebar"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Tous les Sidebars"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Voir le Sidebar"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Chercher"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr ""
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr "Aucun Sidebar trouvé dans la corbeille"
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr ""
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr ""
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr ""
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr ""
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr ""
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr ""
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr ""
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr ""
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr ""
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
msgstr[1] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] ""
|
220 |
-
msgstr[1] ""
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] ""
|
227 |
-
msgstr[1] ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr ""
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr ""
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr ""
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr ""
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr "Obtenez gratuitement la version Premium de Content Aware Sidebars"
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr ""
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr ""
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr ""
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr ""
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr ""
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr ""
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr "Traduisez Content Aware Sidebars dans votre langue et devenez un testeur bêta de la prochaine prochaine version Premium* !"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr ""
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr "Obtenez la version Premium"
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr ""
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr ""
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr ""
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr ""
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr ""
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr ""
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr ""
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr ""
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr ""
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr ""
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr ""
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr ""
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr ""
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr ""
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr ""
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr "Ajouter un nouveau"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr ""
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "Éditer"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr "Contenu"
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr ""
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr ""
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr ""
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr ""
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr ""
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr "Sauvegarder"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr "Annulé"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr ""
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr ""
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr "Supprimé"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr ""
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr ""
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr ""
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr ""
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr "Auteurs"
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr ""
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr ""
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr ""
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr ""
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr ""
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr ""
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr "Dates"
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr "Date des archives"
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr ""
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr "Traduction"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr "Types de poste"
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr ""
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr ""
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr "%s Archives"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr ""
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr ""
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr ""
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr "Page Accueil"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr ""
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr ""
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr ""
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr ""
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr ""
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr ""
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr ""
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr ""
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr ""
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr ""
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr ""
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr "Options, options"
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr ""
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr ""
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr ""
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr ""
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Francois Richard <frichard@videotron.ca>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: French (Canada) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fr_CA/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: fr_CA\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n > 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr ""
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr ""
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "Importer"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "FAQ"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr "Exposition"
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr "Du singulier"
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr ""
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Archive"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr "Poignée"
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Remplacer"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Fusionner"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Manuel"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Forcer le remplacement"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr "Hôte Sidebar"
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr "Fusionner la position"
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Haut"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Bas"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr "Placez le Sidebar en haut ou en bas de l'hôte lors de la fusion."
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Sidebars"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Sidebar"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Ajouter un nouveau"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Ajoutez un nouveau Sidebar"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Éditer le Sidebar"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Nouveau Sidebar"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Tous les Sidebars"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Voir le Sidebar"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Chercher"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr ""
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr "Aucun Sidebar trouvé dans la corbeille"
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr ""
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr ""
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr ""
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr ""
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr ""
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr ""
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr ""
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr ""
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr ""
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
msgstr[1] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] ""
|
220 |
+
msgstr[1] ""
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] ""
|
227 |
+
msgstr[1] ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr ""
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr ""
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr ""
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr ""
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr "Obtenez gratuitement la version Premium de Content Aware Sidebars"
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr ""
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr ""
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr ""
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr ""
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr ""
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr ""
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr "Traduisez Content Aware Sidebars dans votre langue et devenez un testeur bêta de la prochaine prochaine version Premium* !"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr ""
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr "Obtenez la version Premium"
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr ""
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr ""
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr ""
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr ""
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr ""
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr ""
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr ""
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr ""
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr ""
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr ""
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr ""
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr ""
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr ""
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr ""
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr ""
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr ""
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr "Ajouter un nouveau"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr ""
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "Éditer"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr "Contenu"
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr ""
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr ""
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr ""
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr ""
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr ""
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr "Sauvegarder"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr "Annulé"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr ""
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr ""
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr "Supprimé"
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr ""
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr ""
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr ""
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr ""
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr "Auteurs"
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr ""
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr ""
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr ""
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr ""
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr ""
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr ""
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr "Dates"
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr "Date des archives"
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr ""
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr "Traduction"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr "Types de poste"
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr ""
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr ""
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr "%s Archives"
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr ""
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr ""
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr ""
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr "Page Accueil"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr ""
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr ""
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr ""
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr ""
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr ""
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr ""
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr ""
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr ""
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr ""
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr ""
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr ""
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr ""
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr "Options, options"
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr ""
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr ""
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr ""
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr ""
|
lang/content-aware-sidebars-fr_FR.po
CHANGED
@@ -1,713 +1,713 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Pierre-Yves Sorel <admin@synergiaweb.com>, 2015
|
5 |
-
# Rachid <rachid.braymi@gmail.com>, 2015
|
6 |
-
# Seb <fastfuel@hotmail.com>, 2015
|
7 |
-
msgid ""
|
8 |
-
msgstr ""
|
9 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
10 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
11 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
12 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
13 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
14 |
-
"Language-Team: French (France) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fr_FR/)\n"
|
15 |
-
"MIME-Version: 1.0\n"
|
16 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
17 |
-
"Content-Transfer-Encoding: 8bit\n"
|
18 |
-
"Language: fr_FR\n"
|
19 |
-
"Plural-Forms: nplurals=2; plural=(n > 1);\n"
|
20 |
-
"X-Generator: Poedit 1.7.6\n"
|
21 |
-
"X-Poedit-Basepath: .\n"
|
22 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
23 |
-
"X-Poedit-SearchPath-0: .\n"
|
24 |
-
"X-Poedit-SearchPath-1: ..\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
26 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
27 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
28 |
-
"X-Textdomain-Support: yes\n"
|
29 |
-
|
30 |
-
#: ../content-aware-sidebars.php:95
|
31 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
32 |
-
msgstr "Gérer et afficher les sidebars selon le contenu visionné."
|
33 |
-
|
34 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
35 |
-
msgid "Content Aware Sidebars"
|
36 |
-
msgstr "Content Aware Sidebars"
|
37 |
-
|
38 |
-
#: ../content-aware-sidebars.php:97
|
39 |
-
msgid "Import"
|
40 |
-
msgstr "Importer"
|
41 |
-
|
42 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
43 |
-
msgid "FAQ"
|
44 |
-
msgstr "FAQ"
|
45 |
-
|
46 |
-
#: ../content-aware-sidebars.php:256
|
47 |
-
msgid "Exposure"
|
48 |
-
msgstr "Affichage"
|
49 |
-
|
50 |
-
#: ../content-aware-sidebars.php:260
|
51 |
-
msgid "Singular"
|
52 |
-
msgstr "Pages et Articles"
|
53 |
-
|
54 |
-
#: ../content-aware-sidebars.php:261
|
55 |
-
msgid "Singular & Archive"
|
56 |
-
msgstr "Pages, Articles et Listes"
|
57 |
-
|
58 |
-
#: ../content-aware-sidebars.php:262
|
59 |
-
msgid "Archive"
|
60 |
-
msgstr "Listes"
|
61 |
-
|
62 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
63 |
-
msgctxt "option"
|
64 |
-
msgid "Handle"
|
65 |
-
msgstr "Mode d'insertion"
|
66 |
-
|
67 |
-
#: ../content-aware-sidebars.php:271
|
68 |
-
msgid "Replace"
|
69 |
-
msgstr "Substitution"
|
70 |
-
|
71 |
-
#: ../content-aware-sidebars.php:272
|
72 |
-
msgid "Merge"
|
73 |
-
msgstr "Fusion"
|
74 |
-
|
75 |
-
#: ../content-aware-sidebars.php:273
|
76 |
-
msgid "Manual"
|
77 |
-
msgstr "Manuel"
|
78 |
-
|
79 |
-
#: ../content-aware-sidebars.php:274
|
80 |
-
msgid "Forced replace"
|
81 |
-
msgstr "Forcé"
|
82 |
-
|
83 |
-
#: ../content-aware-sidebars.php:276
|
84 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
85 |
-
msgstr "Remplacer la sidebar originale, la fusionner avec ou ajouter une sidebar manuellement."
|
86 |
-
|
87 |
-
#: ../content-aware-sidebars.php:280
|
88 |
-
msgid "Host Sidebar"
|
89 |
-
msgstr "Affiche la Sidebar"
|
90 |
-
|
91 |
-
#: ../content-aware-sidebars.php:287
|
92 |
-
msgid "Merge Position"
|
93 |
-
msgstr "Fusionner les positions"
|
94 |
-
|
95 |
-
#: ../content-aware-sidebars.php:291
|
96 |
-
msgid "Top"
|
97 |
-
msgstr "Dessus"
|
98 |
-
|
99 |
-
#: ../content-aware-sidebars.php:292
|
100 |
-
msgid "Bottom"
|
101 |
-
msgstr "Dessous"
|
102 |
-
|
103 |
-
#: ../content-aware-sidebars.php:294
|
104 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
105 |
-
msgstr "Place la sidebar au-dessus ou en-dessous de l'hôte pendant la fusion."
|
106 |
-
|
107 |
-
#: ../content-aware-sidebars.php:309
|
108 |
-
msgid "Sidebars"
|
109 |
-
msgstr "Sidebars"
|
110 |
-
|
111 |
-
#: ../content-aware-sidebars.php:310
|
112 |
-
msgid "Sidebar"
|
113 |
-
msgstr "Sidebar"
|
114 |
-
|
115 |
-
#: ../content-aware-sidebars.php:311
|
116 |
-
msgctxt "sidebar"
|
117 |
-
msgid "Add New"
|
118 |
-
msgstr "Ajouter nouvelle"
|
119 |
-
|
120 |
-
#: ../content-aware-sidebars.php:312
|
121 |
-
msgid "Add New Sidebar"
|
122 |
-
msgstr "Ajouter nouvelle sidebar"
|
123 |
-
|
124 |
-
#: ../content-aware-sidebars.php:313
|
125 |
-
msgid "Edit Sidebar"
|
126 |
-
msgstr "Éditer la sidebar"
|
127 |
-
|
128 |
-
#: ../content-aware-sidebars.php:314
|
129 |
-
msgid "New Sidebar"
|
130 |
-
msgstr "Nouvelle sidebar"
|
131 |
-
|
132 |
-
#: ../content-aware-sidebars.php:315
|
133 |
-
msgid "All Sidebars"
|
134 |
-
msgstr "Toutes les sidebars"
|
135 |
-
|
136 |
-
#: ../content-aware-sidebars.php:316
|
137 |
-
msgid "View Sidebar"
|
138 |
-
msgstr "Voir la sidebar"
|
139 |
-
|
140 |
-
#: ../content-aware-sidebars.php:317
|
141 |
-
msgid "Search Sidebars"
|
142 |
-
msgstr "Rechercher une Sidebar"
|
143 |
-
|
144 |
-
#: ../content-aware-sidebars.php:318
|
145 |
-
msgid "No sidebars found"
|
146 |
-
msgstr "Aucune sidebar trouvée"
|
147 |
-
|
148 |
-
#: ../content-aware-sidebars.php:319
|
149 |
-
msgid "No sidebars found in Trash"
|
150 |
-
msgstr "Aucune sidebar trouvée dans la corbeille"
|
151 |
-
|
152 |
-
#: ../content-aware-sidebars.php:321
|
153 |
-
msgid "Display sidebar with"
|
154 |
-
msgstr "Afficher la sidebar avec"
|
155 |
-
|
156 |
-
#: ../content-aware-sidebars.php:322
|
157 |
-
msgid ""
|
158 |
-
"No content. Please add at least one condition group to make the sidebar "
|
159 |
-
"content aware."
|
160 |
-
msgstr "Aucun contenu. Veuillez ajouter au moins un groupe de condition pour rendre la sidebar consciente du contenu. "
|
161 |
-
|
162 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
163 |
-
msgid "Manage widgets"
|
164 |
-
msgstr "Gérer les widgets"
|
165 |
-
|
166 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
167 |
-
msgid "Sidebar updated."
|
168 |
-
msgstr "Sidebar mise à jour"
|
169 |
-
|
170 |
-
#: ../content-aware-sidebars.php:361
|
171 |
-
msgid "Sidebar published."
|
172 |
-
msgstr "Sidebar publiée"
|
173 |
-
|
174 |
-
#: ../content-aware-sidebars.php:362
|
175 |
-
msgid "Sidebar saved."
|
176 |
-
msgstr "Sidebar sauvegardée"
|
177 |
-
|
178 |
-
#: ../content-aware-sidebars.php:363
|
179 |
-
msgid "Sidebar submitted."
|
180 |
-
msgstr "Sidebar soumise"
|
181 |
-
|
182 |
-
#: ../content-aware-sidebars.php:364
|
183 |
-
#, php-format
|
184 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
185 |
-
msgstr "Sidebar programmée pour <strong>%1$s</strong>."
|
186 |
-
|
187 |
-
#. translators: Publish box date format, see http://php.net/date
|
188 |
-
#: ../content-aware-sidebars.php:366
|
189 |
-
msgid "M j, Y @ G:i"
|
190 |
-
msgstr "j M Y, G:i "
|
191 |
-
|
192 |
-
#: ../content-aware-sidebars.php:367
|
193 |
-
msgid "Sidebar draft updated."
|
194 |
-
msgstr "Brouillon de la sidebar mis à jour."
|
195 |
-
|
196 |
-
#: ../content-aware-sidebars.php:383
|
197 |
-
#, php-format
|
198 |
-
msgid "%s sidebar updated."
|
199 |
-
msgid_plural "%s sidebars updated."
|
200 |
-
msgstr[0] ""
|
201 |
-
msgstr[1] ""
|
202 |
-
|
203 |
-
#: ../content-aware-sidebars.php:384
|
204 |
-
#, php-format
|
205 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
-
msgstr[0] ""
|
208 |
-
msgstr[1] ""
|
209 |
-
|
210 |
-
#: ../content-aware-sidebars.php:385
|
211 |
-
#, php-format
|
212 |
-
msgid "%s sidebar permanently deleted."
|
213 |
-
msgid_plural "%s sidebars permanently deleted."
|
214 |
-
msgstr[0] ""
|
215 |
-
msgstr[1] ""
|
216 |
-
|
217 |
-
#: ../content-aware-sidebars.php:386
|
218 |
-
#, php-format
|
219 |
-
msgid "%s sidebar moved to the Trash."
|
220 |
-
msgid_plural "%s sidebars moved to the Trash."
|
221 |
-
msgstr[0] ""
|
222 |
-
msgstr[1] ""
|
223 |
-
|
224 |
-
#: ../content-aware-sidebars.php:387
|
225 |
-
#, php-format
|
226 |
-
msgid "%s sidebar restored from the Trash."
|
227 |
-
msgid_plural "%s sidebars restored from the Trash."
|
228 |
-
msgstr[0] ""
|
229 |
-
msgstr[1] ""
|
230 |
-
|
231 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
232 |
-
msgid "Please update Host Sidebar"
|
233 |
-
msgstr "Veuillez mettre à jour la sidebar originale"
|
234 |
-
|
235 |
-
#: ../content-aware-sidebars.php:472
|
236 |
-
msgid "Merge position"
|
237 |
-
msgstr "Position d'insertion"
|
238 |
-
|
239 |
-
#: ../content-aware-sidebars.php:473
|
240 |
-
msgid "Widgets"
|
241 |
-
msgstr "Widgets"
|
242 |
-
|
243 |
-
#: ../content-aware-sidebars.php:586
|
244 |
-
msgid "Manage Widgets"
|
245 |
-
msgstr "Gérer les widgets"
|
246 |
-
|
247 |
-
#: ../content-aware-sidebars.php:756
|
248 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
249 |
-
msgstr "Obtenez une version gratuite de Content Aware Sidebars Prenium."
|
250 |
-
|
251 |
-
#: ../content-aware-sidebars.php:772
|
252 |
-
msgid "Options"
|
253 |
-
msgstr "Options"
|
254 |
-
|
255 |
-
#: ../content-aware-sidebars.php:795
|
256 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
257 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
258 |
-
msgid "Condition Groups"
|
259 |
-
msgstr "Groupes de conditions"
|
260 |
-
|
261 |
-
#: ../content-aware-sidebars.php:796
|
262 |
-
msgid ""
|
263 |
-
"Each created condition group describe some specific content (conditions) "
|
264 |
-
"that the current sidebar should be displayed with."
|
265 |
-
msgstr "Chaque groupe de condition créé décrit du contenu spécifique (des conditions) avec lequel la sidebar devrait être affichée."
|
266 |
-
|
267 |
-
#: ../content-aware-sidebars.php:797
|
268 |
-
msgid ""
|
269 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
270 |
-
" groups themselves use logical disjunction. This means that content added to"
|
271 |
-
" a group should be associated, as they are treated as such, and that the "
|
272 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
273 |
-
"extremely focused and at the same time distinct conditions."
|
274 |
-
msgstr "Le contenu ajouté à un groupe de condition utilise une logique de conjonction, alors que les groupes de condition eux utilisent une logique de disjonction. Cela signifie que les contenus ajoutés à un groupe devrait être associés, puisqu'ils sont traités en tant que tel, et que les groupes n'interfèrent pas entre eux. Ainsi, il est possible d'avoir des conditions à la fois extrêmement focalisées et distinctes. "
|
275 |
-
|
276 |
-
#: ../content-aware-sidebars.php:800
|
277 |
-
msgid "More Information"
|
278 |
-
msgstr "Plus d'informations"
|
279 |
-
|
280 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
281 |
-
msgid "Get Support"
|
282 |
-
msgstr "Recevoir du support"
|
283 |
-
|
284 |
-
#: ../content-aware-sidebars.php:816
|
285 |
-
msgid ""
|
286 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
287 |
-
" of the upcoming Premium Bundle*!"
|
288 |
-
msgstr "Traduisez Content Aware Sidebars dans votre langue et devenez un BETA testeur de la version Prenium* à venir!"
|
289 |
-
|
290 |
-
#: ../content-aware-sidebars.php:817
|
291 |
-
msgid "Translate Now"
|
292 |
-
msgstr "Traduisez maintenant"
|
293 |
-
|
294 |
-
#: ../content-aware-sidebars.php:818
|
295 |
-
msgid "Get Premium Bundle"
|
296 |
-
msgstr "Recevez la version Prenium"
|
297 |
-
|
298 |
-
#: ../content-aware-sidebars.php:819
|
299 |
-
msgid ""
|
300 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
301 |
-
msgstr "Utilisation sur un seul site. BETA implique pas recommandé pour les sites de production."
|
302 |
-
|
303 |
-
#: ../content-aware-sidebars.php:822
|
304 |
-
msgid "Partial Feature List"
|
305 |
-
msgstr "Liste partielle de caractéristiques"
|
306 |
-
|
307 |
-
#: ../content-aware-sidebars.php:824
|
308 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
309 |
-
msgstr "Sélectionner et créer des sidebars dans la page d'édition des articles."
|
310 |
-
|
311 |
-
#: ../content-aware-sidebars.php:825
|
312 |
-
msgid "Display sidebars with URLs using wildcards"
|
313 |
-
msgstr "Afficher les sidebars avec des URLs en utilisant des jokers"
|
314 |
-
|
315 |
-
#: ../content-aware-sidebars.php:826
|
316 |
-
msgid "Display sidebars with User Roles"
|
317 |
-
msgstr "Afficher les sidebars avec des Rôles d'Utilisateurs"
|
318 |
-
|
319 |
-
#: ../content-aware-sidebars.php:827
|
320 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
321 |
-
msgstr "Afficher les sidebars avec les Groupes d'Utilisateurs de BuddyPress"
|
322 |
-
|
323 |
-
#: ../content-aware-sidebars.php:828
|
324 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
325 |
-
msgstr "Colonnes de sidebars dans les fenêtres de types d'articles et taxonomie"
|
326 |
-
|
327 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
328 |
-
msgid "Order"
|
329 |
-
msgstr "Commande"
|
330 |
-
|
331 |
-
#: ../content-aware-sidebars.php:880
|
332 |
-
msgid "Give a review on WordPress.org"
|
333 |
-
msgstr ""
|
334 |
-
|
335 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
336 |
-
msgid "Translate the plugin into your language"
|
337 |
-
msgstr "Traduire l'extension dans votre langue"
|
338 |
-
|
339 |
-
#: ../content-aware-sidebars.php:884
|
340 |
-
msgid "Read the FAQ"
|
341 |
-
msgstr ""
|
342 |
-
|
343 |
-
#: ../content-aware-sidebars.php:899
|
344 |
-
msgid ""
|
345 |
-
"If you love this plugin, please consider donating to support future "
|
346 |
-
"development."
|
347 |
-
msgstr "Si vous aimez cette extension, s'il vous plait envisagez de faire un don pour supporter le développement futur. "
|
348 |
-
|
349 |
-
#: ../content-aware-sidebars.php:908
|
350 |
-
msgid "Or you could:"
|
351 |
-
msgstr "Ou vous pourriez"
|
352 |
-
|
353 |
-
#: ../content-aware-sidebars.php:910
|
354 |
-
msgid "Rate the plugin on WordPress.org"
|
355 |
-
msgstr "Évaluer l'extension sur WordPress.org"
|
356 |
-
|
357 |
-
#: ../content-aware-sidebars.php:911
|
358 |
-
msgid "Link to the plugin page"
|
359 |
-
msgstr "Lien vers la page de l'extension"
|
360 |
-
|
361 |
-
#: ../content-aware-sidebars.php:1045
|
362 |
-
msgid "Filter Sidebars"
|
363 |
-
msgstr "Filtrer les sidebars"
|
364 |
-
|
365 |
-
#: ../content-aware-sidebars.php:1046
|
366 |
-
msgid "Filter Widgets"
|
367 |
-
msgstr ""
|
368 |
-
|
369 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
370 |
-
msgid "Condition Group"
|
371 |
-
msgstr "Groupe de conditions"
|
372 |
-
|
373 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
374 |
-
msgctxt "group"
|
375 |
-
msgid "Add New"
|
376 |
-
msgstr "Ajouter nouveau"
|
377 |
-
|
378 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
380 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
381 |
-
msgid "Add New Group"
|
382 |
-
msgstr "Ajouter nouveau groupe"
|
383 |
-
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
385 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
386 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
387 |
-
msgctxt "group"
|
388 |
-
msgid "Edit"
|
389 |
-
msgstr "Éditer"
|
390 |
-
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
392 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
393 |
-
msgid "No Groups found"
|
394 |
-
msgstr ""
|
395 |
-
|
396 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
397 |
-
msgctxt "condition group"
|
398 |
-
msgid "Negated"
|
399 |
-
msgstr ""
|
400 |
-
|
401 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
402 |
-
msgid "Content"
|
403 |
-
msgstr "Contenu"
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
407 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
408 |
-
msgid "Unauthorized request"
|
409 |
-
msgstr "Requête non autorisée"
|
410 |
-
|
411 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
412 |
-
msgid "Condition group cannot be empty"
|
413 |
-
msgstr "Le groupe de condition ne peut pas être vide"
|
414 |
-
|
415 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
416 |
-
msgid "Condition group saved"
|
417 |
-
msgstr "Groupe de condition sauvegardé"
|
418 |
-
|
419 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
420 |
-
msgid "Condition group could not be removed"
|
421 |
-
msgstr "Le groupe de condition n'a pas pu être supprimé"
|
422 |
-
|
423 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
424 |
-
msgid "Condition group removed"
|
425 |
-
msgstr "Groupe de condition supprimé"
|
426 |
-
|
427 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
428 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
429 |
-
msgid "Save"
|
430 |
-
msgstr "Sauvegarder"
|
431 |
-
|
432 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
433 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
434 |
-
msgid "Cancel"
|
435 |
-
msgstr "Annuler"
|
436 |
-
|
437 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
438 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
439 |
-
msgid "Or"
|
440 |
-
msgstr "Ou"
|
441 |
-
|
442 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
443 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
444 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
445 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
446 |
-
msgid "And"
|
447 |
-
msgstr ""
|
448 |
-
|
449 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
450 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
451 |
-
msgid "Remove"
|
452 |
-
msgstr "Supprimer"
|
453 |
-
|
454 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
455 |
-
msgid "Remove this group and its contents permanently?"
|
456 |
-
msgstr "Supprimer ce groupe et son contenu de façon permanente?"
|
457 |
-
|
458 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
459 |
-
msgid "No results found."
|
460 |
-
msgstr "Aucun résultat trouvé."
|
461 |
-
|
462 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
463 |
-
msgid ""
|
464 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
465 |
-
"these changes?"
|
466 |
-
msgstr "Le groupe courant a des changements non sauvegardés. Voulez-vous continuer et abandonner ces changements?"
|
467 |
-
|
468 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
469 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
470 |
-
msgid "Negate group"
|
471 |
-
msgstr ""
|
472 |
-
|
473 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
474 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
475 |
-
msgid "Target all but this context"
|
476 |
-
msgstr ""
|
477 |
-
|
478 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
479 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
480 |
-
msgid "Target this context"
|
481 |
-
msgstr ""
|
482 |
-
|
483 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
484 |
-
msgid "Authors"
|
485 |
-
msgstr "Auteurs"
|
486 |
-
|
487 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
488 |
-
#, php-format
|
489 |
-
msgid "Display with All %s"
|
490 |
-
msgstr "Afficher avec toutes les %s"
|
491 |
-
|
492 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
493 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
494 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
495 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
496 |
-
msgid "View All"
|
497 |
-
msgstr "Tout voir"
|
498 |
-
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
500 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
502 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
504 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
505 |
-
msgid "Search"
|
506 |
-
msgstr "Chercher"
|
507 |
-
|
508 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
509 |
-
msgid "bbPress User Profiles"
|
510 |
-
msgstr "Profils d'Utilisateurs bbPress"
|
511 |
-
|
512 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
513 |
-
msgid "BuddyPress Members"
|
514 |
-
msgstr "Membres BuddyPress"
|
515 |
-
|
516 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
517 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
518 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
519 |
-
msgid "Add to Group"
|
520 |
-
msgstr "Ajouter au groupe"
|
521 |
-
|
522 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
523 |
-
msgid "Dates"
|
524 |
-
msgstr "Dates"
|
525 |
-
|
526 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
527 |
-
msgid "Date Archives"
|
528 |
-
msgstr "Date de listes"
|
529 |
-
|
530 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
531 |
-
msgid "Page Templates"
|
532 |
-
msgstr "Gabarit de Page"
|
533 |
-
|
534 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
537 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
538 |
-
msgid "Languages"
|
539 |
-
msgstr "Langues"
|
540 |
-
|
541 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
542 |
-
msgid "Post Types"
|
543 |
-
msgstr "Types d'article"
|
544 |
-
|
545 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
547 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
548 |
-
msgid "Automatically select new children of a selected ancestor"
|
549 |
-
msgstr "Sélectionne automatiquement les nouveaux enfants de l'ancêtre sélectionné"
|
550 |
-
|
551 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
552 |
-
msgid "Automatically add new children of a selected ancestor"
|
553 |
-
msgstr ""
|
554 |
-
|
555 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
556 |
-
#, php-format
|
557 |
-
msgid "%s Archives"
|
558 |
-
msgstr ""
|
559 |
-
|
560 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
561 |
-
msgid "Blog Page"
|
562 |
-
msgstr ""
|
563 |
-
|
564 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
565 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
566 |
-
msgid "No items."
|
567 |
-
msgstr "Aucun élément"
|
568 |
-
|
569 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
570 |
-
msgid "Most Recent"
|
571 |
-
msgstr "Plus récent(s)"
|
572 |
-
|
573 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
574 |
-
msgid "Static Pages"
|
575 |
-
msgstr "Pages statiques"
|
576 |
-
|
577 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
578 |
-
msgid "Front Page"
|
579 |
-
msgstr "Page d'accueil"
|
580 |
-
|
581 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
582 |
-
msgid "Search Results"
|
583 |
-
msgstr "Résultats de recherche"
|
584 |
-
|
585 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
586 |
-
msgid "404 Page"
|
587 |
-
msgstr "Page 404"
|
588 |
-
|
589 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
590 |
-
msgid "Taxonomies"
|
591 |
-
msgstr "Taxonomies"
|
592 |
-
|
593 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
594 |
-
msgid "Most Used"
|
595 |
-
msgstr "La plus utilisée"
|
596 |
-
|
597 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
598 |
-
msgid "Conditional Content"
|
599 |
-
msgstr ""
|
600 |
-
|
601 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
602 |
-
msgid ""
|
603 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
604 |
-
" it. In each group, you can combine different types of associated content."
|
605 |
-
msgstr "Cliquez ici pour éditer un groupe ou en créer un nouveau. Sélectionnez le contenu sur la gauche pour l'ajouter. Dans chaque groupe, vous pouvez combiner différents types de contenus associés. "
|
606 |
-
|
607 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
608 |
-
#, php-format
|
609 |
-
msgid "All %s"
|
610 |
-
msgstr "Toutes les %s"
|
611 |
-
|
612 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
613 |
-
msgid "Password protected"
|
614 |
-
msgstr ""
|
615 |
-
|
616 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
617 |
-
msgid "Private"
|
618 |
-
msgstr ""
|
619 |
-
|
620 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
621 |
-
msgid "Draft"
|
622 |
-
msgstr ""
|
623 |
-
|
624 |
-
#. translators: post state
|
625 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
626 |
-
msgctxt "post state"
|
627 |
-
msgid "Pending"
|
628 |
-
msgstr ""
|
629 |
-
|
630 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
631 |
-
msgid "Sticky"
|
632 |
-
msgstr ""
|
633 |
-
|
634 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
635 |
-
msgid "Scheduled"
|
636 |
-
msgstr ""
|
637 |
-
|
638 |
-
#: ../pointers.php:68
|
639 |
-
msgid "Get started"
|
640 |
-
msgstr ""
|
641 |
-
|
642 |
-
#: ../pointers.php:69
|
643 |
-
msgid ""
|
644 |
-
"You've just installed Content Aware Sidebars!\n"
|
645 |
-
"\n"
|
646 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
647 |
-
"\n"
|
648 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
649 |
-
msgstr ""
|
650 |
-
|
651 |
-
#: ../pointers.php:76
|
652 |
-
msgid "Start Tour"
|
653 |
-
msgstr ""
|
654 |
-
|
655 |
-
#: ../pointers.php:78
|
656 |
-
msgid "Not now"
|
657 |
-
msgstr ""
|
658 |
-
|
659 |
-
#: ../pointers.php:83
|
660 |
-
msgid ""
|
661 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
662 |
-
"\n"
|
663 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
664 |
-
"\n"
|
665 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
666 |
-
msgstr ""
|
667 |
-
|
668 |
-
#: ../pointers.php:92
|
669 |
-
msgid "Content and contexts"
|
670 |
-
msgstr ""
|
671 |
-
|
672 |
-
#: ../pointers.php:93
|
673 |
-
msgid ""
|
674 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
675 |
-
"\n"
|
676 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
677 |
-
"\n"
|
678 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
679 |
-
msgstr ""
|
680 |
-
|
681 |
-
#: ../pointers.php:102
|
682 |
-
msgid "Options, options"
|
683 |
-
msgstr ""
|
684 |
-
|
685 |
-
#: ../pointers.php:103
|
686 |
-
msgid ""
|
687 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
688 |
-
"\n"
|
689 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
690 |
-
"\n"
|
691 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
692 |
-
"\n"
|
693 |
-
" You are in control."
|
694 |
-
msgstr ""
|
695 |
-
|
696 |
-
#: ../pointers.php:112
|
697 |
-
msgid "Help and Support"
|
698 |
-
msgstr ""
|
699 |
-
|
700 |
-
#: ../pointers.php:113
|
701 |
-
msgid ""
|
702 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
703 |
-
"\n"
|
704 |
-
"If you need more help, click on the \"Help\" tab here."
|
705 |
-
msgstr ""
|
706 |
-
|
707 |
-
#: ../pointers.php:142
|
708 |
-
msgid "Close"
|
709 |
-
msgstr "Fermer"
|
710 |
-
|
711 |
-
#: ../pointers.php:143
|
712 |
-
msgid "Next"
|
713 |
-
msgstr "Suivant"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Pierre-Yves Sorel <admin@synergiaweb.com>, 2015
|
5 |
+
# Rachid <rachid.braymi@gmail.com>, 2015
|
6 |
+
# Seb <fastfuel@hotmail.com>, 2015
|
7 |
+
msgid ""
|
8 |
+
msgstr ""
|
9 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
10 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
11 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
12 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
13 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
14 |
+
"Language-Team: French (France) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/fr_FR/)\n"
|
15 |
+
"MIME-Version: 1.0\n"
|
16 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
17 |
+
"Content-Transfer-Encoding: 8bit\n"
|
18 |
+
"Language: fr_FR\n"
|
19 |
+
"Plural-Forms: nplurals=2; plural=(n > 1);\n"
|
20 |
+
"X-Generator: Poedit 1.7.6\n"
|
21 |
+
"X-Poedit-Basepath: .\n"
|
22 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
23 |
+
"X-Poedit-SearchPath-0: .\n"
|
24 |
+
"X-Poedit-SearchPath-1: ..\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
26 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
27 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
28 |
+
"X-Textdomain-Support: yes\n"
|
29 |
+
|
30 |
+
#: ../content-aware-sidebars.php:95
|
31 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
32 |
+
msgstr "Gérer et afficher les sidebars selon le contenu visionné."
|
33 |
+
|
34 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
35 |
+
msgid "Content Aware Sidebars"
|
36 |
+
msgstr "Content Aware Sidebars"
|
37 |
+
|
38 |
+
#: ../content-aware-sidebars.php:97
|
39 |
+
msgid "Import"
|
40 |
+
msgstr "Importer"
|
41 |
+
|
42 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
43 |
+
msgid "FAQ"
|
44 |
+
msgstr "FAQ"
|
45 |
+
|
46 |
+
#: ../content-aware-sidebars.php:256
|
47 |
+
msgid "Exposure"
|
48 |
+
msgstr "Affichage"
|
49 |
+
|
50 |
+
#: ../content-aware-sidebars.php:260
|
51 |
+
msgid "Singular"
|
52 |
+
msgstr "Pages et Articles"
|
53 |
+
|
54 |
+
#: ../content-aware-sidebars.php:261
|
55 |
+
msgid "Singular & Archive"
|
56 |
+
msgstr "Pages, Articles et Listes"
|
57 |
+
|
58 |
+
#: ../content-aware-sidebars.php:262
|
59 |
+
msgid "Archive"
|
60 |
+
msgstr "Listes"
|
61 |
+
|
62 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
63 |
+
msgctxt "option"
|
64 |
+
msgid "Handle"
|
65 |
+
msgstr "Mode d'insertion"
|
66 |
+
|
67 |
+
#: ../content-aware-sidebars.php:271
|
68 |
+
msgid "Replace"
|
69 |
+
msgstr "Substitution"
|
70 |
+
|
71 |
+
#: ../content-aware-sidebars.php:272
|
72 |
+
msgid "Merge"
|
73 |
+
msgstr "Fusion"
|
74 |
+
|
75 |
+
#: ../content-aware-sidebars.php:273
|
76 |
+
msgid "Manual"
|
77 |
+
msgstr "Manuel"
|
78 |
+
|
79 |
+
#: ../content-aware-sidebars.php:274
|
80 |
+
msgid "Forced replace"
|
81 |
+
msgstr "Forcé"
|
82 |
+
|
83 |
+
#: ../content-aware-sidebars.php:276
|
84 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
85 |
+
msgstr "Remplacer la sidebar originale, la fusionner avec ou ajouter une sidebar manuellement."
|
86 |
+
|
87 |
+
#: ../content-aware-sidebars.php:280
|
88 |
+
msgid "Host Sidebar"
|
89 |
+
msgstr "Affiche la Sidebar"
|
90 |
+
|
91 |
+
#: ../content-aware-sidebars.php:287
|
92 |
+
msgid "Merge Position"
|
93 |
+
msgstr "Fusionner les positions"
|
94 |
+
|
95 |
+
#: ../content-aware-sidebars.php:291
|
96 |
+
msgid "Top"
|
97 |
+
msgstr "Dessus"
|
98 |
+
|
99 |
+
#: ../content-aware-sidebars.php:292
|
100 |
+
msgid "Bottom"
|
101 |
+
msgstr "Dessous"
|
102 |
+
|
103 |
+
#: ../content-aware-sidebars.php:294
|
104 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
105 |
+
msgstr "Place la sidebar au-dessus ou en-dessous de l'hôte pendant la fusion."
|
106 |
+
|
107 |
+
#: ../content-aware-sidebars.php:309
|
108 |
+
msgid "Sidebars"
|
109 |
+
msgstr "Sidebars"
|
110 |
+
|
111 |
+
#: ../content-aware-sidebars.php:310
|
112 |
+
msgid "Sidebar"
|
113 |
+
msgstr "Sidebar"
|
114 |
+
|
115 |
+
#: ../content-aware-sidebars.php:311
|
116 |
+
msgctxt "sidebar"
|
117 |
+
msgid "Add New"
|
118 |
+
msgstr "Ajouter nouvelle"
|
119 |
+
|
120 |
+
#: ../content-aware-sidebars.php:312
|
121 |
+
msgid "Add New Sidebar"
|
122 |
+
msgstr "Ajouter nouvelle sidebar"
|
123 |
+
|
124 |
+
#: ../content-aware-sidebars.php:313
|
125 |
+
msgid "Edit Sidebar"
|
126 |
+
msgstr "Éditer la sidebar"
|
127 |
+
|
128 |
+
#: ../content-aware-sidebars.php:314
|
129 |
+
msgid "New Sidebar"
|
130 |
+
msgstr "Nouvelle sidebar"
|
131 |
+
|
132 |
+
#: ../content-aware-sidebars.php:315
|
133 |
+
msgid "All Sidebars"
|
134 |
+
msgstr "Toutes les sidebars"
|
135 |
+
|
136 |
+
#: ../content-aware-sidebars.php:316
|
137 |
+
msgid "View Sidebar"
|
138 |
+
msgstr "Voir la sidebar"
|
139 |
+
|
140 |
+
#: ../content-aware-sidebars.php:317
|
141 |
+
msgid "Search Sidebars"
|
142 |
+
msgstr "Rechercher une Sidebar"
|
143 |
+
|
144 |
+
#: ../content-aware-sidebars.php:318
|
145 |
+
msgid "No sidebars found"
|
146 |
+
msgstr "Aucune sidebar trouvée"
|
147 |
+
|
148 |
+
#: ../content-aware-sidebars.php:319
|
149 |
+
msgid "No sidebars found in Trash"
|
150 |
+
msgstr "Aucune sidebar trouvée dans la corbeille"
|
151 |
+
|
152 |
+
#: ../content-aware-sidebars.php:321
|
153 |
+
msgid "Display sidebar with"
|
154 |
+
msgstr "Afficher la sidebar avec"
|
155 |
+
|
156 |
+
#: ../content-aware-sidebars.php:322
|
157 |
+
msgid ""
|
158 |
+
"No content. Please add at least one condition group to make the sidebar "
|
159 |
+
"content aware."
|
160 |
+
msgstr "Aucun contenu. Veuillez ajouter au moins un groupe de condition pour rendre la sidebar consciente du contenu. "
|
161 |
+
|
162 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
163 |
+
msgid "Manage widgets"
|
164 |
+
msgstr "Gérer les widgets"
|
165 |
+
|
166 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
167 |
+
msgid "Sidebar updated."
|
168 |
+
msgstr "Sidebar mise à jour"
|
169 |
+
|
170 |
+
#: ../content-aware-sidebars.php:361
|
171 |
+
msgid "Sidebar published."
|
172 |
+
msgstr "Sidebar publiée"
|
173 |
+
|
174 |
+
#: ../content-aware-sidebars.php:362
|
175 |
+
msgid "Sidebar saved."
|
176 |
+
msgstr "Sidebar sauvegardée"
|
177 |
+
|
178 |
+
#: ../content-aware-sidebars.php:363
|
179 |
+
msgid "Sidebar submitted."
|
180 |
+
msgstr "Sidebar soumise"
|
181 |
+
|
182 |
+
#: ../content-aware-sidebars.php:364
|
183 |
+
#, php-format
|
184 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
185 |
+
msgstr "Sidebar programmée pour <strong>%1$s</strong>."
|
186 |
+
|
187 |
+
#. translators: Publish box date format, see http://php.net/date
|
188 |
+
#: ../content-aware-sidebars.php:366
|
189 |
+
msgid "M j, Y @ G:i"
|
190 |
+
msgstr "j M Y, G:i "
|
191 |
+
|
192 |
+
#: ../content-aware-sidebars.php:367
|
193 |
+
msgid "Sidebar draft updated."
|
194 |
+
msgstr "Brouillon de la sidebar mis à jour."
|
195 |
+
|
196 |
+
#: ../content-aware-sidebars.php:383
|
197 |
+
#, php-format
|
198 |
+
msgid "%s sidebar updated."
|
199 |
+
msgid_plural "%s sidebars updated."
|
200 |
+
msgstr[0] ""
|
201 |
+
msgstr[1] ""
|
202 |
+
|
203 |
+
#: ../content-aware-sidebars.php:384
|
204 |
+
#, php-format
|
205 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
+
msgstr[0] ""
|
208 |
+
msgstr[1] ""
|
209 |
+
|
210 |
+
#: ../content-aware-sidebars.php:385
|
211 |
+
#, php-format
|
212 |
+
msgid "%s sidebar permanently deleted."
|
213 |
+
msgid_plural "%s sidebars permanently deleted."
|
214 |
+
msgstr[0] ""
|
215 |
+
msgstr[1] ""
|
216 |
+
|
217 |
+
#: ../content-aware-sidebars.php:386
|
218 |
+
#, php-format
|
219 |
+
msgid "%s sidebar moved to the Trash."
|
220 |
+
msgid_plural "%s sidebars moved to the Trash."
|
221 |
+
msgstr[0] ""
|
222 |
+
msgstr[1] ""
|
223 |
+
|
224 |
+
#: ../content-aware-sidebars.php:387
|
225 |
+
#, php-format
|
226 |
+
msgid "%s sidebar restored from the Trash."
|
227 |
+
msgid_plural "%s sidebars restored from the Trash."
|
228 |
+
msgstr[0] ""
|
229 |
+
msgstr[1] ""
|
230 |
+
|
231 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
232 |
+
msgid "Please update Host Sidebar"
|
233 |
+
msgstr "Veuillez mettre à jour la sidebar originale"
|
234 |
+
|
235 |
+
#: ../content-aware-sidebars.php:472
|
236 |
+
msgid "Merge position"
|
237 |
+
msgstr "Position d'insertion"
|
238 |
+
|
239 |
+
#: ../content-aware-sidebars.php:473
|
240 |
+
msgid "Widgets"
|
241 |
+
msgstr "Widgets"
|
242 |
+
|
243 |
+
#: ../content-aware-sidebars.php:586
|
244 |
+
msgid "Manage Widgets"
|
245 |
+
msgstr "Gérer les widgets"
|
246 |
+
|
247 |
+
#: ../content-aware-sidebars.php:756
|
248 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
249 |
+
msgstr "Obtenez une version gratuite de Content Aware Sidebars Prenium."
|
250 |
+
|
251 |
+
#: ../content-aware-sidebars.php:772
|
252 |
+
msgid "Options"
|
253 |
+
msgstr "Options"
|
254 |
+
|
255 |
+
#: ../content-aware-sidebars.php:795
|
256 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
257 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
258 |
+
msgid "Condition Groups"
|
259 |
+
msgstr "Groupes de conditions"
|
260 |
+
|
261 |
+
#: ../content-aware-sidebars.php:796
|
262 |
+
msgid ""
|
263 |
+
"Each created condition group describe some specific content (conditions) "
|
264 |
+
"that the current sidebar should be displayed with."
|
265 |
+
msgstr "Chaque groupe de condition créé décrit du contenu spécifique (des conditions) avec lequel la sidebar devrait être affichée."
|
266 |
+
|
267 |
+
#: ../content-aware-sidebars.php:797
|
268 |
+
msgid ""
|
269 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
270 |
+
" groups themselves use logical disjunction. This means that content added to"
|
271 |
+
" a group should be associated, as they are treated as such, and that the "
|
272 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
273 |
+
"extremely focused and at the same time distinct conditions."
|
274 |
+
msgstr "Le contenu ajouté à un groupe de condition utilise une logique de conjonction, alors que les groupes de condition eux utilisent une logique de disjonction. Cela signifie que les contenus ajoutés à un groupe devrait être associés, puisqu'ils sont traités en tant que tel, et que les groupes n'interfèrent pas entre eux. Ainsi, il est possible d'avoir des conditions à la fois extrêmement focalisées et distinctes. "
|
275 |
+
|
276 |
+
#: ../content-aware-sidebars.php:800
|
277 |
+
msgid "More Information"
|
278 |
+
msgstr "Plus d'informations"
|
279 |
+
|
280 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
281 |
+
msgid "Get Support"
|
282 |
+
msgstr "Recevoir du support"
|
283 |
+
|
284 |
+
#: ../content-aware-sidebars.php:816
|
285 |
+
msgid ""
|
286 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
287 |
+
" of the upcoming Premium Bundle*!"
|
288 |
+
msgstr "Traduisez Content Aware Sidebars dans votre langue et devenez un BETA testeur de la version Prenium* à venir!"
|
289 |
+
|
290 |
+
#: ../content-aware-sidebars.php:817
|
291 |
+
msgid "Translate Now"
|
292 |
+
msgstr "Traduisez maintenant"
|
293 |
+
|
294 |
+
#: ../content-aware-sidebars.php:818
|
295 |
+
msgid "Get Premium Bundle"
|
296 |
+
msgstr "Recevez la version Prenium"
|
297 |
+
|
298 |
+
#: ../content-aware-sidebars.php:819
|
299 |
+
msgid ""
|
300 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
301 |
+
msgstr "Utilisation sur un seul site. BETA implique pas recommandé pour les sites de production."
|
302 |
+
|
303 |
+
#: ../content-aware-sidebars.php:822
|
304 |
+
msgid "Partial Feature List"
|
305 |
+
msgstr "Liste partielle de caractéristiques"
|
306 |
+
|
307 |
+
#: ../content-aware-sidebars.php:824
|
308 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
309 |
+
msgstr "Sélectionner et créer des sidebars dans la page d'édition des articles."
|
310 |
+
|
311 |
+
#: ../content-aware-sidebars.php:825
|
312 |
+
msgid "Display sidebars with URLs using wildcards"
|
313 |
+
msgstr "Afficher les sidebars avec des URLs en utilisant des jokers"
|
314 |
+
|
315 |
+
#: ../content-aware-sidebars.php:826
|
316 |
+
msgid "Display sidebars with User Roles"
|
317 |
+
msgstr "Afficher les sidebars avec des Rôles d'Utilisateurs"
|
318 |
+
|
319 |
+
#: ../content-aware-sidebars.php:827
|
320 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
321 |
+
msgstr "Afficher les sidebars avec les Groupes d'Utilisateurs de BuddyPress"
|
322 |
+
|
323 |
+
#: ../content-aware-sidebars.php:828
|
324 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
325 |
+
msgstr "Colonnes de sidebars dans les fenêtres de types d'articles et taxonomie"
|
326 |
+
|
327 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
328 |
+
msgid "Order"
|
329 |
+
msgstr "Commande"
|
330 |
+
|
331 |
+
#: ../content-aware-sidebars.php:880
|
332 |
+
msgid "Give a review on WordPress.org"
|
333 |
+
msgstr ""
|
334 |
+
|
335 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
336 |
+
msgid "Translate the plugin into your language"
|
337 |
+
msgstr "Traduire l'extension dans votre langue"
|
338 |
+
|
339 |
+
#: ../content-aware-sidebars.php:884
|
340 |
+
msgid "Read the FAQ"
|
341 |
+
msgstr ""
|
342 |
+
|
343 |
+
#: ../content-aware-sidebars.php:899
|
344 |
+
msgid ""
|
345 |
+
"If you love this plugin, please consider donating to support future "
|
346 |
+
"development."
|
347 |
+
msgstr "Si vous aimez cette extension, s'il vous plait envisagez de faire un don pour supporter le développement futur. "
|
348 |
+
|
349 |
+
#: ../content-aware-sidebars.php:908
|
350 |
+
msgid "Or you could:"
|
351 |
+
msgstr "Ou vous pourriez"
|
352 |
+
|
353 |
+
#: ../content-aware-sidebars.php:910
|
354 |
+
msgid "Rate the plugin on WordPress.org"
|
355 |
+
msgstr "Évaluer l'extension sur WordPress.org"
|
356 |
+
|
357 |
+
#: ../content-aware-sidebars.php:911
|
358 |
+
msgid "Link to the plugin page"
|
359 |
+
msgstr "Lien vers la page de l'extension"
|
360 |
+
|
361 |
+
#: ../content-aware-sidebars.php:1045
|
362 |
+
msgid "Filter Sidebars"
|
363 |
+
msgstr "Filtrer les sidebars"
|
364 |
+
|
365 |
+
#: ../content-aware-sidebars.php:1046
|
366 |
+
msgid "Filter Widgets"
|
367 |
+
msgstr ""
|
368 |
+
|
369 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
370 |
+
msgid "Condition Group"
|
371 |
+
msgstr "Groupe de conditions"
|
372 |
+
|
373 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
374 |
+
msgctxt "group"
|
375 |
+
msgid "Add New"
|
376 |
+
msgstr "Ajouter nouveau"
|
377 |
+
|
378 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
380 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
381 |
+
msgid "Add New Group"
|
382 |
+
msgstr "Ajouter nouveau groupe"
|
383 |
+
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
385 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
386 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
387 |
+
msgctxt "group"
|
388 |
+
msgid "Edit"
|
389 |
+
msgstr "Éditer"
|
390 |
+
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
392 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
393 |
+
msgid "No Groups found"
|
394 |
+
msgstr ""
|
395 |
+
|
396 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
397 |
+
msgctxt "condition group"
|
398 |
+
msgid "Negated"
|
399 |
+
msgstr ""
|
400 |
+
|
401 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
402 |
+
msgid "Content"
|
403 |
+
msgstr "Contenu"
|
404 |
+
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
407 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
408 |
+
msgid "Unauthorized request"
|
409 |
+
msgstr "Requête non autorisée"
|
410 |
+
|
411 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
412 |
+
msgid "Condition group cannot be empty"
|
413 |
+
msgstr "Le groupe de condition ne peut pas être vide"
|
414 |
+
|
415 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
416 |
+
msgid "Condition group saved"
|
417 |
+
msgstr "Groupe de condition sauvegardé"
|
418 |
+
|
419 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
420 |
+
msgid "Condition group could not be removed"
|
421 |
+
msgstr "Le groupe de condition n'a pas pu être supprimé"
|
422 |
+
|
423 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
424 |
+
msgid "Condition group removed"
|
425 |
+
msgstr "Groupe de condition supprimé"
|
426 |
+
|
427 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
428 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
429 |
+
msgid "Save"
|
430 |
+
msgstr "Sauvegarder"
|
431 |
+
|
432 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
433 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
434 |
+
msgid "Cancel"
|
435 |
+
msgstr "Annuler"
|
436 |
+
|
437 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
438 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
439 |
+
msgid "Or"
|
440 |
+
msgstr "Ou"
|
441 |
+
|
442 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
443 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
444 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
445 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
446 |
+
msgid "And"
|
447 |
+
msgstr ""
|
448 |
+
|
449 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
450 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
451 |
+
msgid "Remove"
|
452 |
+
msgstr "Supprimer"
|
453 |
+
|
454 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
455 |
+
msgid "Remove this group and its contents permanently?"
|
456 |
+
msgstr "Supprimer ce groupe et son contenu de façon permanente?"
|
457 |
+
|
458 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
459 |
+
msgid "No results found."
|
460 |
+
msgstr "Aucun résultat trouvé."
|
461 |
+
|
462 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
463 |
+
msgid ""
|
464 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
465 |
+
"these changes?"
|
466 |
+
msgstr "Le groupe courant a des changements non sauvegardés. Voulez-vous continuer et abandonner ces changements?"
|
467 |
+
|
468 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
469 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
470 |
+
msgid "Negate group"
|
471 |
+
msgstr ""
|
472 |
+
|
473 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
474 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
475 |
+
msgid "Target all but this context"
|
476 |
+
msgstr ""
|
477 |
+
|
478 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
479 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
480 |
+
msgid "Target this context"
|
481 |
+
msgstr ""
|
482 |
+
|
483 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
484 |
+
msgid "Authors"
|
485 |
+
msgstr "Auteurs"
|
486 |
+
|
487 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
488 |
+
#, php-format
|
489 |
+
msgid "Display with All %s"
|
490 |
+
msgstr "Afficher avec toutes les %s"
|
491 |
+
|
492 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
493 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
494 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
495 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
496 |
+
msgid "View All"
|
497 |
+
msgstr "Tout voir"
|
498 |
+
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
500 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
502 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
504 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
505 |
+
msgid "Search"
|
506 |
+
msgstr "Chercher"
|
507 |
+
|
508 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
509 |
+
msgid "bbPress User Profiles"
|
510 |
+
msgstr "Profils d'Utilisateurs bbPress"
|
511 |
+
|
512 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
513 |
+
msgid "BuddyPress Members"
|
514 |
+
msgstr "Membres BuddyPress"
|
515 |
+
|
516 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
517 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
518 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
519 |
+
msgid "Add to Group"
|
520 |
+
msgstr "Ajouter au groupe"
|
521 |
+
|
522 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
523 |
+
msgid "Dates"
|
524 |
+
msgstr "Dates"
|
525 |
+
|
526 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
527 |
+
msgid "Date Archives"
|
528 |
+
msgstr "Date de listes"
|
529 |
+
|
530 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
531 |
+
msgid "Page Templates"
|
532 |
+
msgstr "Gabarit de Page"
|
533 |
+
|
534 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
537 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
538 |
+
msgid "Languages"
|
539 |
+
msgstr "Langues"
|
540 |
+
|
541 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
542 |
+
msgid "Post Types"
|
543 |
+
msgstr "Types d'article"
|
544 |
+
|
545 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
547 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
548 |
+
msgid "Automatically select new children of a selected ancestor"
|
549 |
+
msgstr "Sélectionne automatiquement les nouveaux enfants de l'ancêtre sélectionné"
|
550 |
+
|
551 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
552 |
+
msgid "Automatically add new children of a selected ancestor"
|
553 |
+
msgstr ""
|
554 |
+
|
555 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
556 |
+
#, php-format
|
557 |
+
msgid "%s Archives"
|
558 |
+
msgstr ""
|
559 |
+
|
560 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
561 |
+
msgid "Blog Page"
|
562 |
+
msgstr ""
|
563 |
+
|
564 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
565 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
566 |
+
msgid "No items."
|
567 |
+
msgstr "Aucun élément"
|
568 |
+
|
569 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
570 |
+
msgid "Most Recent"
|
571 |
+
msgstr "Plus récent(s)"
|
572 |
+
|
573 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
574 |
+
msgid "Static Pages"
|
575 |
+
msgstr "Pages statiques"
|
576 |
+
|
577 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
578 |
+
msgid "Front Page"
|
579 |
+
msgstr "Page d'accueil"
|
580 |
+
|
581 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
582 |
+
msgid "Search Results"
|
583 |
+
msgstr "Résultats de recherche"
|
584 |
+
|
585 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
586 |
+
msgid "404 Page"
|
587 |
+
msgstr "Page 404"
|
588 |
+
|
589 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
590 |
+
msgid "Taxonomies"
|
591 |
+
msgstr "Taxonomies"
|
592 |
+
|
593 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
594 |
+
msgid "Most Used"
|
595 |
+
msgstr "La plus utilisée"
|
596 |
+
|
597 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
598 |
+
msgid "Conditional Content"
|
599 |
+
msgstr ""
|
600 |
+
|
601 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
602 |
+
msgid ""
|
603 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
604 |
+
" it. In each group, you can combine different types of associated content."
|
605 |
+
msgstr "Cliquez ici pour éditer un groupe ou en créer un nouveau. Sélectionnez le contenu sur la gauche pour l'ajouter. Dans chaque groupe, vous pouvez combiner différents types de contenus associés. "
|
606 |
+
|
607 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
608 |
+
#, php-format
|
609 |
+
msgid "All %s"
|
610 |
+
msgstr "Toutes les %s"
|
611 |
+
|
612 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
613 |
+
msgid "Password protected"
|
614 |
+
msgstr ""
|
615 |
+
|
616 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
617 |
+
msgid "Private"
|
618 |
+
msgstr ""
|
619 |
+
|
620 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
621 |
+
msgid "Draft"
|
622 |
+
msgstr ""
|
623 |
+
|
624 |
+
#. translators: post state
|
625 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
626 |
+
msgctxt "post state"
|
627 |
+
msgid "Pending"
|
628 |
+
msgstr ""
|
629 |
+
|
630 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
631 |
+
msgid "Sticky"
|
632 |
+
msgstr ""
|
633 |
+
|
634 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
635 |
+
msgid "Scheduled"
|
636 |
+
msgstr ""
|
637 |
+
|
638 |
+
#: ../pointers.php:68
|
639 |
+
msgid "Get started"
|
640 |
+
msgstr ""
|
641 |
+
|
642 |
+
#: ../pointers.php:69
|
643 |
+
msgid ""
|
644 |
+
"You've just installed Content Aware Sidebars!\n"
|
645 |
+
"\n"
|
646 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
647 |
+
"\n"
|
648 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
649 |
+
msgstr ""
|
650 |
+
|
651 |
+
#: ../pointers.php:76
|
652 |
+
msgid "Start Tour"
|
653 |
+
msgstr ""
|
654 |
+
|
655 |
+
#: ../pointers.php:78
|
656 |
+
msgid "Not now"
|
657 |
+
msgstr ""
|
658 |
+
|
659 |
+
#: ../pointers.php:83
|
660 |
+
msgid ""
|
661 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
662 |
+
"\n"
|
663 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
664 |
+
"\n"
|
665 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
666 |
+
msgstr ""
|
667 |
+
|
668 |
+
#: ../pointers.php:92
|
669 |
+
msgid "Content and contexts"
|
670 |
+
msgstr ""
|
671 |
+
|
672 |
+
#: ../pointers.php:93
|
673 |
+
msgid ""
|
674 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
675 |
+
"\n"
|
676 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
677 |
+
"\n"
|
678 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
679 |
+
msgstr ""
|
680 |
+
|
681 |
+
#: ../pointers.php:102
|
682 |
+
msgid "Options, options"
|
683 |
+
msgstr ""
|
684 |
+
|
685 |
+
#: ../pointers.php:103
|
686 |
+
msgid ""
|
687 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
688 |
+
"\n"
|
689 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
690 |
+
"\n"
|
691 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
692 |
+
"\n"
|
693 |
+
" You are in control."
|
694 |
+
msgstr ""
|
695 |
+
|
696 |
+
#: ../pointers.php:112
|
697 |
+
msgid "Help and Support"
|
698 |
+
msgstr ""
|
699 |
+
|
700 |
+
#: ../pointers.php:113
|
701 |
+
msgid ""
|
702 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
703 |
+
"\n"
|
704 |
+
"If you need more help, click on the \"Help\" tab here."
|
705 |
+
msgstr ""
|
706 |
+
|
707 |
+
#: ../pointers.php:142
|
708 |
+
msgid "Close"
|
709 |
+
msgstr "Fermer"
|
710 |
+
|
711 |
+
#: ../pointers.php:143
|
712 |
+
msgid "Next"
|
713 |
+
msgstr "Suivant"
|
lang/content-aware-sidebars-he_IL.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# stas arshanski <stuk88@gmail.com>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Hebrew (Israel) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/he_IL/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: he_IL\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr ""
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr ""
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "ייבוא"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "שאלות ותשובות"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr "חשיפה"
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr "יחיד"
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr "יחיד וארכיון"
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "ארכיון"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr ""
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "החלף"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "חיבור"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "מדריך"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "החלפה בכח"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr ""
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr ""
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr ""
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr ""
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr ""
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr ""
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr ""
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr ""
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr ""
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr ""
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr ""
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr ""
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr ""
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr ""
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr ""
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr ""
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr ""
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr ""
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr ""
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr ""
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr ""
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr ""
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr ""
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr ""
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr ""
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
msgstr[1] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
msgstr[1] ""
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] ""
|
213 |
-
msgstr[1] ""
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] ""
|
220 |
-
msgstr[1] ""
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] ""
|
227 |
-
msgstr[1] ""
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr ""
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr ""
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr ""
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr ""
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr ""
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr ""
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr ""
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr ""
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr ""
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr ""
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr ""
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr ""
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr ""
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr ""
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr ""
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr ""
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr ""
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr ""
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr ""
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr ""
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr ""
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr "סדר"
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr ""
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr ""
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr ""
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr ""
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr ""
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr ""
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr ""
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr ""
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr ""
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr ""
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "עריכה"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr ""
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr ""
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr ""
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr ""
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr ""
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr ""
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr ""
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr ""
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr ""
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr ""
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr ""
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr ""
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr ""
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr ""
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr ""
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr ""
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr ""
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr ""
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr ""
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr ""
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr ""
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr ""
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr ""
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr ""
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr ""
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr ""
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr ""
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr ""
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr ""
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr ""
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr ""
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr ""
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr ""
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr ""
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr ""
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr ""
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr ""
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr ""
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr ""
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr ""
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr ""
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr ""
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr ""
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr ""
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr ""
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr ""
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr ""
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr ""
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr ""
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr ""
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr "סגור"
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr "הבא"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# stas arshanski <stuk88@gmail.com>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Hebrew (Israel) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/he_IL/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: he_IL\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr ""
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr ""
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "ייבוא"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "שאלות ותשובות"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr "חשיפה"
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr "יחיד"
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr "יחיד וארכיון"
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "ארכיון"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr ""
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "החלף"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "חיבור"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "מדריך"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "החלפה בכח"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr ""
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr ""
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr ""
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr ""
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr ""
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr ""
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr ""
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr ""
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr ""
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr ""
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr ""
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr ""
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr ""
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr ""
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr ""
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr ""
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr ""
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr ""
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr ""
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr ""
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr ""
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr ""
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr ""
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr ""
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr ""
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
msgstr[1] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
msgstr[1] ""
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] ""
|
213 |
+
msgstr[1] ""
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] ""
|
220 |
+
msgstr[1] ""
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] ""
|
227 |
+
msgstr[1] ""
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr ""
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr ""
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr ""
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr ""
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr ""
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr ""
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr ""
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr ""
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr ""
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr ""
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr ""
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr ""
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr ""
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr ""
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr ""
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr ""
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr ""
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr ""
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr ""
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr ""
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr ""
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr "סדר"
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr ""
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr ""
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr ""
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr ""
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr ""
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr ""
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr ""
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr ""
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr ""
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr ""
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr ""
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "עריכה"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr ""
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr ""
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr ""
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr ""
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr ""
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr ""
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr ""
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr ""
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr ""
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr ""
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr ""
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr ""
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr ""
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr ""
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr ""
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr ""
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr ""
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr ""
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr ""
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr ""
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr ""
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr ""
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr ""
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr ""
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr ""
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr ""
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr ""
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr ""
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr ""
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr ""
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr ""
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr ""
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr ""
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr ""
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr ""
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr ""
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr ""
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr ""
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr ""
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr ""
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr ""
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr ""
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr ""
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr ""
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr ""
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr ""
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr ""
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr ""
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr ""
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr ""
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr ""
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr ""
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr ""
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr ""
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr ""
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr "סגור"
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr "הבא"
|
lang/content-aware-sidebars-hr.po
CHANGED
@@ -1,717 +1,717 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Luka Peharda <luka.peharda@gmail.com>, 2015
|
5 |
-
# Marijan Rajic <mr.rajic@gmail.com>, 2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Croatian (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/hr/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: hr\n"
|
18 |
-
"Plural-Forms: nplurals=3; plural=n%10==1 && n%100!=11 ? 0 : n%10>=2 && n%10<=4 && (n%100<10 || n%100>=20) ? 1 : 2;\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Upravljaj i prikazuj bočne trake sukladno sadržaju koji se pregledava."
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Sadržajno svjesne bočne trake"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "Uvoz"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "Česta pitanja"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Ekspozicija"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Jednina"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Jednina & arhiva"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Arhiva"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Rukovanje"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Zamijeni"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Spoji"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Ručno"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Prisilna zamjena"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "Zamijeni bočnu traku hosta, spoji se sa njom ili dodaj bočnu traku ručno."
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "Bočna traka hosta"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "Spoji poziciju"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Vrh"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Dno"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Smjesti bočnu traku na vrh ili dno hosta prilikom spajanja."
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "Bočne trake"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "Bočna traka"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Dodaj novu"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Dodaj novu bočnu traku"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Uredi bočnu traku"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Nova bočna traka"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Sve bočne trake"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Pregled bočnih traka"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Pretraži bočne trake"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "Nisu nađene bočne trake"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "Nema nađenih bočnih traka u smeću"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Prikaži bočnu traku sa"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Bez sadržaja. Molim dodajte barem jednu uvjetnu grupu kako bi učinili bočnu traku sadržajno svjesnom."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Upravljanje widgetima"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "Bočna traka ažurirana."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Bočna traka objavljena."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Bočna traka pohranjena."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Bočna traka predana."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Bočna traka na rasporedu za: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "M j, Y @ G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Nacrt bočne trake ažuriran."
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
msgstr[1] ""
|
201 |
-
msgstr[2] ""
|
202 |
-
|
203 |
-
#: ../content-aware-sidebars.php:384
|
204 |
-
#, php-format
|
205 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
-
msgstr[0] ""
|
208 |
-
msgstr[1] ""
|
209 |
-
msgstr[2] ""
|
210 |
-
|
211 |
-
#: ../content-aware-sidebars.php:385
|
212 |
-
#, php-format
|
213 |
-
msgid "%s sidebar permanently deleted."
|
214 |
-
msgid_plural "%s sidebars permanently deleted."
|
215 |
-
msgstr[0] ""
|
216 |
-
msgstr[1] ""
|
217 |
-
msgstr[2] ""
|
218 |
-
|
219 |
-
#: ../content-aware-sidebars.php:386
|
220 |
-
#, php-format
|
221 |
-
msgid "%s sidebar moved to the Trash."
|
222 |
-
msgid_plural "%s sidebars moved to the Trash."
|
223 |
-
msgstr[0] ""
|
224 |
-
msgstr[1] ""
|
225 |
-
msgstr[2] ""
|
226 |
-
|
227 |
-
#: ../content-aware-sidebars.php:387
|
228 |
-
#, php-format
|
229 |
-
msgid "%s sidebar restored from the Trash."
|
230 |
-
msgid_plural "%s sidebars restored from the Trash."
|
231 |
-
msgstr[0] ""
|
232 |
-
msgstr[1] ""
|
233 |
-
msgstr[2] ""
|
234 |
-
|
235 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
236 |
-
msgid "Please update Host Sidebar"
|
237 |
-
msgstr "Molim ažurirajte bočnu traku hosta."
|
238 |
-
|
239 |
-
#: ../content-aware-sidebars.php:472
|
240 |
-
msgid "Merge position"
|
241 |
-
msgstr "Spoji pozicije"
|
242 |
-
|
243 |
-
#: ../content-aware-sidebars.php:473
|
244 |
-
msgid "Widgets"
|
245 |
-
msgstr "Widgeti"
|
246 |
-
|
247 |
-
#: ../content-aware-sidebars.php:586
|
248 |
-
msgid "Manage Widgets"
|
249 |
-
msgstr "Upravljanje widgetima"
|
250 |
-
|
251 |
-
#: ../content-aware-sidebars.php:756
|
252 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
253 |
-
msgstr "Nabavite besplatni premium paket sadržajno svjesnih bočnih traka."
|
254 |
-
|
255 |
-
#: ../content-aware-sidebars.php:772
|
256 |
-
msgid "Options"
|
257 |
-
msgstr "Opcije"
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:795
|
260 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
261 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
262 |
-
msgid "Condition Groups"
|
263 |
-
msgstr "Uvjetne grupe"
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:796
|
266 |
-
msgid ""
|
267 |
-
"Each created condition group describe some specific content (conditions) "
|
268 |
-
"that the current sidebar should be displayed with."
|
269 |
-
msgstr "Svaka kreirana uvjetna grupa opisuje neke specifične sadržaje (uvjete) kojim bi trenutna bočna traka trebala biti ispunjena."
|
270 |
-
|
271 |
-
#: ../content-aware-sidebars.php:797
|
272 |
-
msgid ""
|
273 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
274 |
-
" groups themselves use logical disjunction. This means that content added to"
|
275 |
-
" a group should be associated, as they are treated as such, and that the "
|
276 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
277 |
-
"extremely focused and at the same time distinct conditions."
|
278 |
-
msgstr "Sadržaj dodan uvjetnim grupama koristi logičke spojeve, dok same uvjetne grupe koriste logičke razmake. Ovo znači da bi sadržaj dodan u grupu trebao biti povezan, jer se kao takav i tretira, kao i da se grupe ne miješaju jedna sa drugom. Samim time moguće je imati oboje, ekstremno fokusirane, a istovremeno različite uvjete."
|
279 |
-
|
280 |
-
#: ../content-aware-sidebars.php:800
|
281 |
-
msgid "More Information"
|
282 |
-
msgstr "Više informacija"
|
283 |
-
|
284 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
285 |
-
msgid "Get Support"
|
286 |
-
msgstr "Traži podršku"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:816
|
289 |
-
msgid ""
|
290 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
291 |
-
" of the upcoming Premium Bundle*!"
|
292 |
-
msgstr "Prevedi sadržajno svjesne bočne traka na svoj jezik i postani BETA tester za nadolazeći premium paket*!"
|
293 |
-
|
294 |
-
#: ../content-aware-sidebars.php:817
|
295 |
-
msgid "Translate Now"
|
296 |
-
msgstr "Prevedi sad"
|
297 |
-
|
298 |
-
#: ../content-aware-sidebars.php:818
|
299 |
-
msgid "Get Premium Bundle"
|
300 |
-
msgstr "Nabavi premium paket"
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:819
|
303 |
-
msgid ""
|
304 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
305 |
-
msgstr "Korištenje na jednom mjestu. BETA implicira da nije preporučeno korištenje u produkciji."
|
306 |
-
|
307 |
-
#: ../content-aware-sidebars.php:822
|
308 |
-
msgid "Partial Feature List"
|
309 |
-
msgstr "Parcijalna lista značajki"
|
310 |
-
|
311 |
-
#: ../content-aware-sidebars.php:824
|
312 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
313 |
-
msgstr "Odaberite i kreirajte bočne trake u naknadno uređivanim prikazima."
|
314 |
-
|
315 |
-
#: ../content-aware-sidebars.php:825
|
316 |
-
msgid "Display sidebars with URLs using wildcards"
|
317 |
-
msgstr "Prikaži bočne trake sa URL adresama korištenjem wildcarda"
|
318 |
-
|
319 |
-
#: ../content-aware-sidebars.php:826
|
320 |
-
msgid "Display sidebars with User Roles"
|
321 |
-
msgstr "Prikaži bočne trake sa korisničkim ulogama"
|
322 |
-
|
323 |
-
#: ../content-aware-sidebars.php:827
|
324 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
325 |
-
msgstr "Prikaži bočne trake sa BuddyPress korisničkim grupama"
|
326 |
-
|
327 |
-
#: ../content-aware-sidebars.php:828
|
328 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
329 |
-
msgstr "Kolone bočnih traka u Post Type i prikazom Taxonomy pregleda"
|
330 |
-
|
331 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
332 |
-
msgid "Order"
|
333 |
-
msgstr "Redoslijed"
|
334 |
-
|
335 |
-
#: ../content-aware-sidebars.php:880
|
336 |
-
msgid "Give a review on WordPress.org"
|
337 |
-
msgstr ""
|
338 |
-
|
339 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
340 |
-
msgid "Translate the plugin into your language"
|
341 |
-
msgstr "Prevedi ovaj plugin na svoj jezik"
|
342 |
-
|
343 |
-
#: ../content-aware-sidebars.php:884
|
344 |
-
msgid "Read the FAQ"
|
345 |
-
msgstr ""
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:899
|
348 |
-
msgid ""
|
349 |
-
"If you love this plugin, please consider donating to support future "
|
350 |
-
"development."
|
351 |
-
msgstr "Ukoliko volite ovaj dodatak, molim razmotrite donaciju za podršku daljnjem razvoju."
|
352 |
-
|
353 |
-
#: ../content-aware-sidebars.php:908
|
354 |
-
msgid "Or you could:"
|
355 |
-
msgstr "Ili možete:"
|
356 |
-
|
357 |
-
#: ../content-aware-sidebars.php:910
|
358 |
-
msgid "Rate the plugin on WordPress.org"
|
359 |
-
msgstr "Ocijeni plugin na WordPress.org"
|
360 |
-
|
361 |
-
#: ../content-aware-sidebars.php:911
|
362 |
-
msgid "Link to the plugin page"
|
363 |
-
msgstr "Poveznica na stranicu plugina"
|
364 |
-
|
365 |
-
#: ../content-aware-sidebars.php:1045
|
366 |
-
msgid "Filter Sidebars"
|
367 |
-
msgstr "Filtriraj bočne trake"
|
368 |
-
|
369 |
-
#: ../content-aware-sidebars.php:1046
|
370 |
-
msgid "Filter Widgets"
|
371 |
-
msgstr ""
|
372 |
-
|
373 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
374 |
-
msgid "Condition Group"
|
375 |
-
msgstr "Grupa uvjeta"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
378 |
-
msgctxt "group"
|
379 |
-
msgid "Add New"
|
380 |
-
msgstr "Dodaj novi"
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
383 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
385 |
-
msgid "Add New Group"
|
386 |
-
msgstr "Dodaj novu grupu"
|
387 |
-
|
388 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
390 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
391 |
-
msgctxt "group"
|
392 |
-
msgid "Edit"
|
393 |
-
msgstr "Izmijeni"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
396 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
397 |
-
msgid "No Groups found"
|
398 |
-
msgstr "Nisu nađene grupe"
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
401 |
-
msgctxt "condition group"
|
402 |
-
msgid "Negated"
|
403 |
-
msgstr "Negirano"
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
406 |
-
msgid "Content"
|
407 |
-
msgstr "Sadržaj"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
411 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
412 |
-
msgid "Unauthorized request"
|
413 |
-
msgstr "Nedozvoljeni zahtjev"
|
414 |
-
|
415 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
416 |
-
msgid "Condition group cannot be empty"
|
417 |
-
msgstr "Uvjetne grupe ne mogu biti prazne"
|
418 |
-
|
419 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
420 |
-
msgid "Condition group saved"
|
421 |
-
msgstr "Grupa uvjeta spremljena"
|
422 |
-
|
423 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
424 |
-
msgid "Condition group could not be removed"
|
425 |
-
msgstr "Uvjetne grupe ne mogu biti uklonjene"
|
426 |
-
|
427 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
428 |
-
msgid "Condition group removed"
|
429 |
-
msgstr "Grupa uvjeta obrisana"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Save"
|
434 |
-
msgstr "Spremi"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
438 |
-
msgid "Cancel"
|
439 |
-
msgstr "Odustani"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
442 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
443 |
-
msgid "Or"
|
444 |
-
msgstr "Ili"
|
445 |
-
|
446 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
447 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
448 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
449 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
450 |
-
msgid "And"
|
451 |
-
msgstr ""
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
454 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
455 |
-
msgid "Remove"
|
456 |
-
msgstr "Izbriši"
|
457 |
-
|
458 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
459 |
-
msgid "Remove this group and its contents permanently?"
|
460 |
-
msgstr "Uklanjate ovu grupu i njezin sadržaj trajno?"
|
461 |
-
|
462 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
463 |
-
msgid "No results found."
|
464 |
-
msgstr "Nema rezultata."
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
467 |
-
msgid ""
|
468 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
469 |
-
"these changes?"
|
470 |
-
msgstr "Trenutna grupa ima nepohranjene promjene. Da li želite nastaviti i zanemariti ove promjene?"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
474 |
-
msgid "Negate group"
|
475 |
-
msgstr "Negirajte grupu"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target all but this context"
|
480 |
-
msgstr "Naciljaj sve osim ovog konteksta"
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
483 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
484 |
-
msgid "Target this context"
|
485 |
-
msgstr "Naciljaj ovaj kontekst"
|
486 |
-
|
487 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
488 |
-
msgid "Authors"
|
489 |
-
msgstr "Autori"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
492 |
-
#, php-format
|
493 |
-
msgid "Display with All %s"
|
494 |
-
msgstr "Prikažite sa svim %s"
|
495 |
-
|
496 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
497 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
498 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
499 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
500 |
-
msgid "View All"
|
501 |
-
msgstr "Pregledaj sve"
|
502 |
-
|
503 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
504 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
505 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
506 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
507 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
508 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
509 |
-
msgid "Search"
|
510 |
-
msgstr "Pretraži"
|
511 |
-
|
512 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
513 |
-
msgid "bbPress User Profiles"
|
514 |
-
msgstr "bbPress korisnički profili"
|
515 |
-
|
516 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
517 |
-
msgid "BuddyPress Members"
|
518 |
-
msgstr "BuddyPress članovi"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
521 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
522 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
523 |
-
msgid "Add to Group"
|
524 |
-
msgstr "Dodaj u grupu"
|
525 |
-
|
526 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
527 |
-
msgid "Dates"
|
528 |
-
msgstr "Datumi"
|
529 |
-
|
530 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
531 |
-
msgid "Date Archives"
|
532 |
-
msgstr "Datum arhiva"
|
533 |
-
|
534 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
535 |
-
msgid "Page Templates"
|
536 |
-
msgstr "Predlošci stranice"
|
537 |
-
|
538 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
539 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
540 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
541 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
542 |
-
msgid "Languages"
|
543 |
-
msgstr "Jezici"
|
544 |
-
|
545 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
546 |
-
msgid "Post Types"
|
547 |
-
msgstr "Tipovi objava"
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
550 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
551 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
552 |
-
msgid "Automatically select new children of a selected ancestor"
|
553 |
-
msgstr "Automatski odaberite novog potomka za selektirani objekt"
|
554 |
-
|
555 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
556 |
-
msgid "Automatically add new children of a selected ancestor"
|
557 |
-
msgstr "Automatski dodaj djecu odabranog pretka"
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
560 |
-
#, php-format
|
561 |
-
msgid "%s Archives"
|
562 |
-
msgstr "%s arhiva"
|
563 |
-
|
564 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
565 |
-
msgid "Blog Page"
|
566 |
-
msgstr "Blog stranica"
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
569 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
570 |
-
msgid "No items."
|
571 |
-
msgstr "Nema stavki."
|
572 |
-
|
573 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
574 |
-
msgid "Most Recent"
|
575 |
-
msgstr "Posljednje"
|
576 |
-
|
577 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
578 |
-
msgid "Static Pages"
|
579 |
-
msgstr "Statične stranice"
|
580 |
-
|
581 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
582 |
-
msgid "Front Page"
|
583 |
-
msgstr "Početna stranica"
|
584 |
-
|
585 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
586 |
-
msgid "Search Results"
|
587 |
-
msgstr "Rezultati pretrage"
|
588 |
-
|
589 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
590 |
-
msgid "404 Page"
|
591 |
-
msgstr "404 stranica"
|
592 |
-
|
593 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
594 |
-
msgid "Taxonomies"
|
595 |
-
msgstr "Taksonomije"
|
596 |
-
|
597 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
598 |
-
msgid "Most Used"
|
599 |
-
msgstr "Najčešće korištene"
|
600 |
-
|
601 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
602 |
-
msgid "Conditional Content"
|
603 |
-
msgstr ""
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
606 |
-
msgid ""
|
607 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
608 |
-
" it. In each group, you can combine different types of associated content."
|
609 |
-
msgstr "Kliknite za uređivanje grupe ili kreirajte novu. Odaberite sadržaj na lijevo i dodajte ga. U svakoj grupi možete kombinirati različite tipove povezanih sadržaja."
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
612 |
-
#, php-format
|
613 |
-
msgid "All %s"
|
614 |
-
msgstr "Sve %s"
|
615 |
-
|
616 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
617 |
-
msgid "Password protected"
|
618 |
-
msgstr ""
|
619 |
-
|
620 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
621 |
-
msgid "Private"
|
622 |
-
msgstr ""
|
623 |
-
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
625 |
-
msgid "Draft"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#. translators: post state
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
630 |
-
msgctxt "post state"
|
631 |
-
msgid "Pending"
|
632 |
-
msgstr ""
|
633 |
-
|
634 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
635 |
-
msgid "Sticky"
|
636 |
-
msgstr ""
|
637 |
-
|
638 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
639 |
-
msgid "Scheduled"
|
640 |
-
msgstr ""
|
641 |
-
|
642 |
-
#: ../pointers.php:68
|
643 |
-
msgid "Get started"
|
644 |
-
msgstr "Započni"
|
645 |
-
|
646 |
-
#: ../pointers.php:69
|
647 |
-
msgid ""
|
648 |
-
"You've just installed Content Aware Sidebars!\n"
|
649 |
-
"\n"
|
650 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
651 |
-
"\n"
|
652 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
653 |
-
msgstr "Upravo ste instalirali sadržajno svjesne bočne trake!\n\nOne vam daju puno opcija pa vam ovaj prikaz možda izgleda komplicirano na prvu. Ne brinite.\n\nKliknite početni obilazak kako bi na brzinu pogledali uvod i naučili kako prikazati bočnu traku točno tamo gdje je i želite."
|
654 |
-
|
655 |
-
#: ../pointers.php:76
|
656 |
-
msgid "Start Tour"
|
657 |
-
msgstr "Početni obilazak"
|
658 |
-
|
659 |
-
#: ../pointers.php:78
|
660 |
-
msgid "Not now"
|
661 |
-
msgstr "Ne sada"
|
662 |
-
|
663 |
-
#: ../pointers.php:83
|
664 |
-
msgid ""
|
665 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
666 |
-
"\n"
|
667 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
668 |
-
"\n"
|
669 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
670 |
-
msgstr "Kako bi bočne trake učinili kontekstualnima, krenite stvaranjem nove uvjetne grupe.\n\nUvjetne grupe su izolirane jedna od druge, što znači da bočna traka može imati vrlo različite uvjete.\n\nNegiranje grupe znači da će bočna traka biti prikazana ali bez tih uvjeta."
|
671 |
-
|
672 |
-
#: ../pointers.php:92
|
673 |
-
msgid "Content and contexts"
|
674 |
-
msgstr "Sadržaj i konteksti"
|
675 |
-
|
676 |
-
#: ../pointers.php:93
|
677 |
-
msgid ""
|
678 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
679 |
-
"\n"
|
680 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
681 |
-
"\n"
|
682 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
683 |
-
msgstr "Ovdje možete naći cjelokupni sadržaj na vašem mjestu koji sadržajno svjesne bočne trake podržavaju bez ikakve prilagodbe.\n\nJednostavno odaberite sadržaj koji želite prikazati na bočnoj traci i pridodajte ga grupi.\n\nMožete čak i kombinirati povezani sadržaj u jednu grupu; pokušajte odabrati \"Sve objave\", kategoriju i autora. Izvrsno!"
|
684 |
-
|
685 |
-
#: ../pointers.php:102
|
686 |
-
msgid "Options, options"
|
687 |
-
msgstr "Opcije, opcije"
|
688 |
-
|
689 |
-
#: ../pointers.php:103
|
690 |
-
msgid ""
|
691 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
692 |
-
"\n"
|
693 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
694 |
-
"\n"
|
695 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
696 |
-
"\n"
|
697 |
-
" You are in control."
|
698 |
-
msgstr "Da li bočne trake treba prikazati na pojedinim stranicama i/ili arhivama?\n\nTreba li ih spojiti sa drugim postojećim bočnim trakama ili ih zamijeniti? Možda ih želite ubaciti ručno u svoj sadržaj putem kratkog koda.\n\nRasporedite bočne trake kao što radite sa objavama i stranicama ili ih učinite privatnima kako bi bile vidljive samo prijavljenim korisnicima.\n\n Vi imate kontolu."
|
699 |
-
|
700 |
-
#: ../pointers.php:112
|
701 |
-
msgid "Help and Support"
|
702 |
-
msgstr "Pomoć i podrška"
|
703 |
-
|
704 |
-
#: ../pointers.php:113
|
705 |
-
msgid ""
|
706 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
707 |
-
"\n"
|
708 |
-
"If you need more help, click on the \"Help\" tab here."
|
709 |
-
msgstr "To je to! Sada možete početi kreirati bočne trake i prikazati ih po svojim uvjetima.\n\nUkoliko trebate opsežniju pomoč, kliknite na \"Pomoć\" tabulator ovdje."
|
710 |
-
|
711 |
-
#: ../pointers.php:142
|
712 |
-
msgid "Close"
|
713 |
-
msgstr "Zatvori"
|
714 |
-
|
715 |
-
#: ../pointers.php:143
|
716 |
-
msgid "Next"
|
717 |
-
msgstr "Slijedeće"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Luka Peharda <luka.peharda@gmail.com>, 2015
|
5 |
+
# Marijan Rajic <mr.rajic@gmail.com>, 2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Croatian (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/hr/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: hr\n"
|
18 |
+
"Plural-Forms: nplurals=3; plural=n%10==1 && n%100!=11 ? 0 : n%10>=2 && n%10<=4 && (n%100<10 || n%100>=20) ? 1 : 2;\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Upravljaj i prikazuj bočne trake sukladno sadržaju koji se pregledava."
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Sadržajno svjesne bočne trake"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "Uvoz"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "Česta pitanja"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Ekspozicija"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Jednina"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Jednina & arhiva"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Arhiva"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Rukovanje"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Zamijeni"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Spoji"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Ručno"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Prisilna zamjena"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "Zamijeni bočnu traku hosta, spoji se sa njom ili dodaj bočnu traku ručno."
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "Bočna traka hosta"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "Spoji poziciju"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Vrh"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Dno"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Smjesti bočnu traku na vrh ili dno hosta prilikom spajanja."
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "Bočne trake"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "Bočna traka"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Dodaj novu"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Dodaj novu bočnu traku"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Uredi bočnu traku"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Nova bočna traka"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Sve bočne trake"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Pregled bočnih traka"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Pretraži bočne trake"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "Nisu nađene bočne trake"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "Nema nađenih bočnih traka u smeću"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Prikaži bočnu traku sa"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Bez sadržaja. Molim dodajte barem jednu uvjetnu grupu kako bi učinili bočnu traku sadržajno svjesnom."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Upravljanje widgetima"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "Bočna traka ažurirana."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Bočna traka objavljena."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Bočna traka pohranjena."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Bočna traka predana."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Bočna traka na rasporedu za: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "M j, Y @ G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Nacrt bočne trake ažuriran."
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
msgstr[1] ""
|
201 |
+
msgstr[2] ""
|
202 |
+
|
203 |
+
#: ../content-aware-sidebars.php:384
|
204 |
+
#, php-format
|
205 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
206 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
207 |
+
msgstr[0] ""
|
208 |
+
msgstr[1] ""
|
209 |
+
msgstr[2] ""
|
210 |
+
|
211 |
+
#: ../content-aware-sidebars.php:385
|
212 |
+
#, php-format
|
213 |
+
msgid "%s sidebar permanently deleted."
|
214 |
+
msgid_plural "%s sidebars permanently deleted."
|
215 |
+
msgstr[0] ""
|
216 |
+
msgstr[1] ""
|
217 |
+
msgstr[2] ""
|
218 |
+
|
219 |
+
#: ../content-aware-sidebars.php:386
|
220 |
+
#, php-format
|
221 |
+
msgid "%s sidebar moved to the Trash."
|
222 |
+
msgid_plural "%s sidebars moved to the Trash."
|
223 |
+
msgstr[0] ""
|
224 |
+
msgstr[1] ""
|
225 |
+
msgstr[2] ""
|
226 |
+
|
227 |
+
#: ../content-aware-sidebars.php:387
|
228 |
+
#, php-format
|
229 |
+
msgid "%s sidebar restored from the Trash."
|
230 |
+
msgid_plural "%s sidebars restored from the Trash."
|
231 |
+
msgstr[0] ""
|
232 |
+
msgstr[1] ""
|
233 |
+
msgstr[2] ""
|
234 |
+
|
235 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
236 |
+
msgid "Please update Host Sidebar"
|
237 |
+
msgstr "Molim ažurirajte bočnu traku hosta."
|
238 |
+
|
239 |
+
#: ../content-aware-sidebars.php:472
|
240 |
+
msgid "Merge position"
|
241 |
+
msgstr "Spoji pozicije"
|
242 |
+
|
243 |
+
#: ../content-aware-sidebars.php:473
|
244 |
+
msgid "Widgets"
|
245 |
+
msgstr "Widgeti"
|
246 |
+
|
247 |
+
#: ../content-aware-sidebars.php:586
|
248 |
+
msgid "Manage Widgets"
|
249 |
+
msgstr "Upravljanje widgetima"
|
250 |
+
|
251 |
+
#: ../content-aware-sidebars.php:756
|
252 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
253 |
+
msgstr "Nabavite besplatni premium paket sadržajno svjesnih bočnih traka."
|
254 |
+
|
255 |
+
#: ../content-aware-sidebars.php:772
|
256 |
+
msgid "Options"
|
257 |
+
msgstr "Opcije"
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:795
|
260 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
261 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
262 |
+
msgid "Condition Groups"
|
263 |
+
msgstr "Uvjetne grupe"
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:796
|
266 |
+
msgid ""
|
267 |
+
"Each created condition group describe some specific content (conditions) "
|
268 |
+
"that the current sidebar should be displayed with."
|
269 |
+
msgstr "Svaka kreirana uvjetna grupa opisuje neke specifične sadržaje (uvjete) kojim bi trenutna bočna traka trebala biti ispunjena."
|
270 |
+
|
271 |
+
#: ../content-aware-sidebars.php:797
|
272 |
+
msgid ""
|
273 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
274 |
+
" groups themselves use logical disjunction. This means that content added to"
|
275 |
+
" a group should be associated, as they are treated as such, and that the "
|
276 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
277 |
+
"extremely focused and at the same time distinct conditions."
|
278 |
+
msgstr "Sadržaj dodan uvjetnim grupama koristi logičke spojeve, dok same uvjetne grupe koriste logičke razmake. Ovo znači da bi sadržaj dodan u grupu trebao biti povezan, jer se kao takav i tretira, kao i da se grupe ne miješaju jedna sa drugom. Samim time moguće je imati oboje, ekstremno fokusirane, a istovremeno različite uvjete."
|
279 |
+
|
280 |
+
#: ../content-aware-sidebars.php:800
|
281 |
+
msgid "More Information"
|
282 |
+
msgstr "Više informacija"
|
283 |
+
|
284 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
285 |
+
msgid "Get Support"
|
286 |
+
msgstr "Traži podršku"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:816
|
289 |
+
msgid ""
|
290 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
291 |
+
" of the upcoming Premium Bundle*!"
|
292 |
+
msgstr "Prevedi sadržajno svjesne bočne traka na svoj jezik i postani BETA tester za nadolazeći premium paket*!"
|
293 |
+
|
294 |
+
#: ../content-aware-sidebars.php:817
|
295 |
+
msgid "Translate Now"
|
296 |
+
msgstr "Prevedi sad"
|
297 |
+
|
298 |
+
#: ../content-aware-sidebars.php:818
|
299 |
+
msgid "Get Premium Bundle"
|
300 |
+
msgstr "Nabavi premium paket"
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:819
|
303 |
+
msgid ""
|
304 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
305 |
+
msgstr "Korištenje na jednom mjestu. BETA implicira da nije preporučeno korištenje u produkciji."
|
306 |
+
|
307 |
+
#: ../content-aware-sidebars.php:822
|
308 |
+
msgid "Partial Feature List"
|
309 |
+
msgstr "Parcijalna lista značajki"
|
310 |
+
|
311 |
+
#: ../content-aware-sidebars.php:824
|
312 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
313 |
+
msgstr "Odaberite i kreirajte bočne trake u naknadno uređivanim prikazima."
|
314 |
+
|
315 |
+
#: ../content-aware-sidebars.php:825
|
316 |
+
msgid "Display sidebars with URLs using wildcards"
|
317 |
+
msgstr "Prikaži bočne trake sa URL adresama korištenjem wildcarda"
|
318 |
+
|
319 |
+
#: ../content-aware-sidebars.php:826
|
320 |
+
msgid "Display sidebars with User Roles"
|
321 |
+
msgstr "Prikaži bočne trake sa korisničkim ulogama"
|
322 |
+
|
323 |
+
#: ../content-aware-sidebars.php:827
|
324 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
325 |
+
msgstr "Prikaži bočne trake sa BuddyPress korisničkim grupama"
|
326 |
+
|
327 |
+
#: ../content-aware-sidebars.php:828
|
328 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
329 |
+
msgstr "Kolone bočnih traka u Post Type i prikazom Taxonomy pregleda"
|
330 |
+
|
331 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
332 |
+
msgid "Order"
|
333 |
+
msgstr "Redoslijed"
|
334 |
+
|
335 |
+
#: ../content-aware-sidebars.php:880
|
336 |
+
msgid "Give a review on WordPress.org"
|
337 |
+
msgstr ""
|
338 |
+
|
339 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
340 |
+
msgid "Translate the plugin into your language"
|
341 |
+
msgstr "Prevedi ovaj plugin na svoj jezik"
|
342 |
+
|
343 |
+
#: ../content-aware-sidebars.php:884
|
344 |
+
msgid "Read the FAQ"
|
345 |
+
msgstr ""
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:899
|
348 |
+
msgid ""
|
349 |
+
"If you love this plugin, please consider donating to support future "
|
350 |
+
"development."
|
351 |
+
msgstr "Ukoliko volite ovaj dodatak, molim razmotrite donaciju za podršku daljnjem razvoju."
|
352 |
+
|
353 |
+
#: ../content-aware-sidebars.php:908
|
354 |
+
msgid "Or you could:"
|
355 |
+
msgstr "Ili možete:"
|
356 |
+
|
357 |
+
#: ../content-aware-sidebars.php:910
|
358 |
+
msgid "Rate the plugin on WordPress.org"
|
359 |
+
msgstr "Ocijeni plugin na WordPress.org"
|
360 |
+
|
361 |
+
#: ../content-aware-sidebars.php:911
|
362 |
+
msgid "Link to the plugin page"
|
363 |
+
msgstr "Poveznica na stranicu plugina"
|
364 |
+
|
365 |
+
#: ../content-aware-sidebars.php:1045
|
366 |
+
msgid "Filter Sidebars"
|
367 |
+
msgstr "Filtriraj bočne trake"
|
368 |
+
|
369 |
+
#: ../content-aware-sidebars.php:1046
|
370 |
+
msgid "Filter Widgets"
|
371 |
+
msgstr ""
|
372 |
+
|
373 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
374 |
+
msgid "Condition Group"
|
375 |
+
msgstr "Grupa uvjeta"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
378 |
+
msgctxt "group"
|
379 |
+
msgid "Add New"
|
380 |
+
msgstr "Dodaj novi"
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
383 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
385 |
+
msgid "Add New Group"
|
386 |
+
msgstr "Dodaj novu grupu"
|
387 |
+
|
388 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
390 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
391 |
+
msgctxt "group"
|
392 |
+
msgid "Edit"
|
393 |
+
msgstr "Izmijeni"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
396 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
397 |
+
msgid "No Groups found"
|
398 |
+
msgstr "Nisu nađene grupe"
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
401 |
+
msgctxt "condition group"
|
402 |
+
msgid "Negated"
|
403 |
+
msgstr "Negirano"
|
404 |
+
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
406 |
+
msgid "Content"
|
407 |
+
msgstr "Sadržaj"
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
411 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
412 |
+
msgid "Unauthorized request"
|
413 |
+
msgstr "Nedozvoljeni zahtjev"
|
414 |
+
|
415 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
416 |
+
msgid "Condition group cannot be empty"
|
417 |
+
msgstr "Uvjetne grupe ne mogu biti prazne"
|
418 |
+
|
419 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
420 |
+
msgid "Condition group saved"
|
421 |
+
msgstr "Grupa uvjeta spremljena"
|
422 |
+
|
423 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
424 |
+
msgid "Condition group could not be removed"
|
425 |
+
msgstr "Uvjetne grupe ne mogu biti uklonjene"
|
426 |
+
|
427 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
428 |
+
msgid "Condition group removed"
|
429 |
+
msgstr "Grupa uvjeta obrisana"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Save"
|
434 |
+
msgstr "Spremi"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
438 |
+
msgid "Cancel"
|
439 |
+
msgstr "Odustani"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
442 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
443 |
+
msgid "Or"
|
444 |
+
msgstr "Ili"
|
445 |
+
|
446 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
447 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
448 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
449 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
450 |
+
msgid "And"
|
451 |
+
msgstr ""
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
454 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
455 |
+
msgid "Remove"
|
456 |
+
msgstr "Izbriši"
|
457 |
+
|
458 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
459 |
+
msgid "Remove this group and its contents permanently?"
|
460 |
+
msgstr "Uklanjate ovu grupu i njezin sadržaj trajno?"
|
461 |
+
|
462 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
463 |
+
msgid "No results found."
|
464 |
+
msgstr "Nema rezultata."
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
467 |
+
msgid ""
|
468 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
469 |
+
"these changes?"
|
470 |
+
msgstr "Trenutna grupa ima nepohranjene promjene. Da li želite nastaviti i zanemariti ove promjene?"
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
474 |
+
msgid "Negate group"
|
475 |
+
msgstr "Negirajte grupu"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target all but this context"
|
480 |
+
msgstr "Naciljaj sve osim ovog konteksta"
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
483 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
484 |
+
msgid "Target this context"
|
485 |
+
msgstr "Naciljaj ovaj kontekst"
|
486 |
+
|
487 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
488 |
+
msgid "Authors"
|
489 |
+
msgstr "Autori"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
492 |
+
#, php-format
|
493 |
+
msgid "Display with All %s"
|
494 |
+
msgstr "Prikažite sa svim %s"
|
495 |
+
|
496 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
497 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
498 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
499 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
500 |
+
msgid "View All"
|
501 |
+
msgstr "Pregledaj sve"
|
502 |
+
|
503 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
504 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
505 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
506 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
507 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
508 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
509 |
+
msgid "Search"
|
510 |
+
msgstr "Pretraži"
|
511 |
+
|
512 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
513 |
+
msgid "bbPress User Profiles"
|
514 |
+
msgstr "bbPress korisnički profili"
|
515 |
+
|
516 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
517 |
+
msgid "BuddyPress Members"
|
518 |
+
msgstr "BuddyPress članovi"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
521 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
522 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
523 |
+
msgid "Add to Group"
|
524 |
+
msgstr "Dodaj u grupu"
|
525 |
+
|
526 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
527 |
+
msgid "Dates"
|
528 |
+
msgstr "Datumi"
|
529 |
+
|
530 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
531 |
+
msgid "Date Archives"
|
532 |
+
msgstr "Datum arhiva"
|
533 |
+
|
534 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
535 |
+
msgid "Page Templates"
|
536 |
+
msgstr "Predlošci stranice"
|
537 |
+
|
538 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
539 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
540 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
541 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
542 |
+
msgid "Languages"
|
543 |
+
msgstr "Jezici"
|
544 |
+
|
545 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
546 |
+
msgid "Post Types"
|
547 |
+
msgstr "Tipovi objava"
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
550 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
551 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
552 |
+
msgid "Automatically select new children of a selected ancestor"
|
553 |
+
msgstr "Automatski odaberite novog potomka za selektirani objekt"
|
554 |
+
|
555 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
556 |
+
msgid "Automatically add new children of a selected ancestor"
|
557 |
+
msgstr "Automatski dodaj djecu odabranog pretka"
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
560 |
+
#, php-format
|
561 |
+
msgid "%s Archives"
|
562 |
+
msgstr "%s arhiva"
|
563 |
+
|
564 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
565 |
+
msgid "Blog Page"
|
566 |
+
msgstr "Blog stranica"
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
569 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
570 |
+
msgid "No items."
|
571 |
+
msgstr "Nema stavki."
|
572 |
+
|
573 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
574 |
+
msgid "Most Recent"
|
575 |
+
msgstr "Posljednje"
|
576 |
+
|
577 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
578 |
+
msgid "Static Pages"
|
579 |
+
msgstr "Statične stranice"
|
580 |
+
|
581 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
582 |
+
msgid "Front Page"
|
583 |
+
msgstr "Početna stranica"
|
584 |
+
|
585 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
586 |
+
msgid "Search Results"
|
587 |
+
msgstr "Rezultati pretrage"
|
588 |
+
|
589 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
590 |
+
msgid "404 Page"
|
591 |
+
msgstr "404 stranica"
|
592 |
+
|
593 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
594 |
+
msgid "Taxonomies"
|
595 |
+
msgstr "Taksonomije"
|
596 |
+
|
597 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
598 |
+
msgid "Most Used"
|
599 |
+
msgstr "Najčešće korištene"
|
600 |
+
|
601 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
602 |
+
msgid "Conditional Content"
|
603 |
+
msgstr ""
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
606 |
+
msgid ""
|
607 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
608 |
+
" it. In each group, you can combine different types of associated content."
|
609 |
+
msgstr "Kliknite za uređivanje grupe ili kreirajte novu. Odaberite sadržaj na lijevo i dodajte ga. U svakoj grupi možete kombinirati različite tipove povezanih sadržaja."
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
612 |
+
#, php-format
|
613 |
+
msgid "All %s"
|
614 |
+
msgstr "Sve %s"
|
615 |
+
|
616 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
617 |
+
msgid "Password protected"
|
618 |
+
msgstr ""
|
619 |
+
|
620 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
621 |
+
msgid "Private"
|
622 |
+
msgstr ""
|
623 |
+
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
625 |
+
msgid "Draft"
|
626 |
+
msgstr ""
|
627 |
+
|
628 |
+
#. translators: post state
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
630 |
+
msgctxt "post state"
|
631 |
+
msgid "Pending"
|
632 |
+
msgstr ""
|
633 |
+
|
634 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
635 |
+
msgid "Sticky"
|
636 |
+
msgstr ""
|
637 |
+
|
638 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
639 |
+
msgid "Scheduled"
|
640 |
+
msgstr ""
|
641 |
+
|
642 |
+
#: ../pointers.php:68
|
643 |
+
msgid "Get started"
|
644 |
+
msgstr "Započni"
|
645 |
+
|
646 |
+
#: ../pointers.php:69
|
647 |
+
msgid ""
|
648 |
+
"You've just installed Content Aware Sidebars!\n"
|
649 |
+
"\n"
|
650 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
651 |
+
"\n"
|
652 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
653 |
+
msgstr "Upravo ste instalirali sadržajno svjesne bočne trake!\n\nOne vam daju puno opcija pa vam ovaj prikaz možda izgleda komplicirano na prvu. Ne brinite.\n\nKliknite početni obilazak kako bi na brzinu pogledali uvod i naučili kako prikazati bočnu traku točno tamo gdje je i želite."
|
654 |
+
|
655 |
+
#: ../pointers.php:76
|
656 |
+
msgid "Start Tour"
|
657 |
+
msgstr "Početni obilazak"
|
658 |
+
|
659 |
+
#: ../pointers.php:78
|
660 |
+
msgid "Not now"
|
661 |
+
msgstr "Ne sada"
|
662 |
+
|
663 |
+
#: ../pointers.php:83
|
664 |
+
msgid ""
|
665 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
666 |
+
"\n"
|
667 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
668 |
+
"\n"
|
669 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
670 |
+
msgstr "Kako bi bočne trake učinili kontekstualnima, krenite stvaranjem nove uvjetne grupe.\n\nUvjetne grupe su izolirane jedna od druge, što znači da bočna traka može imati vrlo različite uvjete.\n\nNegiranje grupe znači da će bočna traka biti prikazana ali bez tih uvjeta."
|
671 |
+
|
672 |
+
#: ../pointers.php:92
|
673 |
+
msgid "Content and contexts"
|
674 |
+
msgstr "Sadržaj i konteksti"
|
675 |
+
|
676 |
+
#: ../pointers.php:93
|
677 |
+
msgid ""
|
678 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
679 |
+
"\n"
|
680 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
681 |
+
"\n"
|
682 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
683 |
+
msgstr "Ovdje možete naći cjelokupni sadržaj na vašem mjestu koji sadržajno svjesne bočne trake podržavaju bez ikakve prilagodbe.\n\nJednostavno odaberite sadržaj koji želite prikazati na bočnoj traci i pridodajte ga grupi.\n\nMožete čak i kombinirati povezani sadržaj u jednu grupu; pokušajte odabrati \"Sve objave\", kategoriju i autora. Izvrsno!"
|
684 |
+
|
685 |
+
#: ../pointers.php:102
|
686 |
+
msgid "Options, options"
|
687 |
+
msgstr "Opcije, opcije"
|
688 |
+
|
689 |
+
#: ../pointers.php:103
|
690 |
+
msgid ""
|
691 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
692 |
+
"\n"
|
693 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
694 |
+
"\n"
|
695 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
696 |
+
"\n"
|
697 |
+
" You are in control."
|
698 |
+
msgstr "Da li bočne trake treba prikazati na pojedinim stranicama i/ili arhivama?\n\nTreba li ih spojiti sa drugim postojećim bočnim trakama ili ih zamijeniti? Možda ih želite ubaciti ručno u svoj sadržaj putem kratkog koda.\n\nRasporedite bočne trake kao što radite sa objavama i stranicama ili ih učinite privatnima kako bi bile vidljive samo prijavljenim korisnicima.\n\n Vi imate kontolu."
|
699 |
+
|
700 |
+
#: ../pointers.php:112
|
701 |
+
msgid "Help and Support"
|
702 |
+
msgstr "Pomoć i podrška"
|
703 |
+
|
704 |
+
#: ../pointers.php:113
|
705 |
+
msgid ""
|
706 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
707 |
+
"\n"
|
708 |
+
"If you need more help, click on the \"Help\" tab here."
|
709 |
+
msgstr "To je to! Sada možete početi kreirati bočne trake i prikazati ih po svojim uvjetima.\n\nUkoliko trebate opsežniju pomoč, kliknite na \"Pomoć\" tabulator ovdje."
|
710 |
+
|
711 |
+
#: ../pointers.php:142
|
712 |
+
msgid "Close"
|
713 |
+
msgstr "Zatvori"
|
714 |
+
|
715 |
+
#: ../pointers.php:143
|
716 |
+
msgid "Next"
|
717 |
+
msgstr "Slijedeće"
|
lang/content-aware-sidebars-hu_HU.po
CHANGED
@@ -1,711 +1,711 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Neftigon <kislukacs@gmail.com>, 2014-2016
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:41+0000\n"
|
11 |
-
"Last-Translator: Neftigon <kislukacs@gmail.com>\n"
|
12 |
-
"Language-Team: Hungarian (Hungary) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/hu_HU/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: hu_HU\n"
|
17 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr "Az oldalsávok kezelése és megjelenítése a tartalomnak megfelelően."
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr "Tartalomfüggő oldalsáv"
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "Importálás"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "GYIK"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr "Expozíció"
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr "Egyes szám"
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr "Egyes szám & archívum"
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Archívum"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr "Művelet"
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Helyettesítés"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Egyesítés"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Manuális"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Kötelező csere"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr "Eredeti oldalsáv helyettesítése, egyesítés vele vagy oldalsáv hozzáadása manuálisan."
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr "Eredeti oldalsáv"
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr "Pozíció összevonása"
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Fent"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Lent"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr "Az oldalsáv elhelyezése a eredeti oldalsáv fölött vagy alatt egyesítéskor."
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Oldalsávok"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Oldalsáv"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Új hozzáadása"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Új oldalsáv hozzáadása"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Oldalsáv szerkesztése"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Új oldalsáv"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Összes oldalsáv"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Oldalsáv megtekintése"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Oldalsáv keresése"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr "Oldalsáv nem található"
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr "Oldalsáv nem található a kukában"
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr "Oldalsáv megjelenítése ezzel"
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr "Nincs tartalom. Kérjük, adjon hozzá legalább egy feltétel csoportot, hogy az oldalsáv tartalomfüggő legyen. "
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr "Widgetek kezelése"
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr "Oldalsáv frissítve."
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr "Oldalsáv közzétéve."
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr "Oldalsáv mentve."
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr "Oldalsáv létrehozva."
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr "Oldalsáv időzítve: <strong>%1$s</strong>."
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr "M j, Y @ G:i"
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr "Oldalsáv vázlat frissítve."
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] "%s oldalsáv frissítve."
|
199 |
-
msgstr[1] "%s oldalsávok frissítve."
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] "%s oldalsáv nincs frissítve, valaki épp szerkeszti."
|
206 |
-
msgstr[1] "%s oldalsávok nincsenek frissítve, valaki épp szerkeszti."
|
207 |
-
|
208 |
-
#: ../content-aware-sidebars.php:385
|
209 |
-
#, php-format
|
210 |
-
msgid "%s sidebar permanently deleted."
|
211 |
-
msgid_plural "%s sidebars permanently deleted."
|
212 |
-
msgstr[0] "%s oldalsáv véglegesen törölve."
|
213 |
-
msgstr[1] "%s oldalsávok véglegesen törölve."
|
214 |
-
|
215 |
-
#: ../content-aware-sidebars.php:386
|
216 |
-
#, php-format
|
217 |
-
msgid "%s sidebar moved to the Trash."
|
218 |
-
msgid_plural "%s sidebars moved to the Trash."
|
219 |
-
msgstr[0] "%s oldalsáv áthelyezve a Kukába."
|
220 |
-
msgstr[1] "%s oldalsávok áthelyezve a Kukába."
|
221 |
-
|
222 |
-
#: ../content-aware-sidebars.php:387
|
223 |
-
#, php-format
|
224 |
-
msgid "%s sidebar restored from the Trash."
|
225 |
-
msgid_plural "%s sidebars restored from the Trash."
|
226 |
-
msgstr[0] "%s oldalsáv visszaállítva a Kukából."
|
227 |
-
msgstr[1] "%s oldalsávok visszaállítva a Kukából."
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
-
msgid "Please update Host Sidebar"
|
231 |
-
msgstr "Kérjük, frissítse az eredeti oldalsávot"
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:472
|
234 |
-
msgid "Merge position"
|
235 |
-
msgstr "Egyesítés helye"
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:473
|
238 |
-
msgid "Widgets"
|
239 |
-
msgstr "Widgetek"
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:586
|
242 |
-
msgid "Manage Widgets"
|
243 |
-
msgstr "Widgetek kezelése"
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:756
|
246 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
-
msgstr "Ingyenes Tartalomfüggő oldalsáv prémium csomag beszerzése"
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:772
|
250 |
-
msgid "Options"
|
251 |
-
msgstr "Beállítások"
|
252 |
-
|
253 |
-
#: ../content-aware-sidebars.php:795
|
254 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
-
msgid "Condition Groups"
|
257 |
-
msgstr "Feltétel csoportok"
|
258 |
-
|
259 |
-
#: ../content-aware-sidebars.php:796
|
260 |
-
msgid ""
|
261 |
-
"Each created condition group describe some specific content (conditions) "
|
262 |
-
"that the current sidebar should be displayed with."
|
263 |
-
msgstr "Minden létrehozott csoport egy bizonyos tartalomfajtát (feltételt) jelöl, ami mellett az oldalsáv meg fog jelenni."
|
264 |
-
|
265 |
-
#: ../content-aware-sidebars.php:797
|
266 |
-
msgid ""
|
267 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
-
" groups themselves use logical disjunction. This means that content added to"
|
269 |
-
" a group should be associated, as they are treated as such, and that the "
|
270 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
-
"extremely focused and at the same time distinct conditions."
|
272 |
-
msgstr "Tartalom hozzáadva a csoporthoz logikai konjunkció alapján, míg a csoportok egymással logikai diszjunkcióban vannak. A csoporthoz adott tartalmat társítani kell, együtt kell kezelni őket, és a csoportok között nem lehet átfedés. Így elérhető, hogy minden célzottan jelenjen meg a megfelelő helyen és körülmények között."
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:800
|
275 |
-
msgid "More Information"
|
276 |
-
msgstr "További információk"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
-
msgid "Get Support"
|
280 |
-
msgstr "Segítség kérése"
|
281 |
-
|
282 |
-
#: ../content-aware-sidebars.php:816
|
283 |
-
msgid ""
|
284 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
-
" of the upcoming Premium Bundle*!"
|
286 |
-
msgstr "Fordítsa le a Tartalomfüggő oldalsávot a saját nyelvére, és legyen béta tesztelője a prémium csomagoknak*!"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:817
|
289 |
-
msgid "Translate Now"
|
290 |
-
msgstr "Lefordítom most"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:818
|
293 |
-
msgid "Get Premium Bundle"
|
294 |
-
msgstr "Prémium csomag beszerzése"
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:819
|
297 |
-
msgid ""
|
298 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
-
msgstr "Egy honlapos használat. A béta változatot nem javasolt éles honlapon használni."
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:822
|
302 |
-
msgid "Partial Feature List"
|
303 |
-
msgstr "Részleges funkció lista"
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:824
|
306 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
-
msgstr "Oldalsáv kiválasztása és létrehozása a bejegyzés szerkesztése nézetben"
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:825
|
310 |
-
msgid "Display sidebars with URLs using wildcards"
|
311 |
-
msgstr "OIdalsávok megjelenítése URL-ekkel, helyettesítő karakterrel"
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:826
|
314 |
-
msgid "Display sidebars with User Roles"
|
315 |
-
msgstr "Oldalsávok megjelenítése felhasználói szerepkörökkel"
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:827
|
318 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
-
msgstr "Oldalsávok megjelenítése BuddyPress felhasználói csoportokkal"
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:828
|
322 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
-
msgstr "Oldalsáv oszlop a bejegyzés típusánál és a taxonómiák nézetben"
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
-
msgid "Order"
|
327 |
-
msgstr "Sorrend"
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:880
|
330 |
-
msgid "Give a review on WordPress.org"
|
331 |
-
msgstr "Írj értékelés a WordPress.org-on"
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
-
msgid "Translate the plugin into your language"
|
335 |
-
msgstr "Plugin lefordítása a saját nyelvre"
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:884
|
338 |
-
msgid "Read the FAQ"
|
339 |
-
msgstr "Olvasd el a GYIK-et"
|
340 |
-
|
341 |
-
#: ../content-aware-sidebars.php:899
|
342 |
-
msgid ""
|
343 |
-
"If you love this plugin, please consider donating to support future "
|
344 |
-
"development."
|
345 |
-
msgstr "Ha tetszik ez a plugin, kérjük támogassa, hogy folytathassuk a fejlesztését."
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:908
|
348 |
-
msgid "Or you could:"
|
349 |
-
msgstr "Vagy esetleg:"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:910
|
352 |
-
msgid "Rate the plugin on WordPress.org"
|
353 |
-
msgstr "Értékelje a plugint a WordPress.org címen"
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:911
|
356 |
-
msgid "Link to the plugin page"
|
357 |
-
msgstr "Link a plugin oldalra"
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1045
|
360 |
-
msgid "Filter Sidebars"
|
361 |
-
msgstr "Oldalsáv filter"
|
362 |
-
|
363 |
-
#: ../content-aware-sidebars.php:1046
|
364 |
-
msgid "Filter Widgets"
|
365 |
-
msgstr "Widgetek szűrése"
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
-
msgid "Condition Group"
|
369 |
-
msgstr "Feltétel csoport"
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
-
msgctxt "group"
|
373 |
-
msgid "Add New"
|
374 |
-
msgstr "Új hozzáadása"
|
375 |
-
|
376 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
-
msgid "Add New Group"
|
380 |
-
msgstr "Új csoport hozzáadása"
|
381 |
-
|
382 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
-
msgctxt "group"
|
386 |
-
msgid "Edit"
|
387 |
-
msgstr "Szerkesztés"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
-
msgid "No Groups found"
|
392 |
-
msgstr "Csoportok nem találhatóak"
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
-
msgctxt "condition group"
|
396 |
-
msgid "Negated"
|
397 |
-
msgstr "Negált"
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
-
msgid "Content"
|
401 |
-
msgstr "Tartalom"
|
402 |
-
|
403 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
-
msgid "Unauthorized request"
|
407 |
-
msgstr "Jogosulatlan kérés"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
-
msgid "Condition group cannot be empty"
|
411 |
-
msgstr "Feltétel csoportot nem leht létrehozni"
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
-
msgid "Condition group saved"
|
415 |
-
msgstr "Feltétel csoport mentve"
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
-
msgid "Condition group could not be removed"
|
419 |
-
msgstr "Feltétel csoportot nem lehet törölni"
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
-
msgid "Condition group removed"
|
423 |
-
msgstr "Feltétel csoport törölve"
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Save"
|
428 |
-
msgstr "Mentés"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
-
msgid "Cancel"
|
433 |
-
msgstr "Mégse"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
-
msgid "Or"
|
438 |
-
msgstr "vagy"
|
439 |
-
|
440 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
-
msgid "And"
|
445 |
-
msgstr "és"
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
-
msgid "Remove"
|
450 |
-
msgstr "Eltávolítás"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
-
msgid "Remove this group and its contents permanently?"
|
454 |
-
msgstr "Csoport és tartalmának eltávolítása véglegesen?"
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
-
msgid "No results found."
|
458 |
-
msgstr "Nincs találat."
|
459 |
-
|
460 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
-
msgid ""
|
462 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
-
"these changes?"
|
464 |
-
msgstr "A csoportban vannak nem mentett módosítások. Valóban szeretné elvetni a módosításokat és szeretne továbblépni?"
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
-
msgid "Negate group"
|
469 |
-
msgstr "Csoport negálása"
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target all but this context"
|
474 |
-
msgstr "Összes célzása ebben az összefüggésben"
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
-
msgid "Target this context"
|
479 |
-
msgstr "Következő célzása"
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
-
msgid "Authors"
|
483 |
-
msgstr "Szerzők"
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
-
#, php-format
|
487 |
-
msgid "Display with All %s"
|
488 |
-
msgstr "Megjelenítés az összes %s-val/vel"
|
489 |
-
|
490 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
-
msgid "View All"
|
495 |
-
msgstr "Összes megtekintése"
|
496 |
-
|
497 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
-
msgid "Search"
|
504 |
-
msgstr "Keresés"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
-
msgid "bbPress User Profiles"
|
508 |
-
msgstr "bbPress felhasználói fiókok"
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
-
msgid "BuddyPress Members"
|
512 |
-
msgstr "BuddyPress felhasználók"
|
513 |
-
|
514 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
-
msgid "Add to Group"
|
518 |
-
msgstr "Hozzáadás a csoporthoz"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
-
msgid "Dates"
|
522 |
-
msgstr "Dátum"
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
-
msgid "Date Archives"
|
526 |
-
msgstr "Dátum archívum"
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
-
msgid "Page Templates"
|
530 |
-
msgstr "Oldal sablonok"
|
531 |
-
|
532 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
-
msgid "Languages"
|
537 |
-
msgstr "Nyelvek"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
-
msgid "Post Types"
|
541 |
-
msgstr "Bejegyzés típusok"
|
542 |
-
|
543 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
-
msgid "Automatically select new children of a selected ancestor"
|
547 |
-
msgstr "Automatikus utód kiválasztása az ős alapján."
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
-
msgid "Automatically add new children of a selected ancestor"
|
551 |
-
msgstr "Automatikus utód hozzáadása a kiválasztott őshöz"
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
-
#, php-format
|
555 |
-
msgid "%s Archives"
|
556 |
-
msgstr "%s archívuma"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
-
msgid "Blog Page"
|
560 |
-
msgstr "Blog oldal"
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
-
msgid "No items."
|
565 |
-
msgstr "Nincs elem."
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
-
msgid "Most Recent"
|
569 |
-
msgstr "Legújabb"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
-
msgid "Static Pages"
|
573 |
-
msgstr "Statikus oldal"
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
-
msgid "Front Page"
|
577 |
-
msgstr "Kezdőlap"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
-
msgid "Search Results"
|
581 |
-
msgstr "Keresési találatok"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
-
msgid "404 Page"
|
585 |
-
msgstr "404-es oldal"
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
-
msgid "Taxonomies"
|
589 |
-
msgstr "Taxonómiák"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
-
msgid "Most Used"
|
593 |
-
msgstr "Leggyakrabban használt"
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
-
msgid "Conditional Content"
|
597 |
-
msgstr "Feltételfüggő tartalom"
|
598 |
-
|
599 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
-
msgid ""
|
601 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
-
" it. In each group, you can combine different types of associated content."
|
603 |
-
msgstr "Kattintson ide a csoportok szerkesztéséhez, vagy új létrehozásához. A tartalmat válassza ki a bal oldalon. Minden csoportban külön tudja kezelni a tartalomhoz megfelelő típusokat."
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
-
#, php-format
|
607 |
-
msgid "All %s"
|
608 |
-
msgstr "Összes %s"
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
-
msgid "Password protected"
|
612 |
-
msgstr "Jelszóval védett"
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
-
msgid "Private"
|
616 |
-
msgstr "Privát"
|
617 |
-
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
-
msgid "Draft"
|
620 |
-
msgstr "Piszkozat"
|
621 |
-
|
622 |
-
#. translators: post state
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
-
msgctxt "post state"
|
625 |
-
msgid "Pending"
|
626 |
-
msgstr "Függőben"
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
-
msgid "Sticky"
|
630 |
-
msgstr "Ragadós"
|
631 |
-
|
632 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
-
msgid "Scheduled"
|
634 |
-
msgstr "Időzített"
|
635 |
-
|
636 |
-
#: ../pointers.php:68
|
637 |
-
msgid "Get started"
|
638 |
-
msgstr "Kezdjünk hozzá"
|
639 |
-
|
640 |
-
#: ../pointers.php:69
|
641 |
-
msgid ""
|
642 |
-
"You've just installed Content Aware Sidebars!\n"
|
643 |
-
"\n"
|
644 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
-
"\n"
|
646 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
-
msgstr "Épp most telepítette a Tartalomfüggő oldalsávot!\n\nTöbb féle beállítási módot ad, ami elsőre túl soknak tűnet. Ne aggódjon.\n\nKattintson a Túra indítása gombra egy rövid segédanyag megjelenítéséhez, hogy megtanulja mi hol van, mi mire való."
|
648 |
-
|
649 |
-
#: ../pointers.php:76
|
650 |
-
msgid "Start Tour"
|
651 |
-
msgstr "Túra indítása"
|
652 |
-
|
653 |
-
#: ../pointers.php:78
|
654 |
-
msgid "Not now"
|
655 |
-
msgstr "Később"
|
656 |
-
|
657 |
-
#: ../pointers.php:83
|
658 |
-
msgid ""
|
659 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
-
"\n"
|
661 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
-
"\n"
|
663 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
-
msgstr ""
|
665 |
-
|
666 |
-
#: ../pointers.php:92
|
667 |
-
msgid "Content and contexts"
|
668 |
-
msgstr "Tartalom és feltételek"
|
669 |
-
|
670 |
-
#: ../pointers.php:93
|
671 |
-
msgid ""
|
672 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
-
"\n"
|
674 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
-
"\n"
|
676 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
-
msgstr ""
|
678 |
-
|
679 |
-
#: ../pointers.php:102
|
680 |
-
msgid "Options, options"
|
681 |
-
msgstr "Beállítások, beállítások"
|
682 |
-
|
683 |
-
#: ../pointers.php:103
|
684 |
-
msgid ""
|
685 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
-
"\n"
|
687 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
-
"\n"
|
689 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
-
"\n"
|
691 |
-
" You are in control."
|
692 |
-
msgstr ""
|
693 |
-
|
694 |
-
#: ../pointers.php:112
|
695 |
-
msgid "Help and Support"
|
696 |
-
msgstr "Segítség és támogatás"
|
697 |
-
|
698 |
-
#: ../pointers.php:113
|
699 |
-
msgid ""
|
700 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
-
"\n"
|
702 |
-
"If you need more help, click on the \"Help\" tab here."
|
703 |
-
msgstr "Ez minden! Most már elkezdheti létrehozni az oldalsávokat a saját feltételek alapján.\n\nHa további segítségre van szüksége, kattintson a \"Segítség\" fülre."
|
704 |
-
|
705 |
-
#: ../pointers.php:142
|
706 |
-
msgid "Close"
|
707 |
-
msgstr "Bezár"
|
708 |
-
|
709 |
-
#: ../pointers.php:143
|
710 |
-
msgid "Next"
|
711 |
-
msgstr "Következő"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Neftigon <kislukacs@gmail.com>, 2014-2016
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:41+0000\n"
|
11 |
+
"Last-Translator: Neftigon <kislukacs@gmail.com>\n"
|
12 |
+
"Language-Team: Hungarian (Hungary) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/hu_HU/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: hu_HU\n"
|
17 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr "Az oldalsávok kezelése és megjelenítése a tartalomnak megfelelően."
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr "Tartalomfüggő oldalsáv"
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "Importálás"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "GYIK"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr "Expozíció"
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr "Egyes szám"
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr "Egyes szám & archívum"
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Archívum"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr "Művelet"
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Helyettesítés"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Egyesítés"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Manuális"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Kötelező csere"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr "Eredeti oldalsáv helyettesítése, egyesítés vele vagy oldalsáv hozzáadása manuálisan."
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr "Eredeti oldalsáv"
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr "Pozíció összevonása"
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Fent"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Lent"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr "Az oldalsáv elhelyezése a eredeti oldalsáv fölött vagy alatt egyesítéskor."
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Oldalsávok"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Oldalsáv"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Új hozzáadása"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Új oldalsáv hozzáadása"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Oldalsáv szerkesztése"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Új oldalsáv"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Összes oldalsáv"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Oldalsáv megtekintése"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Oldalsáv keresése"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr "Oldalsáv nem található"
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr "Oldalsáv nem található a kukában"
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr "Oldalsáv megjelenítése ezzel"
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr "Nincs tartalom. Kérjük, adjon hozzá legalább egy feltétel csoportot, hogy az oldalsáv tartalomfüggő legyen. "
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr "Widgetek kezelése"
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr "Oldalsáv frissítve."
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr "Oldalsáv közzétéve."
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr "Oldalsáv mentve."
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr "Oldalsáv létrehozva."
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr "Oldalsáv időzítve: <strong>%1$s</strong>."
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr "M j, Y @ G:i"
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr "Oldalsáv vázlat frissítve."
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] "%s oldalsáv frissítve."
|
199 |
+
msgstr[1] "%s oldalsávok frissítve."
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] "%s oldalsáv nincs frissítve, valaki épp szerkeszti."
|
206 |
+
msgstr[1] "%s oldalsávok nincsenek frissítve, valaki épp szerkeszti."
|
207 |
+
|
208 |
+
#: ../content-aware-sidebars.php:385
|
209 |
+
#, php-format
|
210 |
+
msgid "%s sidebar permanently deleted."
|
211 |
+
msgid_plural "%s sidebars permanently deleted."
|
212 |
+
msgstr[0] "%s oldalsáv véglegesen törölve."
|
213 |
+
msgstr[1] "%s oldalsávok véglegesen törölve."
|
214 |
+
|
215 |
+
#: ../content-aware-sidebars.php:386
|
216 |
+
#, php-format
|
217 |
+
msgid "%s sidebar moved to the Trash."
|
218 |
+
msgid_plural "%s sidebars moved to the Trash."
|
219 |
+
msgstr[0] "%s oldalsáv áthelyezve a Kukába."
|
220 |
+
msgstr[1] "%s oldalsávok áthelyezve a Kukába."
|
221 |
+
|
222 |
+
#: ../content-aware-sidebars.php:387
|
223 |
+
#, php-format
|
224 |
+
msgid "%s sidebar restored from the Trash."
|
225 |
+
msgid_plural "%s sidebars restored from the Trash."
|
226 |
+
msgstr[0] "%s oldalsáv visszaállítva a Kukából."
|
227 |
+
msgstr[1] "%s oldalsávok visszaállítva a Kukából."
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
230 |
+
msgid "Please update Host Sidebar"
|
231 |
+
msgstr "Kérjük, frissítse az eredeti oldalsávot"
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:472
|
234 |
+
msgid "Merge position"
|
235 |
+
msgstr "Egyesítés helye"
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:473
|
238 |
+
msgid "Widgets"
|
239 |
+
msgstr "Widgetek"
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:586
|
242 |
+
msgid "Manage Widgets"
|
243 |
+
msgstr "Widgetek kezelése"
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:756
|
246 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
247 |
+
msgstr "Ingyenes Tartalomfüggő oldalsáv prémium csomag beszerzése"
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:772
|
250 |
+
msgid "Options"
|
251 |
+
msgstr "Beállítások"
|
252 |
+
|
253 |
+
#: ../content-aware-sidebars.php:795
|
254 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
255 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
256 |
+
msgid "Condition Groups"
|
257 |
+
msgstr "Feltétel csoportok"
|
258 |
+
|
259 |
+
#: ../content-aware-sidebars.php:796
|
260 |
+
msgid ""
|
261 |
+
"Each created condition group describe some specific content (conditions) "
|
262 |
+
"that the current sidebar should be displayed with."
|
263 |
+
msgstr "Minden létrehozott csoport egy bizonyos tartalomfajtát (feltételt) jelöl, ami mellett az oldalsáv meg fog jelenni."
|
264 |
+
|
265 |
+
#: ../content-aware-sidebars.php:797
|
266 |
+
msgid ""
|
267 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
268 |
+
" groups themselves use logical disjunction. This means that content added to"
|
269 |
+
" a group should be associated, as they are treated as such, and that the "
|
270 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
271 |
+
"extremely focused and at the same time distinct conditions."
|
272 |
+
msgstr "Tartalom hozzáadva a csoporthoz logikai konjunkció alapján, míg a csoportok egymással logikai diszjunkcióban vannak. A csoporthoz adott tartalmat társítani kell, együtt kell kezelni őket, és a csoportok között nem lehet átfedés. Így elérhető, hogy minden célzottan jelenjen meg a megfelelő helyen és körülmények között."
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:800
|
275 |
+
msgid "More Information"
|
276 |
+
msgstr "További információk"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
279 |
+
msgid "Get Support"
|
280 |
+
msgstr "Segítség kérése"
|
281 |
+
|
282 |
+
#: ../content-aware-sidebars.php:816
|
283 |
+
msgid ""
|
284 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
285 |
+
" of the upcoming Premium Bundle*!"
|
286 |
+
msgstr "Fordítsa le a Tartalomfüggő oldalsávot a saját nyelvére, és legyen béta tesztelője a prémium csomagoknak*!"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:817
|
289 |
+
msgid "Translate Now"
|
290 |
+
msgstr "Lefordítom most"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:818
|
293 |
+
msgid "Get Premium Bundle"
|
294 |
+
msgstr "Prémium csomag beszerzése"
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:819
|
297 |
+
msgid ""
|
298 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
299 |
+
msgstr "Egy honlapos használat. A béta változatot nem javasolt éles honlapon használni."
|
300 |
+
|
301 |
+
#: ../content-aware-sidebars.php:822
|
302 |
+
msgid "Partial Feature List"
|
303 |
+
msgstr "Részleges funkció lista"
|
304 |
+
|
305 |
+
#: ../content-aware-sidebars.php:824
|
306 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
307 |
+
msgstr "Oldalsáv kiválasztása és létrehozása a bejegyzés szerkesztése nézetben"
|
308 |
+
|
309 |
+
#: ../content-aware-sidebars.php:825
|
310 |
+
msgid "Display sidebars with URLs using wildcards"
|
311 |
+
msgstr "OIdalsávok megjelenítése URL-ekkel, helyettesítő karakterrel"
|
312 |
+
|
313 |
+
#: ../content-aware-sidebars.php:826
|
314 |
+
msgid "Display sidebars with User Roles"
|
315 |
+
msgstr "Oldalsávok megjelenítése felhasználói szerepkörökkel"
|
316 |
+
|
317 |
+
#: ../content-aware-sidebars.php:827
|
318 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
319 |
+
msgstr "Oldalsávok megjelenítése BuddyPress felhasználói csoportokkal"
|
320 |
+
|
321 |
+
#: ../content-aware-sidebars.php:828
|
322 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
323 |
+
msgstr "Oldalsáv oszlop a bejegyzés típusánál és a taxonómiák nézetben"
|
324 |
+
|
325 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
326 |
+
msgid "Order"
|
327 |
+
msgstr "Sorrend"
|
328 |
+
|
329 |
+
#: ../content-aware-sidebars.php:880
|
330 |
+
msgid "Give a review on WordPress.org"
|
331 |
+
msgstr "Írj értékelés a WordPress.org-on"
|
332 |
+
|
333 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
334 |
+
msgid "Translate the plugin into your language"
|
335 |
+
msgstr "Plugin lefordítása a saját nyelvre"
|
336 |
+
|
337 |
+
#: ../content-aware-sidebars.php:884
|
338 |
+
msgid "Read the FAQ"
|
339 |
+
msgstr "Olvasd el a GYIK-et"
|
340 |
+
|
341 |
+
#: ../content-aware-sidebars.php:899
|
342 |
+
msgid ""
|
343 |
+
"If you love this plugin, please consider donating to support future "
|
344 |
+
"development."
|
345 |
+
msgstr "Ha tetszik ez a plugin, kérjük támogassa, hogy folytathassuk a fejlesztését."
|
346 |
+
|
347 |
+
#: ../content-aware-sidebars.php:908
|
348 |
+
msgid "Or you could:"
|
349 |
+
msgstr "Vagy esetleg:"
|
350 |
+
|
351 |
+
#: ../content-aware-sidebars.php:910
|
352 |
+
msgid "Rate the plugin on WordPress.org"
|
353 |
+
msgstr "Értékelje a plugint a WordPress.org címen"
|
354 |
+
|
355 |
+
#: ../content-aware-sidebars.php:911
|
356 |
+
msgid "Link to the plugin page"
|
357 |
+
msgstr "Link a plugin oldalra"
|
358 |
+
|
359 |
+
#: ../content-aware-sidebars.php:1045
|
360 |
+
msgid "Filter Sidebars"
|
361 |
+
msgstr "Oldalsáv filter"
|
362 |
+
|
363 |
+
#: ../content-aware-sidebars.php:1046
|
364 |
+
msgid "Filter Widgets"
|
365 |
+
msgstr "Widgetek szűrése"
|
366 |
+
|
367 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
368 |
+
msgid "Condition Group"
|
369 |
+
msgstr "Feltétel csoport"
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
372 |
+
msgctxt "group"
|
373 |
+
msgid "Add New"
|
374 |
+
msgstr "Új hozzáadása"
|
375 |
+
|
376 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
377 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
379 |
+
msgid "Add New Group"
|
380 |
+
msgstr "Új csoport hozzáadása"
|
381 |
+
|
382 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
384 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
385 |
+
msgctxt "group"
|
386 |
+
msgid "Edit"
|
387 |
+
msgstr "Szerkesztés"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
391 |
+
msgid "No Groups found"
|
392 |
+
msgstr "Csoportok nem találhatóak"
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
395 |
+
msgctxt "condition group"
|
396 |
+
msgid "Negated"
|
397 |
+
msgstr "Negált"
|
398 |
+
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
400 |
+
msgid "Content"
|
401 |
+
msgstr "Tartalom"
|
402 |
+
|
403 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
406 |
+
msgid "Unauthorized request"
|
407 |
+
msgstr "Jogosulatlan kérés"
|
408 |
+
|
409 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
410 |
+
msgid "Condition group cannot be empty"
|
411 |
+
msgstr "Feltétel csoportot nem leht létrehozni"
|
412 |
+
|
413 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
414 |
+
msgid "Condition group saved"
|
415 |
+
msgstr "Feltétel csoport mentve"
|
416 |
+
|
417 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
418 |
+
msgid "Condition group could not be removed"
|
419 |
+
msgstr "Feltétel csoportot nem lehet törölni"
|
420 |
+
|
421 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
422 |
+
msgid "Condition group removed"
|
423 |
+
msgstr "Feltétel csoport törölve"
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Save"
|
428 |
+
msgstr "Mentés"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
432 |
+
msgid "Cancel"
|
433 |
+
msgstr "Mégse"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
436 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
437 |
+
msgid "Or"
|
438 |
+
msgstr "vagy"
|
439 |
+
|
440 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
441 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
442 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
443 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
444 |
+
msgid "And"
|
445 |
+
msgstr "és"
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
448 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
449 |
+
msgid "Remove"
|
450 |
+
msgstr "Eltávolítás"
|
451 |
+
|
452 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
453 |
+
msgid "Remove this group and its contents permanently?"
|
454 |
+
msgstr "Csoport és tartalmának eltávolítása véglegesen?"
|
455 |
+
|
456 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
457 |
+
msgid "No results found."
|
458 |
+
msgstr "Nincs találat."
|
459 |
+
|
460 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
461 |
+
msgid ""
|
462 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
463 |
+
"these changes?"
|
464 |
+
msgstr "A csoportban vannak nem mentett módosítások. Valóban szeretné elvetni a módosításokat és szeretne továbblépni?"
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
468 |
+
msgid "Negate group"
|
469 |
+
msgstr "Csoport negálása"
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target all but this context"
|
474 |
+
msgstr "Összes célzása ebben az összefüggésben"
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
477 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
478 |
+
msgid "Target this context"
|
479 |
+
msgstr "Következő célzása"
|
480 |
+
|
481 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
482 |
+
msgid "Authors"
|
483 |
+
msgstr "Szerzők"
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
486 |
+
#, php-format
|
487 |
+
msgid "Display with All %s"
|
488 |
+
msgstr "Megjelenítés az összes %s-val/vel"
|
489 |
+
|
490 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
491 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
492 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
493 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
494 |
+
msgid "View All"
|
495 |
+
msgstr "Összes megtekintése"
|
496 |
+
|
497 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
499 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
501 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
503 |
+
msgid "Search"
|
504 |
+
msgstr "Keresés"
|
505 |
+
|
506 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
507 |
+
msgid "bbPress User Profiles"
|
508 |
+
msgstr "bbPress felhasználói fiókok"
|
509 |
+
|
510 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
511 |
+
msgid "BuddyPress Members"
|
512 |
+
msgstr "BuddyPress felhasználók"
|
513 |
+
|
514 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
515 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
516 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
517 |
+
msgid "Add to Group"
|
518 |
+
msgstr "Hozzáadás a csoporthoz"
|
519 |
+
|
520 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
521 |
+
msgid "Dates"
|
522 |
+
msgstr "Dátum"
|
523 |
+
|
524 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
525 |
+
msgid "Date Archives"
|
526 |
+
msgstr "Dátum archívum"
|
527 |
+
|
528 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
529 |
+
msgid "Page Templates"
|
530 |
+
msgstr "Oldal sablonok"
|
531 |
+
|
532 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
533 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
536 |
+
msgid "Languages"
|
537 |
+
msgstr "Nyelvek"
|
538 |
+
|
539 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
540 |
+
msgid "Post Types"
|
541 |
+
msgstr "Bejegyzés típusok"
|
542 |
+
|
543 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
544 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
546 |
+
msgid "Automatically select new children of a selected ancestor"
|
547 |
+
msgstr "Automatikus utód kiválasztása az ős alapján."
|
548 |
+
|
549 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
550 |
+
msgid "Automatically add new children of a selected ancestor"
|
551 |
+
msgstr "Automatikus utód hozzáadása a kiválasztott őshöz"
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
554 |
+
#, php-format
|
555 |
+
msgid "%s Archives"
|
556 |
+
msgstr "%s archívuma"
|
557 |
+
|
558 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
559 |
+
msgid "Blog Page"
|
560 |
+
msgstr "Blog oldal"
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
563 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
564 |
+
msgid "No items."
|
565 |
+
msgstr "Nincs elem."
|
566 |
+
|
567 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
568 |
+
msgid "Most Recent"
|
569 |
+
msgstr "Legújabb"
|
570 |
+
|
571 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
572 |
+
msgid "Static Pages"
|
573 |
+
msgstr "Statikus oldal"
|
574 |
+
|
575 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
576 |
+
msgid "Front Page"
|
577 |
+
msgstr "Kezdőlap"
|
578 |
+
|
579 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
580 |
+
msgid "Search Results"
|
581 |
+
msgstr "Keresési találatok"
|
582 |
+
|
583 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
584 |
+
msgid "404 Page"
|
585 |
+
msgstr "404-es oldal"
|
586 |
+
|
587 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
588 |
+
msgid "Taxonomies"
|
589 |
+
msgstr "Taxonómiák"
|
590 |
+
|
591 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
592 |
+
msgid "Most Used"
|
593 |
+
msgstr "Leggyakrabban használt"
|
594 |
+
|
595 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
596 |
+
msgid "Conditional Content"
|
597 |
+
msgstr "Feltételfüggő tartalom"
|
598 |
+
|
599 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
600 |
+
msgid ""
|
601 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
602 |
+
" it. In each group, you can combine different types of associated content."
|
603 |
+
msgstr "Kattintson ide a csoportok szerkesztéséhez, vagy új létrehozásához. A tartalmat válassza ki a bal oldalon. Minden csoportban külön tudja kezelni a tartalomhoz megfelelő típusokat."
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
606 |
+
#, php-format
|
607 |
+
msgid "All %s"
|
608 |
+
msgstr "Összes %s"
|
609 |
+
|
610 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
611 |
+
msgid "Password protected"
|
612 |
+
msgstr "Jelszóval védett"
|
613 |
+
|
614 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
615 |
+
msgid "Private"
|
616 |
+
msgstr "Privát"
|
617 |
+
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
619 |
+
msgid "Draft"
|
620 |
+
msgstr "Piszkozat"
|
621 |
+
|
622 |
+
#. translators: post state
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
624 |
+
msgctxt "post state"
|
625 |
+
msgid "Pending"
|
626 |
+
msgstr "Függőben"
|
627 |
+
|
628 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
629 |
+
msgid "Sticky"
|
630 |
+
msgstr "Ragadós"
|
631 |
+
|
632 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
633 |
+
msgid "Scheduled"
|
634 |
+
msgstr "Időzített"
|
635 |
+
|
636 |
+
#: ../pointers.php:68
|
637 |
+
msgid "Get started"
|
638 |
+
msgstr "Kezdjünk hozzá"
|
639 |
+
|
640 |
+
#: ../pointers.php:69
|
641 |
+
msgid ""
|
642 |
+
"You've just installed Content Aware Sidebars!\n"
|
643 |
+
"\n"
|
644 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
645 |
+
"\n"
|
646 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
647 |
+
msgstr "Épp most telepítette a Tartalomfüggő oldalsávot!\n\nTöbb féle beállítási módot ad, ami elsőre túl soknak tűnet. Ne aggódjon.\n\nKattintson a Túra indítása gombra egy rövid segédanyag megjelenítéséhez, hogy megtanulja mi hol van, mi mire való."
|
648 |
+
|
649 |
+
#: ../pointers.php:76
|
650 |
+
msgid "Start Tour"
|
651 |
+
msgstr "Túra indítása"
|
652 |
+
|
653 |
+
#: ../pointers.php:78
|
654 |
+
msgid "Not now"
|
655 |
+
msgstr "Később"
|
656 |
+
|
657 |
+
#: ../pointers.php:83
|
658 |
+
msgid ""
|
659 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
660 |
+
"\n"
|
661 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
662 |
+
"\n"
|
663 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
664 |
+
msgstr ""
|
665 |
+
|
666 |
+
#: ../pointers.php:92
|
667 |
+
msgid "Content and contexts"
|
668 |
+
msgstr "Tartalom és feltételek"
|
669 |
+
|
670 |
+
#: ../pointers.php:93
|
671 |
+
msgid ""
|
672 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
673 |
+
"\n"
|
674 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
675 |
+
"\n"
|
676 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
677 |
+
msgstr ""
|
678 |
+
|
679 |
+
#: ../pointers.php:102
|
680 |
+
msgid "Options, options"
|
681 |
+
msgstr "Beállítások, beállítások"
|
682 |
+
|
683 |
+
#: ../pointers.php:103
|
684 |
+
msgid ""
|
685 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
686 |
+
"\n"
|
687 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
688 |
+
"\n"
|
689 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
690 |
+
"\n"
|
691 |
+
" You are in control."
|
692 |
+
msgstr ""
|
693 |
+
|
694 |
+
#: ../pointers.php:112
|
695 |
+
msgid "Help and Support"
|
696 |
+
msgstr "Segítség és támogatás"
|
697 |
+
|
698 |
+
#: ../pointers.php:113
|
699 |
+
msgid ""
|
700 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
701 |
+
"\n"
|
702 |
+
"If you need more help, click on the \"Help\" tab here."
|
703 |
+
msgstr "Ez minden! Most már elkezdheti létrehozni az oldalsávokat a saját feltételek alapján.\n\nHa további segítségre van szüksége, kattintson a \"Segítség\" fülre."
|
704 |
+
|
705 |
+
#: ../pointers.php:142
|
706 |
+
msgid "Close"
|
707 |
+
msgstr "Bezár"
|
708 |
+
|
709 |
+
#: ../pointers.php:143
|
710 |
+
msgid "Next"
|
711 |
+
msgstr "Következő"
|
lang/content-aware-sidebars-id_ID.po
CHANGED
@@ -1,706 +1,706 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Dhyayi Warapsari <aurodigo@gmail.com>, 2015
|
5 |
-
msgid ""
|
6 |
-
msgstr ""
|
7 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
-
"Language-Team: Indonesian (Indonesia) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/id_ID/)\n"
|
13 |
-
"MIME-Version: 1.0\n"
|
14 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
-
"Content-Transfer-Encoding: 8bit\n"
|
16 |
-
"Language: id_ID\n"
|
17 |
-
"Plural-Forms: nplurals=1; plural=0;\n"
|
18 |
-
"X-Generator: Poedit 1.7.6\n"
|
19 |
-
"X-Poedit-Basepath: .\n"
|
20 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
-
"X-Poedit-SearchPath-0: .\n"
|
22 |
-
"X-Poedit-SearchPath-1: ..\n"
|
23 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
-
"X-Textdomain-Support: yes\n"
|
27 |
-
|
28 |
-
#: ../content-aware-sidebars.php:95
|
29 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
-
msgstr "Atur dan tampilkan sidebar sesuai dengan konten yang sedang dilihat"
|
31 |
-
|
32 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
-
msgid "Content Aware Sidebars"
|
34 |
-
msgstr "Content Aware Sidebars"
|
35 |
-
|
36 |
-
#: ../content-aware-sidebars.php:97
|
37 |
-
msgid "Import"
|
38 |
-
msgstr "Impor"
|
39 |
-
|
40 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
-
msgid "FAQ"
|
42 |
-
msgstr "FAQ"
|
43 |
-
|
44 |
-
#: ../content-aware-sidebars.php:256
|
45 |
-
msgid "Exposure"
|
46 |
-
msgstr ""
|
47 |
-
|
48 |
-
#: ../content-aware-sidebars.php:260
|
49 |
-
msgid "Singular"
|
50 |
-
msgstr ""
|
51 |
-
|
52 |
-
#: ../content-aware-sidebars.php:261
|
53 |
-
msgid "Singular & Archive"
|
54 |
-
msgstr ""
|
55 |
-
|
56 |
-
#: ../content-aware-sidebars.php:262
|
57 |
-
msgid "Archive"
|
58 |
-
msgstr "Arsip"
|
59 |
-
|
60 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
-
msgctxt "option"
|
62 |
-
msgid "Handle"
|
63 |
-
msgstr ""
|
64 |
-
|
65 |
-
#: ../content-aware-sidebars.php:271
|
66 |
-
msgid "Replace"
|
67 |
-
msgstr "Ganti"
|
68 |
-
|
69 |
-
#: ../content-aware-sidebars.php:272
|
70 |
-
msgid "Merge"
|
71 |
-
msgstr "Gabung"
|
72 |
-
|
73 |
-
#: ../content-aware-sidebars.php:273
|
74 |
-
msgid "Manual"
|
75 |
-
msgstr "Manual"
|
76 |
-
|
77 |
-
#: ../content-aware-sidebars.php:274
|
78 |
-
msgid "Forced replace"
|
79 |
-
msgstr "Ganti secara paksa"
|
80 |
-
|
81 |
-
#: ../content-aware-sidebars.php:276
|
82 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
-
msgstr ""
|
84 |
-
|
85 |
-
#: ../content-aware-sidebars.php:280
|
86 |
-
msgid "Host Sidebar"
|
87 |
-
msgstr ""
|
88 |
-
|
89 |
-
#: ../content-aware-sidebars.php:287
|
90 |
-
msgid "Merge Position"
|
91 |
-
msgstr "Gabung Posisi"
|
92 |
-
|
93 |
-
#: ../content-aware-sidebars.php:291
|
94 |
-
msgid "Top"
|
95 |
-
msgstr "Atas"
|
96 |
-
|
97 |
-
#: ../content-aware-sidebars.php:292
|
98 |
-
msgid "Bottom"
|
99 |
-
msgstr "Bawah"
|
100 |
-
|
101 |
-
#: ../content-aware-sidebars.php:294
|
102 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
-
msgstr ""
|
104 |
-
|
105 |
-
#: ../content-aware-sidebars.php:309
|
106 |
-
msgid "Sidebars"
|
107 |
-
msgstr "Sidebar"
|
108 |
-
|
109 |
-
#: ../content-aware-sidebars.php:310
|
110 |
-
msgid "Sidebar"
|
111 |
-
msgstr "Sidebar"
|
112 |
-
|
113 |
-
#: ../content-aware-sidebars.php:311
|
114 |
-
msgctxt "sidebar"
|
115 |
-
msgid "Add New"
|
116 |
-
msgstr "Tambah Baru"
|
117 |
-
|
118 |
-
#: ../content-aware-sidebars.php:312
|
119 |
-
msgid "Add New Sidebar"
|
120 |
-
msgstr "Tambah Sidebar Baru"
|
121 |
-
|
122 |
-
#: ../content-aware-sidebars.php:313
|
123 |
-
msgid "Edit Sidebar"
|
124 |
-
msgstr "Ubah Sidebar"
|
125 |
-
|
126 |
-
#: ../content-aware-sidebars.php:314
|
127 |
-
msgid "New Sidebar"
|
128 |
-
msgstr "Sidebar Baru"
|
129 |
-
|
130 |
-
#: ../content-aware-sidebars.php:315
|
131 |
-
msgid "All Sidebars"
|
132 |
-
msgstr "Semua Sidebar"
|
133 |
-
|
134 |
-
#: ../content-aware-sidebars.php:316
|
135 |
-
msgid "View Sidebar"
|
136 |
-
msgstr "Lihat Sidebar"
|
137 |
-
|
138 |
-
#: ../content-aware-sidebars.php:317
|
139 |
-
msgid "Search Sidebars"
|
140 |
-
msgstr "Cari Sidebar"
|
141 |
-
|
142 |
-
#: ../content-aware-sidebars.php:318
|
143 |
-
msgid "No sidebars found"
|
144 |
-
msgstr "Tidak ada sidebar"
|
145 |
-
|
146 |
-
#: ../content-aware-sidebars.php:319
|
147 |
-
msgid "No sidebars found in Trash"
|
148 |
-
msgstr ""
|
149 |
-
|
150 |
-
#: ../content-aware-sidebars.php:321
|
151 |
-
msgid "Display sidebar with"
|
152 |
-
msgstr "Tampilkan sidebar dengan"
|
153 |
-
|
154 |
-
#: ../content-aware-sidebars.php:322
|
155 |
-
msgid ""
|
156 |
-
"No content. Please add at least one condition group to make the sidebar "
|
157 |
-
"content aware."
|
158 |
-
msgstr ""
|
159 |
-
|
160 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
-
msgid "Manage widgets"
|
162 |
-
msgstr "Atur widget"
|
163 |
-
|
164 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
-
msgid "Sidebar updated."
|
166 |
-
msgstr "Sidebar diperbarui."
|
167 |
-
|
168 |
-
#: ../content-aware-sidebars.php:361
|
169 |
-
msgid "Sidebar published."
|
170 |
-
msgstr "Sidebar dipublikasikan."
|
171 |
-
|
172 |
-
#: ../content-aware-sidebars.php:362
|
173 |
-
msgid "Sidebar saved."
|
174 |
-
msgstr "Sidebar disimpan."
|
175 |
-
|
176 |
-
#: ../content-aware-sidebars.php:363
|
177 |
-
msgid "Sidebar submitted."
|
178 |
-
msgstr ""
|
179 |
-
|
180 |
-
#: ../content-aware-sidebars.php:364
|
181 |
-
#, php-format
|
182 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
-
msgstr "Sidebar dijadwalkan untuk: <strong>%1$s</strong>."
|
184 |
-
|
185 |
-
#. translators: Publish box date format, see http://php.net/date
|
186 |
-
#: ../content-aware-sidebars.php:366
|
187 |
-
msgid "M j, Y @ G:i"
|
188 |
-
msgstr "M j, Y @ G:i"
|
189 |
-
|
190 |
-
#: ../content-aware-sidebars.php:367
|
191 |
-
msgid "Sidebar draft updated."
|
192 |
-
msgstr ""
|
193 |
-
|
194 |
-
#: ../content-aware-sidebars.php:383
|
195 |
-
#, php-format
|
196 |
-
msgid "%s sidebar updated."
|
197 |
-
msgid_plural "%s sidebars updated."
|
198 |
-
msgstr[0] ""
|
199 |
-
|
200 |
-
#: ../content-aware-sidebars.php:384
|
201 |
-
#, php-format
|
202 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
203 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
204 |
-
msgstr[0] ""
|
205 |
-
|
206 |
-
#: ../content-aware-sidebars.php:385
|
207 |
-
#, php-format
|
208 |
-
msgid "%s sidebar permanently deleted."
|
209 |
-
msgid_plural "%s sidebars permanently deleted."
|
210 |
-
msgstr[0] ""
|
211 |
-
|
212 |
-
#: ../content-aware-sidebars.php:386
|
213 |
-
#, php-format
|
214 |
-
msgid "%s sidebar moved to the Trash."
|
215 |
-
msgid_plural "%s sidebars moved to the Trash."
|
216 |
-
msgstr[0] ""
|
217 |
-
|
218 |
-
#: ../content-aware-sidebars.php:387
|
219 |
-
#, php-format
|
220 |
-
msgid "%s sidebar restored from the Trash."
|
221 |
-
msgid_plural "%s sidebars restored from the Trash."
|
222 |
-
msgstr[0] ""
|
223 |
-
|
224 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
225 |
-
msgid "Please update Host Sidebar"
|
226 |
-
msgstr ""
|
227 |
-
|
228 |
-
#: ../content-aware-sidebars.php:472
|
229 |
-
msgid "Merge position"
|
230 |
-
msgstr "Gabungkan posisi"
|
231 |
-
|
232 |
-
#: ../content-aware-sidebars.php:473
|
233 |
-
msgid "Widgets"
|
234 |
-
msgstr "Widget"
|
235 |
-
|
236 |
-
#: ../content-aware-sidebars.php:586
|
237 |
-
msgid "Manage Widgets"
|
238 |
-
msgstr "Atur Widget"
|
239 |
-
|
240 |
-
#: ../content-aware-sidebars.php:756
|
241 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
242 |
-
msgstr "Dapatkan paket premium Content Aware Sidebars gratis"
|
243 |
-
|
244 |
-
#: ../content-aware-sidebars.php:772
|
245 |
-
msgid "Options"
|
246 |
-
msgstr "Pilihan"
|
247 |
-
|
248 |
-
#: ../content-aware-sidebars.php:795
|
249 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
250 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
251 |
-
msgid "Condition Groups"
|
252 |
-
msgstr ""
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:796
|
255 |
-
msgid ""
|
256 |
-
"Each created condition group describe some specific content (conditions) "
|
257 |
-
"that the current sidebar should be displayed with."
|
258 |
-
msgstr ""
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:797
|
261 |
-
msgid ""
|
262 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
263 |
-
" groups themselves use logical disjunction. This means that content added to"
|
264 |
-
" a group should be associated, as they are treated as such, and that the "
|
265 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
266 |
-
"extremely focused and at the same time distinct conditions."
|
267 |
-
msgstr ""
|
268 |
-
|
269 |
-
#: ../content-aware-sidebars.php:800
|
270 |
-
msgid "More Information"
|
271 |
-
msgstr "Informasi Lebih Lanjut"
|
272 |
-
|
273 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
274 |
-
msgid "Get Support"
|
275 |
-
msgstr "Dapatkan Bantuan"
|
276 |
-
|
277 |
-
#: ../content-aware-sidebars.php:816
|
278 |
-
msgid ""
|
279 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
280 |
-
" of the upcoming Premium Bundle*!"
|
281 |
-
msgstr ""
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:817
|
284 |
-
msgid "Translate Now"
|
285 |
-
msgstr "Terjemahkan Sekarang"
|
286 |
-
|
287 |
-
#: ../content-aware-sidebars.php:818
|
288 |
-
msgid "Get Premium Bundle"
|
289 |
-
msgstr "Dapatkan Paket Premium"
|
290 |
-
|
291 |
-
#: ../content-aware-sidebars.php:819
|
292 |
-
msgid ""
|
293 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
294 |
-
msgstr ""
|
295 |
-
|
296 |
-
#: ../content-aware-sidebars.php:822
|
297 |
-
msgid "Partial Feature List"
|
298 |
-
msgstr "Daftar Fitur Sebagian"
|
299 |
-
|
300 |
-
#: ../content-aware-sidebars.php:824
|
301 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
302 |
-
msgstr ""
|
303 |
-
|
304 |
-
#: ../content-aware-sidebars.php:825
|
305 |
-
msgid "Display sidebars with URLs using wildcards"
|
306 |
-
msgstr ""
|
307 |
-
|
308 |
-
#: ../content-aware-sidebars.php:826
|
309 |
-
msgid "Display sidebars with User Roles"
|
310 |
-
msgstr ""
|
311 |
-
|
312 |
-
#: ../content-aware-sidebars.php:827
|
313 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
314 |
-
msgstr ""
|
315 |
-
|
316 |
-
#: ../content-aware-sidebars.php:828
|
317 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
318 |
-
msgstr ""
|
319 |
-
|
320 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
321 |
-
msgid "Order"
|
322 |
-
msgstr "Urutan"
|
323 |
-
|
324 |
-
#: ../content-aware-sidebars.php:880
|
325 |
-
msgid "Give a review on WordPress.org"
|
326 |
-
msgstr ""
|
327 |
-
|
328 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
329 |
-
msgid "Translate the plugin into your language"
|
330 |
-
msgstr "Terjemahkan plugin ini ke dalam bahasa Anda"
|
331 |
-
|
332 |
-
#: ../content-aware-sidebars.php:884
|
333 |
-
msgid "Read the FAQ"
|
334 |
-
msgstr ""
|
335 |
-
|
336 |
-
#: ../content-aware-sidebars.php:899
|
337 |
-
msgid ""
|
338 |
-
"If you love this plugin, please consider donating to support future "
|
339 |
-
"development."
|
340 |
-
msgstr "Jika Anda menyukai plugin ini, pertimbangkan untuk memberikan donasi untuk mendukung pengembangan selanjutnya."
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:908
|
343 |
-
msgid "Or you could:"
|
344 |
-
msgstr "Atau Anda bisa:"
|
345 |
-
|
346 |
-
#: ../content-aware-sidebars.php:910
|
347 |
-
msgid "Rate the plugin on WordPress.org"
|
348 |
-
msgstr "Nilai plugin ini di WordPress.org"
|
349 |
-
|
350 |
-
#: ../content-aware-sidebars.php:911
|
351 |
-
msgid "Link to the plugin page"
|
352 |
-
msgstr "Tautkan ke laman plugin"
|
353 |
-
|
354 |
-
#: ../content-aware-sidebars.php:1045
|
355 |
-
msgid "Filter Sidebars"
|
356 |
-
msgstr "Filter Sidebar"
|
357 |
-
|
358 |
-
#: ../content-aware-sidebars.php:1046
|
359 |
-
msgid "Filter Widgets"
|
360 |
-
msgstr ""
|
361 |
-
|
362 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
363 |
-
msgid "Condition Group"
|
364 |
-
msgstr ""
|
365 |
-
|
366 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
367 |
-
msgctxt "group"
|
368 |
-
msgid "Add New"
|
369 |
-
msgstr "Tambah Baru"
|
370 |
-
|
371 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
372 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
373 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
374 |
-
msgid "Add New Group"
|
375 |
-
msgstr "Tambah Grup Baru"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
378 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
380 |
-
msgctxt "group"
|
381 |
-
msgid "Edit"
|
382 |
-
msgstr "Ubah"
|
383 |
-
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
385 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
386 |
-
msgid "No Groups found"
|
387 |
-
msgstr "Tidak ada Grup"
|
388 |
-
|
389 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
390 |
-
msgctxt "condition group"
|
391 |
-
msgid "Negated"
|
392 |
-
msgstr ""
|
393 |
-
|
394 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
395 |
-
msgid "Content"
|
396 |
-
msgstr ""
|
397 |
-
|
398 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
401 |
-
msgid "Unauthorized request"
|
402 |
-
msgstr ""
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
405 |
-
msgid "Condition group cannot be empty"
|
406 |
-
msgstr ""
|
407 |
-
|
408 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
409 |
-
msgid "Condition group saved"
|
410 |
-
msgstr ""
|
411 |
-
|
412 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
413 |
-
msgid "Condition group could not be removed"
|
414 |
-
msgstr ""
|
415 |
-
|
416 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
417 |
-
msgid "Condition group removed"
|
418 |
-
msgstr ""
|
419 |
-
|
420 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
421 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
422 |
-
msgid "Save"
|
423 |
-
msgstr "Simpan"
|
424 |
-
|
425 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
426 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
-
msgid "Cancel"
|
428 |
-
msgstr "Batal"
|
429 |
-
|
430 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
431 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
432 |
-
msgid "Or"
|
433 |
-
msgstr "Atau"
|
434 |
-
|
435 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
436 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
437 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
438 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
439 |
-
msgid "And"
|
440 |
-
msgstr ""
|
441 |
-
|
442 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
443 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
444 |
-
msgid "Remove"
|
445 |
-
msgstr "Hapus"
|
446 |
-
|
447 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
448 |
-
msgid "Remove this group and its contents permanently?"
|
449 |
-
msgstr "Hapus grup ini dan isinya secara permanen?"
|
450 |
-
|
451 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
452 |
-
msgid "No results found."
|
453 |
-
msgstr "Tidak ada hasil."
|
454 |
-
|
455 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
456 |
-
msgid ""
|
457 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
458 |
-
"these changes?"
|
459 |
-
msgstr "Grup ini mempunyai perubahan yang belum disimpan. Anda ingin melanjutkan dan menghapus perubahan tersebut?"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
462 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
463 |
-
msgid "Negate group"
|
464 |
-
msgstr ""
|
465 |
-
|
466 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
467 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
468 |
-
msgid "Target all but this context"
|
469 |
-
msgstr ""
|
470 |
-
|
471 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
472 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
-
msgid "Target this context"
|
474 |
-
msgstr ""
|
475 |
-
|
476 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
477 |
-
msgid "Authors"
|
478 |
-
msgstr "Penulis"
|
479 |
-
|
480 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
481 |
-
#, php-format
|
482 |
-
msgid "Display with All %s"
|
483 |
-
msgstr "Tampilkan dengan semua %s"
|
484 |
-
|
485 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
486 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
487 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
488 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
489 |
-
msgid "View All"
|
490 |
-
msgstr "Lihat Semua"
|
491 |
-
|
492 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
493 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
494 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
495 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
496 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
497 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
498 |
-
msgid "Search"
|
499 |
-
msgstr "Cari"
|
500 |
-
|
501 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
502 |
-
msgid "bbPress User Profiles"
|
503 |
-
msgstr "Profil Pengguna bbPress"
|
504 |
-
|
505 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
506 |
-
msgid "BuddyPress Members"
|
507 |
-
msgstr "Anggota BuddyPress"
|
508 |
-
|
509 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
510 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
511 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
512 |
-
msgid "Add to Group"
|
513 |
-
msgstr "Tambahkan ke Grup"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
516 |
-
msgid "Dates"
|
517 |
-
msgstr "Tanggal"
|
518 |
-
|
519 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
520 |
-
msgid "Date Archives"
|
521 |
-
msgstr "Arsip Tanggal"
|
522 |
-
|
523 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
524 |
-
msgid "Page Templates"
|
525 |
-
msgstr ""
|
526 |
-
|
527 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
528 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
529 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
530 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
531 |
-
msgid "Languages"
|
532 |
-
msgstr "Bahasa"
|
533 |
-
|
534 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
535 |
-
msgid "Post Types"
|
536 |
-
msgstr "Tipe Pos"
|
537 |
-
|
538 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
539 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
540 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
541 |
-
msgid "Automatically select new children of a selected ancestor"
|
542 |
-
msgstr ""
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
545 |
-
msgid "Automatically add new children of a selected ancestor"
|
546 |
-
msgstr ""
|
547 |
-
|
548 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
549 |
-
#, php-format
|
550 |
-
msgid "%s Archives"
|
551 |
-
msgstr "Arsip %s"
|
552 |
-
|
553 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
554 |
-
msgid "Blog Page"
|
555 |
-
msgstr "Laman Blog"
|
556 |
-
|
557 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
558 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
559 |
-
msgid "No items."
|
560 |
-
msgstr ""
|
561 |
-
|
562 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
563 |
-
msgid "Most Recent"
|
564 |
-
msgstr "Terbaru"
|
565 |
-
|
566 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
567 |
-
msgid "Static Pages"
|
568 |
-
msgstr "Laman Statis"
|
569 |
-
|
570 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
571 |
-
msgid "Front Page"
|
572 |
-
msgstr "Laman Depan"
|
573 |
-
|
574 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
575 |
-
msgid "Search Results"
|
576 |
-
msgstr "Hasil Pencarian"
|
577 |
-
|
578 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
579 |
-
msgid "404 Page"
|
580 |
-
msgstr "Laman 404"
|
581 |
-
|
582 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
583 |
-
msgid "Taxonomies"
|
584 |
-
msgstr "Taksonomi"
|
585 |
-
|
586 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
587 |
-
msgid "Most Used"
|
588 |
-
msgstr "Paling Sering Digunakan"
|
589 |
-
|
590 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
591 |
-
msgid "Conditional Content"
|
592 |
-
msgstr ""
|
593 |
-
|
594 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
595 |
-
msgid ""
|
596 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
597 |
-
" it. In each group, you can combine different types of associated content."
|
598 |
-
msgstr ""
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
601 |
-
#, php-format
|
602 |
-
msgid "All %s"
|
603 |
-
msgstr "Semua %s"
|
604 |
-
|
605 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
606 |
-
msgid "Password protected"
|
607 |
-
msgstr ""
|
608 |
-
|
609 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
610 |
-
msgid "Private"
|
611 |
-
msgstr ""
|
612 |
-
|
613 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
614 |
-
msgid "Draft"
|
615 |
-
msgstr ""
|
616 |
-
|
617 |
-
#. translators: post state
|
618 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
619 |
-
msgctxt "post state"
|
620 |
-
msgid "Pending"
|
621 |
-
msgstr ""
|
622 |
-
|
623 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
624 |
-
msgid "Sticky"
|
625 |
-
msgstr ""
|
626 |
-
|
627 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
628 |
-
msgid "Scheduled"
|
629 |
-
msgstr ""
|
630 |
-
|
631 |
-
#: ../pointers.php:68
|
632 |
-
msgid "Get started"
|
633 |
-
msgstr "Mulai"
|
634 |
-
|
635 |
-
#: ../pointers.php:69
|
636 |
-
msgid ""
|
637 |
-
"You've just installed Content Aware Sidebars!\n"
|
638 |
-
"\n"
|
639 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
640 |
-
"\n"
|
641 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
642 |
-
msgstr "Anda baru saja menginstal Content Aware Sidebars!\n\nPlugin ini akan memberikan Anda banyak pilihan, jadi tampilannya mungkin akan membingungkan Anda pada awalnya. Jangan khawatir.\n\nKlik Mulai Tur untuk melihat pengenalan singkat dan belajar cara menampilkan sidebar persis di tempat dan waktu yang Anda inginkan."
|
643 |
-
|
644 |
-
#: ../pointers.php:76
|
645 |
-
msgid "Start Tour"
|
646 |
-
msgstr "Mulai Tur"
|
647 |
-
|
648 |
-
#: ../pointers.php:78
|
649 |
-
msgid "Not now"
|
650 |
-
msgstr "Tidak sekarang"
|
651 |
-
|
652 |
-
#: ../pointers.php:83
|
653 |
-
msgid ""
|
654 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
655 |
-
"\n"
|
656 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
657 |
-
"\n"
|
658 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
659 |
-
msgstr ""
|
660 |
-
|
661 |
-
#: ../pointers.php:92
|
662 |
-
msgid "Content and contexts"
|
663 |
-
msgstr "Konten dan konteks"
|
664 |
-
|
665 |
-
#: ../pointers.php:93
|
666 |
-
msgid ""
|
667 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
668 |
-
"\n"
|
669 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
670 |
-
"\n"
|
671 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
672 |
-
msgstr ""
|
673 |
-
|
674 |
-
#: ../pointers.php:102
|
675 |
-
msgid "Options, options"
|
676 |
-
msgstr ""
|
677 |
-
|
678 |
-
#: ../pointers.php:103
|
679 |
-
msgid ""
|
680 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
681 |
-
"\n"
|
682 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
683 |
-
"\n"
|
684 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
685 |
-
"\n"
|
686 |
-
" You are in control."
|
687 |
-
msgstr ""
|
688 |
-
|
689 |
-
#: ../pointers.php:112
|
690 |
-
msgid "Help and Support"
|
691 |
-
msgstr "Bantuan dan Dukungan"
|
692 |
-
|
693 |
-
#: ../pointers.php:113
|
694 |
-
msgid ""
|
695 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
696 |
-
"\n"
|
697 |
-
"If you need more help, click on the \"Help\" tab here."
|
698 |
-
msgstr ""
|
699 |
-
|
700 |
-
#: ../pointers.php:142
|
701 |
-
msgid "Close"
|
702 |
-
msgstr "Tutup"
|
703 |
-
|
704 |
-
#: ../pointers.php:143
|
705 |
-
msgid "Next"
|
706 |
-
msgstr "Selanjutnya"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Dhyayi Warapsari <aurodigo@gmail.com>, 2015
|
5 |
+
msgid ""
|
6 |
+
msgstr ""
|
7 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
9 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
10 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
11 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
12 |
+
"Language-Team: Indonesian (Indonesia) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/id_ID/)\n"
|
13 |
+
"MIME-Version: 1.0\n"
|
14 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
16 |
+
"Language: id_ID\n"
|
17 |
+
"Plural-Forms: nplurals=1; plural=0;\n"
|
18 |
+
"X-Generator: Poedit 1.7.6\n"
|
19 |
+
"X-Poedit-Basepath: .\n"
|
20 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
21 |
+
"X-Poedit-SearchPath-0: .\n"
|
22 |
+
"X-Poedit-SearchPath-1: ..\n"
|
23 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
25 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
26 |
+
"X-Textdomain-Support: yes\n"
|
27 |
+
|
28 |
+
#: ../content-aware-sidebars.php:95
|
29 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
30 |
+
msgstr "Atur dan tampilkan sidebar sesuai dengan konten yang sedang dilihat"
|
31 |
+
|
32 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
33 |
+
msgid "Content Aware Sidebars"
|
34 |
+
msgstr "Content Aware Sidebars"
|
35 |
+
|
36 |
+
#: ../content-aware-sidebars.php:97
|
37 |
+
msgid "Import"
|
38 |
+
msgstr "Impor"
|
39 |
+
|
40 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
41 |
+
msgid "FAQ"
|
42 |
+
msgstr "FAQ"
|
43 |
+
|
44 |
+
#: ../content-aware-sidebars.php:256
|
45 |
+
msgid "Exposure"
|
46 |
+
msgstr ""
|
47 |
+
|
48 |
+
#: ../content-aware-sidebars.php:260
|
49 |
+
msgid "Singular"
|
50 |
+
msgstr ""
|
51 |
+
|
52 |
+
#: ../content-aware-sidebars.php:261
|
53 |
+
msgid "Singular & Archive"
|
54 |
+
msgstr ""
|
55 |
+
|
56 |
+
#: ../content-aware-sidebars.php:262
|
57 |
+
msgid "Archive"
|
58 |
+
msgstr "Arsip"
|
59 |
+
|
60 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
61 |
+
msgctxt "option"
|
62 |
+
msgid "Handle"
|
63 |
+
msgstr ""
|
64 |
+
|
65 |
+
#: ../content-aware-sidebars.php:271
|
66 |
+
msgid "Replace"
|
67 |
+
msgstr "Ganti"
|
68 |
+
|
69 |
+
#: ../content-aware-sidebars.php:272
|
70 |
+
msgid "Merge"
|
71 |
+
msgstr "Gabung"
|
72 |
+
|
73 |
+
#: ../content-aware-sidebars.php:273
|
74 |
+
msgid "Manual"
|
75 |
+
msgstr "Manual"
|
76 |
+
|
77 |
+
#: ../content-aware-sidebars.php:274
|
78 |
+
msgid "Forced replace"
|
79 |
+
msgstr "Ganti secara paksa"
|
80 |
+
|
81 |
+
#: ../content-aware-sidebars.php:276
|
82 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
83 |
+
msgstr ""
|
84 |
+
|
85 |
+
#: ../content-aware-sidebars.php:280
|
86 |
+
msgid "Host Sidebar"
|
87 |
+
msgstr ""
|
88 |
+
|
89 |
+
#: ../content-aware-sidebars.php:287
|
90 |
+
msgid "Merge Position"
|
91 |
+
msgstr "Gabung Posisi"
|
92 |
+
|
93 |
+
#: ../content-aware-sidebars.php:291
|
94 |
+
msgid "Top"
|
95 |
+
msgstr "Atas"
|
96 |
+
|
97 |
+
#: ../content-aware-sidebars.php:292
|
98 |
+
msgid "Bottom"
|
99 |
+
msgstr "Bawah"
|
100 |
+
|
101 |
+
#: ../content-aware-sidebars.php:294
|
102 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
103 |
+
msgstr ""
|
104 |
+
|
105 |
+
#: ../content-aware-sidebars.php:309
|
106 |
+
msgid "Sidebars"
|
107 |
+
msgstr "Sidebar"
|
108 |
+
|
109 |
+
#: ../content-aware-sidebars.php:310
|
110 |
+
msgid "Sidebar"
|
111 |
+
msgstr "Sidebar"
|
112 |
+
|
113 |
+
#: ../content-aware-sidebars.php:311
|
114 |
+
msgctxt "sidebar"
|
115 |
+
msgid "Add New"
|
116 |
+
msgstr "Tambah Baru"
|
117 |
+
|
118 |
+
#: ../content-aware-sidebars.php:312
|
119 |
+
msgid "Add New Sidebar"
|
120 |
+
msgstr "Tambah Sidebar Baru"
|
121 |
+
|
122 |
+
#: ../content-aware-sidebars.php:313
|
123 |
+
msgid "Edit Sidebar"
|
124 |
+
msgstr "Ubah Sidebar"
|
125 |
+
|
126 |
+
#: ../content-aware-sidebars.php:314
|
127 |
+
msgid "New Sidebar"
|
128 |
+
msgstr "Sidebar Baru"
|
129 |
+
|
130 |
+
#: ../content-aware-sidebars.php:315
|
131 |
+
msgid "All Sidebars"
|
132 |
+
msgstr "Semua Sidebar"
|
133 |
+
|
134 |
+
#: ../content-aware-sidebars.php:316
|
135 |
+
msgid "View Sidebar"
|
136 |
+
msgstr "Lihat Sidebar"
|
137 |
+
|
138 |
+
#: ../content-aware-sidebars.php:317
|
139 |
+
msgid "Search Sidebars"
|
140 |
+
msgstr "Cari Sidebar"
|
141 |
+
|
142 |
+
#: ../content-aware-sidebars.php:318
|
143 |
+
msgid "No sidebars found"
|
144 |
+
msgstr "Tidak ada sidebar"
|
145 |
+
|
146 |
+
#: ../content-aware-sidebars.php:319
|
147 |
+
msgid "No sidebars found in Trash"
|
148 |
+
msgstr ""
|
149 |
+
|
150 |
+
#: ../content-aware-sidebars.php:321
|
151 |
+
msgid "Display sidebar with"
|
152 |
+
msgstr "Tampilkan sidebar dengan"
|
153 |
+
|
154 |
+
#: ../content-aware-sidebars.php:322
|
155 |
+
msgid ""
|
156 |
+
"No content. Please add at least one condition group to make the sidebar "
|
157 |
+
"content aware."
|
158 |
+
msgstr ""
|
159 |
+
|
160 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
161 |
+
msgid "Manage widgets"
|
162 |
+
msgstr "Atur widget"
|
163 |
+
|
164 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
165 |
+
msgid "Sidebar updated."
|
166 |
+
msgstr "Sidebar diperbarui."
|
167 |
+
|
168 |
+
#: ../content-aware-sidebars.php:361
|
169 |
+
msgid "Sidebar published."
|
170 |
+
msgstr "Sidebar dipublikasikan."
|
171 |
+
|
172 |
+
#: ../content-aware-sidebars.php:362
|
173 |
+
msgid "Sidebar saved."
|
174 |
+
msgstr "Sidebar disimpan."
|
175 |
+
|
176 |
+
#: ../content-aware-sidebars.php:363
|
177 |
+
msgid "Sidebar submitted."
|
178 |
+
msgstr ""
|
179 |
+
|
180 |
+
#: ../content-aware-sidebars.php:364
|
181 |
+
#, php-format
|
182 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
183 |
+
msgstr "Sidebar dijadwalkan untuk: <strong>%1$s</strong>."
|
184 |
+
|
185 |
+
#. translators: Publish box date format, see http://php.net/date
|
186 |
+
#: ../content-aware-sidebars.php:366
|
187 |
+
msgid "M j, Y @ G:i"
|
188 |
+
msgstr "M j, Y @ G:i"
|
189 |
+
|
190 |
+
#: ../content-aware-sidebars.php:367
|
191 |
+
msgid "Sidebar draft updated."
|
192 |
+
msgstr ""
|
193 |
+
|
194 |
+
#: ../content-aware-sidebars.php:383
|
195 |
+
#, php-format
|
196 |
+
msgid "%s sidebar updated."
|
197 |
+
msgid_plural "%s sidebars updated."
|
198 |
+
msgstr[0] ""
|
199 |
+
|
200 |
+
#: ../content-aware-sidebars.php:384
|
201 |
+
#, php-format
|
202 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
203 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
204 |
+
msgstr[0] ""
|
205 |
+
|
206 |
+
#: ../content-aware-sidebars.php:385
|
207 |
+
#, php-format
|
208 |
+
msgid "%s sidebar permanently deleted."
|
209 |
+
msgid_plural "%s sidebars permanently deleted."
|
210 |
+
msgstr[0] ""
|
211 |
+
|
212 |
+
#: ../content-aware-sidebars.php:386
|
213 |
+
#, php-format
|
214 |
+
msgid "%s sidebar moved to the Trash."
|
215 |
+
msgid_plural "%s sidebars moved to the Trash."
|
216 |
+
msgstr[0] ""
|
217 |
+
|
218 |
+
#: ../content-aware-sidebars.php:387
|
219 |
+
#, php-format
|
220 |
+
msgid "%s sidebar restored from the Trash."
|
221 |
+
msgid_plural "%s sidebars restored from the Trash."
|
222 |
+
msgstr[0] ""
|
223 |
+
|
224 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
225 |
+
msgid "Please update Host Sidebar"
|
226 |
+
msgstr ""
|
227 |
+
|
228 |
+
#: ../content-aware-sidebars.php:472
|
229 |
+
msgid "Merge position"
|
230 |
+
msgstr "Gabungkan posisi"
|
231 |
+
|
232 |
+
#: ../content-aware-sidebars.php:473
|
233 |
+
msgid "Widgets"
|
234 |
+
msgstr "Widget"
|
235 |
+
|
236 |
+
#: ../content-aware-sidebars.php:586
|
237 |
+
msgid "Manage Widgets"
|
238 |
+
msgstr "Atur Widget"
|
239 |
+
|
240 |
+
#: ../content-aware-sidebars.php:756
|
241 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
242 |
+
msgstr "Dapatkan paket premium Content Aware Sidebars gratis"
|
243 |
+
|
244 |
+
#: ../content-aware-sidebars.php:772
|
245 |
+
msgid "Options"
|
246 |
+
msgstr "Pilihan"
|
247 |
+
|
248 |
+
#: ../content-aware-sidebars.php:795
|
249 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
250 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
251 |
+
msgid "Condition Groups"
|
252 |
+
msgstr ""
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:796
|
255 |
+
msgid ""
|
256 |
+
"Each created condition group describe some specific content (conditions) "
|
257 |
+
"that the current sidebar should be displayed with."
|
258 |
+
msgstr ""
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:797
|
261 |
+
msgid ""
|
262 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
263 |
+
" groups themselves use logical disjunction. This means that content added to"
|
264 |
+
" a group should be associated, as they are treated as such, and that the "
|
265 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
266 |
+
"extremely focused and at the same time distinct conditions."
|
267 |
+
msgstr ""
|
268 |
+
|
269 |
+
#: ../content-aware-sidebars.php:800
|
270 |
+
msgid "More Information"
|
271 |
+
msgstr "Informasi Lebih Lanjut"
|
272 |
+
|
273 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
274 |
+
msgid "Get Support"
|
275 |
+
msgstr "Dapatkan Bantuan"
|
276 |
+
|
277 |
+
#: ../content-aware-sidebars.php:816
|
278 |
+
msgid ""
|
279 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
280 |
+
" of the upcoming Premium Bundle*!"
|
281 |
+
msgstr ""
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:817
|
284 |
+
msgid "Translate Now"
|
285 |
+
msgstr "Terjemahkan Sekarang"
|
286 |
+
|
287 |
+
#: ../content-aware-sidebars.php:818
|
288 |
+
msgid "Get Premium Bundle"
|
289 |
+
msgstr "Dapatkan Paket Premium"
|
290 |
+
|
291 |
+
#: ../content-aware-sidebars.php:819
|
292 |
+
msgid ""
|
293 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
294 |
+
msgstr ""
|
295 |
+
|
296 |
+
#: ../content-aware-sidebars.php:822
|
297 |
+
msgid "Partial Feature List"
|
298 |
+
msgstr "Daftar Fitur Sebagian"
|
299 |
+
|
300 |
+
#: ../content-aware-sidebars.php:824
|
301 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
302 |
+
msgstr ""
|
303 |
+
|
304 |
+
#: ../content-aware-sidebars.php:825
|
305 |
+
msgid "Display sidebars with URLs using wildcards"
|
306 |
+
msgstr ""
|
307 |
+
|
308 |
+
#: ../content-aware-sidebars.php:826
|
309 |
+
msgid "Display sidebars with User Roles"
|
310 |
+
msgstr ""
|
311 |
+
|
312 |
+
#: ../content-aware-sidebars.php:827
|
313 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
314 |
+
msgstr ""
|
315 |
+
|
316 |
+
#: ../content-aware-sidebars.php:828
|
317 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
318 |
+
msgstr ""
|
319 |
+
|
320 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
321 |
+
msgid "Order"
|
322 |
+
msgstr "Urutan"
|
323 |
+
|
324 |
+
#: ../content-aware-sidebars.php:880
|
325 |
+
msgid "Give a review on WordPress.org"
|
326 |
+
msgstr ""
|
327 |
+
|
328 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
329 |
+
msgid "Translate the plugin into your language"
|
330 |
+
msgstr "Terjemahkan plugin ini ke dalam bahasa Anda"
|
331 |
+
|
332 |
+
#: ../content-aware-sidebars.php:884
|
333 |
+
msgid "Read the FAQ"
|
334 |
+
msgstr ""
|
335 |
+
|
336 |
+
#: ../content-aware-sidebars.php:899
|
337 |
+
msgid ""
|
338 |
+
"If you love this plugin, please consider donating to support future "
|
339 |
+
"development."
|
340 |
+
msgstr "Jika Anda menyukai plugin ini, pertimbangkan untuk memberikan donasi untuk mendukung pengembangan selanjutnya."
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:908
|
343 |
+
msgid "Or you could:"
|
344 |
+
msgstr "Atau Anda bisa:"
|
345 |
+
|
346 |
+
#: ../content-aware-sidebars.php:910
|
347 |
+
msgid "Rate the plugin on WordPress.org"
|
348 |
+
msgstr "Nilai plugin ini di WordPress.org"
|
349 |
+
|
350 |
+
#: ../content-aware-sidebars.php:911
|
351 |
+
msgid "Link to the plugin page"
|
352 |
+
msgstr "Tautkan ke laman plugin"
|
353 |
+
|
354 |
+
#: ../content-aware-sidebars.php:1045
|
355 |
+
msgid "Filter Sidebars"
|
356 |
+
msgstr "Filter Sidebar"
|
357 |
+
|
358 |
+
#: ../content-aware-sidebars.php:1046
|
359 |
+
msgid "Filter Widgets"
|
360 |
+
msgstr ""
|
361 |
+
|
362 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
363 |
+
msgid "Condition Group"
|
364 |
+
msgstr ""
|
365 |
+
|
366 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
367 |
+
msgctxt "group"
|
368 |
+
msgid "Add New"
|
369 |
+
msgstr "Tambah Baru"
|
370 |
+
|
371 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
372 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
373 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
374 |
+
msgid "Add New Group"
|
375 |
+
msgstr "Tambah Grup Baru"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
378 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
380 |
+
msgctxt "group"
|
381 |
+
msgid "Edit"
|
382 |
+
msgstr "Ubah"
|
383 |
+
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
385 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
386 |
+
msgid "No Groups found"
|
387 |
+
msgstr "Tidak ada Grup"
|
388 |
+
|
389 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
390 |
+
msgctxt "condition group"
|
391 |
+
msgid "Negated"
|
392 |
+
msgstr ""
|
393 |
+
|
394 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
395 |
+
msgid "Content"
|
396 |
+
msgstr ""
|
397 |
+
|
398 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
399 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
401 |
+
msgid "Unauthorized request"
|
402 |
+
msgstr ""
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
405 |
+
msgid "Condition group cannot be empty"
|
406 |
+
msgstr ""
|
407 |
+
|
408 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
409 |
+
msgid "Condition group saved"
|
410 |
+
msgstr ""
|
411 |
+
|
412 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
413 |
+
msgid "Condition group could not be removed"
|
414 |
+
msgstr ""
|
415 |
+
|
416 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
417 |
+
msgid "Condition group removed"
|
418 |
+
msgstr ""
|
419 |
+
|
420 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
421 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
422 |
+
msgid "Save"
|
423 |
+
msgstr "Simpan"
|
424 |
+
|
425 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
426 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
427 |
+
msgid "Cancel"
|
428 |
+
msgstr "Batal"
|
429 |
+
|
430 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
431 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
432 |
+
msgid "Or"
|
433 |
+
msgstr "Atau"
|
434 |
+
|
435 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
436 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
437 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
438 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
439 |
+
msgid "And"
|
440 |
+
msgstr ""
|
441 |
+
|
442 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
443 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
444 |
+
msgid "Remove"
|
445 |
+
msgstr "Hapus"
|
446 |
+
|
447 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
448 |
+
msgid "Remove this group and its contents permanently?"
|
449 |
+
msgstr "Hapus grup ini dan isinya secara permanen?"
|
450 |
+
|
451 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
452 |
+
msgid "No results found."
|
453 |
+
msgstr "Tidak ada hasil."
|
454 |
+
|
455 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
456 |
+
msgid ""
|
457 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
458 |
+
"these changes?"
|
459 |
+
msgstr "Grup ini mempunyai perubahan yang belum disimpan. Anda ingin melanjutkan dan menghapus perubahan tersebut?"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
462 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
463 |
+
msgid "Negate group"
|
464 |
+
msgstr ""
|
465 |
+
|
466 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
467 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
468 |
+
msgid "Target all but this context"
|
469 |
+
msgstr ""
|
470 |
+
|
471 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
472 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
473 |
+
msgid "Target this context"
|
474 |
+
msgstr ""
|
475 |
+
|
476 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
477 |
+
msgid "Authors"
|
478 |
+
msgstr "Penulis"
|
479 |
+
|
480 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
481 |
+
#, php-format
|
482 |
+
msgid "Display with All %s"
|
483 |
+
msgstr "Tampilkan dengan semua %s"
|
484 |
+
|
485 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
486 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
487 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
488 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
489 |
+
msgid "View All"
|
490 |
+
msgstr "Lihat Semua"
|
491 |
+
|
492 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
493 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
494 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
495 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
496 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
497 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
498 |
+
msgid "Search"
|
499 |
+
msgstr "Cari"
|
500 |
+
|
501 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
502 |
+
msgid "bbPress User Profiles"
|
503 |
+
msgstr "Profil Pengguna bbPress"
|
504 |
+
|
505 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
506 |
+
msgid "BuddyPress Members"
|
507 |
+
msgstr "Anggota BuddyPress"
|
508 |
+
|
509 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
510 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
511 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
512 |
+
msgid "Add to Group"
|
513 |
+
msgstr "Tambahkan ke Grup"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
516 |
+
msgid "Dates"
|
517 |
+
msgstr "Tanggal"
|
518 |
+
|
519 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
520 |
+
msgid "Date Archives"
|
521 |
+
msgstr "Arsip Tanggal"
|
522 |
+
|
523 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
524 |
+
msgid "Page Templates"
|
525 |
+
msgstr ""
|
526 |
+
|
527 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
528 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
529 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
530 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
531 |
+
msgid "Languages"
|
532 |
+
msgstr "Bahasa"
|
533 |
+
|
534 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
535 |
+
msgid "Post Types"
|
536 |
+
msgstr "Tipe Pos"
|
537 |
+
|
538 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
539 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
540 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
541 |
+
msgid "Automatically select new children of a selected ancestor"
|
542 |
+
msgstr ""
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
545 |
+
msgid "Automatically add new children of a selected ancestor"
|
546 |
+
msgstr ""
|
547 |
+
|
548 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
549 |
+
#, php-format
|
550 |
+
msgid "%s Archives"
|
551 |
+
msgstr "Arsip %s"
|
552 |
+
|
553 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
554 |
+
msgid "Blog Page"
|
555 |
+
msgstr "Laman Blog"
|
556 |
+
|
557 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
558 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
559 |
+
msgid "No items."
|
560 |
+
msgstr ""
|
561 |
+
|
562 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
563 |
+
msgid "Most Recent"
|
564 |
+
msgstr "Terbaru"
|
565 |
+
|
566 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
567 |
+
msgid "Static Pages"
|
568 |
+
msgstr "Laman Statis"
|
569 |
+
|
570 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
571 |
+
msgid "Front Page"
|
572 |
+
msgstr "Laman Depan"
|
573 |
+
|
574 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
575 |
+
msgid "Search Results"
|
576 |
+
msgstr "Hasil Pencarian"
|
577 |
+
|
578 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
579 |
+
msgid "404 Page"
|
580 |
+
msgstr "Laman 404"
|
581 |
+
|
582 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
583 |
+
msgid "Taxonomies"
|
584 |
+
msgstr "Taksonomi"
|
585 |
+
|
586 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
587 |
+
msgid "Most Used"
|
588 |
+
msgstr "Paling Sering Digunakan"
|
589 |
+
|
590 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
591 |
+
msgid "Conditional Content"
|
592 |
+
msgstr ""
|
593 |
+
|
594 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
595 |
+
msgid ""
|
596 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
597 |
+
" it. In each group, you can combine different types of associated content."
|
598 |
+
msgstr ""
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
601 |
+
#, php-format
|
602 |
+
msgid "All %s"
|
603 |
+
msgstr "Semua %s"
|
604 |
+
|
605 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
606 |
+
msgid "Password protected"
|
607 |
+
msgstr ""
|
608 |
+
|
609 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
610 |
+
msgid "Private"
|
611 |
+
msgstr ""
|
612 |
+
|
613 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
614 |
+
msgid "Draft"
|
615 |
+
msgstr ""
|
616 |
+
|
617 |
+
#. translators: post state
|
618 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
619 |
+
msgctxt "post state"
|
620 |
+
msgid "Pending"
|
621 |
+
msgstr ""
|
622 |
+
|
623 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
624 |
+
msgid "Sticky"
|
625 |
+
msgstr ""
|
626 |
+
|
627 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
628 |
+
msgid "Scheduled"
|
629 |
+
msgstr ""
|
630 |
+
|
631 |
+
#: ../pointers.php:68
|
632 |
+
msgid "Get started"
|
633 |
+
msgstr "Mulai"
|
634 |
+
|
635 |
+
#: ../pointers.php:69
|
636 |
+
msgid ""
|
637 |
+
"You've just installed Content Aware Sidebars!\n"
|
638 |
+
"\n"
|
639 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
640 |
+
"\n"
|
641 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
642 |
+
msgstr "Anda baru saja menginstal Content Aware Sidebars!\n\nPlugin ini akan memberikan Anda banyak pilihan, jadi tampilannya mungkin akan membingungkan Anda pada awalnya. Jangan khawatir.\n\nKlik Mulai Tur untuk melihat pengenalan singkat dan belajar cara menampilkan sidebar persis di tempat dan waktu yang Anda inginkan."
|
643 |
+
|
644 |
+
#: ../pointers.php:76
|
645 |
+
msgid "Start Tour"
|
646 |
+
msgstr "Mulai Tur"
|
647 |
+
|
648 |
+
#: ../pointers.php:78
|
649 |
+
msgid "Not now"
|
650 |
+
msgstr "Tidak sekarang"
|
651 |
+
|
652 |
+
#: ../pointers.php:83
|
653 |
+
msgid ""
|
654 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
655 |
+
"\n"
|
656 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
657 |
+
"\n"
|
658 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
659 |
+
msgstr ""
|
660 |
+
|
661 |
+
#: ../pointers.php:92
|
662 |
+
msgid "Content and contexts"
|
663 |
+
msgstr "Konten dan konteks"
|
664 |
+
|
665 |
+
#: ../pointers.php:93
|
666 |
+
msgid ""
|
667 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
668 |
+
"\n"
|
669 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
670 |
+
"\n"
|
671 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
672 |
+
msgstr ""
|
673 |
+
|
674 |
+
#: ../pointers.php:102
|
675 |
+
msgid "Options, options"
|
676 |
+
msgstr ""
|
677 |
+
|
678 |
+
#: ../pointers.php:103
|
679 |
+
msgid ""
|
680 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
681 |
+
"\n"
|
682 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
683 |
+
"\n"
|
684 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
685 |
+
"\n"
|
686 |
+
" You are in control."
|
687 |
+
msgstr ""
|
688 |
+
|
689 |
+
#: ../pointers.php:112
|
690 |
+
msgid "Help and Support"
|
691 |
+
msgstr "Bantuan dan Dukungan"
|
692 |
+
|
693 |
+
#: ../pointers.php:113
|
694 |
+
msgid ""
|
695 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
696 |
+
"\n"
|
697 |
+
"If you need more help, click on the \"Help\" tab here."
|
698 |
+
msgstr ""
|
699 |
+
|
700 |
+
#: ../pointers.php:142
|
701 |
+
msgid "Close"
|
702 |
+
msgstr "Tutup"
|
703 |
+
|
704 |
+
#: ../pointers.php:143
|
705 |
+
msgid "Next"
|
706 |
+
msgstr "Selanjutnya"
|
lang/content-aware-sidebars-it_IT.po
CHANGED
@@ -1,712 +1,712 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Luciano <luciano@myweb2.it>, 2014-2016
|
5 |
-
# Luciano <luciano@myweb2.it>, 2014
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Italian (Italy) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/it_IT/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: it_IT\n"
|
18 |
-
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "Gestisce e mostra le barre laterali a seconda del contenuto visualizzato."
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Content Aware Sidebars"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "Importa"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "FAQ"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "Tipologia"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "Singola"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "Singola e Archivio"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "Archivio"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "Comportamento"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "Sostituzione"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "Unione"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "Manuale"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "Forza la sostituzione"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "Sostituisce la barra laterale, si fonde con essa o la aggiunge manualmente."
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "Barra laterale"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "Fondi posizione"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "Alto"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "Basso"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "Posizione sidebar in alto o in basso dell'host durante la fusione."
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "Barre laterali"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "Barra laterale"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "Aggiungi"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "Aggiungi nuova barra laterale"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "Modifica barra laterale"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "Nuova barra laterale"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "Tutte le barre laterali"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "Vedi barra laterale"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "Cerca barre laterali"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "Nessuna barra laterale trovata"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "nessuna barra laterale spostata nel cestino"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "Visualizza sidebar"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "Nessun contenuto. Si prega di aggiungere almeno una condizione di gruppo per impostare il contenuto della barra laterale."
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "Gestione widgets"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "Barra laterale aggiornata."
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "Barra laterale pubblicata."
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "Barra laterale salvata."
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "Barra laterale inviata."
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "Barra laterale posticipata per: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "M j, Y @ G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "Bozza sidebar aggiornata. "
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] "%s barre laterali aggiorate."
|
200 |
-
msgstr[1] "%s barre laterali aggiorate."
|
201 |
-
|
202 |
-
#: ../content-aware-sidebars.php:384
|
203 |
-
#, php-format
|
204 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
-
msgstr[0] "%s barre laterali non aggiornati, qualcuno li sta modificando."
|
207 |
-
msgstr[1] "%s barre laterali non aggiornate, qualcuno le sta modificando."
|
208 |
-
|
209 |
-
#: ../content-aware-sidebars.php:385
|
210 |
-
#, php-format
|
211 |
-
msgid "%s sidebar permanently deleted."
|
212 |
-
msgid_plural "%s sidebars permanently deleted."
|
213 |
-
msgstr[0] "%s barre laterali cancellate. "
|
214 |
-
msgstr[1] "%s barre laterali cancellate. "
|
215 |
-
|
216 |
-
#: ../content-aware-sidebars.php:386
|
217 |
-
#, php-format
|
218 |
-
msgid "%s sidebar moved to the Trash."
|
219 |
-
msgid_plural "%s sidebars moved to the Trash."
|
220 |
-
msgstr[0] "%s barra laterale spostata nel cestino."
|
221 |
-
msgstr[1] "barre laterali %s spostato nel cestino."
|
222 |
-
|
223 |
-
#: ../content-aware-sidebars.php:387
|
224 |
-
#, php-format
|
225 |
-
msgid "%s sidebar restored from the Trash."
|
226 |
-
msgid_plural "%s sidebars restored from the Trash."
|
227 |
-
msgstr[0] "%s barre laterali ripristinate dal cestino."
|
228 |
-
msgstr[1] "%s barre laterali ripristinate dal cestino."
|
229 |
-
|
230 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
-
msgid "Please update Host Sidebar"
|
232 |
-
msgstr "Aggiorna sidebar"
|
233 |
-
|
234 |
-
#: ../content-aware-sidebars.php:472
|
235 |
-
msgid "Merge position"
|
236 |
-
msgstr "Posizione"
|
237 |
-
|
238 |
-
#: ../content-aware-sidebars.php:473
|
239 |
-
msgid "Widgets"
|
240 |
-
msgstr "Widgets"
|
241 |
-
|
242 |
-
#: ../content-aware-sidebars.php:586
|
243 |
-
msgid "Manage Widgets"
|
244 |
-
msgstr "Gestione Widgets"
|
245 |
-
|
246 |
-
#: ../content-aware-sidebars.php:756
|
247 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
-
msgstr "Ottieni gratis Content Aware Sidebars Premium Bundle"
|
249 |
-
|
250 |
-
#: ../content-aware-sidebars.php:772
|
251 |
-
msgid "Options"
|
252 |
-
msgstr "Opzioni"
|
253 |
-
|
254 |
-
#: ../content-aware-sidebars.php:795
|
255 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
-
msgid "Condition Groups"
|
258 |
-
msgstr "Condizione gruppi "
|
259 |
-
|
260 |
-
#: ../content-aware-sidebars.php:796
|
261 |
-
msgid ""
|
262 |
-
"Each created condition group describe some specific content (conditions) "
|
263 |
-
"that the current sidebar should be displayed with."
|
264 |
-
msgstr "Ogni condizione creata dal gruppo descrive alcuni contenuti specifici (condizioni) che la barra laterale attuale dovrebbe visualizzare."
|
265 |
-
|
266 |
-
#: ../content-aware-sidebars.php:797
|
267 |
-
msgid ""
|
268 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
-
" groups themselves use logical disjunction. This means that content added to"
|
270 |
-
" a group should be associated, as they are treated as such, and that the "
|
271 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
-
"extremely focused and at the same time distinct conditions."
|
273 |
-
msgstr "Il contenuto aggiunto a un gruppo di condizioni utilizza la congiunzione logica, mentre i gruppi di condizione si usano come disgiunzione logica. Ciò significa che il contenuto aggiunto a un gruppo dovrebbe essere associato e i gruppi non devono interferire uno con l'altro. In altre parole non è possibile ottenere le stesse condizioni concentrate allo stesso tempo."
|
274 |
-
|
275 |
-
#: ../content-aware-sidebars.php:800
|
276 |
-
msgid "More Information"
|
277 |
-
msgstr "Altre informazioni"
|
278 |
-
|
279 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
-
msgid "Get Support"
|
281 |
-
msgstr "Ottieni supporto"
|
282 |
-
|
283 |
-
#: ../content-aware-sidebars.php:816
|
284 |
-
msgid ""
|
285 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
-
" of the upcoming Premium Bundle*!"
|
287 |
-
msgstr "Traduci Content Aware Sidebars nella tua lingua e chiedi come diventare BETA tester del plugin Premium Bundle*!"
|
288 |
-
|
289 |
-
#: ../content-aware-sidebars.php:817
|
290 |
-
msgid "Translate Now"
|
291 |
-
msgstr "Traduci ora"
|
292 |
-
|
293 |
-
#: ../content-aware-sidebars.php:818
|
294 |
-
msgid "Get Premium Bundle"
|
295 |
-
msgstr "Ottieni Premium Bundle"
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:819
|
298 |
-
msgid ""
|
299 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
-
msgstr "E' una versione BETA e non è raccomandato l'uso su siti web già avviati."
|
301 |
-
|
302 |
-
#: ../content-aware-sidebars.php:822
|
303 |
-
msgid "Partial Feature List"
|
304 |
-
msgstr "Elenco parziale funzionalità"
|
305 |
-
|
306 |
-
#: ../content-aware-sidebars.php:824
|
307 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
-
msgstr "Seleziona e crea barre laterali nella schermata di modifica degli articoli"
|
309 |
-
|
310 |
-
#: ../content-aware-sidebars.php:825
|
311 |
-
msgid "Display sidebars with URLs using wildcards"
|
312 |
-
msgstr "Mostra barre laterali con URL utilizzando i caratteri jolly"
|
313 |
-
|
314 |
-
#: ../content-aware-sidebars.php:826
|
315 |
-
msgid "Display sidebars with User Roles"
|
316 |
-
msgstr "Mostra barre laterali con ruoli utente"
|
317 |
-
|
318 |
-
#: ../content-aware-sidebars.php:827
|
319 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
-
msgstr "Mostra sidebars con gruppi utenti BuddyPress"
|
321 |
-
|
322 |
-
#: ../content-aware-sidebars.php:828
|
323 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
-
msgstr "Colonna sidebar nei tipi di articoli e anteprima tassonomie nella schermata"
|
325 |
-
|
326 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
-
msgid "Order"
|
328 |
-
msgstr "Ordina"
|
329 |
-
|
330 |
-
#: ../content-aware-sidebars.php:880
|
331 |
-
msgid "Give a review on WordPress.org"
|
332 |
-
msgstr "Valuta il plugin su WordPress.org"
|
333 |
-
|
334 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
-
msgid "Translate the plugin into your language"
|
336 |
-
msgstr "Traduci questo plugin nella tua lingua"
|
337 |
-
|
338 |
-
#: ../content-aware-sidebars.php:884
|
339 |
-
msgid "Read the FAQ"
|
340 |
-
msgstr "Leggi le FAQ"
|
341 |
-
|
342 |
-
#: ../content-aware-sidebars.php:899
|
343 |
-
msgid ""
|
344 |
-
"If you love this plugin, please consider donating to support future "
|
345 |
-
"development."
|
346 |
-
msgstr "Se ti piace questo plugin, considera l'eventualità di fare una donazione per supportare lo sviluppo."
|
347 |
-
|
348 |
-
#: ../content-aware-sidebars.php:908
|
349 |
-
msgid "Or you could:"
|
350 |
-
msgstr "Ti potrebbe anche interessare:"
|
351 |
-
|
352 |
-
#: ../content-aware-sidebars.php:910
|
353 |
-
msgid "Rate the plugin on WordPress.org"
|
354 |
-
msgstr "Valutare il plugin su WordPress.org"
|
355 |
-
|
356 |
-
#: ../content-aware-sidebars.php:911
|
357 |
-
msgid "Link to the plugin page"
|
358 |
-
msgstr "Collegati alla pagina WordPress del plugin"
|
359 |
-
|
360 |
-
#: ../content-aware-sidebars.php:1045
|
361 |
-
msgid "Filter Sidebars"
|
362 |
-
msgstr "Filtra barre laterali"
|
363 |
-
|
364 |
-
#: ../content-aware-sidebars.php:1046
|
365 |
-
msgid "Filter Widgets"
|
366 |
-
msgstr "Gestione Widgets"
|
367 |
-
|
368 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
-
msgid "Condition Group"
|
370 |
-
msgstr "Condizione gruppo "
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
-
msgctxt "group"
|
374 |
-
msgid "Add New"
|
375 |
-
msgstr "Aggiungi"
|
376 |
-
|
377 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
-
msgid "Add New Group"
|
381 |
-
msgstr "Aggiungi nuovo gruppo"
|
382 |
-
|
383 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
-
msgctxt "group"
|
387 |
-
msgid "Edit"
|
388 |
-
msgstr "Modifica"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
-
msgid "No Groups found"
|
393 |
-
msgstr "Nessun gruppo trovato"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
-
msgctxt "condition group"
|
397 |
-
msgid "Negated"
|
398 |
-
msgstr "Negato"
|
399 |
-
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
-
msgid "Content"
|
402 |
-
msgstr "Contenuto"
|
403 |
-
|
404 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
-
msgid "Unauthorized request"
|
408 |
-
msgstr "Richiesta non autorizzata"
|
409 |
-
|
410 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
-
msgid "Condition group cannot be empty"
|
412 |
-
msgstr "Impossibile creare condizioni di gruppo"
|
413 |
-
|
414 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
-
msgid "Condition group saved"
|
416 |
-
msgstr "Condizioni di gruppo salvate"
|
417 |
-
|
418 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
-
msgid "Condition group could not be removed"
|
420 |
-
msgstr "Le condizioni di gruppo non possono essere eliminate"
|
421 |
-
|
422 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
-
msgid "Condition group removed"
|
424 |
-
msgstr "Condizione di gruppo eliminata "
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Save"
|
429 |
-
msgstr "Salva"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
-
msgid "Cancel"
|
434 |
-
msgstr "Annulla"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
-
msgid "Or"
|
439 |
-
msgstr "O"
|
440 |
-
|
441 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
-
msgid "And"
|
446 |
-
msgstr "E"
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
-
msgid "Remove"
|
451 |
-
msgstr "Elimina"
|
452 |
-
|
453 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
-
msgid "Remove this group and its contents permanently?"
|
455 |
-
msgstr "Vuoi eliminare questo gruppo e il suo contenuto in modo permanente?"
|
456 |
-
|
457 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
-
msgid "No results found."
|
459 |
-
msgstr "Nessuna risultato trovato"
|
460 |
-
|
461 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
-
msgid ""
|
463 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
-
"these changes?"
|
465 |
-
msgstr "Il gruppo attuale contiene modifiche non salvate. Vuoi proseguire e eliminare questi cambiamenti?"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
-
msgid "Negate group"
|
470 |
-
msgstr "Gruppo negato"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target all but this context"
|
475 |
-
msgstr "Obiettivo completo di questo contesto"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
-
msgid "Target this context"
|
480 |
-
msgstr "Obiettivo di questo contesto"
|
481 |
-
|
482 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
-
msgid "Authors"
|
484 |
-
msgstr "Autori"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
-
#, php-format
|
488 |
-
msgid "Display with All %s"
|
489 |
-
msgstr "Visualizza tutte le %s"
|
490 |
-
|
491 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
-
msgid "View All"
|
496 |
-
msgstr "Vedi tutto"
|
497 |
-
|
498 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
-
msgid "Search"
|
505 |
-
msgstr "Cerca"
|
506 |
-
|
507 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
-
msgid "bbPress User Profiles"
|
509 |
-
msgstr "Profilo utente bbPress"
|
510 |
-
|
511 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
-
msgid "BuddyPress Members"
|
513 |
-
msgstr "Utente BuddyPress"
|
514 |
-
|
515 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
-
msgid "Add to Group"
|
519 |
-
msgstr "Aggiungi al gruppo"
|
520 |
-
|
521 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
-
msgid "Dates"
|
523 |
-
msgstr "Dati"
|
524 |
-
|
525 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
-
msgid "Date Archives"
|
527 |
-
msgstr "Archivio dati"
|
528 |
-
|
529 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
-
msgid "Page Templates"
|
531 |
-
msgstr "Template pagine"
|
532 |
-
|
533 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
-
msgid "Languages"
|
538 |
-
msgstr "Lingue"
|
539 |
-
|
540 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
-
msgid "Post Types"
|
542 |
-
msgstr "Tipi di messaggi"
|
543 |
-
|
544 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
-
msgid "Automatically select new children of a selected ancestor"
|
548 |
-
msgstr "Seleziona automaticamente nuovi figli di un percorso selezionato"
|
549 |
-
|
550 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
-
msgid "Automatically add new children of a selected ancestor"
|
552 |
-
msgstr "Aggiungi automaticamente nuovi figli di un percorso selezionato"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
-
#, php-format
|
556 |
-
msgid "%s Archives"
|
557 |
-
msgstr "%s Archivi"
|
558 |
-
|
559 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
-
msgid "Blog Page"
|
561 |
-
msgstr "Pagina Blog"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
-
msgid "No items."
|
566 |
-
msgstr "Nessun oggetto."
|
567 |
-
|
568 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
-
msgid "Most Recent"
|
570 |
-
msgstr "Più recenti"
|
571 |
-
|
572 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
-
msgid "Static Pages"
|
574 |
-
msgstr "Pagine statiche"
|
575 |
-
|
576 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
-
msgid "Front Page"
|
578 |
-
msgstr "Pagina principale"
|
579 |
-
|
580 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
-
msgid "Search Results"
|
582 |
-
msgstr "Risultati di ricerca"
|
583 |
-
|
584 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
-
msgid "404 Page"
|
586 |
-
msgstr "Pagina 404"
|
587 |
-
|
588 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
-
msgid "Taxonomies"
|
590 |
-
msgstr "Tassonomie"
|
591 |
-
|
592 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
-
msgid "Most Used"
|
594 |
-
msgstr "Più usati"
|
595 |
-
|
596 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
-
msgid "Conditional Content"
|
598 |
-
msgstr "Condizione gruppo "
|
599 |
-
|
600 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
-
msgid ""
|
602 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
-
" it. In each group, you can combine different types of associated content."
|
604 |
-
msgstr "Clicca per modificare un gruppo o crearne uno nuovo. Seleziona il contenuto a sinistra per aggiungerlo. In ogni gruppo, è possibile combinare diversi tipi di contenuti associati."
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
-
#, php-format
|
608 |
-
msgid "All %s"
|
609 |
-
msgstr "Tutte le %s"
|
610 |
-
|
611 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
-
msgid "Password protected"
|
613 |
-
msgstr "Protezione password "
|
614 |
-
|
615 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
-
msgid "Private"
|
617 |
-
msgstr "Privato"
|
618 |
-
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
-
msgid "Draft"
|
621 |
-
msgstr "Bozza"
|
622 |
-
|
623 |
-
#. translators: post state
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
-
msgctxt "post state"
|
626 |
-
msgid "Pending"
|
627 |
-
msgstr "In attesa"
|
628 |
-
|
629 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
-
msgid "Sticky"
|
631 |
-
msgstr "Importante"
|
632 |
-
|
633 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
-
msgid "Scheduled"
|
635 |
-
msgstr "Programmato"
|
636 |
-
|
637 |
-
#: ../pointers.php:68
|
638 |
-
msgid "Get started"
|
639 |
-
msgstr "Come iniziare"
|
640 |
-
|
641 |
-
#: ../pointers.php:69
|
642 |
-
msgid ""
|
643 |
-
"You've just installed Content Aware Sidebars!\n"
|
644 |
-
"\n"
|
645 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
-
"\n"
|
647 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
-
msgstr "Hai appena installato Content Aware Sidebars!\n\nCi sono tante opzioni, in apparenza può sembrare complicato, non preoccuparti. \n\nClicca su Inizia Tour per visualizzare una rapida introduzione e imparare come visualizzare una barra laterale esattamente dove e quando la desideri."
|
649 |
-
|
650 |
-
#: ../pointers.php:76
|
651 |
-
msgid "Start Tour"
|
652 |
-
msgstr "Inizia Tour"
|
653 |
-
|
654 |
-
#: ../pointers.php:78
|
655 |
-
msgid "Not now"
|
656 |
-
msgstr "Non ora"
|
657 |
-
|
658 |
-
#: ../pointers.php:83
|
659 |
-
msgid ""
|
660 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
-
"\n"
|
662 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
-
"\n"
|
664 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
-
msgstr "Per creare una barra laterale devi prima creare una condizione al gruppo.\n\nLe condizioni dei gruppi sono isolate le une dalle altre , il che significa che una barra laterale può avere condizioni molto differenti.\n\nNegare un gruppo significa che la barra laterale verrà visualizzato su tutti, ma a queste condizioni ."
|
666 |
-
|
667 |
-
#: ../pointers.php:92
|
668 |
-
msgid "Content and contexts"
|
669 |
-
msgstr "Contenuto e contesto"
|
670 |
-
|
671 |
-
#: ../pointers.php:93
|
672 |
-
msgid ""
|
673 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
-
"\n"
|
675 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
-
"\n"
|
677 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
-
msgstr "Qui troverai tutti i contenuti che riguardano Content Aware Sidebars. \n\nBasta selezionare il contenuto che desideri e aggiungerlo a un gruppo .\n\nPuoi combinare contenuti associati in ogni gruppo; prova a selezionale \"Tutti gli articoli\", una Categoria e un Autore. Impressionante!"
|
679 |
-
|
680 |
-
#: ../pointers.php:102
|
681 |
-
msgid "Options, options"
|
682 |
-
msgstr "Opzioni, opzioni"
|
683 |
-
|
684 |
-
#: ../pointers.php:103
|
685 |
-
msgid ""
|
686 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
-
"\n"
|
688 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
-
"\n"
|
690 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
-
"\n"
|
692 |
-
" You are in control."
|
693 |
-
msgstr "Se la barra laterale viene visualizzato su pagine e/o archivi singoli ?\n\nSe dovesse fondersi con un'altra barra laterale o sostituirla ? Forse vuoi inserire manualmente il contenuto con un shortcode .\n\nPianificare la barra laterale, proprio come si fa con i messaggi e le pagine, o renderlo privato in modo che sia visibile solo per gli utenti registrati .\n\n Hai il pieno controllo."
|
694 |
-
|
695 |
-
#: ../pointers.php:112
|
696 |
-
msgid "Help and Support"
|
697 |
-
msgstr "Aiuto e Supporto"
|
698 |
-
|
699 |
-
#: ../pointers.php:113
|
700 |
-
msgid ""
|
701 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
-
"\n"
|
703 |
-
"If you need more help, click on the \"Help\" tab here."
|
704 |
-
msgstr "Questo è tutto! Ora puoi iniziare a creare le barre laterali e le visualizzi con le tue condizioni .\n\nSe hai bisogno di più aiut , fai clic sulla scheda \"Aiuto\" qui."
|
705 |
-
|
706 |
-
#: ../pointers.php:142
|
707 |
-
msgid "Close"
|
708 |
-
msgstr "Chiudi"
|
709 |
-
|
710 |
-
#: ../pointers.php:143
|
711 |
-
msgid "Next"
|
712 |
-
msgstr "Seguente"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Luciano <luciano@myweb2.it>, 2014-2016
|
5 |
+
# Luciano <luciano@myweb2.it>, 2014
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Italian (Italy) (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/it_IT/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: it_IT\n"
|
18 |
+
"Plural-Forms: nplurals=2; plural=(n != 1);\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "Gestisce e mostra le barre laterali a seconda del contenuto visualizzato."
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Content Aware Sidebars"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "Importa"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "FAQ"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "Tipologia"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "Singola"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "Singola e Archivio"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "Archivio"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "Comportamento"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "Sostituzione"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "Unione"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "Manuale"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "Forza la sostituzione"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "Sostituisce la barra laterale, si fonde con essa o la aggiunge manualmente."
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "Barra laterale"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "Fondi posizione"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "Alto"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "Basso"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "Posizione sidebar in alto o in basso dell'host durante la fusione."
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "Barre laterali"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "Barra laterale"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "Aggiungi"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "Aggiungi nuova barra laterale"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "Modifica barra laterale"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "Nuova barra laterale"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "Tutte le barre laterali"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "Vedi barra laterale"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "Cerca barre laterali"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "Nessuna barra laterale trovata"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "nessuna barra laterale spostata nel cestino"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "Visualizza sidebar"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "Nessun contenuto. Si prega di aggiungere almeno una condizione di gruppo per impostare il contenuto della barra laterale."
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "Gestione widgets"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "Barra laterale aggiornata."
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "Barra laterale pubblicata."
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "Barra laterale salvata."
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "Barra laterale inviata."
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "Barra laterale posticipata per: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "M j, Y @ G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "Bozza sidebar aggiornata. "
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] "%s barre laterali aggiorate."
|
200 |
+
msgstr[1] "%s barre laterali aggiorate."
|
201 |
+
|
202 |
+
#: ../content-aware-sidebars.php:384
|
203 |
+
#, php-format
|
204 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
205 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
206 |
+
msgstr[0] "%s barre laterali non aggiornati, qualcuno li sta modificando."
|
207 |
+
msgstr[1] "%s barre laterali non aggiornate, qualcuno le sta modificando."
|
208 |
+
|
209 |
+
#: ../content-aware-sidebars.php:385
|
210 |
+
#, php-format
|
211 |
+
msgid "%s sidebar permanently deleted."
|
212 |
+
msgid_plural "%s sidebars permanently deleted."
|
213 |
+
msgstr[0] "%s barre laterali cancellate. "
|
214 |
+
msgstr[1] "%s barre laterali cancellate. "
|
215 |
+
|
216 |
+
#: ../content-aware-sidebars.php:386
|
217 |
+
#, php-format
|
218 |
+
msgid "%s sidebar moved to the Trash."
|
219 |
+
msgid_plural "%s sidebars moved to the Trash."
|
220 |
+
msgstr[0] "%s barra laterale spostata nel cestino."
|
221 |
+
msgstr[1] "barre laterali %s spostato nel cestino."
|
222 |
+
|
223 |
+
#: ../content-aware-sidebars.php:387
|
224 |
+
#, php-format
|
225 |
+
msgid "%s sidebar restored from the Trash."
|
226 |
+
msgid_plural "%s sidebars restored from the Trash."
|
227 |
+
msgstr[0] "%s barre laterali ripristinate dal cestino."
|
228 |
+
msgstr[1] "%s barre laterali ripristinate dal cestino."
|
229 |
+
|
230 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
231 |
+
msgid "Please update Host Sidebar"
|
232 |
+
msgstr "Aggiorna sidebar"
|
233 |
+
|
234 |
+
#: ../content-aware-sidebars.php:472
|
235 |
+
msgid "Merge position"
|
236 |
+
msgstr "Posizione"
|
237 |
+
|
238 |
+
#: ../content-aware-sidebars.php:473
|
239 |
+
msgid "Widgets"
|
240 |
+
msgstr "Widgets"
|
241 |
+
|
242 |
+
#: ../content-aware-sidebars.php:586
|
243 |
+
msgid "Manage Widgets"
|
244 |
+
msgstr "Gestione Widgets"
|
245 |
+
|
246 |
+
#: ../content-aware-sidebars.php:756
|
247 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
248 |
+
msgstr "Ottieni gratis Content Aware Sidebars Premium Bundle"
|
249 |
+
|
250 |
+
#: ../content-aware-sidebars.php:772
|
251 |
+
msgid "Options"
|
252 |
+
msgstr "Opzioni"
|
253 |
+
|
254 |
+
#: ../content-aware-sidebars.php:795
|
255 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
256 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
257 |
+
msgid "Condition Groups"
|
258 |
+
msgstr "Condizione gruppi "
|
259 |
+
|
260 |
+
#: ../content-aware-sidebars.php:796
|
261 |
+
msgid ""
|
262 |
+
"Each created condition group describe some specific content (conditions) "
|
263 |
+
"that the current sidebar should be displayed with."
|
264 |
+
msgstr "Ogni condizione creata dal gruppo descrive alcuni contenuti specifici (condizioni) che la barra laterale attuale dovrebbe visualizzare."
|
265 |
+
|
266 |
+
#: ../content-aware-sidebars.php:797
|
267 |
+
msgid ""
|
268 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
269 |
+
" groups themselves use logical disjunction. This means that content added to"
|
270 |
+
" a group should be associated, as they are treated as such, and that the "
|
271 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
272 |
+
"extremely focused and at the same time distinct conditions."
|
273 |
+
msgstr "Il contenuto aggiunto a un gruppo di condizioni utilizza la congiunzione logica, mentre i gruppi di condizione si usano come disgiunzione logica. Ciò significa che il contenuto aggiunto a un gruppo dovrebbe essere associato e i gruppi non devono interferire uno con l'altro. In altre parole non è possibile ottenere le stesse condizioni concentrate allo stesso tempo."
|
274 |
+
|
275 |
+
#: ../content-aware-sidebars.php:800
|
276 |
+
msgid "More Information"
|
277 |
+
msgstr "Altre informazioni"
|
278 |
+
|
279 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
280 |
+
msgid "Get Support"
|
281 |
+
msgstr "Ottieni supporto"
|
282 |
+
|
283 |
+
#: ../content-aware-sidebars.php:816
|
284 |
+
msgid ""
|
285 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
286 |
+
" of the upcoming Premium Bundle*!"
|
287 |
+
msgstr "Traduci Content Aware Sidebars nella tua lingua e chiedi come diventare BETA tester del plugin Premium Bundle*!"
|
288 |
+
|
289 |
+
#: ../content-aware-sidebars.php:817
|
290 |
+
msgid "Translate Now"
|
291 |
+
msgstr "Traduci ora"
|
292 |
+
|
293 |
+
#: ../content-aware-sidebars.php:818
|
294 |
+
msgid "Get Premium Bundle"
|
295 |
+
msgstr "Ottieni Premium Bundle"
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:819
|
298 |
+
msgid ""
|
299 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
300 |
+
msgstr "E' una versione BETA e non è raccomandato l'uso su siti web già avviati."
|
301 |
+
|
302 |
+
#: ../content-aware-sidebars.php:822
|
303 |
+
msgid "Partial Feature List"
|
304 |
+
msgstr "Elenco parziale funzionalità"
|
305 |
+
|
306 |
+
#: ../content-aware-sidebars.php:824
|
307 |
+
msgid "Select and create sidebars in the Post Editing Screens"
|
308 |
+
msgstr "Seleziona e crea barre laterali nella schermata di modifica degli articoli"
|
309 |
+
|
310 |
+
#: ../content-aware-sidebars.php:825
|
311 |
+
msgid "Display sidebars with URLs using wildcards"
|
312 |
+
msgstr "Mostra barre laterali con URL utilizzando i caratteri jolly"
|
313 |
+
|
314 |
+
#: ../content-aware-sidebars.php:826
|
315 |
+
msgid "Display sidebars with User Roles"
|
316 |
+
msgstr "Mostra barre laterali con ruoli utente"
|
317 |
+
|
318 |
+
#: ../content-aware-sidebars.php:827
|
319 |
+
msgid "Display sidebars with BuddyPress User Groups"
|
320 |
+
msgstr "Mostra sidebars con gruppi utenti BuddyPress"
|
321 |
+
|
322 |
+
#: ../content-aware-sidebars.php:828
|
323 |
+
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
324 |
+
msgstr "Colonna sidebar nei tipi di articoli e anteprima tassonomie nella schermata"
|
325 |
+
|
326 |
+
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
327 |
+
msgid "Order"
|
328 |
+
msgstr "Ordina"
|
329 |
+
|
330 |
+
#: ../content-aware-sidebars.php:880
|
331 |
+
msgid "Give a review on WordPress.org"
|
332 |
+
msgstr "Valuta il plugin su WordPress.org"
|
333 |
+
|
334 |
+
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
335 |
+
msgid "Translate the plugin into your language"
|
336 |
+
msgstr "Traduci questo plugin nella tua lingua"
|
337 |
+
|
338 |
+
#: ../content-aware-sidebars.php:884
|
339 |
+
msgid "Read the FAQ"
|
340 |
+
msgstr "Leggi le FAQ"
|
341 |
+
|
342 |
+
#: ../content-aware-sidebars.php:899
|
343 |
+
msgid ""
|
344 |
+
"If you love this plugin, please consider donating to support future "
|
345 |
+
"development."
|
346 |
+
msgstr "Se ti piace questo plugin, considera l'eventualità di fare una donazione per supportare lo sviluppo."
|
347 |
+
|
348 |
+
#: ../content-aware-sidebars.php:908
|
349 |
+
msgid "Or you could:"
|
350 |
+
msgstr "Ti potrebbe anche interessare:"
|
351 |
+
|
352 |
+
#: ../content-aware-sidebars.php:910
|
353 |
+
msgid "Rate the plugin on WordPress.org"
|
354 |
+
msgstr "Valutare il plugin su WordPress.org"
|
355 |
+
|
356 |
+
#: ../content-aware-sidebars.php:911
|
357 |
+
msgid "Link to the plugin page"
|
358 |
+
msgstr "Collegati alla pagina WordPress del plugin"
|
359 |
+
|
360 |
+
#: ../content-aware-sidebars.php:1045
|
361 |
+
msgid "Filter Sidebars"
|
362 |
+
msgstr "Filtra barre laterali"
|
363 |
+
|
364 |
+
#: ../content-aware-sidebars.php:1046
|
365 |
+
msgid "Filter Widgets"
|
366 |
+
msgstr "Gestione Widgets"
|
367 |
+
|
368 |
+
#: ../lib/wp-content-aware-engine/core.php:204
|
369 |
+
msgid "Condition Group"
|
370 |
+
msgstr "Condizione gruppo "
|
371 |
+
|
372 |
+
#: ../lib/wp-content-aware-engine/core.php:205
|
373 |
+
msgctxt "group"
|
374 |
+
msgid "Add New"
|
375 |
+
msgstr "Aggiungi"
|
376 |
+
|
377 |
+
#: ../lib/wp-content-aware-engine/core.php:206
|
378 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
379 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
380 |
+
msgid "Add New Group"
|
381 |
+
msgstr "Aggiungi nuovo gruppo"
|
382 |
+
|
383 |
+
#: ../lib/wp-content-aware-engine/core.php:207
|
384 |
+
#: ../lib/wp-content-aware-engine/core.php:626
|
385 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
386 |
+
msgctxt "group"
|
387 |
+
msgid "Edit"
|
388 |
+
msgstr "Modifica"
|
389 |
+
|
390 |
+
#: ../lib/wp-content-aware-engine/core.php:212
|
391 |
+
#: ../lib/wp-content-aware-engine/core.php:440
|
392 |
+
msgid "No Groups found"
|
393 |
+
msgstr "Nessun gruppo trovato"
|
394 |
+
|
395 |
+
#: ../lib/wp-content-aware-engine/core.php:224
|
396 |
+
msgctxt "condition group"
|
397 |
+
msgid "Negated"
|
398 |
+
msgstr "Negato"
|
399 |
+
|
400 |
+
#: ../lib/wp-content-aware-engine/core.php:447
|
401 |
+
msgid "Content"
|
402 |
+
msgstr "Contenuto"
|
403 |
+
|
404 |
+
#: ../lib/wp-content-aware-engine/core.php:525
|
405 |
+
#: ../lib/wp-content-aware-engine/core.php:573
|
406 |
+
#: ../lib/wp-content-aware-engine/core.php:578
|
407 |
+
msgid "Unauthorized request"
|
408 |
+
msgstr "Richiesta non autorizzata"
|
409 |
+
|
410 |
+
#: ../lib/wp-content-aware-engine/core.php:531
|
411 |
+
msgid "Condition group cannot be empty"
|
412 |
+
msgstr "Impossibile creare condizioni di gruppo"
|
413 |
+
|
414 |
+
#: ../lib/wp-content-aware-engine/core.php:550
|
415 |
+
msgid "Condition group saved"
|
416 |
+
msgstr "Condizioni di gruppo salvate"
|
417 |
+
|
418 |
+
#: ../lib/wp-content-aware-engine/core.php:583
|
419 |
+
msgid "Condition group could not be removed"
|
420 |
+
msgstr "Le condizioni di gruppo non possono essere eliminate"
|
421 |
+
|
422 |
+
#: ../lib/wp-content-aware-engine/core.php:588
|
423 |
+
msgid "Condition group removed"
|
424 |
+
msgstr "Condizione di gruppo eliminata "
|
425 |
+
|
426 |
+
#: ../lib/wp-content-aware-engine/core.php:622
|
427 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
+
msgid "Save"
|
429 |
+
msgstr "Salva"
|
430 |
+
|
431 |
+
#: ../lib/wp-content-aware-engine/core.php:623
|
432 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
433 |
+
msgid "Cancel"
|
434 |
+
msgstr "Annulla"
|
435 |
+
|
436 |
+
#: ../lib/wp-content-aware-engine/core.php:624
|
437 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
438 |
+
msgid "Or"
|
439 |
+
msgstr "O"
|
440 |
+
|
441 |
+
#: ../lib/wp-content-aware-engine/core.php:625
|
442 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
443 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
444 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
445 |
+
msgid "And"
|
446 |
+
msgstr "E"
|
447 |
+
|
448 |
+
#: ../lib/wp-content-aware-engine/core.php:627
|
449 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
450 |
+
msgid "Remove"
|
451 |
+
msgstr "Elimina"
|
452 |
+
|
453 |
+
#: ../lib/wp-content-aware-engine/core.php:628
|
454 |
+
msgid "Remove this group and its contents permanently?"
|
455 |
+
msgstr "Vuoi eliminare questo gruppo e il suo contenuto in modo permanente?"
|
456 |
+
|
457 |
+
#: ../lib/wp-content-aware-engine/core.php:629
|
458 |
+
msgid "No results found."
|
459 |
+
msgstr "Nessuna risultato trovato"
|
460 |
+
|
461 |
+
#: ../lib/wp-content-aware-engine/core.php:630
|
462 |
+
msgid ""
|
463 |
+
"The current group has unsaved changes. Do you want to continue and discard "
|
464 |
+
"these changes?"
|
465 |
+
msgstr "Il gruppo attuale contiene modifiche non salvate. Vuoi proseguire e eliminare questi cambiamenti?"
|
466 |
+
|
467 |
+
#: ../lib/wp-content-aware-engine/core.php:632
|
468 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
469 |
+
msgid "Negate group"
|
470 |
+
msgstr "Gruppo negato"
|
471 |
+
|
472 |
+
#: ../lib/wp-content-aware-engine/core.php:633
|
473 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
+
msgid "Target all but this context"
|
475 |
+
msgstr "Obiettivo completo di questo contesto"
|
476 |
+
|
477 |
+
#: ../lib/wp-content-aware-engine/core.php:634
|
478 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
479 |
+
msgid "Target this context"
|
480 |
+
msgstr "Obiettivo di questo contesto"
|
481 |
+
|
482 |
+
#: ../lib/wp-content-aware-engine/module/author.php:30
|
483 |
+
msgid "Authors"
|
484 |
+
msgstr "Autori"
|
485 |
+
|
486 |
+
#: ../lib/wp-content-aware-engine/module/base.php:134
|
487 |
+
#, php-format
|
488 |
+
msgid "Display with All %s"
|
489 |
+
msgstr "Visualizza tutte le %s"
|
490 |
+
|
491 |
+
#: ../lib/wp-content-aware-engine/module/base.php:141
|
492 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
493 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
494 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
495 |
+
msgid "View All"
|
496 |
+
msgstr "Vedi tutto"
|
497 |
+
|
498 |
+
#: ../lib/wp-content-aware-engine/module/base.php:148
|
499 |
+
#: ../lib/wp-content-aware-engine/module/base.php:151
|
500 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
501 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
502 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
503 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
504 |
+
msgid "Search"
|
505 |
+
msgstr "Cerca"
|
506 |
+
|
507 |
+
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
508 |
+
msgid "bbPress User Profiles"
|
509 |
+
msgstr "Profilo utente bbPress"
|
510 |
+
|
511 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
512 |
+
msgid "BuddyPress Members"
|
513 |
+
msgstr "Utente BuddyPress"
|
514 |
+
|
515 |
+
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
516 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
517 |
+
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
518 |
+
msgid "Add to Group"
|
519 |
+
msgstr "Aggiungi al gruppo"
|
520 |
+
|
521 |
+
#: ../lib/wp-content-aware-engine/module/date.php:31
|
522 |
+
msgid "Dates"
|
523 |
+
msgstr "Dati"
|
524 |
+
|
525 |
+
#: ../lib/wp-content-aware-engine/module/date.php:70
|
526 |
+
msgid "Date Archives"
|
527 |
+
msgstr "Archivio dati"
|
528 |
+
|
529 |
+
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
530 |
+
msgid "Page Templates"
|
531 |
+
msgstr "Template pagine"
|
532 |
+
|
533 |
+
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
534 |
+
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
535 |
+
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
536 |
+
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
537 |
+
msgid "Languages"
|
538 |
+
msgstr "Lingue"
|
539 |
+
|
540 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
541 |
+
msgid "Post Types"
|
542 |
+
msgstr "Tipi di messaggi"
|
543 |
+
|
544 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
545 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
546 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
547 |
+
msgid "Automatically select new children of a selected ancestor"
|
548 |
+
msgstr "Seleziona automaticamente nuovi figli di un percorso selezionato"
|
549 |
+
|
550 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
551 |
+
msgid "Automatically add new children of a selected ancestor"
|
552 |
+
msgstr "Aggiungi automaticamente nuovi figli di un percorso selezionato"
|
553 |
+
|
554 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
555 |
+
#, php-format
|
556 |
+
msgid "%s Archives"
|
557 |
+
msgstr "%s Archivi"
|
558 |
+
|
559 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
560 |
+
msgid "Blog Page"
|
561 |
+
msgstr "Pagina Blog"
|
562 |
+
|
563 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
564 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
565 |
+
msgid "No items."
|
566 |
+
msgstr "Nessun oggetto."
|
567 |
+
|
568 |
+
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
569 |
+
msgid "Most Recent"
|
570 |
+
msgstr "Più recenti"
|
571 |
+
|
572 |
+
#: ../lib/wp-content-aware-engine/module/static.php:31
|
573 |
+
msgid "Static Pages"
|
574 |
+
msgstr "Pagine statiche"
|
575 |
+
|
576 |
+
#: ../lib/wp-content-aware-engine/module/static.php:44
|
577 |
+
msgid "Front Page"
|
578 |
+
msgstr "Pagina principale"
|
579 |
+
|
580 |
+
#: ../lib/wp-content-aware-engine/module/static.php:45
|
581 |
+
msgid "Search Results"
|
582 |
+
msgstr "Risultati di ricerca"
|
583 |
+
|
584 |
+
#: ../lib/wp-content-aware-engine/module/static.php:46
|
585 |
+
msgid "404 Page"
|
586 |
+
msgstr "Pagina 404"
|
587 |
+
|
588 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
589 |
+
msgid "Taxonomies"
|
590 |
+
msgstr "Tassonomie"
|
591 |
+
|
592 |
+
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
593 |
+
msgid "Most Used"
|
594 |
+
msgstr "Più usati"
|
595 |
+
|
596 |
+
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
597 |
+
msgid "Conditional Content"
|
598 |
+
msgstr "Condizione gruppo "
|
599 |
+
|
600 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
601 |
+
msgid ""
|
602 |
+
"Click to edit a group or create a new one. Select content on the left to add"
|
603 |
+
" it. In each group, you can combine different types of associated content."
|
604 |
+
msgstr "Clicca per modificare un gruppo o crearne uno nuovo. Seleziona il contenuto a sinistra per aggiungerlo. In ogni gruppo, è possibile combinare diversi tipi di contenuti associati."
|
605 |
+
|
606 |
+
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
607 |
+
#, php-format
|
608 |
+
msgid "All %s"
|
609 |
+
msgstr "Tutte le %s"
|
610 |
+
|
611 |
+
#: ../lib/wp-content-aware-engine/walker.php:175
|
612 |
+
msgid "Password protected"
|
613 |
+
msgstr "Protezione password "
|
614 |
+
|
615 |
+
#: ../lib/wp-content-aware-engine/walker.php:177
|
616 |
+
msgid "Private"
|
617 |
+
msgstr "Privato"
|
618 |
+
|
619 |
+
#: ../lib/wp-content-aware-engine/walker.php:179
|
620 |
+
msgid "Draft"
|
621 |
+
msgstr "Bozza"
|
622 |
+
|
623 |
+
#. translators: post state
|
624 |
+
#: ../lib/wp-content-aware-engine/walker.php:182
|
625 |
+
msgctxt "post state"
|
626 |
+
msgid "Pending"
|
627 |
+
msgstr "In attesa"
|
628 |
+
|
629 |
+
#: ../lib/wp-content-aware-engine/walker.php:184
|
630 |
+
msgid "Sticky"
|
631 |
+
msgstr "Importante"
|
632 |
+
|
633 |
+
#: ../lib/wp-content-aware-engine/walker.php:186
|
634 |
+
msgid "Scheduled"
|
635 |
+
msgstr "Programmato"
|
636 |
+
|
637 |
+
#: ../pointers.php:68
|
638 |
+
msgid "Get started"
|
639 |
+
msgstr "Come iniziare"
|
640 |
+
|
641 |
+
#: ../pointers.php:69
|
642 |
+
msgid ""
|
643 |
+
"You've just installed Content Aware Sidebars!\n"
|
644 |
+
"\n"
|
645 |
+
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
646 |
+
"\n"
|
647 |
+
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
648 |
+
msgstr "Hai appena installato Content Aware Sidebars!\n\nCi sono tante opzioni, in apparenza può sembrare complicato, non preoccuparti. \n\nClicca su Inizia Tour per visualizzare una rapida introduzione e imparare come visualizzare una barra laterale esattamente dove e quando la desideri."
|
649 |
+
|
650 |
+
#: ../pointers.php:76
|
651 |
+
msgid "Start Tour"
|
652 |
+
msgstr "Inizia Tour"
|
653 |
+
|
654 |
+
#: ../pointers.php:78
|
655 |
+
msgid "Not now"
|
656 |
+
msgstr "Non ora"
|
657 |
+
|
658 |
+
#: ../pointers.php:83
|
659 |
+
msgid ""
|
660 |
+
"To make a sidebar contextual, you start by creating a condition group.\n"
|
661 |
+
"\n"
|
662 |
+
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
663 |
+
"\n"
|
664 |
+
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
665 |
+
msgstr "Per creare una barra laterale devi prima creare una condizione al gruppo.\n\nLe condizioni dei gruppi sono isolate le une dalle altre , il che significa che una barra laterale può avere condizioni molto differenti.\n\nNegare un gruppo significa che la barra laterale verrà visualizzato su tutti, ma a queste condizioni ."
|
666 |
+
|
667 |
+
#: ../pointers.php:92
|
668 |
+
msgid "Content and contexts"
|
669 |
+
msgstr "Contenuto e contesto"
|
670 |
+
|
671 |
+
#: ../pointers.php:93
|
672 |
+
msgid ""
|
673 |
+
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
674 |
+
"\n"
|
675 |
+
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
676 |
+
"\n"
|
677 |
+
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
678 |
+
msgstr "Qui troverai tutti i contenuti che riguardano Content Aware Sidebars. \n\nBasta selezionare il contenuto che desideri e aggiungerlo a un gruppo .\n\nPuoi combinare contenuti associati in ogni gruppo; prova a selezionale \"Tutti gli articoli\", una Categoria e un Autore. Impressionante!"
|
679 |
+
|
680 |
+
#: ../pointers.php:102
|
681 |
+
msgid "Options, options"
|
682 |
+
msgstr "Opzioni, opzioni"
|
683 |
+
|
684 |
+
#: ../pointers.php:103
|
685 |
+
msgid ""
|
686 |
+
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
687 |
+
"\n"
|
688 |
+
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
689 |
+
"\n"
|
690 |
+
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
691 |
+
"\n"
|
692 |
+
" You are in control."
|
693 |
+
msgstr "Se la barra laterale viene visualizzato su pagine e/o archivi singoli ?\n\nSe dovesse fondersi con un'altra barra laterale o sostituirla ? Forse vuoi inserire manualmente il contenuto con un shortcode .\n\nPianificare la barra laterale, proprio come si fa con i messaggi e le pagine, o renderlo privato in modo che sia visibile solo per gli utenti registrati .\n\n Hai il pieno controllo."
|
694 |
+
|
695 |
+
#: ../pointers.php:112
|
696 |
+
msgid "Help and Support"
|
697 |
+
msgstr "Aiuto e Supporto"
|
698 |
+
|
699 |
+
#: ../pointers.php:113
|
700 |
+
msgid ""
|
701 |
+
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
702 |
+
"\n"
|
703 |
+
"If you need more help, click on the \"Help\" tab here."
|
704 |
+
msgstr "Questo è tutto! Ora puoi iniziare a creare le barre laterali e le visualizzi con le tue condizioni .\n\nSe hai bisogno di più aiut , fai clic sulla scheda \"Aiuto\" qui."
|
705 |
+
|
706 |
+
#: ../pointers.php:142
|
707 |
+
msgid "Close"
|
708 |
+
msgstr "Chiudi"
|
709 |
+
|
710 |
+
#: ../pointers.php:143
|
711 |
+
msgid "Next"
|
712 |
+
msgstr "Seguente"
|
lang/content-aware-sidebars-ja.po
CHANGED
@@ -1,707 +1,707 @@
|
|
1 |
-
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
-
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
-
# Translators:
|
4 |
-
# Ash F <fujita@handyla.com>, 2015
|
5 |
-
# Takafumi Kojima <tkfmkjm@gmail.com>, 2015
|
6 |
-
msgid ""
|
7 |
-
msgstr ""
|
8 |
-
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
-
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
-
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
-
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
-
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
-
"Language-Team: Japanese (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ja/)\n"
|
14 |
-
"MIME-Version: 1.0\n"
|
15 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
-
"Content-Transfer-Encoding: 8bit\n"
|
17 |
-
"Language: ja\n"
|
18 |
-
"Plural-Forms: nplurals=1; plural=0;\n"
|
19 |
-
"X-Generator: Poedit 1.7.6\n"
|
20 |
-
"X-Poedit-Basepath: .\n"
|
21 |
-
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
-
"X-Poedit-SearchPath-0: .\n"
|
23 |
-
"X-Poedit-SearchPath-1: ..\n"
|
24 |
-
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
-
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
-
"X-Textdomain-Support: yes\n"
|
28 |
-
|
29 |
-
#: ../content-aware-sidebars.php:95
|
30 |
-
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
-
msgstr "閲覧されるコンテントによってサイドバーの管理と表示ができます。"
|
32 |
-
|
33 |
-
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
-
msgid "Content Aware Sidebars"
|
35 |
-
msgstr "Content Aware Sidebars"
|
36 |
-
|
37 |
-
#: ../content-aware-sidebars.php:97
|
38 |
-
msgid "Import"
|
39 |
-
msgstr "インポート"
|
40 |
-
|
41 |
-
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
-
msgid "FAQ"
|
43 |
-
msgstr "よくある質問"
|
44 |
-
|
45 |
-
#: ../content-aware-sidebars.php:256
|
46 |
-
msgid "Exposure"
|
47 |
-
msgstr "表示"
|
48 |
-
|
49 |
-
#: ../content-aware-sidebars.php:260
|
50 |
-
msgid "Singular"
|
51 |
-
msgstr "単一"
|
52 |
-
|
53 |
-
#: ../content-aware-sidebars.php:261
|
54 |
-
msgid "Singular & Archive"
|
55 |
-
msgstr "単一 & アーカイブ"
|
56 |
-
|
57 |
-
#: ../content-aware-sidebars.php:262
|
58 |
-
msgid "Archive"
|
59 |
-
msgstr "アーカイブ"
|
60 |
-
|
61 |
-
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
-
msgctxt "option"
|
63 |
-
msgid "Handle"
|
64 |
-
msgstr "処理"
|
65 |
-
|
66 |
-
#: ../content-aware-sidebars.php:271
|
67 |
-
msgid "Replace"
|
68 |
-
msgstr "置換"
|
69 |
-
|
70 |
-
#: ../content-aware-sidebars.php:272
|
71 |
-
msgid "Merge"
|
72 |
-
msgstr "結合"
|
73 |
-
|
74 |
-
#: ../content-aware-sidebars.php:273
|
75 |
-
msgid "Manual"
|
76 |
-
msgstr "手動"
|
77 |
-
|
78 |
-
#: ../content-aware-sidebars.php:274
|
79 |
-
msgid "Forced replace"
|
80 |
-
msgstr "強制置換"
|
81 |
-
|
82 |
-
#: ../content-aware-sidebars.php:276
|
83 |
-
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
-
msgstr "対象サイドバーを結合または手動追加による置換"
|
85 |
-
|
86 |
-
#: ../content-aware-sidebars.php:280
|
87 |
-
msgid "Host Sidebar"
|
88 |
-
msgstr "対象サイドバー"
|
89 |
-
|
90 |
-
#: ../content-aware-sidebars.php:287
|
91 |
-
msgid "Merge Position"
|
92 |
-
msgstr "結合位置"
|
93 |
-
|
94 |
-
#: ../content-aware-sidebars.php:291
|
95 |
-
msgid "Top"
|
96 |
-
msgstr "上部"
|
97 |
-
|
98 |
-
#: ../content-aware-sidebars.php:292
|
99 |
-
msgid "Bottom"
|
100 |
-
msgstr "下部"
|
101 |
-
|
102 |
-
#: ../content-aware-sidebars.php:294
|
103 |
-
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
-
msgstr "結合時にサイドバーを対象の上部か下部に配置"
|
105 |
-
|
106 |
-
#: ../content-aware-sidebars.php:309
|
107 |
-
msgid "Sidebars"
|
108 |
-
msgstr "サイドバー"
|
109 |
-
|
110 |
-
#: ../content-aware-sidebars.php:310
|
111 |
-
msgid "Sidebar"
|
112 |
-
msgstr "サイドバー"
|
113 |
-
|
114 |
-
#: ../content-aware-sidebars.php:311
|
115 |
-
msgctxt "sidebar"
|
116 |
-
msgid "Add New"
|
117 |
-
msgstr "新規追加"
|
118 |
-
|
119 |
-
#: ../content-aware-sidebars.php:312
|
120 |
-
msgid "Add New Sidebar"
|
121 |
-
msgstr "新規サイドバーを追加"
|
122 |
-
|
123 |
-
#: ../content-aware-sidebars.php:313
|
124 |
-
msgid "Edit Sidebar"
|
125 |
-
msgstr "サイドバーを編集"
|
126 |
-
|
127 |
-
#: ../content-aware-sidebars.php:314
|
128 |
-
msgid "New Sidebar"
|
129 |
-
msgstr "新規サイドバー"
|
130 |
-
|
131 |
-
#: ../content-aware-sidebars.php:315
|
132 |
-
msgid "All Sidebars"
|
133 |
-
msgstr "全てのサイドバー"
|
134 |
-
|
135 |
-
#: ../content-aware-sidebars.php:316
|
136 |
-
msgid "View Sidebar"
|
137 |
-
msgstr "サイドバーを表示"
|
138 |
-
|
139 |
-
#: ../content-aware-sidebars.php:317
|
140 |
-
msgid "Search Sidebars"
|
141 |
-
msgstr "サイドバーを検索"
|
142 |
-
|
143 |
-
#: ../content-aware-sidebars.php:318
|
144 |
-
msgid "No sidebars found"
|
145 |
-
msgstr "サイドバーが見つかりません"
|
146 |
-
|
147 |
-
#: ../content-aware-sidebars.php:319
|
148 |
-
msgid "No sidebars found in Trash"
|
149 |
-
msgstr "ゴミ箱にサイドバーは入っていません"
|
150 |
-
|
151 |
-
#: ../content-aware-sidebars.php:321
|
152 |
-
msgid "Display sidebar with"
|
153 |
-
msgstr "サイドバーを同時に表示:"
|
154 |
-
|
155 |
-
#: ../content-aware-sidebars.php:322
|
156 |
-
msgid ""
|
157 |
-
"No content. Please add at least one condition group to make the sidebar "
|
158 |
-
"content aware."
|
159 |
-
msgstr "条件がありません。サイドバーをコンテントに反応させる為には少なくとも条件グループを一つ追加してください。"
|
160 |
-
|
161 |
-
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
-
msgid "Manage widgets"
|
163 |
-
msgstr "ウィジェットを管理"
|
164 |
-
|
165 |
-
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
-
msgid "Sidebar updated."
|
167 |
-
msgstr "サイドバーを更新しました"
|
168 |
-
|
169 |
-
#: ../content-aware-sidebars.php:361
|
170 |
-
msgid "Sidebar published."
|
171 |
-
msgstr "サイドバーを公開しました"
|
172 |
-
|
173 |
-
#: ../content-aware-sidebars.php:362
|
174 |
-
msgid "Sidebar saved."
|
175 |
-
msgstr "サイドバーを保存しました"
|
176 |
-
|
177 |
-
#: ../content-aware-sidebars.php:363
|
178 |
-
msgid "Sidebar submitted."
|
179 |
-
msgstr "サイドバーを送信しました"
|
180 |
-
|
181 |
-
#: ../content-aware-sidebars.php:364
|
182 |
-
#, php-format
|
183 |
-
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
-
msgstr "公開予定日時: <strong>%1$s</strong>."
|
185 |
-
|
186 |
-
#. translators: Publish box date format, see http://php.net/date
|
187 |
-
#: ../content-aware-sidebars.php:366
|
188 |
-
msgid "M j, Y @ G:i"
|
189 |
-
msgstr "M j, Y @ G:i"
|
190 |
-
|
191 |
-
#: ../content-aware-sidebars.php:367
|
192 |
-
msgid "Sidebar draft updated."
|
193 |
-
msgstr "サイドバーの下書きを更新しました"
|
194 |
-
|
195 |
-
#: ../content-aware-sidebars.php:383
|
196 |
-
#, php-format
|
197 |
-
msgid "%s sidebar updated."
|
198 |
-
msgid_plural "%s sidebars updated."
|
199 |
-
msgstr[0] ""
|
200 |
-
|
201 |
-
#: ../content-aware-sidebars.php:384
|
202 |
-
#, php-format
|
203 |
-
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
-
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
-
msgstr[0] ""
|
206 |
-
|
207 |
-
#: ../content-aware-sidebars.php:385
|
208 |
-
#, php-format
|
209 |
-
msgid "%s sidebar permanently deleted."
|
210 |
-
msgid_plural "%s sidebars permanently deleted."
|
211 |
-
msgstr[0] ""
|
212 |
-
|
213 |
-
#: ../content-aware-sidebars.php:386
|
214 |
-
#, php-format
|
215 |
-
msgid "%s sidebar moved to the Trash."
|
216 |
-
msgid_plural "%s sidebars moved to the Trash."
|
217 |
-
msgstr[0] ""
|
218 |
-
|
219 |
-
#: ../content-aware-sidebars.php:387
|
220 |
-
#, php-format
|
221 |
-
msgid "%s sidebar restored from the Trash."
|
222 |
-
msgid_plural "%s sidebars restored from the Trash."
|
223 |
-
msgstr[0] ""
|
224 |
-
|
225 |
-
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
226 |
-
msgid "Please update Host Sidebar"
|
227 |
-
msgstr "対象サイドバーを更新してください"
|
228 |
-
|
229 |
-
#: ../content-aware-sidebars.php:472
|
230 |
-
msgid "Merge position"
|
231 |
-
msgstr "結合位置"
|
232 |
-
|
233 |
-
#: ../content-aware-sidebars.php:473
|
234 |
-
msgid "Widgets"
|
235 |
-
msgstr "ウィジェット"
|
236 |
-
|
237 |
-
#: ../content-aware-sidebars.php:586
|
238 |
-
msgid "Manage Widgets"
|
239 |
-
msgstr "ウィジェットを管理"
|
240 |
-
|
241 |
-
#: ../content-aware-sidebars.php:756
|
242 |
-
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
243 |
-
msgstr "Content Aware Sidebars プレミアムバンドルを無料ゲット"
|
244 |
-
|
245 |
-
#: ../content-aware-sidebars.php:772
|
246 |
-
msgid "Options"
|
247 |
-
msgstr "オプション"
|
248 |
-
|
249 |
-
#: ../content-aware-sidebars.php:795
|
250 |
-
#: ../lib/wp-content-aware-engine/core.php:203
|
251 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
252 |
-
msgid "Condition Groups"
|
253 |
-
msgstr "条件グループ"
|
254 |
-
|
255 |
-
#: ../content-aware-sidebars.php:796
|
256 |
-
msgid ""
|
257 |
-
"Each created condition group describe some specific content (conditions) "
|
258 |
-
"that the current sidebar should be displayed with."
|
259 |
-
msgstr "作成された各条件グループは現在のサイドバーが表示されるべき特定のコンテント(条件)を表します。"
|
260 |
-
|
261 |
-
#: ../content-aware-sidebars.php:797
|
262 |
-
msgid ""
|
263 |
-
"Content added to a condition group uses logical conjunction, while condition"
|
264 |
-
" groups themselves use logical disjunction. This means that content added to"
|
265 |
-
" a group should be associated, as they are treated as such, and that the "
|
266 |
-
"groups do not interfere with each other. Thus it is possible to have both "
|
267 |
-
"extremely focused and at the same time distinct conditions."
|
268 |
-
msgstr "条件グループ自体が論理和を使用する一方、条件グループに追加されたコンテントは論理積を使用します。\nつまり、条件グループに追加されたコンテントは関連項目のように扱われグループ同士は妨害しません。\nよって、非常に密度の高く且つ独特な条件を持つことができます。"
|
269 |
-
|
270 |
-
#: ../content-aware-sidebars.php:800
|
271 |
-
msgid "More Information"
|
272 |
-
msgstr "詳細情報"
|
273 |
-
|
274 |
-
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
275 |
-
msgid "Get Support"
|
276 |
-
msgstr "サポートに連絡"
|
277 |
-
|
278 |
-
#: ../content-aware-sidebars.php:816
|
279 |
-
msgid ""
|
280 |
-
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
281 |
-
" of the upcoming Premium Bundle*!"
|
282 |
-
msgstr "Content Aware Sidebars を貴方の言語に翻訳、またはもうすぐ発表されるプレミアムバンドル*のベータテスターになりませんか!"
|
283 |
-
|
284 |
-
#: ../content-aware-sidebars.php:817
|
285 |
-
msgid "Translate Now"
|
286 |
-
msgstr "翻訳する"
|
287 |
-
|
288 |
-
#: ../content-aware-sidebars.php:818
|
289 |
-
msgid "Get Premium Bundle"
|
290 |
-
msgstr "プレミアムバンドルをゲット"
|
291 |
-
|
292 |
-
#: ../content-aware-sidebars.php:819
|
293 |
-
msgid ""
|
294 |
-
"Single-site use. BETA implies it is not recommended for production sites."
|
295 |
-
msgstr "単一サイトに限ります。ベータですので公開中のサイトには使用を推奨しません。\n."
|
296 |
-
|
297 |
-
#: ../content-aware-sidebars.php:822
|
298 |
-
msgid "
|
299 |
-
msgstr "機能の一部リスト"
|
300 |
-
|
301 |
-
#: ../content-aware-sidebars.php:824
|
302 |
-
msgid "Select and create sidebars in the Post Editing Screens"
|
303 |
-
msgstr "記事編集画面でサイドバーを選択、作成"
|
304 |
-
|
305 |
-
#: ../content-aware-sidebars.php:825
|
306 |
-
msgid "Display sidebars with URLs using wildcards"
|
307 |
-
msgstr "ワイルドカードを使ったURLでサイドバーを表示"
|
308 |
-
|
309 |
-
#: ../content-aware-sidebars.php:826
|
310 |
-
msgid "Display sidebars with User Roles"
|
311 |
-
msgstr "ユーザロールでサイドバーを表示"
|
312 |
-
|
313 |
-
#: ../content-aware-sidebars.php:827
|
314 |
-
msgid "Display sidebars with BuddyPress User Groups"
|
315 |
-
msgstr "BuddyPress ユーザーグループでサイドバーを表示"
|
316 |
-
|
317 |
-
#: ../content-aware-sidebars.php:828
|
318 |
-
msgid "Sidebars column in Post Type and Taxonomy Overview Screens"
|
319 |
-
msgstr "投稿タイプや分類の一覧画面にサイドバーのコラムを表示"
|
320 |
-
|
321 |
-
#: ../content-aware-sidebars.php:864 ../content-aware-sidebars.php:865
|
322 |
-
msgid "Order"
|
323 |
-
msgstr "オーダー"
|
324 |
-
|
325 |
-
#: ../content-aware-sidebars.php:880
|
326 |
-
msgid "Give a review on WordPress.org"
|
327 |
-
msgstr ""
|
328 |
-
|
329 |
-
#: ../content-aware-sidebars.php:882 ../content-aware-sidebars.php:912
|
330 |
-
msgid "Translate the plugin into your language"
|
331 |
-
msgstr "プラグインを貴方の言語に翻訳する"
|
332 |
-
|
333 |
-
#: ../content-aware-sidebars.php:884
|
334 |
-
msgid "Read the FAQ"
|
335 |
-
msgstr ""
|
336 |
-
|
337 |
-
#: ../content-aware-sidebars.php:899
|
338 |
-
msgid ""
|
339 |
-
"If you love this plugin, please consider donating to support future "
|
340 |
-
"development."
|
341 |
-
msgstr "もしこのプラグインが気に入ったら、将来の開発を支援する寄付にご協力ください。"
|
342 |
-
|
343 |
-
#: ../content-aware-sidebars.php:908
|
344 |
-
msgid "Or you could:"
|
345 |
-
msgstr "あるいは:"
|
346 |
-
|
347 |
-
#: ../content-aware-sidebars.php:910
|
348 |
-
msgid "Rate the plugin on WordPress.org"
|
349 |
-
msgstr "WordPress.orgでプラグンを評価する"
|
350 |
-
|
351 |
-
#: ../content-aware-sidebars.php:911
|
352 |
-
msgid "Link to the plugin page"
|
353 |
-
msgstr "プラグインのページをリンクする"
|
354 |
-
|
355 |
-
#: ../content-aware-sidebars.php:1045
|
356 |
-
msgid "Filter Sidebars"
|
357 |
-
msgstr "サイドバーをフィルターする"
|
358 |
-
|
359 |
-
#: ../content-aware-sidebars.php:1046
|
360 |
-
msgid "Filter Widgets"
|
361 |
-
msgstr ""
|
362 |
-
|
363 |
-
#: ../lib/wp-content-aware-engine/core.php:204
|
364 |
-
msgid "Condition Group"
|
365 |
-
msgstr "条件グループ"
|
366 |
-
|
367 |
-
#: ../lib/wp-content-aware-engine/core.php:205
|
368 |
-
msgctxt "group"
|
369 |
-
msgid "Add New"
|
370 |
-
msgstr "新規追加"
|
371 |
-
|
372 |
-
#: ../lib/wp-content-aware-engine/core.php:206
|
373 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:21
|
374 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:65
|
375 |
-
msgid "Add New Group"
|
376 |
-
msgstr "新規グループを追加"
|
377 |
-
|
378 |
-
#: ../lib/wp-content-aware-engine/core.php:207
|
379 |
-
#: ../lib/wp-content-aware-engine/core.php:626
|
380 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
381 |
-
msgctxt "group"
|
382 |
-
msgid "Edit"
|
383 |
-
msgstr "編集"
|
384 |
-
|
385 |
-
#: ../lib/wp-content-aware-engine/core.php:212
|
386 |
-
#: ../lib/wp-content-aware-engine/core.php:440
|
387 |
-
msgid "No Groups found"
|
388 |
-
msgstr "グループがありません"
|
389 |
-
|
390 |
-
#: ../lib/wp-content-aware-engine/core.php:224
|
391 |
-
msgctxt "condition group"
|
392 |
-
msgid "Negated"
|
393 |
-
msgstr "否定する"
|
394 |
-
|
395 |
-
#: ../lib/wp-content-aware-engine/core.php:447
|
396 |
-
msgid "Content"
|
397 |
-
msgstr "コンテント"
|
398 |
-
|
399 |
-
#: ../lib/wp-content-aware-engine/core.php:525
|
400 |
-
#: ../lib/wp-content-aware-engine/core.php:573
|
401 |
-
#: ../lib/wp-content-aware-engine/core.php:578
|
402 |
-
msgid "Unauthorized request"
|
403 |
-
msgstr "許可されていないリクエストです"
|
404 |
-
|
405 |
-
#: ../lib/wp-content-aware-engine/core.php:531
|
406 |
-
msgid "Condition group cannot be empty"
|
407 |
-
msgstr "条件グループは空にできません"
|
408 |
-
|
409 |
-
#: ../lib/wp-content-aware-engine/core.php:550
|
410 |
-
msgid "Condition group saved"
|
411 |
-
msgstr "条件グループを保存しました"
|
412 |
-
|
413 |
-
#: ../lib/wp-content-aware-engine/core.php:583
|
414 |
-
msgid "Condition group could not be removed"
|
415 |
-
msgstr "条件グループは削除できませんでした"
|
416 |
-
|
417 |
-
#: ../lib/wp-content-aware-engine/core.php:588
|
418 |
-
msgid "Condition group removed"
|
419 |
-
msgstr "条件グループを削除しました"
|
420 |
-
|
421 |
-
#: ../lib/wp-content-aware-engine/core.php:622
|
422 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
423 |
-
msgid "Save"
|
424 |
-
msgstr "保存"
|
425 |
-
|
426 |
-
#: ../lib/wp-content-aware-engine/core.php:623
|
427 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:35
|
428 |
-
msgid "Cancel"
|
429 |
-
msgstr "キャンセル"
|
430 |
-
|
431 |
-
#: ../lib/wp-content-aware-engine/core.php:624
|
432 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:56
|
433 |
-
msgid "Or"
|
434 |
-
msgstr "または"
|
435 |
-
|
436 |
-
#: ../lib/wp-content-aware-engine/core.php:625
|
437 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:172
|
438 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:228
|
439 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:11
|
440 |
-
msgid "And"
|
441 |
-
msgstr ""
|
442 |
-
|
443 |
-
#: ../lib/wp-content-aware-engine/core.php:627
|
444 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:38
|
445 |
-
msgid "Remove"
|
446 |
-
msgstr "削除"
|
447 |
-
|
448 |
-
#: ../lib/wp-content-aware-engine/core.php:628
|
449 |
-
msgid "Remove this group and its contents permanently?"
|
450 |
-
msgstr "グループとその内容を削除してもよろしいですか?"
|
451 |
-
|
452 |
-
#: ../lib/wp-content-aware-engine/core.php:629
|
453 |
-
msgid "No results found."
|
454 |
-
msgstr "見つかりませんでした"
|
455 |
-
|
456 |
-
#: ../lib/wp-content-aware-engine/core.php:630
|
457 |
-
msgid ""
|
458 |
-
"The current group has unsaved changes. Do you want to continue and discard "
|
459 |
-
"these changes?"
|
460 |
-
msgstr "現在のグループはまだ保存されていません。続行して変更内容を破棄しますか?"
|
461 |
-
|
462 |
-
#: ../lib/wp-content-aware-engine/core.php:632
|
463 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:45
|
464 |
-
msgid "Negate group"
|
465 |
-
msgstr "グループを否定する"
|
466 |
-
|
467 |
-
#: ../lib/wp-content-aware-engine/core.php:633
|
468 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
469 |
-
msgid "Target all but this context"
|
470 |
-
msgstr "この状況以外全てを対象"
|
471 |
-
|
472 |
-
#: ../lib/wp-content-aware-engine/core.php:634
|
473 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:49
|
474 |
-
msgid "Target this context"
|
475 |
-
msgstr "この状況を対象"
|
476 |
-
|
477 |
-
#: ../lib/wp-content-aware-engine/module/author.php:30
|
478 |
-
msgid "Authors"
|
479 |
-
msgstr "投稿者"
|
480 |
-
|
481 |
-
#: ../lib/wp-content-aware-engine/module/base.php:134
|
482 |
-
#, php-format
|
483 |
-
msgid "Display with All %s"
|
484 |
-
msgstr "全ての %sで表示"
|
485 |
-
|
486 |
-
#: ../lib/wp-content-aware-engine/module/base.php:141
|
487 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:139
|
488 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:278
|
489 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:302
|
490 |
-
msgid "View All"
|
491 |
-
msgstr "全て表示"
|
492 |
-
|
493 |
-
#: ../lib/wp-content-aware-engine/module/base.php:148
|
494 |
-
#: ../lib/wp-content-aware-engine/module/base.php:151
|
495 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:284
|
496 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:287
|
497 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:308
|
498 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:311
|
499 |
-
msgid "Search"
|
500 |
-
msgstr "検索"
|
501 |
-
|
502 |
-
#: ../lib/wp-content-aware-engine/module/bbpress.php:31
|
503 |
-
msgid "bbPress User Profiles"
|
504 |
-
msgstr "bbPress ユーザープロフィール"
|
505 |
-
|
506 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:29
|
507 |
-
msgid "BuddyPress Members"
|
508 |
-
msgstr "BuddyPress メンバー"
|
509 |
-
|
510 |
-
#: ../lib/wp-content-aware-engine/module/bp_member.php:148
|
511 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:321
|
512 |
-
#: ../lib/wp-content-aware-engine/view/module/meta_box.php:24
|
513 |
-
msgid "Add to Group"
|
514 |
-
msgstr "グループを追加"
|
515 |
-
|
516 |
-
#: ../lib/wp-content-aware-engine/module/date.php:31
|
517 |
-
msgid "Dates"
|
518 |
-
msgstr "日付"
|
519 |
-
|
520 |
-
#: ../lib/wp-content-aware-engine/module/date.php:70
|
521 |
-
msgid "Date Archives"
|
522 |
-
msgstr "日付アーカイブ"
|
523 |
-
|
524 |
-
#: ../lib/wp-content-aware-engine/module/page_template.php:30
|
525 |
-
msgid "Page Templates"
|
526 |
-
msgstr "ページテンプレート"
|
527 |
-
|
528 |
-
#: ../lib/wp-content-aware-engine/module/polylang.php:29
|
529 |
-
#: ../lib/wp-content-aware-engine/module/qtranslate.php:29
|
530 |
-
#: ../lib/wp-content-aware-engine/module/transposh.php:29
|
531 |
-
#: ../lib/wp-content-aware-engine/module/wpml.php:29
|
532 |
-
msgid "Languages"
|
533 |
-
msgstr "言語"
|
534 |
-
|
535 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:37
|
536 |
-
msgid "Post Types"
|
537 |
-
msgstr "投稿タイプ"
|
538 |
-
|
539 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:177
|
540 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:233
|
541 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:276
|
542 |
-
msgid "Automatically select new children of a selected ancestor"
|
543 |
-
msgstr "選択項目の子が作成された場合自動選択する"
|
544 |
-
|
545 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:245
|
546 |
-
msgid "Automatically add new children of a selected ancestor"
|
547 |
-
msgstr "選択項目の子が作成された場合自動追加する"
|
548 |
-
|
549 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:250
|
550 |
-
#, php-format
|
551 |
-
msgid "%s Archives"
|
552 |
-
msgstr "%s のアーカイブ"
|
553 |
-
|
554 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:251
|
555 |
-
msgid "Blog Page"
|
556 |
-
msgstr "ブログページ"
|
557 |
-
|
558 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:258
|
559 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:284
|
560 |
-
msgid "No items."
|
561 |
-
msgstr "項目がありません。"
|
562 |
-
|
563 |
-
#: ../lib/wp-content-aware-engine/module/post_type.php:273
|
564 |
-
msgid "Most Recent"
|
565 |
-
msgstr "最近の"
|
566 |
-
|
567 |
-
#: ../lib/wp-content-aware-engine/module/static.php:31
|
568 |
-
msgid "Static Pages"
|
569 |
-
msgstr "固定ページ"
|
570 |
-
|
571 |
-
#: ../lib/wp-content-aware-engine/module/static.php:44
|
572 |
-
msgid "Front Page"
|
573 |
-
msgstr "フロントページ"
|
574 |
-
|
575 |
-
#: ../lib/wp-content-aware-engine/module/static.php:45
|
576 |
-
msgid "Search Results"
|
577 |
-
msgstr "検索結果"
|
578 |
-
|
579 |
-
#: ../lib/wp-content-aware-engine/module/static.php:46
|
580 |
-
msgid "404 Page"
|
581 |
-
msgstr "404ページ"
|
582 |
-
|
583 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:44
|
584 |
-
msgid "Taxonomies"
|
585 |
-
msgstr "分類"
|
586 |
-
|
587 |
-
#: ../lib/wp-content-aware-engine/module/taxonomy.php:297
|
588 |
-
msgid "Most Used"
|
589 |
-
msgstr "最も使用された"
|
590 |
-
|
591 |
-
#: ../lib/wp-content-aware-engine/posttypemanager.php:63
|
592 |
-
msgid "Conditional Content"
|
593 |
-
msgstr ""
|
594 |
-
|
595 |
-
#: ../lib/wp-content-aware-engine/view/meta_box.php:24
|
596 |
-
msgid ""
|
597 |
-
"Click to edit a group or create a new one. Select content on the left to add"
|
598 |
-
" it. In each group, you can combine different types of associated content."
|
599 |
-
msgstr "クリックしてグループを編集するか新規作成できます。左側にあるコンテントを選択して追加してください。各グループで違う種類のコンテントを組み合わせることができます。"
|
600 |
-
|
601 |
-
#: ../lib/wp-content-aware-engine/view/module/group.php:17
|
602 |
-
#, php-format
|
603 |
-
msgid "All %s"
|
604 |
-
msgstr "全ての %s"
|
605 |
-
|
606 |
-
#: ../lib/wp-content-aware-engine/walker.php:175
|
607 |
-
msgid "Password protected"
|
608 |
-
msgstr ""
|
609 |
-
|
610 |
-
#: ../lib/wp-content-aware-engine/walker.php:177
|
611 |
-
msgid "Private"
|
612 |
-
msgstr ""
|
613 |
-
|
614 |
-
#: ../lib/wp-content-aware-engine/walker.php:179
|
615 |
-
msgid "Draft"
|
616 |
-
msgstr ""
|
617 |
-
|
618 |
-
#. translators: post state
|
619 |
-
#: ../lib/wp-content-aware-engine/walker.php:182
|
620 |
-
msgctxt "post state"
|
621 |
-
msgid "Pending"
|
622 |
-
msgstr ""
|
623 |
-
|
624 |
-
#: ../lib/wp-content-aware-engine/walker.php:184
|
625 |
-
msgid "Sticky"
|
626 |
-
msgstr ""
|
627 |
-
|
628 |
-
#: ../lib/wp-content-aware-engine/walker.php:186
|
629 |
-
msgid "Scheduled"
|
630 |
-
msgstr ""
|
631 |
-
|
632 |
-
#: ../pointers.php:68
|
633 |
-
msgid "Get started"
|
634 |
-
msgstr "始める"
|
635 |
-
|
636 |
-
#: ../pointers.php:69
|
637 |
-
msgid ""
|
638 |
-
"You've just installed Content Aware Sidebars!\n"
|
639 |
-
"\n"
|
640 |
-
"It gives you a lot of options, so this screen might look overwhelming at first. Don't worry.\n"
|
641 |
-
"\n"
|
642 |
-
"Click Start Tour to view a quick introduction and learn how to display a sidebar exactly where and when you want it to."
|
643 |
-
msgstr "Content Aware Sidebars をインストールしました!\n\nオプションが沢山あって面倒に見えるかもしれませんがご心配なく。\n\n「ツアーを開始」をクリックすると簡単な紹介とサイドバーを思い通りに表示するための説明をご覧になれます。"
|
644 |
-
|
645 |
-
#: ../pointers.php:76
|
646 |
-
msgid "Start Tour"
|
647 |
-
msgstr "ツアーを開始"
|
648 |
-
|
649 |
-
#: ../pointers.php:78
|
650 |
-
msgid "Not now"
|
651 |
-
msgstr "後で"
|
652 |
-
|
653 |
-
#: ../pointers.php:83
|
654 |
-
msgid ""
|
655 |
-
"To make a sidebar contextual, you start by creating a condition group.\n"
|
656 |
-
"\n"
|
657 |
-
"Condition groups are isolated from each other, meaning that a sidebar can have very different conditions.\n"
|
658 |
-
"\n"
|
659 |
-
"Negating a group means that the sidebar will be displayed on all but those conditions."
|
660 |
-
msgstr "サイドバーを反応させる為には、まず条件グループをつくることです。\n\n各条件グループは独立しており、一つのサイドバーが複数の異なる条件を持つことができます。\n\nグループを否定することによりサイドバーがその条件以外の時に表示されます。"
|
661 |
-
|
662 |
-
#: ../pointers.php:92
|
663 |
-
msgid "Content and contexts"
|
664 |
-
msgstr "コンテントと状況"
|
665 |
-
|
666 |
-
#: ../pointers.php:93
|
667 |
-
msgid ""
|
668 |
-
"Here you'll find all the content on your site that Content Aware Sidebars supports out of the box.\n"
|
669 |
-
"\n"
|
670 |
-
"Simply select the content you want the sidebar to be displayed with and add it to a group.\n"
|
671 |
-
"\n"
|
672 |
-
"You can even combine associated content in one group; try selecting \"All Posts\", a Category and an Author. Awesome!"
|
673 |
-
msgstr "これらが Content Aware Sidebars が標準でサポートするコンテントの一覧です。\n\nサイドバーを表示したいコンテントを選んでグループに追加するだけです。\n\n関連コンテントを一つのグループにまとめることもできます。試しに「全ての投稿」、カテゴリー、投稿者を選択してみてください。素晴らしいでしょう!"
|
674 |
-
|
675 |
-
#: ../pointers.php:102
|
676 |
-
msgid "Options, options"
|
677 |
-
msgstr "オプション"
|
678 |
-
|
679 |
-
#: ../pointers.php:103
|
680 |
-
msgid ""
|
681 |
-
"Should the sidebar be displayed on singular pages and/or archives?\n"
|
682 |
-
"\n"
|
683 |
-
"Should it merge with another sidebar or replace it? Maybe you want to insert it manually in your content with a shortcode.\n"
|
684 |
-
"\n"
|
685 |
-
"Schedule the sidebar just like you do with posts and pages, or make it private so that it is only visible for logged-in users.\n"
|
686 |
-
"\n"
|
687 |
-
" You are in control."
|
688 |
-
msgstr "サイドバーを単一ページとアーカイブのどちらか、または両方に表示したいですか?\n\nサイドバーを他のサイドバーと結合、または置換したいですか?\nショートコードを使ってコンテントに手動挿入したいかもしれませんね。\n\nサイドバーを記事やページの様に公開予約したりプライベートにしてログインしたユーザのみに見せることができます。\n\nあなたの思い通りにできます。"
|
689 |
-
|
690 |
-
#: ../pointers.php:112
|
691 |
-
msgid "Help and Support"
|
692 |
-
msgstr "ヘルプとサポート"
|
693 |
-
|
694 |
-
#: ../pointers.php:113
|
695 |
-
msgid ""
|
696 |
-
"That's it! Now you can start creating sidebars and display them on your own conditions.\n"
|
697 |
-
"\n"
|
698 |
-
"If you need more help, click on the \"Help\" tab here."
|
699 |
-
msgstr "以上です! これで貴方はサイドバーを作成して条件表示をすることができます。\n\nもしなにか必要なことがあったら「ヘルプ」タブを押してください。"
|
700 |
-
|
701 |
-
#: ../pointers.php:142
|
702 |
-
msgid "Close"
|
703 |
-
msgstr "閉じる"
|
704 |
-
|
705 |
-
#: ../pointers.php:143
|
706 |
-
msgid "Next"
|
707 |
-
msgstr "次へ"
|
1 |
+
# Copyright (C) 2012 Content Aware Sidebars
|
2 |
+
# This file is distributed under the same license as the Content Aware Sidebars package.
|
3 |
+
# Translators:
|
4 |
+
# Ash F <fujita@handyla.com>, 2015
|
5 |
+
# Takafumi Kojima <tkfmkjm@gmail.com>, 2015
|
6 |
+
msgid ""
|
7 |
+
msgstr ""
|
8 |
+
"Project-Id-Version: Content Aware Sidebars\n"
|
9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/content-aware-sidebars\n"
|
10 |
+
"POT-Creation-Date: 2015-10-01 16:11-0800\n"
|
11 |
+
"PO-Revision-Date: 2016-03-07 00:18+0000\n"
|
12 |
+
"Last-Translator: Joachim Jensen <jv@intox.dk>\n"
|
13 |
+
"Language-Team: Japanese (http://www.transifex.com/intoxstudio/content-aware-sidebars/language/ja/)\n"
|
14 |
+
"MIME-Version: 1.0\n"
|
15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
17 |
+
"Language: ja\n"
|
18 |
+
"Plural-Forms: nplurals=1; plural=0;\n"
|
19 |
+
"X-Generator: Poedit 1.7.6\n"
|
20 |
+
"X-Poedit-Basepath: .\n"
|
21 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_ex:1,2c;esc_attr__;esc_attr_e;esc_attr_x:1,2c;esc_html__;esc_html_e;esc_html_x:1,2c\n"
|
22 |
+
"X-Poedit-SearchPath-0: .\n"
|
23 |
+
"X-Poedit-SearchPath-1: ..\n"
|
24 |
+
"X-Poedit-SearchPathExcluded-0: ../node_modules\n"
|
25 |
+
"X-Poedit-SearchPathExcluded-1: ../lib/wp-content-aware-engine/node_modules\n"
|
26 |
+
"X-Poedit-SourceCharset: UTF-8\n"
|
27 |
+
"X-Textdomain-Support: yes\n"
|
28 |
+
|
29 |
+
#: ../content-aware-sidebars.php:95
|
30 |
+
msgid "Manage and show sidebars according to the content being viewed."
|
31 |
+
msgstr "閲覧されるコンテントによってサイドバーの管理と表示ができます。"
|
32 |
+
|
33 |
+
#: ../content-aware-sidebars.php:96 ../content-aware-sidebars.php:748
|
34 |
+
msgid "Content Aware Sidebars"
|
35 |
+
msgstr "Content Aware Sidebars"
|
36 |
+
|
37 |
+
#: ../content-aware-sidebars.php:97
|
38 |
+
msgid "Import"
|
39 |
+
msgstr "インポート"
|
40 |
+
|
41 |
+
#: ../content-aware-sidebars.php:178 ../content-aware-sidebars.php:801
|
42 |
+
msgid "FAQ"
|
43 |
+
msgstr "よくある質問"
|
44 |
+
|
45 |
+
#: ../content-aware-sidebars.php:256
|
46 |
+
msgid "Exposure"
|
47 |
+
msgstr "表示"
|
48 |
+
|
49 |
+
#: ../content-aware-sidebars.php:260
|
50 |
+
msgid "Singular"
|
51 |
+
msgstr "単一"
|
52 |
+
|
53 |
+
#: ../content-aware-sidebars.php:261
|
54 |
+
msgid "Singular & Archive"
|
55 |
+
msgstr "単一 & アーカイブ"
|
56 |
+
|
57 |
+
#: ../content-aware-sidebars.php:262
|
58 |
+
msgid "Archive"
|
59 |
+
msgstr "アーカイブ"
|
60 |
+
|
61 |
+
#: ../content-aware-sidebars.php:267 ../content-aware-sidebars.php:471
|
62 |
+
msgctxt "option"
|
63 |
+
msgid "Handle"
|
64 |
+
msgstr "処理"
|
65 |
+
|
66 |
+
#: ../content-aware-sidebars.php:271
|
67 |
+
msgid "Replace"
|
68 |
+
msgstr "置換"
|
69 |
+
|
70 |
+
#: ../content-aware-sidebars.php:272
|
71 |
+
msgid "Merge"
|
72 |
+
msgstr "結合"
|
73 |
+
|
74 |
+
#: ../content-aware-sidebars.php:273
|
75 |
+
msgid "Manual"
|
76 |
+
msgstr "手動"
|
77 |
+
|
78 |
+
#: ../content-aware-sidebars.php:274
|
79 |
+
msgid "Forced replace"
|
80 |
+
msgstr "強制置換"
|
81 |
+
|
82 |
+
#: ../content-aware-sidebars.php:276
|
83 |
+
msgid "Replace host sidebar, merge with it or add sidebar manually."
|
84 |
+
msgstr "対象サイドバーを結合または手動追加による置換"
|
85 |
+
|
86 |
+
#: ../content-aware-sidebars.php:280
|
87 |
+
msgid "Host Sidebar"
|
88 |
+
msgstr "対象サイドバー"
|
89 |
+
|
90 |
+
#: ../content-aware-sidebars.php:287
|
91 |
+
msgid "Merge Position"
|
92 |
+
msgstr "結合位置"
|
93 |
+
|
94 |
+
#: ../content-aware-sidebars.php:291
|
95 |
+
msgid "Top"
|
96 |
+
msgstr "上部"
|
97 |
+
|
98 |
+
#: ../content-aware-sidebars.php:292
|
99 |
+
msgid "Bottom"
|
100 |
+
msgstr "下部"
|
101 |
+
|
102 |
+
#: ../content-aware-sidebars.php:294
|
103 |
+
msgid "Place sidebar on top or bottom of host when merging."
|
104 |
+
msgstr "結合時にサイドバーを対象の上部か下部に配置"
|
105 |
+
|
106 |
+
#: ../content-aware-sidebars.php:309
|
107 |
+
msgid "Sidebars"
|
108 |
+
msgstr "サイドバー"
|
109 |
+
|
110 |
+
#: ../content-aware-sidebars.php:310
|
111 |
+
msgid "Sidebar"
|
112 |
+
msgstr "サイドバー"
|
113 |
+
|
114 |
+
#: ../content-aware-sidebars.php:311
|
115 |
+
msgctxt "sidebar"
|
116 |
+
msgid "Add New"
|
117 |
+
msgstr "新規追加"
|
118 |
+
|
119 |
+
#: ../content-aware-sidebars.php:312
|
120 |
+
msgid "Add New Sidebar"
|
121 |
+
msgstr "新規サイドバーを追加"
|
122 |
+
|
123 |
+
#: ../content-aware-sidebars.php:313
|
124 |
+
msgid "Edit Sidebar"
|
125 |
+
msgstr "サイドバーを編集"
|
126 |
+
|
127 |
+
#: ../content-aware-sidebars.php:314
|
128 |
+
msgid "New Sidebar"
|
129 |
+
msgstr "新規サイドバー"
|
130 |
+
|
131 |
+
#: ../content-aware-sidebars.php:315
|
132 |
+
msgid "All Sidebars"
|
133 |
+
msgstr "全てのサイドバー"
|
134 |
+
|
135 |
+
#: ../content-aware-sidebars.php:316
|
136 |
+
msgid "View Sidebar"
|
137 |
+
msgstr "サイドバーを表示"
|
138 |
+
|
139 |
+
#: ../content-aware-sidebars.php:317
|
140 |
+
msgid "Search Sidebars"
|
141 |
+
msgstr "サイドバーを検索"
|
142 |
+
|
143 |
+
#: ../content-aware-sidebars.php:318
|
144 |
+
msgid "No sidebars found"
|
145 |
+
msgstr "サイドバーが見つかりません"
|
146 |
+
|
147 |
+
#: ../content-aware-sidebars.php:319
|
148 |
+
msgid "No sidebars found in Trash"
|
149 |
+
msgstr "ゴミ箱にサイドバーは入っていません"
|
150 |
+
|
151 |
+
#: ../content-aware-sidebars.php:321
|
152 |
+
msgid "Display sidebar with"
|
153 |
+
msgstr "サイドバーを同時に表示:"
|
154 |
+
|
155 |
+
#: ../content-aware-sidebars.php:322
|
156 |
+
msgid ""
|
157 |
+
"No content. Please add at least one condition group to make the sidebar "
|
158 |
+
"content aware."
|
159 |
+
msgstr "条件がありません。サイドバーをコンテントに反応させる為には少なくとも条件グループを一つ追加してください。"
|
160 |
+
|
161 |
+
#: ../content-aware-sidebars.php:353 ../content-aware-sidebars.php:381
|
162 |
+
msgid "Manage widgets"
|
163 |
+
msgstr "ウィジェットを管理"
|
164 |
+
|
165 |
+
#: ../content-aware-sidebars.php:356 ../content-aware-sidebars.php:359
|
166 |
+
msgid "Sidebar updated."
|
167 |
+
msgstr "サイドバーを更新しました"
|
168 |
+
|
169 |
+
#: ../content-aware-sidebars.php:361
|
170 |
+
msgid "Sidebar published."
|
171 |
+
msgstr "サイドバーを公開しました"
|
172 |
+
|
173 |
+
#: ../content-aware-sidebars.php:362
|
174 |
+
msgid "Sidebar saved."
|
175 |
+
msgstr "サイドバーを保存しました"
|
176 |
+
|
177 |
+
#: ../content-aware-sidebars.php:363
|
178 |
+
msgid "Sidebar submitted."
|
179 |
+
msgstr "サイドバーを送信しました"
|
180 |
+
|
181 |
+
#: ../content-aware-sidebars.php:364
|
182 |
+
#, php-format
|
183 |
+
msgid "Sidebar scheduled for: <strong>%1$s</strong>."
|
184 |
+
msgstr "公開予定日時: <strong>%1$s</strong>."
|
185 |
+
|
186 |
+
#. translators: Publish box date format, see http://php.net/date
|
187 |
+
#: ../content-aware-sidebars.php:366
|
188 |
+
msgid "M j, Y @ G:i"
|
189 |
+
msgstr "M j, Y @ G:i"
|
190 |
+
|
191 |
+
#: ../content-aware-sidebars.php:367
|
192 |
+
msgid "Sidebar draft updated."
|
193 |
+
msgstr "サイドバーの下書きを更新しました"
|
194 |
+
|
195 |
+
#: ../content-aware-sidebars.php:383
|
196 |
+
#, php-format
|
197 |
+
msgid "%s sidebar updated."
|
198 |
+
msgid_plural "%s sidebars updated."
|
199 |
+
msgstr[0] ""
|
200 |
+
|
201 |
+
#: ../content-aware-sidebars.php:384
|
202 |
+
#, php-format
|
203 |
+
msgid "%s sidebar not updated, somebody is editing it."
|
204 |
+
msgid_plural "%s sidebars not updated, somebody is editing them."
|
205 |
+
msgstr[0] ""
|
206 |
+
|
207 |
+
#: ../content-aware-sidebars.php:385
|
208 |
+
#, php-format
|
209 |
+
msgid "%s sidebar permanently deleted."
|
210 |
+
msgid_plural "%s sidebars permanently deleted."
|
211 |
+
msgstr[0] ""
|
212 |
+
|
213 |
+
#: ../content-aware-sidebars.php:386
|
214 |
+
#, php-format
|
215 |
+
msgid "%s sidebar moved to the Trash."
|
216 |
+
msgid_plural "%s sidebars moved to the Trash."
|
217 |
+
msgstr[0] ""
|
218 |
+
|
219 |
+
#: ../content-aware-sidebars.php:387
|
220 |
+
#, php-format
|
221 |
+
msgid "%s sidebar restored from the Trash."
|
222 |
+
msgid_plural "%s sidebars restored from the Trash."
|
223 |
+
msgstr[0] ""
|
224 |
+
|
225 |
+
#: ../content-aware-sidebars.php:444 ../content-aware-sidebars.php:535
|
226 |
+
msgid "Please update Host Sidebar"
|
227 |
+
msgstr "対象サイドバーを更新してください"
|
228 |
+
|
229 |
+
#: ../content-aware-sidebars.php:472
|
230 |
+
msgid "Merge position"
|
231 |
+
msgstr "結合位置"
|
232 |
+
|
233 |
+
#: ../content-aware-sidebars.php:473
|
234 |
+
msgid "Widgets"
|
235 |
+
msgstr "ウィジェット"
|
236 |
+
|
237 |
+
#: ../content-aware-sidebars.php:586
|
238 |
+
msgid "Manage Widgets"
|
239 |
+
msgstr "ウィジェットを管理"
|
240 |
+
|
241 |
+
#: ../content-aware-sidebars.php:756
|
242 |
+
msgid "Get a free Content Aware Sidebars Premium Bundle"
|
243 |
+
msgstr "Content Aware Sidebars プレミアムバンドルを無料ゲット"
|
244 |
+
|
245 |
+
#: ../content-aware-sidebars.php:772
|
246 |
+
msgid "Options"
|
247 |
+
msgstr "オプション"
|
248 |
+
|
249 |
+
#: ../content-aware-sidebars.php:795
|
250 |
+
#: ../lib/wp-content-aware-engine/core.php:203
|
251 |
+
#: ../lib/wp-content-aware-engine/view/meta_box.php:20 ../pointers.php:82
|
252 |
+
msgid "Condition Groups"
|
253 |
+
msgstr "条件グループ"
|
254 |
+
|
255 |
+
#: ../content-aware-sidebars.php:796
|
256 |
+
msgid ""
|
257 |
+
"Each created condition group describe some specific content (conditions) "
|
258 |
+
"that the current sidebar should be displayed with."
|
259 |
+
msgstr "作成された各条件グループは現在のサイドバーが表示されるべき特定のコンテント(条件)を表します。"
|
260 |
+
|
261 |
+
#: ../content-aware-sidebars.php:797
|
262 |
+
msgid ""
|
263 |
+
"Content added to a condition group uses logical conjunction, while condition"
|
264 |
+
" groups themselves use logical disjunction. This means that content added to"
|
265 |
+
" a group should be associated, as they are treated as such, and that the "
|
266 |
+
"groups do not interfere with each other. Thus it is possible to have both "
|
267 |
+
"extremely focused and at the same time distinct conditions."
|
268 |
+
msgstr "条件グループ自体が論理和を使用する一方、条件グループに追加されたコンテントは論理積を使用します。\nつまり、条件グループに追加されたコンテントは関連項目のように扱われグループ同士は妨害しません。\nよって、非常に密度の高く且つ独特な条件を持つことができます。"
|
269 |
+
|
270 |
+
#: ../content-aware-sidebars.php:800
|
271 |
+
msgid "More Information"
|
272 |
+
msgstr "詳細情報"
|
273 |
+
|
274 |
+
#: ../content-aware-sidebars.php:802 ../content-aware-sidebars.php:885
|
275 |
+
msgid "Get Support"
|
276 |
+
msgstr "サポートに連絡"
|
277 |
+
|
278 |
+
#: ../content-aware-sidebars.php:816
|
279 |
+
msgid ""
|
280 |
+
"Translate Content Aware Sidebars into your language and become a BETA tester"
|
281 |
+
" of the upcoming Premium Bundle*!"
|
282 |
+
msgstr "Content Aware Sidebars を貴方の言語に翻訳、またはもうすぐ発表されるプレミアムバンドル*のベータテスターになりませんか!"
|
283 |
+
|
284 |
+
#: ../content-aware-sidebars.php:817
|
285 |
+
msgid "Translate Now"
|
286 |
+
msgstr "翻訳する"
|
287 |
+
|
288 |
+
#: ../content-aware-sidebars.php:818
|
289 |
+
msgid "Get Premium Bundle"
|
290 |
+
msgstr "プレミアムバンドルをゲット"
|
291 |
+
|
292 |
+
#: ../content-aware-sidebars.php:819
|
293 |
+
msgid ""
|
294 |
+
"Single-site use. BETA implies it is not recommended for production sites."
|
295 |
+
msgstr "単一サイトに限ります。ベータですので公開中のサイトには使用を推奨しません。\n."
|
296 |
+
|
297 |
+
#: ../content-aware-sidebars.php:822
|
298 |
+
msgid "P
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|