Content Views – Post Grid &amp; List for WordPress

Version Description

Fix some bugs
Adjust styles

Release Info

Developer	PT Guy
Plugin	Content Views – Post Grid & List for WordPress
Version	1.0.1
Comparing to
See all releases

Version 1.0.1

Files changed (52) hide show

.htaccess +3 -0
LICENSE.txt +339 -0
README.txt +137 -0
admin/assets/css/admin.css +185 -0
admin/assets/css/menu.css +14 -0
admin/assets/css/wp.css +18 -0
admin/assets/css/wp38.css +25 -0
admin/assets/images/icon.png +0 -0
admin/assets/js/admin.js +683 -0
admin/content-views-admin.php +402 -0
admin/includes/options.php +395 -0
admin/views/admin.php +35 -0
admin/views/list.php +14 -0
admin/views/view.php +542 -0
assets/bootstrap-paginator/bootstrap-paginator.min.js +18 -0
assets/bootstrap/css/bootstrap.min.css +7 -0
assets/bootstrap/fonts/glyphicons-halflings-regular.eot +0 -0
assets/bootstrap/fonts/glyphicons-halflings-regular.svg +229 -0
assets/bootstrap/fonts/glyphicons-halflings-regular.ttf +0 -0
assets/bootstrap/fonts/glyphicons-halflings-regular.woff +0 -0
assets/bootstrap/js/bootstrap.min.js +7 -0
assets/ie-fix/html5shiv.min.js +1 -0
assets/ie-fix/respond.js +224 -0
assets/select2/select2-bootstrap.min.css +1 -0
assets/select2/select2-spinner.gif +0 -0
assets/select2/select2.min.css +1 -0
assets/select2/select2.min.js +22 -0
assets/select2/select2.png +0 -0
content-views.php +91 -0
includes/assets.php +197 -0
includes/defines.php +36 -0
includes/functions.php +984 -0
includes/hooks.php +119 -0
includes/html-viewtype.php +272 -0
includes/html.php +828 -0
includes/settings.php +734 -0
includes/update.php +19 -0
includes/values.php +447 -0
languages/plugin-name.pot +31 -0
public/assets/css/assets.css +1 -0
public/assets/css/public.css +194 -0
public/assets/js/assets.js +1 -0
public/assets/js/public.js +217 -0
public/content-views.php +322 -0
public/templates/_view_type_/css/main.css +10 -0
public/templates/_view_type_/html/main.php +42 -0
public/templates/_view_type_/js/main.js +10 -0
public/templates/collapsible/html/main.php +66 -0
public/templates/grid/html/main.php +40 -0
public/templates/readme.txt +19 -0
public/templates/scrollable/html/main.php +31 -0
uninstall.php +21 -0

.htaccess ADDED Viewed

	@@ -0,0 +1,3 @@


1	+
2	+ # Disable Indexing
3	+ Options -Indexes

LICENSE.txt ADDED Viewed

	@@ -0,0 +1,339 @@


1	+ GNU GENERAL PUBLIC LICENSE
2	+ Version 2, June 1991
3	+
4	+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
5	+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
6	+ Everyone is permitted to copy and distribute verbatim copies
7	+ of this license document, but changing it is not allowed.
8	+
9	+ Preamble
10	+
11	+ The licenses for most software are designed to take away your
12	+ freedom to share and change it. By contrast, the GNU General Public
13	+ License is intended to guarantee your freedom to share and change free
14	+ software--to make sure the software is free for all its users. This
15	+ General Public License applies to most of the Free Software
16	+ Foundation's software and to any other program whose authors commit to
17	+ using it. (Some other Free Software Foundation software is covered by
18	+ the GNU Lesser General Public License instead.) You can apply it to
19	+ your programs, too.
20	+
21	+ When we speak of free software, we are referring to freedom, not
22	+ price. Our General Public Licenses are designed to make sure that you
23	+ have the freedom to distribute copies of free software (and charge for
24	+ this service if you wish), that you receive source code or can get it
25	+ if you want it, that you can change the software or use pieces of it
26	+ in new free programs; and that you know you can do these things.
27	+
28	+ To protect your rights, we need to make restrictions that forbid
29	+ anyone to deny you these rights or to ask you to surrender the rights.
30	+ These restrictions translate to certain responsibilities for you if you
31	+ distribute copies of the software, or if you modify it.
32	+
33	+ For example, if you distribute copies of such a program, whether
34	+ gratis or for a fee, you must give the recipients all the rights that
35	+ you have. You must make sure that they, too, receive or can get the
36	+ source code. And you must show them these terms so they know their
37	+ rights.
38	+
39	+ We protect your rights with two steps: (1) copyright the software, and
40	+ (2) offer you this license which gives you legal permission to copy,
41	+ distribute and/or modify the software.
42	+
43	+ Also, for each author's protection and ours, we want to make certain
44	+ that everyone understands that there is no warranty for this free
45	+ software. If the software is modified by someone else and passed on, we
46	+ want its recipients to know that what they have is not the original, so
47	+ that any problems introduced by others will not reflect on the original
48	+ authors' reputations.
49	+
50	+ Finally, any free program is threatened constantly by software
51	+ patents. We wish to avoid the danger that redistributors of a free
52	+ program will individually obtain patent licenses, in effect making the
53	+ program proprietary. To prevent this, we have made it clear that any
54	+ patent must be licensed for everyone's free use or not licensed at all.
55	+
56	+ The precise terms and conditions for copying, distribution and
57	+ modification follow.
58	+
59	+ GNU GENERAL PUBLIC LICENSE
60	+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
61	+
62	+ 0. This License applies to any program or other work which contains
63	+ a notice placed by the copyright holder saying it may be distributed
64	+ under the terms of this General Public License. The "Program", below,
65	+ refers to any such program or work, and a "work based on the Program"
66	+ means either the Program or any derivative work under copyright law:
67	+ that is to say, a work containing the Program or a portion of it,
68	+ either verbatim or with modifications and/or translated into another
69	+ language. (Hereinafter, translation is included without limitation in
70	+ the term "modification".) Each licensee is addressed as "you".
71	+
72	+ Activities other than copying, distribution and modification are not
73	+ covered by this License; they are outside its scope. The act of
74	+ running the Program is not restricted, and the output from the Program
75	+ is covered only if its contents constitute a work based on the
76	+ Program (independent of having been made by running the Program).
77	+ Whether that is true depends on what the Program does.
78	+
79	+ 1. You may copy and distribute verbatim copies of the Program's
80	+ source code as you receive it, in any medium, provided that you
81	+ conspicuously and appropriately publish on each copy an appropriate
82	+ copyright notice and disclaimer of warranty; keep intact all the
83	+ notices that refer to this License and to the absence of any warranty;
84	+ and give any other recipients of the Program a copy of this License
85	+ along with the Program.
86	+
87	+ You may charge a fee for the physical act of transferring a copy, and
88	+ you may at your option offer warranty protection in exchange for a fee.
89	+
90	+ 2. You may modify your copy or copies of the Program or any portion
91	+ of it, thus forming a work based on the Program, and copy and
92	+ distribute such modifications or work under the terms of Section 1
93	+ above, provided that you also meet all of these conditions:
94	+
95	+ a) You must cause the modified files to carry prominent notices
96	+ stating that you changed the files and the date of any change.
97	+
98	+ b) You must cause any work that you distribute or publish, that in
99	+ whole or in part contains or is derived from the Program or any
100	+ part thereof, to be licensed as a whole at no charge to all third
101	+ parties under the terms of this License.
102	+
103	+ c) If the modified program normally reads commands interactively
104	+ when run, you must cause it, when started running for such
105	+ interactive use in the most ordinary way, to print or display an
106	+ announcement including an appropriate copyright notice and a
107	+ notice that there is no warranty (or else, saying that you provide
108	+ a warranty) and that users may redistribute the program under
109	+ these conditions, and telling the user how to view a copy of this
110	+ License. (Exception: if the Program itself is interactive but
111	+ does not normally print such an announcement, your work based on
112	+ the Program is not required to print an announcement.)
113	+
114	+ These requirements apply to the modified work as a whole. If
115	+ identifiable sections of that work are not derived from the Program,
116	+ and can be reasonably considered independent and separate works in
117	+ themselves, then this License, and its terms, do not apply to those
118	+ sections when you distribute them as separate works. But when you
119	+ distribute the same sections as part of a whole which is a work based
120	+ on the Program, the distribution of the whole must be on the terms of
121	+ this License, whose permissions for other licensees extend to the
122	+ entire whole, and thus to each and every part regardless of who wrote it.
123	+
124	+ Thus, it is not the intent of this section to claim rights or contest
125	+ your rights to work written entirely by you; rather, the intent is to
126	+ exercise the right to control the distribution of derivative or
127	+ collective works based on the Program.
128	+
129	+ In addition, mere aggregation of another work not based on the Program
130	+ with the Program (or with a work based on the Program) on a volume of
131	+ a storage or distribution medium does not bring the other work under
132	+ the scope of this License.
133	+
134	+ 3. You may copy and distribute the Program (or a work based on it,
135	+ under Section 2) in object code or executable form under the terms of
136	+ Sections 1 and 2 above provided that you also do one of the following:
137	+
138	+ a) Accompany it with the complete corresponding machine-readable
139	+ source code, which must be distributed under the terms of Sections
140	+ 1 and 2 above on a medium customarily used for software interchange; or,
141	+
142	+ b) Accompany it with a written offer, valid for at least three
143	+ years, to give any third party, for a charge no more than your
144	+ cost of physically performing source distribution, a complete
145	+ machine-readable copy of the corresponding source code, to be
146	+ distributed under the terms of Sections 1 and 2 above on a medium
147	+ customarily used for software interchange; or,
148	+
149	+ c) Accompany it with the information you received as to the offer
150	+ to distribute corresponding source code. (This alternative is
151	+ allowed only for noncommercial distribution and only if you
152	+ received the program in object code or executable form with such
153	+ an offer, in accord with Subsection b above.)
154	+
155	+ The source code for a work means the preferred form of the work for
156	+ making modifications to it. For an executable work, complete source
157	+ code means all the source code for all modules it contains, plus any
158	+ associated interface definition files, plus the scripts used to
159	+ control compilation and installation of the executable. However, as a
160	+ special exception, the source code distributed need not include
161	+ anything that is normally distributed (in either source or binary
162	+ form) with the major components (compiler, kernel, and so on) of the
163	+ operating system on which the executable runs, unless that component
164	+ itself accompanies the executable.
165	+
166	+ If distribution of executable or object code is made by offering
167	+ access to copy from a designated place, then offering equivalent
168	+ access to copy the source code from the same place counts as
169	+ distribution of the source code, even though third parties are not
170	+ compelled to copy the source along with the object code.
171	+
172	+ 4. You may not copy, modify, sublicense, or distribute the Program
173	+ except as expressly provided under this License. Any attempt
174	+ otherwise to copy, modify, sublicense or distribute the Program is
175	+ void, and will automatically terminate your rights under this License.
176	+ However, parties who have received copies, or rights, from you under
177	+ this License will not have their licenses terminated so long as such
178	+ parties remain in full compliance.
179	+
180	+ 5. You are not required to accept this License, since you have not
181	+ signed it. However, nothing else grants you permission to modify or
182	+ distribute the Program or its derivative works. These actions are
183	+ prohibited by law if you do not accept this License. Therefore, by
184	+ modifying or distributing the Program (or any work based on the
185	+ Program), you indicate your acceptance of this License to do so, and
186	+ all its terms and conditions for copying, distributing or modifying
187	+ the Program or works based on it.
188	+
189	+ 6. Each time you redistribute the Program (or any work based on the
190	+ Program), the recipient automatically receives a license from the
191	+ original licensor to copy, distribute or modify the Program subject to
192	+ these terms and conditions. You may not impose any further
193	+ restrictions on the recipients' exercise of the rights granted herein.
194	+ You are not responsible for enforcing compliance by third parties to
195	+ this License.
196	+
197	+ 7. If, as a consequence of a court judgment or allegation of patent
198	+ infringement or for any other reason (not limited to patent issues),
199	+ conditions are imposed on you (whether by court order, agreement or
200	+ otherwise) that contradict the conditions of this License, they do not
201	+ excuse you from the conditions of this License. If you cannot
202	+ distribute so as to satisfy simultaneously your obligations under this
203	+ License and any other pertinent obligations, then as a consequence you
204	+ may not distribute the Program at all. For example, if a patent
205	+ license would not permit royalty-free redistribution of the Program by
206	+ all those who receive copies directly or indirectly through you, then
207	+ the only way you could satisfy both it and this License would be to
208	+ refrain entirely from distribution of the Program.
209	+
210	+ If any portion of this section is held invalid or unenforceable under
211	+ any particular circumstance, the balance of the section is intended to
212	+ apply and the section as a whole is intended to apply in other
213	+ circumstances.
214	+
215	+ It is not the purpose of this section to induce you to infringe any
216	+ patents or other property right claims or to contest validity of any
217	+ such claims; this section has the sole purpose of protecting the
218	+ integrity of the free software distribution system, which is
219	+ implemented by public license practices. Many people have made
220	+ generous contributions to the wide range of software distributed
221	+ through that system in reliance on consistent application of that
222	+ system; it is up to the author/donor to decide if he or she is willing
223	+ to distribute software through any other system and a licensee cannot
224	+ impose that choice.
225	+
226	+ This section is intended to make thoroughly clear what is believed to
227	+ be a consequence of the rest of this License.
228	+
229	+ 8. If the distribution and/or use of the Program is restricted in
230	+ certain countries either by patents or by copyrighted interfaces, the
231	+ original copyright holder who places the Program under this License
232	+ may add an explicit geographical distribution limitation excluding
233	+ those countries, so that distribution is permitted only in or among
234	+ countries not thus excluded. In such case, this License incorporates
235	+ the limitation as if written in the body of this License.
236	+
237	+ 9. The Free Software Foundation may publish revised and/or new versions
238	+ of the General Public License from time to time. Such new versions will
239	+ be similar in spirit to the present version, but may differ in detail to
240	+ address new problems or concerns.
241	+
242	+ Each version is given a distinguishing version number. If the Program
243	+ specifies a version number of this License which applies to it and "any
244	+ later version", you have the option of following the terms and conditions
245	+ either of that version or of any later version published by the Free
246	+ Software Foundation. If the Program does not specify a version number of
247	+ this License, you may choose any version ever published by the Free Software
248	+ Foundation.
249	+
250	+ 10. If you wish to incorporate parts of the Program into other free
251	+ programs whose distribution conditions are different, write to the author
252	+ to ask for permission. For software which is copyrighted by the Free
253	+ Software Foundation, write to the Free Software Foundation; we sometimes
254	+ make exceptions for this. Our decision will be guided by the two goals
255	+ of preserving the free status of all derivatives of our free software and
256	+ of promoting the sharing and reuse of software generally.
257	+
258	+ NO WARRANTY
259	+
260	+ 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
261	+ FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
262	+ OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
263	+ PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
264	+ OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
265	+ MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
266	+ TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
267	+ PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
268	+ REPAIR OR CORRECTION.
269	+
270	+ 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
271	+ WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
272	+ REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
273	+ INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
274	+ OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
275	+ TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
276	+ YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
277	+ PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
278	+ POSSIBILITY OF SUCH DAMAGES.
279	+
280	+ END OF TERMS AND CONDITIONS
281	+
282	+ How to Apply These Terms to Your New Programs
283	+
284	+ If you develop a new program, and you want it to be of the greatest
285	+ possible use to the public, the best way to achieve this is to make it
286	+ free software which everyone can redistribute and change under these terms.
287	+
288	+ To do so, attach the following notices to the program. It is safest
289	+ to attach them to the start of each source file to most effectively
290	+ convey the exclusion of warranty; and each file should have at least
291	+ the "copyright" line and a pointer to where the full notice is found.
292	+
293	+ <one line to give the program's name and a brief idea of what it does.>
294	+ Copyright (C) <year> <name of author>
295	+
296	+ This program is free software; you can redistribute it and/or modify
297	+ it under the terms of the GNU General Public License as published by
298	+ the Free Software Foundation; either version 2 of the License, or
299	+ (at your option) any later version.
300	+
301	+ This program is distributed in the hope that it will be useful,
302	+ but WITHOUT ANY WARRANTY; without even the implied warranty of
303	+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
304	+ GNU General Public License for more details.
305	+
306	+ You should have received a copy of the GNU General Public License along
307	+ with this program; if not, write to the Free Software Foundation, Inc.,
308	+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
309	+
310	+ Also add information on how to contact you by electronic and paper mail.
311	+
312	+ If the program is interactive, make it output a short notice like this
313	+ when it starts in an interactive mode:
314	+
315	+ Gnomovision version 69, Copyright (C) year name of author
316	+ Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
317	+ This is free software, and you are welcome to redistribute it
318	+ under certain conditions; type `show c' for details.
319	+
320	+ The hypothetical commands `show w' and `show c' should show the appropriate
321	+ parts of the General Public License. Of course, the commands you use may
322	+ be called something other than `show w' and `show c'; they could even be
323	+ mouse-clicks or menu items--whatever suits your program.
324	+
325	+ You should also get your employer (if you work as a programmer) or your
326	+ school, if any, to sign a "copyright disclaimer" for the program, if
327	+ necessary. Here is a sample; alter the names:
328	+
329	+ Yoyodyne, Inc., hereby disclaims all copyright interest in the program
330	+ `Gnomovision' (which makes passes at compilers) written by James Hacker.
331	+
332	+ <signature of Ty Coon>, 1 April 1989
333	+ Ty Coon, President of Vice
334	+
335	+ This General Public License does not permit incorporating your program into
336	+ proprietary programs. If your program is a subroutine library, you may
337	+ consider it more useful to permit linking proprietary applications with the
338	+ library. If this is what you want to do, use the GNU Lesser General
339	+ Public License instead of this License.

README.txt ADDED Viewed

	@@ -0,0 +1,137 @@


1	+ === Content Views - Query and display posts, pages without coding ===
2	+ Contributors: pt-guy
3	+ Donate link: https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=JGUF974QBRKQE
4	+ Tags: post, posts, page, pages, query, queries, search, display, show, shortcode, thumbnail, title, content, excerpt, meta, date, author, term, taxonomy, grid, scrollable, collapsible, list, slide, layout, ui
5	+ Requires at least: 3.3
6	+ Tested up to: 3.9.1
7	+ Stable tag: 1.0.1
8	+ License: GPLv2 or later
9	+ License URI: http://www.gnu.org/licenses/gpl-2.0.html
10	+
11	+ Query and display <strong>posts, pages</strong> in awesome layouts (<strong>grid, scrollable list, collapsible list</strong>) easier than ever, without coding!
12	+
13	+ == Description ==
14	+
15	+ [Content Views](http://www.wordpressquery.com/?utm_source=wordpress&utm_medium=plugin&utm_campaign=content-views "Visit Content Views website") is a WordPress plugin helps you to query and display posts, pages in different kind of responsive layouts (grid, scrollable list, collapsible list), in very 3 simple steps:
16	+
17	+ * Step 1 : Select criteria to query posts, pages
18	+ * Step 2 : Select layout which you want to display your queried entries
19	+ * Step 3 : Paste shortcode [pt_view id="UNIQUE_ID"] to editor of a post, page or a Text widget where you want to show your desired content. If you are a developer, you can `<?php echo do_shortcode('[pt_view id="UNIQUE_ID"]'); ?>` in theme of your WordPress site. (Please check FAQ to know how to get UNIQUE_ID of View)
20	+
21	+ = And here is your power with this plugin: =
22	+
23	+ in Step 1, you can:
24	+
25	+ * query & display a single post, page
26	+ * query & display multiple posts, pages
27	+ * query posts, pages written by, not written by any authors
28	+ * query posts, pages associate with, don't associate with tags, categories
29	+ * query posts, pages in any status (publish, draft, private...)
30	+ * sort posts, pages by Id, Title, Created date, Modified date in ascending, descending order
31	+ * query posts, pages which contain a specific keyword
32	+
33	+ in Step 2, you can:
34	+
35	+ * Select a layout to show queried posts, pages: Grid, Collapsible List, Scrollable List. More awesome layouts are available in [Content Views PRO](http://www.wordpressquery.com/?utm_source=wordpress&utm_medium=plugin&utm_campaign=content-views "Content Views Pro plugin")
36	+ * Choose a layout format of each item (item is the output of a post, page at frontend): 1 column, 2 columns
37	+ * Select fields to show (thumbnail, title, content, meta fields)
38	+ * Select size of thumbnail
39	+ * Show full content, or an excerpt with specific length
40	+ * Select meta fields to show (date, author, term [categories, tags], comment count)
41	+ * Enable/Disable pagination
42	+ * Open an item in new tab, current tab
43	+
44	+ Also, you can import/export 'View' to use in other WordPress sites (Please check FAQ tab to know what is 'View')
45	+
46	+
47	+ = More amazing features: =
48	+
49	+ * Be able to query custom post types (Woocommerce products, FAQ...)
50	+ * Advanced output & settings of Grid, Collapsible List, Scrollable List layout
51	+ * Additional layouts: Pinterest, Timeline
52	+ * Drag & drop to change display order of fields (thumbnail, title, content, meta fields)
53	+ * Customize Font settings
54	+ * More Pagination options
55	+ * And much more...
56	+
57	+ are available in [Content Views PRO](http://www.wordpressquery.com/?utm_source=wordpress&utm_medium=plugin&utm_campaign=content-views "Content Views Pro plugin")
58	+
59	+
60	+ == Installation ==
61	+
62	+ = Using The WordPress Dashboard =
63	+
64	+ 1. Navigate to the 'Add New' in the plugins dashboard
65	+ 2. Search for 'Content Views'
66	+ 3. Click 'Install Now'
67	+ 4. Activate the plugin on the Plugin dashboard
68	+
69	+ = Uploading in WordPress Dashboard =
70	+
71	+ 1. Navigate to the 'Add New' in the plugins dashboard
72	+ 2. Navigate to the 'Upload' area
73	+ 3. Select `pt-content-views.zip` from your computer
74	+ 4. Click 'Install Now'
75	+ 5. Activate the plugin in the Plugin dashboard
76	+
77	+ = Using FTP =
78	+
79	+ 1. Download `pt-content-views.zip`
80	+ 2. Extract the `pt-content-views` directory to your computer
81	+ 3. Upload the `pt-content-views` directory to the `/wp-content/plugins/` directory
82	+ 4. Activate the plugin in the Plugin dashboard
83	+
84	+
85	+
86	+ == Frequently Asked Questions ==
87	+
88	+ = How can I start? =
89	+
90	+ In left menu of your Admin dashboard, click Content View Settings > Add View
91	+
92	+ = What is 'View'? =
93	+
94	+ 'View' is a custom post type which Content Views uses to store all settings to query & display your posts
95	+
96	+ = How can I see all my Views? =
97	+
98	+ In left menu of your Admin dashboard, click Content View Settings > All Views
99	+
100	+ = How can I edit a View? =
101	+
102	+ Firstly, you should go to "All Views" page (please check above question). Then click on Title of View you want to edit. You will be forwarded to editing page of View.
103	+
104	+ = How to get UNIQUE_ID of View? =
105	+
106	+ You can get View ID in URL of editing page of View (please check above question). The url has following format: http://your_domain/wp-admin/admin.php?page=content-views-add&id=UNIQUE_ID
107	+
108	+ = How many Views I can create? =
109	+
110	+ You can create Unlimited Views, in Unlimited websites
111	+
112	+
113	+ == Screenshots ==
114	+
115	+ 1. Content Views plugin overview
116	+ 2. Display Setting form to customize output of queried posts at frontend
117	+ 3. Query and display in Grid layout (Show Title, Thumbnail)
118	+ 4. Query and display in Grid layout (Show Title, Thumbnail, Content, Meta fields), with Pagination
119	+ 5. Query and display in Collapsible List
120	+ 6. Query and display in Scrollable List
121	+
122	+
123	+
124	+ == Changelog ==
125	+
126	+ = 1.0.1 =
127	+ * Fix some bugs
128	+ * Adjust styles
129	+
130	+ = 1.0.0 =
131	+ * Initial release
132	+
133	+
134	+
135	+ == Upgrade Notice ==
136	+
137	+ Fix some bugs. Adjust styles.

admin/assets/css/admin.css ADDED Viewed

	@@ -0,0 +1,185 @@


1	+ /**
2	+ * Common styles for WP admin
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+
11	+ /* Overwrite WP */
12	+ .update-nag {
13	+ display: none;
14	+ }
15	+
16	+ /* Fix small error when use Bootstrap */
17	+ html {
18	+ background: none;
19	+ }
20	+
21	+ .wp-color-result {
22	+ height: 24px;
23	+ }
24	+
25	+ .pt-wrap .font-color .input-group {
26	+ width: 100px;
27	+ float: left;
28	+ margin-right: 20px;
29	+ }
30	+
31	+ .pt-wrap select {
32	+ height: 34px !important;
33	+ }
34	+
35	+ .pt-wrap .text-muted {
36	+ clear: both;
37	+ margin: 4px 0;
38	+ float: left;
39	+ }
40	+
41	+ /* Overwrite Bootstrap */
42	+ .form-control:focus {
43	+ border-color: #66afe9 !important;
44	+ outline: 0;
45	+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 8px rgba(102, 175, 233, .6) !important;
46	+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 8px rgba(102, 175, 233, .6) !important;
47	+ }
48	+
49	+ .form-horizontal .control-label {
50	+ text-align: left !important;
51	+ }
52	+
53	+ .nav-tabs a {
54	+ font-weight: 600;
55	+ font-size: 1.3em;
56	+ }
57	+
58	+ /* Other settings */
59	+ .hide {
60	+ display: none;
61	+ }
62	+
63	+ #pt-cv-form-view *, .preview-wrapper label {
64	+ font-size: 14px;
65	+ }
66	+
67	+ .pt-wrap h2 {
68	+ margin-bottom: 20px;
69	+ }
70	+
71	+ .pt-wrap .tab-content {
72	+ margin-top: 20px;
73	+ }
74	+
75	+ .pt-wrap .form-group.pt-form-group {
76	+ margin-bottom: 5px;
77	+ }
78	+
79	+ .pt-cv-color {
80	+ width: 100px !important;
81	+ }
82	+
83	+ /* Group type */
84	+ .panel-group .pt-cv-group {
85	+ margin-top: 10px;
86	+ }
87	+
88	+ .pt-cv-group .form-group {
89	+ margin-bottom: 6px;
90	+ }
91	+
92	+ .pt-cv-group .panel-body {
93	+ padding: 10px 15px;
94	+ }
95	+
96	+ .pt-cv-group .control-label {
97	+ font-weight: 400;
98	+ }
99	+
100	+ .pt-cv-group .checkbox,
101	+ .pt-cv-w50 .pt-form-group {
102	+ width: 50%;
103	+ float: left;
104	+ }
105	+
106	+ .pt-cv-group .radio {
107	+ /* width: 33%;
108	+ float: left;
109	+ margin-bottom: 10px !important;*/
110	+ }
111	+
112	+ .pt-cv-group .radio img {
113	+ height: 100px;
114	+ }
115	+
116	+ .pt-cv-group .checkbox {
117	+ background: none;
118	+ }
119	+
120	+ .pt-cv-no-panel {
121	+ margin-top: 0px;
122	+ }
123	+
124	+ .pt-cv-text {
125	+ margin-top: 7px;
126	+ }
127	+
128	+ .pt-wrap .input-group {
129	+ width: 200px;
130	+ }
131	+
132	+ /* Accordion */
133	+ .pt-cv-group .pt-accordion .panel-heading {
134	+ cursor: pointer;
135	+ padding-left: 30px;
136	+ }
137	+
138	+ .pt-cv-group .clickable {
139	+ cursor: pointer;
140	+ }
141	+
142	+ .pt-cv-group .panel-heading span {
143	+ margin-top: -20px;
144	+ font-size: 15px;
145	+ }
146	+
147	+ .pt-cv-group-activate .panel-body {
148	+ background: #FFCFCF;
149	+ }
150	+
151	+ /* Preview */
152	+ #pt-cv-preview-box {
153	+ margin-bottom: 5px;
154	+ height: 300px;
155	+ padding: 20px;
156	+ position: relative;
157	+ overflow-y: scroll;
158	+ overflow-x: hidden;
159	+ }
160	+
161	+ #pt-cv-preview-box + .text-muted {
162	+ margin-top: 8px;
163	+ }
164	+
165	+ #pt-cv-show-preview {
166	+ position: fixed;
167	+ right: 20px;
168	+ bottom: 140px;
169	+ z-index: 1001;
170	+ }
171	+
172	+ /* Field dislay */
173	+ .pt-cv-bg-none {
174	+ background: #fff;
175	+ }
176	+
177	+ /* Sortable */
178	+ .pt-wrap .ui-sortable {
179	+ background: #FFF9D7;
180	+ }
181	+
182	+ /* Custom css for Settings Group/Option */
183	+ #pt-cv-group-excerpt-settings {
184	+ margin-bottom: 20px;
185	+ }

admin/assets/css/menu.css ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ /**
2	+ * Overwrite WP style : make the icon look clear on WP admin menu
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+
11	+ #adminmenu #toplevel_page_content-views .menu-icon-generic div.wp-menu-image:before {
12	+ background: url(../images/icon.png) no-repeat 0 7px;
13	+ content: '' !important;
14	+ }

admin/assets/css/wp.css ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ /**
2	+ * Fix css error for Wordpress <= 3.7
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+
11	+ .pt-wrap label input[type=radio],
12	+ .pt-wrap label input[type=checkbox] {
13	+ margin-top: 4px !important;
14	+ }
15	+
16	+ /* Screen Resolutions */
17	+ @media screen and (max-width: 782px) {
18	+ }

admin/assets/css/wp38.css ADDED Viewed

	@@ -0,0 +1,25 @@


1	+ /**
2	+ * Fix css error for Wordpress 3.8
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+
11	+ .pt-wrap input[type=radio], input[type=checkbox] {
12	+ margin-top: 2px !important;
13	+ }
14	+
15	+ /* Screen Resolutions */
16	+ @media screen and (max-width: 782px) {
17	+ .pt-wrap label {
18	+ margin-left: 6px;
19	+ }
20	+
21	+ .pt-wrap label input[type=radio],
22	+ .pt-wrap label input[type=checkbox] {
23	+ margin-top: -2px !important;
24	+ }
25	+ }

admin/assets/images/icon.png ADDED Viewed

Binary file

admin/assets/js/admin.js ADDED Viewed

	@@ -0,0 +1,683 @@


1	+ /**
2	+ * Main script file for WP admin
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+
11	+ ( function ($) {
12	+ "use strict";
13	+
14	+ $.PT_CV_Admin = $.PT_CV_Admin \|\| { };
15	+
16	+ $.PT_CV_Admin = function (options) {
17	+ this.options = options;
18	+ this.options.onload = 1;
19	+ this.options.scroll_time = 500;
20	+ this.options.can_preview = 1;
21	+ };
22	+
23	+ $.PT_CV_Admin.prototype = {
24	+
25	+ /**
26	+ * Toggle panel when click Show/Hide icon on Heading
27	+ *
28	+ * @param {type} $selector
29	+ * @returns {undefined}
30	+ */
31	+ _toggle_panel : function ($selector) {
32	+ $('body').on('click', $selector, function (e) {
33	+ var $heading = $(this);
34	+ var $span = $heading.find('span.clickable');
35	+ var time = 100;
36	+
37	+ if (!$span.hasClass('panel-collapsed')) {
38	+ $heading.next('.panel-body').slideUp(time);
39	+ $span.addClass('panel-collapsed');
40	+ $span.find('i').removeClass('glyphicon-minus').addClass('glyphicon-plus');
41	+ } else {
42	+ $heading.next('.panel-body').slideDown(time);
43	+ $span.removeClass('panel-collapsed');
44	+ $span.find('i').removeClass('glyphicon-plus').addClass('glyphicon-minus');
45	+ }
46	+ });
47	+ },
48	+ /**
49	+ * Toggle Taxonomy Relation setting on page load & on change
50	+ *
51	+ * @returns void
52	+ */
53	+ _toggle_taxonomy_relation : function () {
54	+ var $self = this;
55	+ var _prefix = $self.options._prefix;
56	+
57	+ var $taxonomy_relation = $('.' + _prefix + 'taxonomy-relation').parent().parent('.form-group');
58	+
59	+ // Taxonomies Settings wrapper div
60	+ var $wrap_taxonomies = $('#' + _prefix + 'group-taxonomy');
61	+
62	+ // Get Taxonomy checkbox item
63	+ var taxonomy_item = '.' + _prefix + 'taxonomy-item';
64	+
65	+ // Run on page load
66	+ $self._do_toggle_taxonomy_relation($taxonomy_relation, $wrap_taxonomies);
67	+
68	+ // Run on change
69	+ $(taxonomy_item).change(function () {
70	+ $self._do_toggle_taxonomy_relation($taxonomy_relation, $wrap_taxonomies);
71	+ });
72	+ },
73	+ /**
74	+ * Toggle Taxonomy Relation setting by number of selected taxonomies
75	+ *
76	+ * @returns void
77	+ */
78	+ _do_toggle_taxonomy_relation: function ($taxonomy_relation, $wrap_taxonomies) {
79	+ // If there is no taxonomies
80	+ if ($wrap_taxonomies.find('.pt-params .checkbox').filter(function () {
81	+ return !$(this).hasClass('hidden') && $(this).find('input:checked').length;
82	+ }).length > 1) {
83	+ $taxonomy_relation.removeClass('hidden');
84	+ } else {
85	+ $taxonomy_relation.addClass('hidden');
86	+ }
87	+ },
88	+ /**
89	+ * Color picker element
90	+ *
91	+ * @param {type} picker_el
92	+ * @returns {undefined}
93	+ */
94	+ _color_picker : function (picker_el) {
95	+ $(picker_el).click(function (e) {
96	+ var colorPicker = $(this).next('div');
97	+ var input = $(this);
98	+ $(colorPicker).farbtastic(input);
99	+ colorPicker.show();
100	+ e.preventDefault();
101	+ $(document).mousedown(function () {
102	+ $(colorPicker).hide();
103	+ });
104	+ });
105	+ },
106	+ /**
107	+ * Get field value, depends on field type & its parent is show/hide
108	+ *
109	+ * @param {type} el : string to selector
110	+ * @returns {undefined}
111	+ */
112	+ _get_field_val : function (el) {
113	+ var $this = $(el);
114	+ var value = $(el).val();
115	+
116	+ if ($this.is(':checkbox') \|\| $this.is(':radio')) {
117	+ value = $(el + ':checked').val();
118	+ }
119	+
120	+ return value;
121	+ },
122	+ /**
123	+ * Do toggle all dependency groups
124	+ *
125	+ * @param {type} $toggle_data_js_
126	+ * @returns {undefined}
127	+ */
128	+ dependence_do_all : function ($toggle_data_js_) {
129	+ var $self = this;
130	+ var _prefix = $self.options._prefix;
131	+ var $toggle_data_js = $.parseJSON($toggle_data_js_);
132	+ $.each($toggle_data_js, function (idx, obj) {
133	+ // Obj_sub: an object contains (dependence_id, operator, expect_val)
134	+ $.each(obj, function (key, obj_sub) {
135	+ // Get name of depended element (which other elements depend on it)
136	+ var el_name = _prefix + key;
137	+
138	+ var el = "[name='" + el_name + "']";
139	+
140	+ // Run on page load
141	+ $self._dependence_group($self._get_field_val(el), obj_sub);
142	+
143	+ // Run on change
144	+ $(el).change(function () {
145	+ $self._dependence_group($self._get_field_val(el), obj_sub);
146	+ });
147	+ });
148	+ });
149	+ },
150	+ /**
151	+ * Toggle each dependency group
152	+ * @param {type} this_val : current value of depended element (which other elements depend on it)
153	+ * @param {type} obj_sub : an object contains (dependence_id, expect_val, operator)
154	+ * @returns {undefined}
155	+ */
156	+ _dependence_group : function (this_val, obj_sub) {
157	+ var $self = this;
158	+ $.each(obj_sub, function (key, data) {
159	+ $self._dependence_element(data[0], this_val, data[2], data[1]);
160	+ });
161	+ },
162	+ /**
163	+ * Toggle each dependency element
164	+ *
165	+ * @param {type} dependence_id : id of group A which depends on an element B
166	+ * @param {type} this_val : current value of B
167	+ * @param {type} operator : operator to comparing A's value & B's value : =, >, < ...
168	+ * @param {type} expect_val : expect value of B to show A group
169	+ * @returns {undefined}
170	+ */
171	+ _dependence_element : function (dependence_id, this_val, operator, expect_val) {
172	+
173	+ var dependence_el = $("#" + dependence_id);
174	+ var pass = 0;
175	+ switch (operator) {
176	+ case "=":
177	+ {
178	+ if (typeof expect_val === 'string')
179	+ expect_val = [expect_val];
180	+ pass = ( $.inArray(this_val, expect_val) >= 0 );
181	+ }
182	+ break;
183	+ case "!=":
184	+ {
185	+ if (typeof expect_val === 'string')
186	+ expect_val = [expect_val];
187	+ pass = ( $.inArray(this_val, expect_val) < 0 );
188	+ }
189	+ break;
190	+ default :
191	+ if (typeof expect_val !== 'array')
192	+ pass = eval("this_val " + operator + " expect_val");
193	+ break;
194	+
195	+ }
196	+ var action = '';
197	+ var result = 0;
198	+ if (pass) {
199	+ dependence_el.removeClass('hidden');
200	+
201	+ action = 'remove';
202	+ result = !dependence_el.hasClass('hidden');
203	+ } else {
204	+ dependence_el.addClass('hidden');
205	+
206	+ action = 'add';
207	+ result = dependence_el.hasClass('hidden');
208	+ }
209	+
210	+ // Log if something is wrong
211	+ if (!result)
212	+ console.log(dependence_id, this_val, operator, expect_val, action);
213	+ },
214	+ /**
215	+ * Toggle a group inside Panel group when check/uncheck a checkbox inside checboxes list
216	+ *
217	+ * @param {type} selector
218	+ * @param {type} id_prefix
219	+ * @returns {undefined}
220	+ */
221	+ toggle_group : function (selector, id_prefix) {
222	+ var $self = this;
223	+ // Run on page load
224	+ $(selector).each(function () {
225	+ $self._toggle_each_group($(this), id_prefix);
226	+ });
227	+ // Run on change
228	+ $(selector).each(function () {
229	+ $(this).change(function () {
230	+ $self._toggle_each_group($(this), id_prefix);
231	+ });
232	+ });
233	+ },
234	+ /**
235	+ * Toggle group depends on selector value
236	+ *
237	+ * @param {type} $this
238	+ * @param {type} id_prefix
239	+ * @returns {undefined}
240	+ */
241	+ _toggle_each_group : function ($this, id_prefix) {
242	+ var $self = this;
243	+ var _prefix = $self.options._prefix;
244	+ if ($this.is('select') \|\| ( ( $this.is(':checkbox') \|\| $this.is(':radio') ) && $this.is(':checked') )) {
245	+ // Get id of element A which needs to toggle
246	+ var toggle_id = '#' + id_prefix + $this.val();
247	+
248	+ // Get siblings groups of A
249	+ var other_groups = $(toggle_id).parent().children('.' + _prefix + 'group').not(toggle_id);
250	+
251	+ if ($(toggle_id).hasClass(_prefix + 'only-one')) {
252	+ // Hide other group in a same Panel group
253	+ other_groups.addClass('hidden');
254	+ } else {
255	+ }
256	+
257	+ // Show group
258	+ $(toggle_id).removeClass('hidden');
259	+
260	+ // Show the content
261	+ $(toggle_id).find('.panel-body').show();
262	+
263	+ // Scroll to
264	+ if (!$self.options.onload && !$(toggle_id).hasClass(_prefix + 'no-animation') && $(toggle_id).offset()) {
265	+ $('html, body').animate({
266	+ scrollTop: $(toggle_id).offset().top - 20
267	+ }, $self.options.scroll_time);
268	+ }
269	+
270	+ // Highlight color
271	+ var activate_group = _prefix + 'group-activate';
272	+ $(toggle_id).addClass(activate_group);
273	+
274	+ // Remove highlight color
275	+ setTimeout(function () {
276	+ $(toggle_id).removeClass(activate_group);
277	+ }, 800);
278	+
279	+ } else {
280	+ $('#' + id_prefix + $this.val()).addClass('hidden');
281	+ }
282	+ },
283	+ /**
284	+ * Custom function for 'Content Type'
285	+ *
286	+ * @returns {undefined}
287	+ */
288	+ _content_type : function () {
289	+ var $self = this;
290	+ var _prefix = $self.options._prefix;
291	+
292	+ // Taxonomies Settings wrapper div
293	+ var $wrap_taxonomies = $('#' + _prefix + 'group-taxonomy');
294	+
295	+ // Order Advanced Settings box
296	+ var $order_advance_settings = $('#' + _prefix + 'group-order #' + _prefix + 'group-advanced');
297	+
298	+ // Append <div> : "There is no taxonomy for selected content type" before description of Taxonomies
299	+ var no_taxonomy_id = _prefix + 'no-taxonomy';
300	+ var no_taxonomy_class = _prefix + 'text';
301	+ $wrap_taxonomies.find('.text-muted').first().before('<div id="' + no_taxonomy_id + '" class="' + no_taxonomy_class + '">' + PT_CV_ADMIN.text.no_taxonomy + '</div>');
302	+ var no_taxonomy = $('#' + no_taxonomy_id);
303	+
304	+ // Hide all Taxonomies at beginning
305	+ var fn_taxonomy_hide = function (taxonomies) {
306	+ taxonomies.each(function () {
307	+ $(this).parents('.checkbox').addClass('hidden');
308	+ });
309	+ // Hide no taxonomy div
310	+ no_taxonomy.addClass('hidden');
311	+
312	+ // Hide Order Advanced Settings box
313	+ $order_advance_settings.addClass('hidden');
314	+
315	+ // Hide Terms group
316	+ $('.panel-group.terms').find('.' + _prefix + 'group').addClass('hidden');
317	+ };
318	+ var $taxonomies = $('.' + _prefix + 'taxonomy-item');
319	+ fn_taxonomy_hide($taxonomies);
320	+
321	+ // Create function to handle
322	+ var fn_content_type = function (this_val, is_change) {
323	+ if ( typeof this_val === 'undefined' ) {
324	+ return;
325	+ }
326	+
327	+ if (is_change) {
328	+ // Uncheck all checkbox of taxonomies
329	+ $taxonomies.attr('checked', false);
330	+
331	+ // Toggle Taxonomy Relation setting
332	+ var $taxonomy_relation = $('.' + _prefix + 'taxonomy-relation').parent().parent('.form-group');
333	+ $self._do_toggle_taxonomy_relation($taxonomy_relation, $wrap_taxonomies);
334	+ }
335	+
336	+ // Show taxonomies which theirs value have this format {this_val}_
337	+ if (this_val !== '') {
338	+ fn_taxonomy_hide($taxonomies);
339	+ $taxonomies.filter(function () {
340	+ var val = $(this).val();
341	+ return val.substr(0, this_val.length) === this_val;
342	+ }).parents('.checkbox').removeClass('hidden');
343	+ }
344	+
345	+ // Show Category if Content Type = Post
346	+ if (this_val === 'post') {
347	+ $taxonomies.filter(function () {
348	+ var val = $(this).val();
349	+ return val === 'category';
350	+ }).parents('.checkbox').removeClass('hidden');
351	+ }
352	+
353	+ // Show there is no taxonomies
354	+ if ($wrap_taxonomies.find('.pt-params .checkbox').filter(function () {
355	+ return !$(this).hasClass('hidden');
356	+ }).length === 0) {
357	+ // Show no taxonomy div
358	+ no_taxonomy.removeClass('hidden');
359	+ }
360	+
361	+ // Show Order Advanced Settings box if Content type = product
362	+ if (this_val === 'product') {
363	+ $order_advance_settings.removeClass('hidden');
364	+ }
365	+
366	+ };
367	+
368	+ // Get "Content Type" input object
369	+ var content_type = '[name="' + _prefix + 'content-type' + '"]';
370	+
371	+ // Run on page load
372	+ fn_content_type($(content_type + ':checked').val());
373	+
374	+ // Run on change
375	+ $(content_type).change(function () {
376	+ fn_content_type($(content_type + ':checked').val(), 1);
377	+ });
378	+ },
379	+ /**
380	+ * Preview handle
381	+ *
382	+ * @param string _nonce
383	+ * @returns {undefined}
384	+ */
385	+ preview : function (_nonce) {
386	+ var $self = this;
387	+ var _prefix = $self.options._prefix;
388	+
389	+ // Store previous offset top position
390	+ var offset_top;
391	+
392	+ $('#' + _prefix + 'show-preview').click(function (e) {
393	+ e.preventDefault();
394	+
395	+ var $this_btn = $(this);
396	+
397	+ // Get Preview box
398	+ var $preview = $('#' + _prefix + 'preview-box');
399	+
400	+ // Show/hide Preview box
401	+ if ($self.options.can_preview) {
402	+ $preview.addClass('in');
403	+ } else {
404	+ $preview.removeClass('in');
405	+ }
406	+
407	+ /**
408	+ * Send request
409	+ */
410	+ if ($self.options.can_preview) {
411	+
412	+ // Get settings data
413	+ var data = $('#' + _prefix + 'form-view').serialize();
414	+
415	+ // Call handle function
416	+ $self._preview_request($preview, data, _nonce, $this_btn);
417	+ }
418	+
419	+ /**
420	+ * Animation
421	+ */
422	+ // Scroll to preview box if want to show it
423	+ if ($self.options.can_preview) {
424	+ // Get current offset top to go back later
425	+ offset_top = $(document).scrollTop();
426	+
427	+ // Scroll to preview box
428	+ $('html, body').animate({
429	+ scrollTop: $preview.offset().top - 100
430	+ }, $self.options.scroll_time);
431	+ } else {
432	+ // Scroll to previous position
433	+ $('html, body').animate({
434	+ scrollTop: offset_top
435	+ }, $self.options.scroll_time);
436	+
437	+ // Toggle text of this button
438	+ $this_btn.html(PT_CV_ADMIN.btn.preview.show);
439	+
440	+ // Enable preview
441	+ $self.options.can_preview = 1;
442	+ }
443	+ });
444	+ },
445	+ /**
446	+ * Send preview Ajax request
447	+ *
448	+ * @param object preview_box The jqurey object
449	+ * @param string _data
450	+ * @param string _nonce The generated nonce
451	+ * @param object $this_btn The Show/Hide preview button
452	+ * @returns void
453	+ */
454	+ _preview_request : function (preview_box, _data, _nonce, $this_btn) {
455	+ var $self = this;
456	+ var _prefix = $self.options._prefix;
457	+
458	+ // Setup data
459	+ var data = {
460	+ action : 'preview_request',
461	+ data : _data,
462	+ ajax_nonce: _nonce
463	+ };
464	+
465	+ // Sent POST request
466	+ $.ajax({
467	+ type : "POST",
468	+ url : ajaxurl,
469	+ data : data,
470	+ beforeSend: function () {
471	+ // Show loading icon
472	+ preview_box.next().toggleClass('hidden');
473	+ },
474	+ }).done(function (response) {
475	+ // Hide loading icon
476	+ preview_box.next().toggleClass('hidden');
477	+
478	+ // Update content of Preview box
479	+ preview_box.html(response);
480	+
481	+ // Toggle text of this button
482	+ $this_btn.html(PT_CV_ADMIN.btn.preview.hide);
483	+
484	+ // Disable preview
485	+ $self.options.can_preview = 0;
486	+
487	+ // Trigger action, to recall function such as pagination, pinterest render layout...
488	+ $('body').trigger(_prefix + 'custom-trigger');
489	+ });
490	+ },
491	+ /**
492	+ * Toggle 'Thumbnail settings'
493	+ *
494	+ * @returns {undefined}
495	+ */
496	+ _thumbnail_settings : function () {
497	+ var _prefix = this.options._prefix;
498	+ var _thumbnail_setting_state = 1;
499	+
500	+ /**
501	+ * Toggle 'Thumbnail settings' when change 'Layout format'
502	+ *
503	+ * @param this_val Layout format value
504	+ * @returns void
505	+ */
506	+
507	+ var fn_thumbnail_setting = function (this_val) {
508	+
509	+ var $thumbnail_wrapper = $('.' + _prefix + 'thumbnail-setting').parent();
510	+ if (this_val === '2-col') {
511	+ _thumbnail_setting_state = $thumbnail_wrapper.hasClass('hidden') ? 0 : 1;
512	+ $thumbnail_wrapper.removeClass('hidden');
513	+ } else if (this_val === '1-col') {
514	+ if (_thumbnail_setting_state) {
515	+ $thumbnail_wrapper.removeClass('hidden');
516	+ } else {
517	+ $thumbnail_wrapper.addClass('hidden');
518	+ }
519	+ }
520	+ };
521	+
522	+ var layout_format = '[name="' + _prefix + 'layout-format' + '"]';
523	+
524	+ // Run on page load
525	+ fn_thumbnail_setting($(layout_format + ':checked').val());
526	+
527	+ // Run on change
528	+ $(layout_format).change(function () {
529	+ fn_thumbnail_setting($(layout_format + ':checked').val());
530	+ });
531	+
532	+ /**
533	+ * Toggle 'Thumbnail settings' when change 'View type'
534	+ */
535	+
536	+ var fn_view_type = function (this_val, layout_format) {
537	+ var expect_val = [ 'scrollable', 'pinterest', 'timeline' ];
538	+
539	+ // 'View type' = Pinterest \| Timeline
540	+ if ($.inArray(this_val, expect_val) >= 0) {
541	+ // Trigger select 1-col
542	+ $(layout_format + '[value="1-col"]').trigger('click');
543	+ // Disable 2-col
544	+ $(layout_format + '[value="2-col"]').attr('disabled', true);
545	+ } else {
546	+ // Enable 2-col
547	+ $(layout_format + '[value="2-col"]').attr('disabled', false);
548	+ }
549	+ };
550	+
551	+ var view_type = '[name="' + _prefix + 'view-type' + '"]';
552	+
553	+ // Run on page load
554	+ fn_view_type($(view_type + ':checked').val(), layout_format);
555	+
556	+ // Run on change
557	+ $(view_type).change(function () {
558	+ fn_view_type($(view_type + ':checked').val(), layout_format);
559	+ });
560	+ },
561	+ /**
562	+ * Disable pagination in some cases
563	+ *
564	+ * @param string _prefix
565	+ * @returns {undefined}
566	+ */
567	+ _pagination_disable : function () {
568	+ var _prefix = this.options._prefix;
569	+
570	+ var fn_selector = function (this_val) {
571	+ var layout_format_el = '[name="' + _prefix + 'layout-format' + '"]';
572	+
573	+ var expect_val = ['grid', 'collapsible'];
574	+ if ($.inArray(this_val, expect_val) < 0) {
575	+ // Disable "2 columns" option
576	+ $(layout_format_el + '[value="2-col"]').attr('disabled', true);
577	+ $(layout_format_el + '[value="2-col"]').attr('checked', false);
578	+
579	+ // Auto select "1 column" option
580	+ $(layout_format_el + '[value="1-col"]').attr('checked', true);
581	+ } else {
582	+ // Enable "2 columns" option
583	+ $(layout_format_el + '[value="2-col"]').removeAttr('disabled');
584	+ $(layout_format_el + '[value="2-col"]').removeAttr('checked');
585	+ }
586	+ };
587	+
588	+ var selector = '[name="' + _prefix + 'view-type' + '"]';
589	+
590	+ // Run on page load
591	+ fn_selector($(selector + ':checked').val());
592	+
593	+ // Run on change
594	+ $(selector).change(function () {
595	+ fn_selector($(selector + ':checked').val());
596	+ });
597	+ },
598	+ /**
599	+ * Custom js for elements
600	+ * @returns {undefined}
601	+ */
602	+ custom : function () {
603	+
604	+ var $self = this;
605	+ var _prefix = $self.options._prefix;
606	+
607	+ // Bind on change input after page load
608	+ $('input, select, textarea', '.pt-wrap .tab-content').change(function () {
609	+ $self.options.onload = 0;
610	+
611	+ // Toggle text of this button
612	+ $('#' + _prefix + 'show-preview').html(PT_CV_ADMIN.btn.preview.update);
613	+
614	+ // Enable preview
615	+ $self.options.can_preview = 1;
616	+ });
617	+
618	+ // Custom JS for Content Type
619	+ $self._content_type();
620	+
621	+ // Toggle Taxonomy Relation
622	+ $self._toggle_taxonomy_relation();
623	+
624	+ // Toggle panel of 'Advanced filters'
625	+ $self._toggle_panel('.' + _prefix + 'group .panel-heading');
626	+
627	+ // Color picker
628	+ $self._color_picker('.' + _prefix + 'color');
629	+
630	+ // 'Thumbnail settings' toggle
631	+ $self._thumbnail_settings();
632	+
633	+ // Select 2
634	+ $('.' + _prefix + 'select2').select2();
635	+
636	+ // Change class of panel inside panel
637	+ $('.' + _prefix + 'group .panel .panel').each(function () {
638	+ $(this).removeClass('panel-primary').addClass('panel-info');
639	+ });
640	+
641	+ // Set custom style for 'Thumbnail position' box
642	+ $('.' + _prefix + 'bg-none').parent().css({'background-color': '#fff', 'padding-bottom': '10px'});
643	+ $('.' + _prefix + 'bg-none').parent().addClass('unsortable');
644	+
645	+ // Disable pagination
646	+ $self._pagination_disable();
647	+
648	+ // Prevent click on Links but title
649	+ $('#pt-cv-preview-box').on('click', 'a', function (e) {
650	+ e.preventDefault();
651	+
652	+ // alert(PT_CV_ADMIN.text.prevent_click);
653	+ });
654	+ },
655	+
656	+ /**
657	+ * Do handy toggle for Excerpt settings
658	+ *
659	+ * @returns {undefined}
660	+ */
661	+ handy_toggle_excerpt_settings: function () {
662	+ var _prefix = this.options._prefix;
663	+
664	+ var _this_toggle = function (show_content) {
665	+ if (!show_content) {
666	+ $('#' + _prefix + 'group-excerpt-settings').addClass('hidden');
667	+ } else {
668	+ $('#' + _prefix + 'group-excerpt-settings').removeClass('hidden');
669	+ }
670	+ };
671	+
672	+ var selector = '[name="' + _prefix + 'show-field-content' + '"]';
673	+
674	+ // Run on page load
675	+ _this_toggle($(selector).is(':checked'));
676	+
677	+ // Run on change
678	+ $(selector).change(function () {
679	+ _this_toggle($(selector).is(':checked'));
680	+ });
681	+ }
682	+ };
683	+ }(jQuery) );

admin/content-views-admin.php ADDED Viewed

	@@ -0,0 +1,402 @@


1	+ <?php
2	+ /**
3	+ * Content Views Admin
4	+ *
5	+ * @package PT_Content_Views_Admin
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ class PT_Content_Views_Admin {
13	+
14	+ /**
15	+ * Instance of this class.
16	+ *
17	+ * @since 1.0.0
18	+ *
19	+ * @var object
20	+ */
21	+ protected static $instance = null;
22	+
23	+ /**
24	+ * Slug of the plugin screen.
25	+ *
26	+ * @since 1.0.0
27	+ *
28	+ * @var string
29	+ */
30	+ protected $plugin_screen_hook_suffix = null;
31	+
32	+ // Slugs for sub menu pages
33	+ protected $plugin_sub_screen_hook_suffix = null;
34	+
35	+ /**
36	+ * Initialize the plugin by loading admin scripts & styles and adding a
37	+ * settings page and menu.
38	+ *
39	+ * @since 1.0.0
40	+ */
41	+ private function __construct() {
42	+
43	+ /*
44	+ * @TODO :
45	+ *
46	+ * - Uncomment following lines if the admin class should only be available for super admins
47	+ */
48	+ /* if( ! is_super_admin() ) {
49	+ return;
50	+ } */
51	+
52	+ /*
53	+ * Call $plugin_slug from public plugin class.
54	+ */
55	+ $plugin = PT_Content_Views::get_instance();
56	+ $this->plugin_slug = $plugin->get_plugin_slug();
57	+
58	+ // Fix redirect error
59	+ add_action( 'init', array( $this, 'do_output_buffer' ) );
60	+
61	+ // Redirect to "Add View" page when click "Add new" link in "All Views" page
62	+ add_action( 'admin_init', array( $this, 'redirect_add_new' ) );
63	+
64	+ // Load admin style sheet and JavaScript.
65	+ add_action( 'admin_enqueue_scripts', array( $this, 'enqueue_admin_styles' ) );
66	+ add_action( 'admin_enqueue_scripts', array( $this, 'enqueue_admin_scripts' ) );
67	+ add_action( 'admin_print_footer_scripts', array( $this, 'print_footer_scripts' ) );
68	+
69	+ // Add the options page and menu item.
70	+ add_action( 'admin_menu', array( $this, 'add_plugin_admin_menu' ) );
71	+
72	+ // Add an action link pointing to the options page.
73	+ $plugin_basename = plugin_basename( plugin_dir_path( __DIR__ ) . $this->plugin_slug . '.php' );
74	+ add_filter( 'plugin_action_links_' . $plugin_basename, array( $this, 'filter_add_action_links' ) );
75	+
76	+ // Filter link of actions in All Views page
77	+ add_filter( 'post_row_actions', array( $this, 'filter_post_row_actions' ), 10, 2 );
78	+
79	+ // Filter link of Title in All Views page
80	+ add_filter( 'get_edit_post_link', array( $this, 'filter_get_edit_post_link' ), 10, 3 );
81	+
82	+ // Ajax action
83	+ $action = 'preview_request';
84	+ add_action( 'wp_ajax_' . $action, array( 'PT_CV_Functions', 'ajax_callback_' . $action ) );
85	+
86	+ // Output assets content at footer of page
87	+ add_action( PT_CV_PREFIX_ . 'preview_footer', array( 'PT_CV_Html', 'assets_of_view_types' ) );
88	+
89	+ // Custom hooks for both preview & frontend
90	+ PT_CV_Hooks::init();
91	+ }
92	+
93	+ /**
94	+ * Return an instance of this class.
95	+ *
96	+ * @since 1.0.0
97	+ *
98	+ * @return object A single instance of this class.
99	+ */
100	+ public static function get_instance() {
101	+
102	+ /*
103	+ * @TODO :
104	+ *
105	+ * - Uncomment following lines if the admin class should only be available for super admins
106	+ */
107	+ /* if( ! is_super_admin() ) {
108	+ return;
109	+ } */
110	+
111	+ // If the single instance hasn't been set, set it now.
112	+ if ( null == self::$instance ) {
113	+ self::$instance = new self;
114	+ }
115	+
116	+ return self::$instance;
117	+ }
118	+
119	+ /**
120	+ * Output buffering
121	+ */
122	+ public function do_output_buffer() {
123	+ ob_start();
124	+ }
125	+
126	+ /**
127	+ * Redirect to "Add View" page when click "Add new" link in "All Views" page
128	+ */
129	+ public function redirect_add_new() {
130	+ global $pagenow;
131	+ if ( $pagenow === 'post-new.php' ) {
132	+ $post_type = isset( $_GET['post_type'] ) ? $_GET['post_type'] : '';
133	+ if ( $post_type === PT_CV_POST_TYPE ) {
134	+ wp_redirect( admin_url( 'admin.php?page=' . $this->plugin_slug . '-add' ), 301 );
135	+ exit;
136	+ }
137	+ }
138	+ }
139	+
140	+ /**
141	+ * Register and enqueue admin-specific style sheet.
142	+ *
143	+ * @since 1.0.0
144	+ *
145	+ * @return null Return early if no settings page is registered.
146	+ */
147	+ public function enqueue_admin_styles() {
148	+
149	+ if ( ! isset( $this->plugin_screen_hook_suffix ) ) {
150	+ return;
151	+ }
152	+
153	+ // Load every Admin pages
154	+ PT_CV_Asset::enqueue(
155	+ 'admin-menu', 'style', array(
156	+ 'src' => plugins_url( 'assets/css/menu.css', __FILE__ ),
157	+ )
158	+ );
159	+
160	+ $screen = get_current_screen();
161	+ if ( $this->plugin_screen_hook_suffix == $screen->id \|\| in_array( $screen->id, $this->plugin_sub_screen_hook_suffix ) ) {
162	+
163	+ // WP assets
164	+ wp_enqueue_style( 'thickbox' );
165	+ wp_enqueue_style( 'media-upload' );
166	+ wp_enqueue_style( 'farbtastic' );
167	+
168	+ // Main admin style
169	+ PT_CV_Asset::enqueue(
170	+ 'admin', 'style', array(
171	+ 'src' => plugins_url( 'assets/css/admin.css', __FILE__ ),
172	+ )
173	+ );
174	+
175	+ // Fix style of WP
176	+ global $wp_version;
177	+ if ( version_compare( $wp_version, '3.8.0' ) >= 0 ) {
178	+ PT_CV_Asset::enqueue(
179	+ 'admin-fix', 'style', array(
180	+ 'src' => plugins_url( 'assets/css/wp38.css', __FILE__ ),
181	+ 'ver' => $wp_version,
182	+ )
183	+ );
184	+ } else {
185	+ PT_CV_Asset::enqueue(
186	+ 'admin-fix', 'style', array(
187	+ 'src' => plugins_url( 'assets/css/wp.css', __FILE__ ),
188	+ 'ver' => $wp_version,
189	+ )
190	+ );
191	+ }
192	+
193	+ // For Preview
194	+ PT_CV_Html::frontend_styles();
195	+
196	+ // Main scripts
197	+ PT_CV_Asset::enqueue( 'select2', 'style' );
198	+ PT_CV_Asset::enqueue( 'select2-bootstrap', 'style' );
199	+ }
200	+ }
201	+
202	+ /**
203	+ * Register and enqueue admin-specific JavaScript.
204	+ *
205	+ * @since 1.0.0
206	+ *
207	+ * @return null Return early if no settings page is registered.
208	+ */
209	+ public function enqueue_admin_scripts() {
210	+
211	+ if ( ! isset( $this->plugin_screen_hook_suffix ) ) {
212	+ return;
213	+ }
214	+
215	+ $screen = get_current_screen();
216	+ if ( $this->plugin_screen_hook_suffix == $screen->id \|\| in_array( $screen->id, $this->plugin_sub_screen_hook_suffix ) ) {
217	+
218	+ // WP assets
219	+ wp_enqueue_script( 'farbtastic' );
220	+ wp_enqueue_script( 'jquery-ui-sortable' );
221	+
222	+ // Main admin script
223	+ PT_CV_Asset::enqueue(
224	+ 'admin', 'script', array(
225	+ 'src' => plugins_url( 'assets/js/admin.js', __FILE__ ),
226	+ 'deps' => array( 'jquery' ),
227	+ )
228	+ );
229	+
230	+ // Localize strings
231	+ PT_CV_Asset::localize_script(
232	+ 'admin', PT_CV_PREFIX_UPPER . 'ADMIN', array(
233	+ 'text' => array(
234	+ 'no_taxonomy' => __( 'There is no taxonomy for selected content type', PT_CV_DOMAIN ),
235	+ 'pagination_disable' => __( 'Pagination is disabled when Limit = -1', PT_CV_DOMAIN ),
236	+ 'prevent_click' => __( 'Opening a link is prevented in preview box', PT_CV_DOMAIN ),
237	+ ),
238	+ 'btn' => array(
239	+ 'preview' => array(
240	+ 'show' => __( 'Show Preview', PT_CV_DOMAIN ),
241	+ 'hide' => __( 'Hide Preview', PT_CV_DOMAIN ),
242	+ 'update' => __( 'Update Preview', PT_CV_DOMAIN ),
243	+ ),
244	+ ),
245	+ )
246	+ );
247	+
248	+ // For Preview
249	+ PT_CV_Html::frontend_scripts();
250	+
251	+ PT_CV_Asset::enqueue( 'select2' );
252	+ }
253	+ }
254	+
255	+ /**
256	+ * Print script at footer of WP admin
257	+ */
258	+ public function print_footer_scripts() {
259	+ if ( ! isset( $this->plugin_screen_hook_suffix ) ) {
260	+ return;
261	+ }
262	+
263	+ $screen = get_current_screen();
264	+ if ( $this->plugin_screen_hook_suffix == $screen->id \|\| in_array( $screen->id, $this->plugin_sub_screen_hook_suffix ) ) {
265	+ PT_Options_Framework::print_js();
266	+ }
267	+ }
268	+
269	+ /**
270	+ * Register the administration menu for this plugin into the WordPress Dashboard menu.
271	+ *
272	+ * @since 1.0.0
273	+ */
274	+ public function add_plugin_admin_menu() {
275	+
276	+ /*
277	+ * Add a settings page for this plugin to the Settings menu.
278	+ */
279	+ $this->plugin_screen_hook_suffix = add_menu_page(
280	+ __( 'Content View Settings', $this->plugin_slug ),
281	+ __( 'Content View Settings', $this->plugin_slug ),
282	+ 'manage_options',
283	+ $this->plugin_slug,
284	+ array( $this, 'display_plugin_admin_page' ),
285	+ '',
286	+ '45.6'
287	+ );
288	+
289	+ $this->plugin_sub_screen_hook_suffix[] = PT_CV_Functions::menu_add_sub(
290	+ $this->plugin_slug,
291	+ __( 'All Content Views', $this->plugin_slug ),
292	+ __( 'All Views', $this->plugin_slug ),
293	+ 'list',
294	+ __CLASS__
295	+ );
296	+
297	+ $this->plugin_sub_screen_hook_suffix[] = PT_CV_Functions::menu_add_sub(
298	+ $this->plugin_slug,
299	+ __( 'Add New View', $this->plugin_slug ),
300	+ __( 'Add New', $this->plugin_slug ),
301	+ 'add',
302	+ __CLASS__
303	+ );
304	+
305	+ }
306	+
307	+ /**
308	+ * Render the settings page for this plugin.
309	+ *
310	+ * @since 1.0.0
311	+ */
312	+ public function display_plugin_admin_page() {
313	+ include_once( 'views/admin.php' );
314	+ }
315	+
316	+ /**
317	+ * List all Views page
318	+ */
319	+ public function display_sub_page_list() {
320	+ include_once( 'views/list.php' );
321	+ }
322	+
323	+ /**
324	+ * Add/Edit View page
325	+ */
326	+ public function display_sub_page_add() {
327	+ include_once( 'views/view.php' );
328	+ }
329	+
330	+ /**
331	+ * Add settings action link to the plugins page, doesn't work in Multiple site
332	+ *
333	+ * @since 1.0.0
334	+ */
335	+ public function filter_add_action_links( $links ) {
336	+
337	+ return array_merge(
338	+ array(
339	+ 'settings' => '<a href="' . admin_url( 'admin.php?page=' . $this->plugin_slug ) . '">' . __( 'Settings', $this->plugin_slug ) . '</a>',
340	+ 'add' => '<a href="' . admin_url( 'admin.php?page=' . $this->plugin_slug . '-add' ) . '">' . __( 'Add View', $this->plugin_slug ) . '</a>',
341	+ ),
342	+ $links
343	+ );
344	+ }
345	+
346	+ /**
347	+ * Filter link of actions in All Views page
348	+ *
349	+ * @param array $actions Array of actions link
350	+ * @param object $post The post
351	+ *
352	+ * @return array
353	+ */
354	+ public function filter_post_row_actions( $actions, $post ) {
355	+
356	+ // Get current post type
357	+ $post_type = PT_CV_Functions::admin_current_post_type();
358	+
359	+ if ( $post_type != PT_CV_POST_TYPE ) {
360	+ return $actions;
361	+ }
362	+
363	+ // Remove Quick edit link
364	+ unset( $actions['inline hide-if-no-js'] );
365	+
366	+ // Remove View link
367	+ unset( $actions['view'] );
368	+
369	+ // Update Edit link
370	+
371	+ // Get View id
372	+ $view_id = get_post_meta( $post->ID, PT_CV_META_ID, true );
373	+
374	+ if ( ! empty( $view_id ) ) {
375	+ $edit_link = PT_CV_Functions::view_link( $view_id );
376	+ $actions['edit'] = '<a href="' . esc_url( $edit_link ) . '" title="' . esc_attr( __( 'Edit this item' ) ) . '">' . __( 'Edit' ) . '</a>';
377	+ }
378	+
379	+ return $actions;
380	+ }
381	+
382	+ /**
383	+ * Filter link of Title in All Views page
384	+ */
385	+ public function filter_get_edit_post_link( $edit_link, $post_id, $context ) {
386	+
387	+ // Get current post type
388	+ $post_type = PT_CV_Functions::admin_current_post_type();
389	+
390	+ if ( $post_type != PT_CV_POST_TYPE ) {
391	+ return $edit_link;
392	+ }
393	+
394	+ // Get View id
395	+ $view_id = get_post_meta( $post_id, PT_CV_META_ID, true );
396	+
397	+ $edit_link = PT_CV_Functions::view_link( $view_id );
398	+
399	+ return $edit_link;
400	+ }
401	+
402	+ }

admin/includes/options.php ADDED Viewed

	@@ -0,0 +1,395 @@


1	+ <?php
2	+ /**
3	+ * Options framework
4	+ *
5	+ * Contain all functions to display setting options on page
6	+ *
7	+ * @package PT_Options_Framework
8	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
9	+ * @license GPL-2.0+
10	+ * @link http://example.com
11	+ * @copyright 2014 Palace Of Themes
12	+ */
13	+
14	+ if ( ! class_exists( 'PT_Options_Framework' ) ) {
15	+
16	+ class PT_Options_Framework {
17	+
18	+ private static $dependence_info; // Store dependency information of options
19	+
20	+ public function __construct() {
21	+ }
22	+
23	+ /**
24	+ * Check dependence information & generate random id for dependency elements
25	+ *
26	+ * @param array $param Array of parameters of a setting option
27	+ * @param array $dependence_ Global dependence array
28	+ *
29	+ * @return string\|null
30	+ */
31	+ public static function _dependence_check( $param, &$dependence_ ) {
32	+ if ( isset( $param['dependence'] ) ) {
33	+ // Depend array: 3 params in order : name (of param this param depends), value (of param this param depends), operator
34	+ $dependence = (array) $param['dependence'];
35	+ $random_id = PT_CV_PREFIX . 'dependence_' . PT_CV_Functions::string_random();
36	+
37	+ // Single dependency relationship
38	+ if ( ! is_array( $dependence[0] ) ) {
39	+ self::_dependence_assign( $dependence, $random_id, $dependence_ );
40	+ } else {
41	+ // Multiple dependency relationships
42	+ foreach ( $dependence as $dp ) {
43	+ self::_dependence_assign( $dp, $random_id, $dependence_ );
44	+ }
45	+ }
46	+
47	+ return $random_id;
48	+ }
49	+
50	+ return NULL;
51	+ }
52	+
53	+ /**
54	+ * Assign dependency relationship
55	+ *
56	+ * @param array $dependence Array of dependence attributes
57	+ * @param string $random_id Random string
58	+ * @param array $dependence_ Global dependence array
59	+ */
60	+ public static function _dependence_assign( $dependence, $random_id, &$dependence_ ) {
61	+ $dependence_[$dependence[0]][] = array( $random_id, $dependence[1], isset( $dependence[2] ) ? $dependence[2] : '=' );
62	+ }
63	+
64	+ /**
65	+ * Settings for group of options
66	+ *
67	+ * @param array $options List of setting options
68	+ * @param array $data Stored data of settings
69	+ *
70	+ * @return string
71	+ */
72	+ public static function do_settings( $options, $data = array() ) {
73	+ $result = $dependence_ = array();
74	+ if ( ! $options ) {
75	+ return '';
76	+ }
77	+
78	+ foreach ( $options as $group ) {
79	+ $result[] = self::group( $group, $data, $dependence_ );
80	+ }
81	+ if ( $dependence_ ) {
82	+ self::$dependence_info[] = $dependence_;
83	+ }
84	+
85	+ return implode( '', $result );
86	+ }
87	+
88	+ /**
89	+ * Group of options
90	+ *
91	+ * @param array $group
92	+ * @param array $data Stored data of settings
93	+ * @param array $dependence_ Global dependence array
94	+ *
95	+ * @return string
96	+ */
97	+ public static function group( $group, $data, &$dependence_ ) {
98	+ if ( empty( $group['label'] ) && empty( $group['params'] ) ) {
99	+ return '';
100	+ }
101	+
102	+ $extra_setting = isset( $group['extra_setting'] ) ? $group['extra_setting'] : array();
103	+ $label = self::label( $group['label'], $extra_setting );
104	+ $params = self::params( $group['params'], $data, $extra_setting );
105	+ $random_id = self::_dependence_check( $group, $dependence_ );
106	+ $id = $class = '';
107	+ if ( $random_id ) {
108	+ $id = "id='$random_id'";
109	+ $class = 'hidden';
110	+ }
111	+
112	+ return "<div class='form-group pt-form-group $class' $id>$label $params</div>";
113	+ }
114	+
115	+ /**
116	+ * Label
117	+ *
118	+ * @param string $label Text for label
119	+ */
120	+ public static function label( $label = array(), $extra_setting = array() ) {
121	+ $for = isset( $label['for'] ) ? "for='{$label['for']}'" : '';
122	+ $width = 12 - ( isset( $extra_setting['params']['width'] ) ? intval( $extra_setting['params']['width'] ) : 10 );
123	+ if ( $width ) {
124	+ $html = "<label $for class='col-sm-$width control-label'>" . __( $label['text'], PT_CV_DOMAIN ) . '</label>';
125	+ } else {
126	+ $html = '';
127	+ }
128	+
129	+ return $html;
130	+ }
131	+
132	+ /**
133	+ * Print params next to label
134	+ *
135	+ * @param string $params Array of setting options in a group
136	+ */
137	+ public static function params( $params, $data, $extra_setting ) {
138	+ $params_html = array();
139	+ foreach ( (array) $params as $param ) {
140	+ $params_html[] = self::field_type( (array) $param, $data ) . "\n";
141	+ }
142	+ $html = implode( '', $params_html );
143	+ $param_wrap_class = isset( $extra_setting['params']['wrap-class'] ) ? esc_attr( $extra_setting['params']['wrap-class'] ) : '';
144	+ $param_wrap_id = isset( $extra_setting['params']['wrap-id'] ) ? "id='" . esc_attr( $extra_setting['params']['wrap-id'] ) . "'" : '';
145	+ $width = isset( $extra_setting['params']['width'] ) ? intval( $extra_setting['params']['width'] ) : 10;
146	+
147	+ return "<div class='col-sm-$width pt-params $param_wrap_class' $param_wrap_id>$html</div>";
148	+ }
149	+
150	+ /**
151	+ * Get value of field
152	+ *
153	+ * @param array $data Stored data of settings
154	+ * @param array $param Array of parameters of a setting option
155	+ *
156	+ * @return string
157	+ */
158	+ public static function field_value( $data, $param, $name ) {
159	+ // Get name without []
160	+ $single_name = rtrim( $name, '[]' );
161	+
162	+ // Get value of field
163	+ if ( $data ) {
164	+ $value = isset( $data[$single_name] ) ? $data[$single_name] : '';
165	+ } else {
166	+ $value = isset( $param['std'] ) ? $param['std'] : '';
167	+ }
168	+
169	+ return $value;
170	+ }
171	+
172	+ /**
173	+ * Print HTML code of field type: input, select, textarea...
174	+ *
175	+ * @param array $param Array of parameters of a setting option
176	+ *
177	+ * @return string
178	+ */
179	+ public static function field_type( $param, $data ) {
180	+ if ( ! $param \|\| ! isset( $param['type'] ) ) {
181	+ return '';
182	+ }
183	+ $html = $extend = '';
184	+ $class = 'form-control ' . ( isset( $param['class'] ) ? ' ' . PT_CV_PREFIX . $param['class'] : '' );
185	+
186	+ $type = esc_attr( $param['type'] );
187	+ $name = ! empty( $param['name'] ) ? PT_CV_PREFIX . esc_attr( $param['name'] ) : '';
188	+ $id = ! empty( $param['id'] ) ? "id='" . PT_CV_PREFIX . esc_attr( $param['id'] ) . "'" : '';
189	+ $value = self::field_value( $data, $param, $name );
190	+ $description = isset( $param['desc'] ) ? esc_html__( $param['desc'], PT_CV_DOMAIN ) : '';
191	+
192	+ // Add extra information of option type
193	+ switch ( $type ) {
194	+ case 'number':
195	+ $min = ! empty( $param['min'] ) ? intval( $param['min'] ) : 1;
196	+ $extend = 'min="' . $min . '"';
197	+ break;
198	+ case 'color':
199	+ $class .= ' ' . PT_CV_PREFIX . 'color';
200	+ break;
201	+ case 'checkbox':
202	+ case 'radio':
203	+ // Remove form-control class in checkbox, radio
204	+ $class = str_replace( 'form-control', '', $class );
205	+ break;
206	+ }
207	+
208	+ $class = esc_attr( $class );
209	+
210	+ // Show HTML of option type
211	+ switch ( $type ) {
212	+ case 'group':
213	+ $html .= self::do_settings( $param['params'], $data );
214	+ break;
215	+ case 'text':
216	+ case 'email':
217	+ case 'password':
218	+ case 'number':
219	+ case 'url':
220	+ $placeholder = ! empty( $param['placeholder'] ) ? $param['placeholder'] : '';
221	+ $append_text = ! empty( $param['append_text'] ) ? $param['append_text'] : '';
222	+
223	+ $input = "<input type='$type' name='$name' value='$value' class='$class' $id $extend placeholder='$placeholder'>";
224	+ if ( empty( $append_text ) ) {
225	+ $html .= $input;
226	+ } else {
227	+ $html .= "<div class='input-group'>$input<span class='input-group-addon'>$append_text</span></div>";
228	+ }
229	+ break;
230	+ case 'color':
231	+ $html .= "<input type='text' name='$name' value='$value' class='$class' $id $extend style='background-color:$value;'>";
232	+ $html .= "<div class='" . PT_CV_PREFIX . "colorpicker' style='z-index: 100; background:#eee; border:1px solid #ccc; position:absolute; display:none;'></div><br>";
233	+ break;
234	+ case 'textarea':
235	+ $html .= "<textarea name='$name' class='$class' $id $extend>$value</textarea>";
236	+ break;
237	+ case 'checkbox':
238	+ case 'radio':
239	+ if ( ! isset( $param['options'] ) ) {
240	+ break;
241	+ }
242	+
243	+ $settings = isset( $param['settings'] ) ? $param['settings'] : array();
244	+ foreach ( $param['options'] as $key => $text ) {
245	+ // Append Html to $text, such as image...
246	+ if ( $settings ) {
247	+ $append = isset( $settings['text-append'] ) ? $settings['text-append'] : '';
248	+ if ( $append == 'image' ) {
249	+ $path = isset( $settings['path'] ) ? $settings['path'] : '';
250	+ if ( $path ) {
251	+ $text .= "<br> <img src='" . plugins_url( $path . "/$key.png", PT_CV_FILE ) . "' />";
252	+ }
253	+ }
254	+ }
255	+
256	+ $checked = ( in_array( $key, (array) $value ) \|\| ( $value == 'all' ) ) ? 'checked' : '';
257	+ $html .= "<div class='$type'><label><input type='$type' name='$name' value='$key' class='$class' $checked $id $extend>$text</label></div>";
258	+ }
259	+
260	+ break;
261	+ case 'select':
262	+ if ( ! isset( $param['options'] ) ) {
263	+ break;
264	+ }
265	+
266	+ $options = '';
267	+ foreach ( $param['options'] as $key => $text ) {
268	+ $selected = ( in_array( $key, (array) $value ) \|\| ( $value == 'all' ) ) ? 'selected' : '';
269	+ $option_class = isset( $param['option_class_prefix'] ) ? sprintf( "class='%s'", $param['option_class_prefix'] . esc_attr( sanitize_title( $key ) ) ) : '';
270	+ $options .= "<option value='$key' $selected $option_class>$text</option>";
271	+ }
272	+ if ( empty( $options ) ) {
273	+ $html .= "<div class='" . PT_CV_PREFIX . "text'>" . __( 'There is no option', PT_CV_DOMAIN ) . '</div>';
274	+ } else {
275	+ $multiple = '';
276	+ if ( ( isset( $param['multiple'] ) && $param['multiple'] == '1' ) \|\| $value == 'all' ) {
277	+ $multiple = 'multiple';
278	+ // Auto add [] to name of select
279	+ $name .= substr( $name, - 2 ) == '[]' ? '' : '[]';
280	+ }
281	+ $html .= "<select name='$name' class='$class' $multiple $id $extend>$options</select>";
282	+ }
283	+ break;
284	+ case 'font_color':
285	+ $html .= "<div class='form-inline font-color'>";
286	+ $font = self::field_type( $param['options']['font'], $data );
287	+ $html .= "<div class='input-group'>$font<span class='input-group-addon'>px</span></div>";
288	+ $color = self::field_type( $param['options']['color'], $data );
289	+ $html .= "<div class='form-group'>$color</div>";
290	+ $html .= '</div>';
291	+ break;
292	+ case 'html':
293	+ if ( isset( $param['content'] ) ) {
294	+ $html .= $param['content'];
295	+ }
296	+ break;
297	+ case 'panel_group':
298	+ // In format: key => array of params
299	+ $parent_id = PT_CV_Functions::string_random( true );
300	+ $settings = isset( $param['settings'] ) ? $param['settings'] : array();
301	+ foreach ( $param['params'] as $key => $param_group ) {
302	+ $html .= self::sub_panel_group( $key, $param_group, $data, $parent_id, $settings );
303	+ }
304	+ break;
305	+ default:
306	+ break;
307	+ }
308	+
309	+ if ( ! empty( $description ) ) {
310	+ $description = str_replace( '[--br--]', '<br>', $description );
311	+ $html .= "<p class='text-muted'>$description</p>";
312	+ }
313	+
314	+ return $html;
315	+ }
316	+
317	+ /**
318	+ * HTML for group of params inside Panel group
319	+ *
320	+ * @param string $key
321	+ * @param array $param_group Array of setting options in a group
322	+ * @param array $data Stored data of settings
323	+ * @param string $parent_id
324	+ * @param bool $settings : array of custom settings
325	+ *
326	+ * @return string
327	+ */
328	+ static function sub_panel_group( $key, $param_group, $data, $parent_id, $settings = array() ) {
329	+
330	+ // Content for body
331	+ $content = self::do_settings( $param_group, $data );
332	+ // Class for wrapper
333	+ $class = PT_CV_Html::html_group_class();
334	+ $class .= ( isset( $settings['show_all'] ) ? '' : ' hidden' );
335	+ $class .= ( isset( $settings['show_only_one'] ) ? ' ' . PT_CV_PREFIX . 'only-one' : '' );
336	+ $class .= ( isset( $settings['no_panel'] ) ? ' ' . PT_CV_PREFIX . 'no-panel' : '' );
337	+ $class .= ( isset( $settings['no_animation'] ) ? ' ' . PT_CV_PREFIX . 'no-animation' : '' );
338	+ // Id for wrapper
339	+ $id = PT_CV_Html::html_group_id( $key );
340	+
341	+ if ( ! isset( $settings['no_panel'] ) ) {
342	+ // Heading text
343	+ $heading = ( isset( $settings['nice_name'] ) && isset( $settings['nice_name'][$key] ) ) ? $settings['nice_name'][$key] : PT_CV_Functions::string_slug_to_text( $key );
344	+ $heading = __( $heading, PT_CV_DOMAIN ) . ' ' . __( 'Settings', PT_CV_DOMAIN );
345	+ $html = PT_CV_Html::html_collapse_one( $parent_id, $id . '-child', $heading, $content, true );
346	+ } else {
347	+ $html = $content;
348	+ }
349	+
350	+ return "<div class='$class' id='$id'>$html</div>";
351	+ }
352	+
353	+ /**
354	+ * Print inline js
355	+ */
356	+ public static function print_js() {
357	+ $toggle_data_js = json_encode( self::$dependence_info );
358	+ ?>
359	+ <script>
360	+ (function ($) {
361	+ "use strict";
362	+
363	+ $(function () {
364	+ var _prefix = '<?php echo esc_js( PT_CV_PREFIX ); ?>';
365	+ var $pt_cv_admin_js = new $.PT_CV_Admin({_prefix: _prefix});
366	+ var group_prefix = '<?php echo esc_js( PT_CV_Html::html_group_class() ); ?>' + '-';
367	+
368	+ // Preview actions
369	+ $pt_cv_admin_js.preview('<?php echo balanceTags( wp_create_nonce( PT_CV_PREFIX_ . 'ajax_nonce' ) );?>');
370	+
371	+ // Custom js
372	+ $pt_cv_admin_js.custom();
373	+
374	+ // Toggle Panel group of 'Advance Settings'
375	+ $pt_cv_admin_js.toggle_group('.' + _prefix + 'advanced-settings-item', group_prefix);
376	+ // Toggle Panel group of 'Terms' (in "Taxonomy Settings")
377	+ $pt_cv_admin_js.toggle_group('.' + _prefix + 'taxonomy-item', group_prefix);
378	+ // Toggle Panel group of 'Advanced Order by'
379	+ $pt_cv_admin_js.toggle_group('[name="' + _prefix + 'content-type' + '"]', group_prefix);
380	+ // Toggle Panel group of 'View type settings'
381	+ $pt_cv_admin_js.toggle_group('[name="' + _prefix + 'view-type' + '"]', group_prefix);
382	+
383	+ // Toggle dependence
384	+ $pt_cv_admin_js.dependence_do_all('<?php echo balanceTags( $toggle_data_js ); ?>');
385	+
386	+ $pt_cv_admin_js.handy_toggle_excerpt_settings();
387	+ });
388	+ }(jQuery));
389	+ </script>
390	+ <?php
391	+ }
392	+
393	+ }
394	+
395	+ }

admin/views/admin.php ADDED Viewed

	@@ -0,0 +1,35 @@


1	+ <?php
2	+ /**
3	+ * Setting page
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+ ?>
12	+
13	+ <div class="wrap">
14	+
15	+ <h2><?php echo esc_html( get_admin_page_title() ); ?></h2>
16	+
17	+ <?php
18	+
19	+ ob_start();
20	+ ?>
21	+ <p><br>Thank you for using Content Views!</p>
22	+ <p>You are using <strong>Free</strong> version: <?php echo PT_CV_Functions::plugin_info( PT_CV_FILE, 'Version' ); ?></p>
23	+ <p>More awesome features are available at <a href="http://wordpressquery.com" target="_blank">Wordpress Query</a>.</p>
24	+ <p><br>Enjoy with Content Views!</p>
25	+ <p>---<br>
26	+ Plugin developed by PT guy.<br>
27	+ Copyright © 2014</p>
28	+ <?php
29	+ $text = ob_get_clean();
30	+
31	+ $settings = apply_filters( PT_CV_PREFIX_ . 'page_settings', $text );
32	+
33	+ echo $settings;
34	+ ?>
35	+ </div>

admin/views/list.php ADDED Viewed

	@@ -0,0 +1,14 @@


1	+ <?php
2	+ /**
3	+ * List all Content Views
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ // Redirect to edit.php page of Content Views post type
13	+ wp_redirect( admin_url( 'edit.php?post_type=' . PT_CV_POST_TYPE ) );
14	+ exit;

admin/views/view.php ADDED Viewed

	@@ -0,0 +1,542 @@


1	+ <?php
2	+ /**
3	+ * Add / Edit Content Views
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ // Check if using Wordpress version 3.7 or higher
13	+ $version_gt_37 = PT_CV_Functions::wp_version_compare( '3.7' );
14	+
15	+ $settings = array();
16	+
17	+ // Id of current view
18	+ $id = 0;
19	+
20	+ // Check if this is edit View page
21	+ if ( ! empty ( $_GET['id'] ) ) {
22	+
23	+ $id = esc_sql( $_GET['id'] );
24	+
25	+ if ( $id ) {
26	+
27	+ // Get View settings
28	+ $settings = PT_CV_Functions::view_get_settings( $id );
29	+ }
30	+ }
31	+
32	+ // Store settings
33	+ session_start();
34	+ $_SESSION[PT_CV_PREFIX . 'settings'] = $settings;
35	+
36	+ // Submit handle
37	+ PT_CV_Functions::view_submit();
38	+
39	+ ?>
40	+
41	+ <div class="wrap form-horizontal pt-wrap">
42	+
43	+ <h2><?php echo esc_html( get_admin_page_title() ); ?></h2>
44	+
45	+ <div class="preview-wrapper">
46	+ <?php
47	+ // Preview
48	+ $options = array(
49	+ array(
50	+ 'label' => array(
51	+ 'text' => __( 'Preview', PT_CV_DOMAIN ),
52	+ ),
53	+ 'params' => array(
54	+ array(
55	+ 'type' => 'html',
56	+ 'name' => 'preview',
57	+ 'content' => PT_CV_Html::html_preview_box(),
58	+ 'desc' => __( 'Click "Show Preview" or "Update Preview" button to show, "Hide Preview" button to hide the output', PT_CV_DOMAIN ),
59	+ ),
60	+ ),
61	+ ),
62	+ );
63	+ echo balanceTags( PT_Options_Framework::do_settings( $options, $settings ) );
64	+ ?>
65	+ </div>
66	+
67	+ <!-- Show Preview -->
68	+ <a class="btn btn-success" id="<?php echo esc_attr( PT_CV_PREFIX ); ?>show-preview"><?php _e( 'Show Preview', PT_CV_DOMAIN ); ?></a>
69	+
70	+ <br>
71	+
72	+ <!-- Settings form -->
73	+ <form action="" method="POST" id="<?php echo esc_attr( PT_CV_PREFIX . 'form-view' ); ?>">
74	+
75	+ <?php
76	+ // Add nonce field
77	+ wp_nonce_field( PT_CV_PREFIX_ . 'view_submit', PT_CV_PREFIX_ . 'form_nonce' );
78	+
79	+ ?>
80	+ <!-- add hidden field -->
81	+ <input type="hidden" name="<?php echo esc_attr( PT_CV_PREFIX . 'post-id' ); ?>" value="<?php echo esc_attr( PT_CV_Functions::post_id_from_meta_id( $id ) ); ?>" />
82	+ <input type="hidden" name="<?php echo esc_attr( PT_CV_PREFIX . 'view-id' ); ?>" value="<?php echo esc_attr( $id ); ?>" />
83	+
84	+ <?php
85	+ // View title
86	+ $options = array(
87	+ array(
88	+ 'label' => array(
89	+ 'text' => __( 'View title', PT_CV_DOMAIN ),
90	+ ),
91	+ 'params' => array(
92	+ array(
93	+ 'type' => 'text',
94	+ 'name' => 'view-title',
95	+ 'std' => '',
96	+ 'desc' => __( 'Enter a name to identify your views easily', PT_CV_DOMAIN ),
97	+ ),
98	+ ),
99	+ ),
100	+ );
101	+ echo balanceTags( PT_Options_Framework::do_settings( $options, $settings ) );
102	+ ?>
103	+ <br>
104	+
105	+ <!-- Save -->
106	+ <input type="submit" class="btn btn-primary pull-right <?php echo esc_attr( PT_CV_PREFIX ); ?>save-view" value="<?php _e( 'Save', PT_CV_DOMAIN ); ?>">
107	+
108	+ <!-- Nav tabs -->
109	+ <ul class="nav nav-tabs">
110	+ <li class="active">
111	+ <a href="#<?php echo esc_attr( PT_CV_PREFIX ); ?>filter-settings" data-toggle="tab"><?php _e( 'Filter Settings', PT_CV_DOMAIN ); ?></a>
112	+ </li>
113	+ <li>
114	+ <a href="#<?php echo esc_attr( PT_CV_PREFIX ); ?>display-settings" data-toggle="tab"><?php _e( 'Display Settings', PT_CV_DOMAIN ); ?></a>
115	+ </li>
116	+ </ul>
117	+
118	+ <!-- Tab panes -->
119	+ <div class="tab-content">
120	+ <!-- Filter Settings -->
121	+ <div class="tab-pane active" id="<?php echo esc_attr( PT_CV_PREFIX ); ?>filter-settings">
122	+ <?php
123	+ $options = array(
124	+ array(
125	+ 'label' => array(
126	+ 'text' => __( 'Content type', PT_CV_DOMAIN ),
127	+ ),
128	+ 'params' => array(
129	+ array(
130	+ 'type' => 'radio',
131	+ 'name' => 'content-type',
132	+ 'options' => PT_CV_Values::post_types(),
133	+ 'std' => 'post',
134	+ ),
135	+ ),
136	+ ),
137	+
138	+ // Common Filters
139	+ array(
140	+ 'label' => array(
141	+ 'text' => __( 'Common filters', PT_CV_DOMAIN ),
142	+ ),
143	+ 'extra_setting' => array(
144	+ 'params' => array(
145	+ 'wrap-class' => PT_CV_Html::html_group_class(),
146	+ ),
147	+ ),
148	+ 'params' => array(
149	+ array(
150	+ 'type' => 'group',
151	+ 'params' => array(
152	+
153	+ // Includes
154	+ array(
155	+ 'label' => array(
156	+ 'text' => __( 'In list', PT_CV_DOMAIN ),
157	+ ),
158	+ 'params' => array(
159	+ array(
160	+ 'type' => 'text',
161	+ 'name' => 'post__in',
162	+ 'std' => '',
163	+ 'desc' => __( 'List of ids (comma-separated values) of posts to retrieve', PT_CV_DOMAIN ),
164	+ ),
165	+ ),
166	+ ),
167	+
168	+ // Excludes
169	+ array(
170	+ 'label' => array(
171	+ 'text' => __( 'Excludes', PT_CV_DOMAIN ),
172	+ ),
173	+ 'params' => array(
174	+ array(
175	+ 'type' => 'text',
176	+ 'name' => 'post__not_in',
177	+ 'std' => '',
178	+ 'desc' => __( 'List of ids (comma-separated values) of posts to exclude from view', PT_CV_DOMAIN ),
179	+ ),
180	+ ),
181	+ ),
182	+
183	+ // Limit
184	+ array(
185	+ 'label' => array(
186	+ 'text' => __( 'Limit', PT_CV_DOMAIN ),
187	+ ),
188	+ 'params' => array(
189	+ array(
190	+ 'type' => 'number',
191	+ 'name' => 'limit',
192	+ 'std' => '10',
193	+ 'min' => '1',
194	+ 'desc' => __( 'The number of posts to show. Leaving it blank to show all found posts (which match all settings)', PT_CV_DOMAIN ),
195	+ ),
196	+ ),
197	+ ),
198	+ ),
199	+ ),
200	+ ),
201	+ ), // End Common Filters
202	+
203	+ // Advanced Filters
204	+ array(
205	+ 'label' => array(
206	+ 'text' => __( 'Advanced filters', PT_CV_DOMAIN ),
207	+ ),
208	+ 'extra_setting' => array(
209	+ 'params' => array(
210	+ 'wrap-class' => PT_CV_Html::html_group_class(),
211	+ 'wrap-id' => PT_CV_Html::html_group_id( 'advanced-params' ),
212	+ ),
213	+ ),
214	+ 'params' => array(
215	+ array(
216	+ 'type' => 'group',
217	+ 'params' => array(
218	+ array(
219	+ 'label' => array(
220	+ 'text' => __( '', PT_CV_DOMAIN ),
221	+ ),
222	+ 'extra_setting' => array(
223	+ 'params' => array(
224	+ 'width' => 12,
225	+ ),
226	+ ),
227	+ 'params' => array(
228	+ array(
229	+ 'type' => 'checkbox',
230	+ 'name' => 'advanced-settings[]',
231	+ 'options' => PT_CV_Values::advanced_settings(),
232	+ 'std' => '',
233	+ 'class' => 'advanced-settings-item',
234	+ ),
235	+ ),
236	+ ),
237	+ ),
238	+ ),
239	+ ),
240	+ ), // End Advanced Filters
241	+
242	+ // Settings of Advanced Filters options
243	+ array(
244	+ 'label' => array(
245	+ 'text' => '',
246	+ ),
247	+ 'extra_setting' => array(
248	+ 'params' => array(
249	+ 'wrap-class' => PT_CV_Html::html_panel_group_class(),
250	+ 'wrap-id' => PT_CV_Html::html_panel_group_id( PT_CV_Functions::string_random() ),
251	+ ),
252	+ ),
253	+ 'params' => array(
254	+ array(
255	+ 'type' => 'panel_group',
256	+ 'params' => array(
257	+
258	+ // Author Settings
259	+ 'author' => array(
260	+ array(
261	+ 'label' => array(
262	+ 'text' => __( 'Written by', PT_CV_DOMAIN ),
263	+ ),
264	+ 'params' => array(
265	+ array(
266	+ 'type' => 'select',
267	+ 'name' => 'author__in[]',
268	+ 'options' => PT_CV_Values::user_list(),
269	+ 'std' => '',
270	+ 'class' => 'select2',
271	+ 'multiple' => $version_gt_37 ? '1' : '0',
272	+ ),
273	+ ),
274	+ ),
275	+ $version_gt_37 ?
276	+ array(
277	+ 'label' => array(
278	+ 'text' => __( 'Not written by', PT_CV_DOMAIN ),
279	+ ),
280	+ 'params' => array(
281	+ array(
282	+ 'type' => 'select',
283	+ 'name' => 'author__not_in[]',
284	+ 'options' => PT_CV_Values::user_list(),
285	+ 'std' => '',
286	+ 'class' => 'select2',
287	+ 'multiple' => $version_gt_37 ? '1' : '0',
288	+ ),
289	+ ),
290	+ ) : array(),
291	+ ), // End Author Settings
292	+
293	+ // Taxonomies Settings
294	+ 'taxonomy' => array(
295	+
296	+ // Taxonomies list
297	+ array(
298	+ 'label' => array(
299	+ 'text' => __( 'Taxonomies', PT_CV_DOMAIN ),
300	+ ),
301	+ 'params' => array(
302	+ array(
303	+ 'type' => 'checkbox',
304	+ 'name' => 'taxonomy[]',
305	+ 'options' => PT_CV_Values::taxonomy_list(),
306	+ 'std' => '',
307	+ 'class' => 'taxonomy-item',
308	+ 'desc' => __( 'Select checkbox of taxonomies to filter their terms', PT_CV_DOMAIN ),
309	+ ),
310	+ ),
311	+ ),
312	+
313	+ // Terms list
314	+ array(
315	+ 'label' => array(
316	+ 'text' => __( 'Terms', PT_CV_DOMAIN ),
317	+ ),
318	+ 'extra_setting' => array(
319	+ 'params' => array(
320	+ 'wrap-class' => PT_CV_Html::html_panel_group_class() . ' terms',
321	+ 'wrap-id' => PT_CV_Html::html_panel_group_id( PT_CV_Functions::string_random() ),
322	+ ),
323	+ ),
324	+ 'params' => array(
325	+ array(
326	+ 'type' => 'panel_group',
327	+ 'settings' => array(
328	+ 'nice_name' => PT_CV_Values::taxonomy_list(),
329	+ ),
330	+ 'params' => PT_CV_Settings::terms_of_taxonomies(),
331	+ ),
332	+ ),
333	+ ),
334	+
335	+ // Relation of taxonomies
336	+ array(
337	+ 'label' => array(
338	+ 'text' => __( 'Relation', PT_CV_DOMAIN ),
339	+ ),
340	+ 'params' => array(
341	+ array(
342	+ 'type' => 'select',
343	+ 'name' => 'taxonomy-relation',
344	+ 'options' => PT_CV_Values::taxonomy_relation(),
345	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::taxonomy_relation() ),
346	+ 'class' => 'taxonomy-relation',
347	+ 'desc' => __( 'Select AND to show posts which match ALL settings of selected taxonomies[--br--]Select OR to show posts which match settings of at least one selected taxonomy', PT_CV_DOMAIN ),
348	+ ),
349	+ ),
350	+ ),
351	+ ), // End Taxonomies Settings
352	+
353	+ // Order by Settings
354	+ 'order' => array(
355	+ array(
356	+ 'label' => array(
357	+ 'text' => __( 'Order by', PT_CV_DOMAIN ),
358	+ ),
359	+ 'extra_setting' => array(
360	+ 'params' => array(
361	+ 'width' => 12,
362	+ ),
363	+ ),
364	+ 'params' => array(
365	+ array(
366	+ 'type' => 'panel_group',
367	+ 'settings' => array(
368	+ 'show_all' => 1,
369	+ ),
370	+ 'params' => PT_CV_Settings::orderby(),
371	+ ),
372	+ ),
373	+ ),
374	+ ), // End Order by Settings
375	+
376	+ // Status Settings
377	+ 'status' => array(
378	+ array(
379	+ 'label' => array(
380	+ 'text' => __( 'Status', PT_CV_DOMAIN ),
381	+ ),
382	+ 'params' => array(
383	+ array(
384	+ 'type' => 'select',
385	+ 'name' => 'post_status',
386	+ 'options' => PT_CV_Values::post_statuses(),
387	+ 'std' => 'publish',
388	+ 'class' => 'select2',
389	+ 'multiple' => '1',
390	+ 'desc' => __( 'Select status of posts', PT_CV_DOMAIN ),
391	+ ),
392	+ ),
393	+ ),
394	+ ), // End Status Settings
395	+
396	+ // Keyword Settings
397	+ 'search' => array(
398	+ array(
399	+ 'label' => array(
400	+ 'text' => __( 'Keyword', PT_CV_DOMAIN ),
401	+ ),
402	+ 'params' => array(
403	+ array(
404	+ 'type' => 'text',
405	+ 'name' => 's',
406	+ 'std' => '',
407	+ 'desc' => __( 'Enter the keyword to searching for posts', PT_CV_DOMAIN ),
408	+ ),
409	+ ),
410	+ ),
411	+ ), // End Keyword Settings
412	+ ),
413	+ ),
414	+ ),
415	+ ),
416	+ );
417	+ echo balanceTags( PT_Options_Framework::do_settings( $options, $settings ) );
418	+ ?>
419	+ </div>
420	+ <!-- end Filter Settings -->
421	+
422	+ <!-- Display Settings -->
423	+ <div class="tab-pane" id="<?php echo esc_attr( PT_CV_PREFIX ); ?>display-settings">
424	+ <?php
425	+ $options = array(
426	+
427	+ // View Type
428	+ array(
429	+ 'label' => array(
430	+ 'text' => __( 'View type', PT_CV_DOMAIN ),
431	+ ),
432	+ 'params' => array(
433	+ array(
434	+ 'type' => 'radio',
435	+ 'name' => 'view-type',
436	+ 'options' => PT_CV_Values::view_type(),
437	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::view_type() ),
438	+ ),
439	+ ),
440	+ ),
441	+
442	+ // View settings
443	+ array(
444	+ 'label' => array(
445	+ 'text' => __( 'View type settings', PT_CV_DOMAIN ),
446	+ ),
447	+ 'params' => array(
448	+ array(
449	+ 'type' => 'panel_group',
450	+ 'settings' => array(
451	+ 'no_panel' => 1,
452	+ 'no_animation' => 1,
453	+ 'show_only_one' => 1,
454	+ ),
455	+ 'params' => PT_CV_Values::view_type_settings(),
456	+ ),
457	+ ),
458	+ ),
459	+
460	+ // Layout format of output item
461	+ array(
462	+ 'label' => array(
463	+ 'text' => __( 'Layout format of an output item', PT_CV_DOMAIN ),
464	+ ),
465	+ 'params' => array(
466	+ array(
467	+ 'type' => 'radio',
468	+ 'name' => 'layout-format',
469	+ 'options' => PT_CV_Values::layout_format(),
470	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::layout_format() ),
471	+ ),
472	+ ),
473	+ ),
474	+
475	+ // Fields settings
476	+ array(
477	+ 'label' => array(
478	+ 'text' => __( 'Fields settings', PT_CV_DOMAIN ),
479	+ ),
480	+ 'extra_setting' => array(
481	+ 'params' => array(
482	+ 'wrap-class' => PT_CV_Html::html_group_class(),
483	+ ),
484	+ ),
485	+ 'params' => array(
486	+ array(
487	+ 'type' => 'group',
488	+ 'params' => PT_CV_Settings::field_settings(),
489	+ ),
490	+ ),
491	+ ),
492	+
493	+ // Pagination settings
494	+ array(
495	+ 'label' => array(
496	+ 'text' => __( 'Pagination settings', PT_CV_DOMAIN ),
497	+ ),
498	+ 'extra_setting' => array(
499	+ 'params' => array(
500	+ 'wrap-class' => PT_CV_Html::html_group_class(),
501	+ ),
502	+ ),
503	+ 'params' => array(
504	+ array(
505	+ 'type' => 'group',
506	+ 'params' => PT_CV_Settings::settings_pagination(),
507	+ ),
508	+ ),
509	+ ),
510	+
511	+ // Other settings
512	+ array(
513	+ 'label' => array(
514	+ 'text' => __( 'Other settings', PT_CV_DOMAIN ),
515	+ ),
516	+ 'extra_setting' => array(
517	+ 'params' => array(
518	+ 'wrap-class' => PT_CV_Html::html_group_class(),
519	+ ),
520	+ ),
521	+ 'params' => array(
522	+ array(
523	+ 'type' => 'group',
524	+ 'params' => PT_CV_Settings::settings_other(),
525	+ ),
526	+ ),
527	+ ),
528	+
529	+ );
530	+ echo balanceTags( PT_Options_Framework::do_settings( $options, $settings ) );
531	+ ?>
532	+ </div>
533	+ <!-- end Display Settings -->
534	+
535	+ </div>
536	+
537	+ <div class="clearfix"></div>
538	+ <hr>
539	+ <!-- Save -->
540	+ <input type="submit" class="btn btn-primary pull-right <?php echo esc_attr( PT_CV_PREFIX ); ?>save-view" value="<?php _e( 'Save', PT_CV_DOMAIN ); ?>">
541	+ </form>
542	+ </div>

assets/bootstrap-paginator/bootstrap-paginator.min.js ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ /**
2	+ * bootstrap-paginator.js v0.5
3	+ * --
4	+ * Copyright 2013 Yun Lai <lyonlai1984@gmail.com>
5	+ * --
6	+ * Licensed under the Apache License, Version 2.0 (the "License");
7	+ * you may not use this file except in compliance with the License.
8	+ * You may obtain a copy of the License at
9	+ *
10	+ * http://www.apache.org/licenses/LICENSE-2.0
11	+ *
12	+ * Unless required by applicable law or agreed to in writing, software
13	+ * distributed under the License is distributed on an "AS IS" BASIS,
14	+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
15	+ * See the License for the specific language governing permissions and
16	+ * limitations under the License.
17	+ */
18	+ (function(c){var b=function(e,d){this.init(e,d)},a=null;b.prototype={init:function(f,e){this.$element=c(f);var d=(e&&e.bootstrapMajorVersion)?e.bootstrapMajorVersion:c.fn.bootstrapPaginator.defaults.bootstrapMajorVersion,g=this.$element.attr("id");if(d===2&&!this.$element.is("div")){throw"in Bootstrap version 2 the pagination must be a div element. Or if you are using Bootstrap pagination 3. Please specify it in bootstrapMajorVersion in the option"}else{if(d>2&&!this.$element.is("ul")){throw"in Bootstrap version 3 the pagination root item must be an ul element."}}this.currentPage=1;this.lastPage=1;this.setOptions(e);this.initialized=true},setOptions:function(d){this.options=c.extend({},(this.options\|\|c.fn.bootstrapPaginator.defaults),d);this.totalPages=parseInt(this.options.totalPages,10);this.numberOfPages=parseInt(this.options.numberOfPages,10);if(d&&typeof(d.currentPage)!=="undefined"){this.setCurrentPage(d.currentPage)}this.listen();this.render();if(!this.initialized&&this.lastPage!==this.currentPage){this.$element.trigger("page-changed",[this.lastPage,this.currentPage])}},listen:function(){this.$element.off("page-clicked");this.$element.off("page-changed");if(typeof(this.options.onPageClicked)==="function"){this.$element.bind("page-clicked",this.options.onPageClicked)}if(typeof(this.options.onPageChanged)==="function"){this.$element.on("page-changed",this.options.onPageChanged)}this.$element.bind("page-clicked",this.onPageClicked)},destroy:function(){this.$element.off("page-clicked");this.$element.off("page-changed");this.$element.removeData("bootstrapPaginator");this.$element.empty()},show:function(d){this.setCurrentPage(d);this.render();if(this.lastPage!==this.currentPage){this.$element.trigger("page-changed",[this.lastPage,this.currentPage])}},showNext:function(){var d=this.getPages();if(d.next){this.show(d.next)}},showPrevious:function(){var d=this.getPages();if(d.prev){this.show(d.prev)}},showFirst:function(){var d=this.getPages();if(d.first){this.show(d.first)}},showLast:function(){var d=this.getPages();if(d.last){this.show(d.last)}},onPageItemClicked:function(e){var d=e.data.type,f=e.data.page;this.$element.trigger("page-clicked",[e,d,f])},onPageClicked:function(f,d,e,g){var h=c(f.currentTarget);switch(e){case"first":h.bootstrapPaginator("showFirst");break;case"prev":h.bootstrapPaginator("showPrevious");break;case"next":h.bootstrapPaginator("showNext");break;case"last":h.bootstrapPaginator("showLast");break;case"page":h.bootstrapPaginator("show",g);break}},render:function(){var o=this.getValueFromOption(this.options.containerClass,this.$element),q=this.options.size\|\|"normal",l=this.options.alignment\|\|"left",e=this.getPages(),k=this.options.bootstrapMajorVersion===2?c("<ul></ul>"):this.$element,m=this.options.bootstrapMajorVersion===2?this.getValueFromOption(this.options.listContainerClass,k):null,j=null,f=null,h=null,n=null,d=null,g=0;this.$element.prop("class","");this.$element.addClass("pagination");switch(q.toLowerCase()){case"large":case"small":case"mini":this.$element.addClass(c.fn.bootstrapPaginator.sizeArray[this.options.bootstrapMajorVersion][q.toLowerCase()]);break;default:break}if(this.options.bootstrapMajorVersion===2){switch(l.toLowerCase()){case"center":this.$element.addClass("pagination-centered");break;case"right":this.$element.addClass("pagination-right");break;default:break}}this.$element.addClass(o);this.$element.empty();if(this.options.bootstrapMajorVersion===2){this.$element.append(k);k.addClass(m)}this.pageRef=[];if(e.first){j=this.buildPageItem("first",e.first);if(j){k.append(j)}}if(e.prev){f=this.buildPageItem("prev",e.prev);if(f){k.append(f)}}for(g=0;g<e.length;g=g+1){d=this.buildPageItem("page",e[g]);if(d){k.append(d)}}if(e.next){h=this.buildPageItem("next",e.next);if(h){k.append(h)}}if(e.last){n=this.buildPageItem("last",e.last);if(n){k.append(n)}}},buildPageItem:function(i,g){var j=c("<li></li>"),e=c("<a></a>"),l="",k="",d=this.options.itemContainerClass(i,g,this.currentPage),f=this.getValueFromOption(this.options.itemContentClass,i,g,this.currentPage),h=null;switch(i){case"first":if(!this.getValueFromOption(this.options.shouldShowPage,i,g,this.currentPage)){return}l=this.options.itemTexts(i,g,this.currentPage);k=this.options.tooltipTitles(i,g,this.currentPage);break;case"last":if(!this.getValueFromOption(this.options.shouldShowPage,i,g,this.currentPage)){return}l=this.options.itemTexts(i,g,this.currentPage);k=this.options.tooltipTitles(i,g,this.currentPage);break;case"prev":if(!this.getValueFromOption(this.options.shouldShowPage,i,g,this.currentPage)){return}l=this.options.itemTexts(i,g,this.currentPage);k=this.options.tooltipTitles(i,g,this.currentPage);break;case"next":if(!this.getValueFromOption(this.options.shouldShowPage,i,g,this.currentPage)){return}l=this.options.itemTexts(i,g,this.currentPage);k=this.options.tooltipTitles(i,g,this.currentPage);break;case"page":if(!this.getValueFromOption(this.options.shouldShowPage,i,g,this.currentPage)){return}l=this.options.itemTexts(i,g,this.currentPage);k=this.options.tooltipTitles(i,g,this.currentPage);break}j.addClass(d).append(e);e.addClass(f).html(l).on("click",null,{type:i,page:g},c.proxy(this.onPageItemClicked,this));if(this.options.pageUrl){e.attr("href",this.getValueFromOption(this.options.pageUrl,i,g,this.currentPage))}if(this.options.useBootstrapTooltip){h=c.extend({},this.options.bootstrapTooltipOptions,{title:k});e.tooltip(h)}else{e.attr("title",k)}return j},setCurrentPage:function(d){if(d>this.totalPages\|\|d<1){throw"Page out of range"}this.lastPage=this.currentPage;this.currentPage=parseInt(d,10)},getPages:function(){var g=this.totalPages,h=(this.currentPage%this.numberOfPages===0)?(parseInt(this.currentPage/this.numberOfPages,10)-1)this.numberOfPages+1:parseInt(this.currentPage/this.numberOfPages,10)this.numberOfPages+1,e=[],f=0,d=0;h=h<1?1:h;for(f=h,d=0;d<this.numberOfPages&&f<=g;f=f+1,d=d+1){e.push(f)}e.first=1;if(this.currentPage>1){e.prev=this.currentPage-1}else{e.prev=1}if(this.currentPage<g){e.next=this.currentPage+1}else{e.next=g}e.last=g;e.current=this.currentPage;e.total=g;e.numberOfPages=this.options.numberOfPages;return e},getValueFromOption:function(f){var d=null,e=Array.prototype.slice.call(arguments,1);if(typeof f==="function"){d=f.apply(this,e)}else{d=f}return d}};a=c.fn.bootstrapPaginator;c.fn.bootstrapPaginator=function(f){var e=arguments,d=null;c(this).each(function(h,i){var k=c(i),j=k.data("bootstrapPaginator"),g=(typeof f!=="object")?null:f;if(!j){j=new b(this,g);k=c(j.$element);k.data("bootstrapPaginator",j);return}if(typeof f==="string"){if(j[f]){d=j[f].apply(j,Array.prototype.slice.call(e,1))}else{throw"Method "+f+" does not exist"}}else{d=j.setOptions(f)}});return d};c.fn.bootstrapPaginator.sizeArray={"2":{large:"pagination-large",small:"pagination-small",mini:"pagination-mini"},"3":{large:"pagination-lg",small:"pagination-sm",mini:""}};c.fn.bootstrapPaginator.defaults={containerClass:"",size:"normal",alignment:"left",bootstrapMajorVersion:2,listContainerClass:"",itemContainerClass:function(d,e,f){return(e===f)?"active":""},itemContentClass:function(d,e,f){return""},currentPage:1,numberOfPages:5,totalPages:1,pageUrl:function(d,e,f){return null},onPageClicked:null,onPageChanged:null,useBootstrapTooltip:false,shouldShowPage:function(e,f,g){var d=true;switch(e){case"first":d=(g!==1);break;case"prev":d=(g!==1);break;case"next":d=(g!==this.totalPages);break;case"last":d=(g!==this.totalPages);break;case"page":d=true;break}return d},itemTexts:function(d,e,f){switch(d){case"first":return"«";case"prev":return"&lsaquo;";case"next":return"&rsaquo;";case"last":return"»";case"page":return e}},tooltipTitles:function(d,e,f){switch(d){case"first":return"Go to first page";case"prev":return"Go to previous page";case"next":return"Go to next page";case"last":return"Go to last page";case"page":return(e===f)?"Current page is "+e:"Go to page "+e}},bootstrapTooltipOptions:{animation:true,html:true,placement:"top",selector:false,title:"",container:false}};c.fn.bootstrapPaginator.Constructor=b}(window.jQuery));

assets/bootstrap/css/bootstrap.min.css ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ /*!
2	+ * Bootstrap v3.1.1 (http://getbootstrap.com)
3	+ * Copyright 2011-2014 Twitter, Inc.
4	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	+ */
6	+
7	+ /! normalize.css v3.0.0 \| MIT License \| git.io/normalize /html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}article,aside,details,figcaption,figure,footer,header,hgroup,main,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{-moz-box-sizing:content-box;box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}@media print{{text-shadow:none !important;color:#000 !important;background:transparent !important;box-shadow:none !important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}a[href^="javascript:"]:after,a[href^="#"]:after{content:""}pre,blockquote{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}img{max-width:100% !important}p,h2,h3{orphans:3;widows:3}h2,h3{page-break-after:avoid}select{background:#fff !important}.navbar{display:none}.table td,.table th{background-color:#fff !important}.btn>.caret,.dropup>.btn>.caret{border-top-color:#000 !important}.label{border:1px solid #000}.table{border-collapse:collapse !important}.table-bordered th,.table-bordered td{border:1px solid #ddd !important}}{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}:before,:after{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-size:62.5%;-webkit-tap-highlight-color:rgba(0,0,0,0)}input,button,select,textarea{font-family:inherit;font-size:inherit;line-height:inherit}a{color:#428bca;text-decoration:none}a:hover,a:focus{color:#2a6496;text-decoration:underline}a:focus{outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}figure{margin:0}img{vertical-align:middle}.img-responsive,.thumbnail>img,.thumbnail a>img,.carousel-inner>.item>img,.carousel-inner>.item>a>img{display:block;max-width:100%;height:auto}.img-rounded{border-radius:6px}.img-thumbnail{padding:4px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:all .2s ease-in-out;transition:all .2s ease-in-out;display:inline-block;max-width:100%;height:auto}.img-circle{border-radius:50%}hr{margin-top:20px;margin-bottom:20px;border:0;border-top:1px solid #eee}.sr-only{position:absolute;width:1px;height:1px;margin:-1px;padding:0;overflow:hidden;clip:rect(0, 0, 0, 0);border:0}h1,h2,h3,h4,h5,h6,.h1,.h2,.h3,.h4,.h5,.h6{font-family:inherit;font-weight:500;line-height:1.1;color:inherit}h1 small,h2 small,h3 small,h4 small,h5 small,h6 small,.h1 small,.h2 small,.h3 small,.h4 small,.h5 small,.h6 small,h1 .small,h2 .small,h3 .small,h4 .small,h5 .small,h6 .small,.h1 .small,.h2 .small,.h3 .small,.h4 .small,.h5 .small,.h6 .small{font-weight:normal;line-height:1;color:#999}h1,.h1,h2,.h2,h3,.h3{margin-top:20px;margin-bottom:10px}h1 small,.h1 small,h2 small,.h2 small,h3 small,.h3 small,h1 .small,.h1 .small,h2 .small,.h2 .small,h3 .small,.h3 .small{font-size:65%}h4,.h4,h5,.h5,h6,.h6{margin-top:10px;margin-bottom:10px}h4 small,.h4 small,h5 small,.h5 small,h6 small,.h6 small,h4 .small,.h4 .small,h5 .small,.h5 .small,h6 .small,.h6 .small{font-size:75%}h1,.h1{font-size:36px}h2,.h2{font-size:30px}h3,.h3{font-size:24px}h4,.h4{font-size:18px}h5,.h5{font-size:14px}h6,.h6{font-size:12px}p{margin:0 0 10px}.lead{margin-bottom:20px;font-size:16px;font-weight:200;line-height:1.4}@media (min-width:768px){.lead{font-size:21px}}small,.small{font-size:85%}cite{font-style:normal}.text-left{text-align:left}.text-right{text-align:right}.text-center{text-align:center}.text-justify{text-align:justify}.text-muted{color:#999}.text-primary{color:#428bca}a.text-primary:hover{color:#3071a9}.text-success{color:#3c763d}a.text-success:hover{color:#2b542c}.text-info{color:#31708f}a.text-info:hover{color:#245269}.text-warning{color:#8a6d3b}a.text-warning:hover{color:#66512c}.text-danger{color:#a94442}a.text-danger:hover{color:#843534}.bg-primary{color:#fff;background-color:#428bca}a.bg-primary:hover{background-color:#3071a9}.bg-success{background-color:#dff0d8}a.bg-success:hover{background-color:#c1e2b3}.bg-info{background-color:#d9edf7}a.bg-info:hover{background-color:#afd9ee}.bg-warning{background-color:#fcf8e3}a.bg-warning:hover{background-color:#f7ecb5}.bg-danger{background-color:#f2dede}a.bg-danger:hover{background-color:#e4b9b9}.page-header{padding-bottom:9px;margin:40px 0 20px;border-bottom:1px solid #eee}ul,ol{margin-top:0;margin-bottom:10px}ul ul,ol ul,ul ol,ol ol{margin-bottom:0}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none;margin-left:-5px}.list-inline>li{display:inline-block;padding-left:5px;padding-right:5px}dl{margin-top:0;margin-bottom:20px}dt,dd{line-height:1.42857143}dt{font-weight:bold}dd{margin-left:0}@media (min-width:768px){.dl-horizontal dt{float:left;width:160px;clear:left;text-align:right;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:180px}}abbr[title],abbr[data-original-title]{cursor:help;border-bottom:1px dotted #999}.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:10px 20px;margin:0 0 20px;font-size:17.5px;border-left:5px solid #eee}blockquote p:last-child,blockquote ul:last-child,blockquote ol:last-child{margin-bottom:0}blockquote footer,blockquote small,blockquote .small{display:block;font-size:80%;line-height:1.42857143;color:#999}blockquote footer:before,blockquote small:before,blockquote .small:before{content:'\2014 \00A0'}.blockquote-reverse,blockquote.pull-right{padding-right:15px;padding-left:0;border-right:5px solid #eee;border-left:0;text-align:right}.blockquote-reverse footer:before,blockquote.pull-right footer:before,.blockquote-reverse small:before,blockquote.pull-right small:before,.blockquote-reverse .small:before,blockquote.pull-right .small:before{content:''}.blockquote-reverse footer:after,blockquote.pull-right footer:after,.blockquote-reverse small:after,blockquote.pull-right small:after,.blockquote-reverse .small:after,blockquote.pull-right .small:after{content:'\00A0 \2014'}blockquote:before,blockquote:after{content:""}address{margin-bottom:20px;font-style:normal;line-height:1.42857143}code,kbd,pre,samp{font-family:Menlo,Monaco,Consolas,"Courier New",monospace}code{padding:2px 4px;font-size:90%;color:#c7254e;background-color:#f9f2f4;white-space:nowrap;border-radius:4px}kbd{padding:2px 4px;font-size:90%;color:#fff;background-color:#333;border-radius:3px;box-shadow:inset 0 -1px 0 rgba(0,0,0,0.25)}pre{display:block;padding:9.5px;margin:0 0 10px;font-size:13px;line-height:1.42857143;word-break:break-all;word-wrap:break-word;color:#333;background-color:#f5f5f5;border:1px solid #ccc;border-radius:4px}pre code{padding:0;font-size:inherit;color:inherit;white-space:pre-wrap;background-color:transparent;border-radius:0}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{margin-right:auto;margin-left:auto;padding-left:15px;padding-right:15px}@media (min-width:768px){.container{width:750px}}@media (min-width:992px){.container{width:970px}}@media (min-width:1200px){.container{width:1170px}}.container-fluid{margin-right:auto;margin-left:auto;padding-left:15px;padding-right:15px}.row{margin-left:-15px;margin-right:-15px}.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12{position:relative;min-height:1px;padding-left:15px;padding-right:15px}.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12{float:left}.col-xs-12{width:100%}.col-xs-11{width:91.66666667%}.col-xs-10{width:83.33333333%}.col-xs-9{width:75%}.col-xs-8{width:66.66666667%}.col-xs-7{width:58.33333333%}.col-xs-6{width:50%}.col-xs-5{width:41.66666667%}.col-xs-4{width:33.33333333%}.col-xs-3{width:25%}.col-xs-2{width:16.66666667%}.col-xs-1{width:8.33333333%}.col-xs-pull-12{right:100%}.col-xs-pull-11{right:91.66666667%}.col-xs-pull-10{right:83.33333333%}.col-xs-pull-9{right:75%}.col-xs-pull-8{right:66.66666667%}.col-xs-pull-7{right:58.33333333%}.col-xs-pull-6{right:50%}.col-xs-pull-5{right:41.66666667%}.col-xs-pull-4{right:33.33333333%}.col-xs-pull-3{right:25%}.col-xs-pull-2{right:16.66666667%}.col-xs-pull-1{right:8.33333333%}.col-xs-pull-0{right:0}.col-xs-push-12{left:100%}.col-xs-push-11{left:91.66666667%}.col-xs-push-10{left:83.33333333%}.col-xs-push-9{left:75%}.col-xs-push-8{left:66.66666667%}.col-xs-push-7{left:58.33333333%}.col-xs-push-6{left:50%}.col-xs-push-5{left:41.66666667%}.col-xs-push-4{left:33.33333333%}.col-xs-push-3{left:25%}.col-xs-push-2{left:16.66666667%}.col-xs-push-1{left:8.33333333%}.col-xs-push-0{left:0}.col-xs-offset-12{margin-left:100%}.col-xs-offset-11{margin-left:91.66666667%}.col-xs-offset-10{margin-left:83.33333333%}.col-xs-offset-9{margin-left:75%}.col-xs-offset-8{margin-left:66.66666667%}.col-xs-offset-7{margin-left:58.33333333%}.col-xs-offset-6{margin-left:50%}.col-xs-offset-5{margin-left:41.66666667%}.col-xs-offset-4{margin-left:33.33333333%}.col-xs-offset-3{margin-left:25%}.col-xs-offset-2{margin-left:16.66666667%}.col-xs-offset-1{margin-left:8.33333333%}.col-xs-offset-0{margin-left:0}@media (min-width:768px){.col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12{float:left}.col-sm-12{width:100%}.col-sm-11{width:91.66666667%}.col-sm-10{width:83.33333333%}.col-sm-9{width:75%}.col-sm-8{width:66.66666667%}.col-sm-7{width:58.33333333%}.col-sm-6{width:50%}.col-sm-5{width:41.66666667%}.col-sm-4{width:33.33333333%}.col-sm-3{width:25%}.col-sm-2{width:16.66666667%}.col-sm-1{width:8.33333333%}.col-sm-pull-12{right:100%}.col-sm-pull-11{right:91.66666667%}.col-sm-pull-10{right:83.33333333%}.col-sm-pull-9{right:75%}.col-sm-pull-8{right:66.66666667%}.col-sm-pull-7{right:58.33333333%}.col-sm-pull-6{right:50%}.col-sm-pull-5{right:41.66666667%}.col-sm-pull-4{right:33.33333333%}.col-sm-pull-3{right:25%}.col-sm-pull-2{right:16.66666667%}.col-sm-pull-1{right:8.33333333%}.col-sm-pull-0{right:0}.col-sm-push-12{left:100%}.col-sm-push-11{left:91.66666667%}.col-sm-push-10{left:83.33333333%}.col-sm-push-9{left:75%}.col-sm-push-8{left:66.66666667%}.col-sm-push-7{left:58.33333333%}.col-sm-push-6{left:50%}.col-sm-push-5{left:41.66666667%}.col-sm-push-4{left:33.33333333%}.col-sm-push-3{left:25%}.col-sm-push-2{left:16.66666667%}.col-sm-push-1{left:8.33333333%}.col-sm-push-0{left:0}.col-sm-offset-12{margin-left:100%}.col-sm-offset-11{margin-left:91.66666667%}.col-sm-offset-10{margin-left:83.33333333%}.col-sm-offset-9{margin-left:75%}.col-sm-offset-8{margin-left:66.66666667%}.col-sm-offset-7{margin-left:58.33333333%}.col-sm-offset-6{margin-left:50%}.col-sm-offset-5{margin-left:41.66666667%}.col-sm-offset-4{margin-left:33.33333333%}.col-sm-offset-3{margin-left:25%}.col-sm-offset-2{margin-left:16.66666667%}.col-sm-offset-1{margin-left:8.33333333%}.col-sm-offset-0{margin-left:0}}@media (min-width:992px){.col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12{float:left}.col-md-12{width:100%}.col-md-11{width:91.66666667%}.col-md-10{width:83.33333333%}.col-md-9{width:75%}.col-md-8{width:66.66666667%}.col-md-7{width:58.33333333%}.col-md-6{width:50%}.col-md-5{width:41.66666667%}.col-md-4{width:33.33333333%}.col-md-3{width:25%}.col-md-2{width:16.66666667%}.col-md-1{width:8.33333333%}.col-md-pull-12{right:100%}.col-md-pull-11{right:91.66666667%}.col-md-pull-10{right:83.33333333%}.col-md-pull-9{right:75%}.col-md-pull-8{right:66.66666667%}.col-md-pull-7{right:58.33333333%}.col-md-pull-6{right:50%}.col-md-pull-5{right:41.66666667%}.col-md-pull-4{right:33.33333333%}.col-md-pull-3{right:25%}.col-md-pull-2{right:16.66666667%}.col-md-pull-1{right:8.33333333%}.col-md-pull-0{right:0}.col-md-push-12{left:100%}.col-md-push-11{left:91.66666667%}.col-md-push-10{left:83.33333333%}.col-md-push-9{left:75%}.col-md-push-8{left:66.66666667%}.col-md-push-7{left:58.33333333%}.col-md-push-6{left:50%}.col-md-push-5{left:41.66666667%}.col-md-push-4{left:33.33333333%}.col-md-push-3{left:25%}.col-md-push-2{left:16.66666667%}.col-md-push-1{left:8.33333333%}.col-md-push-0{left:0}.col-md-offset-12{margin-left:100%}.col-md-offset-11{margin-left:91.66666667%}.col-md-offset-10{margin-left:83.33333333%}.col-md-offset-9{margin-left:75%}.col-md-offset-8{margin-left:66.66666667%}.col-md-offset-7{margin-left:58.33333333%}.col-md-offset-6{margin-left:50%}.col-md-offset-5{margin-left:41.66666667%}.col-md-offset-4{margin-left:33.33333333%}.col-md-offset-3{margin-left:25%}.col-md-offset-2{margin-left:16.66666667%}.col-md-offset-1{margin-left:8.33333333%}.col-md-offset-0{margin-left:0}}@media (min-width:1200px){.col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12{float:left}.col-lg-12{width:100%}.col-lg-11{width:91.66666667%}.col-lg-10{width:83.33333333%}.col-lg-9{width:75%}.col-lg-8{width:66.66666667%}.col-lg-7{width:58.33333333%}.col-lg-6{width:50%}.col-lg-5{width:41.66666667%}.col-lg-4{width:33.33333333%}.col-lg-3{width:25%}.col-lg-2{width:16.66666667%}.col-lg-1{width:8.33333333%}.col-lg-pull-12{right:100%}.col-lg-pull-11{right:91.66666667%}.col-lg-pull-10{right:83.33333333%}.col-lg-pull-9{right:75%}.col-lg-pull-8{right:66.66666667%}.col-lg-pull-7{right:58.33333333%}.col-lg-pull-6{right:50%}.col-lg-pull-5{right:41.66666667%}.col-lg-pull-4{right:33.33333333%}.col-lg-pull-3{right:25%}.col-lg-pull-2{right:16.66666667%}.col-lg-pull-1{right:8.33333333%}.col-lg-pull-0{right:0}.col-lg-push-12{left:100%}.col-lg-push-11{left:91.66666667%}.col-lg-push-10{left:83.33333333%}.col-lg-push-9{left:75%}.col-lg-push-8{left:66.66666667%}.col-lg-push-7{left:58.33333333%}.col-lg-push-6{left:50%}.col-lg-push-5{left:41.66666667%}.col-lg-push-4{left:33.33333333%}.col-lg-push-3{left:25%}.col-lg-push-2{left:16.66666667%}.col-lg-push-1{left:8.33333333%}.col-lg-push-0{left:0}.col-lg-offset-12{margin-left:100%}.col-lg-offset-11{margin-left:91.66666667%}.col-lg-offset-10{margin-left:83.33333333%}.col-lg-offset-9{margin-left:75%}.col-lg-offset-8{margin-left:66.66666667%}.col-lg-offset-7{margin-left:58.33333333%}.col-lg-offset-6{margin-left:50%}.col-lg-offset-5{margin-left:41.66666667%}.col-lg-offset-4{margin-left:33.33333333%}.col-lg-offset-3{margin-left:25%}.col-lg-offset-2{margin-left:16.66666667%}.col-lg-offset-1{margin-left:8.33333333%}.col-lg-offset-0{margin-left:0}}table{max-width:100%;background-color:transparent}th{text-align:left}.table{width:100%;margin-bottom:20px}.table>thead>tr>th,.table>tbody>tr>th,.table>tfoot>tr>th,.table>thead>tr>td,.table>tbody>tr>td,.table>tfoot>tr>td{padding:8px;line-height:1.42857143;vertical-align:top;border-top:1px solid #ddd}.table>thead>tr>th{vertical-align:bottom;border-bottom:2px solid #ddd}.table>caption+thead>tr:first-child>th,.table>colgroup+thead>tr:first-child>th,.table>thead:first-child>tr:first-child>th,.table>caption+thead>tr:first-child>td,.table>colgroup+thead>tr:first-child>td,.table>thead:first-child>tr:first-child>td{border-top:0}.table>tbody+tbody{border-top:2px solid #ddd}.table .table{background-color:#fff}.table-condensed>thead>tr>th,.table-condensed>tbody>tr>th,.table-condensed>tfoot>tr>th,.table-condensed>thead>tr>td,.table-condensed>tbody>tr>td,.table-condensed>tfoot>tr>td{padding:5px}.table-bordered{border:1px solid #ddd}.table-bordered>thead>tr>th,.table-bordered>tbody>tr>th,.table-bordered>tfoot>tr>th,.table-bordered>thead>tr>td,.table-bordered>tbody>tr>td,.table-bordered>tfoot>tr>td{border:1px solid #ddd}.table-bordered>thead>tr>th,.table-bordered>thead>tr>td{border-bottom-width:2px}.table-striped>tbody>tr:nth-child(odd)>td,.table-striped>tbody>tr:nth-child(odd)>th{background-color:#f9f9f9}.table-hover>tbody>tr:hover>td,.table-hover>tbody>tr:hover>th{background-color:#f5f5f5}table col[class="col-"]{position:static;float:none;display:table-column}table td[class="col-"],table th[class="col-"]{position:static;float:none;display:table-cell}.table>thead>tr>td.active,.table>tbody>tr>td.active,.table>tfoot>tr>td.active,.table>thead>tr>th.active,.table>tbody>tr>th.active,.table>tfoot>tr>th.active,.table>thead>tr.active>td,.table>tbody>tr.active>td,.table>tfoot>tr.active>td,.table>thead>tr.active>th,.table>tbody>tr.active>th,.table>tfoot>tr.active>th{background-color:#f5f5f5}.table-hover>tbody>tr>td.active:hover,.table-hover>tbody>tr>th.active:hover,.table-hover>tbody>tr.active:hover>td,.table-hover>tbody>tr.active:hover>th{background-color:#e8e8e8}.table>thead>tr>td.success,.table>tbody>tr>td.success,.table>tfoot>tr>td.success,.table>thead>tr>th.success,.table>tbody>tr>th.success,.table>tfoot>tr>th.success,.table>thead>tr.success>td,.table>tbody>tr.success>td,.table>tfoot>tr.success>td,.table>thead>tr.success>th,.table>tbody>tr.success>th,.table>tfoot>tr.success>th{background-color:#dff0d8}.table-hover>tbody>tr>td.success:hover,.table-hover>tbody>tr>th.success:hover,.table-hover>tbody>tr.success:hover>td,.table-hover>tbody>tr.success:hover>th{background-color:#d0e9c6}.table>thead>tr>td.info,.table>tbody>tr>td.info,.table>tfoot>tr>td.info,.table>thead>tr>th.info,.table>tbody>tr>th.info,.table>tfoot>tr>th.info,.table>thead>tr.info>td,.table>tbody>tr.info>td,.table>tfoot>tr.info>td,.table>thead>tr.info>th,.table>tbody>tr.info>th,.table>tfoot>tr.info>th{background-color:#d9edf7}.table-hover>tbody>tr>td.info:hover,.table-hover>tbody>tr>th.info:hover,.table-hover>tbody>tr.info:hover>td,.table-hover>tbody>tr.info:hover>th{background-color:#c4e3f3}.table>thead>tr>td.warning,.table>tbody>tr>td.warning,.table>tfoot>tr>td.warning,.table>thead>tr>th.warning,.table>tbody>tr>th.warning,.table>tfoot>tr>th.warning,.table>thead>tr.warning>td,.table>tbody>tr.warning>td,.table>tfoot>tr.warning>td,.table>thead>tr.warning>th,.table>tbody>tr.warning>th,.table>tfoot>tr.warning>th{background-color:#fcf8e3}.table-hover>tbody>tr>td.warning:hover,.table-hover>tbody>tr>th.warning:hover,.table-hover>tbody>tr.warning:hover>td,.table-hover>tbody>tr.warning:hover>th{background-color:#faf2cc}.table>thead>tr>td.danger,.table>tbody>tr>td.danger,.table>tfoot>tr>td.danger,.table>thead>tr>th.danger,.table>tbody>tr>th.danger,.table>tfoot>tr>th.danger,.table>thead>tr.danger>td,.table>tbody>tr.danger>td,.table>tfoot>tr.danger>td,.table>thead>tr.danger>th,.table>tbody>tr.danger>th,.table>tfoot>tr.danger>th{background-color:#f2dede}.table-hover>tbody>tr>td.danger:hover,.table-hover>tbody>tr>th.danger:hover,.table-hover>tbody>tr.danger:hover>td,.table-hover>tbody>tr.danger:hover>th{background-color:#ebcccc}@media (max-width:767px){.table-responsive{width:100%;margin-bottom:15px;overflow-y:hidden;overflow-x:scroll;-ms-overflow-style:-ms-autohiding-scrollbar;border:1px solid #ddd;-webkit-overflow-scrolling:touch}.table-responsive>.table{margin-bottom:0}.table-responsive>.table>thead>tr>th,.table-responsive>.table>tbody>tr>th,.table-responsive>.table>tfoot>tr>th,.table-responsive>.table>thead>tr>td,.table-responsive>.table>tbody>tr>td,.table-responsive>.table>tfoot>tr>td{white-space:nowrap}.table-responsive>.table-bordered{border:0}.table-responsive>.table-bordered>thead>tr>th:first-child,.table-responsive>.table-bordered>tbody>tr>th:first-child,.table-responsive>.table-bordered>tfoot>tr>th:first-child,.table-responsive>.table-bordered>thead>tr>td:first-child,.table-responsive>.table-bordered>tbody>tr>td:first-child,.table-responsive>.table-bordered>tfoot>tr>td:first-child{border-left:0}.table-responsive>.table-bordered>thead>tr>th:last-child,.table-responsive>.table-bordered>tbody>tr>th:last-child,.table-responsive>.table-bordered>tfoot>tr>th:last-child,.table-responsive>.table-bordered>thead>tr>td:last-child,.table-responsive>.table-bordered>tbody>tr>td:last-child,.table-responsive>.table-bordered>tfoot>tr>td:last-child{border-right:0}.table-responsive>.table-bordered>tbody>tr:last-child>th,.table-responsive>.table-bordered>tfoot>tr:last-child>th,.table-responsive>.table-bordered>tbody>tr:last-child>td,.table-responsive>.table-bordered>tfoot>tr:last-child>td{border-bottom:0}}fieldset{padding:0;margin:0;border:0;min-width:0}legend{display:block;width:100%;padding:0;margin-bottom:20px;font-size:21px;line-height:inherit;color:#333;border:0;border-bottom:1px solid #e5e5e5}label{display:inline-block;margin-bottom:5px;font-weight:bold}input[type="search"]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}input[type="radio"],input[type="checkbox"]{margin:4px 0 0;margin-top:1px \9;line-height:normal}input[type="file"]{display:block}input[type="range"]{display:block;width:100%}select[multiple],select[size]{height:auto}input[type="file"]:focus,input[type="radio"]:focus,input[type="checkbox"]:focus{outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}output{display:block;padding-top:7px;font-size:14px;line-height:1.42857143;color:#555}.form-control{display:block;width:100%;height:34px;padding:6px 12px;font-size:14px;line-height:1.42857143;color:#555;background-color:#fff;background-image:none;border:1px solid #ccc;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-webkit-transition:border-color ease-in-out .15s, box-shadow ease-in-out .15s;transition:border-color ease-in-out .15s, box-shadow ease-in-out .15s}.form-control:focus{border-color:#66afe9;outline:0;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6);box-shadow:inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6)}.form-control::-moz-placeholder{color:#999;opacity:1}.form-control:-ms-input-placeholder{color:#999}.form-control::-webkit-input-placeholder{color:#999}.form-control[disabled],.form-control[readonly],fieldset[disabled] .form-control{cursor:not-allowed;background-color:#eee;opacity:1}textarea.form-control{height:auto}input[type="search"]{-webkit-appearance:none}input[type="date"]{line-height:34px}.form-group{margin-bottom:15px}.radio,.checkbox{display:block;min-height:20px;margin-top:10px;margin-bottom:10px;padding-left:20px}.radio label,.checkbox label{display:inline;font-weight:normal;cursor:pointer}.radio input[type="radio"],.radio-inline input[type="radio"],.checkbox input[type="checkbox"],.checkbox-inline input[type="checkbox"]{float:left;margin-left:-20px}.radio+.radio,.checkbox+.checkbox{margin-top:-5px}.radio-inline,.checkbox-inline{display:inline-block;padding-left:20px;margin-bottom:0;vertical-align:middle;font-weight:normal;cursor:pointer}.radio-inline+.radio-inline,.checkbox-inline+.checkbox-inline{margin-top:0;margin-left:10px}input[type="radio"][disabled],input[type="checkbox"][disabled],.radio[disabled],.radio-inline[disabled],.checkbox[disabled],.checkbox-inline[disabled],fieldset[disabled] input[type="radio"],fieldset[disabled] input[type="checkbox"],fieldset[disabled] .radio,fieldset[disabled] .radio-inline,fieldset[disabled] .checkbox,fieldset[disabled] .checkbox-inline{cursor:not-allowed}.input-sm{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-sm{height:30px;line-height:30px}textarea.input-sm,select[multiple].input-sm{height:auto}.input-lg{height:46px;padding:10px 16px;font-size:18px;line-height:1.33;border-radius:6px}select.input-lg{height:46px;line-height:46px}textarea.input-lg,select[multiple].input-lg{height:auto}.has-feedback{position:relative}.has-feedback .form-control{padding-right:42.5px}.has-feedback .form-control-feedback{position:absolute;top:25px;right:0;display:block;width:34px;height:34px;line-height:34px;text-align:center}.has-success .help-block,.has-success .control-label,.has-success .radio,.has-success .checkbox,.has-success .radio-inline,.has-success .checkbox-inline{color:#3c763d}.has-success .form-control{border-color:#3c763d;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.has-success .form-control:focus{border-color:#2b542c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #67b168;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #67b168}.has-success .input-group-addon{color:#3c763d;border-color:#3c763d;background-color:#dff0d8}.has-success .form-control-feedback{color:#3c763d}.has-warning .help-block,.has-warning .control-label,.has-warning .radio,.has-warning .checkbox,.has-warning .radio-inline,.has-warning .checkbox-inline{color:#8a6d3b}.has-warning .form-control{border-color:#8a6d3b;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.has-warning .form-control:focus{border-color:#66512c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #c0a16b;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #c0a16b}.has-warning .input-group-addon{color:#8a6d3b;border-color:#8a6d3b;background-color:#fcf8e3}.has-warning .form-control-feedback{color:#8a6d3b}.has-error .help-block,.has-error .control-label,.has-error .radio,.has-error .checkbox,.has-error .radio-inline,.has-error .checkbox-inline{color:#a94442}.has-error .form-control{border-color:#a94442;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.has-error .form-control:focus{border-color:#843534;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #ce8483;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #ce8483}.has-error .input-group-addon{color:#a94442;border-color:#a94442;background-color:#f2dede}.has-error .form-control-feedback{color:#a94442}.form-control-static{margin-bottom:0}.help-block{display:block;margin-top:5px;margin-bottom:10px;color:#737373}@media (min-width:768px){.form-inline .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .input-group>.form-control{width:100%}.form-inline .control-label{margin-bottom:0;vertical-align:middle}.form-inline .radio,.form-inline .checkbox{display:inline-block;margin-top:0;margin-bottom:0;padding-left:0;vertical-align:middle}.form-inline .radio input[type="radio"],.form-inline .checkbox input[type="checkbox"]{float:none;margin-left:0}.form-inline .has-feedback .form-control-feedback{top:0}}.form-horizontal .control-label,.form-horizontal .radio,.form-horizontal .checkbox,.form-horizontal .radio-inline,.form-horizontal .checkbox-inline{margin-top:0;margin-bottom:0;padding-top:7px}.form-horizontal .radio,.form-horizontal .checkbox{min-height:27px}.form-horizontal .form-group{margin-left:-15px;margin-right:-15px}.form-horizontal .form-control-static{padding-top:7px}@media (min-width:768px){.form-horizontal .control-label{text-align:right}}.form-horizontal .has-feedback .form-control-feedback{top:0;right:15px}.btn{display:inline-block;margin-bottom:0;font-weight:normal;text-align:center;vertical-align:middle;cursor:pointer;background-image:none;border:1px solid transparent;white-space:nowrap;padding:6px 12px;font-size:14px;line-height:1.42857143;border-radius:4px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.btn:focus,.btn:active:focus,.btn.active:focus{outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn:hover,.btn:focus{color:#333;text-decoration:none}.btn:active,.btn.active{outline:0;background-image:none;-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,0.125);box-shadow:inset 0 3px 5px rgba(0,0,0,0.125)}.btn.disabled,.btn[disabled],fieldset[disabled] .btn{cursor:not-allowed;pointer-events:none;opacity:.65;filter:alpha(opacity=65);-webkit-box-shadow:none;box-shadow:none}.btn-default{color:#333;background-color:#fff;border-color:#ccc}.btn-default:hover,.btn-default:focus,.btn-default:active,.btn-default.active,.open .dropdown-toggle.btn-default{color:#333;background-color:#ebebeb;border-color:#adadad}.btn-default:active,.btn-default.active,.open .dropdown-toggle.btn-default{background-image:none}.btn-default.disabled,.btn-default[disabled],fieldset[disabled] .btn-default,.btn-default.disabled:hover,.btn-default[disabled]:hover,fieldset[disabled] .btn-default:hover,.btn-default.disabled:focus,.btn-default[disabled]:focus,fieldset[disabled] .btn-default:focus,.btn-default.disabled:active,.btn-default[disabled]:active,fieldset[disabled] .btn-default:active,.btn-default.disabled.active,.btn-default[disabled].active,fieldset[disabled] .btn-default.active{background-color:#fff;border-color:#ccc}.btn-default .badge{color:#fff;background-color:#333}.btn-primary{color:#fff;background-color:#428bca;border-color:#357ebd}.btn-primary:hover,.btn-primary:focus,.btn-primary:active,.btn-primary.active,.open .dropdown-toggle.btn-primary{color:#fff;background-color:#3276b1;border-color:#285e8e}.btn-primary:active,.btn-primary.active,.open .dropdown-toggle.btn-primary{background-image:none}.btn-primary.disabled,.btn-primary[disabled],fieldset[disabled] .btn-primary,.btn-primary.disabled:hover,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary:hover,.btn-primary.disabled:focus,.btn-primary[disabled]:focus,fieldset[disabled] .btn-primary:focus,.btn-primary.disabled:active,.btn-primary[disabled]:active,fieldset[disabled] .btn-primary:active,.btn-primary.disabled.active,.btn-primary[disabled].active,fieldset[disabled] .btn-primary.active{background-color:#428bca;border-color:#357ebd}.btn-primary .badge{color:#428bca;background-color:#fff}.btn-success{color:#fff;background-color:#5cb85c;border-color:#4cae4c}.btn-success:hover,.btn-success:focus,.btn-success:active,.btn-success.active,.open .dropdown-toggle.btn-success{color:#fff;background-color:#47a447;border-color:#398439}.btn-success:active,.btn-success.active,.open .dropdown-toggle.btn-success{background-image:none}.btn-success.disabled,.btn-success[disabled],fieldset[disabled] .btn-success,.btn-success.disabled:hover,.btn-success[disabled]:hover,fieldset[disabled] .btn-success:hover,.btn-success.disabled:focus,.btn-success[disabled]:focus,fieldset[disabled] .btn-success:focus,.btn-success.disabled:active,.btn-success[disabled]:active,fieldset[disabled] .btn-success:active,.btn-success.disabled.active,.btn-success[disabled].active,fieldset[disabled] .btn-success.active{background-color:#5cb85c;border-color:#4cae4c}.btn-success .badge{color:#5cb85c;background-color:#fff}.btn-info{color:#fff;background-color:#5bc0de;border-color:#46b8da}.btn-info:hover,.btn-info:focus,.btn-info:active,.btn-info.active,.open .dropdown-toggle.btn-info{color:#fff;background-color:#39b3d7;border-color:#269abc}.btn-info:active,.btn-info.active,.open .dropdown-toggle.btn-info{background-image:none}.btn-info.disabled,.btn-info[disabled],fieldset[disabled] .btn-info,.btn-info.disabled:hover,.btn-info[disabled]:hover,fieldset[disabled] .btn-info:hover,.btn-info.disabled:focus,.btn-info[disabled]:focus,fieldset[disabled] .btn-info:focus,.btn-info.disabled:active,.btn-info[disabled]:active,fieldset[disabled] .btn-info:active,.btn-info.disabled.active,.btn-info[disabled].active,fieldset[disabled] .btn-info.active{background-color:#5bc0de;border-color:#46b8da}.btn-info .badge{color:#5bc0de;background-color:#fff}.btn-warning{color:#fff;background-color:#f0ad4e;border-color:#eea236}.btn-warning:hover,.btn-warning:focus,.btn-warning:active,.btn-warning.active,.open .dropdown-toggle.btn-warning{color:#fff;background-color:#ed9c28;border-color:#d58512}.btn-warning:active,.btn-warning.active,.open .dropdown-toggle.btn-warning{background-image:none}.btn-warning.disabled,.btn-warning[disabled],fieldset[disabled] .btn-warning,.btn-warning.disabled:hover,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning:hover,.btn-warning.disabled:focus,.btn-warning[disabled]:focus,fieldset[disabled] .btn-warning:focus,.btn-warning.disabled:active,.btn-warning[disabled]:active,fieldset[disabled] .btn-warning:active,.btn-warning.disabled.active,.btn-warning[disabled].active,fieldset[disabled] .btn-warning.active{background-color:#f0ad4e;border-color:#eea236}.btn-warning .badge{color:#f0ad4e;background-color:#fff}.btn-danger{color:#fff;background-color:#d9534f;border-color:#d43f3a}.btn-danger:hover,.btn-danger:focus,.btn-danger:active,.btn-danger.active,.open .dropdown-toggle.btn-danger{color:#fff;background-color:#d2322d;border-color:#ac2925}.btn-danger:active,.btn-danger.active,.open .dropdown-toggle.btn-danger{background-image:none}.btn-danger.disabled,.btn-danger[disabled],fieldset[disabled] .btn-danger,.btn-danger.disabled:hover,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger:hover,.btn-danger.disabled:focus,.btn-danger[disabled]:focus,fieldset[disabled] .btn-danger:focus,.btn-danger.disabled:active,.btn-danger[disabled]:active,fieldset[disabled] .btn-danger:active,.btn-danger.disabled.active,.btn-danger[disabled].active,fieldset[disabled] .btn-danger.active{background-color:#d9534f;border-color:#d43f3a}.btn-danger .badge{color:#d9534f;background-color:#fff}.btn-link{color:#428bca;font-weight:normal;cursor:pointer;border-radius:0}.btn-link,.btn-link:active,.btn-link[disabled],fieldset[disabled] .btn-link{background-color:transparent;-webkit-box-shadow:none;box-shadow:none}.btn-link,.btn-link:hover,.btn-link:focus,.btn-link:active{border-color:transparent}.btn-link:hover,.btn-link:focus{color:#2a6496;text-decoration:underline;background-color:transparent}.btn-link[disabled]:hover,fieldset[disabled] .btn-link:hover,.btn-link[disabled]:focus,fieldset[disabled] .btn-link:focus{color:#999;text-decoration:none}.btn-lg,.btn-group-lg>.btn{padding:10px 16px;font-size:18px;line-height:1.33;border-radius:6px}.btn-sm,.btn-group-sm>.btn{padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.btn-xs,.btn-group-xs>.btn{padding:1px 5px;font-size:12px;line-height:1.5;border-radius:3px}.btn-block{display:block;width:100%;padding-left:0;padding-right:0}.btn-block+.btn-block{margin-top:5px}input[type="submit"].btn-block,input[type="reset"].btn-block,input[type="button"].btn-block{width:100%}.fade{opacity:0;-webkit-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{display:none}.collapse.in{display:block}.collapsing{position:relative;height:0;overflow:hidden;-webkit-transition:height .35s ease;transition:height .35s ease}@font-face{font-family:'Glyphicons Halflings';src:url('../fonts/glyphicons-halflings-regular.eot');src:url('../fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'),url('../fonts/glyphicons-halflings-regular.woff') format('woff'),url('../fonts/glyphicons-halflings-regular.ttf') format('truetype'),url('../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg')}.glyphicon{position:relative;top:1px;display:inline-block;font-family:'Glyphicons Halflings';font-style:normal;font-weight:normal;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.glyphicon-asterisk:before{content:"\2a"}.glyphicon-plus:before{content:"\2b"}.glyphicon-euro:before{content:"\20ac"}.glyphicon-minus:before{content:"\2212"}.glyphicon-cloud:before{content:"\2601"}.glyphicon-envelope:before{content:"\2709"}.glyphicon-pencil:before{content:"\270f"}.glyphicon-glass:before{content:"\e001"}.glyphicon-music:before{content:"\e002"}.glyphicon-search:before{content:"\e003"}.glyphicon-heart:before{content:"\e005"}.glyphicon-star:before{content:"\e006"}.glyphicon-star-empty:before{content:"\e007"}.glyphicon-user:before{content:"\e008"}.glyphicon-film:before{content:"\e009"}.glyphicon-th-large:before{content:"\e010"}.glyphicon-th:before{content:"\e011"}.glyphicon-th-list:before{content:"\e012"}.glyphicon-ok:before{content:"\e013"}.glyphicon-remove:before{content:"\e014"}.glyphicon-zoom-in:before{content:"\e015"}.glyphicon-zoom-out:before{content:"\e016"}.glyphicon-off:before{content:"\e017"}.glyphicon-signal:before{content:"\e018"}.glyphicon-cog:before{content:"\e019"}.glyphicon-trash:before{content:"\e020"}.glyphicon-home:before{content:"\e021"}.glyphicon-file:before{content:"\e022"}.glyphicon-time:before{content:"\e023"}.glyphicon-road:before{content:"\e024"}.glyphicon-download-alt:before{content:"\e025"}.glyphicon-download:before{content:"\e026"}.glyphicon-upload:before{content:"\e027"}.glyphicon-inbox:before{content:"\e028"}.glyphicon-play-circle:before{content:"\e029"}.glyphicon-repeat:before{content:"\e030"}.glyphicon-refresh:before{content:"\e031"}.glyphicon-list-alt:before{content:"\e032"}.glyphicon-lock:before{content:"\e033"}.glyphicon-flag:before{content:"\e034"}.glyphicon-headphones:before{content:"\e035"}.glyphicon-volume-off:before{content:"\e036"}.glyphicon-volume-down:before{content:"\e037"}.glyphicon-volume-up:before{content:"\e038"}.glyphicon-qrcode:before{content:"\e039"}.glyphicon-barcode:before{content:"\e040"}.glyphicon-tag:before{content:"\e041"}.glyphicon-tags:before{content:"\e042"}.glyphicon-book:before{content:"\e043"}.glyphicon-bookmark:before{content:"\e044"}.glyphicon-print:before{content:"\e045"}.glyphicon-camera:before{content:"\e046"}.glyphicon-font:before{content:"\e047"}.glyphicon-bold:before{content:"\e048"}.glyphicon-italic:before{content:"\e049"}.glyphicon-text-height:before{content:"\e050"}.glyphicon-text-width:before{content:"\e051"}.glyphicon-align-left:before{content:"\e052"}.glyphicon-align-center:before{content:"\e053"}.glyphicon-align-right:before{content:"\e054"}.glyphicon-align-justify:before{content:"\e055"}.glyphicon-list:before{content:"\e056"}.glyphicon-indent-left:before{content:"\e057"}.glyphicon-indent-right:before{content:"\e058"}.glyphicon-facetime-video:before{content:"\e059"}.glyphicon-picture:before{content:"\e060"}.glyphicon-map-marker:before{content:"\e062"}.glyphicon-adjust:before{content:"\e063"}.glyphicon-tint:before{content:"\e064"}.glyphicon-edit:before{content:"\e065"}.glyphicon-share:before{content:"\e066"}.glyphicon-check:before{content:"\e067"}.glyphicon-move:before{content:"\e068"}.glyphicon-step-backward:before{content:"\e069"}.glyphicon-fast-backward:before{content:"\e070"}.glyphicon-backward:before{content:"\e071"}.glyphicon-play:before{content:"\e072"}.glyphicon-pause:before{content:"\e073"}.glyphicon-stop:before{content:"\e074"}.glyphicon-forward:before{content:"\e075"}.glyphicon-fast-forward:before{content:"\e076"}.glyphicon-step-forward:before{content:"\e077"}.glyphicon-eject:before{content:"\e078"}.glyphicon-chevron-left:before{content:"\e079"}.glyphicon-chevron-right:before{content:"\e080"}.glyphicon-plus-sign:before{content:"\e081"}.glyphicon-minus-sign:before{content:"\e082"}.glyphicon-remove-sign:before{content:"\e083"}.glyphicon-ok-sign:before{content:"\e084"}.glyphicon-question-sign:before{content:"\e085"}.glyphicon-info-sign:before{content:"\e086"}.glyphicon-screenshot:before{content:"\e087"}.glyphicon-remove-circle:before{content:"\e088"}.glyphicon-ok-circle:before{content:"\e089"}.glyphicon-ban-circle:before{content:"\e090"}.glyphicon-arrow-left:before{content:"\e091"}.glyphicon-arrow-right:before{content:"\e092"}.glyphicon-arrow-up:before{content:"\e093"}.glyphicon-arrow-down:before{content:"\e094"}.glyphicon-share-alt:before{content:"\e095"}.glyphicon-resize-full:before{content:"\e096"}.glyphicon-resize-small:before{content:"\e097"}.glyphicon-exclamation-sign:before{content:"\e101"}.glyphicon-gift:before{content:"\e102"}.glyphicon-leaf:before{content:"\e103"}.glyphicon-fire:before{content:"\e104"}.glyphicon-eye-open:before{content:"\e105"}.glyphicon-eye-close:before{content:"\e106"}.glyphicon-warning-sign:before{content:"\e107"}.glyphicon-plane:before{content:"\e108"}.glyphicon-calendar:before{content:"\e109"}.glyphicon-random:before{content:"\e110"}.glyphicon-comment:before{content:"\e111"}.glyphicon-magnet:before{content:"\e112"}.glyphicon-chevron-up:before{content:"\e113"}.glyphicon-chevron-down:before{content:"\e114"}.glyphicon-retweet:before{content:"\e115"}.glyphicon-shopping-cart:before{content:"\e116"}.glyphicon-folder-close:before{content:"\e117"}.glyphicon-folder-open:before{content:"\e118"}.glyphicon-resize-vertical:before{content:"\e119"}.glyphicon-resize-horizontal:before{content:"\e120"}.glyphicon-hdd:before{content:"\e121"}.glyphicon-bullhorn:before{content:"\e122"}.glyphicon-bell:before{content:"\e123"}.glyphicon-certificate:before{content:"\e124"}.glyphicon-thumbs-up:before{content:"\e125"}.glyphicon-thumbs-down:before{content:"\e126"}.glyphicon-hand-right:before{content:"\e127"}.glyphicon-hand-left:before{content:"\e128"}.glyphicon-hand-up:before{content:"\e129"}.glyphicon-hand-down:before{content:"\e130"}.glyphicon-circle-arrow-right:before{content:"\e131"}.glyphicon-circle-arrow-left:before{content:"\e132"}.glyphicon-circle-arrow-up:before{content:"\e133"}.glyphicon-circle-arrow-down:before{content:"\e134"}.glyphicon-globe:before{content:"\e135"}.glyphicon-wrench:before{content:"\e136"}.glyphicon-tasks:before{content:"\e137"}.glyphicon-filter:before{content:"\e138"}.glyphicon-briefcase:before{content:"\e139"}.glyphicon-fullscreen:before{content:"\e140"}.glyphicon-dashboard:before{content:"\e141"}.glyphicon-paperclip:before{content:"\e142"}.glyphicon-heart-empty:before{content:"\e143"}.glyphicon-link:before{content:"\e144"}.glyphicon-phone:before{content:"\e145"}.glyphicon-pushpin:before{content:"\e146"}.glyphicon-usd:before{content:"\e148"}.glyphicon-gbp:before{content:"\e149"}.glyphicon-sort:before{content:"\e150"}.glyphicon-sort-by-alphabet:before{content:"\e151"}.glyphicon-sort-by-alphabet-alt:before{content:"\e152"}.glyphicon-sort-by-order:before{content:"\e153"}.glyphicon-sort-by-order-alt:before{content:"\e154"}.glyphicon-sort-by-attributes:before{content:"\e155"}.glyphicon-sort-by-attributes-alt:before{content:"\e156"}.glyphicon-unchecked:before{content:"\e157"}.glyphicon-expand:before{content:"\e158"}.glyphicon-collapse-down:before{content:"\e159"}.glyphicon-collapse-up:before{content:"\e160"}.glyphicon-log-in:before{content:"\e161"}.glyphicon-flash:before{content:"\e162"}.glyphicon-log-out:before{content:"\e163"}.glyphicon-new-window:before{content:"\e164"}.glyphicon-record:before{content:"\e165"}.glyphicon-save:before{content:"\e166"}.glyphicon-open:before{content:"\e167"}.glyphicon-saved:before{content:"\e168"}.glyphicon-import:before{content:"\e169"}.glyphicon-export:before{content:"\e170"}.glyphicon-send:before{content:"\e171"}.glyphicon-floppy-disk:before{content:"\e172"}.glyphicon-floppy-saved:before{content:"\e173"}.glyphicon-floppy-remove:before{content:"\e174"}.glyphicon-floppy-save:before{content:"\e175"}.glyphicon-floppy-open:before{content:"\e176"}.glyphicon-credit-card:before{content:"\e177"}.glyphicon-transfer:before{content:"\e178"}.glyphicon-cutlery:before{content:"\e179"}.glyphicon-header:before{content:"\e180"}.glyphicon-compressed:before{content:"\e181"}.glyphicon-earphone:before{content:"\e182"}.glyphicon-phone-alt:before{content:"\e183"}.glyphicon-tower:before{content:"\e184"}.glyphicon-stats:before{content:"\e185"}.glyphicon-sd-video:before{content:"\e186"}.glyphicon-hd-video:before{content:"\e187"}.glyphicon-subtitles:before{content:"\e188"}.glyphicon-sound-stereo:before{content:"\e189"}.glyphicon-sound-dolby:before{content:"\e190"}.glyphicon-sound-5-1:before{content:"\e191"}.glyphicon-sound-6-1:before{content:"\e192"}.glyphicon-sound-7-1:before{content:"\e193"}.glyphicon-copyright-mark:before{content:"\e194"}.glyphicon-registration-mark:before{content:"\e195"}.glyphicon-cloud-download:before{content:"\e197"}.glyphicon-cloud-upload:before{content:"\e198"}.glyphicon-tree-conifer:before{content:"\e199"}.glyphicon-tree-deciduous:before{content:"\e200"}.caret{display:inline-block;width:0;height:0;margin-left:2px;vertical-align:middle;border-top:4px solid;border-right:4px solid transparent;border-left:4px solid transparent}.dropdown{position:relative}.dropdown-toggle:focus{outline:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:5px 0;margin:2px 0 0;list-style:none;font-size:14px;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.15);border-radius:4px;-webkit-box-shadow:0 6px 12px rgba(0,0,0,0.175);box-shadow:0 6px 12px rgba(0,0,0,0.175);background-clip:padding-box}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.dropdown-menu>li>a{display:block;padding:3px 20px;clear:both;font-weight:normal;line-height:1.42857143;color:#333;white-space:nowrap}.dropdown-menu>li>a:hover,.dropdown-menu>li>a:focus{text-decoration:none;color:#262626;background-color:#f5f5f5}.dropdown-menu>.active>a,.dropdown-menu>.active>a:hover,.dropdown-menu>.active>a:focus{color:#fff;text-decoration:none;outline:0;background-color:#428bca}.dropdown-menu>.disabled>a,.dropdown-menu>.disabled>a:hover,.dropdown-menu>.disabled>a:focus{color:#999}.dropdown-menu>.disabled>a:hover,.dropdown-menu>.disabled>a:focus{text-decoration:none;background-color:transparent;background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);cursor:not-allowed}.open>.dropdown-menu{display:block}.open>a{outline:0}.dropdown-menu-right{left:auto;right:0}.dropdown-menu-left{left:0;right:auto}.dropdown-header{display:block;padding:3px 20px;font-size:12px;line-height:1.42857143;color:#999}.dropdown-backdrop{position:fixed;left:0;right:0;bottom:0;top:0;z-index:990}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{border-top:0;border-bottom:4px solid;content:""}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:1px}@media (min-width:768px){.navbar-right .dropdown-menu{left:auto;right:0}.navbar-right .dropdown-menu-left{left:0;right:auto}}.btn-group,.btn-group-vertical{position:relative;display:inline-block;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;float:left}.btn-group>.btn:hover,.btn-group-vertical>.btn:hover,.btn-group>.btn:focus,.btn-group-vertical>.btn:focus,.btn-group>.btn:active,.btn-group-vertical>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn.active{z-index:2}.btn-group>.btn:focus,.btn-group-vertical>.btn:focus{outline:none}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{margin-left:-5px}.btn-toolbar .btn-group,.btn-toolbar .input-group{float:left}.btn-toolbar>.btn,.btn-toolbar>.btn-group,.btn-toolbar>.input-group{margin-left:5px}.btn-group>.btn:not(:first-child):not(:last-child):not(.dropdown-toggle){border-radius:0}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn:first-child:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-top-right-radius:0}.btn-group>.btn:last-child:not(:first-child),.btn-group>.dropdown-toggle:not(:first-child){border-bottom-left-radius:0;border-top-left-radius:0}.btn-group>.btn-group{float:left}.btn-group>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group>.btn-group:first-child>.btn:last-child,.btn-group>.btn-group:first-child>.dropdown-toggle{border-bottom-right-radius:0;border-top-right-radius:0}.btn-group>.btn-group:last-child>.btn:first-child{border-bottom-left-radius:0;border-top-left-radius:0}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.btn+.dropdown-toggle{padding-left:8px;padding-right:8px}.btn-group>.btn-lg+.dropdown-toggle{padding-left:12px;padding-right:12px}.btn-group.open .dropdown-toggle{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,0.125);box-shadow:inset 0 3px 5px rgba(0,0,0,0.125)}.btn-group.open .dropdown-toggle.btn-link{-webkit-box-shadow:none;box-shadow:none}.btn .caret{margin-left:0}.btn-lg .caret{border-width:5px 5px 0;border-bottom-width:0}.dropup .btn-lg .caret{border-width:0 5px 5px}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group,.btn-group-vertical>.btn-group>.btn{display:block;float:none;width:100%;max-width:100%}.btn-group-vertical>.btn-group>.btn{float:none}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:not(:first-child):not(:last-child){border-radius:0}.btn-group-vertical>.btn:first-child:not(:last-child){border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:last-child:not(:first-child){border-bottom-left-radius:4px;border-top-right-radius:0;border-top-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group-vertical>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group-vertical>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-right-radius:0;border-top-left-radius:0}.btn-group-justified{display:table;width:100%;table-layout:fixed;border-collapse:separate}.btn-group-justified>.btn,.btn-group-justified>.btn-group{float:none;display:table-cell;width:1%}.btn-group-justified>.btn-group .btn{width:100%}[data-toggle="buttons"]>.btn>input[type="radio"],[data-toggle="buttons"]>.btn>input[type="checkbox"]{display:none}.input-group{position:relative;display:table;border-collapse:separate}.input-group[class="col-"]{float:none;padding-left:0;padding-right:0}.input-group .form-control{position:relative;z-index:2;float:left;width:100%;margin-bottom:0}.input-group-lg>.form-control,.input-group-lg>.input-group-addon,.input-group-lg>.input-group-btn>.btn{height:46px;padding:10px 16px;font-size:18px;line-height:1.33;border-radius:6px}select.input-group-lg>.form-control,select.input-group-lg>.input-group-addon,select.input-group-lg>.input-group-btn>.btn{height:46px;line-height:46px}textarea.input-group-lg>.form-control,textarea.input-group-lg>.input-group-addon,textarea.input-group-lg>.input-group-btn>.btn,select[multiple].input-group-lg>.form-control,select[multiple].input-group-lg>.input-group-addon,select[multiple].input-group-lg>.input-group-btn>.btn{height:auto}.input-group-sm>.form-control,.input-group-sm>.input-group-addon,.input-group-sm>.input-group-btn>.btn{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-group-sm>.form-control,select.input-group-sm>.input-group-addon,select.input-group-sm>.input-group-btn>.btn{height:30px;line-height:30px}textarea.input-group-sm>.form-control,textarea.input-group-sm>.input-group-addon,textarea.input-group-sm>.input-group-btn>.btn,select[multiple].input-group-sm>.form-control,select[multiple].input-group-sm>.input-group-addon,select[multiple].input-group-sm>.input-group-btn>.btn{height:auto}.input-group-addon,.input-group-btn,.input-group .form-control{display:table-cell}.input-group-addon:not(:first-child):not(:last-child),.input-group-btn:not(:first-child):not(:last-child),.input-group .form-control:not(:first-child):not(:last-child){border-radius:0}.input-group-addon,.input-group-btn{width:1%;white-space:nowrap;vertical-align:middle}.input-group-addon{padding:6px 12px;font-size:14px;font-weight:normal;line-height:1;color:#555;text-align:center;background-color:#eee;border:1px solid #ccc;border-radius:4px}.input-group-addon.input-sm{padding:5px 10px;font-size:12px;border-radius:3px}.input-group-addon.input-lg{padding:10px 16px;font-size:18px;border-radius:6px}.input-group-addon input[type="radio"],.input-group-addon input[type="checkbox"]{margin-top:0}.input-group .form-control:first-child,.input-group-addon:first-child,.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group>.btn,.input-group-btn:first-child>.dropdown-toggle,.input-group-btn:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group-btn:last-child>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-top-right-radius:0}.input-group-addon:first-child{border-right:0}.input-group .form-control:last-child,.input-group-addon:last-child,.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group>.btn,.input-group-btn:last-child>.dropdown-toggle,.input-group-btn:first-child>.btn:not(:first-child),.input-group-btn:first-child>.btn-group:not(:first-child)>.btn{border-bottom-left-radius:0;border-top-left-radius:0}.input-group-addon:last-child{border-left:0}.input-group-btn{position:relative;font-size:0;white-space:nowrap}.input-group-btn>.btn{position:relative}.input-group-btn>.btn+.btn{margin-left:-1px}.input-group-btn>.btn:hover,.input-group-btn>.btn:focus,.input-group-btn>.btn:active{z-index:2}.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group{margin-right:-1px}.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group{margin-left:-1px}.nav{margin-bottom:0;padding-left:0;list-style:none}.nav>li{position:relative;display:block}.nav>li>a{position:relative;display:block;padding:10px 15px}.nav>li>a:hover,.nav>li>a:focus{text-decoration:none;background-color:#eee}.nav>li.disabled>a{color:#999}.nav>li.disabled>a:hover,.nav>li.disabled>a:focus{color:#999;text-decoration:none;background-color:transparent;cursor:not-allowed}.nav .open>a,.nav .open>a:hover,.nav .open>a:focus{background-color:#eee;border-color:#428bca}.nav .nav-divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.nav>li>a>img{max-width:none}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{float:left;margin-bottom:-1px}.nav-tabs>li>a{margin-right:2px;line-height:1.42857143;border:1px solid transparent;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>li.active>a,.nav-tabs>li.active>a:hover,.nav-tabs>li.active>a:focus{color:#555;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent;cursor:default}.nav-tabs.nav-justified{width:100%;border-bottom:0}.nav-tabs.nav-justified>li{float:none}.nav-tabs.nav-justified>li>a{text-align:center;margin-bottom:5px}.nav-tabs.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-tabs.nav-justified>li{display:table-cell;width:1%}.nav-tabs.nav-justified>li>a{margin-bottom:0}}.nav-tabs.nav-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:hover,.nav-tabs.nav-justified>.active>a:focus{border:1px solid #ddd}@media (min-width:768px){.nav-tabs.nav-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:hover,.nav-tabs.nav-justified>.active>a:focus{border-bottom-color:#fff}}.nav-pills>li{float:left}.nav-pills>li>a{border-radius:4px}.nav-pills>li+li{margin-left:2px}.nav-pills>li.active>a,.nav-pills>li.active>a:hover,.nav-pills>li.active>a:focus{color:#fff;background-color:#428bca}.nav-stacked>li{float:none}.nav-stacked>li+li{margin-top:2px;margin-left:0}.nav-justified{width:100%}.nav-justified>li{float:none}.nav-justified>li>a{text-align:center;margin-bottom:5px}.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-justified>li{display:table-cell;width:1%}.nav-justified>li>a{margin-bottom:0}}.nav-tabs-justified{border-bottom:0}.nav-tabs-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:hover,.nav-tabs-justified>.active>a:focus{border:1px solid #ddd}@media (min-width:768px){.nav-tabs-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:hover,.nav-tabs-justified>.active>a:focus{border-bottom-color:#fff}}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-right-radius:0;border-top-left-radius:0}.navbar{position:relative;min-height:50px;margin-bottom:20px;border:1px solid transparent}@media (min-width:768px){.navbar{border-radius:4px}}@media (min-width:768px){.navbar-header{float:left}}.navbar-collapse{max-height:340px;overflow-x:visible;padding-right:15px;padding-left:15px;border-top:1px solid transparent;box-shadow:inset 0 1px 0 rgba(255,255,255,0.1);-webkit-overflow-scrolling:touch}.navbar-collapse.in{overflow-y:auto}@media (min-width:768px){.navbar-collapse{width:auto;border-top:0;box-shadow:none}.navbar-collapse.collapse{display:block !important;height:auto !important;padding-bottom:0;overflow:visible !important}.navbar-collapse.in{overflow-y:visible}.navbar-fixed-top .navbar-collapse,.navbar-static-top .navbar-collapse,.navbar-fixed-bottom .navbar-collapse{padding-left:0;padding-right:0}}.container>.navbar-header,.container-fluid>.navbar-header,.container>.navbar-collapse,.container-fluid>.navbar-collapse{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.container>.navbar-header,.container-fluid>.navbar-header,.container>.navbar-collapse,.container-fluid>.navbar-collapse{margin-right:0;margin-left:0}}.navbar-static-top{z-index:1000;border-width:0 0 1px}@media (min-width:768px){.navbar-static-top{border-radius:0}}.navbar-fixed-top,.navbar-fixed-bottom{position:fixed;right:0;left:0;z-index:1030}@media (min-width:768px){.navbar-fixed-top,.navbar-fixed-bottom{border-radius:0}}.navbar-fixed-top{top:0;border-width:0 0 1px}.navbar-fixed-bottom{bottom:0;margin-bottom:0;border-width:1px 0 0}.navbar-brand{float:left;padding:15px 15px;font-size:18px;line-height:20px;height:50px}.navbar-brand:hover,.navbar-brand:focus{text-decoration:none}@media (min-width:768px){.navbar>.container .navbar-brand,.navbar>.container-fluid .navbar-brand{margin-left:-15px}}.navbar-toggle{position:relative;float:right;margin-right:15px;padding:9px 10px;margin-top:8px;margin-bottom:8px;background-color:transparent;background-image:none;border:1px solid transparent;border-radius:4px}.navbar-toggle:focus{outline:none}.navbar-toggle .icon-bar{display:block;width:22px;height:2px;border-radius:1px}.navbar-toggle .icon-bar+.icon-bar{margin-top:4px}@media (min-width:768px){.navbar-toggle{display:none}}.navbar-nav{margin:7.5px -15px}.navbar-nav>li>a{padding-top:10px;padding-bottom:10px;line-height:20px}@media (max-width:767px){.navbar-nav .open .dropdown-menu{position:static;float:none;width:auto;margin-top:0;background-color:transparent;border:0;box-shadow:none}.navbar-nav .open .dropdown-menu>li>a,.navbar-nav .open .dropdown-menu .dropdown-header{padding:5px 15px 5px 25px}.navbar-nav .open .dropdown-menu>li>a{line-height:20px}.navbar-nav .open .dropdown-menu>li>a:hover,.navbar-nav .open .dropdown-menu>li>a:focus{background-image:none}}@media (min-width:768px){.navbar-nav{float:left;margin:0}.navbar-nav>li{float:left}.navbar-nav>li>a{padding-top:15px;padding-bottom:15px}.navbar-nav.navbar-right:last-child{margin-right:-15px}}@media (min-width:768px){.navbar-left{float:left !important}.navbar-right{float:right !important}}.navbar-form{margin-left:-15px;margin-right:-15px;padding:10px 15px;border-top:1px solid transparent;border-bottom:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);margin-top:8px;margin-bottom:8px}@media (min-width:768px){.navbar-form .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.navbar-form .form-control{display:inline-block;width:auto;vertical-align:middle}.navbar-form .input-group>.form-control{width:100%}.navbar-form .control-label{margin-bottom:0;vertical-align:middle}.navbar-form .radio,.navbar-form .checkbox{display:inline-block;margin-top:0;margin-bottom:0;padding-left:0;vertical-align:middle}.navbar-form .radio input[type="radio"],.navbar-form .checkbox input[type="checkbox"]{float:none;margin-left:0}.navbar-form .has-feedback .form-control-feedback{top:0}}@media (max-width:767px){.navbar-form .form-group{margin-bottom:5px}}@media (min-width:768px){.navbar-form{width:auto;border:0;margin-left:0;margin-right:0;padding-top:0;padding-bottom:0;-webkit-box-shadow:none;box-shadow:none}.navbar-form.navbar-right:last-child{margin-right:-15px}}.navbar-nav>li>.dropdown-menu{margin-top:0;border-top-right-radius:0;border-top-left-radius:0}.navbar-fixed-bottom .navbar-nav>li>.dropdown-menu{border-bottom-right-radius:0;border-bottom-left-radius:0}.navbar-btn{margin-top:8px;margin-bottom:8px}.navbar-btn.btn-sm{margin-top:10px;margin-bottom:10px}.navbar-btn.btn-xs{margin-top:14px;margin-bottom:14px}.navbar-text{margin-top:15px;margin-bottom:15px}@media (min-width:768px){.navbar-text{float:left;margin-left:15px;margin-right:15px}.navbar-text.navbar-right:last-child{margin-right:0}}.navbar-default{background-color:#f8f8f8;border-color:#e7e7e7}.navbar-default .navbar-brand{color:#777}.navbar-default .navbar-brand:hover,.navbar-default .navbar-brand:focus{color:#5e5e5e;background-color:transparent}.navbar-default .navbar-text{color:#777}.navbar-default .navbar-nav>li>a{color:#777}.navbar-default .navbar-nav>li>a:hover,.navbar-default .navbar-nav>li>a:focus{color:#333;background-color:transparent}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.active>a:hover,.navbar-default .navbar-nav>.active>a:focus{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav>.disabled>a,.navbar-default .navbar-nav>.disabled>a:hover,.navbar-default .navbar-nav>.disabled>a:focus{color:#ccc;background-color:transparent}.navbar-default .navbar-toggle{border-color:#ddd}.navbar-default .navbar-toggle:hover,.navbar-default .navbar-toggle:focus{background-color:#ddd}.navbar-default .navbar-toggle .icon-bar{background-color:#888}.navbar-default .navbar-collapse,.navbar-default .navbar-form{border-color:#e7e7e7}.navbar-default .navbar-nav>.open>a,.navbar-default .navbar-nav>.open>a:hover,.navbar-default .navbar-nav>.open>a:focus{background-color:#e7e7e7;color:#555}@media (max-width:767px){.navbar-default .navbar-nav .open .dropdown-menu>li>a{color:#777}.navbar-default .navbar-nav .open .dropdown-menu>li>a:hover,.navbar-default .navbar-nav .open .dropdown-menu>li>a:focus{color:#333;background-color:transparent}.navbar-default .navbar-nav .open .dropdown-menu>.active>a,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:hover,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:focus{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:hover,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:focus{color:#ccc;background-color:transparent}}.navbar-default .navbar-link{color:#777}.navbar-default .navbar-link:hover{color:#333}.navbar-inverse{background-color:#222;border-color:#080808}.navbar-inverse .navbar-brand{color:#999}.navbar-inverse .navbar-brand:hover,.navbar-inverse .navbar-brand:focus{color:#fff;background-color:transparent}.navbar-inverse .navbar-text{color:#999}.navbar-inverse .navbar-nav>li>a{color:#999}.navbar-inverse .navbar-nav>li>a:hover,.navbar-inverse .navbar-nav>li>a:focus{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.active>a:hover,.navbar-inverse .navbar-nav>.active>a:focus{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav>.disabled>a,.navbar-inverse .navbar-nav>.disabled>a:hover,.navbar-inverse .navbar-nav>.disabled>a:focus{color:#444;background-color:transparent}.navbar-inverse .navbar-toggle{border-color:#333}.navbar-inverse .navbar-toggle:hover,.navbar-inverse .navbar-toggle:focus{background-color:#333}.navbar-inverse .navbar-toggle .icon-bar{background-color:#fff}.navbar-inverse .navbar-collapse,.navbar-inverse .navbar-form{border-color:#101010}.navbar-inverse .navbar-nav>.open>a,.navbar-inverse .navbar-nav>.open>a:hover,.navbar-inverse .navbar-nav>.open>a:focus{background-color:#080808;color:#fff}@media (max-width:767px){.navbar-inverse .navbar-nav .open .dropdown-menu>.dropdown-header{border-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu .divider{background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a{color:#999}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:hover,.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:focus{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:hover,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:focus{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:hover,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:focus{color:#444;background-color:transparent}}.navbar-inverse .navbar-link{color:#999}.navbar-inverse .navbar-link:hover{color:#fff}.breadcrumb{padding:8px 15px;margin-bottom:20px;list-style:none;background-color:#f5f5f5;border-radius:4px}.breadcrumb>li{display:inline-block}.breadcrumb>li+li:before{content:"/\00a0";padding:0 5px;color:#ccc}.breadcrumb>.active{color:#999}.pagination{display:inline-block;padding-left:0;margin:20px 0;border-radius:4px}.pagination>li{display:inline}.pagination>li>a,.pagination>li>span{position:relative;float:left;padding:6px 12px;line-height:1.42857143;text-decoration:none;color:#428bca;background-color:#fff;border:1px solid #ddd;margin-left:-1px}.pagination>li:first-child>a,.pagination>li:first-child>span{margin-left:0;border-bottom-left-radius:4px;border-top-left-radius:4px}.pagination>li:last-child>a,.pagination>li:last-child>span{border-bottom-right-radius:4px;border-top-right-radius:4px}.pagination>li>a:hover,.pagination>li>span:hover,.pagination>li>a:focus,.pagination>li>span:focus{color:#2a6496;background-color:#eee;border-color:#ddd}.pagination>.active>a,.pagination>.active>span,.pagination>.active>a:hover,.pagination>.active>span:hover,.pagination>.active>a:focus,.pagination>.active>span:focus{z-index:2;color:#fff;background-color:#428bca;border-color:#428bca;cursor:default}.pagination>.disabled>span,.pagination>.disabled>span:hover,.pagination>.disabled>span:focus,.pagination>.disabled>a,.pagination>.disabled>a:hover,.pagination>.disabled>a:focus{color:#999;background-color:#fff;border-color:#ddd;cursor:not-allowed}.pagination-lg>li>a,.pagination-lg>li>span{padding:10px 16px;font-size:18px}.pagination-lg>li:first-child>a,.pagination-lg>li:first-child>span{border-bottom-left-radius:6px;border-top-left-radius:6px}.pagination-lg>li:last-child>a,.pagination-lg>li:last-child>span{border-bottom-right-radius:6px;border-top-right-radius:6px}.pagination-sm>li>a,.pagination-sm>li>span{padding:5px 10px;font-size:12px}.pagination-sm>li:first-child>a,.pagination-sm>li:first-child>span{border-bottom-left-radius:3px;border-top-left-radius:3px}.pagination-sm>li:last-child>a,.pagination-sm>li:last-child>span{border-bottom-right-radius:3px;border-top-right-radius:3px}.pager{padding-left:0;margin:20px 0;list-style:none;text-align:center}.pager li{display:inline}.pager li>a,.pager li>span{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;border-radius:15px}.pager li>a:hover,.pager li>a:focus{text-decoration:none;background-color:#eee}.pager .next>a,.pager .next>span{float:right}.pager .previous>a,.pager .previous>span{float:left}.pager .disabled>a,.pager .disabled>a:hover,.pager .disabled>a:focus,.pager .disabled>span{color:#999;background-color:#fff;cursor:not-allowed}.label{display:inline;padding:.2em .6em .3em;font-size:75%;font-weight:bold;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25em}.label[href]:hover,.label[href]:focus{color:#fff;text-decoration:none;cursor:pointer}.label:empty{display:none}.btn .label{position:relative;top:-1px}.label-default{background-color:#999}.label-default[href]:hover,.label-default[href]:focus{background-color:#808080}.label-primary{background-color:#428bca}.label-primary[href]:hover,.label-primary[href]:focus{background-color:#3071a9}.label-success{background-color:#5cb85c}.label-success[href]:hover,.label-success[href]:focus{background-color:#449d44}.label-info{background-color:#5bc0de}.label-info[href]:hover,.label-info[href]:focus{background-color:#31b0d5}.label-warning{background-color:#f0ad4e}.label-warning[href]:hover,.label-warning[href]:focus{background-color:#ec971f}.label-danger{background-color:#d9534f}.label-danger[href]:hover,.label-danger[href]:focus{background-color:#c9302c}.badge{display:inline-block;min-width:10px;padding:3px 7px;font-size:12px;font-weight:bold;color:#fff;line-height:1;vertical-align:baseline;white-space:nowrap;text-align:center;background-color:#999;border-radius:10px}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.btn-xs .badge{top:0;padding:1px 5px}a.badge:hover,a.badge:focus{color:#fff;text-decoration:none;cursor:pointer}a.list-group-item.active>.badge,.nav-pills>.active>a>.badge{color:#428bca;background-color:#fff}.nav-pills>li>a>.badge{margin-left:3px}.jumbotron{padding:30px;margin-bottom:30px;color:inherit;background-color:#eee}.jumbotron h1,.jumbotron .h1{color:inherit}.jumbotron p{margin-bottom:15px;font-size:21px;font-weight:200}.container .jumbotron{border-radius:6px}.jumbotron .container{max-width:100%}@media screen and (min-width:768px){.jumbotron{padding-top:48px;padding-bottom:48px}.container .jumbotron{padding-left:60px;padding-right:60px}.jumbotron h1,.jumbotron .h1{font-size:63px}}.thumbnail{display:block;padding:4px;margin-bottom:20px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.thumbnail>img,.thumbnail a>img{margin-left:auto;margin-right:auto}a.thumbnail:hover,a.thumbnail:focus,a.thumbnail.active{border-color:#428bca}.thumbnail .caption{padding:9px;color:#333}.alert{padding:15px;margin-bottom:20px;border:1px solid transparent;border-radius:4px}.alert h4{margin-top:0;color:inherit}.alert .alert-link{font-weight:bold}.alert>p,.alert>ul{margin-bottom:0}.alert>p+p{margin-top:5px}.alert-dismissable{padding-right:35px}.alert-dismissable .close{position:relative;top:-2px;right:-21px;color:inherit}.alert-success{background-color:#dff0d8;border-color:#d6e9c6;color:#3c763d}.alert-success hr{border-top-color:#c9e2b3}.alert-success .alert-link{color:#2b542c}.alert-info{background-color:#d9edf7;border-color:#bce8f1;color:#31708f}.alert-info hr{border-top-color:#a6e1ec}.alert-info .alert-link{color:#245269}.alert-warning{background-color:#fcf8e3;border-color:#faebcc;color:#8a6d3b}.alert-warning hr{border-top-color:#f7e1b5}.alert-warning .alert-link{color:#66512c}.alert-danger{background-color:#f2dede;border-color:#ebccd1;color:#a94442}.alert-danger hr{border-top-color:#e4b9c0}.alert-danger .alert-link{color:#843534}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{overflow:hidden;height:20px;margin-bottom:20px;background-color:#f5f5f5;border-radius:4px;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1);box-shadow:inset 0 1px 2px rgba(0,0,0,0.1)}.progress-bar{float:left;width:0%;height:100%;font-size:12px;line-height:20px;color:#fff;text-align:center;background-color:#428bca;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);-webkit-transition:width .6s ease;transition:width .6s ease}.progress-striped .progress-bar{background-image:-webkit-linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-size:40px 40px}.progress.active .progress-bar{-webkit-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-bar-success{background-color:#5cb85c}.progress-striped .progress-bar-success{background-image:-webkit-linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent)}.progress-bar-info{background-color:#5bc0de}.progress-striped .progress-bar-info{background-image:-webkit-linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent)}.progress-bar-warning{background-color:#f0ad4e}.progress-striped .progress-bar-warning{background-image:-webkit-linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent)}.progress-bar-danger{background-color:#d9534f}.progress-striped .progress-bar-danger{background-image:-webkit-linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent)}.media,.media-body{overflow:hidden;zoom:1}.media,.media .media{margin-top:15px}.media:first-child{margin-top:0}.media-object{display:block}.media-heading{margin:0 0 5px}.media>.pull-left{margin-right:10px}.media>.pull-right{margin-left:10px}.media-list{padding-left:0;list-style:none}.list-group{margin-bottom:20px;padding-left:0}.list-group-item{position:relative;display:block;padding:10px 15px;margin-bottom:-1px;background-color:#fff;border:1px solid #ddd}.list-group-item:first-child{border-top-right-radius:4px;border-top-left-radius:4px}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}.list-group-item>.badge{float:right}.list-group-item>.badge+.badge{margin-right:5px}a.list-group-item{color:#555}a.list-group-item .list-group-item-heading{color:#333}a.list-group-item:hover,a.list-group-item:focus{text-decoration:none;background-color:#f5f5f5}a.list-group-item.active,a.list-group-item.active:hover,a.list-group-item.active:focus{z-index:2;color:#fff;background-color:#428bca;border-color:#428bca}a.list-group-item.active .list-group-item-heading,a.list-group-item.active:hover .list-group-item-heading,a.list-group-item.active:focus .list-group-item-heading{color:inherit}a.list-group-item.active .list-group-item-text,a.list-group-item.active:hover .list-group-item-text,a.list-group-item.active:focus .list-group-item-text{color:#e1edf7}.list-group-item-success{color:#3c763d;background-color:#dff0d8}a.list-group-item-success{color:#3c763d}a.list-group-item-success .list-group-item-heading{color:inherit}a.list-group-item-success:hover,a.list-group-item-success:focus{color:#3c763d;background-color:#d0e9c6}a.list-group-item-success.active,a.list-group-item-success.active:hover,a.list-group-item-success.active:focus{color:#fff;background-color:#3c763d;border-color:#3c763d}.list-group-item-info{color:#31708f;background-color:#d9edf7}a.list-group-item-info{color:#31708f}a.list-group-item-info .list-group-item-heading{color:inherit}a.list-group-item-info:hover,a.list-group-item-info:focus{color:#31708f;background-color:#c4e3f3}a.list-group-item-info.active,a.list-group-item-info.active:hover,a.list-group-item-info.active:focus{color:#fff;background-color:#31708f;border-color:#31708f}.list-group-item-warning{color:#8a6d3b;background-color:#fcf8e3}a.list-group-item-warning{color:#8a6d3b}a.list-group-item-warning .list-group-item-heading{color:inherit}a.list-group-item-warning:hover,a.list-group-item-warning:focus{color:#8a6d3b;background-color:#faf2cc}a.list-group-item-warning.active,a.list-group-item-warning.active:hover,a.list-group-item-warning.active:focus{color:#fff;background-color:#8a6d3b;border-color:#8a6d3b}.list-group-item-danger{color:#a94442;background-color:#f2dede}a.list-group-item-danger{color:#a94442}a.list-group-item-danger .list-group-item-heading{color:inherit}a.list-group-item-danger:hover,a.list-group-item-danger:focus{color:#a94442;background-color:#ebcccc}a.list-group-item-danger.active,a.list-group-item-danger.active:hover,a.list-group-item-danger.active:focus{color:#fff;background-color:#a94442;border-color:#a94442}.list-group-item-heading{margin-top:0;margin-bottom:5px}.list-group-item-text{margin-bottom:0;line-height:1.3}.panel{margin-bottom:20px;background-color:#fff;border:1px solid transparent;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0,0,0,0.05);box-shadow:0 1px 1px rgba(0,0,0,0.05)}.panel-body{padding:15px}.panel-heading{padding:10px 15px;border-bottom:1px solid transparent;border-top-right-radius:3px;border-top-left-radius:3px}.panel-heading>.dropdown .dropdown-toggle{color:inherit}.panel-title{margin-top:0;margin-bottom:0;font-size:16px;color:inherit}.panel-title>a{color:inherit}.panel-footer{padding:10px 15px;background-color:#f5f5f5;border-top:1px solid #ddd;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.list-group{margin-bottom:0}.panel>.list-group .list-group-item{border-width:1px 0;border-radius:0}.panel>.list-group:first-child .list-group-item:first-child{border-top:0;border-top-right-radius:3px;border-top-left-radius:3px}.panel>.list-group:last-child .list-group-item:last-child{border-bottom:0;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel-heading+.list-group .list-group-item:first-child{border-top-width:0}.panel>.table,.panel>.table-responsive>.table{margin-bottom:0}.panel>.table:first-child,.panel>.table-responsive:first-child>.table:first-child{border-top-right-radius:3px;border-top-left-radius:3px}.panel>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table:first-child>thead:first-child>tr:first-child th:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:first-child{border-top-left-radius:3px}.panel>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table:first-child>thead:first-child>tr:first-child th:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:last-child{border-top-right-radius:3px}.panel>.table:last-child,.panel>.table-responsive:last-child>.table:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:first-child{border-bottom-left-radius:3px}.panel>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:last-child{border-bottom-right-radius:3px}.panel>.panel-body+.table,.panel>.panel-body+.table-responsive{border-top:1px solid #ddd}.panel>.table>tbody:first-child>tr:first-child th,.panel>.table>tbody:first-child>tr:first-child td{border-top:0}.panel>.table-bordered,.panel>.table-responsive>.table-bordered{border:0}.panel>.table-bordered>thead>tr>th:first-child,.panel>.table-responsive>.table-bordered>thead>tr>th:first-child,.panel>.table-bordered>tbody>tr>th:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:first-child,.panel>.table-bordered>tfoot>tr>th:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:first-child,.panel>.table-bordered>thead>tr>td:first-child,.panel>.table-responsive>.table-bordered>thead>tr>td:first-child,.panel>.table-bordered>tbody>tr>td:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:first-child,.panel>.table-bordered>tfoot>tr>td:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:first-child{border-left:0}.panel>.table-bordered>thead>tr>th:last-child,.panel>.table-responsive>.table-bordered>thead>tr>th:last-child,.panel>.table-bordered>tbody>tr>th:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:last-child,.panel>.table-bordered>tfoot>tr>th:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:last-child,.panel>.table-bordered>thead>tr>td:last-child,.panel>.table-responsive>.table-bordered>thead>tr>td:last-child,.panel>.table-bordered>tbody>tr>td:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:last-child,.panel>.table-bordered>tfoot>tr>td:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:last-child{border-right:0}.panel>.table-bordered>thead>tr:first-child>td,.panel>.table-responsive>.table-bordered>thead>tr:first-child>td,.panel>.table-bordered>tbody>tr:first-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>td,.panel>.table-bordered>thead>tr:first-child>th,.panel>.table-responsive>.table-bordered>thead>tr:first-child>th,.panel>.table-bordered>tbody>tr:first-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>th{border-bottom:0}.panel>.table-bordered>tbody>tr:last-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>td,.panel>.table-bordered>tfoot>tr:last-child>td,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>td,.panel>.table-bordered>tbody>tr:last-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>th,.panel>.table-bordered>tfoot>tr:last-child>th,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}.panel>.table-responsive{border:0;margin-bottom:0}.panel-group{margin-bottom:20px}.panel-group .panel{margin-bottom:0;border-radius:4px;overflow:hidden}.panel-group .panel+.panel{margin-top:5px}.panel-group .panel-heading{border-bottom:0}.panel-group .panel-heading+.panel-collapse .panel-body{border-top:1px solid #ddd}.panel-group .panel-footer{border-top:0}.panel-group .panel-footer+.panel-collapse .panel-body{border-bottom:1px solid #ddd}.panel-default{border-color:#ddd}.panel-default>.panel-heading{color:#333;background-color:#f5f5f5;border-color:#ddd}.panel-default>.panel-heading+.panel-collapse .panel-body{border-top-color:#ddd}.panel-default>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#ddd}.panel-primary{border-color:#428bca}.panel-primary>.panel-heading{color:#fff;background-color:#428bca;border-color:#428bca}.panel-primary>.panel-heading+.panel-collapse .panel-body{border-top-color:#428bca}.panel-primary>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#428bca}.panel-success{border-color:#d6e9c6}.panel-success>.panel-heading{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.panel-success>.panel-heading+.panel-collapse .panel-body{border-top-color:#d6e9c6}.panel-success>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#d6e9c6}.panel-info{border-color:#bce8f1}.panel-info>.panel-heading{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.panel-info>.panel-heading+.panel-collapse .panel-body{border-top-color:#bce8f1}.panel-info>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#bce8f1}.panel-warning{border-color:#faebcc}.panel-warning>.panel-heading{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.panel-warning>.panel-heading+.panel-collapse .panel-body{border-top-color:#faebcc}.panel-warning>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#faebcc}.panel-danger{border-color:#ebccd1}.panel-danger>.panel-heading{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.panel-danger>.panel-heading+.panel-collapse .panel-body{border-top-color:#ebccd1}.panel-danger>.panel-footer+.panel-collapse .panel-body{border-bottom-color:#ebccd1}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #e3e3e3;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.05);box-shadow:inset 0 1px 1px rgba(0,0,0,0.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,0.15)}.well-lg{padding:24px;border-radius:6px}.well-sm{padding:9px;border-radius:3px}.close{float:right;font-size:21px;font-weight:bold;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.2;filter:alpha(opacity=20)}.close:hover,.close:focus{color:#000;text-decoration:none;cursor:pointer;opacity:.5;filter:alpha(opacity=50)}button.close{padding:0;cursor:pointer;background:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{display:none;overflow:auto;overflow-y:scroll;position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;-webkit-overflow-scrolling:touch;outline:0}.modal.fade .modal-dialog{-webkit-transform:translate(0, -25%);-ms-transform:translate(0, -25%);transform:translate(0, -25%);-webkit-transition:-webkit-transform 0.3s ease-out;-moz-transition:-moz-transform 0.3s ease-out;-o-transition:-o-transform 0.3s ease-out;transition:transform 0.3s ease-out}.modal.in .modal-dialog{-webkit-transform:translate(0, 0);-ms-transform:translate(0, 0);transform:translate(0, 0)}.modal-dialog{position:relative;width:auto;margin:10px}.modal-content{position:relative;background-color:#fff;border:1px solid #999;border:1px solid rgba(0,0,0,0.2);border-radius:6px;-webkit-box-shadow:0 3px 9px rgba(0,0,0,0.5);box-shadow:0 3px 9px rgba(0,0,0,0.5);background-clip:padding-box;outline:none}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0;filter:alpha(opacity=0)}.modal-backdrop.in{opacity:.5;filter:alpha(opacity=50)}.modal-header{padding:15px;border-bottom:1px solid #e5e5e5;min-height:16.42857143px}.modal-header .close{margin-top:-2px}.modal-title{margin:0;line-height:1.42857143}.modal-body{position:relative;padding:20px}.modal-footer{margin-top:15px;padding:19px 20px 20px;text-align:right;border-top:1px solid #e5e5e5}.modal-footer .btn+.btn{margin-left:5px;margin-bottom:0}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.modal-footer .btn-block+.btn-block{margin-left:0}@media (min-width:768px){.modal-dialog{width:600px;margin:30px auto}.modal-content{-webkit-box-shadow:0 5px 15px rgba(0,0,0,0.5);box-shadow:0 5px 15px rgba(0,0,0,0.5)}.modal-sm{width:300px}}@media (min-width:992px){.modal-lg{width:900px}}.tooltip{position:absolute;z-index:1030;display:block;visibility:visible;font-size:12px;line-height:1.4;opacity:0;filter:alpha(opacity=0)}.tooltip.in{opacity:.9;filter:alpha(opacity=90)}.tooltip.top{margin-top:-3px;padding:5px 0}.tooltip.right{margin-left:3px;padding:0 5px}.tooltip.bottom{margin-top:3px;padding:5px 0}.tooltip.left{margin-left:-3px;padding:0 5px}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;text-decoration:none;background-color:#000;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0;border-color:transparent;border-style:solid}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-left .tooltip-arrow{bottom:0;left:5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-right .tooltip-arrow{bottom:0;right:5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-width:5px 5px 5px 0;border-right-color:#000}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-width:5px 0 5px 5px;border-left-color:#000}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-left .tooltip-arrow{top:0;left:5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-right .tooltip-arrow{top:0;right:5px;border-width:0 5px 5px;border-bottom-color:#000}.popover{position:absolute;top:0;left:0;z-index:1010;display:none;max-width:276px;padding:1px;text-align:left;background-color:#fff;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);white-space:normal}.popover.top{margin-top:-10px}.popover.right{margin-left:10px}.popover.bottom{margin-top:10px}.popover.left{margin-left:-10px}.popover-title{margin:0;padding:8px 14px;font-size:14px;font-weight:normal;line-height:18px;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-radius:5px 5px 0 0}.popover-content{padding:9px 14px}.popover>.arrow,.popover>.arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.popover>.arrow{border-width:11px}.popover>.arrow:after{border-width:10px;content:""}.popover.top>.arrow{left:50%;margin-left:-11px;border-bottom-width:0;border-top-color:#999;border-top-color:rgba(0,0,0,0.25);bottom:-11px}.popover.top>.arrow:after{content:" ";bottom:1px;margin-left:-10px;border-bottom-width:0;border-top-color:#fff}.popover.right>.arrow{top:50%;left:-11px;margin-top:-11px;border-left-width:0;border-right-color:#999;border-right-color:rgba(0,0,0,0.25)}.popover.right>.arrow:after{content:" ";left:1px;bottom:-10px;border-left-width:0;border-right-color:#fff}.popover.bottom>.arrow{left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#999;border-bottom-color:rgba(0,0,0,0.25);top:-11px}.popover.bottom>.arrow:after{content:" ";top:1px;margin-left:-10px;border-top-width:0;border-bottom-color:#fff}.popover.left>.arrow{top:50%;right:-11px;margin-top:-11px;border-right-width:0;border-left-color:#999;border-left-color:rgba(0,0,0,0.25)}.popover.left>.arrow:after{content:" ";right:1px;border-right-width:0;border-left-color:#fff;bottom:-10px}.carousel{position:relative}.carousel-inner{position:relative;overflow:hidden;width:100%}.carousel-inner>.item{display:none;position:relative;-webkit-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel-inner>.item>img,.carousel-inner>.item>a>img{line-height:1}.carousel-inner>.active,.carousel-inner>.next,.carousel-inner>.prev{display:block}.carousel-inner>.active{left:0}.carousel-inner>.next,.carousel-inner>.prev{position:absolute;top:0;width:100%}.carousel-inner>.next{left:100%}.carousel-inner>.prev{left:-100%}.carousel-inner>.next.left,.carousel-inner>.prev.right{left:0}.carousel-inner>.active.left{left:-100%}.carousel-inner>.active.right{left:100%}.carousel-control{position:absolute;top:0;left:0;bottom:0;width:15%;opacity:.5;filter:alpha(opacity=50);font-size:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,0.6)}.carousel-control.left{background-image:-webkit-linear-gradient(left, color-stop(rgba(0,0,0,0.5) 0), color-stop(rgba(0,0,0,0.0001) 100%));background-image:linear-gradient(to right, rgba(0,0,0,0.5) 0, rgba(0,0,0,0.0001) 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1)}.carousel-control.right{left:auto;right:0;background-image:-webkit-linear-gradient(left, color-stop(rgba(0,0,0,0.0001) 0), color-stop(rgba(0,0,0,0.5) 100%));background-image:linear-gradient(to right, rgba(0,0,0,0.0001) 0, rgba(0,0,0,0.5) 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1)}.carousel-control:hover,.carousel-control:focus{outline:none;color:#fff;text-decoration:none;opacity:.9;filter:alpha(opacity=90)}.carousel-control .icon-prev,.carousel-control .icon-next,.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right{position:absolute;top:50%;z-index:5;display:inline-block}.carousel-control .icon-prev,.carousel-control .glyphicon-chevron-left{left:50%}.carousel-control .icon-next,.carousel-control .glyphicon-chevron-right{right:50%}.carousel-control .icon-prev,.carousel-control .icon-next{width:20px;height:20px;margin-top:-10px;margin-left:-10px;font-family:serif}.carousel-control .icon-prev:before{content:'\2039'}.carousel-control .icon-next:before{content:'\203a'}.carousel-indicators{position:absolute;bottom:10px;left:50%;z-index:15;width:60%;margin-left:-30%;padding-left:0;list-style:none;text-align:center}.carousel-indicators li{display:inline-block;width:10px;height:10px;margin:1px;text-indent:-999px;border:1px solid #fff;border-radius:10px;cursor:pointer;background-color:#000 \9;background-color:rgba(0,0,0,0)}.carousel-indicators .active{margin:0;width:12px;height:12px;background-color:#fff}.carousel-caption{position:absolute;left:15%;right:15%;bottom:20px;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,0.6)}.carousel-caption .btn{text-shadow:none}@media screen and (min-width:768px){.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-prev,.carousel-control .icon-next{width:30px;height:30px;margin-top:-15px;margin-left:-15px;font-size:30px}.carousel-caption{left:20%;right:20%;padding-bottom:30px}.carousel-indicators{bottom:20px}}.clearfix:before,.clearfix:after,.container:before,.container:after,.container-fluid:before,.container-fluid:after,.row:before,.row:after,.form-horizontal .form-group:before,.form-horizontal .form-group:after,.btn-toolbar:before,.btn-toolbar:after,.btn-group-vertical>.btn-group:before,.btn-group-vertical>.btn-group:after,.nav:before,.nav:after,.navbar:before,.navbar:after,.navbar-header:before,.navbar-header:after,.navbar-collapse:before,.navbar-collapse:after,.pager:before,.pager:after,.panel-body:before,.panel-body:after,.modal-footer:before,.modal-footer:after{content:" ";display:table}.clearfix:after,.container:after,.container-fluid:after,.row:after,.form-horizontal .form-group:after,.btn-toolbar:after,.btn-group-vertical>.btn-group:after,.nav:after,.navbar:after,.navbar-header:after,.navbar-collapse:after,.pager:after,.panel-body:after,.modal-footer:after{clear:both}.center-block{display:block;margin-left:auto;margin-right:auto}.pull-right{float:right !important}.pull-left{float:left !important}.hide{display:none !important}.show{display:block !important}.invisible{visibility:hidden}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.hidden{display:none !important;visibility:hidden !important}.affix{position:fixed}@-ms-viewport{width:device-width}.visible-xs,.visible-sm,.visible-md,.visible-lg{display:none !important}@media (max-width:767px){.visible-xs{display:block !important}table.visible-xs{display:table}tr.visible-xs{display:table-row !important}th.visible-xs,td.visible-xs{display:table-cell !important}}@media (min-width:768px) and (max-width:991px){.visible-sm{display:block !important}table.visible-sm{display:table}tr.visible-sm{display:table-row !important}th.visible-sm,td.visible-sm{display:table-cell !important}}@media (min-width:992px) and (max-width:1199px){.visible-md{display:block !important}table.visible-md{display:table}tr.visible-md{display:table-row !important}th.visible-md,td.visible-md{display:table-cell !important}}@media (min-width:1200px){.visible-lg{display:block !important}table.visible-lg{display:table}tr.visible-lg{display:table-row !important}th.visible-lg,td.visible-lg{display:table-cell !important}}@media (max-width:767px){.hidden-xs{display:none !important}}@media (min-width:768px) and (max-width:991px){.hidden-sm{display:none !important}}@media (min-width:992px) and (max-width:1199px){.hidden-md{display:none !important}}@media (min-width:1200px){.hidden-lg{display:none !important}}.visible-print{display:none !important}@media print{.visible-print{display:block !important}table.visible-print{display:table}tr.visible-print{display:table-row !important}th.visible-print,td.visible-print{display:table-cell !important}}@media print{.hidden-print{display:none !important}}

assets/bootstrap/fonts/glyphicons-halflings-regular.eot ADDED Viewed

Binary file

assets/bootstrap/fonts/glyphicons-halflings-regular.svg ADDED Viewed

	@@ -0,0 +1,229 @@


1	+ <?xml version="1.0" standalone="no"?>
2	+ <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
3	+ <svg xmlns="http://www.w3.org/2000/svg">
4	+ <metadata></metadata>
5	+ <defs>
6	+ <font id="glyphicons_halflingsregular" horiz-adv-x="1200" >
7	+ <font-face units-per-em="1200" ascent="960" descent="-240" />
8	+ <missing-glyph horiz-adv-x="500" />
9	+ <glyph />
10	+ <glyph />
11	+ <glyph unicode=" " />
12	+ <glyph unicode=" " />
13	+ <glyph unicode="*" d="M100 500v200h259l-183 183l141 141l183 -183v259h200v-259l183 183l141 -141l-183 -183h259v-200h-259l183 -183l-141 -141l-183 183v-259h-200v259l-183 -183l-141 141l183 183h-259z" />
14	+ <glyph unicode="+" d="M0 400v300h400v400h300v-400h400v-300h-400v-400h-300v400h-400z" />
15	+ <glyph unicode=" " />
16	+ <glyph unicode=" " horiz-adv-x="652" />
17	+ <glyph unicode=" " horiz-adv-x="1304" />
18	+ <glyph unicode=" " horiz-adv-x="652" />
19	+ <glyph unicode=" " horiz-adv-x="1304" />
20	+ <glyph unicode=" " horiz-adv-x="434" />
21	+ <glyph unicode=" " horiz-adv-x="326" />
22	+ <glyph unicode=" " horiz-adv-x="217" />
23	+ <glyph unicode=" " horiz-adv-x="217" />
24	+ <glyph unicode=" " horiz-adv-x="163" />
25	+ <glyph unicode=" " horiz-adv-x="260" />
26	+ <glyph unicode=" " horiz-adv-x="72" />
27	+ <glyph unicode=" " horiz-adv-x="260" />
28	+ <glyph unicode=" " horiz-adv-x="326" />
29	+ <glyph unicode="€" d="M100 500l100 100h113q0 47 5 100h-218l100 100h135q37 167 112 257q117 141 297 141q242 0 354 -189q60 -103 66 -209h-181q0 55 -25.5 99t-63.5 68t-75 36.5t-67 12.5q-24 0 -52.5 -10t-62.5 -32t-65.5 -67t-50.5 -107h379l-100 -100h-300q-6 -46 -6 -100h406l-100 -100 h-300q9 -74 33 -132t52.5 -91t62 -54.5t59 -29t46.5 -7.5q29 0 66 13t75 37t63.5 67.5t25.5 96.5h174q-31 -172 -128 -278q-107 -117 -274 -117q-205 0 -324 158q-36 46 -69 131.5t-45 205.5h-217z" />
30	+ <glyph unicode="−" d="M200 400h900v300h-900v-300z" />
31	+ <glyph unicode="◼" horiz-adv-x="500" d="M0 0z" />
32	+ <glyph unicode="☁" d="M-14 494q0 -80 56.5 -137t135.5 -57h750q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5z" />
33	+ <glyph unicode="✉" d="M0 100l400 400l200 -200l200 200l400 -400h-1200zM0 300v600l300 -300zM0 1100l600 -603l600 603h-1200zM900 600l300 300v-600z" />
34	+ <glyph unicode="✏" d="M-13 -13l333 112l-223 223zM187 403l214 -214l614 614l-214 214zM887 1103l214 -214l99 92q13 13 13 32.5t-13 33.5l-153 153q-15 13 -33 13t-33 -13z" />
35	+ <glyph unicode="" d="M0 1200h1200l-500 -550v-550h300v-100h-800v100h300v550z" />
36	+ <glyph unicode="" d="M14 84q18 -55 86 -75.5t147 5.5q65 21 109 69t44 90v606l600 155v-521q-64 16 -138 -7q-79 -26 -122.5 -83t-25.5 -111q18 -55 86 -75.5t147 4.5q70 23 111.5 63.5t41.5 95.5v881q0 10 -7 15.5t-17 2.5l-752 -193q-10 -3 -17 -12.5t-7 -19.5v-689q-64 17 -138 -7 q-79 -25 -122.5 -82t-25.5 -112z" />
37	+ <glyph unicode="" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233z" />
38	+ <glyph unicode="" d="M100 784q0 64 28 123t73 100.5t104.5 64t119 20.5t120 -38.5t104.5 -104.5q48 69 109.5 105t121.5 38t118.5 -20.5t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-149.5 152.5t-126.5 127.5 t-94 124.5t-33.5 117.5z" />
39	+ <glyph unicode="" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1z" />
40	+ <glyph unicode="" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1zM237 700l196 -142l-73 -226l192 140l195 -141l-74 229l193 140h-235l-77 211l-78 -211h-239z" />
41	+ <glyph unicode="" d="M0 0v143l400 257v100q-37 0 -68.5 74.5t-31.5 125.5v200q0 124 88 212t212 88t212 -88t88 -212v-200q0 -51 -31.5 -125.5t-68.5 -74.5v-100l400 -257v-143h-1200z" />
42	+ <glyph unicode="" d="M0 0v1100h1200v-1100h-1200zM100 100h100v100h-100v-100zM100 300h100v100h-100v-100zM100 500h100v100h-100v-100zM100 700h100v100h-100v-100zM100 900h100v100h-100v-100zM300 100h600v400h-600v-400zM300 600h600v400h-600v-400zM1000 100h100v100h-100v-100z M1000 300h100v100h-100v-100zM1000 500h100v100h-100v-100zM1000 700h100v100h-100v-100zM1000 900h100v100h-100v-100z" />
43	+ <glyph unicode="" d="M0 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM0 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5zM600 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM600 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5z" />
44	+ <glyph unicode="" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200 q-21 0 -35.5 14.5t-14.5 35.5zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 450v200q0 21 14.5 35.5t35.5 14.5h200 q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5z" />
45	+ <glyph unicode="" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v200q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5 t-14.5 -35.5v-200zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5z" />
46	+ <glyph unicode="" d="M29 454l419 -420l818 820l-212 212l-607 -607l-206 207z" />
47	+ <glyph unicode="" d="M106 318l282 282l-282 282l212 212l282 -282l282 282l212 -212l-282 -282l282 -282l-212 -212l-282 282l-282 -282z" />
48	+ <glyph unicode="" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233zM300 600v200h100v100h200v-100h100v-200h-100v-100h-200v100h-100z" />
49	+ <glyph unicode="" d="M23 694q0 200 142 342t342 142t342 -142t142 -342q0 -141 -78 -262l300 -299q7 -7 7 -18t-7 -18l-109 -109q-8 -8 -18 -8t-18 8l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 694q0 -136 97 -233t234 -97t233.5 97t96.5 233t-96.5 233t-233.5 97t-234 -97 t-97 -233zM300 601h400v200h-400v-200z" />
50	+ <glyph unicode="" d="M23 600q0 183 105 331t272 210v-166q-103 -55 -165 -155t-62 -220q0 -177 125 -302t302 -125t302 125t125 302q0 120 -62 220t-165 155v166q167 -62 272 -210t105 -331q0 -118 -45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5 zM500 750q0 -21 14.5 -35.5t35.5 -14.5h100q21 0 35.5 14.5t14.5 35.5v400q0 21 -14.5 35.5t-35.5 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-400z" />
51	+ <glyph unicode="" d="M100 1h200v300h-200v-300zM400 1v500h200v-500h-200zM700 1v800h200v-800h-200zM1000 1v1200h200v-1200h-200z" />
52	+ <glyph unicode="" d="M26 601q0 -33 6 -74l151 -38l2 -6q14 -49 38 -93l3 -5l-80 -134q45 -59 105 -105l133 81l5 -3q45 -26 94 -39l5 -2l38 -151q40 -5 74 -5q27 0 74 5l38 151l6 2q46 13 93 39l5 3l134 -81q56 44 104 105l-80 134l3 5q24 44 39 93l1 6l152 38q5 40 5 74q0 28 -5 73l-152 38 l-1 6q-16 51 -39 93l-3 5l80 134q-44 58 -104 105l-134 -81l-5 3q-45 25 -93 39l-6 1l-38 152q-40 5 -74 5q-27 0 -74 -5l-38 -152l-5 -1q-50 -14 -94 -39l-5 -3l-133 81q-59 -47 -105 -105l80 -134l-3 -5q-25 -47 -38 -93l-2 -6l-151 -38q-6 -48 -6 -73zM385 601 q0 88 63 151t152 63t152 -63t63 -151q0 -89 -63 -152t-152 -63t-152 63t-63 152z" />
53	+ <glyph unicode="" d="M100 1025v50q0 10 7.5 17.5t17.5 7.5h275v100q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5v-100h275q10 0 17.5 -7.5t7.5 -17.5v-50q0 -11 -7 -18t-18 -7h-1050q-11 0 -18 7t-7 18zM200 100v800h900v-800q0 -41 -29.5 -71t-70.5 -30h-700q-41 0 -70.5 30 t-29.5 71zM300 100h100v700h-100v-700zM500 100h100v700h-100v-700zM500 1100h300v100h-300v-100zM700 100h100v700h-100v-700zM900 100h100v700h-100v-700z" />
54	+ <glyph unicode="" d="M1 601l656 644l644 -644h-200v-600h-300v400h-300v-400h-300v600h-200z" />
55	+ <glyph unicode="" d="M100 25v1150q0 11 7 18t18 7h475v-500h400v-675q0 -11 -7 -18t-18 -7h-850q-11 0 -18 7t-7 18zM700 800v300l300 -300h-300z" />
56	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 500v400h100 v-300h200v-100h-300z" />
57	+ <glyph unicode="" d="M-100 0l431 1200h209l-21 -300h162l-20 300h208l431 -1200h-538l-41 400h-242l-40 -400h-539zM488 500h224l-27 300h-170z" />
58	+ <glyph unicode="" d="M0 0v400h490l-290 300h200v500h300v-500h200l-290 -300h490v-400h-1100zM813 200h175v100h-175v-100z" />
59	+ <glyph unicode="" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM188 600q0 -170 121 -291t291 -121t291 121t121 291t-121 291t-291 121 t-291 -121t-121 -291zM350 600h150v300h200v-300h150l-250 -300z" />
60	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM350 600l250 300 l250 -300h-150v-300h-200v300h-150z" />
61	+ <glyph unicode="" d="M0 25v475l200 700h800l199 -700l1 -475q0 -11 -7 -18t-18 -7h-1150q-11 0 -18 7t-7 18zM200 500h200l50 -200h300l50 200h200l-97 500h-606z" />
62	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 397v401 l297 -200z" />
63	+ <glyph unicode="" d="M23 600q0 -118 45.5 -224.5t123 -184t184 -123t224.5 -45.5t224.5 45.5t184 123t123 184t45.5 224.5h-150q0 -177 -125 -302t-302 -125t-302 125t-125 302t125 302t302 125q136 0 246 -81l-146 -146h400v400l-145 -145q-157 122 -355 122q-118 0 -224.5 -45.5t-184 -123 t-123 -184t-45.5 -224.5z" />
64	+ <glyph unicode="" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5q198 0 355 -122l145 145v-400h-400l147 147q-112 80 -247 80q-177 0 -302 -125t-125 -302h-150zM100 0v400h400l-147 -147q112 -80 247 -80q177 0 302 125t125 302h150q0 -118 -45.5 -224.5t-123 -184t-184 -123 t-224.5 -45.5q-198 0 -355 122z" />
65	+ <glyph unicode="" d="M100 0h1100v1200h-1100v-1200zM200 100v900h900v-900h-900zM300 200v100h100v-100h-100zM300 400v100h100v-100h-100zM300 600v100h100v-100h-100zM300 800v100h100v-100h-100zM500 200h500v100h-500v-100zM500 400v100h500v-100h-500zM500 600v100h500v-100h-500z M500 800v100h500v-100h-500z" />
66	+ <glyph unicode="" d="M0 100v600q0 41 29.5 70.5t70.5 29.5h100v200q0 82 59 141t141 59h300q82 0 141 -59t59 -141v-200h100q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-900q-41 0 -70.5 29.5t-29.5 70.5zM400 800h300v150q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-150z" />
67	+ <glyph unicode="" d="M100 0v1100h100v-1100h-100zM300 400q60 60 127.5 84t127.5 17.5t122 -23t119 -30t110 -11t103 42t91 120.5v500q-40 -81 -101.5 -115.5t-127.5 -29.5t-138 25t-139.5 40t-125.5 25t-103 -29.5t-65 -115.5v-500z" />
68	+ <glyph unicode="" d="M0 275q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 127 70.5 231.5t184.5 161.5t245 57t245 -57t184.5 -161.5t70.5 -231.5v-300q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 116 -49.5 227t-131 192.5t-192.5 131t-227 49.5t-227 -49.5t-192.5 -131t-131 -192.5 t-49.5 -227v-300zM200 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14zM800 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14z" />
69	+ <glyph unicode="" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM688 459l141 141l-141 141l71 71l141 -141l141 141l71 -71l-141 -141l141 -141l-71 -71l-141 141l-141 -141z" />
70	+ <glyph unicode="" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM700 857l69 53q111 -135 111 -310q0 -169 -106 -302l-67 54q86 110 86 248q0 146 -93 257z" />
71	+ <glyph unicode="" d="M0 401v400h300l300 200v-800l-300 200h-300zM702 858l69 53q111 -135 111 -310q0 -170 -106 -303l-67 55q86 110 86 248q0 145 -93 257zM889 951l7 -8q123 -151 123 -344q0 -189 -119 -339l-7 -8l81 -66l6 8q142 178 142 405q0 230 -144 408l-6 8z" />
72	+ <glyph unicode="" d="M0 0h500v500h-200v100h-100v-100h-200v-500zM0 600h100v100h400v100h100v100h-100v300h-500v-600zM100 100v300h300v-300h-300zM100 800v300h300v-300h-300zM200 200v100h100v-100h-100zM200 900h100v100h-100v-100zM500 500v100h300v-300h200v-100h-100v-100h-200v100 h-100v100h100v200h-200zM600 0v100h100v-100h-100zM600 1000h100v-300h200v-300h300v200h-200v100h200v500h-600v-200zM800 800v300h300v-300h-300zM900 0v100h300v-100h-300zM900 900v100h100v-100h-100zM1100 200v100h100v-100h-100z" />
73	+ <glyph unicode="" d="M0 200h100v1000h-100v-1000zM100 0v100h300v-100h-300zM200 200v1000h100v-1000h-100zM500 0v91h100v-91h-100zM500 200v1000h200v-1000h-200zM700 0v91h100v-91h-100zM800 200v1000h100v-1000h-100zM900 0v91h200v-91h-200zM1000 200v1000h200v-1000h-200z" />
74	+ <glyph unicode="" d="M0 700l1 475q0 10 7.5 17.5t17.5 7.5h474l700 -700l-500 -500zM148 953q0 -42 29 -71q30 -30 71.5 -30t71.5 30q29 29 29 71t-29 71q-30 30 -71.5 30t-71.5 -30q-29 -29 -29 -71z" />
75	+ <glyph unicode="" d="M1 700l1 475q0 11 7 18t18 7h474l700 -700l-500 -500zM148 953q0 -42 30 -71q29 -30 71 -30t71 30q30 29 30 71t-30 71q-29 30 -71 30t-71 -30q-30 -29 -30 -71zM701 1200h100l700 -700l-500 -500l-50 50l450 450z" />
76	+ <glyph unicode="" d="M100 0v1025l175 175h925v-1000l-100 -100v1000h-750l-100 -100h750v-1000h-900z" />
77	+ <glyph unicode="" d="M200 0l450 444l450 -443v1150q0 20 -14.5 35t-35.5 15h-800q-21 0 -35.5 -15t-14.5 -35v-1151z" />
78	+ <glyph unicode="" d="M0 100v700h200l100 -200h600l100 200h200v-700h-200v200h-800v-200h-200zM253 829l40 -124h592l62 124l-94 346q-2 11 -10 18t-18 7h-450q-10 0 -18 -7t-10 -18zM281 24l38 152q2 10 11.5 17t19.5 7h500q10 0 19.5 -7t11.5 -17l38 -152q2 -10 -3.5 -17t-15.5 -7h-600 q-10 0 -15.5 7t-3.5 17z" />
79	+ <glyph unicode="" d="M0 200q0 -41 29.5 -70.5t70.5 -29.5h1000q41 0 70.5 29.5t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5h-150q-4 8 -11.5 21.5t-33 48t-53 61t-69 48t-83.5 21.5h-200q-41 0 -82 -20.5t-70 -50t-52 -59t-34 -50.5l-12 -20h-150q-41 0 -70.5 -29.5t-29.5 -70.5v-600z M356 500q0 100 72 172t172 72t172 -72t72 -172t-72 -172t-172 -72t-172 72t-72 172zM494 500q0 -44 31 -75t75 -31t75 31t31 75t-31 75t-75 31t-75 -31t-31 -75zM900 700v100h100v-100h-100z" />
80	+ <glyph unicode="" d="M53 0h365v66q-41 0 -72 11t-49 38t1 71l92 234h391l82 -222q16 -45 -5.5 -88.5t-74.5 -43.5v-66h417v66q-34 1 -74 43q-18 19 -33 42t-21 37l-6 13l-385 998h-93l-399 -1006q-24 -48 -52 -75q-12 -12 -33 -25t-36 -20l-15 -7v-66zM416 521l178 457l46 -140l116 -317h-340 z" />
81	+ <glyph unicode="" d="M100 0v89q41 7 70.5 32.5t29.5 65.5v827q0 28 -1 39.5t-5.5 26t-15.5 21t-29 14t-49 14.5v71l471 -1q120 0 213 -88t93 -228q0 -55 -11.5 -101.5t-28 -74t-33.5 -47.5t-28 -28l-12 -7q8 -3 21.5 -9t48 -31.5t60.5 -58t47.5 -91.5t21.5 -129q0 -84 -59 -156.5t-142 -111 t-162 -38.5h-500zM400 200h161q89 0 153 48.5t64 132.5q0 90 -62.5 154.5t-156.5 64.5h-159v-400zM400 700h139q76 0 130 61.5t54 138.5q0 82 -84 130.5t-239 48.5v-379z" />
82	+ <glyph unicode="" d="M200 0v57q77 7 134.5 40.5t65.5 80.5l173 849q10 56 -10 74t-91 37q-6 1 -10.5 2.5t-9.5 2.5v57h425l2 -57q-33 -8 -62 -25.5t-46 -37t-29.5 -38t-17.5 -30.5l-5 -12l-128 -825q-10 -52 14 -82t95 -36v-57h-500z" />
83	+ <glyph unicode="" d="M-75 200h75v800h-75l125 167l125 -167h-75v-800h75l-125 -167zM300 900v300h150h700h150v-300h-50q0 29 -8 48.5t-18.5 30t-33.5 15t-39.5 5.5t-50.5 1h-200v-850l100 -50v-100h-400v100l100 50v850h-200q-34 0 -50.5 -1t-40 -5.5t-33.5 -15t-18.5 -30t-8.5 -48.5h-49z " />
84	+ <glyph unicode="" d="M33 51l167 125v-75h800v75l167 -125l-167 -125v75h-800v-75zM100 901v300h150h700h150v-300h-50q0 29 -8 48.5t-18 30t-33.5 15t-40 5.5t-50.5 1h-200v-650l100 -50v-100h-400v100l100 50v650h-200q-34 0 -50.5 -1t-39.5 -5.5t-33.5 -15t-18.5 -30t-8 -48.5h-50z" />
85	+ <glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 350q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM0 650q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1000q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 950q0 -20 14.5 -35t35.5 -15h600q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-600q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
86	+ <glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 650q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM200 350q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM200 950q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
87	+ <glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM100 650v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1000q-21 0 -35.5 15 t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM500 950v100q0 21 14.5 35.5t35.5 14.5h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-600 q-21 0 -35.5 15t-14.5 35z" />
88	+ <glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100 q-21 0 -35.5 15t-14.5 35z" />
89	+ <glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM300 50v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800 q-21 0 -35.5 15t-14.5 35zM300 650v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 950v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15 h-800q-21 0 -35.5 15t-14.5 35z" />
90	+ <glyph unicode="" d="M-101 500v100h201v75l166 -125l-166 -125v75h-201zM300 0h100v1100h-100v-1100zM500 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35 v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 650q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100 q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100z" />
91	+ <glyph unicode="" d="M1 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 650 q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM801 0v1100h100v-1100 h-100zM934 550l167 -125v75h200v100h-200v75z" />
92	+ <glyph unicode="" d="M0 275v650q0 31 22 53t53 22h750q31 0 53 -22t22 -53v-650q0 -31 -22 -53t-53 -22h-750q-31 0 -53 22t-22 53zM900 600l300 300v-600z" />
93	+ <glyph unicode="" d="M0 44v1012q0 18 13 31t31 13h1112q19 0 31.5 -13t12.5 -31v-1012q0 -18 -12.5 -31t-31.5 -13h-1112q-18 0 -31 13t-13 31zM100 263l247 182l298 -131l-74 156l293 318l236 -288v500h-1000v-737zM208 750q0 56 39 95t95 39t95 -39t39 -95t-39 -95t-95 -39t-95 39t-39 95z " />
94	+ <glyph unicode="" d="M148 745q0 124 60.5 231.5t165 172t226.5 64.5q123 0 227 -63t164.5 -169.5t60.5 -229.5t-73 -272q-73 -114 -166.5 -237t-150.5 -189l-57 -66q-10 9 -27 26t-66.5 70.5t-96 109t-104 135.5t-100.5 155q-63 139 -63 262zM342 772q0 -107 75.5 -182.5t181.5 -75.5 q107 0 182.5 75.5t75.5 182.5t-75.5 182t-182.5 75t-182 -75.5t-75 -181.5z" />
95	+ <glyph unicode="" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM173 600q0 -177 125.5 -302t301.5 -125v854q-176 0 -301.5 -125 t-125.5 -302z" />
96	+ <glyph unicode="" d="M117 406q0 94 34 186t88.5 172.5t112 159t115 177t87.5 194.5q21 -71 57.5 -142.5t76 -130.5t83 -118.5t82 -117t70 -116t50 -125.5t18.5 -136q0 -89 -39 -165.5t-102 -126.5t-140 -79.5t-156 -33.5q-114 6 -211.5 53t-161.5 139t-64 210zM243 414q14 -82 59.5 -136 t136.5 -80l16 98q-7 6 -18 17t-34 48t-33 77q-15 73 -14 143.5t10 122.5l9 51q-92 -110 -119.5 -185t-12.5 -156z" />
97	+ <glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5q366 -6 397 -14l-186 -186h-311q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v125l200 200v-225q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM436 341l161 50l412 412l-114 113l-405 -405zM995 1015l113 -113l113 113l-21 85l-92 28z" />
98	+ <glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h261l2 -80q-133 -32 -218 -120h-145q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5l200 153v-53q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5 zM423 524q30 38 81.5 64t103 35.5t99 14t77.5 3.5l29 -1v-209l360 324l-359 318v-216q-7 0 -19 -1t-48 -8t-69.5 -18.5t-76.5 -37t-76.5 -59t-62 -88t-39.5 -121.5z" />
99	+ <glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q61 0 127 -23l-178 -177h-349q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v69l200 200v-169q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM342 632l283 -284l567 567l-137 137l-430 -431l-146 147z" />
100	+ <glyph unicode="" d="M0 603l300 296v-198h200v200h-200l300 300l295 -300h-195v-200h200v198l300 -296l-300 -300v198h-200v-200h195l-295 -300l-300 300h200v200h-200v-198z" />
101	+ <glyph unicode="" d="M200 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-1100l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
102	+ <glyph unicode="" d="M0 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-487l500 487v-1100l-500 488v-488l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
103	+ <glyph unicode="" d="M136 550l564 550v-487l500 487v-1100l-500 488v-488z" />
104	+ <glyph unicode="" d="M200 0l900 550l-900 550v-1100z" />
105	+ <glyph unicode="" d="M200 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5t-14.5 -35.5v-800zM600 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
106	+ <glyph unicode="" d="M200 150q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v800q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
107	+ <glyph unicode="" d="M0 0v1100l500 -487v487l564 -550l-564 -550v488z" />
108	+ <glyph unicode="" d="M0 0v1100l500 -487v487l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438l-500 -488v488z" />
109	+ <glyph unicode="" d="M300 0v1100l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438z" />
110	+ <glyph unicode="" d="M100 250v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5zM100 500h1100l-550 564z" />
111	+ <glyph unicode="" d="M185 599l592 -592l240 240l-353 353l353 353l-240 240z" />
112	+ <glyph unicode="" d="M272 194l353 353l-353 353l241 240l572 -571l21 -22l-1 -1v-1l-592 -591z" />
113	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h200v-200h200v200h200v200h-200v200h-200v-200h-200v-200z" />
114	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h600v200h-600v-200z" />
115	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM246 459l213 -213l141 142l141 -142l213 213l-142 141l142 141l-213 212l-141 -141l-141 142l-212 -213l141 -141 z" />
116	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM270 551l276 -277l411 411l-175 174l-236 -236l-102 102z" />
117	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM364 700h143q4 0 11.5 -1t11 -1t6.5 3t3 9t1 11t3.5 8.5t3.5 6t5.5 4t6.5 2.5t9 1.5t9 0.5h11.5h12.5 q19 0 30 -10t11 -26q0 -22 -4 -28t-27 -22q-5 -1 -12.5 -3t-27 -13.5t-34 -27t-26.5 -46t-11 -68.5h200q5 3 14 8t31.5 25.5t39.5 45.5t31 69t14 94q0 51 -17.5 89t-42 58t-58.5 32t-58.5 15t-51.5 3q-50 0 -90.5 -12t-75 -38.5t-53.5 -74.5t-19 -114zM500 300h200v100h-200 v-100z" />
118	+ <glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM400 300h400v100h-100v300h-300v-100h100v-200h-100v-100zM500 800h200v100h-200v-100z" />
119	+ <glyph unicode="" d="M0 500v200h195q31 125 98.5 199.5t206.5 100.5v200h200v-200q54 -20 113 -60t112.5 -105.5t71.5 -134.5h203v-200h-203q-25 -102 -116.5 -186t-180.5 -117v-197h-200v197q-140 27 -208 102.5t-98 200.5h-194zM290 500q24 -73 79.5 -127.5t130.5 -78.5v206h200v-206 q149 48 201 206h-201v200h200q-25 74 -75.5 127t-124.5 77v-204h-200v203q-75 -23 -130 -77t-79 -126h209v-200h-210z" />
120	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM356 465l135 135 l-135 135l109 109l135 -135l135 135l109 -109l-135 -135l135 -135l-109 -109l-135 135l-135 -135z" />
121	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM322 537l141 141 l87 -87l204 205l142 -142l-346 -345z" />
122	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -115 62 -215l568 567q-100 62 -216 62q-171 0 -292.5 -121.5t-121.5 -292.5zM391 245q97 -59 209 -59q171 0 292.5 121.5t121.5 292.5 q0 112 -59 209z" />
123	+ <glyph unicode="" d="M0 547l600 453v-300h600v-300h-600v-301z" />
124	+ <glyph unicode="" d="M0 400v300h600v300l600 -453l-600 -448v301h-600z" />
125	+ <glyph unicode="" d="M204 600l450 600l444 -600h-298v-600h-300v600h-296z" />
126	+ <glyph unicode="" d="M104 600h296v600h300v-600h298l-449 -600z" />
127	+ <glyph unicode="" d="M0 200q6 132 41 238.5t103.5 193t184 138t271.5 59.5v271l600 -453l-600 -448v301q-95 -2 -183 -20t-170 -52t-147 -92.5t-100 -135.5z" />
128	+ <glyph unicode="" d="M0 0v400l129 -129l294 294l142 -142l-294 -294l129 -129h-400zM635 777l142 -142l294 294l129 -129v400h-400l129 -129z" />
129	+ <glyph unicode="" d="M34 176l295 295l-129 129h400v-400l-129 130l-295 -295zM600 600v400l129 -129l295 295l142 -141l-295 -295l129 -130h-400z" />
130	+ <glyph unicode="" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5t224.5 -45.5t184 -123t123 -184t45.5 -224.5t-45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5zM456 851l58 -302q4 -20 21.5 -34.5t37.5 -14.5h54q20 0 37.5 14.5 t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5h-207q-21 0 -33 -14.5t-8 -34.5zM500 300h200v100h-200v-100z" />
131	+ <glyph unicode="" d="M0 800h100v-200h400v300h200v-300h400v200h100v100h-111q1 1 1 6.5t-1.5 15t-3.5 17.5l-34 172q-11 39 -41.5 63t-69.5 24q-32 0 -61 -17l-239 -144q-22 -13 -40 -35q-19 24 -40 36l-238 144q-33 18 -62 18q-39 0 -69.5 -23t-40.5 -61l-35 -177q-2 -8 -3 -18t-1 -15v-6 h-111v-100zM100 0h400v400h-400v-400zM200 900q-3 0 14 48t36 96l18 47l213 -191h-281zM700 0v400h400v-400h-400zM731 900l202 197q5 -12 12 -32.5t23 -64t25 -72t7 -28.5h-269z" />
132	+ <glyph unicode="" d="M0 -22v143l216 193q-9 53 -13 83t-5.5 94t9 113t38.5 114t74 124q47 60 99.5 102.5t103 68t127.5 48t145.5 37.5t184.5 43.5t220 58.5q0 -189 -22 -343t-59 -258t-89 -181.5t-108.5 -120t-122 -68t-125.5 -30t-121.5 -1.5t-107.5 12.5t-87.5 17t-56.5 7.5l-99 -55z M238.5 300.5q19.5 -6.5 86.5 76.5q55 66 367 234q70 38 118.5 69.5t102 79t99 111.5t86.5 148q22 50 24 60t-6 19q-7 5 -17 5t-26.5 -14.5t-33.5 -39.5q-35 -51 -113.5 -108.5t-139.5 -89.5l-61 -32q-369 -197 -458 -401q-48 -111 -28.5 -117.5z" />
133	+ <glyph unicode="" d="M111 408q0 -33 5 -63q9 -56 44 -119.5t105 -108.5q31 -21 64 -16t62 23.5t57 49.5t48 61.5t35 60.5q32 66 39 184.5t-13 157.5q79 -80 122 -164t26 -184q-5 -33 -20.5 -69.5t-37.5 -80.5q-10 -19 -14.5 -29t-12 -26t-9 -23.5t-3 -19t2.5 -15.5t11 -9.5t19.5 -5t30.5 2.5 t42 8q57 20 91 34t87.5 44.5t87 64t65.5 88.5t47 122q38 172 -44.5 341.5t-246.5 278.5q22 -44 43 -129q39 -159 -32 -154q-15 2 -33 9q-79 33 -120.5 100t-44 175.5t48.5 257.5q-13 -8 -34 -23.5t-72.5 -66.5t-88.5 -105.5t-60 -138t-8 -166.5q2 -12 8 -41.5t8 -43t6 -39.5 t3.5 -39.5t-1 -33.5t-6 -31.5t-13.5 -24t-21 -20.5t-31 -12q-38 -10 -67 13t-40.5 61.5t-15 81.5t10.5 75q-52 -46 -83.5 -101t-39 -107t-7.5 -85z" />
134	+ <glyph unicode="" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5t145.5 -23.5t132.5 -59t116.5 -83.5t97 -90t74.5 -85.5t49 -63.5t20 -30l26 -40l-26 -40q-6 -10 -20 -30t-49 -63.5t-74.5 -85.5t-97 -90t-116.5 -83.5t-132.5 -59t-145.5 -23.5 t-145.5 23.5t-132.5 59t-116.5 83.5t-97 90t-74.5 85.5t-49 63.5t-20 30zM120 600q7 -10 40.5 -58t56 -78.5t68 -77.5t87.5 -75t103 -49.5t125 -21.5t123.5 20t100.5 45.5t85.5 71.5t66.5 75.5t58 81.5t47 66q-1 1 -28.5 37.5t-42 55t-43.5 53t-57.5 63.5t-58.5 54 q49 -74 49 -163q0 -124 -88 -212t-212 -88t-212 88t-88 212q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l105 105q-37 24 -75 72t-57 84l-20 36z" />
135	+ <glyph unicode="" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5q61 0 121 -17l37 142h148l-314 -1200h-148l37 143q-82 21 -165 71.5t-140 102t-109.5 112t-72 88.5t-29.5 43zM120 600q210 -282 393 -336l37 141q-107 18 -178.5 101.5t-71.5 193.5 q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l47 47l23 87q-30 28 -59 69t-44 68l-14 26zM780 161l38 145q22 15 44.5 34t46 44t40.5 44t41 50.5t33.5 43.5t33 44t24.5 34q-97 127 -140 175l39 146q67 -54 131.5 -125.5t87.5 -103.5t36 -52l26 -40l-26 -40 q-7 -12 -25.5 -38t-63.5 -79.5t-95.5 -102.5t-124 -100t-146.5 -79z" />
136	+ <glyph unicode="" d="M-97.5 34q13.5 -34 50.5 -34h1294q37 0 50.5 35.5t-7.5 67.5l-642 1056q-20 34 -48 36.5t-48 -29.5l-642 -1066q-21 -32 -7.5 -66zM155 200l445 723l445 -723h-345v100h-200v-100h-345zM500 600l100 -300l100 300v100h-200v-100z" />
137	+ <glyph unicode="" d="M100 262v41q0 20 11 44.5t26 38.5l363 325v339q0 62 44 106t106 44t106 -44t44 -106v-339l363 -325q15 -14 26 -38.5t11 -44.5v-41q0 -20 -12 -26.5t-29 5.5l-359 249v-263q100 -91 100 -113v-64q0 -20 -13 -28.5t-32 0.5l-94 78h-222l-94 -78q-19 -9 -32 -0.5t-13 28.5 v64q0 22 100 113v263l-359 -249q-17 -12 -29 -5.5t-12 26.5z" />
138	+ <glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v750h-1100v-750zM0 900h1100v150q0 21 -14.5 35.5t-35.5 14.5h-150v100h-100v-100h-500v100h-100v-100h-150q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 100v100h100v-100h-100zM100 300v100h100v-100h-100z M100 500v100h100v-100h-100zM300 100v100h100v-100h-100zM300 300v100h100v-100h-100zM300 500v100h100v-100h-100zM500 100v100h100v-100h-100zM500 300v100h100v-100h-100zM500 500v100h100v-100h-100zM700 100v100h100v-100h-100zM700 300v100h100v-100h-100zM700 500 v100h100v-100h-100zM900 100v100h100v-100h-100zM900 300v100h100v-100h-100zM900 500v100h100v-100h-100z" />
139	+ <glyph unicode="" d="M0 200v200h259l600 600h241v198l300 -295l-300 -300v197h-159l-600 -600h-341zM0 800h259l122 -122l141 142l-181 180h-341v-200zM678 381l141 142l122 -123h159v198l300 -295l-300 -300v197h-241z" />
140	+ <glyph unicode="" d="M0 400v600q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-596l-304 -300v300h-100q-41 0 -70.5 29.5t-29.5 70.5z" />
141	+ <glyph unicode="" d="M100 600v200h300v-250q0 -113 6 -145q17 -92 102 -117q39 -11 92 -11q37 0 66.5 5.5t50 15.5t36 24t24 31.5t14 37.5t7 42t2.5 45t0 47v25v250h300v-200q0 -42 -3 -83t-15 -104t-31.5 -116t-58 -109.5t-89 -96.5t-129 -65.5t-174.5 -25.5t-174.5 25.5t-129 65.5t-89 96.5 t-58 109.5t-31.5 116t-15 104t-3 83zM100 900v300h300v-300h-300zM800 900v300h300v-300h-300z" />
142	+ <glyph unicode="" d="M-30 411l227 -227l352 353l353 -353l226 227l-578 579z" />
143	+ <glyph unicode="" d="M70 797l580 -579l578 579l-226 227l-353 -353l-352 353z" />
144	+ <glyph unicode="" d="M-198 700l299 283l300 -283h-203v-400h385l215 -200h-800v600h-196zM402 1000l215 -200h381v-400h-198l299 -283l299 283h-200v600h-796z" />
145	+ <glyph unicode="" d="M18 939q-5 24 10 42q14 19 39 19h896l38 162q5 17 18.5 27.5t30.5 10.5h94q20 0 35 -14.5t15 -35.5t-15 -35.5t-35 -14.5h-54l-201 -961q-2 -4 -6 -10.5t-19 -17.5t-33 -11h-31v-50q0 -20 -14.5 -35t-35.5 -15t-35.5 15t-14.5 35v50h-300v-50q0 -20 -14.5 -35t-35.5 -15 t-35.5 15t-14.5 35v50h-50q-21 0 -35.5 15t-14.5 35q0 21 14.5 35.5t35.5 14.5h535l48 200h-633q-32 0 -54.5 21t-27.5 43z" />
146	+ <glyph unicode="" d="M0 0v800h1200v-800h-1200zM0 900v100h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-100h-1200z" />
147	+ <glyph unicode="" d="M1 0l300 700h1200l-300 -700h-1200zM1 400v600h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-200h-1000z" />
148	+ <glyph unicode="" d="M302 300h198v600h-198l298 300l298 -300h-198v-600h198l-298 -300z" />
149	+ <glyph unicode="" d="M0 600l300 298v-198h600v198l300 -298l-300 -297v197h-600v-197z" />
150	+ <glyph unicode="" d="M0 100v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM31 400l172 739q5 22 23 41.5t38 19.5h672q19 0 37.5 -22.5t23.5 -45.5l172 -732h-1138zM800 100h100v100h-100v-100z M1000 100h100v100h-100v-100z" />
151	+ <glyph unicode="" d="M-101 600v50q0 24 25 49t50 38l25 13v-250l-11 5.5t-24 14t-30 21.5t-24 27.5t-11 31.5zM100 500v250v8v8v7t0.5 7t1.5 5.5t2 5t3 4t4.5 3.5t6 1.5t7.5 0.5h200l675 250v-850l-675 200h-38l47 -276q2 -12 -3 -17.5t-11 -6t-21 -0.5h-8h-83q-20 0 -34.5 14t-18.5 35 q-55 337 -55 351zM1100 200v850q0 21 14.5 35.5t35.5 14.5q20 0 35 -14.5t15 -35.5v-850q0 -20 -15 -35t-35 -15q-21 0 -35.5 15t-14.5 35z" />
152	+ <glyph unicode="" d="M74 350q0 21 13.5 35.5t33.5 14.5h18l117 173l63 327q15 77 76 140t144 83l-18 32q-6 19 3 32t29 13h94q20 0 29 -10.5t3 -29.5q-18 -36 -18 -37q83 -19 144 -82.5t76 -140.5l63 -327l118 -173h17q20 0 33.5 -14.5t13.5 -35.5q0 -20 -13 -40t-31 -27q-8 -3 -23 -8.5 t-65 -20t-103 -25t-132.5 -19.5t-158.5 -9q-125 0 -245.5 20.5t-178.5 40.5l-58 20q-18 7 -31 27.5t-13 40.5zM497 110q12 -49 40 -79.5t63 -30.5t63 30.5t39 79.5q-48 -6 -102 -6t-103 6z" />
153	+ <glyph unicode="" d="M21 445l233 -45l-78 -224l224 78l45 -233l155 179l155 -179l45 233l224 -78l-78 224l234 45l-180 155l180 156l-234 44l78 225l-224 -78l-45 233l-155 -180l-155 180l-45 -233l-224 78l78 -225l-233 -44l179 -156z" />
154	+ <glyph unicode="" d="M0 200h200v600h-200v-600zM300 275q0 -75 100 -75h61q124 -100 139 -100h250q46 0 83 57l238 344q29 31 29 74v100q0 44 -30.5 84.5t-69.5 40.5h-328q28 118 28 125v150q0 44 -30.5 84.5t-69.5 40.5h-50q-27 0 -51 -20t-38 -48l-96 -198l-145 -196q-20 -26 -20 -63v-400z M400 300v375l150 213l100 212h50v-175l-50 -225h450v-125l-250 -375h-214l-136 100h-100z" />
155	+ <glyph unicode="" d="M0 400v600h200v-600h-200zM300 525v400q0 75 100 75h61q124 100 139 100h250q46 0 83 -57l238 -344q29 -31 29 -74v-100q0 -44 -30.5 -84.5t-69.5 -40.5h-328q28 -118 28 -125v-150q0 -44 -30.5 -84.5t-69.5 -40.5h-50q-27 0 -51 20t-38 48l-96 198l-145 196 q-20 26 -20 63zM400 525l150 -212l100 -213h50v175l-50 225h450v125l-250 375h-214l-136 -100h-100v-375z" />
156	+ <glyph unicode="" d="M8 200v600h200v-600h-200zM308 275v525q0 17 14 35.5t28 28.5l14 9l362 230q14 6 25 6q17 0 29 -12l109 -112q14 -14 14 -34q0 -18 -11 -32l-85 -121h302q85 0 138.5 -38t53.5 -110t-54.5 -111t-138.5 -39h-107l-130 -339q-7 -22 -20.5 -41.5t-28.5 -19.5h-341 q-7 0 -90 81t-83 94zM408 289l100 -89h293l131 339q6 21 19.5 41t28.5 20h203q16 0 25 15t9 36q0 20 -9 34.5t-25 14.5h-457h-6.5h-7.5t-6.5 0.5t-6 1t-5 1.5t-5.5 2.5t-4 4t-4 5.5q-5 12 -5 20q0 14 10 27l147 183l-86 83l-339 -236v-503z" />
157	+ <glyph unicode="" d="M-101 651q0 72 54 110t139 38l302 -1l-85 121q-11 16 -11 32q0 21 14 34l109 113q13 12 29 12q11 0 25 -6l365 -230q7 -4 17 -10.5t26.5 -26t16.5 -36.5v-526q0 -13 -86 -93.5t-94 -80.5h-341q-16 0 -29.5 20t-19.5 41l-130 339h-107q-84 0 -139 39t-55 111zM-1 601h222 q15 0 28.5 -20.5t19.5 -40.5l131 -339h293l107 89v502l-343 237l-87 -83l145 -184q10 -11 10 -26q0 -11 -5 -20q-1 -3 -3.5 -5.5l-4 -4t-5 -2.5t-5.5 -1.5t-6.5 -1t-6.5 -0.5h-7.5h-6.5h-476v-100zM1000 201v600h200v-600h-200z" />
158	+ <glyph unicode="" d="M97 719l230 -363q4 -6 10.5 -15.5t26 -25t36.5 -15.5h525q13 0 94 83t81 90v342q0 15 -20 28.5t-41 19.5l-339 131v106q0 84 -39 139t-111 55t-110 -53.5t-38 -138.5v-302l-121 84q-15 12 -33.5 11.5t-32.5 -13.5l-112 -110q-22 -22 -6 -53zM172 739l83 86l183 -146 q22 -18 47 -5q3 1 5.5 3.5l4 4t2.5 5t1.5 5.5t1 6.5t0.5 6.5v7.5v6.5v456q0 22 25 31t50 -0.5t25 -30.5v-202q0 -16 20 -29.5t41 -19.5l339 -130v-294l-89 -100h-503zM400 0v200h600v-200h-600z" />
159	+ <glyph unicode="" d="M2 585q-16 -31 6 -53l112 -110q13 -13 32 -13.5t34 10.5l121 85q0 -51 -0.5 -153.5t-0.5 -148.5q0 -84 38.5 -138t110.5 -54t111 55t39 139v106l339 131q20 6 40.5 19.5t20.5 28.5v342q0 7 -81 90t-94 83h-525q-17 0 -35.5 -14t-28.5 -28l-10 -15zM77 565l236 339h503 l89 -100v-294l-340 -130q-20 -6 -40 -20t-20 -29v-202q0 -22 -25 -31t-50 0t-25 31v456v14.5t-1.5 11.5t-5 12t-9.5 7q-24 13 -46 -5l-184 -146zM305 1104v200h600v-200h-600z" />
160	+ <glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM298 701l2 -201h300l-2 -194l402 294l-402 298v-197h-300z" />
161	+ <glyph unicode="" d="M0 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t231.5 47.5q122 0 232.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-218 -217.5t-300 -80t-299.5 80t-217.5 217.5t-80 299.5zM200 600l402 -294l-2 194h300l2 201h-300v197z" />
162	+ <glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600h200v-300h200v300h200l-300 400z" />
163	+ <glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600l300 -400l300 400h-200v300h-200v-300h-200z" />
164	+ <glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q121 0 231.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM254 780q-8 -33 5.5 -92.5t7.5 -87.5q0 -9 17 -44t16 -60 q12 0 23 -5.5t23 -15t20 -13.5q24 -12 108 -42q22 -8 53 -31.5t59.5 -38.5t57.5 -11q8 -18 -15 -55t-20 -57q42 -71 87 -80q0 -6 -3 -15.5t-3.5 -14.5t4.5 -17q104 -3 221 112q30 29 47 47t34.5 49t20.5 62q-14 9 -37 9.5t-36 7.5q-14 7 -49 15t-52 19q-9 0 -39.5 -0.5 t-46.5 -1.5t-39 -6.5t-39 -16.5q-50 -35 -66 -12q-4 2 -3.5 25.5t0.5 25.5q-6 13 -26.5 17t-24.5 7q2 22 -2 41t-16.5 28t-38.5 -20q-23 -25 -42 4q-19 28 -8 58q6 16 22 22q6 -1 26 -1.5t33.5 -4t19.5 -13.5q12 -19 32 -37.5t34 -27.5l14 -8q0 3 9.5 39.5t5.5 57.5 q-4 23 14.5 44.5t22.5 31.5q5 14 10 35t8.5 31t15.5 22.5t34 21.5q-6 18 10 37q8 0 23.5 -1.5t24.5 -1.5t20.5 4.5t20.5 15.5q-10 23 -30.5 42.5t-38 30t-49 26.5t-43.5 23q11 39 2 44q31 -13 58 -14.5t39 3.5l11 4q7 36 -16.5 53.5t-64.5 28.5t-56 23q-19 -3 -37 0 q-15 -12 -36.5 -21t-34.5 -12t-44 -8t-39 -6q-15 -3 -45.5 0.5t-45.5 -2.5q-21 -7 -52 -26.5t-34 -34.5q-3 -11 6.5 -22.5t8.5 -18.5q-3 -34 -27.5 -90.5t-29.5 -79.5zM518 916q3 12 16 30t16 25q10 -10 18.5 -10t14 6t14.5 14.5t16 12.5q0 -24 17 -66.5t17 -43.5 q-9 2 -31 5t-36 5t-32 8t-30 14zM692 1003h1h-1z" />
165	+ <glyph unicode="" d="M0 164.5q0 21.5 15 37.5l600 599q-33 101 6 201.5t135 154.5q164 92 306 -9l-259 -138l145 -232l251 126q13 -175 -151 -267q-123 -70 -253 -23l-596 -596q-15 -16 -36.5 -16t-36.5 16l-111 110q-15 15 -15 36.5z" />
166	+ <glyph unicode="" horiz-adv-x="1220" d="M0 196v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 596v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5zM0 996v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM600 596h500v100h-500v-100zM800 196h300v100h-300v-100zM900 996h200v100h-200v-100z" />
167	+ <glyph unicode="" d="M100 1100v100h1000v-100h-1000zM150 1000h900l-350 -500v-300l-200 -200v500z" />
168	+ <glyph unicode="" d="M0 200v200h1200v-200q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 500v400q0 41 29.5 70.5t70.5 29.5h300v100q0 41 29.5 70.5t70.5 29.5h200q41 0 70.5 -29.5t29.5 -70.5v-100h300q41 0 70.5 -29.5t29.5 -70.5v-400h-500v100h-200v-100h-500z M500 1000h200v100h-200v-100z" />
169	+ <glyph unicode="" d="M0 0v400l129 -129l200 200l142 -142l-200 -200l129 -129h-400zM0 800l129 129l200 -200l142 142l-200 200l129 129h-400v-400zM729 329l142 142l200 -200l129 129v-400h-400l129 129zM729 871l200 200l-129 129h400v-400l-129 129l-200 -200z" />
170	+ <glyph unicode="" d="M0 596q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 596q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM291 655 q0 23 15.5 38.5t38.5 15.5t39 -16t16 -38q0 -23 -16 -39t-39 -16q-22 0 -38 16t-16 39zM400 850q0 22 16 38.5t39 16.5q22 0 38 -16t16 -39t-16 -39t-38 -16q-23 0 -39 16.5t-16 38.5zM514 609q0 32 20.5 56.5t51.5 29.5l122 126l1 1q-9 14 -9 28q0 22 16 38.5t39 16.5 q22 0 38 -16t16 -39t-16 -39t-38 -16q-14 0 -29 10l-55 -145q17 -22 17 -51q0 -36 -25.5 -61.5t-61.5 -25.5t-61.5 25.5t-25.5 61.5zM800 655q0 22 16 38t39 16t38.5 -15.5t15.5 -38.5t-16 -39t-38 -16q-23 0 -39 16t-16 39z" />
171	+ <glyph unicode="" d="M-40 375q-13 -95 35 -173q35 -57 94 -89t129 -32q63 0 119 28q33 16 65 40.5t52.5 45.5t59.5 64q40 44 57 61l394 394q35 35 47 84t-3 96q-27 87 -117 104q-20 2 -29 2q-46 0 -78.5 -16.5t-67.5 -51.5l-389 -396l-7 -7l69 -67l377 373q20 22 39 38q23 23 50 23 q38 0 53 -36q16 -39 -20 -75l-547 -547q-52 -52 -125 -52q-55 0 -100 33t-54 96q-5 35 2.5 66t31.5 63t42 50t56 54q24 21 44 41l348 348q52 52 82.5 79.5t84 54t107.5 26.5q25 0 48 -4q95 -17 154 -94.5t51 -175.5q-7 -101 -98 -192l-252 -249l-253 -256l7 -7l69 -60 l517 511q67 67 95 157t11 183q-16 87 -67 154t-130 103q-69 33 -152 33q-107 0 -197 -55q-40 -24 -111 -95l-512 -512q-68 -68 -81 -163z" />
172	+ <glyph unicode="" d="M80 784q0 131 98.5 229.5t230.5 98.5q143 0 241 -129q103 129 246 129q129 0 226 -98.5t97 -229.5q0 -46 -17.5 -91t-61 -99t-77 -89.5t-104.5 -105.5q-197 -191 -293 -322l-17 -23l-16 23q-43 58 -100 122.5t-92 99.5t-101 100q-71 70 -104.5 105.5t-77 89.5t-61 99 t-17.5 91zM250 784q0 -27 30.5 -70t61.5 -75.5t95 -94.5l22 -22q93 -90 190 -201q82 92 195 203l12 12q64 62 97.5 97t64.5 79t31 72q0 71 -48 119.5t-105 48.5q-74 0 -132 -83l-118 -171l-114 174q-51 80 -123 80q-60 0 -109.5 -49.5t-49.5 -118.5z" />
173	+ <glyph unicode="" d="M57 353q0 -95 66 -159l141 -142q68 -66 159 -66q93 0 159 66l283 283q66 66 66 159t-66 159l-141 141q-8 9 -19 17l-105 -105l212 -212l-389 -389l-247 248l95 95l-18 18q-46 45 -75 101l-55 -55q-66 -66 -66 -159zM269 706q0 -93 66 -159l141 -141q7 -7 19 -17l105 105 l-212 212l389 389l247 -247l-95 -96l18 -17q47 -49 77 -100l29 29q35 35 62.5 88t27.5 96q0 93 -66 159l-141 141q-66 66 -159 66q-95 0 -159 -66l-283 -283q-66 -64 -66 -159z" />
174	+ <glyph unicode="" d="M200 100v953q0 21 30 46t81 48t129 38t163 15t162 -15t127 -38t79 -48t29 -46v-953q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-41 0 -70.5 29.5t-29.5 70.5zM300 300h600v700h-600v-700zM496 150q0 -43 30.5 -73.5t73.5 -30.5t73.5 30.5t30.5 73.5t-30.5 73.5t-73.5 30.5 t-73.5 -30.5t-30.5 -73.5z" />
175	+ <glyph unicode="" d="M0 0l303 380l207 208l-210 212h300l267 279l-35 36q-15 14 -15 35t15 35q14 15 35 15t35 -15l283 -282q15 -15 15 -36t-15 -35q-14 -15 -35 -15t-35 15l-36 35l-279 -267v-300l-212 210l-208 -207z" />
176	+ <glyph unicode="" d="M295 433h139q5 -77 48.5 -126.5t117.5 -64.5v335q-6 1 -15.5 4t-11.5 3q-46 14 -79 26.5t-72 36t-62.5 52t-40 72.5t-16.5 99q0 92 44 159.5t109 101t144 40.5v78h100v-79q38 -4 72.5 -13.5t75.5 -31.5t71 -53.5t51.5 -84t24.5 -118.5h-159q-8 72 -35 109.5t-101 50.5 v-307l64 -14q34 -7 64 -16.5t70 -31.5t67.5 -52t47.5 -80.5t20 -112.5q0 -139 -89 -224t-244 -96v-77h-100v78q-152 17 -237 104q-40 40 -52.5 93.5t-15.5 139.5zM466 889q0 -29 8 -51t16.5 -34t29.5 -22.5t31 -13.5t38 -10q7 -2 11 -3v274q-61 -8 -97.5 -37.5t-36.5 -102.5 zM700 237q170 18 170 151q0 64 -44 99.5t-126 60.5v-311z" />
177	+ <glyph unicode="" d="M100 600v100h166q-24 49 -44 104q-10 26 -14.5 55.5t-3 72.5t25 90t68.5 87q97 88 263 88q129 0 230 -89t101 -208h-153q0 52 -34 89.5t-74 51.5t-76 14q-37 0 -79 -14.5t-62 -35.5q-41 -44 -41 -101q0 -28 16.5 -69.5t28 -62.5t41.5 -72h241v-100h-197q8 -50 -2.5 -115 t-31.5 -94q-41 -59 -99 -113q35 11 84 18t70 7q33 1 103 -16t103 -17q76 0 136 30l50 -147q-41 -25 -80.5 -36.5t-59 -13t-61.5 -1.5q-23 0 -128 33t-155 29q-39 -4 -82 -17t-66 -25l-24 -11l-55 145l16.5 11t15.5 10t13.5 9.5t14.5 12t14.5 14t17.5 18.5q48 55 54 126.5 t-30 142.5h-221z" />
178	+ <glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM602 900l298 300l298 -300h-198v-900h-200v900h-198z" />
179	+ <glyph unicode="" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v200h100v-100h200v-100h-300zM700 400v100h300v-200h-99v-100h-100v100h99v100h-200zM700 700v500h300v-500h-100v100h-100v-100h-100zM801 900h100v200h-100v-200z" />
180	+ <glyph unicode="" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v500h300v-500h-100v100h-100v-100h-100zM700 700v200h100v-100h200v-100h-300zM700 1100v100h300v-200h-99v-100h-100v100h99v100h-200zM801 200h100v200h-100v-200z" />
181	+ <glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 100v400h300v-500h-100v100h-200zM800 1100v100h200v-500h-100v400h-100zM901 200h100v200h-100v-200z" />
182	+ <glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 400v100h200v-500h-100v400h-100zM800 800v400h300v-500h-100v100h-200zM901 900h100v200h-100v-200z" />
183	+ <glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h500v-200h-500zM700 400v200h400v-200h-400zM700 700v200h300v-200h-300zM700 1000v200h200v-200h-200z" />
184	+ <glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h200v-200h-200zM700 400v200h300v-200h-300zM700 700v200h400v-200h-400zM700 1000v200h500v-200h-500z" />
185	+ <glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q162 0 281 -118.5t119 -281.5v-300q0 -165 -118.5 -282.5t-281.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500z" />
186	+ <glyph unicode="" d="M0 400v300q0 163 119 281.5t281 118.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-163 0 -281.5 117.5t-118.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM400 300l333 250l-333 250v-500z" />
187	+ <glyph unicode="" d="M0 400v300q0 163 117.5 281.5t282.5 118.5h300q163 0 281.5 -119t118.5 -281v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 700l250 -333l250 333h-500z" />
188	+ <glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -162 -118.5 -281t-281.5 -119h-300q-165 0 -282.5 118.5t-117.5 281.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 400h500l-250 333z" />
189	+ <glyph unicode="" d="M0 400v300h300v200l400 -350l-400 -350v200h-300zM500 0v200h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-500v200h400q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-400z" />
190	+ <glyph unicode="" d="M217 519q8 -19 31 -19h302q-155 -438 -160 -458q-5 -21 4 -32l9 -8h9q14 0 26 15q11 13 274.5 321.5t264.5 308.5q14 19 5 36q-8 17 -31 17l-301 -1q1 4 78 219.5t79 227.5q2 15 -5 27l-9 9h-9q-15 0 -25 -16q-4 -6 -98 -111.5t-228.5 -257t-209.5 -237.5q-16 -19 -6 -41 z" />
191	+ <glyph unicode="" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q47 0 100 15v185h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h500v185q-14 4 -114 7.5t-193 5.5l-93 2q-165 0 -282.5 -117.5t-117.5 -282.5v-300zM600 400v300h300v200l400 -350l-400 -350v200h-300z " />
192	+ <glyph unicode="" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q163 0 281.5 117.5t118.5 282.5v98l-78 73l-122 -123v-148q0 -41 -29.5 -70.5t-70.5 -29.5h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h156l118 122l-74 78h-100q-165 0 -282.5 -117.5t-117.5 -282.5 v-300zM496 709l353 342l-149 149h500v-500l-149 149l-342 -353z" />
193	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM406 600 q0 80 57 137t137 57t137 -57t57 -137t-57 -137t-137 -57t-137 57t-57 137z" />
194	+ <glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 800l445 -500l450 500h-295v400h-300v-400h-300zM900 150h100v50h-100v-50z" />
195	+ <glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 700h300v-300h300v300h295l-445 500zM900 150h100v50h-100v-50z" />
196	+ <glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 705l305 -305l596 596l-154 155l-442 -442l-150 151zM900 150h100v50h-100v-50z" />
197	+ <glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 988l97 -98l212 213l-97 97zM200 400l697 1l3 699l-250 -239l-149 149l-212 -212l149 -149zM900 150h100v50h-100v-50z" />
198	+ <glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM200 612l212 -212l98 97l-213 212zM300 1200l239 -250l-149 -149l212 -212l149 148l249 -237l-1 697zM900 150h100v50h-100v-50z" />
199	+ <glyph unicode="" d="M23 415l1177 784v-1079l-475 272l-310 -393v416h-392zM494 210l672 938l-672 -712v-226z" />
200	+ <glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-850q0 -21 -15 -35.5t-35 -14.5h-150v400h-700v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200z" />
201	+ <glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-218l-276 -275l-120 120l-126 -127h-378v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM581 306l123 123l120 -120l353 352l123 -123l-475 -476zM600 1000h100v200h-100v-200z" />
202	+ <glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-269l-103 -103l-170 170l-298 -298h-329v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200zM700 133l170 170l-170 170l127 127l170 -170l170 170l127 -128l-170 -169l170 -170 l-127 -127l-170 170l-170 -170z" />
203	+ <glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-300h-400v-200h-500v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300l300 -300l300 300h-200v300h-200v-300h-200zM600 1000v200h100v-200h-100z" />
204	+ <glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-402l-200 200l-298 -298h-402v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300h200v-300h200v300h200l-300 300zM600 1000v200h100v-200h-100z" />
205	+ <glyph unicode="" d="M0 250q0 -21 14.5 -35.5t35.5 -14.5h1100q21 0 35.5 14.5t14.5 35.5v550h-1200v-550zM0 900h1200v150q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 300v200h400v-200h-400z" />
206	+ <glyph unicode="" d="M0 400l300 298v-198h400v-200h-400v-198zM100 800v200h100v-200h-100zM300 800v200h100v-200h-100zM500 800v200h400v198l300 -298l-300 -298v198h-400zM800 300v200h100v-200h-100zM1000 300h100v200h-100v-200z" />
207	+ <glyph unicode="" d="M100 700v400l50 100l50 -100v-300h100v300l50 100l50 -100v-300h100v300l50 100l50 -100v-400l-100 -203v-447q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v447zM800 597q0 -29 10.5 -55.5t25 -43t29 -28.5t25.5 -18l10 -5v-397q0 -21 14.5 -35.5 t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v1106q0 31 -18 40.5t-44 -7.5l-276 -116q-25 -17 -43.5 -51.5t-18.5 -65.5v-359z" />
208	+ <glyph unicode="" d="M100 0h400v56q-75 0 -87.5 6t-12.5 44v394h500v-394q0 -38 -12.5 -44t-87.5 -6v-56h400v56q-4 0 -11 0.5t-24 3t-30 7t-24 15t-11 24.5v888q0 22 25 34.5t50 13.5l25 2v56h-400v-56q75 0 87.5 -6t12.5 -44v-394h-500v394q0 38 12.5 44t87.5 6v56h-400v-56q4 0 11 -0.5 t24 -3t30 -7t24 -15t11 -24.5v-888q0 -22 -25 -34.5t-50 -13.5l-25 -2v-56z" />
209	+ <glyph unicode="" d="M0 300q0 -41 29.5 -70.5t70.5 -29.5h300q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-300q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM100 100h400l200 200h105l295 98v-298h-425l-100 -100h-375zM100 300v200h300v-200h-300zM100 600v200h300v-200h-300z M100 1000h400l200 -200v-98l295 98h105v200h-425l-100 100h-375zM700 402v163l400 133v-163z" />
210	+ <glyph unicode="" d="M16.5 974.5q0.5 -21.5 16 -90t46.5 -140t104 -177.5t175 -208q103 -103 207.5 -176t180 -103.5t137 -47t92.5 -16.5l31 1l163 162q17 18 13.5 41t-22.5 37l-192 136q-19 14 -45 12t-42 -19l-118 -118q-142 101 -268 227t-227 268l118 118q17 17 20 41.5t-11 44.5 l-139 194q-14 19 -36.5 22t-40.5 -14l-162 -162q-1 -11 -0.5 -32.5z" />
211	+ <glyph unicode="" d="M0 50v212q0 20 10.5 45.5t24.5 39.5l365 303v50q0 4 1 10.5t12 22.5t30 28.5t60 23t97 10.5t97 -10t60 -23.5t30 -27.5t12 -24l1 -10v-50l365 -303q14 -14 24.5 -39.5t10.5 -45.5v-212q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-20 0 -35 14.5t-15 35.5zM0 712 q0 -21 14.5 -33.5t34.5 -8.5l202 33q20 4 34.5 21t14.5 38v146q141 24 300 24t300 -24v-146q0 -21 14.5 -38t34.5 -21l202 -33q20 -4 34.5 8.5t14.5 33.5v200q-6 8 -19 20.5t-63 45t-112 57t-171 45t-235 20.5q-92 0 -175 -10.5t-141.5 -27t-108.5 -36.5t-81.5 -40 t-53.5 -36.5t-31 -27.5l-9 -10v-200z" />
212	+ <glyph unicode="" d="M100 0v100h1100v-100h-1100zM175 200h950l-125 150v250l100 100v400h-100v-200h-100v200h-200v-200h-100v200h-200v-200h-100v200h-100v-400l100 -100v-250z" />
213	+ <glyph unicode="" d="M100 0h300v400q0 41 -29.5 70.5t-70.5 29.5h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-400zM500 0v1000q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-1000h-300zM900 0v700q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-700h-300z" />
214	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
215	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h100v200h100v-200h100v500h-100v-200h-100v200h-100v-500zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
216	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v100h-200v300h200v100h-300v-500zM600 300h300v100h-200v300h200v100h-300v-500z" />
217	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 550l300 -150v300zM600 400l300 150l-300 150v-300z" />
218	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300v500h700v-500h-700zM300 400h130q41 0 68 42t27 107t-28.5 108t-66.5 43h-130v-300zM575 549 q0 -65 27 -107t68 -42h130v300h-130q-38 0 -66.5 -43t-28.5 -108z" />
219	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
220	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v400h-200v100h-100v-500zM301 400v200h100v-200h-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
221	+ <glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 700v100h300v-300h-99v-100h-100v100h99v200h-200zM201 300v100h100v-100h-100zM601 300v100h100v-100h-100z M700 700v100h200v-500h-100v400h-100z" />
222	+ <glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 500v200 l100 100h300v-100h-300v-200h300v-100h-300z" />
223	+ <glyph unicode="" d="M0 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 400v400h300 l100 -100v-100h-100v100h-200v-100h200v-100h-200v-100h-100zM700 400v100h100v-100h-100z" />
224	+ <glyph unicode="" d="M-14 494q0 -80 56.5 -137t135.5 -57h222v300h400v-300h128q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200h200v300h200v-300h200 l-300 -300z" />
225	+ <glyph unicode="" d="M-14 494q0 -80 56.5 -137t135.5 -57h8l414 414l403 -403q94 26 154.5 104.5t60.5 178.5q0 120 -85 206.5t-205 86.5q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200l300 300 l300 -300h-200v-300h-200v300h-200z" />
226	+ <glyph unicode="" d="M100 200h400v-155l-75 -45h350l-75 45v155h400l-270 300h170l-270 300h170l-300 333l-300 -333h170l-270 -300h170z" />
227	+ <glyph unicode="" d="M121 700q0 -53 28.5 -97t75.5 -65q-4 -16 -4 -38q0 -74 52.5 -126.5t126.5 -52.5q56 0 100 30v-306l-75 -45h350l-75 45v306q46 -30 100 -30q74 0 126.5 52.5t52.5 126.5q0 24 -9 55q50 32 79.5 83t29.5 112q0 90 -61.5 155.5t-150.5 71.5q-26 89 -99.5 145.5 t-167.5 56.5q-116 0 -197.5 -81.5t-81.5 -197.5q0 -4 1 -11.5t1 -11.5q-14 2 -23 2q-74 0 -126.5 -52.5t-52.5 -126.5z" />
228	+ </font>
229	+ </defs></svg>

assets/bootstrap/fonts/glyphicons-halflings-regular.ttf ADDED Viewed

Binary file

assets/bootstrap/fonts/glyphicons-halflings-regular.woff ADDED Viewed

Binary file

assets/bootstrap/js/bootstrap.min.js ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ /*!
2	+ * Bootstrap v3.1.1 (http://getbootstrap.com)
3	+ * Copyright 2011-2014 Twitter, Inc.
4	+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
5	+ */
6	+
7	+ +function(a){"use strict";var b='[data-dismiss="alert"]',c=function(c){a(c).on("click",b,this.close)};c.prototype.close=function(b){function f(){e.trigger("closed.bs.alert").remove()}var c=a(this),d=c.attr("data-target");d\|\|(d=c.attr("href"),d=d&&d.replace(/.(?=#[^\s]$)/,""));var e=a(d);b&&b.preventDefault(),e.length\|\|(e=c.hasClass("alert")?c:c.parent()),e.trigger(b=a.Event("close.bs.alert"));if(b.isDefaultPrevented())return;e.removeClass("in"),a.support.transition&&e.hasClass("fade")?e.one(a.support.transition.end,f).emulateTransitionEnd(150):f()};var d=a.fn.alert;a.fn.alert=function(b){return this.each(function(){var d=a(this),e=d.data("bs.alert");e\|\|d.data("bs.alert",e=new c(this)),typeof b=="string"&&e[b].call(d)})},a.fn.alert.Constructor=c,a.fn.alert.noConflict=function(){return a.fn.alert=d,this},a(document).on("click.bs.alert.data-api",b,c.prototype.close)}(jQuery),+function(a){"use strict";var b=function(c,d){this.$element=a(c),this.options=a.extend({},b.DEFAULTS,d),this.isLoading=!1};b.DEFAULTS={loadingText:"loading..."},b.prototype.setState=function(b){var c="disabled",d=this.$element,e=d.is("input")?"val":"html",f=d.data();b+="Text",f.resetText\|\|d.data("resetText",d[e]()),d[e](f[b]\|\|this.options[b]),setTimeout(a.proxy(function(){b=="loadingText"?(this.isLoading=!0,d.addClass(c).attr(c,c)):this.isLoading&&(this.isLoading=!1,d.removeClass(c).removeAttr(c))},this),0)},b.prototype.toggle=function(){var a=!0,b=this.$element.closest('[data-toggle="buttons"]');if(b.length){var c=this.$element.find("input");c.prop("type")=="radio"&&(c.prop("checked")&&this.$element.hasClass("active")?a=!1:b.find(".active").removeClass("active")),a&&c.prop("checked",!this.$element.hasClass("active")).trigger("change")}a&&this.$element.toggleClass("active")};var c=a.fn.button;a.fn.button=function(c){return this.each(function(){var d=a(this),e=d.data("bs.button"),f=typeof c=="object"&&c;e\|\|d.data("bs.button",e=new b(this,f)),c=="toggle"?e.toggle():c&&e.setState(c)})},a.fn.button.Constructor=b,a.fn.button.noConflict=function(){return a.fn.button=c,this},a(document).on("click.bs.button.data-api","[data-toggle^=button]",function(b){var c=a(b.target);c.hasClass("btn")\|\|(c=c.closest(".btn")),c.button("toggle"),b.preventDefault()})}(jQuery),+function(a){"use strict";var b=function(b,c){this.$element=a(b),this.$indicators=this.$element.find(".carousel-indicators"),this.options=c,this.paused=this.sliding=this.interval=this.$active=this.$items=null,this.options.pause=="hover"&&this.$element.on("mouseenter",a.proxy(this.pause,this)).on("mouseleave",a.proxy(this.cycle,this))};b.DEFAULTS={interval:5e3,pause:"hover",wrap:!0},b.prototype.cycle=function(b){return b\|\|(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(a.proxy(this.next,this),this.options.interval)),this},b.prototype.getActiveIndex=function(){return this.$active=this.$element.find(".item.active"),this.$items=this.$active.parent().children(),this.$items.index(this.$active)},b.prototype.to=function(b){var c=this,d=this.getActiveIndex();if(b>this.$items.length-1\|\|b<0)return;return this.sliding?this.$element.one("slid.bs.carousel",function(){c.to(b)}):d==b?this.pause().cycle():this.slide(b>d?"next":"prev",a(this.$items[b]))},b.prototype.pause=function(b){return b\|\|(this.paused=!0),this.$element.find(".next, .prev").length&&a.support.transition&&(this.$element.trigger(a.support.transition.end),this.cycle(!0)),this.interval=clearInterval(this.interval),this},b.prototype.next=function(){if(this.sliding)return;return this.slide("next")},b.prototype.prev=function(){if(this.sliding)return;return this.slide("prev")},b.prototype.slide=function(b,c){var d=this.$element.find(".item.active"),e=c\|\|d[b](),f=this.interval,g=b=="next"?"left":"right",h=b=="next"?"first":"last",i=this;if(!e.length){if(!this.options.wrap)return;e=this.$element.find(".item")[h]()}if(e.hasClass("active"))return this.sliding=!1;var j=a.Event("slide.bs.carousel",{relatedTarget:e[0],direction:g});this.$element.trigger(j);if(j.isDefaultPrevented())return;return this.sliding=!0,f&&this.pause(),this.$indicators.length&&(this.$indicators.find(".active").removeClass("active"),this.$element.one("slid.bs.carousel",function(){var b=a(i.$indicators.children()[i.getActiveIndex()]);b&&b.addClass("active")})),a.support.transition&&this.$element.hasClass("slide")?(e.addClass(b),e[0].offsetWidth,d.addClass(g),e.addClass(g),d.one(a.support.transition.end,function(){e.removeClass([b,g].join(" ")).addClass("active"),d.removeClass(["active",g].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger("slid.bs.carousel")},0)}).emulateTransitionEnd(d.css("transition-duration").slice(0,-1)1e3)):(d.removeClass("active"),e.addClass("active"),this.sliding=!1,this.$element.trigger("slid.bs.carousel")),f&&this.cycle(),this};var c=a.fn.carousel;a.fn.carousel=function(c){return this.each(function(){var d=a(this),e=d.data("bs.carousel"),f=a.extend({},b.DEFAULTS,d.data(),typeof c=="object"&&c),g=typeof c=="string"?c:f.slide;e\|\|d.data("bs.carousel",e=new b(this,f)),typeof c=="number"?e.to(c):g?e[g]():f.interval&&e.pause().cycle()})},a.fn.carousel.Constructor=b,a.fn.carousel.noConflict=function(){return a.fn.carousel=c,this},a(document).on("click.bs.carousel.data-api","[data-slide], [data-slide-to]",function(b){var c=a(this),d,e=a(c.attr("data-target")\|\|(d=c.attr("href"))&&d.replace(/.(?=#[^\s]+$)/,"")),f=a.extend({},e.data(),c.data()),g=c.attr("data-slide-to");g&&(f.interval=!1),e.carousel(f),(g=c.attr("data-slide-to"))&&e.data("bs.carousel").to(g),b.preventDefault()}),a(window).on("load",function(){a('[data-ride="carousel"]').each(function(){var b=a(this);b.carousel(b.data())})})}(jQuery),+function(a){function e(d){a(b).remove(),a(c).each(function(){var b=f(a(this)),c={relatedTarget:this};if(!b.hasClass("open"))return;b.trigger(d=a.Event("hide.bs.dropdown",c));if(d.isDefaultPrevented())return;b.removeClass("open").trigger("hidden.bs.dropdown",c)})}function f(b){var c=b.attr("data-target");c\|\|(c=b.attr("href"),c=c&&/#[A-Za-z]/.test(c)&&c.replace(/.(?=#[^\s]$)/,""));var d=c&&a(c);return d&&d.length?d:b.parent()}"use strict";var b=".dropdown-backdrop",c="[data-toggle=dropdown]",d=function(b){a(b).on("click.bs.dropdown",this.toggle)};d.prototype.toggle=function(b){var c=a(this);if(c.is(".disabled, :disabled"))return;var d=f(c),g=d.hasClass("open");e();if(!g){"ontouchstart"in document.documentElement&&!d.closest(".navbar-nav").length&&a('<div class="dropdown-backdrop"/>').insertAfter(a(this)).on("click",e);var h={relatedTarget:this};d.trigger(b=a.Event("show.bs.dropdown",h));if(b.isDefaultPrevented())return;d.toggleClass("open").trigger("shown.bs.dropdown",h),c.focus()}return!1},d.prototype.keydown=function(b){if(!/(38\|40\|27)/.test(b.keyCode))return;var d=a(this);b.preventDefault(),b.stopPropagation();if(d.is(".disabled, :disabled"))return;var e=f(d),g=e.hasClass("open");if(!g\|\|g&&b.keyCode==27)return b.which==27&&e.find(c).focus(),d.click();var h=" li:not(.divider):visible a",i=e.find("[role=menu]"+h+", [role=listbox]"+h);if(!i.length)return;var j=i.index(i.filter(":focus"));b.keyCode==38&&j>0&&j--,b.keyCode==40&&j<i.length-1&&j++,~j\|\|(j=0),i.eq(j).focus()};var g=a.fn.dropdown;a.fn.dropdown=function(b){return this.each(function(){var c=a(this),e=c.data("bs.dropdown");e\|\|c.data("bs.dropdown",e=new d(this)),typeof b=="string"&&e[b].call(c)})},a.fn.dropdown.Constructor=d,a.fn.dropdown.noConflict=function(){return a.fn.dropdown=g,this},a(document).on("click.bs.dropdown.data-api",e).on("click.bs.dropdown.data-api",".dropdown form",function(a){a.stopPropagation()}).on("click.bs.dropdown.data-api",c,d.prototype.toggle).on("keydown.bs.dropdown.data-api",c+", [role=menu], [role=listbox]",d.prototype.keydown)}(jQuery),+function(a){"use strict";var b=function(b,c){this.options=c,this.$element=a(b),this.$backdrop=this.isShown=null,this.options.remote&&this.$element.find(".modal-content").load(this.options.remote,a.proxy(function(){this.$element.trigger("loaded.bs.modal")},this))};b.DEFAULTS={backdrop:!0,keyboard:!0,show:!0},b.prototype.toggle=function(a){return this[this.isShown?"hide":"show"](a)},b.prototype.show=function(b){var c=this,d=a.Event("show.bs.modal",{relatedTarget:b});this.$element.trigger(d);if(this.isShown\|\|d.isDefaultPrevented())return;this.isShown=!0,this.escape(),this.$element.on("click.dismiss.bs.modal",'[data-dismiss="modal"]',a.proxy(this.hide,this)),this.backdrop(function(){var d=a.support.transition&&c.$element.hasClass("fade");c.$element.parent().length\|\|c.$element.appendTo(document.body),c.$element.show().scrollTop(0),d&&c.$element[0].offsetWidth,c.$element.addClass("in").attr("aria-hidden",!1),c.enforceFocus();var e=a.Event("shown.bs.modal",{relatedTarget:b});d?c.$element.find(".modal-dialog").one(a.support.transition.end,function(){c.$element.focus().trigger(e)}).emulateTransitionEnd(300):c.$element.focus().trigger(e)})},b.prototype.hide=function(b){b&&b.preventDefault(),b=a.Event("hide.bs.modal"),this.$element.trigger(b);if(!this.isShown\|\|b.isDefaultPrevented())return;this.isShown=!1,this.escape(),a(document).off("focusin.bs.modal"),this.$element.removeClass("in").attr("aria-hidden",!0).off("click.dismiss.bs.modal"),a.support.transition&&this.$element.hasClass("fade")?this.$element.one(a.support.transition.end,a.proxy(this.hideModal,this)).emulateTransitionEnd(300):this.hideModal()},b.prototype.enforceFocus=function(){a(document).off("focusin.bs.modal").on("focusin.bs.modal",a.proxy(function(a){this.$element[0]!==a.target&&!this.$element.has(a.target).length&&this.$element.focus()},this))},b.prototype.escape=function(){this.isShown&&this.options.keyboard?this.$element.on("keyup.dismiss.bs.modal",a.proxy(function(a){a.which==27&&this.hide()},this)):this.isShown\|\|this.$element.off("keyup.dismiss.bs.modal")},b.prototype.hideModal=function(){var a=this;this.$element.hide(),this.backdrop(function(){a.removeBackdrop(),a.$element.trigger("hidden.bs.modal")})},b.prototype.removeBackdrop=function(){this.$backdrop&&this.$backdrop.remove(),this.$backdrop=null},b.prototype.backdrop=function(b){var c=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var d=a.support.transition&&c;this.$backdrop=a('<div class="modal-backdrop '+c+'" />').appendTo(document.body),this.$element.on("click.dismiss.bs.modal",a.proxy(function(a){if(a.target!==a.currentTarget)return;this.options.backdrop=="static"?this.$element[0].focus.call(this.$element[0]):this.hide.call(this)},this)),d&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in");if(!b)return;d?this.$backdrop.one(a.support.transition.end,b).emulateTransitionEnd(150):b()}else!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one(a.support.transition.end,b).emulateTransitionEnd(150):b()):b&&b()};var c=a.fn.modal;a.fn.modal=function(c,d){return this.each(function(){var e=a(this),f=e.data("bs.modal"),g=a.extend({},b.DEFAULTS,e.data(),typeof c=="object"&&c);f\|\|e.data("bs.modal",f=new b(this,g)),typeof c=="string"?f[c](d):g.show&&f.show(d)})},a.fn.modal.Constructor=b,a.fn.modal.noConflict=function(){return a.fn.modal=c,this},a(document).on("click.bs.modal.data-api",'[data-toggle="modal"]',function(b){var c=a(this),d=c.attr("href"),e=a(c.attr("data-target")\|\|d&&d.replace(/.(?=#[^\s]+$)/,"")),f=e.data("bs.modal")?"toggle":a.extend({remote:!/#/.test(d)&&d},e.data(),c.data());c.is("a")&&b.preventDefault(),e.modal(f,this).one("hide",function(){c.is(":visible")&&c.focus()})}),a(document).on("show.bs.modal",".modal",function(){a(document.body).addClass("modal-open")}).on("hidden.bs.modal",".modal",function(){a(document.body).removeClass("modal-open")})}(jQuery),+function(a){"use strict";var b=function(a,b){this.type=this.options=this.enabled=this.timeout=this.hoverState=this.$element=null,this.init("tooltip",a,b)};b.DEFAULTS={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,container:!1},b.prototype.init=function(b,c,d){this.enabled=!0,this.type=b,this.$element=a(c),this.options=this.getOptions(d);var e=this.options.trigger.split(" ");for(var f=e.length;f--;){var g=e[f];if(g=="click")this.$element.on("click."+this.type,this.options.selector,a.proxy(this.toggle,this));else if(g!="manual"){var h=g=="hover"?"mouseenter":"focusin",i=g=="hover"?"mouseleave":"focusout";this.$element.on(h+"."+this.type,this.options.selector,a.proxy(this.enter,this)),this.$element.on(i+"."+this.type,this.options.selector,a.proxy(this.leave,this))}}this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},b.prototype.getDefaults=function(){return b.DEFAULTS},b.prototype.getOptions=function(b){return b=a.extend({},this.getDefaults(),this.$element.data(),b),b.delay&&typeof b.delay=="number"&&(b.delay={show:b.delay,hide:b.delay}),b},b.prototype.getDelegateOptions=function(){var b={},c=this.getDefaults();return this._options&&a.each(this._options,function(a,d){c[a]!=d&&(b[a]=d)}),b},b.prototype.enter=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget)[this.type](this.getDelegateOptions()).data("bs."+this.type);clearTimeout(c.timeout),c.hoverState="in";if(!c.options.delay\|\|!c.options.delay.show)return c.show();c.timeout=setTimeout(function(){c.hoverState=="in"&&c.show()},c.options.delay.show)},b.prototype.leave=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget)[this.type](this.getDelegateOptions()).data("bs."+this.type);clearTimeout(c.timeout),c.hoverState="out";if(!c.options.delay\|\|!c.options.delay.hide)return c.hide();c.timeout=setTimeout(function(){c.hoverState=="out"&&c.hide()},c.options.delay.hide)},b.prototype.show=function(){var b=a.Event("show.bs."+this.type);if(this.hasContent()&&this.enabled){this.$element.trigger(b);if(b.isDefaultPrevented())return;var c=this,d=this.tip();this.setContent(),this.options.animation&&d.addClass("fade");var e=typeof this.options.placement=="function"?this.options.placement.call(this,d[0],this.$element[0]):this.options.placement,f=/\s?auto?\s?/i,g=f.test(e);g&&(e=e.replace(f,"")\|\|"top"),d.detach().css({top:0,left:0,display:"block"}).addClass(e),this.options.container?d.appendTo(this.options.container):d.insertAfter(this.$element);var h=this.getPosition(),i=d[0].offsetWidth,j=d[0].offsetHeight;if(g){var k=this.$element.parent(),l=e,m=document.documentElement.scrollTop\|\|document.body.scrollTop,n=this.options.container=="body"?window.innerWidth:k.outerWidth(),o=this.options.container=="body"?window.innerHeight:k.outerHeight(),p=this.options.container=="body"?0:k.offset().left;e=e=="bottom"&&h.top+h.height+j-m>o?"top":e=="top"&&h.top-m-j<0?"bottom":e=="right"&&h.right+i>n?"left":e=="left"&&h.left-i<p?"right":e,d.removeClass(l).addClass(e)}var q=this.getCalculatedOffset(e,h,i,j);this.applyPlacement(q,e),this.hoverState=null;var r=function(){c.$element.trigger("shown.bs."+c.type)};a.support.transition&&this.$tip.hasClass("fade")?d.one(a.support.transition.end,r).emulateTransitionEnd(150):r()}},b.prototype.applyPlacement=function(b,c){var d,e=this.tip(),f=e[0].offsetWidth,g=e[0].offsetHeight,h=parseInt(e.css("margin-top"),10),i=parseInt(e.css("margin-left"),10);isNaN(h)&&(h=0),isNaN(i)&&(i=0),b.top=b.top+h,b.left=b.left+i,a.offset.setOffset(e[0],a.extend({using:function(a){e.css({top:Math.round(a.top),left:Math.round(a.left)})}},b),0),e.addClass("in");var j=e[0].offsetWidth,k=e[0].offsetHeight;c=="top"&&k!=g&&(d=!0,b.top=b.top+g-k);if(/bottom\|top/.test(c)){var l=0;b.left<0&&(l=b.left-2,b.left=0,e.offset(b),j=e[0].offsetWidth,k=e[0].offsetHeight),this.replaceArrow(l-f+j,j,"left")}else this.replaceArrow(k-g,k,"top");d&&e.offset(b)},b.prototype.replaceArrow=function(a,b,c){this.arrow().css(c,a?50(1-a/b)+"%":"")},b.prototype.setContent=function(){var a=this.tip(),b=this.getTitle();a.find(".tooltip-inner")[this.options.html?"html":"text"](b),a.removeClass("fade in top bottom left right")},b.prototype.hide=function(){function e(){b.hoverState!="in"&&c.detach(),b.$element.trigger("hidden.bs."+b.type)}var b=this,c=this.tip(),d=a.Event("hide.bs."+this.type);this.$element.trigger(d);if(d.isDefaultPrevented())return;return c.removeClass("in"),a.support.transition&&this.$tip.hasClass("fade")?c.one(a.support.transition.end,e).emulateTransitionEnd(150):e(),this.hoverState=null,this},b.prototype.fixTitle=function(){var a=this.$element;(a.attr("title")\|\|typeof a.attr("data-original-title")!="string")&&a.attr("data-original-title",a.attr("title")\|\|"").attr("title","")},b.prototype.hasContent=function(){return this.getTitle()},b.prototype.getPosition=function(){var b=this.$element[0];return a.extend({},typeof b.getBoundingClientRect=="function"?b.getBoundingClientRect():{width:b.offsetWidth,height:b.offsetHeight},this.$element.offset())},b.prototype.getCalculatedOffset=function(a,b,c,d){return a=="bottom"?{top:b.top+b.height,left:b.left+b.width/2-c/2}:a=="top"?{top:b.top-d,left:b.left+b.width/2-c/2}:a=="left"?{top:b.top+b.height/2-d/2,left:b.left-c}:{top:b.top+b.height/2-d/2,left:b.left+b.width}},b.prototype.getTitle=function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")\|\|(typeof c.title=="function"?c.title.call(b[0]):c.title),a},b.prototype.tip=function(){return this.$tip=this.$tip\|\|a(this.options.template)},b.prototype.arrow=function(){return this.$arrow=this.$arrow\|\|this.tip().find(".tooltip-arrow")},b.prototype.validate=function(){this.$element[0].parentNode\|\|(this.hide(),this.$element=null,this.options=null)},b.prototype.enable=function(){this.enabled=!0},b.prototype.disable=function(){this.enabled=!1},b.prototype.toggleEnabled=function(){this.enabled=!this.enabled},b.prototype.toggle=function(b){var c=b?a(b.currentTarget)[this.type](this.getDelegateOptions()).data("bs."+this.type):this;c.tip().hasClass("in")?c.leave(c):c.enter(c)},b.prototype.destroy=function(){clearTimeout(this.timeout),this.hide().$element.off("."+this.type).removeData("bs."+this.type)};var c=a.fn.tooltip;a.fn.tooltip=function(c){return this.each(function(){var d=a(this),e=d.data("bs.tooltip"),f=typeof c=="object"&&c;if(!e&&c=="destroy")return;e\|\|d.data("bs.tooltip",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.tooltip.Constructor=b,a.fn.tooltip.noConflict=function(){return a.fn.tooltip=c,this}}(jQuery),+function(a){"use strict";var b=function(a,b){this.init("popover",a,b)};if(!a.fn.tooltip)throw new Error("Popover requires tooltip.js");b.DEFAULTS=a.extend({},a.fn.tooltip.Constructor.DEFAULTS,{placement:"right",trigger:"click",content:"",template:'<div class="popover"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'}),b.prototype=a.extend({},a.fn.tooltip.Constructor.prototype),b.prototype.constructor=b,b.prototype.getDefaults=function(){return b.DEFAULTS},b.prototype.setContent=function(){var a=this.tip(),b=this.getTitle(),c=this.getContent();a.find(".popover-title")[this.options.html?"html":"text"](b),a.find(".popover-content")[this.options.html?typeof c=="string"?"html":"append":"text"](c),a.removeClass("fade top bottom left right in"),a.find(".popover-title").html()\|\|a.find(".popover-title").hide()},b.prototype.hasContent=function(){return this.getTitle()\|\|this.getContent()},b.prototype.getContent=function(){var a=this.$element,b=this.options;return a.attr("data-content")\|\|(typeof b.content=="function"?b.content.call(a[0]):b.content)},b.prototype.arrow=function(){return this.$arrow=this.$arrow\|\|this.tip().find(".arrow")},b.prototype.tip=function(){return this.$tip\|\|(this.$tip=a(this.options.template)),this.$tip};var c=a.fn.popover;a.fn.popover=function(c){return this.each(function(){var d=a(this),e=d.data("bs.popover"),f=typeof c=="object"&&c;if(!e&&c=="destroy")return;e\|\|d.data("bs.popover",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.popover.Constructor=b,a.fn.popover.noConflict=function(){return a.fn.popover=c,this}}(jQuery),+function(a){"use strict";var b=function(b){this.element=a(b)};b.prototype.show=function(){var b=this.element,c=b.closest("ul:not(.dropdown-menu)"),d=b.data("target");d\|\|(d=b.attr("href"),d=d&&d.replace(/.(?=#[^\s]$)/,""));if(b.parent("li").hasClass("active"))return;var e=c.find(".active:last a")[0],f=a.Event("show.bs.tab",{relatedTarget:e});b.trigger(f);if(f.isDefaultPrevented())return;var g=a(d);this.activate(b.parent("li"),c),this.activate(g,g.parent(),function(){b.trigger({type:"shown.bs.tab",relatedTarget:e})})},b.prototype.activate=function(b,c,d){function g(){e.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),b.addClass("active"),f?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu")&&b.closest("li.dropdown").addClass("active"),d&&d()}var e=c.find("> .active"),f=d&&a.support.transition&&e.hasClass("fade");f?e.one(a.support.transition.end,g).emulateTransitionEnd(150):g(),e.removeClass("in")};var c=a.fn.tab;a.fn.tab=function(c){return this.each(function(){var d=a(this),e=d.data("bs.tab");e\|\|d.data("bs.tab",e=new b(this)),typeof c=="string"&&e[c]()})},a.fn.tab.Constructor=b,a.fn.tab.noConflict=function(){return a.fn.tab=c,this},a(document).on("click.bs.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(b){b.preventDefault(),a(this).tab("show")})}(jQuery),+function(a){"use strict";var b=function(c,d){this.options=a.extend({},b.DEFAULTS,d),this.$window=a(window).on("scroll.bs.affix.data-api",a.proxy(this.checkPosition,this)).on("click.bs.affix.data-api",a.proxy(this.checkPositionWithEventLoop,this)),this.$element=a(c),this.affixed=this.unpin=this.pinnedOffset=null,this.checkPosition()};b.RESET="affix affix-top affix-bottom",b.DEFAULTS={offset:0},b.prototype.getPinnedOffset=function(){if(this.pinnedOffset)return this.pinnedOffset;this.$element.removeClass(b.RESET).addClass("affix");var a=this.$window.scrollTop(),c=this.$element.offset();return this.pinnedOffset=c.top-a},b.prototype.checkPositionWithEventLoop=function(){setTimeout(a.proxy(this.checkPosition,this),1)},b.prototype.checkPosition=function(){if(!this.$element.is(":visible"))return;var c=a(document).height(),d=this.$window.scrollTop(),e=this.$element.offset(),f=this.options.offset,g=f.top,h=f.bottom;this.affixed=="top"&&(e.top+=d),typeof f!="object"&&(h=g=f),typeof g=="function"&&(g=f.top(this.$element)),typeof h=="function"&&(h=f.bottom(this.$element));var i=this.unpin!=null&&d+this.unpin<=e.top?!1:h!=null&&e.top+this.$element.height()>=c-h?"bottom":g!=null&&d<=g?"top":!1;if(this.affixed===i)return;this.unpin&&this.$element.css("top","");var j="affix"+(i?"-"+i:""),k=a.Event(j+".bs.affix");this.$element.trigger(k);if(k.isDefaultPrevented())return;this.affixed=i,this.unpin=i=="bottom"?this.getPinnedOffset():null,this.$element.removeClass(b.RESET).addClass(j).trigger(a.Event(j.replace("affix","affixed"))),i=="bottom"&&this.$element.offset({top:c-h-this.$element.height()})};var c=a.fn.affix;a.fn.affix=function(c){return this.each(function(){var d=a(this),e=d.data("bs.affix"),f=typeof c=="object"&&c;e\|\|d.data("bs.affix",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.affix.Constructor=b,a.fn.affix.noConflict=function(){return a.fn.affix=c,this},a(window).on("load",function(){a('[data-spy="affix"]').each(function(){var b=a(this),c=b.data();c.offset=c.offset\|\|{},c.offsetBottom&&(c.offset.bottom=c.offsetBottom),c.offsetTop&&(c.offset.top=c.offsetTop),b.affix(c)})})}(jQuery),+function(a){"use strict";var b=function(c,d){this.$element=a(c),this.options=a.extend({},b.DEFAULTS,d),this.transitioning=null,this.options.parent&&(this.$parent=a(this.options.parent)),this.options.toggle&&this.toggle()};b.DEFAULTS={toggle:!0},b.prototype.dimension=function(){var a=this.$element.hasClass("width");return a?"width":"height"},b.prototype.show=function(){if(this.transitioning\|\|this.$element.hasClass("in"))return;var b=a.Event("show.bs.collapse");this.$element.trigger(b);if(b.isDefaultPrevented())return;var c=this.$parent&&this.$parent.find("> .panel > .in");if(c&&c.length){var d=c.data("bs.collapse");if(d&&d.transitioning)return;c.collapse("hide"),d\|\|c.data("bs.collapse",null)}var e=this.dimension();this.$element.removeClass("collapse").addClass("collapsing")[e](0),this.transitioning=1;var f=function(){this.$element.removeClass("collapsing").addClass("collapse in")[e]("auto"),this.transitioning=0,this.$element.trigger("shown.bs.collapse")};if(!a.support.transition)return f.call(this);var g=a.camelCase(["scroll",e].join("-"));this.$element.one(a.support.transition.end,a.proxy(f,this)).emulateTransitionEnd(350)[e](this.$element[0][g])},b.prototype.hide=function(){if(this.transitioning\|\|!this.$element.hasClass("in"))return;var b=a.Event("hide.bs.collapse");this.$element.trigger(b);if(b.isDefaultPrevented())return;var c=this.dimension();this.$element[c](this.$element[c]())[0].offsetHeight,this.$element.addClass("collapsing").removeClass("collapse").removeClass("in"),this.transitioning=1;var d=function(){this.transitioning=0,this.$element.trigger("hidden.bs.collapse").removeClass("collapsing").addClass("collapse")};if(!a.support.transition)return d.call(this);this.$element[c](0).one(a.support.transition.end,a.proxy(d,this)).emulateTransitionEnd(350)},b.prototype.toggle=function(){this[this.$element.hasClass("in")?"hide":"show"]()};var c=a.fn.collapse;a.fn.collapse=function(c){return this.each(function(){var d=a(this),e=d.data("bs.collapse"),f=a.extend({},b.DEFAULTS,d.data(),typeof c=="object"&&c);!e&&f.toggle&&c=="show"&&(c=!c),e\|\|d.data("bs.collapse",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.collapse.Constructor=b,a.fn.collapse.noConflict=function(){return a.fn.collapse=c,this},a(document).on("click.bs.collapse.data-api","[data-toggle=collapse]",function(b){var c=a(this),d,e=c.attr("data-target")\|\|b.preventDefault()\|\|(d=c.attr("href"))&&d.replace(/.(?=#[^\s]+$)/,""),f=a(e),g=f.data("bs.collapse"),h=g?"toggle":c.data(),i=c.attr("data-parent"),j=i&&a(i);if(!g\|\|!g.transitioning)j&&j.find('[data-toggle=collapse][data-parent="'+i+'"]').not(c).addClass("collapsed"),c[f.hasClass("in")?"addClass":"removeClass"]("collapsed");f.collapse(h)})}(jQuery),+function(a){function b(c,d){var e,f=a.proxy(this.process,this);this.$element=a(c).is("body")?a(window):a(c),this.$body=a("body"),this.$scrollElement=this.$element.on("scroll.bs.scroll-spy.data-api",f),this.options=a.extend({},b.DEFAULTS,d),this.selector=(this.options.target\|\|(e=a(c).attr("href"))&&e.replace(/.*(?=#[^\s]+$)/,"")\|\|"")+" .nav li > a",this.offsets=a([]),this.targets=a([]),this.activeTarget=null,this.refresh(),this.process()}"use strict",b.DEFAULTS={offset:10},b.prototype.refresh=function(){var b=this.$element[0]==window?"offset":"position";this.offsets=a([]),this.targets=a([]);var c=this,d=this.$body.find(this.selector).map(function(){var d=a(this),e=d.data("target")\|\|d.attr("href"),f=/^#./.test(e)&&a(e);return f&&f.length&&f.is(":visible")&&[[f[b]().top+(!a.isWindow(c.$scrollElement.get(0))&&c.$scrollElement.scrollTop()),e]]\|\|null}).sort(function(a,b){return a[0]-b[0]}).each(function(){c.offsets.push(this[0]),c.targets.push(this[1])})},b.prototype.process=function(){var a=this.$scrollElement.scrollTop()+this.options.offset,b=this.$scrollElement[0].scrollHeight\|\|this.$body[0].scrollHeight,c=b-this.$scrollElement.height(),d=this.offsets,e=this.targets,f=this.activeTarget,g;if(a>=c)return f!=(g=e.last()[0])&&this.activate(g);if(f&&a<=d[0])return f!=(g=e[0])&&this.activate(g);for(g=d.length;g--;)f!=e[g]&&a>=d[g]&&(!d[g+1]\|\|a<=d[g+1])&&this.activate(e[g])},b.prototype.activate=function(b){this.activeTarget=b,a(this.selector).parentsUntil(this.options.target,".active").removeClass("active");var c=this.selector+'[data-target="'+b+'"],'+this.selector+'[href="'+b+'"]',d=a(c).parents("li").addClass("active");d.parent(".dropdown-menu").length&&(d=d.closest("li.dropdown").addClass("active")),d.trigger("activate.bs.scrollspy")};var c=a.fn.scrollspy;a.fn.scrollspy=function(c){return this.each(function(){var d=a(this),e=d.data("bs.scrollspy"),f=typeof c=="object"&&c;e\|\|d.data("bs.scrollspy",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.scrollspy.Constructor=b,a.fn.scrollspy.noConflict=function(){return a.fn.scrollspy=c,this},a(window).on("load",function(){a('[data-spy="scroll"]').each(function(){var b=a(this);b.scrollspy(b.data())})})}(jQuery),+function(a){function b(){var a=document.createElement("bootstrap"),b={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var c in b)if(a.style[c]!==undefined)return{end:b[c]};return!1}"use strict",a.fn.emulateTransitionEnd=function(b){var c=!1,d=this;a(this).one(a.support.transition.end,function(){c=!0});var e=function(){c\|\|a(d).trigger(a.support.transition.end)};return setTimeout(e,b),this},a(function(){a.support.transition=b()})}(jQuery)

assets/ie-fix/html5shiv.min.js ADDED Viewed

	@@ -0,0 +1 @@

assets/ie-fix/respond.js ADDED Viewed

	@@ -0,0 +1,224 @@


1	+ /! matchMedia() polyfill - Test a CSS media type/query in JS. Authors & copyright (c) 2012: Scott Jehl, Paul Irish, Nicholas Zakas. Dual MIT/BSD license /
2	+ /! NOTE: If you're already including a window.matchMedia polyfill via Modernizr or otherwise, you don't need this part /
3	+ (function(w) {
4	+ "use strict";
5	+ w.matchMedia = w.matchMedia \|\| function(doc, undefined) {
6	+ var bool, docElem = doc.documentElement, refNode = docElem.firstElementChild \|\| docElem.firstChild, fakeBody = doc.createElement("body"), div = doc.createElement("div");
7	+ div.id = "mq-test-1";
8	+ div.style.cssText = "position:absolute;top:-100em";
9	+ fakeBody.style.background = "none";
10	+ fakeBody.appendChild(div);
11	+ return function(q) {
12	+ div.innerHTML = '<style media="' + q + '"> #mq-test-1 { width: 42px; }</style>';
13	+ docElem.insertBefore(fakeBody, refNode);
14	+ bool = div.offsetWidth === 42;
15	+ docElem.removeChild(fakeBody);
16	+ return {
17	+ matches: bool,
18	+ media: q
19	+ };
20	+ };
21	+ }(w.document);
22	+ })(this);
23	+
24	+ /! Respond.js v1.4.0: min/max-width media query polyfill. (c) Scott Jehl. MIT Lic. j.mp/respondjs /
25	+ (function(w) {
26	+ "use strict";
27	+ var respond = {};
28	+ w.respond = respond;
29	+ respond.update = function() {};
30	+ var requestQueue = [], xmlHttp = function() {
31	+ var xmlhttpmethod = false;
32	+ try {
33	+ xmlhttpmethod = new w.XMLHttpRequest();
34	+ } catch (e) {
35	+ xmlhttpmethod = new w.ActiveXObject("Microsoft.XMLHTTP");
36	+ }
37	+ return function() {
38	+ return xmlhttpmethod;
39	+ };
40	+ }(), ajax = function(url, callback) {
41	+ var req = xmlHttp();
42	+ if (!req) {
43	+ return;
44	+ }
45	+ req.open("GET", url, true);
46	+ req.onreadystatechange = function() {
47	+ if (req.readyState !== 4 \|\| req.status !== 200 && req.status !== 304) {
48	+ return;
49	+ }
50	+ callback(req.responseText);
51	+ };
52	+ if (req.readyState === 4) {
53	+ return;
54	+ }
55	+ req.send(null);
56	+ };
57	+ respond.ajax = ajax;
58	+ respond.queue = requestQueue;
59	+ respond.regex = {
60	+ media: /@media[^\{]+\{([^\{\}]\{[^\}\{]\})+/gi,
61	+ keyframes: /@(?:\-(?:o\|moz\|webkit)\-)?keyframes[^\{]+\{(?:[^\{\}]\{[^\}\{]\})+[^\}]*\}/gi,
62	+ urls: /(url$)['"]?([^\/$'"][^:\)'"]+)['"]?(\))/g,
63	+ findStyles: /@media *([^\{]+)\{([\S\s]+?)$/,
64	+ only: /(only\s+)?([a-zA-Z]+)\s?/,
65	+ minw: /$[\s]min\-width\s:[\s]([\s][0-9\.]+)(px\|em)[\s]*$/,
66	+ maxw: /$[\s]max\-width\s:[\s]([\s][0-9\.]+)(px\|em)[\s]*$/
67	+ };
68	+ respond.mediaQueriesSupported = w.matchMedia && w.matchMedia("only all") !== null && w.matchMedia("only all").matches;
69	+ if (respond.mediaQueriesSupported) {
70	+ return;
71	+ }
72	+ var doc = w.document, docElem = doc.documentElement, mediastyles = [], rules = [], appendedEls = [], parsedSheets = {}, resizeThrottle = 30, head = doc.getElementsByTagName("head")[0] \|\| docElem, base = doc.getElementsByTagName("base")[0], links = head.getElementsByTagName("link"), lastCall, resizeDefer, eminpx, getEmValue = function() {
73	+ var ret, div = doc.createElement("div"), body = doc.body, originalHTMLFontSize = docElem.style.fontSize, originalBodyFontSize = body && body.style.fontSize, fakeUsed = false;
74	+ div.style.cssText = "position:absolute;font-size:1em;width:1em";
75	+ if (!body) {
76	+ body = fakeUsed = doc.createElement("body");
77	+ body.style.background = "none";
78	+ }
79	+ docElem.style.fontSize = "100%";
80	+ body.style.fontSize = "100%";
81	+ body.appendChild(div);
82	+ if (fakeUsed) {
83	+ docElem.insertBefore(body, docElem.firstChild);
84	+ }
85	+ ret = div.offsetWidth;
86	+ if (fakeUsed) {
87	+ docElem.removeChild(body);
88	+ } else {
89	+ body.removeChild(div);
90	+ }
91	+ docElem.style.fontSize = originalHTMLFontSize;
92	+ if (originalBodyFontSize) {
93	+ body.style.fontSize = originalBodyFontSize;
94	+ }
95	+ ret = eminpx = parseFloat(ret);
96	+ return ret;
97	+ }, applyMedia = function(fromResize) {
98	+ var name = "clientWidth", docElemProp = docElem[name], currWidth = doc.compatMode === "CSS1Compat" && docElemProp \|\| doc.body[name] \|\| docElemProp, styleBlocks = {}, lastLink = links[links.length - 1], now = new Date().getTime();
99	+ if (fromResize && lastCall && now - lastCall < resizeThrottle) {
100	+ w.clearTimeout(resizeDefer);
101	+ resizeDefer = w.setTimeout(applyMedia, resizeThrottle);
102	+ return;
103	+ } else {
104	+ lastCall = now;
105	+ }
106	+ for (var i in mediastyles) {
107	+ if (mediastyles.hasOwnProperty(i)) {
108	+ var thisstyle = mediastyles[i], min = thisstyle.minw, max = thisstyle.maxw, minnull = min === null, maxnull = max === null, em = "em";
109	+ if (!!min) {
110	+ min = parseFloat(min) * (min.indexOf(em) > -1 ? eminpx \|\| getEmValue() : 1);
111	+ }
112	+ if (!!max) {
113	+ max = parseFloat(max) * (max.indexOf(em) > -1 ? eminpx \|\| getEmValue() : 1);
114	+ }
115	+ if (!thisstyle.hasquery \|\| (!minnull \|\| !maxnull) && (minnull \|\| currWidth >= min) && (maxnull \|\| currWidth <= max)) {
116	+ if (!styleBlocks[thisstyle.media]) {
117	+ styleBlocks[thisstyle.media] = [];
118	+ }
119	+ styleBlocks[thisstyle.media].push(rules[thisstyle.rules]);
120	+ }
121	+ }
122	+ }
123	+ for (var j in appendedEls) {
124	+ if (appendedEls.hasOwnProperty(j)) {
125	+ if (appendedEls[j] && appendedEls[j].parentNode === head) {
126	+ head.removeChild(appendedEls[j]);
127	+ }
128	+ }
129	+ }
130	+ appendedEls.length = 0;
131	+ for (var k in styleBlocks) {
132	+ if (styleBlocks.hasOwnProperty(k)) {
133	+ var ss = doc.createElement("style"), css = styleBlocks[k].join("\n");
134	+ ss.type = "text/css";
135	+ ss.media = k;
136	+ head.insertBefore(ss, lastLink.nextSibling);
137	+ if (ss.styleSheet) {
138	+ ss.styleSheet.cssText = css;
139	+ } else {
140	+ ss.appendChild(doc.createTextNode(css));
141	+ }
142	+ appendedEls.push(ss);
143	+ }
144	+ }
145	+ }, translate = function(styles, href, media) {
146	+ var qs = styles.replace(respond.regex.keyframes, "").match(respond.regex.media), ql = qs && qs.length \|\| 0;
147	+ href = href.substring(0, href.lastIndexOf("/"));
148	+ var repUrls = function(css) {
149	+ return css.replace(respond.regex.urls, "$1" + href + "$2$3");
150	+ }, useMedia = !ql && media;
151	+ if (href.length) {
152	+ href += "/";
153	+ }
154	+ if (useMedia) {
155	+ ql = 1;
156	+ }
157	+ for (var i = 0; i < ql; i++) {
158	+ var fullq, thisq, eachq, eql;
159	+ if (useMedia) {
160	+ fullq = media;
161	+ rules.push(repUrls(styles));
162	+ } else {
163	+ fullq = qs[i].match(respond.regex.findStyles) && RegExp.$1;
164	+ rules.push(RegExp.$2 && repUrls(RegExp.$2));
165	+ }
166	+ eachq = fullq.split(",");
167	+ eql = eachq.length;
168	+ for (var j = 0; j < eql; j++) {
169	+ thisq = eachq[j];
170	+ mediastyles.push({
171	+ media: thisq.split("(")[0].match(respond.regex.only) && RegExp.$2 \|\| "all",
172	+ rules: rules.length - 1,
173	+ hasquery: thisq.indexOf("(") > -1,
174	+ minw: thisq.match(respond.regex.minw) && parseFloat(RegExp.$1) + (RegExp.$2 \|\| ""),
175	+ maxw: thisq.match(respond.regex.maxw) && parseFloat(RegExp.$1) + (RegExp.$2 \|\| "")
176	+ });
177	+ }
178	+ }
179	+ applyMedia();
180	+ }, makeRequests = function() {
181	+ if (requestQueue.length) {
182	+ var thisRequest = requestQueue.shift();
183	+ ajax(thisRequest.href, function(styles) {
184	+ translate(styles, thisRequest.href, thisRequest.media);
185	+ parsedSheets[thisRequest.href] = true;
186	+ w.setTimeout(function() {
187	+ makeRequests();
188	+ }, 0);
189	+ });
190	+ }
191	+ }, ripCSS = function() {
192	+ for (var i = 0; i < links.length; i++) {
193	+ var sheet = links[i], href = sheet.href, media = sheet.media, isCSS = sheet.rel && sheet.rel.toLowerCase() === "stylesheet";
194	+ if (!!href && isCSS && !parsedSheets[href]) {
195	+ if (sheet.styleSheet && sheet.styleSheet.rawCssText) {
196	+ translate(sheet.styleSheet.rawCssText, href, media);
197	+ parsedSheets[href] = true;
198	+ } else {
199	+ if (!/^([a-zA-Z:]*\/\/)/.test(href) && !base \|\| href.replace(RegExp.$1, "").split("/")[0] === w.location.host) {
200	+ if (href.substring(0, 2) === "//") {
201	+ href = w.location.protocol + href;
202	+ }
203	+ requestQueue.push({
204	+ href: href,
205	+ media: media
206	+ });
207	+ }
208	+ }
209	+ }
210	+ }
211	+ makeRequests();
212	+ };
213	+ ripCSS();
214	+ respond.update = ripCSS;
215	+ respond.getEmValue = getEmValue;
216	+ function callMedia() {
217	+ applyMedia(true);
218	+ }
219	+ if (w.addEventListener) {
220	+ w.addEventListener("resize", callMedia, false);
221	+ } else if (w.attachEvent) {
222	+ w.attachEvent("onresize", callMedia);
223	+ }
224	+ })(this);

assets/select2/select2-bootstrap.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ .form-control .select2-choice{border:0;border-radius:2px}.form-control .select2-choice .select2-arrow{border-radius:0 2px 2px 0}.form-control.select2-container{height:auto!important;padding:0}.form-control.select2-container.select2-dropdown-open{border-color:#5897fb;border-radius:3px 3px 0 0}.form-control .select2-container.select2-dropdown-open .select2-choices{border-radius:3px 3px 0 0}.form-control.select2-container .select2-choices{border:0!important;border-radius:3px}.control-group.warning .select2-container .select2-choice,.control-group.warning .select2-container .select2-choices,.control-group.warning .select2-container-active .select2-choice,.control-group.warning .select2-container-active .select2-choices,.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,.control-group.warning .select2-container-multi.select2-container-active .select2-choices{border:1px solid #c09853!important}.control-group.warning .select2-container .select2-choice div{border-left:1px solid #c09853!important;background:#fcf8e3!important}.control-group.error .select2-container .select2-choice,.control-group.error .select2-container .select2-choices,.control-group.error .select2-container-active .select2-choice,.control-group.error .select2-container-active .select2-choices,.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,.control-group.error .select2-container-multi.select2-container-active .select2-choices{border:1px solid #b94a48!important}.control-group.error .select2-container .select2-choice div{border-left:1px solid #b94a48!important;background:#f2dede!important}.control-group.info .select2-container .select2-choice,.control-group.info .select2-container .select2-choices,.control-group.info .select2-container-active .select2-choice,.control-group.info .select2-container-active .select2-choices,.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,.control-group.info .select2-container-multi.select2-container-active .select2-choices{border:1px solid #3a87ad!important}.control-group.info .select2-container .select2-choice div{border-left:1px solid #3a87ad!important;background:#d9edf7!important}.control-group.success .select2-container .select2-choice,.control-group.success .select2-container .select2-choices,.control-group.success .select2-container-active .select2-choice,.control-group.success .select2-container-active .select2-choices,.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,.control-group.success .select2-container-multi.select2-container-active .select2-choices{border:1px solid #468847!important}.control-group.success .select2-container .select2-choice div{border-left:1px solid #468847!important;background:#dff0d8!important}

assets/select2/select2-spinner.gif ADDED Viewed

Binary file

assets/select2/select2.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ .select2-container{margin:0;position:relative;display:inline-block;zoom:1;*display:inline;vertical-align:middle}.select2-container,.select2-drop,.select2-search,.select2-search input{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.select2-container .select2-choice{display:block;height:26px;padding:0 0 0 8px;overflow:hidden;position:relative;border:1px solid #aaa;white-space:nowrap;line-height:26px;color:#444;text-decoration:none;border-radius:4px;background-clip:padding-box;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#fff;background-image:-webkit-gradient(linear,left bottom,left top,color-stop(0,#eee),color-stop(0.5,#fff));background-image:-webkit-linear-gradient(center bottom,#eee 0,#fff 50%);background-image:-moz-linear-gradient(center bottom,#eee 0,#fff 50%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff',endColorstr='#eeeeee',GradientType=0);background-image:linear-gradient(top,#fff 0,#eee 50%)}.select2-container.select2-drop-above .select2-choice{border-bottom-color:#aaa;border-radius:0 0 4px 4px;background-image:-webkit-gradient(linear,left bottom,left top,color-stop(0,#eee),color-stop(0.9,#fff));background-image:-webkit-linear-gradient(center bottom,#eee 0,#fff 90%);background-image:-moz-linear-gradient(center bottom,#eee 0,#fff 90%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff',endColorstr='#eeeeee',GradientType=0);background-image:linear-gradient(top,#eee 0,#fff 90%)}.select2-container.select2-allowclear .select2-choice .select2-chosen{margin-right:42px}.select2-container .select2-choice>.select2-chosen{margin-right:26px;display:block;overflow:hidden;white-space:nowrap;text-overflow:ellipsis}.select2-container .select2-choice abbr{display:none;width:12px;height:12px;position:absolute;right:24px;top:8px;font-size:1px;text-decoration:none;border:0;background:url('select2.png') right top no-repeat;cursor:pointer;outline:0}.select2-container.select2-allowclear .select2-choice abbr{display:inline-block}.select2-container .select2-choice abbr:hover{background-position:right -11px;cursor:pointer}.select2-drop-mask{border:0;margin:0;padding:0;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:9998;background-color:#fff;filter:alpha(opacity=0)}.select2-drop{width:100%;margin-top:-1px;position:absolute;z-index:9999;top:100%;background:#fff;color:#000;border:1px solid #aaa;border-top:0;border-radius:0 0 4px 4px;-webkit-box-shadow:0 4px 5px rgba(0,0,0,.15);box-shadow:0 4px 5px rgba(0,0,0,.15)}.select2-drop-auto-width{border-top:1px solid #aaa;width:auto}.select2-drop-auto-width .select2-search{padding-top:4px}.select2-drop.select2-drop-above{margin-top:1px;border-top:1px solid #aaa;border-bottom:0;border-radius:4px 4px 0 0;-webkit-box-shadow:0 -4px 5px rgba(0,0,0,.15);box-shadow:0 -4px 5px rgba(0,0,0,.15)}.select2-drop-active{border:1px solid #5897fb;border-top:0}.select2-drop.select2-drop-above.select2-drop-active{border-top:1px solid #5897fb}.select2-container .select2-choice .select2-arrow{display:inline-block;width:18px;height:100%;position:absolute;right:0;top:0;border-left:1px solid #aaa;border-radius:0 4px 4px 0;background-clip:padding-box;background:#ccc;background-image:-webkit-gradient(linear,left bottom,left top,color-stop(0,#ccc),color-stop(0.6,#eee));background-image:-webkit-linear-gradient(center bottom,#ccc 0,#eee 60%);background-image:-moz-linear-gradient(center bottom,#ccc 0,#eee 60%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee',endColorstr='#cccccc',GradientType=0);background-image:linear-gradient(top,#ccc 0,#eee 60%)}.select2-container .select2-choice .select2-arrow b{display:block;width:100%;height:100%;background:url('select2.png') no-repeat 0 1px}.select2-search{display:inline-block;width:100%;min-height:26px;margin:0;padding-left:4px;padding-right:4px;position:relative;z-index:10000;white-space:nowrap}.select2-search input{width:100%;height:auto!important;min-height:26px;padding:4px 20px 4px 5px;margin:0;outline:0;font-family:sans-serif;font-size:1em;border:1px solid #aaa;border-radius:0;-webkit-box-shadow:none;box-shadow:none;background:#fff url('select2.png') no-repeat 100% -22px;background:url('select2.png') no-repeat 100% -22px,-webkit-gradient(linear,left bottom,left top,color-stop(0.85,#fff),color-stop(0.99,#eee));background:url('select2.png') no-repeat 100% -22px,-webkit-linear-gradient(center bottom,#fff 85%,#eee 99%);background:url('select2.png') no-repeat 100% -22px,-moz-linear-gradient(center bottom,#fff 85%,#eee 99%);background:url('select2.png') no-repeat 100% -22px,linear-gradient(top,#fff 85%,#eee 99%)}.select2-drop.select2-drop-above .select2-search input{margin-top:4px}.select2-search input.select2-active{background:#fff url('select2-spinner.gif') no-repeat 100%;background:url('select2-spinner.gif') no-repeat 100%,-webkit-gradient(linear,left bottom,left top,color-stop(0.85,#fff),color-stop(0.99,#eee));background:url('select2-spinner.gif') no-repeat 100%,-webkit-linear-gradient(center bottom,#fff 85%,#eee 99%);background:url('select2-spinner.gif') no-repeat 100%,-moz-linear-gradient(center bottom,#fff 85%,#eee 99%);background:url('select2-spinner.gif') no-repeat 100%,linear-gradient(top,#fff 85%,#eee 99%)}.select2-container-active .select2-choice,.select2-container-active .select2-choices{border:1px solid #5897fb;outline:0;-webkit-box-shadow:0 0 5px rgba(0,0,0,.3);box-shadow:0 0 5px rgba(0,0,0,.3)}.select2-dropdown-open .select2-choice{border-bottom-color:transparent;-webkit-box-shadow:0 1px 0 #fff inset;box-shadow:0 1px 0 #fff inset;border-bottom-left-radius:0;border-bottom-right-radius:0;background-color:#eee;background-image:-webkit-gradient(linear,left bottom,left top,color-stop(0,#fff),color-stop(0.5,#eee));background-image:-webkit-linear-gradient(center bottom,#fff 0,#eee 50%);background-image:-moz-linear-gradient(center bottom,#fff 0,#eee 50%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee',endColorstr='#ffffff',GradientType=0);background-image:linear-gradient(top,#fff 0,#eee 50%)}.select2-dropdown-open.select2-drop-above .select2-choice,.select2-dropdown-open.select2-drop-above .select2-choices{border:1px solid #5897fb;border-top-color:transparent;background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fff),color-stop(0.5,#eee));background-image:-webkit-linear-gradient(center top,#fff 0,#eee 50%);background-image:-moz-linear-gradient(center top,#fff 0,#eee 50%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee',endColorstr='#ffffff',GradientType=0);background-image:linear-gradient(bottom,#fff 0,#eee 50%)}.select2-dropdown-open .select2-choice .select2-arrow{background:transparent;border-left:none;filter:none}.select2-dropdown-open .select2-choice .select2-arrow b{background-position:-18px 1px}.select2-results{max-height:200px;padding:0 0 0 4px;margin:4px 4px 4px 0;position:relative;overflow-x:hidden;overflow-y:auto;-webkit-tap-highlight-color:rgba(0,0,0,0)}.select2-results ul.select2-result-sub{margin:0;padding-left:0}.select2-results ul.select2-result-sub>li .select2-result-label{padding-left:20px}.select2-results ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:40px}.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:60px}.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:80px}.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:100px}.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:110px}.select2-results ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub ul.select2-result-sub>li .select2-result-label{padding-left:120px}.select2-results li{list-style:none;display:list-item;background-image:none}.select2-results li.select2-result-with-children>.select2-result-label{font-weight:bold}.select2-results .select2-result-label{padding:3px 7px 4px;margin:0;cursor:pointer;min-height:1em;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.select2-results .select2-highlighted{background:#3875d7;color:#fff}.select2-results li em{background:#feffde;font-style:normal}.select2-results .select2-highlighted em{background:transparent}.select2-results .select2-highlighted ul{background:#fff;color:#000}.select2-results .select2-no-results,.select2-results .select2-searching,.select2-results .select2-selection-limit{background:#f4f4f4;display:list-item}.select2-results .select2-disabled.select2-highlighted{color:#666;background:#f4f4f4;display:list-item;cursor:default}.select2-results .select2-disabled{background:#f4f4f4;display:list-item;cursor:default}.select2-results .select2-selected{display:none}.select2-more-results.select2-active{background:#f4f4f4 url('select2-spinner.gif') no-repeat 100%}.select2-more-results{background:#f4f4f4;display:list-item}.select2-container.select2-container-disabled .select2-choice{background-color:#f4f4f4;background-image:none;border:1px solid #ddd;cursor:default}.select2-container.select2-container-disabled .select2-choice .select2-arrow{background-color:#f4f4f4;background-image:none;border-left:0}.select2-container.select2-container-disabled .select2-choice abbr{display:none}.select2-container-multi .select2-choices{height:auto!important;height:1%;margin:0;padding:0;position:relative;border:1px solid #aaa;cursor:text;overflow:hidden;background-color:#fff;background-image:-webkit-gradient(linear,0% 0,0% 100%,color-stop(1%,#eee),color-stop(15%,#fff));background-image:-webkit-linear-gradient(top,#eee 1%,#fff 15%);background-image:-moz-linear-gradient(top,#eee 1%,#fff 15%);background-image:linear-gradient(top,#eee 1%,#fff 15%)}.select2-locked{padding:3px 5px 3px 5px!important}.select2-container-multi .select2-choices{min-height:26px}.select2-container-multi.select2-container-active .select2-choices{border:1px solid #5897fb;outline:0;-webkit-box-shadow:0 0 5px rgba(0,0,0,.3);box-shadow:0 0 5px rgba(0,0,0,.3)}.select2-container-multi .select2-choices li{float:left;list-style:none}.select2-container-multi .select2-choices .select2-search-field{margin:0;padding:0;white-space:nowrap}.select2-container-multi .select2-choices .select2-search-field input{padding:5px;margin:1px 0;font-family:sans-serif;font-size:100%;color:#666;outline:0;border:0;-webkit-box-shadow:none;box-shadow:none;background:transparent!important}.select2-container-multi .select2-choices .select2-search-field input.select2-active{background:#fff url('select2-spinner.gif') no-repeat 100%!important}.select2-default{color:#999!important}.select2-container-multi .select2-choices .select2-search-choice{padding:3px 5px 3px 18px;margin:3px 0 3px 5px;position:relative;line-height:13px;color:#333;cursor:default;border:1px solid #aaa;border-radius:3px;-webkit-box-shadow:0 0 2px #fff inset,0 1px 0 rgba(0,0,0,0.05);box-shadow:0 0 2px #fff inset,0 1px 0 rgba(0,0,0,0.05);background-clip:padding-box;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#e4e4e4;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee',endColorstr='#f4f4f4',GradientType=0);background-image:-webkit-gradient(linear,0% 0,0% 100%,color-stop(20%,#f4f4f4),color-stop(50%,#f0f0f0),color-stop(52%,#e8e8e8),color-stop(100%,#eee));background-image:-webkit-linear-gradient(top,#f4f4f4 20%,#f0f0f0 50%,#e8e8e8 52%,#eee 100%);background-image:-moz-linear-gradient(top,#f4f4f4 20%,#f0f0f0 50%,#e8e8e8 52%,#eee 100%);background-image:linear-gradient(top,#f4f4f4 20%,#f0f0f0 50%,#e8e8e8 52%,#eee 100%)}.select2-container-multi .select2-choices .select2-search-choice .select2-chosen{cursor:default}.select2-container-multi .select2-choices .select2-search-choice-focus{background:#d4d4d4}.select2-search-choice-close{display:block;width:12px;height:13px;position:absolute;right:3px;top:4px;font-size:1px;outline:0;background:url('select2.png') right top no-repeat}.select2-container-multi .select2-search-choice-close{left:3px}.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover{background-position:right -11px}.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close{background-position:right -11px}.select2-container-multi.select2-container-disabled .select2-choices{background-color:#f4f4f4;background-image:none;border:1px solid #ddd;cursor:default}.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice{padding:3px 5px 3px 5px;border:1px solid #ddd;background-image:none;background-color:#f4f4f4}.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close{display:none;background:0}.select2-result-selectable .select2-match,.select2-result-unselectable .select2-match{text-decoration:underline}.select2-offscreen,.select2-offscreen:focus{clip:rect(0 0 0 0)!important;width:1px!important;height:1px!important;border:0!important;margin:0!important;padding:0!important;overflow:hidden!important;position:absolute!important;outline:0!important;left:0!important;top:0!important}.select2-display-none{display:none}.select2-measure-scrollbar{position:absolute;top:-10000px;left:-10000px;width:100px;height:100px;overflow:scroll}@media only screen and (-webkit-min-device-pixel-ratio:1.5),only screen and (min-resolution:1.25dppx){.select2-search input,.select2-search-choice-close,.select2-container .select2-choice abbr,.select2-container .select2-choice .select2-arrow b{background-image:url('select2x2.png')!important;background-repeat:no-repeat!important;background-size:60px 40px!important}.select2-search input{background-position:100% -21px!important}}

assets/select2/select2.min.js ADDED Viewed

	@@ -0,0 +1,22 @@


1	+ /*
2	+ Copyright 2012 Igor Vaynberg
3	+
4	+ Version: 3.4.5 Timestamp: Mon Nov 4 08:22:42 PST 2013
5	+
6	+ This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
7	+ General Public License version 2 (the "GPL License"). You may choose either license to govern your
8	+ use of this software only upon the condition that you accept all of the terms of either the Apache
9	+ License or the GPL License.
10	+
11	+ You may obtain a copy of the Apache License and the GPL License at:
12	+
13	+ http://www.apache.org/licenses/LICENSE-2.0
14	+ http://www.gnu.org/licenses/gpl-2.0.html
15	+
16	+ Unless required by applicable law or agreed to in writing, software distributed under the Apache License
17	+ or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
18	+ either express or implied. See the Apache License and the GPL License for the specific language governing
19	+ permissions and limitations under the Apache License and the GPL License.
20	+ */
21	+ !function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(a){var b,c,d,e;if(!a\|\|a.length<1)return a;for(b="",c=0,d=a.length;d>c;c++)e=a.charAt(c),b+=m[e]\|\|e;return b}function o(a,b){for(var c=0,d=b.length;d>c;c+=1)if(q(a,b[c]))return c;return-1}function p(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function q(a,c){return a===c?!0:a===b\|\|c===b?!1:null===a\|\|null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function r(b,c){var d,e,f;if(null===b\|\|b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function s(a){return a.outerWidth(!1)-a.width()}function t(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function u(c){c.on("mousemove",function(c){var d=i;(d===b\|\|d.x!==c.pageX\|\|d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function v(a,c,d){d=d\|\|b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function w(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function x(a,b){var c=v(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){o(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle\|\|window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=n(a.toUpperCase()).indexOf(n(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis\|\|100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport\|\|a.fn.select2.ajaxDefaults.transport,k={type:c.type\|\|"GET",cache:c.cache\|\|!1,jsonpCallback:c.jsonpCallback\|\|b,dataType:c.dataType\|\|"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)\|\|(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length\|\|b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f\|\|e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw new Error(c+" must be a function or a falsy value")}function K(b){return a.isFunction(b)?b():b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice\|\|!e.tokenSeparators\|\|e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(q(e.id(h),e.id(c[j]))){g=!0;break}g\|\|d(h)}}return f!==a?a:void 0}function N(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=N(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")\|\|"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]=>\\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=w(function(){return c.element.closest("body")}),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),u(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),t(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k\|\|p(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.nextSearchTerm=b},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus\|\|!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:q(a.attr("locked"),"locked")\|\|q(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,i=this.opts.id;g=function(d,e,j){var k,l,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),k=0,l=d.length;l>k;k+=1)m=d[k],o=m.disabled===!0,n=!o&&i(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+j),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("select2-result-sub"),g(m.children,s,j+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c\|\|("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0&&(c.ajax.url=g),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(r(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return q(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,d,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var c=a.prop("disabled");c===b&&(c=!1),this.enable(!c);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass))}),a.on("propertychange.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),d=window.MutationObserver\|\|window.WebKitMutationObserver\|\|window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b\|\|{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=this.body().scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(t=this.body().offset(),m-=t.top,n-=t.left),r\|\|(n=c.left+e-q),w={left:n,width:e},u?(w.bottom=i-c.top,w.top="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1\|\|this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){var f,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close({focus:!0}),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),f=e.offset().top+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=e.offset().top-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled, .select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?o(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.ensureHighlightVisible(),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(e.opts.formatLoadMore(d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown()}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0\|\|!k\|\|!q(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0\|\|this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+f.formatSelectionTooBig(o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;
22	+ if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return q(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")\|\|this.opts.element.attr("data-placeholder")\|\|this.opts.element.data("placeholder")\|\|this.opts.placeholder\|\|((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a\|\|"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width\|\|"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px\|em\|ex\|%\|in\|cm\|mm\|pt\|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>"," </div>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e)),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(a){this.opened()&&(this.parent.close.apply(this,arguments),a=a\|\|{focus:!0},this.focusser.removeAttr("disabled"),a.focus&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var b,d=this.container,e=this.dropdown;this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP\|\|a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN\|\|a.which==c.UP\|\|a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE\|\|a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),t(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(b)})),e.on("mousedown",this.bind(function(){this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()\|\|(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()?(a=this.getPlaceholderOption())!==b&&a.prop("selected")\|\|""===this.opts.element.val()\|\|this.opts.element.val()===b\|\|null===this.opts.element.val():!1},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=q(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return q(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus\|\|this.focusser.focus(),q(c,this.id(a))\|\|this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=N(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=r(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return q(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(q(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]\|\|(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments)},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()\|\|this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT\|\|a.which==c.RIGHT\|\|a.which==c.BACKSPACE\|\|a.which==c.DELETE\|\|a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?(this.unselect(b.first()),this.search.width(10),h=e.length?e:f):a.which==c.DELETE?(this.unselect(b.first()),this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length\|\|this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns\|\|a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return}this.open(),(a.which===c.PAGE_UP\|\|a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()\|\|this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0\|\|(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select\|\|""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){o(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select\|\|!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus\|\|this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),A(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){for(;(e=o(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();var f=a.Event("select2-removing");f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented()\|\|(b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}))}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));o(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")\|\|0!==b.find(".select2-result-selectable:not(.select2-selected)").length\|\|b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a\|\|a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-s(this.search)},resizeSearch:function(){var a,b,c,d,e,f=s(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),r(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){o(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)q(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length\|\|(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b\|\|(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],l=["opened","isFocused","container","dropdown"],m=["val","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length\|\|"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple\|\|!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(o(c[0],k)<0)throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),o(c[0],l)>=0\|\|o(c[0],m)&&1==c.length)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return n(""+b).toUpperCase().indexOf(n(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:v,markMatch:E,escapeMarkup:F,stripDiacritics:n},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);

assets/select2/select2.png ADDED Viewed

Binary file

content-views.php ADDED Viewed

	@@ -0,0 +1,91 @@


1	+ <?php
2	+ /**
3	+ * @package PT_Content_Views
4	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
5	+ * @license GPL-2.0+
6	+ * @link http://example.com
7	+ * @copyright 2014 Palace Of Themes
8	+ *
9	+ * @wordpress-plugin
10	+ * Plugin Name: Content Views
11	+ * Plugin URI: http://wordpress.org/plugins/content-views-query-and-display-post-page/
12	+ * Description: Query and display <strong>posts, pages</strong> in awesome layouts (<strong>grid, scrollable list, collapsible list</strong>) easier than ever, without coding!
13	+ * Version: 1.0.1
14	+ * Author: Palace Of Themes
15	+ * Author URI: http://profiles.wordpress.org/pt-guy
16	+ * Text Domain: content-views
17	+ * License: GPL-2.0+
18	+ * License URI: http://www.gnu.org/licenses/gpl-2.0.txt
19	+ * Domain Path: /languages
20	+ * GitHub Plugin URI: https://github.com/<owner>/<repo>
21	+ */
22	+
23	+ // If this file is called directly, abort.
24	+ if ( ! defined( 'WPINC' ) ) {
25	+ die;
26	+ }
27	+ /*
28	+ * Define Constant
29	+ */
30	+ define( 'PT_CV_VERSION', '1.0.1' );
31	+ define( 'PT_CV_FILE', __FILE__ );
32	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/defines.php' );
33	+
34	+ /*
35	+ * Include other library files (name ASC)
36	+ */
37	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/assets.php' );
38	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/functions.php' );
39	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/hooks.php' );
40	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/html-viewtype.php' );
41	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/html.php' );
42	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/settings.php' );
43	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/update.php' );
44	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/values.php' );
45	+
46	+ /----------------------------------------------------------------------------
47	+ * Public-Facing Functionality
48	+ ----------------------------------------------------------------------------/
49	+
50	+ /*
51	+ * the plugin's class file
52	+ */
53	+ include_once( plugin_dir_path( __FILE__ ) . 'public/content-views.php' );
54	+
55	+ /*
56	+ * Register hooks that are fired when the plugin is activated or deactivated.
57	+ * When the plugin is deleted, the uninstall.php file is loaded.
58	+ */
59	+ register_activation_hook( __FILE__, array( 'PT_Content_Views', 'activate' ) );
60	+ register_deactivation_hook( __FILE__, array( 'PT_Content_Views', 'deactivate' ) );
61	+
62	+ add_action( 'plugins_loaded', array( 'PT_Content_Views', 'get_instance' ) );
63	+
64	+ /----------------------------------------------------------------------------
65	+ * Dashboard and Administrative Functionality
66	+ ----------------------------------------------------------------------------/
67	+
68	+ /*
69	+ * the plugin's admin file
70	+ */
71	+ if ( is_admin() ) {
72	+
73	+ // Require Admin side functions
74	+ include_once( plugin_dir_path( __FILE__ ) . 'admin/content-views-admin.php' );
75	+ add_action( 'plugins_loaded', array( 'PT_Content_Views_Admin', 'get_instance' ) );
76	+
77	+ // Require PT Options framework
78	+ include_once( plugin_dir_path( __FILE__ ) . 'admin/includes/options.php' );
79	+ }
80	+
81	+ /**
82	+ * Common settings
83	+ */
84	+ // Support for post thumbnails
85	+ add_theme_support( 'post-thumbnails' );
86	+
87	+ // Enable shortcode in content
88	+ add_filter( 'the_content', 'do_shortcode', 11 );
89	+
90	+ // Enable shortcodes in text widgets.
91	+ add_filter( 'widget_text', 'do_shortcode' );

includes/assets.php ADDED Viewed

	@@ -0,0 +1,197 @@


1	+ <?php
2	+ /**
3	+ * Asset management
4	+ *
5	+ * Register, enqueue, localize asset functions
6	+ *
7	+ * @package PT_Content_Views
8	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
9	+ * @license GPL-2.0+
10	+ * @link http://example.com
11	+ * @copyright 2014 Palace Of Themes
12	+ */
13	+
14	+ if ( ! class_exists( 'PT_CV_Asset' ) ) {
15	+
16	+ /**
17	+ * @name PT_CV_Asset
18	+ * @todo Register, enqueue, localize asset functions
19	+ */
20	+ class PT_CV_Asset {
21	+
22	+ // Prefix for handle of all assets
23	+ static $prefix = PT_CV_PREFIX;
24	+ // Array of style & script
25	+ static $assets = array();
26	+ /**
27	+ * version of assets
28	+ * if an asset doesn't have configed version, it will get plugin version as asset version
29	+ */
30	+ static $version = array(
31	+ 'bootstrap' => '3.1.1',
32	+ 'bootstrap-paginator' => '0.5',
33	+ 'select2' => '3.4.5',
34	+ 'select2-bootstrap' => '3.4.5',
35	+ );
36	+
37	+ /**
38	+ * Register assets to enqueue later
39	+ */
40	+ static function register() {
41	+ self::$assets['style'] = self::style();
42	+ self::$assets['script'] = self::script();
43	+ }
44	+
45	+ /**
46	+ * Enqueue registered assets
47	+ *
48	+ * @param string $name Asset slug name
49	+ * @param string $type Asset type (css/js)
50	+ * @param array $data Asset data (url, depends, version...)
51	+ * @param string $prefix Prefix string for asset
52	+ */
53	+ static function enqueue( $name, $type = 'script', $data = '', $prefix = '' ) {
54	+
55	+ // If asset is registered, get handle information $data
56	+ if ( array_key_exists( $name, self::$assets[$type] ) ) {
57	+ $data = self::$assets[$type][$name];
58	+ }
59	+
60	+ // Do action
61	+ self::action( $name, $data, $type, 'enqueue', $prefix );
62	+ }
63	+
64	+ /**
65	+ * Styles list
66	+ *
67	+ * @return array
68	+ */
69	+ static function style() {
70	+ return array(
71	+ 'bootstrap' => array(
72	+ 'src' => plugins_url( 'assets/bootstrap/css/bootstrap.min.css', PT_CV_FILE ),
73	+ ),
74	+ 'select2' => array(
75	+ 'src' => plugins_url( 'assets/select2/select2.min.css', PT_CV_FILE ),
76	+ ),
77	+ 'select2-bootstrap' => array(
78	+ 'src' => plugins_url( 'assets/select2/select2-bootstrap.min.css', PT_CV_FILE ),
79	+ ),
80	+ );
81	+ }
82	+
83	+ /**
84	+ * Scripts list
85	+ *
86	+ * @return array
87	+ */
88	+ static function script() {
89	+ return array(
90	+ 'bootstrap' => array(
91	+ 'src' => plugins_url( 'assets/bootstrap/js/bootstrap.min.js', PT_CV_FILE ),
92	+ 'deps' => array( 'jquery' ),
93	+ ),
94	+ 'bootstrap-paginator' => array(
95	+ 'src' => plugins_url( 'assets/bootstrap-paginator/bootstrap-paginator.min.js', PT_CV_FILE ),
96	+ 'deps' => array( PT_CV_PREFIX . 'bootstrap' . '-' . 'script' ),
97	+ ),
98	+ 'select2' => array(
99	+ 'src' => plugins_url( 'assets/select2/select2.min.js', PT_CV_FILE ),
100	+ 'deps' => array( 'jquery' ),
101	+ ),
102	+ );
103	+ }
104	+
105	+ /**
106	+ * Get version of handle
107	+ *
108	+ * @param string $name Asset slug name
109	+ * @param array $data Asset data (url, depends, version...)
110	+ *
111	+ * @return string
112	+ */
113	+ static function get_version( $name, $data ) {
114	+
115	+ if ( isset( $data['ver'] ) ) {
116	+ return $data['ver'];
117	+ }
118	+
119	+ if ( array_key_exists( $name, self::$version ) ) {
120	+ return self::$version[$name];
121	+ }
122	+
123	+ return PT_CV_Functions::plugin_info( PT_CV_FILE, 'Version' );
124	+ }
125	+
126	+ /**
127	+ * Register / Enqueue a style / script
128	+ *
129	+ * @param string $name Asset slug name
130	+ * @param string $data Asset information
131	+ * @param string $type Asset type (css/js)
132	+ * @param string $action Action to executing: enqueue / register
133	+ * @param string $prefix Prefix string for asset
134	+ */
135	+ static function action( $name, $data, $type, $action, $prefix ) {
136	+ $prefix_ = ! empty( $prefix ) ? $prefix : self::$prefix;
137	+ $handle = $prefix_ . $name . '-' . $type;
138	+ $src = isset( $data['src'] ) ? $data['src'] : '';
139	+ $deps = isset( $data['deps'] ) ? $data['deps'] : '';
140	+ $ver = self::get_version( $name, $data );
141	+
142	+ if ( $type == 'style' ) {
143	+ $last_param = isset( $data['media'] ) ? $data['media'] : 'all';
144	+ } else {
145	+ // Auto enqueue script in footer
146	+ $last_param = isset( $data['in_footer'] ) ? $data['in_footer'] : true;
147	+ }
148	+ $function = "wp_{$action}_{$type}";
149	+ if ( function_exists( $function ) ) {
150	+ $function( $handle, $src, $deps, $ver, $last_param );
151	+ }
152	+ }
153	+
154	+ /**
155	+ * Localize script
156	+ *
157	+ * @param string $name Asset slug name
158	+ * @param string $object_name The name of the variable which will contain the data
159	+ * @param string $translation_array Array of translation strings
160	+ * @param string $prefix Prefix string for asset
161	+ */
162	+ static function localize_script( $name, $object_name, $translation_array, $prefix = '' ) {
163	+ $type = 'script';
164	+ $prefix_ = ! empty( $prefix ) ? $prefix : self::$prefix;
165	+ $handle = $prefix_ . $name . '-' . $type;
166	+
167	+ wp_localize_script( $handle, $object_name, $translation_array );
168	+ }
169	+
170	+ /**
171	+ * Include asset files directly in page
172	+ *
173	+ * @param string $name Asset slug name
174	+ * @param string $scr The link to asset file
175	+ * @param string $type Asset type (css/js)
176	+ * @param string $prefix Prefix string for asset
177	+ */
178	+ static function include_inline( $name, $src, $type, $prefix = '' ) {
179	+ $prefix_ = ! empty( $prefix ) ? $prefix : self::$prefix;
180	+ $handle = $prefix_ . $name . '-' . $type;
181	+
182	+ switch ( $type ) {
183	+ case 'js':
184	+ printf( "<script type='text/javascript' src='%s'></script>", $src );
185	+ break;
186	+
187	+ case 'css':
188	+ printf( "<link rel='stylesheet' id='%s' href='%s' type='text/css' media='all' />", esc_attr( $handle ), esc_url( $src ) );
189	+ break;
190	+ }
191	+ }
192	+
193	+ }
194	+ }
195	+
196	+ // Call to run
197	+ PT_CV_Asset::register();

includes/defines.php ADDED Viewed

	@@ -0,0 +1,36 @@


1	+ <?php
2	+ /**
3	+ * Defines common constant
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ define( 'PT_CV_DOMAIN', 'content-views' );
13	+ define( 'PT_CV_PREFIX', 'pt-cv-' );
14	+ define( 'PT_CV_PREFIX_', 'pt_cv_' );
15	+ define( 'PT_CV_PREFIX_UPPER', 'PT_CV_' );
16	+
17	+ // Custom post type
18	+ define( 'PT_CV_POST_TYPE', 'pt_view' );
19	+
20	+ // Options
21	+ define( 'PT_CV_OPTION_VERSION', PT_CV_PREFIX_ . 'version' );
22	+ define( 'PT_CV_OPTION_NAME', PT_CV_PREFIX_ . 'options' );
23	+
24	+ // Custom fields
25	+ define( 'PT_CV_META_ID', '_' . PT_CV_PREFIX_ . 'id' );
26	+ define( 'PT_CV_META_SETTINGS', '_' . PT_CV_PREFIX_ . 'settings' );
27	+ define( 'PT_CV_META_VIEW_COUNT', '_' . PT_CV_PREFIX_ . 'view_count' );
28	+
29	+ // Public assets directory
30	+ define( 'PT_CV_PUBLIC_ASSETS', plugin_dir_path( PT_CV_FILE ) . 'public/assets/' );
31	+
32	+ // Public assets uri
33	+ define( 'PT_CV_PUBLIC_ASSETS_URI', plugins_url( 'public/assets/', PT_CV_FILE ) );
34	+
35	+ // View type directory (HTML + CSS + JS)
36	+ define( 'PT_CV_VIEW_TYPE_OUTPUT', plugin_dir_path( PT_CV_FILE ) . 'public/templates/' );

includes/functions.php ADDED Viewed

	@@ -0,0 +1,984 @@


1	+ <?php
2	+ /**
3	+ * Contain main functions to work with plugin, post, custom fields...
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ if ( ! function_exists( 'get_plugin_data' ) ) {
13	+ require_once( ABSPATH . 'wp-admin/includes/plugin.php' );
14	+ }
15	+ if ( ! class_exists( 'PT_CV_Functions' ) ) {
16	+
17	+ /**
18	+ * @name PT_CV_Functions
19	+ * @todo Utility functions
20	+ */
21	+ class PT_CV_Functions {
22	+
23	+ static $prev_random_string = '';
24	+
25	+ /**
26	+ * Compare current Wordpress version with a version
27	+ *
28	+ * @global string $wp_version
29	+ * @param string $version_to_compare
30	+ * @param string $operator
31	+ * @return boolean
32	+ */
33	+ static function wp_version_compare( $version_to_compare, $operator = '>=' ) {
34	+ if ( empty( $version_to_compare ) ) {
35	+ return true;
36	+ }
37	+
38	+ global $wp_version;
39	+ // Check if using Wordpress version 3.7 or higher
40	+ return version_compare( $wp_version, $version_to_compare, $operator );
41	+ }
42	+
43	+ /**
44	+ * Get plugin info
45	+ *
46	+ * @param string $file Absolute path to the plugin file
47	+ * @param string $data Field of plugin data want to get
48	+ *
49	+ * @return array \| null
50	+ */
51	+ static function plugin_info( $file, $data = '' ) {
52	+ $plugin_data = get_plugin_data( $file );
53	+
54	+ return isset( $plugin_data[$data] ) ? $plugin_data[$data] : NULL;
55	+ }
56	+
57	+ /**
58	+ * Add sub menu page
59	+ *
60	+ * @param string $parent_slug Slug of parent menu
61	+ * @param string $page_title Title of page
62	+ * @param string $menu_title Title of menu
63	+ * @param string $sub_page Slug of sub menu
64	+ * @param string $class Class name which contains function to output content of page created by this menu
65	+ */
66	+ static function menu_add_sub( $parent_slug, $page_title, $menu_title, $sub_page, $class ) {
67	+ return add_submenu_page(
68	+ $parent_slug, $page_title, $menu_title, 'manage_options', $parent_slug . '-' . $sub_page, array( $class, 'display_sub_page_' . $sub_page )
69	+ );
70	+ }
71	+
72	+ /**
73	+ * Get current post type in Admin
74	+ *
75	+ * @global type $post
76	+ * @global type $typenow
77	+ * @global type $current_screen
78	+ * @return type
79	+ */
80	+ static function admin_current_post_type() {
81	+ global $post, $typenow, $current_screen;
82	+
83	+ //we have a post so we can just get the post type from that
84	+ if ( $post && $post->post_type ) {
85	+ return $post->post_type;
86	+ } //check the global $typenow - set in admin.php
87	+ elseif ( $typenow ) {
88	+ return $typenow;
89	+ } //check the global $current_screen object - set in sceen.php
90	+ elseif ( $current_screen && isset( $current_screen->post_type ) ) {
91	+ return $current_screen->post_type;
92	+ }
93	+ }
94	+
95	+ /**
96	+ * Include content of file
97	+ *
98	+ * @param string $file_path Absolute path of file
99	+ *
100	+ * @return NULL \| string Content of file
101	+ */
102	+ static function file_include_content( $file_path ) {
103	+ $content = NULL;
104	+
105	+ if ( file_exists( $file_path ) ) {
106	+ ob_start();
107	+ include_once $file_path;
108	+ $content = ob_get_clean();
109	+ }
110	+
111	+ return $content;
112	+ }
113	+
114	+ /**
115	+ * Generate random string
116	+ *
117	+ * @param bool $prev_return Return previous generated string
118	+ *
119	+ * @return string
120	+ */
121	+ static function string_random( $prev_return = false ) {
122	+ if ( $prev_return ) {
123	+ return PT_CV_Functions::$prev_random_string;
124	+ }
125	+ PT_CV_Functions::$prev_random_string = substr( md5( rand() ), 0, 10 );
126	+
127	+ return PT_CV_Functions::$prev_random_string;
128	+ }
129	+
130	+ /**
131	+ * Create array from string, use explode function
132	+ *
133	+ * @param string $string String to explode
134	+ * @param string $delimiter Delimiter to explode string
135	+ *
136	+ * @return array
137	+ */
138	+ static function string_to_array( $string, $delimiter = ',' ) {
139	+ return is_array( $string ) ? $string : (array) explode( $delimiter, (string) str_replace( ' ', '', $string ) );
140	+ }
141	+
142	+ /**
143	+ * Slug to nice String
144	+ *
145	+ * @param string $slug Slug string
146	+ *
147	+ * @return string
148	+ */
149	+ static function string_slug_to_text( $slug ) {
150	+ $slug = preg_replace( '/[^a-z]+/', ' ', $slug );
151	+
152	+ return ucwords( $slug );
153	+ }
154	+
155	+ /**
156	+ * Get thumbnail dimensions
157	+ *
158	+ * @param array $fargs The settings of thumbnail
159	+ *
160	+ * @return array
161	+ */
162	+ static function field_thumbnail_dimensions( $fargs ) {
163	+ $size = $fargs['size'];
164	+
165	+ return (array) explode( '×', str_replace( ' ', '', $size ) );
166	+ }
167	+
168	+ /**
169	+ * Get value of a setting from global settings array
170	+ *
171	+ * @param string $field The full name of setting to get value
172	+ * @param array $array_to_get Array to get values of wanted setting
173	+ * @param type \| null $assign The value to assign if setting is not found
174	+ */
175	+ static function setting_value( $field, $array_to_get, $assign = NULL ) {
176	+ return isset( $array_to_get[$field] ) ? $array_to_get[$field] : $assign;
177	+ }
178	+
179	+ /**
180	+ * Get values of settings from global settings array
181	+ *
182	+ * @param array $fields Array of setting fields to get value
183	+ * @param array $array_to_save Array to save values of wanted setting fields
184	+ * @param array $array_to_get Array to get values of wanted setting fields
185	+ * @param string $prefix Prefix string to looking for fields in $array_to_get
186	+ */
187	+ static function settings_values( $fields, &$array_to_save, $array_to_get, $prefix ) {
188	+ foreach ( $fields as $tsetting ) {
189	+ $array_to_save[$tsetting] = PT_CV_Functions::setting_value( $prefix . $tsetting, $array_to_get );
190	+ }
191	+ }
192	+
193	+ /**
194	+ * Get names of options for a setting group (setting name started by a prefix)
195	+ *
196	+ * @param string $prefix The prefix in name of settings
197	+ * @param array $options The options array (contain full paramaters of settings)
198	+ */
199	+ static function settings_keys( $prefix, $options ) {
200	+ $result = array();
201	+ foreach ( $options as $option ) {
202	+ if ( $option['params'] ) {
203	+ foreach ( $option['params'] as $params ) {
204	+ // If name of setting match with prefix string, got it name
205	+ if ( isset( $params['name'] ) && substr( $params['name'], 0, strlen( $prefix ) ) === $prefix ) {
206	+ $result[] = substr( $params['name'], strlen( $prefix ) );
207	+ }
208	+ }
209	+ }
210	+ }
211	+
212	+ return $result;
213	+ }
214	+
215	+ /**
216	+ * Get value of some setting options by prefix
217	+ *
218	+ * @param string $prefix The prefix in name of setting options
219	+ * @param type $settings_ The settings array
220	+ */
221	+ static function settings_values_by_prefix( $prefix, $settings_ ) {
222	+ $result = array();
223	+
224	+ foreach ( $settings_ as $name => $value ) {
225	+ // If name of setting match with prefix string, got it name
226	+ if ( substr( $name, 0, strlen( $prefix ) ) === $prefix ) {
227	+ $result[substr( $name, strlen( $prefix ) )] = $value;
228	+ }
229	+ }
230	+
231	+ return $result;
232	+ }
233	+
234	+ /**
235	+ * Get terms list of a post
236	+ *
237	+ * @param object $post The post object
238	+ *
239	+ * @return string
240	+ */
241	+ static function post_terms( $post ) {
242	+ // List of HTML link to terms
243	+ $links = array();
244	+
245	+ // Get list of taxonomies
246	+ $taxonomies = get_taxonomies( '', 'names' );
247	+
248	+ // Get lists of terms of this post
249	+ $terms = wp_get_object_terms( $post->ID, $taxonomies );
250	+
251	+ foreach ( $terms as $term ) {
252	+ $links[] = sprintf(
253	+ '<a href="%1$s" title="%2$s %3$s">%3$s</a>',
254	+ esc_url( get_term_link( $term, $term->taxonomy ) ),
255	+ __( 'View all posts in', PT_CV_DOMAIN ),
256	+ $term->name
257	+ );
258	+ }
259	+
260	+ return implode( ', ', $links );
261	+ }
262	+
263	+ /**
264	+ * Update post view count
265	+ *
266	+ * @param string $post_id ID of post
267	+ */
268	+ static function post_update_view_count( $post_id ) {
269	+ $meta_key = PT_CV_META_VIEW_COUNT;
270	+ $count = get_post_meta( $post_id, $meta_key, true );
271	+ if ( ! $count ) {
272	+ $count = 0;
273	+ }
274	+ $count ++;
275	+ update_post_meta( $post_id, $meta_key, $count );
276	+ }
277	+
278	+ /**
279	+ * Get post view count
280	+ *
281	+ * @param string $post_id ID of post
282	+ */
283	+ static function post_get_view_count( $post_id ) {
284	+ $meta_key = PT_CV_META_VIEW_COUNT;
285	+ $count = get_post_meta( $post_id, $meta_key, true );
286	+ if ( ! $count ) {
287	+ $count = 1;
288	+ }
289	+
290	+ return _n( 'view', 'views', $count, PT_CV_DOMAIN );
291	+ }
292	+
293	+ /**
294	+ * Insert new post
295	+ *
296	+ * @param string $arr Array of post data
297	+ */
298	+ static function post_insert( $arr ) {
299	+ if ( ! $arr ) {
300	+ return;
301	+ }
302	+ // Create post object
303	+ $my_post = array(
304	+ 'ID' => (int) $arr['ID'],
305	+ 'post_type' => PT_CV_POST_TYPE,
306	+ 'post_content' => '',
307	+ 'post_title' => ! empty( $arr['title'] ) ? $arr['title'] : __( '(no title)', PT_CV_DOMAIN ),
308	+ 'post_status' => 'publish',
309	+ );
310	+
311	+ // Insert the post into the database
312	+ return wp_insert_post( $my_post );
313	+ }
314	+
315	+ /**
316	+ * Get View id in post table, from "id" meta key value
317	+ *
318	+ * @param string $meta_id ID of custom field
319	+ */
320	+ static function post_id_from_meta_id( $meta_id ) {
321	+
322	+ $post_id = 0;
323	+ if ( ! $meta_id ) {
324	+ return $post_id;
325	+ }
326	+
327	+ // Query view which has view id = $meta_id
328	+ $pt_query = new WP_Query(
329	+ array(
330	+ 'post_type' => PT_CV_POST_TYPE,
331	+ 'post_status' => 'publish',
332	+ 'meta_key' => PT_CV_META_ID,
333	+ 'meta_value' => $meta_id,
334	+ )
335	+ );
336	+ if ( $pt_query->have_posts() ) :
337	+ while ( $pt_query->have_posts() ):
338	+ $pt_query->the_post();
339	+ $post_id = get_the_ID();
340	+ endwhile;
341	+ endif;
342	+
343	+ return $post_id;
344	+ }
345	+
346	+ /**
347	+ * Get first key of array
348	+ *
349	+ * @param array $args Array data
350	+ *
351	+ * @return string
352	+ */
353	+ static function array_get_first_key( $args ) {
354	+ return current( array_keys( $args ) );
355	+ }
356	+
357	+ /**
358	+ * Check valid request
359	+ *
360	+ * @param string $nonce_name Name of nonce field
361	+ * @param string $action_name name of action relates to nonce field
362	+ */
363	+ static function _nonce_check( $nonce_name, $action_name ) {
364	+ $nonce_name = PT_CV_PREFIX_ . $nonce_name;
365	+ if ( ! isset( $_POST[$nonce_name] ) \|\| ! wp_verify_nonce( $_POST[$nonce_name], PT_CV_PREFIX_ . $action_name ) ) {
366	+ print esc_html( __( 'Sorry, your nonce did not verify.', PT_CV_DOMAIN ) );
367	+ exit;
368	+ }
369	+ }
370	+
371	+ /**
372	+ * Get view data
373	+ *
374	+ * @param string $meta_id ID of custom field
375	+ *
376	+ * @return array
377	+ */
378	+ static function view_get_settings( $meta_id ) {
379	+ if ( ! $meta_id ) {
380	+ return;
381	+ }
382	+
383	+ $post_id = PT_CV_Functions::post_id_from_meta_id( $meta_id );
384	+
385	+ // Get view settings
386	+ if ( $post_id ) {
387	+ $view_settings = get_post_meta( $post_id, PT_CV_META_SETTINGS, true );
388	+ return unserialize( base64_decode( $view_settings ) );
389	+ }
390	+
391	+ return array();
392	+ }
393	+
394	+ /**
395	+ * Process view $settings array, return HTML output
396	+ *
397	+ * @param string $id The current view id
398	+ * @param array $settings The settings array
399	+ * @param array $pargs The pagination settings array
400	+ *
401	+ * @return string HTML output of Content View
402	+ */
403	+ static function view_process_settings( $id, $settings, $pargs = array() ) {
404	+ if ( ! $settings ) {
405	+ return '';
406	+ }
407	+
408	+ // Escaped value appropriate for use in a SQL query
409	+ $settings_ = array();
410	+ foreach ( $settings as $key => $value ) {
411	+ $settings_[$key] = esc_sql( $value );
412	+ }
413	+
414	+ // Get content type
415	+ $content_type = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'content-type', $settings_ );
416	+
417	+ /**
418	+ * Get Query parameters
419	+ * Set default values
420	+ */
421	+ $args = $default_args = array(
422	+ 'post_type' => $content_type,
423	+ 'post_status' => 'publish',
424	+ 'ignore_sticky_posts' => 1,
425	+ );
426	+
427	+ // Post in
428	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'post__in', $settings_ ) ) {
429	+ $post_in = PT_CV_Functions::string_to_array( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'post__in', $settings_ ) );
430	+ $args['post__in'] = array_map( 'intval', array_filter( $post_in ) );
431	+ }
432	+
433	+ // Post not in
434	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'post__not_in', $settings_ ) ) {
435	+ $post_not_in = PT_CV_Functions::string_to_array( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'post__not_in', $settings_ ) );
436	+ $args['post__not_in'] = array_map( 'intval', array_filter( $post_not_in ) );
437	+ }
438	+
439	+ // Advance settings
440	+ PT_CV_Functions::view_get_advanced_settings( $settings_, $args, $content_type );
441	+
442	+ /**
443	+ * Get Display parameters
444	+ */
445	+ $dargs = array();
446	+
447	+ // Get view type
448	+ $view_type = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'view-type', $settings_ );
449	+
450	+ $dargs['view-type'] = $view_type;
451	+
452	+ // Field settings of a item
453	+ PT_CV_Functions::view_get_display_settings( $settings_, $dargs );
454	+
455	+ // Pagination settings
456	+ PT_CV_Functions::view_get_pagination_settings( $settings_, $dargs, $args, $pargs );
457	+
458	+ // Other settings
459	+ PT_CV_Functions::view_get_other_settings( $settings_, $dargs );
460	+
461	+ // View type settings
462	+ $dargs['view-type-settings'] = PT_CV_Functions::settings_values_by_prefix( PT_CV_PREFIX . $view_type . '-', $settings_ );
463	+
464	+ $dargs = apply_filters( PT_CV_PREFIX_ . 'all_display_settings', $dargs, $settings_ );
465	+
466	+ // Validate settings before processing, if some required parameters are missing, show error and exit
467	+ $error = apply_filters( PT_CV_PREFIX_ . 'validate_settings', array(), $dargs, $args );
468	+
469	+ // Return error message
470	+ if ( $error ) {
471	+ return ( implode( '</p><p>', $error ) );
472	+ }
473	+
474	+ /**
475	+ * Output Items
476	+ */
477	+
478	+ // Store HTML output of each item
479	+ $content_items = array();
480	+
481	+ // The Query
482	+ $pt_query = new WP_Query( $args );
483	+
484	+ // The Loop
485	+ if ( $pt_query->have_posts() ) {
486	+ while ( $pt_query->have_posts() ) {
487	+ $pt_query->the_post();
488	+ global $post;
489	+
490	+ // Output HTML for this item
491	+ $content_items[] = PT_CV_Html::view_type_output( $view_type, $dargs, $post );
492	+ }
493	+ } else {
494	+ // Get no post found class
495	+ $_class = apply_filters( PT_CV_PREFIX_ . 'content_no_post_found_class', 'alert alert-warning' );
496	+
497	+ // Get no post found text
498	+ $_text = apply_filters( PT_CV_PREFIX_ . 'content_no_post_found_text', __( 'No post found', PT_CV_DOMAIN ) );
499	+
500	+ // Output HTML
501	+ $content_items[] = sprintf( '<div class="%1$s">%2$s</div>', esc_attr( $_class ), balanceTags( $_text ) );
502	+ }
503	+
504	+ // Restore original Post Data
505	+ wp_reset_postdata();
506	+
507	+ /**
508	+ * Output Pagination
509	+ */
510	+ $current_page = ( isset( $pargs['page'] ) && $pargs['page'] > 1 ) ? $pargs['page'] : 1;
511	+ $html = PT_CV_Html::content_items_wrap( $content_items, $dargs, $current_page, $args['posts_per_page'] );
512	+
513	+ // Append Pagination HTML if this is first page, or not Ajax calling
514	+ if ( $args['posts_per_page'] > 0 && $current_page === 1 ) {
515	+ // Total number of items
516	+ $total_items = ( $args['limit'] > 0 && $pt_query->found_posts > $args['limit'] ) ? $args['limit'] : $pt_query->found_posts;
517	+
518	+ // Total number of pages
519	+ $max_num_pages = ceil( $total_items / $args['posts_per_page'] );
520	+ $html .= "\n" . PT_CV_Html::pagination_output( $max_num_pages, $dargs, $id );
521	+ }
522	+
523	+ return $html;
524	+ }
525	+
526	+ /**
527	+ * Get Advance settings
528	+ *
529	+ * @param array $settings_ The settings array
530	+ * @param array $args The parameters array
531	+ * @param string $content_type The content type
532	+ */
533	+ static function view_get_advanced_settings( $settings_, &$args, $content_type ) {
534	+
535	+ $advanced_settings = (array) PT_CV_Functions::setting_value( PT_CV_PREFIX . 'advanced-settings', $settings_ );
536	+ if ( $advanced_settings ) {
537	+ foreach ( $advanced_settings as $setting ) {
538	+ switch ( $setting ) {
539	+
540	+ // Author
541	+ case 'author':
542	+ $author_in = PT_CV_Functions::string_to_array( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'author__in', $settings_ ) );
543	+
544	+ // Check if using Wordpress version 3.7 or higher
545	+ $version_gt_37 = PT_CV_Functions::wp_version_compare( '3.7' );
546	+
547	+ if ( $version_gt_37 ) {
548	+ $author_not_in = PT_CV_Functions::string_to_array( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'author__not_in', $settings_ ) );
549	+
550	+ // Author in
551	+ if ( ! empty( $author_in[0] ) ) {
552	+ $args = array_merge(
553	+ $args, array(
554	+ 'author__in' => array_map( 'intval', $author_in ),
555	+ )
556	+ );
557	+ }
558	+
559	+ // Author not in
560	+ if ( ! empty( $author_not_in[0] ) ) {
561	+ $args = array_merge(
562	+ $args, array(
563	+ 'author__not_in' => array_map( 'intval', $author_not_in ),
564	+ )
565	+ );
566	+ }
567	+ } else {
568	+ // Author = ID
569	+ if ( ! empty( $author_in[0] ) ) {
570	+ $args = array_merge(
571	+ $args, array(
572	+ 'author' => intval( $author_in[0] ),
573	+ )
574	+ );
575	+ }
576	+ }
577	+
578	+ break;
579	+
580	+ // Status
581	+ case 'status':
582	+ $args = array_merge(
583	+ $args, array(
584	+ 'post_status' => PT_CV_Functions::string_to_array( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'post_status', $settings_, 'publish' ) ),
585	+ )
586	+ );
587	+ break;
588	+
589	+ // Search
590	+ case 'search':
591	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . 's', $settings_ ) ) {
592	+ $args = array_merge(
593	+ $args, array(
594	+ 's' => PT_CV_Functions::setting_value( PT_CV_PREFIX . 's', $settings_ ),
595	+ )
596	+ );
597	+ }
598	+ break;
599	+
600	+ // Taxonomy
601	+ case 'taxonomy':
602	+ // No taxonomy found
603	+ if ( ! PT_CV_Functions::setting_value( PT_CV_PREFIX . 'taxonomy', $settings_ ) ) {
604	+ break;
605	+ }
606	+
607	+ // All settings of taxonomies
608	+ $taxonomy_setting = array();
609	+
610	+ // Selected taxonomies
611	+ $taxonomies = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'taxonomy', $settings_ );
612	+
613	+ // Get Terms & criterias (In, Not in)
614	+ foreach ( $taxonomies as $taxonomy ) {
615	+
616	+ // If found setting for taxonomy
617	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . $taxonomy . '__in', $settings_ ) ) {
618	+ $taxonomy_setting[] = array(
619	+ 'taxonomy' => $taxonomy,
620	+ 'field' => 'slug',
621	+ 'terms' => (array) PT_CV_Functions::setting_value( PT_CV_PREFIX . $taxonomy . '__in', $settings_ ),
622	+ );
623	+ }
624	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . $taxonomy . '__not_in', $settings_ ) ) {
625	+ $taxonomy_setting[] = array(
626	+ 'taxonomy' => $taxonomy,
627	+ 'field' => 'slug',
628	+ 'terms' => (array) PT_CV_Functions::setting_value( PT_CV_PREFIX . $taxonomy . '__not_in', $settings_ ),
629	+ 'operator' => 'NOT IN',
630	+ );
631	+ }
632	+ }
633	+
634	+ // Get Taxonomy relation if there are more than 1 selected taxonomies \| set In & Not in of a taxonomy
635	+ if ( count( $taxonomies ) > 1 \|\| count( $taxonomy_setting ) > 1 ) {
636	+ $taxonomy_setting['relation'] = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'taxonomy-relation', $settings_, 'AND' );
637	+ }
638	+
639	+ // Filter taxonomy with Custom post types
640	+ $taxonomy_setting_ = apply_filters( PT_CV_PREFIX_ . 'taxonomy_setting', $taxonomy_setting );
641	+
642	+ $args = array_merge( $args, array( 'tax_query' => $taxonomy_setting_ ) );
643	+ break;
644	+
645	+ // Order
646	+ case 'order':
647	+
648	+ $order_settings = array();
649	+
650	+ // Advanced order by
651	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . $content_type . '-orderby', $settings_ ) ) {
652	+
653	+ // Get meta key to order by
654	+ $meta_key = PT_CV_Functions::setting_value( PT_CV_PREFIX . $content_type . '-orderby', $settings_ );
655	+
656	+ // Use 'meta_value_num' for numeric values
657	+ $meta_numeric_values = apply_filters( PT_CV_PREFIX_ . 'meta_numeric_values', array() );
658	+ $meta_orderby = in_array( $meta_key, $meta_numeric_values ) ? 'meta_value_num' : 'meta_value';
659	+ $order_settings = array(
660	+ 'meta_key' => $meta_key,
661	+ 'orderby' => $meta_orderby,
662	+ 'order' => PT_CV_Functions::setting_value( PT_CV_PREFIX . 'advanced-order', $settings_ ),
663	+ );
664	+
665	+ } else {
666	+ // Common order by
667	+
668	+ $orderby = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'orderby', $settings_ );
669	+ $order_by_options = array_keys( PT_CV_Values::post_regular_orderby() );
670	+ if ( in_array( $orderby, $order_by_options ) ) {
671	+ $order_settings = array(
672	+ 'orderby' => $orderby,
673	+ 'order' => PT_CV_Functions::setting_value( PT_CV_PREFIX . 'order', $settings_ )
674	+ );
675	+ }
676	+ }
677	+
678	+ $args = array_merge( $args, $order_settings );
679	+ break;
680	+
681	+ default:
682	+ break;
683	+ }
684	+ }
685	+ }
686	+ }
687	+
688	+ /**
689	+ * Get Fields settings
690	+ *
691	+ * @param array $settings_ The settings array
692	+ * @param array $dargs The settings array of Fields
693	+ */
694	+ static function view_get_display_settings( $settings_, &$dargs ) {
695	+
696	+ $view_type = $dargs['view-type'];
697	+
698	+ /**
699	+ * Layout format
700	+ */
701	+ $dargs['layout-format'] = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'layout-format', $settings_ );
702	+
703	+ /**
704	+ * Columns count & Rows count
705	+ */
706	+ $dargs['number-columns'] = PT_CV_Functions::setting_value( PT_CV_PREFIX . $view_type . '-' . 'number-columns', $settings_, 1 );
707	+ $dargs['number-rows'] = PT_CV_Functions::setting_value( PT_CV_PREFIX . $view_type . '-' . 'number-rows', $settings_, 1 );
708	+
709	+ /**
710	+ * Fields settings
711	+ */
712	+ $cfields_settings = PT_CV_Functions::settings_values_by_prefix( PT_CV_PREFIX . 'show-field-', $settings_ );
713	+ $cfields = (array) array_keys( (array) $cfields_settings );
714	+ foreach ( $cfields as $field ) {
715	+ // If show this field
716	+ if ( PT_CV_Functions::setting_value( PT_CV_PREFIX . 'show-field-' . $field, $settings_ ) ) {
717	+ // Add this field to display fields list
718	+ $dargs['fields'][] = $field;
719	+
720	+ // Get field settings
721	+ switch ( $field ) {
722	+
723	+ // Get thumbnail settings
724	+ case 'thumbnail':
725	+
726	+ $field_setting = array();
727	+
728	+ $fields = array( 'position', 'size', 'style' );
729	+ $prefix = PT_CV_PREFIX . 'field-thumbnail-';
730	+ PT_CV_Functions::settings_values( $fields, $field_setting, $settings_, $prefix );
731	+
732	+ $dargs['field-settings'][$field] = apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_setting_values', $field_setting, $settings_, $prefix );
733	+
734	+ break;
735	+
736	+ // Get meta fields settings
737	+ case 'meta-fields':
738	+
739	+ $field_setting = array();
740	+
741	+ $prefix = PT_CV_PREFIX . 'meta-fields-';
742	+ $meta_fields_settings = PT_CV_Functions::settings_values_by_prefix( PT_CV_PREFIX . 'meta-fields-', $settings_ );
743	+ $fields = (array) array_keys( (array) $meta_fields_settings );
744	+
745	+ PT_CV_Functions::settings_values( $fields, $field_setting, $settings_, $prefix );
746	+
747	+ $dargs['field-settings'][$field] = apply_filters( PT_CV_PREFIX_ . 'field_meta_fields_setting_values', $field_setting, $settings_, $prefix );
748	+
749	+ break;
750	+
751	+ // Get content settings
752	+ case 'content':
753	+
754	+ $field_setting = array();
755	+
756	+ $prefix = PT_CV_PREFIX . 'field-content-';
757	+ $fields = PT_CV_Functions::settings_keys( 'field-content-', PT_CV_Settings::field_settings() );
758	+ PT_CV_Functions::settings_values( $fields, $field_setting, $settings_, $prefix );
759	+
760	+ if ( $field_setting['show'] == 'excerpt' ) {
761	+ $field_setting = array_merge( $field_setting, PT_CV_Functions::settings_values_by_prefix( PT_CV_PREFIX . 'field-excerpt-', $settings_ ) );
762	+ }
763	+
764	+ $dargs['field-settings'][$field] = apply_filters( PT_CV_PREFIX_ . 'field_content_setting_values', $field_setting, $settings_, $prefix );
765	+
766	+ break;
767	+
768	+ default:
769	+ break;
770	+ }
771	+ }
772	+ }
773	+ }
774	+
775	+ /**
776	+ * Get Pagination settings
777	+ *
778	+ * @param array $settings_ The settings array
779	+ * @param array $dargs The settings array of Fields
780	+ * @param array $args The parameters array
781	+ * @param array $pargs The pagination settings array
782	+ */
783	+ static function view_get_pagination_settings( $settings_, &$dargs, &$args, $pargs ) {
784	+
785	+ // Get Limit value
786	+ $limit = (int) PT_CV_Functions::setting_value( PT_CV_PREFIX . 'limit', $settings_ );
787	+ $args['limit'] = $args['posts_per_page'] = empty( $limit ) ? - 1 : $limit;
788	+
789	+ // Get pagination enable/disable
790	+ $pagination = PT_CV_Functions::setting_value( PT_CV_PREFIX . 'enable-pagination', $settings_ );
791	+ if ( $pagination ) {
792	+ $field_setting = array();
793	+
794	+ $prefix = PT_CV_PREFIX . 'pagination-';
795	+ $fields = PT_CV_Functions::settings_keys( 'pagination-', PT_CV_Settings::settings_pagination() );
796	+ PT_CV_Functions::settings_values( $fields, $field_setting, $settings_, $prefix );
797	+
798	+ $dargs['pagination-settings'] = apply_filters( PT_CV_PREFIX_ . 'pagination_settings', $field_setting );
799	+
800	+ // If Items per page is set, get its value
801	+ $posts_per_page = isset( $dargs['pagination-settings']['items-per-page'] ) ? (int) $dargs['pagination-settings']['items-per-page'] : $limit;
802	+
803	+ if ( $limit != - 1 && $posts_per_page > $limit ) {
804	+ $posts_per_page = $limit;
805	+ }
806	+
807	+ // Set 'posts_per_page' parameter
808	+ $args['posts_per_page'] = $posts_per_page;
809	+
810	+ // Get offset
811	+ if ( isset( $pargs['page'] ) ) {
812	+ $offset = $posts_per_page * ( (int) $pargs['page'] - 1 );
813	+
814	+ // Reaching out of limit
815	+ if ( $offset > $limit ) {
816	+ return '';
817	+ }
818	+
819	+ // Set 'offset' parameter
820	+ $args['offset'] = $offset;
821	+ }
822	+ }
823	+ }
824	+
825	+ /**
826	+ * Get Other settings
827	+ *
828	+ * @param array $settings_ The settings array
829	+ * @param array $dargs The settings array of Fields
830	+ */
831	+ static function view_get_other_settings( $settings_, &$dargs ) {
832	+ $field_setting = array();
833	+
834	+ $prefix = PT_CV_PREFIX . 'other-';
835	+ $fields = PT_CV_Functions::settings_keys( 'other-', PT_CV_Settings::settings_other() );
836	+ PT_CV_Functions::settings_values( $fields, $field_setting, $settings_, $prefix );
837	+
838	+ $dargs['other-settings'] = apply_filters( PT_CV_PREFIX_ . 'other_settings', $field_setting, $settings_ );
839	+ }
840	+
841	+ /**
842	+ * Process data when submit form add/edit view
843	+ *
844	+ * @return void
845	+ */
846	+ static function view_submit() {
847	+ if ( empty( $_POST ) ) {
848	+ return;
849	+ }
850	+
851	+ PT_CV_Functions::_nonce_check( 'form_nonce', 'view_submit' );
852	+
853	+ /**
854	+ * INSERT VIEW
855	+ */
856	+ // View title
857	+ $title = esc_sql( $_POST[PT_CV_PREFIX . 'view-title'] );
858	+
859	+ // Current post id ( 0 if new view )
860	+ $cur_post_id = esc_sql( $_POST[PT_CV_PREFIX . 'post-id'] );
861	+
862	+ // Insert/update post
863	+ $post_id = PT_CV_Functions::post_insert( array( 'ID' => $cur_post_id, 'title' => $title ) );
864	+
865	+ /**
866	+ * ADD/UPDATE CUSTOM FIELDS
867	+ */
868	+ // Get current view id, = 0 if it is new view
869	+ $cur_view_id = esc_sql( $_POST[PT_CV_PREFIX . 'view-id'] );
870	+ $view_id = empty( $cur_view_id ) ? PT_CV_Functions::string_random() : $cur_view_id;
871	+ update_post_meta( $post_id, PT_CV_META_ID, $view_id );
872	+ update_post_meta( $post_id, PT_CV_META_SETTINGS, base64_encode( serialize( $_POST ) ) );
873	+
874	+ /**
875	+ * redirect to edit page
876	+ */
877	+ $edit_link = PT_CV_Functions::view_link( $view_id );
878	+ wp_redirect( $edit_link );
879	+ exit;
880	+ }
881	+
882	+ /**
883	+ * Add shortcode
884	+ *
885	+ * @param array $atts Array of setting parameters for shortcode
886	+ * @param string $content Content of shortcode
887	+ */
888	+ static function view_output( $atts, $content = '' ) {
889	+ $atts = shortcode_atts(
890	+ array(
891	+ 'id' => 0,
892	+ ),
893	+ $atts
894	+ );
895	+
896	+ // View meta id
897	+ $id = esc_sql( $atts['id'] );
898	+
899	+ // Get View settings
900	+ $settings = PT_CV_Functions::view_get_settings( $id );
901	+
902	+ // Show View output
903	+ return balanceTags( PT_CV_Functions::view_process_settings( $id, $settings ) );
904	+ }
905	+
906	+ /**
907	+ * Generate link to View page: Add view/ Edit view
908	+ *
909	+ * @param string $view_id The view id
910	+ *
911	+ * @return string
912	+ */
913	+ public static function view_link( $view_id ) {
914	+
915	+ $edit_link = admin_url( 'admin.php?page=' . PT_CV_DOMAIN . '-add' );
916	+ if ( ! empty( $view_id ) ) {
917	+ $query_args = array( 'id' => $view_id );
918	+ $edit_link = add_query_arg( $query_args, $edit_link );
919	+ }
920	+
921	+ return $edit_link;
922	+ }
923	+
924	+ /**
925	+ * Callback function for ajax Preview action 'preview_request'
926	+ */
927	+ static function ajax_callback_preview_request() {
928	+
929	+ // Validate request
930	+ check_ajax_referer( PT_CV_PREFIX_ . 'ajax_nonce', 'ajax_nonce' );
931	+
932	+ do_action( PT_CV_PREFIX_ . 'preview_header' );
933	+
934	+ // Request handle
935	+ $settings = array();
936	+ parse_str( $_POST['data'], $settings );
937	+
938	+ // Store settings
939	+ session_start();
940	+ $_SESSION[PT_CV_PREFIX . 'settings'] = $settings;
941	+
942	+ // Show View output
943	+ echo balanceTags( PT_CV_Functions::view_process_settings( null, $settings ) );
944	+
945	+ do_action( PT_CV_PREFIX_ . 'preview_footer' );
946	+ // Must exit
947	+ die;
948	+ }
949	+
950	+ /**
951	+ * Callback function for ajax Pagination action 'pagination_request'
952	+ */
953	+ static function ajax_callback_pagination_request() {
954	+
955	+ // Validate request
956	+ check_ajax_referer( PT_CV_PREFIX_ . 'ajax_nonce', 'ajax_nonce' );
957	+
958	+ // View meta id
959	+ $id = esc_sql( $_POST['id'] );
960	+
961	+ if ( empty( $id ) ) {
962	+ // Get saved $settings
963	+ session_start();
964	+ if ( isset( $_SESSION[PT_CV_PREFIX . 'settings'] ) ) {
965	+ $settings = $_SESSION[PT_CV_PREFIX . 'settings'];
966	+ } else {
967	+ $settings = '';
968	+ }
969	+ } else {
970	+ // Get View settings
971	+ $settings = PT_CV_Functions::view_get_settings( $id );
972	+ }
973	+ // Pagination settings
974	+ $pargs = array( 'page' => (int) esc_sql( $_POST['page'] ) );
975	+
976	+ // Show View output
977	+ echo balanceTags( PT_CV_Functions::view_process_settings( $id, $settings, $pargs ) );
978	+
979	+ // Must exit
980	+ die;
981	+ }
982	+ }
983	+
984	+ }

includes/hooks.php ADDED Viewed

	@@ -0,0 +1,119 @@


1	+ <?php
2	+
3	+ /**
4	+ * Custom filters/actions
5	+ *
6	+ * @package PT_Content_Views
7	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
8	+ * @license GPL-2.0+
9	+ * @link http://example.com
10	+ * @copyright 2014 Palace Of Themes
11	+ */
12	+ if ( ! class_exists( 'PT_CV_Hooks' ) ) {
13	+
14	+ /**
15	+ * @name PT_CV_Hooks
16	+ */
17	+ class PT_CV_Hooks {
18	+
19	+ /**
20	+ * Add custom filters/actions
21	+ */
22	+ static function init() {
23	+ // Filter Output
24	+ add_filter( PT_CV_PREFIX_ . 'validate_settings', array( __CLASS__, 'filter_validate_settings' ), 10, 3 );
25	+
26	+ // Do action
27	+ }
28	+
29	+ /**
30	+ * Validate settings filter
31	+ *
32	+ * @param string $error The error message
33	+ * @param array $dargs The Display parameters array
34	+ * @param array $args The Query parameters array
35	+ */
36	+ public static function filter_validate_settings( $errors, $dargs, $args ) {
37	+
38	+ // echo "<pre>";
39	+ // var_dump( 'query args', $args );
40	+ // echo "</pre>";
41	+ ////
42	+ // echo "<pre>";
43	+ // var_dump( 'display args', $dargs );
44	+ // echo "</pre>";
45	+
46	+ // Prefix string for error message
47	+ $messages = array(
48	+ 'field' => array(
49	+ 'select' => __( 'Please select an option in : ', PT_CV_DOMAIN ),
50	+ 'text' => __( 'Please set value in : ', PT_CV_DOMAIN ),
51	+ ),
52	+ 'tab' => array(
53	+ 'filter' => __( 'Filter Settings', PT_CV_DOMAIN ),
54	+ 'display' => __( 'Display Settings', PT_CV_DOMAIN ),
55	+ ),
56	+ );
57	+
58	+ /**
59	+ * Validate Query parameters
60	+ */
61	+
62	+ // Post type
63	+ if ( empty( $args['post_type'] ) ) {
64	+ $errors[] = $messages['field']['select'] . $messages['tab']['filter'] . ' > ' . __( 'Content type', PT_CV_DOMAIN );
65	+ }
66	+
67	+ /**
68	+ * Validate common Display parameters
69	+ */
70	+
71	+ // View type
72	+ if ( empty( $dargs['view-type'] ) ) {
73	+ $errors[] = $messages['field']['select'] . $messages['tab']['display'] . ' > ' . __( 'View type', PT_CV_DOMAIN );
74	+ }
75	+
76	+ // Layout format
77	+ if ( empty( $dargs['layout-format'] ) ) {
78	+ $errors[] = $messages['field']['select'] . $messages['tab']['display'] . ' > ' . __( 'Layout format of an output item', PT_CV_DOMAIN );
79	+ }
80	+
81	+ // Field settings
82	+ if ( ! isset( $dargs['fields'] ) ) {
83	+ $errors[] = $messages['field']['select'] . $messages['tab']['display'] . ' > ' . __( 'Fields settings', PT_CV_DOMAIN ) . ' > ' . __( 'Fields display', PT_CV_DOMAIN );
84	+ }
85	+
86	+ // Excerpt length
87	+ $fargs = isset( $dargs['field-settings'] ) ? $dargs['field-settings'] : array();
88	+ if ( isset( $fargs['content'] ) && $fargs['content']['show'] === 'excerpt' ) {
89	+ if ( empty( $fargs['content']['length'] ) ) {
90	+ $errors[] = $messages['field']['text'] . $messages['tab']['display'] . ' > ' . __( 'Fields settings', PT_CV_DOMAIN ) . ' > ' . __( 'Content settings', PT_CV_DOMAIN ) . __( 'Excerpt length', PT_CV_DOMAIN );
91	+ }
92	+ }
93	+
94	+ // Item per page
95	+ if ( isset( $dargs['pagination-settings'] ) ) {
96	+ if ( empty( $dargs['pagination-settings']['items-per-page'] ) ) {
97	+ $errors[] = $messages['field']['text'] . $messages['tab']['display'] . ' > ' . __( 'Pagination settings', PT_CV_DOMAIN ) . ' > ' . __( 'Items per page', PT_CV_DOMAIN );
98	+ }
99	+ }
100	+
101	+ /**
102	+ * Validate Display parameters of view types
103	+ */
104	+ if ( ! empty( $dargs['view-type'] ) ) {
105	+ switch ( $dargs['view-type'] ) {
106	+ case 'grid':
107	+ if ( empty( $dargs['number-columns'] ) ) {
108	+ $errors[] = $messages['field']['text'] . $messages['tab']['display'] . ' > ' . __( 'View type settings', PT_CV_DOMAIN ) . ' > ' . __( 'Items per row', PT_CV_DOMAIN );
109	+ }
110	+ break;
111	+ }
112	+ }
113	+
114	+ return array_filter( $errors );
115	+ }
116	+
117	+ }
118	+
119	+ }

includes/html-viewtype.php ADDED Viewed

	@@ -0,0 +1,272 @@


1	+ <?php
2	+ /**
3	+ * HTML output for specific View types
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ if ( ! class_exists( 'PT_CV_Html_ViewType' ) ) {
13	+
14	+ /**
15	+ * @name PT_CV_Html_ViewType
16	+ * @todo List of functions relates to View type output
17	+ */
18	+ class PT_CV_Html_ViewType {
19	+
20	+ /**
21	+ * Wrap content of Grid type
22	+ *
23	+ * @param array $content_items The array of Raw HTML output (is not wrapped) of each item
24	+ * @param array $dargs The array of Display settings
25	+ * @param array $content The output array
26	+ *
27	+ * @return array Array of rows, each row contains columns
28	+ */
29	+ static function grid_wrapper( $content_items, $dargs, &$content ) {
30	+
31	+ // -- Get column span
32	+ $columns = ( (int) $dargs['number-columns'] < count( $content_items ) ) ? (int) $dargs['number-columns'] : count( $content_items );
33	+
34	+ if ( ! $columns ) {
35	+ $columns = 1;
36	+ }
37	+
38	+ $span_width_last = $span_width = (int) ( 12 / $columns );
39	+
40	+ // Get span for the last column on row
41	+ if ( 12 % $columns ) {
42	+ $span_width_last = $span_width + ( 12 % $columns );
43	+ }
44	+
45	+ // Get span class
46	+ $span_class = apply_filters( PT_CV_PREFIX_ . 'span_class', 'col-md-' );
47	+
48	+ // -- Row output
49	+
50	+ // Get wrapper class of a row
51	+ $row_classes = apply_filters( PT_CV_PREFIX_ . 'row_class', array( 'row', PT_CV_PREFIX . 'row' ) );
52	+ $row_class = implode( ' ', $row_classes );
53	+
54	+ // Split items to rows
55	+ $columns_item = array_chunk( $content_items, $columns );
56	+
57	+ // Get HTML of each row
58	+ foreach ( $columns_item as $items_per_row ) {
59	+ $row_html = array();
60	+
61	+ foreach ( $items_per_row as $idx => $content_item ) {
62	+ $_span_width = ( $idx == count( $items_per_row ) - 1 ) ? $span_width_last : $span_width;
63	+
64	+ // Wrap content of item
65	+ $row_html[] = PT_CV_Html::content_item_wrap( $content_item, $span_class . $_span_width, $dargs );
66	+ }
67	+
68	+ $content[] = sprintf( '<div class="%1$s">%2$s</div>', esc_attr( $row_class ), implode( "\n", $row_html ) );
69	+ }
70	+ }
71	+
72	+ /**
73	+ * Wrap content of Collapsible List type
74	+ *
75	+ * @param array $content_items The array of Raw HTML output (is not wrapped) of each item
76	+ * @param array $dargs The array of Display settings
77	+ * @param array $content The output array
78	+ *
79	+ * @return string Collapsible list, wrapped in a "panel-group" div
80	+ */
81	+ static function collapsible_wrapper( $content_items, $dargs, &$content ) {
82	+
83	+ // Generate random id for the wrapper of Collapsible list
84	+ $random_id = PT_CV_Functions::string_random();
85	+
86	+ $collapsible_list = array();
87	+ foreach ( $content_items as $idx => $content_item ) {
88	+ // Replace class in body of collapsible item, to show one (now is the first item)
89	+ $class = ( $idx == 0 ) ? 'in' : '';
90	+ $content_item = str_replace( PT_CV_PREFIX_UPPER . 'CLASS', $class, $content_item );
91	+
92	+ // Replace id in {data-parent="#ID"} of each item by generated id
93	+ $collapsible_list[] = str_replace( PT_CV_PREFIX_UPPER . 'ID', $random_id, $content_item );
94	+ }
95	+
96	+ // Data attribute
97	+ $open_multiple = ( isset( $dargs['view-type-settings']['open-multiple'] ) && $dargs['view-type-settings']['open-multiple'] == 'yes' ) ? 'data-multiple-open="yes"' : '';
98	+
99	+ // Collapsible wrapper class
100	+ $wrapper_class = apply_filters( PT_CV_PREFIX_ . 'wrapper_collapsible_class', 'panel-group' );
101	+
102	+ $output = sprintf( '<div class="%s" id="%s" %s>%s</div>', esc_attr( $wrapper_class ), esc_attr( $random_id ), $open_multiple, balanceTags( implode( "\n", $collapsible_list ) ) );
103	+
104	+ $content[] = $output;
105	+ }
106	+
107	+ /**
108	+ * Wrap content of Scrollable list
109	+ *
110	+ * @param array $content_items The array of Raw HTML output (is not wrapped) of each item
111	+ * @param array $dargs The array of Display settings
112	+ * @param array $content The output array
113	+ *
114	+ * @return array Array of rows, each row contains columns
115	+ */
116	+ static function scrollable_wrapper( $content_items, $dargs, &$content ) {
117	+
118	+ // ID for the wrapper of scrollable list
119	+ $wrapper_id = PT_CV_Functions::string_random();
120	+
121	+ // Store all output of Scrollale list (indicators, content, controls)
122	+ $scrollable_html = array();
123	+
124	+ $scrollable_content_data = self::scrollable_content( $content_items, $dargs );
125	+ $count_slides = $scrollable_content_data['count_slides'];
126	+ $scrollable_content = $scrollable_content_data['scrollable_content'];
127	+
128	+ // Js code
129	+ $interval = apply_filters( PT_CV_PREFIX_ . 'scrollable_interval', 'false', $dargs );
130	+ $js = "$('#$wrapper_id').carousel({ interval : $interval })";
131	+
132	+ $scrollable_html[] = PT_CV_Html::inline_script( $js );
133	+
134	+ // Indicator html
135	+ $show_indicator = isset( $dargs['view-type-settings']['indicator'] ) ? $dargs['view-type-settings']['indicator'] : 'yes';
136	+ $scrollable_html[] = self::scrollable_indicator( ( $show_indicator == 'yes' ) ? 1 : 0, $wrapper_id, $count_slides );
137	+
138	+ // Content html
139	+ $scrollable_html[] = $scrollable_content;
140	+
141	+ // Control html
142	+ $show_navigation = isset( $dargs['view-type-settings']['navigation'] ) ? $dargs['view-type-settings']['navigation'] : 'yes';
143	+ $scrollable_html[] = self::scrollable_control( ( $show_navigation == 'yes' ) ? 1 : 0, $wrapper_id );
144	+
145	+ // Get wrapper class scrollable
146	+ $scrollable_class = apply_filters( PT_CV_PREFIX_ . 'scrollable_class', 'carousel slide' );
147	+ $content[] = sprintf( '<div id="%s" class="%s" data-ride="carousel">%s</div>', esc_attr( $wrapper_id ), esc_attr( $scrollable_class ), implode( "\n", $scrollable_html ) );
148	+ }
149	+
150	+ /**
151	+ * HTML output of item in Scrollable List
152	+ *
153	+ * @param array $content_items The array of Raw HTML output (is not wrapped) of each item
154	+ * @param array $dargs The array of Display settings
155	+ *
156	+ * @return array
157	+ */
158	+ static function scrollable_content( $content_items, $dargs ) {
159	+ // Store content of a Scrollable list
160	+ $scrollable_content = array();
161	+
162	+ // -- Get column span
163	+ $columns = ( (int) $dargs['number-columns'] < count( $content_items ) ) ? (int) $dargs['number-columns'] : count( $content_items );
164	+ $rows = ( $dargs['number-rows'] ) ? (int) $dargs['number-rows'] : 1;
165	+
166	+ $span_width_last = $span_width = (int) ( 12 / $columns );
167	+
168	+ // Get span for the last column on row
169	+ if ( 12 % $columns ) {
170	+ $span_width_last = $span_width + ( 12 % $columns );
171	+ }
172	+
173	+ // Get span class
174	+ $span_class = apply_filters( PT_CV_PREFIX_ . 'span_class', 'col-md-' );
175	+
176	+ // -- Row output
177	+
178	+ // Get wrapper class of a scrollable slide
179	+ $slide_class = apply_filters( PT_CV_PREFIX_ . 'scrollable_slide_class', 'item' );
180	+
181	+ // Get wrapper class of a row
182	+ $row_classes = apply_filters( PT_CV_PREFIX_ . 'row_class', array( 'row', PT_CV_PREFIX . 'row' ) );
183	+ $row_class = implode( ' ', array_filter( $row_classes ) );
184	+
185	+ // Split items to slide
186	+ $slides_item = array_chunk( $content_items, $columns * $rows );
187	+
188	+ foreach ( $slides_item as $s_idx => $slide ) {
189	+ // Store content of a slide
190	+ $slide_html = array();
191	+
192	+ // Split items to rows
193	+ $columns_item = array_chunk( $slide, $columns );
194	+
195	+ // Get HTML of each row
196	+ foreach ( $columns_item as $items_per_row ) {
197	+ $row_html = array();
198	+
199	+ foreach ( $items_per_row as $idx => $content_item ) {
200	+ $_span_width = ( $idx == count( $items_per_row ) - 1 ) ? $span_width_last : $span_width;
201	+
202	+ // Wrap content of item
203	+ $row_html[] = PT_CV_Html::content_item_wrap( $content_item, $span_class . $_span_width );
204	+ }
205	+
206	+ $slide_html[] = sprintf( '<div class="%1$s">%2$s</div>', esc_attr( $row_class ), implode( "\n", $row_html ) );
207	+ }
208	+
209	+ // Show first slide
210	+ $this_class = $slide_class . ( ( $s_idx == 0 ) ? ' active' : '' );
211	+ $scrollable_content[] = sprintf( '<div class="%1$s">%2$s</div>', esc_attr( $this_class ), implode( "\n", $slide_html ) );
212	+ }
213	+
214	+ // Get class of wrapper of content of scrollable list
215	+ $content_class = apply_filters( PT_CV_PREFIX_ . 'scrollable_content_class', 'carousel-inner' );
216	+ $content = sprintf( '<div class="%s">%s</div>', esc_attr( $content_class ), implode( "\n", $scrollable_content ) );
217	+
218	+ return array(
219	+ 'scrollable_content' => $content,
220	+ 'count_slides' => count( $slides_item ),
221	+ );
222	+ }
223	+
224	+ /**
225	+ * HTML output of Indicators in Scrollable
226	+ *
227	+ * @param bool $show Whether or not to show this element
228	+ * @param string $wrapper_id The ID of wrapper of scrollable list
229	+ * @param int $count_slides The amount of items
230	+ */
231	+ static function scrollable_indicator( $show, $wrapper_id, $count_slides ) {
232	+ if ( ! $show ) {
233	+ return '';
234	+ }
235	+
236	+ $li = array();
237	+ for ( $index = 0; $index < $count_slides; $index ++ ) {
238	+ $class = ( $index == 0 ) ? 'active' : '';
239	+ $li[] = sprintf( '<li data-target="#%s" data-slide-to="%s" class="%s"></li>', esc_attr( $wrapper_id ), esc_attr( $index ), $class );
240	+ }
241	+
242	+ $output = '<ol class="carousel-indicators">' . implode( "\n", $li ) . '</ol>';
243	+
244	+ return $output;
245	+ }
246	+
247	+ /**
248	+ * HTML output of Controls in Scrollable
249	+ *
250	+ * @param bool $show Whether or not to show this element
251	+ * @param string $wrapper_id The ID of wrapper of scrollable list
252	+ */
253	+ static function scrollable_control( $show, $wrapper_id ) {
254	+ if ( ! $show ) {
255	+ return '';
256	+ }
257	+
258	+ $output = sprintf(
259	+ '<a class="left carousel-control" href="#%1$s" data-slide="prev">
260	+ <span class="glyphicon glyphicon-chevron-left"></span>
261	+ </a>
262	+ <a class="right carousel-control" href="#%1$s" data-slide="next">
263	+ <span class="glyphicon glyphicon-chevron-right"></span>
264	+ </a>',
265	+ esc_attr( $wrapper_id )
266	+ );
267	+
268	+ return $output;
269	+ }
270	+ }
271	+
272	+ }

includes/html.php ADDED Viewed

	@@ -0,0 +1,828 @@


1	+ <?php
2	+ /**
3	+ * HTML output, class, id generating
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ if ( ! class_exists( 'PT_CV_Html' ) ) {
13	+
14	+ /**
15	+ * @name PT_CV_Html
16	+ * @todo related HTML functions: Define HTML layout, Set class name...
17	+ */
18	+ class PT_CV_Html {
19	+
20	+ // Store directory of selected view_types
21	+ static $view_type_dir = array();
22	+ // Store all selected styles
23	+ static $style = array();
24	+
25	+ /**
26	+ * return class for Panel (Group of) group of params
27	+ *
28	+ * @return string
29	+ */
30	+ static function html_panel_group_class() {
31	+ return 'panel-group';
32	+ }
33	+
34	+ /**
35	+ * Return ID for Panel (Group of) group of params
36	+ *
37	+ * @param string $id Unique id of element
38	+ *
39	+ * @return string
40	+ */
41	+ static function html_panel_group_id( $id ) {
42	+ return 'panel-group-' . $id;
43	+ }
44	+
45	+ /**
46	+ * Return class for no animation elements
47	+ *
48	+ * @return string
49	+ */
50	+ static function html_no_animation_class() {
51	+ return PT_CV_PREFIX . 'no-animation';
52	+ }
53	+
54	+ /**
55	+ * Return class for group of params
56	+ *
57	+ * @return string
58	+ */
59	+ static function html_group_class() {
60	+ return PT_CV_PREFIX . 'group';
61	+ }
62	+
63	+ /**
64	+ * Return ID for group of params
65	+ *
66	+ * @param string $id Unique id of element
67	+ *
68	+ * @return string
69	+ */
70	+ static function html_group_id( $id ) {
71	+ return self::html_group_class() . '-' . $id;
72	+ }
73	+
74	+ /**
75	+ * Collapse HTML
76	+ *
77	+ * @param string $parent_id Id of parent element
78	+ * @param string $id Unique id of element
79	+ * @param string $heading Heading text
80	+ * @param string $content Content
81	+ * @param bool $show Show/hide the content
82	+ */
83	+ static function html_collapse_one( $parent_id, $id, $heading, $content = '', $show = true ) {
84	+ $class = $show ? 'in' : '';
85	+ ob_start();
86	+ ?>
87	+ <div class="panel panel-primary pt-accordion">
88	+ <div class="panel-heading">
89	+ <h4 class="panel-title" title="<?php _e( 'Click to toggle', PT_CV_DOMAIN ); ?>">
90	+ <a class="pt-accordion-a" data-parent="#<?php echo esc_attr( $parent_id ); ?>" href="#<?php echo esc_attr( $id ); ?>">
91	+ <?php echo balanceTags( $heading ); ?>
92	+ </a>
93	+ </h4>
94	+ <span class="pull-right clickable"><i class="glyphicon glyphicon-minus"></i></span>
95	+ </div>
96	+ <div id="<?php echo esc_attr( $id ); ?>" class="panel-body <?php echo esc_attr( $class ); ?>">
97	+ <div class="panel-body">
98	+ <?php echo balanceTags( $content ); ?>
99	+ </div>
100	+ </div>
101	+ </div>
102	+ <?php
103	+ return ob_get_clean();
104	+ }
105	+
106	+ /**
107	+ * HTML content of Preview box
108	+ */
109	+ static function html_preview_box() {
110	+ ob_start();
111	+ ?>
112	+ <div class="panel panel-default collapse" id="<?php echo esc_attr( PT_CV_PREFIX ); ?>preview-box"></div>
113	+ <div class="text-center hidden" style="position: absolute; left: 50%; top: 160px;">
114	+ <?php echo balanceTags( self::html_loading_img() ); ?>
115	+ </div>
116	+ <?php
117	+ return ob_get_clean();
118	+ }
119	+
120	+ /**
121	+ * Show loading image
122	+ *
123	+ * @param type $dimension
124	+ *
125	+ * @return type
126	+ */
127	+ static function html_loading_img( $dimension = 16, $class = '' ) {
128	+ $img = sprintf( '<img width="%1$s" height="%1$s" class="%2$s" alt="%3$s" src="%4$s" /><div class="clear %5$s"></div>', esc_attr( $dimension ), esc_attr( $class ), __( 'loading', PT_CV_DOMAIN ), 'data:image/gif;base64,R0lGODlhEAAQAPIAAP///wAAAMLCwkJCQgAAAGJiYoKCgpKSkiH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAEAAQAAADMwi63P4wyklrE2MIOggZnAdOmGYJRbExwroUmcG2LmDEwnHQLVsYOd2mBzkYDAdKa+dIAAAh+QQJCgAAACwAAAAAEAAQAAADNAi63P5OjCEgG4QMu7DmikRxQlFUYDEZIGBMRVsaqHwctXXf7WEYB4Ag1xjihkMZsiUkKhIAIfkECQoAAAAsAAAAABAAEAAAAzYIujIjK8pByJDMlFYvBoVjHA70GU7xSUJhmKtwHPAKzLO9HMaoKwJZ7Rf8AYPDDzKpZBqfvwQAIfkECQoAAAAsAAAAABAAEAAAAzMIumIlK8oyhpHsnFZfhYumCYUhDAQxRIdhHBGqRoKw0R8DYlJd8z0fMDgsGo/IpHI5TAAAIfkECQoAAAAsAAAAABAAEAAAAzIIunInK0rnZBTwGPNMgQwmdsNgXGJUlIWEuR5oWUIpz8pAEAMe6TwfwyYsGo/IpFKSAAAh+QQJCgAAACwAAAAAEAAQAAADMwi6IMKQORfjdOe82p4wGccc4CEuQradylesojEMBgsUc2G7sDX3lQGBMLAJibufbSlKAAAh+QQJCgAAACwAAAAAEAAQAAADMgi63P7wCRHZnFVdmgHu2nFwlWCI3WGc3TSWhUFGxTAUkGCbtgENBMJAEJsxgMLWzpEAACH5BAkKAAAALAAAAAAQABAAAAMyCLrc/jDKSatlQtScKdceCAjDII7HcQ4EMTCpyrCuUBjCYRgHVtqlAiB1YhiCnlsRkAAAOwAAAAAAAAAAAA==', PT_CV_PREFIX . 'clear-pagination' );
129	+
130	+ return apply_filters( PT_CV_PREFIX_ . 'loading_image', $img );
131	+ }
132	+
133	+ /**
134	+ * Html output for button
135	+ *
136	+ * @param string $style Bootstrap type of button
137	+ * @param string $text Text of button
138	+ * @param string $class Class of button
139	+ * @param string $size Size of button
140	+ *
141	+ * @return string
142	+ */
143	+ static function html_button( $style, $text = 'Button', $class = '', $size = '' ) {
144	+ return sprintf( '<button type="button" class="btn btn-%s %s %s">%s</button>', $style, $class, $size, $text );
145	+ }
146	+
147	+ /**
148	+ * Html output for a link, but style as button
149	+ *
150	+ * @param string $link Value for href attribute of link
151	+ * @param string $style Bootstrap type of button
152	+ * @param string $text Text of button
153	+ * @param string $class Class of button
154	+ * @param string $size Size of button
155	+ *
156	+ * @return string
157	+ */
158	+ static function link_button( $link, $style, $text = 'Button', $class = '', $size = '' ) {
159	+ return sprintf( '<a href="%s" class="btn btn-%s %s %s">%s</a>', $link, $style, $class, $size, $text );
160	+ }
161	+
162	+ /**
163	+ * Get Output HTML of a View type
164	+ *
165	+ * @param string $view_type The view type (grid, collapse...)
166	+ * @param array $dargs The array of Display settings
167	+ * @param object $post The post object
168	+ * @param string $style The style of view type (main, style2...)
169	+ */
170	+ static function view_type_output( $view_type, $dargs, $post, $style = 'main' ) {
171	+ $content = NULL;
172	+
173	+ if ( empty( $view_type ) ) {
174	+ return $content;
175	+ }
176	+
177	+ // Get view type directory
178	+ $view_type_dir = apply_filters( PT_CV_PREFIX_ . 'view_type_dir', PT_CV_VIEW_TYPE_OUTPUT, $view_type ) . $view_type;
179	+
180	+ // Get asset directory
181	+ $view_type_assets_dir = apply_filters( PT_CV_PREFIX_ . 'view_type_asset', $view_type_dir, $view_type );
182	+
183	+ if ( is_dir( $view_type_dir ) ) {
184	+ // Store view type & asset information
185	+ self::$view_type_dir[] = $view_type_assets_dir;
186	+ self::$style[] = $style;
187	+
188	+ // Generate HTML output of all content fields
189	+ $fields_html = array();
190	+ foreach ( $dargs['fields'] as $field_name ) {
191	+ // Get settings of fields
192	+ $fargs = isset( $dargs['field-settings'] ) ? $dargs['field-settings'] : array();
193	+
194	+ $fargs['layout-format'] = $dargs['layout-format'];
195	+
196	+ // Get HTML output of field
197	+ $fields_html[$field_name] = self::field_item_html( $field_name, $post, $fargs, $dargs );
198	+ }
199	+
200	+ // Get HTML content of view type, with specific style
201	+ $file_path = $view_type_dir . '/' . 'html' . '/' . $style . '.' . 'php';
202	+
203	+ if ( file_exists( $file_path ) ) {
204	+ ob_start();
205	+ // Include, not include_once
206	+ include $file_path;
207	+ $content = ob_get_clean();
208	+ }
209	+ }
210	+
211	+ return $content;
212	+ }
213	+
214	+ /**
215	+ * Wrap content of a item
216	+ *
217	+ * @param array $html_item The HTML output of a item
218	+ * @param string $class The extra wrapper class of a item, such as col span
219	+ * @param array $dargs The array of Display settings
220	+ *
221	+ * @return string Full HTML output of a item
222	+ */
223	+ static function content_item_wrap( $html_item, $class = '', $dargs = array() ) {
224	+ if ( empty( $html_item ) ) {
225	+ return '';
226	+ }
227	+ if ( $dargs ) {
228	+ // If only show Title
229	+ if ( isset( $dargs['fields'] ) && count( (array) $dargs['fields'] ) == 1 && $dargs['fields'][0] === 'title' ) {
230	+ $class .= ' ' . PT_CV_PREFIX . 'only-title';
231	+ }
232	+ }
233	+ // Get wrapper class of a item
234	+ $item_class = apply_filters( PT_CV_PREFIX_ . 'content_item_class', array( $class, PT_CV_PREFIX . 'content-item' ) );
235	+
236	+ $result = sprintf( '<div class="%1$s">%2$s</div>', esc_attr( implode( ' ', $item_class ) ), balanceTags( $html_item ) );
237	+
238	+ return $result;
239	+ }
240	+
241	+ /**
242	+ * Wrap content of all items
243	+ *
244	+ * @param array $content_items The array of Raw HTML output (is not wrapped) of each item
245	+ * @param array $dargs The array of Display settings
246	+ * @param int $current_page The current page
247	+ * @param int $post_per_page The number of posts per page
248	+ *
249	+ * @return string Full HTML output for Content View
250	+ */
251	+ static function content_items_wrap( $content_items, $dargs, $current_page, $post_per_page ) {
252	+ if ( empty( $content_items ) ) {
253	+ return '';
254	+ }
255	+
256	+ $content = array();
257	+
258	+ $view_type = $dargs['view-type'];
259	+
260	+ // Separate items by row, column
261	+ switch ( $view_type ) {
262	+
263	+ // Grid
264	+ case 'grid':
265	+
266	+ PT_CV_Html_ViewType::grid_wrapper( $content_items, $dargs, $content );
267	+
268	+ break;
269	+
270	+ // Collapsible List
271	+ case 'collapsible':
272	+
273	+ PT_CV_Html_ViewType::collapsible_wrapper( $content_items, $dargs, $content );
274	+
275	+ break;
276	+
277	+ // Scrollable List
278	+ case 'scrollable':
279	+
280	+ PT_CV_Html_ViewType::scrollable_wrapper( $content_items, $dargs, $content );
281	+
282	+ break;
283	+
284	+ default :
285	+ foreach ( $content_items as $content_item ) {
286	+ // Wrap content of item
287	+ $content[] = PT_CV_Html::content_item_wrap( $content_item );
288	+ }
289	+
290	+ $content = apply_filters( PT_CV_PREFIX_ . 'content_items_wrap', $content, $content_items, $dargs, $current_page, $post_per_page );
291	+
292	+ break;
293	+ }
294	+
295	+ // Join content
296	+ $content_list = balanceTags( implode( "\n", $content ) );
297	+
298	+ // Custom attribute of a page
299	+ $page_attr_ = apply_filters( PT_CV_PREFIX_ . 'page_attr', '', $view_type, $dargs, $content_items );
300	+ $page_attr = strip_tags( $page_attr_ );
301	+
302	+ // Wrap items in 'page' wrapper
303	+ $wrap_in_page = apply_filters( PT_CV_PREFIX_ . 'wrap_in_page', true, $dargs );
304	+ if ( $wrap_in_page ) {
305	+ // Wrap in page wrapper
306	+ $html = sprintf( '<div id="%s" class="%s" %s>%s</div>', esc_attr( PT_CV_PREFIX . 'page' . '-' . $current_page ), esc_attr( PT_CV_PREFIX . 'page' ), $page_attr, $content_list );
307	+ // Remove page attribute value
308	+ $page_attr = '';
309	+ } else {
310	+ $html = $content_list;
311	+ }
312	+
313	+ // If is first page, wrap content in 'view' wrapper
314	+ if ( $current_page === 1 ) {
315	+ // Get wrapper class of a view
316	+ $view_class = apply_filters( PT_CV_PREFIX_ . 'view_class', array( PT_CV_PREFIX . 'view', PT_CV_PREFIX . $view_type ) );
317	+
318	+ // ID for the wrapper
319	+ $view_id = PT_CV_PREFIX . 'view-' . PT_CV_Functions::string_random();
320	+
321	+ $output = sprintf( '<div class="%s" id="%s" %s>%s</div>', esc_attr( implode( ' ', array_filter( $view_class ) ) ), esc_attr( $view_id ), $page_attr, $html );
322	+
323	+ do_action( PT_CV_PREFIX_ . 'store_view_data', $view_id, $dargs );
324	+ } else {
325	+ $output = $html;
326	+ }
327	+
328	+ return $output;
329	+ }
330	+
331	+ /**
332	+ * HTML output of a field (thumbnail, title, content, meta fields...)
333	+ *
334	+ * @param string $field_name The name of field
335	+ * @param object $post The post object
336	+ * @param array $fargs The array of Field settings
337	+ * @param array $dargs The settings array of Fields
338	+ *
339	+ * @return string
340	+ */
341	+ static function field_item_html( $field_name, $post, $fargs, $dargs ) {
342	+ if ( empty( $field_name ) ) {
343	+ return '';
344	+ }
345	+
346	+ $html = '';
347	+
348	+ // Get other settings
349	+ $oargs = isset( $dargs['other-settings'] ) ? $dargs['other-settings'] : array();
350	+
351	+ switch ( $field_name ) {
352	+
353	+ // Thumbnail
354	+ case 'thumbnail':
355	+
356	+ if ( empty( $fargs['thumbnail'] ) ) {
357	+ break;
358	+ }
359	+
360	+ $html = self::_field_thumbnail( $post, $fargs, $dargs );
361	+
362	+ break;
363	+
364	+ // Title
365	+ case 'title':
366	+
367	+ // Get title class
368	+ $title_class = apply_filters( PT_CV_PREFIX_ . 'field_title_class', PT_CV_PREFIX . 'title' );
369	+
370	+ // Get title tag
371	+ $tag = apply_filters( PT_CV_PREFIX_ . 'field_title_tag', 'h4' );
372	+
373	+ // Get post title
374	+ $title = get_the_title( $post );
375	+ if ( empty( $title ) ) {
376	+ $title = __( '(no title)', PT_CV_DOMAIN );
377	+ }
378	+
379	+ $html = sprintf(
380	+ '<%1$s class="%2$s">%3$s</%1$s>',
381	+ $tag, esc_attr( $title_class ), self::_field_href( $oargs, $post, $title )
382	+ );
383	+
384	+ break;
385	+
386	+ // Content
387	+ case 'content':
388	+
389	+ if ( empty( $fargs['content'] ) ) {
390	+ break;
391	+ }
392	+
393	+ // Sets up global post data
394	+ setup_postdata( $post );
395	+
396	+ // Get content class
397	+ $content_class = apply_filters( PT_CV_PREFIX_ . 'field_content_class', PT_CV_PREFIX . 'content' );
398	+
399	+ // Get content tag (div/p/span...)
400	+ $tag = apply_filters( PT_CV_PREFIX_ . 'field_content_tag', 'div' );
401	+
402	+ // Get full content/exceprt
403	+ $content = '';
404	+ switch ( $fargs['content']['show'] ) {
405	+ case 'excerpt':
406	+ $length = (int) $fargs['content']['length'];
407	+ $readmore = '<br />' . PT_CV_Html::link_button( get_permalink(), 'success', __( 'Read More' ), PT_CV_PREFIX . 'readmore', 'btn-sm' );
408	+ $content = wp_trim_words( get_the_content(), $length, ' ...' . apply_filters( PT_CV_PREFIX_ . 'field_content_readmore', $readmore, $fargs['content'], get_permalink() ) );
409	+ break;
410	+
411	+ case 'full':
412	+ ob_start();
413	+ the_content();
414	+ $content = ob_get_clean();
415	+
416	+ break;
417	+ }
418	+
419	+ $html = sprintf(
420	+ '<%1$s class="%2$s">%3$s</%1$s>',
421	+ $tag, esc_attr( $content_class ), balanceTags( $content )
422	+ );
423	+
424	+ break;
425	+
426	+ // Meta fields
427	+ case 'meta-fields':
428	+
429	+ if ( empty( $fargs['meta-fields'] ) ) {
430	+ break;
431	+ }
432	+
433	+ $html = self::_field_meta( $post, $fargs['meta-fields'], $dargs );
434	+
435	+ break;
436	+ }
437	+
438	+ return $html;
439	+ }
440	+
441	+ /**
442	+ * Output link to item
443	+ *
444	+ * @param array $oargs The other settings
445	+ * @param object $post The post object
446	+ * @param string $content The HTML of <a> tag
447	+ */
448	+ static function _field_href( $oargs, $post, $content ) {
449	+
450	+ // Open in
451	+ $open_in = isset( $oargs['open-in'] ) ? $oargs['open-in'] : '_blank';
452	+
453	+ // Class of href
454	+ $href_class = apply_filters( PT_CV_PREFIX_ . 'field_href_class', array( $open_in ), $oargs );
455	+
456	+ // Custom data
457	+ $custom_attr = apply_filters( PT_CV_PREFIX_ . 'field_href_attrs', array(), $open_in, $oargs );
458	+
459	+ $html = sprintf(
460	+ '<a href="%s" class="%s" target="%s" %s>%s</a>',
461	+ get_permalink( $post->ID ), implode( ' ', array_filter( $href_class ) ), $open_in, implode( ' ', array_filter( $custom_attr ) ), balanceTags( $content )
462	+ );
463	+
464	+ return $html;
465	+ }
466	+
467	+ /**
468	+ * HTML output of thumbnail field
469	+ *
470	+ * @param object $post The post object
471	+ * @param array $fargs The settings of this field
472	+ * @param array $dargs The settings array
473	+ *
474	+ * @return string
475	+ */
476	+ static function _field_thumbnail( $post, $fargs, $dargs ) {
477	+
478	+ // Get layout format
479	+ $layout_format = $fargs['layout-format'];
480	+
481	+ // Get thumbnail settings
482	+ $fargs = $fargs['thumbnail'];
483	+
484	+ $html = '';
485	+
486	+ // Get post ID
487	+ $post_id = $post->ID;
488	+
489	+ // Custom args for get_the_post_thumbnail function
490	+ $thumbnail_class = array();
491	+ $thumbnail_class[] = PT_CV_PREFIX . 'thumbnail';
492	+ $thumbnail_class[] = isset( $fargs['style'] ) ? $fargs['style'] : '';
493	+ if ( $layout_format === '2-col' ) {
494	+ $thumbnail_class[] = isset( $fargs['position'] ) ? 'pull-' . $fargs['position'] : 'pull-left';
495	+ }
496	+ $gargs = array(
497	+ 'class' => apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_class', implode( ' ', array_filter( $thumbnail_class ) ) ),
498	+ );
499	+
500	+ // Get thumbnail dimensions
501	+ $dimensions = PT_CV_Functions::field_thumbnail_dimensions( $fargs );
502	+
503	+ // Check if has thumbnail ( has_post_thumbnail doesn't works )
504	+ $has_thumbnail = get_the_post_thumbnail( $post_id );
505	+ if ( ! empty( $has_thumbnail ) ) {
506	+ $thumbnail_size = (array) apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_dimension_output', $dimensions, $fargs );
507	+ $thumbnail_size = count( $thumbnail_size ) > 1 ? $thumbnail_size : $thumbnail_size[0];
508	+ $html = get_the_post_thumbnail( $post_id, $thumbnail_size, $gargs );
509	+ } else {
510	+ $html = apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_not_found', $html, $post, $dimensions, $gargs );
511	+ }
512	+
513	+ // If title is not shown, add link to thumbnail
514	+ if ( ! in_array( 'title', $dargs['fields'] ) ) {
515	+ $oargs = isset( $dargs['other-settings'] ) ? $dargs['other-settings'] : array();
516	+ $html = self::_field_href( $oargs, $post, $html );
517	+ }
518	+
519	+ return $html;
520	+ }
521	+
522	+ /**
523	+ * HTML output of meta fields group
524	+ *
525	+ * @param object $post The post object
526	+ * @param array $fargs The settings of this field
527	+ * @param array $dargs The settings array of Fields
528	+ *
529	+ * @return string
530	+ */
531	+ static function _field_meta( $post, $fargs, $dargs ) {
532	+
533	+ $html = array();
534	+
535	+ // Sets up global post data
536	+ setup_postdata( $post );
537	+
538	+ foreach ( $fargs as $meta => $val ) {
539	+ if ( ! $val ) {
540	+ continue;
541	+ }
542	+
543	+ switch ( $meta ) {
544	+ case 'date':
545	+ // Get date wrapper class
546	+ $date_class = apply_filters( PT_CV_PREFIX_ . 'field_meta_date_class', 'entry-date' );
547	+
548	+ $html['date'] = sprintf( '<span class="%1$s"><time datetime="%2$s">%3$s</time></span>', esc_html( $date_class ), esc_attr( get_the_date( 'c' ) ), esc_html( get_the_date() ) );
549	+ break;
550	+
551	+ case 'taxonomy':
552	+
553	+ // Get terms wrapper class
554	+ $term_class = apply_filters( PT_CV_PREFIX_ . 'field_meta_terms_class', 'terms' );
555	+
556	+ $terms = PT_CV_Functions::post_terms( $post );
557	+ if ( ! empty( $terms ) ) {
558	+ $html['taxonomy'] = sprintf( '<span class="%s">%s %s</span>', esc_attr( $term_class ), __( 'in', PT_CV_DOMAIN ), balanceTags( $terms ) );
559	+ }
560	+ break;
561	+
562	+ case 'comment':
563	+ if ( ! post_password_required() && ( comments_open() \|\| get_comments_number() ) ) :
564	+ // Get comment wrapper class
565	+ $comment_class = apply_filters( PT_CV_PREFIX_ . 'field_meta_comment_class', 'comments-link' );
566	+
567	+ ob_start();
568	+ ?>
569	+ <span class="<?php echo esc_attr( $comment_class ); ?>"><?php comments_popup_link( __( 'Leave a comment', PT_CV_DOMAIN ), __( '1 Comment', PT_CV_DOMAIN ), __( '% Comments', PT_CV_DOMAIN ) ); ?></span>
570	+ <?php
571	+ $html['comment'] = ob_get_clean();
572	+ endif;
573	+ break;
574	+
575	+ case 'author':
576	+
577	+ // Get author wrapper class
578	+ $author_class = apply_filters( PT_CV_PREFIX_ . 'field_meta_author_class', 'author' );
579	+
580	+ $author_html = sprintf( '<span class="%s">%s <a href="%s" rel="author">%s</a></span>', esc_attr( $author_class ), __( 'by', PT_CV_DOMAIN ), esc_url( get_author_posts_url( get_the_author_meta( 'ID' ) ) ), get_the_author() );
581	+ $html['author'] = apply_filters( PT_CV_PREFIX_ . 'field_meta_author_html', $author_html, $post, $dargs );
582	+ break;
583	+
584	+ default:
585	+ break;
586	+ }
587	+ }
588	+
589	+ // Merge fields, or let them as seperate items in array
590	+ $merge_fields = apply_filters( PT_CV_PREFIX_ . 'field_meta_merge_fields', true, $dargs );
591	+
592	+ if ( $merge_fields ) {
593	+ $result = PT_CV_Html::_field_meta_wrap( $html );
594	+ } else {
595	+ $result = $html;
596	+ }
597	+
598	+ return $result;
599	+ }
600	+
601	+ /**
602	+ * Wrap meta fields in a wrapper
603	+ *
604	+ * @param array $meta_html Array of meta fields to wrapping
605	+ * @param string $seperator Seperator string when join meta fields
606	+ *
607	+ * @return string
608	+ */
609	+ static function _field_meta_wrap( $meta_html, $seperator = NULL ) {
610	+
611	+ $seperator = isset( $seperator ) ? $seperator : apply_filters( PT_CV_PREFIX_ . 'field_meta_seperator', ' / ' );
612	+
613	+ // Get meta fields class
614	+ $meta_fields_class = apply_filters( PT_CV_PREFIX_ . 'field_meta_fields_class', PT_CV_PREFIX . 'meta-fields' );
615	+
616	+ // Get meta fields tag
617	+ $tag = apply_filters( PT_CV_PREFIX_ . 'field_meta_fields_tag', 'div' );
618	+
619	+ // Define wrapper
620	+ $wrapper = sprintf(
621	+ '<%1$s class="%2$s">%3$s</%1$s>',
622	+ $tag, esc_attr( $meta_fields_class ), '%s'
623	+ );
624	+
625	+ // Join fields
626	+ $meta_html = implode( $seperator, (array) $meta_html );
627	+
628	+ // Wrap
629	+ $html = sprintf( $wrapper, balanceTags( $meta_html ) );
630	+
631	+ return $html;
632	+ }
633	+
634	+ /**
635	+ * Output pagination
636	+ *
637	+ * @param type $max_num_pages The total of pages
638	+ * @param array $dargs The settings array of Fields
639	+ * @param string $view_id The current view id
640	+ *
641	+ * @return type
642	+ */
643	+ static function pagination_output( $max_num_pages, $dargs, $view_id ) {
644	+
645	+ if ( ! $max_num_pages \|\| (int) $max_num_pages === 1 ) {
646	+ return '';
647	+ }
648	+
649	+ $output = '';
650	+
651	+ $style = isset( $dargs['pagination-settings']['style'] ) ? $dargs['pagination-settings']['style'] : 'regular';
652	+ if ( $style == 'regular' ) {
653	+ $output = sprintf( '<ul class="%s" data-totalpages="%s" data-id="%s"></ul>', PT_CV_PREFIX . 'pagination', esc_attr( $max_num_pages ), esc_attr( $view_id ) );
654	+ } else {
655	+ $output = apply_filters( PT_CV_PREFIX_ . 'btn_more_html', $output, $max_num_pages, $view_id );
656	+ }
657	+
658	+ // Add loading icon
659	+ $output .= self::html_loading_img( 12, PT_CV_PREFIX . 'spinner' );
660	+
661	+ return $output;
662	+ }
663	+
664	+ /**
665	+ * Get assets content of all selected view types in a page
666	+ * by merging css files to public/assets/css/public.css, js files to public/assets/js/public.js
667	+ */
668	+ static function assets_of_view_types() {
669	+ $assets = array( 'css', 'js' );
670	+ $assets_output = $assets_files = array();
671	+
672	+ // Get content of asset files in directory of view type
673	+ foreach ( self::$view_type_dir as $idx => $view_type_dir ) {
674	+ // Get selected style of current view type
675	+ $style = self::$style[$idx];
676	+
677	+ // With each type of asset (css, js), looking for suit file of selected style
678	+ foreach ( $assets as $type ) {
679	+ $file_path = $view_type_dir . '/' . $type . '/' . $style . '.' . $type;
680	+ $assets_output[$type][] = PT_CV_Functions::file_include_content( $file_path );
681	+ }
682	+ }
683	+
684	+ // Merge content of asset files
685	+ if ( $assets_output ) {
686	+ foreach ( $assets as $type ) {
687	+
688	+ $asset_file = $type . '/' . 'assets' . '.' . $type;
689	+
690	+ // Write to file
691	+ $file_path = PT_CV_PUBLIC_ASSETS . $asset_file;
692	+
693	+ if ( file_exists( $file_path ) ) {
694	+ $fp = @fopen( $file_path, 'w' );
695	+ fwrite( $fp, implode( "\n", $assets_output[$type] ) );
696	+ fclose( $fp );
697	+ }
698	+
699	+ $assets_files[$type] = PT_CV_PUBLIC_ASSETS_URI . $asset_file;
700	+ }
701	+ }
702	+
703	+ if ( is_admin() ) {
704	+ // Include assets file in Preview
705	+ foreach ( $assets_files as $type => $src ) {
706	+ PT_CV_Asset::include_inline( 'preview', $src, $type );
707	+ }
708	+ } else {
709	+ // Enqueue merged asset contents
710	+ foreach ( $assets_files as $type => $src ) {
711	+
712	+ $type = ( $type == 'js' ) ? 'script' : 'style';
713	+ $function = "wp_enqueue_{$type}";
714	+
715	+ if ( function_exists( $function ) ) {
716	+ $function( PT_CV_PREFIX . $type, $src );
717	+ }
718	+ }
719	+ }
720	+
721	+ // Output font style for views
722	+ do_action( PT_CV_PREFIX_ . 'print_view_style' );
723	+ }
724	+
725	+ /**
726	+ * Scripts for Preview & WP frontend
727	+ */
728	+ static function frontend_scripts() {
729	+ // Load bootstrap js
730	+ PT_CV_Asset::enqueue( 'bootstrap' );
731	+
732	+ // Load bootstrap paginator
733	+ PT_CV_Asset::enqueue( 'bootstrap-paginator' );
734	+
735	+ // Public script
736	+ PT_CV_Asset::enqueue(
737	+ 'public', 'script', array(
738	+ 'src' => plugins_url( 'public/assets/js/public.js', PT_CV_FILE ),
739	+ 'deps' => array( 'jquery' ),
740	+ )
741	+ );
742	+
743	+ // Localize for Public script
744	+ PT_CV_Asset::localize_script(
745	+ 'public', PT_CV_PREFIX_UPPER . 'PUBLIC', array(
746	+ 'is_admin' => is_admin() ? 1 : 0,
747	+ '_prefix' => PT_CV_PREFIX,
748	+ 'ajaxurl' => admin_url( 'admin-ajax.php' ),
749	+ '_nonce' => wp_create_nonce( PT_CV_PREFIX_ . 'ajax_nonce' ),
750	+ )
751	+ );
752	+ }
753	+
754	+ /**
755	+ * Styles for Preview & WP frontend
756	+ */
757	+ static function frontend_styles() {
758	+ PT_CV_Asset::enqueue( 'bootstrap', 'style' );
759	+
760	+ PT_CV_Asset::enqueue(
761	+ 'public', 'style', array(
762	+ 'src' => plugins_url( 'public/assets/css/public.css', PT_CV_FILE ),
763	+ )
764	+ );
765	+
766	+ // Fix bootstrap error in IE
767	+ global $is_IE;
768	+ if ( $is_IE ) {
769	+ PT_CV_Asset::enqueue(
770	+ 'html5shiv', 'script', array(
771	+ 'src' => plugins_url( 'assets/ie-fix/html5shiv.min.js', PT_CV_FILE ),
772	+ 'ver' => '3.7.0',
773	+ )
774	+ );
775	+ PT_CV_Asset::enqueue(
776	+ 'respond', 'script', array(
777	+ 'src' => plugins_url( 'assets/ie-fix/respond.js', PT_CV_FILE ),
778	+ 'ver' => '1.4.2',
779	+ )
780	+ );
781	+ }
782	+ }
783	+
784	+ /**
785	+ * Print inline js code
786	+ *
787	+ * @param string $js The js code
788	+ *
789	+ * @return string
790	+ */
791	+ static function inline_script( $js ) {
792	+ // Generate random id for script tag
793	+ $random_id = PT_CV_Functions::string_random();
794	+
795	+ ob_start();
796	+ ?>
797	+ <script type="text/javascript" id="<?php echo esc_attr( PT_CV_PREFIX . 'inline-script-' . $random_id ); ?>">
798	+ (function ($) {
799	+ $(function () { <?php echo balanceTags( $js ); ?>
800	+ });
801	+ }(jQuery));
802	+ </script>
803	+ <?php
804	+ return ob_get_clean();
805	+ }
806	+
807	+ /**
808	+ * Print inline css code
809	+ *
810	+ * @param string $css The css code
811	+ *
812	+ * @return string
813	+ */
814	+ static function inline_style( $css ) {
815	+ // Generate random id for style tag
816	+ $random_id = PT_CV_Functions::string_random();
817	+
818	+ ob_start();
819	+ ?>
820	+ <style type="text/css" id="<?php echo esc_attr( PT_CV_PREFIX . 'inline-style-' . $random_id ); ?>">
821	+ <?php echo balanceTags( $css ); ?>
822	+ </style>
823	+ <?php
824	+ return ob_get_clean();
825	+ }
826	+ }
827	+
828	+ }

includes/settings.php ADDED Viewed

	@@ -0,0 +1,734 @@


1	+ <?php
2	+ /**
3	+ * Define settings for options
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ if ( ! class_exists( 'PT_CV_Settings' ) ) {
13	+
14	+ /**
15	+ * @name PT_CV_Settings
16	+ * @todo Define settings for options
17	+ */
18	+ class PT_CV_Settings {
19	+
20	+ /**
21	+ * Get collection : Taxonomies => Terms
22	+ *
23	+ * @param string $taxonomies Array of taxonomies
24	+ * @param array $args Array of query parameters
25	+ */
26	+ static function terms_of_taxonomies( $taxonomies = array(), $args = array() ) {
27	+ $terms_of_taxonomies = $result = array();
28	+ // Get taxonomies
29	+ $taxonomies = PT_CV_Values::taxonomy_list();
30	+ // Get slug list of taxonomies
31	+ $taxonomies_slug = array_keys( $taxonomies );
32	+
33	+ foreach ( $taxonomies_slug as $taxonomy_slug ) {
34	+ PT_CV_Values::term_of_taxonomy( $taxonomy_slug, $terms_of_taxonomies, $args );
35	+ }
36	+
37	+ foreach ( $terms_of_taxonomies as $taxonomy_slug => $terms ) {
38	+
39	+ $result[$taxonomy_slug] = array(
40	+ // In
41	+ array(
42	+ 'label' => array(
43	+ 'text' => __( 'In ', PT_CV_DOMAIN ),
44	+ //'text' => __( 'In ', PT_CV_DOMAIN ) . $taxonomies[$taxonomy_slug],
45	+ ),
46	+ 'params' => array(
47	+ array(
48	+ 'type' => 'select',
49	+ 'name' => $taxonomy_slug . '__in[]',
50	+ 'options' => $terms,
51	+ 'std' => '',
52	+ 'class' => 'select2',
53	+ 'multiple' => '1',
54	+ ),
55	+ ),
56	+ ),
57	+ // Not In
58	+ array(
59	+ 'label' => array(
60	+ 'text' => __( 'Not in ', PT_CV_DOMAIN ),
61	+ //'text' => __( 'Not in ', PT_CV_DOMAIN ) . $taxonomies[$taxonomy_slug],
62	+ ),
63	+ 'params' => array(
64	+ array(
65	+ 'type' => 'select',
66	+ 'name' => $taxonomy_slug . '__not_in[]',
67	+ 'options' => $terms,
68	+ 'std' => '',
69	+ 'class' => 'select2',
70	+ 'multiple' => '1',
71	+ ),
72	+ ),
73	+ ),
74	+ );
75	+ }
76	+
77	+ return $result;
78	+ }
79	+
80	+ /**
81	+ * Order by options
82	+ *
83	+ * @return array
84	+ */
85	+ static function orderby() {
86	+ $result = array();
87	+
88	+ $result['common'] = array(
89	+ // Order By
90	+ array(
91	+ 'label' => array(
92	+ 'text' => __( 'Order by', PT_CV_DOMAIN ),
93	+ ),
94	+ 'params' => array(
95	+ array(
96	+ 'type' => 'select',
97	+ 'name' => 'orderby',
98	+ 'options' => PT_CV_Values::post_regular_orderby(),
99	+ 'std' => '',
100	+ ),
101	+ ),
102	+ ),
103	+ // Order
104	+ array(
105	+ 'label' => array(
106	+ 'text' => __( 'Order', PT_CV_DOMAIN ),
107	+ ),
108	+ 'params' => array(
109	+ array(
110	+ 'type' => 'radio',
111	+ 'name' => 'order',
112	+ 'options' => PT_CV_Values::orders(),
113	+ 'std' => 'asc',
114	+ ),
115	+ ),
116	+ ),
117	+ );
118	+
119	+ $result = apply_filters( PT_CV_PREFIX_ . 'orderby', $result );
120	+
121	+ return $result;
122	+ }
123	+
124	+ /**
125	+ * Pagination settings
126	+ *
127	+ * @return array
128	+ */
129	+ static function settings_pagination() {
130	+
131	+ $prefix = 'pagination-';
132	+
133	+ $result = array(
134	+
135	+ // Pagination
136	+ array(
137	+ 'label' => array(
138	+ 'text' => __( 'Pagination', PT_CV_DOMAIN ),
139	+ ),
140	+ 'params' => array(
141	+ array(
142	+ 'type' => 'checkbox',
143	+ 'name' => 'enable-pagination',
144	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Enable', PT_CV_DOMAIN ) ),
145	+ 'std' => '',
146	+ ),
147	+ ),
148	+ ),
149	+
150	+ // Items per page
151	+ array(
152	+ 'label' => array(
153	+ 'text' => __( 'Items per page', PT_CV_DOMAIN ),
154	+ ),
155	+ 'params' => array(
156	+ array(
157	+ 'type' => 'number',
158	+ 'name' => $prefix . 'items-per-page',
159	+ 'std' => '10',
160	+ 'placeholder' => 'e.g. 10',
161	+ 'desc' => __( 'The number of items per page', PT_CV_DOMAIN ),
162	+ ),
163	+ ),
164	+ 'dependence' => array( 'enable-pagination', 'yes' ),
165	+ ),
166	+
167	+ // Pagination Style
168	+ array(
169	+ 'label' => array(
170	+ 'text' => __( 'Pagination style', PT_CV_DOMAIN ),
171	+ ),
172	+ 'params' => array(
173	+ array(
174	+ 'type' => 'radio',
175	+ 'name' => $prefix . 'style',
176	+ 'options' => PT_CV_Values::pagination_styles(),
177	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::pagination_styles() ),
178	+ ),
179	+ ),
180	+ 'dependence' => array( 'enable-pagination', 'yes' ),
181	+ ),
182	+ );
183	+
184	+ $result = apply_filters( PT_CV_PREFIX_ . 'settings_pagination', $result );
185	+
186	+ return $result;
187	+ }
188	+
189	+ /**
190	+ * Other settings for All View Type
191	+ */
192	+ static function settings_other() {
193	+
194	+ $prefix = 'other-';
195	+
196	+ $result = array(
197	+ // Open an item in
198	+ array(
199	+ 'label' => array(
200	+ 'text' => __( 'Open item in', PT_CV_DOMAIN ),
201	+ ),
202	+ 'params' => array(
203	+ array(
204	+ 'type' => 'radio',
205	+ 'name' => $prefix . 'open-in',
206	+ 'options' => PT_CV_Values::open_in(),
207	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::open_in() ),
208	+ 'desc' => __( 'How to open an item when click on Title (if "Show Title" is checked) or Thumbnail (if only check "Show Thumbnail")', PT_CV_DOMAIN ),
209	+ ),
210	+ ),
211	+ ),
212	+ );
213	+
214	+ $result = apply_filters( PT_CV_PREFIX_ . 'settings_other', $result, $prefix );
215	+
216	+ return $result;
217	+ }
218	+
219	+ /**
220	+ * Fields settings
221	+ */
222	+ static function field_settings() {
223	+
224	+ $prefix = 'field-';
225	+ $prefix2 = 'show-' . $prefix;
226	+
227	+ $result = array(
228	+
229	+ // Fields display
230	+ array(
231	+ 'label' => array(
232	+ 'text' => __( 'Fields display', PT_CV_DOMAIN ),
233	+ ),
234	+ 'extra_setting' => array(
235	+ 'params' => array(
236	+ 'wrap-class' => PT_CV_Html::html_group_class(),
237	+ ),
238	+ ),
239	+ 'params' => array(
240	+ array(
241	+ 'type' => 'group',
242	+ 'params' => PT_CV_Settings::field_display_settings(),
243	+ ),
244	+ ),
245	+ ),
246	+
247	+ // Thumbnail settings
248	+ array(
249	+ 'label' => array(
250	+ 'text' => __( 'Thumbnail settings', PT_CV_DOMAIN ),
251	+ ),
252	+ 'extra_setting' => array(
253	+ 'params' => array(
254	+ 'wrap-class' => PT_CV_Html::html_group_class() . ' ' . PT_CV_PREFIX . 'thumbnail-setting',
255	+ ),
256	+ ),
257	+ 'params' => array(
258	+ array(
259	+ 'type' => 'group',
260	+ 'params' => PT_CV_Settings::field_thumbnail_settings( $prefix ),
261	+ ),
262	+ ),
263	+ 'dependence' => array( $prefix2 . 'thumbnail', 'yes' ),
264	+ ),
265	+
266	+ // Meta fields settings
267	+ array(
268	+ 'label' => array(
269	+ 'text' => __( 'Meta fields settings', PT_CV_DOMAIN ),
270	+ ),
271	+ 'extra_setting' => array(
272	+ 'params' => array(
273	+ 'wrap-class' => PT_CV_Html::html_group_class() . ' ' . PT_CV_PREFIX . 'meta-fields-settings',
274	+ ),
275	+ ),
276	+ 'params' => array(
277	+ array(
278	+ 'type' => 'group',
279	+ 'params' => PT_CV_Settings::field_meta_fields( 'meta-fields-' ),
280	+ 'desc' => apply_filters( PT_CV_PREFIX_ . 'settings_sort_text', '' ),
281	+ ),
282	+ ),
283	+ 'dependence' => array( $prefix2 . 'meta-fields', 'yes' ),
284	+ ),
285	+
286	+ // Content settings
287	+ array(
288	+ 'label' => array(
289	+ 'text' => __( 'Content settings', PT_CV_DOMAIN ),
290	+ ),
291	+ 'params' => array(
292	+ array(
293	+ 'type' => 'radio',
294	+ 'name' => $prefix . 'content-show',
295	+ 'options' => array(
296	+ 'full' => __( 'Show Full Content', PT_CV_DOMAIN ),
297	+ 'excerpt' => __( 'Show Excerpt', PT_CV_DOMAIN ),
298	+ ),
299	+ 'std' => 'excerpt',
300	+ ),
301	+ ),
302	+ 'dependence' => array( $prefix2 . 'content', 'yes' ),
303	+ ),
304	+
305	+ // Excerpt settings
306	+ array(
307	+ 'label' => array(
308	+ 'text' => __( '', PT_CV_DOMAIN ),
309	+ ),
310	+ 'extra_setting' => array(
311	+ 'params' => array(
312	+ 'wrap-id' => PT_CV_Html::html_group_id( 'excerpt-settings' ),
313	+ ),
314	+ ),
315	+ 'params' => array(
316	+ array(
317	+ 'type' => 'group',
318	+ 'params' => apply_filters(
319	+ PT_CV_PREFIX_ . 'excerpt_settings',
320	+ array(
321	+ // Excerpt length
322	+ array(
323	+ 'label' => array(
324	+ 'text' => __( 'Excerpt length', PT_CV_DOMAIN ),
325	+ ),
326	+ 'extra_setting' => array(
327	+ 'params' => array(
328	+ 'width' => 9,
329	+ ),
330	+ ),
331	+ 'params' => array(
332	+ array(
333	+ 'type' => 'number',
334	+ 'name' => $prefix . 'excerpt-length',
335	+ 'std' => '20',
336	+ 'placeholder' => 'e.g. 20',
337	+ 'desc' => __( 'The number of words in excerpt', PT_CV_DOMAIN ),
338	+ ),
339	+ ),
340	+ ),
341	+ ),
342	+ $prefix . 'excerpt-'
343	+ ),
344	+ ),
345	+ ),
346	+ 'dependence' => array( array( $prefix . 'content-show', 'excerpt' ) ),
347	+ ),
348	+ );
349	+
350	+ $result = apply_filters( PT_CV_PREFIX_ . 'field_settings', $result, $prefix2 );
351	+
352	+ return $result;
353	+ }
354	+
355	+ /**
356	+ * Fields display
357	+ *
358	+ * @return array
359	+ */
360	+ static function field_display_settings() {
361	+
362	+ $field_display_settings = array(
363	+ array(
364	+ 'label' => array(
365	+ 'text' => __( '', PT_CV_DOMAIN ),
366	+ ),
367	+ 'extra_setting' => array(
368	+ 'params' => array(
369	+ 'width' => 12,
370	+ 'wrap-class' => PT_CV_PREFIX . 'field-display',
371	+ ),
372	+ ),
373	+ 'params' => array(
374	+ array(
375	+ 'type' => 'group',
376	+ 'params' => PT_CV_Settings::field_display(),
377	+ 'desc' => apply_filters( PT_CV_PREFIX_ . 'settings_sort_text', '' ),
378	+ ),
379	+ ),
380	+ ),
381	+ );
382	+
383	+ $result = apply_filters( PT_CV_PREFIX_ . 'field_display_settings', $field_display_settings );
384	+
385	+ return $result;
386	+ }
387	+
388	+ /**
389	+ * Options to check/uncheck to display fields
390	+ *
391	+ * @return array
392	+ */
393	+ static function field_display() {
394	+
395	+ $prefix = 'show-field-';
396	+
397	+ $result = array(
398	+
399	+ // Thumbnail position
400	+ array(
401	+ 'label' => array(
402	+ 'text' => __( 'Thumbnail position', PT_CV_DOMAIN ),
403	+ ),
404	+ 'extra_setting' => array(
405	+ 'params' => array(
406	+ 'width' => 9,
407	+ 'wrap-class' => PT_CV_PREFIX . 'bg-none',
408	+ ),
409	+ ),
410	+ 'params' => array(
411	+ array(
412	+ 'type' => 'select',
413	+ 'name' => 'field-' . 'thumbnail-position',
414	+ 'options' => PT_CV_Values::thumbnail_position(),
415	+ 'std' => PT_CV_Functions::array_get_first_key( PT_CV_Values::thumbnail_position() ),
416	+ ),
417	+ ),
418	+ 'dependence' => array( 'layout-format', '2-col' ),
419	+ ),
420	+
421	+ // Show Thumbnail
422	+ array(
423	+ 'label' => array(
424	+ 'text' => __( '', PT_CV_DOMAIN ),
425	+ ),
426	+ 'extra_setting' => array(
427	+ 'params' => array(
428	+ 'width' => 12,
429	+ ),
430	+ ),
431	+ 'params' => array(
432	+ array(
433	+ 'type' => 'checkbox',
434	+ 'name' => $prefix . 'thumbnail',
435	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Thumbnail', PT_CV_DOMAIN ) ),
436	+ 'std' => 'yes',
437	+ ),
438	+ ),
439	+ 'dependence' => array( 'layout-format', '1-col' ),
440	+ ),
441	+
442	+ // Show Title
443	+ array(
444	+ 'label' => array(
445	+ 'text' => __( '', PT_CV_DOMAIN ),
446	+ ),
447	+ 'extra_setting' => array(
448	+ 'params' => array(
449	+ 'width' => 12,
450	+ ),
451	+ ),
452	+ 'params' => array(
453	+ array(
454	+ 'type' => 'checkbox',
455	+ 'name' => $prefix . 'title',
456	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Title', PT_CV_DOMAIN ) ),
457	+ 'std' => 'yes',
458	+ ),
459	+ ),
460	+ ),
461	+
462	+ // Show Content
463	+ array(
464	+ 'label' => array(
465	+ 'text' => __( '', PT_CV_DOMAIN ),
466	+ ),
467	+ 'extra_setting' => array(
468	+ 'params' => array(
469	+ 'width' => 12,
470	+ ),
471	+ ),
472	+ 'params' => array(
473	+ array(
474	+ 'type' => 'checkbox',
475	+ 'name' => $prefix . 'content',
476	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Content', PT_CV_DOMAIN ) ),
477	+ 'std' => 'yes',
478	+ ),
479	+ ),
480	+ ),
481	+
482	+ // Show Meta fields
483	+ array(
484	+ 'label' => array(
485	+ 'text' => __( '', PT_CV_DOMAIN ),
486	+ ),
487	+ 'extra_setting' => array(
488	+ 'params' => array(
489	+ 'width' => 12,
490	+ ),
491	+ ),
492	+ 'params' => array(
493	+ array(
494	+ 'type' => 'checkbox',
495	+ 'name' => $prefix . 'meta-fields',
496	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Meta Fields', PT_CV_DOMAIN ) ),
497	+ 'std' => 'yes',
498	+ ),
499	+ ),
500	+ ),
501	+ );
502	+
503	+ // Add/remove params
504	+ $result = apply_filters( PT_CV_PREFIX_ . 'field_display', $result );
505	+
506	+ // Sort array of params by saved order
507	+ $result = apply_filters( PT_CV_PREFIX_ . 'settings_sort', $result, PT_CV_PREFIX . $prefix );
508	+
509	+ return $result;
510	+ }
511	+
512	+ /**
513	+ * Setting options for Field = Thumbnail
514	+ */
515	+ static function field_thumbnail_settings( $prefix ) {
516	+
517	+ $result = array(
518	+ // Size
519	+ array(
520	+ 'label' => array(
521	+ 'text' => __( 'Thumbnail size', PT_CV_DOMAIN ),
522	+ ),
523	+ 'extra_setting' => array(
524	+ 'params' => array(
525	+ 'width' => 9,
526	+ ),
527	+ ),
528	+ 'params' => array(
529	+ array(
530	+ 'type' => 'select',
531	+ 'name' => $prefix . 'thumbnail-size',
532	+ 'options' => PT_CV_Values::field_thumbnail_sizes(),
533	+ 'std' => 'medium',
534	+ ),
535	+ ),
536	+ ),
537	+ );
538	+
539	+ $result = apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_settings', $result, $prefix );
540	+
541	+ return $result;
542	+ }
543	+
544	+ /**
545	+ * Show settings of other fields
546	+ */
547	+ static function field_meta_fields( $prefix ) {
548	+
549	+ $result = array(
550	+
551	+ // Date
552	+ array(
553	+ 'label' => array(
554	+ 'text' => '',
555	+ ),
556	+ 'extra_setting' => array(
557	+ 'params' => array(
558	+ 'width' => 12,
559	+ ),
560	+ ),
561	+ 'params' => array(
562	+ array(
563	+ 'type' => 'checkbox',
564	+ 'name' => $prefix . 'date',
565	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Date', PT_CV_DOMAIN ) ),
566	+ 'std' => 'yes',
567	+ ),
568	+ ),
569	+ ),
570	+
571	+ // Author
572	+ array(
573	+ 'label' => array(
574	+ 'text' => '',
575	+ ),
576	+ 'extra_setting' => array(
577	+ 'params' => array(
578	+ 'width' => 12,
579	+ ),
580	+ ),
581	+ 'params' => array(
582	+ array(
583	+ 'type' => 'checkbox',
584	+ 'name' => $prefix . 'author',
585	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Author', PT_CV_DOMAIN ) ),
586	+ 'std' => 'yes',
587	+ ),
588	+ ),
589	+ ),
590	+
591	+ // Taxonomy
592	+ array(
593	+ 'label' => array(
594	+ 'text' => '',
595	+ ),
596	+ 'extra_setting' => array(
597	+ 'params' => array(
598	+ 'width' => 12,
599	+ ),
600	+ ),
601	+ 'params' => array(
602	+ array(
603	+ 'type' => 'checkbox',
604	+ 'name' => $prefix . 'taxonomy',
605	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Terms (categories, post tags...)', PT_CV_DOMAIN ) ),
606	+ 'std' => 'yes',
607	+ ),
608	+ ),
609	+ 'dependence' => array( 'content-type', 'page', '!=' ),
610	+ ),
611	+
612	+ // Comment
613	+ array(
614	+ 'label' => array(
615	+ 'text' => '',
616	+ ),
617	+ 'extra_setting' => array(
618	+ 'params' => array(
619	+ 'width' => 12,
620	+ ),
621	+ ),
622	+ 'params' => array(
623	+ array(
624	+ 'type' => 'checkbox',
625	+ 'name' => $prefix . 'comment',
626	+ 'options' => PT_CV_Values::yes_no( 'yes', __( 'Show Comment Count', PT_CV_DOMAIN ) ),
627	+ 'std' => 'yes',
628	+ ),
629	+ ),
630	+ ),
631	+
632	+ );
633	+
634	+ // Sort array of params by saved order
635	+ $result = apply_filters( PT_CV_PREFIX_ . 'settings_sort', $result, PT_CV_PREFIX . $prefix );
636	+
637	+ return $result;
638	+ }
639	+
640	+ /**
641	+ * Settings of View Type = Grid
642	+ *
643	+ * @return array
644	+ */
645	+ static function view_type_settings_grid() {
646	+
647	+ $prefix = 'grid-';
648	+
649	+ $result = array(
650	+ // Number of columns
651	+ array(
652	+ 'label' => array(
653	+ 'text' => __( 'Items per row', PT_CV_DOMAIN ),
654	+ ),
655	+ 'params' => array(
656	+ array(
657	+ 'type' => 'number',
658	+ 'name' => $prefix . 'number-columns',
659	+ 'std' => '2',
660	+ 'desc' => __( 'The number of items on each row of grid', PT_CV_DOMAIN ),
661	+ ),
662	+ ),
663	+ 'dependence' => array( 'view-type', 'grid' ),
664	+ ),
665	+ );
666	+
667	+ $result = apply_filters( PT_CV_PREFIX_ . 'view_type_settings_grid', $result );
668	+
669	+ return $result;
670	+ }
671	+
672	+ /**
673	+ * Settings of View Type = Collapsible
674	+ *
675	+ * @return array
676	+ */
677	+ static function view_type_settings_collapsible() {
678	+
679	+ $prefix = 'collapsible-';
680	+
681	+ $result = array(
682	+ PT_CV_Settings::setting_no_option(),
683	+ );
684	+
685	+ $result = apply_filters( PT_CV_PREFIX_ . 'view_type_settings_collapsible', $result );
686	+
687	+ return $result;
688	+ }
689	+
690	+ /**
691	+ * Settings of View Type = Scrollable
692	+ *
693	+ * @return array
694	+ */
695	+ static function view_type_settings_scrollable() {
696	+
697	+ $prefix = 'scrollable-';
698	+
699	+ $result = array(
700	+ PT_CV_Settings::setting_no_option(),
701	+ );
702	+
703	+ $result = apply_filters( PT_CV_PREFIX_ . 'view_type_settings_scrollable', $result );
704	+
705	+ return $result;
706	+ }
707	+
708	+ /**
709	+ * Setting with no option
710	+ *
711	+ * @return array
712	+ */
713	+ static function setting_no_option() {
714	+
715	+ return array(
716	+ 'label' => array(
717	+ 'text' => __( '', PT_CV_DOMAIN ),
718	+ ),
719	+ 'extra_setting' => array(
720	+ 'params' => array(
721	+ 'width' => 12,
722	+ ),
723	+ ),
724	+ 'params' => array(
725	+ array(
726	+ 'type' => 'html',
727	+ 'content' => "<div class='" . PT_CV_PREFIX . "text'>" . __( 'There is no option', PT_CV_DOMAIN ) . '</div>',
728	+ ),
729	+ ),
730	+ );
731	+ }
732	+ }
733	+
734	+ }

includes/update.php ADDED Viewed

	@@ -0,0 +1,19 @@


1	+ <?php
2	+ /**
3	+ * Check update, do update
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ // Compare stored version and current version
13	+ $stored_version = get_option( PT_CV_OPTION_VERSION );
14	+ if ( $stored_version && version_compare( $stored_version, PT_CV_VERSION, '<' ) ) {
15	+ // Do update
16	+
17	+ // Update version
18	+ update_option( PT_CV_OPTION_VERSION, PT_CV_VERSION );
19	+ }

includes/values.php ADDED Viewed

	@@ -0,0 +1,447 @@


1	+ <?php
2	+ /**
3	+ * Define values for input, select...
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ if ( ! class_exists( 'PT_CV_Values' ) ) {
13	+
14	+ /**
15	+ * @name PT_CV_Values
16	+ * @todo Define values for input, select...
17	+ */
18	+ class PT_CV_Values {
19	+
20	+ /**
21	+ * Get Post Types
22	+ *
23	+ * @param array $args Array of query parameters
24	+ * @param string $excludes_ Array of slug of post types want to exclude from result
25	+ *
26	+ * @return array
27	+ */
28	+ static function post_types( $args = array(), $excludes_ = array() ) {
29	+ $excludes = array_merge( array( 'attachment' ), $excludes_ );
30	+ $result = array();
31	+ $args = array_merge( array( 'public' => true, 'show_ui' => true, '_builtin' => true ), $args );
32	+ $args = apply_filters( PT_CV_PREFIX_ . 'post_types', $args );
33	+ $post_types = get_post_types( $args, 'objects' );
34	+
35	+ foreach ( $post_types as $post_type ) {
36	+ if ( in_array( $post_type->name, $excludes ) ) {
37	+ continue;
38	+ }
39	+ $result[$post_type->name] = __( $post_type->labels->singular_name, PT_CV_DOMAIN );
40	+ }
41	+
42	+ return $result;
43	+ }
44	+
45	+ /**
46	+ * Get list of taxonomies
47	+ *
48	+ * @param array $args Array of query parameters
49	+ *
50	+ * @return array
51	+ */
52	+ static function taxonomy_list( $args = array() ) {
53	+ $result = array();
54	+ $args = array_merge( array( 'public' => true, 'show_ui' => true, '_builtin' => true ), $args );
55	+ $args = apply_filters( PT_CV_PREFIX_ . 'taxonomy_list', $args );
56	+ $taxonomies = get_taxonomies( $args, 'objects' );
57	+
58	+ foreach ( $taxonomies as $taxonomy ) {
59	+ $result[$taxonomy->name] = __( $taxonomy->labels->singular_name, PT_CV_DOMAIN );
60	+ }
61	+
62	+ return $result;
63	+ }
64	+
65	+ /**
66	+ * The logical relationship between taxonomies
67	+ *
68	+ * @return array
69	+ */
70	+ static function taxonomy_relation() {
71	+ return array(
72	+ 'AND' => __( 'AND', PT_CV_DOMAIN ),
73	+ 'OR' => __( 'OR', PT_CV_DOMAIN ),
74	+ );
75	+ }
76	+
77	+ /**
78	+ * Get taxonomies of Post type
79	+ *
80	+ * @param string $object Name of the post type, or a post object
81	+ * @param string $output The type of output to return, either taxonomy 'names' or 'objects'
82	+ *
83	+ * @return array
84	+ */
85	+ static function taxonomy_by_post_type( $object, $output = 'names' ) {
86	+ $data = get_object_taxonomies( $object, $output );
87	+ $result = array();
88	+
89	+ foreach ( (array) $data as $taxonomy ) {
90	+ $result[$taxonomy] = self::taxonomy_info( $taxonomy, 'singular_name' );
91	+ }
92	+
93	+ return $result;
94	+ }
95	+
96	+ /**
97	+ * Get taxonomy information
98	+ *
99	+ * @param string $taxonomy The name of the taxonomy
100	+ * @param string $info Field of metadata want to retrieve
101	+ *
102	+ * @return string \| array
103	+ */
104	+ static function taxonomy_info( $taxonomy, $info ) {
105	+ $data = get_taxonomy( $taxonomy );
106	+
107	+ if ( isset( $data->$info ) ) {
108	+ $result = $data->$info;
109	+ } else {
110	+ if ( isset( $data->labels->$info ) ) {
111	+ $result = __( $data->labels->$info, PT_CV_DOMAIN );
112	+ }
113	+ }
114	+
115	+ return isset( $result ) ? $result : NULL;
116	+ }
117	+
118	+ /**
119	+ * Get terms of one/many taxonomies
120	+ *
121	+ * @param string $taxonomy The name of the taxonomy
122	+ * @param string $terms_of_taxonomies Array of terms of taxonomies
123	+ * @param array $args Array of query parameters
124	+ */
125	+ static function term_of_taxonomy( $taxonomy, &$terms_of_taxonomies, $args = array() ) {
126	+
127	+ $args = array_merge( array( 'hide_empty' => false ), $args );
128	+ $terms = get_terms( array( $taxonomy ), $args );
129	+ if ( ! isset( $terms_of_taxonomies[$taxonomy] ) ) {
130	+ $terms_of_taxonomies[$taxonomy] = array();
131	+ }
132	+ $term_slug_name = array();
133	+ foreach ( $terms as $term ) {
134	+ $term_slug_name[$term->slug] = $term->name;
135	+ }
136	+ $terms_of_taxonomies[$taxonomy] = array_merge( $terms_of_taxonomies[$taxonomy], $term_slug_name );
137	+ }
138	+
139	+ /**
140	+ * Yes no options
141	+ *
142	+ * @return array
143	+ */
144	+ static function yes_no( $key = '', $value = '' ) {
145	+ $result = array(
146	+ 'yes' => __( 'Yes', PT_CV_DOMAIN ),
147	+ 'no' => __( 'No', PT_CV_DOMAIN ),
148	+ );
149	+ if ( ! empty( $key ) ) {
150	+ return array( $key => empty( $value ) ? $result[$key] : $value );
151	+ }
152	+
153	+ return $result;
154	+ }
155	+
156	+ /**
157	+ * Show Hide options
158	+ *
159	+ * @return array
160	+ */
161	+ static function show_hide() {
162	+ return array(
163	+ 'show' => __( 'Show', PT_CV_DOMAIN ),
164	+ 'hide' => __( 'Hide', PT_CV_DOMAIN ),
165	+ );
166	+ }
167	+
168	+ /**
169	+ * Paging styles
170	+ *
171	+ * @return array
172	+ */
173	+ static function pagination_styles() {
174	+ $result = array(
175	+ 'regular' => __( 'Regular pagination', PT_CV_DOMAIN ),
176	+ );
177	+
178	+ $result = apply_filters( PT_CV_PREFIX_ . 'pagination_styles', $result );
179	+
180	+ return $result;
181	+ }
182	+
183	+ /**
184	+ * Order options
185	+ *
186	+ * @return array
187	+ */
188	+ static function orders() {
189	+ return array(
190	+ 'asc' => __( 'ASC', PT_CV_DOMAIN ),
191	+ 'desc' => __( 'DESC', PT_CV_DOMAIN ),
192	+ );
193	+ }
194	+
195	+ /**
196	+ * List post status
197	+ */
198	+ static function post_statuses() {
199	+ return array(
200	+ 'publish' => __( 'Publish', PT_CV_DOMAIN ),
201	+ 'pending' => __( 'Pending', PT_CV_DOMAIN ),
202	+ 'draft' => __( 'Draft', PT_CV_DOMAIN ),
203	+ 'auto-draft' => __( 'Auto draft', PT_CV_DOMAIN ),
204	+ 'future' => __( 'Future', PT_CV_DOMAIN ),
205	+ 'private' => __( 'Private', PT_CV_DOMAIN ),
206	+ 'inherit' => __( 'Inherit', PT_CV_DOMAIN ),
207	+ 'trash' => __( 'Trash', PT_CV_DOMAIN ),
208	+ );
209	+ }
210	+
211	+ /**
212	+ * Advanced settings options
213	+ *
214	+ * @return array
215	+ */
216	+ static function advanced_settings() {
217	+ return array(
218	+ 'author' => __( 'Author', PT_CV_DOMAIN ),
219	+ 'status' => __( 'Status', PT_CV_DOMAIN ),
220	+ 'taxonomy' => __( 'Taxonomy', PT_CV_DOMAIN ),
221	+ 'search' => __( 'Search', PT_CV_DOMAIN ),
222	+ 'order' => __( 'Order & Orderby', PT_CV_DOMAIN ),
223	+ );
224	+ }
225	+
226	+ /**
227	+ * Show WP author dropdown list by WP wp_dropdown_users functions
228	+ *
229	+ * @return array
230	+ */
231	+ static function post_author( $name = 'author', $data = array() ) {
232	+ $field_name = PT_CV_PREFIX . $name;
233	+ $selected = isset( $data[$field_name] ) ? $data[$field_name] : '';
234	+
235	+ return wp_dropdown_users( array( 'name' => $field_name, 'selected' => $selected, 'class' => 'form-control', 'show_option_none' => __( '— Select —', PT_CV_DOMAIN ), 'echo' => false ) );
236	+ }
237	+
238	+ /**
239	+ * Show WP author dropdown list
240	+ *
241	+ * @return array
242	+ */
243	+ static function user_list() {
244	+
245	+ $result = array();
246	+ $show = 'display_name';
247	+
248	+ $args = array(
249	+ 'fields' => array( 'ID', $show ),
250	+ 'orderby' => 'display_name',
251	+ 'order' => 'ASC',
252	+ );
253	+
254	+ $users = get_users( $args );
255	+ foreach ( (array) $users as $user ) {
256	+ $user->ID = (int) $user->ID;
257	+ $display = ! empty( $user->$show ) ? $user->$show : '(' . $user->user_login . ')';
258	+
259	+ $result[$user->ID] = esc_html( $display );
260	+ }
261	+
262	+ return $result;
263	+ }
264	+
265	+ /**
266	+ * Get available filters for Order by Content item
267	+ */
268	+ static function post_regular_orderby() {
269	+ $regular_orderby = array(
270	+ '' => __( '— Select —', PT_CV_DOMAIN ),
271	+ 'ID' => __( 'ID', PT_CV_DOMAIN ),
272	+ 'title' => __( 'Title', PT_CV_DOMAIN ),
273	+ 'date' => __( 'Created date', PT_CV_DOMAIN ),
274	+ 'modified' => __( 'Modified date', PT_CV_DOMAIN ),
275	+ );
276	+
277	+ $result = apply_filters( PT_CV_PREFIX_ . 'regular_orderby', $regular_orderby );
278	+
279	+ return $result;
280	+ }
281	+
282	+ /**
283	+ * View type options
284	+ *
285	+ * @return array
286	+ */
287	+ static function view_type() {
288	+
289	+ $view_type = array(
290	+ 'grid' => __( 'Grid', PT_CV_DOMAIN ),
291	+ 'collapsible' => __( 'Collapsible List', PT_CV_DOMAIN ),
292	+ 'scrollable' => __( 'Scrollable List', PT_CV_DOMAIN ),
293	+ );
294	+
295	+ $result = apply_filters( PT_CV_PREFIX_ . 'view_type', $view_type );
296	+
297	+ return $result;
298	+ }
299	+
300	+ /**
301	+ * Settings of All View Types
302	+ *
303	+ * @return array
304	+ */
305	+ static function view_type_settings() {
306	+
307	+ $view_type_settings = array();
308	+
309	+ // Settings of Grid type
310	+ $view_type_settings['grid'] = PT_CV_Settings::view_type_settings_grid();
311	+
312	+ // Settings of Collapsible type
313	+ $view_type_settings['collapsible'] = PT_CV_Settings::view_type_settings_collapsible();
314	+
315	+ // Settings of Scrollable type
316	+ $view_type_settings['scrollable'] = PT_CV_Settings::view_type_settings_scrollable();
317	+
318	+ $result = apply_filters( PT_CV_PREFIX_ . 'view_type_settings', $view_type_settings );
319	+
320	+ return $result;
321	+ }
322	+
323	+ /**
324	+ * Layout format options
325	+ *
326	+ * @return array
327	+ */
328	+ static function layout_format() {
329	+
330	+ $result = array(
331	+ '1-col' => __( '1 column — All fields inside an output item are shown in one column', PT_CV_DOMAIN ),
332	+ '2-col' => __( '2 columns — Show thumbnail on the left/right side of other fields', PT_CV_DOMAIN ),
333	+ );
334	+
335	+ $result = apply_filters( PT_CV_PREFIX_ . 'layout_format', $result );
336	+
337	+ return $result;
338	+ }
339	+
340	+ /**
341	+ * Open in options
342	+ */
343	+ static function open_in() {
344	+
345	+ $open_in = array(
346	+ '_blank' => __( 'New tab', PT_CV_DOMAIN ),
347	+ '_self' => __( 'Current tab', PT_CV_DOMAIN ),
348	+
349	+ );
350	+
351	+ $result = apply_filters( PT_CV_PREFIX_ . 'open_in', $open_in );
352	+
353	+ return $result;
354	+ }
355	+
356	+ /**
357	+ * Get all thumbnail sizes
358	+ */
359	+ static function field_thumbnail_sizes() {
360	+ // All available thumbnail sizes
361	+ global $_wp_additional_image_sizes;
362	+
363	+ $result = $sizes_to_sort = $dimensions_to_sort = array();
364	+
365	+ foreach ( get_intermediate_image_sizes() as $size_name ) {
366	+ if ( in_array( $size_name, array( 'thumbnail', 'medium', 'large' ) ) ) {
367	+ $this_size = array();
368	+ $this_size[] = get_option( $size_name . '_size_w' );
369	+ $this_size[] = get_option( $size_name . '_size_h' );
370	+
371	+ // Add official sizes to result
372	+ $result[$size_name] = ucfirst( $size_name ) . ' (' . implode( ' × ', $this_size ) . ')';
373	+ } else {
374	+ if ( isset( $_wp_additional_image_sizes ) && isset( $_wp_additional_image_sizes[$size_name] ) ) {
375	+
376	+ $this_size = array();
377	+ $this_size['width'] = $_wp_additional_image_sizes[$size_name]['width'];
378	+ $this_size['height'] = $_wp_additional_image_sizes[$size_name]['height'];
379	+
380	+ // Calculate sizes value for sorting
381	+ $sizes_value = intval( $this_size['width'] ) * intval( $this_size['height'] ) + rand( 1, 10 );
382	+
383	+ $dimensions_to_sort[$sizes_value] = $size_name;
384	+ } else {
385	+ $this_size = array( 0, 0 );
386	+ }
387	+
388	+ $sizes_to_sort[$size_name] = ucfirst( preg_replace( '/[\-_]/', ' ', $size_name ) ) . ' (' . implode( ' × ', $this_size ) . ')';
389	+ }
390	+ }
391	+ // Add full sizes
392	+ $result['full'] = __( 'Original resolution (But resize automatically to fit its container)', PT_CV_DOMAIN );
393	+
394	+ // Sort custom sizes by index (width * height)
395	+ krsort( $dimensions_to_sort );
396	+
397	+ // Get array element in ASC sorted order
398	+ foreach ( array_reverse( $dimensions_to_sort ) as $size_name ) {
399	+ $result[$size_name] = $sizes_to_sort[$size_name];
400	+ }
401	+
402	+ $result = apply_filters( PT_CV_PREFIX_ . 'field_thumbnail_sizes', $result );
403	+
404	+ return $result;
405	+ }
406	+
407	+ /**
408	+ * Tab Position
409	+ *
410	+ * @return array
411	+ */
412	+ static function tab_position() {
413	+
414	+ $tab_position = array(
415	+ 'top' => __( 'Top', PT_CV_DOMAIN ),
416	+ 'left' => __( 'Left', PT_CV_DOMAIN ),
417	+ 'bottom' => __( 'Bottom', PT_CV_DOMAIN ),
418	+ 'right' => __( 'Right', PT_CV_DOMAIN ),
419	+ );
420	+
421	+ $result = apply_filters( PT_CV_PREFIX_ . 'tab_position', $tab_position );
422	+
423	+ return $result;
424	+
425	+ }
426	+
427	+ /**
428	+ * Thumbnail Position
429	+ *
430	+ * @return array
431	+ */
432	+ static function thumbnail_position() {
433	+
434	+ $thumbnail_position = array(
435	+ 'left' => __( 'Left', PT_CV_DOMAIN ),
436	+ 'right' => __( 'Right', PT_CV_DOMAIN ),
437	+ );
438	+
439	+ $result = apply_filters( PT_CV_PREFIX_ . 'thumbnail_position', $thumbnail_position );
440	+
441	+ return $result;
442	+
443	+ }
444	+
445	+ }
446	+
447	+ }

languages/plugin-name.pot ADDED Viewed

	@@ -0,0 +1,31 @@


1	+ # Copyright (C) 2013 TODO
2	+ # This file is distributed under the same license as the TODO package.
3	+ msgid ""
4	+ msgstr ""
5	+ "Project-Id-Version: TODO 1.0.0\n"
6	+ "Report-Msgid-Bugs-To: http://wordpress.org/plugins/pt-content-views\n"
7	+ "POT-Creation-Date: 2013-05-10 11:23:19+00:00\n"
8	+ "PO-Revision-Date: 2013-05-10 10:37-0500\n"
9	+ "Last-Translator: FULL NAME <email@example.com>\n"
10	+ "Language-Team: LANGUAGE <translations@example.com >\n"
11	+ "MIME-Version: 1.0\n"
12	+ "Content-Type: text/plain; charset=UTF-8\n"
13	+ "Content-Transfer-Encoding: 8bit\n"
14	+ "X-Generator: Poedit 1.5.7\n"
15	+ "X-Poedit-KeywordsList: __;_e;_n;_x;esc_html_e;esc_html__;esc_attr_e;"
16	+ "esc_attr__;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;_x:1,2c;_n:1,2\n"
17	+ "X-Poedit-Basepath: ../\n"
18	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
19	+ "X-Poedit-SearchPath-0: .\n"
20	+
21	+ #: class-pt-content-views-admin.php:170
22	+ msgid "Page Title"
23	+ msgstr ""
24	+
25	+ #: class-pt-content-views-admin.php:171
26	+ msgid "Menu Text"
27	+ msgstr ""
28	+
29	+ #: class-pt-content-views-admin.php:197
30	+ msgid "Settings"
31	+ msgstr ""

public/assets/css/assets.css ADDED Viewed

	@@ -0,0 +1 @@


1	+ /* Do not paste code here, this page used to show code generated automatically */

public/assets/css/public.css ADDED Viewed

	@@ -0,0 +1,194 @@


1	+ /* This stylesheet is used to style the public-facing components of the plugin. */
2	+
3	+ .pt-cv-view {
4	+ position: relative;
5	+ margin-bottom: 50px;
6	+ clear: both;
7	+ }
8	+
9	+ /* Common */
10	+ .pt-cv-page {
11	+ position: relative;
12	+ }
13	+
14	+ /* Link */
15	+ .pt-cv-view a {
16	+ color: #000;
17	+ text-decoration: none !important;
18	+ }
19	+
20	+ .pt-cv-view a:hover, .pt-cv-view .panel-heading:hover a {
21	+ color: #ff3c1f;
22	+ }
23	+
24	+ /* Read more */
25	+ .pt-cv-readmore {
26	+ color: #fff !important;
27	+ margin: 10px 0;
28	+ }
29	+
30	+ /* An Item */
31	+ .pt-cv-content-item {
32	+ margin-bottom: 1.875em;
33	+ position: relative;
34	+ overflow: hidden;
35	+ }
36	+
37	+ /* For the output which shows only Title */
38	+ .pt-cv-only-title {
39	+ margin-bottom: 0;
40	+ }
41	+
42	+ /* Title */
43	+ .pt-cv-title {
44	+ margin-top: 0;
45	+ font-size: 20px;
46	+ }
47	+
48	+ .pt-cv-title a {
49	+ font-weight: 600;
50	+ }
51	+
52	+ /* Thumbnail */
53	+ .pt-cv-thumbnail {
54	+ max-width: 100% !important;
55	+ margin-bottom: 15px;
56	+ }
57	+
58	+ .pt-cv-thumbnail.pull-left {
59	+ margin-right: 10px;
60	+ }
61	+
62	+ .pt-cv-thumbnail.pull-right {
63	+ margin-left: 10px;
64	+ }
65	+
66	+ .pt-cv-no-image {
67	+ min-width: 80px;
68	+ min-height: 80px;
69	+ }
70	+
71	+ /* Content */
72	+ .pt-cv-content, .pt-cv-content * {
73	+ font-size: 14px;
74	+ zoom: 1;
75	+ line-height: 1.6em;
76	+ }
77	+
78	+ /* Meta fields */
79	+ .pt-cv-meta-fields {
80	+ font-size: 13px;
81	+ margin-top: 15px;
82	+ padding-bottom: 15px;
83	+ }
84	+
85	+ .pt-cv-meta-fields * {
86	+ color: rgba(0, 0, 0, .5);
87	+ }
88	+
89	+ .pt-cv-meta-fields a {
90	+ color: #41b7d8;
91	+ }
92	+
93	+ /* Pagination */
94	+ .pt-cv-view + .pagination {
95	+ float: left;
96	+ margin: 0 auto !important;
97	+ }
98	+ .pt-cv-spinner {
99	+ display: inline-block;
100	+ opacity: 0;
101	+ filter: alpha(opacity=0);
102	+ color: #0470ec;
103	+
104	+ margin-top: 12px;
105	+ margin-left: 10px;
106	+
107	+ -webkit-transition: opacity 0.25s, width 0.25s;
108	+ -moz-transition: opacity 0.25s, width 0.25s;
109	+ -o-transition: opacity 0.25s, width 0.25s;
110	+ transition: opacity 0.25s, width 0.25s;
111	+ }
112	+
113	+ .pt-cv-spinner.active {
114	+ opacity: 1;
115	+ filter: alpha(opacity=100);
116	+ }
117	+ .pt-cv-clear-pagination {
118	+ margin-bottom: 50px;
119	+ }
120	+
121	+ /* View type : Collapsible List */
122	+ .pt-cv-collapsible .panel-heading {
123	+ padding: 0;
124	+ }
125	+
126	+ .pt-cv-collapsible .panel-heading a {
127	+ display: block;
128	+ padding: 10px 15px;
129	+ }
130	+
131	+ /* View type : Scrollable List */
132	+
133	+ /* Caption */
134	+ .pt-cv-view .carousel-caption {
135	+ text-align: left;
136	+ left: 0;
137	+ right: 15px;
138	+ bottom: 15px;
139	+ }
140	+
141	+ .pt-cv-view .carousel-caption * {
142	+ text-shadow: none;
143	+ }
144	+
145	+ /* Caption with image */
146	+ .pt-cv-cap-w-img {
147	+ background: rgba(0, 0, 0, 0.6);
148	+ text-shadow: 0px 1px 1px #000;
149	+ left: 15px !important;
150	+ padding-left: 10px;
151	+ }
152	+
153	+ .pt-cv-cap-w-img * {
154	+ color: #fff;
155	+ }
156	+
157	+ .pt-cv-cap-w-img .pt-cv-title a {
158	+ color: #fff !important;
159	+ }
160	+
161	+ /* Caption without image */
162	+ .pt-cv-cap-wo-img {
163	+ position: relative;
164	+ }
165	+
166	+ .pt-cv-cap-wo-img * {
167	+ color: #000;
168	+ }
169	+
170	+ /* Control */
171	+ .pt-cv-view .carousel-control {
172	+ background-image: none !important;
173	+ z-index: 1000;
174	+ height: 30px;
175	+ width: 40px;
176	+ bottom: 0;
177	+ top: auto;
178	+ }
179	+
180	+ /* Indicator */
181	+ .pt-cv-view .carousel-indicators {
182	+ bottom: 0;
183	+ margin-bottom: 4px;
184	+ }
185	+
186	+ .pt-cv-view .carousel-indicators li {
187	+ background: #cecece;
188	+ border: 1px solid #cecece;
189	+ }
190	+
191	+ .pt-cv-view .carousel-indicators li.active {
192	+ background: #428bca;
193	+ border: 1px solid #428bca;
194	+ }

public/assets/js/assets.js ADDED Viewed

	@@ -0,0 +1 @@


1	+ /* Do not paste code here, this page used to show code generated automatically */

public/assets/js/public.js ADDED Viewed

	@@ -0,0 +1,217 @@


1	+ (function ($) {
2	+ "use strict";
3	+
4	+ $.PT_CV_Public = $.PT_CV_Public \|\| { };
5	+
6	+ $.PT_CV_Public = function (options) {
7	+ this.options = options;
8	+
9	+ this.pagination();
10	+ this.openin_window();
11	+ };
12	+
13	+ $.PT_CV_Public.prototype = {
14	+
15	+ /**
16	+ * Bootstrap pagination
17	+ * @returns {undefined}
18	+ */
19	+ pagination: function () {
20	+ var $self = this;
21	+ var _prefix = PT_CV_PUBLIC._prefix;
22	+
23	+ // Bootstrap paginator
24	+ $('.' + _prefix + 'pagination').each(function () {
25	+ var this_ = $(this);
26	+ var total_pages = $(this).attr('data-totalpages');
27	+ $(this).bootstrapPaginator({
28	+ bootstrapMajorVersion: 3,
29	+ totalPages : total_pages,
30	+ shouldShowPage : function (type, page, current) {
31	+ if (total_pages < 10) {
32	+ switch (type) {
33	+ case "first":
34	+ case "last":
35	+ return false;
36	+ default:
37	+ return true;
38	+ }
39	+ }
40	+ },
41	+ // When changing page
42	+ onPageClicked : function (e, originalEvent, type, page) {
43	+ var selected_page = page;
44	+
45	+ $self._setup_pagination(this_, selected_page, function () {
46	+ $self.doing = 0;
47	+ });
48	+ }
49	+ });
50	+ });
51	+ },
52	+
53	+ /**
54	+ * Get parameters to process pagination
55	+ *
56	+ * @param object this_
57	+ * @param int selected_page
58	+ * @param function callback
59	+ * @returns {undefined}
60	+ */
61	+ _setup_pagination: function (this_, selected_page, callback) {
62	+ var $self = this;
63	+ var _prefix = PT_CV_PUBLIC._prefix;
64	+
65	+ // Prevent duplicate processing
66	+ if ($self.doing) {
67	+ return;
68	+ } else {
69	+ $self.doing = 1;
70	+ }
71	+
72	+ var view_id = this_.attr('data-id');
73	+ var spinner = this_.next('.' + _prefix + 'spinner');
74	+ var pages_holder = this_.prev('.' + _prefix + 'view');
75	+
76	+ // For Timeline
77	+ if ( pages_holder.hasClass(_prefix + 'timeline') ) {
78	+ pages_holder = pages_holder.children('.tl-items');
79	+ }
80	+
81	+ $self._get_page(view_id, selected_page, spinner, pages_holder, callback);
82	+ },
83	+
84	+ /**
85	+ * Get wrapper of selected page
86	+ *
87	+ * @param string view_id The id of view
88	+ * @param int selected_page The page to show
89	+ * @param object spinner The jquery object of loading element
90	+ * @param string pages_holder The selector expression of wrapper of pages
91	+ * @param null\|function callback The callback function
92	+ * @returns void
93	+ */
94	+ _get_page: function (view_id, selected_page, spinner, pages_holder, callback) {
95	+
96	+ var $self = this;
97	+
98	+ var page_existed = $self._active_page(selected_page, pages_holder, callback);
99	+
100	+ if (page_existed) {
101	+ return;
102	+ }
103	+
104	+ // Setup data
105	+ var data = {
106	+ action : 'pagination_request',
107	+ id : view_id,
108	+ page : selected_page,
109	+ ajax_nonce: PT_CV_PUBLIC._nonce
110	+ };
111	+
112	+ // Sent POST request
113	+ $.ajax({
114	+ type : "POST",
115	+ url : PT_CV_PUBLIC.ajaxurl,
116	+ data : data,
117	+ beforeSend: function () {
118	+ // Show loading icon
119	+ spinner.toggleClass('active');
120	+ }
121	+ }).done(function (response) {
122	+ // Hide loading icon
123	+ spinner.toggleClass('active');
124	+
125	+ // Update content of Preview box
126	+ pages_holder.append(response);
127	+
128	+ // Active current page
129	+ $self._active_page(selected_page, pages_holder, callback);
130	+ });
131	+ },
132	+
133	+ /**
134	+ * Show content of selected page
135	+ *
136	+ * @param int selected_page The page to show
137	+ * @param string pages_holder The selector expression of wrapper of pages
138	+ * @param null\|function callback The callback function
139	+ * @returns bool
140	+ */
141	+ _active_page: function (selected_page, pages_holder, callback) {
142	+ var _prefix = PT_CV_PUBLIC._prefix;
143	+ var page_existed = false;
144	+ var page_selector = '#' + _prefix + 'page' + '-' + parseInt(selected_page);
145	+
146	+ if (pages_holder.children(page_selector).length) {
147	+ page_existed = true;
148	+
149	+ // Hide all pages
150	+ pages_holder.children().hide();
151	+
152	+ // Show this page
153	+ pages_holder.children(page_selector).show();
154	+
155	+ // Scroll to this page
156	+ $('html, body').animate({
157	+ scrollTop: pages_holder.children(page_selector).offset().top - 160
158	+ }, 1000);
159	+ }
160	+
161	+ if (callback && typeof callback === 'function') {
162	+ callback();
163	+ }
164	+
165	+ // Trigger to make Pinterest layout works when do pagination
166	+ if ($('.' + _prefix + 'pinterest').length && PT_CV_PUBLIC.is_admin) {
167	+ $('body').trigger(_prefix + 'custom-trigger');
168	+ }
169	+
170	+ // Trigger action after pagination finished
171	+ $('body').trigger(_prefix + 'pagination-finished');
172	+
173	+ return page_existed;
174	+ },
175	+
176	+ /**
177	+ * Open in new window
178	+ *
179	+ * @returns {undefined}
180	+ */
181	+ openin_window: function () {
182	+ var _prefix = PT_CV_PUBLIC._prefix;
183	+
184	+ $('body').on('click', '.' + _prefix + 'window', function (e) {
185	+ e.preventDefault();
186	+
187	+ var this_ = $(this);
188	+
189	+ var href = this_.attr('href');
190	+ var width = this_.attr('data-width');
191	+ var height = this_.attr('data-height');
192	+ var left = (window.screen.width / 2) - (width / 2);
193	+ var top = (window.screen.height / 2) - (height / 2);
194	+
195	+ var settings = 'toolbar=no, location=no, directories=no, status=no, menubar=no, scrollbars=no, resizable=no, copyhistory=no, ';
196	+ window.open(href, "_blank", settings + ' top=' + top + ', left=' + left + ', width=' + width + ', height=' + height);
197	+ });
198	+ }
199	+ };
200	+
201	+ $(function () {
202	+
203	+ var _prefix = PT_CV_PUBLIC._prefix;
204	+
205	+ // Run at page load
206	+ var $pt_cv_public_js = new $.PT_CV_Public({_prefix: _prefix});
207	+
208	+ // Trigger in Admin, for Preview
209	+ if (PT_CV_PUBLIC.is_admin) {
210	+ $('body').bind(_prefix + 'custom-trigger', function () {
211	+ $pt_cv_public_js.pagination();
212	+ });
213	+ }
214	+
215	+ });
216	+
217	+ }(jQuery));

public/content-views.php ADDED Viewed

	@@ -0,0 +1,322 @@


1	+ <?php
2	+ /**
3	+ * Content Views for Public
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+ class PT_Content_Views {
12	+
13	+ /**
14	+ * The variable name is used as the text domain when internationalizing strings
15	+ * of text. Its value should match the Text Domain file header in the main
16	+ * plugin file.
17	+ *
18	+ * @since 1.0.0
19	+ *
20	+ * @var string
21	+ */
22	+ protected $plugin_slug = PT_CV_DOMAIN;
23	+
24	+ /**
25	+ * Instance of this class.
26	+ *
27	+ * @since 1.0.0
28	+ *
29	+ * @var object
30	+ */
31	+ protected static $instance = null;
32	+
33	+ /**
34	+ * Initialize the plugin by setting localization and loading public scripts
35	+ * and styles.
36	+ *
37	+ * @since 1.0.0
38	+ */
39	+ private function __construct() {
40	+
41	+ // Load plugin text domain
42	+ add_action( 'init', array( $this, 'load_plugin_textdomain' ) );
43	+
44	+ // Register content
45	+ add_action( 'init', array( $this, 'content_register' ) );
46	+
47	+ // Activate plugin when new blog is added
48	+ add_action( 'wpmu_new_blog', array( $this, 'activate_new_site' ) );
49	+
50	+ // Load public-facing style sheet and JavaScript.
51	+ add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_styles' ) );
52	+ add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_scripts' ) );
53	+
54	+ // Update view count of post
55	+ add_action( 'wp_head', array( &$this, 'update_view_count' ) );
56	+
57	+ // Output assets content at footer of page
58	+ add_action( 'wp_footer', array( 'PT_CV_Html', 'assets_of_view_types' ) );
59	+
60	+ // Ajax action
61	+ $action = 'pagination_request';
62	+ add_action( 'wp_ajax_' . $action, array( 'PT_CV_Functions', 'ajax_callback_' . $action ) );
63	+
64	+ // Custom hooks for both preview & frontend
65	+ PT_CV_Hooks::init();
66	+ }
67	+
68	+ /**
69	+ * Return the plugin slug.
70	+ *
71	+ * @since 1.0.0
72	+ *
73	+ * @return Plugin slug variable.
74	+ */
75	+ public function get_plugin_slug() {
76	+ return $this->plugin_slug;
77	+ }
78	+
79	+ /**
80	+ * Return an instance of this class.
81	+ *
82	+ * @since 1.0.0
83	+ *
84	+ * @return object A single instance of this class.
85	+ */
86	+ public static function get_instance() {
87	+
88	+ // If the single instance hasn't been set, set it now.
89	+ if ( null == self::$instance ) {
90	+ self::$instance = new self;
91	+ }
92	+
93	+ return self::$instance;
94	+ }
95	+
96	+ /**
97	+ * Fired when the plugin is activated.
98	+ *
99	+ * @since 1.0.0
100	+ *
101	+ * @param boolean $network_wide True if WPMU superadmin uses
102	+ * "Network Activate" action, false if
103	+ * WPMU is disabled or plugin is
104	+ * activated on an individual blog.
105	+ */
106	+ public static function activate( $network_wide ) {
107	+
108	+ if ( function_exists( 'is_multisite' ) && is_multisite() ) {
109	+
110	+ if ( $network_wide ) {
111	+
112	+ // Get all blog ids
113	+ $blog_ids = self::get_blog_ids();
114	+
115	+ foreach ( $blog_ids as $blog_id ) {
116	+
117	+ switch_to_blog( $blog_id );
118	+ self::single_activate();
119	+ }
120	+
121	+ restore_current_blog();
122	+ } else {
123	+ self::single_activate();
124	+ }
125	+ } else {
126	+ self::single_activate();
127	+ }
128	+ }
129	+
130	+ /**
131	+ * Fired when the plugin is deactivated.
132	+ *
133	+ * @since 1.0.0
134	+ *
135	+ * @param boolean $network_wide True if WPMU superadmin uses
136	+ * "Network Deactivate" action, false if
137	+ * WPMU is disabled or plugin is
138	+ * deactivated on an individual blog.
139	+ */
140	+ public static function deactivate( $network_wide ) {
141	+
142	+ if ( function_exists( 'is_multisite' ) && is_multisite() ) {
143	+
144	+ if ( $network_wide ) {
145	+
146	+ // Get all blog ids
147	+ $blog_ids = self::get_blog_ids();
148	+
149	+ foreach ( $blog_ids as $blog_id ) {
150	+
151	+ switch_to_blog( $blog_id );
152	+ self::single_deactivate();
153	+ }
154	+
155	+ restore_current_blog();
156	+ } else {
157	+ self::single_deactivate();
158	+ }
159	+ } else {
160	+ self::single_deactivate();
161	+ }
162	+ }
163	+
164	+ /**
165	+ * Fired when a new site is activated with a WPMU environment.
166	+ *
167	+ * @since 1.0.0
168	+ *
169	+ * @param int $blog_id ID of the new blog.
170	+ */
171	+ public function activate_new_site( $blog_id ) {
172	+
173	+ if ( 1 !== did_action( 'wpmu_new_blog' ) ) {
174	+ return;
175	+ }
176	+
177	+ switch_to_blog( $blog_id );
178	+ self::single_activate();
179	+ restore_current_blog();
180	+ }
181	+
182	+ /**
183	+ * Get all blog ids of blogs in the current network that are:
184	+ * - not archived
185	+ * - not spam
186	+ * - not deleted
187	+ *
188	+ * @since 1.0.0
189	+ *
190	+ * @return array\|false The blog ids, false if no matches.
191	+ */
192	+ private static function get_blog_ids() {
193	+
194	+ global $wpdb;
195	+
196	+ // Get an array of blog ids
197	+ $sql = "SELECT blog_id FROM $wpdb->blogs
198	+ WHERE archived = '0' AND spam = '0'
199	+ AND deleted = '0'";
200	+
201	+ return $wpdb->get_col( $sql );
202	+ }
203	+
204	+ /**
205	+ * Fired for each blog when the plugin is activated.
206	+ *
207	+ * @since 1.0.0
208	+ */
209	+ private static function single_activate() {
210	+ update_option( PT_CV_OPTION_VERSION, PT_CV_VERSION );
211	+ }
212	+
213	+ /**
214	+ * Fired for each blog when the plugin is deactivated.
215	+ *
216	+ * @since 1.0.0
217	+ */
218	+ private static function single_deactivate() {
219	+ delete_option( PT_CV_OPTION_VERSION );
220	+ }
221	+
222	+ /**
223	+ * Load the plugin text domain for translation.
224	+ *
225	+ * @since 1.0.0
226	+ */
227	+ public function load_plugin_textdomain() {
228	+
229	+ $domain = $this->plugin_slug;
230	+ $locale = apply_filters( 'plugin_locale', get_locale(), $domain );
231	+
232	+ load_textdomain( $domain, trailingslashit( WP_LANG_DIR ) . $domain . '/' . $domain . '-' . $locale . '.mo' );
233	+ load_plugin_textdomain( $domain, FALSE, basename( plugin_dir_path( dirname( __FILE__ ) ) ) . '/languages/' );
234	+
235	+ }
236	+
237	+ /**
238	+ * Content register: Create custom post type
239	+ */
240	+ public function content_register() {
241	+
242	+ /**
243	+ * Register custom post type : View
244	+ */
245	+ $labels = array(
246	+ 'name' => _x( 'Views', 'post type general name', PT_CV_DOMAIN ),
247	+ 'singular_name' => _x( 'View', 'post type singular name', PT_CV_DOMAIN ),
248	+ 'menu_name' => _x( 'Views', 'admin menu', PT_CV_DOMAIN ),
249	+ 'name_admin_bar' => _x( 'View', 'add new on admin bar', PT_CV_DOMAIN ),
250	+ 'add_new' => _x( 'Add New', PT_CV_POST_TYPE, PT_CV_DOMAIN ),
251	+ 'add_new_item' => __( 'Add New View', PT_CV_DOMAIN ),
252	+ 'new_item' => __( 'New View', PT_CV_DOMAIN ),
253	+ 'edit_item' => __( 'Edit View', PT_CV_DOMAIN ),
254	+ 'view_item' => __( 'View View', PT_CV_DOMAIN ),
255	+ 'all_items' => __( 'All Views', PT_CV_DOMAIN ),
256	+ 'search_items' => __( 'Search Views', PT_CV_DOMAIN ),
257	+ 'parent_item_colon' => __( 'Parent Views:', PT_CV_DOMAIN ),
258	+ 'not_found' => __( 'No views found.', PT_CV_DOMAIN ),
259	+ 'not_found_in_trash' => __( 'No views found in Trash.', PT_CV_DOMAIN ),
260	+ );
261	+
262	+ $args = array(
263	+ 'labels' => $labels,
264	+ 'public' => true,
265	+ 'publicly_queryable' => true,
266	+
267	+ // Hide in menu, but can see All Views page
268	+ 'show_ui' => false,
269	+ 'show_in_menu' => false,
270	+
271	+ 'query_var' => true,
272	+ 'rewrite' => array( 'slug' => PT_CV_POST_TYPE ),
273	+ 'capability_type' => 'post',
274	+ 'has_archive' => true,
275	+ 'hierarchical' => false,
276	+ 'menu_position' => null,
277	+ 'supports' => array( 'title', 'author', 'custom-fields' ),
278	+ );
279	+
280	+ register_post_type( PT_CV_POST_TYPE, $args );
281	+
282	+ /**
283	+ * Add shortcode
284	+ */
285	+ add_shortcode( PT_CV_POST_TYPE, array( 'PT_CV_Functions', 'view_output' ) );
286	+ }
287	+
288	+ /**
289	+ * Register and enqueue public-facing style sheet.
290	+ *
291	+ * @since 1.0.0
292	+ */
293	+ public function enqueue_styles() {
294	+ PT_CV_Html::frontend_styles();
295	+ }
296	+
297	+ /**
298	+ * Register and enqueues public-facing JavaScript files.
299	+ *
300	+ * @since 1.0.0
301	+ */
302	+ public function enqueue_scripts() {
303	+ PT_CV_Html::frontend_scripts();
304	+ }
305	+
306	+ /**
307	+ * Update view count
308	+ *
309	+ * @global type $post
310	+ * @return void
311	+ */
312	+ public function update_view_count() {
313	+ global $post;
314	+ if ( ! isset( $post ) \|\| ! is_object( $post ) ) {
315	+ return;
316	+ }
317	+ if ( is_single( $post->ID ) ) {
318	+ PT_CV_Functions::post_update_view_count( $post->ID );
319	+ }
320	+ }
321	+
322	+ }

public/templates/_view_type_/css/main.css ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ /**
2	+ * Style Name: View type
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+

public/templates/_view_type_/html/main.php ADDED Viewed

	@@ -0,0 +1,42 @@


1	+ <?php
2	+ /**
3	+ * Layout Name: View type
4	+ *
5	+ * @package PT_Content_Views_Admin
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ $html = array();
13	+
14	+ $layout = $dargs['layout-format'];
15	+
16	+ // Prevent the case: there are 2 columns but have not setting for thumbnail position
17	+ if ( $layout == '2-col' && ! isset( $dargs['field-settings']['thumbnail'] ) ) {
18	+ $layout = '1-col';
19	+ }
20	+
21	+ switch ( $layout ) {
22	+ case '1-col':
23	+ foreach ( $fields_html as $field_html ) {
24	+ $html[] = $field_html;
25	+ }
26	+ break;
27	+ case '2-col':
28	+
29	+ // Thumbnail html
30	+ $thumbnail_html = $fields_html['thumbnail'];
31	+
32	+ // Other fields html
33	+ unset( $fields_html['thumbnail'] );
34	+ $others_html = implode( "\n", $fields_html );
35	+
36	+ $html[] = $thumbnail_html;
37	+ $html[] = $others_html;
38	+
39	+ break;
40	+ }
41	+
42	+ echo balanceTags( implode( "\n", $html ) );

public/templates/_view_type_/js/main.js ADDED Viewed

	@@ -0,0 +1,10 @@


1	+ /**
2	+ * Script Name: View type
3	+ *
4	+ * @package PT_Content_Views_Admin
5	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
6	+ * @license GPL-2.0+
7	+ * @link http://example.com
8	+ * @copyright 2014 Palace Of Themes
9	+ */
10	+

public/templates/collapsible/html/main.php ADDED Viewed

	@@ -0,0 +1,66 @@


1	+ <?php
2	+ /**
3	+ * Layout Name: Collapsible List
4	+ *
5	+ * @package PT_Content_Views_Admin
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ $html = array();
13	+
14	+ $layout = $dargs['layout-format'];
15	+
16	+ // Prevent the case: there are 2 columns but have not setting for thumbnail position
17	+ if ( $layout == '2-col' && ! isset( $dargs['field-settings']['thumbnail'] ) ) {
18	+ $layout = '1-col';
19	+ }
20	+
21	+ // Get title
22	+ $heading = isset( $fields_html['title'] ) ? $fields_html['title'] : '';
23	+ unset( $fields_html['title'] );
24	+
25	+ switch ( $layout ) {
26	+ case '1-col':
27	+ foreach ( $fields_html as $field_html ) {
28	+ $html[] = $field_html;
29	+ }
30	+ break;
31	+ case '2-col':
32	+
33	+ // Thumbnail html
34	+ $thumbnail_html = $fields_html['thumbnail'];
35	+
36	+ // Other fields html
37	+ unset( $fields_html['thumbnail'] );
38	+ $others_html = implode( "\n", $fields_html );
39	+
40	+ $html[] = $thumbnail_html;
41	+ $html[] = $others_html;
42	+
43	+ break;
44	+ }
45	+
46	+ $random_id = PT_CV_Functions::string_random();
47	+ ?>
48	+ <div class="panel panel-default">
49	+ <div class="panel-heading">
50	+ <a class="panel-title" data-toggle="collapse" data-parent="#<?php echo esc_attr( PT_CV_PREFIX_UPPER . 'ID' ); ?>" href="#<?php echo esc_attr( $random_id ); ?>">
51	+ <?php echo balanceTags( strip_tags( $heading ) ); ?>
52	+ </a>
53	+ <?php
54	+ // Custom toggle icon
55	+ $toggle_icon = apply_filters( PT_CV_PREFIX_ . 'scrollable_toggle_icon', '' );
56	+ echo balanceTags( $toggle_icon );
57	+ ?>
58	+ </div>
59	+ <div id="<?php echo esc_attr( $random_id ); ?>" class="panel-collapse collapse <?php echo esc_attr( PT_CV_PREFIX_UPPER . 'CLASS' ); ?>">
60	+ <div class="panel-body">
61	+ <?php
62	+ echo balanceTags( implode( "\n", $html ) );
63	+ ?>
64	+ </div>
65	+ </div>
66	+ </div>

public/templates/grid/html/main.php ADDED Viewed

	@@ -0,0 +1,40 @@


1	+ <?php
2	+ /**
3	+ * Layout Name: Grid
4	+ *
5	+ * @package PT_Content_Views_Admin
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ $html = array();
13	+
14	+ $layout = $dargs['layout-format'];
15	+
16	+ // Prevent the case: there are 2 columns but have not setting for thumbnail position
17	+ if ( $layout == '2-col' && ! isset( $dargs['field-settings']['thumbnail'] ) ) {
18	+ $layout = '1-col';
19	+ }
20	+
21	+ switch ( $layout ) {
22	+ case '1-col':
23	+ foreach ( $fields_html as $field_html ) {
24	+ $html[] = $field_html;
25	+ }
26	+ break;
27	+ case '2-col':
28	+
29	+ // Thumbnail html
30	+ $html[] = $fields_html['thumbnail'];
31	+
32	+ // Other fields html
33	+ unset( $fields_html['thumbnail'] );
34	+ $others_html = implode( "\n", $fields_html );
35	+ $html[] = $others_html;
36	+
37	+ break;
38	+ }
39	+
40	+ echo balanceTags( implode( "\n", $html ) );

public/templates/readme.txt ADDED Viewed

	@@ -0,0 +1,19 @@


1	+
2	+ == Description ==
3	+ This folder contains HTML output of View types:
4	+ Grid
5	+ Collapsible List
6	+ Tab
7	+ ...
8	+
9	+ Folder structure:
10	+ name_of_view_type
11	+ html
12	+ main.php : HTML layout - Style 1
13	+ style2.php : HTML layout - Style 2
14	+ css
15	+ main.css : stylesheet - Style 1
16	+ style2.css : stylesheet - Style 2
17	+ js
18	+ main.js : script - Style 1
19	+ script2.js : script - Style 2

public/templates/scrollable/html/main.php ADDED Viewed

	@@ -0,0 +1,31 @@


1	+ <?php
2	+ /**
3	+ * Layout Name: Scrollable List
4	+ *
5	+ * @package PT_Content_Views_Admin
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ $html = array();
13	+
14	+ $ex_cap_cls = PT_CV_PREFIX . 'cap-w-img';;
15	+
16	+ if ( ! empty( $fields_html['thumbnail'] ) ) {
17	+ // Thumbnail html
18	+ $html[] = $fields_html['thumbnail'];
19	+ unset( $fields_html['thumbnail'] );
20	+ } else {
21	+ $ex_cap_cls = PT_CV_PREFIX . 'cap-wo-img';
22	+ }
23	+
24	+ // Other fields html
25	+ $others_html = implode( "\n", $fields_html );
26	+
27	+ // Get wrapper class of caption
28	+ $caption_class = apply_filters( PT_CV_PREFIX_ . 'scrollable_caption_class', array( 'carousel-caption', $ex_cap_cls ) );
29	+ $html[] = sprintf( '<div class="%s">%s</div>', esc_attr( implode( ' ', array_filter( $caption_class ) ) ), balanceTags( $others_html ) );
30	+
31	+ echo balanceTags( implode( "\n", $html ) );

uninstall.php ADDED Viewed

	@@ -0,0 +1,21 @@


1	+ <?php
2	+ /**
3	+ * Uninstall the plugin
4	+ *
5	+ * @package PT_Content_Views
6	+ * @author Palace Of Themes <palaceofthemes@gmail.com>
7	+ * @license GPL-2.0+
8	+ * @link http://example.com
9	+ * @copyright 2014 Palace Of Themes
10	+ */
11	+
12	+ // If uninstall not called from WordPress, then exit
13	+ if ( ! defined( 'WP_UNINSTALL_PLUGIN' ) ) {
14	+ exit;
15	+ }
16	+
17	+ // Include library files
18	+ include_once( plugin_dir_path( __FILE__ ) . 'includes/defines.php' );
19	+
20	+ // Delete all posts of PT View post type ?
21	+

Content Views – Post Grid & List for WordPress - Version 1.0.1

Version Description

Release Info

Version 1.0.1